![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0ad-0.27.1_8.pkg | 2025-12-29 13:35 | 1.5G | |
| 0d1n-3.8_1.pkg | 2025-12-20 07:25 | 234K | |
| 0verkill-0.16_2.pkg | 2025-12-23 04:18 | 236K | |
| 1password-client-1.1..> | 2025-08-17 01:08 | 3.1M | |
| 1password-client2-2...> | 2025-08-17 05:38 | 6.9M | |
| 1password-client2-be..> | 2025-08-17 21:36 | 6.9M | |
| 2bsd-diff-2.11.1_2.pkg | 2025-08-16 22:35 | 22K | |
| 2bsd-vi-050325_3.pkg | 2025-08-16 16:34 | 147K | |
| 2d-rewriter-1.6_1.pkg | 2025-08-16 13:38 | 18K | |
| 2fa-1.2.0_34.pkg | 2025-12-21 22:28 | 769K | |
| 2ping-4.5.1_1.pkg | 2025-12-22 00:02 | 72K | |
| 3d-ascii-viewer-1.4...> | 2025-08-22 02:25 | 647K | |
| 3dc-0.8.1_4.pkg | 2025-12-21 18:44 | 33K | |
| 3ddesktop-0.2.9_19.pkg | 2025-12-28 15:24 | 57K | |
| 3dm-2.11.00.021_4,1.pkg | 2025-08-17 04:46 | 4.8M | |
| 3dpong-0.5_7.pkg | 2025-08-19 21:28 | 28K | |
| 3mux-1.1.0_34.pkg | 2025-12-22 11:45 | 1.3M | |
| 3omns-0.2_4.pkg | 2025-12-30 09:03 | 81K | |
| 3proxy-0.9.5.pkg | 2025-08-21 14:52 | 216K | |
| 4pane-8.0_3.pkg | 2025-12-28 07:42 | 1.4M | |
| 4ti2-1.6.13.pkg | 2025-08-14 23:54 | 941K | |
| 4va-1.21_3.pkg | 2025-08-16 04:33 | 21K | |
| 6tunnel-0.14.pkg | 2025-12-21 09:17 | 11K | |
| 7-zip-25.01.pkg | 2025-08-13 20:22 | 1.0M | |
| 7kaa-2.15.6.pkg | 2025-12-29 04:00 | 33M | |
| 9base-20170701_1.pkg | 2025-08-21 18:46 | 785K | |
| 9box-0.2.1_3.pkg | 2025-08-20 14:48 | 9.7K | |
| 9e-1.0.pkg | 2025-08-16 10:24 | 4.1K | |
| 9menu-1.11.pkg | 2025-08-18 03:47 | 11K | |
| 44bsd-csh-20001106_7..> | 2025-08-16 09:10 | 96K | |
| 44bsd-more-20000521_..> | 2025-08-16 13:39 | 39K | |
| 44bsd-rdist-20001111..> | 2025-08-18 17:59 | 32K | |
| 86Box-5.2.pkg | 2025-12-30 14:27 | 9.2M | |
| 90secondportraits-1...> | 2025-12-29 16:10 | 4.7M | |
| 915resolution-0.5.3_..> | 2025-08-21 23:58 | 11K | |
| 2048-0.9.1_1.pkg | 2025-08-21 05:03 | 9.7K | |
| 3270font-3.0.1.pkg | 2025-12-29 09:52 | 945K | |
| 54321-1.0.2001.11.16..> | 2025-12-29 23:25 | 549K | |
| ADMsmb-0.3.pkg | 2025-08-22 06:40 | 82K | |
| ADMsnmp-0.1.pkg | 2025-08-20 16:06 | 9.8K | |
| ALPSCore-2.3.2.pkg | 2025-12-30 15:55 | 1.4M | |
| APKiD-3.0.0.pkg | 2025-12-23 05:28 | 137K | |
| Aluminum-1.4.2_1.pkg | 2025-12-29 06:36 | 81K | |
| Andika-6.200.pkg | 2025-12-29 18:24 | 1.3M | |
| AndikaCompact-6.200.pkg | 2025-12-29 12:15 | 1.3M | |
| AppStream-1.1.1.pkg | 2025-12-18 02:53 | 927K | |
| AppStreamCompose-1.1..> | 2025-12-27 16:14 | 122K | |
| AppStreamQt6-1.1.1.pkg | 2025-12-26 09:27 | 126K | |
| BRiAl-1.2.12_3.pkg | 2025-12-27 10:17 | 1.2M | |
| Bento4-1.6.0_3.pkg | 2025-12-23 00:57 | 1.5M | |
| BerkeleyGW-4.0_2.pkg | 2025-12-28 05:28 | 74M | |
| BlackjackClient-0.1_..> | 2025-12-30 15:43 | 21K | |
| Box2D-2.4.1.pkg | 2025-08-13 20:52 | 122K | |
| Bugdom-1.3.4.pkg | 2025-12-28 12:46 | 45M | |
| Bugdom2-4.0.0.pkg | 2025-12-30 09:27 | 115M | |
| CAMotics-1.3.0_2.pkg | 2025-12-28 08:17 | 8.3M | |
| CLDR-47.pkg | 2025-08-14 16:50 | 20M | |
| CTK-widgets-2023.07...> | 2025-12-29 19:52 | 892K | |
| CalculiX-ccx-2.22_1.pkg | 2025-12-27 02:52 | 16M | |
| CaribbeanStud-1.0_3.pkg | 2025-12-29 19:55 | 38K | |
| ChaiScript-6.1.0_3.pkg | 2025-12-18 12:25 | 1.1M | |
| Charis-7.000.pkg | 2025-12-27 18:30 | 1.8M | |
| CharisSILCompact-6.2..> | 2025-12-27 19:55 | 1.1M | |
| CheMPS2-1.8.12_6.pkg | 2025-12-27 12:31 | 534K | |
| ChipmunkPhysics-7.0...> | 2025-08-16 03:03 | 488K | |
| Clipper2-1.4.0_1.pkg | 2025-08-17 10:38 | 114K | |
| Coin-4.0.6.pkg | 2025-12-26 18:43 | 2.5M | |
| CoinMP-1.8.4_14.pkg | 2025-12-27 09:40 | 36K | |
| CombBLAS-2.0.0_2.pkg | 2025-12-30 05:28 | 483K | |
| CsoundQt-0.9.8.1_3.pkg | 2025-12-30 04:51 | 54M | |
| Cura-5.7.0_1,2.pkg | 2025-12-29 11:52 | 37M | |
| CuraEngine-5.7.0_6,1..> | 2025-12-27 08:31 | 1.1M | |
| CuraEngine-debuginfo..> | 2025-08-14 23:06 | 17M | |
| CuraEngine-debuginfo..> | 2025-08-26 18:50 | 16M | |
| CuraEngine-debuginfo..> | 2025-12-19 11:07 | 16M | |
| CycloneDDS-0.10.5.pkg | 2025-08-19 13:28 | 1.0M | |
| DDNet-19.5_3.pkg | 2025-12-30 19:01 | 38M | |
| DRAWxtl-5.5_1.pkg | 2025-12-30 02:29 | 262K | |
| Doom64EX-g20180824_1..> | 2025-12-27 21:07 | 381K | |
| DoulosSIL-7.000.pkg | 2025-12-27 16:07 | 395K | |
| DoulosSILCompact-6.2..> | 2025-12-28 02:50 | 369K | |
| Drawpile-2.3.0_2.pkg | 2025-12-27 20:44 | 5.2M | |
| FAudio-25.03.pkg | 2025-12-27 16:51 | 119K | |
| FAudio-sdl3-25.03.pkg | 2025-12-30 05:01 | 119K | |
| FFaudioConverter-0.3..> | 2025-12-28 10:45 | 76K | |
| FastTree-2.1.11.pkg | 2025-08-19 00:32 | 117K | |
| FlexGet-3.9.10_4.pkg | 2025-12-29 07:13 | 1.7M | |
| FlintQS-1.0.pkg | 2025-08-19 12:37 | 25K | |
| FluidPlug-lv2-g20230..> | 2025-12-29 00:31 | 360M | |
| FrontISTR-5.2_6.pkg | 2025-12-29 19:06 | 22M | |
| GLee-5.4.0_1.pkg | 2025-08-18 10:04 | 110K | |
| GNUDoku-0.93_12.pkg | 2025-12-29 11:23 | 28K | |
| Gdtclft-2.2.5_19.pkg | 2025-12-30 17:18 | 14K | |
| Gentium-7.000.pkg | 2025-12-26 19:52 | 3.1M | |
| GentiumBook-7.000.pkg | 2025-12-30 02:39 | 2.7M | |
| GentiumPlusCompact-6..> | 2025-12-29 06:34 | 2.3M | |
| GiNaC-1.8.9.pkg | 2025-12-21 20:29 | 2.0M | |
| GraphicsMagick-1.3.4..> | 2025-12-26 09:19 | 3.1M | |
| GraphicsMagick-nox11..> | 2025-12-29 17:32 | 2.8M | |
| GroopM-0.3.4_6.pkg | 2025-12-29 22:56 | 275K | |
| GxSwitchlessWah-lv2-..> | 2025-08-18 07:35 | 6.1K | |
| HPCombi-1.1.1.pkg | 2025-12-19 04:57 | 513K | |
| HVSC-Update-2.8.8.pkg | 2025-08-21 10:31 | 42K | |
| Hasklig-1.1_1.pkg | 2025-12-28 13:27 | 836K | |
| Hyperlatex-2.9.a_26.pkg | 2025-12-29 19:53 | 60K | |
| Hyperlatex-emacs_can..> | 2025-12-29 01:28 | 60K | |
| Hyperlatex-emacs_dev..> | 2025-12-30 16:26 | 60K | |
| Hyperlatex-emacs_dev..> | 2025-12-30 05:23 | 60K | |
| Hyperlatex-emacs_nox..> | 2025-12-29 02:26 | 60K | |
| Hyperlatex-emacs_way..> | 2025-12-27 20:52 | 60K | |
| IMB-2021.7_1.pkg | 2025-12-29 21:59 | 439K | |
| ISCD-Commons-1.0.0.pkg | 2025-08-13 07:15 | 44K | |
| Ice-3.6.5_2.pkg | 2025-12-19 17:10 | 5.5M | |
| Ice37-3.7.10.pkg | 2025-12-20 00:01 | 7.0M | |
| ImageMagick6-6.9.13...> | 2025-12-26 13:39 | 8.2M | |
| ImageMagick6-nox11-6..> | 2025-12-27 09:50 | 7.9M | |
| ImageMagick7-7.1.2.1..> | 2025-12-26 10:53 | 9.3M | |
| ImageMagick7-nox11-7..> | 2025-12-27 17:48 | 8.9M | |
| Imath-3.2.2_1.pkg | 2025-12-16 01:46 | 148K | |
| Inconsolata-LGC-2013..> | 2025-12-29 16:33 | 90K | |
| InsightToolkit-5.3.0..> | 2025-12-27 02:42 | 17M | |
| InsightToolkit501-5...> | 2025-12-27 04:05 | 8.2M | |
| Ipopt-3.14.19.pkg | 2025-12-26 15:01 | 816K | |
| Jellyfish-2.3.0_4.pkg | 2025-12-19 22:45 | 267K | |
| Jmol-16.1.25_1.pkg | 2025-12-28 05:31 | 55M | |
| Judy-1.0.5_4.pkg | 2025-08-15 20:14 | 211K | |
| KVIrc-5.2.8.pkg | 2025-12-30 09:58 | 5.3M | |
| Kvantum-1.1.5.pkg | 2025-12-28 12:38 | 1.0M | |
| LAStools-2.0.3.pkg | 2025-08-16 11:49 | 665K | |
| LLnextgen-0.5.5_1.pkg | 2025-08-17 22:59 | 287K | |
| LPRng-3.8.C_7,1.pkg | 2025-12-22 03:47 | 501K | |
| LPRngTool-1.3.2_12.pkg | 2025-12-30 04:04 | 128K | |
| LibreMines-2.2.1.pkg | 2025-12-29 22:25 | 783K | |
| LinearElasticity-1.0..> | 2025-08-13 08:53 | 723K | |
| Lohit-20140220_3.pkg | 2025-12-30 14:19 | 313K | |
| M4RI-20240729.pkg | 2025-12-26 19:41 | 136K | |
| M4RIE-20250103.pkg | 2025-12-30 09:37 | 191K | |
| MMseqs2-17.b804.f.pkg | 2025-08-22 04:12 | 3.5M | |
| MST-Bench-0.2.2_1.pkg | 2025-08-17 11:12 | 8.4K | |
| Maaate-0.3.1_5.pkg | 2025-08-20 03:55 | 295K | |
| MailScanner-5.3.4.3_..> | 2025-12-29 16:18 | 469K | |
| MathJax-2.7.9.pkg | 2025-08-13 21:02 | 18M | |
| MathJax3-3.2.2.pkg | 2025-08-14 17:22 | 2.0M | |
| MathMod-13.0.pkg | 2025-12-30 18:30 | 1.2M | |
| MetaPhysicL-1.3.3_1.pkg | 2025-08-14 16:20 | 68K | |
| Mojo-Base-XS-0.07.pkg | 2025-12-21 21:02 | 15K | |
| MolScript-2.1.2_4.pkg | 2025-12-29 02:41 | 2.1M | |
| Mowitz-0.2.1_6.pkg | 2025-12-21 16:06 | 738K | |
| NTPoly-3.1.1_1.pkg | 2025-12-29 13:22 | 872K | |
| Nanosaur-1.4.4.pkg | 2025-12-29 20:46 | 11M | |
| NetRexx-2.05_3.pkg | 2025-12-29 23:21 | 700K | |
| NotiMail-2.0.2.pkg | 2025-12-30 08:46 | 14K | |
| NunniMCAX-1.4.1.pkg | 2025-08-16 20:02 | 20K | |
| NymphCastLib-v0.2.1_..> | 2025-12-19 22:30 | 541K | |
| NymphRPC-v0.1_2.pkg | 2025-12-18 19:34 | 1.3M | |
| O2-tools-2.01_1.pkg | 2025-08-17 04:42 | 101K | |
| OSCAR-1.6.1.pkg | 2025-12-29 19:35 | 5.9M | |
| OSKAR-2.8.3_5.pkg | 2025-12-30 12:41 | 800K | |
| Open3D-0.2_12.pkg | 2025-12-30 02:15 | 570K | |
| OpenClaw-0.3.98_6.pkg | 2025-12-27 20:31 | 3.5M | |
| OpenCorsairLink-g201..> | 2025-08-17 11:07 | 18K | |
| OpenFodder-1.9.2.pkg | 2025-12-29 10:37 | 3.2M | |
| OpenHMD-0.3.0_1.pkg | 2025-12-22 09:20 | 72K | |
| OpenJUMP-2.0.pkg | 2025-12-28 12:04 | 53M | |
| OpenLara-g20240302.pkg | 2025-12-29 20:20 | 465K | |
| OpenSP-1.5.2_4.pkg | 2025-12-18 08:41 | 1.4M | |
| OpenSPH-0.4.1_10.pkg | 2025-12-29 06:28 | 3.3M | |
| OpenSSH-askpass-1.2...> | 2025-08-15 18:40 | 27K | |
| OpenSim-core-4.1_9.pkg | 2025-12-30 13:43 | 17M | |
| OpenTomb-2018.02.03...> | 2025-12-27 22:07 | 1.6M | |
| PETSc-3.22.4_1.pkg | 2025-12-26 19:49 | 21M | |
| PackageKit-1.3.2_1.pkg | 2025-12-26 08:53 | 674K | |
| PackageKit-Qt-1.1.4.pkg | 2025-12-26 09:21 | 110K | |
| ParMetis-4.0.3.p10_9..> | 2025-12-29 06:21 | 124K | |
| PoseLib-2.0.5.pkg | 2025-08-27 14:15 | 695K | |
| QComicBook-0.9.1_53.pkg | 2025-12-28 14:31 | 712K | |
| QtBitcoinTrader-1.42..> | 2025-12-29 22:20 | 1.2M | |
| Quaternion-0.0.97.1.pkg | 2025-12-30 05:54 | 1.0M | |
| R-4.5.2.pkg | 2025-12-26 06:02 | 47M | |
| R-cran-ADGofTest-0.3..> | 2025-12-30 10:05 | 15K | |
| R-cran-AER-1.2.14.pkg | 2025-12-27 10:39 | 2.4M | |
| R-cran-Amelia-1.8.3.pkg | 2025-12-27 16:39 | 1.4M | |
| R-cran-BH-1.90.0.1.pkg | 2025-12-26 08:42 | 8.8M | |
| R-cran-Biobase-2.66...> | 2025-12-27 15:12 | 2.2M | |
| R-cran-BiocGenerics-..> | 2025-12-27 01:16 | 607K | |
| R-cran-BiocManager-1..> | 2025-12-27 10:45 | 625K | |
| R-cran-BsMD-2023.920..> | 2025-12-27 12:34 | 378K | |
| R-cran-CVST-0.2.3_1.pkg | 2025-12-26 20:23 | 84K | |
| R-cran-ChangeAnomaly..> | 2025-12-30 11:22 | 17K | |
| R-cran-DBI-1.2.3.pkg | 2025-12-26 18:04 | 841K | |
| R-cran-DCluster-0.2...> | 2025-12-27 20:36 | 199K | |
| R-cran-DEoptimR-1.1...> | 2025-12-26 22:18 | 75K | |
| R-cran-DRR-0.0.4_2.pkg | 2025-12-27 12:33 | 153K | |
| R-cran-DT-0.34.0.pkg | 2025-12-29 04:38 | 1.3M | |
| R-cran-Defaults-1.1...> | 2025-12-30 05:30 | 135K | |
| R-cran-Deriv-4.2.0.pkg | 2025-12-26 13:49 | 155K | |
| R-cran-DiagrammeR-1...> | 2025-12-30 02:03 | 2.0M | |
| R-cran-DoE.base-1.2...> | 2025-12-27 06:12 | 1.7M | |
| R-cran-Epi-2.61.pkg | 2025-12-28 06:52 | 3.3M | |
| R-cran-FAdist-2.4_1.pkg | 2025-12-30 12:31 | 67K | |
| R-cran-FNN-1.1.4.1.pkg | 2025-12-26 18:33 | 126K | |
| R-cran-Formula-1.2.5..> | 2025-12-26 18:48 | 156K | |
| R-cran-FrF2-2.3.4.pkg | 2025-12-29 07:42 | 917K | |
| R-cran-GDD-0.1.13.1_..> | 2025-12-30 12:48 | 50K | |
| R-cran-GPArotation-2..> | 2025-12-26 21:21 | 592K | |
| R-cran-Hmisc-5.2.3.pkg | 2025-12-28 13:15 | 3.4M | |
| R-cran-KFAS-1.6.0.pkg | 2025-12-27 10:02 | 727K | |
| R-cran-LearnBayes-2...> | 2025-12-28 00:42 | 940K | |
| R-cran-MCMCpack-1.7...> | 2025-12-27 15:55 | 1.9M | |
| R-cran-MSwM-1.5_1.pkg | 2025-12-30 08:15 | 692K | |
| R-cran-MatchIt-4.7.2..> | 2025-12-27 16:50 | 1.7M | |
| R-cran-Matching-4.10..> | 2025-12-27 01:19 | 473K | |
| R-cran-MatrixModels-..> | 2025-12-26 15:35 | 345K | |
| R-cran-ModelMetrics-..> | 2025-12-27 16:11 | 135K | |
| R-cran-NMF-0.28.pkg | 2025-12-29 15:16 | 2.9M | |
| R-cran-PerformanceAn..> | 2025-12-29 00:47 | 2.0M | |
| R-cran-R.cache-0.17...> | 2025-12-27 18:41 | 113K | |
| R-cran-R.devices-2.1..> | 2025-12-29 01:11 | 386K | |
| R-cran-R.methodsS3-1..> | 2025-12-26 11:48 | 83K | |
| R-cran-R.oo-1.27.1.pkg | 2025-12-26 13:34 | 955K | |
| R-cran-R.rsp-0.46.0.pkg | 2025-12-29 12:09 | 1.3M | |
| R-cran-R.utils-2.13...> | 2025-12-26 14:47 | 1.4M | |
| R-cran-R2HTML-2.3.4.pkg | 2025-12-27 04:51 | 570K | |
| R-cran-R6-2.6.1.pkg | 2025-12-26 09:06 | 97K | |
| R-cran-RColorBrewer-..> | 2025-12-26 09:34 | 51K | |
| R-cran-RCurl-1.98.1...> | 2025-12-26 22:46 | 802K | |
| R-cran-RFinanceYJ-0...> | 2025-12-28 22:56 | 27K | |
| R-cran-RJSONIO-2.0.0..> | 2025-12-27 01:29 | 538K | |
| R-cran-RMySQL-0.11.1..> | 2025-12-28 03:30 | 282K | |
| R-cran-ROAuth-0.9.6_..> | 2025-12-28 04:44 | 139K | |
| R-cran-RPostgreSQL-0..> | 2025-12-29 03:25 | 359K | |
| R-cran-RSQLite-2.4.0..> | 2025-12-27 19:42 | 1.2M | |
| R-cran-RUnit-0.4.33.pkg | 2025-12-28 13:39 | 370K | |
| R-cran-Rcpp-1.1.0.pkg | 2025-12-26 08:34 | 2.0M | |
| R-cran-RcppArmadillo..> | 2025-12-26 11:41 | 917K | |
| R-cran-RcppEigen-0.3..> | 2025-12-26 13:43 | 1.4M | |
| R-cran-RcppProgress-..> | 2025-12-26 21:49 | 21K | |
| R-cran-RcppRoll-0.3...> | 2025-12-30 17:14 | 92K | |
| R-cran-Rdpack-2.6.4.pkg | 2025-12-26 11:10 | 619K | |
| R-cran-RgoogleMaps-1..> | 2025-12-29 07:19 | 503K | |
| R-cran-Rmpfr-1.1.2.pkg | 2025-12-30 16:20 | 1.2M | |
| R-cran-Rook-1.2.pkg | 2025-12-28 20:38 | 344K | |
| R-cran-Rsolnp-2.0.1.pkg | 2025-12-27 16:10 | 613K | |
| R-cran-S7-0.2.1.pkg | 2025-12-26 10:06 | 317K | |
| R-cran-SQUAREM-2021...> | 2025-12-26 13:40 | 173K | |
| R-cran-SparseM-1.84...> | 2025-12-26 15:31 | 793K | |
| R-cran-TH.data-1.1.5..> | 2025-12-29 19:29 | 8.3M | |
| R-cran-TTR-0.24.4.pkg | 2025-12-26 09:19 | 509K | |
| R-cran-VGAM-1.1.13.pkg | 2025-12-27 16:19 | 7.4M | |
| R-cran-XLConnect-1.2..> | 2025-12-27 09:50 | 1.4M | |
| R-cran-XML-3.99.0.20..> | 2025-12-27 17:17 | 1.7M | |
| R-cran-Zelig-5.1.7_1..> | 2025-12-27 21:02 | 1.9M | |
| R-cran-abind-1.4.8.pkg | 2025-12-26 19:05 | 71K | |
| R-cran-acepack-1.4.1..> | 2025-12-29 01:12 | 58K | |
| R-cran-admisc-0.39.pkg | 2025-12-26 19:05 | 365K | |
| R-cran-alabama-2015...> | 2025-12-30 07:55 | 71K | |
| R-cran-arabic2kansuj..> | 2025-12-27 02:57 | 20K | |
| R-cran-ash-1.0.15_1.pkg | 2025-12-26 23:02 | 26K | |
| R-cran-askpass-1.2.1..> | 2025-12-26 11:44 | 23K | |
| R-cran-assertthat-0...> | 2025-12-26 08:54 | 55K | |
| R-cran-backports-1.5..> | 2025-12-26 09:54 | 117K | |
| R-cran-base64enc-0.1..> | 2025-12-26 09:23 | 26K | |
| R-cran-bayesm-3.1.6.pkg | 2025-12-29 13:00 | 2.5M | |
| R-cran-bdsmatrix-1.3..> | 2025-12-27 13:00 | 301K | |
| R-cran-bibtex-0.5.1.pkg | 2025-12-28 00:55 | 95K | |
| R-cran-bindr-0.1.3.pkg | 2025-12-27 16:42 | 18K | |
| R-cran-bindrcpp-0.2...> | 2025-12-27 20:47 | 74K | |
| R-cran-bit-4.6.0.pkg | 2025-12-26 09:23 | 604K | |
| R-cran-bit64-4.6.0.1..> | 2025-12-26 09:58 | 493K | |
| R-cran-bitops-1.0.9.pkg | 2025-12-26 19:00 | 28K | |
| R-cran-blob-1.2.4.pkg | 2025-12-27 00:48 | 49K | |
| R-cran-brew-1.0.10.pkg | 2025-12-26 20:11 | 65K | |
| R-cran-brio-1.1.5.pkg | 2025-12-26 15:26 | 37K | |
| R-cran-broom-1.0.11.pkg | 2025-12-26 11:32 | 1.7M | |
| R-cran-brotli-1.3.2.pkg | 2025-12-30 02:31 | 790K | |
| R-cran-bslib-0.9.0.pkg | 2025-12-26 13:20 | 4.7M | |
| R-cran-caTools-1.18...> | 2025-12-29 23:28 | 201K | |
| R-cran-cachem-1.1.0.pkg | 2025-12-26 09:53 | 70K | |
| R-cran-callr-3.7.6.pkg | 2025-12-26 14:44 | 439K | |
| R-cran-car-3.1.3_1.pkg | 2025-12-27 01:36 | 1.5M | |
| R-cran-carData-3.0.5..> | 2025-12-26 19:04 | 1.6M | |
| R-cran-caret-7.0.1.pkg | 2025-12-29 19:01 | 3.4M | |
| R-cran-cellranger-1...> | 2025-12-26 11:39 | 106K | |
| R-cran-checkmate-2.3..> | 2025-12-27 01:12 | 689K | |
| R-cran-chk-0.10.0.pkg | 2025-12-26 23:26 | 674K | |
| R-cran-chron-2.3.57_..> | 2025-12-27 08:03 | 184K | |
| R-cran-classInt-0.4...> | 2025-12-26 19:07 | 469K | |
| R-cran-cli-3.6.5.pkg | 2025-12-26 06:04 | 1.3M | |
| R-cran-cliapp-0.1.2.pkg | 2025-12-30 09:04 | 237K | |
| R-cran-clipr-0.8.0_1..> | 2025-12-26 11:55 | 52K | |
| R-cran-clisymbols-1...> | 2025-12-28 02:42 | 19K | |
| R-cran-clock-0.7.3.pkg | 2025-12-27 01:10 | 1.6M | |
| R-cran-cmprsk-2.2.12..> | 2025-12-27 16:46 | 97K | |
| R-cran-coda-0.19.4.1..> | 2025-12-26 20:45 | 318K | |
| R-cran-collapse-2.1...> | 2025-12-27 11:36 | 3.2M | |
| R-cran-colorspace-2...> | 2025-12-26 11:13 | 2.4M | |
| R-cran-combinat-0.0...> | 2025-12-26 20:46 | 41K | |
| R-cran-commonmark-2...> | 2025-12-26 11:09 | 119K | |
| R-cran-conf.design-2..> | 2025-12-26 21:18 | 44K | |
| R-cran-conflicted-1...> | 2025-12-27 12:04 | 59K | |
| R-cran-conquer-1.3.3..> | 2025-12-29 11:21 | 503K | |
| R-cran-covr-3.6.5.pkg | 2025-12-28 08:20 | 352K | |
| R-cran-cowplot-1.2.0..> | 2025-12-26 14:46 | 1.3M | |
| R-cran-cpp11-0.5.2.pkg | 2025-12-26 09:23 | 226K | |
| R-cran-crayon-1.5.3.pkg | 2025-12-26 09:51 | 161K | |
| R-cran-credentials-2..> | 2025-12-26 15:40 | 212K | |
| R-cran-crosstalk-1.2..> | 2025-12-27 16:54 | 363K | |
| R-cran-curl-7.0.0.pkg | 2025-12-26 08:55 | 456K | |
| R-cran-cvar-0.6.pkg | 2025-12-27 16:21 | 154K | |
| R-cran-cyclocomp-1.1..> | 2025-12-27 21:49 | 34K | |
| R-cran-data.table-1...> | 2025-12-26 16:00 | 2.2M | |
| R-cran-date-1.2.42_1..> | 2025-12-30 17:36 | 48K | |
| R-cran-dbplyr-2.5.1.pkg | 2025-12-27 13:00 | 1.2M | |
| R-cran-ddalpha-1.3.1..> | 2025-12-28 03:59 | 1.2M | |
| R-cran-decor-1.0.2.pkg | 2025-12-30 12:13 | 32K | |
| R-cran-deldir-2.0.4.pkg | 2025-12-26 19:34 | 268K | |
| R-cran-desc-1.4.3.pkg | 2025-12-26 12:54 | 349K | |
| R-cran-devtools-2.4...> | 2025-12-27 14:18 | 672K | |
| R-cran-diagram-1.6.5..> | 2025-12-28 16:15 | 647K | |
| R-cran-dichromat-2.0..> | 2025-12-29 13:57 | 143K | |
| R-cran-diffobj-0.3.6..> | 2025-12-26 16:10 | 1.1M | |
| R-cran-digest-0.6.39..> | 2025-12-26 09:23 | 205K | |
| R-cran-dimRed-0.2.7.pkg | 2025-12-30 08:28 | 1.5M | |
| R-cran-dlmodeler-1.4..> | 2025-12-29 18:16 | 166K | |
| R-cran-doBy-4.7.1.pkg | 2025-12-26 15:32 | 4.5M | |
| R-cran-doParallel-1...> | 2025-12-27 17:39 | 183K | |
| R-cran-docopt-0.7.2.pkg | 2025-12-29 17:26 | 240K | |
| R-cran-downlit-0.4.5..> | 2025-12-26 18:57 | 121K | |
| R-cran-downloader-0...> | 2025-12-30 14:15 | 23K | |
| R-cran-dplyr-1.1.4.pkg | 2025-12-26 09:18 | 1.4M | |
| R-cran-dtplyr-1.3.2.pkg | 2025-12-27 17:03 | 418K | |
| R-cran-dygraphs-1.1...> | 2025-12-29 00:34 | 373K | |
| R-cran-e1071-1.7.17.pkg | 2025-12-26 15:26 | 572K | |
| R-cran-eRm-1.0.10.pkg | 2025-12-30 06:31 | 1.2M | |
| R-cran-ellipsis-0.3...> | 2025-12-26 21:30 | 35K | |
| R-cran-energy-1.7.12..> | 2025-12-30 06:39 | 283K | |
| R-cran-epicalc-2.15...> | 2025-12-28 21:36 | 746K | |
| R-cran-etm-1.1.2.pkg | 2025-12-27 18:11 | 552K | |
| R-cran-evaluate-1.0...> | 2025-12-26 09:52 | 112K | |
| R-cran-exactRankTest..> | 2025-12-27 17:26 | 155K | |
| R-cran-exams-2.4.2.pkg | 2025-12-27 16:52 | 2.0M | |
| R-cran-exams2forms-0..> | 2025-12-30 11:43 | 432K | |
| R-cran-expm-1.0.0.pkg | 2025-12-26 18:37 | 218K | |
| R-cran-fBasics-4041...> | 2025-12-27 15:45 | 2.4M | |
| R-cran-fGarch-4033.9..> | 2025-12-30 05:23 | 664K | |
| R-cran-fansi-1.0.7.pkg | 2025-12-26 17:37 | 637K | |
| R-cran-farver-2.1.2.pkg | 2025-12-26 09:21 | 1.3M | |
| R-cran-fastICA-1.2.7..> | 2025-12-27 11:59 | 47K | |
| R-cran-fastmap-1.2.0..> | 2025-12-26 09:23 | 71K | |
| R-cran-filelock-1.0...> | 2025-12-26 21:19 | 26K | |
| R-cran-fontawesome-0..> | 2025-12-26 14:19 | 1.3M | |
| R-cran-forcats-1.0.1..> | 2025-12-26 13:35 | 414K | |
| R-cran-foreach-1.5.2..> | 2025-12-27 00:09 | 124K | |
| R-cran-forecast-8.24..> | 2025-12-26 14:09 | 1.5M | |
| R-cran-formatR-1.14.pkg | 2025-12-30 02:07 | 147K | |
| R-cran-fracdiff-1.5...> | 2025-12-26 11:00 | 108K | |
| R-cran-fs-1.6.6.pkg | 2025-12-26 10:49 | 294K | |
| R-cran-future-1.68.0..> | 2025-12-26 11:52 | 898K | |
| R-cran-future.apply-..> | 2025-12-26 14:42 | 188K | |
| R-cran-gapminder-1.0..> | 2025-12-29 23:21 | 2.0M | |
| R-cran-gargle-1.6.0.pkg | 2025-12-26 19:16 | 594K | |
| R-cran-gbRd-0.4.12.pkg | 2025-12-29 00:02 | 45K | |
| R-cran-gbm-2.0.8_12.pkg | 2025-12-30 16:40 | 437K | |
| R-cran-gbutils-0.5.1..> | 2025-12-26 23:54 | 308K | |
| R-cran-gdata-3.0.1.pkg | 2025-12-27 15:17 | 496K | |
| R-cran-geepack-1.3.1..> | 2025-12-27 09:39 | 400K | |
| R-cran-generics-0.1...> | 2025-12-26 09:04 | 82K | |
| R-cran-geometry-0.5...> | 2025-12-27 08:28 | 878K | |
| R-cran-gert-2.1.0_3.pkg | 2025-12-26 19:49 | 244K | |
| R-cran-getopt-1.20.4..> | 2025-12-26 19:22 | 39K | |
| R-cran-ggforce-0.5.0..> | 2025-12-29 08:56 | 1.8M | |
| R-cran-ggplot2-4.0.0..> | 2025-12-26 11:02 | 5.9M | |
| R-cran-ggrepel-0.9.6..> | 2025-12-30 09:32 | 272K | |
| R-cran-gh-1.5.0.pkg | 2025-12-26 18:02 | 126K | |
| R-cran-git2r-0.36.2.pkg | 2025-12-29 22:16 | 421K | |
| R-cran-gitcreds-0.1...> | 2025-12-26 15:43 | 91K | |
| R-cran-glmnet-1.8.5_..> | 2025-12-28 03:11 | 308K | |
| R-cran-globals-0.18...> | 2025-12-26 09:52 | 154K | |
| R-cran-glue-1.8.0.pkg | 2025-12-26 06:03 | 160K | |
| R-cran-gmm-1.9.1.pkg | 2025-12-30 11:15 | 1.2M | |
| R-cran-gmodels-2.19...> | 2025-12-30 01:59 | 115K | |
| R-cran-gmp-0.7.5.pkg | 2025-12-26 19:59 | 311K | |
| R-cran-googledrive-2..> | 2025-12-26 22:06 | 1.2M | |
| R-cran-googlesheets4..> | 2025-12-27 18:24 | 522K | |
| R-cran-gower-1.0.2.pkg | 2025-12-27 01:08 | 202K | |
| R-cran-gpclib-1.5.6_..> | 2025-12-29 15:23 | 197K | |
| R-cran-gridBase-0.4...> | 2025-12-27 03:32 | 157K | |
| R-cran-gridExtra-2.3..> | 2025-12-27 00:59 | 1.0M | |
| R-cran-gsl-2.1.9.pkg | 2025-12-27 06:09 | 493K | |
| R-cran-gss-2.2.9.pkg | 2025-12-26 20:27 | 1.6M | |
| R-cran-gsubfn-0.7_1.pkg | 2025-12-27 16:12 | 341K | |
| R-cran-gtable-0.3.6.pkg | 2025-12-26 09:56 | 222K | |
| R-cran-gtools-3.9.5.pkg | 2025-12-26 21:41 | 350K | |
| R-cran-hardhat-1.4.2..> | 2025-12-26 22:54 | 854K | |
| R-cran-haven-2.5.5.pkg | 2025-12-26 16:40 | 366K | |
| R-cran-hdrcde-3.4_1.pkg | 2025-12-27 02:10 | 213K | |
| R-cran-hexbin-1.28.5..> | 2025-12-29 05:42 | 1.5M | |
| R-cran-highr-0.11.pkg | 2025-12-26 09:52 | 38K | |
| R-cran-hms-1.1.4.pkg | 2025-12-26 09:47 | 106K | |
| R-cran-htmlTable-2.4..> | 2025-12-27 14:16 | 572K | |
| R-cran-htmltools-0.5..> | 2025-12-26 10:46 | 365K | |
| R-cran-htmlwidgets-1..> | 2025-12-26 19:07 | 408K | |
| R-cran-httpuv-1.6.16..> | 2025-12-26 17:29 | 476K | |
| R-cran-httr-1.4.7.pkg | 2025-12-26 14:55 | 473K | |
| R-cran-httr2-1.2.2.pkg | 2025-12-26 16:32 | 803K | |
| R-cran-hunspell-3.0...> | 2025-12-26 11:00 | 2.5M | |
| R-cran-ids-1.0.1.pkg | 2025-12-26 23:09 | 122K | |
| R-cran-igraph-2.2.1.pkg | 2025-12-27 17:16 | 5.3M | |
| R-cran-influenceR-0...> | 2025-12-28 21:11 | 49K | |
| R-cran-ini-0.3.1_1.pkg | 2025-12-26 15:36 | 15K | |
| R-cran-inline-0.3.21..> | 2025-12-28 16:53 | 127K | |
| R-cran-interp-1.1.6.pkg | 2025-12-26 22:01 | 1.5M | |
| R-cran-intervals-0.1..> | 2025-12-29 00:58 | 590K | |
| R-cran-ipred-0.9.15.pkg | 2025-12-26 20:29 | 375K | |
| R-cran-irlba-2.3.5.1..> | 2025-12-28 07:24 | 288K | |
| R-cran-isoband-0.3.0..> | 2025-12-26 10:01 | 1.6M | |
| R-cran-iterators-1.0..> | 2025-12-26 18:28 | 329K | |
| R-cran-itertools-0.1..> | 2025-12-28 10:50 | 109K | |
| R-cran-jose-1.2.1.pkg | 2025-12-28 05:19 | 248K | |
| R-cran-jpeg-0.1.11.pkg | 2025-12-26 22:04 | 31K | |
| R-cran-jquerylib-0.1..> | 2025-12-26 11:30 | 290K | |
| R-cran-jsonlite-2.0...> | 2025-12-26 09:26 | 624K | |
| R-cran-kernlab-0.9.3..> | 2025-12-26 20:15 | 1.9M | |
| R-cran-kit-0.0.20.pkg | 2025-12-28 12:02 | 159K | |
| R-cran-knitr-1.51.pkg | 2025-12-26 11:25 | 957K | |
| R-cran-ks-1.15.0.pkg | 2025-12-26 21:23 | 1.9M | |
| R-cran-labeling-0.4...> | 2025-12-26 09:20 | 60K | |
| R-cran-later-1.4.4.pkg | 2025-12-26 11:24 | 133K | |
| R-cran-latticeExtra-..> | 2025-12-27 07:38 | 2.1M | |
| R-cran-lava-1.8.2.pkg | 2025-12-26 15:32 | 2.4M | |
| R-cran-lazyeval-0.2...> | 2025-12-27 00:58 | 142K | |
| R-cran-lifecycle-1.0..> | 2025-12-26 06:32 | 119K | |
| R-cran-linprog-0.9.4..> | 2025-12-26 20:29 | 69K | |
| R-cran-lintr-3.3.0.1..> | 2025-12-28 06:13 | 1.4M | |
| R-cran-listenv-0.10...> | 2025-12-26 09:52 | 110K | |
| R-cran-litedown-0.9.pkg | 2025-12-27 15:50 | 364K | |
| R-cran-lme4-1.1.38.pkg | 2025-12-26 15:31 | 4.4M | |
| R-cran-lmtest-0.9.40..> | 2025-12-26 11:39 | 401K | |
| R-cran-locfit-1.5.9...> | 2025-12-27 01:13 | 537K | |
| R-cran-lpSolve-5.6.2..> | 2025-12-26 18:49 | 344K | |
| R-cran-ltm-1.2.0_1.pkg | 2025-12-27 17:52 | 693K | |
| R-cran-lubridate-1.9..> | 2025-12-26 21:25 | 1.0M | |
| R-cran-magic-1.6.1.pkg | 2025-12-26 20:52 | 394K | |
| R-cran-magick-2.9.0.pkg | 2025-12-27 01:16 | 4.6M | |
| R-cran-magrittr-2.0...> | 2025-12-26 06:56 | 203K | |
| R-cran-maps-3.4.3.pkg | 2025-12-30 10:35 | 2.2M | |
| R-cran-markdown-2.0.pkg | 2025-12-30 08:17 | 62K | |
| R-cran-mathjaxr-1.8...> | 2025-12-26 19:38 | 592K | |
| R-cran-matrixStats-1..> | 2025-12-27 12:57 | 466K | |
| R-cran-maxLik-1.5.2...> | 2025-12-27 18:22 | 1.0M | |
| R-cran-mclust-6.1.2.pkg | 2025-12-26 20:20 | 3.8M | |
| R-cran-mcmc-0.9.8.pkg | 2025-12-26 20:23 | 1.2M | |
| R-cran-memisc-0.99.3..> | 2025-12-30 16:20 | 1.7M | |
| R-cran-memoise-2.0.1..> | 2025-12-26 11:09 | 51K | |
| R-cran-microbenchmar..> | 2025-12-26 14:20 | 65K | |
| R-cran-mime-0.13.pkg | 2025-12-26 12:24 | 44K | |
| R-cran-miniUI-0.1.2.pkg | 2025-12-26 20:45 | 35K | |
| R-cran-minqa-1.2.8.pkg | 2025-12-26 14:02 | 109K | |
| R-cran-misc3d-0.9.1_..> | 2025-12-26 15:41 | 234K | |
| R-cran-miscTools-0.6..> | 2025-12-26 21:14 | 95K | |
| R-cran-mitools-2.4_3..> | 2025-12-27 01:13 | 260K | |
| R-cran-mlbench-2.1.6..> | 2025-12-30 15:57 | 1.0M | |
| R-cran-mnormt-2.1.1.pkg | 2025-12-26 22:46 | 166K | |
| R-cran-mockery-0.4.5..> | 2025-12-30 17:21 | 43K | |
| R-cran-mockr-0.2.2.pkg | 2025-12-28 01:16 | 43K | |
| R-cran-modelr-0.1.11..> | 2025-12-26 14:40 | 200K | |
| R-cran-moments-0.14...> | 2025-12-27 18:02 | 54K | |
| R-cran-mpoly-1.1.2.pkg | 2025-12-30 10:36 | 215K | |
| R-cran-msm-1.8.2.pkg | 2025-12-27 00:59 | 1.5M | |
| R-cran-multicool-1.0..> | 2025-12-26 20:01 | 104K | |
| R-cran-munsell-0.5.1..> | 2025-12-28 06:34 | 230K | |
| R-cran-mvtnorm-1.3.3..> | 2025-12-26 18:44 | 921K | |
| R-cran-ncdf4-1.24.pkg | 2025-12-29 19:29 | 272K | |
| R-cran-nloptr-2.2.1.pkg | 2025-12-26 13:05 | 254K | |
| R-cran-nnls-1.4_13.pkg | 2025-12-30 16:51 | 34K | |
| R-cran-nortest-1.0.4..> | 2025-12-27 03:39 | 37K | |
| R-cran-numDeriv-2016..> | 2025-12-26 13:05 | 116K | |
| R-cran-numbers-0.8.5..> | 2025-12-26 23:34 | 231K | |
| R-cran-openssl-2.3.4..> | 2025-12-26 14:46 | 667K | |
| R-cran-openxlsx-4.2...> | 2025-12-26 22:10 | 2.0M | |
| R-cran-optimx-2025.4..> | 2025-12-29 17:15 | 2.4M | |
| R-cran-optparse-1.7...> | 2025-12-26 20:37 | 79K | |
| R-cran-orthopolynom-..> | 2025-12-27 17:05 | 331K | |
| R-cran-otel-0.2.0.pkg | 2025-12-26 10:56 | 283K | |
| R-cran-outliers-0.15..> | 2025-12-27 10:15 | 81K | |
| R-cran-pROC-1.19.0.1..> | 2025-12-27 18:29 | 939K | |
| R-cran-pak-0.9.2.pkg | 2025-12-30 12:04 | 5.5M | |
| R-cran-parallelly-1...> | 2025-12-26 10:01 | 582K | |
| R-cran-parsedate-1.3..> | 2025-12-28 12:37 | 45K | |
| R-cran-partitions-1...> | 2025-12-26 22:13 | 504K | |
| R-cran-patrick-0.3.1..> | 2025-12-30 07:09 | 23K | |
| R-cran-pbkrtest-0.5...> | 2025-12-26 20:20 | 212K | |
| R-cran-pdftools-3.6...> | 2025-12-28 19:37 | 918K | |
| R-cran-pillar-1.11.1..> | 2025-12-26 06:46 | 636K | |
| R-cran-pingr-2.0.5.pkg | 2025-12-30 02:37 | 42K | |
| R-cran-pixmap-0.4.14..> | 2025-12-29 22:24 | 211K | |
| R-cran-pixture-0.1.0..> | 2025-12-29 04:50 | 312K | |
| R-cran-pkgbuild-1.4...> | 2025-12-26 17:00 | 208K | |
| R-cran-pkgcache-2.2...> | 2025-12-27 09:12 | 1.0M | |
| R-cran-pkgconfig-2.0..> | 2025-12-26 06:54 | 20K | |
| R-cran-pkgdepends-0...> | 2025-12-28 23:09 | 2.0M | |
| R-cran-pkgdown-2.2.0..> | 2025-12-26 22:52 | 1.3M | |
| R-cran-pkgload-1.4.1..> | 2025-12-26 19:50 | 243K | |
| R-cran-pkgmaker-0.32..> | 2025-12-27 15:34 | 669K | |
| R-cran-pkgsearch-3.1..> | 2025-12-27 22:50 | 195K | |
| R-cran-plm-2.6.7.pkg | 2025-12-30 09:00 | 1.7M | |
| R-cran-plogr-0.2.0_4..> | 2025-12-26 09:05 | 14K | |
| R-cran-plot3D-1.4.2.pkg | 2025-12-26 19:29 | 2.6M | |
| R-cran-pls-2.8.5.pkg | 2025-12-29 06:43 | 4.4M | |
| R-cran-plyr-1.8.9.pkg | 2025-12-26 21:09 | 774K | |
| R-cran-png-0.1.8.pkg | 2025-12-27 01:00 | 40K | |
| R-cran-polyclip-1.10..> | 2025-12-27 18:01 | 122K | |
| R-cran-polycor-0.8.2..> | 2025-12-26 22:52 | 73K | |
| R-cran-polynom-1.4.1..> | 2025-12-26 19:53 | 376K | |
| R-cran-pracma-2.4.6.pkg | 2025-12-26 19:07 | 1.6M | |
| R-cran-praise-1.0.0_..> | 2025-12-26 19:10 | 19K | |
| R-cran-prettycode-1...> | 2025-12-27 18:37 | 240K | |
| R-cran-prettyunits-1..> | 2025-12-26 09:45 | 154K | |
| R-cran-processx-3.8...> | 2025-12-26 10:59 | 339K | |
| R-cran-prodlim-1.6.1..> | 2025-12-26 18:44 | 385K | |
| R-cran-profvis-0.4.0..> | 2025-12-26 21:48 | 208K | |
| R-cran-progress-1.2...> | 2025-12-26 10:54 | 91K | |
| R-cran-progressr-0.1..> | 2025-12-26 14:06 | 370K | |
| R-cran-promises-1.5...> | 2025-12-26 13:23 | 1.5M | |
| R-cran-proto-1.0.0_5..> | 2025-12-26 23:00 | 455K | |
| R-cran-proxy-0.4.28.pkg | 2025-12-26 13:56 | 170K | |
| R-cran-ps-1.9.1.pkg | 2025-12-26 10:24 | 377K | |
| R-cran-psych-2.5.6.pkg | 2025-12-27 11:45 | 3.3M | |
| R-cran-purrr-1.2.0.pkg | 2025-12-26 09:24 | 555K | |
| R-cran-pwr-1.3.0_1.pkg | 2025-12-27 15:35 | 145K | |
| R-cran-pystr-2.0.0_6..> | 2025-12-29 08:03 | 141K | |
| R-cran-qcc-2.7_5.pkg | 2025-12-27 13:19 | 3.2M | |
| R-cran-qpdf-1.4.1.pkg | 2025-12-27 17:26 | 96K | |
| R-cran-quadprog-1.5...> | 2025-12-26 09:54 | 33K | |
| R-cran-qualityTools-..> | 2025-12-30 07:08 | 1.8M | |
| R-cran-quantmod-0.4...> | 2025-12-26 09:52 | 1.0M | |
| R-cran-quantreg-6.1.pkg | 2025-12-26 19:55 | 1.4M | |
| R-cran-rJava-1.0.11_..> | 2025-12-27 01:17 | 695K | |
| R-cran-ragg-1.5.0.pkg | 2025-12-26 20:05 | 546K | |
| R-cran-randomForest-..> | 2025-12-30 14:19 | 214K | |
| R-cran-rappdirs-0.3...> | 2025-12-26 10:46 | 47K | |
| R-cran-raster-3.6.32..> | 2025-12-29 18:04 | 3.0M | |
| R-cran-rbibutils-2.4..> | 2025-12-26 09:54 | 1.0M | |
| R-cran-rcmdcheck-1.4..> | 2025-12-26 23:00 | 198K | |
| R-cran-readr-2.1.6.pkg | 2025-12-26 13:22 | 776K | |
| R-cran-readxl-1.4.5.pkg | 2025-12-26 13:39 | 965K | |
| R-cran-recipes-1.3.1..> | 2025-12-27 09:07 | 2.0M | |
| R-cran-reformulas-0...> | 2025-12-26 14:46 | 144K | |
| R-cran-registry-0.5...> | 2025-12-27 01:00 | 190K | |
| R-cran-rematch-2.0.0..> | 2025-12-26 10:22 | 18K | |
| R-cran-rematch2-2.1...> | 2025-12-27 00:43 | 49K | |
| R-cran-remotes-2.5.0..> | 2025-12-26 21:43 | 435K | |
| R-cran-repr-1.1.7.pkg | 2025-12-30 06:42 | 131K | |
| R-cran-reprex-2.1.1.pkg | 2025-12-27 14:52 | 493K | |
| R-cran-reshape-0.8.1..> | 2025-12-30 10:31 | 165K | |
| R-cran-reshape2-1.4...> | 2025-12-27 11:55 | 114K | |
| R-cran-revealjs-0.10..> | 2025-12-30 17:32 | 1.6M | |
| R-cran-rex-1.2.1_1.pkg | 2025-12-27 10:11 | 122K | |
| R-cran-rgenoud-5.9.0..> | 2025-12-26 22:51 | 659K | |
| R-cran-rgexf-0.16.3.pkg | 2025-12-29 13:55 | 1.4M | |
| R-cran-rgl-1.3.31.pkg | 2025-12-28 00:36 | 4.1M | |
| R-cran-rio-1.2.4.pkg | 2025-12-26 20:07 | 577K | |
| R-cran-rjson-0.2.23.pkg | 2025-12-27 18:32 | 101K | |
| R-cran-rlang-1.1.6.pkg | 2025-12-26 06:03 | 1.6M | |
| R-cran-rmarkdown-2.3..> | 2025-12-26 15:40 | 2.0M | |
| R-cran-rngtools-1.5...> | 2025-12-27 17:02 | 80K | |
| R-cran-robustbase-0...> | 2025-12-27 18:01 | 3.0M | |
| R-cran-roxygen2-7.3...> | 2025-12-27 02:01 | 712K | |
| R-cran-rprojroot-2.1..> | 2025-12-26 11:38 | 128K | |
| R-cran-rstudioapi-0...> | 2025-12-26 15:10 | 299K | |
| R-cran-rversions-3.0..> | 2025-12-26 22:49 | 160K | |
| R-cran-rvest-1.0.5.pkg | 2025-12-27 17:07 | 298K | |
| R-cran-s2-1.1.9.pkg | 2025-12-26 19:04 | 1.7M | |
| R-cran-sandwich-3.1...> | 2025-12-26 09:21 | 1.4M | |
| R-cran-sass-0.4.10.pkg | 2025-12-26 12:21 | 2.1M | |
| R-cran-scales-1.4.0.pkg | 2025-12-26 10:55 | 772K | |
| R-cran-scatterplot3d..> | 2025-12-27 14:47 | 340K | |
| R-cran-scrapeR-0.1.8..> | 2025-12-30 18:29 | 18K | |
| R-cran-selectr-0.5.1..> | 2025-12-26 22:56 | 494K | |
| R-cran-servr-0.32.pkg | 2025-12-27 12:45 | 97K | |
| R-cran-sessioninfo-1..> | 2025-12-26 18:28 | 270K | |
| R-cran-sets-1.0.25.pkg | 2025-12-26 20:10 | 614K | |
| R-cran-sf-1.0.21_2.pkg | 2025-12-26 22:10 | 4.3M | |
| R-cran-sfsmisc-1.1.2..> | 2025-12-27 13:16 | 669K | |
| R-cran-shape-1.4.6.1..> | 2025-12-27 10:01 | 729K | |
| R-cran-shiny-1.12.1.pkg | 2025-12-26 18:11 | 3.6M | |
| R-cran-shinyjs-2.1.0..> | 2025-12-29 19:21 | 1.0M | |
| R-cran-slam-0.1.55.pkg | 2025-12-30 08:00 | 193K | |
| R-cran-sm-2.2.6.0.pkg | 2025-12-29 06:39 | 782K | |
| R-cran-snow-0.4.4_1.pkg | 2025-12-27 03:37 | 96K | |
| R-cran-sodium-1.4.0.pkg | 2025-12-28 08:30 | 258K | |
| R-cran-som-0.3.5.2.pkg | 2025-12-29 17:10 | 232K | |
| R-cran-sourcetools-0..> | 2025-12-26 15:40 | 44K | |
| R-cran-sp-2.2.0.pkg | 2025-12-26 19:27 | 4.4M | |
| R-cran-spData-2.3.4.pkg | 2025-12-27 01:38 | 3.5M | |
| R-cran-sparsevctrs-0..> | 2025-12-26 19:41 | 201K | |
| R-cran-spdep-1.4.1.pkg | 2025-12-27 10:57 | 4.0M | |
| R-cran-spelling-2.3...> | 2025-12-26 14:45 | 54K | |
| R-cran-sqldf-0.4.11_..> | 2025-12-28 18:14 | 75K | |
| R-cran-sspir-0.2.10_..> | 2025-12-30 14:29 | 169K | |
| R-cran-stabledist-0...> | 2025-12-27 01:40 | 84K | |
| R-cran-statmod-1.5.0..> | 2025-12-28 08:30 | 296K | |
| R-cran-stringi-1.8.7..> | 2025-12-26 09:11 | 861K | |
| R-cran-stringr-1.6.0..> | 2025-12-26 09:21 | 316K | |
| R-cran-strucchange-1..> | 2025-12-26 10:16 | 936K | |
| R-cran-survey-4.4.8.pkg | 2025-12-27 08:15 | 3.3M | |
| R-cran-sys-3.4.3.pkg | 2025-12-26 09:55 | 43K | |
| R-cran-systemfonts-1..> | 2025-12-26 13:20 | 639K | |
| R-cran-tensor-1.5.1.pkg | 2025-12-29 00:39 | 15K | |
| R-cran-terra-1.8.86_..> | 2025-12-27 12:31 | 4.2M | |
| R-cran-testit-0.15.pkg | 2025-12-30 01:00 | 34K | |
| R-cran-testthat-3.3...> | 2025-12-26 23:31 | 1.8M | |
| R-cran-textshaping-1..> | 2025-12-26 15:38 | 164K | |
| R-cran-tibble-3.3.0.pkg | 2025-12-26 08:51 | 645K | |
| R-cran-tidyr-1.3.2.pkg | 2025-12-26 10:10 | 1.1M | |
| R-cran-tidyselect-1...> | 2025-12-26 09:06 | 223K | |
| R-cran-tidyverse-2.0..> | 2025-12-28 10:19 | 409K | |
| R-cran-timeDate-4041..> | 2025-12-26 11:09 | 1.2M | |
| R-cran-timeSeries-40..> | 2025-12-27 00:58 | 1.8M | |
| R-cran-timechange-0...> | 2025-12-26 19:16 | 162K | |
| R-cran-tinytest-1.4...> | 2025-12-29 05:52 | 661K | |
| R-cran-tinytex-0.58.pkg | 2025-12-26 13:39 | 143K | |
| R-cran-truncnorm-1.0..> | 2025-12-26 21:29 | 24K | |
| R-cran-tseries-0.10...> | 2025-12-26 11:01 | 367K | |
| R-cran-tth-4.16.0.pkg | 2025-12-26 21:30 | 411K | |
| R-cran-tweenr-2.0.3.pkg | 2025-12-27 19:25 | 372K | |
| R-cran-twitteR-1.1.9..> | 2025-12-30 02:28 | 590K | |
| R-cran-tzdb-0.5.0.pkg | 2025-12-26 10:26 | 529K | |
| R-cran-udunits2-0.13..> | 2025-12-29 17:01 | 50K | |
| R-cran-units-1.0.0.pkg | 2025-12-26 19:50 | 464K | |
| R-cran-urca-1.3.4.pkg | 2025-12-26 11:49 | 1.0M | |
| R-cran-urlchecker-1...> | 2025-12-26 23:34 | 33K | |
| R-cran-uroot-2.1.3.pkg | 2025-12-30 00:59 | 1.8M | |
| R-cran-usethis-3.0.0..> | 2025-12-26 22:26 | 908K | |
| R-cran-utf8-1.2.6.pkg | 2025-12-26 06:35 | 143K | |
| R-cran-uuid-1.2.1.pkg | 2025-12-26 19:09 | 45K | |
| R-cran-vars-1.6.1.pkg | 2025-12-28 18:33 | 408K | |
| R-cran-vcd-1.4.13.pkg | 2025-12-26 22:17 | 1.2M | |
| R-cran-vctrs-0.6.5.pkg | 2025-12-26 06:42 | 1.3M | |
| R-cran-viridis-0.6.5..> | 2025-12-27 02:16 | 2.9M | |
| R-cran-viridisLite-0..> | 2025-12-26 09:20 | 1.2M | |
| R-cran-visNetwork-2...> | 2025-12-27 10:06 | 3.6M | |
| R-cran-vroom-1.6.7.pkg | 2025-12-26 12:24 | 807K | |
| R-cran-waldo-0.6.2.pkg | 2025-12-26 18:57 | 146K | |
| R-cran-webfakes-1.4...> | 2025-12-28 11:00 | 865K | |
| R-cran-webp-1.3.0.pkg | 2025-12-30 16:01 | 28K | |
| R-cran-webshot-0.5.5..> | 2025-12-29 16:19 | 187K | |
| R-cran-webutils-1.2...> | 2025-12-27 23:52 | 47K | |
| R-cran-whisker-0.4.1..> | 2025-12-26 18:28 | 62K | |
| R-cran-whoami-1.3.0.pkg | 2025-12-29 22:44 | 31K | |
| R-cran-withr-3.0.2.pkg | 2025-12-26 06:48 | 225K | |
| R-cran-wk-0.9.5.pkg | 2025-12-26 15:36 | 1.7M | |
| R-cran-writexl-1.5.4..> | 2025-12-26 16:34 | 146K | |
| R-cran-xfun-0.55.pkg | 2025-12-26 09:16 | 576K | |
| R-cran-xml2-1.5.1.pkg | 2025-12-26 11:32 | 317K | |
| R-cran-xmlparsedata-..> | 2025-12-27 03:34 | 21K | |
| R-cran-xopen-1.0.1.pkg | 2025-12-26 19:50 | 26K | |
| R-cran-xtable-1.8.4_..> | 2025-12-26 15:28 | 674K | |
| R-cran-xts-0.14.1.pkg | 2025-12-26 09:04 | 1.1M | |
| R-cran-yaml-2.3.12.pkg | 2025-12-26 09:53 | 112K | |
| R-cran-zeallot-0.2.0..> | 2025-12-30 07:14 | 58K | |
| R-cran-zip-2.3.3.pkg | 2025-12-26 17:30 | 157K | |
| R-cran-zoo-1.8.14.pkg | 2025-12-26 07:57 | 1.0M | |
| REminiscence-0.5.5.pkg | 2025-12-29 15:15 | 208K | |
| RVVM-0.6.pkg | 2025-08-17 03:31 | 936K | |
| RVVM-nox11-0.6.pkg | 2025-08-21 23:03 | 918K | |
| ReText-8.1.0_1.pkg | 2025-12-29 04:47 | 285K | |
| RetroArch-1.22.2_1.pkg | 2025-12-28 11:18 | 5.1M | |
| Ri-li-3.1.5.pkg | 2025-12-30 17:06 | 14M | |
| RyzenAdj-0.17.0.pkg | 2025-12-29 03:49 | 19K | |
| SASM-3.15.0.pkg | 2025-12-28 08:46 | 1.2M | |
| SCIP-9.2.4_1.pkg | 2025-12-27 00:41 | 8.0M | |
| SFML-2.6.2.pkg | 2025-12-26 22:57 | 470K | |
| SLICOT-5.9.1.pkg | 2025-12-29 07:09 | 2.5M | |
| SNIP-1.1.1.pkg | 2025-12-29 08:44 | 8.0M | |
| SNMP4Nagios-0.4_5.pkg | 2025-12-29 13:21 | 145K | |
| SPRNG-5.0_2.pkg | 2025-12-28 10:14 | 578K | |
| SRB2-2.2.13_2.pkg | 2025-12-28 05:22 | 138M | |
| SamDruckerClientShel..> | 2025-12-22 14:38 | 2.4K | |
| SciPlot-1.36_6.pkg | 2025-12-27 19:55 | 68K | |
| ScrollZ-2.3.1_1.pkg | 2025-08-17 16:09 | 515K | |
| SearchAndRescue-1.4...> | 2025-12-20 16:55 | 316K | |
| SearchAndRescue-data..> | 2025-08-15 02:58 | 48M | |
| SimGrid-3.35_7.pkg | 2025-12-29 04:29 | 1.7M | |
| SoPlex-8.0.0.pkg | 2025-12-18 15:58 | 4.0M | |
| SoQt-1.6.4,1.pkg | 2025-12-26 20:41 | 261K | |
| SoapyAirspy-0.2.0.pkg | 2025-08-16 05:24 | 20K | |
| SoapyBladeRF-0.4.1_3..> | 2025-12-22 08:47 | 45K | |
| SoapyHackRF-0.3.3_2.pkg | 2025-08-21 14:48 | 30K | |
| SoapyPlutoSDR-0.2.2.pkg | 2025-12-24 01:18 | 30K | |
| SoapyRTLSDR-0.3.2_2.pkg | 2025-08-18 09:48 | 29K | |
| SoapyRedPitaya-0.1.1..> | 2025-08-18 17:12 | 15K | |
| SoapyRemote-0.5.2_2.pkg | 2025-12-22 09:01 | 131K | |
| SoapySDR-0.8.1_1.pkg | 2025-08-13 14:56 | 143K | |
| SoapyUHD-0.4.1.18_2.pkg | 2025-12-24 05:17 | 158K | |
| Sockets-2.3.9.9_3.pkg | 2025-12-19 09:50 | 347K | |
| Sorcer-lv2-1.1.3_9.pkg | 2025-12-30 15:29 | 52K | |
| SpaceCadetPinball-2...> | 2025-12-30 15:13 | 632K | |
| SpaceCadetPinball-de..> | 2025-12-28 06:11 | 686K | |
| SparseBitSet-1.3.pkg | 2025-12-26 20:07 | 23K | |
| SpecTcl-1.2.2a.pkg | 2025-12-29 20:29 | 1.4M | |
| TIC-80-1.1.2837_2.pkg | 2025-12-29 07:59 | 753K | |
| TatSu-5.13.2.pkg | 2025-12-18 18:48 | 214K | |
| TestU01-1.2.3_3.pkg | 2025-08-15 14:43 | 2.1M | |
| TkTopNetFlows-0.4_8.pkg | 2025-12-28 01:17 | 82K | |
| Tuba-0.10.3.pkg | 2025-12-30 00:53 | 1.0M | |
| UCD-17.0.0,1.pkg | 2025-12-18 10:15 | 20M | |
| UEFITool-72.pkg | 2025-12-28 19:04 | 733K | |
| UniversalFeedCreator..> | 2025-12-29 12:51 | 26K | |
| Uranium-5.7.0_1,1.pkg | 2025-12-27 14:43 | 391K | |
| VVVVVV-2.4.3.pkg | 2025-12-30 05:23 | 1.8M | |
| VVVVVV-makeandplay-2..> | 2025-12-29 19:28 | 60M | |
| WWWdb-0.8.3_2.pkg | 2025-12-21 21:35 | 55K | |
| WebCalendar-php81-1...> | 2025-12-29 12:15 | 1.5M | |
| WebCalendar-php82-1...> | 2025-12-28 02:11 | 1.5M | |
| WebCalendar-php83-1...> | 2025-12-28 19:48 | 1.5M | |
| WebCalendar-php84-1...> | 2025-12-28 12:06 | 1.5M | |
| WebCalendar-php85-1...> | 2025-12-30 05:56 | 1.5M | |
| WinFF-gtk2-1.6.4_9.pkg | 2025-12-29 01:22 | 3.3M | |
| WinFF-qt5-1.6.4_9.pkg | 2025-12-29 19:07 | 3.2M | |
| WinFF-qt6-1.6.4_9.pkg | 2025-12-30 10:06 | 3.2M | |
| WordNet-3.0_7.pkg | 2025-12-19 02:35 | 7.9M | |
| XPostitPlus-2.3_4.pkg | 2025-12-23 00:10 | 34K | |
| XScreenSaver.App-2.3..> | 2025-12-30 18:54 | 20K | |
| Xbae-4.60.4_6.pkg | 2025-12-26 19:17 | 1.2M | |
| XmHTML-1.1.10_1.pkg | 2025-12-26 19:04 | 593K | |
| Xmt-4.0.0_2.pkg | 2025-12-29 16:08 | 475K | |
| Ymir-0.2.0_1.pkg | 2025-12-30 18:26 | 2.1M | |
| Ymir-gtk4-0.2.0_1.pkg | 2025-12-29 03:48 | 2.1M | |
| ZeGrapher-3.1.1.2025..> | 2025-12-29 17:29 | 713K | |
| a2jmidid-9_5.pkg | 2025-12-28 05:53 | 28K | |
| a2pdf-1.13_2.pkg | 2025-12-22 10:48 | 9.5K | |
| a2png-0.1.5_12.pkg | 2025-12-27 20:48 | 13K | |
| a2ps-4.15.8.pkg | 2025-12-19 15:24 | 648K | |
| aalib-1.4.r5_14.pkg | 2025-08-13 09:46 | 135K | |
| aamath-0.3_5.pkg | 2025-12-23 22:37 | 33K | |
| aaphoto-0.43.1_15.pkg | 2025-12-27 22:44 | 41K | |
| aarch64-binutils-2.4..> | 2025-12-19 15:08 | 2.3M | |
| aarch64-freebsd-sysr..> | 2025-12-20 01:40 | 53M | |
| aarch64-gcc12-12.3.0..> | 2025-12-21 01:58 | 37M | |
| aarch64-gcc13-13.2.0..> | 2025-12-23 08:09 | 39M | |
| aarch64-gcc14-14.1.0..> | 2025-12-24 03:29 | 44M | |
| aarch64-none-elf-bin..> | 2025-12-18 18:11 | 2.5M | |
| aarch64-none-elf-gcc..> | 2025-12-19 03:02 | 37M | |
| aarch64-rust-bootstr..> | 2025-12-30 14:12 | 79M | |
| aardvark-dns-1.17.0_..> | 2025-12-28 03:05 | 613K | |
| ab-av1-0.10.3_1.pkg | 2025-12-29 13:07 | 783K | |
| ab25-0.2.5.pkg | 2025-12-21 22:21 | 35K | |
| abGate-lv2-1.2.0_5.pkg | 2025-12-29 12:04 | 611K | |
| abaddon-0.2.2_2.pkg | 2025-12-29 19:05 | 11M | |
| abbayedesmorts-2.0.5..> | 2025-12-30 10:35 | 1.4M | |
| abc-g202511104.pkg | 2025-12-18 15:31 | 6.4M | |
| abcde-2.9.3_4.pkg | 2025-12-29 05:22 | 68K | |
| abcl-1.9.2_1.pkg | 2025-12-29 23:36 | 10M | |
| abclock-1.0d_4.pkg | 2025-08-18 09:10 | 17K | |
| abcm2ps-8.14.15.pkg | 2025-12-30 06:42 | 230K | |
| abcselect-1.5_1.pkg | 2025-12-21 09:29 | 4.0K | |
| abduco-0.6_1.pkg | 2025-08-18 17:00 | 11K | |
| abe-1.1_9.pkg | 2025-12-21 19:39 | 2.8M | |
| abella-2.0.8_2.pkg | 2025-08-21 06:28 | 955K | |
| abgx360-1.0.7.pkg | 2025-12-23 17:38 | 166K | |
| abi-compliance-check..> | 2025-12-19 14:00 | 197K | |
| abinit-10.4.7.pkg | 2025-12-27 10:13 | 64M | |
| abiword-3.0.5_15.pkg | 2025-12-27 12:10 | 4.7M | |
| abiword-docs-3.0.1_1..> | 2025-12-29 23:04 | 1.0M | |
| abook-0.6.1_2.pkg | 2025-12-20 11:01 | 87K | |
| abs-0908_4.pkg | 2025-12-23 13:38 | 180K | |
| abseil-20250127.1.pkg | 2025-08-10 21:33 | 1.1M | |
| abuse_sdl-0.8_9.pkg | 2025-12-23 14:25 | 4.2M | |
| abx-0.1_2.pkg | 2025-12-28 10:04 | 17K | |
| abyss-2.3.10.pkg | 2025-12-29 11:10 | 1.5M | |
| acados-0.4.3.pkg | 2025-12-30 18:49 | 247K | |
| acalc-0.3.pkg | 2025-12-29 12:10 | 91K | |
| accerciser-3.46.2.pkg | 2025-12-28 05:20 | 1.6M | |
| accounts-qml-module-..> | 2025-12-26 06:36 | 137K | |
| accountsservice-23.1..> | 2025-12-18 12:50 | 134K | |
| accrete-1.0_1.pkg | 2025-08-18 12:40 | 11K | |
| ace-of-penguins-1.4.pkg | 2025-12-30 14:57 | 214K | |
| acerhdf-kmod-0.1.4.1..> | 2025-08-21 12:29 | 8.5K | |
| acfax-0.981011_4.pkg | 2025-12-22 10:23 | 34K | |
| acfgfs-0.6.3.4_1.pkg | 2025-12-29 23:48 | 7.1K | |
| aclgen-2.02_1.pkg | 2025-08-22 20:02 | 11K | |
| aclip-0.6.3.4.pkg | 2025-12-28 04:41 | 7.0K | |
| aclock-0.4.0_11.pkg | 2025-12-27 04:00 | 161K | |
| acltool-1.16.2_1.pkg | 2025-12-21 13:09 | 48K | |
| acme-0.97.r447,1.pkg | 2025-08-15 00:21 | 164K | |
| acme-dns-1.0_30,1.pkg | 2025-12-23 10:59 | 3.6M | |
| acme-tiny-5.0.2.pkg | 2025-12-22 07:41 | 8.0K | |
| acme.sh-3.1.2.pkg | 2025-12-23 17:11 | 252K | |
| acmed-0.21.0_25.pkg | 2025-12-29 14:19 | 1.2M | |
| acmetool-0.2.2_24.pkg | 2025-12-20 15:34 | 3.6M | |
| acpi_call-1.0.1.1403..> | 2025-08-20 00:50 | 5.8K | |
| acpica-tools-2025121..> | 2025-12-28 12:31 | 612K | |
| acsccid-1.1.11.pkg | 2025-12-22 15:38 | 62K | |
| actiona-3.10.1_8.pkg | 2025-12-28 21:08 | 1.7M | |
| activemq-5.18.3.pkg | 2025-12-29 18:44 | 36M | |
| activitymail-1.26.pkg | 2025-12-24 06:59 | 23K | |
| actor-framework-0.19..> | 2025-08-18 23:59 | 1.3M | |
| acts-1.4.2.pkg | 2025-08-17 23:40 | 6.2K | |
| ad-0.4.0.pkg | 2025-12-28 22:39 | 1.7M | |
| ad2vcf-0.1.6.19.pkg | 2025-12-27 11:53 | 8.9K | |
| adacurses-20211021_2..> | 2025-08-15 15:32 | 416K | |
| adamem-1.0_4.pkg | 2025-08-18 23:48 | 473K | |
| adapta-backgrounds-0..> | 2025-12-22 07:44 | 5.0M | |
| adapta-gtk-theme-3.9..> | 2025-12-27 21:47 | 676K | |
| adcli-0.9.2_3.pkg | 2025-12-26 21:56 | 87K | |
| adcomplain-3.52.pkg | 2025-12-20 11:02 | 53K | |
| add-20250914.pkg | 2025-12-21 22:22 | 23K | |
| addlicense-1.2.0_4.pkg | 2025-12-21 17:02 | 1.1M | |
| addresses-0.4.8_10.pkg | 2025-12-27 01:37 | 193K | |
| addresses-goodies-0...> | 2025-12-27 17:50 | 28K | |
| addrwatch-1.0.2_2.pkg | 2025-12-23 07:43 | 18K | |
| addts-1.0.pkg | 2025-08-18 15:17 | 9.0K | |
| adept-2.1.1_4.pkg | 2025-12-29 01:24 | 203K | |
| adguard-exporter-1.1..> | 2025-12-22 14:39 | 2.5M | |
| adguardhome-0.107.69..> | 2025-12-23 09:36 | 7.6M | |
| adiak-0.4.1.pkg | 2025-12-19 14:01 | 24K | |
| adios2-2.10.2_2.pkg | 2025-12-29 13:21 | 3.5M | |
| adjuster-3.246.pkg | 2025-12-21 10:02 | 272K | |
| admesh-0.98.5_1.pkg | 2025-08-20 23:31 | 40K | |
| admintools-g20201224..> | 2025-08-20 23:55 | 2.8K | |
| admiral-1.0.0.7_72.pkg | 2025-12-29 08:47 | 346K | |
| adms-2.3.7.pkg | 2025-08-15 09:47 | 179K | |
| adns-1.6.0.pkg | 2025-08-14 06:18 | 136K | |
| adobe-cmaps-20051217..> | 2025-12-26 14:09 | 2.2M | |
| adoc-mode.el-0.7.0_7..> | 2025-12-29 22:00 | 51K | |
| adoc-mode.el-emacs_c..> | 2025-12-30 07:29 | 51K | |
| adoc-mode.el-emacs_d..> | 2025-12-29 06:56 | 51K | |
| adoc-mode.el-emacs_d..> | 2025-12-24 01:10 | 51K | |
| adoc-mode.el-emacs_n..> | 2025-12-24 07:31 | 51K | |
| adoc-mode.el-emacs_w..> | 2025-12-29 02:59 | 52K | |
| adodb5-php81-5.22.11..> | 2025-12-29 12:25 | 310K | |
| adodb5-php82-5.22.11..> | 2025-12-28 16:22 | 310K | |
| adodb5-php83-5.22.11..> | 2025-12-28 12:26 | 310K | |
| adodb5-php84-5.22.11..> | 2025-12-27 18:30 | 310K | |
| adodb5-php85-5.22.11..> | 2025-12-28 10:39 | 310K | |
| adol-c-2.7.2_13.pkg | 2025-12-24 01:13 | 352K | |
| adom-3.0.6.pkg | 2025-12-23 19:12 | 1.3M | |
| adplay-1.8.1_3.pkg | 2025-08-21 12:17 | 17K | |
| adtool-1.3.3_4.pkg | 2025-08-17 09:21 | 13K | |
| advancecomp-2.6_1.pkg | 2025-12-22 23:44 | 156K | |
| adwaita-icon-theme-4..> | 2025-12-24 22:02 | 500K | |
| adwaita-icon-theme-l..> | 2025-12-24 21:54 | 2.0M | |
| adwaita-qt5-1.4.2.pkg | 2025-12-28 18:15 | 201K | |
| adwaita-qt6-1.4.2.pkg | 2025-12-29 06:20 | 212K | |
| aee-2.2.22_1.pkg | 2025-08-22 12:19 | 93K | |
| aeolus-0.10.4_2.pkg | 2025-12-29 07:35 | 92K | |
| aerc-0.21.0_4.pkg | 2025-12-23 05:07 | 5.5M | |
| aeron-1.49.2.pkg | 2025-12-23 14:06 | 822K | |
| aescrypt-0.7_2.pkg | 2025-08-20 01:03 | 28K | |
| aeskulap-0.2.2.20190..> | 2025-12-28 03:55 | 264K | |
| aespipe-2.4e_1.pkg | 2025-12-20 10:58 | 29K | |
| aestats-5.39.pkg | 2025-08-20 12:52 | 333K | |
| aewan-1.0.01_2.pkg | 2025-08-20 18:52 | 57K | |
| af-aspell-0.50.0_1,1..> | 2025-12-20 16:31 | 909K | |
| af-libreoffice-25.8...> | 2025-12-27 09:42 | 856K | |
| afdko-4.0.3.pkg | 2025-12-18 12:47 | 649K | |
| affenspiel-1.0_2.pkg | 2025-08-19 13:03 | 9.8K | |
| affiche-0.6.0_13.pkg | 2025-12-27 02:15 | 37K | |
| afflib-3.7.20.pkg | 2025-12-19 15:51 | 395K | |
| afio-2.5.2_1.pkg | 2025-08-15 23:15 | 75K | |
| afl++-llvm-4.34.c.pkg | 2025-12-24 05:31 | 8.4M | |
| afm-1.0_1.pkg | 2025-08-20 09:18 | 63K | |
| afni-25.3.04.pkg | 2025-12-29 05:07 | 795M | |
| afpfs-ng-0.8.1_7.pkg | 2025-12-21 17:48 | 97K | |
| afsp-8.2_1.pkg | 2025-08-21 14:36 | 338K | |
| aften-0.0.8.pkg | 2025-08-16 03:42 | 68K | |
| afterglow-1.6.2_2.pkg | 2025-12-28 23:30 | 59K | |
| afternoonstalker-1.2..> | 2025-12-28 04:42 | 94K | |
| afterstep-2.2.12_12.pkg | 2025-12-29 18:23 | 5.5M | |
| afterstep1-1.0_6.pkg | 2025-12-20 17:05 | 471K | |
| agame-1577_13.pkg | 2025-12-29 23:36 | 1.2M | |
| agar-1.7.1.pkg | 2025-12-29 23:59 | 4.8M | |
| agate-3.3.19_3.pkg | 2025-12-30 15:57 | 1.0M | |
| agave-37.pkg | 2025-12-27 20:32 | 108K | |
| agave-blockchain-2.2..> | 2025-12-28 13:32 | 119M | |
| age-1.2.1_11.pkg | 2025-12-20 07:54 | 1.6M | |
| agedu-20241013.3622e..> | 2025-08-17 02:36 | 49K | |
| aget-0.4.1_1.pkg | 2025-08-19 10:58 | 11K | |
| agg-2.7.0.pkg | 2025-12-26 20:23 | 350K | |
| aggregate-1.6_2.pkg | 2025-08-18 07:59 | 11K | |
| agrep-3.41.5.pkg | 2025-08-15 11:42 | 385K | |
| agrum-2.3.0.pkg | 2025-12-29 19:04 | 4.9M | |
| ags-3.6.2.14.pkg | 2025-12-30 08:00 | 1.5M | |
| ah-tty-0.3.12_4.pkg | 2025-08-16 06:04 | 431K | |
| aha-0.5.1_1.pkg | 2025-08-19 12:02 | 13K | |
| aichat-0.30.0_3.pkg | 2025-12-28 09:22 | 3.5M | |
| aide-0.19.2.pkg | 2025-12-21 16:26 | 101K | |
| aide-without_acl-0.1..> | 2025-12-22 09:02 | 99K | |
| aifad-2.3.1.pkg | 2025-08-16 23:02 | 627K | |
| aiksaurus-1.2.1_3.pkg | 2025-08-16 19:48 | 316K | |
| aimage-3.2.5_2.pkg | 2025-12-20 06:53 | 31K | |
| air-ai-chat-client-0..> | 2025-12-29 22:16 | 1.3M | |
| air-go-1.63.4_1.pkg | 2025-12-23 10:01 | 2.9M | |
| aircrack-ng-1.5.2_4.pkg | 2025-12-30 08:01 | 462K | |
| aircraft-datcom-0.0...> | 2025-12-30 03:04 | 36M | |
| aird-1.0_1.pkg | 2025-08-18 14:34 | 7.0K | |
| airsaned-0.3.4.0_1.pkg | 2025-12-28 11:05 | 193K | |
| airspy-1.0.10.pkg | 2025-08-14 19:28 | 38K | |
| airspyhf-1.6.8.7.pkg | 2025-08-15 17:39 | 31K | |
| aish-1.13.pkg | 2025-08-16 00:03 | 33K | |
| aisleriot-3.22.35.pkg | 2025-12-27 08:52 | 8.2M | |
| aixlog-1.5.0_1.pkg | 2025-08-16 13:25 | 8.1K | |
| akhq-0.25.1_2.pkg | 2025-12-29 17:24 | 169M | |
| akira-0.0.16_3.pkg | 2025-12-30 00:20 | 317K | |
| aklabeth-1.0.pkg | 2025-12-23 05:45 | 30K | |
| akonadi-25.12.0.pkg | 2025-12-26 06:18 | 3.0M | |
| akonadi-calendar-25...> | 2025-12-26 17:20 | 747K | |
| akonadi-calendar-too..> | 2025-12-29 22:16 | 436K | |
| akonadi-contacts-25...> | 2025-12-26 06:46 | 551K | |
| akonadi-import-wizar..> | 2025-12-26 19:56 | 693K | |
| akonadi-mime-25.12.0..> | 2025-12-26 06:27 | 238K | |
| akonadi-search-25.12..> | 2025-12-26 06:41 | 279K | |
| akonadiconsole-25.12..> | 2025-12-26 21:35 | 505K | |
| akpop3d-0.7.7_1.pkg | 2025-08-16 02:22 | 18K | |
| akregator-25.12.0.pkg | 2025-12-26 21:20 | 2.4M | |
| alac-0.0.7,1.pkg | 2025-08-20 23:30 | 42K | |
| alacarte-3.58.0.pkg | 2025-12-27 12:55 | 116K | |
| alacenc-0.4.1.pkg | 2025-08-19 13:22 | 119K | |
| alacritty-0.16.1_2.pkg | 2025-12-30 10:39 | 2.0M | |
| alarm-clock-applet-0..> | 2025-12-29 04:41 | 152K | |
| alass-2.0.0_20.pkg | 2025-12-28 13:57 | 665K | |
| albert-0.30.1.pkg | 2025-12-29 22:30 | 1.3M | |
| alberta-fem-3.0.3_1.pkg | 2025-12-26 19:41 | 8.5M | |
| alchemist.el-1.8.2_2..> | 2025-12-30 04:09 | 1.5M | |
| alchemist.el-emacs_c..> | 2025-12-29 17:58 | 1.5M | |
| alchemist.el-emacs_d..> | 2025-12-28 20:56 | 1.5M | |
| alchemist.el-emacs_d..> | 2025-12-23 00:04 | 1.5M | |
| alchemist.el-emacs_n..> | 2025-12-22 04:29 | 1.5M | |
| alchemist.el-emacs_w..> | 2025-12-29 22:45 | 1.5M | |
| aldo-0.7.8.pkg | 2025-12-22 07:14 | 52K | |
| alef-1.0_4.pkg | 2025-12-27 23:22 | 76K | |
| alef-webfont-1.0_2.pkg | 2025-08-16 23:50 | 363K | |
| alegreya-2.008_1.pkg | 2025-12-29 02:23 | 1.4M | |
| alegreya-sans-2.008_..> | 2025-12-29 22:48 | 1.9M | |
| alembic-1.8.7_1.pkg | 2025-12-26 21:35 | 772K | |
| alertmanager-0.29.0_..> | 2025-12-23 08:42 | 14M | |
| alex4-1.1_1.pkg | 2025-12-30 00:56 | 685K | |
| alfio-0.3_1.pkg | 2025-08-20 01:03 | 3.7K | |
| alfont-2.0.9_1,1.pkg | 2025-12-27 12:31 | 28K | |
| algae-4.3.6_20.pkg | 2025-12-28 01:12 | 710K | |
| alglib-4.06.0.pkg | 2025-12-18 11:29 | 2.0M | |
| algol68g-3.10.6.pkg | 2025-12-30 15:10 | 623K | |
| ali-0.7.5_34.pkg | 2025-12-21 03:44 | 2.5M | |
| alienarena-7.71.6_2,..> | 2025-12-28 14:43 | 705K | |
| alienarena-data-7.71..> | 2025-08-15 05:24 | 778M | |
| alienblaster-1.1.0_7..> | 2025-12-21 11:13 | 6.1M | |
| alienwah-1.13_1.pkg | 2025-08-16 00:46 | 5.6K | |
| alienwave-0.4.0.pkg | 2025-08-22 12:01 | 18K | |
| align-1.7.5.pkg | 2025-12-21 03:16 | 4.0K | |
| alignmargins-1.0_1.pkg | 2025-12-23 23:54 | 5.5K | |
| alire-1.2.2_1.pkg | 2025-12-23 14:39 | 4.3M | |
| alizams-1.9.10.pkg | 2025-12-28 09:50 | 2.6M | |
| alkimia-8.2.1_1.pkg | 2025-12-27 03:12 | 364K | |
| allegro-4.4.3.1_4.pkg | 2025-12-26 23:29 | 2.5M | |
| allegro5-5.2.10.1.pkg | 2025-12-28 19:03 | 8.7M | |
| alliance-5.1.1_6.pkg | 2025-12-27 22:26 | 4.3M | |
| alligator-25.12.0.pkg | 2025-12-29 12:20 | 177K | |
| alloy-1.10.2_5.pkg | 2025-12-21 05:40 | 57M | |
| alltraxclock-2.0.2_1..> | 2025-12-28 10:31 | 6.3K | |
| almostti-1.3.pkg | 2025-08-17 14:27 | 1.4M | |
| alo-lv2-0.9.pkg | 2025-08-18 01:18 | 395K | |
| aloadimage-0.6.3.3.pkg | 2025-12-30 02:57 | 113K | |
| alpaca-5.3.0_2.pkg | 2025-12-28 09:58 | 446K | |
| alpine-2.26_3.pkg | 2025-12-19 09:53 | 2.1M | |
| alpng-1.3_4.pkg | 2025-12-27 07:55 | 20K | |
| alsa-lib-1.2.14.pkg | 2025-08-10 22:41 | 529K | |
| alsa-plugins-1.2.12_..> | 2025-12-25 00:50 | 64K | |
| alsa-seq-server-1.1...> | 2025-08-15 18:19 | 20K | |
| alsa-sndio-0.2_1.pkg | 2025-12-23 17:40 | 5.3K | |
| alsa-utils-1.2.14.pkg | 2025-12-26 18:35 | 1.2M | |
| alt-ergo-2.5.4_2.pkg | 2025-12-28 11:14 | 17M | |
| alttab-1.7.0_1.pkg | 2025-12-30 12:15 | 43K | |
| alure-1.2_14.pkg | 2025-12-27 12:59 | 59K | |
| am-aspell-0.03.1_1,2..> | 2025-12-24 06:08 | 118K | |
| am-libreoffice-25.8...> | 2025-12-27 16:20 | 3.3M | |
| am-utils-6.2_14,1.pkg | 2025-12-21 12:52 | 331K | |
| amanda-client-3.5.1_..> | 2025-12-19 15:03 | 1.5M | |
| amanda-perl-wrapper-..> | 2025-12-18 19:31 | 2.4K | |
| amanda-server-3.5.1_..> | 2025-12-20 10:27 | 856K | |
| amass-5.0.1_4.pkg | 2025-12-22 14:00 | 9.2M | |
| amath-1.8.5_1.pkg | 2025-08-20 21:36 | 182K | |
| amavis-logwatch-1.51..> | 2025-12-22 13:57 | 69K | |
| amavisd-milter-1.7.0..> | 2025-12-21 05:40 | 28K | |
| amavisd-new-2.14.0,1..> | 2025-12-19 17:12 | 745K | |
| amazon-ssm-agent-2.3..> | 2025-12-22 02:57 | 16M | |
| amazon-ssm-plugin-1...> | 2025-12-30 15:33 | 7.6M | |
| amb-plugins-0.8.1_2.pkg | 2025-12-28 20:22 | 25K | |
| amber-code-search-re..> | 2025-12-28 19:12 | 1.0M | |
| amber-language-0.4.0..> | 2025-12-29 00:17 | 544K | |
| amberfish-1.7.1.pkg | 2025-08-17 06:48 | 61K | |
| amberol-2025.1_6.pkg | 2025-12-29 22:41 | 1.6M | |
| ambit-tensor-0.7.1_3..> | 2025-12-27 10:27 | 225K | |
| amd64-binutils-2.44,..> | 2025-12-19 23:23 | 2.5M | |
| amd64-freebsd-sysroo..> | 2025-12-19 06:14 | 53M | |
| amd64-gcc12-12.3.0_2..> | 2025-12-21 11:22 | 39M | |
| amd64-gcc13-13.2.0_2..> | 2025-12-23 04:26 | 40M | |
| amd64-gcc14-14.1.0.pkg | 2025-12-22 12:10 | 44M | |
| amd64-rust-bootstrap..> | 2025-12-30 19:37 | 76M | |
| amdmsrtweaker-1.1.pkg | 2025-08-18 13:36 | 15K | |
| amfora-1.11.0_2.pkg | 2025-12-23 06:46 | 4.7M | |
| amgcl-1.4.5.pkg | 2025-12-22 14:02 | 135K | |
| amiberry-7.1.1.pkg | 2025-12-29 04:46 | 9.1M | |
| amigadepacker-0.04_2..> | 2025-08-17 21:34 | 13K | |
| amigafonts-1.02.pkg | 2025-12-29 03:47 | 30K | |
| aminal-0.9.0_35.pkg | 2025-12-23 16:33 | 4.3M | |
| amiwm-0.22.pl2_2.pkg | 2025-08-22 04:45 | 100K | |
| aml-1.0.0.pkg | 2025-12-18 23:43 | 13K | |
| ammonite-3.0.2.pkg | 2025-12-30 04:13 | 79M | |
| amnesia-tdd-0.3.2.pkg | 2025-12-27 23:46 | 2.0M | |
| amnezia-kmod-2.0.8.1..> | 2025-12-30 17:54 | 37K | |
| amnezia-tools-1.0.20..> | 2025-12-29 16:17 | 58K | |
| amoebax-0.2.1_9.pkg | 2025-12-27 21:40 | 8.7M | |
| amp-0.7.1_15.pkg | 2025-12-30 15:20 | 1.7M | |
| ampache-php81-5.6.0_..> | 2025-12-29 12:20 | 39M | |
| ampache-php82-5.6.0_..> | 2025-12-28 12:20 | 39M | |
| ampache-php83-5.6.0_..> | 2025-12-29 17:10 | 39M | |
| ampache-php84-5.6.0_..> | 2025-12-30 02:32 | 39M | |
| ampache-php85-5.6.0_..> | 2025-12-29 13:22 | 39M | |
| ampasACES-container-..> | 2025-08-14 09:22 | 42K | |
| ampasCTL-1.5.2_24.pkg | 2025-12-30 07:55 | 1.2M | |
| amphetadesk-0.93.1_7..> | 2025-12-21 17:18 | 618K | |
| amqp-cpp-4.1.4_1.pkg | 2025-08-17 18:30 | 160K | |
| amqpcat-1.0.2.pkg | 2025-12-23 10:37 | 567K | |
| amrstat-20070216_1.pkg | 2025-08-16 02:11 | 214K | |
| amsynth-1.13.3_1.pkg | 2025-12-27 20:50 | 1.0M | |
| amtc-0.8.5.pkg | 2025-12-23 17:40 | 65K | |
| amtk-5.9.1.pkg | 2025-12-26 18:32 | 60K | |
| amtterm-1.6_1.pkg | 2025-12-22 15:49 | 18K | |
| amule-2.3.3_16.pkg | 2025-12-30 07:55 | 3.9M | |
| an-1.2_19.pkg | 2025-08-16 12:37 | 8.0K | |
| anacron-2.3_8.pkg | 2025-08-21 18:21 | 15K | |
| analitza-25.12.0.pkg | 2025-12-26 17:56 | 559K | |
| analog-6.0_14,1.pkg | 2025-12-27 17:01 | 528K | |
| ancient-2.3.0.pkg | 2025-12-19 13:17 | 298K | |
| and-1.2.2_2.pkg | 2025-08-17 08:55 | 18K | |
| andi-0.14.3.pkg | 2025-08-21 13:34 | 453K | |
| android-file-transfe..> | 2025-12-21 22:31 | 155K | |
| android-file-transfe..> | 2025-12-30 00:17 | 226K | |
| android-ota-payload-..> | 2025-12-21 05:34 | 926K | |
| android-tools-31.0.3..> | 2025-12-19 05:33 | 1.8M | |
| andwatch-2.2.0.pkg | 2025-12-20 10:48 | 21K | |
| anese-0.9.1.pkg | 2025-12-29 03:15 | 200K | |
| angband-4.2.2.pkg | 2025-12-28 03:18 | 22M | |
| angelfish-25.12.0.pkg | 2025-12-28 21:50 | 593K | |
| angelscript-2.34.0.pkg | 2025-08-14 22:47 | 660K | |
| angie-1.10.3.pkg | 2025-12-18 22:23 | 2.5M | |
| angie-console-light-..> | 2025-12-22 22:39 | 858K | |
| angie-module-auth-jw..> | 2025-12-22 07:31 | 120K | |
| angie-module-auth-sp..> | 2025-12-30 04:34 | 64K | |
| angie-module-auth-to..> | 2025-12-23 16:01 | 43K | |
| angie-module-brotli-..> | 2025-12-23 05:33 | 59K | |
| angie-module-cache-p..> | 2025-12-20 21:07 | 51K | |
| angie-module-dav-ext..> | 2025-12-23 09:32 | 74K | |
| angie-module-echo-0...> | 2025-12-23 11:36 | 180K | |
| angie-module-enhance..> | 2025-12-21 02:54 | 59K | |
| angie-module-eval-20..> | 2025-12-20 23:37 | 43K | |
| angie-module-geoip2-..> | 2025-12-21 03:08 | 58K | |
| angie-module-headers..> | 2025-12-20 06:17 | 84K | |
| angie-module-image-f..> | 2025-12-29 10:07 | 52K | |
| angie-module-jwt-3.4..> | 2025-12-20 21:24 | 43K | |
| angie-module-keyval-..> | 2025-12-23 15:59 | 50K | |
| angie-module-lua-0.1..> | 2025-12-21 23:43 | 1.4M | |
| angie-module-ndk-0.3..> | 2025-12-19 12:45 | 45K | |
| angie-module-njs-0.9..> | 2025-12-21 02:27 | 1.7M | |
| angie-module-perl-1...> | 2025-12-21 14:15 | 75K | |
| angie-module-postgre..> | 2025-12-24 07:29 | 162K | |
| angie-module-redis2-..> | 2025-12-23 14:03 | 83K | |
| angie-module-rtmp-1...> | 2025-12-20 10:08 | 450K | |
| angie-module-set-mis..> | 2025-12-24 00:09 | 169K | |
| angie-module-subs-1...> | 2025-12-24 02:13 | 47K | |
| angie-module-testcoo..> | 2025-12-23 06:52 | 63K | |
| angie-module-upload-..> | 2025-12-21 07:22 | 82K | |
| angie-module-vod-1.3..> | 2025-12-28 10:08 | 1.1M | |
| angie-module-xslt-1...> | 2025-12-22 04:49 | 65K | |
| angie-module-zstd-0...> | 2025-12-20 21:04 | 172K | |
| angle-grinder-0.19.6..> | 2025-12-30 11:51 | 6.9M | |
| angrysearch-1.0.3_4.pkg | 2025-12-28 01:15 | 321K | |
| animorph-0.3_8.pkg | 2025-08-17 23:52 | 275K | |
| anki-25.09.2_3.pkg | 2025-12-30 17:52 | 8.8M | |
| ann-1.1.2_1.pkg | 2025-08-17 11:44 | 365K | |
| annoy-1.17.3.pkg | 2025-08-16 06:49 | 15K | |
| anomaly-mono-g202103..> | 2025-12-29 23:26 | 346K | |
| anomy-sanitizer-1.76..> | 2025-12-22 09:24 | 90K | |
| anongitssh-0.2.pkg | 2025-08-18 14:17 | 7.0K | |
| anonymous-pro-1.002_..> | 2025-12-29 07:20 | 150K | |
| anope-2.0.18.pkg | 2025-12-21 18:57 | 3.5M | |
| anope-devel-default-..> | 2025-12-23 19:31 | 3.1M | |
| anope-devel-mysql-2...> | 2025-12-23 13:42 | 3.2M | |
| ansible-sshjail-1.1...> | 2025-12-28 14:17 | 5.4K | |
| ansifilter-2.22.pkg | 2025-12-23 17:58 | 75K | |
| ansilove-4.2.1.pkg | 2025-12-28 12:39 | 26K | |
| ansiprint-1.0.pkg | 2025-08-17 09:23 | 5.3K | |
| ansiweather-1.19.0_1..> | 2025-12-29 23:25 | 8.1K | |
| ant-dracula-theme-4...> | 2025-08-22 07:57 | 1.4M | |
| antibody-6.1.1_34.pkg | 2025-12-20 17:44 | 1.5M | |
| antic-0.2.5_1,1.pkg | 2025-12-27 02:43 | 40K | |
| antimicrox-3.5.1.pkg | 2025-12-28 09:44 | 1.2M | |
| antimony-cad-0.9.3.2..> | 2025-12-29 23:22 | 391K | |
| antimony-language-0...> | 2025-12-30 10:02 | 388K | |
| antioch-0.4.0.156_14..> | 2025-12-23 09:46 | 492K | |
| antipolix-2.1_2.pkg | 2025-08-22 21:16 | 44K | |
| antivirus-3.30_10.pkg | 2025-08-19 13:44 | 13K | |
| antiword-0.37_5.pkg | 2025-08-14 15:17 | 148K | |
| antlr-2.7.7_2.pkg | 2025-12-26 20:30 | 661K | |
| antlr3-3.5.2_1.pkg | 2025-12-30 07:13 | 2.2M | |
| antlr4-4.13.1.pkg | 2025-12-30 11:46 | 1.8M | |
| anttweakbar-1.16_1.pkg | 2025-08-15 09:46 | 259K | |
| anubis-4.3_8.pkg | 2025-12-22 05:03 | 278K | |
| anvil-0.0.20.pkg | 2025-08-18 06:27 | 5.1K | |
| anydesk-6.1.1_2.pkg | 2025-12-27 22:52 | 3.8M | |
| anyremote-6.7.3_2.pkg | 2025-12-19 16:21 | 2.0M | |
| anyremote2html-1.4.pkg | 2025-12-23 06:24 | 590K | |
| aoi-3.0_5.pkg | 2025-12-27 20:28 | 24M | |
| aom-3.13.1.pkg | 2025-12-16 02:08 | 3.3M | |
| aop-0.6_2.pkg | 2025-08-16 15:38 | 11K | |
| ap-utils-1.4.1_6.pkg | 2025-12-21 17:24 | 177K | |
| ap24-mod_auth_cas-1...> | 2025-12-23 05:02 | 33K | |
| ap24-mod_auth_cookie..> | 2025-12-23 04:58 | 5.7K | |
| ap24-mod_auth_gssapi..> | 2025-12-28 10:59 | 61K | |
| ap24-mod_auth_kerb2-..> | 2025-12-21 00:05 | 14K | |
| ap24-mod_auth_mellon..> | 2025-12-21 00:06 | 49K | |
| ap24-mod_auth_mysql2..> | 2025-12-22 20:25 | 10K | |
| ap24-mod_auth_mysql_..> | 2025-12-21 09:15 | 15K | |
| ap24-mod_auth_openid..> | 2025-12-21 17:30 | 206K | |
| ap24-mod_auth_pam2-1..> | 2025-12-24 06:36 | 7.0K | |
| ap24-mod_auth_pgsql2..> | 2025-12-23 10:18 | 16K | |
| ap24-mod_auth_pubtkt..> | 2025-12-23 16:57 | 11K | |
| ap24-mod_auth_tkt-2...> | 2025-12-23 10:50 | 37K | |
| ap24-mod_auth_xradiu..> | 2025-12-22 03:44 | 18K | |
| ap24-mod_authn_dovec..> | 2025-12-21 07:47 | 6.5K | |
| ap24-mod_authnz_exte..> | 2025-12-23 06:12 | 32K | |
| ap24-mod_authz_unixg..> | 2025-12-20 07:17 | 7.9K | |
| ap24-mod_cfg_ldap-1...> | 2025-12-20 17:29 | 8.1K | |
| ap24-mod_defensible-..> | 2025-12-22 19:35 | 4.4K | |
| ap24-mod_dnssd-0.6_1..> | 2025-12-19 08:31 | 11K | |
| ap24-mod_evasive-1.1..> | 2025-12-21 13:26 | 12K | |
| ap24-mod_fastcgi-2.4..> | 2025-12-19 01:54 | 46K | |
| ap24-mod_fcgid-2.3.9..> | 2025-12-23 06:23 | 49K | |
| ap24-mod_fileiri-1.1..> | 2025-12-20 15:02 | 5.6K | |
| ap24-mod_gnutls-0.12..> | 2025-12-21 22:26 | 44K | |
| ap24-mod_h264_stream..> | 2025-12-20 14:44 | 32K | |
| ap24-mod_http2-2.0.3..> | 2025-12-23 09:41 | 124K | |
| ap24-mod_jk-1.2.49,1..> | 2025-12-23 19:08 | 152K | |
| ap24-mod_limitipconn..> | 2025-12-23 14:42 | 7.5K | |
| ap24-mod_log_sql-1.1..> | 2025-12-21 05:20 | 56K | |
| ap24-mod_maxminddb-1..> | 2025-12-20 23:19 | 8.0K | |
| ap24-mod_memcache-0...> | 2025-12-23 04:02 | 3.9K | |
| ap24-mod_memcache_bl..> | 2025-12-21 06:16 | 7.2K | |
| ap24-mod_mono-3.13_3..> | 2025-12-22 00:47 | 32K | |
| ap24-mod_mpm_itk-2.4..> | 2025-12-20 20:20 | 7.5K | |
| ap24-mod_perl2-2.0.1..> | 2025-12-18 19:57 | 806K | |
| ap24-mod_proctitle-0..> | 2025-12-23 14:18 | 2.8K | |
| ap24-mod_qos-11.76.pkg | 2025-12-20 05:29 | 90K | |
| ap24-mod_realdoc-201..> | 2025-12-22 12:06 | 3.8K | |
| ap24-mod_reproxy-0.0..> | 2025-12-21 19:01 | 8.4K | |
| ap24-mod_rpaf2-0.8.4..> | 2025-12-21 23:05 | 7.4K | |
| ap24-mod_scgi-2.0.pkg | 2025-12-22 20:58 | 8.0K | |
| ap24-mod_security-2...> | 2025-12-22 19:08 | 290K | |
| ap24-mod_setenvifplu..> | 2025-12-22 23:33 | 17K | |
| ap24-mod_tls-0.14.0_..> | 2025-12-27 21:55 | 73K | |
| ap24-mod_umask-0.1.0..> | 2025-12-21 03:47 | 2.7K | |
| ap24-mod_webkit-1.2...> | 2025-12-24 07:22 | 7.2K | |
| ap24-mod_xsendfile-0..> | 2025-12-24 01:21 | 5.6K | |
| ap24-py311-mod_wsgi-..> | 2025-12-22 08:22 | 84K | |
| apache-ant-1.10.15.pkg | 2025-12-26 11:16 | 4.5M | |
| apache-bcel-6.4.1.pkg | 2025-12-30 10:37 | 1.4M | |
| apache-commons-beanu..> | 2025-12-27 01:11 | 400K | |
| apache-commons-cli-1..> | 2025-12-26 15:30 | 355K | |
| apache-commons-codec..> | 2025-12-26 14:59 | 734K | |
| apache-commons-colle..> | 2025-12-26 19:50 | 900K | |
| apache-commons-colle..> | 2025-12-26 19:56 | 1.9M | |
| apache-commons-compr..> | 2025-12-26 19:26 | 2.1M | |
| apache-commons-confi..> | 2025-12-30 02:35 | 590K | |
| apache-commons-csv-1..> | 2025-12-28 05:20 | 221K | |
| apache-commons-daemo..> | 2025-12-26 15:29 | 441K | |
| apache-commons-dbcp-..> | 2025-12-27 12:31 | 577K | |
| apache-commons-dbuti..> | 2025-12-30 02:54 | 256K | |
| apache-commons-diges..> | 2025-12-29 20:46 | 444K | |
| apache-commons-httpc..> | 2025-12-26 19:10 | 412K | |
| apache-commons-io-2...> | 2025-12-26 14:54 | 1.4M | |
| apache-commons-jelly..> | 2025-12-28 03:29 | 2.8M | |
| apache-commons-jxpat..> | 2025-12-30 08:14 | 696K | |
| apache-commons-lang-..> | 2025-12-27 12:35 | 498K | |
| apache-commons-lang3..> | 2025-12-26 19:56 | 2.0M | |
| apache-commons-loggi..> | 2025-12-26 15:25 | 250K | |
| apache-commons-math-..> | 2025-12-26 18:11 | 1.9M | |
| apache-commons-net-3..> | 2025-12-27 11:37 | 898K | |
| apache-commons-pool-..> | 2025-12-26 22:51 | 414K | |
| apache-jmeter-5.6.3_..> | 2025-12-27 22:05 | 54M | |
| apache-log4j2-2.25.2..> | 2025-12-26 15:54 | 2.9M | |
| apache-mode.el-2.0_1..> | 2025-08-22 18:02 | 6.5K | |
| apache-openoffice-4...> | 2025-12-28 09:59 | 97M | |
| apache-openoffice-de..> | 2025-12-29 11:33 | 95M | |
| apache-orc-2.2.0.pkg | 2025-12-22 13:34 | 1.5M | |
| apache-poi-5.4.1.pkg | 2025-12-26 22:35 | 20M | |
| apache-rat-0.13.pkg | 2025-12-30 13:46 | 1.4M | |
| apache-solr-9.9.0,1.pkg | 2025-12-30 04:12 | 359M | |
| apache-spark-3.3.4.pkg | 2025-12-30 11:05 | 245M | |
| apache-xml-security-..> | 2025-08-13 14:47 | 330K | |
| apache-xmlbeans-5.3...> | 2025-12-26 19:26 | 1.8M | |
| apache24-2.4.66.pkg | 2025-12-18 15:56 | 5.3M | |
| apachetop-0.23.2_1.pkg | 2025-12-21 16:06 | 20K | |
| aparapi-1.0.0_2.pkg | 2025-12-30 12:14 | 493K | |
| apbs-1.5.102.pkg | 2025-08-18 19:04 | 19M | |
| apc-1.0_9.pkg | 2025-12-29 16:16 | 17K | |
| apcctrl-0.8.21_2.pkg | 2025-08-16 00:49 | 102K | |
| apcpwr-1.3_2.pkg | 2025-12-30 18:53 | 6.9K | |
| apcupsd-3.14.14_6.pkg | 2025-08-21 03:07 | 154K | |
| apel-10.8.20220720_1..> | 2025-12-26 15:53 | 47K | |
| apel-emacs_canna-10...> | 2025-12-26 15:40 | 47K | |
| apel-emacs_devel-10...> | 2025-12-26 16:58 | 47K | |
| apel-emacs_devel_nox..> | 2025-12-18 13:21 | 47K | |
| apel-emacs_nox-10.8...> | 2025-12-18 13:57 | 47K | |
| apel-emacs_wayland-1..> | 2025-12-26 14:53 | 47K | |
| apertium-3.9.12_1.pkg | 2025-12-20 04:06 | 1.2M | |
| apertium-eng-0.1.0.2..> | 2025-12-21 15:41 | 3.1M | |
| apg-1.2.0_9,1.pkg | 2025-08-17 10:09 | 1.8M | |
| aphelia-g20190913_1.pkg | 2025-12-30 12:05 | 4.2K | |
| api-linter-1.72.0_2.pkg | 2025-12-22 21:18 | 4.5M | |
| api-sanity-checker-1..> | 2025-12-28 06:53 | 97K | |
| apib-1.2.1_7.pkg | 2025-08-22 11:19 | 87K | |
| apinger-0.6.1_3.pkg | 2025-08-18 06:08 | 31K | |
| apio-0.9.5.pkg | 2025-12-28 09:26 | 121K | |
| apitrace-13.0.pkg | 2025-12-29 06:12 | 3.0M | |
| apl385-20191020.pkg | 2025-12-29 01:28 | 90K | |
| apngasm-2.91.pkg | 2025-12-30 16:17 | 59K | |
| apngdis-2.9.pkg | 2025-12-29 12:22 | 9.5K | |
| apoolGL-0.99.22_9.pkg | 2025-12-22 13:02 | 1.6M | |
| aporetic-1.2.0.pkg | 2025-12-28 07:00 | 41M | |
| app-builder-3.4.2_19..> | 2025-12-27 18:55 | 4.2M | |
| app-builder-devel-5...> | 2025-12-28 05:26 | 4.5M | |
| apparix-20110303_1.pkg | 2025-08-21 01:18 | 92K | |
| appcsxcad-0.2.3_1.pkg | 2025-12-30 02:55 | 13K | |
| appjail-4.7.1.pkg | 2025-12-29 18:02 | 302K | |
| appjail-devel-4.7.1...> | 2025-12-28 00:23 | 302K | |
| appmenu-gtk-module-0..> | 2025-12-27 10:10 | 53K | |
| appmenu-registrar-0...> | 2025-12-27 18:01 | 16K | |
| appres-1.0.7.pkg | 2025-08-14 08:28 | 5.6K | |
| appstream-generator-..> | 2025-12-30 16:30 | 532K | |
| appstream-glib-0.8.3..> | 2025-12-26 10:00 | 491K | |
| appwrapper-0.1_13.pkg | 2025-12-27 16:42 | 15K | |
| apr-1.7.5.1.6.3_5.pkg | 2025-12-18 04:40 | 498K | |
| apricots-0.2.9.pkg | 2025-12-30 11:42 | 244K | |
| apron-0.9.15.pkg | 2025-08-14 11:55 | 1.3M | |
| aprsc-2.1.10_1.pkg | 2025-12-23 02:12 | 407K | |
| aprsd-2.2.515_3.pkg | 2025-08-16 12:51 | 127K | |
| apt-mirror-devel-0.5..> | 2025-12-23 12:03 | 12K | |
| aptly-1.5.0_32.pkg | 2025-12-23 05:34 | 6.2M | |
| apwal-0.4.5_16.pkg | 2025-12-29 09:16 | 43K | |
| aq-0.3.0_15.pkg | 2025-12-30 18:51 | 352K | |
| aqbanking-6.6.4.pkg | 2025-12-19 06:01 | 1.2M | |
| aqemu-0.9.2_4.pkg | 2025-12-30 08:13 | 1.5M | |
| aquamarine-0.10.0_1.pkg | 2025-12-26 19:18 | 366K | |
| aquantia-atlantic-km..> | 2025-08-16 10:29 | 23K | |
| aquaria-1.002.22_12.pkg | 2025-12-30 00:39 | 1.5M | |
| aquatone-1.7.0_34.pkg | 2025-12-23 05:32 | 3.1M | |
| ar-ae_fonts1_ttf-1.1..> | 2025-12-27 09:50 | 800K | |
| ar-ae_fonts_mono-1.0..> | 2025-12-27 08:43 | 59K | |
| ar-arabtex-3.11_7.pkg | 2025-12-30 16:54 | 503K | |
| ar-aspell-1.2.0_1,1.pkg | 2025-12-23 12:20 | 5.0M | |
| ar-kacst_fonts-2.01_..> | 2025-12-27 03:19 | 261K | |
| ar-khotot-1.0_3.pkg | 2025-12-30 15:07 | 1.1K | |
| ar-libitl-0.8.0.pkg | 2025-08-22 04:34 | 1.2M | |
| ar-libreoffice-25.8...> | 2025-12-27 09:46 | 3.0M | |
| arachne-pnr-g2018102..> | 2025-12-21 06:51 | 9.1M | |
| arandr-0.1.11_2.pkg | 2025-12-28 03:17 | 108K | |
| aranym-1.1.0_5.pkg | 2025-12-30 17:33 | 626K | |
| arataga-0.5.4_6.pkg | 2025-12-20 20:43 | 582K | |
| aravis-0.8.34.pkg | 2025-12-30 03:00 | 61K | |
| arb-2.23.0_1.pkg | 2025-12-26 16:59 | 1.2M | |
| arbor-0.11.0_1.pkg | 2025-12-27 19:37 | 1.3M | |
| arborx-1.7_1.pkg | 2025-12-29 17:01 | 75K | |
| arc-5.21q_1.pkg | 2025-08-13 20:44 | 45K | |
| arc-gruvbox-theme-g2..> | 2025-08-18 01:17 | 158K | |
| arc_summary-20231114..> | 2025-12-21 16:26 | 10K | |
| arcan-0.7.0.1_2.pkg | 2025-12-27 09:39 | 1.8M | |
| arcan-trayicon-0.7.0..> | 2025-12-29 12:18 | 37K | |
| arcanist-lib-php81-2..> | 2025-12-27 06:10 | 1.6M | |
| arcanist-lib-php82-2..> | 2025-12-27 12:28 | 1.6M | |
| arcanist-lib-php83-2..> | 2025-12-27 16:41 | 1.6M | |
| arcanist-lib-php84-2..> | 2025-12-27 17:02 | 1.6M | |
| arcanist-php81-20220..> | 2025-12-29 14:56 | 943 | |
| arcanist-php82-20220..> | 2025-12-29 05:27 | 944 | |
| arcanist-php83-20220..> | 2025-12-28 04:55 | 945 | |
| arcanist-php84-20220..> | 2025-12-28 10:48 | 943 | |
| arcconf-4.09.00.2561..> | 2025-12-28 19:10 | 1.4M | |
| archey4-4.14.1.0_1.pkg | 2025-12-23 09:17 | 118K | |
| archimedes-2.0.1.pkg | 2025-08-16 19:02 | 54K | |
| archiva-2.2.3.pkg | 2025-12-29 06:17 | 63M | |
| archivemount-0.9.1_1..> | 2025-12-22 12:30 | 21K | |
| archiveopteryx-3.2.0..> | 2025-08-16 08:45 | 11M | |
| archiveopteryx-devel..> | 2025-08-19 04:27 | 11M | |
| archivesmtp-1.2_4.pkg | 2025-08-18 10:12 | 21K | |
| archmbox-4.10.0_2.pkg | 2025-12-20 08:28 | 30K | |
| ardour-8.12.0_2.pkg | 2025-12-29 15:39 | 16M | |
| arduino-1.0.6.140300..> | 2025-12-27 16:11 | 6.7M | |
| arduino-avrdude-6.3_..> | 2025-12-18 15:54 | 208K | |
| arduino-bsd-mk-2.6.pkg | 2025-12-24 03:30 | 11K | |
| arduino-builder-1.3...> | 2025-12-19 22:33 | 1.1M | |
| arduino-core-1.6.18_..> | 2025-08-13 18:41 | 12M | |
| arduino-ctags-5.8_1.pkg | 2025-08-13 16:35 | 101K | |
| arduino-irremote-4.5..> | 2025-12-22 14:39 | 167K | |
| arduino-mk-0.10_5.pkg | 2025-12-30 18:31 | 16K | |
| arduino-openglcd-1.0..> | 2025-12-27 21:02 | 1.1M | |
| arduino-sevseg-3.7.0..> | 2025-08-19 09:38 | 8.2K | |
| arduino-tools-1.8.2_..> | 2025-12-19 03:01 | 1.5K | |
| arduino18-1.8.5_3.pkg | 2025-12-28 21:37 | 26M | |
| arduinoOTA-1.2.0_33.pkg | 2025-12-18 18:50 | 2.0M | |
| ares-146_1.pkg | 2025-12-29 16:49 | 3.9M | |
| argc-1.23.0_4.pkg | 2025-12-30 05:57 | 380K | |
| argdata-0.7_4.pkg | 2025-08-15 02:32 | 19K | |
| argobots-1.2.pkg | 2025-08-20 18:54 | 138K | |
| argouml-0.35.1.pkg | 2025-12-27 22:41 | 19M | |
| argp-standalone-1.5...> | 2025-12-18 07:54 | 31K | |
| argparse-3.2.pkg | 2025-08-14 20:07 | 19K | |
| args-6.4.7.pkg | 2025-08-15 10:16 | 21K | |
| argtable-2.13_3.pkg | 2025-08-14 08:28 | 2.0M | |
| argtable3-3.2.2_1.pkg | 2025-08-15 15:23 | 55K | |
| argus-clients-sasl-3..> | 2025-12-22 00:48 | 3.1M | |
| argus-sasl-3.0.8.2_2..> | 2025-12-23 16:36 | 179K | |
| argyllcms-1.9.2_7.pkg | 2025-12-29 19:20 | 5.9M | |
| aria2-1.37.0_1.pkg | 2025-12-19 01:55 | 2.5M | |
| arianna-25.12.0.pkg | 2025-12-29 08:05 | 763K | |
| aribas-1.64_1.pkg | 2025-08-18 16:27 | 189K | |
| aribb24-1.0.4.pkg | 2025-12-27 11:41 | 42K | |
| ario-1.6_7.pkg | 2025-12-28 20:09 | 414K | |
| arj-3.10.22_12.pkg | 2025-08-13 17:18 | 209K | |
| ark-25.12.0.pkg | 2025-12-27 00:30 | 1.4M | |
| arm-elf-binutils-2.4..> | 2025-12-21 23:56 | 2.2M | |
| arm-gnueabi-binutils..> | 2025-12-19 10:00 | 2.2M | |
| arm-none-eabi-binuti..> | 2025-12-18 18:29 | 2.2M | |
| arm-none-eabi-gcc-11..> | 2025-12-18 23:43 | 35M | |
| arm-none-eabi-newlib..> | 2025-08-21 04:19 | 1.1M | |
| armadillo-15.2.2.pkg | 2025-12-26 22:59 | 435K | |
| armv6-gcc12-12.3.0_2..> | 2025-12-21 20:19 | 33M | |
| armv6-gcc13-13.2.0_2..> | 2025-12-21 08:03 | 36M | |
| armv7-freebsd-sysroo..> | 2025-12-19 18:18 | 42M | |
| armv7-gcc12-12.3.0_2..> | 2025-12-23 20:39 | 33M | |
| armv7-gcc13-13.2.0_2..> | 2025-12-23 13:35 | 36M | |
| armv7-gcc14-14.1.0.pkg | 2025-12-20 05:22 | 39M | |
| armv7-rust-bootstrap..> | 2025-12-28 01:47 | 78M | |
| arp-scan-1.10.0.pkg | 2025-08-16 04:06 | 473K | |
| arp-sk-0.0.16_6.pkg | 2025-08-18 05:45 | 15K | |
| arpCounterattack-1.2..> | 2025-12-23 14:52 | 539K | |
| arpack++-2.4.0_13.pkg | 2025-12-26 19:22 | 1.8M | |
| arpack-ng-3.9.1_4.pkg | 2025-12-26 09:21 | 235K | |
| arpdig-0.5.7_1.pkg | 2025-08-20 23:18 | 7.9K | |
| arping-2.25.pkg | 2025-08-18 20:08 | 23K | |
| arpoison-0.7_1.pkg | 2025-08-20 03:51 | 3.6K | |
| arprelease-1.2_5.pkg | 2025-08-18 21:48 | 3.3K | |
| arpscan-0.5_1.pkg | 2025-12-23 16:53 | 4.9K | |
| arpwatch-3.9.pkg | 2025-12-22 04:13 | 33K | |
| arqiver-1.0.1.pkg | 2025-12-29 15:32 | 186K | |
| arrow-21.0.0_3.pkg | 2025-12-26 13:07 | 9.3M | |
| arrow-datafusion-45...> | 2025-12-28 05:58 | 11M | |
| arrow-glib-21.0.0.pkg | 2025-12-26 17:58 | 1.1M | |
| arrowdl-4.0.2.pkg | 2025-12-29 06:32 | 780K | |
| arss-0.2.3_2.pkg | 2025-08-22 14:43 | 19K | |
| art-0.9.02_1.pkg | 2025-12-22 19:28 | 75K | |
| art-raw-image-editor..> | 2025-12-29 07:17 | 19M | |
| artem-3.0.0_8.pkg | 2025-12-29 19:12 | 2.0M | |
| artemis-17.0.1.11.pkg | 2025-12-30 02:19 | 98M | |
| arti-1.8.0_1.pkg | 2025-12-30 18:15 | 3.6M | |
| arti-full-1.8.0_1.pkg | 2025-12-27 22:57 | 4.3M | |
| artikulate-25.12.0.pkg | 2025-12-26 21:46 | 1.2M | |
| arttime-2.4.0.pkg | 2025-12-29 12:34 | 305K | |
| artwiz-aleczapka-de-..> | 2025-12-29 02:04 | 25K | |
| artwiz-aleczapka-en-..> | 2025-12-29 19:11 | 27K | |
| artwiz-aleczapka-se-..> | 2025-12-30 02:29 | 24K | |
| artwiz-fonts-1.0_5.pkg | 2025-12-28 23:55 | 36K | |
| artyfx-lv2-1.3.1_1,1..> | 2025-12-29 12:19 | 99K | |
| arx-libertatis-1.2.1..> | 2025-12-28 08:46 | 1.8M | |
| as-libreoffice-25.8...> | 2025-12-27 19:25 | 375K | |
| asbutton-0.3_3.pkg | 2025-12-21 21:19 | 79K | |
| ascent-simulation-en..> | 2025-08-16 23:22 | 24K | |
| ascent-visualizer-0...> | 2025-12-27 16:16 | 3.4M | |
| ascii-invaders-1.0.1..> | 2025-08-22 21:12 | 8.5K | |
| ascii2binary-2.14_2.pkg | 2025-12-19 08:42 | 16K | |
| asciidoc-10.2.1.pkg | 2025-12-16 01:51 | 338K | |
| asciinema-agg-1.7.0.pkg | 2025-12-28 18:07 | 2.4M | |
| asciio-1.9.02_2,1.pkg | 2025-12-30 06:28 | 94K | |
| asciiquarium-1.1_1.pkg | 2025-12-23 15:28 | 8.7K | |
| asclock-1.3.pkg | 2025-12-19 11:20 | 12K | |
| asclock-xlib-2.0.12.pkg | 2025-12-21 00:00 | 71K | |
| ascpu-1.11_8.pkg | 2025-12-30 10:00 | 14K | |
| aseprite-1.2.9_10.pkg | 2025-12-30 16:20 | 1.5M | |
| asfml-2.5.5_2.pkg | 2025-12-29 01:04 | 1.1M | |
| asfsm-1.0.p15_4.pkg | 2025-12-23 11:00 | 68K | |
| ashell-0.6.0_2.pkg | 2025-12-28 07:40 | 7.1M | |
| asignify-1.0_1.pkg | 2025-08-18 16:42 | 74K | |
| asio-1.34.2.pkg | 2025-08-13 18:50 | 406K | |
| asio130-1.30.2.pkg | 2025-08-15 22:13 | 403K | |
| ask-2.5.3_1.pkg | 2025-12-22 09:14 | 78K | |
| asl-1.42.183_1.pkg | 2025-08-20 00:56 | 1.1M | |
| asm-lsp-0.10.1_2.pkg | 2025-12-29 03:51 | 1.7M | |
| asm-xml-1.4.pkg | 2025-08-17 06:14 | 8.6K | |
| asm2html-1.7_1.pkg | 2025-08-16 13:20 | 10K | |
| asmail-2.1_5.pkg | 2025-12-23 21:01 | 138K | |
| asmctl-2.2.pkg | 2025-08-17 07:01 | 8.7K | |
| asmem-1.12_2.pkg | 2025-12-21 13:40 | 13K | |
| asmix-1.5_4.pkg | 2025-12-21 02:56 | 12K | |
| asmixer-0.5_4.pkg | 2025-12-23 02:28 | 8.8K | |
| asmjit-g20221210.pkg | 2025-08-14 12:20 | 395K | |
| asmx-2.0.0.pkg | 2025-08-22 14:01 | 91K | |
| asn1c-0.9.27_1.pkg | 2025-12-20 11:17 | 576K | |
| aspell-0.60.8.1_1,1.pkg | 2025-12-18 00:08 | 824K | |
| aspell-ispell-0.60.8..> | 2025-12-19 07:56 | 1.2K | |
| asprint-1.0_3.pkg | 2025-12-23 05:38 | 5.1K | |
| asql-1.7.pkg | 2025-12-23 18:44 | 10K | |
| asr-manpages-2000040..> | 2025-08-22 02:08 | 21K | |
| asr10-1.0.pkg | 2025-08-19 02:03 | 19K | |
| assaultcube-1.3.0.2_..> | 2025-12-30 01:16 | 41M | |
| assh-2.15.0_28.pkg | 2025-12-23 11:36 | 2.9M | |
| assimp-6.0.2.pkg | 2025-08-13 00:27 | 2.7M | |
| assp-1.9.9.14158_2,1..> | 2025-12-29 19:56 | 519K | |
| ast-aspell-0.01.pkg | 2025-12-21 06:38 | 333K | |
| ast-libreoffice-25.8..> | 2025-12-27 14:50 | 3.1M | |
| astc-encoder-5.3.0.pkg | 2025-12-20 17:25 | 272K | |
| asterisk20-20.17.0.pkg | 2025-12-27 05:54 | 22M | |
| asterisk20-chan_sccp..> | 2025-12-30 09:22 | 460K | |
| asterisk20-espeak-5...> | 2025-12-28 14:14 | 8.2K | |
| asterisk20-flite-3.0..> | 2025-12-28 23:24 | 7.0K | |
| asterisk20-g72x-1.4...> | 2025-12-28 13:13 | 5.5K | |
| asterisk22-22.7.0.pkg | 2025-12-27 19:03 | 22M | |
| asterisk22-chan_sccp..> | 2025-12-28 01:32 | 460K | |
| asterisk22-espeak-5...> | 2025-12-28 21:48 | 8.3K | |
| asterisk22-flite-3.0..> | 2025-12-29 16:27 | 7.0K | |
| asterisk22-g72x-1.4...> | 2025-12-27 22:16 | 5.5K | |
| asteroids3d-0.5.1_9.pkg | 2025-08-20 08:57 | 530K | |
| astime-2.8_3.pkg | 2025-12-21 22:12 | 20K | |
| astk-client-2020.0.1..> | 2025-12-29 04:16 | 310K | |
| astk-serveur-2020.0...> | 2025-12-21 07:28 | 669K | |
| astroid-0.17_2.pkg | 2025-12-29 21:31 | 1.1M | |
| astromenace-1.4.2.pkg | 2025-12-30 08:03 | 53M | |
| astrometry-0.97_1.pkg | 2025-12-30 08:33 | 8.6M | |
| astron-0.0.20200521_..> | 2025-08-19 06:18 | 291K | |
| astroterm-1.0.9.pkg | 2025-12-24 06:58 | 301K | |
| astyle-3.6.13.pkg | 2025-12-20 01:59 | 264K | |
| astzclock-1.0_3.pkg | 2025-12-21 16:18 | 17K | |
| asusoled-0.10_10.pkg | 2025-12-30 00:03 | 12K | |
| asylum-0.3.2_2.pkg | 2025-12-21 20:49 | 338K | |
| asymptote-2.92_5.pkg | 2025-12-27 08:40 | 3.9M | |
| async-0.1.1_27.pkg | 2025-12-29 05:15 | 573K | |
| asyncplusplus-1.2.pkg | 2025-08-14 17:31 | 45K | |
| at-spi2-core-2.56.6.pkg | 2025-12-16 02:18 | 580K | |
| atac-seq-0.2.0_1.pkg | 2025-12-30 07:19 | 783 | |
| atanks-6.5_3.pkg | 2025-12-27 23:07 | 4.7M | |
| atari800-3.1.0_3.pkg | 2025-12-29 03:25 | 470K | |
| aterm-1.0.1_8.pkg | 2025-12-20 04:25 | 77K | |
| atf-0.23.pkg | 2025-08-14 03:24 | 447K | |
| atf-fvp-v2.10.6.pkg | 2025-08-22 12:11 | 616K | |
| atf-rk3328-v2.10.6.pkg | 2025-08-15 19:31 | 26K | |
| atf-rk3399-v2.10.6.pkg | 2025-08-15 01:01 | 50K | |
| atf-sun50i_a64-v2.10..> | 2025-08-15 00:39 | 17K | |
| atf-sun50i_h6-v2.10...> | 2025-08-14 19:10 | 17K | |
| atheme-services-7.2...> | 2025-12-23 07:12 | 1.1M | |
| athens-0.16.1_6.pkg | 2025-12-20 18:27 | 13M | |
| atkinson-hyperlegibl..> | 2025-12-29 01:22 | 141K | |
| atkmm-2.28.4.pkg | 2025-12-18 16:14 | 104K | |
| atl-2.2.1.43.pkg | 2025-12-20 04:14 | 30K | |
| atlantis-0.31.0_5.pkg | 2025-12-24 02:13 | 9.1M | |
| atlast-1.2.pkg | 2025-08-17 03:36 | 345K | |
| atlc-4.6.1_1.pkg | 2025-08-22 02:50 | 1.5M | |
| atomicparsley-202406..> | 2025-08-15 05:47 | 111K | |
| atomix-44.0.pkg | 2025-12-27 06:26 | 447K | |
| atompaw-4.2.0.3_3.pkg | 2025-12-26 20:52 | 4.0M | |
| atool-0.39.0_1.pkg | 2025-12-19 21:37 | 23K | |
| atop-2.0.2.b3_4.pkg | 2025-08-18 10:57 | 100K | |
| atp-1.50_3.pkg | 2025-12-22 05:00 | 83K | |
| atr3d-0.6_19.pkg | 2025-12-21 10:36 | 217K | |
| atracdenc-0.2.2.pkg | 2025-12-30 10:35 | 128K | |
| atril-1.28.1_6.pkg | 2025-12-27 02:59 | 1.5M | |
| atril-lite-1.28.1_6.pkg | 2025-12-28 10:13 | 1.4M | |
| atris-1.0.7_7.pkg | 2025-12-27 11:15 | 305K | |
| atris-sounds-1.0.1_2..> | 2025-12-30 11:17 | 568K | |
| atslog-2.1.1_10.pkg | 2025-12-30 04:05 | 455K | |
| atuin-18.10.0_2.pkg | 2025-12-27 20:09 | 5.5M | |
| atunes-3.1.2_5.pkg | 2025-12-28 10:45 | 15M | |
| aub-2.2_1.pkg | 2025-08-21 05:03 | 39K | |
| aubio-0.4.9_7.pkg | 2025-12-27 15:44 | 547K | |
| auctex-13.3_2.pkg | 2025-12-29 20:51 | 1.4M | |
| auctex-emacs_canna-1..> | 2025-12-29 09:22 | 1.4M | |
| auctex-emacs_devel-1..> | 2025-12-29 05:35 | 1.4M | |
| auctex-emacs_devel_n..> | 2025-12-29 20:25 | 1.4M | |
| auctex-emacs_nox-13...> | 2025-12-29 16:32 | 1.4M | |
| auctex-emacs_wayland..> | 2025-12-27 22:19 | 1.4M | |
| audacious-4.5.1.pkg | 2025-12-27 11:56 | 607K | |
| audacious-gtk2-4.5.1..> | 2025-12-27 09:58 | 549K | |
| audacious-gtk3-4.5.1..> | 2025-12-27 09:08 | 548K | |
| audacious-plugins-4...> | 2025-12-28 06:41 | 1.5M | |
| audacious-plugins-gt..> | 2025-12-29 12:20 | 1.4M | |
| audacious-plugins-gt..> | 2025-12-28 00:31 | 1.4M | |
| audacious-plugins-qt..> | 2025-12-29 22:45 | 1.5M | |
| audacious-qt5-4.5.1.pkg | 2025-12-27 16:39 | 597K | |
| audacious-skins-1.0...> | 2025-08-21 09:28 | 8.0M | |
| audacity-3.7.7_1.pkg | 2025-12-30 04:12 | 10M | |
| audi-1.9.2.1_1.pkg | 2025-12-27 03:46 | 25K | |
| audiocd-kio-25.12.0.pkg | 2025-12-26 23:41 | 710K | |
| audiowmark-0.6.5_2.pkg | 2025-12-30 08:15 | 225K | |
| augeas-1.14.0_4.pkg | 2025-12-18 10:12 | 740K | |
| augustus-4.0.0.pkg | 2025-12-29 16:30 | 12M | |
| augustus-gene-predic..> | 2025-12-30 05:39 | 24M | |
| aumix-2.9.1_2.pkg | 2025-12-22 21:51 | 44K | |
| auralquiz-1.0.0_7.pkg | 2025-12-30 12:42 | 378K | |
| ausweisapp2-2.3.2.pkg | 2025-12-29 01:39 | 3.8M | |
| authelia-4.39.15_1.pkg | 2025-12-23 18:44 | 13M | |
| authenticator-4.4.0_..> | 2025-12-27 22:18 | 17M | |
| authoscope-0.8.1_27.pkg | 2025-12-30 12:59 | 2.1M | |
| auto-admin-0.8.4.6.pkg | 2025-12-27 03:46 | 114K | |
| autobackupmysql-1.4.pkg | 2025-12-21 18:34 | 7.5K | |
| autobench-2.1.2_11.pkg | 2025-12-28 11:10 | 25K | |
| autobook-1.5.pkg | 2025-08-22 16:20 | 268K | |
| autocd-3.02.12b_4.pkg | 2025-12-23 04:59 | 28K | |
| autoconf-2.72_1.pkg | 2025-12-16 01:34 | 568K | |
| autoconf-archive-202..> | 2025-08-13 10:11 | 411K | |
| autoconf-switch-2022..> | 2025-08-10 21:06 | 961 | |
| autoconf2.13-2.13.pkg | 2025-12-20 00:46 | 116K | |
| autoconf2.69-2.69_1.pkg | 2025-12-18 03:17 | 516K | |
| autocutsel-0.10.1_1.pkg | 2025-12-24 04:45 | 12K | |
| autodia-2.14_1.pkg | 2025-12-28 05:57 | 92K | |
| autofirma-1.9.pkg | 2025-12-29 22:23 | 34M | |
| autogen-5.18.16_6.pkg | 2025-12-19 12:17 | 637K | |
| autojump-22.5.3_1.pkg | 2025-12-20 08:39 | 26K | |
| automake-1.18.1.pkg | 2025-12-16 01:34 | 575K | |
| automount-1.7.9_1.pkg | 2025-12-21 21:34 | 8.1K | |
| automounter-1.5.1_1.pkg | 2025-08-17 05:38 | 25K | |
| automuteus-8.3.7_5.pkg | 2025-12-20 09:07 | 7.7M | |
| automx-0.10.2_7.pkg | 2025-12-29 17:25 | 44K | |
| automysqlbackup-3.0...> | 2025-12-23 12:18 | 25K | |
| autopano-sift-C-2.5...> | 2025-12-30 05:25 | 93K | |
| autorandr-1.15.pkg | 2025-12-20 18:06 | 66K | |
| autorespond-2.0.5_1.pkg | 2025-08-14 06:46 | 7.9K | |
| autorestic-1.8.3_11.pkg | 2025-12-21 09:04 | 3.2M | |
| autoscan-1.4.0_19.pkg | 2025-12-23 05:00 | 4.5M | |
| autossh-1.4g_1.pkg | 2025-08-20 00:27 | 24K | |
| autotalent-0.2_1.pkg | 2025-12-29 02:59 | 13K | |
| autotools-20220528.pkg | 2025-12-23 19:30 | 584 | |
| autotrace-0.31.10_1.pkg | 2025-12-27 20:03 | 95K | |
| autozen-2.1_8.pkg | 2025-12-29 07:33 | 88K | |
| av1an-0.5.0_2.pkg | 2025-12-30 15:51 | 1.7M | |
| avahi-0.8.pkg | 2025-12-29 18:06 | 794 | |
| avahi-app-0.8_6.pkg | 2025-12-16 01:55 | 366K | |
| avahi-autoipd-0.8_2.pkg | 2025-12-19 06:02 | 18K | |
| avahi-gtk-0.8_2.pkg | 2025-12-29 09:46 | 17K | |
| avahi-gtk3-0.8_2.pkg | 2025-12-26 22:49 | 27K | |
| avahi-header-0.8_2.pkg | 2025-08-13 21:41 | 2.8K | |
| avahi-libdns-0.8_2.pkg | 2025-12-18 21:56 | 30K | |
| avahi-qt5-0.8_2.pkg | 2025-12-22 15:04 | 6.6K | |
| avahi-sharp-0.8_2.pkg | 2025-12-23 12:51 | 21K | |
| avalon-framework-4.2..> | 2025-12-27 01:08 | 270K | |
| avanor-0.5.8.pkg | 2025-08-21 02:42 | 223K | |
| avarice-2.14_1.pkg | 2025-12-22 04:03 | 67K | |
| avce00-2.0.0.pkg | 2025-08-17 11:49 | 171K | |
| averiagwf-1.00_1.pkg | 2025-12-27 15:03 | 615K | |
| avfs-1.1.4.pkg | 2025-12-19 10:44 | 238K | |
| avida-2.12.4.pkg | 2025-08-22 10:15 | 2.4M | |
| aview-1.3.0.r1_9.pkg | 2025-12-29 21:12 | 21K | |
| avir-3.1.pkg | 2025-08-14 15:17 | 50K | |
| avis-1.2.0_1.pkg | 2025-08-20 15:19 | 515K | |
| avldrums-lv2-0.7.3.pkg | 2025-12-29 17:01 | 84M | |
| avogadro2-1.100.0.pkg | 2025-12-29 12:58 | 1.3M | |
| avogadrolibs-1.100.0..> | 2025-12-26 20:22 | 34M | |
| avoision-1.1_9.pkg | 2025-12-30 08:01 | 2.9M | |
| avp-20170505_1.pkg | 2025-12-22 15:50 | 722K | |
| avr-binutils-2.44,1.pkg | 2025-12-18 11:06 | 1.8M | |
| avr-gcc-14.2.0.pkg | 2025-12-18 14:20 | 46M | |
| avr-gdb-7.3.1_6.pkg | 2025-12-23 23:06 | 1.3M | |
| avr-libc-2.2.0,1.pkg | 2025-12-18 18:55 | 1.2M | |
| avra-1.4.2.pkg | 2025-08-19 16:33 | 122K | |
| avrdude-7.3.pkg | 2025-12-18 19:22 | 934K | |
| avro-1.12.1.pkg | 2025-12-23 16:24 | 803 | |
| avro-c-1.12.1.pkg | 2025-12-19 23:40 | 230K | |
| avro-cpp-1.12.1_1.pkg | 2025-12-19 21:45 | 820K | |
| awale-1.6_1.pkg | 2025-12-28 03:08 | 374K | |
| awele-1.0_5.pkg | 2025-12-29 19:20 | 12K | |
| awesome-4.3_6,1.pkg | 2025-12-27 10:28 | 891K | |
| awesome-cli-0.7.6_6.pkg | 2025-12-20 08:24 | 3.0M | |
| awesome-vicious-2.7...> | 2025-12-30 08:56 | 62K | |
| awgg-gtk2-0.6.0.6034..> | 2025-12-30 07:50 | 2.8M | |
| awgg-qt5-0.6.0.6034...> | 2025-12-29 03:52 | 2.8M | |
| awgg-qt6-0.6.0.6034...> | 2025-12-30 15:13 | 2.8M | |
| awka-0.7.5_2.pkg | 2025-08-18 11:34 | 238K | |
| aws-c-auth-0.9.4.pkg | 2025-12-26 09:05 | 95K | |
| aws-c-cal-0.9.13.pkg | 2025-12-18 01:12 | 39K | |
| aws-c-common-0.12.6,..> | 2025-12-18 01:09 | 229K | |
| aws-c-compression-0...> | 2025-12-18 01:32 | 8.8K | |
| aws-c-event-stream-0..> | 2025-12-26 09:25 | 40K | |
| aws-c-http-0.10.8.pkg | 2025-12-26 06:48 | 153K | |
| aws-c-io-0.24.2.pkg | 2025-12-26 06:37 | 139K | |
| aws-c-mqtt-0.13.3.pkg | 2025-12-26 09:47 | 134K | |
| aws-c-s3-0.11.3.pkg | 2025-12-26 09:22 | 109K | |
| aws-c-sdkutils-0.2.4..> | 2025-12-18 01:42 | 41K | |
| aws-checksums-0.2.8,..> | 2025-12-26 09:04 | 66K | |
| aws-crt-cpp-0.36.1.pkg | 2025-12-26 10:07 | 222K | |
| aws-crt-ffi-0.4.2.pkg | 2025-12-27 03:02 | 14K | |
| aws-ec2-imdsv2-get-1..> | 2025-12-27 10:22 | 166K | |
| aws-iam-authenticato..> | 2025-12-22 05:24 | 14M | |
| aws-lc-1.66.0.pkg | 2025-12-26 21:13 | 1.8M | |
| aws-sdk-cpp-1.11.714..> | 2025-12-26 12:55 | 83M | |
| aws-sdk-php81-3.356...> | 2025-12-28 01:31 | 3.1M | |
| aws-sdk-php82-3.356...> | 2025-12-29 21:24 | 3.1M | |
| aws-sdk-php83-3.356...> | 2025-12-30 12:49 | 3.1M | |
| aws-sdk-php84-3.356...> | 2025-12-29 01:11 | 3.1M | |
| aws-sdk-php85-3.356...> | 2025-12-28 10:35 | 3.1M | |
| aws-vault-6.6.2_25.pkg | 2025-12-23 16:52 | 3.5M | |
| awslim-0.5.0_1.pkg | 2025-12-21 00:38 | 79M | |
| awslim-compact-0.5.0..> | 2025-12-21 08:23 | 14M | |
| awstats-8.0,1.pkg | 2025-12-22 19:58 | 2.1M | |
| axa-3.0.2_4.pkg | 2025-12-20 12:23 | 345K | |
| axc-0.3.7.pkg | 2025-12-20 02:01 | 25K | |
| axel-2.17.14_1.pkg | 2025-12-21 03:27 | 50K | |
| axfr2acl-1.01.pkg | 2025-12-21 12:26 | 9.0K | |
| axis2-1.8.0_1.pkg | 2025-12-28 11:48 | 31M | |
| axmldec-1.2.0_16.pkg | 2025-12-20 23:20 | 58K | |
| axom-0.10.1_3.pkg | 2025-12-27 18:29 | 2.0M | |
| ayatana-ido-0.10.4.pkg | 2025-12-26 13:15 | 86K | |
| aylet-0.5_8.pkg | 2025-12-27 21:12 | 43K | |
| az-aspell-0.02.0_1,2..> | 2025-12-21 23:04 | 136K | |
| azure-agent-2.12.0.2..> | 2025-12-21 09:24 | 710K | |
| b2sum-20190724_2.pkg | 2025-08-19 16:38 | 16K | |
| b3sum-1.8.2_6.pkg | 2025-12-28 21:11 | 320K | |
| b43-fwcutter-019.pkg | 2025-08-15 19:31 | 15K | |
| b612-1.008.pkg | 2025-12-29 03:44 | 228K | |
| babel-1.6_4.pkg | 2025-08-18 19:33 | 133K | |
| babeld-1.13.1.pkg | 2025-08-19 08:56 | 73K | |
| babelflow-1.1.0_2.pkg | 2025-12-28 12:26 | 174K | |
| babeltrace-1.5.7_2.pkg | 2025-12-23 10:38 | 289K | |
| babl-0.1.116.pkg | 2025-12-26 15:39 | 440K | |
| backdown-1.1.2_11.pkg | 2025-12-29 19:26 | 721K | |
| backrest-1.10.1_2.pkg | 2025-12-24 01:23 | 10M | |
| backuppc-3.3.2_6.pkg | 2025-12-23 21:01 | 406K | |
| backuppc-devel-4.4.1..> | 2025-12-20 23:04 | 490K | |
| backuppc4-4.4.0_2.pkg | 2025-12-23 03:42 | 472K | |
| backupuser-1.1.1_1.pkg | 2025-12-23 11:23 | 7.7K | |
| bacnet-stack-1.4.1_1..> | 2025-08-15 04:54 | 466K | |
| bacnet-stack-apps-1...> | 2025-12-20 08:21 | 647K | |
| bacon-3.20.1_1.pkg | 2025-12-28 18:30 | 1.8M | |
| bacula-web-php81-9.8..> | 2025-12-29 04:06 | 155K | |
| bacula-web-php82-9.8..> | 2025-12-30 03:54 | 155K | |
| bacula-web-php83-9.8..> | 2025-12-29 11:24 | 155K | |
| bacula-web-php84-9.8..> | 2025-12-29 16:20 | 155K | |
| bacula-web-php85-9.8..> | 2025-12-29 19:04 | 155K | |
| bacula11-libs3-20200..> | 2025-12-29 19:17 | 100K | |
| bacula13-client-13.0..> | 2025-12-19 20:28 | 447K | |
| bacula13-client-stat..> | 2025-12-21 06:27 | 2.7M | |
| bacula13-docs-13.0.4..> | 2025-08-18 15:44 | 6.4M | |
| bacula13-server-13.0..> | 2025-12-21 03:30 | 739K | |
| bacula15-client-15.0..> | 2025-12-19 22:16 | 494K | |
| bacula15-client-stat..> | 2025-12-21 04:52 | 3.0M | |
| bacula15-docs-15.0.3..> | 2025-08-17 15:49 | 14M | |
| bacula15-server-15.0..> | 2025-12-23 06:26 | 794K | |
| baculum-api-11.0.6.pkg | 2025-12-28 10:53 | 110K | |
| baculum-common-11.0...> | 2025-12-27 15:42 | 5.0M | |
| baculum-web-11.0.6_1..> | 2025-12-27 21:34 | 355K | |
| badwolf-1.4.0.pkg | 2025-12-30 09:39 | 86K | |
| bagel-1.2.2.132_17.pkg | 2025-12-29 19:38 | 34M | |
| baikal-php81-0.10.1.pkg | 2025-12-29 12:43 | 1.0M | |
| baikal-php82-0.10.1.pkg | 2025-12-28 21:57 | 1.0M | |
| baikal-php83-0.10.1.pkg | 2025-12-28 08:30 | 1.0M | |
| baikal-php84-0.10.1.pkg | 2025-12-30 10:19 | 1.0M | |
| baikal-php85-0.10.1.pkg | 2025-12-30 09:25 | 1.0M | |
| baka-mplayer-2.0.4_1..> | 2025-12-28 21:07 | 391K | |
| balance-3.57_1.pkg | 2025-08-22 00:31 | 20K | |
| ballerburg-1.2.3.pkg | 2025-12-22 08:38 | 64K | |
| baloo-widgets-25.12...> | 2025-12-26 18:37 | 131K | |
| balsa-2.6.5_4.pkg | 2025-12-30 00:34 | 1.7M | |
| bam-0.4.0.pkg | 2025-08-17 21:04 | 106K | |
| bambootracker-0.6.5.pkg | 2025-12-29 05:44 | 1.2M | |
| bamf-0.5.6_4.pkg | 2025-12-27 00:58 | 146K | |
| bamp-lv2-g20210212.pkg | 2025-12-30 05:24 | 85K | |
| bamtools-2.5.3.pkg | 2025-08-15 00:19 | 345K | |
| bamutil-1.0.15.pkg | 2025-08-15 13:43 | 319K | |
| bandwhich-0.23.1_11.pkg | 2025-12-30 02:18 | 1.1M | |
| bandwidthd-2.0.1_12.pkg | 2025-12-30 04:00 | 37K | |
| bangr-lv2-1.6.2.pkg | 2025-12-27 20:11 | 255K | |
| banihstypos-0.2_1.pkg | 2025-08-16 22:55 | 7.0K | |
| baobab-47.0.pkg | 2025-12-27 12:22 | 329K | |
| barcode-0.98_2.pkg | 2025-08-21 04:44 | 60K | |
| bareos-client-24.0.7..> | 2025-12-19 15:35 | 765K | |
| bareos-server-24.0.7..> | 2025-12-23 18:36 | 1.6M | |
| bareos-traymonitor-q..> | 2025-12-27 21:20 | 191K | |
| bareos-traymonitor-q..> | 2025-12-29 22:44 | 192K | |
| bareos-webui-24.0.7.pkg | 2025-12-29 01:40 | 3.8M | |
| bareos22-client-22.1..> | 2025-12-19 11:00 | 714K | |
| bareos22-server-22.1..> | 2025-12-23 22:05 | 1.2M | |
| bareos22-traymonitor..> | 2025-12-27 22:38 | 163K | |
| bareos22-webui-22.1...> | 2025-12-30 17:25 | 4.0M | |
| bareos23-client-23.1..> | 2025-12-19 12:47 | 756K | |
| bareos23-traymonitor..> | 2025-12-28 06:01 | 167K | |
| bareos23-traymonitor..> | 2025-12-28 20:17 | 168K | |
| bareos23-webui-23.1...> | 2025-12-29 03:16 | 4.0M | |
| baresip-4.4.0_1.pkg | 2025-12-29 13:12 | 951K | |
| baresip-nox11-4.4.0_..> | 2025-12-30 12:26 | 866K | |
| barnyard2-1.13_6.pkg | 2025-08-14 03:16 | 148K | |
| barnyard2-sguil-1.13..> | 2025-08-28 06:16 | 150K | |
| barony-3.3.7_3.pkg | 2025-12-29 23:52 | 1.2M | |
| barrage-1.0.7.pkg | 2025-12-20 14:53 | 269K | |
| barrier-2.4.0.pkg | 2025-12-30 05:42 | 689K | |
| barrnap-0.9.pkg | 2025-12-23 18:08 | 489K | |
| barvinok-0.41.8.pkg | 2025-12-27 09:06 | 310K | |
| bas2tap-2.6.pkg | 2025-08-22 04:18 | 25K | |
| base64-1.5_2.pkg | 2025-08-14 00:48 | 6.4K | |
| base91-0.6.0_1.pkg | 2025-08-18 20:45 | 6.9K | |
| bash-5.3.9.pkg | 2025-12-16 01:34 | 1.9M | |
| bash-completion-2.17..> | 2025-12-24 20:09 | 218K | |
| bash-completion-free..> | 2025-12-16 01:29 | 6.3K | |
| bash-completion-zfs-..> | 2025-08-23 01:47 | 3.8K | |
| bash-static-5.3.9.pkg | 2025-12-23 12:37 | 2.2M | |
| bashc-5.1.8_1.pkg | 2025-12-21 12:50 | 1.7M | |
| bashdb-5.0.1.1.2_1.pkg | 2025-12-23 16:00 | 140K | |
| bashtop-0.9.25_1.pkg | 2025-12-30 14:48 | 46K | |
| basic-stats-0.1.2.8_..> | 2025-12-30 09:06 | 54K | |
| basic256-2.0.0.11_2.pkg | 2025-12-28 06:22 | 598K | |
| bass-1.2_5.pkg | 2025-12-30 11:17 | 65M | |
| bastet-0.43.2_12.pkg | 2025-12-22 20:16 | 72K | |
| bastille-1.3.1.25122..> | 2025-12-30 09:28 | 99K | |
| bastillion-3.14.00.pkg | 2025-12-28 03:17 | 23M | |
| basu-0.2.1.pkg | 2025-08-13 06:36 | 203K | |
| bat-0.25.0_15.pkg | 2025-12-27 09:38 | 2.3M | |
| bat-extras-2024.08.2..> | 2025-12-28 06:28 | 21K | |
| batik-1.18.pkg | 2025-12-26 19:29 | 8.0M | |
| batmon-0.8_7.pkg | 2025-12-27 08:43 | 34K | |
| bats-core-1.11.1.pkg | 2025-12-29 06:59 | 42K | |
| battalion-1.4b_4.pkg | 2025-08-21 01:23 | 1.2M | |
| batterycat-1.6_1.pkg | 2025-12-28 17:36 | 61K | |
| battmond-0.4_2.pkg | 2025-08-20 12:45 | 5.4K | |
| battray-2.3_3.pkg | 2025-12-29 15:43 | 69K | |
| batv-milter-0.5.0_3.pkg | 2025-08-21 02:45 | 39K | |
| bayespam-0.9.2_1.pkg | 2025-12-23 00:06 | 15K | |
| bazarr-1.5.2_3.pkg | 2025-12-29 15:17 | 30M | |
| bazel-buildtools-3.2..> | 2025-12-22 10:27 | 2.2M | |
| bazel5-5.4.1.pkg | 2025-12-26 19:41 | 27M | |
| bb-1.3.r1_3.pkg | 2025-08-17 00:38 | 1.0M | |
| bbappconf-0.0.2_2.pkg | 2025-08-19 19:30 | 35K | |
| bbdate-0.2.4_3.pkg | 2025-08-18 15:01 | 26K | |
| bbdb-3.2.2.a_12.pkg | 2025-12-29 19:44 | 348K | |
| bbdb-emacs_canna-3.2..> | 2025-12-29 02:35 | 348K | |
| bbdb-emacs_devel-3.2..> | 2025-12-27 19:55 | 348K | |
| bbdb-emacs_devel_nox..> | 2025-12-24 07:11 | 348K | |
| bbdb-emacs_nox-3.2.2..> | 2025-12-22 18:00 | 348K | |
| bbdb-emacs_wayland-3..> | 2025-12-29 23:18 | 348K | |
| bbdock-0.2.9_2.pkg | 2025-12-29 05:35 | 27K | |
| bbe-0.2.2_3.pkg | 2025-08-18 08:00 | 28K | |
| bbftp-client-3.2.1_1..> | 2025-08-19 23:25 | 58K | |
| bbftp-server-3.2.1_2..> | 2025-08-20 01:37 | 43K | |
| bbjd-1.01_1.pkg | 2025-08-16 22:08 | 30K | |
| bbkeys-0.9.1_2.pkg | 2025-08-20 22:10 | 131K | |
| bbmail-0.9.3_1.pkg | 2025-08-18 14:59 | 109K | |
| bbmap-39.34.pkg | 2025-12-27 19:24 | 6.3M | |
| bbpager-0.4.7_4.pkg | 2025-12-28 06:01 | 101K | |
| bbparse-0.1.0_1.pkg | 2025-08-17 09:37 | 20K | |
| bbrun-1.6_14.pkg | 2025-12-27 21:04 | 13K | |
| bcal-2.4.pkg | 2025-12-30 07:50 | 25K | |
| bcc-1995.03.12_3.pkg | 2025-08-16 04:29 | 105K | |
| bcf-score-1.20_3.pkg | 2025-12-27 23:43 | 117K | |
| bcftools-1.22.pkg | 2025-12-18 16:58 | 851K | |
| bcg729-1.1.1.pkg | 2025-08-13 22:07 | 54K | |
| bchoppr-lv2-1.12.6.1..> | 2025-12-29 02:36 | 369K | |
| bchunk-1.2.2_1.pkg | 2025-08-22 21:14 | 8.2K | |
| bclock-1.0_3.pkg | 2025-08-19 08:19 | 10K | |
| bcmatroska2-5.4.29.pkg | 2025-12-18 16:27 | 140K | |
| bcpp-20250914.pkg | 2025-12-22 10:05 | 33K | |
| bctoolbox-5.4.28.pkg | 2025-12-18 12:35 | 184K | |
| bcunit-5.4.29.pkg | 2025-12-18 11:27 | 45K | |
| bcwipe-1.9.13_1.pkg | 2025-08-21 12:37 | 29K | |
| bddsolve-1.04_20.pkg | 2025-12-20 08:35 | 101K | |
| bdelta-0.3.1.pkg | 2025-08-14 01:28 | 23K | |
| bdes-1993_1.pkg | 2025-08-20 01:15 | 14K | |
| bdf2sfd-1.1.9.pkg | 2025-08-18 05:18 | 6.7K | |
| bdfresize-1.5_3.pkg | 2025-08-18 19:17 | 13K | |
| bdftopcf-1.1_3.pkg | 2025-08-10 21:25 | 23K | |
| be-aspell-0.01_1,2.pkg | 2025-12-23 06:50 | 9.8M | |
| be-libreoffice-25.8...> | 2025-12-27 16:06 | 895K | |
| beacon-1.4_4.pkg | 2025-12-23 15:48 | 88K | |
| beadm-1.3.5_1.pkg | 2025-08-18 06:49 | 10K | |
| beancount-3.2.0.pkg | 2025-12-26 18:34 | 713K | |
| beangulp-0.2.0_3.pkg | 2025-12-26 22:17 | 156K | |
| beanie-0.8.2_1.pkg | 2025-12-23 08:26 | 219K | |
| beanquery-0.2.0_1.pkg | 2025-12-26 20:47 | 250K | |
| beansdb-0.7.1.4_1.pkg | 2025-08-19 06:21 | 88K | |
| beanstalkd-1.12_1.pkg | 2025-08-15 06:20 | 37K | |
| bear-3.1.5_19.pkg | 2025-12-20 06:23 | 315K | |
| bearssl-0.6.pkg | 2025-08-15 08:45 | 314K | |
| beats7-7.17.11_17.pkg | 2025-12-20 01:49 | 36M | |
| beats8-8.14.3_12.pkg | 2025-12-22 03:54 | 46M | |
| beav-1.40.18_4.pkg | 2025-08-18 21:03 | 63K | |
| bedrust-0.8.8_7.pkg | 2025-12-29 19:59 | 3.3M | |
| bedtools-2.31.1.pkg | 2025-12-18 22:37 | 579K | |
| bee-host-1.4.2.pkg | 2025-12-23 03:56 | 11K | |
| beebeep-5.8.4.pkg | 2025-12-27 20:05 | 22M | |
| beecrypt-4.2.1_3.pkg | 2025-08-21 18:37 | 143K | |
| beehive-0.4.0_35.pkg | 2025-12-20 07:18 | 8.2M | |
| beep-1.0_2.pkg | 2025-08-21 23:33 | 5.3K | |
| beets-2.0.0_2.pkg | 2025-12-29 08:18 | 937K | |
| beforelight-1.0.5_2.pkg | 2025-12-22 07:31 | 5.7K | |
| beid-5.1.26.pkg | 2025-12-30 14:06 | 513K | |
| beidconnect-2.11.pkg | 2025-12-23 07:20 | 128K | |
| belcard-5.4.28.pkg | 2025-12-18 20:21 | 254K | |
| belle-sip-5.4.28.pkg | 2025-12-18 19:31 | 482K | |
| belooted-0.1.4.1_8.pkg | 2025-12-30 12:29 | 88K | |
| belr-5.4.28.pkg | 2025-12-18 15:25 | 149K | |
| bemenu-0.6.23.pkg | 2025-12-28 05:08 | 77K | |
| benchmark-1.9.4,1.pkg | 2025-12-18 06:27 | 135K | |
| bencodetools-1.0.1.pkg | 2025-08-14 20:32 | 27K | |
| bend-language-0.2.38..> | 2025-12-28 21:15 | 840K | |
| beret-1.2.1.pkg | 2025-12-29 00:36 | 42M | |
| berry-0.1.12_1.pkg | 2025-12-28 13:11 | 24K | |
| bespokesynth-1.3.0.pkg | 2025-12-28 11:18 | 18M | |
| bestfit-0.2.0_1.pkg | 2025-08-19 02:46 | 13K | |
| bfbtester-2.0.1_1.pkg | 2025-08-17 20:53 | 15K | |
| bfc-g20150417.pkg | 2025-08-15 05:17 | 27K | |
| bfe2-20030723_11.pkg | 2025-12-29 17:01 | 23K | |
| bfg-1.15.0.pkg | 2025-12-28 15:24 | 12M | |
| bfhist-0.4.pkg | 2025-08-20 18:45 | 5.7K | |
| bforce-kst-0.22.8.7_..> | 2025-08-22 01:28 | 186K | |
| bfs-4.1.pkg | 2025-12-21 11:27 | 116K | |
| bftpd-6.1_1.pkg | 2025-08-16 00:40 | 79K | |
| bg-aspell-4.1.0_1,2.pkg | 2025-12-21 03:00 | 789K | |
| bg-hyphen-4.3_1.pkg | 2025-08-20 01:03 | 4.8K | |
| bg-libreoffice-25.8...> | 2025-12-27 17:44 | 3.6M | |
| bg-mythes-4.3_1.pkg | 2025-08-21 04:13 | 717K | |
| bgfx-1.128.8786.481.pkg | 2025-08-14 04:57 | 5.2M | |
| bglibs-2.04_3,1.pkg | 2025-12-18 23:37 | 563K | |
| bgpq3-0.1.38.pkg | 2025-08-21 17:34 | 36K | |
| bgpq4-1.12.pkg | 2025-08-15 22:45 | 38K | |
| bgpuma-20151209_2.pkg | 2025-12-23 16:53 | 29K | |
| bgrot-1.31_1.pkg | 2025-12-29 15:30 | 4.1K | |
| bgs-0.8_4.pkg | 2025-12-29 07:20 | 5.9K | |
| bharvestr-lv2-g20201..> | 2025-12-27 21:15 | 727K | |
| bhyve-firmware-1.0_2..> | 2025-08-14 03:08 | 537 | |
| bhyve-rc-4.pkg | 2025-12-23 01:13 | 2.5K | |
| bhyvemgr-gtk2-1.13.1..> | 2025-12-29 03:30 | 1.5M | |
| bhyvemgr-qt5-1.13.1.pkg | 2025-12-29 13:49 | 1.5M | |
| bhyvemgr-qt6-1.13.1.pkg | 2025-12-28 11:15 | 1.5M | |
| biabam-0.9.7_2.pkg | 2025-12-23 08:10 | 2.8K | |
| bib2html-6.7.pkg | 2025-12-22 02:53 | 97K | |
| bibata-cursor-theme-..> | 2025-12-20 19:03 | 24M | |
| bibclean-3.07.pkg | 2025-08-16 19:11 | 121K | |
| bibcursed-2.0.1_1.pkg | 2025-08-17 20:31 | 15K | |
| bible-kjv-4.38_1.pkg | 2025-12-23 19:20 | 2.4M | |
| biblesync-2.1.0_2.pkg | 2025-12-19 13:13 | 38K | |
| bibletime-3.1.1.pkg | 2025-12-29 18:33 | 5.9M | |
| biblical-curse-0.02.pkg | 2025-12-23 16:22 | 2.2K | |
| bibtex2html-1.99_2.pkg | 2025-12-23 13:38 | 593K | |
| bibtexconv-2.1.0.pkg | 2025-12-27 22:58 | 180K | |
| bibutils-7.2.pkg | 2025-08-18 05:01 | 1.2M | |
| bibview-2.2_3.pkg | 2025-12-23 22:21 | 77K | |
| bicom-1.01.pkg | 2025-08-18 14:17 | 30K | |
| bicon-0.5_1.pkg | 2025-08-21 11:02 | 37K | |
| biew-6.1.0_5.pkg | 2025-12-29 05:21 | 462K | |
| bifrost-1.3.5_1.pkg | 2025-08-19 00:09 | 924K | |
| bigyear-20010226_1,1..> | 2025-08-16 05:49 | 5.5K | |
| bijiben-40.1_10.pkg | 2025-12-30 00:21 | 334K | |
| billardgl-1.75_2.pkg | 2025-08-21 05:53 | 533K | |
| biloba-0.9.3_5.pkg | 2025-12-29 23:56 | 2.6M | |
| binary-cvsup-static-..> | 2025-08-19 08:56 | 841K | |
| binaryen-125.pkg | 2025-12-19 10:43 | 4.7M | |
| binbloom-2.1.pkg | 2025-08-22 03:26 | 19K | |
| bincimap-1.2.13_4.pkg | 2025-08-15 23:25 | 295K | |
| binclock-1.5_1.pkg | 2025-08-19 22:19 | 6.5K | |
| bind-tools-9.20.17.pkg | 2025-12-26 22:33 | 1.5M | |
| bind9-devel-9.21.16.pkg | 2025-12-30 16:05 | 7.3M | |
| bind916-9.16.50_1.pkg | 2025-12-30 16:52 | 8.5M | |
| bind918-9.18.43.pkg | 2025-12-29 01:27 | 6.7M | |
| bind920-9.20.17.pkg | 2025-12-27 16:37 | 6.8M | |
| bind_exporter-0.8.0_..> | 2025-12-22 06:29 | 4.0M | |
| bindgraph-0.3_1.pkg | 2025-12-29 15:25 | 9.2K | |
| bindtest-1.56_2.pkg | 2025-08-20 17:53 | 13K | |
| bined-0.2.3.pkg | 2025-12-28 07:40 | 9.0M | |
| bingrep-0.11.0_26.pkg | 2025-12-27 20:01 | 1.3M | |
| bingrok-0.0.1.pkg | 2025-12-29 07:58 | 44K | |
| biniax2-1.30_9.pkg | 2025-12-29 17:16 | 2.5M | |
| binkd-1.1.a.115_1.pkg | 2025-08-17 09:41 | 129K | |
| binocle-0.3.2_19.pkg | 2025-12-30 07:14 | 2.9M | |
| binutils-2.44,1.pkg | 2025-12-16 01:39 | 11M | |
| binwalk-2.3.3_1.pkg | 2025-12-21 19:38 | 198K | |
| bio-mocha-1.20_1.pkg | 2025-12-19 09:11 | 92K | |
| bioawk-1.0.7.pkg | 2025-08-14 19:36 | 62K | |
| biococoa-2.2.2_9.pkg | 2025-12-27 11:35 | 145K | |
| biodiff-1.2.1_15.pkg | 2025-12-30 10:32 | 1.2M | |
| biolibc-0.2.7.pkg | 2025-12-26 20:31 | 324K | |
| biolibc-tools-0.1.5.pkg | 2025-12-27 09:22 | 29K | |
| bioparser-3.1.0.pkg | 2025-08-15 16:40 | 6.6K | |
| biorythm-1.1.4_1.pkg | 2025-08-16 10:52 | 8.3K | |
| biosfont-1.3.1.14030..> | 2025-08-14 22:21 | 4.6K | |
| biosfont-demos-1.3.1..> | 2025-08-20 19:04 | 5.5K | |
| biosig-2.6.1_2.pkg | 2025-12-26 21:28 | 1.7M | |
| biosoup-0.11.0_1.pkg | 2025-08-14 07:14 | 6.1K | |
| bip-0.9.2.pkg | 2025-08-22 13:19 | 123K | |
| bird2-2.17.3.pkg | 2025-12-21 13:08 | 430K | |
| bird2-rtsock-2.17.3.pkg | 2025-12-23 12:55 | 423K | |
| bird3-3.1.5.pkg | 2025-12-23 11:41 | 517K | |
| birda-1.3_1.pkg | 2025-08-18 15:25 | 65K | |
| birdfont-2.33.4_4.pkg | 2025-12-30 09:10 | 3.5M | |
| birdtray-1.11.4.pkg | 2025-12-29 12:44 | 349K | |
| birthday-1.6.2_1.pkg | 2025-08-17 21:26 | 13K | |
| bison-3.8.2_2,1.pkg | 2025-12-16 01:34 | 727K | |
| bitchx-1.2.1_4,1.pkg | 2025-08-21 04:31 | 1.0M | |
| bitcoin-29.1_1.pkg | 2025-12-29 16:03 | 7.6M | |
| bitcoin-daemon-29.1_..> | 2025-12-22 07:56 | 4.3M | |
| bitcoin-utils-29.1_1..> | 2025-12-18 20:08 | 15M | |
| bitedit-0.9.4.pkg | 2025-08-19 05:29 | 8.7K | |
| bitefusion-1.0.2_3.pkg | 2025-12-20 15:00 | 66K | |
| bitlbee-3.6_2.pkg | 2025-12-19 20:17 | 253K | |
| bitlbee-discord-0.4...> | 2025-12-21 06:42 | 24K | |
| bitlbee-facebook-1.2..> | 2025-12-20 10:58 | 57K | |
| bitlbee-mastodon-1.4..> | 2025-12-21 13:20 | 46K | |
| bitlbee-steam-1.4.2.pkg | 2025-12-23 15:28 | 28K | |
| bitmap-1.1.1.pkg | 2025-12-19 02:37 | 53K | |
| bitmap-graphics-libr..> | 2025-08-16 09:14 | 27K | |
| bitmap2pp-4.39.0.pkg | 2025-12-29 11:22 | 147K | |
| bitmark-0.16.0_10.pkg | 2025-12-20 07:32 | 11M | |
| bitmark-cli-0.16.0_1..> | 2025-12-23 16:18 | 3.8M | |
| bitmark-daemon-0.16...> | 2025-12-22 14:36 | 5.3M | |
| bitmark-recorder-0.1..> | 2025-12-23 10:33 | 2.6M | |
| bitsery-5.2.5.pkg | 2025-12-22 12:36 | 40K | |
| bitstream-1.5.pkg | 2025-08-14 20:29 | 91K | |
| bitstream-vera-1.10_..> | 2025-12-27 16:27 | 235K | |
| bitter-2.110,1.pkg | 2025-12-29 20:19 | 201K | |
| bittwist-4.7.pkg | 2025-08-18 01:01 | 39K | |
| bitwarden-cli-2025.1..> | 2025-12-29 16:30 | 23M | |
| bitwise-0.50_1.pkg | 2025-12-22 09:23 | 18K | |
| bitwuzla-0.8.2.pkg | 2025-12-28 06:49 | 1.0M | |
| bjumblr-lv2-1.6.8_1.pkg | 2025-12-27 21:16 | 442K | |
| bkpupsd-1.0a_1.pkg | 2025-08-20 08:01 | 6.0K | |
| bksh-1.7.pkg | 2025-08-22 14:56 | 4.9K | |
| bkt-0.8.2_11.pkg | 2025-12-28 23:54 | 362K | |
| black-box-1.4.8_3.pkg | 2025-12-30 18:53 | 233K | |
| black-hole-solver-1...> | 2025-08-13 20:54 | 15K | |
| blackbox-0.70.1_8.pkg | 2025-12-27 15:50 | 284K | |
| blackbox_exporter-0...> | 2025-12-21 02:54 | 6.5M | |
| blackout-g20140730.pkg | 2025-12-29 08:54 | 115K | |
| blacs-1.7_41.pkg | 2025-12-30 04:54 | 452K | |
| bladeRF-2025.10.pkg | 2025-12-19 05:38 | 334K | |
| blahtexml-1.0_1.pkg | 2025-08-17 00:57 | 322K | |
| blame-1.4.20250101.pkg | 2025-08-18 14:26 | 55K | |
| blas-3.12.1.pkg | 2025-12-26 06:42 | 242K | |
| blasfeo-0.1.4.2.pkg | 2025-12-26 21:48 | 610K | |
| blaspp-2022.05.00_4.pkg | 2025-12-29 21:44 | 126K | |
| blaze-3.8_5.pkg | 2025-12-27 09:45 | 1.0M | |
| blazeiterative-g2018..> | 2025-12-28 21:11 | 6.0K | |
| blender-doc-4.2.pkg | 2025-08-17 11:47 | 434M | |
| bless-0.6.3_3,1.pkg | 2025-12-29 11:03 | 481K | |
| blind-1.1_1.pkg | 2025-08-19 13:12 | 101K | |
| blinken-25.12.0.pkg | 2025-12-27 00:45 | 2.2M | |
| blinkensisters-with-..> | 2025-12-29 16:21 | 75M | |
| blis-2.0.pkg | 2025-12-26 09:45 | 3.3M | |
| blisp-g20230703.pkg | 2025-08-16 11:44 | 70K | |
| bliss-graph-tool-0.7..> | 2025-12-19 16:51 | 77K | |
| blitz-1.0.2_4.pkg | 2025-08-20 03:54 | 218K | |
| bloaty-1.1_19.pkg | 2025-12-22 23:43 | 166K | |
| blobby-1.1.1,1.pkg | 2025-12-29 19:59 | 1.4M | |
| blobwars-2.00_2.pkg | 2025-12-30 17:31 | 64M | |
| block-0.6_1.pkg | 2025-08-21 06:22 | 19K | |
| blockattack-2.10.0.pkg | 2025-12-28 10:45 | 6.8M | |
| blockout-2.5_5.pkg | 2025-12-21 07:02 | 4.1M | |
| blockrage-0.2.3_7.pkg | 2025-12-30 12:05 | 71K | |
| blocksolve95-3.0_32.pkg | 2025-12-29 06:16 | 270K | |
| blocky-0.28.2_2.pkg | 2025-12-20 08:59 | 7.4M | |
| blogbench-1.1_2.pkg | 2025-08-16 13:10 | 8.3K | |
| blokish-0.9.4_13.pkg | 2025-12-29 11:28 | 69K | |
| bloodfrontier-b2_12.pkg | 2025-12-30 09:36 | 381M | |
| bloomberg-bde-3.117...> | 2025-08-19 11:59 | 6.0M | |
| blop-0.2.8_2.pkg | 2025-12-20 15:07 | 720K | |
| blst-0.3.14_2.pkg | 2025-12-18 21:56 | 78K | |
| blt-2.5.3_7.pkg | 2025-12-27 01:22 | 1.8M | |
| bluefish-2.2.19.pkg | 2025-12-30 11:39 | 2.8M | |
| bluegps-linux-2.0_1.pkg | 2025-08-18 05:45 | 10K | |
| bluemoon-2.13.pkg | 2025-08-22 01:02 | 13K | |
| blueprint-compiler-0..> | 2025-12-27 01:23 | 230K | |
| blues-g20220312.pkg | 2025-12-30 02:12 | 124K | |
| bluez-firmware-1.2.pkg | 2025-08-18 17:14 | 65K | |
| bmd-3.5.pkg | 2025-12-19 15:12 | 96K | |
| bmd-plugin-avahi-3.0..> | 2025-12-22 18:12 | 4.5K | |
| bmd-plugin-hookcmd-3..> | 2025-12-21 13:42 | 6.3K | |
| bmf-0.9.4_2,1.pkg | 2025-12-23 11:11 | 25K | |
| bmfdec-g20211007.pkg | 2025-08-17 15:30 | 20K | |
| bmk-0.1.pkg | 2025-08-18 17:28 | 32K | |
| bmon-4.0_3.pkg | 2025-12-23 15:42 | 39K | |
| bmp2html-0.1_6.pkg | 2025-12-22 09:45 | 5.9K | |
| bmpanel2-2.1.p1_2.pkg | 2025-12-28 10:23 | 230K | |
| bn-aspell-0.01.1.1_1..> | 2025-12-23 21:37 | 653K | |
| bn-freebsd-doc-20251..> | 2025-12-19 19:21 | 157K | |
| bn-libreoffice-25.8...> | 2025-12-27 03:04 | 2.9M | |
| bn_IN-libreoffice-25..> | 2025-12-27 14:39 | 3.2M | |
| bnf-1.6.10_1.pkg | 2025-08-16 22:55 | 29K | |
| bo-libreoffice-25.8...> | 2025-12-27 07:55 | 2.9M | |
| bochs-3.0,2.pkg | 2025-12-27 16:22 | 1.1M | |
| bodr-10.pkg | 2025-08-14 13:26 | 85K | |
| boehm-gc-8.2.10.pkg | 2025-12-16 01:29 | 274K | |
| boehm-gc-threaded-8...> | 2025-12-18 04:03 | 167K | |
| bogofilter-1.3.0.r1.pkg | 2025-12-18 23:30 | 381K | |
| bogofilter-kc-1.3.0...> | 2025-12-22 15:26 | 330K | |
| bogofilter-sqlite-1...> | 2025-12-22 06:15 | 333K | |
| bogosort-0.4.2_3.pkg | 2025-08-22 22:20 | 17K | |
| boiling-egg-0.02_1.pkg | 2025-08-19 11:26 | 1.9K | |
| boinc-client-8.2.8.pkg | 2025-12-27 17:57 | 3.9M | |
| boinc_curses-0.2.3_1..> | 2025-08-21 01:38 | 110K | |
| boinctui-2.7.2.pkg | 2025-12-21 03:35 | 119K | |
| bolt-lmm-2.3.6_17.pkg | 2025-12-28 10:27 | 312M | |
| bomb-her-man-0.3_7.pkg | 2025-12-29 22:36 | 1.2M | |
| bombadillo-2.4.0_11.pkg | 2025-12-21 19:01 | 2.2M | |
| bombardier-1.2.6_21.pkg | 2025-12-22 12:54 | 3.5M | |
| bomber-25.12.0.pkg | 2025-12-26 21:20 | 940K | |
| bomberclone-0.11.9_3..> | 2025-12-29 20:19 | 7.2M | |
| bomns-0.99.3_3.pkg | 2025-12-29 16:08 | 841K | |
| bonnie++-1.98_1.pkg | 2025-08-19 16:28 | 56K | |
| bonnie-2.0.6_2.pkg | 2025-08-19 06:59 | 8.5K | |
| bonzomatic-2023.06.1..> | 2025-12-29 02:22 | 457K | |
| bookworm-1.1.2_27.pkg | 2025-12-28 10:43 | 1.5M | |
| boolector-3.2.4_1.pkg | 2025-12-29 07:32 | 609K | |
| boomer-0.0.1.pkg | 2025-08-22 11:56 | 55K | |
| boops-lv2-1.8.2_1.pkg | 2025-12-27 23:11 | 1.0M | |
| boost-all-1.89.0.pkg | 2025-12-20 08:38 | 1.0K | |
| boost-build-5.3.2.pkg | 2025-12-18 18:53 | 578K | |
| boost-docs-1.89.0.pkg | 2025-12-19 20:07 | 59M | |
| boost-jam-1.89.0.pkg | 2025-12-17 23:04 | 282K | |
| boost-libs-1.89.0_1.pkg | 2025-12-17 23:24 | 15M | |
| boot-extract-g201906..> | 2025-08-21 22:02 | 3.5K | |
| bootstrap-openjdk8-r..> | 2025-12-18 02:42 | 32M | |
| bootstrap-openjdk11-..> | 2025-12-18 10:34 | 102M | |
| bootstrap-openjdk17-..> | 2025-12-18 04:20 | 109M | |
| boringssl-0.20251124..> | 2025-12-23 20:06 | 1.4M | |
| bosh-2024.03.21.pkg | 2025-12-19 06:08 | 235K | |
| bosh-bootloader-7.6...> | 2025-08-22 18:44 | 8.6M | |
| bosh-cli-5.5.0_29.pkg | 2025-08-17 06:53 | 5.5M | |
| bossa-1.9.1_1.pkg | 2025-12-18 18:55 | 53K | |
| bosun-0.9.0_34.pkg | 2025-12-21 07:47 | 9.5M | |
| botan3-3.10.0.pkg | 2025-12-20 03:02 | 8.3M | |
| bottlerocket-0.04c_2..> | 2025-08-21 01:17 | 8.8K | |
| bottom-0.11.4_1.pkg | 2025-12-28 10:52 | 2.2M | |
| bounce-1.0_8.pkg | 2025-08-22 00:04 | 5.3K | |
| bouncycastle-1.71_3.pkg | 2025-12-26 16:36 | 124M | |
| bout++-5.1.1_5.pkg | 2025-12-29 04:49 | 1.4M | |
| bovo-25.12.0.pkg | 2025-12-26 21:27 | 315K | |
| bowtie-1.3.1.pkg | 2025-12-21 05:09 | 6.9M | |
| bowtie2-2.5.4.pkg | 2025-12-19 13:16 | 8.8M | |
| box-0.4.0_3.pkg | 2025-12-28 04:54 | 467K | |
| boxed-cpp-1.4.3.pkg | 2025-08-14 22:47 | 6.8K | |
| boxes-2.3.1.pkg | 2025-12-22 21:12 | 82K | |
| boxfort-0.1.4.pkg | 2025-08-15 02:40 | 18K | |
| bozohttpd-20240126.pkg | 2025-12-21 13:21 | 47K | |
| bpatch-1.0_2.pkg | 2025-08-19 14:10 | 17K | |
| bpft-4.20040506_2.pkg | 2025-08-17 09:53 | 47K | |
| bpl+-1.0_1.pkg | 2025-08-17 07:06 | 21K | |
| bpython-py311-0.26.pkg | 2025-12-30 07:27 | 372K | |
| bpytop-1.0.68_1.pkg | 2025-12-20 11:16 | 53K | |
| br-aspell-0.50.2,1.pkg | 2025-12-22 05:37 | 329K | |
| br-libreoffice-25.8...> | 2025-12-27 17:00 | 466K | |
| braa-0.9.1,1.pkg | 2025-08-22 03:04 | 20K | |
| braincurses-1.1.0_5.pkg | 2025-08-19 06:15 | 21K | |
| brainparty-0.61_3.pkg | 2025-12-30 10:40 | 39M | |
| brainworkshop-5.0.3.pkg | 2025-12-20 12:22 | 6.7M | |
| brasero-3.12.3_8.pkg | 2025-12-27 08:26 | 2.1M | |
| bredbandskollen-1.2...> | 2025-08-22 03:03 | 178K | |
| brename-2.14.0_18.pkg | 2025-12-19 21:40 | 2.9M | |
| brickout-2002.06.09.pkg | 2025-12-21 06:52 | 98K | |
| brickshooter-0.04_8.pkg | 2025-12-29 16:59 | 2.1M | |
| brikx-0.4.5_9.pkg | 2025-12-30 13:50 | 4.5M | |
| briquolo-0.5.7_16.pkg | 2025-12-28 04:20 | 1.4M | |
| brisk-menu-0.6.2_2.pkg | 2025-12-29 10:54 | 61K | |
| bristol-0.60.10_9.pkg | 2025-12-29 17:26 | 3.1M | |
| brlaser-6.2.8.pkg | 2025-12-20 19:06 | 20K | |
| brlcad-7.32.6.pkg | 2025-12-29 12:10 | 131M | |
| brogue-1.14.1_1.pkg | 2025-12-30 02:40 | 802K | |
| brogue-nox11-1.14.1_..> | 2025-12-21 01:17 | 792K | |
| broot-1.52.0_2.pkg | 2025-12-29 14:21 | 4.1M | |
| brotli-1.2.0,1.pkg | 2025-12-16 01:41 | 388K | |
| browsh-1.8.0_1.pkg | 2025-12-29 06:47 | 2.7M | |
| brumbrumrally-0.7.pkg | 2025-12-28 23:25 | 352K | |
| brunsli-0.1_4.pkg | 2025-12-19 13:59 | 121K | |
| brut-1.55_2.pkg | 2025-12-30 15:13 | 101K | |
| brutalchess-0.5.2_16..> | 2025-12-28 17:53 | 4.1M | |
| bruteblock-0.1.1.pkg | 2025-12-21 05:03 | 32K | |
| brx-libreoffice-25.8..> | 2025-12-27 14:37 | 247K | |
| brynet-1.12.2.pkg | 2025-08-19 20:55 | 56K | |
| bs-2.11_1.pkg | 2025-08-19 03:48 | 17K | |
| bs-libreoffice-25.8...> | 2025-12-27 13:22 | 2.9M | |
| bschaffl-lv2-1.4.10_..> | 2025-12-28 10:08 | 303K | |
| bsd-plotutils-1.4.2_..> | 2025-08-22 10:11 | 66K | |
| bsd-spell-1.0.1_3.pkg | 2025-12-21 04:34 | 41K | |
| bsd-splash-changer-0..> | 2025-08-15 22:54 | 1.6K | |
| bsd-vacation-1.0.1.pkg | 2025-08-17 09:25 | 10K | |
| bsdadminscripts2-0.5..> | 2025-08-18 07:40 | 102K | |
| bsdbuild-3.1_1.pkg | 2025-12-21 22:26 | 277K | |
| bsdcflow-0.0.6_2.pkg | 2025-08-21 10:42 | 30K | |
| bsdconfig-0.9.0_2.pkg | 2025-08-20 19:13 | 152K | |
| bsdconv-11.6.pkg | 2025-08-14 06:33 | 1.5M | |
| bsdconv-opencc-11.5.pkg | 2025-08-17 12:29 | 3.8K | |
| bsdcrashtar-0.1.3_2.pkg | 2025-08-17 09:55 | 7.0K | |
| bsddialog-1.1.pkg | 2025-08-25 23:35 | 91K | |
| bsdebfetch-1.1.b.pkg | 2025-12-21 03:16 | 2.5K | |
| bsdec2-image-upload-..> | 2025-12-20 21:03 | 26K | |
| bsdfan-g20180112_1.pkg | 2025-08-21 03:04 | 6.5K | |
| bsdftpd-ssl-1.1.0_5.pkg | 2025-08-20 19:47 | 207K | |
| bsdgames-0.76,2.pkg | 2025-08-19 03:45 | 1.2M | |
| bsdhwmon-20151206_1.pkg | 2025-08-17 15:32 | 12K | |
| bsdinfo-0.22_2.pkg | 2025-08-22 02:33 | 5.2K | |
| bsdisks-0.38.pkg | 2025-12-26 04:42 | 179K | |
| bsdnt-1.0_1.pkg | 2025-08-22 05:53 | 145K | |
| bsdowl-2.2.1_4.pkg | 2025-12-27 22:44 | 43K | |
| bsdrcmds-20171003.01..> | 2025-08-15 07:06 | 38K | |
| bsdsensors-0.1.20250..> | 2025-12-20 09:07 | 311K | |
| bsdsfv-1.18.pkg | 2025-08-21 18:45 | 14K | |
| bsdtris-1.1_3.pkg | 2025-08-19 11:24 | 14K | |
| bsequencer-lv2-1.8.1..> | 2025-12-30 11:07 | 613K | |
| bsfilter-1.0.20.pkg | 2025-12-20 02:02 | 25K | |
| bsh-2.1.1_1.pkg | 2025-12-27 18:47 | 408K | |
| bshapr-lv2-0.13.pkg | 2025-12-29 06:21 | 417K | |
| bslizr-lv2-1.2.16.pkg | 2025-12-28 21:57 | 455K | |
| bsmtp-1.02_5.pkg | 2025-12-24 06:08 | 13K | |
| bsmtrace-1.4_2.pkg | 2025-08-22 04:53 | 27K | |
| bsmtrace3-3.1.pkg | 2025-08-22 20:56 | 27K | |
| bsnmp-regex-0.6_4.pkg | 2025-08-22 14:26 | 20K | |
| bsnmp-ucd-0.4.5_1.pkg | 2025-08-17 21:00 | 18K | |
| bsod-0.2.pkg | 2025-08-16 03:25 | 7.7K | |
| bsp-5.2_1.pkg | 2025-08-16 05:10 | 20K | |
| bspwm-0.9.12.pkg | 2025-12-22 11:28 | 103K | |
| bspwm-devel-0.9.12.2..> | 2025-12-23 01:01 | 103K | |
| bstack-0.1_1.pkg | 2025-12-21 11:49 | 1.5K | |
| bstone-1.1.9_3.pkg | 2025-12-28 06:21 | 292K | |
| bstring-1.0.3.pkg | 2025-12-20 00:39 | 42K | |
| bsvc-2.4.6.pkg | 2025-12-29 22:01 | 199K | |
| btanks-0.9.8083_11.pkg | 2025-12-27 20:22 | 27M | |
| btavctpd-1.0.0.pkg | 2025-12-28 06:59 | 8.7K | |
| btcheck-2.1_2.pkg | 2025-08-19 06:12 | 14K | |
| btllib-1.7.5_1.pkg | 2025-12-19 04:49 | 599K | |
| btoa-5.2_2,1.pkg | 2025-08-19 21:37 | 10K | |
| btop-1.4.5.pkg | 2025-12-23 14:31 | 494K | |
| btor2tools-g20320816..> | 2025-08-14 18:42 | 70K | |
| btsixad-0.1.1_1.pkg | 2025-08-17 11:47 | 15K | |
| bubble-chains-0.2.0_..> | 2025-12-28 00:08 | 3.0M | |
| bucklespring-1.5.1.pkg | 2025-12-29 16:50 | 3.2M | |
| buddy-2.4_2.pkg | 2025-08-14 12:07 | 344K | |
| budgie-10.9.pkg | 2025-12-29 19:23 | 1.9K | |
| budgie-backgrounds-3..> | 2025-08-15 13:44 | 16M | |
| budgie-control-cente..> | 2025-12-27 04:56 | 3.1M | |
| budgie-desktop-10.9...> | 2025-12-26 21:07 | 1.3M | |
| budgie-desktop-view-..> | 2025-12-27 16:53 | 43K | |
| budgie-screensaver-5..> | 2025-12-26 19:08 | 222K | |
| budgie-session-0.9.1..> | 2025-12-26 20:00 | 306K | |
| buf-1.61.0_1.pkg | 2025-12-24 02:00 | 23M | |
| bugsquish-0.0.6_13.pkg | 2025-12-30 15:26 | 6.1M | |
| bugsx-1.08_3.pkg | 2025-08-21 07:32 | 18K | |
| bugzilla2atom-0.0.0...> | 2025-12-23 05:29 | 834K | |
| bugzilla50-5.0.4.1.pkg | 2025-12-27 16:49 | 1.1M | |
| bugzilla52-5.2.pkg | 2025-12-28 12:04 | 1.1M | |
| buici-clock-0.4.9.4_..> | 2025-12-29 03:47 | 25K | |
| build-0.3.10.pkg | 2025-12-24 07:19 | 53K | |
| build2-0.17.0_1.pkg | 2025-12-18 04:02 | 6.6M | |
| buildah-1.42.2.pkg | 2025-12-19 11:35 | 21M | |
| buildkite-agent-3.10..> | 2025-12-20 15:01 | 11M | |
| buildkite-cli-3.13.1..> | 2025-12-21 01:51 | 6.5M | |
| buku-5.1.pkg | 2025-12-29 21:31 | 177K | |
| bulk_extractor-2.1.1..> | 2025-12-20 07:20 | 1.0M | |
| bulk_mailer-1.13_2.pkg | 2025-08-16 22:44 | 25K | |
| bullet-3.25.pkg | 2025-08-13 20:50 | 12M | |
| bullet-double-3.25.pkg | 2025-08-15 12:54 | 12M | |
| bumprace-1.5.8_1.pkg | 2025-12-30 06:11 | 4.0M | |
| bunyan-0.1.9_27.pkg | 2025-12-29 16:13 | 346K | |
| bupstash-0.12.0_29.pkg | 2025-12-29 10:11 | 2.1M | |
| burgerspace-1.10.0_1..> | 2025-12-29 06:34 | 134K | |
| burp-2.4.0.pkg | 2025-12-21 03:51 | 248K | |
| burp-devel-3.1.4.pkg | 2025-12-20 11:04 | 215K | |
| burr-tools-0.7.0.pkg | 2025-12-28 04:07 | 585K | |
| busd-0.4.0_11.pkg | 2025-12-28 13:21 | 1.3M | |
| bustle-0.12.0_5.pkg | 2025-12-30 10:39 | 1.3M | |
| busybox-1.37.0.pkg | 2025-08-22 02:47 | 826K | |
| butt-1.45.0_2.pkg | 2025-12-29 12:41 | 234K | |
| butterfly-3.2.5_2.pkg | 2025-12-28 14:08 | 917K | |
| buzhug-1.8_2.pkg | 2025-12-20 07:52 | 67K | |
| bvi-1.5.0.pkg | 2025-08-20 15:15 | 53K | |
| bvm-1.3.5.pkg | 2025-12-22 03:20 | 108K | |
| bwa-0.7.19.pkg | 2025-12-19 23:34 | 178K | |
| bwbasic-3.30.pkg | 2025-08-16 09:39 | 136K | |
| bwi-firmware-kmod-3...> | 2025-08-20 07:50 | 27K | |
| bwidget-1.10.1.pkg | 2025-12-26 22:33 | 178K | |
| bwm-ng-0.6.3_1.pkg | 2025-12-24 07:30 | 25K | |
| bwn-firmware-kmod-0...> | 2025-08-21 19:35 | 94K | |
| bwping-2.6.pkg | 2025-08-19 00:29 | 9.8K | |
| byacc-20241231.pkg | 2025-08-16 00:35 | 71K | |
| byaccj-1.15.pkg | 2025-08-16 15:21 | 52K | |
| byobu-5.133_3.pkg | 2025-12-30 14:48 | 93K | |
| bzflag-2.4.26_2.pkg | 2025-12-30 17:22 | 11M | |
| bzflag-server-2.4.26..> | 2025-12-20 19:59 | 9.8M | |
| bzip-0.21_1.pkg | 2025-08-20 03:55 | 28K | |
| bzip2-1.0.8_1.pkg | 2025-08-14 10:18 | 449K | |
| bzip3-1.5.3.pkg | 2025-08-26 14:23 | 54K | |
| bzrtp-5.4.28.pkg | 2025-12-18 14:45 | 50K | |
| c-0.15.1.pkg | 2025-12-21 18:34 | 3.2K | |
| c-a-i-r-2.19.pkg | 2025-08-22 13:53 | 36K | |
| c-ares-1.34.6.pkg | 2025-12-16 01:53 | 223K | |
| c-blosc-1.21.0.pkg | 2025-12-18 12:52 | 43K | |
| c-blosc2-2.22.0.pkg | 2025-12-18 13:56 | 624K | |
| c-icap-0.6.4,2.pkg | 2025-12-19 17:32 | 281K | |
| c-icap-modules-0.5.7..> | 2025-12-29 00:33 | 102K | |
| c-lightning-25.12_1.pkg | 2025-12-27 12:12 | 29M | |
| c-nocem-3.7_4.pkg | 2025-12-21 12:44 | 18K | |
| c-sig-3.8.0.1_19.pkg | 2025-12-30 07:37 | 25K | |
| c-sig-emacs_canna-3...> | 2025-12-29 01:05 | 25K | |
| c-sig-emacs_devel-3...> | 2025-12-27 20:17 | 25K | |
| c-sig-emacs_devel_no..> | 2025-12-21 18:51 | 25K | |
| c-sig-emacs_nox-3.8...> | 2025-12-20 18:01 | 25K | |
| c-sig-emacs_wayland-..> | 2025-12-28 09:59 | 25K | |
| c2html-0.9.6_1.pkg | 2025-08-16 14:39 | 33K | |
| c2mdoc-20040302_1.pkg | 2025-08-16 21:02 | 1.2K | |
| c2ps-4.0_5.pkg | 2025-08-20 22:11 | 31K | |
| c3p0-0.9.5.3.pkg | 2025-12-27 07:40 | 641K | |
| c4core-0.2.6.pkg | 2025-12-18 02:30 | 123K | |
| c64bdf-1.0_4.pkg | 2025-12-29 16:32 | 3.2K | |
| c3270-4.3_1.pkg | 2025-12-20 07:52 | 1.4M | |
| ca-aspell-2.1.5.1,1.pkg | 2025-12-22 04:44 | 1.2M | |
| ca-libreoffice-25.8...> | 2025-12-27 08:29 | 3.4M | |
| ca_root_nss-3.117_3.pkg | 2025-12-16 01:30 | 279K | |
| ca_valencia-libreoff..> | 2025-12-27 16:12 | 3.4M | |
| cabextract-1.11_1.pkg | 2025-08-14 07:19 | 62K | |
| cacti-php81-1.2.30.pkg | 2025-12-28 23:57 | 34M | |
| cacti-php82-1.2.30.pkg | 2025-12-29 08:54 | 34M | |
| cacti-php83-1.2.30.pkg | 2025-12-30 04:15 | 34M | |
| cacti-php84-1.2.30.pkg | 2025-12-29 07:33 | 34M | |
| cacti-php85-1.2.30.pkg | 2025-12-30 00:48 | 34M | |
| cacti88-spine-0.8.8h..> | 2025-12-29 15:36 | 37K | |
| cadabra2-2.5.8_5.pkg | 2025-12-29 12:51 | 6.9M | |
| cadaver-0.26.pkg | 2025-12-20 11:02 | 44K | |
| caddy-2.10.2_5.pkg | 2025-12-23 00:00 | 13M | |
| cadence-0.9.2_5.pkg | 2025-12-29 23:25 | 1.7M | |
| cadiback-g20240729_1..> | 2025-12-22 15:35 | 26K | |
| cadical-2.1.3_1.pkg | 2025-12-18 20:19 | 932K | |
| cado-nfs-2.3.0.20240..> | 2025-12-30 07:44 | 4.2M | |
| cadubi-1.3.4.pkg | 2025-12-22 03:29 | 12K | |
| caesarcipher-1.1_1.pkg | 2025-08-20 19:14 | 7.5K | |
| caffe-1.0.136_22.pkg | 2025-12-29 20:22 | 1.6M | |
| cage-0.2.1.pkg | 2025-12-27 09:58 | 20K | |
| cagebreak-3.1.0.pkg | 2025-12-29 13:17 | 69K | |
| cairo-1.18.2,3.pkg | 2025-12-24 20:23 | 773K | |
| cairo-clock-0.3.4_5.pkg | 2025-12-30 09:18 | 212K | |
| cairo-dock-3.6.1.pkg | 2025-12-27 08:32 | 1.4M | |
| cairo-dock-plugins-3..> | 2025-12-30 00:00 | 3.1M | |
| cairo-language-2.14...> | 2025-12-30 08:40 | 29M | |
| cairomm-1.14.5.pkg | 2025-12-26 15:40 | 88K | |
| cairomm11-1.18.0.pkg | 2025-12-26 14:55 | 90K | |
| caja-1.28.0_4.pkg | 2025-12-26 21:02 | 3.3M | |
| caja-extensions-1.28..> | 2025-12-27 16:22 | 267K | |
| cake-2005.12.26_14.pkg | 2025-12-28 11:57 | 147K | |
| cal-4.1_1.pkg | 2025-08-21 12:36 | 26K | |
| cal3d-0.11.1_1.pkg | 2025-08-17 02:18 | 179K | |
| calamares-3.3.14.pkg | 2025-12-28 16:22 | 3.7M | |
| calamaris-2.59_3.pkg | 2025-12-23 18:12 | 35K | |
| calamaris-devel-2.99..> | 2025-12-30 18:54 | 70K | |
| calc-2.16.0.2_1.pkg | 2025-12-27 02:17 | 932K | |
| calc-tiny-2.16.0.2_1..> | 2025-12-29 10:05 | 8.9K | |
| calcium-0.4.1_1.pkg | 2025-12-28 00:36 | 442K | |
| calcmysky-0.3.4.pkg | 2025-12-27 18:40 | 351K | |
| calcoo-1.3.18_9.pkg | 2025-12-28 13:39 | 33K | |
| calculix-2.22.pkg | 2025-12-27 21:01 | 8.6M | |
| calcurse-4.8.2.pkg | 2025-12-22 05:39 | 237K | |
| caldavzap-0.13.1_2.pkg | 2025-12-30 11:17 | 2.8M | |
| caldera-5.3.0_11.pkg | 2025-12-27 16:51 | 25M | |
| caldera-ot-5.3.0_9.pkg | 2025-12-29 01:43 | 123M | |
| calendar-0.9.3.pkg | 2025-08-16 14:46 | 29K | |
| calendar-data-2022.1..> | 2025-08-15 22:52 | 77K | |
| calendarsupport-25.1..> | 2025-12-26 17:22 | 615K | |
| calf-lv2-0.90.4_1.pkg | 2025-12-28 09:17 | 13M | |
| calibrator-0.9.pkg | 2025-08-16 23:44 | 14K | |
| calibre-8.16.2_1.pkg | 2025-12-27 21:09 | 27M | |
| calife-3.0.6_2.pkg | 2025-08-22 02:50 | 12K | |
| calindori-1.4_3.pkg | 2025-12-28 16:17 | 192K | |
| caliper-2.12.0.pkg | 2025-12-21 16:27 | 540K | |
| calligra-25.12.0.pkg | 2025-12-29 14:55 | 38M | |
| camerakit-0.0.1_16.pkg | 2025-12-27 17:07 | 4.7K | |
| camp-2025.12.0.pkg | 2025-12-18 15:57 | 36K | |
| camv-rnd-1.1.6.pkg | 2025-12-28 19:50 | 157K | |
| candycrisis-3.0.1.pkg | 2025-12-29 14:33 | 5.0M | |
| caneda-0.4.0_1.pkg | 2025-12-29 13:30 | 781K | |
| cannonball-0.34_3.pkg | 2025-12-30 10:29 | 197K | |
| canta-gtk-themes-202..> | 2025-12-28 21:30 | 1.1M | |
| canta-icon-theme-202..> | 2025-12-20 08:56 | 1.0M | |
| cantarell-fonts-0.30..> | 2025-12-26 10:58 | 108K | |
| cantata-3.3.1_1.pkg | 2025-12-27 23:00 | 2.9M | |
| cantera-3.1.0_4.pkg | 2025-12-29 05:28 | 6.4M | |
| cantor-25.12.0.pkg | 2025-12-26 20:27 | 2.2M | |
| canu-2.2_8.pkg | 2025-12-29 03:56 | 2.2M | |
| caph-1.1_6.pkg | 2025-12-30 08:46 | 619K | |
| capnproto-1.2.0.pkg | 2025-08-13 15:09 | 1.8M | |
| capnproto1-1.2.0.pkg | 2025-12-26 20:44 | 3.0M | |
| caps-lv2-g20200529.pkg | 2025-08-18 10:26 | 12M | |
| caps-plugins-0.4.5_1..> | 2025-12-30 10:21 | 652K | |
| capslock-0.3.0_1.pkg | 2025-12-23 18:18 | 2.8M | |
| capstone-5.0.6.pkg | 2025-08-13 02:23 | 2.3M | |
| capstone4-4.0.2_1.pkg | 2025-08-14 23:11 | 1.5M | |
| carapace-1.5.7.pkg | 2025-12-23 16:20 | 9.3M | |
| carbon-relay-ng-0.10..> | 2025-12-21 16:47 | 4.4M | |
| carbonapi-0.14.1_34.pkg | 2025-12-22 12:44 | 9.8M | |
| carbonzipper-0.74_33..> | 2025-12-21 18:47 | 2.9M | |
| cardinal-25.06.pkg | 2025-12-28 07:52 | 281M | |
| cardioid-g20211026_4..> | 2025-12-30 08:09 | 364K | |
| cardpeek-0.8.4_2.pkg | 2025-12-28 17:09 | 788K | |
| cardpics-0.4.pkg | 2025-08-15 20:52 | 102K | |
| cargo-about-0.8.2.pkg | 2025-12-23 23:33 | 4.1M | |
| cargo-audit-0.22.0_2..> | 2025-12-30 10:05 | 3.8M | |
| cargo-bloat-0.12.1_1..> | 2025-12-30 09:44 | 456K | |
| cargo-c-0.10.16_2.pkg | 2025-12-25 00:30 | 22M | |
| cargo-cache-0.8.3_14..> | 2025-12-29 09:56 | 1.1M | |
| cargo-deny-0.18.7_1.pkg | 2025-12-30 15:07 | 5.8M | |
| cargo-depgraph-1.6.0..> | 2025-12-29 13:26 | 378K | |
| cargo-dist-0.30.3_1.pkg | 2025-12-28 16:48 | 4.0M | |
| cargo-edit-0.13.8_1.pkg | 2025-12-28 01:16 | 2.3M | |
| cargo-generate-0.23...> | 2025-12-28 18:55 | 2.5M | |
| cargo-hack-0.6.39_2.pkg | 2025-12-30 00:51 | 660K | |
| cargo-leptos-0.2.42_..> | 2025-12-28 18:11 | 11M | |
| cargo-llvm-cov-0.6.2..> | 2025-12-27 20:24 | 1.2M | |
| cargo-make-0.37.24_4..> | 2025-12-30 08:00 | 5.6M | |
| cargo-mutants-25.3.1..> | 2025-12-28 18:44 | 1.6M | |
| cargo-readme-3.3.1_4..> | 2025-12-29 06:23 | 726K | |
| cargo-spellcheck-0.1..> | 2025-12-21 21:33 | 23M | |
| cargo-tarpaulin-0.34..> | 2025-12-29 15:13 | 2.6M | |
| cargo-udeps-0.1.60.pkg | 2025-12-20 16:30 | 4.8M | |
| caribou-0.4.21.78_1.pkg | 2025-12-27 12:09 | 230K | |
| caronade-0.7.1_6.pkg | 2025-12-21 16:37 | 3.4M | |
| cartotheque-0.1_13.pkg | 2025-12-27 10:12 | 30K | |
| cas-3.8.0.pkg | 2025-12-20 10:13 | 322K | |
| casadi-3.7.0.pkg | 2025-12-29 19:46 | 3.4M | |
| cascade-1.4_1.pkg | 2025-08-17 23:19 | 18K | |
| cascade-compiler-g20..> | 2025-12-20 22:33 | 1.6M | |
| cascade-dns-0.1.0.r1..> | 2025-12-30 16:49 | 4.6M | |
| cascadia-code-2407.2..> | 2025-12-30 12:25 | 7.8M | |
| cascadia-next-g20240..> | 2025-12-30 02:55 | 7.0M | |
| cask-0.8.3_18.pkg | 2025-12-27 09:55 | 32K | |
| cask-emacs_canna-0.8..> | 2025-12-27 11:20 | 32K | |
| cask-emacs_devel-0.8..> | 2025-12-27 12:31 | 32K | |
| cask-emacs_devel_nox..> | 2025-12-23 04:16 | 32K | |
| cask-emacs_nox-0.8.3..> | 2025-12-21 13:37 | 32K | |
| cask-emacs_wayland-0..> | 2025-12-27 02:53 | 32K | |
| cassandra-cpp-driver..> | 2025-08-15 22:44 | 1.4M | |
| cassandra3-3.11.14_1..> | 2025-12-29 20:29 | 30M | |
| cassandra4-4.0.8.pkg | 2025-12-29 14:04 | 36M | |
| casstcl-2.16.1.pkg | 2025-08-28 23:45 | 40K | |
| cast2gif-0.1.0.5_21.pkg | 2025-12-29 10:56 | 3.3M | |
| castget-2.0.1.202202..> | 2025-12-21 15:56 | 22K | |
| castxml-0.6.13.pkg | 2025-12-18 12:12 | 842K | |
| cataclysm-dda-0.H_1,..> | 2025-12-24 04:17 | 56M | |
| cataclysm-dda-tiles-..> | 2025-12-28 14:06 | 102M | |
| catapult-18.0_3.pkg | 2025-12-29 01:29 | 363K | |
| catatonit-0.2.1.pkg | 2025-08-14 17:06 | 219K | |
| catch-2.13.10_1.pkg | 2025-08-13 22:06 | 182K | |
| catch2-3.11.0.pkg | 2025-12-19 00:49 | 467K | |
| catclock-g20200328.pkg | 2025-12-30 11:22 | 25K | |
| catdoc-0.95_1.pkg | 2025-12-26 23:41 | 80K | |
| catdvi-0.14_8.pkg | 2025-12-27 03:26 | 38K | |
| catesc-0.6_2.pkg | 2025-12-30 04:14 | 3.0M | |
| catfish-4.20.1_1.pkg | 2025-12-29 15:25 | 227K | |
| catgirl-2.2a.pkg | 2025-08-21 15:34 | 65K | |
| catimg-2.8.0.pkg | 2025-12-24 03:42 | 44K | |
| catppuccin-cursor-th..> | 2025-12-20 07:17 | 39M | |
| catppuccin-gtk-theme..> | 2025-12-30 08:52 | 9.9M | |
| catppuccin-whiskers-..> | 2025-12-27 16:39 | 1.3M | |
| catseye-fm-4.2.0.0_3..> | 2025-12-29 12:20 | 131K | |
| catsit-1.4_1.pkg | 2025-08-17 09:48 | 19K | |
| cava-0.10.4.pkg | 2025-12-30 05:17 | 54K | |
| cave9-0.4.1.git20150..> | 2025-12-29 22:23 | 848K | |
| cavezofphear-0.6.2.pkg | 2025-12-20 10:15 | 21K | |
| cayley-0.7.7_24.pkg | 2025-12-20 04:26 | 8.5M | |
| cbang-1.8.0_2.pkg | 2025-12-19 16:37 | 3.0M | |
| cbfmt-0.2.0_27.pkg | 2025-12-30 04:48 | 905K | |
| cblas-3.12.1.pkg | 2025-12-26 11:40 | 53K | |
| cbmbasic-20221219_1.pkg | 2025-08-20 15:36 | 47K | |
| cbmc-6.4.1.pkg | 2025-12-28 08:11 | 13M | |
| cbonsai-1.3.1.pkg | 2025-08-18 13:30 | 14K | |
| cbrowser-0.8_4.pkg | 2025-12-29 11:20 | 52K | |
| cbsd-15.0.0.pkg | 2025-12-20 09:26 | 5.2M | |
| cbsd-mq-api-0.5_11.pkg | 2025-12-21 16:27 | 2.2M | |
| cbsd-mq-router-0.2_3..> | 2025-12-20 11:13 | 1.0M | |
| cbviewer-0.8_3.pkg | 2025-12-28 01:13 | 291K | |
| cc65-2.19.pkg | 2025-08-14 02:41 | 2.5M | |
| ccache-3.7.12_8.pkg | 2025-08-14 04:58 | 123K | |
| ccache-static-3.7.12..> | 2025-08-18 23:06 | 591K | |
| ccache4-4.10.2_2.pkg | 2025-12-22 17:43 | 538K | |
| cccc-3.2.0.pkg | 2025-08-18 16:48 | 176K | |
| ccd2iso-0.9_1.pkg | 2025-08-17 13:09 | 3.0K | |
| ccextractor-0.94_3.pkg | 2025-12-27 16:23 | 635K | |
| ccextractor-gui-0.94..> | 2025-12-30 12:16 | 392K | |
| cciss_vol_status-1.1..> | 2025-08-16 06:02 | 22K | |
| ccl-1.13_1.pkg | 2025-08-13 22:13 | 10M | |
| ccls-0.20240202.pkg | 2025-12-22 20:19 | 486K | |
| ccmath-2.2.1_3.pkg | 2025-08-20 15:25 | 211K | |
| ccmix-g20170612_3.pkg | 2025-08-18 06:53 | 184K | |
| ccrypt-1.11_1.pkg | 2025-12-21 03:17 | 95K | |
| ccsrch-1.0.3_1.pkg | 2025-08-16 02:08 | 12K | |
| cctz-2.4.pkg | 2025-08-13 23:09 | 64K | |
| ccxstream-1.0.15_4.pkg | 2025-12-23 18:54 | 40K | |
| ccze-0.2.1_6.pkg | 2025-08-22 21:17 | 46K | |
| cd-discid-1.4.14_1.pkg | 2025-08-15 02:42 | 4.9K | |
| cd-hit-4.8.1_3.pkg | 2025-08-14 19:25 | 112K | |
| cdargs-1.35_1.pkg | 2025-08-21 03:31 | 35K | |
| cdb-0.75_1.pkg | 2025-08-14 14:48 | 20K | |
| cdbfasta-2023.07.10.pkg | 2025-08-18 06:25 | 54K | |
| cdbkup-1.0_4.pkg | 2025-12-30 06:35 | 23K | |
| cddb-bundle-0.2_13.pkg | 2025-12-26 20:37 | 13K | |
| cddlib-0.94m.pkg | 2025-08-13 19:38 | 872K | |
| cde-2.5.3.pkg | 2025-12-28 20:12 | 56M | |
| cde-devel-2025.11.25..> | 2025-12-29 22:08 | 56M | |
| cdecl-18.5.pkg | 2025-12-22 05:27 | 224K | |
| cdeploy-0.2.1_1.pkg | 2025-08-18 02:07 | 7.5K | |
| cdf3-3.9.1_1.pkg | 2025-12-26 13:42 | 1.2M | |
| cdialog-1.3.20240619..> | 2025-08-14 19:06 | 271K | |
| cdircmp-0.3.pkg | 2025-08-17 15:46 | 14K | |
| cdk-5.0.20251014,1.pkg | 2025-12-19 05:08 | 376K | |
| cdk-chemistry-2.7.1.pkg | 2025-12-28 12:08 | 24M | |
| cdlabelgen-4.3.0_1.pkg | 2025-12-22 11:30 | 122K | |
| cdo-2.5.4_1.pkg | 2025-12-27 06:44 | 3.5M | |
| cdogs-sdl-2.3.2_1.pkg | 2025-12-29 11:30 | 26M | |
| cdparanoia-3.10.2.pkg | 2025-08-13 22:11 | 85K | |
| cdpd-1.0.4.1_2.pkg | 2025-08-19 14:10 | 9.9K | |
| cdpr-2.4.pkg | 2025-08-21 17:14 | 16K | |
| cdpsnarf-0.1.6_1.pkg | 2025-08-16 12:44 | 9.2K | |
| cdrdao-1.2.5_2.pkg | 2025-12-18 20:21 | 295K | |
| cdrkit-1.1.11_3.pkg | 2025-12-21 05:55 | 420K | |
| cdrkit-genisoimage-1..> | 2025-12-19 22:45 | 210K | |
| cdroot-1.2.6.pkg | 2025-08-17 06:53 | 15K | |
| cdrtools-2024.03.21.pkg | 2025-12-26 19:03 | 539K | |
| cego-2.53.4.pkg | 2025-12-27 15:48 | 2.9M | |
| cegobridge-1.10.0.pkg | 2025-12-30 11:54 | 109K | |
| cegui-0.8.7_22.pkg | 2025-12-29 23:12 | 16M | |
| celestia-glut-1.6.1_..> | 2025-12-28 20:59 | 34M | |
| celestia-gtk-1.6.1_1..> | 2025-12-29 05:30 | 34M | |
| celluloid-0.29.pkg | 2025-12-30 09:56 | 357K | |
| cemu-2.0.pkg | 2025-12-29 12:24 | 1.0M | |
| cenon-4.0.2_7,1.pkg | 2025-12-27 05:56 | 3.2M | |
| centreon-clib-21.04...> | 2025-08-19 00:05 | 77K | |
| cereal-1.3.2_1.pkg | 2025-12-19 15:31 | 189K | |
| ceres-solver-2.2.0_1..> | 2025-12-26 11:26 | 6.5M | |
| certificate_maker-1...> | 2025-12-28 23:14 | 7.2M | |
| certmgr-3.0.3_34.pkg | 2025-12-23 06:27 | 3.7M | |
| certmonger-0.79.20_2..> | 2025-12-27 23:42 | 499K | |
| certspotter-0.23.0.pkg | 2025-12-27 22:45 | 2.2M | |
| ceylon-1.3.3_1.pkg | 2025-12-29 07:59 | 19M | |
| cf-6.49.0_29.pkg | 2025-08-18 22:02 | 5.3M | |
| cfdg-3.4.2_2.pkg | 2025-12-30 06:22 | 360K | |
| cfengine-3.26.0_1.pkg | 2025-12-19 19:50 | 857K | |
| cfengine-devel-3.25...> | 2025-12-19 12:01 | 821K | |
| cfengine-lts-3.24.1_..> | 2025-12-19 12:57 | 848K | |
| cfengine-masterfiles..> | 2025-12-23 01:46 | 142K | |
| cfengine-masterfiles..> | 2025-12-24 06:57 | 144K | |
| cfengine-masterfiles..> | 2025-12-22 16:46 | 140K | |
| cfengine-masterfiles..> | 2025-12-22 09:26 | 137K | |
| cfengine-masterfiles..> | 2025-12-21 13:08 | 136K | |
| cfengine-masterfiles..> | 2025-12-22 19:58 | 138K | |
| cfengine-masterfiles..> | 2025-12-20 21:26 | 140K | |
| cfengine-masterfiles..> | 2025-12-23 11:01 | 141K | |
| cfengine-masterfiles..> | 2025-12-21 02:04 | 142K | |
| cfengine321-3.21.3_1..> | 2025-12-19 09:36 | 841K | |
| cfengine322-3.22.0_1..> | 2025-12-20 03:55 | 844K | |
| cfengine323-3.23.0_1..> | 2025-12-19 22:37 | 843K | |
| cfengine324-3.24.1_1..> | 2025-12-19 19:58 | 848K | |
| cfengine325-3.25.0_1..> | 2025-12-19 08:53 | 852K | |
| cfengine326-3.26.0_1..> | 2025-12-19 22:29 | 857K | |
| cfiles-1.8.6_33.pkg | 2025-12-27 19:57 | 17K | |
| cfitsio-4.6.3.pkg | 2025-12-18 06:31 | 2.5M | |
| cflow-2.0_2.pkg | 2025-08-19 01:57 | 15K | |
| cflow2vcg-0.5_1.pkg | 2025-08-22 20:53 | 69K | |
| cfortran-4.3.pkg | 2025-08-15 15:32 | 74K | |
| cfr-0.152.pkg | 2025-12-28 13:13 | 1.8M | |
| cfs-1.5.0_1.pkg | 2025-08-20 01:16 | 85K | |
| cfssl-1.6.5_17.pkg | 2025-12-21 03:27 | 40M | |
| cg-0.4_1.pkg | 2025-08-20 03:11 | 32K | |
| cg3-1.3.6_13.pkg | 2025-12-20 01:53 | 397K | |
| cgal-5.6.2_4.pkg | 2025-12-18 14:43 | 5.0M | |
| cgdb-0.8.0.pkg | 2025-12-21 12:00 | 165K | |
| cgi-lib-1.4_1.pkg | 2025-08-18 23:21 | 16K | |
| cgi-lib_pl-2.18_1.pkg | 2025-12-21 16:59 | 6.3K | |
| cgicc-3.2.20.pkg | 2025-12-21 07:49 | 382K | |
| cgif-0.5.0.pkg | 2025-08-13 07:05 | 13K | |
| cgiirc-0.5.12.pkg | 2025-12-21 22:12 | 93K | |
| cgit-1.2.3_1.pkg | 2025-08-22 05:05 | 810K | |
| cgiwrap-4.1.pkg | 2025-08-19 09:54 | 38K | |
| cglm-0.9.6.pkg | 2025-12-19 22:02 | 150K | |
| cgnslib-4.5.0,1.pkg | 2025-12-26 13:42 | 1.0M | |
| cgprof-1.2_5.pkg | 2025-12-29 11:10 | 4.5K | |
| cgribex-2.0.0_1.pkg | 2025-12-26 23:01 | 131K | |
| ch-7.0.0_1.pkg | 2025-08-19 07:05 | 16M | |
| chaco-2.2.pkg | 2025-08-18 02:12 | 824K | |
| chafa-1.18.0.pkg | 2025-12-27 09:21 | 368K | |
| chai-library-2025.09..> | 2025-12-20 01:50 | 56K | |
| chamfer-s20240928_5.pkg | 2025-12-28 10:11 | 319K | |
| chaoskube-0.37.1.pkg | 2025-12-22 11:29 | 9.5M | |
| chaosreader-0.96.pkg | 2025-12-22 08:05 | 47K | |
| chapping-0.43_14.pkg | 2025-12-28 02:50 | 4.2M | |
| charls-2.4.2.pkg | 2025-08-14 21:26 | 108K | |
| charm-uiuc-6.8.2_5.pkg | 2025-12-29 20:16 | 3.5M | |
| charmtimetracker-1.1..> | 2025-12-29 11:29 | 432K | |
| chart-3.0.0_34.pkg | 2025-12-23 15:58 | 1.2M | |
| charva-1.1.4_7.pkg | 2025-12-28 05:35 | 560K | |
| chatblade-0.7.0.pkg | 2025-12-29 22:45 | 33K | |
| chatgpt-shell-cli-g2..> | 2025-12-30 02:10 | 5.6K | |
| chatgpt-shell-cli-no..> | 2025-12-29 03:53 | 5.6K | |
| chawan-0.3.2.pkg | 2025-12-30 18:14 | 2.8M | |
| chayang-0.1.0.pkg | 2025-12-23 16:03 | 6.4K | |
| cheat-4.4.2_18.pkg | 2025-12-21 06:47 | 3.7M | |
| check-0.15.2_1.pkg | 2025-08-13 01:31 | 102K | |
| check_ipmi_sensor-3...> | 2025-12-22 23:58 | 8.9K | |
| check_logfiles-4.1.1..> | 2025-12-22 12:30 | 43K | |
| check_mk_agent-2.3.0..> | 2025-12-23 12:10 | 13K | |
| check_multi-0.26_1.pkg | 2025-12-23 15:02 | 46K | |
| check_mysql_health-3..> | 2025-12-23 01:02 | 30K | |
| check_nwc_health-11...> | 2025-12-22 13:00 | 475K | |
| check_ssl_cert-2.95...> | 2025-12-22 23:58 | 52K | |
| check_syncthing-1.0...> | 2025-12-23 05:13 | 2.3M | |
| check_ups_health-3.0..> | 2025-12-23 19:30 | 143K | |
| check_wg-0.0.8_4.pkg | 2025-12-21 14:11 | 1.1M | |
| checkbashisms-2.24.1..> | 2025-12-24 03:30 | 12K | |
| checkbot-1.80_2.pkg | 2025-12-20 05:13 | 25K | |
| checkheaders-1.0.1_1..> | 2025-08-18 03:51 | 40K | |
| checkmate-0.21_1.pkg | 2025-08-16 10:33 | 13K | |
| checkmol-0.5_18.pkg | 2025-12-21 09:14 | 231K | |
| checkpassword-0.90_1..> | 2025-08-17 00:16 | 6.9K | |
| checkpassword-pam-0...> | 2025-08-14 16:32 | 12K | |
| checkrestart-0.5.0_1..> | 2025-08-20 05:16 | 7.5K | |
| cheese-44.1.pkg | 2025-12-28 03:16 | 832K | |
| cheesecutter-2.9.b.3..> | 2025-12-23 00:29 | 630K | |
| chef-19930426.pkg | 2025-08-18 12:43 | 7.6K | |
| chemical-mime-data-0..> | 2025-12-26 19:13 | 16K | |
| chemicalfun-0.1.8_4.pkg | 2025-12-19 06:05 | 363K | |
| chemtool-1.6.14_5.pkg | 2025-12-30 02:28 | 227K | |
| chemtool-devel-1.7.2..> | 2025-12-29 04:36 | 208K | |
| cherrytree-1.6.2.pkg | 2025-12-29 18:01 | 3.0M | |
| chessx-1.6.2.pkg | 2025-12-30 06:19 | 6.1M | |
| chexedit-0.9.7_2.pkg | 2025-08-16 05:08 | 36K | |
| chez-scheme-10.3.0.pkg | 2025-12-19 20:01 | 2.8M | |
| chezmoi-2.50.0_12.pkg | 2025-12-22 13:05 | 9.8M | |
| chgrep-1.2.4_1.pkg | 2025-08-22 05:44 | 11K | |
| chiapos-1.0.7.pkg | 2025-08-17 11:36 | 443K | |
| chibi-scheme-0.11.0.pkg | 2025-08-20 09:02 | 849K | |
| chicago95-3.0.1.49.pkg | 2025-08-22 12:21 | 4.0M | |
| chicken-5.4.0,1.pkg | 2025-08-21 07:01 | 3.0M | |
| chilitags-2.0.0.169_..> | 2025-12-30 00:05 | 63K | |
| chillispot-1.0_14.pkg | 2025-12-29 01:05 | 80K | |
| chimes-calculator-1...> | 2025-12-26 21:14 | 125K | |
| chip-seq-0.1.2_1.pkg | 2025-12-28 16:24 | 767 | |
| chipvault-200607.pkg | 2025-12-21 05:58 | 86K | |
| chirp-py311-20251106..> | 2025-12-29 01:23 | 3.0M | |
| chisel-1.11.3_2.pkg | 2025-12-24 04:11 | 3.3M | |
| chkascii-2.4_1.pkg | 2025-08-18 21:18 | 9.1K | |
| chkrootkit-0.58b.pkg | 2025-08-21 13:36 | 32K | |
| chmlib-0.40_1.pkg | 2025-08-13 17:36 | 25K | |
| chmview-2.0b4_2.pkg | 2025-08-16 16:55 | 5.6K | |
| chntpw-140201.pkg | 2025-08-20 15:44 | 60K | |
| chocolate-doom-3.1.1..> | 2025-12-30 11:40 | 1.0M | |
| chomsky-2.3.pkg | 2025-12-29 19:48 | 69K | |
| choose-1.3.7_4.pkg | 2025-12-27 22:44 | 650K | |
| choparp-20150613_1.pkg | 2025-08-16 15:01 | 7.4K | |
| chordpack-0.8.1_2.pkg | 2025-12-22 16:18 | 20K | |
| choria-0.29.4_4.pkg | 2025-08-15 02:49 | 13M | |
| chpasswd-2.2.4_1.pkg | 2025-08-20 17:44 | 14K | |
| chpp-0.3.5_7.pkg | 2025-12-23 07:31 | 148K | |
| chroma-1.20.pkg | 2025-12-28 13:39 | 2.4M | |
| chroma-syntax-highli..> | 2025-12-21 04:34 | 2.5M | |
| chromaprint-1.6.0_1.pkg | 2025-12-26 16:56 | 52K | |
| chrome-gnome-shell-1..> | 2025-12-30 18:53 | 11K | |
| chromium-143.0.7499...> | 2025-12-25 16:53 | 127M | |
| chromium-bsu-0.9.16...> | 2025-12-28 03:03 | 1.3M | |
| chromono-1.1.1.pkg | 2025-12-29 07:16 | 604K | |
| chrono-time-tracking..> | 2025-12-24 07:26 | 3.1M | |
| chrony-4.8.pkg | 2025-12-21 17:20 | 275K | |
| chrony-lite-4.8.pkg | 2025-12-21 10:48 | 261K | |
| chroot_safe-1.4_2.pkg | 2025-08-22 07:08 | 5.3K | |
| chrootuid-1.3_1.pkg | 2025-08-19 07:14 | 6.6K | |
| chrpath-0.18.pkg | 2025-08-21 06:16 | 23K | |
| chruby-0.3.9.pkg | 2025-12-22 13:16 | 2.5K | |
| chryzodus-0.32_4.pkg | 2025-12-29 17:00 | 14K | |
| chu-0.1.29_1.pkg | 2025-08-17 17:00 | 21K | |
| chuffed-0.13.2.pkg | 2025-08-14 09:53 | 678K | |
| chyves-0.2.0_1.pkg | 2025-08-19 15:34 | 73K | |
| cidr-2.3.2_3.pkg | 2025-08-20 18:53 | 6.2K | |
| cilium-0.18.8_2.pkg | 2025-12-24 06:43 | 55M | |
| cim-3.37_3.pkg | 2025-08-18 04:12 | 183K | |
| cimg-3.6.5_1,3.pkg | 2025-12-27 06:02 | 6.7M | |
| cimod-1.7.3.pkg | 2025-12-27 14:50 | 20K | |
| cineencoder-3.5.5_2.pkg | 2025-12-29 05:55 | 847K | |
| cingb-0.32_2.pkg | 2025-08-20 01:02 | 46K | |
| cinnamon-6.4.13_1.pkg | 2025-12-30 06:46 | 1.9M | |
| cinnamon-control-cen..> | 2025-12-27 14:41 | 239K | |
| cinnamon-desktop-6.4..> | 2025-12-26 18:47 | 273K | |
| cinnamon-menus-6.4.0..> | 2025-12-19 02:17 | 72K | |
| cinnamon-screensaver..> | 2025-12-27 17:59 | 174K | |
| cinnamon-session-6.4..> | 2025-12-27 00:31 | 110K | |
| cinnamon-settings-da..> | 2025-12-27 18:38 | 413K | |
| cinnamon-translation..> | 2025-08-15 01:59 | 3.8M | |
| cinny-4.10.2.pkg | 2025-12-20 10:57 | 4.8M | |
| circuslinux-1.0.3_14..> | 2025-12-29 19:55 | 1.1M | |
| cirrus-cli-0.158.0.pkg | 2025-12-30 14:14 | 10M | |
| ciscoconf-1.1_1.pkg | 2025-08-18 04:54 | 9.8K | |
| ciso-1.0.0_2.pkg | 2025-08-16 08:19 | 6.7K | |
| ciso-maker-1.02.pkg | 2025-08-22 19:18 | 6.5K | |
| cityhash-1.1.1_1.pkg | 2025-08-21 22:33 | 14K | |
| civetweb-1.15.pkg | 2025-08-14 00:37 | 98K | |
| cjose-0.6.1_2.pkg | 2025-08-15 20:27 | 58K | |
| cjs-128.0.pkg | 2025-12-27 11:05 | 373K | |
| ck4up-1.4_2.pkg | 2025-12-22 11:14 | 6.6K | |
| ckb-libreoffice-25.8..> | 2025-12-27 18:44 | 265K | |
| ckeditor-4.21.0.pkg | 2025-08-21 09:16 | 1.0M | |
| ckpass-0.2.pkg | 2025-12-21 04:34 | 11K | |
| cksfv-1.3.15_1.pkg | 2025-08-18 11:31 | 11K | |
| cl-alexandria-1.4_1,..> | 2025-08-13 22:56 | 181K | |
| cl-alexandria-ccl-1...> | 2025-08-15 02:24 | 95K | |
| cl-alexandria-clisp-..> | 2025-12-27 05:45 | 54K | |
| cl-alexandria-sbcl-1..> | 2025-12-20 02:36 | 110K | |
| cl-asdf-3.3.7,2.pkg | 2025-08-15 19:40 | 275K | |
| cl-asdf-ccl-3.3.7.pkg | 2025-08-19 05:35 | 390K | |
| cl-asdf-clisp-3.3.7.pkg | 2025-12-28 10:38 | 255K | |
| cl-asdf-sbcl-3.3.7_1..> | 2025-12-24 04:21 | 530K | |
| cl-babel-0.5.0.24,1.pkg | 2025-08-14 15:46 | 145K | |
| cl-babel-ccl-0.5.0.2..> | 2025-08-20 14:31 | 307K | |
| cl-babel-clisp-0.5.0..> | 2025-12-29 06:43 | 167K | |
| cl-babel-sbcl-0.5.0...> | 2025-12-20 15:03 | 222K | |
| cl-cffi-0.16.1.pkg | 2025-08-16 15:04 | 843K | |
| cl-clx-0.7.7.pkg | 2025-08-25 22:32 | 409K | |
| cl-clx-ccl-0.7.6.pkg | 2025-09-01 05:12 | 637K | |
| cl-clx-clisp-0.7.6.pkg | 2025-12-29 05:22 | 423K | |
| cl-clx-sbcl-0.7.6_10..> | 2025-12-19 13:13 | 1.0M | |
| cl-flexi-streams-1.0..> | 2025-08-14 02:28 | 212K | |
| cl-flexi-streams-ccl..> | 2025-08-15 13:21 | 454K | |
| cl-flexi-streams-cli..> | 2025-12-27 12:43 | 214K | |
| cl-flexi-streams-sbc..> | 2025-12-20 02:37 | 405K | |
| cl-freebsd-asdf-init..> | 2025-08-13 13:26 | 2.8K | |
| cl-infix-19960628_4.pkg | 2025-08-15 14:57 | 12K | |
| cl-infix-ccl-1996062..> | 2025-08-18 15:09 | 22K | |
| cl-infix-clisp-19960..> | 2025-12-29 21:23 | 12K | |
| cl-infix-sbcl-199606..> | 2025-12-20 15:55 | 26K | |
| cl-lml-2.5.7_3.pkg | 2025-08-15 15:09 | 11K | |
| cl-lml-ccl-2.5.7.pkg | 2025-08-17 15:22 | 29K | |
| cl-lml-clisp-2.5.7.pkg | 2025-12-30 10:15 | 16K | |
| cl-lml-sbcl-2.5.7_98..> | 2025-12-22 01:14 | 33K | |
| cl-md5-2.0.5.pkg | 2025-08-14 15:42 | 11K | |
| cl-md5-ccl-2.0.5.pkg | 2025-08-21 11:32 | 21K | |
| cl-md5-clisp-2.0.5.pkg | 2025-12-29 22:17 | 15K | |
| cl-md5-sbcl-2.0.5_8.pkg | 2025-12-20 08:56 | 20K | |
| cl-port-2002.10.02.1..> | 2025-08-14 11:52 | 20K | |
| cl-port-sbcl-2002.10..> | 2025-12-22 04:35 | 46K | |
| cl-ppcre-2.1.2_1.pkg | 2025-08-14 08:13 | 117K | |
| cl-ppcre-ccl-2.1.2.pkg | 2025-08-17 13:17 | 175K | |
| cl-ppcre-clisp-2.1.2..> | 2025-12-28 18:16 | 80K | |
| cl-ppcre-sbcl-2.1.2_..> | 2025-12-19 05:39 | 236K | |
| cl-split-sequence-2...> | 2025-08-15 13:21 | 8.2K | |
| cl-split-sequence-cc..> | 2025-08-22 18:52 | 21K | |
| cl-split-sequence-cl..> | 2025-12-29 10:04 | 10K | |
| cl-split-sequence-sb..> | 2025-12-20 18:24 | 47K | |
| cl-trivial-features-..> | 2025-08-14 07:35 | 9.1K | |
| cl-trivial-features-..> | 2025-08-15 12:23 | 1.4K | |
| cl-trivial-features-..> | 2025-12-27 09:02 | 2.3K | |
| cl-trivial-features-..> | 2025-12-19 19:50 | 2.0K | |
| cl-trivial-gray-stre..> | 2025-08-13 22:07 | 7.8K | |
| cl-trivial-gray-stre..> | 2025-08-14 07:59 | 5.5K | |
| cl-trivial-gray-stre..> | 2025-12-27 01:36 | 6.0K | |
| cl-trivial-gray-stre..> | 2025-12-18 20:37 | 8.8K | |
| clad-2.2.pkg | 2025-12-23 07:40 | 628K | |
| clamassassin-1.2.4_7..> | 2025-12-30 12:22 | 3.4K | |
| clamav-1.5.1_2,1.pkg | 2025-12-26 22:21 | 24M | |
| clamav-lts-1.4.3_2,1..> | 2025-12-28 13:28 | 13M | |
| clamav-unofficial-si..> | 2025-12-27 20:52 | 49K | |
| clamd-stream-client-..> | 2025-08-20 03:11 | 6.4K | |
| clamfs-1.2.0_6.pkg | 2025-12-30 05:52 | 49K | |
| clamsmtp-1.10_6.pkg | 2025-12-28 07:48 | 29K | |
| clamtk-6.18_2.pkg | 2025-12-29 13:18 | 59K | |
| clang-uml-0.6.2.pkg | 2025-12-24 03:53 | 1.2M | |
| clapper-0.8.0.pkg | 2025-12-27 05:57 | 1.4M | |
| clasp-3.3.9.pkg | 2025-08-20 09:21 | 464K | |
| classiclooks-2.2.0_1..> | 2025-12-28 05:20 | 178K | |
| claude-code-2.0.58.pkg | 2025-12-28 16:16 | 26M | |
| claws-mail-3.21.0_1.pkg | 2025-12-27 13:25 | 2.9M | |
| claws-mail-acpi_noti..> | 2025-12-30 08:01 | 8.8K | |
| claws-mail-address_k..> | 2025-12-30 16:38 | 7.8K | |
| claws-mail-archive-3..> | 2025-12-29 13:33 | 20K | |
| claws-mail-att_remov..> | 2025-12-29 07:27 | 8.3K | |
| claws-mail-attachwar..> | 2025-12-28 06:23 | 7.6K | |
| claws-mail-bogofilte..> | 2025-12-28 10:53 | 13K | |
| claws-mail-bsfilter-..> | 2025-12-29 21:41 | 11K | |
| claws-mail-clamd-3.2..> | 2025-12-28 18:53 | 16K | |
| claws-mail-dillo-3.2..> | 2025-12-29 23:58 | 7.0K | |
| claws-mail-fetchinfo..> | 2025-12-30 08:28 | 6.2K | |
| claws-mail-keyword_w..> | 2025-12-30 13:49 | 7.3K | |
| claws-mail-libravata..> | 2025-12-28 12:35 | 15K | |
| claws-mail-litehtml_..> | 2025-12-29 05:46 | 235K | |
| claws-mail-mailmbox-..> | 2025-12-28 20:25 | 48K | |
| claws-mail-managesie..> | 2025-12-30 12:16 | 25K | |
| claws-mail-newmail-3..> | 2025-12-28 16:22 | 4.0K | |
| claws-mail-notificat..> | 2025-12-28 15:34 | 50K | |
| claws-mail-pdf_viewe..> | 2025-12-29 19:47 | 17K | |
| claws-mail-perl-3.21..> | 2025-12-27 19:55 | 23K | |
| claws-mail-pgp-3.21...> | 2025-12-30 13:54 | 48K | |
| claws-mail-plugins-3..> | 2025-08-21 19:01 | 717 | |
| claws-mail-rssyl-3.2..> | 2025-12-29 23:44 | 50K | |
| claws-mail-spam_repo..> | 2025-12-27 22:44 | 9.1K | |
| claws-mail-spamassas..> | 2025-12-28 21:08 | 23K | |
| claws-mail-themes-20..> | 2025-08-14 07:38 | 2.9M | |
| claws-mail-tnef_pars..> | 2025-12-29 15:38 | 11K | |
| claws-mail-vcalendar..> | 2025-12-30 18:17 | 74K | |
| clawsker-1.4.0_2.pkg | 2025-12-30 06:30 | 113K | |
| clazy-1.13.pkg | 2025-12-20 07:19 | 515K | |
| clblas-2.12_3.pkg | 2025-12-19 15:13 | 1.1M | |
| clblast-1.6.3.pkg | 2025-12-22 12:15 | 1.2M | |
| clboss-0.14.1.pkg | 2025-12-29 17:41 | 2.8M | |
| cld2-20150505.pkg | 2025-08-14 12:48 | 5.5M | |
| cldr-emoji-annotatio..> | 2025-08-13 11:24 | 4.8M | |
| clean-3.4_2.pkg | 2025-08-16 11:12 | 9.1K | |
| cleanfeed-20200402.pkg | 2025-12-30 16:51 | 28K | |
| cleanfeed-current-20..> | 2025-12-29 13:45 | 28K | |
| cleanup-maildir-0.3...> | 2025-12-24 07:31 | 6.5K | |
| clearlooks-phenix-th..> | 2025-12-30 16:21 | 82K | |
| clearlooks-themes-0...> | 2025-12-29 13:54 | 16K | |
| clearsans-1.00_2.pkg | 2025-12-29 08:14 | 417K | |
| clearsilver-0.10.5_2..> | 2025-08-14 05:48 | 256K | |
| clewn-1.14_3.pkg | 2025-12-21 22:22 | 61K | |
| clex-4.7_1.pkg | 2025-08-16 22:08 | 120K | |
| clfft-2.12.2_1.pkg | 2025-12-22 05:25 | 299K | |
| clhep-2.4.7.2.pkg | 2025-12-27 17:33 | 1.2M | |
| cli-2.2.0_1.pkg | 2025-12-23 04:59 | 29K | |
| cli-visualizer-1.8.2..> | 2025-12-29 18:27 | 65K | |
| cli11-2.6.1.pkg | 2025-12-19 01:34 | 81K | |
| cli53-0.8.25_1.pkg | 2025-08-17 03:57 | 3.7M | |
| clickhouse-25.11.1.5..> | 2025-12-24 01:50 | 74M | |
| clifm-1.26.3.pkg | 2025-12-29 01:14 | 519K | |
| clig-1.9.11.1_4.pkg | 2025-12-27 22:30 | 60K | |
| cligen-6.5.0.pkg | 2025-08-14 22:42 | 90K | |
| clinfo-3.0.25.02.14.pkg | 2025-12-18 16:22 | 52K | |
| cling-1.2_1.pkg | 2025-12-20 10:04 | 74M | |
| clingcon-5.2.1.pkg | 2025-08-21 07:19 | 155K | |
| clingo-5.7.1.pkg | 2025-08-15 16:20 | 1.3M | |
| clip-clipboard-libra..> | 2025-12-27 17:48 | 26K | |
| clipcat-0.21.1_3.pkg | 2025-12-30 04:51 | 5.2M | |
| cliphist-0.7.0_3.pkg | 2025-12-23 21:48 | 858K | |
| clipit-1.4.5_3.pkg | 2025-12-29 21:53 | 56K | |
| clipman-1.6.5_3.pkg | 2025-12-21 03:14 | 1.6M | |
| clipmenu-6.2.0.pkg | 2025-12-28 15:21 | 5.8K | |
| clipnotify-1.0.2.6.pkg | 2025-08-14 18:20 | 3.4K | |
| clipp-1.2.3_1.pkg | 2025-08-14 06:46 | 30K | |
| clipper-2.1.20180802..> | 2025-12-28 03:52 | 1.3M | |
| clips-6.30.pkg | 2025-08-18 11:49 | 327K | |
| cliquer-1.22.pkg | 2025-08-15 13:39 | 65K | |
| clisp-2.49.95+202412..> | 2025-12-26 19:33 | 2.9M | |
| clisp-hyperspec-7.0.pkg | 2025-08-21 18:20 | 1.3M | |
| clixon-6.5.0.pkg | 2025-12-21 05:34 | 481K | |
| cln-1.3.7_1.pkg | 2025-08-13 18:56 | 1.0M | |
| cloak-0.3.0_35.pkg | 2025-12-30 08:19 | 385K | |
| cloc-2.06.pkg | 2025-12-18 13:09 | 126K | |
| clockspeed-0.62_7.pkg | 2025-08-16 12:36 | 24K | |
| clog-1.6_1.pkg | 2025-08-16 10:04 | 5.2K | |
| clojure-1.12.0.1488.pkg | 2025-12-29 03:51 | 14M | |
| clojure-cider-1.20.0..> | 2025-12-28 01:48 | 100K | |
| clojure-cider-emacs_..> | 2025-12-29 15:55 | 100K | |
| clojure-cider-emacs_..> | 2025-12-29 16:00 | 100K | |
| clojure-cider-emacs_..> | 2025-12-23 03:05 | 100K | |
| clojure-cider-emacs_..> | 2025-12-20 07:15 | 100K | |
| clojure-cider-emacs_..> | 2025-12-30 01:00 | 100K | |
| clojure-mode.el-5.20..> | 2025-12-27 18:19 | 34K | |
| clojure-mode.el-emac..> | 2025-12-27 11:15 | 34K | |
| clojure-mode.el-emac..> | 2025-12-27 08:43 | 34K | |
| clojure-mode.el-emac..> | 2025-12-19 19:37 | 34K | |
| clojure-mode.el-emac..> | 2025-12-20 02:01 | 34K | |
| clojure-mode.el-emac..> | 2025-12-27 08:43 | 34K | |
| clone-1.0.8_1.pkg | 2025-08-19 00:39 | 22K | |
| clonehdd-2.0.3_2.pkg | 2025-12-22 01:22 | 8.5K | |
| cloog-0.21.1.pkg | 2025-08-22 13:40 | 114K | |
| closql-2.3.2.pkg | 2025-12-27 16:13 | 13K | |
| closql-emacs_canna-2..> | 2025-12-27 17:37 | 13K | |
| closql-emacs_devel-2..> | 2025-12-27 09:38 | 13K | |
| closql-emacs_devel_n..> | 2025-12-19 19:47 | 13K | |
| closql-emacs_nox-2.3..> | 2025-12-19 09:06 | 13K | |
| closql-emacs_wayland..> | 2025-12-27 12:02 | 13K | |
| closure-compiler-202..> | 2025-12-27 21:35 | 12M | |
| cloud-nuke-0.45.0.pkg | 2025-12-22 23:31 | 24M | |
| cloudcompare-2.12.4_..> | 2025-12-28 10:58 | 4.0M | |
| cloudflared-2025.8.0..> | 2025-12-23 19:48 | 7.5M | |
| cloudquery-0.32.0_21..> | 2025-12-22 01:36 | 9.4M | |
| clover-24.1.7_5.pkg | 2025-12-29 18:19 | 3.6M | |
| clpbar-1.11.1_1.pkg | 2025-08-20 17:48 | 33K | |
| clpeak-1.1.5.pkg | 2025-12-22 01:39 | 48K | |
| clrng-1.0.0.b_3.pkg | 2025-12-23 09:29 | 56K | |
| clsync-0.4.r2_3.pkg | 2025-12-23 17:54 | 57K | |
| clthreads-2.4.2_1.pkg | 2025-08-14 02:14 | 12K | |
| cltune-2.7.0_2.pkg | 2025-12-22 08:58 | 89K | |
| clucene-2.3.3.4_21.pkg | 2025-08-13 20:11 | 774K | |
| clunk-1.3.261_1.pkg | 2025-12-24 04:27 | 2.7M | |
| clustal-omega-1.2.4.pkg | 2025-08-14 23:17 | 449K | |
| clustalw-2.1_3.pkg | 2025-08-14 05:26 | 264K | |
| cluster-glue-1.0.12_..> | 2025-12-28 09:14 | 513K | |
| clusterit-2.5_1.pkg | 2025-08-15 23:51 | 84K | |
| clutter-1.26.4_2.pkg | 2025-12-26 16:57 | 1.9M | |
| clutter-gst-2.0.18_2..> | 2025-12-29 03:55 | 73K | |
| clutter-gst3-3.0.27_..> | 2025-12-27 01:08 | 82K | |
| clutter-gtk3-1.8.4_4..> | 2025-12-27 00:42 | 30K | |
| cluttermm-1.17.3_5.pkg | 2025-12-29 01:26 | 334K | |
| clxclient-3.9.2.pkg | 2025-12-27 17:45 | 43K | |
| cm-0.4.4.pkg | 2025-12-28 05:21 | 248K | |
| cmake-3.31.10.pkg | 2025-12-26 21:57 | 811 | |
| cmake-core-3.31.10.pkg | 2025-12-24 20:15 | 14M | |
| cmake-doc-3.31.10.pkg | 2025-12-18 17:05 | 6.5M | |
| cmake-fedora-2.9.2.pkg | 2025-08-15 21:45 | 51K | |
| cmake-gui-3.31.10.pkg | 2025-12-30 07:47 | 2.9M | |
| cmake-man-3.31.10.pkg | 2025-12-18 18:50 | 782K | |
| cmake-modules-webos-..> | 2025-08-15 20:49 | 26K | |
| cmark-0.31.1.pkg | 2025-08-14 04:51 | 87K | |
| cmatrix-2.0_1.pkg | 2025-08-21 06:41 | 9.1K | |
| cmdftp-0.9.8_1.pkg | 2025-08-17 09:56 | 29K | |
| cmdpack-1.06.pkg | 2025-08-16 03:20 | 69K | |
| cmdwatch-0.2.0_3.pkg | 2025-08-22 13:13 | 8.5K | |
| cmh-1.1.1_4.pkg | 2025-12-27 12:44 | 90K | |
| cminpack-1.3.11_1.pkg | 2025-12-26 19:58 | 166K | |
| cmios9-2.1.pkg | 2025-08-19 20:34 | 51K | |
| cmlib-3.0_9.pkg | 2025-12-28 11:14 | 1.4M | |
| cmocka-1.1.8.pkg | 2025-08-25 01:16 | 32K | |
| cmockery2-1.3.8.pkg | 2025-08-17 15:24 | 38K | |
| cmogstored-1.8.1_1.pkg | 2025-08-19 07:30 | 108K | |
| cmospwd-5.1.pkg | 2025-08-19 08:42 | 25K | |
| cmph-2.0.2.pkg | 2025-08-16 10:21 | 87K | |
| cmrt-1.0.6_2.pkg | 2025-12-19 03:02 | 180K | |
| cmrtlib-20.1.1.pkg | 2025-12-18 19:29 | 92K | |
| cmt-1.16_1.pkg | 2025-12-29 12:56 | 52K | |
| cmus-2.12.0_3.pkg | 2025-12-27 22:36 | 216K | |
| cnagios-nagios3-0.33..> | 2025-12-29 00:39 | 24K | |
| cnagios-nagios4-0.33..> | 2025-12-29 12:21 | 24K | |
| cncli-6.0.1_17.pkg | 2025-12-29 16:11 | 3.1M | |
| cnd-0.7_1.pkg | 2025-08-22 09:07 | 7.3K | |
| cnews-cr.g_21.pkg | 2025-12-19 10:54 | 292K | |
| cntlm-0.92.3_1.pkg | 2025-08-22 00:34 | 55K | |
| cobalt-site-generato..> | 2025-08-17 21:46 | 3.2M | |
| coccigrep-1.20_1.pkg | 2025-12-23 19:10 | 29K | |
| coccinella-0.96.20_2..> | 2025-12-30 07:08 | 2.3M | |
| coccinelle-1.3_1.pkg | 2025-12-19 13:16 | 9.8M | |
| cockroach-19.1.11_35..> | 2025-12-30 07:49 | 17M | |
| cocoalib-0.99800_1.pkg | 2025-08-22 20:35 | 4.2M | |
| cocogitto-6.5.0_2.pkg | 2025-12-28 15:36 | 2.2M | |
| cocor-1.7_4.pkg | 2025-08-16 12:00 | 169K | |
| cocot-20171118.pkg | 2025-08-18 16:41 | 12K | |
| code-minimap-0.6.8_9..> | 2025-12-28 13:12 | 384K | |
| code2html-0.9.1_2.pkg | 2025-12-20 11:52 | 36K | |
| code2prompt-4.0.2_3.pkg | 2025-12-30 19:07 | 5.5M | |
| code2000-1.171_3.pkg | 2025-12-29 20:00 | 2.6M | |
| code_saturne-8.1.1_5..> | 2025-12-30 10:17 | 43M | |
| codeberg-pages-serve..> | 2025-12-23 14:14 | 15M | |
| codeblocks-20.03_18.pkg | 2025-12-30 15:54 | 13M | |
| codec2-1.0.3_1.pkg | 2025-12-18 16:35 | 7.7M | |
| codeigniter-3.1.13.pkg | 2025-12-29 11:13 | 307K | |
| codequery-1.0.1.pkg | 2025-12-27 22:11 | 703K | |
| codesearch-1.3.0.r.1..> | 2025-08-19 12:41 | 2.7M | |
| codespell-2.4.1.pkg | 2025-12-22 09:14 | 334K | |
| codex-0.77.0.pkg | 2025-12-30 17:14 | 11M | |
| coeurl-0.3.1_2.pkg | 2025-12-19 00:48 | 29K | |
| coffeebreak-0.1.1_1.pkg | 2025-08-18 11:46 | 4.6K | |
| coffeescript-2.7.0_4..> | 2025-12-29 22:33 | 149K | |
| cogl-1.22.8_2.pkg | 2025-12-26 14:40 | 809K | |
| coin-or-Clp-1.17.9_2..> | 2025-12-26 11:51 | 1.0M | |
| coin-or-CoinUtils-2...> | 2025-12-26 09:17 | 601K | |
| coin-or-Data-Netlib-..> | 2025-08-13 04:40 | 3.4M | |
| coin-or-Data-Sample-..> | 2025-08-13 04:23 | 156K | |
| coin-or-Data-Stochas..> | 2025-08-18 19:13 | 62K | |
| coin-or-Osi-0.108.11..> | 2025-12-26 10:01 | 339K | |
| coin-or-alps-2.0.2_5..> | 2025-12-26 20:35 | 87K | |
| coin-or-asl-2.1.0.pkg | 2025-08-13 08:31 | 275K | |
| coin-or-bcps-0.99.2_..> | 2025-12-27 17:04 | 34K | |
| coin-or-bonmin-1.8.9..> | 2025-12-26 19:57 | 415K | |
| coin-or-cbc-2.10.12_..> | 2025-12-26 15:03 | 941K | |
| coin-or-cgl-0.60.9_2..> | 2025-12-26 13:25 | 489K | |
| coin-or-cgl-conic-1...> | 2025-12-27 15:23 | 72K | |
| coin-or-couenne-0.5...> | 2025-12-27 10:55 | 576K | |
| coin-or-cppad-202500..> | 2025-12-30 11:08 | 458K | |
| coin-or-creme-g20210..> | 2025-08-22 04:00 | 24K | |
| coin-or-csdp-6.2.0_3..> | 2025-12-30 17:29 | 58K | |
| coin-or-disco-1.0.0...> | 2025-12-30 00:03 | 123K | |
| coin-or-flopc++-1.2...> | 2025-12-29 00:14 | 64K | |
| coin-or-gravity-1.1...> | 2025-12-29 13:04 | 957K | |
| coin-or-highs-1.12.0..> | 2025-12-18 14:28 | 2.0M | |
| coin-or-hsl-2.2.5.pkg | 2025-12-29 03:15 | 3.0K | |
| coin-or-lemon-1.3.1_..> | 2025-12-27 02:02 | 502K | |
| coin-or-metis-1.3.10..> | 2025-12-26 09:47 | 94K | |
| coin-or-mumps-3.0.3_..> | 2025-12-26 10:55 | 814K | |
| coin-or-osi-conic-1...> | 2025-12-26 17:56 | 29K | |
| coin-or-osiipopt-0.1..> | 2025-12-26 20:29 | 36K | |
| coin-or-qpOASES-3.2...> | 2025-12-29 08:44 | 192K | |
| coin-or-rehearse-g20..> | 2025-12-30 09:03 | 20K | |
| coin-or-symphony-5.7..> | 2025-12-29 15:24 | 316K | |
| collada-dom-2.5.2.pkg | 2025-12-26 19:50 | 1.5M | |
| collectd5-5.12.0_23.pkg | 2025-12-20 09:46 | 535K | |
| colly-2.1.0_33.pkg | 2025-12-23 14:20 | 37M | |
| colm-0.14.7.43.pkg | 2025-12-23 01:41 | 928K | |
| colmap-3.13.0.pkg | 2025-12-28 13:09 | 11M | |
| colobot-0.2.2.pkg | 2025-12-29 19:51 | 91M | |
| color-g20250810.pkg | 2025-12-21 06:00 | 263K | |
| color-widgets-qt5-2...> | 2025-12-29 15:38 | 151K | |
| colorcode-0.8.7.pkg | 2025-12-29 23:22 | 231K | |
| colord-1.4.8.pkg | 2025-12-24 22:10 | 833K | |
| colord-gtk-0.3.1_1.pkg | 2025-12-26 16:01 | 26K | |
| colord-kde-25.12.0.pkg | 2025-12-26 23:11 | 206K | |
| colordiff-1.0.21.pkg | 2025-12-23 00:53 | 9.7K | |
| colorgcc-1.4.5.pkg | 2025-08-22 12:06 | 5.6K | |
| colorize-0.3.4_3.pkg | 2025-12-19 13:21 | 10K | |
| colormake-0.9.201405..> | 2025-12-23 14:31 | 5.7K | |
| colortail-0.3.5.pkg | 2025-08-21 07:44 | 17K | |
| coloursum-0.3.0_21.pkg | 2025-12-29 21:27 | 354K | |
| colpack-1.0.10.249_1..> | 2025-08-21 20:32 | 590K | |
| colt-1.2.0_2.pkg | 2025-12-28 18:55 | 1.0M | |
| columns-1.2b_9.pkg | 2025-12-20 04:46 | 527K | |
| colwide-0.01.pkg | 2025-12-20 08:20 | 1.8K | |
| comfortaa-ttf-3.001_..> | 2025-12-27 21:42 | 131K | |
| comic-neue-2.51.pkg | 2025-12-29 11:20 | 218K | |
| comlin-g20240315.pkg | 2025-08-20 02:21 | 13K | |
| commit-mono-1.141.pkg | 2025-12-29 12:41 | 146K | |
| commit-patch-2.6.2.pkg | 2025-12-20 11:20 | 22K | |
| commitizen-py311-3.3..> | 2025-12-21 19:28 | 131K | |
| commoncpp-1.8.1_3,2.pkg | 2025-08-17 16:42 | 449K | |
| como-0.3.0_5.pkg | 2025-12-27 05:25 | 4.1M | |
| compat.el-30.1.0.1_1..> | 2025-12-26 19:20 | 85K | |
| compat.el-emacs_cann..> | 2025-12-26 18:10 | 85K | |
| compat.el-emacs_deve..> | 2025-12-26 18:04 | 85K | |
| compat.el-emacs_deve..> | 2025-12-18 14:42 | 85K | |
| compat.el-emacs_nox-..> | 2025-12-18 16:29 | 85K | |
| compat.el-emacs_wayl..> | 2025-12-26 18:54 | 85K | |
| compat4x-i386-5.3_12..> | 2025-08-15 05:14 | 895K | |
| compat5x-amd64-5.4.0..> | 2025-08-14 03:17 | 4.6M | |
| compat6x-amd64-6.4.6..> | 2025-08-20 04:08 | 5.3M | |
| compat7x-amd64-7.4.7..> | 2025-08-16 05:42 | 5.4M | |
| compat8x-amd64-8.4.8..> | 2025-12-20 23:30 | 464K | |
| compat9x-amd64-9.3.9..> | 2025-12-19 10:13 | 3.0M | |
| compat10x-amd64-10.4..> | 2025-12-18 19:10 | 2.5M | |
| compat11x-amd64-11.2..> | 2025-12-18 15:32 | 2.5M | |
| compat12x-amd64-12.2..> | 2025-12-18 11:43 | 1.1M | |
| compat13x-amd64-13.5..> | 2025-12-18 10:17 | 2.5M | |
| compat14x-amd64-14.2..> | 2025-12-22 10:09 | 4.7M | |
| compdbgen-g20250914.pkg | 2025-12-20 15:52 | 19K | |
| compiler-rt-0.r13163..> | 2025-08-21 18:53 | 7.5K | |
| compiz-0.8.8_18.pkg | 2025-12-26 21:23 | 887K | |
| compiz-bcop-0.8.8_5.pkg | 2025-12-26 22:03 | 6.9K | |
| compiz-plugins-extra..> | 2025-12-29 17:38 | 2.5M | |
| compiz-plugins-main-..> | 2025-12-27 19:42 | 1.2M | |
| compiz-plugins-unsup..> | 2025-12-30 17:26 | 942K | |
| compton-20160907_9.pkg | 2025-12-18 20:38 | 97K | |
| compton-conf-0.16.0_..> | 2025-12-29 00:37 | 47K | |
| comrak-0.48.0_1.pkg | 2025-12-30 16:37 | 1.0M | |
| conan-2.23.0.pkg | 2025-12-27 18:06 | 1.2M | |
| conauto-2.03.pkg | 2025-08-17 15:06 | 26K | |
| concentration-1.2_13..> | 2025-12-27 23:22 | 891K | |
| concord-2.4.0.pkg | 2025-12-20 22:15 | 1.4M | |
| concorde-20031219.pkg | 2025-08-21 15:29 | 1.1M | |
| concourse-6.7.2_33.pkg | 2025-12-23 19:40 | 20M | |
| concourse-fly-6.7.1_..> | 2025-08-20 03:30 | 11M | |
| concurrencpp-0.1.7.pkg | 2025-08-18 10:46 | 79K | |
| concurrencykit-0.7.2..> | 2025-08-14 01:26 | 311K | |
| concurrentqueue-1.0...> | 2025-08-18 01:33 | 37K | |
| cond-let-0.2.0.pkg | 2025-12-26 19:20 | 7.9K | |
| cond-let-emacs_canna..> | 2025-12-26 18:04 | 7.9K | |
| cond-let-emacs_devel..> | 2025-12-26 19:29 | 7.9K | |
| cond-let-emacs_devel..> | 2025-12-18 17:10 | 7.9K | |
| cond-let-emacs_nox-0..> | 2025-12-18 16:10 | 7.9K | |
| cond-let-emacs_wayla..> | 2025-12-26 19:25 | 7.9K | |
| conduit-0.9.5_1.pkg | 2025-12-26 21:04 | 2.5M | |
| cone-1.17.pkg | 2025-12-22 08:14 | 1.6M | |
| confctl-1.2_1.pkg | 2025-08-17 04:27 | 15K | |
| confget-5.1.2.pkg | 2025-12-20 07:44 | 12K | |
| confregdecode-1.2.1_..> | 2025-12-28 07:48 | 20K | |
| conky-1.22.2.pkg | 2025-12-27 16:38 | 340K | |
| conky-awesome-1.22.2..> | 2025-12-20 17:06 | 267K | |
| conkyforecast-2.24_1..> | 2025-12-27 22:45 | 2.4M | |
| conman-0.3.0.pkg | 2025-12-22 13:17 | 85K | |
| conmon-2.1.13_7.pkg | 2025-12-18 23:21 | 32K | |
| connectagram-1.3.8.pkg | 2025-12-30 15:46 | 21M | |
| connectfive-1.0.2_9.pkg | 2025-12-20 08:59 | 136K | |
| cons-2.2.1.pkg | 2025-12-20 02:30 | 107K | |
| cons-test-2.2.0_5.pkg | 2025-12-22 14:36 | 71K | |
| conserve-24.8.0_11.pkg | 2025-12-30 14:13 | 17M | |
| conserver-com-8.2.7_..> | 2025-12-23 16:42 | 143K | |
| consolamono-ttf-2013..> | 2025-12-28 12:43 | 210K | |
| consolehm-1.31_2.pkg | 2025-08-17 08:30 | 7.5K | |
| consolekit2-1.2.6_5.pkg | 2025-12-16 02:18 | 161K | |
| construo-0.2.3_2.pkg | 2025-08-17 04:59 | 300K | |
| consul-1.22.2.pkg | 2025-12-27 02:56 | 25M | |
| consul-alerts-0.6.0_..> | 2025-12-20 15:15 | 3.6M | |
| consul-replicate-0.4..> | 2025-12-23 05:56 | 2.4M | |
| consul-template-0.41..> | 2025-12-21 08:45 | 4.3M | |
| consul_exporter-0.3...> | 2025-12-21 16:51 | 3.2M | |
| consult.el-2.9_1.pkg | 2025-12-30 17:15 | 124K | |
| consult.el-emacs_can..> | 2025-12-28 12:31 | 124K | |
| consult.el-emacs_dev..> | 2025-12-30 12:10 | 124K | |
| consult.el-emacs_dev..> | 2025-12-21 03:50 | 124K | |
| consult.el-emacs_nox..> | 2025-12-21 05:32 | 124K | |
| consult.el-emacs_way..> | 2025-12-28 14:29 | 124K | |
| containerd-2.2.1.pkg | 2025-12-27 21:04 | 21M | |
| containernetworking-..> | 2025-12-18 20:39 | 2.4M | |
| containers-0.9.0_4.pkg | 2025-08-14 17:25 | 34K | |
| containers-common-0...> | 2025-12-18 19:05 | 70K | |
| contour-0.6.1.7494_1..> | 2025-12-30 12:21 | 1.1M | |
| contractor-0.3.5.pkg | 2025-12-18 21:46 | 24K | |
| controllermap-2.32.8..> | 2025-12-29 00:23 | 62K | |
| convco-0.6.2_2.pkg | 2025-12-29 13:24 | 1.4M | |
| converseen-0.15.1.3.pkg | 2025-12-29 07:21 | 320K | |
| convertall-0.8.0_8.pkg | 2025-12-30 11:18 | 263K | |
| convey-0.3_4.pkg | 2025-12-29 00:13 | 904K | |
| convmv-2.05_1.pkg | 2025-12-24 01:13 | 20K | |
| cool-retro-term-1.1...> | 2025-12-28 09:29 | 1.5M | |
| cooledit-4.1.2_1.pkg | 2025-12-29 12:16 | 802K | |
| coolmail-1.3_4.pkg | 2025-08-19 13:03 | 13K | |
| coolreader-3.2.59_1.pkg | 2025-12-28 01:31 | 2.3M | |
| coordgenlibs-3.0.2.pkg | 2025-12-18 12:31 | 273K | |
| coovachilli-1.0.12_2..> | 2025-08-19 16:11 | 249K | |
| coppermine-1.6.26_1.pkg | 2025-12-30 17:09 | 2.6M | |
| copperspice-1.7.4_4.pkg | 2025-12-27 15:14 | 26M | |
| copperspice-examples..> | 2025-12-30 14:35 | 894K | |
| cops-1.04_1.pkg | 2025-12-21 21:02 | 265K | |
| copyq-13.0.0_1.pkg | 2025-12-29 02:21 | 1.9M | |
| copytape-1.0_2.pkg | 2025-08-19 08:42 | 6.7K | |
| coq-8.20.1_2,3.pkg | 2025-12-29 22:42 | 189M | |
| coq-emacs_canna-8.20..> | 2025-12-29 05:27 | 189M | |
| coq-emacs_devel-8.20..> | 2025-12-29 07:31 | 189M | |
| coq-emacs_devel_nox-..> | 2025-12-28 05:28 | 189M | |
| coq-emacs_nox-8.20.1..> | 2025-12-30 03:07 | 189M | |
| coq-emacs_wayland-8...> | 2025-12-28 08:57 | 189M | |
| coredns-1.13.1_2.pkg | 2025-12-22 04:50 | 16M | |
| coregarage-5.0.0.pkg | 2025-12-27 16:07 | 60K | |
| coreos-ct-0.9.0_33.pkg | 2025-12-22 04:57 | 2.0M | |
| coreos-etcd-2.3.8_39..> | 2025-12-21 07:16 | 7.7M | |
| coreos-etcd34-3.4.37..> | 2025-08-18 17:06 | 11M | |
| coreos-etcd35-3.5.25..> | 2025-12-20 10:56 | 17M | |
| coreos-etcd36-3.6.5.pkg | 2025-12-24 05:12 | 17M | |
| corepack-0.34.5.pkg | 2025-12-16 01:30 | 178K | |
| coreterminal-5.0.0.pkg | 2025-12-30 02:59 | 52K | |
| coreutils-9.9.pkg | 2025-12-24 20:08 | 2.9M | |
| corkscrew-2.0_1.pkg | 2025-08-18 01:29 | 6.4K | |
| coronapoker-4.33.pkg | 2025-12-30 04:53 | 89M | |
| corosync2-2.4.6_2.pkg | 2025-12-20 18:22 | 458K | |
| corosync3-3.1.9_1.pkg | 2025-12-27 18:05 | 459K | |
| corrade-2020.06.1783..> | 2025-08-13 18:09 | 609K | |
| corrosion-0.5.2_6.pkg | 2025-12-29 20:00 | 30K | |
| corrupter-1.0_33.pkg | 2025-12-22 16:12 | 729K | |
| corsixth-0.69.1_1.pkg | 2025-12-30 09:33 | 2.1M | |
| cosign-2.6.1_4.pkg | 2025-12-21 13:25 | 22M | |
| cosma-2.6.2_5.pkg | 2025-12-29 08:19 | 367K | |
| cosmic-comp-1.0.0_1.pkg | 2025-12-30 02:03 | 7.2M | |
| cosmosmash-1.5.0_1.pkg | 2025-12-29 07:37 | 305K | |
| costa-2.2.2_3.pkg | 2025-12-27 12:08 | 112K | |
| countdown-20220903.pkg | 2025-08-19 14:37 | 4.9K | |
| countrycodes-1.0.6_1..> | 2025-08-17 05:32 | 13K | |
| courier-1.5.1.pkg | 2025-12-21 03:13 | 2.1M | |
| courier-analog-0.21_..> | 2025-12-22 12:14 | 14K | |
| courier-authlib-0.72..> | 2025-12-21 16:23 | 760 | |
| courier-authlib-base..> | 2025-12-20 02:40 | 133K | |
| courier-authlib-ldap..> | 2025-12-23 16:17 | 34K | |
| courier-authlib-mysq..> | 2025-12-24 07:15 | 30K | |
| courier-authlib-pgsq..> | 2025-12-21 11:45 | 21K | |
| courier-authlib-sqli..> | 2025-12-22 17:49 | 20K | |
| courier-authlib-user..> | 2025-12-22 06:27 | 32K | |
| courier-authlib-user..> | 2025-12-24 07:39 | 32K | |
| courier-authlib-vchk..> | 2025-12-21 00:50 | 45K | |
| courier-imap-5.3.1,2..> | 2025-12-20 17:58 | 378K | |
| courier-prime-g20180..> | 2025-12-30 04:01 | 111K | |
| courier-sox-0.17_1.pkg | 2025-12-20 15:24 | 57K | |
| courier-unicode-2.4...> | 2025-12-19 01:56 | 228K | |
| couriergraph-2006020..> | 2025-12-30 04:05 | 8.5K | |
| courierpassd-1.1.2_1..> | 2025-12-20 08:59 | 21K | |
| courierpasswd-1.1.3_..> | 2025-12-21 15:57 | 16K | |
| courieruserinfo-1.1...> | 2025-12-21 06:02 | 12K | |
| coursier-2.1.24.pkg | 2025-12-28 16:25 | 153K | |
| coverm-0.7.0_11.pkg | 2025-12-30 00:30 | 1.6M | |
| covtool-2.1_12.pkg | 2025-12-29 05:23 | 162K | |
| cowpatty-4.8.pkg | 2025-08-22 03:57 | 40K | |
| cowrie-2.9.1.pkg | 2025-12-29 03:44 | 897K | |
| cowsay-3.04_3.pkg | 2025-12-23 14:45 | 17K | |
| coxeter-3.1.20210124..> | 2025-08-16 07:17 | 367K | |
| coyim-0.4.1_8.pkg | 2025-12-30 11:33 | 6.0M | |
| cozette-1.24.1.pkg | 2025-12-30 08:18 | 35K | |
| cp2k-2025.2.pkg | 2025-12-29 21:03 | 277M | |
| cp2k-data-2025.2.pkg | 2025-08-15 03:03 | 18M | |
| cpan-upload-2.2_2.pkg | 2025-12-20 19:12 | 10K | |
| cpan-upload-http-2.4..> | 2025-12-21 22:22 | 9.0K | |
| cparser-0.9.14_1.pkg | 2025-08-16 00:57 | 185K | |
| cpcmx-1.1.0.pkg | 2025-12-29 01:27 | 2.8M | |
| cpdup-1.22_1.pkg | 2025-08-15 14:28 | 29K | |
| cpdup-FreeBSD-1.0.0.pkg | 2025-08-18 03:10 | 31K | |
| cpeditor-7.0.1.pkg | 2025-12-30 05:50 | 940K | |
| cpipe-3.0.2_1.pkg | 2025-08-20 17:44 | 11K | |
| cpmtools-1.1_3.pkg | 2025-08-22 07:59 | 16K | |
| cpmtools2-2.24_1.pkg | 2025-08-17 17:00 | 81K | |
| cpp-httplib-0.28.0.pkg | 2025-12-22 09:23 | 77K | |
| cpp-mcp-g20250523.pkg | 2025-12-22 00:50 | 309K | |
| cpp-peglib-1.9.1.pkg | 2025-08-20 06:05 | 25K | |
| cpp-utilities-5.32.0..> | 2025-12-20 02:05 | 161K | |
| cpp2py-2.0.0_2.pkg | 2025-12-28 19:56 | 73K | |
| cppcheck-2.18.3.pkg | 2025-12-30 11:54 | 2.9M | |
| cppcodec-0.2.11.pkg | 2025-12-21 03:35 | 15K | |
| cppdb-0.3.1_2.pkg | 2025-12-22 08:22 | 118K | |
| cppi-1.18_2.pkg | 2025-12-20 15:22 | 51K | |
| cppinsights-20.1.pkg | 2025-12-21 22:42 | 7.8M | |
| cpplint-2.0.2.pkg | 2025-12-23 19:43 | 146K | |
| cpprestsdk-2.10.19_6..> | 2025-12-24 03:27 | 1.0M | |
| cpptest-2.0.0_1.pkg | 2025-08-14 18:45 | 52K | |
| cpptoml-0.1.1.pkg | 2025-08-13 23:07 | 18K | |
| cppunit-1.15.1.pkg | 2025-08-13 15:42 | 215K | |
| cppurses-0.3.5.pkg | 2025-08-19 04:10 | 214K | |
| cpputest-4.0.pkg | 2025-08-17 03:23 | 199K | |
| cppzmq-4.11.0.pkg | 2025-12-18 16:58 | 23K | |
| cpr-1.14.1.pkg | 2025-12-24 00:47 | 121K | |
| cproto-4.7x.pkg | 2025-08-15 19:44 | 42K | |
| cptutils-1.84_1.pkg | 2025-12-28 07:00 | 278K | |
| cpu-microcode-1.0_1.pkg | 2025-12-29 09:46 | 618 | |
| cpu-microcode-amd-20..> | 2025-12-27 04:45 | 239K | |
| cpu-microcode-intel-..> | 2025-12-19 17:13 | 24M | |
| cpu-microcode-rc-1.0..> | 2025-08-13 23:13 | 2.2K | |
| cpu-x-4.5.3_2.pkg | 2025-12-29 19:23 | 1.6M | |
| cpu-x-tuionly-4.5.3_..> | 2025-12-28 12:08 | 243K | |
| cpu_features-0.9.0.pkg | 2025-08-13 14:30 | 33K | |
| cpu_rec_rs-1.0.0_22.pkg | 2025-12-28 03:58 | 9.3M | |
| cpuburn-1.4_3.pkg | 2025-08-19 20:34 | 6.8K | |
| cpufetch-1.07.pkg | 2025-12-22 03:40 | 36K | |
| cpuid-3.3_7.pkg | 2025-08-19 21:24 | 13K | |
| cpuid-etallen-202403..> | 2025-08-17 17:32 | 96K | |
| cpuid2cpuflags-16.pkg | 2025-08-21 05:51 | 5.3K | |
| cpulimit-2.2_1.pkg | 2025-08-22 17:34 | 9.9K | |
| cpuminer-2.5.1_2.pkg | 2025-12-30 01:42 | 57K | |
| cpupdate-g20180513_1..> | 2025-08-20 18:16 | 14K | |
| cqrlog-gtk2-2.5.2_17..> | 2025-12-29 01:18 | 15M | |
| cqrlog-qt5-2.5.2_17.pkg | 2025-12-28 11:47 | 15M | |
| cqrlog-qt6-2.5.2_17.pkg | 2025-12-27 21:44 | 15M | |
| crack-attack-1.1.14_..> | 2025-12-29 19:55 | 472K | |
| cracklib-2.9.7_2.pkg | 2025-12-18 11:07 | 3.6M | |
| crackpkcs12-0.2.11.pkg | 2025-08-22 16:55 | 6.3K | |
| craft-1.0_10.pkg | 2025-12-20 10:59 | 743K | |
| crafty-25.2_1.pkg | 2025-08-16 05:49 | 1.0M | |
| cramfs-1.1_1.pkg | 2025-08-21 20:51 | 13K | |
| crashme-2.4_2.pkg | 2025-08-17 15:21 | 17K | |
| crashtest-1.1_5.pkg | 2025-12-28 10:38 | 265K | |
| crate-0.1.3_3.pkg | 2025-08-20 03:38 | 125K | |
| crawl-0.4_17.pkg | 2025-08-17 02:52 | 28K | |
| crc32c-1.1.2.pkg | 2025-08-13 07:14 | 15K | |
| cream-0.43.pkg | 2025-12-28 11:07 | 643K | |
| create-cert-2.11.pkg | 2025-08-22 17:34 | 8.6K | |
| create-rb-port-0.0.3..> | 2025-12-22 04:02 | 2.3K | |
| createrepo_c-1.1.4_1..> | 2025-12-23 14:32 | 151K | |
| createtorrent-1.1.4.pkg | 2025-08-18 11:08 | 6.1K | |
| credis-0.2.3.pkg | 2025-08-21 12:38 | 23K | |
| creduce-2.10.0.110,2..> | 2025-12-20 08:15 | 1.9M | |
| crengine-ng-0.9.12.pkg | 2025-12-27 15:58 | 2.0M | |
| cretan-hubris-0.2_7.pkg | 2025-12-28 16:10 | 268K | |
| crex-0.2.5_2.pkg | 2025-08-19 02:40 | 72K | |
| cricket-1.0.5_12.pkg | 2025-12-30 11:21 | 356K | |
| crimson-fields-0.5.3..> | 2025-12-29 16:01 | 535K | |
| crispy-doom-7.1.pkg | 2025-12-28 18:18 | 1.1M | |
| critcl-3.3.1.pkg | 2025-08-27 08:29 | 426K | |
| criterion-2.4.3.pkg | 2025-12-21 16:08 | 124K | |
| criticalmass-1.5.0_4..> | 2025-12-30 16:16 | 2.9M | |
| crlfuzz-1.4.1_34.pkg | 2025-12-22 17:33 | 2.0M | |
| crlibm-1.0.b4_2.pkg | 2025-08-18 23:55 | 1.5M | |
| crm114-20100106_6.pkg | 2025-12-22 06:51 | 397K | |
| crmsh-4.6.0_6.pkg | 2025-12-20 06:27 | 1.8M | |
| croc-10.3.1_1.pkg | 2025-12-24 03:42 | 3.4M | |
| cronic-3.pkg | 2025-12-23 13:48 | 1.3K | |
| cronolog-1.6.2_7.pkg | 2025-08-20 13:48 | 22K | |
| cronolog-devel-1.7.2..> | 2025-08-17 05:59 | 23K | |
| croscorefonts-1.31.0..> | 2025-12-27 15:38 | 2.2M | |
| crosextrafonts-calad..> | 2025-12-26 18:53 | 86K | |
| crosextrafonts-carli..> | 2025-12-26 20:12 | 794K | |
| crossfire-client-1.7..> | 2025-12-30 13:53 | 12M | |
| crosti-1.14.0_2.pkg | 2025-12-28 20:54 | 520K | |
| crow-translate-4.0.2..> | 2025-12-30 01:44 | 1.1M | |
| crowdsec-1.7.4.pkg | 2025-12-22 05:07 | 62M | |
| crowdsec-blocklist-m..> | 2025-12-21 07:03 | 4.2M | |
| crowdsec-firewall-bo..> | 2025-12-21 03:09 | 4.4M | |
| crqt-ng-1.0.15.pkg | 2025-12-30 11:08 | 424K | |
| crrcsim-0.9.13_4.pkg | 2025-12-28 03:47 | 7.1M | |
| crumb-0.0.4.pkg | 2025-08-16 09:10 | 21K | |
| crunch-3.6_1.pkg | 2025-08-16 05:24 | 32K | |
| crush-0.29.1.pkg | 2025-12-30 14:44 | 14M | |
| crw-1.03_4.pkg | 2025-12-28 11:10 | 20K | |
| cryptcat-1.2.1,1.pkg | 2025-08-18 03:10 | 478K | |
| cryptlib-3.4.7.pkg | 2025-08-15 15:12 | 1.1M | |
| cryptoballot-g201810..> | 2025-12-23 10:57 | 5.2M | |
| cryptominisat-5.11.2..> | 2025-12-26 22:59 | 645K | |
| cryptopp-8.9.0.pkg | 2025-08-15 01:12 | 11M | |
| cryptoslam-1.2.pkg | 2025-08-21 07:20 | 11K | |
| crystal-1.18.2_1.pkg | 2025-12-18 23:14 | 7.3M | |
| cs-0.9.6_3.pkg | 2025-12-30 00:35 | 3.0K | |
| cs-aspell-20040614.1..> | 2025-12-21 07:18 | 2.2M | |
| cs-hunspell-2.0.pkg | 2025-08-18 08:02 | 504K | |
| cs-hyphen-2.0.pkg | 2025-08-18 03:29 | 9.8K | |
| cs-libreoffice-25.8...> | 2025-12-27 11:40 | 3.5M | |
| cs-mythes-2007.09.26..> | 2025-08-19 20:23 | 204K | |
| csb-aspell-0.02.0_1,..> | 2025-12-21 02:03 | 46K | |
| cscope-15.9_1.pkg | 2025-08-14 13:08 | 150K | |
| cscout-3.01_1.pkg | 2025-12-30 15:15 | 445K | |
| csfml-2.6.1.pkg | 2025-12-27 11:44 | 133K | |
| csharp-mode.el-2.0.0..> | 2025-12-30 06:42 | 6.4K | |
| csharp-mode.el-emacs..> | 2025-12-30 06:08 | 6.5K | |
| csharp-mode.el-emacs..> | 2025-12-29 23:56 | 6.5K | |
| csharp-mode.el-emacs..> | 2025-12-21 03:38 | 6.5K | |
| csharp-mode.el-emacs..> | 2025-12-22 08:56 | 6.5K | |
| csharp-mode.el-emacs..> | 2025-12-29 06:24 | 6.5K | |
| csmash-0.6.6_23.pkg | 2025-12-30 12:29 | 1.4M | |
| csmith-2.3.0.79.pkg | 2025-12-21 18:49 | 301K | |
| csoap-1.1.0_6.pkg | 2025-12-20 10:47 | 85K | |
| csound-6.15.0_11.pkg | 2025-12-26 22:07 | 6.7M | |
| css-mode-elisp-0.11_..> | 2025-08-20 08:01 | 7.0K | |
| cssc-1.4.1_1.pkg | 2025-08-16 22:57 | 254K | |
| csso-1.3.9_6.pkg | 2025-12-28 05:32 | 21K | |
| csstidy-1.4.pkg | 2025-08-18 14:31 | 105K | |
| cstream-3.2.1_1.pkg | 2025-08-21 08:23 | 19K | |
| csvdiff-1.7_1.pkg | 2025-12-22 12:16 | 19K | |
| csview-1.3.4_3.pkg | 2025-12-30 17:21 | 349K | |
| csvlens-0.15.0.pkg | 2025-12-28 12:43 | 1.6M | |
| csvq-1.18.1_21.pkg | 2025-12-21 13:21 | 3.8M | |
| csvtk-0.36.0.pkg | 2025-12-27 17:17 | 7.5M | |
| csxcad-0.6.3_7.pkg | 2025-12-26 23:28 | 221K | |
| csync2-2.0_4.pkg | 2025-12-20 15:35 | 59K | |
| ct-submit-1.1.2_34.pkg | 2025-12-20 04:52 | 2.0M | |
| ctags-5.8_1.pkg | 2025-08-13 15:28 | 132K | |
| ctcs-1.4.1_1.pkg | 2025-12-20 09:32 | 25K | |
| ctl-language-1.5.4_2..> | 2025-12-27 03:17 | 1.2M | |
| ctl-sat-g20200210.pkg | 2025-08-21 21:36 | 48K | |
| ctm-2.0_4.pkg | 2025-08-22 03:28 | 41K | |
| ctop-0.7.7_32.pkg | 2025-12-23 14:12 | 2.7M | |
| ctorrent-3.3.2_5.pkg | 2025-08-20 14:25 | 108K | |
| ctpl-0.3.5.pkg | 2025-12-18 19:28 | 94K | |
| ctpp2-2.8.3_10.pkg | 2025-12-18 23:24 | 407K | |
| ctrace-0.9_2.pkg | 2025-12-23 16:43 | 13K | |
| ctre-3.10.0.pkg | 2025-12-23 19:59 | 94K | |
| ctris-0.43.pkg | 2025-08-22 04:20 | 12K | |
| ctronome-0.5.6.pkg | 2025-08-18 01:20 | 11K | |
| ctwm-4.1.0_1,1.pkg | 2025-12-28 23:23 | 439K | |
| ctypes.sh-1.2_2.pkg | 2025-12-20 14:44 | 13K | |
| cube-2005.08.29_19.pkg | 2025-12-29 11:48 | 28M | |
| cubicsdr-0.2.7_4.pkg | 2025-12-29 16:18 | 1.0M | |
| cudatext-gtk2-1.230...> | 2025-12-29 09:48 | 7.1M | |
| cudatext-qt5-1.230.5..> | 2025-12-28 03:02 | 7.0M | |
| cudatext-qt6-1.230.5..> | 2025-12-28 11:08 | 7.0M | |
| cudd-3.0.0.pkg | 2025-08-14 01:28 | 311K | |
| cuetools-1.4.1_1.pkg | 2025-08-18 08:38 | 50K | |
| cufflinks-2.2.1.89_1..> | 2025-12-20 07:56 | 1.4M | |
| cunit-2.1.3_3.pkg | 2025-08-15 20:15 | 157K | |
| cups-2.4.16.pkg | 2025-12-16 02:19 | 1.6M | |
| cups-bjnp-2.0.3.pkg | 2025-12-21 17:05 | 19K | |
| cups-filters-1.28.17..> | 2025-12-26 19:15 | 926K | |
| cups-fxlinuxprint-1...> | 2025-12-28 04:42 | 14K | |
| cups-pdf-3.0.1_3.pkg | 2025-12-30 18:46 | 22K | |
| cups-pk-helper-0.2.7..> | 2025-12-18 11:34 | 63K | |
| cups-smb-backend-1.0..> | 2025-12-28 02:29 | 1.4K | |
| curator-2.1_11.pkg | 2025-12-30 06:19 | 24K | |
| curl-8.17.0.pkg | 2025-12-16 01:45 | 1.7M | |
| curlie-1.6.7_34.pkg | 2025-12-23 10:38 | 925K | |
| curlpp-0.8.1_4.pkg | 2025-12-23 19:19 | 156K | |
| currtime-0.2.5.pkg | 2025-08-17 15:13 | 4.5K | |
| cursive-0.11_1,1.pkg | 2025-08-19 00:49 | 5.9K | |
| cursor-ardoise-theme..> | 2025-08-20 20:35 | 250K | |
| cursor-chameleon-ant..> | 2025-08-21 10:27 | 1.4M | |
| cursor-chameleon-dar..> | 2025-08-19 15:57 | 1.4M | |
| cursor-chameleon-pea..> | 2025-08-17 10:48 | 1.3M | |
| cursor-chameleon-sky..> | 2025-08-19 13:11 | 1.4M | |
| cursor-chameleon-whi..> | 2025-08-20 18:56 | 1.2M | |
| cursor-crystal-theme..> | 2025-08-21 04:12 | 141K | |
| cursor-dmz-aa-theme-..> | 2025-12-29 03:46 | 128K | |
| cursor-dmz-theme-0.4..> | 2025-08-20 13:17 | 120K | |
| cursor-jimmac-theme-..> | 2025-08-17 11:45 | 11K | |
| cursor-neutral-white..> | 2025-08-16 11:09 | 12K | |
| curtail-1.13.0.pkg | 2025-12-29 16:50 | 80K | |
| curv-0.5_29.pkg | 2025-12-30 06:28 | 1.0M | |
| cut-2.7_1.pkg | 2025-12-22 20:43 | 10K | |
| cutecom-0.60.0.pkg | 2025-12-30 03:06 | 280K | |
| cutelee-6.1.0_1.pkg | 2025-12-27 08:07 | 292K | |
| cutelyst-4.7.0.pkg | 2025-12-29 03:46 | 769K | |
| cutelyst-asql-0.92.0..> | 2025-12-29 18:27 | 127K | |
| cutemaze-1.3.5.pkg | 2025-12-30 06:47 | 309K | |
| cutils-1.6_2.pkg | 2025-08-18 02:50 | 70K | |
| cutmp3-4.0.pkg | 2025-12-22 13:13 | 50K | |
| cutter-1.2.6_5.pkg | 2025-12-29 12:32 | 481K | |
| cuttlefish-1.3_6.pkg | 2025-12-29 23:21 | 486K | |
| cuttlefish-texture-c..> | 2025-12-22 16:16 | 512K | |
| cuyo-2.1.0_1,1.pkg | 2025-12-29 19:16 | 3.4M | |
| cvc5-1.3.2.pkg | 2025-12-27 06:34 | 7.1M | |
| cvechecker-3.9_3.pkg | 2025-12-20 07:21 | 53K | |
| cvise-2.12.0.pkg | 2025-12-21 16:24 | 2.0M | |
| cvm-0.97.pkg | 2025-12-19 22:38 | 92K | |
| cvs+ipv6-1.20120905_..> | 2025-08-17 09:29 | 506K | |
| cvs-1.20120905_9.pkg | 2025-08-14 00:28 | 505K | |
| cvs-devel-1.12.13_15..> | 2025-12-23 15:43 | 587K | |
| cvs-syncmail-2.1.pkg | 2025-12-21 23:42 | 5.7K | |
| cvs2cl-2.73_1.pkg | 2025-12-21 03:28 | 33K | |
| cvs2darcs-0.8_10.pkg | 2025-12-22 01:12 | 7.8K | |
| cvs2html-1.98_1.pkg | 2025-12-20 23:27 | 16K | |
| cvsadmin-1.0.3_3.pkg | 2025-08-16 08:46 | 13K | |
| cvsbook-1.21_3.pkg | 2025-08-16 11:44 | 1.5M | |
| cvschangelogbuilder-..> | 2025-12-29 00:15 | 59K | |
| cvschk-1.12_1.pkg | 2025-12-22 11:30 | 7.5K | |
| cvsd-1.0.24_1.pkg | 2025-12-20 10:58 | 43K | |
| cvsdadm-0.3.2_2.pkg | 2025-12-21 16:48 | 12K | |
| cvsdelta-1.7.0_1.pkg | 2025-12-21 08:24 | 18K | |
| cvsdiff2patch-1.0.1.pkg | 2025-08-19 12:55 | 3.3K | |
| cvsgraph-1.7.2_3.pkg | 2025-12-27 03:17 | 75K | |
| cvslines-1.6.9_1.pkg | 2025-12-21 19:43 | 37K | |
| cvsmail-2.2_1.pkg | 2025-08-19 13:15 | 15K | |
| cvsmonitor-0.6.3_8.pkg | 2025-12-28 11:01 | 98K | |
| cvsplot-1.7.4_5.pkg | 2025-12-29 19:50 | 10K | |
| cvsps-2.1_3.pkg | 2025-08-15 03:19 | 39K | |
| cvsps-devel-2.2.b1_1..> | 2025-08-16 11:41 | 40K | |
| cvsspam-0.2.12_1.pkg | 2025-12-20 04:26 | 56K | |
| cvstrac-2.0.1_1.pkg | 2025-12-21 20:46 | 156K | |
| cvsutils-0.2.6_1,1.pkg | 2025-12-22 18:50 | 18K | |
| cvsweb-2.0.6_2.pkg | 2025-12-22 21:16 | 48K | |
| cvsweb3-3.0.6_5.pkg | 2025-12-29 01:18 | 65K | |
| cvswrap-0.2_1.pkg | 2025-08-22 21:27 | 8.9K | |
| cvsync-0.25.0_1.pkg | 2025-08-22 10:32 | 141K | |
| cw-1.0.16_2.pkg | 2025-08-21 05:43 | 52K | |
| cwdaemon-0.10.2_1.pkg | 2025-12-22 21:13 | 114K | |
| cweb-3.64a.a_1.pkg | 2025-08-15 02:07 | 91K | |
| cwm-7.4_1.pkg | 2025-12-29 11:00 | 44K | |
| cwrap-1.1.0_1.pkg | 2025-12-30 17:15 | 571 | |
| cwstudio-0.9.6_9.pkg | 2025-12-28 14:57 | 296K | |
| cwtext-0.96.pkg | 2025-12-21 15:42 | 10K | |
| cx88-1.5.5.1403000.pkg | 2025-12-22 12:43 | 228K | |
| cxmon-3.2_1.pkg | 2025-08-16 10:10 | 85K | |
| cxref-1.6e_1.pkg | 2025-08-22 19:34 | 130K | |
| cxxmatrix-g20220324.pkg | 2025-08-18 05:34 | 47K | |
| cxxopts-3.3.1.pkg | 2025-08-13 18:37 | 15K | |
| cxxplot-0.4.2_1.pkg | 2025-12-29 14:14 | 550K | |
| cxxtest-4.4_3.pkg | 2025-12-22 23:25 | 379K | |
| cxxtools-2.2.1_3.pkg | 2025-08-15 15:05 | 1.3M | |
| cy-aspell-0.50.3_1,1..> | 2025-12-21 12:18 | 1.9M | |
| cy-hunspell-23.10.pkg | 2025-08-17 18:25 | 213K | |
| cy-libreoffice-25.8...> | 2025-12-27 09:14 | 852K | |
| cyanrip-0.9.3.1_4.pkg | 2025-12-30 03:56 | 46K | |
| cyberbit-ttfonts-2.0..> | 2025-12-28 03:09 | 4.8M | |
| cyberchef-10.19.4.pkg | 2025-08-20 02:52 | 16M | |
| cyr-rfx-koi8-o-1.1_6..> | 2025-12-28 02:13 | 750K | |
| cyrus-imapd25-2.5.17..> | 2025-12-20 04:26 | 1.3M | |
| cyrus-imapd30-3.0.18..> | 2025-12-23 18:34 | 2.9M | |
| cyrus-imapd32-3.2.12..> | 2025-12-23 10:44 | 3.2M | |
| cyrus-imapd34-3.4.9_..> | 2025-12-24 04:59 | 3.3M | |
| cyrus-imapd34-http-3..> | 2025-12-23 13:51 | 3.5M | |
| cyrus-imapd36-3.6.7_..> | 2025-12-20 19:43 | 5.0M | |
| cyrus-imapd36-http-3..> | 2025-12-20 11:25 | 5.3M | |
| cyrus-imapd38-3.8.6_..> | 2025-12-22 00:01 | 5.1M | |
| cyrus-imapd38-http-3..> | 2025-12-23 00:07 | 5.5M | |
| cyrus-imapd310-3.10...> | 2025-12-23 12:16 | 5.2M | |
| cyrus-imapd310-http-..> | 2025-12-21 08:45 | 5.9M | |
| cyrus-imapd312-3.12...> | 2025-12-23 12:36 | 5.2M | |
| cyrus-imapd312-http-..> | 2025-12-22 02:22 | 6.0M | |
| cyrus-sasl-2.1.28_5.pkg | 2025-08-13 01:15 | 1.0M | |
| cyrus-sasl-gssapi-2...> | 2025-08-14 01:33 | 18K | |
| cyrus-sasl-ldapdb-2...> | 2025-08-19 15:12 | 14K | |
| cyrus-sasl-saslauthd..> | 2025-08-15 02:18 | 45K | |
| cyrus-sasl-sql-2.1.2..> | 2025-12-20 12:23 | 15K | |
| cyrus-sasl-srp-2.1.2..> | 2025-08-22 06:02 | 29K | |
| cyrus-sasl2-xoauth2-..> | 2025-08-22 07:09 | 7.9K | |
| cyrus2courier-1.4_1.pkg | 2025-08-16 20:22 | 12K | |
| cyrus2dovecot-1.3_1.pkg | 2025-12-21 06:56 | 22K | |
| cython-lint-0.18.1.pkg | 2025-12-21 18:57 | 32K | |
| cytoscape-3.6.1.pkg | 2025-12-28 00:06 | 1.2G | |
| czkawka-10.0.0_4.pkg | 2025-12-30 01:35 | 12M | |
| czmq-4.1.1_1.pkg | 2025-08-14 19:26 | 356K | |
| czmq4-4.2.1_2.pkg | 2025-08-16 19:15 | 587K | |
| d-spy-47.0.pkg | 2025-12-27 03:08 | 87K | |
| d0_blind_id-1.0_2.pkg | 2025-08-15 15:13 | 53K | |
| d2-0.7.1_5.pkg | 2025-12-22 15:33 | 10M | |
| d2x-0.2.5_15.pkg | 2025-12-29 12:21 | 398K | |
| d11amp-0.61_2.pkg | 2025-12-29 12:58 | 62K | |
| dDocent-2.7.8_2.pkg | 2025-12-30 12:42 | 25K | |
| dMagnetic-0.37_1.pkg | 2025-08-16 04:09 | 77K | |
| dSFMT-2.2.5_1.pkg | 2025-08-14 09:49 | 67K | |
| da-aspell-1.6.36.11...> | 2025-12-21 07:24 | 2.7M | |
| da-freebsd-doc-20251..> | 2025-12-19 11:36 | 53K | |
| da-libreoffice-25.8...> | 2025-12-27 15:45 | 3.4M | |
| daa2iso-0.1.7e_1.pkg | 2025-08-20 02:21 | 29K | |
| dact-0.8.42_3.pkg | 2025-08-22 21:04 | 60K | |
| dadadodo-1.04.pkg | 2025-08-19 08:04 | 18K | |
| dae-0.9_1.pkg | 2025-08-16 15:21 | 2.5K | |
| daemonize-1.7.8.pkg | 2025-08-16 13:54 | 8.7K | |
| daemonlogger-1.2.2.pkg | 2025-12-24 07:04 | 13K | |
| daemontools-0.76_20.pkg | 2025-08-15 01:57 | 58K | |
| daemontools-encore-1..> | 2025-08-18 08:10 | 71K | |
| dahdi-2.4.0rc5_8.pkg | 2025-12-26 19:21 | 145K | |
| dahdi-kmod26-2.6.1.r..> | 2025-12-30 17:35 | 3.0M | |
| dailystrips-1.0.28_1..> | 2025-12-22 11:10 | 35K | |
| dakota-6.22.0_1.pkg | 2025-12-30 07:08 | 17M | |
| dalmp-3.1.0.pkg | 2025-12-30 06:11 | 162K | |
| dalton-2020.0_6.pkg | 2025-12-29 01:20 | 16M | |
| damager-0.1_1.pkg | 2025-08-17 15:00 | 3.4K | |
| damask-0.3.1.pkg | 2025-12-29 01:04 | 91K | |
| dancer-4.16_1.pkg | 2025-08-22 02:10 | 219K | |
| dangen-0.5_6.pkg | 2025-12-29 21:23 | 228K | |
| dante-1.4.3_4.pkg | 2025-12-19 15:02 | 605K | |
| daq-2.2.2_3.pkg | 2025-12-18 22:48 | 162K | |
| dar-2.8.2.pkg | 2025-12-20 05:06 | 2.5M | |
| darcnes-9b0401_8.pkg | 2025-12-23 05:32 | 77K | |
| darkhttpd-1.16.pkg | 2025-08-17 21:36 | 20K | |
| darkice-1.4_3.pkg | 2025-08-19 21:20 | 109K | |
| darkman-2.0.1_14.pkg | 2025-12-21 23:58 | 1.9M | |
| darknet-4.p_4,1.pkg | 2025-12-29 04:39 | 586K | |
| darkplaces-20180412...> | 2025-12-27 05:37 | 1.9M | |
| darkstat-3.0.721_1.pkg | 2025-08-19 21:44 | 58K | |
| darktable-5.2.1_2.pkg | 2025-12-27 22:28 | 6.6M | |
| darktile-0.0.11_18.pkg | 2025-12-30 11:43 | 4.4M | |
| darts-0.32_1.pkg | 2025-08-13 23:46 | 25K | |
| dartsim-6.15.0_11.pkg | 2025-12-27 11:30 | 13M | |
| dasel-2.8.1_3.pkg | 2025-08-19 02:05 | 2.9M | |
| dash-0.5.13.pkg | 2025-12-21 08:05 | 89K | |
| dash.el-2.20.0_1.pkg | 2025-12-27 11:42 | 51K | |
| dash.el-emacs_canna-..> | 2025-12-27 16:27 | 51K | |
| dash.el-emacs_devel-..> | 2025-12-27 17:00 | 51K | |
| dash.el-emacs_devel_..> | 2025-12-19 20:30 | 51K | |
| dash.el-emacs_nox-2...> | 2025-12-20 01:23 | 51K | |
| dash.el-emacs_waylan..> | 2025-12-27 02:40 | 51K | |
| dasherr-1.05.01.pkg | 2025-12-29 12:37 | 218K | |
| dasm-2.20.14.1.pkg | 2025-08-18 11:08 | 520K | |
| data-prepper-2.12.0.pkg | 2025-12-28 10:37 | 259M | |
| datadraw-3.1.1_1.pkg | 2025-08-17 02:54 | 498K | |
| datalegreya-0.2017.0..> | 2025-12-27 21:12 | 290K | |
| datamash-1.9.pkg | 2025-12-19 12:11 | 376K | |
| datapipe-1.0_1.pkg | 2025-08-16 23:48 | 4.6K | |
| dataplaneapi-3.2.7.pkg | 2025-12-27 22:45 | 8.5M | |
| dataplot-20240806.pkg | 2025-12-28 11:13 | 17M | |
| date-3.0.4.pkg | 2025-12-18 23:57 | 119K | |
| dateutils-0.4.1_2.pkg | 2025-08-17 08:56 | 292K | |
| datovka-4.27.0.pkg | 2025-12-28 12:26 | 4.6M | |
| datum_gateway-0.4.0.pkg | 2025-12-23 14:02 | 152K | |
| dav1d-1.5.2.pkg | 2025-12-16 01:52 | 640K | |
| davical-php81-1.1.12..> | 2025-12-29 12:19 | 1.0M | |
| davical-php82-1.1.12..> | 2025-12-29 18:24 | 1.0M | |
| davical-php83-1.1.12..> | 2025-12-27 23:46 | 1.0M | |
| davical-php84-1.1.12..> | 2025-12-28 00:26 | 1.0M | |
| davical-php85-1.1.12..> | 2025-12-29 21:45 | 1.0M | |
| davix-0.8.10_2.pkg | 2025-12-18 19:00 | 558K | |
| davmail-6.1.0_1.pkg | 2025-12-29 11:29 | 21M | |
| db-1.27,2.pkg | 2025-08-21 08:52 | 10K | |
| db2latex-0.8p1_2.pkg | 2025-12-21 21:43 | 505K | |
| db5-5.3.28_9.pkg | 2025-08-13 11:00 | 13M | |
| db18-18.1.40.pkg | 2025-08-15 20:36 | 17M | |
| db48-4.8.30.0_3.pkg | 2025-08-18 20:09 | 1.2M | |
| dbacl-1.14.1_1.pkg | 2025-12-21 22:33 | 533K | |
| dbcsr-2.8.0_1.pkg | 2025-12-27 05:28 | 1.4M | |
| dbeacon-0.3.9.1_1.pkg | 2025-08-18 00:10 | 32K | |
| dbeaver-25.1.3_1.pkg | 2025-12-30 00:19 | 81M | |
| dbench-4.0_3.pkg | 2025-12-20 05:51 | 602K | |
| dbf-0.9.0_3.pkg | 2025-12-21 03:45 | 24K | |
| dbh-5.0.22_2.pkg | 2025-08-14 03:46 | 1.0M | |
| dbixx-0.0.4_4.pkg | 2025-12-27 21:40 | 40K | |
| dblatex-0.3.12_1.pkg | 2025-12-26 21:21 | 1.5M | |
| dbmail-3.5.5_1.pkg | 2025-12-23 00:22 | 363K | |
| dbow-0.7_2.pkg | 2025-12-19 16:43 | 51K | |
| dbow2-1.1.f.23_5.pkg | 2025-12-30 10:19 | 36K | |
| dbtool-1.9.1_2.pkg | 2025-12-21 09:28 | 37K | |
| dbus-1.16.2_4,1.pkg | 2025-12-16 01:43 | 311K | |
| dbus-c++-0.9.1_6.pkg | 2025-12-23 06:19 | 124K | |
| dbus-glib-0.114.pkg | 2025-12-16 01:47 | 174K | |
| dbus-java-2.7.pkg | 2025-12-29 01:19 | 191K | |
| dbus-sharp-0.8.1_3,1..> | 2025-12-19 02:15 | 78K | |
| dbus-sharp-glib-0.6.pkg | 2025-12-19 21:30 | 6.2K | |
| dbus-tcl-4.1_1.pkg | 2025-12-23 10:53 | 46K | |
| dbview-1.0.4_1.pkg | 2025-08-16 15:19 | 10K | |
| dbvis-25.3.pkg | 2025-12-29 19:57 | 164M | |
| dc3dd-7.3.1_1.pkg | 2025-12-23 11:03 | 108K | |
| dc20pack-1.0.pkg | 2025-08-22 00:23 | 18K | |
| dcc-dccd-2.3.169.pkg | 2025-08-20 19:22 | 895K | |
| dcd-0.99.2_3.pkg | 2025-08-16 06:20 | 13K | |
| dcf77pi-3.7.1.1_2.pkg | 2025-08-16 08:19 | 41K | |
| dcfldd-1.9.1_1.pkg | 2025-08-16 23:47 | 34K | |
| dclib-0.3.23_9.pkg | 2025-12-30 00:35 | 347K | |
| dclock-2.2.2_2.pkg | 2025-12-30 07:16 | 51K | |
| dcmtk-3.6.9_2.pkg | 2025-12-26 19:27 | 7.6M | |
| dconf-0.49.0.pkg | 2025-12-16 05:37 | 81K | |
| dconf-editor-45.0.1.pkg | 2025-12-26 13:43 | 587K | |
| dcp2icc-0.1_9.pkg | 2025-12-29 20:00 | 333K | |
| dcraw-9.28_4.pkg | 2025-12-27 01:24 | 174K | |
| dcraw-m-9.22_10.pkg | 2025-12-28 12:36 | 161K | |
| dcw-gmt-2.1.2.pkg | 2025-08-14 23:40 | 21M | |
| dd_package-2.2.0.pkg | 2025-08-16 01:40 | 41K | |
| dd_rescue-1.99.14.pkg | 2025-08-17 15:05 | 153K | |
| ddate-0.2.2.6_1,3.pkg | 2025-08-19 02:06 | 8.4K | |
| ddclient-3.11.2.pkg | 2025-12-21 07:49 | 59K | |
| ddfun-03.pkg | 2025-12-30 02:28 | 98K | |
| ddgr-2.2.pkg | 2025-12-21 10:44 | 29K | |
| ddh-64_27.pkg | 2025-12-30 12:25 | 367K | |
| ddns-1.0.pkg | 2025-08-18 03:36 | 29K | |
| ddosify-2.6.0_11.pkg | 2025-12-30 00:31 | 3.1M | |
| ddpt-0.97_1.pkg | 2025-08-18 17:32 | 254K | |
| ddrescue-1.27_1.pkg | 2025-08-21 09:38 | 110K | |
| ddrescueview-gtk2-0...> | 2025-12-30 00:39 | 1.1M | |
| ddrescueview-qt5-0.4..> | 2025-12-29 05:17 | 1.0M | |
| ddrescueview-qt6-0.4..> | 2025-12-29 12:33 | 1.0M | |
| de-BBBike-3.18_5.pkg | 2025-12-28 13:17 | 3.0M | |
| de-alt-aspell-2.1.1_..> | 2025-12-20 08:45 | 2.6M | |
| de-aspell-20161207_3..> | 2025-12-23 02:23 | 1.2M | |
| de-dict-1.2_1.pkg | 2025-08-22 22:38 | 751K | |
| de-ding-1.9_1.pkg | 2025-12-29 07:18 | 11M | |
| de-dtaus-0.9_1.pkg | 2025-08-18 22:51 | 31K | |
| de-eric6-21.11.pkg | 2025-08-19 19:22 | 417K | |
| de-freebsd-doc-20251..> | 2025-12-19 17:26 | 8.3M | |
| de-hunspell-20161207..> | 2025-08-17 02:30 | 291K | |
| de-hyphen-2007.02.17..> | 2025-08-18 04:50 | 24K | |
| de-jdictionary-eng-g..> | 2025-12-29 11:14 | 1.4M | |
| de-jdictionary-ger-h..> | 2025-12-30 04:09 | 550K | |
| de-libreoffice-25.8...> | 2025-12-27 10:15 | 3.5M | |
| de-mythes-2025.12.14..> | 2025-12-30 09:13 | 4.9M | |
| de-phone-1.20170802.pkg | 2025-08-16 16:55 | 39K | |
| de-schwobifyer-20050..> | 2025-08-22 21:10 | 9.8K | |
| de-tipp10-3.3.4.pkg | 2025-12-30 09:41 | 1.6M | |
| de-webalizer-2.23.8_..> | 2025-12-29 18:25 | 136K | |
| de-wordpress-de_DE-6..> | 2025-12-29 17:42 | 25M | |
| deadbeef-0.7.2_32.pkg | 2025-12-27 08:43 | 3.0M | |
| deadbeef-jack-plugin..> | 2025-12-30 14:13 | 4.7K | |
| deadbeef-mpris2-plug..> | 2025-12-30 02:58 | 12K | |
| deadbeef-musical-spe..> | 2025-12-28 18:17 | 21K | |
| deadbeef-playback-st..> | 2025-12-29 13:55 | 6.9K | |
| deadbeef-quick-searc..> | 2025-12-27 21:03 | 8.6K | |
| deadbeef-spectrogram..> | 2025-12-30 17:52 | 10K | |
| deadbeef-vu-meter-pl..> | 2025-12-29 17:29 | 28K | |
| deadbeef-waveform-se..> | 2025-12-29 20:04 | 19K | |
| deb2targz-20100710.pkg | 2025-08-15 20:49 | 929 | |
| debhelper-13.29.pkg | 2025-12-29 23:52 | 168K | |
| debian-keyring-2025...> | 2025-08-16 01:36 | 31M | |
| debootstrap-1.0.128n..> | 2025-12-23 08:40 | 34K | |
| debugedit-20170411.1..> | 2025-12-21 18:42 | 15K | |
| deco-extractor-1.6.4..> | 2025-12-23 04:11 | 13K | |
| deco-misc-3.9_6.pkg | 2025-08-18 05:17 | 85K | |
| decompyle3-3.9.3.pkg | 2025-12-20 19:00 | 356K | |
| dee-1.2.7_27.pkg | 2025-12-26 22:54 | 155K | |
| defendguin-0.0.13_1.pkg | 2025-12-23 05:45 | 9.4M | |
| deforaos-browser-0.6..> | 2025-12-26 18:36 | 173K | |
| deforaos-camera-0.3...> | 2025-12-29 03:10 | 28K | |
| deforaos-editor-0.4...> | 2025-12-28 01:03 | 26K | |
| deforaos-integration..> | 2025-12-30 12:45 | 45K | |
| deforaos-keyboard-0...> | 2025-12-27 17:43 | 24K | |
| deforaos-libdesktop-..> | 2025-12-26 15:25 | 88K | |
| deforaos-libsystem-0..> | 2025-08-13 10:33 | 132K | |
| deforaos-locker-0.4...> | 2025-12-27 13:46 | 51K | |
| deforaos-mailer-0.2...> | 2025-12-27 17:50 | 218K | |
| deforaos-notes-0.2.1..> | 2025-12-27 16:36 | 46K | |
| deforaos-panel-0.4.6..> | 2025-12-26 21:49 | 220K | |
| deforaos-pdfviewer-0..> | 2025-12-28 03:18 | 12K | |
| deforaos-phone-0.6.2..> | 2025-12-27 07:27 | 271K | |
| deforaos-player-0.2...> | 2025-12-27 15:38 | 32K | |
| deforaos-surfer-0.3...> | 2025-12-27 19:41 | 71K | |
| deforaos-todo-0.3.1.pkg | 2025-12-27 03:37 | 66K | |
| deheader-1.11.pkg | 2025-12-22 18:29 | 18K | |
| dehydrated-0.7.2.pkg | 2025-12-21 11:42 | 38K | |
| dejagnu-1.6.3_1.pkg | 2025-08-29 05:32 | 163K | |
| dejavu-2.37_3.pkg | 2025-12-24 21:49 | 2.6M | |
| delaboratory-0.8_15.pkg | 2025-12-30 06:37 | 219K | |
| delatt-1.1.3_1.pkg | 2025-12-22 20:53 | 3.3K | |
| delay-1.6_1.pkg | 2025-08-19 11:59 | 18K | |
| delegate-9.9.13_3.pkg | 2025-08-17 08:06 | 1.9M | |
| delta-2020.06.22.pkg | 2025-12-19 04:38 | 22K | |
| deltachat-desktop-2...> | 2025-12-27 21:30 | 25M | |
| deltachat-rpc-server..> | 2025-12-27 16:35 | 7.2M | |
| deltarpm-3.6_2.pkg | 2025-12-21 07:38 | 161K | |
| deltup-0.4.6_1.pkg | 2025-12-19 04:58 | 100K | |
| delve-1.25.2_3.pkg | 2025-12-19 17:32 | 4.6M | |
| demumble-1.3.0.pkg | 2025-08-19 14:58 | 227K | |
| denature-0.6.5_3.pkg | 2025-12-28 07:48 | 16K | |
| dendrite-0.14.1_4.pkg | 2025-08-21 03:31 | 49M | |
| denemo-2.0.6_20.pkg | 2025-12-30 00:07 | 13M | |
| deno-2.4.5_3.pkg | 2025-12-27 00:43 | 59M | |
| deno-dom-0.1.56_2.pkg | 2025-12-27 01:32 | 313K | |
| denominator-4.7.1.pkg | 2025-12-29 23:57 | 5.6M | |
| denyhosts-py311-3.1...> | 2025-12-20 07:50 | 82K | |
| derelict-ft-1.1.3_8.pkg | 2025-08-19 04:15 | 33K | |
| derelict-gl3-1.0.24_..> | 2025-08-17 21:55 | 194K | |
| derelict-sdl2-2.1.4_..> | 2025-08-20 17:48 | 74K | |
| derelict-util-2.1.0_..> | 2025-08-14 17:16 | 25K | |
| desed-1.2.2_11.pkg | 2025-12-28 03:19 | 390K | |
| deskflow-1.25.0.pkg | 2025-12-30 04:40 | 728K | |
| deskmenu-1.4.5_2.pkg | 2025-12-29 00:53 | 17K | |
| desktop-file-utils-0..> | 2025-12-16 05:23 | 43K | |
| desktop-installer-1...> | 2025-12-28 17:02 | 103K | |
| destroy-20130926_1.pkg | 2025-08-18 20:47 | 5.4K | |
| detex-2.8_2.pkg | 2025-08-20 20:42 | 22K | |
| detox-2.0.0.pkg | 2025-08-16 10:31 | 92K | |
| deutex-5.2.3.pkg | 2025-12-29 04:05 | 90K | |
| dev86-0.16.20_1.pkg | 2025-08-17 06:14 | 182K | |
| devctl-jail-kmod-g20..> | 2025-08-18 11:21 | 2.8K | |
| devd-0.9_37.pkg | 2025-12-24 05:02 | 3.3M | |
| devd-controller-rule..> | 2025-12-21 12:23 | 9.0K | |
| devd-mount-0.2.0_1.pkg | 2025-08-14 20:27 | 5.3K | |
| devel-replay-1.0.4.pkg | 2025-08-17 10:32 | 4.0K | |
| devfile-2.3.0_5.pkg | 2025-12-21 04:37 | 8.6M | |
| devhelp-41.2_6.pkg | 2025-12-29 05:34 | 278K | |
| devil-1.8.0_7,1.pkg | 2025-12-27 01:13 | 1.5M | |
| devilspie-0.23_2.pkg | 2025-12-30 14:16 | 46K | |
| devilspie2-0.43_3.pkg | 2025-12-30 08:31 | 34K | |
| devilutionX-1.5.4_3.pkg | 2025-12-29 10:02 | 5.6M | |
| devisor-2.1_3.pkg | 2025-12-29 18:25 | 1.1M | |
| devmon-0.3.1.b1_4.pkg | 2025-12-19 07:13 | 84K | |
| devmon-templates-200..> | 2025-12-23 19:38 | 50K | |
| devstat-0.3.3_2.pkg | 2025-08-22 00:38 | 5.5K | |
| devtodo-0.1.20_4.pkg | 2025-12-22 06:20 | 104K | |
| dexed-synth-1.0.1.pkg | 2025-12-30 10:33 | 1.7M | |
| dezoomify-rs-2.15.0_..> | 2025-12-27 23:07 | 2.9M | |
| dfc-3.1.1_1.pkg | 2025-12-20 17:18 | 39K | |
| dfshow-0.10.3.b.pkg | 2025-12-22 13:02 | 87K | |
| dftbplus-24.1_5.pkg | 2025-12-27 04:55 | 13M | |
| dftd3-3.2.0.3_1.pkg | 2025-12-29 19:15 | 336K | |
| dftd4-3.7.0.31.pkg | 2025-12-27 06:09 | 400K | |
| dfu-programmer-0.7.2..> | 2025-08-15 00:44 | 32K | |
| dfu-util-0.11_1.pkg | 2025-08-15 07:10 | 33K | |
| dfuzzer-2.5.pkg | 2025-12-22 12:51 | 24K | |
| dgd-1.4.23.pkg | 2025-08-15 01:02 | 309K | |
| dgd-kernel-1.3.4_2.pkg | 2025-08-16 11:16 | 44K | |
| dgd-lpmud-2.4.5_6.pkg | 2025-08-16 16:22 | 184K | |
| dgedit-0.10.0_1.pkg | 2025-12-30 14:50 | 177K | |
| dgen-sdl-1.33_6.pkg | 2025-12-23 11:23 | 666K | |
| dgl-1.1.2.pkg | 2025-08-14 02:20 | 2.7M | |
| dgo-libreoffice-25.8..> | 2025-12-27 02:37 | 313K | |
| dhcdrop-0.5_4.pkg | 2025-08-22 13:32 | 35K | |
| dhcp6-20080615.2_4.pkg | 2025-08-15 14:14 | 115K | |
| dhcp_probe-1.3.1_2.pkg | 2025-08-21 10:26 | 36K | |
| dhcpcd-10.3.0_1.pkg | 2025-12-23 21:07 | 180K | |
| dhcpcd-ui-0.7.9_1.pkg | 2025-12-29 03:14 | 187K | |
| dhcpd-6.6.20200413_2..> | 2025-08-20 17:21 | 79K | |
| dhcpd-pools-3.2.pkg | 2025-08-20 23:39 | 42K | |
| dhcpdump-1.8_1.pkg | 2025-08-19 21:43 | 11K | |
| dhcping-1.2_1.pkg | 2025-08-19 04:01 | 10K | |
| dhcprelya-6.1_1.pkg | 2025-08-18 13:22 | 34K | |
| dhewm3-1.5.4.pkg | 2025-12-28 13:12 | 3.4M | |
| dhex-0.69_1.pkg | 2025-08-19 08:58 | 47K | |
| dhisd-5.5.pkg | 2025-08-16 05:21 | 24K | |
| dhrystone-2.1_2.pkg | 2025-08-16 04:56 | 16K | |
| dht-0.27.pkg | 2025-08-14 03:09 | 38K | |
| di-6.2.0.pkg | 2025-12-23 20:14 | 38K | |
| dia-0.97.3_9,1.pkg | 2025-12-28 09:39 | 3.4M | |
| dia2code-0.8.8_4.pkg | 2025-12-22 16:16 | 45K | |
| diablo-5.1_3.pkg | 2025-08-18 16:27 | 1.4M | |
| diakonos-0.9.7_1.pkg | 2025-12-23 18:06 | 98K | |
| dialog4ports-0.1.6_2..> | 2025-08-22 11:03 | 11K | |
| dialog4ports-static-..> | 2025-08-20 02:06 | 10K | |
| diamond-2.1.16.pkg | 2025-12-21 01:26 | 1.7M | |
| diamond-cs-1.3.8_2.pkg | 2025-12-29 08:53 | 733K | |
| diaspora-1.1.1_3.pkg | 2025-12-30 01:07 | 1.6G | |
| dico-2.12_1.pkg | 2025-12-20 07:53 | 638K | |
| dict-1.13.3_1.pkg | 2025-12-20 00:24 | 39K | |
| dictd-1.13.3.pkg | 2025-08-15 10:56 | 92K | |
| dictem-1.0.4_24.pkg | 2025-12-29 15:37 | 30K | |
| dictem-emacs_canna-1..> | 2025-12-29 16:45 | 30K | |
| dictem-emacs_devel-1..> | 2025-12-27 22:07 | 30K | |
| dictem-emacs_devel_n..> | 2025-12-21 09:52 | 30K | |
| dictem-emacs_nox-1.0..> | 2025-12-22 06:32 | 30K | |
| dictem-emacs_wayland..> | 2025-12-29 22:01 | 30K | |
| dictfmt-1.13.3.pkg | 2025-08-20 06:17 | 26K | |
| diction-1.11_3.pkg | 2025-08-19 03:45 | 46K | |
| dictionary-1.8.7_40.pkg | 2025-12-28 10:26 | 29K | |
| dictionary-emacs_can..> | 2025-12-29 21:58 | 29K | |
| dictionary-emacs_dev..> | 2025-12-27 19:45 | 29K | |
| dictionary-emacs_dev..> | 2025-12-22 23:31 | 29K | |
| dictionary-emacs_nox..> | 2025-12-22 10:28 | 29K | |
| dictionary-emacs_way..> | 2025-12-27 21:36 | 29K | |
| dieharder-3.31.1_10.pkg | 2025-08-16 14:25 | 291K | |
| diesel-cli-2.3.3_2.pkg | 2025-12-28 16:11 | 1.6M | |
| diff-pdf-0.5.2_6.pkg | 2025-12-30 08:41 | 42K | |
| diff-so-fancy-1.4.4.pkg | 2025-12-20 06:07 | 16K | |
| diffcode-1.2.pkg | 2025-08-22 03:38 | 5.8K | |
| diffoci-0.1.7_7.pkg | 2025-12-22 03:38 | 7.4M | |
| diffsplit-1.0.pkg | 2025-12-23 08:16 | 2.4K | |
| diffstat-1.68.pkg | 2025-08-14 12:08 | 29K | |
| difftastic-0.67.0_1.pkg | 2025-12-30 15:00 | 6.9M | |
| diffutils-3.12.pkg | 2025-12-18 20:20 | 388K | |
| dify-0.6.0_26.pkg | 2025-12-29 02:55 | 682K | |
| digdag-0.10.5.1.pkg | 2025-12-29 06:31 | 78M | |
| digestpp-g20200907.pkg | 2025-08-22 17:16 | 73K | |
| digger-20020314_3.pkg | 2025-08-19 07:00 | 75K | |
| digiham-0.3.0.pkg | 2025-08-16 19:48 | 40K | |
| digikam-8.8.0_2.pkg | 2025-12-28 08:00 | 29M | |
| digital-0.31.pkg | 2025-12-28 23:57 | 3.3M | |
| digitemp-3.7.2_1.pkg | 2025-08-22 19:55 | 80K | |
| dihydrogen-0.2.1.36_..> | 2025-12-30 18:00 | 43K | |
| dijo-0.2.7_27.pkg | 2025-12-28 12:07 | 641K | |
| dikt-3_1,1.pkg | 2025-12-29 13:58 | 143K | |
| dilay-1.9.0_6.pkg | 2025-12-30 17:18 | 327K | |
| dill-2.4.1.75.pkg | 2025-12-20 00:02 | 77K | |
| dillo-3.2.0_1.pkg | 2025-12-27 18:31 | 579K | |
| dimod-0.12.21.pkg | 2025-12-19 08:05 | 20K | |
| din-59_3.pkg | 2025-12-29 22:47 | 2.7M | |
| dina-2.92_2.pkg | 2025-12-30 14:56 | 58K | |
| ding-libs-0.6.2.pkg | 2025-12-18 23:16 | 125K | |
| dinotrace-9.4f_10.pkg | 2025-12-29 01:28 | 145K | |
| dinotrace-emacs_cann..> | 2025-12-29 15:00 | 145K | |
| dinotrace-emacs_deve..> | 2025-12-30 00:16 | 145K | |
| dinotrace-emacs_deve..> | 2025-12-30 18:17 | 145K | |
| dinotrace-emacs_nox-..> | 2025-12-28 06:36 | 145K | |
| dinotrace-emacs_wayl..> | 2025-12-29 05:22 | 145K | |
| dionysus-topology-li..> | 2025-12-23 05:05 | 27K | |
| diplib-3.5.1.pkg | 2025-12-27 11:44 | 3.8M | |
| dirac-quantum-chemis..> | 2025-12-27 14:00 | 27M | |
| dirbuster-1.0r1.pkg | 2025-12-28 01:47 | 4.0M | |
| dircproxy-1.2.0.r1_3..> | 2025-08-21 18:40 | 77K | |
| dirdiff-2.1_4.pkg | 2025-12-29 16:40 | 32K | |
| direnv-2.35.0_13.pkg | 2025-12-23 16:26 | 2.7M | |
| direvent-5.3_1.pkg | 2025-12-22 12:29 | 151K | |
| direwolf-1.8.pkg | 2025-12-29 23:23 | 18M | |
| dirvish-1.2.1_4.pkg | 2025-12-23 04:10 | 27K | |
| discid-1.3_1.pkg | 2025-08-20 11:53 | 3.3K | |
| disco-1.2_2.pkg | 2025-08-20 12:49 | 22K | |
| discordo-g20220909_2..> | 2025-12-20 21:58 | 2.9M | |
| discount-3.0.1.2.pkg | 2025-12-18 16:08 | 84K | |
| discus-0.5.0_1.pkg | 2025-12-21 23:58 | 9.6K | |
| diskcheckd-20150220_..> | 2025-08-18 20:07 | 13K | |
| diskimage-tools-0.3...> | 2025-12-20 22:15 | 3.7K | |
| diskonaut-0.11.0_48.pkg | 2025-12-28 23:56 | 447K | |
| diskroaster-1.1.1.pkg | 2025-12-23 13:33 | 6.7K | |
| diskscrub-2.6.1_1.pkg | 2025-08-18 18:06 | 22K | |
| diskus-0.7.0_35.pkg | 2025-12-30 18:17 | 358K | |
| disman-0.602.0_1.pkg | 2025-12-27 11:36 | 253K | |
| dissent-0.0.34_10.pkg | 2025-12-29 10:25 | 11M | |
| distcache-1.5.1.pkg | 2025-08-22 12:05 | 195K | |
| distcc-3.4_2.pkg | 2025-12-22 08:47 | 265K | |
| distcc-gtk-3.4_2.pkg | 2025-12-30 00:59 | 278K | |
| distel-4.1.1_20.pkg | 2025-12-29 04:06 | 258K | |
| distel-emacs_canna-4..> | 2025-12-29 06:38 | 258K | |
| distel-emacs_devel-4..> | 2025-12-28 21:52 | 258K | |
| distel-emacs_devel_n..> | 2025-12-20 06:23 | 258K | |
| distel-emacs_nox-4.1..> | 2025-12-23 04:09 | 258K | |
| distel-emacs_wayland..> | 2025-12-29 01:25 | 258K | |
| distilator-1.5.0.pkg | 2025-12-30 14:14 | 2.7K | |
| distorm-20121220.r23..> | 2025-08-19 11:51 | 50K | |
| diswall-0.6.0_11.pkg | 2025-12-29 06:53 | 1.5M | |
| ditaa-0.11.0.pkg | 2025-12-28 03:09 | 11M | |
| dive-0.13.1_1.pkg | 2025-12-21 06:28 | 3.2M | |
| divide-and-succeed-0..> | 2025-12-27 22:14 | 84K | |
| django-recaptcha-4.0..> | 2025-12-23 20:57 | 29K | |
| djgpp-binutils-2.17_..> | 2025-08-19 04:51 | 1.3M | |
| djview-4.12_4.pkg | 2025-12-28 03:13 | 583K | |
| djvulibre-3.5.29.pkg | 2025-12-26 19:04 | 3.0M | |
| dk-milter-1.0.2_7.pkg | 2025-08-17 10:21 | 81K | |
| dkfilter-0.11_1.pkg | 2025-12-24 07:09 | 19K | |
| dkftpbench-0.45_2.pkg | 2025-08-16 22:11 | 20K | |
| dkh-1.2_6.pkg | 2025-12-28 19:51 | 45K | |
| dkimproxy-1.4.1_2.pkg | 2025-12-23 06:23 | 25K | |
| dkns-1.100_1.pkg | 2025-12-22 11:30 | 30K | |
| dlang-tools-2.101.0_..> | 2025-08-16 17:26 | 1.4M | |
| dlib-cpp-20.0_1.pkg | 2025-12-26 19:16 | 2.3M | |
| dlib-models-20210513..> | 2025-08-14 09:34 | 321M | |
| dlint-1.4.3.pkg | 2025-12-30 12:03 | 13K | |
| dlmalloc-2.8.6.pkg | 2025-08-22 07:56 | 25K | |
| dlpack-1.0.pkg | 2025-12-23 10:38 | 6.7K | |
| dma-0.14,1.pkg | 2025-08-19 08:42 | 37K | |
| dmachine-0.25.pkg | 2025-12-29 17:16 | 58K | |
| dmake-4.13.1_1,1.pkg | 2025-08-13 22:27 | 97K | |
| dmalloc-5.6.5.pkg | 2025-08-16 05:29 | 161K | |
| dmarcts-report-parse..> | 2025-12-22 09:24 | 14K | |
| dmarcts-report-viewe..> | 2025-12-29 10:52 | 64K | |
| dmenu-5.1.pkg | 2025-12-26 20:35 | 17K | |
| dmenu-translate-g202..> | 2025-12-29 17:15 | 2.4K | |
| dmenu-wayland-0.1_1.pkg | 2025-12-28 11:01 | 17K | |
| dmenu2-0.2.pkg | 2025-12-30 18:31 | 18K | |
| dmg2img-1.6.7.pkg | 2025-08-17 09:12 | 16K | |
| dmidecode-3.6.pkg | 2025-08-13 15:01 | 75K | |
| dmidiplayer-1.7.3.pkg | 2025-12-30 03:51 | 505K | |
| dmjava-1.05_2.pkg | 2025-12-30 08:01 | 12M | |
| dmlc-core-0.5.27.pkg | 2025-08-14 07:19 | 276K | |
| dmtx-utils-0.7.6_3.pkg | 2025-12-30 04:54 | 21K | |
| dnetc-2.9112.521,1.pkg | 2025-08-16 21:27 | 908K | |
| dnf-4.24.0.pkg | 2025-12-30 06:25 | 602K | |
| dns-blackhole-0.1.0.pkg | 2025-12-23 03:05 | 4.6K | |
| dns-ui-v0.2.8.pkg | 2025-12-29 17:02 | 476K | |
| dns2blackhole-0.1_1.pkg | 2025-08-20 16:50 | 11K | |
| dns2tcp-0.5.2_1.pkg | 2025-08-16 08:04 | 39K | |
| dnsblast-0.0.2016060..> | 2025-08-19 01:09 | 5.2K | |
| dnscap-2.5.0,1.pkg | 2025-12-28 00:06 | 127K | |
| dnscontrol-4.29.0.pkg | 2025-12-30 15:09 | 13M | |
| dnscrypt-proxy2-2.1...> | 2025-12-24 07:03 | 3.7M | |
| dnscrypt-wrapper-0.4..> | 2025-08-18 06:42 | 30K | |
| dnsdbck-1.01.pkg | 2025-12-22 04:07 | 11K | |
| dnsdbflex-1.0.7.pkg | 2025-12-21 20:34 | 21K | |
| dnsdbq-2.6.7.pkg | 2025-12-24 02:00 | 43K | |
| dnsdist-2.0.1_4.pkg | 2025-12-30 16:45 | 3.2M | |
| dnsenum-1.2.4.2.pkg | 2025-12-21 16:31 | 19K | |
| dnsflood-1.20.pkg | 2025-08-17 04:16 | 11K | |
| dnshistory-1.3_3.pkg | 2025-08-20 18:09 | 29K | |
| dnsjava-2.1.9.pkg | 2025-08-15 03:05 | 448K | |
| dnsjit-1.4.0_1.pkg | 2025-12-19 04:58 | 162K | |
| dnsmap-0.30.pkg | 2025-08-20 02:19 | 18K | |
| dnsmasq-2.91_2,1.pkg | 2025-12-18 12:48 | 402K | |
| dnsmasq-devel-2.92.r..> | 2025-12-29 03:20 | 410K | |
| dnsmax-perl-1.0.1.pkg | 2025-12-21 10:55 | 12K | |
| dnsperf-2.14.0.pkg | 2025-12-29 20:02 | 69K | |
| dnsproxy-1.17_5.pkg | 2025-08-16 10:21 | 9.8K | |
| dnsrecon-0.10.1_3.pkg | 2025-12-30 03:04 | 479K | |
| dnsreflector-1.02_1.pkg | 2025-08-18 04:17 | 7.2K | |
| dnssec-rr-0.2.pkg | 2025-08-20 13:44 | 35K | |
| dnst-0.1.0.r2_3.pkg | 2025-12-27 17:14 | 4.6M | |
| dnstable-0.14.0_2.pkg | 2025-12-19 20:50 | 90K | |
| dnstable-convert-0.1..> | 2025-12-21 17:30 | 17K | |
| dnstop-20140915_1.pkg | 2025-08-15 23:31 | 25K | |
| dnstracer-1.10.pkg | 2025-08-19 01:19 | 16K | |
| dnstracer-rs-1.1.9_1..> | 2025-12-30 05:56 | 672K | |
| dnsutl-1.12_3.pkg | 2025-12-20 17:07 | 157K | |
| dnsviz-0.9.4_3.pkg | 2025-12-30 17:57 | 596K | |
| dnswalk-2.0.2_4.pkg | 2025-12-20 17:58 | 13K | |
| dnswall-0.1.4_1.pkg | 2025-08-19 13:06 | 5.3K | |
| dnsx-1.2.3.pkg | 2025-12-20 10:11 | 8.4M | |
| doas-6.3p13.pkg | 2025-12-21 07:47 | 23K | |
| dobutsu-6.pkg | 2025-12-21 15:23 | 27M | |
| doc-2.2.3_1.pkg | 2025-12-29 00:49 | 20K | |
| doc-mode.el-1.1_33.pkg | 2025-12-30 11:39 | 3.2K | |
| doc-mode.el-emacs_ca..> | 2025-12-30 06:11 | 3.2K | |
| doc-mode.el-emacs_de..> | 2025-12-30 10:10 | 3.2K | |
| doc-mode.el-emacs_de..> | 2025-12-23 00:20 | 3.2K | |
| doc-mode.el-emacs_no..> | 2025-12-21 12:29 | 3.2K | |
| doc-mode.el-emacs_wa..> | 2025-12-30 10:51 | 3.2K | |
| docbook-1.5.pkg | 2025-08-10 21:08 | 610 | |
| docbook-sgml-4.5_1.pkg | 2025-08-10 21:08 | 136K | |
| docbook-to-man-1.0_4..> | 2025-12-18 23:00 | 54K | |
| docbook-utils-0.6.14..> | 2025-12-27 00:18 | 53K | |
| docbook-xml-5.0_3.pkg | 2025-08-10 21:08 | 549K | |
| docbook-xsd-1.0.b1.pkg | 2025-08-22 07:25 | 16K | |
| docbook-xsl-1.79.1_1..> | 2025-08-10 21:09 | 20M | |
| docbook-xsl-ns-1.79...> | 2025-08-10 21:45 | 20M | |
| docbook2X-0.8.8_7.pkg | 2025-12-19 08:39 | 230K | |
| docbook2mdoc-1.1.0_2..> | 2025-08-13 11:49 | 64K | |
| docbookrx-1.0.0.d.pkg | 2025-12-22 07:42 | 314K | |
| docear-1.2.0_1.pkg | 2025-12-29 06:32 | 56M | |
| docker-18.09.5_33.pkg | 2025-12-21 17:14 | 12M | |
| docker-compose-1.24...> | 2025-12-28 01:23 | 251K | |
| docker-credential-pa..> | 2025-12-28 12:04 | 807K | |
| docker-machine-0.16...> | 2025-12-23 17:07 | 5.6M | |
| docker-registry-2.8...> | 2025-12-22 10:20 | 6.0M | |
| docker-tray-1.5_8.pkg | 2025-12-23 18:17 | 8.1K | |
| docopt.cpp-0.6.3.5.pkg | 2025-08-15 09:04 | 100K | |
| docproj-4.1.9_1.pkg | 2025-12-26 20:05 | 904 | |
| docproj-fonts-cjk-20..> | 2025-08-14 00:24 | 13M | |
| docsis-0.9.8.pkg | 2025-12-27 23:22 | 282K | |
| doctest-2.4.11.pkg | 2025-08-18 23:46 | 61K | |
| doctl-1.147.0.pkg | 2025-12-20 17:02 | 6.9M | |
| doctorj-5.1.2_4.pkg | 2025-12-30 17:06 | 296K | |
| dodgindiamond2-0.2.2..> | 2025-12-29 23:25 | 176K | |
| doggo-1.1.2_2,1.pkg | 2025-12-20 08:56 | 4.1M | |
| doggo-webui-1.1.2_2,..> | 2025-12-24 05:01 | 3.3M | |
| doh-proxy-0.9.15_2.pkg | 2025-12-28 20:36 | 1.1M | |
| doinkd-0.02_1.pkg | 2025-08-19 08:57 | 26K | |
| dojo-1.12.3.pkg | 2025-08-20 23:46 | 5.6M | |
| dokuwiki-php81-20250..> | 2025-12-29 00:36 | 3.1M | |
| dokuwiki-php82-20250..> | 2025-12-30 01:42 | 3.1M | |
| dokuwiki-php83-20250..> | 2025-12-29 22:45 | 3.1M | |
| dokuwiki-php84-20250..> | 2025-12-30 06:40 | 3.1M | |
| dokuwiki-php85-20250..> | 2025-12-29 13:44 | 3.1M | |
| dolibarr-22.0.2.pkg | 2025-12-29 16:52 | 49M | |
| dolibarr16-16.0.5.pkg | 2025-12-29 19:25 | 36M | |
| dolibarr17-17.0.4.pkg | 2025-12-30 02:14 | 42M | |
| dolibarr18-18.0.8.pkg | 2025-12-29 18:25 | 42M | |
| dolibarr19-19.0.4.pkg | 2025-12-29 12:40 | 44M | |
| dolibarr20-20.0.4.pkg | 2025-12-29 18:54 | 44M | |
| dolibarr21-21.0.4.pkg | 2025-12-27 21:12 | 44M | |
| dolphin-25.12.0.pkg | 2025-12-26 21:38 | 4.7M | |
| dolphin-emu-2509_4.pkg | 2025-12-28 22:11 | 17M | |
| dolphin-plugins-25.1..> | 2025-12-27 13:00 | 492K | |
| domination-1.2.5.pkg | 2025-12-29 19:30 | 16M | |
| domino-chain-1.1_14.pkg | 2025-12-28 06:36 | 34M | |
| domoticz-2025.2.pkg | 2025-12-22 01:51 | 10M | |
| domoticz-devel-2025...> | 2025-12-22 04:44 | 10M | |
| dontspace-1.2_5.pkg | 2025-12-30 00:39 | 34K | |
| dooble-2025.11.25.pkg | 2025-12-30 17:18 | 20M | |
| doom-data-1.0_1.pkg | 2025-08-14 06:01 | 1.5M | |
| doom-freedoom-0.12.1..> | 2025-08-17 06:25 | 16M | |
| doom-hacx-1.0.pkg | 2025-08-18 07:08 | 7.5M | |
| doom-hr-1.0_1.pkg | 2025-08-18 10:30 | 2.9M | |
| doom-hr2-1.0.pkg | 2025-08-18 04:15 | 2.1M | |
| doom-wolfendoom-1.0.pkg | 2025-08-21 13:12 | 28M | |
| doomlegacy-1.48.14,1..> | 2025-12-20 04:29 | 1.5M | |
| doomsday-2.3.1_8.pkg | 2025-12-28 20:53 | 35M | |
| dorst-0.19.5_3.pkg | 2025-12-30 05:44 | 617K | |
| dorst-gtk-0.19.5_3.pkg | 2025-12-28 00:45 | 942K | |
| dos2ansi-2.0.pkg | 2025-12-29 01:20 | 42K | |
| dos2ansi-nox11-2.0.pkg | 2025-08-18 23:10 | 33K | |
| dos2unix-7.5.3.pkg | 2025-12-20 02:04 | 400K | |
| dosage-3.0_3.pkg | 2025-12-28 07:45 | 357K | |
| dosbox-0.74.3_1.pkg | 2025-12-30 08:18 | 847K | |
| dosbox-staging-0.82...> | 2025-12-28 18:38 | 2.2M | |
| dosbox-x-2025.12.01_..> | 2025-12-30 05:56 | 15M | |
| dosunix-1.0.14.pkg | 2025-08-18 05:19 | 5.8K | |
| dot-forward-0.71_2.pkg | 2025-08-14 11:21 | 19K | |
| dotconf-1.4.1_1.pkg | 2025-08-10 23:55 | 37K | |
| dotdotpwn-3.0.2_2.pkg | 2025-12-21 00:53 | 34K | |
| dotenv-linter-4.0.0_..> | 2025-12-30 14:04 | 1.2M | |
| dothttp-0.10.0_7.pkg | 2025-12-29 03:32 | 2.7M | |
| dotnet-9.0.10.pkg | 2025-12-27 14:36 | 719M | |
| dotnet-host-9.0.10.pkg | 2025-12-18 23:51 | 38K | |
| dotnet8-8.0.20.pkg | 2025-12-29 09:44 | 128M | |
| double-conversion-3...> | 2025-08-10 21:30 | 52K | |
| doublecmd-gtk2-1.1.3..> | 2025-12-28 02:49 | 21M | |
| doublecmd-qt5-1.1.30..> | 2025-12-30 16:42 | 21M | |
| doublecmd-qt6-1.1.30..> | 2025-12-29 13:11 | 21M | |
| dovecot-2.3.21.1_3.pkg | 2025-12-19 16:20 | 4.7M | |
| dovecot-coi-2.3.9_4.pkg | 2025-12-23 14:45 | 69K | |
| dovecot-fts-elastic-..> | 2025-12-21 12:15 | 21K | |
| dovecot-fts-flatcurv..> | 2025-12-20 23:30 | 53K | |
| dovecot-fts-flatcurv..> | 2025-12-21 19:45 | 53K | |
| dovecot-fts-flatcurv..> | 2025-12-22 02:57 | 53K | |
| dovecot-fts-xapian-1..> | 2025-12-22 19:29 | 71K | |
| dovecot-mysql-2.3.21..> | 2025-12-19 14:17 | 4.7M | |
| dovecot-pgsql-2.3.21..> | 2025-12-19 17:30 | 4.7M | |
| dovecot-pigeonhole-0..> | 2025-12-22 08:48 | 701K | |
| dovecot-pigeonhole-m..> | 2025-12-21 04:16 | 701K | |
| dovecot-pigeonhole-p..> | 2025-12-23 02:56 | 701K | |
| dovecot-xaps-g202106..> | 2025-12-21 03:39 | 9.2K | |
| dovi_tool-2.1.2_11.pkg | 2025-12-29 12:24 | 1.4M | |
| downtimed-1.0_1.pkg | 2025-08-15 22:52 | 14K | |
| doxx-0.1.1_4.pkg | 2025-12-30 06:11 | 2.0M | |
| doxygen-1.9.6_3,2.pkg | 2025-12-26 05:27 | 6.9M | |
| dparser-1.33_1.pkg | 2025-08-22 18:14 | 168K | |
| dpdk20.11-20.11.8.14..> | 2025-12-23 12:14 | 7.3M | |
| dpdk22.11-22.11.2.14..> | 2025-12-19 22:19 | 8.4M | |
| dpf-plugins-lv2-1.7_..> | 2025-12-28 08:26 | 9.1M | |
| dpinger-3.4.pkg | 2025-12-21 07:12 | 10K | |
| dpkg-1.19.8_1.pkg | 2025-12-19 05:50 | 2.4M | |
| dpp-discord-10.1.3.pkg | 2025-12-29 17:09 | 1.5M | |
| dps8m-3.1.0.pkg | 2025-08-18 23:07 | 395K | |
| dq-20250201.pkg | 2025-08-21 05:10 | 115K | |
| dqfun-03.pkg | 2025-12-28 00:31 | 121K | |
| dra-0.9.1_1.pkg | 2025-12-30 08:21 | 1.2M | |
| draco-3d-compression..> | 2025-08-13 09:58 | 811K | |
| dragon-1.5.6.pkg | 2025-12-29 15:35 | 96K | |
| dragon-player-25.12...> | 2025-12-26 21:47 | 161K | |
| dragonfly-reverb-3.2..> | 2025-12-27 20:45 | 1.1M | |
| drawing-1.0.2_3.pkg | 2025-12-27 22:15 | 4.6M | |
| drawio-28.0.6_15.pkg | 2025-12-30 02:53 | 99M | |
| drawterm-20230903.pkg | 2025-08-18 18:08 | 293K | |
| dreamchess-0.3.0_5.pkg | 2025-12-30 18:55 | 78M | |
| drg2sbg-2.2.1.pkg | 2025-08-21 06:09 | 11K | |
| drgeo-1.1.0_27.pkg | 2025-12-29 15:42 | 521K | |
| driftnet-1.6.0.pkg | 2025-12-30 17:14 | 39K | |
| drill-0.8.3_22.pkg | 2025-12-29 05:33 | 1.4M | |
| drjava-20140826.r576..> | 2025-12-27 21:27 | 11M | |
| drm-61-kmod-6.1.128...> | 2025-12-19 00:33 | 3.5M | |
| drm-515-kmod-5.15.16..> | 2025-12-19 19:36 | 3.0M | |
| drm-kmod-20250428.pkg | 2025-12-22 09:44 | 895 | |
| drm_info-2.9.0.pkg | 2025-12-29 18:13 | 24K | |
| drogon-1.9.11.pkg | 2025-08-22 00:14 | 813K | |
| droid-fonts-ttf-2013..> | 2025-12-26 18:46 | 4.2M | |
| droidcam-2.1.4_1.pkg | 2025-12-28 05:53 | 34K | |
| drool-2.0.0_1.pkg | 2025-12-21 07:27 | 13K | |
| dropbear-2025.89.pkg | 2025-12-28 03:12 | 165K | |
| dropbox-api-command-..> | 2025-12-21 16:59 | 15K | |
| dropbox-uploader-1.0..> | 2025-12-29 06:24 | 11K | |
| drumgizmo-0.9.19_3.pkg | 2025-12-27 20:51 | 514K | |
| drumkv1-lv2-1.3.2.pkg | 2025-12-29 07:31 | 392K | |
| drumpiler-0.9.0_7.pkg | 2025-12-21 00:05 | 8.6K | |
| drumstick-2.10.0.pkg | 2025-12-27 11:33 | 566K | |
| drupal7-7.98.pkg | 2025-12-27 03:37 | 2.5M | |
| drupal7-wysiwyg-7.x...> | 2025-12-28 07:24 | 96K | |
| drupal10-10.5.4.pkg | 2025-12-28 02:32 | 16M | |
| drupal11-11.2.8.pkg | 2025-12-30 08:08 | 15M | |
| drush-php81-8.4.12.pkg | 2025-12-28 10:39 | 1.2M | |
| drush-php82-8.4.12.pkg | 2025-12-28 14:32 | 1.2M | |
| drush-php83-8.4.12.pkg | 2025-12-28 09:54 | 1.2M | |
| drush-php84-8.4.12.pkg | 2025-12-29 19:57 | 1.2M | |
| drush-php85-8.4.12.pkg | 2025-12-30 16:55 | 1.2M | |
| dsb-libreoffice-25.8..> | 2025-12-27 19:41 | 3.4M | |
| dsbautostart-1.2_1.pkg | 2025-12-30 09:02 | 30K | |
| dsbbatmon-1.0.6_1.pkg | 2025-12-30 05:16 | 30K | |
| dsbdriverd-1.1_1.pkg | 2025-12-29 18:25 | 31K | |
| dsblogoutmgr-1.3.2_2..> | 2025-12-30 10:44 | 30K | |
| dsbmc-1.2_1.pkg | 2025-12-30 08:57 | 58K | |
| dsbmc-cli-0.4_1.pkg | 2025-12-30 09:28 | 17K | |
| dsbmd-1.12.pkg | 2025-12-27 06:04 | 44K | |
| dsbmixer-2.0.pkg | 2025-12-27 20:51 | 90K | |
| dsbsu-0.2_2.pkg | 2025-12-29 12:51 | 20K | |
| dsbwrtsysctl-0.1.5.pkg | 2025-08-15 18:16 | 4.2K | |
| dsbxinput-0.1.2.pkg | 2025-12-28 23:25 | 8.9K | |
| dsc-2.15.2.pkg | 2025-12-21 19:44 | 111K | |
| dsd-1.6.0_1.pkg | 2025-08-18 05:39 | 35K | |
| dsdp-5.8_8.pkg | 2025-12-27 10:46 | 336K | |
| dseg-0.46.pkg | 2025-12-29 08:44 | 83K | |
| dspam-3.10.2_11.pkg | 2025-12-28 09:55 | 414K | |
| dspdfviewer-1.15.1_7..> | 2025-12-30 09:30 | 80K | |
| dsr-pdb-1.0.3_17.pkg | 2025-12-22 20:17 | 216K | |
| dssi-1.1.1_13.pkg | 2025-12-26 18:58 | 60K | |
| dssim-3.2.4_29.pkg | 2025-12-28 13:17 | 899K | |
| dssp-4.4.11_2.pkg | 2025-12-21 07:33 | 621K | |
| dsssl-docbook-modula..> | 2025-08-13 17:44 | 336K | |
| dstask-0.26_27.pkg | 2025-12-21 19:54 | 3.3M | |
| dsvpn-0.1.4.pkg | 2025-08-22 15:57 | 11K | |
| dsymbol-0.14.1_4.pkg | 2025-08-16 17:25 | 361K | |
| dtach-0.9_1.pkg | 2025-08-21 20:28 | 14K | |
| dtc-1.7.1.pkg | 2025-08-13 15:25 | 100K | |
| dtcp-20130602_5.pkg | 2025-12-23 04:49 | 22K | |
| dtcpclient-20151002_..> | 2025-08-18 02:17 | 15K | |
| dtd-catalogs-1.2.pkg | 2025-08-21 14:07 | 865 | |
| dtd2relax-1.1.1_2.pkg | 2025-12-30 14:13 | 239K | |
| dtdparse-2.00_1.pkg | 2025-12-22 17:23 | 53K | |
| dte-1.11.1.pkg | 2025-12-20 05:24 | 175K | |
| dtmfdial-0.2.pkg | 2025-08-20 20:26 | 7.0K | |
| dtool-0.12.0_34.pkg | 2025-12-29 04:46 | 1.1M | |
| dtpstree-1.0.3_1.pkg | 2025-08-17 05:39 | 18K | |
| dtrace-toolkit-1.0_1..> | 2025-12-21 04:35 | 481K | |
| dtse-1.3_2.pkg | 2025-12-22 12:32 | 90K | |
| dtv-scan-tables-2025..> | 2025-12-20 03:24 | 628K | |
| du2ps-3.1_1.pkg | 2025-08-20 13:31 | 21K | |
| dua-cli-2.32.2_1.pkg | 2025-12-28 01:30 | 831K | |
| dual-dhclient-1.0_1.pkg | 2025-12-23 17:56 | 1.0K | |
| dual-dhclient-daemon..> | 2025-12-20 17:31 | 3.3K | |
| dub-1.40.0_1.pkg | 2025-08-13 14:43 | 1.3M | |
| duckdb-1.3.2.pkg | 2025-08-14 17:14 | 45M | |
| duel-0.98_11.pkg | 2025-12-29 09:47 | 1.8M | |
| duf-0.9.1_2.pkg | 2025-12-23 01:45 | 1.0M | |
| duff-0.5.2_3.pkg | 2025-12-23 16:32 | 22K | |
| dufs-0.44.0_4.pkg | 2025-12-30 16:39 | 1.7M | |
| duhdraw-2.8.13.pkg | 2025-08-17 16:04 | 27K | |
| duktape-2.7.0.pkg | 2025-08-19 00:46 | 210K | |
| duktape-lib-2.7.0_1.pkg | 2025-12-16 01:29 | 251K | |
| dumb-0.9.3_5.pkg | 2025-08-17 06:05 | 118K | |
| dumb-allegro-0.9.3_5..> | 2025-12-27 09:57 | 132K | |
| dumbpipe-0.32.0_2.pkg | 2025-12-27 23:15 | 2.7M | |
| dump1090-20200718_1.pkg | 2025-08-18 06:55 | 27K | |
| dumpasn1-20210212.pkg | 2025-08-22 01:23 | 52K | |
| duncan-0.4_2.pkg | 2025-12-27 12:41 | 1.3M | |
| dune-alugrid-2.8.0_1..> | 2025-12-27 10:31 | 3.4M | |
| dune-common-2.8.0_17..> | 2025-12-26 16:38 | 362K | |
| dune-curvedgeometry-..> | 2025-12-30 07:18 | 13K | |
| dune-foamgrid-2.8.0_..> | 2025-12-27 15:58 | 539K | |
| dune-functions-2.8.0..> | 2025-12-27 09:56 | 1.8M | |
| dune-geometry-2.8.0_..> | 2025-12-26 18:42 | 917K | |
| dune-grid-2.8.0_15.pkg | 2025-12-26 23:02 | 8.3M | |
| dune-grid-glue-2.8.0..> | 2025-12-28 13:10 | 956K | |
| dune-istl-2.8.0_13.pkg | 2025-12-27 00:49 | 1.4M | |
| dune-localfunctions-..> | 2025-12-27 01:14 | 4.5M | |
| dune-metagrid-g20210..> | 2025-12-28 10:07 | 76K | |
| dune-multidomaingrid..> | 2025-12-30 06:34 | 1.2M | |
| dune-pdelab-2.7.0.20..> | 2025-12-30 01:42 | 23M | |
| dune-polygongrid-2.8..> | 2025-12-27 19:24 | 31K | |
| dune-spgrid-2.8.0_2.pkg | 2025-12-27 12:47 | 1.3M | |
| dune-typetree-2.8.0_..> | 2025-12-27 01:23 | 412K | |
| dune-uggrid-2.8.0_15..> | 2025-12-26 20:02 | 541K | |
| dune-vtk-2.8.0_28.pkg | 2025-12-29 18:12 | 1.4M | |
| dunelegacy-0.96.4_5.pkg | 2025-12-29 11:00 | 1.7M | |
| dungeon-3.2_2.pkg | 2025-08-16 05:52 | 611K | |
| dungeoncrawl-4.0.0.b..> | 2025-08-17 07:07 | 565K | |
| dunst-1.13.0.pkg | 2025-12-27 06:23 | 112K | |
| duo-2.1.0.pkg | 2025-08-18 23:28 | 81K | |
| duo_openvpn-2.5.pkg | 2025-12-28 06:53 | 9.6K | |
| dupd-1.7_1.pkg | 2025-12-24 04:55 | 77K | |
| dupl-1.0.0.11_34.pkg | 2025-12-23 16:22 | 954K | |
| duplicity-3.0.6.3.pkg | 2025-12-27 16:41 | 775K | |
| duplo-0.2.0.pkg | 2025-08-16 03:27 | 25K | |
| duply-2.5.1_1.pkg | 2025-12-28 12:19 | 32K | |
| dupmerge-1.73_1.pkg | 2025-08-18 03:25 | 11K | |
| dura-0.2.0_32.pkg | 2025-12-30 02:05 | 707K | |
| durden-0.6.1_1.pkg | 2025-12-29 08:43 | 3.0M | |
| durdraw-0.29.0.pkg | 2025-12-30 12:05 | 426K | |
| dust-1.2.3_4.pkg | 2025-12-30 02:46 | 872K | |
| dust3d-1.0.0.r.6_1.pkg | 2025-12-30 17:37 | 12M | |
| dustrac-2.1.1_1.pkg | 2025-12-28 00:39 | 4.3M | |
| dutree-0.2.15_23.pkg | 2025-12-28 14:11 | 432K | |
| dv2sub-0.3_6.pkg | 2025-12-23 13:27 | 9.4K | |
| dvb-apps-1.1.2.1505_..> | 2025-08-16 14:32 | 266K | |
| dvbsnoop-1.4.50_1.pkg | 2025-08-22 03:36 | 111K | |
| dvd+rw-tools-7.1_4.pkg | 2025-12-27 02:02 | 84K | |
| dvd-slideshow-0.8.6...> | 2025-12-29 22:24 | 104K | |
| dvdauthor-0.7.2.2021..> | 2025-12-26 18:29 | 176K | |
| dvdbackup-0.4.2_8.pkg | 2025-12-23 03:42 | 41K | |
| dvdid-0.2.0a_2.pkg | 2025-08-16 08:58 | 35K | |
| dvdimagecmp-0.3.pkg | 2025-08-21 17:59 | 4.6K | |
| dvdisaster-0.79.10_1..> | 2025-12-28 12:37 | 3.4M | |
| dvdisaster-nox11-0.7..> | 2025-12-24 00:43 | 401K | |
| dvdread-g20160701_2.pkg | 2025-12-22 10:41 | 6.7K | |
| dvdvideo-py311-20130..> | 2025-12-22 17:14 | 25K | |
| dvi2tty-5.3.4_1.pkg | 2025-08-16 04:13 | 26K | |
| dvips2ascii-1.3.pkg | 2025-08-16 22:44 | 3.3K | |
| dvisvg-0.7.1.d_11.pkg | 2025-12-28 02:14 | 19K | |
| dvorak7min-1.6.1_1.pkg | 2025-08-16 00:56 | 18K | |
| dvtm-0.15_1.pkg | 2025-08-17 09:23 | 31K | |
| dwarf2json-g20220807..> | 2025-12-20 16:00 | 1.0M | |
| dwarfdump-20161124_1..> | 2025-08-15 12:12 | 182K | |
| dwarves-1.19_3.pkg | 2025-12-29 12:44 | 180K | |
| dwatch-0.1.1_2.pkg | 2025-08-19 14:42 | 5.1K | |
| dwatch-gource-0.9.pkg | 2025-08-16 17:50 | 9.2K | |
| dwatch-json-1.2.pkg | 2025-08-18 05:22 | 29K | |
| dwatch-pwsnoop-0.1.1..> | 2025-08-20 14:45 | 1.9K | |
| dwave-preprocessing-..> | 2025-12-21 19:39 | 24K | |
| dwdiff-2.1.4_8.pkg | 2025-12-20 22:33 | 73K | |
| dwl-0.7_2.pkg | 2025-12-29 04:38 | 32K | |
| dwlb-s20250520.pkg | 2025-12-30 14:14 | 21K | |
| dwm-6.6.pkg | 2025-12-27 17:50 | 24K | |
| dwmblocks-g20240823.pkg | 2025-08-16 09:12 | 3.8K | |
| dwz-0.14_1.pkg | 2025-08-16 03:10 | 103K | |
| dxa65-0.1.5_1.pkg | 2025-08-17 15:25 | 22K | |
| dxirc-1.40.1.pkg | 2025-12-27 22:30 | 1.1M | |
| dxpc-3.9.2_1.pkg | 2025-08-16 17:40 | 64K | |
| dxx-rebirth-20250329..> | 2025-12-30 03:48 | 1.0M | |
| dyff-1.10.2_5.pkg | 2025-12-22 05:10 | 2.6M | |
| dymo-cups-drivers-1...> | 2025-12-23 03:56 | 48K | |
| dynamic_motd-1.4.pkg | 2025-08-18 13:36 | 5.8K | |
| dynamips-community-0..> | 2025-08-19 09:00 | 283K | |
| dynare-5.4_14.pkg | 2025-12-29 23:58 | 4.5M | |
| dyncall-1.4_1.pkg | 2025-08-18 16:03 | 34K | |
| dynip-0.0_1.pkg | 2025-08-18 16:13 | 6.2K | |
| dynomite-0.7.0.pkg | 2025-08-17 23:51 | 183K | |
| dz-libreoffice-25.8...> | 2025-12-27 18:40 | 2.9M | |
| dz6-0.4.1_1.pkg | 2025-12-30 09:37 | 1.1M | |
| dzen2-0.9.5.pkg | 2025-12-27 12:39 | 27K | |
| dzip-2.9.pkg | 2025-08-16 13:23 | 43K | |
| e-antic-2.1.0_2.pkg | 2025-12-27 20:43 | 172K | |
| e00compr-1.0.1.pkg | 2025-08-16 22:04 | 20K | |
| e2fsprogs-1.47.3.pkg | 2025-12-23 10:21 | 466K | |
| e2fsprogs-core-1.47...> | 2025-12-18 18:57 | 1.5M | |
| e2guardian-5.3.4_3.pkg | 2025-12-29 05:52 | 530K | |
| e2tools-0.1.2.pkg | 2025-12-20 11:16 | 28K | |
| e16-themes-1.0.3.pkg | 2025-12-21 21:55 | 7.0M | |
| e93-1.4.3.pkg | 2025-09-01 08:44 | 202K | |
| e107-2.3.3.pkg | 2025-12-29 02:51 | 10M | |
| eaglemode-0.96.3_3.pkg | 2025-12-29 00:50 | 15M | |
| eastl-3.21.23.pkg | 2025-08-18 10:47 | 494K | |
| easy-profiler-2.1.0...> | 2025-12-29 09:18 | 427K | |
| easy-rsa-3.2.5_1,1.pkg | 2025-12-26 23:48 | 74K | |
| easydiff-0.4.0_11.pkg | 2025-12-27 16:37 | 33K | |
| easyexif-1.0.pkg | 2025-08-13 23:16 | 19K | |
| easygit-0.98.pkg | 2025-12-20 23:25 | 56K | |
| easylatex-0.080.pkg | 2025-12-20 14:43 | 22K | |
| easyloggingpp-9.97.1..> | 2025-08-18 16:17 | 128K | |
| easyrpg-player-0.8.1..> | 2025-12-30 00:15 | 1.6M | |
| easystroke-0.6.0.9_1..> | 2025-12-29 05:56 | 289K | |
| easytag-2.4.3_13.pkg | 2025-12-30 07:22 | 673K | |
| eawpats-12_4.pkg | 2025-08-14 03:10 | 29M | |
| eawplus-12.1_3.pkg | 2025-08-19 08:40 | 3.6M | |
| ebnf2yacc-0.1.1.pkg | 2025-08-16 14:45 | 31K | |
| eboard-1.1.3_2.pkg | 2025-12-28 15:19 | 1.3M | |
| ebook-tools-0.2.2_9.pkg | 2025-12-18 06:32 | 24K | |
| ebook2cw-0.8.5.pkg | 2025-12-22 00:51 | 21K | |
| ebsnvme-id-1.0.3_1.pkg | 2025-08-15 02:21 | 6.4K | |
| ebsynth-0.0.0.201905..> | 2025-08-16 04:28 | 508K | |
| ebumeter-0.5.1.pkg | 2025-12-30 17:07 | 47K | |
| ebur128-0.1.10_10.pkg | 2025-12-25 00:31 | 387K | |
| ebusd-25.1.pkg | 2025-12-23 08:22 | 348K | |
| ec2-scripts-1.12.pkg | 2025-12-30 12:24 | 5.9K | |
| ecal-6.0.1.pkg | 2025-12-28 14:49 | 4.2M | |
| ecartis-1.0.0.s20060..> | 2025-08-20 06:20 | 241K | |
| ecasound-2.9.3_2.pkg | 2025-12-20 02:20 | 1.1M | |
| ecce-2.9.d_1.pkg | 2025-08-22 22:41 | 64K | |
| eccodes-2.44.0.pkg | 2025-12-26 21:32 | 3.3M | |
| ecflow-5.15.1.pkg | 2025-12-29 14:59 | 12M | |
| ecgi-0.6.3.pkg | 2025-08-18 18:34 | 41K | |
| echat-0.04.b1_1.pkg | 2025-08-19 19:35 | 62K | |
| echinus-0.4.9_3.pkg | 2025-12-27 22:42 | 39K | |
| echolinux-0.17a_8.pkg | 2025-12-28 04:56 | 29K | |
| echoping-6.0.2_13.pkg | 2025-12-22 07:31 | 42K | |
| ecl-24.5.10.pkg | 2025-12-18 21:03 | 2.9M | |
| eclat-2.1_1.pkg | 2025-12-23 19:38 | 269K | |
| eclib-20250627_1.pkg | 2025-12-28 13:10 | 2.3M | |
| eclipse-4.38.pkg | 2025-12-27 15:38 | 263M | |
| eclipse-EPIC-0.6.35_..> | 2025-12-27 21:02 | 2.9M | |
| eclipse-ShellEd-1.0...> | 2025-12-27 23:08 | 2.4M | |
| eclipse-cdt-9.0.1_1.pkg | 2025-12-29 13:06 | 78M | |
| eclipse-drjava-0.9.8..> | 2025-12-29 22:11 | 2.6M | |
| eclipse-ecj-4.4.2_2.pkg | 2025-12-27 00:44 | 1.4M | |
| eclipse-findbugs-3.0..> | 2025-12-30 08:45 | 5.5M | |
| eclipse-glassfish-5...> | 2025-12-28 01:42 | 104M | |
| eclipse-pydev-12.0.0..> | 2025-12-30 08:00 | 25M | |
| eclipse-yaml-editor-..> | 2025-12-29 19:28 | 625K | |
| ecos-2.0.10.pkg | 2025-08-18 17:45 | 60K | |
| ecpprog-g20200725_1.pkg | 2025-12-21 06:41 | 14K | |
| ecrire-0.3.4_1.pkg | 2025-12-29 12:35 | 42K | |
| ecwolf-1.4.2.pkg | 2025-12-30 10:09 | 710K | |
| ed2k-hash-0.4.0.pkg | 2025-08-18 16:41 | 11K | |
| ed2k-hash-openssl-1...> | 2025-08-20 17:09 | 4.3K | |
| edbrowse-3.8.12.pkg | 2025-12-22 05:01 | 651K | |
| eden-0.7.4_36.pkg | 2025-12-23 11:35 | 2.3M | |
| edenmath-1.1.1_13.pkg | 2025-12-27 05:26 | 26K | |
| edfbrowser-1.95.pkg | 2025-12-28 08:42 | 751K | |
| edflib-1.24.pkg | 2025-08-17 02:18 | 61K | |
| edge-1.35_11.pkg | 2025-12-28 10:49 | 886K | |
| edi-0.8.0_1.pkg | 2025-12-29 03:58 | 788K | |
| edid-decode-0.1.2023..> | 2025-08-22 17:43 | 114K | |
| editline-1.17.1.pkg | 2025-08-16 14:47 | 47K | |
| editorconfig-core-c-..> | 2025-12-18 07:19 | 31K | |
| editres-1.0.9.pkg | 2025-12-23 01:30 | 34K | |
| editss-2.2_4.pkg | 2025-12-20 23:27 | 30K | |
| edje_viewer-20130520..> | 2025-12-28 11:01 | 52K | |
| edk2-bhyve-g202308_5..> | 2025-08-13 22:34 | 1.4M | |
| edk2-fvp-g202308_5.pkg | 2025-08-14 12:19 | 578K | |
| edk2-macchiatobin-g2..> | 2025-08-18 03:57 | 1.1M | |
| edk2-qemu-i386-g2023..> | 2025-08-22 17:24 | 965K | |
| edk2-qemu-x64-g20230..> | 2025-08-18 12:53 | 1.0M | |
| edk2-rpi3-g202308_5.pkg | 2025-08-16 10:43 | 1.1M | |
| edk2-rpi4-g202308_5.pkg | 2025-08-19 18:36 | 1.1M | |
| edk2-xen-x64-g202308..> | 2025-08-15 16:29 | 968K | |
| edlib-1.2.7.pkg | 2025-08-18 17:53 | 20K | |
| eduke32-20250411.pkg | 2025-12-29 08:03 | 2.1M | |
| edumips64-1.3.0.pkg | 2025-12-29 11:33 | 3.4M | |
| efivar-39_1.pkg | 2025-12-26 20:46 | 157K | |
| efl-1.28.1_4.pkg | 2025-12-27 09:19 | 31M | |
| eflite-0.4.1.pkg | 2025-08-16 13:58 | 21K | |
| eggdrop-1.10.1.pkg | 2025-12-21 03:50 | 674K | |
| egl-0.3.1_10.pkg | 2025-12-30 14:57 | 13M | |
| egl-wayland-1.1.20.pkg | 2025-12-19 01:38 | 35K | |
| eglexternalplatform-..> | 2025-08-13 13:17 | 5.4K | |
| egoboo-2.8.1_1,1.pkg | 2025-12-30 16:47 | 119M | |
| egress-monitor-0.0.5..> | 2025-08-18 08:29 | 7.4K | |
| egypt-1.11.pkg | 2025-12-22 22:38 | 13K | |
| ehnt-0.3_9.pkg | 2025-08-16 15:41 | 22K | |
| eif-1.3.4_5.pkg | 2025-12-21 06:28 | 36K | |
| eiffelstudio-5.7_8.pkg | 2025-08-16 04:41 | 33M | |
| eigen-3.4.0_4.pkg | 2025-12-26 09:53 | 1.0M | |
| eights-1.0.pkg | 2025-08-18 07:13 | 7.3K | |
| einstein-2.0_10.pkg | 2025-12-28 17:57 | 744K | |
| eiskaltdcpp-cli-2.2...> | 2025-12-21 14:15 | 9.9K | |
| eiskaltdcpp-daemon-2..> | 2025-12-22 14:05 | 139K | |
| eiskaltdcpp-data-2.2..> | 2025-08-14 17:33 | 568K | |
| eiskaltdcpp-gtk-2.2...> | 2025-12-29 11:47 | 888K | |
| eiskaltdcpp-lib-2.2...> | 2025-12-19 10:16 | 739K | |
| eisl-5.59.pkg | 2025-12-21 16:31 | 260K | |
| eispack-1.0_15.pkg | 2025-12-29 23:10 | 87K | |
| ejabberd-25.10_1.pkg | 2025-12-28 05:07 | 12M | |
| ejdb-2.73.pkg | 2025-12-24 07:30 | 128K | |
| eject-1.5_5.pkg | 2025-08-14 18:21 | 8.0K | |
| eksanos-1.2.0_4.pkg | 2025-12-29 12:43 | 98K | |
| eksctl-0.220.0_1.pkg | 2025-12-29 20:05 | 37M | |
| el-aspell-0.50.3_1,1..> | 2025-12-24 05:01 | 3.3M | |
| el-data-1.9.5.9.1,1.pkg | 2025-08-22 22:04 | 158M | |
| el-freebsd-doc-20251..> | 2025-12-19 14:22 | 8.4M | |
| el-hyphen-2005.10.17..> | 2025-08-15 23:13 | 1.7K | |
| el-libreoffice-25.8...> | 2025-12-27 16:13 | 3.7M | |
| elan-4.0.1_6.pkg | 2025-12-29 07:30 | 1.1M | |
| elasticsearch-plugin..> | 2025-08-16 08:15 | 366K | |
| elasticsearch7-7.17...> | 2025-12-29 12:27 | 141M | |
| elasticsearch8-8.11...> | 2025-12-28 03:15 | 235M | |
| elastix-5.1.0_1.pkg | 2025-12-29 21:56 | 26M | |
| electric-7.0.0_5.pkg | 2025-12-28 11:05 | 1.9M | |
| electricfence-2.2.2_..> | 2025-08-19 17:07 | 24K | |
| electron36-36.9.5_3.pkg | 2025-12-26 05:24 | 138M | |
| electron37-37.10.3.pkg | 2025-12-26 03:06 | 141M | |
| electron38-38.7.2.pkg | 2025-12-26 08:35 | 143M | |
| electron39-39.2.7.pkg | 2025-12-25 14:16 | 143M | |
| electrs-0.10.10_4.pkg | 2025-12-30 02:20 | 2.8M | |
| element-web-1.12.7.pkg | 2025-12-29 21:58 | 28M | |
| elemental-1.5.3_2.pkg | 2025-12-28 19:01 | 2.9M | |
| elementary-calculato..> | 2025-12-30 09:27 | 98K | |
| elementary-calendar-..> | 2025-12-29 10:12 | 350K | |
| elementary-code-8.1...> | 2025-12-28 11:36 | 793K | |
| elementary-iconbrows..> | 2025-12-30 04:08 | 146K | |
| elementary-photos-8...> | 2025-12-30 01:03 | 1.5M | |
| elementary-terminal-..> | 2025-12-28 22:45 | 143K | |
| elementary-videos-8...> | 2025-12-29 22:57 | 145K | |
| elephant-2.17.2.pkg | 2025-12-27 14:55 | 111M | |
| elf-0.5.4p1_6.pkg | 2025-12-23 15:19 | 12K | |
| elf-dissector-0.0.1_..> | 2025-12-29 04:50 | 328K | |
| elfcat-0.1.10_6.pkg | 2025-12-30 03:05 | 188K | |
| elfio-3.11.pkg | 2025-08-16 19:58 | 553K | |
| elfkickers-3.2_1.pkg | 2025-08-17 13:56 | 87K | |
| elfsh-0.51b3_5.pkg | 2025-12-23 13:36 | 200K | |
| elfutils-0.187_2.pkg | 2025-12-18 09:17 | 945K | |
| elfx86exts-0.6.2_14.pkg | 2025-12-29 13:58 | 1.1M | |
| elgg-6.3.0.pkg | 2025-12-30 00:02 | 25M | |
| elinks-0.18.0.pkg | 2025-12-21 09:47 | 878K | |
| elisa-25.12.0.pkg | 2025-12-29 03:38 | 1.8M | |
| elixir-1.17.3.pkg | 2025-12-19 06:37 | 9.5M | |
| elixir-devel-1.19.4.pkg | 2025-12-23 14:43 | 10M | |
| elixir-mode.el-2.3.1..> | 2025-12-27 09:57 | 18K | |
| elixir-mode.el-emacs..> | 2025-12-27 17:12 | 18K | |
| elixir-mode.el-emacs..> | 2025-12-27 13:01 | 18K | |
| elixir-mode.el-emacs..> | 2025-12-19 17:37 | 18K | |
| elixir-mode.el-emacs..> | 2025-12-19 11:01 | 18K | |
| elixir-mode.el-emacs..> | 2025-12-27 09:34 | 18K | |
| elk-3.99.8_3.pkg | 2025-12-27 14:42 | 449K | |
| elk-chemistry-10.3.1..> | 2025-12-28 23:53 | 3.0M | |
| elki-0.7.1.1166_1.pkg | 2025-12-29 23:02 | 21M | |
| elliott-803-0.1.11_1..> | 2025-08-21 07:59 | 31M | |
| elm-2.5.8_7.pkg | 2025-12-22 20:56 | 229K | |
| elog-3.1.5.1.pkg | 2025-08-16 03:11 | 2.4M | |
| elpa-2021.11.001_5.pkg | 2025-12-27 00:56 | 419K | |
| elscreen-1.4.6.20180..> | 2025-12-29 07:20 | 27K | |
| elscreen-emacs_canna..> | 2025-12-27 23:50 | 27K | |
| elscreen-emacs_devel..> | 2025-12-29 20:25 | 27K | |
| elscreen-emacs_devel..> | 2025-12-21 19:39 | 27K | |
| elscreen-emacs_nox-1..> | 2025-12-20 18:06 | 27K | |
| elscreen-emacs_wayla..> | 2025-12-28 03:05 | 27K | |
| elvish-0.21.0_11.pkg | 2025-12-22 03:58 | 2.3M | |
| emacs-30.2,3.pkg | 2025-12-26 13:22 | 76M | |
| emacs-canna-30.2,3.pkg | 2025-12-26 14:09 | 50M | |
| emacs-devel-31.0.50...> | 2025-12-26 14:26 | 76M | |
| emacs-devel-nox-31.0..> | 2025-12-18 11:00 | 75M | |
| emacs-eat-0.9.4_1.pkg | 2025-12-30 08:10 | 147K | |
| emacs-eat-emacs_cann..> | 2025-12-28 19:23 | 147K | |
| emacs-eat-emacs_deve..> | 2025-12-29 13:19 | 146K | |
| emacs-eat-emacs_deve..> | 2025-12-23 05:32 | 146K | |
| emacs-eat-emacs_nox-..> | 2025-12-22 16:50 | 147K | |
| emacs-eat-emacs_wayl..> | 2025-12-30 09:11 | 147K | |
| emacs-koi8u-1.0_1.pkg | 2025-08-18 12:59 | 2.2K | |
| emacs-lisp-intro-2.0..> | 2025-08-21 05:10 | 849 | |
| emacs-lsp-booster-0...> | 2025-12-30 04:44 | 401K | |
| emacs-nox-30.2,3.pkg | 2025-12-18 10:07 | 49M | |
| emacs-w3m-1.4.632.b...> | 2025-12-27 10:59 | 777K | |
| emacs-w3m-emacs_cann..> | 2025-12-27 12:31 | 777K | |
| emacs-w3m-emacs_deve..> | 2025-12-27 12:32 | 775K | |
| emacs-w3m-emacs_deve..> | 2025-12-27 12:44 | 775K | |
| emacs-w3m-emacs_nox-..> | 2025-12-27 17:28 | 777K | |
| emacs-w3m-emacs_wayl..> | 2025-12-27 03:40 | 777K | |
| emacs-wayland-30.2,3..> | 2025-12-26 14:05 | 76M | |
| emacsql-4.3.3.pkg | 2025-12-27 00:32 | 38K | |
| emacsql-emacs_canna-..> | 2025-12-26 23:31 | 38K | |
| emacsql-emacs_devel-..> | 2025-12-26 21:05 | 38K | |
| emacsql-emacs_devel_..> | 2025-12-18 21:44 | 38K | |
| emacsql-emacs_nox-4...> | 2025-12-19 02:28 | 38K | |
| emacsql-emacs_waylan..> | 2025-12-26 21:20 | 38K | |
| emailrelay-1.9_7.pkg | 2025-08-19 00:33 | 592K | |
| embb-1.0.0_5.pkg | 2025-08-20 06:21 | 359K | |
| emboss-6.6.0_7.pkg | 2025-12-27 12:18 | 79M | |
| embree-4.2.0.pkg | 2025-12-27 15:33 | 22M | |
| embree3-3.13.5.pkg | 2025-12-27 13:27 | 21M | |
| emby-server-4.8.11.0..> | 2025-12-30 01:28 | 77M | |
| emc2-2.17.pkg | 2025-08-17 09:01 | 1.5M | |
| emerald-0.8.8_8.pkg | 2025-12-30 00:18 | 309K | |
| emerald-themes-0.6.0..> | 2025-08-16 15:30 | 1.1M | |
| emiclock-2.0.2_6.pkg | 2025-12-22 20:21 | 117K | |
| emil-2.1b9_2.pkg | 2025-08-18 14:00 | 115K | |
| emilua-0.12.1_1.pkg | 2025-12-22 15:02 | 1.0M | |
| emms-24.pkg | 2025-12-29 16:17 | 311K | |
| emms-emacs_canna-24.pkg | 2025-12-30 11:15 | 311K | |
| emms-emacs_devel-24.pkg | 2025-12-28 10:09 | 311K | |
| emms-emacs_devel_nox..> | 2025-12-23 04:06 | 311K | |
| emms-emacs_nox-24.pkg | 2025-12-20 11:19 | 311K | |
| emms-emacs_wayland-2..> | 2025-12-29 03:17 | 311K | |
| emprint-20130520_5.pkg | 2025-12-28 08:21 | 8.9K | |
| empty-0.6.23d.pkg | 2025-09-01 07:06 | 20K | |
| emptyepsilon-2024.12..> | 2025-12-30 10:08 | 241M | |
| ems-flasher-0.03_11.pkg | 2025-12-30 10:15 | 6.9K | |
| emscripten-4.0.3_1.pkg | 2025-12-29 13:32 | 7.5M | |
| emulationstation-2.1..> | 2025-12-29 06:33 | 1.2M | |
| emwm-1.3.1.pkg | 2025-12-27 17:09 | 153K | |
| emwm-utils-1.3.1.pkg | 2025-12-29 00:48 | 31K | |
| en-aspell-2020.12.07..> | 2025-12-23 00:50 | 1.2M | |
| en-freebsd-doc-20251..> | 2025-12-19 01:49 | 39M | |
| en-hunspell-2020.12...> | 2025-08-16 03:38 | 185K | |
| en-mythes-2006.12.08..> | 2025-08-18 06:17 | 3.0M | |
| en_GB-libreoffice-25..> | 2025-12-27 03:21 | 3.2M | |
| en_ZA-libreoffice-25..> | 2025-12-27 09:51 | 2.7M | |
| enblend-4.2_27.pkg | 2025-12-27 04:15 | 973K | |
| enc-1.1.5.pkg | 2025-12-28 14:12 | 2.8M | |
| enca-1.19_1.pkg | 2025-12-19 02:11 | 129K | |
| enchant-1.6.0_12.pkg | 2025-12-18 17:06 | 51K | |
| enchant2-2.8.10.pkg | 2025-12-18 01:41 | 67K | |
| enchive-3.5_1.pkg | 2025-08-21 02:08 | 23K | |
| encode-explorer-6.3.pkg | 2025-12-28 23:58 | 36K | |
| encodings-1.1.0,1.pkg | 2025-08-10 21:33 | 566K | |
| encrypted-dns-server..> | 2025-12-29 20:59 | 852K | |
| encryptpad-0.5.0.4_4..> | 2025-12-27 21:11 | 1.1M | |
| endgame-singularity-..> | 2025-12-28 03:17 | 1.8M | |
| endgame-singularity-..> | 2025-08-14 15:50 | 49M | |
| endian-1.1.6.pkg | 2025-08-15 15:08 | 4.6K | |
| endless-sky-0.10.16.pkg | 2025-12-27 12:59 | 331M | |
| endless-sky-high-dpi..> | 2025-12-30 11:16 | 709M | |
| endlessh-1.1_2.pkg | 2025-08-16 18:41 | 11K | |
| enet-1.3.18,1.pkg | 2025-08-15 20:27 | 198K | |
| engauge-digitizer-12..> | 2025-12-28 16:39 | 1.5M | |
| engrampa-1.28.2.pkg | 2025-12-27 12:38 | 1.1M | |
| enigma-1.30_5.pkg | 2025-12-30 06:23 | 40M | |
| enlightenment-0.27.1..> | 2025-12-29 13:54 | 385M | |
| enma-1.2.0_7.pkg | 2025-12-28 06:58 | 324K | |
| enscribe-0.1.0_12.pkg | 2025-12-27 20:00 | 16K | |
| enscript-a4-1.6.6_4.pkg | 2025-12-18 13:19 | 344K | |
| enscript-letter-1.6...> | 2025-12-19 14:00 | 344K | |
| enscript-letterdj-1...> | 2025-12-24 05:17 | 344K | |
| ensemblist-040126_13..> | 2025-12-30 04:41 | 1.0M | |
| ensmallen-2.22.1.pkg | 2025-12-27 18:01 | 170K | |
| ent-0.20080128_1.pkg | 2025-08-21 23:03 | 23K | |
| entangle-1.0_5.pkg | 2025-12-29 22:21 | 409K | |
| enter-tex-3.48.0_1.pkg | 2025-12-28 14:14 | 631K | |
| enteruser-1.0.pkg | 2025-12-23 05:32 | 5.4K | |
| entice-g20240127.pkg | 2025-12-29 20:26 | 37K | |
| entombed-2007.07.04_..> | 2025-12-29 16:30 | 272K | |
| entr-5.7.pkg | 2025-08-14 12:12 | 11K | |
| entt-3.16.0.pkg | 2025-12-23 07:36 | 105K | |
| envconsul-0.13.4_5.pkg | 2025-12-20 10:05 | 4.0M | |
| envsubst-0.1.pkg | 2025-08-18 19:59 | 4.4K | |
| envy-0.1.0_34.pkg | 2025-12-20 13:53 | 900K | |
| enygma-1.04.pkg | 2025-08-21 07:29 | 24K | |
| eo-aspell-2.1.200002..> | 2025-12-20 04:25 | 168K | |
| eo-libreoffice-25.8...> | 2025-12-27 17:08 | 3.3M | |
| eog-47.0_1.pkg | 2025-12-27 06:05 | 3.2M | |
| eog-plugins-44.1_2.pkg | 2025-12-29 17:07 | 139K | |
| eolie-0.9.101_6.pkg | 2025-12-27 21:32 | 292K | |
| eom-1.28.0_2.pkg | 2025-12-27 19:27 | 1.4M | |
| eos-movrec-0.3.2.b_6..> | 2025-12-30 11:23 | 315K | |
| epazote-2.1.2_33.pkg | 2025-12-24 04:56 | 2.3M | |
| epdfview-0.2.0_3.pkg | 2025-12-29 06:28 | 114K | |
| ephemera-6.34_1.pkg | 2025-12-23 15:51 | 278K | |
| ephoto-1.6.0_1.pkg | 2025-12-29 06:28 | 144K | |
| epic4-3.0.pkg | 2025-12-23 05:04 | 691K | |
| epic5-3.0.pkg | 2025-12-20 14:49 | 715K | |
| epiphany-47.7_2.pkg | 2025-12-27 04:45 | 3.3M | |
| epiphany-game-0.7.0.pkg | 2025-12-22 07:35 | 1.9M | |
| epix-1.2.22_2.pkg | 2025-12-29 23:25 | 1.6M | |
| epkowa-2.11.0_7.pkg | 2025-12-29 18:21 | 64K | |
| epl.el-0.8_20.pkg | 2025-12-27 15:42 | 7.1K | |
| epl.el-emacs_canna-0..> | 2025-12-27 02:49 | 7.2K | |
| epl.el-emacs_devel-0..> | 2025-12-27 12:19 | 7.2K | |
| epl.el-emacs_devel_n..> | 2025-12-19 15:53 | 7.2K | |
| epl.el-emacs_nox-0.8..> | 2025-12-19 22:55 | 7.2K | |
| epl.el-emacs_wayland..> | 2025-12-27 10:42 | 7.2K | |
| epm-4.5.1_1.pkg | 2025-08-18 13:03 | 1.4M | |
| eprover-2.6_2.pkg | 2025-12-20 11:52 | 892K | |
| eps-1.7_2.pkg | 2025-08-15 00:03 | 20K | |
| eps2png-2.905_1.pkg | 2025-12-28 18:08 | 12K | |
| epson-inkjet-printer..> | 2025-12-30 08:08 | 1.5M | |
| epson-inkjet-printer..> | 2025-12-30 16:52 | 3.5M | |
| epson-inkjet-printer..> | 2025-12-30 09:51 | 2.6M | |
| epsonepl-0.2.2_7.pkg | 2025-12-29 00:47 | 12K | |
| epsonscan2-6.7.70.0_..> | 2025-12-27 02:57 | 2.1M | |
| epsonscan2-non-free-..> | 2025-12-29 03:50 | 2.9M | |
| epstool-3.09_1.pkg | 2025-12-27 09:39 | 117K | |
| epstools-1.8.pkg | 2025-08-15 23:44 | 24K | |
| epte-2.0.8_2.pkg | 2025-08-22 13:13 | 120K | |
| eq10q-lv2-2.2_6.pkg | 2025-12-30 09:21 | 425K | |
| eqe-1.3.0_8.pkg | 2025-12-28 00:24 | 28K | |
| equinix-metal-cli-0...> | 2025-08-22 18:06 | 4.2M | |
| erd-3.0.6_6.pkg | 2025-12-29 11:34 | 397K | |
| erdtree-3.1.2_22.pkg | 2025-12-29 07:32 | 847K | |
| erfa-2.0.1.pkg | 2025-08-15 15:46 | 174K | |
| ergo-3.8.2_2.pkg | 2025-12-29 22:53 | 1.4M | |
| ergo-irc-server-2.16..> | 2025-12-22 01:16 | 3.8M | |
| erkale-g20220405_10.pkg | 2025-12-30 11:22 | 1.8M | |
| erkale-pseudopotenti..> | 2025-08-15 13:06 | 1.6M | |
| erkale-serial-g20220..> | 2025-12-30 12:32 | 1.8M | |
| erlang-26.2.5.16,4.pkg | 2025-12-18 15:52 | 40M | |
| erlang-cl-1.2.4.pkg | 2025-12-19 10:47 | 134K | |
| erlang-doc-26.2.pkg | 2025-08-19 00:30 | 20M | |
| erlang-java-26.2.5.1..> | 2025-12-29 18:23 | 162K | |
| erlang-man-26.2.pkg | 2025-08-13 15:49 | 1.2M | |
| erlang-native-compil..> | 2025-08-14 15:38 | 25K | |
| erlang-rebar3_hex-2...> | 2025-12-20 20:22 | 84K | |
| erlang-recon-2.5.6.pkg | 2025-12-22 04:53 | 130K | |
| erlang-runtime21-21...> | 2025-08-14 18:14 | 35M | |
| erlang-runtime22-22...> | 2025-08-22 02:46 | 34M | |
| erlang-runtime23-23...> | 2025-08-17 22:23 | 35M | |
| erlang-runtime24-24...> | 2025-08-19 04:57 | 37M | |
| erlang-runtime25-25...> | 2025-08-18 23:37 | 37M | |
| erlang-runtime26-26...> | 2025-12-23 07:32 | 39M | |
| erlang-runtime27-27...> | 2025-12-18 19:10 | 39M | |
| erlang-runtime28-28...> | 2025-12-27 10:59 | 42M | |
| erlang-wx-26.2.5.16,..> | 2025-12-27 16:48 | 6.2M | |
| erminej-3.2.pkg | 2025-12-27 18:18 | 13M | |
| es-0.9.b1_7.pkg | 2025-12-20 11:16 | 102K | |
| es-aspell-1.11.2,1.pkg | 2025-12-20 15:41 | 477K | |
| es-de-3.4.0_2.pkg | 2025-12-28 06:16 | 40M | |
| es-eric6-21.11.pkg | 2025-08-16 08:58 | 422K | |
| es-freebsd-doc-20251..> | 2025-12-19 08:10 | 7.9M | |
| es-hunspell-2.2.pkg | 2025-08-16 00:46 | 207K | |
| es-hyphen-2013.09.01..> | 2025-08-15 23:44 | 3.4K | |
| es-libreoffice-25.8...> | 2025-12-27 11:36 | 3.5M | |
| es-mythes-20140516.pkg | 2025-08-22 16:07 | 559K | |
| esbuild-0.25.0_11.pkg | 2025-12-18 23:27 | 3.6M | |
| eschalot-1.2.0.20191..> | 2025-08-20 15:35 | 12K | |
| espeak-ng-1.52.0_1.pkg | 2025-08-10 23:59 | 11M | |
| espressivo-lv2-0.1.6..> | 2025-08-21 05:46 | 76K | |
| ess-25.01.0_2.pkg | 2025-12-28 23:33 | 1.2M | |
| ess-emacs_canna-25.0..> | 2025-12-30 12:44 | 1.2M | |
| ess-emacs_devel-25.0..> | 2025-12-29 22:29 | 1.2M | |
| ess-emacs_devel_nox-..> | 2025-12-30 08:56 | 1.2M | |
| ess-emacs_nox-25.01...> | 2025-12-30 12:17 | 1.2M | |
| ess-emacs_wayland-25..> | 2025-12-27 20:57 | 1.2M | |
| estd-0.6.5.pkg | 2025-08-21 08:59 | 28K | |
| estic-1.61_10.pkg | 2025-08-17 06:19 | 255K | |
| et-aspell-0.1.21.1_1..> | 2025-12-23 20:57 | 916K | |
| et-libreoffice-25.8...> | 2025-12-27 04:44 | 3.2M | |
| etcd-1.0.1_3.pkg | 2025-12-21 15:40 | 11K | |
| etcmerge-0.4_1.pkg | 2025-08-17 05:24 | 8.9K | |
| eterm-0.9.6_10.pkg | 2025-12-30 08:09 | 517K | |
| eterm-bg-0.9.6.pkg | 2025-08-18 10:06 | 1.8M | |
| eternalterminal-6.2...> | 2025-12-23 05:23 | 708K | |
| eteroj-lv2-0.10.0_1.pkg | 2025-12-29 23:41 | 53K | |
| ethash-1.1.0.pkg | 2025-12-22 13:29 | 20K | |
| etherape-0.9.20_3.pkg | 2025-12-30 08:04 | 790K | |
| ethname-2.0.1.pkg | 2025-08-19 07:30 | 3.9K | |
| etktab-3.2_3.pkg | 2025-12-28 06:48 | 44K | |
| etl-1.4.5.pkg | 2025-12-19 00:40 | 37K | |
| etlegacy-2.81.1_2.pkg | 2025-12-29 03:27 | 13M | |
| etracer-0.8.4.pkg | 2025-12-30 15:03 | 39M | |
| etsh-5.4.0_1.pkg | 2025-08-16 14:50 | 82K | |
| ettercap-0.8.3.1_3,1..> | 2025-12-30 08:40 | 783K | |
| eturnal-1.12.2_2.pkg | 2025-12-21 01:20 | 234K | |
| eu-libreoffice-25.8...> | 2025-12-27 02:53 | 3.3M | |
| euchre-0.8_4.pkg | 2025-12-30 01:44 | 140K | |
| euclid-wm-0.4.3_2.pkg | 2025-08-18 17:57 | 23K | |
| eukleides-1.5.4_9.pkg | 2025-12-29 00:17 | 212K | |
| eureka-1.27.b_3.pkg | 2025-12-27 21:03 | 673K | |
| eval-113_2.pkg | 2025-12-20 17:34 | 34K | |
| evans-0.10.11_22.pkg | 2025-12-23 21:22 | 5.3M | |
| evcxr-jupyter-0.21.1..> | 2025-08-18 04:31 | 8.2M | |
| evdev-proto-5.8.pkg | 2025-08-10 21:09 | 17K | |
| evemu-2.7.0_1.pkg | 2025-08-18 05:08 | 27K | |
| eventviews-25.12.0.pkg | 2025-12-26 17:24 | 701K | |
| evhz-g20210920_1.pkg | 2025-08-17 09:48 | 3.9K | |
| evilfinder-1.00_5.pkg | 2025-12-22 09:34 | 15K | |
| evilvte-0.5.2.p1_5.pkg | 2025-12-29 23:01 | 29K | |
| evilwm-1.5.pkg | 2025-12-30 02:39 | 48K | |
| evince-48.1_1.pkg | 2025-12-26 21:09 | 2.1M | |
| evince-lite-48.1_1.pkg | 2025-12-27 23:51 | 2.0M | |
| evisum-0.6.4.pkg | 2025-12-28 11:48 | 2.0M | |
| evolution-3.56.2_3.pkg | 2025-12-27 06:22 | 12M | |
| evolution-data-serve..> | 2025-12-26 18:31 | 4.3M | |
| evolution-ews-3.56.2..> | 2025-12-30 07:30 | 825K | |
| evolvotron-0.8.1_9.pkg | 2025-12-29 16:34 | 418K | |
| evq3-1.3.20080810_11..> | 2025-12-30 16:04 | 904K | |
| evtViewer-0.6.pkg | 2025-12-21 01:02 | 8.2K | |
| evtest-1.35_1.pkg | 2025-08-15 03:03 | 14K | |
| evtx-0.8.1_23.pkg | 2025-12-26 21:11 | 840K | |
| eww-wayland-0.6.0_10..> | 2025-12-30 06:42 | 2.8M | |
| eww-x11-0.6.0_10.pkg | 2025-12-28 12:45 | 2.9M | |
| exa-0.10.1_49.pkg | 2025-12-29 01:12 | 350K | |
| exaile-4.2.0_1.pkg | 2025-12-27 20:11 | 2.0M | |
| excido-0.1.5c_17.pkg | 2025-12-30 04:54 | 2.5M | |
| execline-2.9.7.0.pkg | 2025-12-18 20:01 | 157K | |
| exempi-2.6.6.pkg | 2025-12-18 12:02 | 1.0M | |
| exercism-3.5.8_4.pkg | 2025-12-20 16:56 | 3.6M | |
| exfat-utils-1.4.0_1.pkg | 2025-08-15 02:33 | 51K | |
| exhale-1.2.2_1.pkg | 2025-12-22 11:29 | 126K | |
| exhaust-1.9.2.pkg | 2025-08-17 07:40 | 13K | |
| exhaust-doc-1.9.2.pkg | 2025-08-20 01:10 | 22K | |
| exhaust-ma-1.9.pkg | 2025-08-18 21:50 | 13K | |
| exif-0.6.22_1.pkg | 2025-12-19 06:40 | 57K | |
| exifprobe-2.0.1.pkg | 2025-08-21 09:36 | 161K | |
| exiftags-1.01_1.pkg | 2025-08-19 09:37 | 61K | |
| exiftran-2.14_2.pkg | 2025-12-27 11:45 | 27K | |
| exilog-0.5_12.pkg | 2025-12-22 15:19 | 91K | |
| exim-4.98.2.pkg | 2025-12-20 01:06 | 1.3M | |
| exim-doc-html-4.98.2..> | 2025-08-21 12:51 | 581K | |
| exim-doc-pdf-4.98.2.pkg | 2025-08-18 22:06 | 2.0M | |
| exim-doc-postscript-..> | 2025-08-18 12:12 | 1.1M | |
| exim-ldap2-4.98.2.pkg | 2025-12-23 03:32 | 1.3M | |
| exim-monitor-4.98.2.pkg | 2025-12-21 10:18 | 61K | |
| exim-mysql-4.98.2.pkg | 2025-12-20 11:29 | 1.3M | |
| exim-postgresql-4.98..> | 2025-12-20 07:50 | 1.3M | |
| exim-sa-exim-4.98.2+..> | 2025-12-23 14:16 | 1.4M | |
| exim-sqlite-4.98.2_1..> | 2025-12-23 16:51 | 1.3M | |
| exipick-20100323.0.pkg | 2025-12-22 12:11 | 17K | |
| exiv2-0.28.7,1.pkg | 2025-12-18 04:34 | 2.9M | |
| exmh-2.9.0_8.pkg | 2025-12-30 18:33 | 502K | |
| exmh-devel-2022.09.2..> | 2025-12-29 16:46 | 502K | |
| exo-2_2.pkg | 2025-12-29 13:36 | 1.0M | |
| exomizer-3.1.2.pkg | 2025-08-18 16:04 | 383K | |
| exonerate-2.4.0_1.pkg | 2025-12-21 19:52 | 954K | |
| exoscale-cli-1.84.0_..> | 2025-08-22 08:59 | 8.8M | |
| expat-2.7.3.pkg | 2025-12-16 01:28 | 125K | |
| expect-5.45.4_6,1.pkg | 2025-08-25 16:31 | 178K | |
| expected-1.2.0.pkg | 2025-08-18 20:42 | 13K | |
| expense-0.1_13.pkg | 2025-12-27 14:55 | 39K | |
| expiretable-0.6_3.pkg | 2025-08-22 04:39 | 7.9K | |
| exploit-pattern-g202..> | 2025-12-21 17:39 | 1.8K | |
| explosions-0.2005.07..> | 2025-12-29 07:30 | 33K | |
| exprtk-0.0.3.pkg | 2025-08-14 00:54 | 120K | |
| exrtools-0.4_38.pkg | 2025-12-28 02:57 | 41K | |
| extipl-5.04_1.pkg | 2025-08-19 14:48 | 52K | |
| extrace-freebsd-0.1...> | 2025-12-22 10:43 | 7.1K | |
| extract_url-1.6.2_1.pkg | 2025-12-21 04:06 | 18K | |
| extractpdfmark-1.1.1..> | 2025-12-28 10:41 | 28K | |
| exult-1.12.0_1,1.pkg | 2025-12-29 00:42 | 9.6M | |
| eyeclock-2.0_5.pkg | 2025-12-20 21:04 | 150K | |
| ez-pine-gpg-0.4.h_2.pkg | 2025-12-21 02:13 | 7.8K | |
| eza-0.23.4_2.pkg | 2025-12-28 05:35 | 804K | |
| ezc3d-1.6.3.pkg | 2025-12-23 15:59 | 138K | |
| ezjail-3.4.2_2.pkg | 2025-08-22 09:10 | 44K | |
| ezmlm-0.53_2.pkg | 2025-08-14 02:59 | 61K | |
| ezmlm-idx-7.2.2_2.pkg | 2025-08-15 16:45 | 736K | |
| ezquake-3.2.3_4,2.pkg | 2025-12-29 16:32 | 17M | |
| ezstream-0.5.6_11.pkg | 2025-12-22 00:28 | 41K | |
| ezxml-0.8.6.pkg | 2025-08-15 20:57 | 18K | |
| f-prot-6.5.1.5927_2.pkg | 2025-08-16 02:56 | 27M | |
| f-upgrade-1.0.4.pkg | 2025-08-18 21:55 | 13K | |
| f1spirit-remake-1.0_..> | 2025-12-28 19:38 | 16M | |
| f2-2.2.2_1.pkg | 2025-12-21 03:05 | 2.3M | |
| f2c-20200916_1.pkg | 2025-08-14 00:19 | 324K | |
| f3-8.0_2.pkg | 2025-12-22 19:30 | 14K | |
| f77flow-0.12_2.pkg | 2025-08-17 21:47 | 9.0K | |
| fa-aspell-0.11.0_1,2..> | 2025-12-24 04:49 | 1.8M | |
| fa-libreoffice-25.8...> | 2025-12-27 18:18 | 302K | |
| faac-1.31.1.pkg | 2025-08-13 22:19 | 98K | |
| faad2-2.11.2,1.pkg | 2025-08-13 22:03 | 213K | |
| fabio-1.6.4_4.pkg | 2025-08-17 11:47 | 7.1M | |
| fabla2-lv2-g20180331..> | 2025-12-28 13:08 | 161K | |
| fabric-ai-1.4.164_2.pkg | 2025-08-20 02:51 | 7.8M | |
| fabric-hyperledger-3..> | 2025-08-22 07:54 | 44M | |
| facedetect-0.1_9.pkg | 2025-12-27 17:13 | 3.8K | |
| faces-1.7.7_14.pkg | 2025-12-18 22:34 | 28K | |
| facile-1.1.3_4.pkg | 2025-08-15 05:32 | 732K | |
| fairymax-5.0b.201603..> | 2025-08-14 17:49 | 72K | |
| faiss-1.13.1.pkg | 2025-12-27 17:41 | 1.4M | |
| fakebo-0.4.2.1_2.pkg | 2025-08-20 08:56 | 32K | |
| fakeident-2.7.pkg | 2025-08-17 17:21 | 6.4K | |
| fakeroot-1.37.1.2.pkg | 2025-08-13 15:29 | 80K | |
| fakertc-3.pkg | 2025-08-19 13:29 | 1.4K | |
| fakesteak-0.2.4.pkg | 2025-08-21 04:56 | 5.8K | |
| faketty-1.0.19_2.pkg | 2025-12-30 09:42 | 252K | |
| falconseye-1.9.3_12.pkg | 2025-12-23 07:32 | 5.1M | |
| falkon-25.12.0.pkg | 2025-12-29 13:34 | 2.8M | |
| falkon-qt6-25.12.0.pkg | 2025-12-30 17:28 | 2.7M | |
| fallout-1.0.4_30.pkg | 2025-12-23 13:48 | 3.9M | |
| fam-2.6.10_10.pkg | 2025-08-21 12:44 | 84K | |
| fancybox-3.5.7.pkg | 2025-08-19 13:23 | 55K | |
| fand-0.2.3_1.pkg | 2025-08-17 04:57 | 7.6K | |
| fann-2.2.0.20230126.pkg | 2025-08-21 12:14 | 146K | |
| fanout-0.6.1.pkg | 2025-12-20 04:58 | 4.6K | |
| fantasque-sans-mono-..> | 2025-12-29 04:37 | 236K | |
| fanwood-g20110526_1.pkg | 2025-12-28 10:53 | 172K | |
| fapg-0.43_1.pkg | 2025-12-30 05:49 | 19K | |
| far2l-2.7.0_1.pkg | 2025-12-30 08:07 | 4.5M | |
| farbfeld-4_2.pkg | 2025-12-27 13:46 | 18K | |
| fargoal-20040629_3.pkg | 2025-12-28 10:46 | 428K | |
| farmhash-g20190513.pkg | 2025-08-18 19:01 | 39K | |
| farsifonts-0.4_4.pkg | 2025-12-29 01:11 | 254K | |
| farstream-0.2.9.pkg | 2025-12-26 19:07 | 250K | |
| fasd-1.0.1_1.pkg | 2025-08-17 03:20 | 11K | |
| fasda-0.2.0.1.pkg | 2025-12-27 14:56 | 34K | |
| fasda-utils-0.1.0.2_..> | 2025-12-28 21:06 | 3.6K | |
| fasm-1.73.34.pkg | 2025-12-19 22:16 | 127K | |
| fasm-fpga-g20190920_..> | 2025-12-22 12:44 | 19K | |
| fast_float-8.1.0.pkg | 2025-12-18 01:27 | 42K | |
| fasta-21.1.1_1.pkg | 2025-08-16 08:56 | 113K | |
| fasta3-36.3.8_1.pkg | 2025-08-16 08:09 | 740K | |
| fastahack-1.0.0.pkg | 2025-08-14 01:01 | 47K | |
| fastani-1.34.pkg | 2025-08-18 01:18 | 112K | |
| fastcap-2.0.w.011109..> | 2025-08-20 00:23 | 1.2M | |
| fastdb-3.75_8.pkg | 2025-12-30 02:45 | 404K | |
| fastdfs-6.0.6_1.pkg | 2025-12-20 05:07 | 308K | |
| fastdnaml-1.2.2_2.pkg | 2025-08-21 06:13 | 54K | |
| fastfetch-2.56.1.pkg | 2025-12-29 17:15 | 453K | |
| fastforward-0.51_2.pkg | 2025-08-15 10:15 | 49K | |
| fasthenry-3.0.w.0211..> | 2025-08-17 01:48 | 1.1M | |
| fastjar-0.98.pkg | 2025-08-16 10:09 | 89K | |
| fastjet-3.5.1.pkg | 2025-12-27 22:24 | 8.8M | |
| fastnetmon-1.2.8_8.pkg | 2025-12-21 08:31 | 1.6M | |
| fastool-0.1.4.pkg | 2025-08-16 01:31 | 5.5K | |
| fastops-1.0.0.pkg | 2025-08-20 08:53 | 135K | |
| fastp-0.26.0.pkg | 2025-12-19 21:50 | 181K | |
| fastq-trim-0.1.4.pkg | 2025-12-27 09:56 | 51K | |
| fastqc-0.12.1.pkg | 2025-12-27 12:32 | 11M | |
| fastresolve-2.10_7.pkg | 2025-12-21 02:59 | 50K | |
| fastscapelib-0.3.0.pkg | 2025-12-20 17:30 | 48K | |
| fastx_toolkit-0.0.14..> | 2025-12-22 08:55 | 67K | |
| fatal-2025.12.15.00.pkg | 2025-12-29 23:01 | 250K | |
| fatback-1.3_3.pkg | 2025-08-22 03:59 | 101K | |
| fatfrog-lv2-1.0.pkg | 2025-12-30 00:00 | 107K | |
| faup-1.5.48_1.pkg | 2025-12-23 20:56 | 430K | |
| faust-2.81.10.pkg | 2025-12-18 18:59 | 73M | |
| faust-lv2-1.4.202208..> | 2025-08-18 11:23 | 333K | |
| faustlive-2.5.19.pkg | 2025-12-30 08:08 | 3.3M | |
| fava-1.30.7.pkg | 2025-12-27 12:40 | 1.2M | |
| favagtk-1.0.0_3.pkg | 2025-12-28 00:14 | 17K | |
| fb303-2025.12.15.00.pkg | 2025-12-29 14:27 | 700K | |
| fbcmd-0.5.1_4.pkg | 2025-12-29 13:14 | 15K | |
| fbg2-0.4_7.pkg | 2025-12-29 21:54 | 3.8M | |
| fblog-4.17.0_2.pkg | 2025-12-28 18:47 | 1.0M | |
| fbpanel-6.1_8.pkg | 2025-12-29 15:17 | 205K | |
| fbreader-0.99.6_8.pkg | 2025-12-29 03:59 | 1.7M | |
| fbreader-qt6-0.99.6_..> | 2025-12-29 19:43 | 1.8M | |
| fbsd-duckstation-202..> | 2025-12-30 00:26 | 7.3M | |
| fbthrift-2025.12.15...> | 2025-12-27 11:31 | 5.8M | |
| fc++-1.5.pkg | 2025-08-19 15:37 | 50K | |
| fccf-0.6.0_5.pkg | 2025-12-23 16:21 | 118K | |
| fcft-3.3.2.pkg | 2025-12-26 22:30 | 89K | |
| fcgi-devkit-2.4.7.pkg | 2025-12-19 02:55 | 175K | |
| fcgiwrap-1.1.0_12.pkg | 2025-12-22 04:40 | 12K | |
| fcitx-m17n-0.2.3_1.pkg | 2025-12-28 16:27 | 21K | |
| fcitx-qt5-1.2.7.pkg | 2025-12-27 18:41 | 151K | |
| fcitx-table-other-0...> | 2025-12-29 18:04 | 345K | |
| fcitx5-5.1.16.pkg | 2025-12-26 17:04 | 8.3M | |
| fcitx5-configtool-5...> | 2025-12-29 15:29 | 422K | |
| fcitx5-gtk-common-5...> | 2025-12-27 10:28 | 21K | |
| fcitx5-gtk2-5.1.4.pkg | 2025-12-28 06:16 | 21K | |
| fcitx5-gtk3-5.1.4.pkg | 2025-12-29 05:50 | 44K | |
| fcitx5-gtk4-5.1.4.pkg | 2025-12-29 21:58 | 43K | |
| fcitx5-lua-5.0.15.pkg | 2025-12-26 22:52 | 42K | |
| fcitx5-m17n-5.1.5.pkg | 2025-12-28 04:59 | 60K | |
| fcitx5-qt-common-5.1..> | 2025-12-26 20:02 | 11K | |
| fcitx5-qt5-5.1.11.pkg | 2025-12-27 02:09 | 183K | |
| fcitx5-qt6-5.1.11.pkg | 2025-12-26 22:22 | 249K | |
| fcl-0.7.0_1.pkg | 2025-08-13 21:34 | 1.2M | |
| fcl05-0.5.0_3.pkg | 2025-12-26 18:51 | 1.1M | |
| fclones-0.35.0_7.pkg | 2025-12-30 08:39 | 1.5M | |
| fcode-utils-1.0.3.pkg | 2025-08-16 13:56 | 92K | |
| fconfig-20080329.pkg | 2025-08-17 10:21 | 8.4K | |
| fconv-1.1_2.pkg | 2025-08-18 22:49 | 3.6K | |
| fcplay-0.0.1_2.pkg | 2025-08-18 00:09 | 17K | |
| fcppt-4.6.0.pkg | 2025-08-19 11:28 | 371K | |
| fcrackzip-1.0_3.pkg | 2025-12-21 21:40 | 19K | |
| fcron-3.2.1_2.pkg | 2025-08-21 12:39 | 162K | |
| fd-3.01j_2.pkg | 2025-12-23 11:59 | 589K | |
| fd-find-10.3.0_4.pkg | 2025-12-26 22:35 | 1.0M | |
| fdk-aac-2.0.3.pkg | 2025-08-13 21:35 | 762K | |
| fdm-2.2_1.pkg | 2025-12-23 18:01 | 151K | |
| fdm_materials-10.9.0..> | 2025-12-19 14:07 | 45K | |
| fdmf-0.0.9.s_12.pkg | 2025-12-28 23:08 | 16K | |
| fdupes-2.4.0,1.pkg | 2025-12-21 09:39 | 38K | |
| feappv-5.1.2.e.pkg | 2025-12-30 00:54 | 1.9M | |
| feathernotes-1.3.2.pkg | 2025-12-29 05:31 | 424K | |
| featherpad-1.6.2.pkg | 2025-12-27 10:24 | 792K | |
| feedbackd-0.7.0.pkg | 2025-12-19 05:47 | 1.1M | |
| feff10-10.0.0.16_1.pkg | 2025-12-30 11:28 | 2.1M | |
| feh-3.11.2.pkg | 2025-12-27 16:22 | 178K | |
| felis-1.0_2.pkg | 2025-08-15 23:14 | 3.9K | |
| feluda-1.10.3_1.pkg | 2025-12-29 01:41 | 3.4M | |
| fence-agents-4.12.1_..> | 2025-12-29 13:35 | 274K | |
| fend-1.5.7_4.pkg | 2025-12-28 15:23 | 907K | |
| fenics-basix-0.8.0_2..> | 2025-12-27 11:48 | 499K | |
| fennel-1.6.0.pkg | 2025-12-20 18:58 | 190K | |
| fermi-lite-0.1.13_1.pkg | 2025-08-14 18:17 | 115K | |
| feroxbuster-2.13.1_1..> | 2025-12-30 16:47 | 4.0M | |
| ferrite-core-2.02.pkg | 2025-12-28 00:51 | 41K | |
| festalon-0.5.5_15.pkg | 2025-12-30 14:53 | 87K | |
| festival-2.4_4.pkg | 2025-12-18 19:28 | 1.2M | |
| festival-freebsoft-u..> | 2025-12-28 21:33 | 42K | |
| festlex-cmu-1.95.pkg | 2025-08-15 10:06 | 1.4M | |
| festlex-czech-0.2.1.pkg | 2025-08-18 03:39 | 21K | |
| festlex-oald-1.4.1_1..> | 2025-12-19 22:39 | 1.1M | |
| festlex-poslex-1.4.1..> | 2025-08-15 21:00 | 191K | |
| festvox-cmu_us_awb_a..> | 2025-12-21 05:59 | 132M | |
| festvox-cmu_us_bdl_a..> | 2025-12-21 09:45 | 96M | |
| festvox-cmu_us_clb_a..> | 2025-12-21 20:17 | 132M | |
| festvox-cmu_us_jmk_a..> | 2025-12-23 16:44 | 97M | |
| festvox-cmu_us_ksp_a..> | 2025-12-21 03:49 | 120M | |
| festvox-cmu_us_rms_a..> | 2025-12-23 05:01 | 120M | |
| festvox-cmu_us_slt_a..> | 2025-12-23 01:22 | 121M | |
| festvox-don-1.4.0_2.pkg | 2025-12-20 14:43 | 603K | |
| festvox-el11-1.4.0_2..> | 2025-12-21 04:14 | 1.4M | |
| festvox-kal8-1.4.0_1..> | 2025-08-22 22:40 | 2.2M | |
| festvox-kal16-1.4.0.pkg | 2025-08-19 17:45 | 3.7M | |
| festvox-ked8-1.4.0_1..> | 2025-08-20 07:23 | 2.2M | |
| festvox-ked16-1.4.0_..> | 2025-08-19 14:50 | 3.9M | |
| festvox-rab8-1.4.1_2..> | 2025-12-21 06:37 | 2.9M | |
| festvox-rab16-1.4.1_..> | 2025-12-20 11:13 | 4.9M | |
| festvox-russian-0.5.pkg | 2025-12-22 12:33 | 180M | |
| fet-7.6.1.pkg | 2025-12-30 15:08 | 10M | |
| fetchconfig-0.26.pkg | 2025-12-23 12:38 | 20K | |
| fetchlog-1.6.pkg | 2025-08-22 17:50 | 22K | |
| fetchmail-6.6.1.pkg | 2025-12-19 05:35 | 514K | |
| fetchmailconf-6.6.1.pkg | 2025-12-30 17:28 | 55K | |
| fex-2.0.0_2.pkg | 2025-08-19 18:19 | 8.9K | |
| ffdec-22.0.2.pkg | 2025-12-28 06:07 | 13M | |
| ffe-0.3.9_2.pkg | 2025-08-21 14:12 | 68K | |
| fff-2.2.pkg | 2025-12-22 09:15 | 12K | |
| fflas-ffpack-2.5.0_3..> | 2025-12-27 16:18 | 227K | |
| ffmpeg-8.0.1,1.pkg | 2025-12-25 00:50 | 12M | |
| ffmpeg-nox11-8.0.1,1..> | 2025-12-29 23:51 | 11M | |
| ffmpeg3-3.0.2_1.pkg | 2025-12-18 23:27 | 2.8M | |
| ffmpegthumbnailer-2...> | 2025-12-26 20:15 | 76K | |
| ffms2-5.0_1.pkg | 2025-12-26 20:46 | 155K | |
| ffnvcodec-headers-13..> | 2025-12-24 20:09 | 68K | |
| ffproxy-1.72.pkg | 2025-08-22 21:03 | 31K | |
| ffs-1.6.0.132.pkg | 2025-12-20 10:10 | 207K | |
| fftw-2.1.5_23.pkg | 2025-12-26 18:50 | 414K | |
| fftw-float-2.1.5_23.pkg | 2025-12-27 17:00 | 219K | |
| fftw3-3.3.10_5.pkg | 2025-08-10 21:51 | 840K | |
| fftw3-float-3.3.10_5..> | 2025-08-10 21:49 | 761K | |
| fftw3-long-3.3.10_5.pkg | 2025-08-20 05:06 | 450K | |
| fftw3-quad-3.3.10_5.pkg | 2025-12-29 19:46 | 948K | |
| ffuf-2.1.0_19.pkg | 2025-12-22 06:26 | 3.1M | |
| fgallery-1.9.1_6.pkg | 2025-12-27 20:48 | 119K | |
| fheroes2-1.1.13.pkg | 2025-12-30 07:19 | 2.1M | |
| fhist-1.21_7.pkg | 2025-12-20 11:00 | 89K | |
| fhourstones-3.1_2.pkg | 2025-08-17 10:54 | 6.8K | |
| fi-aspell-0.7.0_1,2.pkg | 2025-12-20 18:26 | 646K | |
| fi-libreoffice-25.8...> | 2025-12-27 14:41 | 3.3M | |
| fiche-0.9.1_3.pkg | 2025-08-15 23:47 | 7.6K | |
| ficl-4.1.0_4.pkg | 2025-08-18 13:49 | 417K | |
| fidocadj-0.24.8.pkg | 2025-12-29 18:44 | 2.6M | |
| fidogate-5.12.pkg | 2025-12-22 00:50 | 745K | |
| fidogate4-4.4.10_1.pkg | 2025-12-20 23:51 | 1.6M | |
| fifechan-0.1.5_2.pkg | 2025-12-27 01:41 | 219K | |
| fifteen-20150410_1.pkg | 2025-12-30 16:18 | 20K | |
| fig2dev-3.2.9a.pkg | 2025-12-26 23:00 | 274K | |
| fig2sxd-0.23_1.pkg | 2025-08-19 09:56 | 50K | |
| fightorperish-0.5_2.pkg | 2025-12-27 22:34 | 80K | |
| figlet-2.2.5_1.pkg | 2025-08-14 18:47 | 125K | |
| figlet-fonts-2012120..> | 2025-08-21 05:57 | 2.8M | |
| figtree-1.4.4.14.pkg | 2025-08-18 19:08 | 3.1M | |
| fiked-0.0.5_9.pkg | 2025-12-21 08:49 | 25K | |
| filament-1.62.2.pkg | 2025-12-30 02:58 | 16M | |
| file-5.46.pkg | 2025-08-14 07:21 | 429K | |
| file-roller-44.5,1.pkg | 2025-12-27 09:34 | 740K | |
| file2pcap-1.29.pkg | 2025-08-20 23:50 | 24K | |
| filebench-1.5.a3.27.pkg | 2025-08-19 10:08 | 114K | |
| filebrowser-2.52.0.pkg | 2025-12-29 12:43 | 9.6M | |
| filebrowser-quantum-..> | 2025-12-28 02:12 | 8.6M | |
| filedupe-1.1_4.pkg | 2025-12-20 08:29 | 6.7K | |
| filelight-25.12.0.pkg | 2025-12-27 00:58 | 750K | |
| filemon-0.0.1_1.pkg | 2025-08-18 16:01 | 4.2K | |
| fileobj-0.8.7.pkg | 2025-12-22 13:34 | 506K | |
| filepizza-2.0.202508..> | 2025-12-29 23:46 | 5.6M | |
| filepp-1.8.0_1.pkg | 2025-12-21 08:58 | 45K | |
| fileprune-1.12_1.pkg | 2025-08-22 09:20 | 12K | |
| filerunner-24.07.12...> | 2025-12-29 17:57 | 2.7M | |
| fileschanged-0.6.5_4..> | 2025-12-23 19:53 | 26K | |
| filetype-0.1.3_1.pkg | 2025-08-20 18:50 | 19K | |
| filevercmp-g20151117..> | 2025-08-22 15:50 | 5.2K | |
| filewatcherd-1.0_1,1..> | 2025-08-19 14:39 | 13K | |
| filezilla-3.68.1_2.pkg | 2025-12-28 01:09 | 4.0M | |
| fillets-ng-1.0.1_10.pkg | 2025-12-30 09:35 | 135M | |
| filmulator-0.11.1_4.pkg | 2025-12-28 00:09 | 537K | |
| filtermail-0.8.9.pkg | 2025-08-22 09:36 | 69K | |
| filters-2.55_1.pkg | 2025-12-20 08:53 | 133K | |
| filtron-g20180218_34..> | 2025-12-23 04:51 | 2.1M | |
| finch-2.14.14_1.pkg | 2025-12-30 11:09 | 107K | |
| find-cursor-1.8.pkg | 2025-08-22 20:57 | 72K | |
| findmaildirs-0.4.pkg | 2025-08-16 17:04 | 4.0K | |
| findmtu-0.9.pkg | 2025-08-16 23:13 | 6.4K | |
| findomain-9.0.4_17.pkg | 2025-12-30 13:25 | 4.8M | |
| findutils-4.10.0.pkg | 2025-12-16 05:34 | 534K | |
| fineftp-server-1.5.1..> | 2025-12-19 16:18 | 136K | |
| finfo-0.1_1.pkg | 2025-08-18 21:49 | 5.3K | |
| fio-3.40.pkg | 2025-08-15 20:29 | 6.4M | |
| fira-4.301_2.pkg | 2025-12-29 19:20 | 13M | |
| firacode-6.2.pkg | 2025-12-29 22:41 | 417K | |
| firago-1.001_1.pkg | 2025-12-30 08:15 | 11M | |
| fire-hpp-1.0.pkg | 2025-08-18 00:06 | 13K | |
| firebird-emu-1.6.pkg | 2025-12-30 08:32 | 579K | |
| firebird30-client-3...> | 2025-12-18 13:32 | 5.6M | |
| firebird30-server-3...> | 2025-12-21 05:32 | 25M | |
| firebird40-client-4...> | 2025-12-19 13:45 | 8.1M | |
| firebird40-server-4...> | 2025-12-23 18:44 | 40M | |
| firedm-2022.2.5_3.pkg | 2025-12-28 10:18 | 363K | |
| fireflies-2.08_1.pkg | 2025-12-23 04:26 | 27K | |
| firefox-146.0.1_2,2.pkg | 2025-12-27 08:12 | 76M | |
| firefox-esr-140.6.0_..> | 2025-12-28 23:48 | 73M | |
| firstboot-cloudsetup..> | 2025-08-22 03:45 | 5.0K | |
| firstboot-freebsd-up..> | 2025-08-20 03:31 | 1.4K | |
| firstboot-pkgs-1.7.pkg | 2025-08-20 21:24 | 1.3K | |
| fish-4.2.1_1.pkg | 2025-12-30 08:22 | 7.9M | |
| fishsupper-0.1.6_21.pkg | 2025-12-30 06:37 | 957K | |
| fist-4.1_1.pkg | 2025-08-20 13:11 | 7.5K | |
| fistgen-0.2.1_1.pkg | 2025-08-16 10:10 | 295K | |
| five-or-more-48.1.pkg | 2025-12-27 08:03 | 1.2M | |
| fix-mime-charset-0.5..> | 2025-12-21 11:49 | 38K | |
| fixc-1.2_33.pkg | 2025-12-22 03:46 | 1.6M | |
| fixrtf-0.1.20060303_..> | 2025-12-28 05:26 | 15K | |
| fizz-2025.12.15.00.pkg | 2025-12-26 19:19 | 584K | |
| fkiss-0.33a_7.pkg | 2025-08-19 18:39 | 107K | |
| fl0p-0.0.2.b.pkg | 2025-08-17 00:46 | 19K | |
| fl_moxgen-1.00_2.pkg | 2025-12-28 18:20 | 25K | |
| flac-1.5.0,1.pkg | 2025-08-10 21:26 | 678K | |
| flac123-2.1.1_2.pkg | 2025-12-21 17:06 | 10K | |
| flacon-11.3.0_1.pkg | 2025-12-29 17:11 | 1.5M | |
| flag-1.0.6.pkg | 2025-08-20 13:13 | 2.7K | |
| flag-icons-7.5.0.pkg | 2025-08-18 05:22 | 38M | |
| flag-icons-bordered-..> | 2025-08-22 02:07 | 38M | |
| flag-icons-rounded-7..> | 2025-08-15 18:43 | 40M | |
| flam3-3.1.1.5_5.pkg | 2025-12-28 05:07 | 728K | |
| flamegraph-1.1.pkg | 2025-12-20 11:11 | 36K | |
| flameshot-12.1.0_1.pkg | 2025-12-28 05:59 | 643K | |
| flamethrower-0.11.0.pkg | 2025-12-28 12:34 | 179K | |
| flamp-2.2.14.pkg | 2025-12-27 23:41 | 336K | |
| flann-1.9.2_3.pkg | 2025-12-26 22:46 | 1.4M | |
| flare-0.17.5_1.pkg | 2025-12-30 02:45 | 7.0M | |
| flare-engine-1.14_2.pkg | 2025-12-27 04:25 | 3.2M | |
| flare-game-1.14_2.pkg | 2025-12-30 06:38 | 117M | |
| flash-1.2.11.pkg | 2025-08-14 11:13 | 29K | |
| flasher-1.3_1.pkg | 2025-08-17 18:46 | 7.1K | |
| flashlight-machine-l..> | 2025-08-19 20:53 | 1.1M | |
| flashrom-1.6.0_1.pkg | 2025-12-26 22:25 | 5.2M | |
| flasm-1.62_1.pkg | 2025-08-16 08:51 | 53K | |
| flat-frog-2.2.13.pkg | 2025-12-27 22:08 | 45K | |
| flat-remix-gtk-theme..> | 2025-08-16 09:12 | 1.5M | |
| flat-remix-icon-them..> | 2025-08-19 23:59 | 50M | |
| flatbuffers-25.9.23,..> | 2025-12-18 12:13 | 1.2M | |
| flatcc-0.6.1.pkg | 2025-08-16 05:20 | 233K | |
| flatery-icon-themes-..> | 2025-08-22 22:56 | 22M | |
| flatzebra-0.2.0_1.pkg | 2025-12-27 10:28 | 59K | |
| flawfinder-2.0.19_1.pkg | 2025-12-23 19:28 | 189K | |
| flawz-0.3.0_11.pkg | 2025-12-28 03:11 | 1.3M | |
| flcluster-1.1.01.pkg | 2025-12-29 21:54 | 598K | |
| fldiff-1.1_12.pkg | 2025-12-29 18:06 | 67K | |
| fldigi-4.2.09_1.pkg | 2025-12-27 11:02 | 3.3M | |
| fleur-7.2_4.pkg | 2025-12-29 15:11 | 4.2M | |
| flex-2.6.4_3.pkg | 2025-12-18 07:15 | 303K | |
| flex-sdk-4.6.0.23201..> | 2025-12-28 01:49 | 52M | |
| flex-sdk3-3.5.0.1268..> | 2025-12-27 20:36 | 20M | |
| flexbackup-1.2.1_8.pkg | 2025-12-20 07:23 | 64K | |
| flexdock-1.2.4_1.pkg | 2025-12-26 22:08 | 1.2M | |
| flexemu-3.31.pkg | 2025-12-27 21:41 | 7.9M | |
| flexfloat-g20220606_..> | 2025-08-17 23:43 | 12K | |
| flexiblas-3.5.0.pkg | 2025-12-30 00:41 | 4.6M | |
| flexjson-2.1.pkg | 2025-12-30 02:20 | 124K | |
| fli-0.1.0_6.pkg | 2025-12-21 19:37 | 2.9M | |
| flickcurl-1.26_5.pkg | 2025-12-19 22:38 | 778K | |
| flif-0.4.pkg | 2025-12-30 08:17 | 747K | |
| flightgear-2024.1.1_..> | 2025-12-28 03:04 | 5.8M | |
| flightgear-aircraft-..> | 2025-12-22 13:54 | 1.2G | |
| flightgear-data-2024..> | 2025-08-14 19:18 | 1.8G | |
| flightgear-mb339-pan..> | 2025-08-22 18:24 | 1.9M | |
| flim-1.14.9.20250506..> | 2025-12-26 20:16 | 143K | |
| flim-emacs_canna-1.1..> | 2025-12-26 19:02 | 143K | |
| flim-emacs_devel-1.1..> | 2025-12-26 20:10 | 143K | |
| flim-emacs_devel_nox..> | 2025-12-18 18:21 | 143K | |
| flim-emacs_nox-1.14...> | 2025-12-18 16:38 | 143K | |
| flim-emacs_wayland-1..> | 2025-12-26 17:56 | 143K | |
| flint-3.3.1.pkg | 2025-12-28 13:46 | 4.2M | |
| flint2-2.9.0_4.pkg | 2025-12-26 13:36 | 3.4M | |
| flipperbit-0.1.2_19.pkg | 2025-12-29 18:59 | 308K | |
| flite-2.1.pkg | 2025-08-13 10:14 | 15M | |
| fllog-1.2.9.pkg | 2025-12-29 04:00 | 217K | |
| flmsg-4.0.24.pkg | 2025-12-30 12:30 | 716K | |
| flobopuyo-0.20_16.pkg | 2025-12-30 00:03 | 1.8M | |
| flock-2.41.3.pkg | 2025-12-24 20:10 | 17K | |
| flog-1.8.pkg | 2025-08-18 16:19 | 6.1K | |
| flops-2.2.pkg | 2025-08-20 15:47 | 8.7K | |
| florence-0.6.3_7.pkg | 2025-12-30 10:10 | 190K | |
| flow-tools-0.68.6_5.pkg | 2025-12-19 01:22 | 612K | |
| flowd-0.9.1_5.pkg | 2025-12-22 09:15 | 99K | |
| flowgger-0.3.1_22.pkg | 2025-12-28 14:56 | 892K | |
| flowgrind-0.8.2_4.pkg | 2025-12-20 22:43 | 61K | |
| flowviewer-4.5_4.pkg | 2025-12-27 20:52 | 149K | |
| flphoto-1.3.1_16.pkg | 2025-12-29 14:34 | 516K | |
| flpsed-0.7.3_2.pkg | 2025-12-29 17:14 | 41K | |
| flrig-2.0.10.pkg | 2025-12-28 10:01 | 1.3M | |
| flruler-1.05_1.pkg | 2025-12-29 01:04 | 162K | |
| fltk-1.3.10.pkg | 2025-12-26 09:20 | 1.3M | |
| fluctuate-1.40.pkg | 2025-08-17 15:49 | 67K | |
| fluent-bit-4.2.1.pkg | 2025-12-30 02:20 | 7.2M | |
| fluid-soundfont-3.1.pkg | 2025-08-14 06:42 | 126M | |
| fluida-lv2-0.9.5.pkg | 2025-12-29 20:51 | 368K | |
| fluidsynth-2.5.1.pkg | 2025-12-26 16:33 | 269K | |
| fluidsynth-dssi-1.0...> | 2025-12-27 21:19 | 30K | |
| fluxbox-1.3.7_10.pkg | 2025-12-26 20:03 | 785K | |
| fluxbox-tenr-styles-..> | 2025-12-26 21:48 | 5.4M | |
| fluxter-0.2.0_3.pkg | 2025-12-23 04:04 | 42K | |
| flvmeta-1.2.2.202108..> | 2025-08-17 19:14 | 39K | |
| flwrap-1.3.6.pkg | 2025-12-30 01:42 | 50K | |
| fly-2.0.1_7.pkg | 2025-12-30 18:00 | 47K | |
| flycast-2.5_6.pkg | 2025-12-27 20:57 | 6.1M | |
| flyhard-0.42_21.pkg | 2025-12-30 07:38 | 333K | |
| flying-6.20_4.pkg | 2025-08-21 10:20 | 77K | |
| flyspray-0.9.9.7_5.pkg | 2025-12-27 20:46 | 1.0M | |
| fmake-r250982_1.pkg | 2025-08-17 22:23 | 331K | |
| fmars-0.0.207_4.pkg | 2025-08-20 04:40 | 80K | |
| fmirror-0.8.4_5.pkg | 2025-08-19 15:31 | 41K | |
| fmit-1.2.14_3.pkg | 2025-12-29 09:59 | 209K | |
| fmptools-0.2.2_1.pkg | 2025-12-22 09:14 | 27K | |
| fmsx-6.0_1.pkg | 2025-08-18 14:02 | 383K | |
| fmtlatex-g20130930.pkg | 2025-12-21 21:37 | 6.7K | |
| fnc-0.18.pkg | 2025-12-23 21:46 | 1.0M | |
| fnm-1.38.1_10.pkg | 2025-12-29 23:00 | 2.0M | |
| fnott-1.8.0.pkg | 2025-12-27 22:38 | 92K | |
| fnt-1.9_1.pkg | 2025-12-27 22:05 | 6.3K | |
| fntsample-5.4_2.pkg | 2025-12-29 12:21 | 18K | |
| fo-aspell-0.2.16.1_1..> | 2025-12-23 02:29 | 1.0M | |
| focuswriter-1.8.13.pkg | 2025-12-28 18:23 | 6.1M | |
| fogpad-lv2-1.0.0.3_3..> | 2025-12-30 16:53 | 124K | |
| foiltex-2.1.4b_7.pkg | 2025-12-30 15:10 | 119K | |
| foliate-3.3.0_1.pkg | 2025-12-29 01:28 | 3.2M | |
| folks-0.15.9_2.pkg | 2025-12-26 23:15 | 538K | |
| folly-2025.12.15.00.pkg | 2025-12-26 16:46 | 2.9M | |
| fomp-lv2-1.2.4.pkg | 2025-08-21 02:59 | 34K | |
| fondu-051010.pkg | 2025-08-22 21:57 | 71K | |
| font-adobe-75dpi-1.0..> | 2025-12-26 19:41 | 5.3M | |
| font-adobe-100dpi-1...> | 2025-12-26 19:20 | 5.9M | |
| font-adobe-utopia-75..> | 2025-12-26 20:16 | 1.2M | |
| font-adobe-utopia-10..> | 2025-12-26 18:37 | 1.4M | |
| font-adobe-utopia-ty..> | 2025-12-26 20:12 | 169K | |
| font-alias-1.0.4.pkg | 2025-08-13 13:41 | 2.6K | |
| font-amsfonts-3.02_4..> | 2025-12-28 12:36 | 4.9M | |
| font-arabic-misc-1.0..> | 2025-12-26 19:08 | 14K | |
| font-awesome-7.0.1.pkg | 2025-12-27 16:04 | 292K | |
| font-bh-75dpi-1.0.3_..> | 2025-12-26 20:11 | 3.1M | |
| font-bh-100dpi-1.0.3..> | 2025-12-26 19:42 | 3.6M | |
| font-bh-lucidatypewr..> | 2025-12-26 20:05 | 735K | |
| font-bh-lucidatypewr..> | 2025-12-26 18:50 | 838K | |
| font-bh-ttf-1.0.3_5.pkg | 2025-12-24 21:52 | 293K | |
| font-bh-type1-1.0.3_..> | 2025-12-26 20:13 | 519K | |
| font-bitstream-75dpi..> | 2025-12-26 17:54 | 138K | |
| font-bitstream-100dp..> | 2025-12-26 18:12 | 158K | |
| font-bitstream-type1..> | 2025-12-26 20:21 | 295K | |
| font-cronyx-cyrillic..> | 2025-12-26 18:03 | 297K | |
| font-cursor-misc-1.0..> | 2025-12-26 18:01 | 6.2K | |
| font-daewoo-misc-1.0..> | 2025-12-26 19:56 | 648K | |
| font-dec-misc-1.0.3_..> | 2025-12-26 18:55 | 4.4K | |
| font-gost-0.2_4.pkg | 2025-12-28 07:24 | 178K | |
| font-ibm-type1-1.0.3..> | 2025-12-26 19:06 | 272K | |
| font-isas-misc-1.0.3..> | 2025-12-26 18:49 | 781K | |
| font-jis-misc-1.0.3_..> | 2025-12-26 18:29 | 528K | |
| font-manager-0.9.4_1..> | 2025-12-28 21:00 | 2.4M | |
| font-micro-misc-1.0...> | 2025-12-26 19:58 | 2.7K | |
| font-misc-cyrillic-1..> | 2025-12-26 20:01 | 66K | |
| font-misc-ethiopic-1..> | 2025-12-24 21:51 | 133K | |
| font-misc-meltho-1.0..> | 2025-12-24 21:51 | 784K | |
| font-misc-misc-1.1.2..> | 2025-12-26 18:50 | 3.4M | |
| font-mutt-misc-1.0.3..> | 2025-12-26 17:56 | 206K | |
| font-schumacher-misc..> | 2025-12-26 20:01 | 154K | |
| font-screen-cyrillic..> | 2025-12-26 19:07 | 10K | |
| font-sony-misc-1.0.3..> | 2025-12-26 19:33 | 20K | |
| font-sun-misc-1.0.3_..> | 2025-12-26 17:49 | 26K | |
| font-tex-gyre-bonum-..> | 2025-12-29 07:59 | 300K | |
| font-tex-gyre-pagell..> | 2025-12-28 10:06 | 332K | |
| font-tex-gyre-schola..> | 2025-12-28 22:45 | 356K | |
| font-tex-gyre-termes..> | 2025-12-30 03:05 | 306K | |
| font-util-1.3.2_1.pkg | 2025-08-10 21:14 | 29K | |
| font-winitzki-cyrill..> | 2025-12-26 19:58 | 5.8K | |
| font-xfree86-type1-1..> | 2025-12-26 19:06 | 28K | |
| font2svg-1.0_7.pkg | 2025-12-28 12:23 | 5.2K | |
| fontconfig-2.17.1,1.pkg | 2025-12-24 20:22 | 501K | |
| fonteditfs-1.2_1.pkg | 2025-08-18 04:17 | 9.2K | |
| fontforge-20230101_2..> | 2025-12-26 18:33 | 9.5M | |
| fontobene-0.2.0.pkg | 2025-12-21 07:23 | 4.7K | |
| fontpreview-1.0.6_6.pkg | 2025-12-29 16:28 | 5.9M | |
| fonts-indic-2.1.5_4.pkg | 2025-12-29 11:01 | 295K | |
| fonttosfnt-1.2.2_1.pkg | 2025-12-30 01:42 | 22K | |
| foo-yc20-1.3.0_4.pkg | 2025-12-29 15:21 | 290K | |
| foo2zjs-20161203_2.pkg | 2025-12-28 21:10 | 1.2M | |
| foobillard-3.0a_14.pkg | 2025-12-30 07:26 | 1.0M | |
| foomatic-db-20240504..> | 2025-08-14 09:54 | 61M | |
| foomatic-db-engine-4..> | 2025-12-20 16:36 | 150K | |
| foomatic-db-hpijs-1...> | 2025-08-18 21:18 | 38K | |
| foomatic-filters-4.0..> | 2025-12-28 01:14 | 56K | |
| foot-1.25.0.pkg | 2025-12-27 08:51 | 325K | |
| fooyin-0.9.2_1.pkg | 2025-12-30 02:36 | 2.4M | |
| fop-2.8_1.pkg | 2025-12-26 22:34 | 25M | |
| foreign-cdm-20250224..> | 2025-12-20 10:49 | 1.9M | |
| foreman-proxy-3.13.0..> | 2025-12-26 20:40 | 122K | |
| foremost-1.5.7_1.pkg | 2025-08-18 04:47 | 35K | |
| forge-0.6.2.pkg | 2025-12-30 06:48 | 174K | |
| forge-emacs_canna-0...> | 2025-12-30 12:05 | 174K | |
| forge-emacs_devel-0...> | 2025-12-28 17:08 | 173K | |
| forge-emacs_devel_no..> | 2025-12-20 16:33 | 173K | |
| forge-emacs_nox-0.6...> | 2025-12-22 23:14 | 174K | |
| forge-emacs_wayland-..> | 2025-12-28 05:41 | 174K | |
| forgejo-13.0.3_1.pkg | 2025-12-29 17:35 | 36M | |
| forgejo-act_runner-9..> | 2025-12-23 19:56 | 6.2M | |
| forgejo-lts-11.0.8_1..> | 2025-12-29 01:25 | 36M | |
| forgejo7-7.0.14_3.pkg | 2025-12-20 10:40 | 34M | |
| forkbomb-1.4_2.pkg | 2025-08-16 19:22 | 6.2K | |
| form-4.3.1_1.pkg | 2025-08-20 06:18 | 1.3M | |
| formication-1.0.b1_3..> | 2025-12-22 12:37 | 13K | |
| formido-1.0.1_2.pkg | 2025-12-30 05:10 | 8.5M | |
| fort-1.6.7.pkg | 2025-12-21 18:34 | 169K | |
| fortran-stdlib-0.7.0..> | 2025-12-29 12:50 | 6.6M | |
| fortran-utils-1.1_1.pkg | 2025-08-22 03:13 | 13K | |
| fortunate-3.1_12.pkg | 2025-12-27 02:16 | 17K | |
| fortune-mod-bible-1...> | 2025-08-16 23:27 | 1.1M | |
| fortune-mod-bofh-2.0..> | 2025-08-22 20:48 | 12K | |
| fortune-mod-epictetu..> | 2025-08-16 15:55 | 14K | |
| fortune-mod-freebsd-..> | 2025-08-17 23:55 | 1.0M | |
| fortune-mod-futurama..> | 2025-08-20 13:05 | 19K | |
| fortune-mod-mormon-1..> | 2025-12-20 16:42 | 3.0M | |
| fortune-mod-psalms-1..> | 2025-08-17 22:42 | 90K | |
| fortuneit-1.99.pkg | 2025-08-16 10:56 | 614K | |
| fortunelock-0.1.2_1.pkg | 2025-08-18 10:12 | 4.9K | |
| fortytwo-0.2.0_14.pkg | 2025-12-27 17:52 | 106K | |
| fortytwo-bdb-0.2.1_1..> | 2025-12-26 21:41 | 39K | |
| fortytwo-encore-0.3...> | 2025-12-26 18:52 | 107K | |
| fossil-2.27,2.pkg | 2025-12-21 12:27 | 2.0M | |
| fossmixer-0.0.3_5.pkg | 2025-12-30 10:29 | 20M | |
| fossology-nomos-stan..> | 2025-12-22 16:26 | 144K | |
| foswiki-2.1.9.pkg | 2025-12-20 20:38 | 13M | |
| fotaq-1.1_2.pkg | 2025-12-29 00:25 | 31M | |
| fotocx-25.0.pkg | 2025-12-30 11:50 | 14M | |
| founts-13_2.pkg | 2025-12-23 05:03 | 38K | |
| four-in-a-row-3.38.1..> | 2025-12-29 15:02 | 531K | |
| fowsr-2.0_1.pkg | 2025-08-18 15:21 | 11K | |
| fox-xml-4.1.2.91_5.pkg | 2025-12-29 02:27 | 880K | |
| fox16-1.6.59.pkg | 2025-12-27 08:50 | 3.5M | |
| fox17-1.7.86.pkg | 2025-12-27 04:40 | 5.1M | |
| foxtrotgps-1.2.2_7.pkg | 2025-12-29 17:48 | 941K | |
| fp16-g20200514.pkg | 2025-08-19 20:57 | 5.6K | |
| fparser-4.5.2.pkg | 2025-08-13 20:23 | 141K | |
| fpart-1.7.0.pkg | 2025-12-23 12:55 | 51K | |
| fpc-3.2.3_2.pkg | 2025-12-18 22:21 | 43M | |
| fpc-devel-3.3.1.2025..> | 2025-12-19 17:08 | 52M | |
| fpc-devel-source-3.3..> | 2025-08-14 22:28 | 35M | |
| fpc-docs-3.2.2.pkg | 2025-08-16 05:49 | 9.2M | |
| fpc-source-3.2.3_2.pkg | 2025-12-18 23:18 | 31M | |
| fpdf-1.86,1.pkg | 2025-12-30 03:04 | 107K | |
| fping-5.3.pkg | 2025-08-15 06:53 | 28K | |
| fplll-5.5.0.pkg | 2025-12-26 20:45 | 4.9M | |
| fpp-1.1_2.pkg | 2025-08-20 08:15 | 53K | |
| fprintd-1.94.4.pkg | 2025-12-22 08:43 | 135K | |
| fprobe-1.1_2.pkg | 2025-08-18 02:53 | 21K | |
| fq-0.14.0_2.pkg | 2025-08-16 15:08 | 3.5M | |
| fr-aspell-0.50.3_1,1..> | 2025-12-24 04:57 | 4.6M | |
| fr-fortune-mod-zarat..> | 2025-08-16 00:21 | 9.4K | |
| fr-freebsd-doc-20251..> | 2025-12-19 17:39 | 7.5M | |
| fr-hunspell-6.4.1.pkg | 2025-08-17 05:12 | 355K | |
| fr-hyphen-3.0.pkg | 2025-08-18 12:58 | 8.9K | |
| fr-jdictionary-fre-h..> | 2025-12-28 04:01 | 295K | |
| fr-libreoffice-25.8...> | 2025-12-27 15:01 | 3.5M | |
| fr-med-4.0.0_3.pkg | 2025-12-26 14:40 | 14M | |
| fr-mythes-2.3.pkg | 2025-08-17 00:33 | 1.0M | |
| fr-verbiste-0.1.49_1..> | 2025-12-22 12:36 | 135K | |
| fr-wordpress-fr_FR-6..> | 2025-12-27 21:20 | 25M | |
| fracplanet-0.5.1_24.pkg | 2025-12-30 16:43 | 167K | |
| fractgen-3.0.6.pkg | 2025-12-29 12:12 | 282K | |
| fragroute-1.2_17.pkg | 2025-12-21 02:25 | 27K | |
| fragrouter-1.6_2.pkg | 2025-08-22 01:41 | 22K | |
| framework-system-0.4..> | 2025-12-30 12:41 | 822K | |
| framework-tool-tui-0..> | 2025-12-27 21:55 | 478K | |
| frand-0.1_13.pkg | 2025-12-22 18:10 | 10K | |
| fraqtive-0.4.8.1_1.pkg | 2025-12-30 15:31 | 236K | |
| frece-1.0.6_27.pkg | 2025-12-28 01:17 | 385K | |
| free-sa-devel-2.0.0b..> | 2025-08-22 12:37 | 105K | |
| free42-3.3.10.pkg | 2025-12-28 13:24 | 2.0M | |
| freealut-1.1.0.20240..> | 2025-12-18 23:33 | 20K | |
| freebayes-1.3.9.pkg | 2025-12-19 15:12 | 1.0M | |
| freebee-2.0.pkg | 2025-12-21 06:19 | 11K | |
| freeblocks-0.5.pkg | 2025-12-30 06:24 | 6.4M | |
| freebsd-8k-wallpaper..> | 2025-08-20 16:02 | 29M | |
| freebsd-8k-wallpaper..> | 2025-08-19 03:40 | 33M | |
| freebsd-13-mixer-13...> | 2025-08-21 05:13 | 7.6K | |
| freebsd-bsdlabel-15...> | 2025-08-18 11:34 | 20K | |
| freebsd-bugzilla-cli..> | 2025-12-22 18:18 | 16K | |
| freebsd-doc-all-2025..> | 2025-12-24 03:29 | 677 | |
| freebsd-fdisk-15.0.pkg | 2025-08-16 16:12 | 18K | |
| freebsd-ftpd-2025092..> | 2025-12-21 06:12 | 54K | |
| freebsd-git-devtools..> | 2025-12-29 12:44 | 14K | |
| freebsd-nvme-shim-1...> | 2025-08-14 02:33 | 3.3K | |
| freebsd-release-mani..> | 2025-12-18 17:38 | 6.7K | |
| freebsd-route6d-15.0..> | 2025-08-16 17:15 | 27K | |
| freebsd-routed-15.0...> | 2025-08-22 02:50 | 67K | |
| freebsd-rustdate-1.3..> | 2025-12-27 21:48 | 2.4M | |
| freebsd-shar-15.0_2.pkg | 2025-08-20 20:45 | 3.6K | |
| freebsd-snapshot-200..> | 2025-08-16 17:52 | 12K | |
| freebsd-telnetd-15.0..> | 2025-12-21 00:20 | 29K | |
| freebsd-update-notif..> | 2025-12-30 04:52 | 4.5K | |
| freebsd-uucp-1.07.4_..> | 2025-08-14 07:44 | 392K | |
| freecell-solver-6.2...> | 2025-12-18 17:47 | 220K | |
| freeciv-3.2.1.pkg | 2025-12-30 00:04 | 21M | |
| freeciv-nox11-3.2.1.pkg | 2025-12-22 04:52 | 8.6M | |
| freeciv21-3.1.0.pkg | 2025-12-29 04:05 | 24M | |
| freecol-1.2.0.pkg | 2025-12-28 12:25 | 200M | |
| freecolor-0.9.3_1.pkg | 2025-12-23 07:46 | 5.6K | |
| freedesktop-sound-th..> | 2025-08-13 19:45 | 366K | |
| freediameter-1.5.0_1..> | 2025-12-22 15:51 | 389K | |
| freedink-108.4.pkg | 2025-12-29 13:54 | 1.0K | |
| freedink-data-1.08.2..> | 2025-12-19 05:54 | 28M | |
| freedink-dfarc-3.14_..> | 2025-12-27 08:03 | 146K | |
| freedink-engine-108...> | 2025-12-27 16:53 | 377K | |
| freedoko-0.8.1.pkg | 2025-12-30 12:10 | 19M | |
| freedroid-1.0.2_21.pkg | 2025-12-28 14:13 | 4.1M | |
| freedroidrpg-1.0_2.pkg | 2025-12-29 02:29 | 218M | |
| freedt-24.pkg | 2025-08-21 02:12 | 33K | |
| freedv-1.7.0_5.pkg | 2025-12-29 12:56 | 7.8M | |
| freefont-ttf-2012050..> | 2025-12-26 22:51 | 4.4M | |
| freefonts-0.10_10.pkg | 2025-12-29 13:47 | 2.1M | |
| freeglut-3.2.1.pkg | 2025-08-13 11:03 | 261K | |
| freeguide-0.11.1_2.pkg | 2025-12-29 05:12 | 1.7M | |
| freehdl-0.0.8_1.pkg | 2025-12-29 11:47 | 1.7M | |
| freeimage-3.18.0_6.pkg | 2025-08-13 09:19 | 7.0M | |
| freeipa-client-4.12...> | 2025-12-30 11:46 | 1.1M | |
| freeipmi-1.6.16.pkg | 2025-12-19 05:07 | 2.7M | |
| freemind-1.0.1_1,1.pkg | 2025-12-29 21:31 | 26M | |
| freeminer-0.4.10.4_1..> | 2025-12-27 16:21 | 4.3M | |
| freeminer-default-0...> | 2025-12-28 21:28 | 634K | |
| freenginx-1.28.0_6.pkg | 2025-12-23 07:37 | 557K | |
| freenginx-devel-1.29..> | 2025-12-27 11:17 | 563K | |
| freenginx-devel-acme..> | 2025-12-30 07:34 | 436K | |
| freeorion-0.5.1.1.pkg | 2025-12-29 20:45 | 152M | |
| freepats-20060219.pkg | 2025-08-14 02:02 | 27M | |
| freeplane-1.12.14.pkg | 2025-12-30 02:36 | 57M | |
| freeradius-client-1...> | 2025-08-17 01:27 | 64K | |
| freeradius3-3.2.8.pkg | 2025-12-24 01:11 | 2.3M | |
| freeradius3-ldap-3.2..> | 2025-12-23 05:10 | 2.3M | |
| freeradius3-mysql-3...> | 2025-12-23 21:00 | 2.3M | |
| freeradius3-pgsql-3...> | 2025-12-23 05:26 | 2.3M | |
| freeradius3-sqlite3-..> | 2025-12-21 10:33 | 2.3M | |
| freerdp-2.11.7_5.pkg | 2025-12-26 22:24 | 1.4M | |
| freerdp3-3.19.1_1.pkg | 2025-12-26 20:09 | 2.4M | |
| freesbie-2.0.2007071..> | 2025-12-30 18:17 | 35K | |
| freesweep-1.0.2_1.pkg | 2025-08-18 13:21 | 34K | |
| freesynd-0.8_1.pkg | 2025-12-29 16:29 | 2.4M | |
| freetalk-4.2_3.pkg | 2025-12-21 09:14 | 61K | |
| freetds-1.5.10,1.pkg | 2025-12-18 20:25 | 1.4M | |
| freetds-devel-1.5.20..> | 2025-12-29 12:38 | 1.3M | |
| freetennis-0.4.8_18.pkg | 2025-12-28 09:54 | 5.3M | |
| freetype-gl-1.0.pkg | 2025-12-30 12:17 | 47K | |
| freetype2-2.14.1.pkg | 2025-12-24 20:15 | 1.2M | |
| freevrrpd-1.2_1.pkg | 2025-08-20 01:22 | 274K | |
| freexl-2.0.0.pkg | 2025-12-18 01:12 | 43K | |
| frei0r-2.5.0.pkg | 2025-12-16 02:02 | 509K | |
| frei0r-plugins-2.5.0..> | 2025-12-26 18:57 | 939 | |
| frei0r-plugins-cairo..> | 2025-12-26 14:50 | 18K | |
| frei0r-plugins-gavl-..> | 2025-12-26 15:11 | 41K | |
| frei0r-plugins-openc..> | 2025-12-26 17:01 | 21K | |
| freqtrade-2023.12_1.pkg | 2025-12-30 14:20 | 1.1M | |
| fretsonfire-1.3.110_..> | 2025-12-30 05:44 | 122K | |
| fretsonfire-data-1.3..> | 2025-08-15 13:18 | 29M | |
| fribidi-1.0.16.pkg | 2025-08-10 21:38 | 73K | |
| fricas-1.3.10.pkg | 2025-12-23 03:00 | 27M | |
| frikqcc-2.6.pkg | 2025-08-18 19:08 | 47K | |
| frink-2.2.2p4_3.pkg | 2025-08-22 04:36 | 47K | |
| fritzing-1.0.6.pkg | 2025-12-29 20:14 | 25M | |
| frobby-0.9.5_3.pkg | 2025-08-17 10:10 | 1.3M | |
| frodo-4.5.pkg | 2025-12-28 10:38 | 404K | |
| frogr-1.6_6.pkg | 2025-12-30 10:48 | 2.1M | |
| frontaccounting-2.4...> | 2025-12-30 09:22 | 1.3M | |
| frontbase-jdbc-2.5.6..> | 2025-12-29 06:41 | 143K | |
| frotz-2.51_1.pkg | 2025-08-14 16:15 | 79K | |
| froxlor-2.2.8.pkg | 2025-12-28 08:31 | 2.7M | |
| frozen-bubble-2.213...> | 2025-12-29 09:48 | 21M | |
| frp-0.65.0_4.pkg | 2025-12-21 22:16 | 11M | |
| frr8-8.5.7.pkg | 2025-12-20 00:05 | 3.6M | |
| frr8-pythontools-8.5..> | 2025-12-21 00:05 | 20K | |
| frr9-9.1.3_1.pkg | 2025-12-20 03:59 | 4.0M | |
| frr9-pythontools-9.1..> | 2025-12-23 23:59 | 20K | |
| frr10-10.5.0.pkg | 2025-12-19 03:10 | 4.8M | |
| frr10-pythontools-10..> | 2025-12-21 22:12 | 22K | |
| frugally-deep-0.16.2..> | 2025-12-29 08:03 | 41K | |
| fruit-3.7.1.pkg | 2025-12-19 22:37 | 124K | |
| fs-uae-3.1.66.pkg | 2025-12-28 16:51 | 4.3M | |
| fs-uae-launcher-3.1...> | 2025-12-29 06:34 | 8.4M | |
| fs2open-24.2.0_1.pkg | 2025-12-30 05:29 | 5.0M | |
| fsbackup-1.2.1_4.pkg | 2025-12-21 19:28 | 32K | |
| fsc-1.2_1.pkg | 2025-08-16 19:46 | 17K | |
| fsearch-0.2.3_4.pkg | 2025-12-27 23:44 | 246K | |
| fselect-0.8.6_14.pkg | 2025-12-27 20:16 | 1.2M | |
| fsharp-10.2.1_2.pkg | 2025-12-22 03:54 | 7.6M | |
| fslsfonts-1.0.5_1.pkg | 2025-08-20 21:11 | 7.6K | |
| fsmtrie-2.0.0.pkg | 2025-08-21 01:35 | 16K | |
| fsom-g20151117_2.pkg | 2025-08-20 00:27 | 24K | |
| fspclient-0.93.1.pkg | 2025-08-19 02:27 | 135K | |
| fspd-2.8.1.29_1.pkg | 2025-08-21 15:08 | 87K | |
| fsplib-0.14.pkg | 2025-08-17 08:02 | 21K | |
| fstobdf-1.0.7.pkg | 2025-08-22 07:41 | 7.2K | |
| fstrcmp-0.7.D001_1.pkg | 2025-08-13 15:24 | 29K | |
| fstrm-0.6.1_1.pkg | 2025-08-13 22:06 | 69K | |
| fstyp-0.1_1.pkg | 2025-08-22 16:51 | 5.6K | |
| fswatch-0.02.b5_2.pkg | 2025-08-16 20:57 | 33K | |
| fswatch-mon-1.13.0_3..> | 2025-12-22 13:32 | 252K | |
| fswebcam-20200725_1.pkg | 2025-12-30 02:08 | 45K | |
| fswiki-3.6.2_2.pkg | 2025-12-21 16:34 | 542K | |
| fswm-g20230808.pkg | 2025-08-19 02:09 | 4.3K | |
| fsx-0.3.1_4.pkg | 2025-12-30 03:12 | 570K | |
| ft2-clone-2.03.pkg | 2025-12-30 01:00 | 449K | |
| ft2demos-2.11.1.pkg | 2025-12-30 17:40 | 751K | |
| ft2play-g20220407.pkg | 2025-12-28 12:00 | 37K | |
| ftdi-eeprom-1.1_2.pkg | 2025-08-16 22:56 | 5.8K | |
| ftgl-2.4.0_2,1.pkg | 2025-12-26 09:46 | 113K | |
| fth-1.4.5.pkg | 2025-08-18 21:26 | 618K | |
| ftimes-3.11.0_3.pkg | 2025-12-20 17:39 | 307K | |
| ftjam-2.5.2.pkg | 2025-08-17 20:55 | 92K | |
| ftnchek-3.3.1_1.pkg | 2025-08-21 07:05 | 198K | |
| ftpcopy-0.6.7_1.pkg | 2025-08-21 11:09 | 91K | |
| ftpfind-0.996.pkg | 2025-08-18 12:38 | 7.9K | |
| ftplib-4.0.1.pkg | 2025-08-18 22:19 | 20K | |
| ftpproxy-1.2.3_3.pkg | 2025-08-20 04:17 | 27K | |
| ftpsesame-0.95_3.pkg | 2025-08-17 00:04 | 14K | |
| ftpsync-1.3.06,1.pkg | 2025-12-21 12:49 | 18K | |
| ftwin-0.8.10_2.pkg | 2025-12-29 06:35 | 25K | |
| ftxui-6.1.9.pkg | 2025-12-19 03:27 | 5.8M | |
| functionalplus-0.2.2..> | 2025-12-20 00:19 | 77K | |
| fungw-1.2.2.pkg | 2025-12-18 23:51 | 279K | |
| funnyboat-1.6_3.pkg | 2025-12-28 10:25 | 3.6M | |
| fur-libreoffice-25.8..> | 2025-12-27 16:24 | 153K | |
| furnace-0.6.8.3_2.pkg | 2025-12-29 18:16 | 17M | |
| fuse-1.6.0_8.pkg | 2025-12-28 13:14 | 733K | |
| fuse-roms-0.2,1.pkg | 2025-08-16 13:08 | 103K | |
| fuse-utils-1.4.3_3.pkg | 2025-12-30 06:12 | 133K | |
| fuse-zip-0.4.4_2.pkg | 2025-12-21 10:37 | 37K | |
| fusefs-afuse-0.5.0.pkg | 2025-08-18 22:24 | 16K | |
| fusefs-befuse-1.2.pkg | 2025-08-16 20:57 | 154K | |
| fusefs-bindfs-1.18.3..> | 2025-12-21 09:10 | 28K | |
| fusefs-chironfs-1.1...> | 2025-08-19 06:44 | 171K | |
| fusefs-cryptofs-0.6...> | 2025-12-21 14:11 | 15K | |
| fusefs-curlftpfs-0.9..> | 2025-12-24 04:24 | 27K | |
| fusefs-davfs2-1.7.2_..> | 2025-12-23 07:46 | 125K | |
| fusefs-encfs-1.9.5_1..> | 2025-12-21 11:48 | 405K | |
| fusefs-exfat-1.4.0_1..> | 2025-08-15 22:46 | 25K | |
| fusefs-ext2-0.0.11_2..> | 2025-12-18 20:17 | 15K | |
| fusefs-gphotofs-0.5...> | 2025-12-26 20:52 | 8.1K | |
| fusefs-hfsfuse-0.289..> | 2025-12-19 12:45 | 59K | |
| fusefs-httpdirfs-1.2..> | 2025-12-22 00:37 | 29K | |
| fusefs-ifuse-1.1.4_2..> | 2025-12-22 23:23 | 12K | |
| fusefs-jmtpfs-g20190..> | 2025-12-18 21:16 | 40K | |
| fusefs-libs-2.9.9_2.pkg | 2025-08-13 15:05 | 143K | |
| fusefs-libs3-3.17.1_..> | 2025-08-13 09:53 | 110K | |
| fusefs-lkl-4.16.g201..> | 2025-08-15 16:45 | 13M | |
| fusefs-mergerfs-2.41..> | 2025-12-22 19:24 | 398K | |
| fusefs-mhddfs-0.1.37..> | 2025-08-21 17:57 | 17K | |
| fusefs-mp3fs-1.1.1_1..> | 2025-08-22 22:49 | 52K | |
| fusefs-nbt-20250506.pkg | 2025-08-22 02:05 | 46K | |
| fusefs-ntfs-2022.10...> | 2025-08-14 02:41 | 574K | |
| fusefs-ntfs-compress..> | 2025-08-17 17:03 | 12K | |
| fusefs-pod-0.5.2_16.pkg | 2025-12-30 00:00 | 39K | |
| fusefs-rar2fs-1.29.7..> | 2025-12-22 16:24 | 50K | |
| fusefs-s3backer-1.5...> | 2025-12-23 13:38 | 75K | |
| fusefs-s3fs-1.95_1.pkg | 2025-12-21 10:08 | 250K | |
| fusefs-sandboxfs-0.2..> | 2025-12-28 05:29 | 608K | |
| fusefs-securefs-2.0...> | 2025-12-24 07:12 | 262K | |
| fusefs-simple-mtpfs-..> | 2025-12-21 08:59 | 46K | |
| fusefs-smbnetfs-0.6...> | 2025-12-30 00:31 | 54K | |
| fusefs-squashfuse-0...> | 2025-12-20 05:39 | 55K | |
| fusefs-sshfs-3.7.5.pkg | 2025-12-19 22:25 | 35K | |
| fusefs-ufs-0.6.0_3.pkg | 2025-12-27 19:45 | 363K | |
| fusefs-unionfs-3.7.pkg | 2025-12-22 19:44 | 38K | |
| fusefs-unreliablefs-..> | 2025-08-18 06:25 | 12K | |
| fusefs-webdavfs-g202..> | 2025-12-24 00:05 | 2.3M | |
| fusefs-xfuse-0.5.1_3..> | 2025-12-28 16:29 | 580K | |
| futuresql-0.1.1_2.pkg | 2025-12-27 09:47 | 22K | |
| fuzz-0.6_2.pkg | 2025-08-18 16:01 | 18K | |
| fuzzel-1.13.1.pkg | 2025-12-29 23:46 | 107K | |
| fuzzylite-6.0_1.pkg | 2025-08-15 12:28 | 407K | |
| fuzzysearchdatabase-..> | 2025-08-15 21:42 | 4.6K | |
| fv-1.03_7.pkg | 2025-12-29 13:08 | 21K | |
| fvwm-2.6.9_4.pkg | 2025-12-27 19:40 | 2.6M | |
| fvwm-themes-0.7.0_7.pkg | 2025-12-29 17:24 | 1.8M | |
| fvwm3-1.1.0_8.pkg | 2025-12-30 15:11 | 3.4M | |
| fwanalog-0.6.9_6.pkg | 2025-12-29 17:57 | 47K | |
| fwknop-2.6.10_5.pkg | 2025-12-23 09:47 | 188K | |
| fwlogwatch-1.5_1.pkg | 2025-12-23 07:45 | 135K | |
| fwup-1.14.0.pkg | 2025-12-23 01:44 | 143K | |
| fwupd-efi-1.8_1.pkg | 2025-12-26 21:27 | 27K | |
| fx-35.0.0_13.pkg | 2025-12-22 07:28 | 3.4M | |
| fxdiv-g20181121.pkg | 2025-08-13 11:04 | 3.2K | |
| fxite-0.92_5.pkg | 2025-12-28 19:08 | 766K | |
| fxload-20140224_1.pkg | 2025-08-14 17:54 | 16K | |
| fxscintilla-2.28.0_8..> | 2025-12-28 10:03 | 707K | |
| fxt-2025.06.26.pkg | 2025-08-18 07:59 | 960K | |
| fy-aspell-0.12.0_1.pkg | 2025-12-21 01:26 | 225K | |
| fy-libreoffice-25.8...> | 2025-12-27 04:04 | 678K | |
| fyi-1.0.4_1.pkg | 2025-12-21 13:19 | 15K | |
| fyre-1.0.1_30.pkg | 2025-12-30 00:10 | 114K | |
| fzf-0.67.0_1.pkg | 2025-12-18 21:16 | 1.5M | |
| fzy-1.1.pkg | 2025-08-20 21:10 | 14K | |
| g-cows-1.12.pkg | 2025-08-18 15:19 | 186K | |
| g-gcl-1.10.pkg | 2025-08-19 06:07 | 22K | |
| g-golf-guile22-0.8.0..> | 2025-12-22 06:24 | 1.2M | |
| g-wrap-1.9.15_4.pkg | 2025-12-19 18:20 | 95K | |
| g2-0.72.pkg | 2025-12-30 06:40 | 47K | |
| g2o-20241228_1.pkg | 2025-12-30 17:14 | 1.3M | |
| g4music-4.6.pkg | 2025-12-30 17:42 | 258K | |
| g15daemon-3.0.4_1.pkg | 2025-12-22 17:35 | 41K | |
| g810-led-0.4.3.pkg | 2025-12-30 04:08 | 56K | |
| ga-5.9.2.pkg | 2025-12-27 06:49 | 507K | |
| ga-aspell-4.5.0,2.pkg | 2025-12-23 15:22 | 2.6M | |
| ga-libreoffice-25.8...> | 2025-12-27 17:48 | 532K | |
| gaa-1.6.6.pkg | 2025-08-16 10:17 | 114K | |
| gabedit-2.5.1.300720..> | 2025-12-27 21:18 | 2.0M | |
| gaffitter-0.6.0_2.pkg | 2025-08-17 15:37 | 64K | |
| gajim-2.2.0_1.pkg | 2025-12-29 13:04 | 3.6M | |
| galaxis-1.10_1.pkg | 2025-08-20 07:33 | 11K | |
| galculator-2.1.4_3.pkg | 2025-12-29 12:58 | 153K | |
| galene-1.0_2.pkg | 2025-12-23 05:36 | 5.7M | |
| galera26-26.4.22_2.pkg | 2025-12-19 21:45 | 936K | |
| gallant-0.1.pkg | 2025-12-30 10:10 | 68K | |
| gallery-dl-1.31.1.pkg | 2025-12-29 22:30 | 1.4M | |
| gallery2-2.3.2_12.pkg | 2025-12-29 07:34 | 7.6M | |
| gambit-16.0.2_1.pkg | 2025-12-28 00:19 | 1.6M | |
| gamenetworkingsocket..> | 2025-08-20 14:28 | 488K | |
| gamescope-3.13.8_10.pkg | 2025-12-29 01:11 | 635K | |
| gamin-0.1.10_10.pkg | 2025-12-18 06:25 | 56K | |
| gammaray-3.3.0.pkg | 2025-12-29 08:14 | 11M | |
| gammastep-2.0.11.pkg | 2025-12-30 08:29 | 89K | |
| gammu-1.42.0_1.pkg | 2025-12-24 06:54 | 1.2M | |
| ganglia-monitor-core..> | 2025-12-28 12:17 | 180K | |
| ganv-1.8.2_2.pkg | 2025-12-27 09:41 | 112K | |
| gap-4.14.0.pkg | 2025-12-19 21:41 | 471M | |
| gapcmon-0.8.9_9.pkg | 2025-12-28 11:38 | 55K | |
| garage-2.1.0_2.pkg | 2025-12-30 06:24 | 7.3M | |
| garcon-4.20.0.pkg | 2025-12-26 16:57 | 134K | |
| garden-of-coloured-l..> | 2025-12-29 16:25 | 2.1M | |
| gargoyle-2023.1.pkg | 2025-12-29 18:56 | 4.5M | |
| garlic-1.6_1.pkg | 2025-08-18 03:16 | 1.3M | |
| gartoon-redux-1.11_2..> | 2025-12-27 08:44 | 6.5M | |
| gastex-3.0.pkg | 2025-12-29 14:26 | 23K | |
| gather-0.4.1_1.pkg | 2025-12-22 06:36 | 18K | |
| gatk-4.6.2.0.pkg | 2025-12-29 15:42 | 374M | |
| gatling-0.16_1.pkg | 2025-08-19 12:36 | 160K | |
| gatus-5.33.1.pkg | 2025-12-30 03:52 | 9.7M | |
| gau2grid-2.0.7_1.pkg | 2025-08-15 18:28 | 254K | |
| gauche-0.9.15_2.pkg | 2025-12-19 11:42 | 19M | |
| gauche-gl-0.6_5.pkg | 2025-12-20 06:01 | 753K | |
| gauche-makiki-0.5.pkg | 2025-12-22 13:02 | 25K | |
| gauche-readline-0.1_..> | 2025-12-23 12:50 | 7.9K | |
| gaul-0.1849.0_5.pkg | 2025-12-29 11:32 | 202K | |
| gaupol-1.15_1.pkg | 2025-12-27 20:47 | 635K | |
| gauth-1.5.0_5.pkg | 2025-12-21 10:31 | 734K | |
| gavl-1.4.0_4.pkg | 2025-12-26 13:49 | 3.2M | |
| gawk-5.3.2.pkg | 2025-12-18 14:02 | 1.2M | |
| gbase-0.5_9.pkg | 2025-12-29 11:33 | 7.4K | |
| gbdfed-1.6_3.pkg | 2025-12-30 01:59 | 193K | |
| gbe-0.0.22_3.pkg | 2025-08-21 12:00 | 30K | |
| gbrainy-2.4.6_3,2.pkg | 2025-12-23 10:56 | 1.0M | |
| gbsdconv-11.3_4.pkg | 2025-12-29 12:28 | 49K | |
| gbsddialog-0.9.1.pkg | 2025-12-28 12:26 | 84K | |
| gbsplay-0.0.102,1.pkg | 2025-12-21 05:58 | 81K | |
| gbtolib-3.0.3_5.pkg | 2025-12-27 06:47 | 1.1M | |
| gbump-1.1.2_21.pkg | 2025-12-30 03:53 | 840K | |
| gcab-1.6.pkg | 2025-12-18 04:16 | 74K | |
| gcal-4.1_1.pkg | 2025-12-22 21:39 | 866K | |
| gcc-14_5.pkg | 2025-12-24 20:09 | 948 | |
| gcc-arm-embedded-14...> | 2025-12-18 02:23 | 693M | |
| gcc-arm-embedded-aar..> | 2025-12-17 01:15 | 102M | |
| gcc-msp430-ti-toolch..> | 2025-08-12 22:22 | 83M | |
| gcc6-aux-20180516_3,..> | 2025-12-17 08:12 | 58M | |
| gcc12-12.4.0_3.pkg | 2025-12-17 12:39 | 83M | |
| gcc12-devel-12.4.1.s..> | 2025-12-17 14:58 | 83M | |
| gcc13-13.3.0_3.pkg | 2025-12-16 09:23 | 86M | |
| gcc13-devel-13.4.1.s..> | 2025-12-24 21:48 | 86M | |
| gcc14-14.2.0_4.pkg | 2025-12-17 04:15 | 96M | |
| gcc14-devel-14.3.1.s..> | 2025-12-24 22:01 | 96M | |
| gcc15-15.2.0_1.pkg | 2025-12-17 22:40 | 104M | |
| gcc15-devel-15.2.1.s..> | 2025-12-24 22:06 | 104M | |
| gcc16-devel-16.0.0.s..> | 2025-12-17 04:10 | 129M | |
| gccmakedep-1.0.4.pkg | 2025-08-11 13:18 | 3.0K | |
| gcem-1.18.0.pkg | 2025-08-22 04:27 | 26K | |
| gchemutils-0.14.17_5..> | 2025-12-28 10:18 | 1.4M | |
| gcli-2.9.1.pkg | 2025-12-20 14:52 | 152K | |
| gcolor2-0.4_11.pkg | 2025-12-29 07:18 | 16K | |
| gcolor3-2.4.0_4.pkg | 2025-12-30 06:00 | 80K | |
| gcompris-qt-25.1.1.pkg | 2025-12-28 00:54 | 42M | |
| gconf-editor-3.0.1_7..> | 2025-12-28 02:14 | 195K | |
| gconf2-3.2.6_11.pkg | 2025-12-19 21:03 | 1.0M | |
| gcp-2.3.2.pkg | 2025-12-30 09:50 | 143K | |
| gcp-ops-agent-2.48.0..> | 2025-12-20 13:56 | 15M | |
| gcpio-2.15_1.pkg | 2025-12-23 00:23 | 238K | |
| gcr-4.4.0.1.pkg | 2025-12-26 13:01 | 585K | |
| gcr3-3.41.2.pkg | 2025-12-26 10:58 | 764K | |
| gcta-1.94.1_3.pkg | 2025-12-30 17:35 | 1.3M | |
| gd-aspell-0.1.1.1_1,..> | 2025-12-22 19:08 | 138K | |
| gd-libreoffice-25.8...> | 2025-12-27 02:39 | 546K | |
| gdal-3.11.5_2.pkg | 2025-12-26 07:47 | 10M | |
| gdal-grass-2.0.0,1.pkg | 2025-12-29 01:15 | 29K | |
| gdalcpp-1.3.0.pkg | 2025-12-26 20:42 | 4.1K | |
| gdb-15.1_4.pkg | 2025-12-18 23:07 | 13M | |
| gdbm-1.26.pkg | 2025-12-16 01:48 | 251K | |
| gdchart-0.11.5_11.pkg | 2025-12-29 01:12 | 57K | |
| gdcm-3.0.24_1.pkg | 2025-12-26 11:05 | 2.0M | |
| gdisk-1.0.10_1.pkg | 2025-12-22 19:29 | 161K | |
| gdk-pixbuf-extra-0.1..> | 2025-12-26 11:25 | 46K | |
| gdk-pixbuf-xlib-2.40..> | 2025-12-27 00:55 | 43K | |
| gdk-pixbuf2-2.44.1.pkg | 2025-12-24 20:25 | 1.7M | |
| gdl-3.40.0_3.pkg | 2025-12-28 23:55 | 269K | |
| gdm-47.0.pkg | 2025-12-26 18:45 | 904K | |
| gdma-2.2.6_6.pkg | 2025-12-27 23:52 | 140K | |
| gdmap-0.8.1_4.pkg | 2025-12-30 09:39 | 42K | |
| gdmd-0.1.0.20210818.pkg | 2025-12-24 07:20 | 6.8K | |
| gdnsd2-2.4.3_1.pkg | 2025-08-19 00:54 | 370K | |
| gdnsd3-3.8.0_2.pkg | 2025-08-17 23:28 | 293K | |
| gdome2-0.8.1_16.pkg | 2025-12-19 11:51 | 179K | |
| gdrive-3.9.1_9.pkg | 2025-12-28 17:07 | 1.6M | |
| gds3d-g20220203.pkg | 2025-08-21 15:31 | 350K | |
| gdscpp-g20200611.pkg | 2025-08-20 01:06 | 90K | |
| gdsreader-0.3.2_2.pkg | 2025-08-22 00:54 | 62K | |
| gdstk-0.9.61.pkg | 2025-12-21 17:01 | 225K | |
| gdt-4.0.4.pkg | 2025-12-22 07:20 | 526K | |
| gdu-5.32.0.pkg | 2025-12-22 10:46 | 4.8M | |
| geant4-11.3.2.pkg | 2025-12-29 18:39 | 2.6G | |
| geany-2.1.pkg | 2025-12-26 18:35 | 4.2M | |
| geany-plugin-addons-..> | 2025-12-27 11:26 | 38K | |
| geany-plugin-autoclo..> | 2025-12-27 19:43 | 19K | |
| geany-plugin-automar..> | 2025-12-27 02:19 | 11K | |
| geany-plugin-codenav..> | 2025-12-27 17:49 | 18K | |
| geany-plugin-command..> | 2025-12-27 17:02 | 21K | |
| geany-plugin-ctags-2..> | 2025-12-27 06:02 | 22K | |
| geany-plugin-debugge..> | 2025-12-27 16:47 | 70K | |
| geany-plugin-definef..> | 2025-12-27 02:18 | 12K | |
| geany-plugin-doc-2.1..> | 2025-12-27 11:37 | 21K | |
| geany-plugin-extrase..> | 2025-12-27 11:32 | 16K | |
| geany-plugin-gendoc-..> | 2025-12-27 12:44 | 54K | |
| geany-plugin-geniusp..> | 2025-12-27 16:21 | 24K | |
| geany-plugin-git-cha..> | 2025-12-27 09:00 | 25K | |
| geany-plugin-insertn..> | 2025-12-27 11:32 | 16K | |
| geany-plugin-latex-2..> | 2025-12-27 09:35 | 602K | |
| geany-plugin-lineope..> | 2025-12-27 02:19 | 17K | |
| geany-plugin-lipsum-..> | 2025-12-27 15:49 | 13K | |
| geany-plugin-lsp-2.1..> | 2025-12-27 04:45 | 164K | |
| geany-plugin-lua-2.1..> | 2025-12-27 09:01 | 100K | |
| geany-plugin-macro-2..> | 2025-12-27 17:50 | 24K | |
| geany-plugin-markdow..> | 2025-12-27 12:07 | 555K | |
| geany-plugin-miniscr..> | 2025-12-27 02:18 | 17K | |
| geany-plugin-numbere..> | 2025-12-27 15:38 | 21K | |
| geany-plugin-overvie..> | 2025-12-27 16:27 | 24K | |
| geany-plugin-pairtag..> | 2025-12-27 10:26 | 7.8K | |
| geany-plugin-pg-2.1.pkg | 2025-12-27 13:19 | 21K | |
| geany-plugin-pohelpe..> | 2025-12-27 13:08 | 28K | |
| geany-plugin-pretty-..> | 2025-12-27 10:09 | 16K | |
| geany-plugin-prj-2.1..> | 2025-12-27 09:45 | 29K | |
| geany-plugin-project..> | 2025-12-27 07:55 | 44K | |
| geany-plugin-scope-2..> | 2025-12-27 17:13 | 156K | |
| geany-plugin-sendmai..> | 2025-12-27 14:45 | 18K | |
| geany-plugin-shiftco..> | 2025-12-27 13:01 | 13K | |
| geany-plugin-spellch..> | 2025-12-27 11:24 | 29K | |
| geany-plugin-tableco..> | 2025-12-27 17:34 | 15K | |
| geany-plugin-treebro..> | 2025-12-27 18:25 | 23K | |
| geany-plugin-updatec..> | 2025-12-27 12:40 | 14K | |
| geany-plugin-utilsli..> | 2025-12-26 22:53 | 12K | |
| geany-plugin-vc-2.1.pkg | 2025-12-27 13:47 | 36K | |
| geany-plugin-vimode-..> | 2025-12-27 14:13 | 31K | |
| geany-plugin-workben..> | 2025-12-27 16:49 | 45K | |
| geany-plugin-xmlsnip..> | 2025-12-27 11:18 | 14K | |
| geany-plugins-2.1_1.pkg | 2025-12-29 00:18 | 1.3K | |
| geany-plugins-l10n-2..> | 2025-12-27 16:42 | 311K | |
| geany-themes-1.24_3.pkg | 2025-08-22 15:14 | 12K | |
| geary-46.0_3.pkg | 2025-12-27 02:50 | 2.7M | |
| geckodriver-0.36.0_1..> | 2025-12-30 09:44 | 1.3M | |
| gecode-6.3.0_7.pkg | 2025-08-14 06:21 | 4.4M | |
| geda-1.8.2_9,1.pkg | 2025-12-30 04:12 | 6.7M | |
| gedit-48.2.pkg | 2025-12-27 17:28 | 1.8M | |
| gedit-plugins-48.2.pkg | 2025-12-27 21:13 | 356K | |
| gedkeeper-2.25.2_2.pkg | 2025-12-28 10:49 | 13M | |
| geekcode-1.7.3.pkg | 2025-08-22 11:03 | 45K | |
| geeqie-2.4_7.pkg | 2025-12-29 06:38 | 1.4M | |
| gef-2022.01_1.pkg | 2025-12-22 04:59 | 84K | |
| gegl-0.4.64_2.pkg | 2025-12-26 19:55 | 3.0M | |
| geist-mono-1.3.0.pkg | 2025-12-29 15:25 | 247K | |
| geist-sans-1.3.0.pkg | 2025-12-30 04:51 | 229K | |
| gemdropx-0.9_12.pkg | 2025-12-27 19:47 | 810K | |
| gemget-1.9.0_11.pkg | 2025-12-21 17:39 | 1.8M | |
| gemini-cli-0.19.1.pkg | 2025-12-30 11:24 | 21M | |
| gemma-0.98.5_1.pkg | 2025-12-30 10:49 | 29M | |
| gemmi-0.7.3.pkg | 2025-08-14 20:27 | 1.6M | |
| gemmlowp-g20190812.pkg | 2025-08-16 22:46 | 130K | |
| gemrb-0.9.4_1.pkg | 2025-12-29 23:20 | 15M | |
| gemserv-0.6.6_26.pkg | 2025-12-29 17:37 | 1.3M | |
| gen6dns-1.3_1.pkg | 2025-08-17 20:37 | 29K | |
| genact-1.4.2_17.pkg | 2025-12-30 08:09 | 1.2M | |
| generand-0.1.2_1.pkg | 2025-08-18 04:43 | 6.0K | |
| generate-3.2.pkg | 2025-12-20 19:46 | 24K | |
| geneweb-6.08_3.pkg | 2025-08-18 08:33 | 8.4M | |
| gengetopt-2.23_1.pkg | 2025-08-14 08:53 | 216K | |
| genht-1.1.3.pkg | 2025-08-13 18:57 | 32K | |
| genie-g2023092101.pkg | 2025-08-13 23:17 | 160K | |
| genimage-18.pkg | 2025-12-21 01:02 | 36K | |
| genius-1.0.27_5.pkg | 2025-12-30 09:27 | 2.5M | |
| genpatch-1.40_2.pkg | 2025-08-19 03:18 | 6.3K | |
| genromfs-0.5.7_1.pkg | 2025-08-18 01:16 | 12K | |
| genryu-1.501.pkg | 2025-12-29 03:31 | 50M | |
| genseki-1.501.pkg | 2025-12-28 06:12 | 32M | |
| gensen-1.501.pkg | 2025-12-30 04:30 | 43M | |
| gensig-2.3_2.pkg | 2025-08-16 03:21 | 17K | |
| gensio-2.8.12.pkg | 2025-08-14 10:30 | 1.3M | |
| gentoo-0.20.7_2.pkg | 2025-12-28 02:16 | 550K | |
| genwan-1.501.pkg | 2025-12-30 08:22 | 74M | |
| genyo-1.501.pkg | 2025-12-29 02:05 | 46M | |
| genyog-1.501.pkg | 2025-12-30 02:33 | 36M | |
| geoapi-3.0.0.pkg | 2025-12-29 17:02 | 785K | |
| geoclue-2.8.0.pkg | 2025-12-26 06:42 | 199K | |
| geocode-glib-3.26.4.pkg | 2025-12-18 06:29 | 94K | |
| geocode-glib2-3.26.4..> | 2025-12-18 07:43 | 87K | |
| geogebra-5.2.903.0.pkg | 2025-12-29 22:00 | 27M | |
| geogram-1.9.0.pkg | 2025-12-28 22:12 | 5.5M | |
| geographiclib-2.2.pkg | 2025-08-13 14:24 | 17M | |
| geoipupdate-7.1.1_6.pkg | 2025-12-19 12:56 | 2.2M | |
| geom-exporter-0.1.2_..> | 2025-12-30 09:44 | 842K | |
| geomman-1.0.2.pkg | 2025-12-24 04:47 | 32K | |
| geomorph-0.63_1.pkg | 2025-12-29 04:44 | 368K | |
| geomview-1.9.5_5.pkg | 2025-12-28 08:36 | 3.1M | |
| geonkick-lv2-2.10.0.pkg | 2025-12-29 11:14 | 1.6M | |
| geos-3.14.1.pkg | 2025-12-18 01:09 | 1.6M | |
| geoserver-2.28.1.pkg | 2025-12-27 09:56 | 114M | |
| geoserver-mysql-plug..> | 2025-12-30 15:31 | 2.3M | |
| gerbera-3.0.0_2.pkg | 2025-12-30 06:52 | 2.1M | |
| gerbv-2.10.0.pkg | 2025-12-30 16:01 | 1.8M | |
| get_iplayer-3.36.pkg | 2025-12-29 15:26 | 114K | |
| getdelta-0.7.8_5.pkg | 2025-12-24 04:40 | 11K | |
| getdns-1.7.3.pkg | 2025-12-19 12:29 | 297K | |
| getdp-3.6.0_1.pkg | 2025-12-26 13:35 | 1.0M | |
| geteltorito-0.6,1.pkg | 2025-12-21 01:16 | 3.4K | |
| getline-3.9_1.pkg | 2025-08-15 04:54 | 16K | |
| getopt-2.41.3.pkg | 2025-12-24 20:09 | 20K | |
| getoptions-3.3.2.pkg | 2025-08-20 09:40 | 21K | |
| getssl-2.46.pkg | 2025-12-30 07:16 | 36K | |
| gettext-0.26.pkg | 2025-12-20 00:24 | 564 | |
| gettext-lint-0.4_5.pkg | 2025-12-23 16:53 | 20K | |
| gettext-msghack-0.21..> | 2025-12-20 01:41 | 4.2K | |
| gettext-po-mode-0.26..> | 2025-12-23 12:42 | 46K | |
| gettext-runtime-0.26..> | 2025-12-16 01:27 | 293K | |
| gettext-tiny-0.3.2.pkg | 2025-08-19 06:50 | 13K | |
| gettext-tools-0.26.pkg | 2025-12-16 01:30 | 4.0M | |
| gexiv2-0.14.6.pkg | 2025-12-26 17:32 | 124K | |
| gexiv2_016-0.16.0.pkg | 2025-12-30 02:59 | 1.1M | |
| gexpr-2.0.2_2.pkg | 2025-08-21 01:02 | 11K | |
| gf2-g20250204_1.pkg | 2025-12-29 22:49 | 96K | |
| gf2x-1.3.0.pkg | 2025-08-13 07:09 | 68K | |
| gfan-0.6.2_2.pkg | 2025-08-14 06:04 | 1.1M | |
| gfbgraph-0.2.5_1.pkg | 2025-12-30 01:52 | 79K | |
| gff2ps-0.98l.pkg | 2025-12-20 17:11 | 153K | |
| gffread-0.12.7.pkg | 2025-08-15 01:41 | 113K | |
| gflags-2.3.0.pkg | 2025-12-18 04:04 | 120K | |
| gfold-4.0.0_33.pkg | 2025-12-30 01:02 | 671K | |
| gforth-0.7.3_15.pkg | 2025-12-29 00:54 | 679K | |
| gftp-2.9.1b_1.pkg | 2025-12-30 06:26 | 711K | |
| ggml-0.9.4.pkg | 2025-12-27 03:38 | 5.1M | |
| ggobi-2.1.12_3.pkg | 2025-12-28 03:16 | 1.1M | |
| ggwave-0.4.1.pkg | 2025-08-17 08:35 | 46K | |
| gh-2.83.1_1.pkg | 2025-12-23 11:07 | 14M | |
| gh-bc-7.1.0.pkg | 2025-12-21 05:35 | 128K | |
| gh-grep-1.2.3_11.pkg | 2025-12-21 07:51 | 3.4M | |
| gh-md-toc-0.10.0.pkg | 2025-12-20 05:29 | 8.2K | |
| ghc-9.8.4.pkg | 2025-12-18 06:21 | 198M | |
| ghc92-9.2.8_1.pkg | 2025-12-19 20:52 | 119M | |
| ghc94-9.4.8_1.pkg | 2025-12-19 19:44 | 125M | |
| ghc96-9.6.7.pkg | 2025-12-18 22:33 | 130M | |
| ghdl-5.1.1.pkg | 2025-12-19 11:32 | 10M | |
| ghemical-3.0.0_29.pkg | 2025-12-29 03:09 | 1.7M | |
| ghex-46.3.pkg | 2025-12-30 02:27 | 409K | |
| ghidra-11.4.2.pkg | 2025-12-28 07:07 | 385M | |
| ghmm-0.9.r3_3.pkg | 2025-12-21 20:48 | 255K | |
| ghostie-0.3.1_14.pkg | 2025-12-27 20:13 | 1.3M | |
| ghostscript10-10.06...> | 2025-12-26 03:32 | 9.3M | |
| ghostunnel-1.8.4_3.pkg | 2025-08-18 10:21 | 7.8M | |
| ghostwriter-25.12.0.pkg | 2025-12-30 04:14 | 3.5M | |
| ghq-1.8.0_7.pkg | 2025-12-23 12:56 | 3.1M | |
| ghub-5.0.2.pkg | 2025-12-27 10:47 | 50K | |
| ghub-emacs_canna-5.0..> | 2025-12-27 16:20 | 50K | |
| ghub-emacs_devel-5.0..> | 2025-12-27 04:43 | 49K | |
| ghub-emacs_devel_nox..> | 2025-12-19 23:17 | 49K | |
| ghub-emacs_nox-5.0.2..> | 2025-12-19 12:39 | 50K | |
| ghub-emacs_wayland-5..> | 2025-12-27 19:26 | 50K | |
| giacxcas-1.9.0.85_7.pkg | 2025-12-29 11:51 | 77M | |
| giada-0.17.1_6.pkg | 2025-12-28 22:43 | 252K | |
| giflib-5.2.2.pkg | 2025-08-10 21:39 | 241K | |
| gifmerge-1.33.pkg | 2025-08-20 17:43 | 6.9K | |
| gifsicle-1.96.pkg | 2025-08-15 02:11 | 165K | |
| gifsicle-nox11-1.96.pkg | 2025-08-18 10:23 | 145K | |
| gifski-1.10.3_24.pkg | 2025-12-28 09:53 | 533K | |
| giftool-1.0.pkg | 2025-08-20 00:08 | 23K | |
| gigabase-3.91_9.pkg | 2025-12-28 07:00 | 549K | |
| gigalomania-0.28_2.pkg | 2025-12-28 21:06 | 9.7M | |
| gigedit-1.2.2.pkg | 2025-12-29 13:36 | 1.4M | |
| gigolo-0.6.0.pkg | 2025-12-27 03:40 | 211K | |
| gillo-1.0.b1_13.pkg | 2025-12-30 06:14 | 4.6M | |
| gilt-2.2.4_5.pkg | 2025-12-20 11:19 | 2.9M | |
| gimageview-0.2.27_29..> | 2025-12-27 21:38 | 650K | |
| gimp-2.10.38,2.pkg | 2025-12-29 19:50 | 1.0K | |
| gimp-app-2.10.38_8,1..> | 2025-12-27 01:55 | 20M | |
| gimp-beautify-plugin..> | 2025-12-29 16:37 | 20M | |
| gimp-data-extras-2.0..> | 2025-12-28 03:30 | 4.1M | |
| gimp-gutenprint-5.3...> | 2025-12-27 05:44 | 76K | |
| gimp-help-en-3.0.0.pkg | 2025-08-20 18:50 | 47M | |
| gimp-jxl-plugin-0.11..> | 2025-12-29 18:58 | 20K | |
| gimp-lensfun-plugin-..> | 2025-12-29 10:57 | 23K | |
| gimp-lqr-plugin-0.7...> | 2025-12-28 08:38 | 590K | |
| gimp-refocus-plugin-..> | 2025-12-27 21:43 | 206K | |
| gimp-resynthesizer-2..> | 2025-12-29 03:18 | 42K | |
| gimp3-app-3.0.6_2.pkg | 2025-12-27 13:15 | 24M | |
| gindent-2.2.12_2.pkg | 2025-12-21 22:36 | 121K | |
| gio-sharp-2.22.3_2.pkg | 2025-12-27 10:27 | 104K | |
| gir-to-d-0.23.4_1.pkg | 2025-12-19 05:48 | 309K | |
| girara-0.4.5.pkg | 2025-12-26 20:51 | 66K | |
| gismo-25.07.0.pkg | 2025-08-16 03:34 | 21M | |
| gist-6.0.0_1.pkg | 2025-12-22 22:18 | 20K | |
| git-2.52.0.pkg | 2025-12-16 04:09 | 8.5M | |
| git-absorb-0.8.0_6.pkg | 2025-12-28 18:13 | 766K | |
| git-branchless-0.10...> | 2025-12-22 04:25 | 3.9M | |
| git-bug-0.8.0_22.pkg | 2025-12-22 07:44 | 7.3M | |
| git-chglog-0.15.4_22..> | 2025-12-23 10:58 | 3.2M | |
| git-cinnabar-0.7.3_4..> | 2025-12-30 10:06 | 1.8M | |
| git-cliff-2.11.0_1.pkg | 2025-12-30 09:03 | 3.8M | |
| git-codereview-1.18...> | 2025-12-22 10:52 | 2.2M | |
| git-cola-4.14.0.pkg | 2025-12-29 11:04 | 1.1M | |
| git-credential-azure..> | 2025-12-21 22:31 | 2.3M | |
| git-credential-gopas..> | 2025-12-20 20:18 | 4.0M | |
| git-credential-oauth..> | 2025-12-22 08:17 | 2.2M | |
| git-crypt-0.7.0_1.pkg | 2025-12-23 05:07 | 74K | |
| git-cvs-2.52.0.pkg | 2025-12-23 04:18 | 67K | |
| git-delta-0.18.2_12.pkg | 2025-12-29 18:58 | 2.1M | |
| git-extras-7.4.0.pkg | 2025-12-23 03:06 | 104K | |
| git-filter-repo-2.47..> | 2025-12-23 16:23 | 69K | |
| git-filter-repo-deve..> | 2025-12-21 05:14 | 69K | |
| git-graph-0.7.0_1.pkg | 2025-12-28 04:28 | 939K | |
| git-gui-2.52.0.pkg | 2025-12-28 06:43 | 347K | |
| git-lab-0.1_1.pkg | 2025-12-28 13:56 | 43K | |
| git-lfs-3.6.1_11.pkg | 2025-12-19 00:28 | 4.0M | |
| git-lite-2.52.0.pkg | 2025-12-18 02:16 | 8.2M | |
| git-merge-changelog-..> | 2025-08-20 02:22 | 35K | |
| git-modes-1.4.7,1.pkg | 2025-12-29 00:14 | 9.9K | |
| git-modes-emacs_cann..> | 2025-12-28 23:07 | 9.9K | |
| git-modes-emacs_deve..> | 2025-12-30 11:35 | 9.9K | |
| git-modes-emacs_deve..> | 2025-12-20 04:48 | 9.9K | |
| git-modes-emacs_nox-..> | 2025-12-23 03:49 | 9.9K | |
| git-modes-emacs_wayl..> | 2025-12-30 10:37 | 9.9K | |
| git-p4-2.52.0.pkg | 2025-12-22 03:20 | 49K | |
| git-prev-next-g20220..> | 2025-12-24 06:33 | 2.4K | |
| git-prompt.zsh-2.4.0..> | 2025-12-20 15:03 | 8.3K | |
| git-remote-gcrypt-1...> | 2025-12-21 19:43 | 13K | |
| git-repo-manager-0.8..> | 2025-12-30 17:27 | 1.7M | |
| git-review-2.4.0_1.pkg | 2025-12-28 01:16 | 100K | |
| git-secret-0.2.5_1.pkg | 2025-12-21 19:32 | 23K | |
| git-subrepo-0.4.6_1.pkg | 2025-12-21 11:31 | 29K | |
| git-svn-2.52.0.pkg | 2025-12-23 12:45 | 36K | |
| git-tiny-2.52.0.pkg | 2025-12-19 12:26 | 4.5M | |
| git-town-10.0.3_9.pkg | 2025-12-21 19:10 | 4.0M | |
| git-tui-1.3.0.pkg | 2025-12-23 10:50 | 83K | |
| git-who-1.2_7.pkg | 2025-12-20 06:13 | 1.2M | |
| git-workspace-1.9.0_..> | 2025-12-29 14:23 | 1.8M | |
| gitaly-18.6.2_4.pkg | 2025-12-27 04:55 | 278M | |
| gitea-1.24.2_7.pkg | 2025-12-23 08:53 | 32M | |
| gitea-act_runner-0.2..> | 2025-12-22 20:57 | 5.6M | |
| gitg-44.pkg | 2025-12-28 11:04 | 868K | |
| github-backup-utils-..> | 2025-12-30 08:24 | 71K | |
| github-copilot-cli-0..> | 2025-12-28 20:07 | 6.0M | |
| github-copilot-langu..> | 2025-12-27 15:41 | 7.8M | |
| github-release-monit..> | 2025-12-30 08:43 | 5.9M | |
| gitid-1.2.0_5.pkg | 2025-12-23 20:47 | 1.4M | |
| gitinspector-py311-0..> | 2025-12-24 04:34 | 272K | |
| gitjacker-0.1.0_34.pkg | 2025-12-22 13:04 | 2.7M | |
| gitlab-agent-18.6.2_..> | 2025-12-27 02:15 | 12M | |
| gitlab-analyzers-sec..> | 2025-12-20 04:09 | 4.4M | |
| gitlab-ce-18.6.2_4.pkg | 2025-12-30 15:27 | 99M | |
| gitlab-code-parser-0..> | 2025-12-27 00:11 | 13M | |
| gitlab-ee-18.6.2_4.pkg | 2025-12-28 12:35 | 115M | |
| gitlab-elasticsearch..> | 2025-12-27 12:36 | 7.3M | |
| gitlab-pages-18.6.2_..> | 2025-12-27 11:58 | 8.1M | |
| gitlab-runner-18.6.3..> | 2025-12-21 14:55 | 37M | |
| gitlab-shell-14.45.3..> | 2025-12-19 04:55 | 59M | |
| gitlab-workhorse-18...> | 2025-12-27 13:05 | 58M | |
| gitlab-zoekt-indexer..> | 2025-12-19 23:27 | 8.7M | |
| gitleaks-8.30.0_1.pkg | 2025-12-19 01:01 | 5.1M | |
| gitlist-1.1.1.pkg | 2025-12-28 13:52 | 1.5M | |
| gitlogue-0.6.0_1.pkg | 2025-12-29 00:58 | 3.7M | |
| gitmux-0.11.5_4.pkg | 2025-12-21 21:36 | 1.0M | |
| gitolite-3.6.14,1.pkg | 2025-12-24 04:35 | 122K | |
| gitolite2-2.3.1_1.pkg | 2025-12-24 04:54 | 42K | |
| gitoxide-0.47.0_1.pkg | 2025-12-29 17:35 | 7.3M | |
| gitqlient-1.6.3_1.pkg | 2025-12-30 13:27 | 1.5M | |
| gittrac-2.0.1_1.pkg | 2025-12-22 16:13 | 156K | |
| gitty-0.7.0_28.pkg | 2025-12-23 15:28 | 2.6M | |
| gitu-0.39.0_1.pkg | 2025-12-27 22:53 | 3.9M | |
| gitui-0.28.0_1.pkg | 2025-12-27 23:07 | 4.6M | |
| gitup-1.0.pkg | 2025-08-19 17:59 | 35K | |
| gitwatch-0.4.pkg | 2025-12-23 07:45 | 7.3K | |
| givaro-4.2.0.pkg | 2025-08-14 05:11 | 535K | |
| gjs-1.82.3.pkg | 2025-12-26 15:26 | 373K | |
| gkermit-1.0_2.pkg | 2025-08-19 19:04 | 41K | |
| gkl-0.9.1.pkg | 2025-12-27 08:39 | 101K | |
| gkleds2-0.8.2_10.pkg | 2025-12-29 08:48 | 13K | |
| gkmap-0.2_8.pkg | 2025-12-29 07:23 | 25K | |
| gkrellflynn-0.8_9.pkg | 2025-12-28 00:25 | 19K | |
| gkrellkam2-2.0.0_13.pkg | 2025-12-29 19:32 | 19K | |
| gkrellm-gamma-2.03_1..> | 2025-12-28 07:21 | 4.9K | |
| gkrellm-gkfreq-2.2.pkg | 2025-12-29 18:20 | 5.6K | |
| gkrellm-trayicons-1...> | 2025-12-30 02:24 | 15K | |
| gkrellm-xkb-1.05_11.pkg | 2025-12-30 16:16 | 12K | |
| gkrellm2-2.5.0.pkg | 2025-12-27 09:43 | 628K | |
| gkrellmbgchg2-0.1.11..> | 2025-12-30 09:04 | 13K | |
| gkrellmlaunch2-0.5_9..> | 2025-12-28 23:59 | 7.4K | |
| gkrellmoon2-0.6_11.pkg | 2025-12-29 13:05 | 62K | |
| gkrellshoot2-0.4.4_1..> | 2025-12-29 16:11 | 22K | |
| gkrelltop-2.2.13_1.pkg | 2025-12-28 20:56 | 18K | |
| gkx86info2-0.0.2_9.pkg | 2025-12-30 15:16 | 4.4K | |
| gl-117-1.3.2_13.pkg | 2025-08-17 09:15 | 1.9M | |
| gl-aspell-0.2_1,2.pkg | 2025-12-21 15:34 | 302K | |
| gl-libreoffice-25.8...> | 2025-12-27 09:51 | 3.4M | |
| gl2ps-1.4.2_1.pkg | 2025-12-26 09:46 | 290K | |
| glFlow-0.1.4,1.pkg | 2025-08-21 16:43 | 12K | |
| glabels-3.4.1_6.pkg | 2025-12-30 18:48 | 3.0M | |
| glad-0.1.36.pkg | 2025-08-19 09:44 | 91K | |
| glade-3.40.0_7.pkg | 2025-12-29 00:48 | 2.4M | |
| gladtex-1.4.2.pkg | 2025-12-27 21:48 | 19K | |
| glance-0.8.4_4.pkg | 2025-12-21 05:57 | 4.4M | |
| glassfish-4.1.pkg | 2025-12-29 22:31 | 96M | |
| glaxium-0.5_20.pkg | 2025-12-29 06:24 | 1.5M | |
| glaze-5.5.4.pkg | 2025-08-15 21:40 | 260K | |
| glbinding-3.5.0.pkg | 2025-12-30 00:33 | 2.0M | |
| glbsp-2.24_1.pkg | 2025-08-15 02:41 | 80K | |
| glcapsviewer-g201905..> | 2025-12-29 12:43 | 105K | |
| glclock-6.0.b6.0_7.pkg | 2025-08-21 18:23 | 682K | |
| gle-3.1.0_10.pkg | 2025-08-13 18:58 | 439K | |
| gleam-1.11.0_5.pkg | 2025-12-30 06:02 | 5.2M | |
| glest-3.2.2_17.pkg | 2025-12-23 08:32 | 336K | |
| glest-data-3.2.1.pkg | 2025-08-15 02:48 | 58M | |
| glew-2.2.0_3.pkg | 2025-08-13 17:11 | 440K | |
| glew-wayland-2.2.0_3..> | 2025-08-14 05:26 | 284K | |
| glexcess-1.0_8.pkg | 2025-08-17 06:16 | 7.9M | |
| glfw-3.4_2.pkg | 2025-12-26 15:27 | 1.0M | |
| glfw2-2.7.9_3.pkg | 2025-08-15 05:15 | 853K | |
| glib-2.84.4,2.pkg | 2025-12-16 01:46 | 10M | |
| glib-bootstrap-2.84...> | 2025-12-16 01:43 | 2.8M | |
| glib-networking-2.80..> | 2025-12-17 22:59 | 142K | |
| glibd-2.4.3_3.pkg | 2025-12-22 16:58 | 1.2M | |
| glibmm-2.66.8,1.pkg | 2025-12-18 11:45 | 1.0M | |
| glibmm26-2.84.0.pkg | 2025-12-18 12:26 | 1.1M | |
| glightoff-1.0.0_5.pkg | 2025-12-28 14:13 | 15K | |
| glitter-git-tool-1.6..> | 2025-12-30 02:47 | 895K | |
| gliv-1.9.7_9.pkg | 2025-12-28 07:41 | 181K | |
| gllvm-1.3.1_28.pkg | 2025-12-21 18:00 | 1.4M | |
| glm-1.0.2,1.pkg | 2025-12-18 12:05 | 192K | |
| glmark2-2023.01_2.pkg | 2025-12-30 12:24 | 7.3M | |
| glmaze-1.1.a_14.pkg | 2025-12-22 16:50 | 462K | |
| glob2-0.9.5.0.g20240..> | 2025-12-29 18:12 | 10M | |
| global-6.6.14.pkg | 2025-12-21 09:10 | 490K | |
| global-tz-2025.b.pkg | 2025-08-18 01:37 | 79K | |
| glog-0.7.1_1.pkg | 2025-12-18 06:12 | 110K | |
| glogg-1.1.4_20.pkg | 2025-12-28 10:43 | 247K | |
| gloox-1.0.28.pkg | 2025-12-20 01:33 | 871K | |
| glosm-0.0.2_7.pkg | 2025-12-30 07:16 | 83K | |
| glow-2.1.1_2.pkg | 2025-12-22 10:45 | 4.9M | |
| glpi-11.0.1,1.pkg | 2025-12-28 01:25 | 50M | |
| glpk-5.0.pkg | 2025-08-13 07:11 | 2.5M | |
| glpng-1.47.pkg | 2025-12-29 21:54 | 14K | |
| glsfcave-1.0_6.pkg | 2025-08-19 02:00 | 6.6K | |
| glslang-16.1.0_1.pkg | 2025-12-24 20:24 | 2.7M | |
| gltron-0.70_19.pkg | 2025-12-28 11:07 | 1.8M | |
| glucose-4.2.1.pkg | 2025-08-22 00:33 | 82K | |
| gluon-language-0.18...> | 2025-12-28 10:42 | 16M | |
| glvis-mesh-visualize..> | 2025-12-30 14:57 | 1.2M | |
| glx-utils-9.0.0.pkg | 2025-08-17 06:26 | 62K | |
| gmake-4.4.1.pkg | 2025-12-16 01:28 | 478K | |
| gmanedit-0.4.2_10.pkg | 2025-12-28 10:48 | 39K | |
| gmap-2020.09.12.pkg | 2025-12-21 23:02 | 5.5M | |
| gmastermind-0.6_10.pkg | 2025-12-27 12:49 | 18K | |
| gmdb2-0.9.1_5.pkg | 2025-12-30 02:26 | 125K | |
| gmic-3.1.6_12.pkg | 2025-12-27 13:41 | 7.4M | |
| gmic-qt-3.6.5,1.pkg | 2025-12-30 02:44 | 3.8M | |
| gmic-qt-gimp-3.6.5,1..> | 2025-12-30 00:11 | 3.9M | |
| gmic-qt-gimp3-3.6.5,..> | 2025-12-27 22:33 | 3.9M | |
| gmid-2.1.1.pkg | 2025-08-20 03:06 | 135K | |
| gmime26-2.6.23_4.pkg | 2025-12-19 06:41 | 291K | |
| gmime26-sharp-2.6.23..> | 2025-12-30 10:01 | 43K | |
| gmime30-3.2.15_1.pkg | 2025-12-18 15:42 | 420K | |
| gmines-0.2_10.pkg | 2025-12-27 16:17 | 12K | |
| gmm++-5.4.4_2.pkg | 2025-12-26 13:15 | 115K | |
| gmmlib-22.5.4.pkg | 2025-08-14 16:41 | 263K | |
| gmp-6.3.0.pkg | 2025-08-10 21:13 | 498K | |
| gmp-api-135.pkg | 2025-08-10 22:19 | 11K | |
| gmp-ecm-7.0.5_1.pkg | 2025-08-13 21:39 | 244K | |
| gmrun-1.4.w_1.pkg | 2025-12-27 19:51 | 23K | |
| gmsynth-lv2-0.6.3.pkg | 2025-12-21 12:15 | 28M | |
| gmt-6.3.0_11.pkg | 2025-12-29 06:42 | 5.7M | |
| gmtp-1.3.11_8.pkg | 2025-12-30 02:29 | 116K | |
| gmusicbrowser-1.1.15..> | 2025-12-29 12:21 | 1.0M | |
| gn-2234.pkg | 2025-08-13 21:49 | 705K | |
| gnarwl-3.6_8.pkg | 2025-12-23 08:48 | 45K | |
| gnat12-12.3.0_1.pkg | 2025-12-18 17:01 | 174M | |
| gnat13-13.2.0.pkg | 2025-12-21 17:54 | 180M | |
| gnatcross-binutils-a..> | 2025-08-22 03:23 | 1.6M | |
| gnatcross-sysroot-aa..> | 2025-08-15 22:32 | 22M | |
| gnatdroid-binutils-2..> | 2025-08-16 04:13 | 1.6M | |
| gnatdroid-binutils-x..> | 2025-08-17 21:29 | 1.8M | |
| gnatdroid-sysroot-23..> | 2025-08-15 01:02 | 3.4M | |
| gnatdroid-sysroot-x8..> | 2025-08-14 19:56 | 3.9M | |
| gnaural-1.0.20110606..> | 2025-12-29 07:42 | 89K | |
| gnet2-2.0.8_3.pkg | 2025-12-19 12:47 | 148K | |
| gnetcat-0.7.1_5.pkg | 2025-12-22 14:00 | 25K | |
| gngb-20060309_11.pkg | 2025-12-23 19:51 | 71K | |
| gnocky-0.0.7_7.pkg | 2025-12-28 13:13 | 269K | |
| gnokii-0.6.31_16,1.pkg | 2025-12-27 16:01 | 799K | |
| gnome-47.pkg | 2025-12-29 07:56 | 1.0K | |
| gnome-2048-3.38.2_4.pkg | 2025-12-27 18:06 | 104K | |
| gnome-applets-3.58.0..> | 2025-12-27 19:32 | 6.8M | |
| gnome-autoar-0.4.5.pkg | 2025-12-26 18:05 | 64K | |
| gnome-backgrounds-47..> | 2025-12-18 11:52 | 12M | |
| gnome-builder-47.2_1..> | 2025-12-28 05:13 | 2.9M | |
| gnome-calculator-47...> | 2025-12-27 09:22 | 1.1M | |
| gnome-calendar-47.0_..> | 2025-12-27 16:52 | 455K | |
| gnome-characters-47...> | 2025-12-27 18:01 | 582K | |
| gnome-chess-47.0.pkg | 2025-12-27 10:59 | 694K | |
| gnome-clipboard-daem..> | 2025-12-30 16:35 | 5.0K | |
| gnome-clocks-47.0,1.pkg | 2025-12-27 08:38 | 384K | |
| gnome-color-manager-..> | 2025-12-29 00:24 | 1.0M | |
| gnome-common-3.18.0.pkg | 2025-08-14 08:02 | 7.0K | |
| gnome-connections-47..> | 2025-12-28 09:12 | 222K | |
| gnome-console-48.1.pkg | 2025-12-27 16:36 | 179K | |
| gnome-contacts-47.1...> | 2025-12-27 17:07 | 453K | |
| gnome-control-center..> | 2025-12-26 19:53 | 5.4M | |
| gnome-desktop-44.4.pkg | 2025-12-26 13:52 | 282K | |
| gnome-devel-docs-40...> | 2025-08-17 20:49 | 9.5M | |
| gnome-dictionary-40...> | 2025-12-27 10:02 | 436K | |
| gnome-flashback-3.58..> | 2025-12-29 00:01 | 613K | |
| gnome-font-viewer-47..> | 2025-12-27 02:17 | 193K | |
| gnome-games-47.pkg | 2025-12-30 15:31 | 688 | |
| gnome-getting-starte..> | 2025-08-21 09:20 | 77M | |
| gnome-icon-theme-3.1..> | 2025-08-13 23:26 | 9.5M | |
| gnome-icon-theme-ext..> | 2025-12-28 13:58 | 822K | |
| gnome-icon-theme-sym..> | 2025-08-13 22:04 | 134K | |
| gnome-icons-20060914..> | 2025-12-29 15:25 | 959 | |
| gnome-icons-aqua-fus..> | 2025-08-15 17:40 | 1.7M | |
| gnome-icons-crystal-..> | 2025-08-14 17:31 | 3.5M | |
| gnome-icons-elementa..> | 2025-12-29 08:51 | 2.9M | |
| gnome-icons-faenza-1..> | 2025-08-22 03:21 | 17M | |
| gnome-icons-gentoo-t..> | 2025-08-14 16:44 | 1.2M | |
| gnome-icons-iris-200..> | 2025-08-15 18:15 | 158K | |
| gnome-icons-lila-0.6..> | 2025-08-15 11:43 | 1.2M | |
| gnome-icons-luv-0.4...> | 2025-08-20 09:28 | 1.0M | |
| gnome-icons-noia-ful..> | 2025-08-15 13:50 | 12M | |
| gnome-icons-noia-war..> | 2025-08-14 15:38 | 5.1M | |
| gnome-icons-refined-..> | 2025-08-15 20:41 | 1.2M | |
| gnome-icons-slick-20..> | 2025-08-14 10:10 | 415K | |
| gnome-icons-snow-app..> | 2025-08-15 08:38 | 467K | |
| gnome-icons-stylish-..> | 2025-08-15 05:08 | 81K | |
| gnome-icons-ximian-s..> | 2025-08-15 20:48 | 679K | |
| gnome-initial-setup-..> | 2025-12-30 09:50 | 467K | |
| gnome-keyring-48.0.pkg | 2025-12-26 15:53 | 836K | |
| gnome-klotski-3.38.2..> | 2025-12-28 10:09 | 943K | |
| gnome-lite-47.pkg | 2025-12-29 16:04 | 833 | |
| gnome-mahjongg-47.2.pkg | 2025-12-27 16:14 | 1.8M | |
| gnome-maps-47.9.pkg | 2025-12-27 10:15 | 1.1M | |
| gnome-menus-3.38.1.pkg | 2025-12-18 17:51 | 174K | |
| gnome-metronome-1.3...> | 2025-12-30 02:39 | 494K | |
| gnome-mime-data-2.18..> | 2025-12-18 13:41 | 377K | |
| gnome-mines-48.1.pkg | 2025-12-27 17:08 | 232K | |
| gnome-music-47.1.pkg | 2025-12-27 22:38 | 272K | |
| gnome-nettool-42.0_2..> | 2025-12-27 21:31 | 359K | |
| gnome-nibbles-4.4.1.pkg | 2025-12-27 16:12 | 412K | |
| gnome-online-account..> | 2025-12-26 16:41 | 462K | |
| gnome-panel-3.58.1.pkg | 2025-12-26 21:49 | 1.2M | |
| gnome-photos-44.0_1.pkg | 2025-12-27 13:08 | 660K | |
| gnome-pie-0.7.3_4.pkg | 2025-12-30 02:15 | 252K | |
| gnome-planner-0.14.6..> | 2025-12-28 07:15 | 740K | |
| gnome-podcasts-0.7.1..> | 2025-12-29 00:12 | 15M | |
| gnome-pomodoro-0.28...> | 2025-12-27 11:01 | 6.0M | |
| gnome-power-manager-..> | 2025-12-29 17:29 | 179K | |
| gnome-pty-helper-0.4..> | 2025-08-13 19:35 | 6.0K | |
| gnome-robots-41.2_6.pkg | 2025-12-27 06:57 | 3.8M | |
| gnome-screenshot-41...> | 2025-12-26 22:18 | 169K | |
| gnome-session-47.0.1..> | 2025-12-26 15:43 | 311K | |
| gnome-settings-daemo..> | 2025-12-26 15:47 | 873K | |
| gnome-shell-47.10.pkg | 2025-12-26 23:34 | 1.6M | |
| gnome-shell-extensio..> | 2025-12-27 04:32 | 188K | |
| gnome-shell-extensio..> | 2025-12-30 06:49 | 249K | |
| gnome-shell-extensio..> | 2025-12-27 10:15 | 20K | |
| gnome-shell-extensio..> | 2025-12-27 19:25 | 22K | |
| gnome-shell-extensio..> | 2025-12-30 01:42 | 151K | |
| gnome-shell-extensio..> | 2025-12-19 11:40 | 15K | |
| gnome-shell-extensio..> | 2025-12-28 18:48 | 438K | |
| gnome-shell-extensio..> | 2025-12-27 07:35 | 140K | |
| gnome-sound-recorder..> | 2025-12-30 01:47 | 108K | |
| gnome-sudoku-47.3.pkg | 2025-12-27 02:27 | 361K | |
| gnome-system-monitor..> | 2025-12-27 16:22 | 805K | |
| gnome-terminal-3.56...> | 2025-12-27 16:10 | 1.0M | |
| gnome-tetravex-3.38...> | 2025-12-28 03:12 | 1.0M | |
| gnome-text-editor-47..> | 2025-12-27 18:45 | 592K | |
| gnome-themes-extra-3..> | 2025-12-27 01:18 | 2.4M | |
| gnome-todo-41.0_6.pkg | 2025-12-28 05:18 | 384K | |
| gnome-tweaks-46.1_1.pkg | 2025-12-27 12:32 | 267K | |
| gnome-user-docs-47.6..> | 2025-08-14 19:42 | 11M | |
| gnome-user-share-47...> | 2025-12-21 00:12 | 55K | |
| gnome-utils-42_1,1.pkg | 2025-12-28 01:14 | 798 | |
| gnome-video-effects-..> | 2025-12-27 16:48 | 61K | |
| gnome-weather-47.0_1..> | 2025-12-27 17:06 | 144K | |
| gnome_subr-1.0.pkg | 2025-08-10 21:32 | 766 | |
| gnote-47.2_1.pkg | 2025-12-27 16:24 | 4.1M | |
| gnotime-g20231022_6.pkg | 2025-12-27 21:10 | 1.1M | |
| gns3-converter-1.2.4..> | 2025-12-23 00:46 | 47K | |
| gnu-apl-1.8_3.pkg | 2025-08-22 00:30 | 1.6M | |
| gnu-efi-3.0.18.pkg | 2025-12-18 16:00 | 197K | |
| gnu-ipcalc-1.0.3_2.pkg | 2025-08-20 05:46 | 22K | |
| gnu-radius-1.6.1_18.pkg | 2025-12-20 22:07 | 581K | |
| gnu-unifont-17.0.03,..> | 2025-12-26 20:46 | 914K | |
| gnu-unifont-otf-17.0..> | 2025-12-27 18:39 | 1.5M | |
| gnu-watch-3.3.17_1.pkg | 2025-12-21 16:12 | 13K | |
| gnuastro-0.24.pkg | 2025-12-28 21:20 | 4.2M | |
| gnubc-1.08.1.pkg | 2025-12-18 23:31 | 95K | |
| gnubg-1.08.003_1.pkg | 2025-12-29 18:52 | 13M | |
| gnubiff-2.2.13_16.pkg | 2025-12-29 06:27 | 387K | |
| gnubik-2.4.3_7.pkg | 2025-12-30 08:10 | 97K | |
| gnucap-2013.04.23.pkg | 2025-08-22 03:25 | 632K | |
| gnucash-5.14.pkg | 2025-12-29 19:17 | 11M | |
| gnucash-docs-5.14.pkg | 2025-12-30 10:25 | 57M | |
| gnucflow-1.8.pkg | 2025-12-21 22:38 | 122K | |
| gnuchess-6.3.0.pkg | 2025-12-18 17:39 | 354K | |
| gnucobol-3.2_3.pkg | 2025-12-20 05:41 | 1.1M | |
| gnudatalanguage-1.1...> | 2025-12-30 10:43 | 29M | |
| gnugo-3.8_2.pkg | 2025-08-14 05:59 | 1.0M | |
| gnugrep-3.12.pkg | 2025-12-18 12:59 | 279K | |
| gnujump-1.0.8_3.pkg | 2025-12-30 09:29 | 1.5M | |
| gnulib-20140202_2.pkg | 2025-12-18 07:21 | 3.8M | |
| gnulibiberty-2.44.pkg | 2025-08-15 00:05 | 163K | |
| gnumail-1.4.0_3.pkg | 2025-12-27 10:15 | 1.1M | |
| gnumeric-1.12.59_1.pkg | 2025-12-30 08:49 | 13M | |
| gnupg-2.4.8.pkg | 2025-12-17 22:58 | 2.7M | |
| gnupg-pkcs11-scd-0.1..> | 2025-12-20 19:50 | 27K | |
| gnupg1-1.4.23_4.pkg | 2025-12-18 18:37 | 1.2M | |
| gnuplot-5.4.10_3.pkg | 2025-12-26 09:25 | 2.1M | |
| gnuplot-lite-5.4.10_..> | 2025-12-24 07:28 | 1.9M | |
| gnuplot-tex-extras-5..> | 2025-12-30 06:39 | 5.5K | |
| gnupod-0.99.8_4.pkg | 2025-12-21 16:49 | 113K | |
| gnuradio-3.10.12.0_7..> | 2025-12-26 21:59 | 16M | |
| gnurobbo-0.68.pkg | 2025-12-30 02:27 | 1.8M | |
| gnurobots-1.2.0_17.pkg | 2025-12-28 10:39 | 37K | |
| gnushogi-1.4.2_2.pkg | 2025-08-15 01:53 | 181K | |
| gnuspeechsa-0.1.5_6.pkg | 2025-08-18 10:08 | 774K | |
| gnustep-1.28.0_9.pkg | 2025-12-29 10:44 | 1.1K | |
| gnustep-app-2.0.0_24..> | 2025-12-29 02:52 | 1.7K | |
| gnustep-back-0.32.0.pkg | 2025-12-26 16:27 | 246K | |
| gnustep-base-1.31.1_..> | 2025-12-18 07:58 | 2.1M | |
| gnustep-cdplayer-0.5..> | 2025-12-27 17:27 | 147K | |
| gnustep-ftp-0.6_3.pkg | 2025-12-27 10:02 | 73K | |
| gnustep-gui-0.32.0.pkg | 2025-12-26 14:42 | 3.4M | |
| gnustep-ladder-1.0_1..> | 2025-12-27 13:17 | 195K | |
| gnustep-make-2.9.3.pkg | 2025-08-25 01:31 | 171K | |
| gnustep-preview-0.8...> | 2025-12-27 08:14 | 52K | |
| gnustep-sudoku-0.7_1..> | 2025-12-27 04:11 | 27K | |
| gnustep-wrapper-0.1...> | 2025-12-27 13:20 | 56K | |
| gnutls-3.8.11.pkg | 2025-12-16 02:17 | 2.7M | |
| go-1.24_16,2.pkg | 2025-12-23 19:53 | 868 | |
| go-anubis-1.23.1_2.pkg | 2025-12-21 09:51 | 11M | |
| go-bapu-0.3.0_34.pkg | 2025-12-21 05:58 | 2.6M | |
| go-bindata-3.1.3_33.pkg | 2025-12-19 00:02 | 796K | |
| go-bindata-assetfs-1..> | 2025-12-22 06:32 | 678K | |
| go-carbon-0.12.0_34.pkg | 2025-12-23 17:42 | 4.4M | |
| go-critic-0.14.2_2.pkg | 2025-12-24 05:08 | 5.5M | |
| go-cs-0.9_35.pkg | 2025-12-22 04:07 | 698K | |
| go-cve-dictionary-0...> | 2025-12-23 11:35 | 7.2M | |
| go-devel-g20240208_2..> | 2025-08-21 15:59 | 44M | |
| go-for-it-1.9.6_2.pkg | 2025-12-29 03:51 | 518K | |
| go-git-5.10.0_19.pkg | 2025-12-21 12:20 | 1.5M | |
| go-librespot-0.5.3_1..> | 2025-12-23 07:45 | 4.4M | |
| go-md2man-2.0.7_6.pkg | 2025-12-18 15:26 | 830K | |
| go-mode.el-1.6.0_1.pkg | 2025-08-31 14:53 | 35K | |
| go-ntfy-2.15.0_2.pkg | 2025-12-22 22:53 | 22M | |
| go-perf-0.0.0.202506..> | 2025-12-23 20:04 | 5.4M | |
| go-pgweb-0.11.7_34.pkg | 2025-12-20 21:25 | 3.7M | |
| go-pkgsite-0.0.0.202..> | 2025-12-29 21:05 | 5.4M | |
| go-tcping-2.7.1_11.pkg | 2025-12-24 01:44 | 3.5M | |
| go-tools-0.40.0,1.pkg | 2025-12-29 02:43 | 21M | |
| go-transifex-client-..> | 2025-12-21 03:27 | 4.0M | |
| go-tuf-2.3.0_1.pkg | 2025-12-22 13:31 | 2.8M | |
| go-wire-0.6.0_15.pkg | 2025-12-23 14:48 | 1.8M | |
| go-wtf-0.47.1.pkg | 2025-12-23 00:11 | 17M | |
| go-www-2.0.0_33.pkg | 2025-12-23 05:03 | 2.4M | |
| go-yq-4.47.2_4.pkg | 2025-12-20 18:14 | 3.6M | |
| go120-1.20.14_5.pkg | 2025-08-14 07:09 | 41M | |
| go121-1.21.13_5.pkg | 2025-08-14 00:52 | 42M | |
| go122-1.22.12_4.pkg | 2025-08-14 07:29 | 44M | |
| go123-1.23.12.pkg | 2025-08-13 17:17 | 46M | |
| go124-1.24.11.pkg | 2025-12-16 04:00 | 49M | |
| go125-1.25.5.pkg | 2025-12-18 17:30 | 39M | |
| goaccess-1.9.3_1.pkg | 2025-12-22 08:40 | 431K | |
| goattracker-2.77.pkg | 2025-12-21 09:18 | 227K | |
| goawk-1.30.1_1.pkg | 2025-12-23 04:31 | 1.0M | |
| gob2-2.0.18_1.pkg | 2025-12-20 02:35 | 89K | |
| gobang-0.1.0.a.5_28.pkg | 2025-12-29 06:43 | 2.1M | |
| gobang-game-0.1.3.pkg | 2025-08-19 04:16 | 9.2K | |
| gobby-0.6.0_1.pkg | 2025-12-29 01:02 | 482K | |
| gobgp-3.25.0_16.pkg | 2025-12-23 20:06 | 10M | |
| gobi_loader-g2019122..> | 2025-08-19 12:41 | 5.8K | |
| gobject-introspectio..> | 2025-12-16 01:47 | 642K | |
| gobject-introspectio..> | 2025-12-16 01:43 | 642K | |
| gobuffalo-0.16.27_33..> | 2025-12-28 11:39 | 6.1M | |
| gobuster-3.8.2_2.pkg | 2025-12-20 09:24 | 3.0M | |
| gocheese-4.3.0_1.pkg | 2025-12-20 05:39 | 2.9M | |
| gocr-0.52_1.pkg | 2025-12-27 10:09 | 229K | |
| gocritic-0.13.0_4.pkg | 2025-08-19 14:40 | 5.3M | |
| godns-3.3.5.pkg | 2025-12-22 13:26 | 5.3M | |
| godot-4.4.1_1.pkg | 2025-12-30 09:25 | 16M | |
| godot-tools-4.4.1_1.pkg | 2025-12-30 14:56 | 232M | |
| godot35-3.5.3_4.pkg | 2025-12-30 13:59 | 9.9M | |
| goesimage-0.1.4_1.pkg | 2025-12-28 03:55 | 2.6K | |
| goffice-0.10.59_1.pkg | 2025-12-26 21:42 | 2.1M | |
| gofish-1.1_1.pkg | 2025-08-18 00:17 | 31K | |
| gofont-ttf-g20231220..> | 2025-12-30 00:55 | 408K | |
| gogglesmm-1.2.5_6.pkg | 2025-12-29 12:34 | 639K | |
| gogrepo-0.3a_3.pkg | 2025-12-22 13:34 | 15K | |
| gogs-0.13.3_7.pkg | 2025-12-20 22:14 | 30M | |
| gogui-1.6.0.pkg | 2025-12-29 05:21 | 2.7M | |
| gohufont-2.1_1.pkg | 2025-12-30 15:14 | 87K | |
| gohugo-0.153.2,1.pkg | 2025-12-26 15:58 | 14M | |
| gojq-0.12.18_1.pkg | 2025-12-22 03:44 | 1.4M | |
| gokart-0.5.1_28.pkg | 2025-12-22 14:53 | 4.7M | |
| gokey-0.2.0_1.pkg | 2025-12-23 12:52 | 1.1M | |
| gol-1.0.35_1.pkg | 2025-12-21 22:22 | 3.2M | |
| golangci-lint-2.7.2.pkg | 2025-12-20 15:29 | 14M | |
| golddig-3.1_3.pkg | 2025-08-19 17:17 | 37K | |
| golded+-1.1.5.a20170..> | 2025-08-19 02:57 | 1.0M | |
| goldendict-ng-25.10...> | 2025-12-29 12:10 | 2.8M | |
| golint-g20190409_34.pkg | 2025-12-20 12:38 | 1.5M | |
| gollama-1.37.5_1.pkg | 2025-12-20 13:25 | 4.1M | |
| golly-5.0.pkg | 2025-12-30 02:12 | 12M | |
| gom-0.5.4.pkg | 2025-12-26 19:41 | 62K | |
| gomacro-2.7.601_26.pkg | 2025-12-23 21:52 | 9.1M | |
| gomate-g20170711_34.pkg | 2025-12-23 09:36 | 881K | |
| gomi-1.6.1_7.pkg | 2025-12-23 05:45 | 4.1M | |
| gomigrate-4.19.0.pkg | 2025-12-21 05:28 | 12M | |
| gomoku-1.2.9_10.pkg | 2025-12-28 19:06 | 84K | |
| gomplate-4.3.3_6.pkg | 2025-12-22 13:14 | 17M | |
| gomuks-25.12.pkg | 2025-12-28 10:35 | 5.9M | |
| gone-1.3.6_1.pkg | 2025-08-16 09:31 | 8.3K | |
| gonepass-g20181221_5..> | 2025-12-29 04:11 | 116K | |
| gonic-0.19.0_3.pkg | 2025-12-30 15:37 | 6.8M | |
| gonzo-0.2.1.pkg | 2025-12-21 21:37 | 4.9M | |
| goobox-3.6.0_4.pkg | 2025-12-28 17:55 | 273K | |
| goocanvas2-2.0.4_2.pkg | 2025-12-27 00:00 | 341K | |
| goocanvas3-3.0.0_2.pkg | 2025-12-27 12:29 | 292K | |
| goocanvasmm2-1.90.9_..> | 2025-12-30 05:42 | 124K | |
| google-cloud-cpp-2.2..> | 2025-12-22 03:47 | 6.3M | |
| google-cloud-sdk-550..> | 2025-12-28 05:40 | 31M | |
| google-compute-engin..> | 2025-12-19 11:50 | 471K | |
| google-ctemplate-2.4..> | 2025-08-15 10:13 | 326K | |
| google-earth-pro-7.3..> | 2025-12-27 21:29 | 60M | |
| google-perftools-2.1..> | 2025-12-18 18:39 | 592K | |
| google-styleguide-20..> | 2025-12-20 11:00 | 327K | |
| googlebook_dl-202211..> | 2025-12-21 04:14 | 3.3K | |
| googler-4.3.2_1.pkg | 2025-12-22 12:53 | 38K | |
| googletest-1.16.0.pkg | 2025-08-13 04:29 | 371K | |
| goom-2k4.0_7.pkg | 2025-08-17 13:49 | 121K | |
| goonies-1.4.1528_2.pkg | 2025-12-30 09:23 | 11M | |
| goose-db-migration-t..> | 2025-12-23 18:22 | 9.2M | |
| gopass-1.16.1.pkg | 2025-12-19 08:57 | 7.8M | |
| gopher-3.0.6_2.pkg | 2025-08-16 03:23 | 77K | |
| gophernicus-3.0.1.pkg | 2025-08-18 02:01 | 27K | |
| gopherus-1.2.2.pkg | 2025-08-17 15:26 | 23K | |
| gopls-0.21.0.pkg | 2025-12-30 02:30 | 8.4M | |
| goprotobuf-1.5.4_17,..> | 2025-12-21 09:14 | 1.8M | |
| goredo-2.6.5_2.pkg | 2025-12-23 13:36 | 1.0M | |
| goreleaser-2.13.1.pkg | 2025-12-28 05:31 | 19M | |
| goreplay-1.3.2_26.pkg | 2025-12-22 22:23 | 3.9M | |
| gorilla-1.5.3.6.pkg | 2025-12-28 15:23 | 290K | |
| gorm-1.3.1_1.pkg | 2025-12-27 18:02 | 676K | |
| gorss-0.4_19.pkg | 2025-12-21 09:48 | 3.7M | |
| gosec-2.22.10_2.pkg | 2025-12-23 01:31 | 6.5M | |
| gost-engine-g2023010..> | 2025-08-18 11:03 | 575K | |
| gostsum-20221213_1.pkg | 2025-08-19 08:11 | 36K | |
| goswagger-0.33.1_3.pkg | 2025-12-22 07:43 | 7.9M | |
| got-0.120.pkg | 2025-12-21 05:47 | 613K | |
| gotestsum-1.13.0_4.pkg | 2025-12-22 19:56 | 2.0M | |
| gotify-cli-2.3.2_4.pkg | 2025-08-17 22:28 | 3.3M | |
| gotify-server-2.7.3_..> | 2025-12-21 04:33 | 9.7M | |
| gotktrix-0.1.4_30.pkg | 2025-12-27 22:11 | 11M | |
| gotmail-0.9.0_4.pkg | 2025-12-22 18:37 | 28K | |
| gotop-4.1.4_30.pkg | 2025-12-22 20:26 | 2.6M | |
| gotosocial-0.20.2_1.pkg | 2025-12-23 01:18 | 28M | |
| gottet-1.2.6.pkg | 2025-12-30 14:17 | 234K | |
| gotthard-1.3_1.pkg | 2025-08-20 17:38 | 10K | |
| gotty-1.6.0_5.pkg | 2025-12-22 20:17 | 3.4M | |
| gource-0.55.pkg | 2025-12-30 16:41 | 659K | |
| govmomi-0.46.3_2.pkg | 2025-08-18 00:55 | 11M | |
| govulncheck-1.1.4_8.pkg | 2025-12-22 16:29 | 3.3M | |
| gowall-0.2.3_4.pkg | 2025-12-30 01:49 | 6.1M | |
| goxel-0.15.0.pkg | 2025-12-30 07:32 | 1.9M | |
| gp2c-0.0.14.pkg | 2025-12-20 20:00 | 521K | |
| gpa-0.11.0_1.pkg | 2025-12-28 20:55 | 275K | |
| gpac-libgpac-1.0.0_3..> | 2025-12-26 21:17 | 5.6M | |
| gpac-mp4box-1.0.0_1.pkg | 2025-12-27 22:41 | 138K | |
| gpaint-0.3.4_1.pkg | 2025-12-30 05:29 | 98K | |
| gpart-0.1h_3.pkg | 2025-08-21 16:31 | 28K | |
| gpaw-setups-0.9.2000..> | 2025-08-15 08:18 | 50M | |
| gpds-1.10.0.pkg | 2025-08-15 00:06 | 87K | |
| gperf-3.3.pkg | 2025-12-16 01:29 | 87K | |
| gperiodic-3.0.3_1.pkg | 2025-12-29 13:48 | 162K | |
| gpg-gui-0.2.2_2.pkg | 2025-12-30 17:32 | 37K | |
| gpg-tui-0.11.1_6.pkg | 2025-12-30 11:20 | 1.2M | |
| gpgdir-1.9.5_2.pkg | 2025-12-23 14:02 | 15K | |
| gpgme-2.0.1.pkg | 2025-12-17 22:59 | 333K | |
| gpgmepp-2.0.0.pkg | 2025-12-17 23:26 | 135K | |
| gphoto2-2.5.28.pkg | 2025-12-29 16:34 | 197K | |
| gpicker-2.3_2.pkg | 2025-12-29 18:16 | 25K | |
| gpicview-0.2.5_2.pkg | 2025-12-27 16:51 | 116K | |
| gping-1.20.1_4.pkg | 2025-12-29 07:03 | 951K | |
| gplcver-2.12.a.pkg | 2025-08-18 20:47 | 793K | |
| gplink-1.5_1.pkg | 2025-08-18 04:12 | 14K | |
| gpodder-3.11.5.pkg | 2025-12-29 22:47 | 894K | |
| gpp-2.24_1.pkg | 2025-08-16 05:44 | 42K | |
| gprbuild-25.0.0_1,1.pkg | 2025-12-18 20:18 | 8.6M | |
| gpredict-2.2.1_6.pkg | 2025-12-30 02:53 | 3.9M | |
| gprename-2.7_3,1.pkg | 2025-12-29 00:18 | 46K | |
| gprolog-1.5.0.pkg | 2025-08-18 12:58 | 3.1M | |
| gpsbabel-1.10.0.pkg | 2025-12-27 17:11 | 1.2M | |
| gpsbabel14-1.4.4_1.pkg | 2025-12-21 16:56 | 533K | |
| gpscorrelate-1.6.1_1..> | 2025-12-30 11:17 | 117K | |
| gpsd-3.25_2.pkg | 2025-12-26 20:06 | 946K | |
| gpsd-nox11-3.25_2.pkg | 2025-12-19 13:11 | 924K | |
| gpsim-0.32.1.pkg | 2025-12-27 10:32 | 3.1M | |
| gpsman-6.4.4.2.pkg | 2025-12-27 09:00 | 1.1M | |
| gpsmanshp-1.2.3_2.pkg | 2025-12-29 12:25 | 126K | |
| gpsprune-26.pkg | 2025-12-29 12:42 | 1.4M | |
| gpstk-8.0.0.pkg | 2025-08-17 04:39 | 17M | |
| gptscript-0.9.8.pkg | 2025-12-27 14:05 | 12M | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:11 | 586K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:33 | 579K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:35 | 27K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:13 | 856K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:17 | 288K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:06 | 305K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:21 | 78K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:59 | 214K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:24 | 153K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:21 | 139K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:23 | 144K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:07 | 138K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:05 | 279K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:24 | 863K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:21 | 350K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:28 | 50K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:20 | 108K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 01:37 | 108K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 18:58 | 338K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:58 | 243K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:45 | 328K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:45 | 312K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:10 | 244K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:05 | 219K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:10 | 471K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:21 | 52K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:00 | 288K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:24 | 233K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:33 | 235K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:58 | 233K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:53 | 606K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:56 | 632K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:36 | 616K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:39 | 881K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:33 | 191K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 01:37 | 378K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:08 | 191K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:00 | 470K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:21 | 469K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:02 | 446K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:26 | 217K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:04 | 71K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:21 | 93K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:26 | 839K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:40 | 198K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:19 | 92K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:41 | 235K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:45 | 71K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:29 | 72K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:53 | 388K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:46 | 372K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:46 | 475K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:20 | 13K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:43 | 13K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:35 | 13K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:05 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:49 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 01:38 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 19:38 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:01 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:27 | 14K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:12 | 943K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:14 | 136K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:35 | 3.9K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 18:59 | 118K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:10 | 134K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:19 | 135K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:30 | 293K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:02 | 191K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:23 | 408K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:24 | 92K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:03 | 586K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:21 | 388K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 00:06 | 276K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:19 | 276K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:08 | 736 | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:49 | 276K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:44 | 275K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 20:41 | 688K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 18:58 | 691K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:29 | 644K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 22:52 | 414K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 21:32 | 195K | |
| gpu-firmware-amd-kmo..> | 2025-12-19 02:28 | 10K | |
| gpu-firmware-amd-kmo..> | 2025-12-18 23:49 | 746K | |
| gpu-firmware-intel-k..> | 2025-12-18 23:58 | 276K | |
| gpu-firmware-intel-k..> | 2025-12-19 01:33 | 198K | |
| gpu-firmware-intel-k..> | 2025-12-18 21:05 | 5.1K | |
| gpu-firmware-intel-k..> | 2025-12-19 01:35 | 378K | |
| gpu-firmware-intel-k..> | 2025-12-18 19:19 | 171K | |
| gpu-firmware-intel-k..> | 2025-12-18 21:34 | 409K | |
| gpu-firmware-intel-k..> | 2025-12-19 00:50 | 294K | |
| gpu-firmware-intel-k..> | 2025-12-18 22:35 | 413K | |
| gpu-firmware-intel-k..> | 2025-12-18 23:48 | 297K | |
| gpu-firmware-intel-k..> | 2025-12-18 22:33 | 1.0M | |
| gpu-firmware-intel-k..> | 2025-12-18 20:38 | 8.6K | |
| gpu-firmware-intel-k..> | 2025-12-19 01:02 | 195K | |
| gpu-firmware-intel-k..> | 2025-12-18 22:02 | 609K | |
| gpu-firmware-kmod-20..> | 2025-12-19 22:16 | 1.2K | |
| gpu-firmware-radeon-..> | 2025-08-14 08:42 | 11K | |
| gpu-firmware-radeon-..> | 2025-08-14 05:10 | 26K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:25 | 369K | |
| gpu-firmware-radeon-..> | 2025-08-14 03:06 | 2.6K | |
| gpu-firmware-radeon-..> | 2025-08-14 08:59 | 26K | |
| gpu-firmware-radeon-..> | 2025-08-14 00:30 | 32K | |
| gpu-firmware-radeon-..> | 2025-08-13 23:04 | 18K | |
| gpu-firmware-radeon-..> | 2025-08-14 07:00 | 94K | |
| gpu-firmware-radeon-..> | 2025-08-13 22:34 | 77K | |
| gpu-firmware-radeon-..> | 2025-08-14 04:58 | 334K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:24 | 19K | |
| gpu-firmware-radeon-..> | 2025-08-13 22:37 | 256K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:44 | 260K | |
| gpu-firmware-radeon-..> | 2025-08-14 05:49 | 256K | |
| gpu-firmware-radeon-..> | 2025-08-14 05:48 | 77K | |
| gpu-firmware-radeon-..> | 2025-08-14 03:08 | 7.1K | |
| gpu-firmware-radeon-..> | 2025-08-14 03:18 | 78K | |
| gpu-firmware-radeon-..> | 2025-08-13 23:57 | 2.5K | |
| gpu-firmware-radeon-..> | 2025-08-14 08:15 | 2.6K | |
| gpu-firmware-radeon-..> | 2025-08-13 22:33 | 2.5K | |
| gpu-firmware-radeon-..> | 2025-08-14 05:43 | 2.5K | |
| gpu-firmware-radeon-..> | 2025-08-13 22:51 | 2.5K | |
| gpu-firmware-radeon-..> | 2025-08-14 07:06 | 61K | |
| gpu-firmware-radeon-..> | 2025-08-14 01:48 | 3.9K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:33 | 18K | |
| gpu-firmware-radeon-..> | 2025-08-14 08:30 | 2.6K | |
| gpu-firmware-radeon-..> | 2025-08-14 05:58 | 2.6K | |
| gpu-firmware-radeon-..> | 2025-08-13 22:47 | 70K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:11 | 7.7K | |
| gpu-firmware-radeon-..> | 2025-08-14 04:10 | 7.7K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:31 | 7.7K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:57 | 7.7K | |
| gpu-firmware-radeon-..> | 2025-08-13 23:47 | 7.7K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:32 | 88K | |
| gpu-firmware-radeon-..> | 2025-08-14 00:05 | 13K | |
| gpu-firmware-radeon-..> | 2025-08-14 01:07 | 8.3K | |
| gpu-firmware-radeon-..> | 2025-08-14 03:20 | 75K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:42 | 136K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:56 | 7.0K | |
| gpu-firmware-radeon-..> | 2025-08-14 06:06 | 253K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:29 | 26K | |
| gpu-firmware-radeon-..> | 2025-08-14 02:55 | 85K | |
| gputils-1.5.2_1.pkg | 2025-08-13 22:50 | 1.1M | |
| gpx2map-0.2_3.pkg | 2025-12-30 07:07 | 17K | |
| gpxloggerd-0.2.5_1.pkg | 2025-12-30 13:26 | 9.7K | |
| gpxsee-7.32_1.pkg | 2025-12-27 19:59 | 693K | |
| gqlplus-1.16_2.pkg | 2025-12-24 02:13 | 21K | |
| gqrx-qt5-2.17.7_3,1.pkg | 2025-12-30 10:09 | 548K | |
| gqrx-qt6-2.17.7_3,1.pkg | 2025-12-30 00:38 | 541K | |
| gr-osmosdr-0.2.6_3,1..> | 2025-12-27 14:34 | 258K | |
| grabc-1.0.2,1.pkg | 2025-08-17 03:37 | 8.1K | |
| grace-5.1.25_11.pkg | 2025-12-27 00:59 | 1.6M | |
| gracer-0.1.5_26.pkg | 2025-12-29 13:11 | 356K | |
| gracula-3.0_1.pkg | 2025-08-14 12:00 | 87K | |
| gradle-9.0.0.pkg | 2025-12-27 10:17 | 126M | |
| gradle-completion-1...> | 2025-08-17 09:21 | 7.9K | |
| gradle5-5.0.pkg | 2025-12-27 12:00 | 79M | |
| gradle6-6.9.4.pkg | 2025-12-26 23:17 | 100M | |
| gradle8-8.8.pkg | 2025-12-27 09:24 | 129M | |
| gradle62-6.2.2_1.pkg | 2025-12-26 19:12 | 91M | |
| gradle761-7.6.1.pkg | 2025-12-27 10:27 | 114M | |
| grads-1.9b4_18.pkg | 2025-12-28 01:28 | 3.7M | |
| grafana-12.3.0_1.pkg | 2025-12-24 07:47 | 126M | |
| grafana-loki-2.9.2_2..> | 2025-12-22 02:11 | 57M | |
| grafana-tempo-2.7.2_..> | 2025-12-21 00:57 | 45M | |
| graffer-1.1_3.pkg | 2025-12-29 09:44 | 53K | |
| grafx2-2.9_1.pkg | 2025-12-29 00:48 | 855K | |
| grails-1.3.6.pkg | 2025-12-29 22:51 | 40M | |
| gramofile-1.6P_15.pkg | 2025-12-28 08:57 | 60K | |
| gramps-6.0.6.pkg | 2025-12-30 09:32 | 12M | |
| granatier-25.12.0.pkg | 2025-12-26 21:28 | 2.1M | |
| granite-6.2.0_2.pkg | 2025-12-27 09:26 | 306K | |
| granite7-7.7.0.pkg | 2025-12-27 14:14 | 197K | |
| grantlee-editor-25.1..> | 2025-12-26 20:54 | 261K | |
| grantlee5-5.3.0.pkg | 2025-12-27 17:53 | 281K | |
| grantleetheme-25.12...> | 2025-12-26 06:23 | 65K | |
| granulate-0.2.pkg | 2025-08-16 12:33 | 4.4K | |
| grap-1.49.pkg | 2025-08-21 12:41 | 148K | |
| graphene-1.10.8_1.pkg | 2025-12-26 03:34 | 195K | |
| graphite2-1.3.14.pkg | 2025-08-10 21:30 | 90K | |
| graphlan-1.1.3_1.pkg | 2025-12-20 22:14 | 52K | |
| graphos-0.7_4.pkg | 2025-12-29 12:20 | 98K | |
| graphpath-1.2.pkg | 2025-08-16 11:13 | 5.9K | |
| graphviz-14.1.1.pkg | 2025-12-26 05:19 | 3.0M | |
| grass-0.13.4_6.pkg | 2025-12-29 22:44 | 3.0M | |
| grass8-8.4.2_2.pkg | 2025-12-27 14:26 | 46M | |
| graveman-0.3.12.5_19..> | 2025-12-29 16:00 | 535K | |
| gravity-lang-0.8.5.pkg | 2025-08-20 09:21 | 128K | |
| graylog-7.0.2.pkg | 2025-12-29 00:53 | 304M | |
| graywolf-0.1.6.4_4.pkg | 2025-12-27 19:18 | 406K | |
| grc-1.13_1.pkg | 2025-12-23 19:21 | 31K | |
| grc-aspell-0.02.0.pkg | 2025-12-22 05:42 | 6.6M | |
| grcov-0.10.5_4.pkg | 2025-12-28 10:53 | 2.0M | |
| greed-game-4.3.pkg | 2025-08-16 23:03 | 10K | |
| gregarius-0.6.1_1.pkg | 2025-12-29 04:37 | 432K | |
| grepcidr-2.0_1.pkg | 2025-08-21 22:00 | 12K | |
| grepip-1.0_3.pkg | 2025-08-22 06:36 | 14K | |
| greple-8.3304.pkg | 2025-12-22 19:50 | 57K | |
| grepmail-5.3033_1.pkg | 2025-12-21 11:29 | 26K | |
| gretl-2024d_2.pkg | 2025-12-28 10:06 | 14M | |
| grex-1.4.6_1.pkg | 2025-12-29 04:36 | 718K | |
| greybird-theme-3.23...> | 2025-12-27 16:15 | 205K | |
| greyfix-0.4.0_2.pkg | 2025-08-20 01:16 | 15K | |
| greylite-2.3_6.pkg | 2025-12-24 04:43 | 20K | |
| griels-quest-1.0.0_1..> | 2025-12-27 21:18 | 6.0M | |
| grig-0.9.0_4.pkg | 2025-12-30 12:02 | 125K | |
| grilo-0.3.19_1.pkg | 2025-12-18 18:56 | 233K | |
| grilo-plugins-0.3.18..> | 2025-12-27 01:37 | 257K | |
| grim-1.5.0.pkg | 2025-12-27 17:01 | 16K | |
| grimshot-1.8.1.pkg | 2025-12-30 04:17 | 4.0K | |
| grip-4.2.4_3.pkg | 2025-12-29 03:11 | 465K | |
| grisbi-3.90.0.pkg | 2025-12-28 00:12 | 10M | |
| grive2-0.5.2.d_12.pkg | 2025-12-23 04:13 | 213K | |
| groff-1.23.0_5.pkg | 2025-12-17 23:58 | 3.1M | |
| grok-cli-0.0.34.pkg | 2025-12-30 14:19 | 7.0M | |
| grok_exporter-1.0.0...> | 2025-12-20 19:49 | 3.3M | |
| gromacs-2025.4_1.pkg | 2025-12-27 15:23 | 5.7M | |
| gromit-20041213_10.pkg | 2025-12-28 23:36 | 17K | |
| gromit-mpx-1.7.0.pkg | 2025-12-28 01:31 | 52K | |
| gron-0.7.1_9.pkg | 2025-12-21 09:41 | 2.2M | |
| gron.awk-0.2.0.pkg | 2025-08-16 08:33 | 4.4K | |
| groonga-15.0.9.pkg | 2025-12-20 02:23 | 4.7M | |
| groovy-2.4.21.pkg | 2025-12-30 02:39 | 23M | |
| groupoffice-25.0.73.pkg | 2025-12-30 12:28 | 140M | |
| growl-for-linux-0.8...> | 2025-12-30 00:41 | 450K | |
| grpc-1.76.0_1,2.pkg | 2025-12-18 06:58 | 6.1M | |
| grpc-gateway-2.27.3_..> | 2025-12-21 03:36 | 6.3M | |
| grpcox-1.0.0_33.pkg | 2025-12-24 07:40 | 3.5M | |
| grpcui-1.5.1_1.pkg | 2025-12-21 02:00 | 6.7M | |
| grpcurl-1.9.3_10.pkg | 2025-12-22 15:23 | 6.3M | |
| grpn-1.5.2_2.pkg | 2025-12-29 12:22 | 46K | |
| grr-1.0_11.pkg | 2025-12-28 11:10 | 121K | |
| grsync-1.3.1_2.pkg | 2025-12-28 01:23 | 151K | |
| grub2-bhyve-0.40_11.pkg | 2025-08-14 06:30 | 484K | |
| grub2-efi-2.02_21.pkg | 2025-12-30 09:55 | 838K | |
| grub2-pcbsd-2.02q_19..> | 2025-12-27 15:43 | 5.1M | |
| grubik-0.1_12.pkg | 2025-12-27 12:33 | 13K | |
| gruftistats-0.2.4_2.pkg | 2025-08-19 00:20 | 38K | |
| grx-2.4.9_5.pkg | 2025-12-29 00:48 | 691K | |
| grzip-0.3.0_3.pkg | 2025-12-21 22:32 | 46K | |
| gsa-26.4.1.pkg | 2025-12-27 10:00 | 2.3M | |
| gsad-24.9.0.pkg | 2025-12-26 20:40 | 103K | |
| gsasl-2.2.2.pkg | 2025-12-22 14:26 | 155K | |
| gscan2pdf-2.13.5.pkg | 2025-12-29 05:28 | 441K | |
| gscheme-0.6_11.pkg | 2025-12-27 18:34 | 72K | |
| gscloud-0.13.0_20.pkg | 2025-12-23 17:35 | 4.4M | |
| gsed-4.9.pkg | 2025-12-16 01:48 | 333K | |
| gsequencer-8.1.24.pkg | 2025-12-29 10:55 | 8.1M | |
| gsettings-desktop-sc..> | 2025-12-16 01:50 | 734K | |
| gsfonts-8.11_8.pkg | 2025-08-13 00:38 | 4.1M | |
| gsh-1.1.0.pkg | 2025-12-20 06:17 | 13K | |
| gshhg-gmt-2.3.7.pkg | 2025-08-15 18:14 | 54M | |
| gshisen-1.3.0_10.pkg | 2025-12-27 19:22 | 37K | |
| gsimplecal-2.5.2.pkg | 2025-12-28 12:22 | 21K | |
| gsk-1.0.63_2.pkg | 2025-12-24 07:22 | 708K | |
| gskrab-0.0.1_13.pkg | 2025-12-27 19:27 | 19K | |
| gsl-2.7.1_1.pkg | 2025-08-13 08:36 | 2.1M | |
| gsl-lite-0.43.0.pkg | 2025-08-17 18:46 | 31K | |
| gsm-1.0.23.pkg | 2025-12-18 06:40 | 50K | |
| gsmartcontrol-1.1.4_..> | 2025-12-30 05:34 | 540K | |
| gsmc-1.1_7.pkg | 2025-12-29 22:25 | 36K | |
| gsnmp-0.2.0_4.pkg | 2025-12-23 11:30 | 60K | |
| gsoap-2.8.139.pkg | 2025-08-14 04:05 | 1.3M | |
| gsocket-1.4.28_2.pkg | 2025-12-20 04:34 | 86K | |
| gsound-1.0.3.pkg | 2025-12-18 12:32 | 23K | |
| gspdf-0.5_13.pkg | 2025-12-27 17:17 | 46K | |
| gspell-1.14.0.pkg | 2025-12-26 18:52 | 98K | |
| gspiceui-1.1.00_7.pkg | 2025-12-29 11:36 | 725K | |
| gspoof-3.2_18.pkg | 2025-12-29 18:25 | 15K | |
| gssdp-1.6.4.pkg | 2025-12-19 01:29 | 57K | |
| gssdp14-1.4.1_1.pkg | 2025-12-21 07:49 | 55K | |
| gst123-0.4.1.pkg | 2025-12-28 11:01 | 48K | |
| gstat-rs-0.1.7_1.pkg | 2025-12-28 10:12 | 891K | |
| gstopd-1.1_1.pkg | 2025-08-21 12:44 | 5.6K | |
| gstreamer1-1.26.9_1.pkg | 2025-12-25 00:21 | 2.0M | |
| gstreamer1-devtools-..> | 2025-12-27 18:05 | 522K | |
| gstreamer1-editing-s..> | 2025-12-27 16:48 | 488K | |
| gstreamer1-libav-1.2..> | 2025-12-26 14:15 | 92K | |
| gstreamer1-plugins-1..> | 2025-12-25 00:22 | 2.0M | |
| gstreamer1-plugins-a..> | 2025-12-26 14:09 | 9.5K | |
| gstreamer1-plugins-a..> | 2025-12-27 10:14 | 12K | |
| gstreamer1-plugins-a..> | 2025-12-28 22:15 | 1.4K | |
| gstreamer1-plugins-a..> | 2025-12-27 03:29 | 34K | |
| gstreamer1-plugins-a..> | 2025-12-27 10:21 | 7.7K | |
| gstreamer1-plugins-a..> | 2025-12-27 16:53 | 5.4K | |
| gstreamer1-plugins-a..> | 2025-12-27 16:23 | 17K | |
| gstreamer1-plugins-a..> | 2025-12-27 04:42 | 18K | |
| gstreamer1-plugins-b..> | 2025-12-26 04:16 | 2.0M | |
| gstreamer1-plugins-b..> | 2025-12-27 16:24 | 6.4K | |
| gstreamer1-plugins-c..> | 2025-12-27 13:16 | 6.6K | |
| gstreamer1-plugins-c..> | 2025-12-27 11:17 | 8.1K | |
| gstreamer1-plugins-c..> | 2025-12-27 09:13 | 7.9K | |
| gstreamer1-plugins-c..> | 2025-12-26 18:30 | 5.9K | |
| gstreamer1-plugins-c..> | 2025-12-26 14:57 | 882 | |
| gstreamer1-plugins-c..> | 2025-12-27 02:43 | 42K | |
| gstreamer1-plugins-d..> | 2025-12-27 02:09 | 80K | |
| gstreamer1-plugins-d..> | 2025-12-26 18:28 | 35K | |
| gstreamer1-plugins-d..> | 2025-12-26 13:56 | 8.6K | |
| gstreamer1-plugins-d..> | 2025-12-27 02:17 | 21K | |
| gstreamer1-plugins-d..> | 2025-12-26 13:09 | 18K | |
| gstreamer1-plugins-f..> | 2025-12-26 21:08 | 9.9K | |
| gstreamer1-plugins-f..> | 2025-12-26 20:38 | 10K | |
| gstreamer1-plugins-f..> | 2025-12-27 18:24 | 20K | |
| gstreamer1-plugins-f..> | 2025-12-26 23:43 | 25K | |
| gstreamer1-plugins-f..> | 2025-12-27 10:22 | 6.6K | |
| gstreamer1-plugins-g..> | 2025-12-27 10:21 | 16K | |
| gstreamer1-plugins-g..> | 2025-12-26 04:13 | 394K | |
| gstreamer1-plugins-g..> | 2025-12-27 17:06 | 8.1K | |
| gstreamer1-plugins-g..> | 2025-12-26 03:43 | 1.8M | |
| gstreamer1-plugins-g..> | 2025-12-27 09:46 | 6.7K | |
| gstreamer1-plugins-g..> | 2025-12-26 21:08 | 20K | |
| gstreamer1-plugins-h..> | 2025-12-27 13:06 | 39K | |
| gstreamer1-plugins-j..> | 2025-12-27 12:34 | 21K | |
| gstreamer1-plugins-j..> | 2025-12-27 11:12 | 20K | |
| gstreamer1-plugins-k..> | 2025-12-27 02:08 | 30K | |
| gstreamer1-plugins-l..> | 2025-12-27 05:45 | 19K | |
| gstreamer1-plugins-l..> | 2025-12-26 20:47 | 11K | |
| gstreamer1-plugins-l..> | 2025-12-27 16:06 | 9.1K | |
| gstreamer1-plugins-l..> | 2025-12-27 07:29 | 12K | |
| gstreamer1-plugins-l..> | 2025-12-27 11:45 | 7.1K | |
| gstreamer1-plugins-l..> | 2025-12-27 10:26 | 21K | |
| gstreamer1-plugins-m..> | 2025-12-27 09:40 | 11K | |
| gstreamer1-plugins-m..> | 2025-12-27 16:10 | 13K | |
| gstreamer1-plugins-m..> | 2025-12-27 12:53 | 20K | |
| gstreamer1-plugins-m..> | 2025-12-26 13:23 | 10K | |
| gstreamer1-plugins-m..> | 2025-12-27 15:09 | 16K | |
| gstreamer1-plugins-m..> | 2025-12-30 03:59 | 119K | |
| gstreamer1-plugins-n..> | 2025-12-27 16:28 | 12K | |
| gstreamer1-plugins-o..> | 2025-12-26 11:14 | 87K | |
| gstreamer1-plugins-o..> | 2025-12-27 10:22 | 79K | |
| gstreamer1-plugins-o..> | 2025-12-27 03:31 | 9.4K | |
| gstreamer1-plugins-o..> | 2025-12-27 09:05 | 14K | |
| gstreamer1-plugins-o..> | 2025-12-27 13:22 | 30K | |
| gstreamer1-plugins-o..> | 2025-12-27 09:22 | 10K | |
| gstreamer1-plugins-o..> | 2025-12-27 18:02 | 25K | |
| gstreamer1-plugins-p..> | 2025-12-26 13:43 | 32K | |
| gstreamer1-plugins-p..> | 2025-12-26 14:45 | 13K | |
| gstreamer1-plugins-p..> | 2025-12-26 04:12 | 42K | |
| gstreamer1-plugins-q..> | 2025-12-27 10:47 | 59K | |
| gstreamer1-plugins-q..> | 2025-12-27 11:59 | 70K | |
| gstreamer1-plugins-r..> | 2025-12-26 13:21 | 63K | |
| gstreamer1-plugins-r..> | 2025-12-27 15:56 | 11K | |
| gstreamer1-plugins-r..> | 2025-12-27 19:17 | 142M | |
| gstreamer1-plugins-s..> | 2025-12-26 20:11 | 212K | |
| gstreamer1-plugins-s..> | 2025-12-27 03:05 | 12K | |
| gstreamer1-plugins-s..> | 2025-12-27 13:18 | 9.8K | |
| gstreamer1-plugins-s..> | 2025-12-27 19:25 | 19K | |
| gstreamer1-plugins-s..> | 2025-12-27 06:04 | 13K | |
| gstreamer1-plugins-s..> | 2025-12-27 15:59 | 9.7K | |
| gstreamer1-plugins-s..> | 2025-12-27 02:45 | 13K | |
| gstreamer1-plugins-s..> | 2025-12-26 21:18 | 33K | |
| gstreamer1-plugins-s..> | 2025-12-27 09:02 | 10K | |
| gstreamer1-plugins-s..> | 2025-12-27 07:40 | 15K | |
| gstreamer1-plugins-s..> | 2025-12-27 15:46 | 25K | |
| gstreamer1-plugins-s..> | 2025-12-26 19:05 | 22K | |
| gstreamer1-plugins-s..> | 2025-12-29 19:15 | 10K | |
| gstreamer1-plugins-s..> | 2025-12-30 10:26 | 16K | |
| gstreamer1-plugins-s..> | 2025-12-29 23:56 | 9.9K | |
| gstreamer1-plugins-t..> | 2025-12-27 01:24 | 17K | |
| gstreamer1-plugins-t..> | 2025-12-26 13:51 | 23K | |
| gstreamer1-plugins-t..> | 2025-12-27 03:03 | 40K | |
| gstreamer1-plugins-t..> | 2025-12-27 19:03 | 11K | |
| gstreamer1-plugins-u..> | 2025-12-26 04:13 | 112K | |
| gstreamer1-plugins-v..> | 2025-12-26 19:19 | 126K | |
| gstreamer1-plugins-v..> | 2025-12-26 13:04 | 22K | |
| gstreamer1-plugins-v..> | 2025-12-27 02:59 | 32K | |
| gstreamer1-plugins-v..> | 2025-12-27 09:35 | 281K | |
| gstreamer1-plugins-w..> | 2025-12-27 00:58 | 16K | |
| gstreamer1-plugins-w..> | 2025-12-27 17:03 | 11K | |
| gstreamer1-plugins-w..> | 2025-12-26 21:50 | 140K | |
| gstreamer1-plugins-w..> | 2025-12-27 12:43 | 15K | |
| gstreamer1-plugins-x..> | 2025-12-26 21:36 | 44K | |
| gstreamer1-plugins-x..> | 2025-12-27 03:40 | 26K | |
| gstreamer1-plugins-x..> | 2025-12-27 10:22 | 17K | |
| gstreamer1-plugins-x..> | 2025-12-27 13:08 | 17K | |
| gstreamer1-plugins-z..> | 2025-12-27 04:05 | 6.6K | |
| gstreamer1-plugins-z..> | 2025-12-27 16:47 | 8.2K | |
| gstreamer1-rtsp-serv..> | 2025-12-26 20:45 | 259K | |
| gstreamer1-vaapi-1.2..> | 2025-12-27 12:28 | 297K | |
| gstreamermm-1.10.0_3..> | 2025-12-27 18:10 | 663K | |
| gtar-1.35_1.pkg | 2025-12-18 12:33 | 761K | |
| gtgt-3.2.0_1.pkg | 2025-12-23 11:41 | 293K | |
| gthumb-3.12.8.pkg | 2025-12-30 00:20 | 5.2M | |
| gti-1.9.1_1.pkg | 2025-08-19 12:06 | 6.4K | |
| gtick-0.5.5_5.pkg | 2025-12-30 09:26 | 126K | |
| gtimelapse-0.1_17.pkg | 2025-12-29 04:37 | 50K | |
| gtimer-2.0.0_6.pkg | 2025-12-29 22:34 | 74K | |
| gtk-E17-theme-3.22.2..> | 2025-08-16 08:35 | 102K | |
| gtk-aluminumalloy-cr..> | 2025-12-30 15:43 | 161K | |
| gtk-aluminumalloy-sm..> | 2025-12-29 00:57 | 162K | |
| gtk-aluminumalloy-to..> | 2025-12-29 17:50 | 159K | |
| gtk-aluminumalloy-vo..> | 2025-12-29 18:02 | 159K | |
| gtk-aquaextremesunke..> | 2025-12-29 22:20 | 179K | |
| gtk-arc-themes-20220..> | 2025-12-30 03:58 | 279K | |
| gtk-digital-cream-th..> | 2025-12-27 21:04 | 146K | |
| gtk-digital-harmony-..> | 2025-12-30 07:22 | 118K | |
| gtk-doc-1.35.1.pkg | 2025-12-16 01:46 | 237K | |
| gtk-engines2-2.20.2_..> | 2025-12-26 19:59 | 228K | |
| gtk-equinox-engine-1..> | 2025-12-30 04:05 | 475K | |
| gtk-gnutella-1.2.2_5..> | 2025-12-28 03:08 | 17M | |
| gtk-gray-theme-1.7_8..> | 2025-12-29 19:42 | 35K | |
| gtk-layer-shell-0.10..> | 2025-12-26 16:58 | 80K | |
| gtk-lila-theme-0.5.5..> | 2025-12-27 21:27 | 10K | |
| gtk-lila-theme-extra..> | 2025-12-30 16:55 | 8.7K | |
| gtk-longhorninspirat..> | 2025-12-28 07:21 | 115K | |
| gtk-milk-theme-2.1_9..> | 2025-12-30 10:29 | 63K | |
| gtk-mixer-1.0.4.pkg | 2025-12-30 06:33 | 20K | |
| gtk-murrina-aqua-0.1..> | 2025-12-30 07:27 | 2.2K | |
| gtk-murrine-engine-0..> | 2025-12-26 18:48 | 81K | |
| gtk-nodoka-engine-0...> | 2025-12-29 04:06 | 40K | |
| gtk-oxygen-engine-1...> | 2025-12-29 09:21 | 383K | |
| gtk-pipe-viewer-0.5...> | 2025-12-27 22:39 | 263K | |
| gtk-session-lock-0.2..> | 2025-12-27 11:10 | 31K | |
| gtk-sharp-beans-2.14..> | 2025-12-30 00:05 | 16K | |
| gtk-sharp20-2.12.45_..> | 2025-12-27 01:43 | 3.1M | |
| gtk-sharp30-2.99.3_7..> | 2025-12-27 16:21 | 3.1M | |
| gtk-theme-switch-2.0..> | 2025-12-29 20:25 | 12K | |
| gtk-update-icon-cach..> | 2025-12-24 21:53 | 75K | |
| gtk-vnc-1.5.0.pkg | 2025-12-27 00:52 | 1.2M | |
| gtk-xfce-engine-3.2...> | 2025-12-27 21:17 | 28K | |
| gtk-youtube-viewer-3..> | 2025-12-29 03:50 | 109K | |
| gtk2-2.24.33_1.pkg | 2025-12-26 17:48 | 5.8M | |
| gtk2-qtcurve-theme-1..> | 2025-12-27 16:18 | 158K | |
| gtk3-3.24.51.pkg | 2025-12-25 00:46 | 13M | |
| gtk3-oxygen-engine-1..> | 2025-12-28 03:25 | 362K | |
| gtk3-unico-engine-1...> | 2025-12-29 13:28 | 8.3K | |
| gtk4-4.18.6.pkg | 2025-12-26 10:00 | 15M | |
| gtk4-layer-shell-1.3..> | 2025-12-27 04:42 | 55K | |
| gtkam-1.0_9.pkg | 2025-12-30 07:09 | 156K | |
| gtkatlantic-0.6.3_5.pkg | 2025-12-30 18:52 | 240K | |
| gtkballs-3.1.5_15.pkg | 2025-12-28 12:09 | 668K | |
| gtkchtheme-0.3.1_13.pkg | 2025-12-29 03:01 | 13K | |
| gtkd-3.10.0_4.pkg | 2025-08-15 01:44 | 5.8M | |
| gtkdatabox-1.0.0_1.pkg | 2025-12-27 19:18 | 117K | |
| gtkevemon-1.10.2016...> | 2025-12-27 23:09 | 379K | |
| gtkextra-3.3.4_1.pkg | 2025-12-27 16:44 | 690K | |
| gtkglarea-2.0.1_12.pkg | 2025-12-26 22:48 | 14K | |
| gtkglext-1.2.0_21.pkg | 2025-12-26 21:22 | 278K | |
| gtkglextmm-1.2.0_16.pkg | 2025-12-27 04:01 | 279K | |
| gtkguitune-0.8_13.pkg | 2025-12-30 05:51 | 43K | |
| gtkhtml4-4.10.0_4.pkg | 2025-12-27 02:56 | 720K | |
| gtkimageview-1.6.4_6..> | 2025-12-26 22:13 | 341K | |
| gtklock-4.0.0.pkg | 2025-12-27 21:49 | 17K | |
| gtklp-1.3.4_2.pkg | 2025-12-29 02:46 | 149K | |
| gtkmm24-2.24.5_4.pkg | 2025-12-27 00:55 | 1.2M | |
| gtkmm30-3.24.9.pkg | 2025-12-27 02:07 | 1.6M | |
| gtkmm40-4.18.0.pkg | 2025-12-26 22:30 | 1.6M | |
| gtkpasman-0.12.1_2.pkg | 2025-12-29 23:04 | 16K | |
| gtkperf-0.40_11.pkg | 2025-12-28 23:54 | 32K | |
| gtkpod-1.0.0_16.pkg | 2025-12-30 02:11 | 1.1M | |
| gtkradiant-1.5.0_20.pkg | 2025-12-29 13:57 | 2.7M | |
| gtksourceview2-2.10...> | 2025-12-26 20:49 | 693K | |
| gtksourceview3-3.24...> | 2025-12-26 22:02 | 698K | |
| gtksourceview4-4.8.4..> | 2025-12-26 22:56 | 883K | |
| gtksourceview5-5.14...> | 2025-12-26 10:57 | 1.0M | |
| gtksourceviewmm3-3.1..> | 2025-12-27 14:00 | 124K | |
| gtkspell-2.0.16_7.pkg | 2025-12-26 20:30 | 27K | |
| gtkspell3-3.0.10_2.pkg | 2025-12-26 21:42 | 40K | |
| gtkterm2-0.2.3_13.pkg | 2025-12-30 06:11 | 20K | |
| gtkwave-3.3.125.pkg | 2025-12-26 18:50 | 2.4M | |
| gtmixer-1.0.2_3.pkg | 2025-12-28 20:55 | 105K | |
| gtranslator-47.1_1.pkg | 2025-12-30 01:15 | 1.0M | |
| gts-0.7.6_5.pkg | 2025-12-19 02:07 | 288K | |
| gtultra-1.5.5.pkg | 2025-12-29 21:23 | 677K | |
| gtypist-2.10.1.pkg | 2025-12-20 10:57 | 494K | |
| gu-aspell-0.03.0_1,2..> | 2025-12-23 04:59 | 543K | |
| gu-libreoffice-25.8...> | 2025-12-27 18:24 | 2.9M | |
| guacamole-client-1.6..> | 2025-12-30 14:14 | 90M | |
| guacamole-server-1.6..> | 2025-12-27 12:01 | 435K | |
| guake-3.7.0_2.pkg | 2025-12-27 22:08 | 1.0M | |
| gubby-0.5.5_1.pkg | 2025-08-20 17:54 | 33K | |
| gucharmap-17.0.0.pkg | 2025-12-26 20:55 | 2.5M | |
| guetzli-1.0.1_5.pkg | 2025-12-29 16:05 | 120K | |
| gug-libreoffice-25.8..> | 2025-12-27 04:05 | 379K | |
| guichan-0.8.2_15.pkg | 2025-12-29 19:05 | 257K | |
| guidoar-g20210127.pkg | 2025-08-15 02:43 | 300K | |
| guidolib-1.7.7,1.pkg | 2025-12-27 18:31 | 2.8M | |
| guifi-snpservices-0...> | 2025-12-30 06:49 | 32K | |
| guile-aclocal-3.0.10..> | 2025-08-13 05:13 | 5.0K | |
| guile-cairo-guile22-..> | 2025-12-27 06:02 | 97K | |
| guile-cairo-guile30-..> | 2025-12-30 16:27 | 101K | |
| guile-gnome-platform..> | 2025-12-30 07:15 | 870K | |
| guile-gnome-platform..> | 2025-12-29 07:12 | 870K | |
| guile-lib-guile22-0...> | 2025-12-19 04:49 | 331K | |
| guile-lib-guile30-0...> | 2025-12-19 06:34 | 417K | |
| guile-meta-4.pkg | 2025-12-20 01:38 | 954 | |
| guile1-1.8.8_2.pkg | 2025-12-18 23:25 | 1.1M | |
| guile2-2.2.7_6.pkg | 2025-12-18 18:34 | 6.6M | |
| guile3-3.0.10.pkg | 2025-12-18 07:16 | 8.7M | |
| guilib-1.2.1_5.pkg | 2025-12-21 10:36 | 47K | |
| guitarix-0.47.0.pkg | 2025-12-29 02:51 | 31M | |
| gula-plugins-lv2-g20..> | 2025-08-20 17:39 | 2.9M | |
| gum-0.17.0_4.pkg | 2025-12-22 12:28 | 3.6M | |
| gumbo-0.13.0.pkg | 2025-08-13 15:24 | 174K | |
| gummi-0.8.3_3.pkg | 2025-12-28 09:40 | 304K | |
| gunfudeadlands-1.01_..> | 2025-12-29 21:24 | 4.9M | |
| gup-0.4_1.pkg | 2025-08-16 03:13 | 20K | |
| gupnp-1.6.9.pkg | 2025-12-19 12:52 | 169K | |
| gupnp-av-0.14.4.pkg | 2025-12-19 06:08 | 145K | |
| gupnp-igd-1.6.0.pkg | 2025-12-21 21:51 | 23K | |
| gupnp-tools-0.12.2_1..> | 2025-12-29 17:16 | 182K | |
| gurk-rs-0.6.1_7.pkg | 2025-12-28 19:35 | 4.8M | |
| gurl-0.3.0_11.pkg | 2025-12-23 14:01 | 2.2M | |
| guspat-20000706_2.pkg | 2025-08-14 16:16 | 22M | |
| gutenfetch-1.5_2.pkg | 2025-12-23 16:54 | 11K | |
| gutenprint-5.3.4_1.pkg | 2025-12-26 21:03 | 18M | |
| guvcview-2.2.1_1.pkg | 2025-12-29 03:57 | 293K | |
| gv-3.7.4_8.pkg | 2025-12-27 21:05 | 174K | |
| gv-aspell-0.50.0_1,1..> | 2025-12-21 13:21 | 231K | |
| gvfs-1.56.1_1.pkg | 2025-12-26 20:16 | 1.1M | |
| gvm-26.8.0.pkg | 2025-12-29 11:31 | 2.9K | |
| gvm-libs-22.31.1.pkg | 2025-12-26 18:50 | 176K | |
| gvmd-26.8.0.pkg | 2025-12-27 10:57 | 698K | |
| gvolwheel-1.0.3_2.pkg | 2025-12-28 00:24 | 15K | |
| gwenhywfar-5.13.0.pkg | 2025-12-19 00:05 | 802K | |
| gwenhywfar-fox16-5.1..> | 2025-12-29 08:06 | 49K | |
| gwenhywfar-gtk2-5.13..> | 2025-12-29 12:20 | 26K | |
| gwenhywfar-gtk3-5.13..> | 2025-12-27 17:07 | 26K | |
| gwenhywfar-qt5-5.13...> | 2025-12-29 00:13 | 28K | |
| gwenhywfar-qt6-5.13...> | 2025-12-27 13:15 | 30K | |
| gwenview-25.12.0.pkg | 2025-12-27 01:45 | 6.5M | |
| gwhich-2.23.pkg | 2025-08-16 23:19 | 15K | |
| gwhois-20120626_1.pkg | 2025-12-21 16:48 | 20K | |
| gworkspace-1.1.0_1.pkg | 2025-12-26 22:55 | 1.0M | |
| gworkspace-gwmetadat..> | 2025-12-27 16:06 | 275K | |
| gwsocket-0.3_1.pkg | 2025-08-20 16:43 | 29K | |
| gxemul-0.7.0_1.pkg | 2025-12-30 17:06 | 5.1M | |
| gxkb-0.9.6.pkg | 2025-12-30 14:46 | 21K | |
| gxmessage-3.4.3_4.pkg | 2025-12-29 00:23 | 33K | |
| gxneur-0.20.0_5.pkg | 2025-12-29 19:13 | 346K | |
| gxplugins-lv2-1.0.pkg | 2025-12-28 08:30 | 4.4M | |
| gzdoom-4.7.1_8.pkg | 2025-12-28 12:15 | 15M | |
| gzip-1.14.pkg | 2025-08-14 07:23 | 191K | |
| gzip-hpp-0.1.0.1.pkg | 2025-08-18 12:51 | 3.1K | |
| gzrecover-0.8.pkg | 2025-08-18 06:25 | 6.7K | |
| gzstream-1.5_3.pkg | 2025-08-14 16:06 | 7.5K | |
| h2c-1.0.pkg | 2025-12-23 07:31 | 4.0K | |
| h2o-2.3.0.d.20241011..> | 2025-12-21 03:25 | 2.4M | |
| h3-3.7.2_1.pkg | 2025-08-14 01:35 | 72K | |
| h5utils-1.13.2_4.pkg | 2025-12-28 11:36 | 75K | |
| h5z-zfp-1.1.1.pkg | 2025-12-30 17:53 | 16K | |
| h323plus-1.27.2.pkg | 2025-12-29 20:24 | 2.5M | |
| ha-0.999b_2.pkg | 2025-08-17 04:27 | 32K | |
| habak-0.2.5_3.pkg | 2025-12-29 15:25 | 9.4K | |
| habari-0.8.pkg | 2025-12-29 14:21 | 2.5M | |
| hack-font-3.003_1.pkg | 2025-12-26 19:06 | 383K | |
| hackrf-2024.02.1.pkg | 2025-08-15 09:34 | 74K | |
| half-2.2.1.pkg | 2025-12-19 13:06 | 31K | |
| halftone-0.7.2.pkg | 2025-12-30 15:09 | 47K | |
| halibut-1.3.pkg | 2025-12-19 06:15 | 575K | |
| halide-18.0.0,1.pkg | 2025-12-21 10:29 | 9.6M | |
| halloy-2025.12_1.pkg | 2025-12-30 18:44 | 10M | |
| hamclock-4.21.pkg | 2025-12-22 15:10 | 502K | |
| hamcrest-1.3.pkg | 2025-12-26 10:55 | 340K | |
| hamlib-4.6.5.pkg | 2025-12-18 22:06 | 2.3M | |
| hammer2-1.2.13.14030..> | 2025-12-21 18:40 | 158K | |
| hanazono-fonts-ttf-2..> | 2025-12-29 13:09 | 22M | |
| handbrake-1.10.2.pkg | 2025-12-30 17:16 | 23M | |
| handlr-0.7.1_35.pkg | 2025-12-28 05:59 | 948K | |
| hangman-0.9.2_13.pkg | 2025-12-30 14:04 | 893K | |
| hans-1.0.pkg | 2025-08-20 14:50 | 27K | |
| haplohseq-0.1.2.3_2.pkg | 2025-12-27 10:18 | 8.6M | |
| haproxy-3.2.10.pkg | 2025-12-27 11:48 | 2.4M | |
| haproxy-devel-3.3.d1..> | 2025-12-20 19:54 | 2.5M | |
| haproxy-lua-3.2.10.pkg | 2025-12-27 21:16 | 2.5M | |
| haproxy-wolfssl-3.2...> | 2025-12-29 14:32 | 2.4M | |
| haproxy24-2.4.30.pkg | 2025-12-18 23:57 | 1.8M | |
| haproxy24-lua-2.4.30..> | 2025-12-24 04:11 | 1.9M | |
| haproxy26-2.6.23.pkg | 2025-12-22 05:21 | 1.8M | |
| haproxy26-lua-2.6.23..> | 2025-12-22 15:10 | 1.9M | |
| haproxy28-2.8.16.pkg | 2025-12-22 12:30 | 2.0M | |
| haproxy28-lua-2.8.16..> | 2025-12-21 06:57 | 2.1M | |
| haproxy30-3.0.13.pkg | 2025-12-29 15:26 | 2.2M | |
| haproxy30-lua-3.0.13..> | 2025-12-28 00:59 | 2.3M | |
| haproxy30-wolfssl-3...> | 2025-12-28 13:55 | 2.2M | |
| haproxy33-3.3.1.pkg | 2025-12-28 12:47 | 2.5M | |
| haproxy33-lua-3.3.1.pkg | 2025-12-30 12:45 | 2.7M | |
| haproxy33-wolfssl-3...> | 2025-12-27 22:50 | 2.5M | |
| haproxydevel-lua-3.3..> | 2025-12-20 08:43 | 2.6M | |
| hapy-0.0.8_1.pkg | 2025-08-21 11:32 | 68K | |
| hardening-check-2.6.pkg | 2025-12-22 08:56 | 5.4K | |
| hardlink-0.3.0_1.pkg | 2025-08-16 15:29 | 10K | |
| hare-1.1.pkg | 2025-08-21 21:11 | 10K | |
| hare-lang-0.25.2_1.pkg | 2025-12-23 21:15 | 1.0M | |
| harec-0.25.2_1.pkg | 2025-12-19 04:57 | 100K | |
| hared-1.0.45_34.pkg | 2025-12-24 06:08 | 2.0M | |
| harfbuzz-12.2.0.pkg | 2025-12-24 20:27 | 1.2M | |
| harfbuzz-cairo-12.2...> | 2025-12-30 00:35 | 45K | |
| harfbuzz-icu-12.2.0.pkg | 2025-12-24 23:53 | 5.4K | |
| harminv-1.4.2_2.pkg | 2025-12-27 18:45 | 29K | |
| harper-1.2.0_1.pkg | 2025-12-30 03:28 | 12M | |
| haruna-1.7.0_1.pkg | 2025-12-29 16:49 | 896K | |
| harvid-0.9.1_5.pkg | 2025-12-29 19:08 | 71K | |
| hash-g20200929.pkg | 2025-08-22 10:54 | 84K | |
| hashcash-1.22_1.pkg | 2025-08-16 06:07 | 85K | |
| hashcat-7.1.2_4,1.pkg | 2025-12-29 18:09 | 14M | |
| hashdb-3.1.0.8_2.pkg | 2025-12-22 22:17 | 331K | |
| hashicorp-serf-0.10...> | 2025-12-22 15:41 | 3.4M | |
| hashtypes-0.1.5.pkg | 2025-12-23 14:24 | 13K | |
| haskell-mode-17.5_6.pkg | 2025-12-30 00:41 | 159K | |
| haskell-mode-emacs_c..> | 2025-12-30 11:52 | 159K | |
| haskell-mode-emacs_d..> | 2025-12-29 09:02 | 160K | |
| haskell-mode-emacs_d..> | 2025-12-22 21:17 | 159K | |
| haskell-mode-emacs_n..> | 2025-12-20 22:58 | 159K | |
| haskell-mode-emacs_w..> | 2025-12-30 04:52 | 159K | |
| hatari-2.6.1.pkg | 2025-12-28 06:31 | 3.8M | |
| hatop-0.8.1_1.pkg | 2025-12-29 12:03 | 20K | |
| havoc-0.3.1.pkg | 2025-12-30 08:40 | 55K | |
| hbiff-1.2_3.pkg | 2025-08-21 16:27 | 14K | |
| hblock-3.5.1.pkg | 2025-12-23 12:39 | 15K | |
| hcidump-1.5.1_1.pkg | 2025-08-18 22:35 | 19K | |
| hcloud-1.58.0.pkg | 2025-12-29 11:34 | 5.1M | |
| hcs12mem-1.4.1_1.pkg | 2025-08-16 08:22 | 58K | |
| hdf-4.3.0,1.pkg | 2025-12-27 15:34 | 807K | |
| hdf5-1.12.2_2,1.pkg | 2025-12-26 06:32 | 12M | |
| hdf5-18-1.8.23.pkg | 2025-08-21 02:32 | 6.2M | |
| hdf5-110-1.10.11.pkg | 2025-12-26 11:14 | 4.2M | |
| hdr_tools-0.0.2010.1..> | 2025-12-29 08:21 | 87K | |
| hdrecover-0.5.pkg | 2025-08-17 13:49 | 5.4K | |
| he-libreoffice-25.8...> | 2025-12-27 12:30 | 2.9M | |
| heaan-2.1.40_1.pkg | 2025-12-30 08:31 | 84K | |
| headscale-0.27.1_1.pkg | 2025-12-24 04:18 | 14M | |
| headsetcontrol-3.1.0..> | 2025-12-22 12:31 | 39K | |
| healpix-3.50_6.pkg | 2025-12-19 09:02 | 644K | |
| healpix-c-3.50_6.pkg | 2025-12-21 05:11 | 16K | |
| health-0.95.0_22.pkg | 2025-12-29 23:52 | 9.2M | |
| health-nut-20.1_4.pkg | 2025-08-16 20:03 | 1.1M | |
| healthd-0.7.9_3.pkg | 2025-08-20 23:27 | 27K | |
| heaptrack-1.5.0_7.pkg | 2025-12-29 12:45 | 571K | |
| hebcal-5.9.2.2025072..> | 2025-12-22 17:10 | 936K | |
| heidisql-gtk2-12.14...> | 2025-12-28 01:12 | 5.6M | |
| heidisql-qt5-12.14.1..> | 2025-12-29 09:19 | 5.5M | |
| heidisql-qt6-12.14.1..> | 2025-12-29 15:14 | 5.5M | |
| heimdal-7.8.0_8.pkg | 2025-12-19 23:48 | 2.8M | |
| heimdall-1.4.2_5.pkg | 2025-12-30 18:16 | 102K | |
| heimer-4.5.0.pkg | 2025-12-29 15:00 | 340K | |
| heirloom-070715_4.pkg | 2025-08-16 10:07 | 1.1M | |
| heirloom-devtools-07..> | 2025-08-16 06:17 | 357K | |
| heirloom-doctools-19..> | 2025-08-18 22:15 | 949K | |
| heirloom-mailx-12.4_..> | 2025-08-17 16:01 | 247K | |
| heirloom-sh-050706_2..> | 2025-08-18 19:04 | 70K | |
| helfem-g20251026.pkg | 2025-12-28 18:00 | 1.5M | |
| helib-2.3.0.pkg | 2025-12-30 04:09 | 847K | |
| helix-25.07.1_4.pkg | 2025-12-27 22:11 | 17M | |
| hello-2.12.2.pkg | 2025-12-20 18:03 | 63K | |
| helm-3.19.4.pkg | 2025-12-27 05:34 | 17M | |
| helmfile-1.1.2_7.pkg | 2025-12-30 07:20 | 36M | |
| help2man-1.49.3_1.pkg | 2025-12-16 01:30 | 164K | |
| help_hannahs_horse-1..> | 2025-12-28 06:11 | 3.4M | |
| helpviewer-0.3_13.pkg | 2025-12-27 09:25 | 105K | |
| helvum-0.5.1_21.pkg | 2025-12-30 09:41 | 290K | |
| heme-0.4.2.pkg | 2025-08-18 21:45 | 20K | |
| hepmc3-3.3.0.pkg | 2025-08-14 23:24 | 341K | |
| herbe-1.0.0.pkg | 2025-12-29 20:46 | 6.9K | |
| herbstluftwm-0.9.5_2..> | 2025-12-28 13:18 | 552K | |
| hercules-3.13_1.pkg | 2025-12-22 07:20 | 1.4M | |
| heretic-1.2_9.pkg | 2025-08-16 13:43 | 2.2M | |
| hermes-javascript-en..> | 2025-12-21 08:40 | 2.0M | |
| hermit-font-2.0_1.pkg | 2025-12-30 00:28 | 90K | |
| heroes-0.21_21.pkg | 2025-12-21 18:26 | 1.8M | |
| hesiod-3.2.1_5.pkg | 2025-12-21 16:25 | 27K | |
| hetzner_ddns-0.2.4_1..> | 2025-12-20 15:17 | 4.4K | |
| hevea-2.36.pkg | 2025-08-15 14:41 | 2.6M | |
| hex-a-hop-1.1.0_6.pkg | 2025-12-30 10:52 | 8.5M | |
| hexalate-1.2.5.pkg | 2025-12-30 09:29 | 224K | |
| hexcalc-1.11_4.pkg | 2025-12-23 17:39 | 8.0K | |
| hexchat-2.16.2_2.pkg | 2025-12-27 17:34 | 1.1M | |
| hexchat-fishlim-0.0...> | 2025-12-28 03:00 | 9.0K | |
| hexcode-1.0.pkg | 2025-08-18 18:09 | 6.6K | |
| hexcompare-1.0.4.pkg | 2025-08-17 00:38 | 6.7K | |
| hexcurse-1.70.0.pkg | 2025-08-17 01:40 | 23K | |
| hexd-1.0.0_4.pkg | 2025-08-19 13:25 | 7.8K | |
| hexedit-1.6.pkg | 2025-08-19 16:13 | 21K | |
| hexer-1.0.3_2.pkg | 2025-08-22 15:46 | 97K | |
| hexinject-1.6.pkg | 2025-08-17 02:18 | 10K | |
| hexl-1.2.6.pkg | 2025-08-18 05:23 | 59K | |
| hexowl-1.5.1_6.pkg | 2025-12-22 07:04 | 834K | |
| hexpeek-1.0.20200804..> | 2025-12-24 07:40 | 59K | |
| hexpert-2.4.1.pkg | 2025-08-16 16:28 | 8.6K | |
| hexter-1.0.3_3.pkg | 2025-12-30 05:45 | 120K | |
| hextools-1.2_1.pkg | 2025-08-21 14:28 | 12K | |
| hexxagon-1.0.2_4.pkg | 2025-12-28 02:32 | 959K | |
| hexyl-0.16.0_9.pkg | 2025-12-29 07:59 | 352K | |
| hey-0.1.4_34.pkg | 2025-12-21 04:30 | 2.6M | |
| heyu2-2.10.3_1.pkg | 2025-08-20 14:27 | 401K | |
| hfsexplorer-2021.10...> | 2025-12-30 12:38 | 1.4M | |
| hfsutils-3.2.6_4.pkg | 2025-08-16 15:38 | 98K | |
| hhm-0.1.1.pkg | 2025-08-16 17:36 | 9.8K | |
| hhpc-0.3.1.pkg | 2025-08-22 12:30 | 6.5K | |
| hhsuite-3.3.0_3.pkg | 2025-12-29 18:23 | 7.6M | |
| hi-aspell-0.02.0_1,2..> | 2025-12-21 02:59 | 842K | |
| hi-libreoffice-25.8...> | 2025-12-27 16:05 | 2.9M | |
| hiawatha-11.8.pkg | 2025-12-21 20:50 | 136K | |
| hiawatha-monitor-php..> | 2025-12-29 07:20 | 523K | |
| hiawatha-monitor-php..> | 2025-12-30 15:14 | 523K | |
| hiawatha-monitor-php..> | 2025-12-29 11:33 | 523K | |
| hiawatha-monitor-php..> | 2025-12-29 18:12 | 523K | |
| hiawatha-monitor-php..> | 2025-12-28 05:09 | 523K | |
| hicolor-icon-theme-0..> | 2025-08-10 21:32 | 10K | |
| hid-tools-0.8.pkg | 2025-12-21 01:50 | 165K | |
| hidapi-0.15.0.pkg | 2025-12-18 00:23 | 38K | |
| hidden-lake-1.9.1_3.pkg | 2025-12-21 11:00 | 19M | |
| higan-110_1.pkg | 2025-12-29 01:14 | 2.3M | |
| highfive-3.2.0.pkg | 2025-12-27 16:59 | 63K | |
| highlight-4.18,3.pkg | 2025-12-18 23:01 | 840K | |
| highlighterkit-0.1_1..> | 2025-12-27 02:43 | 21K | |
| highlnk-0.2_1.pkg | 2025-08-21 09:58 | 9.5K | |
| highmoon-1.2.4_12.pkg | 2025-12-28 09:43 | 402K | |
| highway-1.3.0.pkg | 2025-08-23 02:19 | 1.0M | |
| highwayhash-g2024041..> | 2025-08-14 00:15 | 93K | |
| hikari-2.3.3_5.pkg | 2025-12-30 06:19 | 948K | |
| hil-aspell-0.11.0_1,..> | 2025-12-20 23:33 | 123K | |
| hilite-1.5.pkg | 2025-08-19 17:13 | 3.2K | |
| himenobench-2015.07...> | 2025-12-28 08:29 | 22K | |
| hinversi-0.8.2_3.pkg | 2025-12-23 23:12 | 26K | |
| hipercontracer-2.1.8..> | 2025-12-29 12:56 | 3.6M | |
| hiredis-1.3.0.15.pkg | 2025-08-13 16:11 | 78K | |
| hisat2-2.2.1_2.pkg | 2025-12-19 20:19 | 1.1M | |
| histring-1.1.1.1.pkg | 2025-08-22 03:20 | 5.5K | |
| hitch-1.8.0_1.pkg | 2025-08-20 11:44 | 88K | |
| hitori-44.0.pkg | 2025-12-30 15:12 | 190K | |
| hivetui-0.1.1_11.pkg | 2025-12-29 03:35 | 747K | |
| hivex-1.3.24.pkg | 2025-12-21 11:42 | 108K | |
| hlextract-2.4.6.pkg | 2025-08-20 08:10 | 10K | |
| hllib-2.4.6.pkg | 2025-08-14 13:14 | 97K | |
| hlmaster-0.9.3_1.pkg | 2025-08-19 09:04 | 36K | |
| hmat-oss-1.11.1.pkg | 2025-12-29 07:18 | 349K | |
| hmmer-3.4.pkg | 2025-08-15 05:19 | 2.0M | |
| hnb-1.9.18_1.pkg | 2025-08-20 08:15 | 62K | |
| hobbes-icons-xpm3-1...> | 2025-08-20 08:14 | 517K | |
| hockeypuck-2.2.4_7.pkg | 2025-12-20 18:22 | 17M | |
| hoel-1.4.29.pkg | 2025-12-20 04:42 | 33K | |
| holotz-castle-1.3.14..> | 2025-12-27 22:35 | 116M | |
| homebank-5.9.6.pkg | 2025-12-29 00:45 | 2.4M | |
| homebox-0.21.0_5.pkg | 2025-12-20 21:13 | 22M | |
| homepage-1.8.0.pkg | 2025-12-28 02:48 | 8.1M | |
| homer-web-25.11.1.pkg | 2025-12-23 16:59 | 1.0M | |
| honeyd-1.5c_13.pkg | 2025-12-23 14:43 | 407K | |
| honeytrap-g20210510_..> | 2025-12-23 15:04 | 5.2M | |
| honggfuzz-0.7.pkg | 2025-08-20 21:10 | 28K | |
| horcrux-0.3_33.pkg | 2025-12-22 13:39 | 857K | |
| host-setup-4.0.2_1.pkg | 2025-08-17 22:07 | 27K | |
| hostapd-2.11_3.pkg | 2025-08-16 11:41 | 263K | |
| hostapd-devel-2025.1..> | 2025-12-21 23:05 | 272K | |
| hostapd29-2.9_5.pkg | 2025-08-20 05:44 | 233K | |
| hostapd210-2.10_10.pkg | 2025-08-16 07:11 | 248K | |
| hostctl-1.1.4_21.pkg | 2025-12-21 16:35 | 3.2M | |
| hostd-2.5.1_1.pkg | 2025-12-21 03:06 | 7.6M | |
| hostdb-1.004_1.pkg | 2025-08-19 11:12 | 126K | |
| hot-babe-0.2.2_12.pkg | 2025-12-30 06:35 | 382K | |
| hotcrp-3.0.0_2.pkg | 2025-12-30 10:06 | 1.6M | |
| hotkeys-0.5.7.1_22.pkg | 2025-12-29 19:26 | 125K | |
| hotspot-1.5.1_2.pkg | 2025-12-29 21:53 | 813K | |
| hourglass-1.0.1.pkg | 2025-08-20 09:29 | 18K | |
| hoverboard-0.8.0_2.pkg | 2025-12-29 09:51 | 3.6M | |
| howdy-3.0.0.b.202303..> | 2025-12-27 12:27 | 36K | |
| howm-1.4.8_12.pkg | 2025-12-28 06:22 | 368K | |
| howm-emacs_canna-1.4..> | 2025-12-29 12:16 | 368K | |
| howm-emacs_nox-1.4.8..> | 2025-12-20 06:07 | 368K | |
| howm-emacs_wayland-1..> | 2025-12-30 17:06 | 368K | |
| hp2xx-3.4.4_10.pkg | 2025-12-30 14:57 | 83K | |
| hp48cc-1.3_2.pkg | 2025-08-18 18:31 | 19K | |
| hpacucli-7.50_4.pkg | 2025-08-19 15:01 | 750K | |
| hpenc-3.0_4.pkg | 2025-08-19 03:55 | 35K | |
| hping3-20051105_1.pkg | 2025-08-20 13:13 | 100K | |
| hpipm-0.1.3.225.pkg | 2025-12-27 17:07 | 371K | |
| hpl-2.3_7.pkg | 2025-12-28 10:43 | 173K | |
| hplip-3.25.8.pkg | 2025-12-27 07:28 | 22M | |
| hplip-plugin-3.25.8.pkg | 2025-12-30 07:09 | 768K | |
| hppsmtools-1.1,1.pkg | 2025-08-18 03:02 | 26K | |
| hpsjam-1.2.8.pkg | 2025-12-30 17:56 | 195K | |
| hptcli-3.6_2.pkg | 2025-08-19 14:24 | 1.1M | |
| hptt-1.0.5.18_1.pkg | 2025-12-30 11:14 | 512K | |
| hpx-1.11.0.20250715_..> | 2025-12-29 17:22 | 9.3M | |
| hr-aspell-0.51.0_1,1..> | 2025-12-21 16:48 | 2.1M | |
| hr-libreoffice-25.8...> | 2025-12-27 09:46 | 3.1M | |
| hs-Agda-2.8.0.pkg | 2025-08-19 15:49 | 15M | |
| hs-DAV-1.3.4_7.pkg | 2025-08-18 02:32 | 6.3M | |
| hs-ShellCheck-0.11.0..> | 2025-12-22 10:23 | 5.2M | |
| hs-aeson-pretty-0.8...> | 2025-08-17 05:44 | 3.8M | |
| hs-alex-3.5.4.0.pkg | 2025-08-15 23:03 | 1.8M | |
| hs-arbtt-0.12.0.3.pkg | 2025-08-22 06:03 | 20M | |
| hs-brainfuck-0.1.0.4..> | 2025-08-21 14:15 | 1.0M | |
| hs-cabal-install-3.1..> | 2025-08-13 09:15 | 7.3M | |
| hs-cabal-plan-0.7.6...> | 2025-12-21 07:04 | 4.4M | |
| hs-cabal2tuple-2.0.3..> | 2025-08-19 05:56 | 4.3M | |
| hs-cardano-cli-10.13..> | 2025-12-23 05:44 | 8.7M | |
| hs-cardano-db-sync-1..> | 2025-12-24 06:28 | 15M | |
| hs-cardano-node-10.5..> | 2025-12-19 22:00 | 19M | |
| hs-cgrep-8.1.0_1.pkg | 2025-12-21 15:34 | 4.8M | |
| hs-conlecterm-2.3.0...> | 2025-12-30 11:51 | 14M | |
| hs-cpphs-1.20.9.1_4.pkg | 2025-08-20 00:19 | 1.8M | |
| hs-cputype-0.2.2_2.pkg | 2025-08-18 13:18 | 2.5M | |
| hs-cryptol-3.4.0.pkg | 2025-12-21 06:46 | 13M | |
| hs-darcs-2.18.5_1.pkg | 2025-08-15 09:15 | 8.1M | |
| hs-dhall-1.42.1.pkg | 2025-08-21 10:12 | 7.3M | |
| hs-dhall-bash-1.0.41..> | 2025-08-22 15:41 | 6.8M | |
| hs-dhall-json-1.7.12..> | 2025-08-20 07:11 | 14M | |
| hs-dhall-yaml-1.2.12..> | 2025-08-17 04:03 | 14M | |
| hs-elm-0.19.1_8.pkg | 2025-12-28 06:52 | 6.7M | |
| hs-elm-format-0.8.7_..> | 2025-08-17 23:39 | 4.8M | |
| hs-futhark-0.25.34.pkg | 2025-12-20 18:57 | 16M | |
| hs-ghc-events-0.20.0..> | 2025-08-16 07:52 | 2.9M | |
| hs-ghcprofview-0.1.0..> | 2025-12-29 17:00 | 13M | |
| hs-git-annex-10.2024..> | 2025-12-20 05:51 | 14M | |
| hs-git-brunch-1.7.2...> | 2025-08-18 14:58 | 3.7M | |
| hs-gitit-0.15.1.2.pkg | 2025-08-22 13:51 | 27M | |
| hs-hadolint-2.12.0.pkg | 2025-08-16 12:34 | 7.3M | |
| hs-happy-1.20.1.1.pkg | 2025-08-16 05:18 | 1.7M | |
| hs-hascard-0.6.0.2.pkg | 2025-08-19 09:05 | 4.0M | |
| hs-haskell-language-..> | 2025-12-22 22:12 | 55M | |
| hs-haskell-language-..> | 2025-08-22 16:37 | 32M | |
| hs-haskell-language-..> | 2025-12-23 15:58 | 33M | |
| hs-hasktags-0.73.0.pkg | 2025-08-17 07:24 | 2.7M | |
| hs-hjsmin-0.2.1.pkg | 2025-08-18 08:01 | 2.8M | |
| hs-hledger-1.50.4.pkg | 2025-12-20 18:17 | 10M | |
| hs-hledger-ui-1.42.1..> | 2025-08-20 14:27 | 8.1M | |
| hs-hledger-web-1.42...> | 2025-08-16 21:45 | 12M | |
| hs-hlint-3.10.pkg | 2025-08-20 05:34 | 10M | |
| hs-hoogle-5.0.18.4.pkg | 2025-12-22 02:52 | 8.3M | |
| hs-hpack-0.38.3.pkg | 2025-12-23 10:18 | 6.8M | |
| hs-hscolour-1.25,1.pkg | 2025-08-17 23:04 | 1.5M | |
| hs-hspec-discover-2...> | 2025-12-21 16:03 | 1.6M | |
| hs-koka-3.2.2.pkg | 2025-08-21 06:49 | 11M | |
| hs-lhs2tex-1.25.pkg | 2025-12-28 01:45 | 2.6M | |
| hs-matterhorn-90000...> | 2025-12-21 03:43 | 9.5M | |
| hs-mueval-0.9.4.pkg | 2025-08-20 03:22 | 13M | |
| hs-ogmios-6.13.0.pkg | 2025-12-21 19:26 | 16M | |
| hs-ormolu-0.7.7.0_1.pkg | 2025-08-20 22:28 | 8.9M | |
| hs-pandoc-3.8.2.1_1.pkg | 2025-12-18 11:56 | 31M | |
| hs-pandoc-crossref-0..> | 2025-12-21 14:07 | 11M | |
| hs-panopticum-2.0.1...> | 2025-08-17 04:43 | 2.8M | |
| hs-postgrest-14.0.pkg | 2025-12-22 17:27 | 9.1M | |
| hs-profiteur-0.4.7.0..> | 2025-08-21 23:32 | 3.7M | |
| hs-purescript-0.15.1..> | 2025-08-21 03:49 | 8.1M | |
| hs-scroll-1.20180421..> | 2025-08-16 08:49 | 3.1M | |
| hs-shake-0.19.8.pkg | 2025-08-21 10:26 | 3.3M | |
| hs-spago-0.21.0_1.pkg | 2025-12-22 13:33 | 7.7M | |
| hs-stack-3.7.1.pkg | 2025-12-23 00:40 | 13M | |
| hs-syfco-1.1.34.pkg | 2025-08-19 10:33 | 2.5M | |
| hs-tart-terminal-art..> | 2025-12-23 03:40 | 3.5M | |
| hs-threadscope-0.2.1..> | 2025-12-30 17:51 | 3.9M | |
| hs-unlambda-0.1.4.2_..> | 2025-08-16 19:56 | 936K | |
| hs-verismith-1.1.0_1..> | 2025-08-16 01:45 | 5.9M | |
| hs-wai-app-static-3...> | 2025-08-17 15:46 | 4.2M | |
| hs-xmobar-0.49.pkg | 2025-12-29 13:54 | 6.7M | |
| hs-xmonad-0.18.0.pkg | 2025-12-22 07:34 | 2.0M | |
| hs-yaml-0.11.11.2.pkg | 2025-08-18 05:12 | 8.6M | |
| hs-yesod-bin-1.6.2.3..> | 2025-08-17 08:13 | 8.1M | |
| hsb-aspell-0.02.0,2.pkg | 2025-12-21 08:56 | 334K | |
| hsb-libreoffice-25.8..> | 2025-12-27 11:19 | 3.4M | |
| hsetroot-1.0.5_3.pkg | 2025-12-30 00:56 | 11K | |
| hsflowd-1.24.1.pkg | 2025-08-16 03:41 | 39K | |
| hsftp-1.15_4.pkg | 2025-12-20 07:19 | 13K | |
| hsqldb-2.7.4.pkg | 2025-12-28 16:53 | 4.6M | |
| hstr-2.3_1.pkg | 2025-12-23 00:19 | 25K | |
| htable-1.2_1.pkg | 2025-08-18 15:38 | 9.0K | |
| htdigest-2.4.56_5.pkg | 2025-12-23 18:08 | 5.8K | |
| htdump-0.9y.pkg | 2025-08-18 05:03 | 11K | |
| hte-2.1.1.g20161206_..> | 2025-08-17 13:23 | 546K | |
| html-4.01_2.pkg | 2025-08-15 10:06 | 29K | |
| html-pretty-1.02.pkg | 2025-08-22 09:06 | 152K | |
| html-query-1.2.2_4.pkg | 2025-12-30 10:34 | 524K | |
| html-xml-utils-8.7.pkg | 2025-08-21 14:17 | 279K | |
| html2fo-0.4.2.pkg | 2025-08-22 16:41 | 25K | |
| html2hdml-1.0.5.pkg | 2025-08-18 06:38 | 30K | |
| html2latex-0.9c_1.pkg | 2025-08-22 12:10 | 11K | |
| html2ps-1.0.b7_10,1.pkg | 2025-12-29 21:44 | 90K | |
| html2text-2.2.3,1.pkg | 2025-08-13 12:09 | 75K | |
| html2wml-0.4.11_1.pkg | 2025-12-22 13:57 | 64K | |
| html2xhtml-1.4.pkg | 2025-12-20 23:47 | 54K | |
| htmlc-2.21.0_1.pkg | 2025-08-22 00:07 | 652K | |
| htmlcompressor-1.5.3..> | 2025-12-28 21:33 | 62K | |
| htmlcxx-0.87.pkg | 2025-08-16 16:12 | 81K | |
| htmldoc-1.9.21.pkg | 2025-12-26 20:30 | 2.1M | |
| htmlise-0.2.pkg | 2025-08-20 03:03 | 8.3K | |
| htmlq-0.4.0_36.pkg | 2025-12-29 23:31 | 639K | |
| htmltest-0.17.0_28.pkg | 2025-12-23 14:14 | 2.3M | |
| htmltolatex-1_25.pkg | 2025-12-29 11:35 | 133K | |
| htop-3.4.1.pkg | 2025-12-23 08:10 | 104K | |
| htpdate-2.0.0.pkg | 2025-08-18 11:25 | 17K | |
| htslib-1.22.pkg | 2025-12-18 12:55 | 1.1M | |
| httm-0.48.2_2.pkg | 2025-12-27 20:49 | 1.1M | |
| http-parser-2.9.4.pkg | 2025-08-13 06:57 | 18K | |
| http_get-1.0.2014081..> | 2025-08-17 09:53 | 6.7K | |
| http_load-20160309_1..> | 2025-08-19 04:48 | 15K | |
| http_ping-20160309.pkg | 2025-08-20 06:42 | 8.5K | |
| http_post-1.0.201408..> | 2025-08-18 22:48 | 8.8K | |
| httpasyncclient-4.1...> | 2025-12-27 03:47 | 250K | |
| httpclient-4.5.12.pkg | 2025-12-27 01:45 | 902K | |
| httpcore-4.4.13.pkg | 2025-12-26 18:50 | 638K | |
| httperf-0.9.1_1.pkg | 2025-08-15 02:18 | 63K | |
| httping-4.4.0.pkg | 2025-12-23 18:44 | 67K | |
| httplog-2.1_2.pkg | 2025-08-21 20:47 | 11K | |
| httpry-0.1.8_1.pkg | 2025-08-18 19:41 | 20K | |
| https_dns_proxy-g202..> | 2025-12-20 06:48 | 17K | |
| httptunnel-3.3_4.pkg | 2025-08-21 04:50 | 34K | |
| httpx-1.6.10_2.pkg | 2025-08-16 13:40 | 9.2M | |
| httrack-3.49.5.pkg | 2025-08-16 15:50 | 1.2M | |
| hu-aspell-0.99.4.2.0..> | 2025-12-21 07:45 | 1.7M | |
| hu-freebsd-doc-20251..> | 2025-12-20 03:11 | 7.7M | |
| hu-hunspell-1.6.1.pkg | 2025-08-21 16:45 | 588K | |
| hu-hyphen-2007.05.17..> | 2025-08-20 06:44 | 233K | |
| hu-jdictionary-eng-h..> | 2025-12-29 00:58 | 1.6M | |
| hu-jdictionary-eng-h..> | 2025-12-29 16:27 | 833K | |
| hu-libreoffice-25.8...> | 2025-12-27 14:44 | 3.6M | |
| hu-mythes-2003.09.29..> | 2025-08-16 09:29 | 320K | |
| hub-2.14.2_35.pkg | 2025-12-21 12:39 | 2.5M | |
| huc-3.21.pkg | 2025-08-16 13:44 | 233K | |
| hugin-2025.0.1.pkg | 2025-12-29 21:11 | 12M | |
| hulgalugha-1.0.pkg | 2025-08-17 21:51 | 3.0K | |
| humanzip-0.5_1.pkg | 2025-08-21 10:51 | 54K | |
| hunspell-1.7.2_1.pkg | 2025-12-18 00:01 | 489K | |
| hurl-7.1.0_1.pkg | 2025-12-28 05:02 | 1.9M | |
| husky-1.9.20201211_1..> | 2025-12-23 08:25 | 1.0K | |
| husky-areafix-1.9.20..> | 2025-12-19 01:51 | 46K | |
| husky-fidoconf-1.9.2..> | 2025-12-18 15:59 | 195K | |
| husky-hpt-1.9.202012..> | 2025-12-19 04:21 | 167K | |
| husky-htick-1.9.2020..> | 2025-12-19 14:01 | 66K | |
| husky-huskylib-1.9.2..> | 2025-08-13 10:18 | 80K | |
| husky-smapi-1.9.2020..> | 2025-08-13 14:06 | 55K | |
| husky-sqpack-1.9.202..> | 2025-12-23 03:10 | 10K | |
| hv_kvp_cmd-1.4_1.pkg | 2025-08-17 05:44 | 6.5K | |
| hvif-tools-2.1.0.pkg | 2025-12-22 20:43 | 485K | |
| hvm-g20240821_10.pkg | 2025-12-27 10:41 | 369K | |
| hw-probe-1.6.5.pkg | 2025-12-22 07:17 | 110K | |
| hwdata-0.402,1.pkg | 2025-12-16 01:34 | 1.7M | |
| hwloc-1.11.13_4.pkg | 2025-12-23 19:14 | 2.1M | |
| hwloc2-2.12.1_1.pkg | 2025-12-26 06:39 | 2.8M | |
| hwstat-0.5.1_1.pkg | 2025-08-15 08:37 | 6.3K | |
| hxtools-20231224.pkg | 2025-12-27 22:28 | 127K | |
| hy-aspell-0.10.0.0_1..> | 2025-12-23 15:43 | 855K | |
| hy-libreoffice-25.8...> | 2025-12-27 04:56 | 883K | |
| hybrid-bar-0.4.9_25.pkg | 2025-12-30 05:22 | 611K | |
| hydra-9.6.pkg | 2025-12-23 19:28 | 154K | |
| hydrasdr-1.0.3.pkg | 2025-12-21 13:55 | 50K | |
| hydrogen-1.2.6.pkg | 2025-12-29 23:21 | 9.2M | |
| hydrogen-linear-alge..> | 2025-12-29 11:58 | 3.3M | |
| hydroxide-0.2.30_6.pkg | 2025-12-21 02:50 | 3.2M | |
| hyperestraier-1.4.13..> | 2025-08-14 12:03 | 660K | |
| hyperfine-1.19.0_8.pkg | 2025-12-29 18:11 | 476K | |
| hyperhotp-0.1.pkg | 2025-08-18 20:39 | 8.6K | |
| hypermail-2.4.0_6.pkg | 2025-12-22 15:42 | 202K | |
| hyperrogue-13.1g.pkg | 2025-12-30 02:58 | 71M | |
| hyperscan-5.4.2.pkg | 2025-08-15 20:59 | 3.0M | |
| hyperswitch-2025.05...> | 2025-12-29 21:43 | 60M | |
| hyphen-2.8.8.pkg | 2025-12-18 01:36 | 56K | |
| hyphy-2.5.90.pkg | 2025-12-22 06:58 | 1.4M | |
| hyprcursor-0.1.13.pkg | 2025-12-27 02:57 | 160K | |
| hypre-2.33.0_1.pkg | 2025-12-26 20:05 | 1.9M | |
| hyprgraphics-0.4.0_1..> | 2025-12-26 18:00 | 71K | |
| hypridle-0.1.7_2.pkg | 2025-12-21 11:51 | 97K | |
| hyprland-0.52.2.pkg | 2025-12-28 23:23 | 48M | |
| hyprland-guiutils-0...> | 2025-12-27 05:38 | 126K | |
| hyprland-protocols-0..> | 2025-12-20 01:04 | 9.8K | |
| hyprland-qt-support-..> | 2025-12-27 11:45 | 77K | |
| hyprland-qtutils-0.1..> | 2025-12-28 03:03 | 79K | |
| hyprlang-0.6.7_1.pkg | 2025-12-18 18:47 | 99K | |
| hyprlauncher-0.1.3_3..> | 2025-12-29 01:24 | 106K | |
| hyprlock-0.9.2_3.pkg | 2025-12-30 10:09 | 284K | |
| hyprls-0.11.0_1.pkg | 2025-12-20 05:47 | 2.2M | |
| hyprpaper-0.7.6_3.pkg | 2025-12-29 23:24 | 114K | |
| hyprpicker-0.4.5_4.pkg | 2025-12-30 10:02 | 80K | |
| hyprpolkitagent-0.1...> | 2025-12-30 16:36 | 57K | |
| hyprqt6engine-0.1.0_..> | 2025-12-29 23:42 | 73K | |
| hyprsunset-0.3.3_1.pkg | 2025-12-21 13:53 | 79K | |
| hyprtoolkit-0.4.1.pkg | 2025-12-27 00:44 | 383K | |
| hyprutils-0.11.0.pkg | 2025-12-18 13:08 | 134K | |
| hyprviz-0.7.1_2.pkg | 2025-12-29 11:53 | 1.0M | |
| hyprwayland-scanner-..> | 2025-08-14 06:49 | 89K | |
| hyprwire-0.2.1.pkg | 2025-12-20 00:46 | 137K | |
| i2c-tools-4.3.pkg | 2025-12-23 05:33 | 32K | |
| i2pd-2.58.0_2.pkg | 2025-12-23 15:54 | 3.4M | |
| i3-4.24_2.pkg | 2025-12-27 17:34 | 285K | |
| i3bar-river-1.1.0_10..> | 2025-12-29 18:02 | 517K | |
| i3blocks-1.4.93.pkg | 2025-08-22 13:45 | 22K | |
| i3lock-2.16.pkg | 2025-12-30 11:43 | 27K | |
| i3lock-color-2.13.c...> | 2025-12-28 03:59 | 53K | |
| i3status-2.15_1.pkg | 2025-12-22 02:54 | 40K | |
| i7z-0.27.4_1.pkg | 2025-08-15 22:56 | 19K | |
| i18n-man-1.1_1.pkg | 2025-08-20 02:59 | 17K | |
| i386-binutils-2.44,1..> | 2025-12-19 22:15 | 2.5M | |
| i386-freebsd-sysroot..> | 2025-12-20 02:05 | 44M | |
| i386-gcc12-12.3.0_2.pkg | 2025-12-21 16:48 | 38M | |
| i386-gcc13-13.2.0_2.pkg | 2025-12-21 22:14 | 40M | |
| i386-gcc14-14.1.0.pkg | 2025-12-21 19:03 | 44M | |
| i386-rust-bootstrap-..> | 2025-12-28 16:52 | 88M | |
| ia-aspell-0.50.1_1,1..> | 2025-12-20 08:50 | 594K | |
| iaikPkcs11Wrapper-1...> | 2025-12-28 12:03 | 657K | |
| iaito-qt5-6.0.4.pkg | 2025-12-28 08:04 | 1.3M | |
| iaito-qt6-6.0.4.pkg | 2025-12-30 05:51 | 1.4M | |
| iamb-0.0.10_13.pkg | 2025-12-28 01:41 | 9.2M | |
| iansui-1.020.pkg | 2025-12-28 15:40 | 3.5M | |
| iat-0.1.7_1.pkg | 2025-08-20 04:17 | 19K | |
| ibmfonts-0.2.0.pkg | 2025-12-27 10:56 | 258K | |
| iboview-20150427_28.pkg | 2025-12-30 06:36 | 1.4M | |
| ibp-0.21_3.pkg | 2025-08-17 03:09 | 21K | |
| ibsh-0.3e_1.pkg | 2025-08-16 06:20 | 18K | |
| ibus-1.5.33.pkg | 2025-12-26 15:11 | 9.3M | |
| ibus-kmfl-1.0.3_7.pkg | 2025-12-30 09:17 | 13K | |
| ibus-m17n-1.4.36.pkg | 2025-12-30 07:25 | 164K | |
| ibus-table-1.17.16.pkg | 2025-12-27 15:59 | 1.0M | |
| ibus-typing-booster-..> | 2025-12-28 01:44 | 11M | |
| ibus-uniemoji-0.6.0...> | 2025-12-30 18:18 | 289K | |
| ical-3.0.4_1.pkg | 2025-12-28 22:32 | 178K | |
| ical2html-3.0.pkg | 2025-12-21 23:12 | 14K | |
| icapeg-1.0.0_21.pkg | 2025-12-23 05:08 | 3.7M | |
| icat-0.5_4.pkg | 2025-12-30 04:40 | 6.3K | |
| icbirc-2.1_1.pkg | 2025-08-21 02:26 | 15K | |
| icbm3d-0.4_4.pkg | 2025-08-16 03:13 | 32K | |
| icc-profiles-adobe-c..> | 2025-08-14 22:54 | 5.7M | |
| icc-profiles-basicco..> | 2025-08-14 02:12 | 15M | |
| icc-profiles-openicc..> | 2025-12-19 02:31 | 283K | |
| iccxml-0.9.8_3.pkg | 2025-12-29 18:06 | 177K | |
| icdiff-2.0.7_1.pkg | 2025-12-22 05:41 | 31K | |
| iceauth-1.0.8_3.pkg | 2025-08-13 23:09 | 14K | |
| icebreaker-1.9.8_3.pkg | 2025-12-23 16:44 | 133K | |
| icecast-2.4.4_3,1.pkg | 2025-12-21 05:22 | 1.4M | |
| icedtea-web-1.8.8_31..> | 2025-12-27 22:16 | 2.1M | |
| icegenerator-0.5.5.p..> | 2025-08-18 10:33 | 21K | |
| iceicepenguin-1.5.1_..> | 2025-12-30 14:14 | 17M | |
| iceoryx-2.0.6.pkg | 2025-08-14 20:59 | 659K | |
| ices-2.0.3_3,1.pkg | 2025-12-20 23:20 | 50K | |
| icestorm-1.1.pkg | 2025-12-19 05:31 | 10M | |
| icewm-3.9.0.pkg | 2025-12-29 02:30 | 1.8M | |
| icewm-extra-themes-1..> | 2025-08-17 23:58 | 2.7M | |
| icinga-ipl-i18n-php8..> | 2025-12-29 19:14 | 11K | |
| icinga-ipl-i18n-php8..> | 2025-12-29 16:27 | 11K | |
| icinga-ipl-i18n-php8..> | 2025-12-30 10:09 | 11K | |
| icinga-ipl-i18n-php8..> | 2025-12-28 20:14 | 11K | |
| icinga-ipl-i18n-php8..> | 2025-12-28 14:37 | 11K | |
| icinga-php-library-p..> | 2025-12-26 17:00 | 2.1M | |
| icinga-php-library-p..> | 2025-12-26 17:36 | 2.1M | |
| icinga-php-library-p..> | 2025-12-26 17:13 | 2.1M | |
| icinga-php-library-p..> | 2025-12-26 14:54 | 2.1M | |
| icinga-php-thirdpart..> | 2025-12-26 15:56 | 8.0M | |
| icinga-php-thirdpart..> | 2025-12-26 15:50 | 8.0M | |
| icinga-php-thirdpart..> | 2025-12-26 17:30 | 8.0M | |
| icinga-php-thirdpart..> | 2025-12-26 15:48 | 8.0M | |
| icinga2-2.15.1.pkg | 2025-12-21 17:15 | 13M | |
| icingadb-1.4.0_7.pkg | 2025-12-19 12:01 | 4.1M | |
| icingaweb2-module-bu..> | 2025-12-30 16:26 | 2.0M | |
| icingaweb2-module-bu..> | 2025-12-29 21:22 | 2.0M | |
| icingaweb2-module-bu..> | 2025-12-29 02:33 | 2.0M | |
| icingaweb2-module-bu..> | 2025-12-28 08:57 | 2.0M | |
| icingaweb2-module-cu..> | 2025-12-29 23:59 | 573K | |
| icingaweb2-module-cu..> | 2025-12-30 14:48 | 573K | |
| icingaweb2-module-cu..> | 2025-12-28 02:29 | 573K | |
| icingaweb2-module-cu..> | 2025-12-28 07:41 | 573K | |
| icingaweb2-module-di..> | 2025-12-27 03:50 | 2.9M | |
| icingaweb2-module-di..> | 2025-12-27 09:02 | 2.9M | |
| icingaweb2-module-di..> | 2025-12-27 16:52 | 2.9M | |
| icingaweb2-module-di..> | 2025-12-27 09:09 | 2.9M | |
| icingaweb2-module-el..> | 2025-12-29 03:00 | 297K | |
| icingaweb2-module-el..> | 2025-12-29 08:15 | 297K | |
| icingaweb2-module-el..> | 2025-12-29 09:54 | 297K | |
| icingaweb2-module-el..> | 2025-12-30 11:23 | 297K | |
| icingaweb2-module-fi..> | 2025-12-29 03:49 | 243K | |
| icingaweb2-module-fi..> | 2025-12-29 12:51 | 243K | |
| icingaweb2-module-fi..> | 2025-12-27 21:59 | 243K | |
| icingaweb2-module-fi..> | 2025-12-30 02:21 | 243K | |
| icingaweb2-module-ge..> | 2025-12-28 23:59 | 13K | |
| icingaweb2-module-ge..> | 2025-12-28 12:06 | 13K | |
| icingaweb2-module-ge..> | 2025-12-29 23:17 | 13K | |
| icingaweb2-module-ge..> | 2025-12-30 10:20 | 13K | |
| icingaweb2-module-gr..> | 2025-12-30 10:15 | 1.4M | |
| icingaweb2-module-gr..> | 2025-12-28 04:23 | 1.4M | |
| icingaweb2-module-gr..> | 2025-12-28 08:35 | 1.4M | |
| icingaweb2-module-gr..> | 2025-12-28 14:38 | 1.4M | |
| icingaweb2-module-gr..> | 2025-12-30 13:28 | 302K | |
| icingaweb2-module-gr..> | 2025-12-29 03:53 | 302K | |
| icingaweb2-module-gr..> | 2025-12-29 17:01 | 302K | |
| icingaweb2-module-gr..> | 2025-12-28 16:35 | 302K | |
| icingaweb2-module-ic..> | 2025-12-29 03:03 | 1.9M | |
| icingaweb2-module-ic..> | 2025-12-30 09:40 | 1.9M | |
| icingaweb2-module-ic..> | 2025-12-30 16:35 | 1.9M | |
| icingaweb2-module-ic..> | 2025-12-29 01:31 | 1.9M | |
| icingaweb2-module-id..> | 2025-12-30 12:38 | 104K | |
| icingaweb2-module-id..> | 2025-12-28 08:19 | 104K | |
| icingaweb2-module-id..> | 2025-12-29 03:38 | 104K | |
| icingaweb2-module-id..> | 2025-12-28 16:12 | 104K | |
| icingaweb2-module-in..> | 2025-12-28 21:41 | 167K | |
| icingaweb2-module-in..> | 2025-12-26 16:09 | 167K | |
| icingaweb2-module-in..> | 2025-12-26 15:39 | 167K | |
| icingaweb2-module-in..> | 2025-12-26 15:08 | 167K | |
| icingaweb2-module-in..> | 2025-12-26 16:01 | 167K | |
| icingaweb2-module-ji..> | 2025-12-30 00:25 | 633K | |
| icingaweb2-module-ji..> | 2025-12-28 09:39 | 633K | |
| icingaweb2-module-ji..> | 2025-12-28 03:29 | 633K | |
| icingaweb2-module-ji..> | 2025-12-29 02:33 | 633K | |
| icingaweb2-module-ma..> | 2025-12-29 12:19 | 7.6M | |
| icingaweb2-module-ma..> | 2025-12-28 03:17 | 7.6M | |
| icingaweb2-module-ma..> | 2025-12-28 09:51 | 7.6M | |
| icingaweb2-module-ma..> | 2025-12-30 06:26 | 7.6M | |
| icingaweb2-module-pd..> | 2025-12-26 23:48 | 14M | |
| icingaweb2-module-pd..> | 2025-12-26 21:09 | 14M | |
| icingaweb2-module-pd..> | 2025-12-26 22:23 | 14M | |
| icingaweb2-module-pd..> | 2025-12-26 21:24 | 14M | |
| icingaweb2-module-re..> | 2025-12-26 21:47 | 404K | |
| icingaweb2-module-re..> | 2025-12-26 23:32 | 404K | |
| icingaweb2-module-re..> | 2025-12-27 01:02 | 404K | |
| icingaweb2-module-re..> | 2025-12-26 20:42 | 404K | |
| icingaweb2-module-re..> | 2025-12-27 09:25 | 43K | |
| icingaweb2-module-re..> | 2025-12-27 10:51 | 43K | |
| icingaweb2-module-re..> | 2025-12-27 11:15 | 43K | |
| icingaweb2-module-re..> | 2025-12-27 05:55 | 43K | |
| icingaweb2-module-vs..> | 2025-12-29 07:19 | 320K | |
| icingaweb2-module-vs..> | 2025-12-30 10:40 | 320K | |
| icingaweb2-module-vs..> | 2025-12-29 22:52 | 320K | |
| icingaweb2-module-vs..> | 2025-12-29 08:57 | 320K | |
| icingaweb2-module-vs..> | 2025-12-29 11:31 | 3.4M | |
| icingaweb2-module-vs..> | 2025-12-27 22:37 | 3.4M | |
| icingaweb2-module-vs..> | 2025-12-30 08:12 | 3.4M | |
| icingaweb2-module-vs..> | 2025-12-27 22:50 | 3.4M | |
| icingaweb2-module-x5..> | 2025-12-29 23:03 | 1.3M | |
| icingaweb2-module-x5..> | 2025-12-29 17:42 | 1.3M | |
| icingaweb2-module-x5..> | 2025-12-28 23:36 | 1.3M | |
| icingaweb2-module-x5..> | 2025-12-29 06:55 | 1.3M | |
| icingaweb2-php82-2.1..> | 2025-12-26 19:10 | 5.7M | |
| icingaweb2-php83-2.1..> | 2025-12-26 17:57 | 5.7M | |
| icingaweb2-php84-2.1..> | 2025-12-26 18:37 | 5.7M | |
| icingaweb2-php85-2.1..> | 2025-12-26 19:42 | 5.7M | |
| icmake-9.03.01_1.pkg | 2025-08-15 13:17 | 206K | |
| icmpchat-0.6_1.pkg | 2025-08-18 14:24 | 20K | |
| icmpinfo-1.11_2.pkg | 2025-08-17 10:01 | 9.0K | |
| icmpmonitor-1.2_1.pkg | 2025-08-20 17:12 | 9.7K | |
| icmpquery-1.0.3.pkg | 2025-08-16 17:45 | 5.4K | |
| ico-1.0.6.pkg | 2025-08-18 08:02 | 14K | |
| icon-naming-utils-0...> | 2025-12-18 12:36 | 7.4K | |
| icon-slicer-0.3_11.pkg | 2025-12-29 23:23 | 17K | |
| icons-human-azul-0.1..> | 2025-08-19 07:28 | 278K | |
| icons-tango-0.8.90_4..> | 2025-08-15 01:36 | 1.2M | |
| icons-tango-extras-0..> | 2025-08-21 15:21 | 47K | |
| icontact-1.5_4.pkg | 2025-12-29 07:42 | 23K | |
| icontheme-1.2.3_4.pkg | 2025-08-19 01:00 | 119K | |
| iconv-2.0_7.pkg | 2025-12-18 21:07 | 40K | |
| iconv-extra-2.0_1.pkg | 2025-12-19 12:25 | 9.1K | |
| iconv-rfc1345-2.0_1.pkg | 2025-12-23 17:22 | 4.9K | |
| icoutils-0.32.3.pkg | 2025-12-26 21:15 | 46K | |
| icpld-1.1.5_3.pkg | 2025-08-21 12:22 | 64K | |
| icqlib-1.0.0_3.pkg | 2025-08-17 01:22 | 65K | |
| ictree-1.0.1.pkg | 2025-12-23 10:19 | 26K | |
| icu-76.1,1.pkg | 2025-08-10 21:31 | 13M | |
| icu-le-hb-2.0.0.pkg | 2025-12-27 13:44 | 36K | |
| icu-lx-76.1.pkg | 2025-12-30 00:43 | 39K | |
| id-aspell-1.2.0_1,2.pkg | 2025-12-22 12:24 | 227K | |
| id-freebsd-doc-20251..> | 2025-12-19 06:54 | 56K | |
| id-hyphen-2004.08.12..> | 2025-08-18 00:06 | 24K | |
| id-libreoffice-25.8...> | 2025-12-27 16:05 | 3.3M | |
| id3edit-2.2.1.pkg | 2025-08-28 23:29 | 18K | |
| id3el-0.05_1.pkg | 2025-12-28 01:50 | 6.6K | |
| id3lib-3.8.3.2024011..> | 2025-08-25 21:02 | 120K | |
| id3mtag-0.81_1.pkg | 2025-08-13 23:43 | 81K | |
| id3v2-0.1.12.pkg | 2025-08-26 10:16 | 21K | |
| ida-2.14_4.pkg | 2025-12-28 04:24 | 126K | |
| idea-1.2_2.pkg | 2025-08-20 22:07 | 26K | |
| ideep-2.0.0.119.pkg | 2025-08-21 06:38 | 50K | |
| identify-0.7.pkg | 2025-08-22 21:08 | 5.0K | |
| identme-0.6.0.pkg | 2025-12-20 07:14 | 39K | |
| idesk-0.7.9.pkg | 2025-12-28 13:16 | 68K | |
| idnits-2.17.1.pkg | 2025-12-22 06:36 | 34K | |
| idnkit-1.0_8.pkg | 2025-08-19 13:32 | 222K | |
| idnkit2-2.3_3.pkg | 2025-08-21 23:43 | 257K | |
| idutils-4.6_6.pkg | 2025-12-20 22:18 | 232K | |
| ie-hunspell-1.0.pkg | 2025-08-17 11:26 | 82K | |
| iec16022-0.3.1_1.pkg | 2025-12-22 03:03 | 30K | |
| ifdepd-20110412_2.pkg | 2025-08-16 13:35 | 8.1K | |
| iffinder-1.38.pkg | 2025-08-17 00:39 | 16K | |
| ifile-1.3.8_1.pkg | 2025-08-18 06:38 | 60K | |
| ifmail-2.15_11.pkg | 2025-08-16 22:59 | 316K | |
| ifstat-1.1_6.pkg | 2025-08-20 05:53 | 13K | |
| ifstated-5.1_4,3.pkg | 2025-08-18 03:57 | 22K | |
| iftop-1.0.p4_1.pkg | 2025-08-21 09:00 | 33K | |
| igal2-3.2_1.pkg | 2025-12-29 07:10 | 29K | |
| igmpproxy-0.4_3,1.pkg | 2025-12-28 08:17 | 24K | |
| ignition-cmake-2.0.0..> | 2025-12-18 18:47 | 162K | |
| ignition-math-6.0.0_..> | 2025-08-14 08:25 | 144K | |
| ignition-msgs-3.0.0_..> | 2025-12-22 15:02 | 491K | |
| ignition-plugin-1.0...> | 2025-08-16 13:27 | 65K | |
| ignition-tools-0.1.0..> | 2025-12-19 13:18 | 3.9K | |
| igor-1.595_1.pkg | 2025-12-18 12:09 | 31K | |
| igraph-1.0.0.pkg | 2025-12-27 06:23 | 1.4M | |
| igt-gpu-tools-1.26.1..> | 2025-12-30 08:03 | 2.1M | |
| ii-2.0_1.pkg | 2025-08-19 04:59 | 12K | |
| iio-oscilloscope-0.1..> | 2025-12-29 04:17 | 29M | |
| iipsrv-1.2_2.pkg | 2025-12-27 22:08 | 152K | |
| iir1-1.10.0.pkg | 2025-08-14 09:52 | 45K | |
| iiview-0.32.pkg | 2025-12-28 01:42 | 20K | |
| ikiwiki-3.20250501_1..> | 2025-12-28 06:37 | 885K | |
| ikos-3.5_3.pkg | 2025-12-28 10:18 | 9.7M | |
| iksemel-1.5.pkg | 2025-12-19 02:30 | 67K | |
| ilbc-r3951_1.pkg | 2025-08-15 14:08 | 61K | |
| im-153.pkg | 2025-12-21 07:49 | 143K | |
| imageindex-2.0_7.pkg | 2025-12-29 14:31 | 40K | |
| imageviewer-0.6.3_13..> | 2025-12-27 13:15 | 51K | |
| imageworsener-1.3.5_..> | 2025-12-28 12:35 | 104K | |
| imaginary-20250114_7..> | 2025-12-28 12:50 | 2.5M | |
| imake-1.0.10_1,1.pkg | 2025-12-18 06:26 | 27K | |
| imap-tools-1.7.3_2.pkg | 2025-12-30 14:02 | 1.5M | |
| imapdedup-0.0.201503..> | 2025-12-23 05:04 | 7.4K | |
| imapfilter-2.8.3.pkg | 2025-12-23 00:03 | 56K | |
| imapproxy-1.0_1.pkg | 2025-08-21 15:32 | 24K | |
| imapsync-2.314.pkg | 2025-12-22 09:30 | 149K | |
| imaptools-1.135_1.pkg | 2025-12-20 23:25 | 51K | |
| imaputils-1.0.5.pkg | 2025-12-22 13:35 | 48K | |
| imc-4.3_9.pkg | 2025-12-27 21:12 | 63K | |
| imds-filterd-0.1.pkg | 2025-08-16 01:49 | 35K | |
| imerge-0.2.4_1.pkg | 2025-08-19 04:49 | 4.0K | |
| img2xterm-1.0.0_5.pkg | 2025-12-29 10:07 | 8.5K | |
| imgui-1.92.5.pkg | 2025-12-27 10:44 | 803K | |
| imgurbash2-3.3.pkg | 2025-12-20 23:43 | 9.3K | |
| imhex-1.38.1.pkg | 2025-12-30 17:06 | 12M | |
| iml-1.0.5_5.pkg | 2025-12-27 05:26 | 95K | |
| imlib2-1.12.5_1,2.pkg | 2025-12-26 17:27 | 578K | |
| imlib2-jxl-0.2.0_4.pkg | 2025-12-29 17:12 | 7.6K | |
| imlib2-webp-20230222..> | 2025-12-30 01:42 | 3.5K | |
| imlib2_loaders-1.12...> | 2025-08-16 05:00 | 12K | |
| immer-0.9.0.pkg | 2025-12-26 18:31 | 90K | |
| immortal-0.24.4_29.pkg | 2025-12-20 11:18 | 3.5M | |
| immudb15-1.5.0_21.pkg | 2025-12-23 05:03 | 22M | |
| imposm3-0.11.1_22.pkg | 2025-12-24 05:56 | 3.2M | |
| impossible_mission_p..> | 2025-12-22 10:38 | 132K | |
| impressive-0.13.2_5.pkg | 2025-12-28 19:03 | 185K | |
| imtui-1.0.5.30.pkg | 2025-08-18 06:08 | 505K | |
| imv-4.5.0_1.pkg | 2025-12-30 05:17 | 69K | |
| imwheel-1.0.0.p12_4.pkg | 2025-12-22 12:23 | 51K | |
| inadyn-2.13.0.pkg | 2025-12-23 12:03 | 83K | |
| inastemp-0.2.4.pkg | 2025-08-20 01:32 | 26K | |
| incidenceeditor-25.1..> | 2025-12-26 18:36 | 601K | |
| include-what-you-use..> | 2025-12-29 11:25 | 635K | |
| inconsolata-ttf-3.00..> | 2025-12-26 21:19 | 76K | |
| incron-2017.11.13_3.pkg | 2025-08-20 02:58 | 79K | |
| indexinfo-0.3.1_1.pkg | 2025-08-10 21:06 | 4.7K | |
| indi-2.1.7.pkg | 2025-12-27 04:11 | 5.5M | |
| indicators-2.3.pkg | 2025-08-21 06:59 | 20K | |
| indiwebmanagerapp-1...> | 2025-12-29 05:13 | 70K | |
| infamous-plugins-lv2..> | 2025-12-30 18:18 | 611K | |
| infernal-1.1.5.pkg | 2025-08-15 06:41 | 3.7M | |
| inferno-0.12.4_1.pkg | 2025-12-30 10:43 | 1.0M | |
| influxdb-1.8.10_36.pkg | 2025-12-20 11:21 | 20M | |
| influxdb2-cli-2.7.5_..> | 2025-12-23 15:05 | 5.2M | |
| influxpkg-config-0.2..> | 2025-12-23 00:05 | 1.6M | |
| info2html-2.0.pkg | 2025-08-19 11:28 | 11K | |
| info2man-20040717_1.pkg | 2025-12-22 10:29 | 22K | |
| info_to_html-0.9.6_1..> | 2025-12-23 05:01 | 5.9K | |
| inform7-6L38_1.pkg | 2025-08-21 22:31 | 2.9M | |
| infracost-0.10.42.pkg | 2025-12-20 19:19 | 21M | |
| ini_file_manager-11.pkg | 2025-08-14 15:40 | 58K | |
| inifiled-2.0.0_4.pkg | 2025-08-19 17:10 | 6.6K | |
| inih-62.pkg | 2025-12-18 04:03 | 16K | |
| inilike-1.2.1_4.pkg | 2025-08-14 18:34 | 104K | |
| iniparser-4.2.6.pkg | 2025-08-15 20:41 | 134K | |
| initool-1.0.0.pkg | 2025-08-17 08:16 | 78K | |
| initutil-2.1.b.pkg | 2025-08-21 05:13 | 5.7K | |
| inja-3.5.0.pkg | 2025-12-19 14:34 | 20K | |
| injeqt-1.2.0_5.pkg | 2025-12-23 07:45 | 75K | |
| inko-0.18.1_8.pkg | 2025-12-29 23:25 | 20M | |
| inkscape-1.4.2_4.pkg | 2025-12-27 19:09 | 25M | |
| inkscape-open-symbol..> | 2025-12-29 12:02 | 1.9M | |
| inn-2.7.3.pkg | 2025-12-27 09:44 | 1.6M | |
| inn-current-20251027..> | 2025-12-27 04:32 | 1.6M | |
| innerspace-0.2.0_12.pkg | 2025-12-27 14:42 | 35K | |
| innoextract-1.9.82.pkg | 2025-12-21 01:31 | 262K | |
| innotop-1.15.2.pkg | 2025-12-21 01:59 | 132K | |
| inotify-tools-4.25.9..> | 2025-12-19 16:58 | 52K | |
| inplace-1.2.3_2.pkg | 2025-12-20 13:56 | 8.3K | |
| inputplug-0.4.0_39.pkg | 2025-12-29 11:28 | 358K | |
| inscore-1.34.pkg | 2025-12-30 12:37 | 127M | |
| inspectrum-0.2.3.pkg | 2025-12-29 10:25 | 63K | |
| inspircd-4.9.0.pkg | 2025-12-23 16:25 | 1.8M | |
| installwatch-0.6.3_3..> | 2025-08-16 15:56 | 9.3K | |
| instant-meshes-0.0.4..> | 2025-12-29 22:56 | 1.1M | |
| instead-3.5.2_2.pkg | 2025-12-27 16:58 | 3.7M | |
| intel-em-kmod-7.7.8...> | 2025-08-22 03:05 | 93K | |
| intel-epct-1.39.56.9..> | 2025-08-19 00:46 | 1.3M | |
| intel-ice-kmod-1.38...> | 2025-08-15 12:45 | 161K | |
| intel-igb-kmod-2.5.2..> | 2025-08-19 09:52 | 61K | |
| intel-ipsec-mb-2.0.pkg | 2025-08-15 09:58 | 740K | |
| intel-ix-kmod-3.3.35..> | 2025-08-18 21:53 | 87K | |
| intel-ixl-kmod-1.13...> | 2025-08-18 21:07 | 105K | |
| intel-ixv-kmod-1.5.3..> | 2025-08-22 04:28 | 3.6K | |
| intel-media-sdk-22.5..> | 2025-12-19 09:46 | 4.8M | |
| intel-nvmupdate-10g-..> | 2025-08-18 08:09 | 2.2M | |
| intel-nvmupdate-40g-..> | 2025-08-21 07:30 | 34M | |
| intel-nvmupdate-100g..> | 2025-08-17 12:47 | 32M | |
| intel-one-mono-1.4.0..> | 2025-12-30 02:37 | 546K | |
| intel-pcm-202405_4.pkg | 2025-12-27 09:07 | 1.8M | |
| intel-snap-0.0.1_34.pkg | 2025-12-20 23:02 | 6.5M | |
| intel-undervolt-1.7.pkg | 2025-08-22 03:30 | 19K | |
| intellij-2020.2.3_3.pkg | 2025-12-29 12:31 | 454M | |
| intellij-fsnotifier-..> | 2025-08-15 07:51 | 278K | |
| intellij-pty4j-0.12...> | 2025-08-16 16:22 | 5.1K | |
| intellij-ultimate-20..> | 2025-12-29 09:58 | 843M | |
| interGif-6.15.pkg | 2025-08-22 07:11 | 39K | |
| interactive_rebase_t..> | 2025-12-27 22:39 | 748K | |
| interactsh-1.2.4_4.pkg | 2025-12-23 02:44 | 15M | |
| interbench-0.31_2.pkg | 2025-08-18 13:00 | 25K | |
| intercal-0.33.pkg | 2025-08-19 14:27 | 253K | |
| interlogic-0.30_11.pkg | 2025-12-29 23:25 | 1.5M | |
| intermodal-0.1.14_11..> | 2025-12-30 11:27 | 1.3M | |
| intersect-lv2-1.3.pkg | 2025-08-16 04:38 | 5.2K | |
| intervaltree-0.1.2.pkg | 2025-08-14 09:05 | 154K | |
| intlfonts-1.4.2.pkg | 2025-12-30 11:17 | 9.0M | |
| intltool-0.51.0_2.pkg | 2025-12-16 01:30 | 37K | |
| intx-0.14.0.pkg | 2025-12-21 06:38 | 14K | |
| invada-studio-plugin..> | 2025-12-30 01:18 | 251K | |
| inxi-3.3.11.1_1.pkg | 2025-12-27 02:51 | 399K | |
| io-2017.09.06_11.pkg | 2025-08-21 18:55 | 3.5M | |
| io-devel-20240207_2.pkg | 2025-08-18 17:48 | 444K | |
| io_lib-1.14.10_1.pkg | 2025-12-19 01:01 | 571K | |
| iocell-2.2.0_1.pkg | 2025-12-24 04:17 | 66K | |
| iodine-0.8.0_1.pkg | 2025-08-20 18:35 | 64K | |
| iograph-0.9.1_1.pkg | 2025-08-16 20:56 | 11K | |
| iohyve-0.7.9_1.pkg | 2025-08-18 19:23 | 20K | |
| ion-shell-1.0.5.1509..> | 2025-12-29 15:06 | 1.1M | |
| ioncube-php81-14.4.1..> | 2025-12-29 15:02 | 749K | |
| ioncube-php82-14.4.1..> | 2025-12-30 17:18 | 758K | |
| ioncube-php83-14.4.1..> | 2025-12-28 09:59 | 767K | |
| ioncube-php84-14.4.1..> | 2025-12-28 06:52 | 795K | |
| ioping-1.3.pkg | 2025-08-18 16:22 | 16K | |
| ioquake3-1.36_17.pkg | 2025-12-22 12:30 | 1.4M | |
| ioquake3-server-1.36..> | 2025-08-15 10:04 | 941K | |
| ior-4.0.0.pkg | 2025-12-30 09:06 | 113K | |
| iorate-3.05_1.pkg | 2025-08-22 19:45 | 62K | |
| iortcw-1.51c_4,1.pkg | 2025-12-28 05:08 | 2.2M | |
| iosevka-33.1.0.pkg | 2025-12-30 05:22 | 616M | |
| iosevka-comfy-2.1.0.pkg | 2025-12-30 10:00 | 406M | |
| iowow-1.4.18.pkg | 2025-12-18 19:06 | 268K | |
| iozone-3.508.pkg | 2025-12-24 05:36 | 115K | |
| ip2location-8.7.0.pkg | 2025-12-27 14:12 | 1.1M | |
| ip2proxy-20251118.pkg | 2025-12-27 11:25 | 27K | |
| ip4r-2.4.2.pkg | 2025-12-23 19:11 | 68K | |
| ip6_int-1.0.pkg | 2025-12-23 16:27 | 2.1K | |
| ipa-2.1.2_2.pkg | 2025-08-15 09:05 | 236K | |
| ipa_conv-1.1_3.pkg | 2025-08-18 06:13 | 19K | |
| ipa_sdb-1.1.1_4.pkg | 2025-08-22 15:36 | 54K | |
| ipacctd-1.47_2.pkg | 2025-08-19 20:57 | 17K | |
| ipad_charge-2.0.1.pkg | 2025-08-18 14:20 | 1.7K | |
| ipaudit-1.1_1.pkg | 2025-08-20 04:15 | 60K | |
| ipbt-r8765_1.pkg | 2025-12-20 07:01 | 85K | |
| ipc-bench-1.0.pkg | 2025-08-18 05:08 | 33K | |
| ipcad-3.7.3_4.pkg | 2025-08-18 16:07 | 52K | |
| ipcalc-0.51.pkg | 2025-12-19 14:59 | 9.7K | |
| ipcheck-0.240_1,1.pkg | 2025-12-22 14:33 | 30K | |
| ipdbtools-1.1.2_4.pkg | 2025-08-16 02:54 | 22K | |
| ipdecap-0.7.2_2.pkg | 2025-08-18 19:21 | 11K | |
| ipe-7.2.27.pkg | 2025-12-30 16:50 | 689K | |
| iperf-2.2.1.pkg | 2025-08-18 22:06 | 133K | |
| iperf3-3.20_1.pkg | 2025-12-19 11:59 | 119K | |
| ipfixcol2-2.8.0.pkg | 2025-12-24 05:13 | 372K | |
| ipfmeta-1.3_2.pkg | 2025-12-21 21:42 | 7.0K | |
| ipfs-go-fs-repo-migr..> | 2025-12-20 17:06 | 14M | |
| ipgen-1.30.20240527_..> | 2025-12-23 15:28 | 129K | |
| ipget-0.12.1_1.pkg | 2025-12-21 04:51 | 21M | |
| ipgrab-0.9.10_2.pkg | 2025-08-20 07:44 | 88K | |
| ipguard-1.04_5.pkg | 2025-08-20 03:22 | 29K | |
| ipinfo-3.3.1_17.pkg | 2025-12-24 05:34 | 3.2M | |
| iplike-2.2.0.pkg | 2025-12-23 04:58 | 8.1K | |
| ipmi_exporter-1.10.1..> | 2025-12-23 19:30 | 3.9M | |
| ipmitool-1.8.19_3.pkg | 2025-12-19 08:42 | 2.0M | |
| ipp-usb-0.9.24_11.pkg | 2025-12-20 05:51 | 2.3M | |
| iprange-1.0.4_2.pkg | 2025-08-16 10:22 | 23K | |
| ipsc-0.4.4.pkg | 2025-12-23 01:22 | 8.5K | |
| ipsec-tools-0.8.2_13..> | 2025-08-16 10:38 | 361K | |
| ipsumdump-1.86_2.pkg | 2025-08-14 17:41 | 671K | |
| ipv6calc-4.4.0.pkg | 2025-12-21 10:31 | 1.8M | |
| ipv6gen-1.0_1.pkg | 2025-12-21 01:07 | 6.3K | |
| ipv6mon-1.0_6.pkg | 2025-12-30 04:55 | 181K | |
| ipv6toolkit-2.0_1.pkg | 2025-08-17 15:50 | 422K | |
| ipxe-g20250401,1.pkg | 2025-08-20 11:34 | 2.8M | |
| iqpuzzle-1.4.2.pkg | 2025-12-30 14:46 | 687K | |
| iqtree-3.0.1.pkg | 2025-12-22 19:27 | 3.7M | |
| ir-lv2-1.3.4_4.pkg | 2025-12-28 10:05 | 34K | |
| irc-2.11.2p3_2.pkg | 2025-08-17 17:03 | 179K | |
| irc2dc-0.1.pkg | 2025-08-19 13:17 | 35K | |
| ircd-hybrid-8.2.47.pkg | 2025-12-22 15:16 | 286K | |
| ircd-ratbox-3.0.10_8..> | 2025-12-22 10:45 | 456K | |
| ircii-20240111.pkg | 2025-08-22 00:12 | 375K | |
| ircproxy-1.3.8_2.pkg | 2025-12-21 17:10 | 86K | |
| iridium-browser-2025..> | 2025-12-28 23:58 | 114M | |
| iroffer-dinoex-3.33_..> | 2025-12-21 21:52 | 437K | |
| ironscanner-1.1.0.20..> | 2025-12-29 05:10 | 446K | |
| irrlamb-1.0.6_2.pkg | 2025-12-30 14:18 | 14M | |
| irrlicht-1.8.5_1.pkg | 2025-12-27 01:25 | 7.7M | |
| irrtoolset-5.1.3_2.pkg | 2025-08-17 21:46 | 404K | |
| irsim-lite-9.7.121.pkg | 2025-12-29 22:48 | 166K | |
| irsim-scheme-9.7.121..> | 2025-12-29 01:23 | 166K | |
| irsim-tcl-9.7.121.pkg | 2025-12-30 09:40 | 221K | |
| irssi-1.4.5_1,2.pkg | 2025-12-19 22:32 | 712K | |
| irssi-fish-1.6.20200..> | 2025-12-22 07:41 | 22K | |
| irssi-icb-0.17_3.pkg | 2025-12-20 08:47 | 14K | |
| irssi-scripts-202310..> | 2025-12-24 07:37 | 647K | |
| irssi-themes-2016082..> | 2025-12-20 14:56 | 98K | |
| irssi-xmpp-0.54_1.pkg | 2025-12-21 07:47 | 62K | |
| irssistats-0.75_1.pkg | 2025-08-18 15:06 | 51K | |
| irstlm-5.80.03_4.pkg | 2025-12-22 09:00 | 387K | |
| is-aspell-0.51.1.0_1..> | 2025-12-24 07:30 | 1.5M | |
| is-hyphen-2004.04.15..> | 2025-08-16 23:21 | 12K | |
| is-libreoffice-25.8...> | 2025-12-27 18:04 | 3.1M | |
| isa-l-2.31.1.pkg | 2025-08-14 06:23 | 187K | |
| isa-l_crypto-2.25.0.pkg | 2025-08-19 22:17 | 382K | |
| isaac-4.2_17.pkg | 2025-12-27 21:12 | 3.8M | |
| isabella-ttf-1.202_3..> | 2025-12-30 14:28 | 55K | |
| isal-kmod-g20220517...> | 2025-08-19 00:14 | 72K | |
| isbg-2.2.1_1.pkg | 2025-12-23 04:03 | 56K | |
| isboot-kmod-0.2.15.1..> | 2025-08-19 04:34 | 25K | |
| isboot-kmod-devel-0...> | 2025-12-21 11:31 | 28K | |
| isc-cron-4.1_3.pkg | 2025-08-20 05:13 | 34K | |
| isc-dhcp44-client-4...> | 2025-12-20 01:55 | 1.1M | |
| isc-dhcp44-relay-4.4..> | 2025-08-22 17:32 | 1.0M | |
| isc-dhcp44-server-4...> | 2025-08-18 21:56 | 1.6M | |
| ised-2.7.1_10.pkg | 2025-12-23 00:47 | 72K | |
| iselect-1.4.0_3.pkg | 2025-08-17 05:28 | 28K | |
| isfreedesktop-0.1.1_..> | 2025-08-14 03:00 | 1.5K | |
| ish-2.01a5.pkg | 2025-08-19 07:21 | 22K | |
| ishido-1.1_3.pkg | 2025-08-20 14:43 | 13K | |
| isic-0.07_6.pkg | 2025-08-21 01:46 | 29K | |
| isl-0.27.pkg | 2025-08-11 00:11 | 1.4M | |
| ismtp-g20190921.pkg | 2025-12-24 07:23 | 5.8K | |
| isnprober-1.02.pkg | 2025-12-20 05:42 | 10K | |
| iso-codes-4.19.0.pkg | 2025-12-24 20:09 | 3.8M | |
| iso-schematron-xslt-..> | 2025-08-17 16:14 | 45K | |
| iso2mkv-2011.05.02_4..> | 2025-12-29 18:12 | 9.2K | |
| iso8879-1986_3.pkg | 2025-08-10 21:07 | 14K | |
| iso12083-1993_2.pkg | 2025-08-14 18:15 | 12K | |
| isomaster-1.3.17_2.pkg | 2025-12-28 14:30 | 155K | |
| isoqlog-2.2.1_1.pkg | 2025-08-20 18:36 | 43K | |
| ispc-1.28.2.pkg | 2025-12-26 20:36 | 13M | |
| istgt-20150713_1.pkg | 2025-08-17 22:25 | 156K | |
| istio-1.7.4_34.pkg | 2025-12-29 04:04 | 16M | |
| isync-1.5.1.pkg | 2025-08-18 08:33 | 105K | |
| it-aspell-2.4.200709..> | 2025-12-22 12:30 | 722K | |
| it-freebsd-doc-20251..> | 2025-12-19 11:48 | 1.8M | |
| it-hunspell-2016.02...> | 2025-08-19 10:14 | 304K | |
| it-hyphen-2016.02.10..> | 2025-08-17 04:17 | 1.6K | |
| it-libreoffice-25.8...> | 2025-12-27 06:00 | 3.4M | |
| it-mythes-02.09.l_1.pkg | 2025-08-18 08:32 | 676K | |
| itcl-3.4.4_2,1.pkg | 2025-08-25 14:03 | 114K | |
| itcl4-4.3.4.pkg | 2025-08-29 04:43 | 200K | |
| itinerary-25.12.0.pkg | 2025-12-28 04:36 | 2.1M | |
| itk-3.4.2_3.pkg | 2025-12-27 01:13 | 50K | |
| itop-2.6.1.pkg | 2025-12-28 17:34 | 7.9M | |
| itstool-2.0.7_4.pkg | 2025-12-18 01:42 | 18K | |
| ittapi-3.26.1.pkg | 2025-08-16 15:12 | 58K | |
| ittywm-g20180507.pkg | 2025-08-16 23:01 | 4.1K | |
| ivan-0.59_1.pkg | 2025-12-30 02:21 | 25M | |
| iverilog-12.0_2.pkg | 2025-12-19 21:22 | 1.9M | |
| ivykis-0.43.2_1.pkg | 2025-08-14 22:33 | 67K | |
| iw-aspell-1.0.0_1,2.pkg | 2025-12-23 15:13 | 2.2M | |
| iw-culmus-0.133.pkg | 2025-12-28 15:35 | 855K | |
| iw-elmar-fonts-3.3_6..> | 2025-12-30 14:48 | 439K | |
| iw-hspell-1.4_1.pkg | 2025-08-17 16:41 | 205K | |
| iw-hunspell-1.4.pkg | 2025-08-19 13:10 | 805K | |
| iwidgets-4.1.1.pkg | 2025-12-27 14:40 | 571K | |
| iwmbt-firmware-20250..> | 2025-08-18 03:14 | 4.7M | |
| iwnet-1.1.0.pkg | 2025-12-19 10:52 | 783K | |
| j4-dmenu-desktop-2.1..> | 2025-08-21 22:25 | 42K | |
| ja-ASCIIdates98-fpw-..> | 2025-08-16 00:13 | 25K | |
| ja-CGdic-fpw-1.0_1.pkg | 2025-08-16 10:56 | 43K | |
| ja-FreeWnn-lib-1.1.1..> | 2025-08-14 00:04 | 365K | |
| ja-FreeWnn-server-1...> | 2025-08-17 12:30 | 1.0M | |
| ja-R-cran-zipangu-0...> | 2025-12-28 01:48 | 249K | |
| ja-Wnn6-lib-2000.9.1..> | 2025-08-21 06:08 | 230K | |
| ja-Wnn7-lib-2001.10...> | 2025-08-15 01:51 | 236K | |
| ja-a2ps-1.45_5.pkg | 2025-12-20 15:06 | 10K | |
| ja-ack-1.39_2.pkg | 2025-08-20 08:13 | 9.8K | |
| ja-ajaxzip2-core-200..> | 2025-08-15 05:14 | 6.3K | |
| ja-ajaxzip2-data-202..> | 2025-08-18 01:07 | 1.1M | |
| ja-alias-fonts-1.0_1..> | 2025-12-27 20:27 | 2.1K | |
| ja-another-htmllint-..> | 2025-12-21 06:16 | 264K | |
| ja-anthy-unicode-1.0..> | 2025-08-13 23:24 | 5.7M | |
| ja-aobook-2.0.4.pkg | 2025-12-30 05:53 | 231K | |
| ja-bible_names-fpw-1..> | 2025-08-20 09:02 | 86K | |
| ja-boiled-mozc-0.7_2..> | 2025-12-29 08:52 | 6.0K | |
| ja-boiled-mozc-emacs..> | 2025-12-28 10:14 | 6.0K | |
| ja-boiled-mozc-emacs..> | 2025-12-30 03:58 | 6.0K | |
| ja-boiled-mozc-emacs..> | 2025-12-23 01:27 | 6.0K | |
| ja-boiled-mozc-emacs..> | 2025-12-20 15:34 | 6.0K | |
| ja-boiled-mozc-emacs..> | 2025-12-29 08:47 | 6.0K | |
| ja-bookview-3.2.1_1.pkg | 2025-12-28 19:01 | 216K | |
| ja-bugzilla50-5.0.2.pkg | 2025-12-30 09:38 | 218K | |
| ja-canna-lib-3.7p3_9..> | 2025-08-13 10:13 | 514K | |
| ja-canna-server-3.7p..> | 2025-08-14 18:32 | 962K | |
| ja-cannadic-0.95c_4.pkg | 2025-08-19 23:42 | 1.5M | |
| ja-cdrom2-1996.06.16..> | 2025-08-20 23:25 | 41K | |
| ja-celrw-0.16.pkg | 2025-08-17 21:41 | 27K | |
| ja-chasen-base-2.4.5..> | 2025-08-15 16:27 | 510K | |
| ja-cmigemo-20141220.pkg | 2025-12-19 11:22 | 35K | |
| ja-cmigemo-dict-2014..> | 2025-12-18 19:35 | 3.8M | |
| ja-cp5022x-el-0.0.20..> | 2025-12-29 17:01 | 4.4K | |
| ja-cp5022x-el-emacs_..> | 2025-12-30 05:58 | 4.4K | |
| ja-cp5022x-el-emacs_..> | 2025-12-29 12:03 | 4.4K | |
| ja-cp5022x-el-emacs_..> | 2025-12-21 20:27 | 4.4K | |
| ja-cp5022x-el-emacs_..> | 2025-12-21 03:11 | 4.4K | |
| ja-cp5022x-el-emacs_..> | 2025-12-29 05:27 | 4.4K | |
| ja-cskk-3.2.0_6.pkg | 2025-12-27 17:03 | 1.3M | |
| ja-csrd-1.0_1.pkg | 2025-08-18 23:16 | 45K | |
| ja-ctags-5.8j2_1.pkg | 2025-08-17 04:30 | 128K | |
| ja-dams-4.3.4.pkg | 2025-08-19 18:09 | 112M | |
| ja-dbskkd-cdb-3.00.pkg | 2025-08-19 04:45 | 11K | |
| ja-ddskk-17.1.202307..> | 2025-12-28 06:31 | 564K | |
| ja-ddskk-emacs_canna..> | 2025-12-29 05:10 | 564K | |
| ja-ddskk-emacs_devel..> | 2025-12-28 10:03 | 564K | |
| ja-ddskk-emacs_devel..> | 2025-12-22 18:39 | 564K | |
| ja-ddskk-emacs_nox-1..> | 2025-12-21 06:18 | 564K | |
| ja-ddskk-emacs_wayla..> | 2025-12-28 04:43 | 564K | |
| ja-devil-fpw-1.0.3.pkg | 2025-08-22 00:31 | 175K | |
| ja-dvi2tty-ascii-5.0..> | 2025-08-17 23:24 | 16K | |
| ja-e2ps-4.34.pkg | 2025-08-22 00:24 | 29K | |
| ja-eb-4.4.3_5.pkg | 2025-12-20 01:58 | 297K | |
| ja-ebd-fpw-1.0_1.pkg | 2025-08-20 03:43 | 891K | |
| ja-eblook-1.6.1_10.pkg | 2025-12-24 07:30 | 53K | |
| ja-ebnetd-1.0_12.pkg | 2025-12-21 13:56 | 106K | |
| ja-ebview-gtk2-0.3.6..> | 2025-12-28 08:31 | 167K | |
| ja-edict-19990714_7.pkg | 2025-08-14 19:07 | 30M | |
| ja-edict-fpw-1.2.2.pkg | 2025-08-16 20:52 | 8.3M | |
| ja-edyvalue-2007.01...> | 2025-08-19 17:53 | 3.5K | |
| ja-epwutil-1.1_2.pkg | 2025-08-16 08:08 | 49K | |
| ja-eterm-0.9.6_10.pkg | 2025-12-29 00:35 | 518K | |
| ja-fcitx-anthy-0.2.4..> | 2025-12-21 11:28 | 133K | |
| ja-fcitx-mozc-2.23.2..> | 2025-12-29 18:12 | 225K | |
| ja-fcitx-skk-0.1.4_3..> | 2025-12-30 16:41 | 46K | |
| ja-fcitx5-anthy-5.1...> | 2025-12-30 06:42 | 185K | |
| ja-fcitx5-cskk-1.2.0..> | 2025-12-27 22:34 | 197K | |
| ja-fcitx5-skk-5.1.8.pkg | 2025-12-30 05:30 | 87K | |
| ja-flower-fpw-1.0_1.pkg | 2025-08-20 00:30 | 58K | |
| ja-foldoc-fpw-1.0.2.pkg | 2025-08-17 01:11 | 1.9M | |
| ja-font-aozoramincho..> | 2025-12-28 12:18 | 28M | |
| ja-font-ayu18-1.3.1...> | 2025-12-30 00:47 | 1.0M | |
| ja-font-ayu20-1.7.a_..> | 2025-12-28 03:05 | 554K | |
| ja-font-bizin-gothic..> | 2025-12-30 08:01 | 3.9M | |
| ja-font-bizud-gothic..> | 2025-12-29 11:34 | 9.2M | |
| ja-font-bizud-mincho..> | 2025-12-28 10:40 | 14M | |
| ja-font-cica-5.0.3.pkg | 2025-12-29 00:23 | 20M | |
| ja-font-elisa8-1.0_4..> | 2025-12-27 10:12 | 95K | |
| ja-font-elisa10-1.0_..> | 2025-12-30 14:06 | 86K | |
| ja-font-firge-0.3.0.pkg | 2025-12-28 23:54 | 19M | |
| ja-font-firge-nerd-0..> | 2025-12-29 05:04 | 12M | |
| ja-font-genjyuugothi..> | 2025-12-29 13:13 | 83M | |
| ja-font-genshingothi..> | 2025-12-30 09:22 | 47M | |
| ja-font-hackgen-2.10..> | 2025-12-28 14:51 | 32M | |
| ja-font-hackgen-nf-2..> | 2025-12-28 21:09 | 21M | |
| ja-font-ipa-00303_7.pkg | 2025-12-26 20:47 | 8.1M | |
| ja-font-ipa-uigothic..> | 2025-12-27 02:17 | 2.3M | |
| ja-font-ipaex-00401.pkg | 2025-12-28 12:09 | 7.7M | |
| ja-font-ipamjm-00601..> | 2025-12-30 12:16 | 25M | |
| ja-font-jisx0213-200..> | 2025-12-27 02:57 | 7.1M | |
| ja-font-kaname12-1.1..> | 2025-12-29 06:28 | 584K | |
| ja-font-kanji18-1.0_..> | 2025-12-27 16:39 | 1.4M | |
| ja-font-kanji26-1.0_..> | 2025-12-27 06:22 | 2.6M | |
| ja-font-kappa20-0.39..> | 2025-12-27 16:07 | 3.0M | |
| ja-font-kochi-200308..> | 2025-12-28 12:47 | 7.0M | |
| ja-font-koruri-20210..> | 2025-12-30 14:51 | 4.3M | |
| ja-font-marumoji-1.0..> | 2025-12-28 12:46 | 2.2M | |
| ja-font-mgenplus-201..> | 2025-12-29 10:43 | 169M | |
| ja-font-migmix-1.0.2..> | 2025-12-30 02:55 | 7.2M | |
| ja-font-migu-1.0.201..> | 2025-12-26 20:30 | 7.1M | |
| ja-font-mikachan-9.1..> | 2025-12-30 09:46 | 1.8M | |
| ja-font-mona-2.90_3.pkg | 2025-12-27 14:52 | 4.3M | |
| ja-font-mona-ipa-1.0..> | 2025-12-29 22:02 | 6.6M | |
| ja-font-mona-ttf-2.9..> | 2025-12-29 04:49 | 1.4M | |
| ja-font-moralerspace..> | 2025-12-29 00:39 | 63M | |
| ja-font-moralerspace..> | 2025-12-29 05:19 | 63M | |
| ja-font-moralerspace..> | 2025-12-30 04:43 | 63M | |
| ja-font-moralerspace..> | 2025-12-30 07:27 | 63M | |
| ja-font-motoya-al-0...> | 2025-12-29 18:25 | 2.7M | |
| ja-font-mplus-bitmap..> | 2025-12-29 23:31 | 368K | |
| ja-font-mplus-ipa-1...> | 2025-12-26 21:04 | 3.5M | |
| ja-font-mplus-outlin..> | 2025-12-30 08:02 | 27M | |
| ja-font-myrica-2.012..> | 2025-12-30 18:12 | 4.8M | |
| ja-font-myricam-2.01..> | 2025-12-30 00:49 | 4.5M | |
| ja-font-naga10-1.1_4..> | 2025-12-27 16:50 | 813K | |
| ja-font-nasu-2020022..> | 2025-12-28 12:43 | 10M | |
| ja-font-plemoljp-3.0..> | 2025-12-27 22:55 | 140M | |
| ja-font-plemoljp-hs-..> | 2025-12-29 13:17 | 140M | |
| ja-font-plemoljp-nf-..> | 2025-12-29 19:55 | 73M | |
| ja-font-ricty-4.1.1_..> | 2025-12-30 06:49 | 6.8M | |
| ja-font-ricty-discor..> | 2025-12-27 09:37 | 6.8M | |
| ja-font-rounded-mgen..> | 2025-12-28 03:26 | 272M | |
| ja-font-sazanami-200..> | 2025-12-30 06:44 | 6.1M | |
| ja-font-shinonome-0...> | 2025-12-27 04:16 | 4.7M | |
| ja-font-std-0.0.2019..> | 2025-12-27 13:18 | 1.0K | |
| ja-font-takao-003.02..> | 2025-12-29 13:04 | 14M | |
| ja-font-udev-gothic-..> | 2025-12-29 20:30 | 40M | |
| ja-font-udev-gothic-..> | 2025-12-29 01:27 | 40M | |
| ja-font-udev-gothic-..> | 2025-12-29 22:18 | 29M | |
| ja-font-ume-0.0.670.pkg | 2025-12-30 05:06 | 22M | |
| ja-font-vlgothic-202..> | 2025-12-27 10:27 | 2.3M | |
| ja-freebsd-doc-20251..> | 2025-12-20 00:26 | 4.3M | |
| ja-freepwing-1.4.4_2..> | 2025-12-23 04:49 | 55K | |
| ja-fumeikai-fpw-1.0_..> | 2025-08-20 03:51 | 584K | |
| ja-gawk-3.0.6_2.pkg | 2025-08-16 15:50 | 144K | |
| ja-gedy-0.9.0_3.pkg | 2025-12-28 00:06 | 11K | |
| ja-groff-1.18.1_19.pkg | 2025-12-18 21:45 | 1.7M | |
| ja-gskk-20041208.pkg | 2025-08-22 01:45 | 1.2M | |
| ja-gsuica-0.9.1_4.pkg | 2025-12-30 17:30 | 14K | |
| ja-hns-2.19.9_1.pkg | 2025-12-20 07:18 | 636K | |
| ja-ibus-anthy-1.5.17..> | 2025-12-28 02:32 | 1.0M | |
| ja-ibus-mozc-2.23.28..> | 2025-12-29 01:19 | 247K | |
| ja-ibus-skk-1.4.3_2.pkg | 2025-12-27 22:34 | 42K | |
| ja-icanna-0.9.0.pkg | 2025-08-18 06:24 | 2.9K | |
| ja-ipadic-2.7.0_2.pkg | 2025-08-22 00:23 | 6.1M | |
| ja-jacode.pl-2.13.4...> | 2025-12-23 14:13 | 49K | |
| ja-japana-2.0.6_2.pkg | 2025-12-20 15:03 | 11K | |
| ja-japaneseAFM-1.0.pkg | 2025-08-14 16:07 | 179K | |
| ja-jargon-fpw-2.0.pkg | 2025-08-16 13:40 | 3.3M | |
| ja-jcode.pl-2.13_2.pkg | 2025-12-23 21:36 | 7.5K | |
| ja-jishyo-0.1_14.pkg | 2025-12-27 18:03 | 2.9M | |
| ja-jvim-3.0.j2.1b_3.pkg | 2025-08-21 06:59 | 300K | |
| ja-kakasi-2.3.5_3.pkg | 2025-08-13 14:30 | 788K | |
| ja-kasumi-unicode-2...> | 2025-12-27 17:13 | 59K | |
| ja-kbanner-2.1_6.pkg | 2025-08-22 03:28 | 131K | |
| ja-kcc-1.1_1.pkg | 2025-08-15 21:14 | 13K | |
| ja-kcode-1.0_2.pkg | 2025-12-24 07:05 | 5.1K | |
| ja-kdrill-6.5_1.pkg | 2025-12-22 07:16 | 60K | |
| ja-kinput2-3.1_14.pkg | 2025-12-23 23:10 | 190K | |
| ja-kiten-25.12.0.pkg | 2025-12-26 21:45 | 11M | |
| ja-kon2-14dot-0.3_8.pkg | 2025-08-20 18:35 | 455K | |
| ja-kon2-16dot-0.3_8.pkg | 2025-08-22 10:51 | 455K | |
| ja-kterm-6.2.0_20.pkg | 2025-12-21 12:06 | 126K | |
| ja-leafrogue-0.72_3.pkg | 2025-08-18 06:22 | 23K | |
| ja-less-382.262.03.0..> | 2025-08-14 05:02 | 207K | |
| ja-libgd-2.3.3_13,1.pkg | 2025-12-30 03:50 | 236K | |
| ja-libreoffice-25.8...> | 2025-12-27 15:39 | 3.7M | |
| ja-libskk-1.0.5_1.pkg | 2025-12-27 15:32 | 214K | |
| ja-libslang-1.4.5.j2..> | 2025-08-14 20:10 | 540K | |
| ja-libtomoe-gtk-0.6...> | 2025-12-27 03:49 | 79K | |
| ja-lipsf-2.00_2.pkg | 2025-08-19 02:06 | 74K | |
| ja-lookup-1.99.96.20..> | 2025-12-30 13:49 | 345K | |
| ja-lookup-emacs_cann..> | 2025-12-30 06:35 | 345K | |
| ja-lookup-emacs_deve..> | 2025-12-27 22:34 | 344K | |
| ja-lookup-emacs_deve..> | 2025-12-21 09:00 | 344K | |
| ja-lookup-emacs_nox-..> | 2025-12-23 04:41 | 345K | |
| ja-lookup-emacs_wayl..> | 2025-12-29 09:49 | 345K | |
| ja-ls-0.5_1.pkg | 2025-08-19 10:27 | 20K | |
| ja-lsd-fpw-3.0.1.pkg | 2025-08-21 22:57 | 3.0M | |
| ja-lynx-2.8.9.r1_2.pkg | 2025-08-17 04:36 | 1.1M | |
| ja-lynx-current-2.9...> | 2025-12-23 11:01 | 1.1M | |
| ja-man-1.1j_10.pkg | 2025-12-19 07:31 | 51K | |
| ja-man-doc-5.4.20050..> | 2025-12-23 03:55 | 5.2M | |
| ja-mecab-0.996_4.pkg | 2025-08-13 17:22 | 391K | |
| ja-mecab-ipadic-2.7...> | 2025-08-15 08:42 | 821 | |
| ja-mecab-ipadic-eucj..> | 2025-08-20 00:04 | 9.6M | |
| ja-mecab-ipadic-sjis..> | 2025-08-18 21:06 | 11M | |
| ja-mecab-ipadic-utf8..> | 2025-08-14 05:35 | 11M | |
| ja-mecab-jawiki-g202..> | 2025-08-17 11:39 | 25M | |
| ja-mh-6.8.4.j3.05_8.pkg | 2025-08-16 02:15 | 935K | |
| ja-migemo-0.40_9,1.pkg | 2025-12-23 02:27 | 1.6M | |
| ja-migemo.el-1.9.2_1..> | 2025-12-28 04:24 | 7.5K | |
| ja-migemo.el-emacs_c..> | 2025-12-28 03:32 | 7.5K | |
| ja-migemo.el-emacs_d..> | 2025-12-30 07:23 | 7.5K | |
| ja-migemo.el-emacs_d..> | 2025-12-21 10:16 | 7.5K | |
| ja-migemo.el-emacs_n..> | 2025-12-23 11:01 | 7.5K | |
| ja-migemo.el-emacs_w..> | 2025-12-28 05:08 | 7.5K | |
| ja-mozc-el-2.23.2815..> | 2025-12-27 17:14 | 38K | |
| ja-mozc-el-emacs_can..> | 2025-12-27 06:22 | 38K | |
| ja-mozc-el-emacs_dev..> | 2025-12-27 13:01 | 38K | |
| ja-mozc-el-emacs_dev..> | 2025-12-19 23:31 | 38K | |
| ja-mozc-el-emacs_nox..> | 2025-12-19 12:55 | 38K | |
| ja-mozc-el-emacs_way..> | 2025-12-27 17:45 | 38K | |
| ja-mozc-server-2.23...> | 2025-08-26 04:04 | 13M | |
| ja-mozc-tool-2.23.28..> | 2025-12-27 18:00 | 845K | |
| ja-multiskkserv-2024..> | 2025-08-16 02:06 | 18K | |
| ja-mypaedia-fpw-pack..> | 2025-12-28 10:49 | 7.1K | |
| ja-namazu2-2.0.21_1.pkg | 2025-12-21 12:21 | 600 | |
| ja-navi2ch-2.0.0.d_2..> | 2025-12-27 21:27 | 307K | |
| ja-navi2ch-emacs_can..> | 2025-12-27 22:43 | 307K | |
| ja-navi2ch-emacs_dev..> | 2025-12-28 00:34 | 307K | |
| ja-navi2ch-emacs_dev..> | 2025-12-29 06:59 | 307K | |
| ja-navi2ch-emacs_nox..> | 2025-12-30 00:40 | 307K | |
| ja-navi2ch-emacs_way..> | 2025-12-30 11:05 | 307K | |
| ja-ne-3.05_1.pkg | 2025-08-18 02:17 | 97K | |
| ja-nethack-3.4.3_9.pkg | 2025-12-22 05:37 | 1.2M | |
| ja-newosaka-1.0_1.pkg | 2025-08-18 08:29 | 7.2K | |
| ja-ng-1.4.4_2.pkg | 2025-08-17 00:44 | 142K | |
| ja-ng-canna-1.4.4_2.pkg | 2025-08-20 15:22 | 144K | |
| ja-ng-devel-1.5.b1.pkg | 2025-08-17 20:58 | 143K | |
| ja-ngraph-fonts-1.0_..> | 2025-12-29 13:04 | 906 | |
| ja-nkf-2.1.5_1,1.pkg | 2025-08-13 21:54 | 130K | |
| ja-p5-2chproxy-1.0.1..> | 2025-12-19 09:41 | 18K | |
| ja-p5-Date-Japanese-..> | 2025-12-22 19:20 | 9.8K | |
| ja-p5-Date-Japanese-..> | 2025-12-20 05:39 | 4.0K | |
| ja-p5-DateTime-Calen..> | 2025-12-18 22:06 | 11K | |
| ja-p5-DateTime-Forma..> | 2025-12-22 13:18 | 16K | |
| ja-p5-Encode-EUCJPAS..> | 2025-12-20 01:06 | 129K | |
| ja-p5-Encode-EUCJPMS..> | 2025-12-22 16:29 | 172K | |
| ja-p5-Encode-ISO2022..> | 2025-12-21 22:56 | 116K | |
| ja-p5-Encode-JP-Emoj..> | 2025-12-22 19:45 | 42K | |
| ja-p5-Encode-JP-Mobi..> | 2025-12-19 22:42 | 367K | |
| ja-p5-HTML-MobileJp-..> | 2025-12-23 05:31 | 7.9K | |
| ja-p5-Jcode-2.07_1.pkg | 2025-12-18 17:53 | 24K | |
| ja-p5-Lingua-JA-Kana..> | 2025-12-23 02:34 | 6.8K | |
| ja-p5-Lingua-JA-Moji..> | 2025-12-23 00:27 | 66K | |
| ja-p5-Lingua-JA-Numb..> | 2025-12-19 04:58 | 13K | |
| ja-p5-Lingua-JA-Regu..> | 2025-12-19 21:50 | 5.7K | |
| ja-p5-Lingua-JA-Summ..> | 2025-12-22 09:19 | 12K | |
| ja-p5-MeCab-0.996_2.pkg | 2025-12-19 13:58 | 36K | |
| ja-p5-Number-Phone-J..> | 2025-12-20 05:12 | 24K | |
| ja-p5-PDFJ-0.90_3.pkg | 2025-12-23 23:25 | 1.3M | |
| ja-p5-Text-ChaSen-1...> | 2025-12-20 23:45 | 11K | |
| ja-p5-Text-Kakasi-2...> | 2025-12-18 16:24 | 16K | |
| ja-p5-Text-MeCab-0.2..> | 2025-12-22 06:41 | 24K | |
| ja-p5-Unicode-Japane..> | 2025-12-19 23:05 | 130K | |
| ja-p5-WWW-MobileCarr..> | 2025-12-18 18:45 | 39K | |
| ja-p5-mime_pls-2.02_..> | 2025-12-22 14:39 | 7.8K | |
| ja-p5-nkf-2.1.4,1.pkg | 2025-12-20 00:24 | 122K | |
| ja-pejv-fpw-1.0.4.pkg | 2025-08-18 06:07 | 707K | |
| ja-plain2-2.54.1_2.pkg | 2025-08-19 14:24 | 55K | |
| ja-plan-1.12_3.pkg | 2025-12-28 18:31 | 282K | |
| ja-prn-1.0_3.pkg | 2025-08-19 17:47 | 45K | |
| ja-qkc-1.0.pkg | 2025-08-19 20:34 | 17K | |
| ja-quit-1.2a_3.pkg | 2025-08-16 19:49 | 5.1K | |
| ja-radish-play-g2025..> | 2025-12-30 15:43 | 3.7K | |
| ja-roget-fpw-1.0.2.pkg | 2025-08-16 15:07 | 1.0M | |
| ja-rogue_s-1.3a_3.pkg | 2025-08-15 08:26 | 103K | |
| ja-ruby33-romkan-0.4..> | 2025-12-19 06:06 | 5.1K | |
| ja-ruby33-uconv-0.5...> | 2025-12-20 10:57 | 167K | |
| ja-rubygem-jpmobile-..> | 2025-12-19 22:30 | 4.3K | |
| ja-rubygem-jpmobile-..> | 2025-12-20 00:45 | 5.9K | |
| ja-rubygem-jpmobile4..> | 2025-12-28 16:28 | 240K | |
| ja-rubygem-mail-iso-..> | 2025-12-28 14:57 | 8.3K | |
| ja-rubygem-myrurema-..> | 2025-12-22 14:16 | 8.5K | |
| ja-ryaku-fpw-1.0.1_1..> | 2025-08-21 08:10 | 361K | |
| ja-scim-anthy-1.2.7_..> | 2025-12-30 02:01 | 395K | |
| ja-scim-canna-1.0.0_..> | 2025-12-29 01:05 | 54K | |
| ja-scim-honoka-0.9.1..> | 2025-12-26 20:24 | 214K | |
| ja-scim-honoka-plugi..> | 2025-12-27 16:23 | 47K | |
| ja-scim-honoka-plugi..> | 2025-12-29 16:15 | 39K | |
| ja-scim-skk-0.5.2_12..> | 2025-12-28 11:46 | 157K | |
| ja-scim-tables-0.5.1..> | 2025-12-29 22:49 | 111K | |
| ja-scim-tomoe-0.6.0_..> | 2025-12-29 11:48 | 31K | |
| ja-scim-uim-0.2.0_20..> | 2025-12-30 16:35 | 35K | |
| ja-seaside-080908.s3..> | 2025-12-28 00:30 | 12M | |
| ja-sj3-lib-2.0.1.20_..> | 2025-08-15 05:54 | 39K | |
| ja-sj3-server-2.0.1...> | 2025-08-16 17:14 | 474K | |
| ja-skk-9.6_3.pkg | 2025-12-23 04:52 | 1.1K | |
| ja-skk-jawiki-g20250..> | 2025-08-14 14:01 | 11M | |
| ja-skk-jisyo-2024013..> | 2025-08-13 22:53 | 1.5M | |
| ja-skk-jisyo-cdb-202..> | 2025-08-14 17:46 | 3.1M | |
| ja-skk-tools-1.3.4.2..> | 2025-12-19 05:55 | 21K | |
| ja-skkinput-2.06.4_4..> | 2025-08-16 18:21 | 191K | |
| ja-skkinput3-3.0.6_1..> | 2025-12-29 18:13 | 357K | |
| ja-skkserv-9.6_6.pkg | 2025-08-15 09:56 | 8.7K | |
| ja-slimeforest-158.pkg | 2025-12-23 21:10 | 2.6M | |
| ja-slrn-0.9.6.2_1.pkg | 2025-08-20 01:11 | 297K | |
| ja-sourcehansans-otf..> | 2025-12-30 09:06 | 85M | |
| ja-sourcehanserif-ot..> | 2025-12-29 10:04 | 107M | |
| ja-spoqahansans-ttf-..> | 2025-12-30 07:15 | 40M | |
| ja-srd-fpw-package-1..> | 2025-12-30 16:19 | 6.4K | |
| ja-sudachi-0.6.10_9.pkg | 2025-12-28 01:21 | 52M | |
| ja-suicavalue-2007.0..> | 2025-08-21 16:00 | 3.3K | |
| ja-tdiary-5.4.0.pkg | 2025-12-29 11:01 | 3.6M | |
| ja-tegaki-zinnia-jap..> | 2025-08-14 06:04 | 14M | |
| ja-tex-ptex-3.6_6.pkg | 2025-12-27 16:43 | 19M | |
| ja-tgif-resource-4.2..> | 2025-12-29 23:23 | 1.6K | |
| ja-tiarra-20100212_7..> | 2025-12-23 21:36 | 370K | |
| ja-timidity++-slang-..> | 2025-12-29 06:09 | 9.1K | |
| ja-today-2.12_2.pkg | 2025-08-15 23:11 | 201K | |
| ja-tomoe-0.6.0_7.pkg | 2025-12-19 02:26 | 1.3M | |
| ja-uim-anthy-unicode..> | 2025-12-28 12:35 | 27K | |
| ja-uim-mozc-2.23.281..> | 2025-12-28 14:35 | 184K | |
| ja-uim-tomoe-gtk-0.6..> | 2025-12-28 09:04 | 4.2K | |
| ja-vera-fpw-1.8.1.0...> | 2025-08-17 14:42 | 257K | |
| ja-vftool-1.2_1.pkg | 2025-08-16 09:14 | 126K | |
| ja-w3m-0.5.5.pkg | 2025-12-21 16:18 | 1.0M | |
| ja-w3m-img-0.5.5.pkg | 2025-12-28 01:17 | 1.0M | |
| ja-wdic-fpw-1.4.pkg | 2025-08-19 09:21 | 38M | |
| ja-web1913-fpw-1.1.2..> | 2025-08-19 04:31 | 11M | |
| ja-webalizer-2.23.8_..> | 2025-12-30 18:20 | 135K | |
| ja-wnn7egg-1.02_1.pkg | 2025-08-20 05:07 | 86K | |
| ja-wordnet-fpw-1.6.1..> | 2025-08-17 23:52 | 6.9M | |
| ja-wordpress-ja-6.9.pkg | 2025-12-29 19:13 | 25M | |
| ja-wwasw-fpw-1.0.2.pkg | 2025-08-20 16:29 | 78K | |
| ja-xpdf-jafont-4.02.pkg | 2025-12-30 06:47 | 89K | |
| ja-xshodou-1.11_5.pkg | 2025-12-29 21:55 | 29K | |
| ja-xtr-1.50e.0.2_10.pkg | 2025-12-28 14:00 | 223K | |
| ja-xv-6.1.0.pkg | 2025-12-28 03:19 | 523K | |
| ja-yc.el-5.2.1_29,1.pkg | 2025-12-28 12:08 | 51K | |
| ja-yc.el-emacs_canna..> | 2025-12-29 19:17 | 51K | |
| ja-yc.el-emacs_nox-5..> | 2025-12-22 12:41 | 51K | |
| ja-yc.el-emacs_wayla..> | 2025-12-28 20:55 | 51K | |
| ja-zinnia-0.06_2.pkg | 2025-08-13 18:31 | 97K | |
| ja-zinnia-tomoe-0.6...> | 2025-08-16 19:40 | 29M | |
| ja-zipcodes-20221228..> | 2025-08-21 04:10 | 2.0M | |
| ja2-0.21.0_18.pkg | 2025-12-28 11:00 | 14M | |
| jacal-1c8_2.pkg | 2025-12-23 09:40 | 115K | |
| jack-capture-0.9.73...> | 2025-12-27 11:16 | 28K | |
| jack-example-tools-4..> | 2025-12-29 17:02 | 97K | |
| jack-keyboard-2.7.2_..> | 2025-12-29 13:47 | 25K | |
| jack-smf-utils-1.0_1..> | 2025-12-29 22:30 | 36K | |
| jack_ghero-1.0.4_4.pkg | 2025-12-30 15:07 | 7.2K | |
| jack_umidi-1.1.2_1.pkg | 2025-12-28 09:45 | 7.8K | |
| jackett-0.24.196.pkg | 2025-12-29 19:49 | 35M | |
| jackit-1.9.22_3.pkg | 2025-12-24 22:02 | 434K | |
| jacktrip-2.7.1.pkg | 2025-12-30 14:54 | 925K | |
| jacop-4.8.0.pkg | 2025-12-27 02:51 | 1.9M | |
| jad-1.5.8c.pkg | 2025-08-22 17:03 | 263K | |
| jade-1.2.1_11.pkg | 2025-08-13 13:33 | 2.4M | |
| jai-1.1.3_2.pkg | 2025-12-27 20:52 | 1.9M | |
| jail-primer-0.2_1.pkg | 2025-08-21 04:28 | 25K | |
| jail_exporter-0.18.0..> | 2025-12-30 08:48 | 717K | |
| jailadmin-1.9.pkg | 2025-12-23 19:38 | 12K | |
| jailaudit-1.6.1.pkg | 2025-08-22 21:09 | 4.0K | |
| jaildaemon-0.5_1.pkg | 2025-08-17 06:18 | 9.7K | |
| jailkit-2.23_1.pkg | 2025-12-23 10:19 | 92K | |
| jailmanager-0.3.pkg | 2025-12-23 23:19 | 2.4K | |
| jailme-0.2.0.pkg | 2025-08-18 21:52 | 3.1K | |
| jailrc-1.0.pkg | 2025-08-19 09:51 | 6.9K | |
| jailutils-1.7_1.pkg | 2025-08-18 08:23 | 27K | |
| jakarta-oro-2.0.8_3.pkg | 2025-12-27 15:43 | 122K | |
| jalbum-10.10.7.pkg | 2025-12-29 19:16 | 9.9M | |
| jalingo-0.6.0_4.pkg | 2025-12-30 04:40 | 919K | |
| jalv-1.6.8_3.pkg | 2025-12-27 15:35 | 87K | |
| jalv-select-1.3_6.pkg | 2025-12-29 21:45 | 55K | |
| jalview-2.11.2.5.pkg | 2025-12-28 02:16 | 41M | |
| jam-2.6.1.pkg | 2025-08-14 05:11 | 69K | |
| jama-1.2.5.pkg | 2025-08-17 05:22 | 35K | |
| james-2.3.2.1_1.pkg | 2025-12-28 12:47 | 6.0M | |
| jamlib-1.4.7_3.pkg | 2025-08-19 02:27 | 43K | |
| jamulus-3.11.0.pkg | 2025-12-30 07:18 | 1.4M | |
| jamulus-server-3.11...> | 2025-12-30 00:28 | 1.2M | |
| janet-1.40.1.pkg | 2025-12-19 17:07 | 480K | |
| janet-lsp-0.0.11_1.pkg | 2025-12-29 22:33 | 79K | |
| jansson-2.14.1.pkg | 2025-08-13 06:07 | 62K | |
| janus-1.3.3.pkg | 2025-12-27 08:52 | 5.6M | |
| jaq-2.3.0_2.pkg | 2025-12-27 22:18 | 793K | |
| jargon-4.4.7.pkg | 2025-08-20 17:14 | 8.3M | |
| jarl-0.5001_5.pkg | 2025-12-29 19:12 | 133K | |
| jarnal-1079.pkg | 2025-12-30 19:07 | 12M | |
| jasmin-2.4_2,1.pkg | 2025-12-29 14:58 | 148K | |
| jasper-4.2.8.pkg | 2025-12-26 06:49 | 427K | |
| jattach-2.2.pkg | 2025-08-17 02:14 | 8.0K | |
| java-beepcore-0.9.08..> | 2025-12-29 16:04 | 195K | |
| java-cup-11b.2016061..> | 2025-12-30 17:23 | 115K | |
| java-findbugs-1.3.9_..> | 2025-12-29 05:44 | 6.7M | |
| java-games-suite-1.0..> | 2025-12-29 01:25 | 39K | |
| java-getopt-1.0.14_1..> | 2025-12-27 12:54 | 47K | |
| java-sigar-1.7.3_11.pkg | 2025-12-27 10:56 | 338K | |
| java-simple-serial-c..> | 2025-12-27 13:16 | 21K | |
| java-subversion-1.14..> | 2025-12-29 07:01 | 550K | |
| java-zoneinfo-2021.e..> | 2025-08-13 06:09 | 78K | |
| java3d-1.5.2_11.pkg | 2025-12-27 16:02 | 2.2M | |
| javahelp-2.0.05.2017..> | 2025-12-26 21:47 | 938K | |
| javamail-1.6.2_2.pkg | 2025-12-18 10:31 | 936K | |
| javaservicewrapper-3..> | 2025-12-27 08:04 | 682K | |
| javatar-2.5_2.pkg | 2025-12-28 00:36 | 57K | |
| javatari-4.1_1.pkg | 2025-12-30 10:08 | 877K | |
| javavmwrapper-2.7.10..> | 2025-08-13 05:18 | 16K | |
| jave6-0.1_5.pkg | 2025-12-29 13:06 | 2.1M | |
| jbidwatcher-2.5.6_2.pkg | 2025-12-29 18:06 | 4.5M | |
| jbig2dec-0.20_1.pkg | 2025-12-26 03:21 | 86K | |
| jbigkit-2.1_3.pkg | 2025-08-10 21:09 | 73K | |
| jbxvt-0.8_1.pkg | 2025-08-20 17:09 | 33K | |
| jcalendar-1.3.3_1.pkg | 2025-12-29 00:44 | 416K | |
| jcckit-1.1_2.pkg | 2025-12-29 22:45 | 532K | |
| jchessboard-1.5_5.pkg | 2025-12-29 13:55 | 126K | |
| jcifs-1.3.19,1.pkg | 2025-12-29 13:29 | 562K | |
| jclassinfo-0.19.1_2.pkg | 2025-08-20 07:40 | 51K | |
| jcmdline-2.0.0.pkg | 2025-12-29 22:09 | 114K | |
| jcommon-1.0.23_1.pkg | 2025-12-27 17:02 | 1.0M | |
| jconvolver-1.1.0_2.pkg | 2025-12-28 00:55 | 22K | |
| jd-gui-1.6.6.pkg | 2025-12-30 08:34 | 2.8M | |
| jday-2.4_2.pkg | 2025-08-16 15:12 | 13K | |
| jdb-1.14_3.pkg | 2025-12-22 19:26 | 62K | |
| jdftx-1.7.0_6.pkg | 2025-12-27 21:06 | 49M | |
| jdictionary-1.8_4.pkg | 2025-12-27 13:00 | 292K | |
| jdictionary-int-eng-..> | 2025-12-30 00:16 | 826K | |
| jdiskreport-1.4.1.pkg | 2025-12-30 01:22 | 662K | |
| jdraw-1.1.5_4.pkg | 2025-12-28 01:00 | 640K | |
| jdupes-1.27.3_2.pkg | 2025-08-20 09:29 | 32K | |
| je-7.5.11_2.pkg | 2025-12-30 05:17 | 6.7M | |
| jed-0.99.19_6.pkg | 2025-12-29 17:10 | 513K | |
| jedit-5.7.0,1.pkg | 2025-12-28 11:20 | 3.3M | |
| jellyfin-10.11.5.pkg | 2025-12-30 08:27 | 74M | |
| jenkins-2.543.pkg | 2025-12-30 09:15 | 92M | |
| jenkins-lts-2.528.3.pkg | 2025-12-28 18:14 | 91M | |
| jericho-html-3.4.pkg | 2025-12-30 11:34 | 888K | |
| jesred-1.2.1_1.pkg | 2025-08-18 16:15 | 12K | |
| jest-3.0.16_35.pkg | 2025-12-23 19:56 | 2.4M | |
| jetbrains-clion-2025..> | 2025-12-30 16:16 | 685M | |
| jetbrains-datagrip-2..> | 2025-12-28 06:44 | 279M | |
| jetbrains-goland-202..> | 2025-12-30 06:13 | 616M | |
| jetbrains-mono-2.304..> | 2025-12-29 10:38 | 812K | |
| jetbrains-phpstorm-2..> | 2025-12-27 22:42 | 600M | |
| jetbrains-pty4j-0.13..> | 2025-12-19 17:38 | 5.2K | |
| jetbrains-restarter-..> | 2025-12-27 14:46 | 160K | |
| jetbrains-rustrover-..> | 2025-12-29 04:34 | 636M | |
| jetbrains-sqlite-242..> | 2025-08-14 22:42 | 639K | |
| jetbrains-webstorm-2..> | 2025-12-29 03:00 | 648M | |
| jetty10-10.0.25.pkg | 2025-12-28 21:52 | 9.9M | |
| jetty12-12.0.25.pkg | 2025-12-27 08:32 | 32M | |
| jeuclid-3.1.9.pkg | 2025-12-27 00:34 | 6.7M | |
| jf-openhuninn-2.1.pkg | 2025-12-30 05:45 | 2.5M | |
| jfk-0.1.1_12.pkg | 2025-12-29 11:26 | 1.9M | |
| jflex-1.8.1.pkg | 2025-12-28 06:28 | 2.1M | |
| jfreechart-1.0.17_1.pkg | 2025-12-28 12:03 | 4.6M | |
| jfsw-20240303.pkg | 2025-12-27 20:35 | 863K | |
| jftp-1.60.pkg | 2025-12-28 16:15 | 3.5M | |
| jgmenu-4.4.1_1.pkg | 2025-12-29 00:35 | 140K | |
| jgnash-2.21.0.pkg | 2025-12-27 22:51 | 40M | |
| jgoodies-looks-2.7.0..> | 2025-12-27 00:58 | 967K | |
| jgraph-8.3_2.pkg | 2025-08-15 19:08 | 80K | |
| jgraph-java-5.13.0.4..> | 2025-12-30 18:15 | 608K | |
| jgraphx-4.2.2_1.pkg | 2025-12-26 22:18 | 2.2M | |
| jgroups-2.12.0_1.pkg | 2025-12-30 14:51 | 3.5M | |
| jhead-3.08.pkg | 2025-12-27 00:51 | 39K | |
| jicmp-1.4.4.pkg | 2025-12-29 03:11 | 29K | |
| jicmp6-1.2.3.pkg | 2025-12-28 11:57 | 13K | |
| jicofo-1.0.1118.pkg | 2025-12-27 09:05 | 20M | |
| jid-0.7.6_33.pkg | 2025-12-23 07:06 | 937K | |
| jid3lib-0.5.4_3.pkg | 2025-12-28 18:28 | 156K | |
| jigdo-0.8.2_1.pkg | 2025-12-20 06:03 | 149K | |
| jigsaw-0.8_10.pkg | 2025-12-27 18:37 | 32K | |
| jigzo-0.6.1_13.pkg | 2025-12-30 14:19 | 3.8M | |
| jiic-20120110_1.pkg | 2025-12-28 16:15 | 105K | |
| jikes-1.22_3.pkg | 2025-08-14 14:15 | 425K | |
| jimtcl-0.83.pkg | 2025-08-16 11:19 | 263K | |
| jin-2.14.1_7.pkg | 2025-12-29 15:42 | 16M | |
| jing-20241231.pkg | 2025-12-30 06:11 | 4.6M | |
| jinput-2.0.10,1.pkg | 2025-12-26 22:55 | 181K | |
| jira-cli-1.7.0_5.pkg | 2025-12-21 12:56 | 5.7M | |
| jiri-g2020.08.28_33.pkg | 2025-12-22 17:00 | 3.1M | |
| jitsi-meet-1.0.8339.pkg | 2025-08-15 15:32 | 15M | |
| jitsi-meet-full-2.0...> | 2025-12-28 06:17 | 726 | |
| jitsi-prosody-plugin..> | 2025-12-19 03:28 | 92K | |
| jitsi-srtp-native-1...> | 2025-12-27 16:27 | 5.3K | |
| jitsi-videobridge-2...> | 2025-12-27 00:47 | 49M | |
| jjclient-1.0.2_2.pkg | 2025-12-23 05:46 | 5.2K | |
| jjui-0.9.8.pkg | 2025-12-30 00:15 | 1.9M | |
| jkill-1.0_1.pkg | 2025-12-20 11:07 | 2.2K | |
| jkqtplotter-qt5-5.0...> | 2025-12-28 16:26 | 2.4M | |
| jkqtplotter-qt6-5.0...> | 2025-12-30 16:34 | 2.5M | |
| jlatexmath-1.0.7.pkg | 2025-12-26 21:36 | 626K | |
| jless-0.9.0_6.pkg | 2025-12-28 05:37 | 732K | |
| jlex-1.2.6_3.pkg | 2025-12-29 03:57 | 51K | |
| jline-0.9.94.pkg | 2025-12-27 01:55 | 306K | |
| jlint-3.1.2_5.pkg | 2025-08-16 22:52 | 199K | |
| jlj-2.12.pkg | 2025-12-24 07:24 | 30K | |
| jlog-1.2.2.s20150122..> | 2025-12-22 05:06 | 63K | |
| jmatconvol-0.5.2_1.pkg | 2025-12-30 09:41 | 21K | |
| jmba-0.5.5_1.pkg | 2025-08-21 01:45 | 30K | |
| jmk-x11-fonts-3.0_6.pkg | 2025-12-28 10:39 | 453K | |
| jmore-0.5.20251030.pkg | 2025-12-21 19:36 | 4.8K | |
| jmref-19.0_1.pkg | 2025-08-16 16:19 | 769K | |
| jna-5.15.0_2.pkg | 2025-08-14 03:04 | 9.0M | |
| jnettop-0.13.0_2.pkg | 2025-12-21 19:28 | 28K | |
| jnoisemeter-0.4.1.pkg | 2025-12-30 08:01 | 15K | |
| jnv-0.6.1_4.pkg | 2025-12-29 04:43 | 1.5M | |
| jo-1.6_1.pkg | 2025-08-15 02:41 | 20K | |
| jode-1.1.1.1_5.pkg | 2025-12-30 13:46 | 419K | |
| joe-4.6_1,1.pkg | 2025-08-22 11:43 | 494K | |
| joequake-0.15b1329_1..> | 2025-12-29 02:35 | 4.2M | |
| jogamp-jogl-2.3.2_2.pkg | 2025-12-27 00:42 | 4.0M | |
| jogl-1.1.1_10.pkg | 2025-12-27 19:28 | 1.6M | |
| john-1.9.0.j.1_1.pkg | 2025-08-17 16:38 | 30M | |
| jojodiff-0.8.5.pkg | 2025-08-20 13:28 | 27K | |
| joomla4-4.4.13.pkg | 2025-12-30 04:45 | 19M | |
| joomla5-5.3.1.pkg | 2025-12-29 01:03 | 17M | |
| jose-14_1.pkg | 2025-08-14 09:18 | 107K | |
| joshuto-0.9.8_14.pkg | 2025-12-28 11:20 | 1.8M | |
| josm-19439.pkg | 2025-12-27 14:40 | 17M | |
| jot-0.1.2_24.pkg | 2025-12-28 22:13 | 398K | |
| jotta-cli-0.17.13249..> | 2025-08-19 00:22 | 12M | |
| jove-4.17.5.5.pkg | 2025-12-21 02:55 | 499K | |
| joytran-0.9.5.2_1.pkg | 2025-12-29 11:28 | 44K | |
| jp-1.1.12_36.pkg | 2025-12-20 18:03 | 1.3M | |
| jp2a-1.3.3.pkg | 2025-12-30 00:03 | 27K | |
| jpatch-0.4.p1_3.pkg | 2025-12-29 19:08 | 1.9M | |
| jpeg-turbo-3.1.3.pkg | 2025-12-24 20:16 | 466K | |
| jpeginfo-1.7.1.pkg | 2025-12-29 01:12 | 31K | |
| jpegoptim-1.5.6_1.pkg | 2025-12-27 05:58 | 22K | |
| jpgtn-2.06_7.pkg | 2025-12-30 06:27 | 9.7K | |
| jpm-1.1.0.pkg | 2025-08-16 08:41 | 30K | |
| jps-1.0_1.pkg | 2025-12-22 03:52 | 2.7K | |
| jq-1.8.1.pkg | 2025-08-11 00:01 | 328K | |
| jql-8.0.9_2.pkg | 2025-12-29 10:44 | 357K | |
| jqp-0.8.0_1.pkg | 2025-12-21 07:39 | 3.2M | |
| jrdesktop-0.3.1.0.pkg | 2025-12-29 19:29 | 339K | |
| jrefentry-1.1_2.pkg | 2025-08-21 03:32 | 4.6K | |
| jrobin-1.5.14.pkg | 2025-12-27 19:46 | 749K | |
| jrosetta-1.0.4_1.pkg | 2025-12-26 21:40 | 52K | |
| jrrd-1.1.4_1.pkg | 2025-12-27 22:05 | 7.5K | |
| jruby-9.2.17.0.pkg | 2025-12-26 22:59 | 22M | |
| jruls-0.2.pkg | 2025-08-22 05:32 | 5.4K | |
| jsMath-fonts-1.3.pkg | 2025-08-17 01:44 | 3.8M | |
| jsap-2.1_2.pkg | 2025-12-29 22:44 | 148K | |
| jsch-0.1.55_2.pkg | 2025-12-28 05:59 | 254K | |
| jshon-20180209_1.pkg | 2025-08-18 21:50 | 14K | |
| jsl-0.3.0_2.pkg | 2025-08-19 11:21 | 278K | |
| jslice-1.0.0_4.pkg | 2025-12-30 18:36 | 6.8K | |
| jsmin-20191031.pkg | 2025-08-16 17:00 | 6.4K | |
| json-c-0.18.pkg | 2025-08-13 04:27 | 71K | |
| json-dto-0.3.4.pkg | 2025-08-17 17:18 | 21K | |
| json-fortran-9.0.5.pkg | 2025-12-27 21:31 | 193K | |
| json-glib-1.10.8.pkg | 2025-12-16 01:48 | 1.2M | |
| json-tui-1.4.1.pkg | 2025-12-20 08:34 | 83K | |
| json-yaml-1.2.1_1.pkg | 2025-08-22 01:28 | 8.8K | |
| json2yaml-1.2.0_2.pkg | 2025-12-21 11:30 | 3.1K | |
| jsoncpp-1.9.6_1.pkg | 2025-08-10 21:16 | 130K | |
| jsonnet-0.21.0.pkg | 2025-12-20 03:28 | 3.0M | |
| jsonrpc-glib-3.44.2.pkg | 2025-12-19 05:59 | 40K | |
| jstest-gtk-20180710_..> | 2025-12-28 04:56 | 130K | |
| jstrack-3.4.0.pkg | 2025-12-28 08:32 | 145M | |
| jsxc-4.4.0.pkg | 2025-08-20 00:57 | 1.3M | |
| jtans-1.0_4.pkg | 2025-12-30 06:02 | 132K | |
| jtc-1.76.pkg | 2025-08-19 02:17 | 316K | |
| jtiger-2.1.0376.pkg | 2025-12-29 07:14 | 590K | |
| jtop-1.0_1.pkg | 2025-12-21 07:05 | 3.2K | |
| jtopen-6.2.pkg | 2025-12-27 21:47 | 7.4M | |
| jtransforms-2.4_1.pkg | 2025-12-29 16:51 | 439K | |
| jts-1.18.1.pkg | 2025-12-29 06:18 | 4.7M | |
| juce-8.0.6_3.pkg | 2025-12-27 18:41 | 18M | |
| juce706-7.0.6_3.pkg | 2025-12-27 15:03 | 14M | |
| jucipp-1.8.1.pkg | 2025-12-29 17:34 | 1.0M | |
| jujutsu-0.35.0_2.pkg | 2025-12-27 03:11 | 5.8M | |
| juk-25.12.0.pkg | 2025-12-28 19:55 | 1.9M | |
| juke-0.7_1.pkg | 2025-08-20 18:48 | 15K | |
| julia-1.10.5_1.pkg | 2025-12-27 04:48 | 50M | |
| juliamono-0.055_1.pkg | 2025-12-29 09:53 | 7.3M | |
| julius-4.1.2_3.pkg | 2025-12-21 06:56 | 596K | |
| julius-caesariii-1.8..> | 2025-12-30 10:30 | 445K | |
| jump-0.5_3.pkg | 2025-12-29 06:43 | 67K | |
| jumpgate-0.7_2.pkg | 2025-08-22 18:08 | 8.4K | |
| jumpnbump-1.61_3.pkg | 2025-12-28 01:16 | 200K | |
| jumpy-0.12.2_11.pkg | 2025-12-28 12:09 | 31M | |
| junction-20140329_1.pkg | 2025-12-27 19:48 | 50K | |
| junicode-1.002_1.pkg | 2025-12-28 09:45 | 1.2M | |
| junit-4.13.2.pkg | 2025-12-26 14:15 | 509K | |
| junkfilter-20030115_..> | 2025-08-17 11:51 | 51K | |
| jupp-3.1.41_1.pkg | 2025-08-17 17:09 | 197K | |
| just-1.43.1_1.pkg | 2025-12-27 10:32 | 1.2M | |
| jutils-1.0.1_1,1.pkg | 2025-12-26 19:13 | 6.7K | |
| jvgs-0.5.1_5.pkg | 2025-12-30 00:24 | 23M | |
| jvmtop-0.8.0.27_1.pkg | 2025-12-29 21:12 | 105K | |
| jwasm-2.19,1.pkg | 2025-08-21 02:54 | 223K | |
| jwhois-4.0_10.pkg | 2025-12-22 15:49 | 77K | |
| jwm-2.4.6.pkg | 2025-12-28 06:11 | 144K | |
| jwsmtp-1.32.15_1.pkg | 2025-08-18 13:55 | 138K | |
| jwt-cli-6.2.0_9.pkg | 2025-12-28 11:10 | 1.0M | |
| jwt-cpp-0.7.1_2.pkg | 2025-12-19 13:02 | 32K | |
| jxgrabkey-0.3.2_2.pkg | 2025-12-29 20:50 | 24K | |
| jxrlib-1.1_2.pkg | 2025-08-14 22:20 | 285K | |
| jython-2.7.0.pkg | 2025-12-28 20:32 | 58M | |
| jzintv-1.0.20200712,..> | 2025-12-29 13:19 | 1.9M | |
| jzip-2.0.1g_1.pkg | 2025-08-16 16:45 | 38K | |
| k3b-25.12.0.pkg | 2025-12-30 01:58 | 11M | |
| k4dirstat-3.4.3_1.pkg | 2025-12-30 13:42 | 254K | |
| k6-1.4.2.pkg | 2025-12-21 12:22 | 13M | |
| k8temp-0.4.1_1.pkg | 2025-08-20 02:26 | 7.5K | |
| k9s-0.50.16_2.pkg | 2025-12-23 23:04 | 40M | |
| k40-whisperer-0.70.pkg | 2025-12-29 17:14 | 141K | |
| kBuild-0.1.9998_16.pkg | 2025-12-26 18:00 | 728K | |
| kColorPicker-qt5-0.3..> | 2025-12-27 01:12 | 22K | |
| kColorPicker-qt6-0.3..> | 2025-12-26 17:00 | 23K | |
| kImageAnnotator-qt5-..> | 2025-12-27 09:42 | 352K | |
| kImageAnnotator-qt6-..> | 2025-12-26 19:14 | 327K | |
| ka-libreoffice-25.8...> | 2025-12-27 16:25 | 3.6M | |
| kab-libreoffice-25.8..> | 2025-12-27 13:13 | 476K | |
| kaccounts-integratio..> | 2025-12-26 05:49 | 138K | |
| kaccounts-providers-..> | 2025-12-27 17:14 | 71K | |
| kaddressbook-25.12.0..> | 2025-12-26 18:03 | 3.4M | |
| kadnode-2.4.1_2.pkg | 2025-12-22 13:02 | 60K | |
| kaffeine-2.0.18_6.pkg | 2025-12-29 08:00 | 5.8M | |
| kafka-3.9.1.pkg | 2025-12-29 12:41 | 115M | |
| kahip-3.22.pkg | 2025-12-27 12:22 | 1.3M | |
| kaidan-0.13.0_1.pkg | 2025-12-29 17:42 | 1.3M | |
| kajongg-25.12.0.pkg | 2025-12-26 22:17 | 5.1M | |
| kakoune-2025.06.03.pkg | 2025-08-15 20:33 | 934K | |
| kakoune-lsp-18.2.0_3..> | 2025-12-28 11:45 | 2.2M | |
| kalarm-25.12.0.pkg | 2025-12-26 23:40 | 2.9M | |
| kalc-calculator-1.5...> | 2025-12-30 16:32 | 1.1M | |
| kaldi-vosk-g20231219..> | 2025-12-26 21:40 | 13M | |
| kalgebra-25.12.0.pkg | 2025-12-27 01:03 | 1.1M | |
| kalk-25.12.0.pkg | 2025-12-29 19:59 | 176K | |
| kalker-2.2.1_11.pkg | 2025-12-30 06:25 | 722K | |
| kallisto-0.51.1_1,1.pkg | 2025-12-27 12:17 | 1.2M | |
| kalzium-25.12.0.pkg | 2025-12-26 20:40 | 18M | |
| kamailio-6.0.4.pkg | 2025-12-21 09:25 | 7.5M | |
| kamera-25.12.0.pkg | 2025-12-26 22:55 | 169K | |
| kamerka-0.20_6.pkg | 2025-12-29 05:52 | 135K | |
| kamis-2.1.pkg | 2025-08-21 18:59 | 472K | |
| kamoso-25.12.0.pkg | 2025-12-28 07:50 | 258K | |
| kanagram-25.12.0.pkg | 2025-12-26 22:03 | 6.8M | |
| kanatest-0.4.10.g202..> | 2025-12-30 09:45 | 157K | |
| kanbanapp-1.1.1.pkg | 2025-12-28 12:50 | 101K | |
| kanidm-client-1.8.5_..> | 2025-12-30 01:38 | 8.3M | |
| kanidm-server-1.8.5_..> | 2025-12-30 06:40 | 11M | |
| kannel-1.4.4_15,1.pkg | 2025-12-27 11:19 | 1.2M | |
| kannel-sqlbox-1.0.1_..> | 2025-12-30 07:55 | 109K | |
| kanshi-1.8.0.pkg | 2025-12-20 18:23 | 15K | |
| kapacitor-1.5.1_33.pkg | 2025-12-21 19:30 | 12M | |
| kapitonov-plugins-pa..> | 2025-12-29 13:08 | 3.0M | |
| kapman-25.12.0.pkg | 2025-12-27 00:48 | 2.4M | |
| kapp-0.63.3_4.pkg | 2025-08-19 09:01 | 9.2M | |
| kapptemplate-25.12.0..> | 2025-12-27 02:20 | 578K | |
| kaputa-1.000_3.pkg | 2025-12-30 07:00 | 59K | |
| kartofel-1.2_17.pkg | 2025-12-29 23:27 | 10M | |
| kaspad-go-0.12.17.pkg | 2025-08-21 04:40 | 20M | |
| kassert-1.0.0.pkg | 2025-12-22 14:35 | 252K | |
| kassiber-0.0.3.pkg | 2025-12-21 04:43 | 7.1K | |
| kasts-25.12.0.pkg | 2025-12-30 04:21 | 937K | |
| katana-1.3.0.pkg | 2025-12-20 11:32 | 12M | |
| katarakt-0.2_33.pkg | 2025-12-28 23:10 | 86K | |
| kate-25.12.0.pkg | 2025-12-26 21:18 | 10M | |
| katomic-25.12.0.pkg | 2025-12-26 23:03 | 1.4M | |
| kawa-3.1.1_1.pkg | 2025-12-30 08:28 | 3.3M | |
| kb2mb2-1.0_3.pkg | 2025-08-16 08:08 | 3.9K | |
| kbackup-25.12.0.pkg | 2025-12-29 19:42 | 543K | |
| kbdscan-20110507.pkg | 2025-08-18 22:59 | 3.1K | |
| kbfsd-1.5.3_1.pkg | 2025-12-20 08:28 | 5.3K | |
| kblackbox-25.12.0.pkg | 2025-12-26 22:25 | 632K | |
| kblocks-25.12.0.pkg | 2025-12-27 00:34 | 2.2M | |
| kbounce-25.12.0.pkg | 2025-12-26 22:02 | 3.2M | |
| kbreakout-25.12.0.pkg | 2025-12-26 22:49 | 2.9M | |
| kbruch-25.12.0.pkg | 2025-12-26 22:01 | 4.5M | |
| kc-2.5.3_3.pkg | 2025-12-21 01:04 | 68K | |
| kcachegrind-25.12.0.pkg | 2025-12-27 13:21 | 1.1M | |
| kcalc-25.12.0.pkg | 2025-12-26 20:37 | 705K | |
| kcalutils-25.12.0.pkg | 2025-12-26 09:54 | 323K | |
| kcat-1.7.0.pkg | 2025-12-21 23:58 | 663K | |
| kcd-7.15.0_2,1.pkg | 2025-12-21 03:21 | 132K | |
| kcgi-1.0.1.pkg | 2025-12-19 21:27 | 265K | |
| kcharselect-25.12.0.pkg | 2025-12-26 21:21 | 436K | |
| kcolorchooser-25.12...> | 2025-12-26 21:39 | 36K | |
| kconfig-frontends-4...> | 2025-12-20 10:41 | 117K | |
| kcov-37_2.pkg | 2025-12-24 05:09 | 339K | |
| kcron-25.12.0.pkg | 2025-12-26 21:16 | 903K | |
| kdb-3.2.0_17.pkg | 2025-12-27 02:45 | 827K | |
| kdbg-3.0.1_2.pkg | 2025-12-29 16:57 | 361K | |
| kdbxviewer-0.1.12.pkg | 2025-12-22 12:04 | 22K | |
| kddockwidgets-2.4.0.pkg | 2025-12-26 17:53 | 768K | |
| kde-6.5.4.25.12.0.pkg | 2025-12-28 16:27 | 759 | |
| kde-baseapps-25.12.0..> | 2025-12-27 05:59 | 668 | |
| kde-dev-scripts-25.1..> | 2025-12-27 03:21 | 313K | |
| kde-dev-utils-25.12...> | 2025-12-27 03:20 | 97K | |
| kde-gear-25.12.0.pkg | 2025-12-29 20:54 | 797 | |
| kde-icons-black-and-..> | 2025-08-21 04:26 | 5.1M | |
| kde-icons-nuoveXT2-2..> | 2025-08-17 01:48 | 2.2M | |
| kde-thumbnailer-chm-..> | 2025-12-28 04:15 | 11K | |
| kde-thumbnailer-epub..> | 2025-12-27 21:13 | 11K | |
| kde-thumbnailer-fb2-..> | 2025-12-29 19:31 | 8.2K | |
| kde_poster-1.0_2.pkg | 2025-08-19 17:45 | 17K | |
| kdeaccessibility-25...> | 2025-12-29 18:26 | 594 | |
| kdeadmin-25.12.0.pkg | 2025-12-27 11:42 | 562 | |
| kdebugsettings-25.12..> | 2025-12-26 22:08 | 163K | |
| kdeconnect-kde-25.12..> | 2025-12-29 16:16 | 1.4M | |
| kdeedu-25.12.0.pkg | 2025-12-27 08:16 | 932 | |
| kdeedu-data-25.12.0.pkg | 2025-12-18 16:26 | 332K | |
| kdegames-25.12.0.pkg | 2025-12-27 03:09 | 1.2K | |
| kdegraphics-25.12.0.pkg | 2025-12-27 09:58 | 752 | |
| kdegraphics-mobipock..> | 2025-12-26 10:55 | 18K | |
| kdegraphics-svgpart-..> | 2025-12-27 01:12 | 31K | |
| kdegraphics-thumbnai..> | 2025-12-26 20:10 | 46K | |
| kdemultimedia-25.12...> | 2025-12-27 11:04 | 628 | |
| kdemultimedia-ffmpeg..> | 2025-12-26 18:10 | 29K | |
| kdenetwork-25.12.0.pkg | 2025-12-27 16:33 | 583 | |
| kdenetwork-fileshari..> | 2025-12-27 00:48 | 219K | |
| kdenlive-25.12.0.pkg | 2025-12-26 22:51 | 16M | |
| kdepim-25.12.0.pkg | 2025-12-27 17:05 | 1.2K | |
| kdepim-addons-25.12...> | 2025-12-27 01:10 | 1.5M | |
| kdepim-runtime-25.12..> | 2025-12-26 17:46 | 3.3M | |
| kdesdk-25.12.0.pkg | 2025-12-30 00:30 | 769 | |
| kdesdk-kio-25.12.0.pkg | 2025-12-30 06:26 | 44K | |
| kdesdk-thumbnailers-..> | 2025-12-27 13:17 | 7.0K | |
| kdeutils-25.12.0.pkg | 2025-12-27 13:07 | 792 | |
| kdev-php-25.12.0.pkg | 2025-12-29 07:14 | 1.3M | |
| kdev-python-25.12.0.pkg | 2025-12-27 21:30 | 1.3M | |
| kdevelop-25.12.0.pkg | 2025-12-27 12:26 | 10M | |
| kdevelop-pg-qt-2.4.0..> | 2025-12-26 22:57 | 437K | |
| kdf-25.12.0.pkg | 2025-12-26 22:08 | 620K | |
| kdiagram-2.8.0_1.pkg | 2025-12-30 14:11 | 555K | |
| kdiagram-qt6-3.0.1.pkg | 2025-12-26 13:19 | 587K | |
| kdialog-25.12.0.pkg | 2025-12-26 21:30 | 151K | |
| kdiamond-25.12.0.pkg | 2025-12-26 23:47 | 4.6M | |
| kdiff3-1.12.3.pkg | 2025-12-29 22:47 | 1.6M | |
| kdiskmark-3.1.2.pkg | 2025-12-29 08:15 | 177K | |
| kdisplay-6.2.0_1.pkg | 2025-12-29 20:02 | 126K | |
| kdsingleapplication-..> | 2025-12-27 17:59 | 21K | |
| kdsoap-qt6-2.2.0_1.pkg | 2025-12-26 10:18 | 447K | |
| kdsoap-ws-discovery-..> | 2025-12-26 11:53 | 64K | |
| kea-3.0.2.pkg | 2025-12-20 11:45 | 5.9M | |
| kea-devel-3.1.4.pkg | 2025-12-23 12:38 | 5.9M | |
| kealib-1.6.2.pkg | 2025-12-27 19:45 | 138K | |
| keama-4.5.0.pkg | 2025-12-20 18:03 | 90K | |
| keditbookmarks-25.12..> | 2025-12-26 19:28 | 375K | |
| keep-presence-1.0.7_..> | 2025-12-20 17:52 | 3.0K | |
| keepass-2.56.pkg | 2025-12-27 13:06 | 1.4M | |
| keepass-plugin-keepa..> | 2025-12-30 14:14 | 237K | |
| keepassxc-2.7.11.pkg | 2025-12-30 03:52 | 9.1M | |
| keepassxc276-2.7.6_2..> | 2025-12-30 16:28 | 7.4M | |
| kefir-0.5.0.pkg | 2025-12-20 08:38 | 1.5M | |
| kenny-1.7_2.pkg | 2025-12-23 06:55 | 5.8K | |
| kepubify-4.0.4_33.pkg | 2025-12-22 14:14 | 4.2M | |
| kerl-4.4.0.pkg | 2025-12-21 02:13 | 28K | |
| kermit-10.0.beta12.pkg | 2025-08-16 13:41 | 930K | |
| kevedit-0.5.1_5.pkg | 2025-12-28 06:28 | 174K | |
| kew-3.6.4.pkg | 2025-12-28 13:17 | 484K | |
| kexi-3.2.0_8.pkg | 2025-12-30 11:32 | 3.3M | |
| keybase-6.5.1_9.pkg | 2025-12-19 04:32 | 44M | |
| keybinder-0.3.1_6.pkg | 2025-12-26 23:41 | 19K | |
| keybinder-gtk3-0.3.2..> | 2025-12-27 17:15 | 21K | |
| keyboard-daemon-0.7_..> | 2025-08-22 00:55 | 5.9K | |
| keyboardcast-0.1.1_7..> | 2025-12-30 02:31 | 13K | |
| keychain-2.9.8.pkg | 2025-12-29 15:29 | 45K | |
| keycloak-26.4.7.pkg | 2025-12-28 13:23 | 145M | |
| keyd-2.5.0.pkg | 2025-08-21 19:17 | 176K | |
| keydb-6.3.4_2.pkg | 2025-12-21 05:54 | 1.0M | |
| keynav-0.20180821.0,..> | 2025-12-28 03:29 | 24K | |
| keyprint-1.0_2.pkg | 2025-12-23 01:33 | 8.9K | |
| keysmith-25.12.0.pkg | 2025-12-30 01:15 | 255K | |
| kf5-attica-5.116.0.pkg | 2025-12-18 10:25 | 165K | |
| kf5-baloo-5.116.0_1.pkg | 2025-12-27 09:04 | 330K | |
| kf5-frameworkintegra..> | 2025-12-26 20:06 | 1.5M | |
| kf5-frameworks-5.116..> | 2025-12-28 04:56 | 1.6K | |
| kf5-kactivities-5.11..> | 2025-12-26 19:56 | 115K | |
| kf5-kactivities-stat..> | 2025-12-27 18:02 | 82K | |
| kf5-karchive-5.116.0..> | 2025-12-18 01:37 | 143K | |
| kf5-kauth-5.116.0_1.pkg | 2025-12-26 08:31 | 95K | |
| kf5-kbookmarks-5.116..> | 2025-12-26 11:24 | 144K | |
| kf5-kcalendarcore-5...> | 2025-12-27 15:09 | 320K | |
| kf5-kcmutils-5.116.0..> | 2025-12-26 20:27 | 229K | |
| kf5-kcodecs-5.116.0.pkg | 2025-12-18 01:51 | 152K | |
| kf5-kcompletion-5.11..> | 2025-12-26 10:06 | 116K | |
| kf5-kconfig-5.116.0.pkg | 2025-12-26 06:47 | 365K | |
| kf5-kconfigwidgets-5..> | 2025-12-26 08:55 | 414K | |
| kf5-kcontacts-5.116...> | 2025-12-27 02:49 | 273K | |
| kf5-kcoreaddons-5.11..> | 2025-12-18 01:37 | 483K | |
| kf5-kcrash-5.116.0.pkg | 2025-12-26 08:40 | 18K | |
| kf5-kdav-5.116.0,1.pkg | 2025-12-27 16:46 | 92K | |
| kf5-kdbusaddons-5.11..> | 2025-12-26 06:46 | 60K | |
| kf5-kdeclarative-5.1..> | 2025-12-26 19:02 | 259K | |
| kf5-kded-5.116.0.pkg | 2025-12-26 11:02 | 58K | |
| kf5-kdelibs4support-..> | 2025-12-27 10:50 | 3.5M | |
| kf5-kdesignerplugin-..> | 2025-12-26 21:12 | 72K | |
| kf5-kdesu-5.116.0.pkg | 2025-12-27 12:30 | 69K | |
| kf5-kdnssd-5.116.0.pkg | 2025-12-20 00:45 | 71K | |
| kf5-kdoctools-5.116...> | 2025-12-26 06:49 | 473K | |
| kf5-kemoticons-5.116..> | 2025-12-26 23:05 | 1.6M | |
| kf5-kfilemetadata-5...> | 2025-12-26 21:50 | 192K | |
| kf5-kglobalaccel-5.1..> | 2025-12-26 09:26 | 115K | |
| kf5-kguiaddons-5.116..> | 2025-12-26 08:32 | 92K | |
| kf5-kholidays-5.116...> | 2025-12-27 04:57 | 263K | |
| kf5-khtml-5.116.0.pkg | 2025-12-27 11:37 | 2.3M | |
| kf5-ki18n-5.116.0.pkg | 2025-12-26 06:34 | 1.7M | |
| kf5-kiconthemes-5.11..> | 2025-12-26 09:26 | 145K | |
| kf5-kidletime-5.116...> | 2025-12-26 20:54 | 41K | |
| kf5-kimageformats-5...> | 2025-12-27 09:08 | 212K | |
| kf5-kinit-5.116.0.pkg | 2025-12-26 22:37 | 118K | |
| kf5-kio-5.116.0_2.pkg | 2025-12-26 13:48 | 4.5M | |
| kf5-kirigami2-5.116...> | 2025-12-26 13:46 | 419K | |
| kf5-kitemmodels-5.11..> | 2025-12-27 01:15 | 130K | |
| kf5-kitemviews-5.116..> | 2025-12-26 09:23 | 103K | |
| kf5-kjobwidgets-5.11..> | 2025-12-26 11:53 | 94K | |
| kf5-kjs-5.116.0.pkg | 2025-12-18 23:20 | 350K | |
| kf5-kjsembed-5.116.0..> | 2025-12-27 10:43 | 375K | |
| kf5-kmediaplayer-5.1..> | 2025-12-27 03:48 | 20K | |
| kf5-knewstuff-5.116...> | 2025-12-26 15:38 | 855K | |
| kf5-knotifications-5..> | 2025-12-26 10:54 | 139K | |
| kf5-knotifyconfig-5...> | 2025-12-27 18:45 | 79K | |
| kf5-kpackage-5.116.0..> | 2025-12-26 13:49 | 174K | |
| kf5-kparts-5.116.0.pkg | 2025-12-26 18:54 | 248K | |
| kf5-kpeople-5.116.0.pkg | 2025-12-27 16:45 | 117K | |
| kf5-kplotting-5.116...> | 2025-12-27 18:43 | 39K | |
| kf5-kpty-5.116.0.pkg | 2025-12-26 20:51 | 46K | |
| kf5-kquickcharts-5.1..> | 2025-12-27 02:28 | 111K | |
| kf5-kross-5.116.0.pkg | 2025-12-27 04:52 | 366K | |
| kf5-krunner-5.116.0.pkg | 2025-12-27 13:08 | 146K | |
| kf5-kservice-5.116.0..> | 2025-12-26 09:06 | 327K | |
| kf5-ktexteditor-5.11..> | 2025-12-26 23:47 | 2.5M | |
| kf5-ktextwidgets-5.1..> | 2025-12-26 11:49 | 296K | |
| kf5-kunitconversion-..> | 2025-12-26 23:14 | 909K | |
| kf5-kwallet-5.116.0_..> | 2025-12-26 11:18 | 431K | |
| kf5-kwayland-5.116.0..> | 2025-12-26 09:24 | 534K | |
| kf5-kwidgetsaddons-5..> | 2025-12-26 06:49 | 1.6M | |
| kf5-kwindowsystem-5...> | 2025-12-26 09:01 | 184K | |
| kf5-kxmlgui-5.116.0.pkg | 2025-12-26 09:55 | 719K | |
| kf5-kxmlrpcclient-5...> | 2025-12-27 02:54 | 37K | |
| kf5-plasma-framework..> | 2025-12-26 21:32 | 1.1M | |
| kf5-prison-5.116.0.pkg | 2025-12-26 22:51 | 57K | |
| kf5-purpose-5.116.0_..> | 2025-12-27 15:20 | 292K | |
| kf5-qqc2-desktop-sty..> | 2025-12-27 06:11 | 80K | |
| kf5-solid-5.116.0.pkg | 2025-12-26 11:47 | 316K | |
| kf5-sonnet-5.116.0.pkg | 2025-12-26 09:58 | 311K | |
| kf5-style-qtcurve-1...> | 2025-12-30 15:02 | 311K | |
| kf5-syndication-5.11..> | 2025-12-26 12:31 | 193K | |
| kf5-syntax-highlight..> | 2025-12-26 20:13 | 1.6M | |
| kf5-threadweaver-5.1..> | 2025-12-26 20:44 | 67K | |
| kf6-attica-6.21.0.pkg | 2025-12-26 05:51 | 186K | |
| kf6-baloo-6.21.0.pkg | 2025-12-26 13:00 | 486K | |
| kf6-breeze-icons-6.2..> | 2025-12-26 04:46 | 10M | |
| kf6-extra-cmake-modu..> | 2025-12-26 04:27 | 570K | |
| kf6-frameworkintegra..> | 2025-12-26 09:53 | 68K | |
| kf6-frameworks-6.21...> | 2025-12-28 20:12 | 1.5K | |
| kf6-kapidox-6.21.0.pkg | 2025-12-27 09:46 | 74K | |
| kf6-karchive-6.21.0.pkg | 2025-12-26 04:34 | 180K | |
| kf6-kauth-6.21.0.pkg | 2025-12-26 04:59 | 101K | |
| kf6-kbookmarks-6.21...> | 2025-12-26 05:05 | 116K | |
| kf6-kcalendarcore-6...> | 2025-12-26 06:32 | 351K | |
| kf6-kcmutils-6.21.0.pkg | 2025-12-26 05:42 | 271K | |
| kf6-kcodecs-6.21.0.pkg | 2025-12-26 04:33 | 146K | |
| kf6-kcolorscheme-6.2..> | 2025-12-26 04:35 | 49K | |
| kf6-kcompletion-6.21..> | 2025-12-26 05:04 | 118K | |
| kf6-kconfig-6.21.0.pkg | 2025-12-26 04:30 | 472K | |
| kf6-kconfigwidgets-6..> | 2025-12-26 04:44 | 340K | |
| kf6-kcontacts-6.21.0..> | 2025-12-26 06:20 | 316K | |
| kf6-kcoreaddons-6.21..> | 2025-12-26 04:31 | 495K | |
| kf6-kcrash-6.21.0.pkg | 2025-12-26 04:36 | 23K | |
| kf6-kdav-6.21.0.pkg | 2025-12-26 13:51 | 105K | |
| kf6-kdbusaddons-6.21..> | 2025-12-26 04:37 | 68K | |
| kf6-kdeclarative-6.2..> | 2025-12-26 05:39 | 175K | |
| kf6-kded-6.21.0.pkg | 2025-12-26 04:41 | 31K | |
| kf6-kdesu-6.21.0.pkg | 2025-12-26 17:37 | 70K | |
| kf6-kdnssd-6.21.0.pkg | 2025-12-26 11:52 | 79K | |
| kf6-kdoctools-6.21.0..> | 2025-12-26 04:42 | 460K | |
| kf6-kfilemetadata-6...> | 2025-12-26 11:04 | 242K | |
| kf6-kglobalaccel-6.2..> | 2025-12-26 05:13 | 86K | |
| kf6-kguiaddons-6.21...> | 2025-12-26 04:32 | 137K | |
| kf6-kholidays-6.21.0..> | 2025-12-26 10:02 | 285K | |
| kf6-ki18n-6.21.0.pkg | 2025-12-26 04:29 | 1.7M | |
| kf6-kiconthemes-6.21..> | 2025-12-26 05:01 | 161K | |
| kf6-kidletime-6.21.0..> | 2025-12-26 10:48 | 49K | |
| kf6-kimageformats-6...> | 2025-12-26 18:39 | 516K | |
| kf6-kio-6.21.0.pkg | 2025-12-26 05:36 | 3.4M | |
| kf6-kirigami-6.21.0.pkg | 2025-12-26 05:46 | 809K | |
| kf6-kitemmodels-6.21..> | 2025-12-26 05:50 | 139K | |
| kf6-kitemviews-6.21...> | 2025-12-26 05:10 | 116K | |
| kf6-kjobwidgets-6.21..> | 2025-12-26 05:01 | 122K | |
| kf6-knewstuff-6.21.0..> | 2025-12-26 05:56 | 637K | |
| kf6-knotifications-6..> | 2025-12-26 04:40 | 107K | |
| kf6-knotifyconfig-6...> | 2025-12-26 14:41 | 58K | |
| kf6-kpackage-6.21.0.pkg | 2025-12-26 05:38 | 152K | |
| kf6-kparts-6.21.0.pkg | 2025-12-26 08:35 | 172K | |
| kf6-kpeople-6.21.0.pkg | 2025-12-27 12:30 | 156K | |
| kf6-kplotting-6.21.0..> | 2025-12-26 20:11 | 42K | |
| kf6-kpty-6.21.0.pkg | 2025-12-26 11:00 | 48K | |
| kf6-kquickcharts-6.2..> | 2025-12-26 13:39 | 173K | |
| kf6-krunner-6.21.0.pkg | 2025-12-26 06:19 | 193K | |
| kf6-kservice-6.21.0.pkg | 2025-12-26 04:38 | 187K | |
| kf6-kstatusnotifieri..> | 2025-12-26 13:57 | 111K | |
| kf6-ksvg-6.21.0.pkg | 2025-12-26 05:52 | 135K | |
| kf6-ktexteditor-6.21..> | 2025-12-26 13:38 | 2.7M | |
| kf6-ktexttemplate-6...> | 2025-12-26 05:52 | 273K | |
| kf6-ktextwidgets-6.2..> | 2025-12-26 05:33 | 299K | |
| kf6-kunitconversion-..> | 2025-12-26 06:55 | 1.1M | |
| kf6-kuserfeedback-6...> | 2025-12-26 13:48 | 316K | |
| kf6-kwallet-6.21.0.pkg | 2025-12-26 05:08 | 503K | |
| kf6-kwidgetsaddons-6..> | 2025-12-26 04:40 | 1.7M | |
| kf6-kwindowsystem-6...> | 2025-12-26 04:35 | 234K | |
| kf6-kxmlgui-6.21.0.pkg | 2025-12-26 05:27 | 664K | |
| kf6-networkmanager-q..> | 2025-12-27 07:38 | 433K | |
| kf6-prison-6.21.0.pkg | 2025-12-26 06:23 | 77K | |
| kf6-purpose-6.21.0.pkg | 2025-12-26 07:55 | 381K | |
| kf6-qqc2-desktop-sty..> | 2025-12-26 19:49 | 520K | |
| kf6-solid-6.21.0.pkg | 2025-12-26 05:08 | 367K | |
| kf6-sonnet-6.21.0.pkg | 2025-12-26 05:28 | 332K | |
| kf6-syndication-6.21..> | 2025-12-26 05:45 | 187K | |
| kf6-syntax-highlight..> | 2025-12-26 05:31 | 1.7M | |
| kf6-threadweaver-6.2..> | 2025-12-26 19:35 | 72K | |
| kfind-25.12.0.pkg | 2025-12-29 22:22 | 428K | |
| kfourinline-25.12.0.pkg | 2025-12-27 01:16 | 1.1M | |
| kfr-6.3.1.pkg | 2025-12-24 05:56 | 2.9M | |
| kgeography-25.12.0.pkg | 2025-12-26 22:51 | 11M | |
| kgeotag-1.8.0.pkg | 2025-12-30 08:07 | 484K | |
| kget-25.12.0.pkg | 2025-12-26 22:01 | 5.0M | |
| kgoldrunner-25.12.0.pkg | 2025-12-29 01:02 | 5.2M | |
| kgpg-25.12.0.pkg | 2025-12-26 21:38 | 3.2M | |
| kgraphviewer-25.12.0..> | 2025-12-27 02:42 | 1.3M | |
| khangman-25.12.0.pkg | 2025-12-26 20:35 | 6.5M | |
| khelpcenter-25.12.0.pkg | 2025-12-26 22:58 | 4.7M | |
| khmeros-5.0_2.pkg | 2025-12-29 12:03 | 309K | |
| khronos-texture-4.4...> | 2025-12-18 21:36 | 1.8M | |
| kibana8-8.11.3_1.pkg | 2025-12-28 06:09 | 178M | |
| kibi-0.3.1_2.pkg | 2025-12-28 18:13 | 234K | |
| kickoff-0.7.0_26.pkg | 2025-12-30 06:12 | 1.2M | |
| kickpass-0.2.0_3.pkg | 2025-08-21 09:06 | 27K | |
| kickshaw-0.5.26_1.pkg | 2025-12-30 16:49 | 78K | |
| kiconvtool-0.99_1.pkg | 2025-08-22 13:11 | 8.5K | |
| kid3-kf6-3.9.7_1.pkg | 2025-12-29 23:36 | 2.7M | |
| kid3-qt6-3.9.7_1.pkg | 2025-12-27 20:47 | 2.3M | |
| kidentitymanagement-..> | 2025-12-26 09:14 | 202K | |
| kig-25.12.0.pkg | 2025-12-26 22:06 | 3.5M | |
| kigo-25.12.0.pkg | 2025-12-30 03:47 | 4.8M | |
| kile-3.0.b4_5.pkg | 2025-12-30 14:24 | 7.2M | |
| killbots-25.12.0.pkg | 2025-12-26 21:48 | 1.3M | |
| kim-api-2.4.1.pkg | 2025-12-26 18:44 | 653K | |
| kimagemapeditor-25.1..> | 2025-12-28 10:01 | 1.1M | |
| kimap-25.12.0.pkg | 2025-12-26 07:02 | 260K | |
| kineto-g20211104_33.pkg | 2025-12-20 15:29 | 2.7M | |
| kio-extras-25.12.0.pkg | 2025-12-26 13:14 | 1.7M | |
| kio-fuse-5.1.1.pkg | 2025-12-26 13:09 | 64K | |
| kio-gdrive-25.12.0.pkg | 2025-12-29 18:06 | 140K | |
| kio-zeroconf-25.12.0..> | 2025-12-30 15:45 | 53K | |
| kippo-0.9_1.pkg | 2025-12-27 20:27 | 430K | |
| kirigami-addons-qt5-..> | 2025-12-29 01:25 | 143K | |
| kirigami-addons-qt6-..> | 2025-12-26 08:59 | 2.1M | |
| kirigami-gallery-25...> | 2025-12-28 04:31 | 309K | |
| kiriki-25.12.0.pkg | 2025-12-26 21:31 | 479K | |
| kismet-2016.07.r1_2,..> | 2025-08-21 07:50 | 1.1M | |
| kiss-templates-0.19_..> | 2025-08-16 05:40 | 22K | |
| kissat-4.0.4.pkg | 2025-12-18 20:22 | 333K | |
| kitinerary-25.12.0.pkg | 2025-12-26 18:48 | 1.8M | |
| kitty-0.44.0_1.pkg | 2025-12-28 06:51 | 19M | |
| kiwix-tools-3.7.0_1.pkg | 2025-12-24 07:31 | 32K | |
| kjumpingcube-25.12.0..> | 2025-12-26 21:44 | 475K | |
| kk-libreoffice-25.8...> | 2025-12-27 09:01 | 767K | |
| kktdirect-0.5_15.pkg | 2025-12-30 17:40 | 202K | |
| klatexformula-4.0.0_..> | 2025-12-28 09:11 | 2.8M | |
| klavaro-3.14_2.pkg | 2025-12-29 19:00 | 792K | |
| klayout-0.28.17.pkg | 2025-12-27 23:42 | 35M | |
| kldap-25.12.0.pkg | 2025-12-26 06:34 | 242K | |
| kldfind-0.61_1.pkg | 2025-08-21 03:52 | 5.4K | |
| kldpatch-20090116_1.pkg | 2025-08-18 04:14 | 11K | |
| klee-3.1.pkg | 2025-12-28 14:34 | 766K | |
| kleene-cli-0.1.0.pkg | 2025-12-21 06:51 | 151K | |
| kleene-daemon-0.1.0.pkg | 2025-08-20 05:00 | 6.6M | |
| kleopatra-25.12.0.pkg | 2025-12-30 08:55 | 3.3M | |
| klettres-25.12.0.pkg | 2025-12-26 22:54 | 38M | |
| klg-php81-1.5_1.pkg | 2025-12-28 06:43 | 14K | |
| klg-php82-1.5_1.pkg | 2025-12-27 21:59 | 14K | |
| klg-php83-1.5_1.pkg | 2025-12-29 00:39 | 14K | |
| klg-php84-1.5_1.pkg | 2025-12-28 17:57 | 14K | |
| klg-php85-1.5_1.pkg | 2025-12-30 00:07 | 14K | |
| klib-g20250105.pkg | 2025-08-14 23:27 | 80K | |
| klickety-25.12.0.pkg | 2025-12-26 22:55 | 1.4M | |
| klines-25.12.0.pkg | 2025-12-27 01:41 | 1.7M | |
| klish-2.1.4.pkg | 2025-08-19 03:23 | 173K | |
| klog-2.4.2_2.pkg | 2025-12-28 02:11 | 1.5M | |
| klondike-1.9_5.pkg | 2025-12-29 23:09 | 32K | |
| kludge3d-20040822_16..> | 2025-12-29 22:11 | 119K | |
| klystrack-1.7.8_1.pkg | 2025-12-29 18:13 | 309K | |
| km-libreoffice-25.8...> | 2025-12-27 19:33 | 3.3M | |
| kmag-25.12.0.pkg | 2025-12-27 17:58 | 766K | |
| kmahjongg-25.12.0.pkg | 2025-12-26 22:34 | 3.7M | |
| kmail-25.12.0.pkg | 2025-12-26 21:19 | 7.0M | |
| kmail-account-wizard..> | 2025-12-26 19:50 | 166K | |
| kmailtransport-25.12..> | 2025-12-26 17:07 | 265K | |
| kmbox-25.12.0.pkg | 2025-12-26 06:22 | 29K | |
| kmcp-0.9.4_19.pkg | 2025-12-23 13:16 | 3.7M | |
| kmfl-european-latin-..> | 2025-08-18 02:13 | 204K | |
| kmfl-khmer-1.0.pkg | 2025-08-18 02:56 | 1.9K | |
| kmfl-sil-ezra-2.4_5.pkg | 2025-08-19 00:49 | 92K | |
| kmfl-sil-galatia-1.0..> | 2025-08-18 15:25 | 186K | |
| kmfl-sil-ipa-unicode..> | 2025-08-22 13:33 | 563K | |
| kmfl-sil-panafrican-..> | 2025-08-21 07:25 | 644K | |
| kmfl-sil-yi-20020903..> | 2025-08-16 20:09 | 8.5K | |
| kmfl-varamozhi-malay..> | 2025-08-19 06:44 | 5.9K | |
| kmflcomp-0.9.9_2.pkg | 2025-08-14 05:12 | 134K | |
| kmime-25.12.0.pkg | 2025-12-26 05:57 | 147K | |
| kmines-25.12.0.pkg | 2025-12-26 21:15 | 1.1M | |
| kmix-25.12.0.pkg | 2025-12-28 10:04 | 1.2M | |
| kmousetool-25.12.0.pkg | 2025-12-27 16:52 | 223K | |
| kmouth-25.12.0.pkg | 2025-12-27 11:31 | 1.8M | |
| kmplayer-0.12.0b_8,3..> | 2025-12-28 10:16 | 715K | |
| kmplot-25.12.0.pkg | 2025-12-27 00:23 | 3.2M | |
| kmr_Latn-libreoffice..> | 2025-12-27 10:00 | 261K | |
| kms-cmake-utils-6.18..> | 2025-08-20 12:02 | 9.1K | |
| kmscube-gstreamer-s2..> | 2025-12-28 02:13 | 87K | |
| kmscube-s20241106.pkg | 2025-12-28 01:26 | 84K | |
| kmymoney-5.2.1.pkg | 2025-12-28 09:42 | 13M | |
| kn-aspell-0.01.1.pkg | 2025-12-23 08:15 | 458K | |
| kn-libreoffice-25.8...> | 2025-12-27 13:17 | 405K | |
| knavalbattle-25.12.0..> | 2025-12-26 20:25 | 1.5M | |
| knc-1.7.1_1.pkg | 2025-08-22 00:22 | 22K | |
| knetwalk-25.12.0.pkg | 2025-12-26 22:01 | 1.2M | |
| knews-1.0b.1_15.pkg | 2025-12-27 20:52 | 234K | |
| knightcap-3.6_9.pkg | 2025-08-17 23:15 | 121K | |
| knights-25.12.0.pkg | 2025-12-27 01:40 | 3.4M | |
| knock-0.8_1,1.pkg | 2025-08-21 04:33 | 22K | |
| knocker-0.8.0_1.pkg | 2025-08-22 20:52 | 18K | |
| knockpy-8.0.0_1.pkg | 2025-12-28 00:28 | 54K | |
| knot-resolver-5.7.6_..> | 2025-12-30 08:32 | 684K | |
| knot3-3.5.2.pkg | 2025-12-19 14:47 | 1.5M | |
| knotter-0.9.6.202202..> | 2025-12-28 23:38 | 3.0M | |
| knxd-0.14.72_2.pkg | 2025-12-22 07:33 | 323K | |
| ko-FreeWnn-lib-1.1.1..> | 2025-08-14 23:23 | 216K | |
| ko-FreeWnn-server-1...> | 2025-08-21 09:03 | 460K | |
| ko-aleefonts-ttf-13...> | 2025-12-30 02:29 | 260K | |
| ko-baekmukfonts-bdf-..> | 2025-12-27 23:12 | 6.8M | |
| ko-baekmukfonts-ttf-..> | 2025-12-29 15:40 | 8.8M | |
| ko-d2coding-ttf-1.3...> | 2025-12-29 15:43 | 3.3M | |
| ko-engdic-0.2_1.pkg | 2025-08-20 16:45 | 2.2M | |
| ko-fcitx-hangul-0.3...> | 2025-12-28 11:04 | 21K | |
| ko-fcitx5-hangul-5.1..> | 2025-12-30 07:20 | 53K | |
| ko-freebsd-doc-20251..> | 2025-12-19 22:14 | 226K | |
| ko-h2ps-2.06.pkg | 2025-08-19 20:26 | 28K | |
| ko-hanyangfonts-1.0_..> | 2025-12-28 19:19 | 2.3M | |
| ko-hcode-2.1.3_2.pkg | 2025-08-14 20:00 | 18K | |
| ko-hmconv-1.0.3_1.pkg | 2025-08-16 14:44 | 13K | |
| ko-hpscat-jshin-1.3...> | 2025-12-24 05:36 | 179K | |
| ko-hunspell-0.7.90_2..> | 2025-12-23 06:58 | 604K | |
| ko-ibus-hangul-1.5.1..> | 2025-12-28 10:25 | 43K | |
| ko-imhangul-gtk2-2.1..> | 2025-12-29 03:39 | 16K | |
| ko-imhangul-gtk3-3.1..> | 2025-12-29 18:25 | 16K | |
| ko-kaistfonts-ksc-1...> | 2025-12-29 12:20 | 737K | |
| ko-ko.TeX-0.1.1.2008..> | 2025-12-29 03:00 | 1.0M | |
| ko-ko.TeX-fonts-base..> | 2025-12-27 18:42 | 34M | |
| ko-ko.TeX-fonts-extr..> | 2025-12-28 20:58 | 55M | |
| ko-libhangul-0.1.0_3..> | 2025-12-19 14:43 | 1.9M | |
| ko-libreoffice-25.8...> | 2025-12-27 18:19 | 3.2M | |
| ko-munhwafonts-cid-1..> | 2025-08-19 17:24 | 8.7M | |
| ko-nabi-1.0.0_2.pkg | 2025-12-30 12:48 | 510K | |
| ko-nanum-barun-gothi..> | 2025-12-27 16:05 | 6.6M | |
| ko-nanum-barun-gothi..> | 2025-12-28 10:58 | 5.6M | |
| ko-nanum-barun-pen-2..> | 2025-12-27 12:02 | 3.0M | |
| ko-nanum-barun-pen-o..> | 2025-12-30 17:07 | 1.8M | |
| ko-nanum-brush-20220..> | 2025-12-27 04:06 | 917K | |
| ko-nanum-brush-otf-2..> | 2025-12-30 17:36 | 847K | |
| ko-nanum-gothic-2022..> | 2025-12-27 13:16 | 6.0M | |
| ko-nanum-gothic-codi..> | 2025-12-28 18:12 | 1.1M | |
| ko-nanum-gothic-eco-..> | 2025-12-28 02:50 | 8.3M | |
| ko-nanum-gothic-eco-..> | 2025-12-28 03:00 | 6.2M | |
| ko-nanum-gothic-otf-..> | 2025-12-29 03:50 | 4.4M | |
| ko-nanum-myeongjo-20..> | 2025-12-27 09:44 | 3.0M | |
| ko-nanum-myeongjo-ec..> | 2025-12-30 17:52 | 6.2M | |
| ko-nanum-myeongjo-ec..> | 2025-12-29 03:53 | 3.6M | |
| ko-nanum-myeongjo-ot..> | 2025-12-30 08:34 | 1.9M | |
| ko-nanum-pen-2022021..> | 2025-12-27 02:52 | 963K | |
| ko-nanum-pen-otf-202..> | 2025-12-29 23:10 | 969K | |
| ko-nanum-square-2022..> | 2025-12-27 13:08 | 921K | |
| ko-nanum-square-otf-..> | 2025-12-29 15:35 | 1.0M | |
| ko-nanum-square-roun..> | 2025-12-27 11:55 | 927K | |
| ko-nanum-square-roun..> | 2025-12-29 09:17 | 885K | |
| ko-nanumfonts-202202..> | 2025-12-29 21:04 | 672 | |
| ko-nhpf-1.42_1.pkg | 2025-08-16 23:45 | 29K | |
| ko-scim-hangul-0.4.0..> | 2025-12-29 07:21 | 40K | |
| ko-scim-tables-0.5.1..> | 2025-12-30 00:23 | 164K | |
| ko-sourcehansans-otf..> | 2025-12-30 19:07 | 85M | |
| ko-sourcehanserif-ot..> | 2025-12-30 08:12 | 107M | |
| ko-spoqahansans-ttf-..> | 2025-12-29 06:44 | 40M | |
| ko-unfonts-core-1.0...> | 2025-12-29 11:24 | 15M | |
| ko-unfonts-extra-1.0..> | 2025-12-29 02:34 | 6.8M | |
| ko-uniksc-0.9.pkg | 2025-08-21 07:15 | 25K | |
| kobodeluxe-0.5.1_15.pkg | 2025-12-29 17:14 | 1.5M | |
| koboldcpp-1.102.3.pkg | 2025-12-29 09:02 | 25M | |
| koboldcpp-portable-1..> | 2025-12-30 04:23 | 39M | |
| kodaskanna-0.1.0_3.pkg | 2025-12-28 22:18 | 36K | |
| kodi-platform-202504..> | 2025-12-18 19:13 | 8.7K | |
| koi8-u-gemini-x11-1...> | 2025-12-26 22:59 | 328K | |
| koi8-u-monaco-x11-1...> | 2025-12-30 11:39 | 21K | |
| kok-libreoffice-25.8..> | 2025-12-27 04:26 | 302K | |
| kokkos-4.5.01.pkg | 2025-12-18 20:37 | 652K | |
| kolf-25.12.0.pkg | 2025-12-26 22:23 | 1.3M | |
| kollision-25.12.0.pkg | 2025-12-26 20:35 | 386K | |
| kolourpaint-25.12.0.pkg | 2025-12-26 21:01 | 5.3M | |
| kommit-1.7.1.pkg | 2025-12-28 15:50 | 671K | |
| komodo-edit-11.0.2_1..> | 2025-12-20 11:55 | 55M | |
| kompare-25.12.0.pkg | 2025-12-27 18:58 | 933K | |
| komposter-g20201211_..> | 2025-12-30 12:53 | 147K | |
| kongress-25.12.0.pkg | 2025-12-29 18:42 | 185K | |
| konqueror-25.12.0.pkg | 2025-12-27 01:38 | 8.4M | |
| konquest-25.12.0.pkg | 2025-12-26 22:59 | 952K | |
| konsole-25.12.0.pkg | 2025-12-27 01:28 | 2.0M | |
| kontact-25.12.0.pkg | 2025-12-26 22:13 | 814K | |
| kontactinterface-25...> | 2025-12-26 13:52 | 53K | |
| kontrast-25.12.0.pkg | 2025-12-29 16:08 | 214K | |
| konversation-25.12.0..> | 2025-12-29 22:25 | 4.8M | |
| kooha-2.3.0_17.pkg | 2025-12-30 06:41 | 770K | |
| kooka-0.61.323_5,1.pkg | 2025-12-30 04:47 | 537K | |
| kookbook-0.2.1_4.pkg | 2025-12-29 00:13 | 86K | |
| kopeninghours-25.12...> | 2025-12-26 23:42 | 118K | |
| kopia-0.22.3.pkg | 2025-12-21 06:23 | 12M | |
| kops-1.34.1_1.pkg | 2025-12-21 15:42 | 47M | |
| korganizer-25.12.0.pkg | 2025-12-26 20:40 | 2.5M | |
| korgwm-5.0_2.pkg | 2025-12-29 13:05 | 42K | |
| kosmindoormap-25.12...> | 2025-12-27 03:01 | 1.0M | |
| kosmorro-0.10.13_2.pkg | 2025-12-27 21:03 | 514K | |
| kotlin-2.1.20.pkg | 2025-12-26 20:33 | 80M | |
| kpat-25.12.0.pkg | 2025-12-27 00:44 | 3.8M | |
| kpcli-3.1_2.pkg | 2025-12-23 14:12 | 54K | |
| kpeoplevcard-0.1_1.pkg | 2025-12-29 12:41 | 14K | |
| kphotoalbum-6.1.0.pkg | 2025-12-29 11:27 | 14M | |
| kpimtextedit-25.12.0..> | 2025-12-26 05:58 | 190K | |
| kpkpass-25.12.0.pkg | 2025-12-26 15:52 | 59K | |
| kplib-1.1.1.pkg | 2025-08-17 05:35 | 58K | |
| kplot-0.1.15_1.pkg | 2025-12-30 02:21 | 50K | |
| kpmcore-25.12.0.pkg | 2025-12-30 17:20 | 714K | |
| kpmenu-1.4.1_34.pkg | 2025-12-28 21:11 | 2.1M | |
| kproperty-3.2.0_3.pkg | 2025-12-26 20:30 | 210K | |
| kpublictransport-25...> | 2025-12-26 23:21 | 1.4M | |
| kqtquickcharts-25.12..> | 2025-12-26 19:54 | 54K | |
| kquickimageeditor-qt..> | 2025-12-27 18:39 | 89K | |
| kraft-1.2.2.pkg | 2025-12-29 13:39 | 5.3M | |
| krakend-ce-2.12.0_2.pkg | 2025-12-21 16:55 | 21M | |
| krank-07_12.pkg | 2025-12-29 06:23 | 24M | |
| krb5-1.22.1.pkg | 2025-12-24 20:10 | 4.2M | |
| krb5-120-1.20.2_4.pkg | 2025-12-20 07:56 | 3.8M | |
| krb5-121-1.21.3_1.pkg | 2025-12-30 09:39 | 4.2M | |
| krb5-122-1.22.1.pkg | 2025-12-30 00:14 | 4.2M | |
| krb5-devel-1.22.2025..> | 2025-12-28 06:38 | 1.3M | |
| krb5-ldap-1.22.1.pkg | 2025-12-29 15:16 | 4.3M | |
| krb5-ldap-120-1.20.2..> | 2025-12-22 07:10 | 3.8M | |
| krb5-ldap-121-1.21.3..> | 2025-12-28 05:26 | 4.3M | |
| krb5-ldap-122-1.22.1..> | 2025-12-27 20:10 | 4.3M | |
| krb5-ldap-devel-1.22..> | 2025-12-28 10:20 | 1.3M | |
| krdc-25.12.0.pkg | 2025-12-27 00:50 | 1.7M | |
| krename-5.0.2_4.pkg | 2025-12-30 04:44 | 475K | |
| kreport-3.2.0_11.pkg | 2025-12-27 14:38 | 384K | |
| kreversi-25.12.0.pkg | 2025-12-26 20:27 | 1.0M | |
| krfb-25.12.0.pkg | 2025-12-27 01:01 | 1.2M | |
| krill-0.15.0_4.pkg | 2025-12-29 23:20 | 11M | |
| krita-5.2.14.pkg | 2025-12-27 07:25 | 73M | |
| krita-gmic-plugin-3...> | 2025-12-30 07:16 | 8.5M | |
| kronometer-2.3.0_2.pkg | 2025-12-29 07:07 | 214K | |
| kronosnet-1.26_2.pkg | 2025-12-27 00:46 | 252K | |
| kruler-25.12.0.pkg | 2025-12-26 22:13 | 284K | |
| krusader-2.9.0_1.pkg | 2025-12-30 03:58 | 3.7M | |
| ks-libreoffice-25.8...> | 2025-12-27 10:14 | 250K | |
| ksanecore-25.12.0.pkg | 2025-12-26 16:42 | 88K | |
| kseexpr-4.0.4.0_1.pkg | 2025-12-27 00:59 | 418K | |
| ksh-1.0.10.pkg | 2025-08-15 02:17 | 619K | |
| ksh-devel-2025.10.13..> | 2025-12-21 03:37 | 619K | |
| ksh93-93.u_4,2.pkg | 2025-08-15 16:55 | 624K | |
| kshisen-25.12.0.pkg | 2025-12-27 02:05 | 1.0M | |
| kshutdown-6.0.pkg | 2025-12-28 14:29 | 273K | |
| ksirk-25.12.0.pkg | 2025-12-26 20:58 | 4.4M | |
| ksmtp-25.12.0.pkg | 2025-12-26 09:00 | 63K | |
| ksnakeduel-25.12.0.pkg | 2025-12-26 22:24 | 575K | |
| ksnip-1.10.1_2.pkg | 2025-12-29 02:41 | 529K | |
| kspaceduel-25.12.0.pkg | 2025-12-26 22:48 | 668K | |
| ksquares-25.12.0.pkg | 2025-12-27 01:11 | 401K | |
| kst-2.1.pkg | 2025-12-29 22:31 | 3.8M | |
| kstars-3.8.0,1.pkg | 2025-12-28 03:55 | 31M | |
| kstart-4.3_1.pkg | 2025-08-18 06:21 | 35K | |
| ksudoku-25.12.0.pkg | 2025-12-27 01:14 | 1.8M | |
| ksystemlog-25.12.0.pkg | 2025-12-26 22:29 | 1.9M | |
| ktcplist-1.0.2_4.pkg | 2025-12-30 14:52 | 259K | |
| kteatime-25.12.0.pkg | 2025-12-27 02:01 | 345K | |
| ktechlab-0.51.0_1.pkg | 2025-12-30 08:21 | 1.5M | |
| ktextaddons-1.8.0.pkg | 2025-12-26 05:49 | 1.3M | |
| ktimer-25.12.0.pkg | 2025-12-26 20:29 | 503K | |
| ktimetracker-6.0.0.pkg | 2025-12-29 23:27 | 422K | |
| ktnef-25.12.0.pkg | 2025-12-26 18:58 | 139K | |
| ktoblzcheck-1.59.pkg | 2025-12-24 04:22 | 90K | |
| ktoblzcheck-data-1.0..> | 2025-08-15 14:50 | 387K | |
| ktorrent-25.12.0.pkg | 2025-12-30 14:57 | 2.5M | |
| ktouch-25.12.0.pkg | 2025-12-26 20:29 | 4.3M | |
| ktuberling-25.12.0.pkg | 2025-12-26 22:17 | 73M | |
| kturtle-25.12.0.pkg | 2025-12-26 22:48 | 2.1M | |
| ktx-1.45.pkg | 2025-12-22 16:23 | 1.3M | |
| ku-aspell-0.20.1_1,1..> | 2025-12-23 03:20 | 84K | |
| kube-apiserver-1.27...> | 2025-12-21 07:20 | 22M | |
| kube-controller-mana..> | 2025-12-20 18:00 | 20M | |
| kube-scheduler-1.27...> | 2025-12-23 22:22 | 12M | |
| kubectl-1.35.0.pkg | 2025-12-26 21:47 | 17M | |
| kubetail-1.6.22.pkg | 2025-12-27 23:44 | 6.3K | |
| kubie-0.25.2_6.pkg | 2025-12-28 08:11 | 1.8M | |
| kubo-go-0.29.0_8.pkg | 2025-08-14 14:58 | 17M | |
| kubrick-25.12.0.pkg | 2025-12-27 00:21 | 536K | |
| kuklomenos-0.4.5_4.pkg | 2025-12-22 01:15 | 164K | |
| kuku-2.1.0.pkg | 2025-08-21 06:22 | 22K | |
| kunifiedpush-25.12.0..> | 2025-12-27 16:11 | 170K | |
| kustomize-5.8.0_1.pkg | 2025-12-23 14:49 | 6.3M | |
| kuzu-0.11.3.pkg | 2025-12-22 04:47 | 12M | |
| kvazaar-2.3.2.pkg | 2025-12-28 10:43 | 387K | |
| kwalletmanager-25.12..> | 2025-12-27 02:04 | 1.2M | |
| kwave-25.12.0.pkg | 2025-12-27 20:29 | 5.7M | |
| kweather-25.12.0.pkg | 2025-12-28 16:03 | 480K | |
| kweathercore-25.12.0..> | 2025-12-27 16:00 | 127K | |
| kwordquiz-25.12.0.pkg | 2025-12-27 00:36 | 3.0M | |
| kxstitch-2.2.0_7.pkg | 2025-12-30 14:53 | 2.0M | |
| ky-aspell-0.01.0.pkg | 2025-12-20 04:27 | 73K | |
| kyotocabinet-1.2.80_..> | 2025-08-13 23:28 | 1.5M | |
| kyototycoon-0.9.56_6..> | 2025-08-21 16:24 | 1.1M | |
| kyua-0.14.1,3.pkg | 2025-12-20 10:33 | 3.9M | |
| kzip-20200115_1.pkg | 2025-08-17 14:39 | 208K | |
| l-smash-2.18.0.10.pkg | 2025-12-19 02:21 | 332K | |
| l0pht-watch-1.1_1.pkg | 2025-08-16 10:52 | 456K | |
| l2a-1.2_1.pkg | 2025-08-20 18:14 | 16K | |
| l2p-1.1.1_6.pkg | 2025-12-29 00:18 | 9.0K | |
| l2tpd-0.69_12.pkg | 2025-12-29 13:42 | 45K | |
| la-aspell-20020503.0..> | 2025-12-21 16:46 | 133K | |
| la-capitaine-icon-th..> | 2025-08-14 07:01 | 1.7M | |
| lab-0.25.2.0.2023022..> | 2025-12-21 07:47 | 5.4M | |
| labplot-2.12.1_2.pkg | 2025-12-29 21:20 | 16M | |
| labwc-0.9.2.pkg | 2025-12-30 10:22 | 274K | |
| lace-work-stealing-2..> | 2025-08-18 14:19 | 22K | |
| lace14-work-stealing..> | 2025-12-19 11:51 | 24K | |
| lacheck-1.30.pkg | 2025-12-21 06:52 | 27K | |
| ladder-1.00_2.pkg | 2025-08-19 20:38 | 12K | |
| ladish-1.2_2.pkg | 2025-12-29 22:02 | 313K | |
| ladspa-1.17_1.pkg | 2025-12-26 16:40 | 28K | |
| ladvd-1.1.4.pkg | 2025-08-20 05:05 | 42K | |
| ladybird-g20240505_2..> | 2025-12-27 23:39 | 12M | |
| lafontaine-0.4.1_11.pkg | 2025-12-27 21:17 | 89K | |
| lager-0.1.1.pkg | 2025-12-26 21:43 | 44K | |
| lagrange-1.17.6_1.pkg | 2025-12-30 16:18 | 4.2M | |
| lamarc-2.1.8_2,1.pkg | 2025-08-18 01:45 | 2.9M | |
| lambda-0.1.4_2.pkg | 2025-12-20 06:21 | 31K | |
| lambdamoo-1.8.1_1.pkg | 2025-08-16 04:32 | 141K | |
| lame-3.100_5.pkg | 2025-08-10 21:13 | 377K | |
| laminar-1.3.pkg | 2025-12-22 09:15 | 277K | |
| lammps-20241119_3.pkg | 2025-12-27 18:17 | 31M | |
| lamprop-2020.12.28.pkg | 2025-12-22 05:03 | 126K | |
| lander-0.7.3_2.pkg | 2025-12-28 15:24 | 1.5M | |
| languageclient-neovi..> | 2025-12-30 06:45 | 1.4M | |
| lapack++-2.5.4_14.pkg | 2025-12-28 05:36 | 444K | |
| lapack-3.12.1.pkg | 2025-12-26 08:53 | 12M | |
| lapack95-1.0_22.pkg | 2025-12-28 06:15 | 817K | |
| lapacke-3.12.1.pkg | 2025-12-26 11:46 | 771K | |
| lapce-0.4.5_4.pkg | 2025-12-28 10:52 | 16M | |
| lapispuzzle-1.2_10.pkg | 2025-12-27 04:46 | 31K | |
| largetifftools-1.4.2..> | 2025-12-29 20:00 | 36K | |
| lasem-0.5.1_4.pkg | 2025-12-29 10:58 | 425K | |
| lash-0.5.4_21.pkg | 2025-12-27 16:13 | 117K | |
| lasi-1.1.3_2.pkg | 2025-12-27 00:34 | 144K | |
| laspack-1.12.2.pkg | 2025-08-21 01:55 | 116K | |
| lasso-2.9.0.pkg | 2025-12-19 22:20 | 354K | |
| lastpass-cli-1.6.1_1..> | 2025-12-29 21:49 | 74K | |
| laszip-3.5.1.pkg | 2025-08-13 21:52 | 120K | |
| latd-1.31_1.pkg | 2025-08-16 10:05 | 72K | |
| laternamagica-0.5_6.pkg | 2025-12-27 15:07 | 51K | |
| latex-beamer-3.71.pkg | 2025-12-29 15:33 | 565K | |
| latex-biber-2.21,2.pkg | 2025-12-28 12:43 | 254K | |
| latex-jlisting-0.2.pkg | 2025-12-30 02:37 | 2.8K | |
| latex-ltablex-1.0_2.pkg | 2025-12-29 01:25 | 228K | |
| latex-mk-2.1_5.pkg | 2025-12-29 12:15 | 226K | |
| latex-resume-2001082..> | 2025-12-29 18:28 | 8.1K | |
| latex-service-0.1_12..> | 2025-12-27 11:33 | 5.0K | |
| latex2html-2016_3.pkg | 2025-12-28 10:28 | 700K | |
| latex2rtf-2.3.18_2.pkg | 2025-08-17 06:46 | 139K | |
| latexdiff-1.3.4.pkg | 2025-12-21 04:14 | 103K | |
| lato-g20180831_1.pkg | 2025-12-28 08:22 | 3.1M | |
| latte-1.2.2_6.pkg | 2025-12-27 02:04 | 421K | |
| latte-dock-0.10.9_1.pkg | 2025-12-30 16:55 | 1.3M | |
| latte-integrale-1.7...> | 2025-12-28 06:11 | 7.6M | |
| lava-1.0.1.pkg | 2025-12-21 22:18 | 2.3K | |
| lavalauncher-2.1.1_1..> | 2025-12-28 01:42 | 34K | |
| lavinmq-2.5.2.pkg | 2025-12-22 21:50 | 4.0M | |
| layan-gtk-themes-202..> | 2025-12-30 06:13 | 169K | |
| lazarus-gtk2-4.4_1.pkg | 2025-12-27 08:13 | 175M | |
| lazarus-gtk2-devel-4..> | 2025-12-29 07:57 | 185M | |
| lazarus-gtk3-devel-4..> | 2025-12-29 01:11 | 192M | |
| lazarus-qt5-4.4_1.pkg | 2025-12-27 10:13 | 175M | |
| lazarus-qt5-devel-4...> | 2025-12-30 00:12 | 185M | |
| lazarus-qt6-4.4_1.pkg | 2025-12-27 16:03 | 175M | |
| lazarus-qt6-devel-4...> | 2025-12-30 01:20 | 186M | |
| lazpaint-gtk2-7.3_8.pkg | 2025-12-30 02:00 | 3.9M | |
| lazpaint-qt5-7.3_8.pkg | 2025-12-29 12:37 | 3.9M | |
| lazpaint-qt6-7.3_8.pkg | 2025-12-29 00:58 | 3.9M | |
| lazperf-3.4.0.pkg | 2025-12-18 16:37 | 84K | |
| lazycli-0.1.15_27.pkg | 2025-12-29 07:41 | 729K | |
| lazygit-0.57.0.pkg | 2025-12-29 13:43 | 6.0M | |
| lazyread-2.0.pkg | 2025-08-20 22:51 | 14K | |
| lazyssh-0.3.0_3.pkg | 2025-12-20 16:58 | 2.1M | |
| lb-libreoffice-25.8...> | 2025-12-27 19:44 | 119K | |
| lbdb-0.42.1_1.pkg | 2025-12-23 04:27 | 46K | |
| lbl-cf-1.2.8.pkg | 2025-08-15 01:36 | 6.1K | |
| lbl-hf-1.11.pkg | 2025-08-14 13:26 | 19K | |
| lbrate-1.1_3.pkg | 2025-08-19 18:07 | 20K | |
| lbreakout-010315_10.pkg | 2025-12-23 04:21 | 558K | |
| lbreakout2-2.6.5_1.pkg | 2025-12-30 18:48 | 2.4M | |
| lbreakouthd-1.1.11_1..> | 2025-12-30 08:29 | 3.6M | |
| lbzip2-2.5.pkg | 2025-08-22 07:10 | 88K | |
| lc-1.0_1.pkg | 2025-08-22 17:28 | 6.1K | |
| lcab-1.0b12.pkg | 2025-08-18 23:22 | 8.1K | |
| lcalc-2.1.1_1.pkg | 2025-12-20 05:42 | 845K | |
| lcdproc-0.5.9_1.pkg | 2025-12-30 00:23 | 275K | |
| lcdtest-1.18_11.pkg | 2025-12-29 16:15 | 13K | |
| lci-0.11.2_4.pkg | 2025-12-21 04:31 | 216K | |
| lcms-1.19_9,1.pkg | 2025-12-26 13:42 | 249K | |
| lcms2-2.17.pkg | 2025-12-24 21:52 | 2.2M | |
| lcov-1.15_1.pkg | 2025-12-18 07:04 | 93K | |
| ldap-account-manager..> | 2025-12-29 04:27 | 31M | |
| ldap-stats-5.2_1.pkg | 2025-12-21 01:16 | 7.9K | |
| ldapbrowser-2.8.2_6.pkg | 2025-12-30 14:49 | 626K | |
| ldapdiff-1.4.1_6.pkg | 2025-08-20 23:12 | 27K | |
| ldapdns-2.07_4.pkg | 2025-08-19 10:42 | 87K | |
| ldapscripts-2.0.8_2.pkg | 2025-08-17 05:23 | 45K | |
| ldapsdk-6.0.7_1,1.pkg | 2025-12-20 19:30 | 7.9K | |
| ldapsh-2.00_4,1.pkg | 2025-12-22 15:07 | 41K | |
| ldapvi-1.7_7.pkg | 2025-12-22 04:16 | 64K | |
| ldb25-2.5.3_1.pkg | 2025-12-18 20:34 | 192K | |
| ldb28-2.8.2_1.pkg | 2025-12-19 07:25 | 223K | |
| ldb29-2.9.2_2.pkg | 2025-12-19 07:03 | 223K | |
| ldc-1.41.0.pkg | 2025-12-18 09:13 | 17M | |
| ldmud-3.3.720_7,1.pkg | 2025-12-20 10:59 | 1.0M | |
| ldns-1.9.0.pkg | 2025-12-26 14:50 | 583K | |
| ldraw-20220211,1.pkg | 2025-08-14 17:14 | 41M | |
| ldview-4.6.pkg | 2025-12-30 07:57 | 819K | |
| le-1.16.8_2.pkg | 2025-12-23 17:25 | 183K | |
| leafnode-1.12.0_1.pkg | 2025-12-23 10:38 | 320K | |
| leafpad-0.8.19_3.pkg | 2025-12-30 07:24 | 104K | |
| leafpak-1.1.1.pkg | 2025-08-18 18:57 | 8.6K | |
| league-gothic-1.601.pkg | 2025-12-28 03:52 | 52K | |
| league-spartan-2.220..> | 2025-12-29 20:02 | 250K | |
| leaktracer-2.4.pkg | 2025-12-20 05:51 | 12K | |
| lean4-4.25.2.2025120..> | 2025-12-21 10:21 | 438M | |
| leangz-0.1.14.pkg | 2025-12-22 11:17 | 506K | |
| lebiniou-data-3.66.0..> | 2025-08-15 19:31 | 51M | |
| ledger-3.3.2_6.pkg | 2025-12-20 12:40 | 930K | |
| ledgersmb-1.2.26_2.pkg | 2025-12-22 23:43 | 1.4M | |
| ledit-2.06.pkg | 2025-08-15 22:57 | 372K | |
| leela-zero-0.17.31_1..> | 2025-12-27 14:41 | 425K | |
| lefthook-2.0.5_1.pkg | 2025-12-21 18:00 | 4.5M | |
| leftwm-0.5.4_8.pkg | 2025-12-29 04:31 | 8.1M | |
| legend-of-edgar-1.37..> | 2025-12-29 20:12 | 86M | |
| legesmotus-0.4.0_9.pkg | 2025-12-27 22:36 | 1.1M | |
| lego-4.30.1.pkg | 2025-12-28 00:57 | 14M | |
| leiningen-2.11.1.pkg | 2025-12-30 04:01 | 13M | |
| lemon-3.34.pkg | 2025-08-15 12:58 | 48K | |
| lemonbar-1.5.pkg | 2025-12-30 07:50 | 18K | |
| lemonbar-xft-g202012..> | 2025-12-30 08:00 | 21K | |
| lens-0.2_2.pkg | 2025-12-21 12:43 | 6.7K | |
| lensfun-0.3.95_4.pkg | 2025-12-26 20:42 | 350K | |
| lenticular-lv2-0.5.0..> | 2025-08-21 10:45 | 274K | |
| leo_center-0.4.70_1.pkg | 2025-12-28 11:49 | 5.9M | |
| leocad-25.09.pkg | 2025-12-29 15:15 | 1.8M | |
| leofs-1.4.3_2.pkg | 2025-08-20 19:06 | 20M | |
| leproxy-0.2.2.pkg | 2025-12-30 09:23 | 52K | |
| lepton-eda-1.9.18_4.pkg | 2025-12-28 17:02 | 6.6M | |
| leptonica-1.86.0.pkg | 2025-12-26 19:53 | 1.2M | |
| lerc-4.0.0.pkg | 2025-08-10 21:27 | 176K | |
| less-685.pkg | 2025-12-20 19:10 | 144K | |
| lesspipe-2.06_1.pkg | 2025-12-21 05:40 | 32K | |
| lesstif-0.95.2_8,2.pkg | 2025-12-27 18:07 | 1.4M | |
| lets-0.0.54_12.pkg | 2025-12-21 03:45 | 3.0M | |
| letsdns-1.0.1_2.pkg | 2025-12-27 22:34 | 34K | |
| level-zero-1.26.1.pkg | 2025-12-26 06:21 | 557K | |
| leveldb-1.23_1.pkg | 2025-08-13 14:16 | 182K | |
| levmar-2.6_17.pkg | 2025-12-30 10:10 | 108K | |
| lewton-0.10.2_42.pkg | 2025-12-29 05:50 | 376K | |
| lexbor-2.6.0.pkg | 2025-12-27 21:32 | 1.2M | |
| lexilla-5.4.4.pkg | 2025-08-15 02:35 | 486K | |
| lexter-1.0.3_7.pkg | 2025-12-21 13:10 | 183K | |
| lf-39_1.pkg | 2025-12-20 19:40 | 1.9M | |
| lfacme-1.0.pkg | 2025-12-23 20:31 | 17K | |
| lfcbase-1.23.2.pkg | 2025-12-26 18:05 | 223K | |
| lfcxml-1.3.9.pkg | 2025-12-26 22:59 | 63K | |
| lfe-2.2.0.pkg | 2025-12-23 04:58 | 782K | |
| lfm-3.1_1.pkg | 2025-12-23 13:20 | 196K | |
| lfortran-0.58.0.pkg | 2025-12-21 05:08 | 9.2M | |
| lfpfonts-fix-0.82_5.pkg | 2025-12-30 06:44 | 287K | |
| lfpfonts-var-0.83_5.pkg | 2025-12-30 02:35 | 350K | |
| lft-3.91_1,2.pkg | 2025-08-20 17:09 | 66K | |
| lftp-4.9.3_1.pkg | 2025-12-21 00:28 | 1.0M | |
| lfview-1.1a_3.pkg | 2025-08-20 19:41 | 44K | |
| lg-1.9.s20140622_1.pkg | 2025-12-22 11:11 | 41K | |
| lgeneral-1.4.4_1.pkg | 2025-12-22 10:05 | 1.8M | |
| lgogdownloader-3.17_..> | 2025-12-22 04:28 | 441K | |
| lha-1.14i_10.pkg | 2025-08-15 18:48 | 102K | |
| lha-ac-1.14i.2025092..> | 2025-12-22 11:29 | 57K | |
| lhasa-0.4.0.pkg | 2025-08-15 01:19 | 59K | |
| lib2geom-1.4_3.pkg | 2025-12-26 20:28 | 512K | |
| lib3ds-1.3.0_8.pkg | 2025-08-15 18:27 | 88K | |
| lib3mf-2.4.1_1.pkg | 2025-12-20 01:45 | 1.1M | |
| lib765-0.4.2_2.pkg | 2025-08-17 15:01 | 31K | |
| lib1541img-1.1_1.pkg | 2025-08-15 21:35 | 48K | |
| libArcus-5.3.0_6,1.pkg | 2025-12-26 21:27 | 90K | |
| libCello-2.1.0.pkg | 2025-08-17 08:49 | 254K | |
| libCharon-5.0.0.pkg | 2025-12-19 10:07 | 21K | |
| libEMF-1.0.13_1.pkg | 2025-08-14 06:31 | 639K | |
| libFS-1.0.9.pkg | 2025-08-14 06:01 | 37K | |
| libGLU-9.0.3.pkg | 2025-08-13 04:40 | 229K | |
| libHX-4.27.pkg | 2025-08-14 17:46 | 102K | |
| libICE-1.1.2,1.pkg | 2025-08-10 21:08 | 97K | |
| libIDL-0.8.14_5.pkg | 2025-12-19 02:27 | 141K | |
| libQGLViewer-2.9.1.pkg | 2025-12-26 13:54 | 250K | |
| libRmath-4.5.2.pkg | 2025-12-27 17:06 | 174K | |
| libSM-1.2.6,1.pkg | 2025-08-10 21:09 | 26K | |
| libSavitar-5.3.0.pkg | 2025-12-19 11:01 | 100K | |
| libX11-1.8.12,1.pkg | 2025-08-10 21:18 | 1.7M | |
| libXScrnSaver-1.2.4_..> | 2025-08-11 00:01 | 16K | |
| libXau-1.0.12.pkg | 2025-08-10 21:08 | 12K | |
| libXaw-1.0.16,2.pkg | 2025-12-17 23:05 | 502K | |
| libXaw3d-1.6.6.pkg | 2025-12-18 19:04 | 271K | |
| libXcm-0.5.4_1.pkg | 2025-08-14 00:54 | 41K | |
| libXcomposite-0.4.6_..> | 2025-08-10 22:18 | 11K | |
| libXcursor-1.2.3.pkg | 2025-08-10 22:47 | 44K | |
| libXdamage-1.1.6.pkg | 2025-08-10 22:16 | 6.6K | |
| libXdmcp-1.1.5.pkg | 2025-08-10 21:08 | 16K | |
| libXext-1.3.6,1.pkg | 2025-08-10 21:23 | 97K | |
| libXfixes-6.0.1.pkg | 2025-08-10 21:23 | 15K | |
| libXfont-1.5.4_3,2.pkg | 2025-12-27 11:33 | 168K | |
| libXfont2-2.0.6.pkg | 2025-12-26 10:04 | 173K | |
| libXft-2.3.8.pkg | 2025-12-24 21:49 | 81K | |
| libXi-1.8.2,1.pkg | 2025-08-10 21:23 | 127K | |
| libXinerama-1.1.5,1.pkg | 2025-08-10 22:19 | 11K | |
| libXmu-1.1.4,1.pkg | 2025-08-10 21:23 | 102K | |
| libXpm-3.5.17_1.pkg | 2025-12-17 22:59 | 93K | |
| libXpresent-1.0.1.pkg | 2025-08-13 15:35 | 17K | |
| libXrandr-1.5.4.pkg | 2025-08-10 21:24 | 31K | |
| libXrender-0.9.12.pkg | 2025-08-10 21:21 | 33K | |
| libXres-1.2.2_1.pkg | 2025-08-13 09:55 | 9.7K | |
| libXt-1.3.0,1.pkg | 2025-08-10 21:21 | 474K | |
| libXtst-1.2.5.pkg | 2025-08-10 21:39 | 19K | |
| libXv-1.0.13,1.pkg | 2025-08-10 22:17 | 36K | |
| libXvMC-1.0.14.pkg | 2025-08-14 02:23 | 27K | |
| libXxf86dga-1.1.6_1.pkg | 2025-08-13 15:50 | 20K | |
| libXxf86vm-1.1.6.pkg | 2025-08-10 22:10 | 17K | |
| liba52-0.8.0_2.pkg | 2025-08-13 09:14 | 50K | |
| libaacs-0.11.1_1.pkg | 2025-12-20 00:02 | 83K | |
| libabigail-2.0_3.pkg | 2025-12-24 04:45 | 1.8M | |
| libabw-0.1.3_4.pkg | 2025-12-18 16:37 | 88K | |
| libac-g20190308_1.pkg | 2025-08-13 14:43 | 19K | |
| libaccounts-glib-1.2..> | 2025-12-18 00:24 | 117K | |
| libaccounts-qt5-1.17..> | 2025-12-18 23:43 | 501K | |
| libaccounts-qt6-1.17..> | 2025-12-26 05:40 | 467K | |
| libad9361-iio-0.3.pkg | 2025-12-18 17:14 | 79K | |
| libada-3.3.0.pkg | 2025-12-20 03:38 | 243K | |
| libadplug-2.4.pkg | 2025-08-15 06:32 | 536K | |
| libadwaita-1.7.7.pkg | 2025-12-26 10:59 | 4.2M | |
| libaec-1.1.4.pkg | 2025-08-13 04:02 | 27K | |
| libaegis-0.9.0.pkg | 2025-12-21 14:56 | 182K | |
| libafterbase-0.92_3.pkg | 2025-08-18 18:28 | 60K | |
| libafterimage-1.20_1..> | 2025-12-30 06:25 | 300K | |
| libaiff-6.0.pkg | 2025-08-15 19:53 | 19K | |
| libamrnb-11.0.0.0_2,..> | 2025-08-16 03:49 | 267K | |
| libamrwb-11.0.0.0_3.pkg | 2025-08-16 04:57 | 174K | |
| libansilove-1.4.2.pkg | 2025-12-27 02:50 | 47K | |
| libantlr3c-3.4_1.pkg | 2025-08-13 15:12 | 119K | |
| libantlr4-4.13.2_1.pkg | 2025-12-20 19:34 | 634K | |
| libao-1.2.0_7.pkg | 2025-12-18 07:03 | 50K | |
| libappindicator-12.1..> | 2025-12-27 18:21 | 63K | |
| libapreq2-2.17.pkg | 2025-12-19 00:27 | 69K | |
| libaravis-0.8.34_1.pkg | 2025-12-20 00:44 | 1.5M | |
| libarc-2.0.2_2.pkg | 2025-08-14 02:27 | 67K | |
| libarchive-3.8.3,1.pkg | 2025-12-18 03:52 | 537K | |
| libarchive-qt-2.0.8.pkg | 2025-12-28 19:14 | 78K | |
| libarea-20191031_1.pkg | 2025-12-20 06:49 | 374K | |
| libarena-0.3.7.pkg | 2025-08-16 00:51 | 16K | |
| libargon2-20190702_1..> | 2025-08-13 02:04 | 63K | |
| libarms-6.50.pkg | 2025-12-23 13:55 | 462K | |
| libart_lgpl-2.3.21_3..> | 2025-08-13 17:07 | 87K | |
| libartnet-1.2.0.pkg | 2025-08-19 21:09 | 41K | |
| libass-0.17.4.pkg | 2025-12-24 21:55 | 160K | |
| libassa-3.5.1_2.pkg | 2025-08-22 04:27 | 343K | |
| libassetml-1.2.1_17.pkg | 2025-12-22 15:24 | 24K | |
| libassuan-3.0.2.pkg | 2025-12-17 22:56 | 82K | |
| libast-0.7_16.pkg | 2025-12-27 04:06 | 178K | |
| libastylej-3.0.1_2.pkg | 2025-12-29 19:56 | 114K | |
| libastylej-arduino-3..> | 2025-12-27 06:34 | 114K | |
| libatomic_ops-7.10.0..> | 2025-12-16 01:28 | 96K | |
| libaudec-0.3.4_1.pkg | 2025-12-27 15:59 | 48K | |
| libaudiofile-0.3.6_6..> | 2025-08-14 04:47 | 201K | |
| libavif-1.3.0_2.pkg | 2025-12-26 06:37 | 247K | |
| libavl-1.4.0_1.pkg | 2025-08-17 00:24 | 21K | |
| libayatana-appindica..> | 2025-12-26 18:30 | 83K | |
| libayatana-indicator..> | 2025-12-26 14:54 | 97K | |
| libb2-0.98.1_1.pkg | 2025-08-12 22:23 | 40K | |
| libb64-2.0.0.15.pkg | 2025-08-13 19:11 | 13K | |
| libbacktrace-1.0.202..> | 2025-12-19 22:44 | 59K | |
| libbase64-0.5.2.pkg | 2025-12-26 14:09 | 20K | |
| libbde-a.20240502.pkg | 2025-12-18 23:46 | 771K | |
| libbdplus-0.2.0.pkg | 2025-12-20 07:52 | 81K | |
| libbegemot-1.11_6.pkg | 2025-08-21 12:04 | 91K | |
| libbfd-2.40.pkg | 2025-08-22 08:56 | 3.6M | |
| libbgcode-0.2.0_6.pkg | 2025-12-19 09:28 | 68K | |
| libbgpdump-1.6.0.pkg | 2025-08-14 19:27 | 80K | |
| libbigwig-0.4.8.pkg | 2025-12-24 06:00 | 36K | |
| libbind-6.0_2.pkg | 2025-08-18 12:46 | 229K | |
| libbinio-1.5.pkg | 2025-08-14 09:03 | 34K | |
| libblake3-1.8.2.pkg | 2025-12-19 03:03 | 24K | |
| libblkid-2.41.1_2.pkg | 2025-12-18 14:18 | 248K | |
| libbluray-1.4.0,1.pkg | 2025-12-24 21:54 | 143K | |
| libboard-0.9.6_1.pkg | 2025-12-29 01:30 | 1.4M | |
| libbpfjit-g202008280..> | 2025-08-21 11:14 | 8.4K | |
| libbpg-0.9.8_4.pkg | 2025-12-30 00:01 | 462K | |
| libbpm-0.3_1.pkg | 2025-08-19 07:28 | 199K | |
| libbraiding-1.3.1.pkg | 2025-08-19 04:29 | 134K | |
| libbs2b-3.1.0_8.pkg | 2025-12-27 01:07 | 19K | |
| libbson-1.30.4.pkg | 2025-08-13 22:17 | 680K | |
| libbtc-g20210428_1.pkg | 2025-08-17 21:28 | 308K | |
| libburn-1.5.6_1.pkg | 2025-08-13 18:08 | 393K | |
| libc6-shim-20251025.pkg | 2025-12-22 06:32 | 1.1M | |
| libcabinet-0.31.pkg | 2025-08-18 01:01 | 48K | |
| libcaca-0.99.b20_1.pkg | 2025-12-26 20:28 | 317K | |
| libcaes-a.20240413.pkg | 2025-12-18 17:09 | 36K | |
| libcanberra-0.30_12.pkg | 2025-08-13 00:42 | 36K | |
| libcanberra-gstreame..> | 2025-12-30 14:02 | 7.6K | |
| libcanberra-gtk2-0.3..> | 2025-12-27 15:38 | 18K | |
| libcanberra-gtk3-0.3..> | 2025-12-26 09:24 | 14K | |
| libcanberra-pulse-0...> | 2025-12-26 19:10 | 12K | |
| libcapn-1.1.0.pkg | 2025-08-18 14:29 | 22K | |
| libcbor-0.13.0.pkg | 2025-12-18 00:12 | 51K | |
| libccd-2.1.pkg | 2025-08-13 14:08 | 24K | |
| libccid-1.6.2.pkg | 2025-12-18 21:32 | 64K | |
| libccp4-8.0.0.pkg | 2025-12-27 09:03 | 413K | |
| libcdada-0.5.2.pkg | 2025-12-19 05:48 | 130K | |
| libcdaudio-0.99.12p2..> | 2025-08-14 02:29 | 60K | |
| libcdb-g2020082801.pkg | 2025-08-19 10:41 | 29K | |
| libcdio-2.3.0.pkg | 2025-12-26 14:45 | 265K | |
| libcdio-paranoia-10...> | 2025-12-26 15:36 | 84K | |
| libcdr01-0.1.8_1.pkg | 2025-12-26 20:04 | 363K | |
| libcds-2.3.3.102_1.pkg | 2025-08-20 02:48 | 367K | |
| libcec-7.1.1.pkg | 2025-08-13 14:16 | 406K | |
| libceed-0.12.0.763.pkg | 2025-12-29 09:23 | 186K | |
| libcelero-2.9.0.pkg | 2025-08-20 09:26 | 111K | |
| libcerf-2.4.pkg | 2025-08-14 19:39 | 45K | |
| libcfu-0.04.a_3.pkg | 2025-08-15 02:44 | 45K | |
| libchamplain-0.12.21..> | 2025-12-27 10:22 | 155K | |
| libchdr-g20250522.pkg | 2025-12-19 22:53 | 120K | |
| libchipcard-5.1.6.pkg | 2025-12-21 03:39 | 308K | |
| libchk-1.10.3_1.pkg | 2025-12-19 10:59 | 5.5K | |
| libcidr-1.2.3_1.pkg | 2025-08-15 06:56 | 136K | |
| libcifpp-7.0.8_3.pkg | 2025-12-19 06:57 | 73M | |
| libcii-1.1.pkg | 2025-08-21 08:37 | 145K | |
| libcint-6.1.3.pkg | 2025-12-27 00:54 | 565K | |
| libcircllhist-g20221..> | 2025-08-18 15:43 | 207K | |
| libcjson-1.7.19.pkg | 2025-12-18 12:53 | 39K | |
| libclc-llvm15-15.0.7..> | 2025-08-19 19:18 | 10M | |
| libclc-llvm16-16.0.6..> | 2025-08-16 14:13 | 10M | |
| libclc-llvm17-17.0.6..> | 2025-08-16 10:22 | 9.8M | |
| libclc-llvm18-18.1.8..> | 2025-08-18 18:39 | 9.9M | |
| libclc-llvm19-19.1.3..> | 2025-08-11 00:02 | 12M | |
| libclipboard-1.1.pkg | 2025-08-20 00:54 | 9.1K | |
| libcloudproviders-0...> | 2025-12-18 17:55 | 44K | |
| libcmime-0.2.1_4.pkg | 2025-08-14 02:21 | 43K | |
| libcmis-0.6.2_7.pkg | 2025-12-18 17:25 | 837K | |
| libcoap-4.3.5.pkg | 2025-12-23 12:05 | 9.2M | |
| libcombine-0.2.20_1.pkg | 2025-12-20 06:04 | 274K | |
| libcompizconfig-0.8...> | 2025-12-20 21:43 | 84K | |
| libcomps-0.1.23.pkg | 2025-12-19 20:18 | 106K | |
| libconcurrent-0.0.20..> | 2025-08-16 17:16 | 7.4K | |
| libconfig-1.8.1.pkg | 2025-08-13 09:20 | 105K | |
| libconfuse-3.3_2.pkg | 2025-12-18 10:31 | 59K | |
| libconvolve-0.0.8_8.pkg | 2025-12-30 17:37 | 11K | |
| libcouchbase-3.3.8_1..> | 2025-12-20 10:14 | 790K | |
| libcoverart-1.0.0_6.pkg | 2025-12-19 23:27 | 34K | |
| libcprime-5.0.0.pkg | 2025-12-26 20:26 | 161K | |
| libcpucycles-2025092..> | 2025-12-23 17:28 | 11K | |
| libcpuid-0.8.1.pkg | 2025-12-18 17:27 | 116K | |
| libcreg-e.20240419.pkg | 2025-12-18 19:53 | 693K | |
| libcroco-0.6.13_3.pkg | 2025-12-19 09:54 | 217K | |
| libcrossguid-0.2.2.5..> | 2025-08-13 16:18 | 12K | |
| libcsptr-2.0.4.24.pkg | 2025-08-16 00:04 | 7.0K | |
| libcss-0.9.2.pkg | 2025-12-19 07:14 | 157K | |
| libcsv-3.0.3_4.pkg | 2025-08-15 19:12 | 17K | |
| libctl-4.5.0_5.pkg | 2025-12-27 02:01 | 235K | |
| libcuckoo-0.3.1.pkg | 2025-08-13 22:00 | 32K | |
| libcue-2.3.0.pkg | 2025-08-13 14:28 | 21K | |
| libcutl-1.11.0_1.pkg | 2025-08-13 06:40 | 91K | |
| libcwd-1.0.6_6.pkg | 2025-12-28 12:06 | 101K | |
| libcyaml-1.4.2.pkg | 2025-08-15 14:11 | 38K | |
| libdaemon-0.14_1.pkg | 2025-08-10 21:31 | 27K | |
| libdap-3.21.1_2.pkg | 2025-12-23 05:01 | 2.2M | |
| libdaq-3.0.23.pkg | 2025-12-19 23:28 | 127K | |
| libdatachannel-0.24...> | 2025-12-19 00:23 | 777K | |
| libdatadog-24.0.2_1.pkg | 2025-12-26 19:47 | 249M | |
| libdatovka-0.7.2.pkg | 2025-12-19 14:58 | 259K | |
| libdatrie-0.2.14_1.pkg | 2025-12-16 01:29 | 31K | |
| libdazzle-3.44.0_2.pkg | 2025-12-26 21:22 | 484K | |
| libdbi-0.9.0_3.pkg | 2025-08-14 08:36 | 690K | |
| libdbi-drivers-0.9.0..> | 2025-12-19 23:07 | 380K | |
| libdbusmenu-16.04.0_..> | 2025-12-26 13:16 | 119K | |
| libdbusmenu-lxqt-0.3..> | 2025-12-26 22:48 | 182K | |
| libdbusmenu-qt5-0.9...> | 2025-12-26 09:46 | 153K | |
| libdbusmenu-qt6-0.9...> | 2025-12-30 05:45 | 178K | |
| libdc-5.0.10_1.pkg | 2025-08-15 01:56 | 478K | |
| libdc1394-2.2.7.pkg | 2025-08-13 08:58 | 137K | |
| libdca-0.0.7_1.pkg | 2025-08-13 09:34 | 115K | |
| libdcadec-0.2.0_1.pkg | 2025-08-16 09:49 | 157K | |
| libddoc-0.8.0_4.pkg | 2025-08-19 04:47 | 57K | |
| libddwaf-1.30.1.pkg | 2025-12-26 19:01 | 946K | |
| libde265-1.0.16.pkg | 2025-12-27 01:22 | 240K | |
| libdecaf-1.0.0_3.pkg | 2025-12-21 19:38 | 137K | |
| libdecor-0.2.4.pkg | 2025-12-26 10:50 | 59K | |
| libdeflate-1.25.pkg | 2025-12-16 01:41 | 86K | |
| libdex-0.10.1.pkg | 2025-12-19 14:18 | 80K | |
| libdicom-1.1.0.pkg | 2025-08-14 03:17 | 113K | |
| libdiff-0.1.0_1.pkg | 2025-08-13 21:15 | 17K | |
| libdill-2.14_1.pkg | 2025-08-15 23:34 | 208K | |
| libdisasm-0.23_3.pkg | 2025-08-17 05:47 | 156K | |
| libdiscid-0.6.5.pkg | 2025-08-14 06:22 | 15K | |
| libdisorder-0.0.2_1.pkg | 2025-08-18 02:09 | 8.2K | |
| libdispatch-6.1,1.pkg | 2025-08-14 06:36 | 144K | |
| libdisplay-info-0.3...> | 2025-12-18 07:59 | 117K | |
| libdistance-0.2.2_2.pkg | 2025-08-27 02:17 | 34K | |
| libdivide-5.2.0.pkg | 2025-08-14 03:27 | 20K | |
| libdivsufsort-2.0.2...> | 2025-08-14 12:47 | 22K | |
| libdjinterop-0.20.2.pkg | 2025-12-21 13:31 | 379K | |
| libdkim-1.0.21.pkg | 2025-08-20 07:50 | 50K | |
| libdmapsharing-3.9.1..> | 2025-12-30 07:50 | 210K | |
| libdmtx-0.7.5_1.pkg | 2025-08-13 03:33 | 74K | |
| libdnet-1.13_5.pkg | 2025-12-18 12:09 | 74K | |
| libdnf-0.75.0.pkg | 2025-12-27 16:50 | 1.3M | |
| libdockapp-0.7.2.pkg | 2025-12-27 15:45 | 47K | |
| libdom-0.4.2.pkg | 2025-12-19 16:03 | 126K | |
| libdomainkeys-0.69_1..> | 2025-08-15 19:01 | 26K | |
| libdombey-5.56_1.pkg | 2025-08-17 15:14 | 64K | |
| libdparse-0.20.0_4.pkg | 2025-08-14 17:10 | 609K | |
| libdrizzle-0.8_7.pkg | 2025-12-19 06:35 | 59K | |
| libdrizzle-redux-5.1..> | 2025-08-17 04:44 | 511K | |
| libdrm-2.4.131,1.pkg | 2025-12-16 01:51 | 280K | |
| libds-2.2.pkg | 2025-08-18 15:10 | 38K | |
| libdsk-1.4.2_1.pkg | 2025-08-15 02:03 | 440K | |
| libdssialsacompat-1...> | 2025-08-13 15:47 | 12K | |
| libdv-1.0.0_9.pkg | 2025-12-19 02:20 | 83K | |
| libdvbcsa-1.1.0_1.pkg | 2025-08-15 19:04 | 28K | |
| libdvbpsi-1.3.3.pkg | 2025-08-13 22:21 | 109K | |
| libdvdcss-1.5.0.pkg | 2025-12-20 03:10 | 36K | |
| libdvdnav-7.0.0.pkg | 2025-12-18 07:23 | 61K | |
| libdvdread-7.0.0.pkg | 2025-12-18 05:18 | 83K | |
| libdwarf-20161124.pkg | 2025-08-14 09:30 | 687K | |
| libdynamite-0.1.1_5.pkg | 2025-08-17 08:46 | 8.2K | |
| libe-0.11.0.pkg | 2025-08-16 09:32 | 78K | |
| libe-book-0.1.3_30.pkg | 2025-12-18 17:55 | 715K | |
| libeXosip2-5.3.0.pkg | 2025-08-18 10:54 | 233K | |
| libeatmydata-9.pkg | 2025-08-22 22:39 | 4.5K | |
| libebml-1.4.5.pkg | 2025-08-13 13:27 | 65K | |
| libebur128-1.2.6.pkg | 2025-08-18 20:10 | 17K | |
| libecap-1.0.1.pkg | 2025-08-22 00:30 | 32K | |
| libecc-0.14.0_2.pkg | 2025-08-16 09:47 | 43K | |
| libecpint-1.0.7.pkg | 2025-08-14 11:38 | 512K | |
| libecwj2-3.3_4.pkg | 2025-08-18 03:09 | 854K | |
| libedit-3.1.20251016..> | 2025-12-16 01:28 | 152K | |
| libefp-1.5.0.pkg | 2025-08-18 18:47 | 4.0M | |
| libei-1.5.0.pkg | 2025-12-18 05:27 | 103K | |
| libeio-4.18_2.pkg | 2025-08-16 19:47 | 25K | |
| libelf-0.8.13_3.pkg | 2025-12-18 22:30 | 65K | |
| libemos-4.5.9_4.pkg | 2025-12-27 21:07 | 17M | |
| libepc-0.4.6_3.pkg | 2025-12-30 18:05 | 77K | |
| libepoll-shim-0.0.20..> | 2025-08-10 21:28 | 20K | |
| libepoll-shim-i386-0..> | 2025-08-14 23:32 | 18K | |
| libepoxy-1.5.10.pkg | 2025-08-10 22:18 | 311K | |
| libepp-nicbr-1.20.pkg | 2025-12-21 23:08 | 758K | |
| libepubgen-0.1.1_1.pkg | 2025-08-13 18:10 | 116K | |
| liberasurecode-1.6.5..> | 2025-08-19 00:41 | 291K | |
| liberation-fonts-ttf..> | 2025-12-26 20:12 | 1.5M | |
| libertiff-0.0.0.2025..> | 2025-08-13 06:17 | 11K | |
| libertinus-7.051.pkg | 2025-12-27 16:13 | 1.9M | |
| libesedb-e.20240420.pkg | 2025-12-19 08:13 | 838K | |
| libesmtp-1.1.0,1.pkg | 2025-08-14 08:53 | 59K | |
| libestr-0.1.11_1.pkg | 2025-08-15 01:40 | 14K | |
| libetonyek01-0.1.13,..> | 2025-12-18 17:33 | 628K | |
| libetpan-1.9.4_2.pkg | 2025-12-18 22:58 | 519K | |
| libev-4.33_1,1.pkg | 2025-08-13 12:49 | 114K | |
| libevdev-1.13.2.pkg | 2025-08-10 21:22 | 58K | |
| libevdevplus-0.2.1.pkg | 2025-08-21 23:43 | 30K | |
| libevent-2.1.12.pkg | 2025-08-10 21:34 | 345K | |
| libevent-devel-2.2.1..> | 2025-08-17 17:34 | 374K | |
| libevhtp-1.2.16_4.pkg | 2025-08-13 23:22 | 48K | |
| libevt-a.20240421.pkg | 2025-12-19 06:35 | 764K | |
| libevtx-a.20240504.pkg | 2025-12-19 07:21 | 885K | |
| libewf-20140816_1.pkg | 2025-12-18 22:32 | 1.1M | |
| libexif-0.6.25.pkg | 2025-12-16 04:27 | 527K | |
| libexif-gtk-0.5.0_1.pkg | 2025-12-27 06:41 | 60K | |
| libexo-4.20.0.pkg | 2025-12-26 15:39 | 278K | |
| libexplain-1.3.D012_..> | 2025-12-19 22:27 | 3.1M | |
| libexttextcat-3.4.6.pkg | 2025-08-13 19:16 | 209K | |
| libfabric-1.15.1_4.pkg | 2025-08-13 04:19 | 532K | |
| libfakekey-0.3.pkg | 2025-08-15 16:16 | 5.3K | |
| libfaketime-0.9.12.pkg | 2025-12-28 05:53 | 42K | |
| libfap-1.5.pkg | 2025-08-18 20:41 | 51K | |
| libfastcommon-1.0.43..> | 2025-08-15 16:34 | 134K | |
| libfastjson-1.2304.0..> | 2025-08-15 16:08 | 46K | |
| libfb-2.0.2_3.pkg | 2025-08-19 10:40 | 23K | |
| libfcrypto-a.2024041..> | 2025-12-18 17:18 | 46K | |
| libfds-0.6.0_1.pkg | 2025-12-19 22:48 | 209K | |
| libfec-3.0.1_5.pkg | 2025-08-17 08:59 | 34K | |
| libffcall-2.5.pkg | 2025-08-13 15:10 | 48K | |
| libffi-3.5.1.pkg | 2025-08-10 21:06 | 46K | |
| libffi33-3.3_2.pkg | 2025-08-14 09:49 | 17K | |
| libffi321-3.2.1_3.pkg | 2025-08-14 20:57 | 16K | |
| libfido2-1.16.0.pkg | 2025-12-18 00:15 | 256K | |
| libfilezilla-0.49.0.pkg | 2025-12-20 02:01 | 435K | |
| libfilteraudio-0.0.1..> | 2025-08-14 23:12 | 146K | |
| libfirm-1.21.0_2.pkg | 2025-08-15 10:00 | 2.1M | |
| libfishsound-1.0.1_1..> | 2025-08-14 19:39 | 177K | |
| libfixbuf-2.4.2_1.pkg | 2025-12-18 22:51 | 162K | |
| libfixmath-2023.08.0..> | 2025-08-16 18:46 | 99K | |
| libfixposix-0.4.3_2.pkg | 2025-08-15 18:16 | 18K | |
| libflame-5.2.0_1.pkg | 2025-08-22 04:05 | 4.9M | |
| libfm-1.3.2_4.pkg | 2025-12-26 22:15 | 584K | |
| libfm-extra-1.3.2_4.pkg | 2025-12-18 13:42 | 14K | |
| libfm-gtk3-1.3.2_4.pkg | 2025-12-27 19:40 | 584K | |
| libfm-qt-1.4.0.pkg | 2025-12-26 23:59 | 587K | |
| libfm-qt6-2.3.1.pkg | 2025-12-26 21:15 | 638K | |
| libfmt-12.1.0.pkg | 2025-12-18 00:33 | 181K | |
| libfo-0.6.3_5.pkg | 2025-12-27 03:39 | 1.2M | |
| libfobos-2.3.2.pkg | 2025-08-18 06:18 | 17K | |
| libfolia-2.21.1.pkg | 2025-12-19 23:31 | 751K | |
| libfontenc-1.1.8.pkg | 2025-08-10 21:09 | 21K | |
| libformfactor-0.3.2.pkg | 2025-12-21 12:42 | 64K | |
| libfort-0.4.2.11.pkg | 2025-08-16 16:12 | 47K | |
| libfprint-1.94.8.pkg | 2025-12-19 16:27 | 327K | |
| libfpx-1.3.1.10_1.pkg | 2025-08-16 15:27 | 421K | |
| libfreefare-0.4.0_3.pkg | 2025-12-24 07:32 | 97K | |
| libfreehand-0.1.2_27..> | 2025-12-26 18:31 | 248K | |
| libfsapfs-e.20240429..> | 2025-12-18 21:05 | 936K | |
| libfsext-e.20240501.pkg | 2025-12-18 18:58 | 798K | |
| libfsfat-e.20240501.pkg | 2025-12-19 02:21 | 760K | |
| libfshfs-e.20240501.pkg | 2025-12-18 23:16 | 865K | |
| libfsntfs-e.20240501..> | 2025-12-18 22:34 | 939K | |
| libfsxfs-e.20240501.pkg | 2025-12-18 22:52 | 790K | |
| libftdi-0.20_23.pkg | 2025-12-18 12:07 | 73K | |
| libftdi1-1.5_9.pkg | 2025-12-18 12:51 | 140K | |
| libfvde-20240502.pkg | 2025-12-19 01:17 | 1.0M | |
| libfwnt-20240415.pkg | 2025-12-18 16:57 | 142K | |
| libfwsi-e.20240423.pkg | 2025-12-18 21:12 | 593K | |
| libfyaml-0.9_1.pkg | 2025-08-22 11:34 | 382K | |
| libg15-3.0.7.pkg | 2025-08-14 01:47 | 14K | |
| libg15render-3.0.4_1..> | 2025-08-14 12:21 | 19K | |
| libg19-1.1.1_1.pkg | 2025-08-14 17:59 | 10K | |
| libg19draw-1.0.0_2.pkg | 2025-12-29 23:28 | 12K | |
| libg722-1.2.0.pkg | 2025-08-22 12:25 | 7.0K | |
| libgal-0.5.0_1.pkg | 2025-08-19 15:32 | 4.9M | |
| libgamepad-0.1.2.4.pkg | 2025-08-15 16:13 | 12K | |
| libgav1-0.19.0_2.pkg | 2025-08-18 20:48 | 842K | |
| libgcrypt-1.11.2.pkg | 2025-12-16 01:33 | 1.1M | |
| libgd-2.3.3_13,1.pkg | 2025-12-26 03:25 | 222K | |
| libgda5-5.2.10_5.pkg | 2025-12-19 22:55 | 4.3M | |
| libgda5-jdbc-5.2.10_..> | 2025-12-28 01:00 | 81K | |
| libgda5-ldap-5.2.10_..> | 2025-12-24 07:08 | 46K | |
| libgda5-postgresql-5..> | 2025-12-21 16:08 | 160K | |
| libgda5-ui-5.2.10_5.pkg | 2025-12-30 15:25 | 4.5M | |
| libgda6-6.0.1.g20250..> | 2025-12-27 11:47 | 1.7M | |
| libgdata-0.18.1_2.pkg | 2025-12-27 18:39 | 628K | |
| libgdiplus-6.1_2.pkg | 2025-12-26 20:56 | 270K | |
| libgdsii-0.21.pkg | 2025-08-14 23:44 | 65K | |
| libgedit-gfls-0.3.0.pkg | 2025-12-26 20:21 | 26K | |
| libgedit-gtksourcevi..> | 2025-12-26 19:47 | 566K | |
| libgee-0.20.8.pkg | 2025-12-18 18:33 | 273K | |
| libgeotiff-1.7.4_1.pkg | 2025-12-26 06:42 | 120K | |
| libgepub-0.7.3_1.pkg | 2025-12-18 12:08 | 20K | |
| libgetar-1.1.7.pkg | 2025-08-15 23:31 | 681K | |
| libgff-2.0.0.pkg | 2025-08-15 10:19 | 133K | |
| libghemical-3.0.0_21..> | 2025-12-27 06:12 | 735K | |
| libgig-4.5.0_1.pkg | 2025-12-27 02:07 | 557K | |
| libgit2-1.9.2.pkg | 2025-12-16 01:50 | 783K | |
| libgit2-glib-1.2.1_1..> | 2025-12-19 20:08 | 195K | |
| libglade2-2.6.4_14.pkg | 2025-12-26 17:49 | 63K | |
| libglademm-2.6.7_16.pkg | 2025-12-27 13:07 | 43K | |
| libgltext-0.3.1_9.pkg | 2025-12-28 04:07 | 29K | |
| libgltf-0.1.0_1.pkg | 2025-08-16 22:39 | 168K | |
| libglvnd-1.7.0.pkg | 2025-08-10 21:39 | 384K | |
| libgme-0.6.4.pkg | 2025-08-14 06:09 | 159K | |
| libgnome-games-suppo..> | 2025-12-26 21:32 | 48K | |
| libgnome-games-suppo..> | 2025-12-26 23:43 | 50K | |
| libgnome-keyring-3.1..> | 2025-12-19 22:00 | 129K | |
| libgnomecanvas-2.30...> | 2025-12-26 20:30 | 252K | |
| libgnomecanvasmm-2.2..> | 2025-12-27 17:50 | 119K | |
| libgnomekbd-3.28.1.pkg | 2025-12-26 15:29 | 137K | |
| libgnt-2.14.3_4.pkg | 2025-12-19 20:59 | 171K | |
| libgnuregex-6.0.pkg | 2025-08-14 07:29 | 55K | |
| libgpg-error-1.58.pkg | 2025-12-16 01:31 | 389K | |
| libgphoto2-2.5.31_1.pkg | 2025-12-26 11:52 | 1.3M | |
| libgpkg-0.9.18_3.pkg | 2025-12-21 03:16 | 514K | |
| libgpod-0.8.3_14.pkg | 2025-12-27 03:40 | 408K | |
| libgpr-25.0.0.pkg | 2025-12-22 20:37 | 8.1M | |
| libgrading-0.1.8_1.pkg | 2025-08-28 17:08 | 34K | |
| libgraphqlparser-0.7..> | 2025-08-14 06:48 | 72K | |
| libgravatar-25.12.0.pkg | 2025-12-26 09:18 | 47K | |
| libgridxc-2.0.2.pkg | 2025-12-29 03:01 | 334K | |
| libgrss-0.7.0_3.pkg | 2025-12-22 05:00 | 104K | |
| libgsasl-2.2.2.pkg | 2025-12-19 02:13 | 266K | |
| libgsf-1.14.54.pkg | 2025-12-26 13:44 | 401K | |
| libgta-1.0.8.pkg | 2025-08-18 17:09 | 49K | |
| libgtextutils-0.7.pkg | 2025-08-14 18:43 | 20K | |
| libgtop-2.41.3.pkg | 2025-12-18 07:54 | 205K | |
| libgudev-237.pkg | 2025-12-16 01:47 | 41K | |
| libgusb-0.4.9_1.pkg | 2025-12-16 01:59 | 1.1M | |
| libgutenfetch-1.2_7.pkg | 2025-12-20 02:07 | 63K | |
| libgweather-40.0_7.pkg | 2025-12-27 03:31 | 2.9M | |
| libgweather4-4.4.4_1..> | 2025-12-26 13:52 | 4.2M | |
| libgxps-0.3.2_2.pkg | 2025-12-26 16:00 | 82K | |
| libhandy-1.8.3.pkg | 2025-12-26 11:59 | 430K | |
| libhandy0-0.0.13_3.pkg | 2025-12-27 17:39 | 172K | |
| libharu-2.4.5.pkg | 2025-12-27 00:30 | 707K | |
| libhdhomerun-2021121..> | 2025-08-14 00:14 | 56K | |
| libheif-1.19.8_6.pkg | 2025-12-26 09:22 | 541K | |
| libheinz-3.0.0.pkg | 2025-12-18 17:46 | 5.5K | |
| libhijack-0.9.0.pkg | 2025-12-22 09:30 | 22K | |
| libhoard-3.13_1.pkg | 2025-12-20 23:04 | 17K | |
| libhomfly-1.02.r6.pkg | 2025-12-20 11:02 | 27K | |
| libhsclient-1.0.6.20..> | 2025-08-16 09:35 | 178K | |
| libhsts-0.1.0.pkg | 2025-08-15 00:17 | 11K | |
| libhtp-0.5.52.pkg | 2025-12-21 02:56 | 124K | |
| libhubbub-0.3.8.pkg | 2025-12-18 23:27 | 84K | |
| libhydrogen-0.0.0.g2..> | 2025-12-21 19:40 | 29K | |
| libibuddy-0.0.2.pkg | 2025-08-17 03:22 | 10K | |
| libical-3.0.20_1.pkg | 2025-12-18 00:48 | 847K | |
| libicd-0.0.0.2025041..> | 2025-12-27 09:38 | 100K | |
| libiconv-1.18_1.pkg | 2025-12-16 01:27 | 719K | |
| libid3tag-0.16.3.pkg | 2025-08-13 09:18 | 35K | |
| libident-0.32_5.pkg | 2025-08-15 05:30 | 13K | |
| libidn-1.43.pkg | 2025-12-17 23:24 | 274K | |
| libidn2-2.3.8.pkg | 2025-12-16 01:32 | 149K | |
| libiec61850-1.5.3_1.pkg | 2025-08-15 18:17 | 496K | |
| libifconfig-0.1.pkg | 2025-08-21 02:58 | 33K | |
| libiio-0.26_1.pkg | 2025-12-18 12:03 | 89K | |
| libijs-0.35_6.pkg | 2025-08-15 04:58 | 24K | |
| libilbc-3.0.4_3.pkg | 2025-08-17 17:29 | 66K | |
| libimagequant-4.4.1_..> | 2025-12-26 06:43 | 476K | |
| libimg-1.4.16_3.pkg | 2025-12-30 02:23 | 313K | |
| libimobiledevice-1.4..> | 2025-12-18 07:49 | 342K | |
| libimobiledevice-glu..> | 2025-08-13 05:22 | 55K | |
| libindicator-12.10.1..> | 2025-12-27 17:41 | 49K | |
| libinfinity-0.7.2_1.pkg | 2025-12-27 06:41 | 1.2M | |
| libinjection-3.10.0_..> | 2025-08-13 13:43 | 188K | |
| libinotify-20240724_..> | 2025-08-10 21:08 | 28K | |
| libinput-1.28.1.pkg | 2025-12-16 02:08 | 300K | |
| libinstpatch-1.1.7.pkg | 2025-12-27 17:00 | 302K | |
| libint-1.2.1.15.pkg | 2025-08-13 21:45 | 1.3M | |
| libint2-2.11.0_2.pkg | 2025-12-19 09:57 | 18M | |
| libint2-psi4-0.1.2.7..> | 2025-12-20 03:51 | 108M | |
| libiodbc-3.52.16_1.pkg | 2025-08-14 16:55 | 300K | |
| libiptcdata-1.0.4_2.pkg | 2025-08-13 15:30 | 57K | |
| libircclient-1.10.pkg | 2025-08-14 16:10 | 68K | |
| libirman-0.5.2.pkg | 2025-08-15 04:35 | 30K | |
| libiscsi-1.20.3.pkg | 2025-12-20 05:18 | 155K | |
| libisofs-1.5.6.pkg | 2025-08-13 22:36 | 414K | |
| libixion-0.20.0_1.pkg | 2025-12-18 12:51 | 366K | |
| libixp-0.5_2.pkg | 2025-08-15 02:23 | 33K | |
| libjcat-0.2.5.pkg | 2025-12-19 01:43 | 61K | |
| libjitterentropy-3.6..> | 2025-08-15 01:17 | 31K | |
| libjodycode-3.1_1.pkg | 2025-08-15 01:59 | 14K | |
| libjpeg-turbo-3.1.3.pkg | 2025-12-26 20:06 | 397K | |
| libjwt-2.1.2.pkg | 2025-08-13 07:09 | 33K | |
| libjxl-0.11.1_2.pkg | 2025-12-24 22:05 | 2.1M | |
| libk8055-0.2_1.pkg | 2025-08-18 11:40 | 24K | |
| libkcddb-25.12.0.pkg | 2025-12-26 19:54 | 528K | |
| libkcompactdisc-25.1..> | 2025-12-26 19:42 | 67K | |
| libkdcraw-qt5-25.12...> | 2025-12-26 23:33 | 36K | |
| libkdcraw-qt6-25.12...> | 2025-12-26 16:05 | 38K | |
| libkdegames-25.12.0.pkg | 2025-12-26 18:39 | 8.8M | |
| libkdepim-25.12.0.pkg | 2025-12-26 06:53 | 97K | |
| libkeduvocdocument-2..> | 2025-12-26 20:11 | 176K | |
| libkexiv2-qt6-25.12...> | 2025-12-26 11:14 | 139K | |
| libkeyfinder-2.2.8.pkg | 2025-08-14 16:55 | 42K | |
| libkgapi-25.12.0.pkg | 2025-12-26 17:05 | 565K | |
| libkiwix-14.0.0_2.pkg | 2025-12-24 04:56 | 606K | |
| libkiwix13-13.1.0_2.pkg | 2025-12-19 17:04 | 593K | |
| libklel-1.1.0_3.pkg | 2025-08-15 20:34 | 100K | |
| libkleo-25.12.0.pkg | 2025-12-26 06:31 | 932K | |
| libkmahjongg-25.12.0..> | 2025-12-26 18:48 | 2.1M | |
| libkmfl-0.9.9_2.pkg | 2025-08-14 21:32 | 23K | |
| libkml-1.3.0_31.pkg | 2025-12-26 06:34 | 928K | |
| libkolabxml-1.3.1_6.pkg | 2025-12-18 10:12 | 615K | |
| libkomparediff2-25.1..> | 2025-12-26 20:23 | 111K | |
| libkpass-6_2.pkg | 2025-12-19 03:25 | 13K | |
| libksane-25.12.0.pkg | 2025-12-26 19:37 | 161K | |
| libksba-1.6.7.pkg | 2025-12-17 22:56 | 190K | |
| libksieve-25.12.0.pkg | 2025-12-26 17:12 | 807K | |
| libktorrent-25.12.0.pkg | 2025-12-26 19:46 | 700K | |
| liblangtag-0.6.7_1.pkg | 2025-12-18 11:34 | 307K | |
| liblastfm-qt6-1.1.0...> | 2025-12-30 07:39 | 195K | |
| liblcf-0.8.1.pkg | 2025-12-19 23:17 | 519K | |
| libliftoff-0.5.0.pkg | 2025-12-18 12:41 | 17K | |
| liblinear-2.49.pkg | 2025-08-18 17:57 | 48K | |
| liblnk-20240423.pkg | 2025-12-19 03:32 | 703K | |
| liblo-0.34.pkg | 2025-12-18 12:44 | 92K | |
| liblockfile-1.17_1.pkg | 2025-08-14 05:40 | 26K | |
| liblogging-1.0.8.pkg | 2025-12-27 15:17 | 100K | |
| liblognorm-2.0.9.pkg | 2025-12-30 06:12 | 120K | |
| liblouis-3.35.0.pkg | 2025-12-22 05:01 | 2.5M | |
| liblpm-g2020082801.pkg | 2025-08-16 04:30 | 15K | |
| liblqr-1-0.4.2.pkg | 2025-12-18 03:57 | 42K | |
| liblrdf-0.6.1.pkg | 2025-12-18 20:36 | 24K | |
| liblscp-1.0.1.pkg | 2025-08-14 20:38 | 31K | |
| libltc-1.3.2_2.pkg | 2025-08-14 23:43 | 31K | |
| libltdl-2.5.4.pkg | 2025-08-10 21:46 | 31K | |
| libluksde-e.20240503..> | 2025-12-19 02:20 | 655K | |
| liblxi-1.18_2.pkg | 2025-12-19 10:34 | 17K | |
| liblxqt-2.3.0_1.pkg | 2025-12-26 18:04 | 147K | |
| liblz4-1.10.0_2,1.pkg | 2025-12-18 00:16 | 173K | |
| liblzxcomp-20050705.pkg | 2025-08-14 23:57 | 16K | |
| libmaa-1.5.1,1.pkg | 2025-08-14 07:08 | 134K | |
| libmacaroons-0.3.0.2..> | 2025-08-18 01:18 | 62K | |
| libmad-0.16.4.pkg | 2025-08-13 10:12 | 68K | |
| libmaia-0.9.0_4.pkg | 2025-12-20 00:00 | 47K | |
| libmaitretarot-0.1.9..> | 2025-12-18 17:30 | 21K | |
| libmanette-0.2.6.pkg | 2025-12-23 20:50 | 49K | |
| libmatekbd-1.28.0.pkg | 2025-12-26 16:55 | 170K | |
| libmatemixer-1.28.0_..> | 2025-12-18 11:54 | 172K | |
| libmateweather-1.28...> | 2025-12-26 16:30 | 2.7M | |
| libmatheval-1.1.11_5..> | 2025-12-19 07:08 | 51K | |
| libmatroska-1.7.1.pkg | 2025-08-13 21:38 | 128K | |
| libmatthew-0.8.1_1.pkg | 2025-12-27 16:23 | 46K | |
| libmaxminddb-1.12.2.pkg | 2025-08-13 16:10 | 35K | |
| libmba-0.9.1_2.pkg | 2025-08-18 13:58 | 110K | |
| libmbd-0.12.5_4.pkg | 2025-12-26 20:59 | 379K | |
| libmcfp-1.4.2.pkg | 2025-12-18 19:50 | 14K | |
| libmcrypt-2.5.8_4.pkg | 2025-08-13 11:41 | 122K | |
| libmdf-1.0.27.pkg | 2025-12-20 08:25 | 60K | |
| libmediaart-1.9.7.pkg | 2025-12-26 19:06 | 28K | |
| libmediainfo-25.10.pkg | 2025-12-18 16:19 | 6.8M | |
| libmemcache-1.4.0.r2..> | 2025-08-14 19:51 | 50K | |
| libmemcached-1.1.4_1..> | 2025-08-13 10:15 | 261K | |
| libmesh-1.8.4.pkg | 2025-12-30 17:07 | 23M | |
| libmesode-0.10.1.pkg | 2025-12-22 07:02 | 73K | |
| libmetalink-0.1.3.pkg | 2025-12-21 05:35 | 68K | |
| libmicro-0.4.1.pkg | 2025-08-20 18:10 | 195K | |
| libmicrodns-0.2.0.pkg | 2025-08-15 13:01 | 14K | |
| libmicrohttpd-1.0.2.pkg | 2025-12-18 12:54 | 280K | |
| libmikmod-3.3.13.pkg | 2025-08-13 14:26 | 122K | |
| libmill-1.18.pkg | 2025-08-16 07:41 | 101K | |
| libmilter-8.18.1.pkg | 2025-08-14 00:59 | 138K | |
| libmissing-20130815_..> | 2025-08-17 03:09 | 12K | |
| libmng-2.0.3_2.pkg | 2025-12-26 08:30 | 239K | |
| libmodbus-3.1.11.pkg | 2025-08-15 16:28 | 73K | |
| libmodi-e.20240507.pkg | 2025-12-18 19:09 | 1.0M | |
| libmodplug-0.8.9.1.r..> | 2025-08-13 20:45 | 176K | |
| libmodulemd-2.15.2.pkg | 2025-12-18 22:22 | 217K | |
| libmongocrypt-1.14.1..> | 2025-12-19 08:33 | 535K | |
| libmorph-0.1.2_2.pkg | 2025-08-16 17:36 | 15K | |
| libmowgli-1.0.0.pkg | 2025-08-20 20:58 | 42K | |
| libmowgli2-2.1.3.pkg | 2025-08-15 14:46 | 95K | |
| libmp3-archive-perl-..> | 2025-12-20 01:34 | 21K | |
| libmp3splt-0.9.2_5.pkg | 2025-12-19 20:48 | 225K | |
| libmpcbdm-0.0.3_1.pkg | 2025-08-21 09:30 | 45K | |
| libmpd-11.8.17_2.pkg | 2025-12-19 07:36 | 82K | |
| libmpdclient-2.23.pkg | 2025-08-13 23:16 | 117K | |
| libmpeg2-0.5.1_8.pkg | 2025-08-14 08:55 | 103K | |
| libmrss-0.19.4.pkg | 2025-12-27 18:39 | 39K | |
| libmsiecf-a.20240425..> | 2025-12-19 23:25 | 693K | |
| libmsocket-0.4_6.pkg | 2025-08-21 21:13 | 35K | |
| libmspack-0.11alpha.pkg | 2025-08-13 04:23 | 70K | |
| libmspub01-0.1.4_25.pkg | 2025-08-13 22:21 | 137K | |
| libmswstr-0.0.1.pkg | 2025-08-17 07:17 | 75K | |
| libmsym-0.2.3.pkg | 2025-08-14 03:07 | 98K | |
| libmt_client-0.1.98_..> | 2025-12-18 21:31 | 15K | |
| libmtdev-1.1.7.pkg | 2025-08-10 21:27 | 20K | |
| libmtp-1.1.22.pkg | 2025-12-18 06:55 | 298K | |
| libmtrie-1.0.3.pkg | 2025-08-20 21:34 | 4.7K | |
| libmusicbrainz5-5.1...> | 2025-12-18 13:51 | 161K | |
| libmusicxml-3.22.pkg | 2025-08-16 21:15 | 1.7M | |
| libmustache-0.5.0_3.pkg | 2025-08-15 10:02 | 57K | |
| libmwaw03-0.3.22.pkg | 2025-08-13 19:40 | 2.2M | |
| libmypaint-1.6.1_2.pkg | 2025-12-18 17:21 | 218K | |
| libmysofa-1.3.3.pkg | 2025-08-13 03:55 | 1.1M | |
| libnaji-0.6.4_1.pkg | 2025-08-15 22:23 | 71K | |
| libnatpmp-20230423.pkg | 2025-08-14 08:30 | 13K | |
| libndi-g20250811.pkg | 2025-12-21 12:46 | 14K | |
| libndp-1.9.pkg | 2025-08-13 18:40 | 27K | |
| libnegf-1.1.3_4.pkg | 2025-12-27 00:37 | 693K | |
| libnest2d-ultimaker-..> | 2025-12-26 23:09 | 54K | |
| libnet-1.3,1.pkg | 2025-08-13 16:23 | 133K | |
| libneurosim-1.2.0_1.pkg | 2025-12-21 01:47 | 42K | |
| libnfc-1.8.0_1.pkg | 2025-12-19 20:08 | 162K | |
| libnfs-5.0.2_1.pkg | 2025-08-13 15:11 | 238K | |
| libnghttp2-1.68.0.pkg | 2025-12-16 01:29 | 136K | |
| libnghttp3-1.13.1.pkg | 2025-12-16 01:30 | 121K | |
| libngtcp2-1.18.0.pkg | 2025-12-16 01:30 | 245K | |
| libngtcp2-gnutls-1.1..> | 2025-12-19 00:03 | 22K | |
| libngtcp2-wolfssl-1...> | 2025-12-21 17:39 | 21K | |
| libnice-0.1.22.pkg | 2025-12-18 10:58 | 207K | |
| libnice-gst1-0.1.22.pkg | 2025-12-26 15:32 | 9.0K | |
| libnids-1.24_6.pkg | 2025-12-19 04:45 | 45K | |
| libnitrokey-3.7.pkg | 2025-12-19 09:06 | 310K | |
| libnjs-0.9.4.pkg | 2025-12-21 03:31 | 1.4M | |
| libnoise-1.0.0_4.pkg | 2025-08-18 23:55 | 73K | |
| libnormaliz-3.9.0_3.pkg | 2025-08-15 02:57 | 3.4M | |
| libnotify-0.8.7.pkg | 2025-12-24 22:12 | 35K | |
| libnova-0.16.0.pkg | 2025-08-14 04:47 | 1.0M | |
| libnpupnp-6.2.3.pkg | 2025-12-19 22:54 | 183K | |
| libnsbmp-0.1.7.pkg | 2025-08-16 20:49 | 10K | |
| libnsgif-1.0.0.pkg | 2025-08-13 15:48 | 15K | |
| libnspsl-0.1.7.pkg | 2025-08-18 08:29 | 50K | |
| libnss-cache-0.21.pkg | 2025-08-18 16:57 | 5.6K | |
| libnss-mysql-1.5_6.pkg | 2025-12-23 09:01 | 9.3K | |
| libnss-pgsql-1.5.0_2..> | 2025-12-23 09:41 | 25K | |
| libnsutils-0.1.1.pkg | 2025-08-22 22:59 | 6.8K | |
| libntlm-1.6.pkg | 2025-08-13 21:56 | 22K | |
| libnumbertext-1.0.11..> | 2025-08-13 18:01 | 220K | |
| libnuml-1.1.7_1.pkg | 2025-12-18 21:55 | 1.3M | |
| libnvme-1.11.1_4.pkg | 2025-08-14 21:03 | 191K | |
| libnvpair-2.0.pkg | 2025-08-22 03:42 | 45K | |
| libnxml-0.18.3_4.pkg | 2025-12-18 21:51 | 34K | |
| liboauth-1.0.3_5.pkg | 2025-12-18 20:20 | 34K | |
| libobjc2-2.2.1.pkg | 2025-08-13 06:39 | 86K | |
| libocas-0.96.pkg | 2025-08-17 05:52 | 42K | |
| libodbc++-0.2.5_5.pkg | 2025-12-23 05:40 | 135K | |
| libodfgen01-0.1.8_3.pkg | 2025-12-18 17:36 | 273K | |
| libofx-0.10.9_2.pkg | 2025-12-19 10:50 | 606K | |
| libogg-1.3.6,4.pkg | 2025-08-10 21:10 | 195K | |
| liboggz-1.1.3.pkg | 2025-08-14 10:29 | 124K | |
| liboglappth-1.0.0_5.pkg | 2025-08-15 14:27 | 55K | |
| liboil-0.3.17_3.pkg | 2025-08-14 22:47 | 336K | |
| libolecf-a.20240427.pkg | 2025-12-19 19:38 | 766K | |
| libomemo-0.8.1.pkg | 2025-12-20 02:13 | 19K | |
| libomemo-c-0.5.1_1.pkg | 2025-08-14 01:59 | 142K | |
| libopenbsd-r298107_1..> | 2025-08-14 10:30 | 23K | |
| libopencad-0.2.0_5.pkg | 2025-08-16 13:43 | 187K | |
| libopencm3-0.8.0_2.pkg | 2025-08-21 00:06 | 4.1M | |
| libopendrive-0.6.0_1..> | 2025-08-16 09:13 | 155K | |
| libopenmpt-0.8.4.pkg | 2025-12-26 21:41 | 1.7M | |
| libopennet-0.9.9_2.pkg | 2025-08-16 20:00 | 10K | |
| libopenraw-0.3.7_21.pkg | 2025-12-29 01:20 | 1.2M | |
| libopenshot-audio-0...> | 2025-12-26 22:54 | 1.6M | |
| libopensmtpd-0.7.pkg | 2025-12-19 22:22 | 24K | |
| liboping-1.10.0_1.pkg | 2025-12-19 20:00 | 73K | |
| libopusenc-0.2.1_2.pkg | 2025-12-27 00:55 | 41K | |
| liboqs-0.15.0.pkg | 2025-12-20 04:23 | 1.0M | |
| liborcus-0.20.2_1.pkg | 2025-12-18 18:28 | 1.4M | |
| liborigin-3.0.3,1.pkg | 2025-08-14 18:44 | 107K | |
| libosinfo-1.12.0_2.pkg | 2025-12-26 16:56 | 263K | |
| libosip2-5.3.1.pkg | 2025-08-15 18:14 | 171K | |
| libosmesa-24.1.7.pkg | 2025-12-18 04:13 | 3.0M | |
| libosmium-2.22.0_2.pkg | 2025-12-20 01:02 | 195K | |
| libosmpbf-1.5.1_7.pkg | 2025-08-18 20:15 | 80K | |
| libotf-0.9.16_1.pkg | 2025-12-27 00:01 | 91K | |
| libotr-4.1.1_1.pkg | 2025-12-18 20:17 | 103K | |
| libotr3-3.2.1_5.pkg | 2025-12-23 15:20 | 93K | |
| libowfat-0.34.pkg | 2025-08-15 20:17 | 322K | |
| libp11-0.4.16.pkg | 2025-08-14 19:37 | 122K | |
| libpafe-0.0.8_1.pkg | 2025-08-14 06:54 | 20K | |
| libpagemaker-0.0.4_1..> | 2025-08-13 22:00 | 57K | |
| libpaho-mqtt3-1.3.13..> | 2025-08-13 16:05 | 239K | |
| libpanel-1.10.2.pkg | 2025-12-27 03:00 | 200K | |
| libpano13-2.9.23.pkg | 2025-12-27 09:39 | 412K | |
| libpaper-1.1.28_1.pkg | 2025-08-10 21:14 | 19K | |
| libpar2-0.4_6.pkg | 2025-08-15 22:58 | 193K | |
| libparserutils-0.2.5..> | 2025-08-13 22:21 | 34K | |
| libpasori-02_2.pkg | 2025-08-14 16:58 | 12K | |
| libpbl-1.04.04.pkg | 2025-08-15 03:05 | 120K | |
| libpcap-1.10.5.pkg | 2025-08-13 17:23 | 302K | |
| libpcapnav-0.8_1.pkg | 2025-08-16 10:31 | 42K | |
| libpcd-1.0.1.pkg | 2025-08-16 05:20 | 20K | |
| libpci-3.14.0.pkg | 2025-12-24 20:09 | 70K | |
| libpciaccess-0.18.1_..> | 2025-12-16 01:47 | 16K | |
| libpcl-1.12_1.pkg | 2025-08-16 19:58 | 10K | |
| libpdel-0.6.1_2.pkg | 2025-12-19 07:13 | 1.1M | |
| libpeak-0.1.2_2.pkg | 2025-08-21 03:17 | 64K | |
| libpeas-2.0.7.pkg | 2025-12-26 21:15 | 93K | |
| libpeas1-1.36.0.pkg | 2025-12-26 18:48 | 1.2M | |
| libpfctl-0.17.pkg | 2025-12-18 10:25 | 16K | |
| libpff-20231205.pkg | 2025-12-21 11:57 | 918K | |
| libpg_query-17.6.1.0..> | 2025-12-23 16:04 | 2.2M | |
| libpgf-7.21.7.pkg | 2025-08-21 11:42 | 63K | |
| libphdi-e.20240508.pkg | 2025-12-19 01:37 | 808K | |
| libphonenumber-9.0.2..> | 2025-12-26 15:12 | 3.2M | |
| libpillowfight-0.3.1..> | 2025-08-17 06:14 | 20K | |
| libpki-0.9.2_7.pkg | 2025-12-19 09:51 | 434K | |
| libplacebo-7.351.0_1..> | 2025-12-24 22:01 | 528K | |
| libplist-2.7.0.pkg | 2025-08-13 04:40 | 127K | |
| libpo6-0.8.0.pkg | 2025-08-15 15:53 | 19K | |
| libpololu-avr-151002..> | 2025-12-20 23:17 | 411K | |
| libportal-0.9.1.pkg | 2025-12-18 11:01 | 89K | |
| libportal-gtk3-0.9.1..> | 2025-12-26 22:02 | 9.9K | |
| libportal-gtk4-0.9.1..> | 2025-12-26 19:12 | 9.9K | |
| libportal-qt5-0.9.1.pkg | 2025-12-28 15:24 | 17K | |
| libportal-qt6-0.9.1.pkg | 2025-12-29 22:03 | 21K | |
| libpostal-1.1_2.pkg | 2025-12-19 22:38 | 804K | |
| libpotrace-1.16.pkg | 2025-08-13 00:24 | 21K | |
| libpowershell-native..> | 2025-08-15 06:24 | 6.4K | |
| libpredict-2.0.0.pkg | 2025-08-20 23:26 | 33K | |
| libprelude-5.2.0_1.pkg | 2025-12-19 05:05 | 525K | |
| libpreludedb-5.2.0_1..> | 2025-12-21 17:47 | 228K | |
| libpri-1.6.1.pkg | 2025-08-14 04:19 | 289K | |
| libprinthex-1.0.3.pkg | 2025-08-27 14:43 | 3.5K | |
| libprojectM-3.1.12_1..> | 2025-12-26 21:01 | 2.8M | |
| libprotobuf-mutator-..> | 2025-08-22 08:19 | 36K | |
| libproxy-0.5.10_1.pkg | 2025-12-17 22:58 | 1.0M | |
| libpru-0.4.pkg | 2025-08-15 22:48 | 9.7K | |
| libpsl-0.21.5_2.pkg | 2025-12-16 01:44 | 65K | |
| libpsml-2.1.0.pkg | 2025-12-28 12:37 | 144K | |
| libpst-0.6.76_4.pkg | 2025-12-29 22:30 | 757K | |
| libptytty-2.0.pkg | 2025-08-13 23:09 | 18K | |
| libpurple-2.14.14_1.pkg | 2025-12-26 22:56 | 5.3M | |
| libpuzzle-0.11_12.pkg | 2025-12-27 12:31 | 26K | |
| libpwquality-1.4.5_2..> | 2025-12-18 12:35 | 85K | |
| libqaccessibilitycli..> | 2025-12-30 03:50 | 72K | |
| libqaccessibilitycli..> | 2025-12-26 11:01 | 92K | |
| libqalculate-5.8.2.pkg | 2025-12-18 11:03 | 4.1M | |
| libqb-2.0.9.pkg | 2025-12-18 14:37 | 153K | |
| libqcow-a.20240308.pkg | 2025-12-18 20:20 | 631K | |
| libqrencode-4.1.1.pkg | 2025-12-26 05:56 | 46K | |
| libqsbr-g2020082801.pkg | 2025-08-21 00:55 | 17K | |
| libqt6xdg-4.3.0_1.pkg | 2025-12-26 15:49 | 139K | |
| libqtelegram-ae-6.1_..> | 2025-12-26 21:06 | 470K | |
| libqtxdg-3.12.0.pkg | 2025-12-26 22:01 | 120K | |
| libquantum-1.1.1_1.pkg | 2025-08-22 21:07 | 51K | |
| libquotient-0.9.3_2.pkg | 2025-12-27 02:13 | 1.2M | |
| libqxp-0.0.0_25.pkg | 2025-08-13 18:44 | 99K | |
| libr3-1.0.0_3.pkg | 2025-12-27 16:35 | 14K | |
| libranlip-1.0_2.pkg | 2025-08-17 20:55 | 105K | |
| libraqm-0.10.3.pkg | 2025-12-26 06:39 | 33K | |
| librashader-0.9.1_2.pkg | 2025-12-27 17:05 | 6.4M | |
| librasterlite2-1.1.0..> | 2025-12-27 17:48 | 904K | |
| librav1e-0.8.1_5.pkg | 2025-12-28 15:20 | 8.3M | |
| libraw-0.21.4.pkg | 2025-12-26 09:25 | 620K | |
| librcc-0.2.13_3.pkg | 2025-12-27 16:03 | 106K | |
| librcd-0.1.14_2.pkg | 2025-08-14 01:43 | 27K | |
| librdata-0.1.0.g2023..> | 2025-08-15 12:22 | 18K | |
| librdkafka-2.8.0.pkg | 2025-12-18 01:49 | 1.3M | |
| libreadline-java-0.8..> | 2025-12-28 07:07 | 27K | |
| librecad-2.2.1.2.pkg | 2025-12-29 19:11 | 6.8M | |
| libredwg-0.12.4.pkg | 2025-12-29 13:41 | 6.8M | |
| libregf-a.20240421.pkg | 2025-12-18 19:21 | 727K | |
| librelp-1.12.0.pkg | 2025-12-24 00:33 | 61K | |
| libremidi-5.3.1.pkg | 2025-12-30 06:12 | 270K | |
| librenms-25.12.0,1.pkg | 2025-12-28 08:30 | 66M | |
| libreoffice-25.8.3.2..> | 2025-12-27 02:36 | 141M | |
| libreoffice-i18n-25...> | 2025-12-30 11:42 | 1.6K | |
| librep-0.92.7_7.pkg | 2025-12-18 16:38 | 667K | |
| librepo-1.20.0.pkg | 2025-12-19 00:48 | 87K | |
| librespeed-cli-1.0.1..> | 2025-12-23 17:23 | 2.9M | |
| librespeed-go-1.1.5_..> | 2025-12-23 19:23 | 4.5M | |
| librespeed-php81-5.4..> | 2025-12-28 21:37 | 14M | |
| librespeed-php82-5.4..> | 2025-12-29 19:16 | 14M | |
| librespeed-php83-5.4..> | 2025-12-28 07:22 | 14M | |
| librespeed-php84-5.4..> | 2025-12-29 01:13 | 14M | |
| librespeed-php85-5.4..> | 2025-12-30 08:15 | 14M | |
| librespot-0.8.0_1.pkg | 2025-12-27 12:59 | 2.2M | |
| libresprite-1.2.pkg | 2025-12-28 14:27 | 10M | |
| libressl-4.2.1.pkg | 2025-12-18 21:54 | 3.4M | |
| libressl-devel-4.2.1..> | 2025-12-21 17:37 | 3.4M | |
| libressl-devel-libtl..> | 2025-12-21 00:02 | 1.3M | |
| libressl-libtls-4.2...> | 2025-12-21 23:03 | 1.3M | |
| librest1-0.10.2.pkg | 2025-12-26 12:32 | 1.1M | |
| libreswan-4.12_2.pkg | 2025-12-29 12:44 | 1.1M | |
| libretls-3.8.1_2.pkg | 2025-08-15 20:33 | 66K | |
| libretro-0.4.pkg | 2025-12-28 03:25 | 2.1K | |
| libretro-2048-0.2023..> | 2025-08-14 10:45 | 31K | |
| libretro-a5200-0.202..> | 2025-08-18 09:49 | 97K | |
| libretro-beetle_psx-..> | 2025-12-19 23:00 | 924K | |
| libretro-bluemsx-0.2..> | 2025-08-15 16:51 | 619K | |
| libretro-boom3-0.202..> | 2025-08-15 14:19 | 2.5M | |
| libretro-bsnes-115.a..> | 2025-08-15 08:09 | 724K | |
| libretro-cap32-0.202..> | 2025-08-15 15:56 | 250K | |
| libretro-core-info-1..> | 2025-12-19 16:38 | 80K | |
| libretro-desmume-0.2..> | 2025-08-15 04:25 | 1.0M | |
| libretro-desmume2015..> | 2025-08-15 20:25 | 682K | |
| libretro-dosbox-0.20..> | 2025-08-15 02:43 | 655K | |
| libretro-emux-0.2019..> | 2025-08-15 06:23 | 95K | |
| libretro-fbalpha2012..> | 2025-08-15 06:58 | 3.2M | |
| libretro-fbneo-0.202..> | 2025-08-14 23:58 | 8.1M | |
| libretro-fceumm-0.20..> | 2025-08-14 19:32 | 362K | |
| libretro-flycast-0.2..> | 2025-08-15 20:26 | 2.6M | |
| libretro-fmsx-0.2023..> | 2025-08-15 01:56 | 96K | |
| libretro-freeintv-0...> | 2025-08-15 05:14 | 38K | |
| libretro-fuse-0.2023..> | 2025-08-15 16:25 | 720K | |
| libretro-gambatte-0...> | 2025-12-19 13:18 | 313K | |
| libretro-genesis_plu..> | 2025-08-14 16:42 | 721K | |
| libretro-gpsp-0.2023..> | 2025-08-14 23:53 | 198K | |
| libretro-gw-0.202305..> | 2025-08-15 14:04 | 161K | |
| libretro-handy-0.202..> | 2025-08-15 02:53 | 81K | |
| libretro-hatari-0.20..> | 2025-08-14 18:59 | 648K | |
| libretro-kronos-2.1...> | 2025-12-27 07:02 | 1.0M | |
| libretro-mame2000-0...> | 2025-08-14 13:48 | 2.7M | |
| libretro-mame2003-0...> | 2025-08-15 08:41 | 6.5M | |
| libretro-mame2003_pl..> | 2025-08-17 15:40 | 6.9M | |
| libretro-mednafen_bs..> | 2025-08-15 10:34 | 221K | |
| libretro-mednafen_gb..> | 2025-08-15 20:18 | 136K | |
| libretro-mednafen_ly..> | 2025-08-15 08:22 | 59K | |
| libretro-mednafen_ng..> | 2025-08-14 19:50 | 86K | |
| libretro-mednafen_pc..> | 2025-08-14 16:25 | 373K | |
| libretro-mednafen_pc..> | 2025-08-20 14:24 | 324K | |
| libretro-mednafen_pc..> | 2025-08-15 01:59 | 315K | |
| libretro-mednafen_sa..> | 2025-08-15 09:28 | 1.0M | |
| libretro-mednafen_su..> | 2025-08-14 20:48 | 337K | |
| libretro-mednafen_vb..> | 2025-08-15 02:58 | 50K | |
| libretro-mednafen_ws..> | 2025-08-15 06:32 | 81K | |
| libretro-melonds-0.2..> | 2025-08-14 18:49 | 709K | |
| libretro-mgba-0.2025..> | 2025-12-20 03:39 | 394K | |
| libretro-mu-0.202305..> | 2025-08-15 03:20 | 143K | |
| libretro-nestopia-0...> | 2025-12-19 08:56 | 519K | |
| libretro-nxengine-0...> | 2025-08-15 09:36 | 259K | |
| libretro-o2em-0.2023..> | 2025-08-15 02:45 | 121K | |
| libretro-opera-0.202..> | 2025-08-14 18:34 | 170K | |
| libretro-parallel_n6..> | 2025-08-16 03:20 | 670K | |
| libretro-pcsx2-0.202..> | 2025-12-27 03:36 | 1.8M | |
| libretro-pcsx_rearme..> | 2025-08-14 10:20 | 570K | |
| libretro-picodrive-0..> | 2025-08-15 00:46 | 539K | |
| libretro-play-0.48_5..> | 2025-08-15 08:32 | 913K | |
| libretro-ppsspp-1.19..> | 2025-12-27 16:04 | 5.7M | |
| libretro-prboom-0.20..> | 2025-08-14 12:11 | 387K | |
| libretro-prosystem-0..> | 2025-08-14 23:04 | 52K | |
| libretro-puae-0.2023..> | 2025-08-14 16:20 | 5.0M | |
| libretro-px68k-0.202..> | 2025-08-17 08:40 | 135K | |
| libretro-quicknes-0...> | 2025-08-14 19:44 | 122K | |
| libretro-reicast-0.2..> | 2025-12-27 02:15 | 1.6M | |
| libretro-shaders-gls..> | 2025-08-22 20:36 | 19M | |
| libretro-shaders-sla..> | 2025-12-27 09:45 | 41M | |
| libretro-snes9x-0.20..> | 2025-12-20 01:51 | 667K | |
| libretro-snes9x2005-..> | 2025-08-17 19:00 | 206K | |
| libretro-snes9x2010-..> | 2025-08-18 04:10 | 534K | |
| libretro-stella2014-..> | 2025-08-14 14:45 | 387K | |
| libretro-tgbdual-0.2..> | 2025-08-14 14:10 | 35K | |
| libretro-tyrquake-0...> | 2025-08-14 10:49 | 403K | |
| libretro-vba_next-0...> | 2025-08-14 19:50 | 185K | |
| libretro-vecx-0.2023..> | 2025-08-15 16:01 | 48K | |
| libretro-vice-x64-0...> | 2025-08-14 18:48 | 1.0M | |
| libretro-vice-x64sc-..> | 2025-08-14 13:54 | 1.0M | |
| libretro-vice-x128-0..> | 2025-08-15 02:48 | 1.1M | |
| libretro-vice-xcbm2-..> | 2025-08-15 09:58 | 733K | |
| libretro-vice-xcbm5x..> | 2025-08-14 20:57 | 768K | |
| libretro-vice-xpet-0..> | 2025-08-15 08:24 | 774K | |
| libretro-vice-xplus4..> | 2025-08-15 00:07 | 779K | |
| libretro-vice-xscpu6..> | 2025-08-15 20:25 | 1.0M | |
| libretro-vice-xvic-0..> | 2025-08-15 13:09 | 805K | |
| libretro-virtualjagu..> | 2025-08-15 04:14 | 376K | |
| libretro-xrick-0.202..> | 2025-12-19 16:31 | 113K | |
| libretro-yabause-0.2..> | 2025-08-15 18:20 | 415K | |
| librevenge-0.0.5.pkg | 2025-08-13 12:57 | 203K | |
| librevisa-0.0.201304..> | 2025-08-14 03:32 | 55K | |
| librevisa-vish-0.0.2..> | 2025-08-16 16:30 | 7.2K | |
| librevisa-vxi-0.0.20..> | 2025-08-21 13:55 | 7.1K | |
| librewolf-146.0.1.pkg | 2025-12-28 01:13 | 76M | |
| librfm-5.3.16.4_6.pkg | 2025-12-27 10:25 | 2.3M | |
| librist-0.2.11_2.pkg | 2025-12-19 02:20 | 106K | |
| librnd-4.4.0.pkg | 2025-12-27 15:18 | 1.2M | |
| librolegen-1.0b.pkg | 2025-08-20 03:40 | 11K | |
| librs232-20190531.pkg | 2025-08-17 09:32 | 11K | |
| librsb-1.3.0.2_1.pkg | 2025-12-26 20:44 | 2.9M | |
| librsvg2-2.40.21_6.pkg | 2025-12-30 02:28 | 187K | |
| librsvg2-rust-2.61.3..> | 2025-12-25 00:39 | 3.1M | |
| librsync-2.3.4.pkg | 2025-12-18 23:57 | 34K | |
| librtprocess-0.12.0.pkg | 2025-08-14 15:56 | 125K | |
| librttopo-1.1.0.pkg | 2025-12-18 01:11 | 329K | |
| libruin-0.2.0_5.pkg | 2025-12-20 08:45 | 133K | |
| libs11n-1.2.10_1.pkg | 2025-08-22 22:05 | 343K | |
| libsamplerate-0.2.2_..> | 2025-12-24 21:54 | 1.3M | |
| libsass-3.6.6.pkg | 2025-08-13 04:47 | 723K | |
| libsbml-5.20.5_1.pkg | 2025-12-18 17:37 | 4.4M | |
| libscca-a.20240427.pkg | 2025-12-20 03:29 | 731K | |
| libscep-0.09_1.pkg | 2025-12-27 02:58 | 29K | |
| libscfg-0.1.1.pkg | 2025-08-15 18:34 | 5.5K | |
| libscrypt-1.22.pkg | 2025-08-15 14:24 | 16K | |
| libsdb-0.10.1_1.pkg | 2025-08-20 17:14 | 32K | |
| libsdr-0.1.0_3.pkg | 2025-12-19 20:48 | 87K | |
| libsdr-gui-0.1.0_4.pkg | 2025-12-27 23:22 | 31K | |
| libsearpc-3.2.0_2,1.pkg | 2025-12-19 01:25 | 40K | |
| libsecret-0.21.7_2.pkg | 2025-12-16 03:18 | 1.3M | |
| libsedml-2.0.33_1.pkg | 2025-12-19 23:32 | 2.0M | |
| libsemigroups-3.3.0.pkg | 2025-12-29 22:05 | 1.8M | |
| libserdes-6.0.2_1.pkg | 2025-12-20 23:17 | 56K | |
| libserialport-0.1.2.pkg | 2025-08-14 05:31 | 43K | |
| libshbuf-0.0.3.pkg | 2025-08-16 07:12 | 20K | |
| libshhcards-1.0.6.pkg | 2025-12-19 17:14 | 38K | |
| libshhmsg-1.4.2.pkg | 2025-08-15 18:23 | 12K | |
| libshhopt-1.1.7_1.pkg | 2025-08-15 04:08 | 11K | |
| libshout-2.4.6_1.pkg | 2025-08-14 02:34 | 91K | |
| libshumate-1.4.0_1.pkg | 2025-12-26 22:05 | 6.6M | |
| libsidplay-1.36.60_1..> | 2025-08-14 02:36 | 121K | |
| libsidplayfp-2.15.1.pkg | 2025-12-19 00:46 | 151K | |
| libsieve-2.3.1_2.pkg | 2025-08-15 00:13 | 83K | |
| libsigc++-2.12.1.pkg | 2025-08-13 10:20 | 66K | |
| libsigc++30-3.6.0.pkg | 2025-12-18 11:07 | 47K | |
| libsignal-0.84.0_2.pkg | 2025-12-26 22:43 | 3.3M | |
| libsignal-client-0.9..> | 2025-08-14 00:02 | 631K | |
| libsignal-node-0.86...> | 2025-12-27 10:39 | 8.2M | |
| libsignal-protocol-c..> | 2025-08-14 01:09 | 150K | |
| libsignon-glib-2.1_2..> | 2025-12-27 06:28 | 76K | |
| libsigrok-0.5.2_5.pkg | 2025-12-19 06:57 | 798K | |
| libsigrokdecode-0.5...> | 2025-12-19 10:06 | 277K | |
| libsigscan-e.2024050..> | 2025-12-18 21:07 | 583K | |
| libsigsegv-2.15.pkg | 2025-12-18 11:58 | 13K | |
| libsimdpp-2.1.400.pkg | 2025-08-18 13:33 | 189K | |
| libsixel-1.8.6_1,1.pkg | 2025-08-14 12:57 | 241K | |
| libskiasharp-116_3.pkg | 2025-12-27 11:57 | 1.9M | |
| libslang2-2.3.3_2.pkg | 2025-12-26 14:22 | 1.4M | |
| libslirp-4.9.1.pkg | 2025-12-18 12:22 | 68K | |
| libsmdev-a.20240505.pkg | 2025-12-18 17:55 | 501K | |
| libsmf-1.3_5.pkg | 2025-12-19 19:23 | 49K | |
| libsmi-0.4.8_2.pkg | 2025-08-14 01:37 | 2.0M | |
| libsml-0.1.1_2.pkg | 2025-08-20 13:48 | 136K | |
| libsmpp34-1.10_3.pkg | 2025-12-22 13:55 | 134K | |
| libsmraw-a.20240506.pkg | 2025-12-18 16:33 | 701K | |
| libsndfile-1.2.2_2.pkg | 2025-12-24 21:52 | 313K | |
| libsockpp-1.0.0.pkg | 2025-08-15 15:51 | 48K | |
| libsodium-1.0.19.pkg | 2025-08-13 03:47 | 253K | |
| libsoldout-1.4_1.pkg | 2025-08-14 10:14 | 55K | |
| libsolv-0.7.35.pkg | 2025-12-18 19:23 | 465K | |
| libsonic-0.2.0.65.pkg | 2025-08-17 17:55 | 25K | |
| libsoup-2.74.3_1.pkg | 2025-12-18 01:38 | 598K | |
| libsoup3-3.6.5_2.pkg | 2025-12-17 23:26 | 384K | |
| libsoxr-0.1.3_3.pkg | 2025-08-10 21:44 | 92K | |
| libspamtest-20080808..> | 2025-08-21 02:52 | 38K | |
| libspecbleach-0.1.6.pkg | 2025-08-15 00:53 | 21K | |
| libspectre-0.2.12_1.pkg | 2025-12-26 18:37 | 48K | |
| libspectrum-1.5.0_1.pkg | 2025-12-19 12:43 | 181K | |
| libspeechprovider-1...> | 2025-12-27 08:02 | 15K | |
| libspelling-0.4.9.pkg | 2025-12-27 01:13 | 1.1M | |
| libspf2-1.2.11_2.pkg | 2025-08-13 20:03 | 128K | |
| libsphinxclient-2.0...> | 2025-08-18 22:14 | 27K | |
| libspice-server-0.16..> | 2025-12-27 11:58 | 363K | |
| libspiel-1.0.4.pkg | 2025-12-30 10:28 | 51K | |
| libspiro-20240903,1.pkg | 2025-08-13 14:28 | 22K | |
| libspnav-1.2.pkg | 2025-08-15 12:32 | 49K | |
| libspng-0.7.4.pkg | 2025-08-13 07:05 | 49K | |
| libsrs2-1.0.18_4.pkg | 2025-08-14 12:18 | 22K | |
| libsrs_alt-1.0_3.pkg | 2025-08-19 02:27 | 21K | |
| libsrtp2-2.7.0.pkg | 2025-08-13 15:08 | 44K | |
| libssh-0.11.3.pkg | 2025-12-18 08:31 | 357K | |
| libssh2-1.11.1,3.pkg | 2025-08-10 21:28 | 243K | |
| libssm-1.4.0_4.pkg | 2025-12-30 09:52 | 108K | |
| libstaroffice-0.0.7_..> | 2025-08-13 17:28 | 699K | |
| libstatgrab-0.92.1_1..> | 2025-12-19 09:41 | 125K | |
| libstatgrab0-0.17.pkg | 2025-08-16 16:56 | 24K | |
| libstdc++_stldoc_4.2..> | 2025-08-16 17:03 | 12M | |
| libstree-0.4.2_2.pkg | 2025-08-15 20:23 | 23K | |
| libstrfunc-8.3_3.pkg | 2025-08-14 23:40 | 86K | |
| libstroke-0.5.1_6.pkg | 2025-08-14 05:26 | 7.8K | |
| libstrophe-0.14.0.pkg | 2025-12-19 22:28 | 117K | |
| libsunacl-1.0.1_1.pkg | 2025-08-13 08:06 | 7.5K | |
| libsupertone-0.0.2_1..> | 2025-12-27 20:36 | 20K | |
| libsvgtiny-0.1.8.pkg | 2025-12-20 07:50 | 24K | |
| libsvm-3.24.pkg | 2025-08-14 07:59 | 88K | |
| libsvm-python-3.24_1..> | 2025-12-21 06:27 | 11K | |
| libsweep-lidar-1.3.0..> | 2025-08-19 06:06 | 19K | |
| libsx-1.1_4.pkg | 2025-12-20 02:26 | 63K | |
| libsynaptics-0.14.6...> | 2025-08-17 07:08 | 57K | |
| libsysctlmibinfo-1.0..> | 2025-08-19 07:21 | 12K | |
| libsysctlmibinfo2-2...> | 2025-08-15 19:35 | 16K | |
| libsysinfo-0.0.3_3.pkg | 2025-08-10 21:54 | 28K | |
| libsysstat-0.4.6.pkg | 2025-12-23 22:06 | 24K | |
| libsysstat-qt6-1.1.0..> | 2025-12-26 22:38 | 28K | |
| libszip-2.1.1.pkg | 2025-08-18 12:30 | 32K | |
| libtai-0.60_7.pkg | 2025-08-15 10:21 | 24K | |
| libtap-1.12.0_1.pkg | 2025-08-16 03:31 | 12K | |
| libtasn1-4.20.0_1.pkg | 2025-08-10 21:26 | 168K | |
| libtatsu-1.0.5.pkg | 2025-12-18 04:38 | 30K | |
| libtecla-1.6.3_2.pkg | 2025-08-15 02:28 | 201K | |
| libtermkey-0.22_1.pkg | 2025-08-13 09:16 | 56K | |
| libtexprintf-1.25_1.pkg | 2025-08-16 09:33 | 123K | |
| libtextcat-2.2_6.pkg | 2025-08-15 17:31 | 159K | |
| libtextstyle-0.26.pkg | 2025-12-16 01:27 | 473K | |
| libthai-0.1.29_2.pkg | 2025-12-16 01:30 | 181K | |
| libtheora-1.1.1_7.pkg | 2025-08-13 08:35 | 191K | |
| libthmap-g2020082801..> | 2025-08-18 20:23 | 24K | |
| libthreadar-1.6.1.pkg | 2025-12-20 01:07 | 70K | |
| libticables2-1.3.5_1..> | 2025-12-19 02:37 | 38K | |
| libticalcs2-1.1.9.pkg | 2025-12-20 01:51 | 154K | |
| libtickit-0.4.5.pkg | 2025-08-13 10:22 | 198K | |
| libticonv-1.1.5.pkg | 2025-12-18 18:37 | 21K | |
| libtifiles2-1.1.7.pkg | 2025-12-19 00:09 | 57K | |
| libtlsrpt-0.5.0_1.pkg | 2025-08-16 16:38 | 27K | |
| libtmcg-1.3.18.pkg | 2025-12-22 14:02 | 593K | |
| libtomcrypt-1.18.2_1..> | 2025-08-14 06:59 | 1.3M | |
| libtommath-1.3.0_2.pkg | 2025-08-13 10:59 | 144K | |
| libtool-2.5.4_1.pkg | 2025-12-16 01:34 | 376K | |
| libtorrent-0.16.5.pkg | 2025-12-19 09:19 | 467K | |
| libtorrent-rasterbar..> | 2025-12-19 04:58 | 3.5M | |
| libtpl-1.6_1.pkg | 2025-08-21 06:22 | 48K | |
| libtpms-0.10.1.pkg | 2025-08-14 00:41 | 670K | |
| libtrace-3.0.19_3.pkg | 2025-08-16 02:56 | 316K | |
| libtranslate-0.99_13..> | 2025-12-22 15:08 | 110K | |
| libtre-0.8.0_4.pkg | 2025-12-18 22:03 | 76K | |
| libtree-3.1.1.pkg | 2025-08-16 16:52 | 13K | |
| libtsm-3.pkg | 2025-08-16 00:51 | 27K | |
| libtubo-5.0.14_1.pkg | 2025-08-14 08:20 | 24K | |
| libtuner-1.1.5.pkg | 2025-08-14 22:51 | 173K | |
| libtuntap-0.4_2.pkg | 2025-08-18 03:14 | 8.7K | |
| libublio-20070103_3.pkg | 2025-08-13 18:31 | 14K | |
| libubox-20180803_3.pkg | 2025-12-19 12:46 | 132K | |
| libucl-0.9.3.pkg | 2025-12-18 19:36 | 137K | |
| libudev-devd-0.6.0.pkg | 2025-08-10 21:21 | 21K | |
| libudfread-1.2.0.pkg | 2025-12-18 09:15 | 16K | |
| libudisks-2.11.0.pkg | 2025-12-18 13:15 | 826K | |
| libuinputplus-0.2.1.pkg | 2025-08-22 05:36 | 12K | |
| libuiohook-1.2.2.11.pkg | 2025-12-29 22:12 | 20K | |
| libukcprog-1.0.2_6.pkg | 2025-08-18 06:14 | 31K | |
| libultrahdr-1.4.0.pkg | 2025-12-26 10:54 | 364K | |
| libunibreak-6.1,1.pkg | 2025-08-10 21:38 | 33K | |
| libunicode-0.4_13.pkg | 2025-08-26 05:59 | 61K | |
| libunicode-contour-0..> | 2025-12-19 19:53 | 602K | |
| libuninameslist-2024..> | 2025-08-13 15:51 | 1.6M | |
| libuninum-2.7_5.pkg | 2025-08-14 13:24 | 65K | |
| libunique-3.0.2_5.pkg | 2025-12-26 18:11 | 33K | |
| libunistring-1.4.1.pkg | 2025-12-16 01:28 | 733K | |
| libunit-1.35.0.pkg | 2025-12-24 03:44 | 124K | |
| libunp-1.0_1.pkg | 2025-08-18 15:18 | 34K | |
| libunrar-7.2.1,1.pkg | 2025-12-20 01:25 | 255K | |
| libunwind-20250904.pkg | 2025-12-16 01:29 | 209K | |
| liburcu-0.15.3.pkg | 2025-08-13 16:39 | 163K | |
| libusbmuxd-2.1.1.pkg | 2025-08-13 07:15 | 36K | |
| libusbsio-2.1.11.pkg | 2025-12-18 16:39 | 12K | |
| libusipp-2.25.pkg | 2025-08-17 10:46 | 109K | |
| libusrsctp-0.9.5.0.pkg | 2025-08-14 06:03 | 241K | |
| libutf-2.10_4.pkg | 2025-08-15 01:27 | 28K | |
| libutp-g20231123.pkg | 2025-12-19 00:43 | 38K | |
| libuuid-2.41.1_1.pkg | 2025-08-13 06:10 | 48K | |
| libuutil-1.0.3.pkg | 2025-08-17 15:38 | 29K | |
| libuv-1.51.0.pkg | 2025-08-10 21:08 | 141K | |
| libuvc-0.0.7_1.pkg | 2025-12-26 22:56 | 50K | |
| libv4l-1.23.0_5.pkg | 2025-12-24 21:57 | 387K | |
| libva-2.22.0_1.pkg | 2025-12-16 01:53 | 197K | |
| libva-intel-driver-2..> | 2025-12-23 06:35 | 1.0M | |
| libva-intel-hybrid-d..> | 2025-12-19 22:51 | 426K | |
| libva-intel-media-dr..> | 2025-12-21 04:58 | 105M | |
| libva-nvidia-driver-..> | 2025-12-30 03:56 | 38K | |
| libva-utils-2.22.0.pkg | 2025-12-20 18:00 | 543K | |
| libva-vdpau-driver-0..> | 2025-08-15 23:22 | 38K | |
| libvalkey-0.2.1.pkg | 2025-12-18 21:33 | 110K | |
| libvanessa_adt-0.0.9..> | 2025-08-15 12:34 | 28K | |
| libvanessa_logger-0...> | 2025-08-14 00:15 | 16K | |
| libvanessa_socket-0...> | 2025-12-20 04:16 | 30K | |
| libvc-003_5.pkg | 2025-08-15 18:23 | 39K | |
| libvdpau-1.5.pkg | 2025-08-10 21:51 | 64K | |
| libvdpau-va-gl-0.4.2..> | 2025-12-23 04:59 | 54K | |
| libvdwxc-0.4.6.20190..> | 2025-08-15 08:22 | 1.9M | |
| libversion-3.0.4.pkg | 2025-12-19 17:17 | 25K | |
| libvex-g20230201_2.pkg | 2025-08-21 15:34 | 1.5M | |
| libvgm-g20250714.pkg | 2025-08-15 00:09 | 356K | |
| libvhdi-20240509.pkg | 2025-12-18 19:37 | 649K | |
| libvirt-11.10.0.pkg | 2025-12-18 18:08 | 8.1M | |
| libvirt-dbus-1.4.1_1..> | 2025-12-20 08:50 | 57K | |
| libvirt-glib-5.0.0_1..> | 2025-12-18 19:42 | 303K | |
| libvirt-java-0.5.3.pkg | 2025-12-21 21:13 | 259K | |
| libvisio01-0.1.10.pkg | 2025-12-18 18:46 | 206K | |
| libvisual-0.2.0_5.pkg | 2025-08-19 14:10 | 82K | |
| libvisual04-0.4.0_6.pkg | 2025-12-18 17:56 | 147K | |
| libvisual04-plugins-..> | 2025-12-21 17:04 | 86K | |
| libvlcpp-0.1.0.20210..> | 2025-12-27 21:28 | 39K | |
| libvmdk-20240510.pkg | 2025-12-18 22:10 | 720K | |
| libvmime-0.9.2_14.pkg | 2025-12-20 08:23 | 1.5M | |
| libvncserver-0.9.15.pkg | 2025-12-26 18:46 | 225K | |
| libvorbis-1.3.7_2,3.pkg | 2025-08-10 21:14 | 389K | |
| libvpx-1.15.2.pkg | 2025-08-10 21:51 | 1.5M | |
| libvsapm-e.20240503.pkg | 2025-12-18 23:42 | 595K | |
| libvsgpt-e.20240504.pkg | 2025-12-18 19:13 | 622K | |
| libvshadow-20240504.pkg | 2025-12-18 19:47 | 676K | |
| libvslvm-e.20240504.pkg | 2025-12-19 02:27 | 738K | |
| libvterm-0.3.3.pkg | 2025-08-14 01:03 | 62K | |
| libwacom-2.12.1.pkg | 2025-12-16 01:48 | 140K | |
| libwapcaplet-0.4.3.pkg | 2025-08-14 06:40 | 7.1K | |
| libwasmtime-38.0.3_2..> | 2025-12-27 12:29 | 8.8M | |
| libwbxml-0.11.10.pkg | 2025-12-19 14:43 | 108K | |
| libwebm-1.0.0.32.pkg | 2025-12-22 04:59 | 206K | |
| libwebsockets-4.3.5.pkg | 2025-08-13 22:09 | 492K | |
| libwhisker-2.5_2.pkg | 2025-12-21 12:33 | 99K | |
| libwmf-0.2.13_2.pkg | 2025-12-26 09:06 | 2.1M | |
| libwmf-nox11-0.2.13_..> | 2025-12-26 20:30 | 2.1M | |
| libwnck-2.30.7_3.pkg | 2025-12-26 17:56 | 418K | |
| libwnck3-43.3.pkg | 2025-12-26 13:50 | 374K | |
| libwpd010-0.10.3_7.pkg | 2025-12-26 17:06 | 176K | |
| libwpe-1.12.0.pkg | 2025-12-27 14:42 | 47K | |
| libwpg03-0.3.4.pkg | 2025-12-26 18:47 | 52K | |
| libwps-0.4.14.pkg | 2025-08-13 16:38 | 744K | |
| libwps03-0.3.1_13.pkg | 2025-08-18 01:34 | 202K | |
| libwraster-0.96.0_1.pkg | 2025-12-26 20:37 | 69K | |
| libwww-5.4.2.pkg | 2025-12-18 22:38 | 711K | |
| libx86-1.1_2.pkg | 2025-08-15 15:31 | 75K | |
| libx264-0.164.3095.pkg | 2025-08-10 22:16 | 737K | |
| libxalloc-1.0.4.pkg | 2025-08-14 23:27 | 4.6K | |
| libxaw3dxft-1.6.4.pkg | 2025-12-27 12:32 | 293K | |
| libxc-6.2.2.pkg | 2025-12-26 19:58 | 17M | |
| libxcb-1.17.0.pkg | 2025-08-10 21:15 | 1.1M | |
| libxcrypt-4.5.2.pkg | 2025-12-22 14:55 | 105K | |
| libxcvt-0.1.3.pkg | 2025-08-13 07:21 | 8.9K | |
| libxdf-0.991.pkg | 2025-08-15 22:44 | 50K | |
| libxdg-basedir-1.2.2..> | 2025-08-14 08:11 | 12K | |
| libxdiff-0.23_2.pkg | 2025-08-14 22:56 | 40K | |
| libxfce4menu-4.20.2.pkg | 2025-12-26 13:03 | 361K | |
| libxfce4util-4.20.1.pkg | 2025-12-18 06:29 | 113K | |
| libxfce4windowing-4...> | 2025-12-26 16:07 | 159K | |
| libxine-1.2.13_16.pkg | 2025-12-27 16:18 | 2.5M | |
| libxisf-0.2.13.pkg | 2025-12-18 21:13 | 115K | |
| libxkbcommon-1.13.0_..> | 2025-12-24 20:09 | 300K | |
| libxkbfile-1.1.3.pkg | 2025-08-10 21:22 | 114K | |
| libxklavier-5.3_4,1.pkg | 2025-12-26 14:23 | 96K | |
| libxls-1.6.2_1.pkg | 2025-08-15 09:02 | 38K | |
| libxlsxwriter-1.2.3.pkg | 2025-12-19 09:23 | 218K | |
| libxml++-2.42.3_1,1.pkg | 2025-12-18 23:23 | 132K | |
| libxml++30-3.2.5_2.pkg | 2025-12-19 22:16 | 124K | |
| libxml++50-5.4.0_2.pkg | 2025-12-20 03:04 | 131K | |
| libxml2-2.14.6.pkg | 2025-12-16 01:28 | 1.1M | |
| libxmlb-0.3.22_1.pkg | 2025-12-18 01:49 | 140K | |
| libxmlbird-1.2.12.pkg | 2025-12-20 01:32 | 25K | |
| libxmp-4.6.3.pkg | 2025-08-13 15:52 | 468K | |
| libxo-0.6.1_2.pkg | 2025-12-23 05:35 | 236K | |
| libxode-0.71_6.pkg | 2025-12-21 06:02 | 29K | |
| libxsd-4.2.0.pkg | 2025-12-18 07:31 | 130K | |
| libxsd-frontend-2.1...> | 2025-08-13 07:10 | 319K | |
| libxshmfence-1.3.3.pkg | 2025-08-10 21:57 | 5.3K | |
| libxslt-1.1.43_1.pkg | 2025-12-16 01:33 | 288K | |
| libxsmm-1.17_1.pkg | 2025-12-27 14:38 | 2.3M | |
| libxtend-0.2.1.10.pkg | 2025-12-26 19:35 | 144K | |
| libyaml-0.2.5.pkg | 2025-08-10 21:09 | 75K | |
| libyang-1.0.240.pkg | 2025-08-16 04:23 | 529K | |
| libyang2-2.1.128.pkg | 2025-12-19 00:04 | 533K | |
| libyubikey-1.13_1.pkg | 2025-08-13 19:46 | 16K | |
| libyuv-0.0.1903.pkg | 2025-12-26 06:24 | 375K | |
| libzakalwe-1.0.0.pkg | 2025-08-14 18:46 | 232K | |
| libzapojit-0.0.3_3.pkg | 2025-12-30 06:23 | 76K | |
| libzdb-3.4.1.pkg | 2025-12-18 23:09 | 105K | |
| libzen-0.4.41.25.10,..> | 2025-12-18 12:05 | 167K | |
| libzim-9.2.3_2.pkg | 2025-12-19 02:16 | 254K | |
| libzip-1.11.4.pkg | 2025-12-18 03:54 | 253K | |
| libzippp-7.1.1.10.1.pkg | 2025-12-24 03:50 | 28K | |
| libzmf-0.0.2_30.pkg | 2025-12-26 19:40 | 68K | |
| libzmq3-3.2.5_2.pkg | 2025-08-16 05:06 | 283K | |
| libzmq4-4.3.5_2.pkg | 2025-08-13 03:54 | 638K | |
| libzookeeper-3.8.3.pkg | 2025-08-14 22:40 | 145K | |
| libzvbi-0.2.44.pkg | 2025-12-27 19:30 | 339K | |
| lidarr-2.13.3.4711.pkg | 2025-12-29 18:54 | 29M | |
| lidia-2.3.0_3.pkg | 2025-12-27 20:00 | 21M | |
| lifelines-3.1.1_2.pkg | 2025-12-24 01:28 | 2.0M | |
| liferea-1.16.6_1.pkg | 2025-12-28 04:57 | 1.0M | |
| liggghts-3.8.0.58_7.pkg | 2025-12-27 21:34 | 1.8M | |
| lightdm-1.32.0_7.pkg | 2025-12-26 21:41 | 237K | |
| lightdm-gtk-greeter-..> | 2025-12-27 18:50 | 86K | |
| lightdm-gtk-greeter-..> | 2025-12-29 11:44 | 181K | |
| lightdm-kde-greeter-..> | 2025-12-29 11:50 | 399K | |
| lightgbm-4.5.0.pkg | 2025-08-22 04:44 | 1.8M | |
| lightning-2.2.3.pkg | 2025-08-21 13:09 | 160K | |
| lightsoff-48.1.pkg | 2025-12-27 15:10 | 567K | |
| lightsquid-1.8_4.pkg | 2025-12-29 08:03 | 51K | |
| lighttpd-1.4.82.pkg | 2025-12-22 08:47 | 432K | |
| lightweight-java-pro..> | 2025-12-29 19:11 | 13K | |
| lightzone-4.1.8.3_13..> | 2025-12-28 12:16 | 8.6M | |
| lilv-0.26.2.pkg | 2025-12-26 23:36 | 81K | |
| lilypond-2.24.4_1.pkg | 2025-12-27 11:53 | 4.1M | |
| lilypond-devel-2.25...> | 2025-12-28 09:34 | 5.3M | |
| lilyterm-0.9.9.4_3.pkg | 2025-12-30 12:04 | 179K | |
| lime-5.4.28.pkg | 2025-12-18 19:14 | 202K | |
| limereport-1.5.35_1.pkg | 2025-12-30 12:37 | 3.8M | |
| limesuite-22.09.0_4.pkg | 2025-12-27 10:49 | 2.3M | |
| limesurvey-6.6.1.pkg | 2025-12-29 12:30 | 57M | |
| limine-10.5.0.pkg | 2025-12-30 17:53 | 491K | |
| linbox-1.7.1.pkg | 2025-12-29 18:07 | 669K | |
| lincity-1.13.1_9.pkg | 2025-12-30 11:41 | 444K | |
| lincity-ng-2.14.2_2.pkg | 2025-12-29 07:37 | 41M | |
| linden-hill-g2011052..> | 2025-12-28 10:52 | 83K | |
| lineak-defaultplugin..> | 2025-08-18 15:42 | 40K | |
| lineak-xosdplugin-0...> | 2025-08-21 13:06 | 13K | |
| lineakd-0.9_5.pkg | 2025-08-15 11:00 | 249K | |
| linenoise-1.0.34_2.pkg | 2025-08-14 20:57 | 13K | |
| lingeling-1.0.0.pkg | 2025-08-15 21:50 | 491K | |
| lingot-1.1.1_1.pkg | 2025-12-30 08:23 | 279K | |
| link-grammar-5.12.6.pkg | 2025-12-22 20:14 | 2.5M | |
| linklint-2.3.6.d.pkg | 2025-12-21 12:36 | 35K | |
| links-2.30_1,1.pkg | 2025-12-27 22:07 | 2.8M | |
| links1-1.04_1,1.pkg | 2025-08-19 13:10 | 369K | |
| linpack-1.0_17.pkg | 2025-12-27 22:27 | 219K | |
| linrad-4.02_9.pkg | 2025-12-23 08:45 | 643K | |
| linrename-2.25.2_2.pkg | 2025-08-16 03:05 | 5.7K | |
| linux-ai-ml-env-1.0...> | 2025-12-29 17:26 | 2.6G | |
| linux-bcompare-4.4.7..> | 2025-12-22 16:39 | 15M | |
| linux-bitwarden-cli-..> | 2025-12-23 00:53 | 18M | |
| linux-brave-1.85.111..> | 2025-12-27 21:27 | 133M | |
| linux-c7-7.9.2009_3.pkg | 2025-08-22 03:58 | 1.4K | |
| linux-c7-alsa-lib-1...> | 2025-08-13 15:50 | 738K | |
| linux-c7-alsa-lib-de..> | 2025-08-13 18:32 | 647K | |
| linux-c7-alsa-plugin..> | 2025-08-14 05:11 | 16K | |
| linux-c7-alsa-plugin..> | 2025-08-14 15:13 | 48K | |
| linux-c7-alsa-utils-..> | 2025-08-15 05:56 | 1.1M | |
| linux-c7-aspell-0.60..> | 2025-08-15 14:53 | 923K | |
| linux-c7-at-spi2-atk..> | 2025-12-19 07:26 | 121K | |
| linux-c7-at-spi2-cor..> | 2025-12-18 19:52 | 154K | |
| linux-c7-atk-2.28.1_..> | 2025-08-14 04:22 | 275K | |
| linux-c7-audiofile-0..> | 2025-08-15 07:44 | 228K | |
| linux-c7-avahi-libs-..> | 2025-08-14 01:18 | 81K | |
| linux-c7-ca-certific..> | 2025-08-16 17:32 | 803K | |
| linux-c7-cairo-1.15...> | 2025-08-13 20:34 | 1.3M | |
| linux-c7-cairo-gobje..> | 2025-08-15 02:40 | 15K | |
| linux-c7-cups-libs-1..> | 2025-08-15 04:00 | 491K | |
| linux-c7-curl-7.29.0..> | 2025-08-15 01:57 | 571K | |
| linux-c7-cyrus-sasl-..> | 2025-08-13 20:07 | 180K | |
| linux-c7-dbus-libs-1..> | 2025-08-13 14:15 | 383K | |
| linux-c7-devtools-7...> | 2025-08-13 21:14 | 46M | |
| linux-c7-devtoolset-..> | 2025-08-16 08:00 | 64M | |
| linux-c7-dosfstools-..> | 2025-08-14 21:32 | 88K | |
| linux-c7-dri-18.3.4_..> | 2025-08-13 15:23 | 72M | |
| linux-c7-elfutils-li..> | 2025-08-13 07:12 | 206K | |
| linux-c7-elfutils-li..> | 2025-08-13 08:49 | 496K | |
| linux-c7-expat-2.1.0..> | 2025-08-13 06:12 | 129K | |
| linux-c7-expat-devel..> | 2025-08-14 11:32 | 46K | |
| linux-c7-flac-libs-1..> | 2025-08-13 13:34 | 294K | |
| linux-c7-fontconfig-..> | 2025-08-13 07:58 | 307K | |
| linux-c7-freetype-2...> | 2025-08-13 06:18 | 653K | |
| linux-c7-fribidi-1.0..> | 2025-08-13 17:44 | 84K | |
| linux-c7-gdk-pixbuf2..> | 2025-08-14 00:50 | 690K | |
| linux-c7-glx-utils-8..> | 2025-08-15 02:27 | 39K | |
| linux-c7-gnutls-3.3...> | 2025-08-15 16:11 | 1.0M | |
| linux-c7-graphite2-1..> | 2025-08-13 14:27 | 191K | |
| linux-c7-gsm-1.0.13.pkg | 2025-08-13 13:33 | 39K | |
| linux-c7-gtk2-2.24.3..> | 2025-08-15 20:06 | 5.2M | |
| linux-c7-gtk3-3.22.3..> | 2025-12-27 23:41 | 7.0M | |
| linux-c7-harfbuzz-1...> | 2025-08-13 20:23 | 456K | |
| linux-c7-icu-50.2_1.pkg | 2025-08-18 02:24 | 14M | |
| linux-c7-imageformat..> | 2025-08-13 04:42 | 1.6M | |
| linux-c7-libaio-0.3...> | 2025-08-15 08:20 | 16K | |
| linux-c7-libasyncns-..> | 2025-08-13 22:16 | 30K | |
| linux-c7-libcroco-0...> | 2025-08-14 02:41 | 169K | |
| linux-c7-libdrm-2.4...> | 2025-08-13 11:23 | 267K | |
| linux-c7-libepoxy-1...> | 2025-08-14 18:55 | 402K | |
| linux-c7-libgcrypt-1..> | 2025-08-13 09:55 | 429K | |
| linux-c7-libglade2-2..> | 2025-08-14 22:59 | 85K | |
| linux-c7-libglvnd-1...> | 2025-08-13 12:23 | 476K | |
| linux-c7-libgpg-erro..> | 2025-08-13 07:15 | 83K | |
| linux-c7-libogg-1.3...> | 2025-08-13 11:00 | 27K | |
| linux-c7-libpciacces..> | 2025-08-13 09:13 | 34K | |
| linux-c7-librsvg2-2...> | 2025-08-14 21:54 | 208K | |
| linux-c7-libsigc++20..> | 2025-08-15 13:39 | 35K | |
| linux-c7-libsndfile-..> | 2025-08-13 21:08 | 268K | |
| linux-c7-libssh2-1.8..> | 2025-08-14 00:58 | 142K | |
| linux-c7-libtasn1-4...> | 2025-08-13 21:51 | 339K | |
| linux-c7-libthai-0.1..> | 2025-08-13 18:20 | 209K | |
| linux-c7-libtheora-1..> | 2025-08-15 01:07 | 218K | |
| linux-c7-libtool-ltd..> | 2025-08-19 12:38 | 42K | |
| linux-c7-libunwind-1..> | 2025-08-22 18:45 | 93K | |
| linux-c7-libv4l-0.9...> | 2025-08-15 15:32 | 321K | |
| linux-c7-libvorbis-1..> | 2025-08-13 14:07 | 340K | |
| linux-c7-libxkbcommo..> | 2025-08-15 13:24 | 174K | |
| linux-c7-libxml2-2.9..> | 2025-08-13 17:37 | 1.1M | |
| linux-c7-libxslt-1.1..> | 2025-08-21 05:56 | 344K | |
| linux-c7-lttng-ust-2..> | 2025-08-20 12:44 | 170K | |
| linux-c7-lz4-1.8.3.pkg | 2025-08-13 10:07 | 106K | |
| linux-c7-make-3.82_1..> | 2025-08-17 02:17 | 404K | |
| linux-c7-motif-2.3.4..> | 2025-08-14 20:03 | 2.3M | |
| linux-c7-nettle-2.7...> | 2025-08-13 22:32 | 417K | |
| linux-c7-nspr-4.35.0..> | 2025-08-13 15:33 | 222K | |
| linux-c7-nss-3.90.0.pkg | 2025-08-13 19:12 | 2.3M | |
| linux-c7-numactl-lib..> | 2025-08-15 03:40 | 39K | |
| linux-c7-openal-soft..> | 2025-08-14 18:30 | 424K | |
| linux-c7-openldap-2...> | 2025-08-14 04:25 | 528K | |
| linux-c7-openssl-dev..> | 2025-08-14 19:06 | 1.3M | |
| linux-c7-p11-kit-0.2..> | 2025-08-14 08:02 | 628K | |
| linux-c7-pango-1.42...> | 2025-08-14 09:22 | 393K | |
| linux-c7-pixman-0.34..> | 2025-08-13 16:11 | 476K | |
| linux-c7-power9-func..> | 2025-12-22 23:25 | 3.5M | |
| linux-c7-power10-fun..> | 2025-12-23 14:10 | 3.6M | |
| linux-c7-pulseaudio-..> | 2025-08-14 03:28 | 885K | |
| linux-c7-pulseaudio-..> | 2025-08-14 18:44 | 56K | |
| linux-c7-qt-4.8.7_5.pkg | 2025-08-13 19:01 | 8.4M | |
| linux-c7-qt-x11-4.8...> | 2025-08-14 06:34 | 25M | |
| linux-c7-qtwebkit-2...> | 2025-08-14 14:10 | 9.9M | |
| linux-c7-sdl-1.2.15_..> | 2025-08-14 07:02 | 363K | |
| linux-c7-sdl12-extra..> | 2025-08-14 22:59 | 124K | |
| linux-c7-sdl20-2.0.1..> | 2025-08-14 17:53 | 521K | |
| linux-c7-sqlite-3.7...> | 2025-08-13 16:11 | 709K | |
| linux-c7-strace-4.24..> | 2025-08-16 17:17 | 311K | |
| linux-c7-systemd-lib..> | 2025-08-13 12:57 | 543K | |
| linux-c7-tcl85-8.5.1..> | 2025-08-14 13:08 | 2.1M | |
| linux-c7-tcp_wrapper..> | 2025-08-13 19:17 | 68K | |
| linux-c7-tk85-8.5.13..> | 2025-08-14 15:46 | 1.8M | |
| linux-c7-trousers-0...> | 2025-08-14 08:43 | 425K | |
| linux-c7-unixODBC-2...> | 2025-08-18 08:08 | 606K | |
| linux-c7-userspace-r..> | 2025-08-14 23:26 | 66K | |
| linux-c7-wayland-1.1..> | 2025-08-13 13:09 | 97K | |
| linux-c7-xcb-util-0...> | 2025-08-15 21:00 | 16K | |
| linux-c7-xcb-util-im..> | 2025-08-19 11:08 | 18K | |
| linux-c7-xcb-util-ke..> | 2025-08-22 16:20 | 9.5K | |
| linux-c7-xorg-libs-7..> | 2025-08-13 09:28 | 3.8M | |
| linux-c7-zlib-devel-..> | 2025-08-14 18:46 | 36K | |
| linux-chrome-143.0.7..> | 2025-12-29 06:47 | 126M | |
| linux-discord-0.0.11..> | 2025-12-27 22:48 | 80M | |
| linux-doom3-1.3.1.13..> | 2025-12-23 05:27 | 6.9M | |
| linux-doom3-demo-1.1..> | 2025-08-21 11:19 | 458M | |
| linux-dwarffortress-..> | 2025-12-23 21:18 | 10M | |
| linux-enemyterritory..> | 2025-12-19 16:25 | 254M | |
| linux-enemyterritory..> | 2025-12-21 23:06 | 9.1M | |
| linux-enemyterritory..> | 2025-12-23 02:31 | 491K | |
| linux-enemyterritory..> | 2025-12-22 16:59 | 437M | |
| linux-foldingathome-..> | 2025-12-21 06:33 | 3.1M | |
| linux-freetube-0.23...> | 2025-12-29 00:45 | 79M | |
| linux-gputest-0.7.0.pkg | 2025-12-28 20:45 | 1.7M | |
| linux-j-504b_5.pkg | 2025-12-29 05:03 | 2.6M | |
| linux-jabref-5.3,1.pkg | 2025-12-28 22:21 | 155M | |
| linux-laudio-0.4.pkg | 2025-12-20 23:20 | 459K | |
| linux-miniconda-inst..> | 2025-12-29 05:50 | 2.7K | |
| linux-nerogame-2.0_2..> | 2025-12-20 06:02 | 38M | |
| linux-nvidia-libs-30..> | 2025-12-23 01:37 | 44M | |
| linux-nvidia-libs-34..> | 2025-12-22 14:37 | 67M | |
| linux-nvidia-libs-39..> | 2025-12-23 10:33 | 74M | |
| linux-nvidia-libs-47..> | 2025-12-21 04:21 | 113M | |
| linux-nvidia-libs-58..> | 2025-12-19 18:09 | 239M | |
| linux-nvidia-libs-de..> | 2025-12-22 20:55 | 239M | |
| linux-nwnclient-1.69..> | 2025-12-21 05:56 | 312M | |
| linux-pvs-studio-7.3..> | 2025-12-23 09:18 | 28M | |
| linux-quake3-1.32c.pkg | 2025-12-20 18:23 | 2.0M | |
| linux-quake4-1.4.2_1..> | 2025-12-20 23:01 | 243M | |
| linux-quake4-demo-1...> | 2025-08-21 01:28 | 316M | |
| linux-r7-office-2025..> | 2025-12-30 11:07 | 408M | |
| linux-r7-organizer-3..> | 2025-12-28 12:37 | 72M | |
| linux-r7-organizer-p..> | 2025-12-30 15:12 | 72M | |
| linux-racadm-11.3.0...> | 2025-12-21 05:54 | 1.1M | |
| linux-rkbin-g2019071..> | 2025-08-17 10:43 | 2.1M | |
| linux-rl9-9.7.pkg | 2025-12-28 12:16 | 2.1K | |
| linux-rl9-alsa-lib-1..> | 2025-12-18 17:59 | 940K | |
| linux-rl9-alsa-lib-d..> | 2025-12-18 21:59 | 81K | |
| linux-rl9-alsa-plugi..> | 2025-12-19 09:04 | 16K | |
| linux-rl9-alsa-plugi..> | 2025-12-19 10:17 | 50K | |
| linux-rl9-aom-libs-3..> | 2025-12-18 17:02 | 1.8M | |
| linux-rl9-at-spi2-at..> | 2025-12-18 13:43 | 136K | |
| linux-rl9-at-spi2-co..> | 2025-12-18 10:15 | 184K | |
| linux-rl9-atk-2.36.0..> | 2025-12-18 11:05 | 286K | |
| linux-rl9-avahi-libs..> | 2025-12-18 11:32 | 110K | |
| linux-rl9-ca-certifi..> | 2025-12-19 12:12 | 1.0M | |
| linux-rl9-cairo-1.17..> | 2025-12-18 07:04 | 1.2M | |
| linux-rl9-cairo-gobj..> | 2025-12-18 11:32 | 15K | |
| linux-rl9-cups-libs-..> | 2025-12-18 13:01 | 483K | |
| linux-rl9-curl-7.76...> | 2025-12-19 06:03 | 826K | |
| linux-rl9-cyrus-sasl..> | 2025-12-18 17:13 | 811K | |
| linux-rl9-dbus-libs-..> | 2025-12-18 07:43 | 431K | |
| linux-rl9-devtools-9..> | 2025-12-19 00:27 | 86M | |
| linux-rl9-dri-25.0.7..> | 2025-12-18 06:02 | 34M | |
| linux-rl9-elfutils-l..> | 2025-12-18 01:20 | 243K | |
| linux-rl9-elfutils-l..> | 2025-12-18 01:39 | 549K | |
| linux-rl9-expat-2.5...> | 2025-12-18 01:35 | 172K | |
| linux-rl9-ffmpeg-lib..> | 2025-12-18 23:49 | 7.8M | |
| linux-rl9-flac-libs-..> | 2025-12-18 11:57 | 390K | |
| linux-rl9-fontconfig..> | 2025-12-18 01:43 | 361K | |
| linux-rl9-freetype-2..> | 2025-12-18 01:27 | 701K | |
| linux-rl9-fribidi-1...> | 2025-12-18 08:28 | 90K | |
| linux-rl9-gdk-pixbuf..> | 2025-12-18 10:25 | 641K | |
| linux-rl9-gnupg2-2.3..> | 2025-12-19 09:10 | 2.6M | |
| linux-rl9-gnutls-3.8..> | 2025-12-18 07:17 | 1.8M | |
| linux-rl9-graphene-1..> | 2025-12-21 03:14 | 110K | |
| linux-rl9-graphite2-..> | 2025-12-18 01:24 | 141K | |
| linux-rl9-gsm-1.0.19..> | 2025-12-18 13:07 | 42K | |
| linux-rl9-gstreamer1..> | 2025-12-26 22:54 | 16M | |
| linux-rl9-gstreamer1..> | 2025-12-27 16:37 | 132K | |
| linux-rl9-gtk2-2.24...> | 2025-12-19 12:14 | 6.1M | |
| linux-rl9-gtk3-3.24...> | 2025-12-26 18:08 | 8.1M | |
| linux-rl9-harfbuzz-2..> | 2025-12-18 01:32 | 1.1M | |
| linux-rl9-highway-1...> | 2025-12-18 11:41 | 482K | |
| linux-rl9-icu-67.1_2..> | 2025-12-18 11:26 | 19M | |
| linux-rl9-imageforma..> | 2025-12-18 01:20 | 2.2M | |
| linux-rl9-libassuan-..> | 2025-12-18 22:38 | 91K | |
| linux-rl9-libasyncns..> | 2025-12-18 16:27 | 31K | |
| linux-rl9-libdrm-2.4..> | 2025-12-18 03:47 | 285K | |
| linux-rl9-libepoxy-1..> | 2025-12-18 12:58 | 424K | |
| linux-rl9-libevent-2..> | 2025-12-18 07:33 | 453K | |
| linux-rl9-libgcrypt-..> | 2025-12-18 01:37 | 835K | |
| linux-rl9-libglvnd-1..> | 2025-12-18 04:15 | 540K | |
| linux-rl9-libgpg-err..> | 2025-12-18 01:20 | 256K | |
| linux-rl9-libjxl-0.7..> | 2025-12-18 01:05 | 972K | |
| linux-rl9-libksba-1...> | 2025-12-18 23:38 | 240K | |
| linux-rl9-libnghttp2..> | 2025-12-18 18:40 | 124K | |
| linux-rl9-libogg-1.3..> | 2025-12-18 10:22 | 36K | |
| linux-rl9-libpciacce..> | 2025-12-18 02:38 | 35K | |
| linux-rl9-librsvg2-2..> | 2025-12-18 12:31 | 5.7M | |
| linux-rl9-libsecret-..> | 2025-12-19 13:00 | 232K | |
| linux-rl9-libsigc++2..> | 2025-12-19 16:46 | 39K | |
| linux-rl9-libsndfile..> | 2025-12-18 17:49 | 380K | |
| linux-rl9-libssh-0.1..> | 2025-12-18 17:54 | 381K | |
| linux-rl9-libstemmer..> | 2025-12-18 11:37 | 131K | |
| linux-rl9-libtasn1-4..> | 2025-12-18 03:32 | 100K | |
| linux-rl9-libthai-0...> | 2025-12-18 07:20 | 214K | |
| linux-rl9-libtheora-..> | 2025-12-18 18:42 | 264K | |
| linux-rl9-libtool-lt..> | 2025-12-20 01:19 | 44K | |
| linux-rl9-libtracker..> | 2025-12-18 13:37 | 556K | |
| linux-rl9-libv4l-1.2..> | 2025-12-19 17:37 | 290K | |
| linux-rl9-libva-2.22..> | 2025-12-18 16:36 | 186K | |
| linux-rl9-libvdpau-1..> | 2025-12-18 17:18 | 52K | |
| linux-rl9-libvorbis-..> | 2025-12-18 12:42 | 282K | |
| linux-rl9-libvpx-1.9..> | 2025-12-18 15:21 | 2.0M | |
| linux-rl9-libxkbcomm..> | 2025-12-18 13:46 | 231K | |
| linux-rl9-libxml2-2...> | 2025-12-18 01:35 | 1.3M | |
| linux-rl9-libxslt-1...> | 2025-12-19 22:23 | 363K | |
| linux-rl9-lld-20.1.8..> | 2025-12-23 04:56 | 3.7M | |
| linux-rl9-lldb-20.1...> | 2025-12-22 05:21 | 8.4M | |
| linux-rl9-llvm-20.1...> | 2025-12-18 04:15 | 173M | |
| linux-rl9-lz4-1.9.3_..> | 2025-12-18 01:40 | 162K | |
| linux-rl9-nasm-2.15...> | 2025-12-20 22:46 | 418K | |
| linux-rl9-nettle-3.1..> | 2025-12-18 04:36 | 837K | |
| linux-rl9-npth-1.6_1..> | 2025-12-19 01:50 | 22K | |
| linux-rl9-nspr-4.36...> | 2025-12-18 01:15 | 237K | |
| linux-rl9-nss-3.112...> | 2025-12-18 01:35 | 2.9M | |
| linux-rl9-ocl-icd-2...> | 2025-12-18 18:41 | 68K | |
| linux-rl9-openal-sof..> | 2025-12-19 07:20 | 700K | |
| linux-rl9-openldap-2..> | 2025-12-19 01:03 | 402K | |
| linux-rl9-opus-1.3.1..> | 2025-12-18 18:47 | 345K | |
| linux-rl9-orc-0.4.31..> | 2025-12-18 17:13 | 347K | |
| linux-rl9-p11-kit-0...> | 2025-12-18 06:31 | 969K | |
| linux-rl9-pango-1.48..> | 2025-12-18 09:13 | 455K | |
| linux-rl9-pixman-0.4..> | 2025-12-18 04:38 | 518K | |
| linux-rl9-pulseaudio..> | 2025-12-18 21:07 | 919K | |
| linux-rl9-pulseaudio..> | 2025-12-20 02:40 | 58K | |
| linux-rl9-python39-3..> | 2025-12-18 01:50 | 14M | |
| linux-rl9-qt5-5.15.9..> | 2025-12-20 17:03 | 1.0K | |
| linux-rl9-qt5-qt3d-5..> | 2025-12-19 17:25 | 6.2M | |
| linux-rl9-qt5-qtbase..> | 2025-12-18 15:53 | 17M | |
| linux-rl9-qt5-qtconn..> | 2025-12-19 14:45 | 886K | |
| linux-rl9-qt5-qtdecl..> | 2025-12-19 12:36 | 8.8M | |
| linux-rl9-qt5-qtgrap..> | 2025-12-20 04:25 | 119K | |
| linux-rl9-qt5-qtimag..> | 2025-12-19 02:28 | 145K | |
| linux-rl9-qt5-qtmult..> | 2025-12-19 22:17 | 1.5M | |
| linux-rl9-qt5-qtquic..> | 2025-12-19 16:23 | 5.0M | |
| linux-rl9-qt5-qtscri..> | 2025-12-19 06:06 | 2.0M | |
| linux-rl9-qt5-qtsens..> | 2025-12-19 19:56 | 383K | |
| linux-rl9-qt5-qtseri..> | 2025-12-20 02:39 | 353K | |
| linux-rl9-qt5-qtseri..> | 2025-12-19 16:45 | 84K | |
| linux-rl9-qt5-qtsvg-..> | 2025-12-19 22:23 | 320K | |
| linux-rl9-qt5-qttool..> | 2025-12-20 00:32 | 7.1M | |
| linux-rl9-qt5-qtwayl..> | 2025-12-20 01:52 | 2.1M | |
| linux-rl9-qt5-qtwebc..> | 2025-12-19 23:05 | 149K | |
| linux-rl9-qt5-qtwebs..> | 2025-12-19 14:01 | 161K | |
| linux-rl9-qt5-qtx11e..> | 2025-12-19 15:23 | 31K | |
| linux-rl9-qt5-qtxmlp..> | 2025-12-19 07:03 | 1.9M | |
| linux-rl9-sdl-1.2.60..> | 2025-12-19 02:08 | 140K | |
| linux-rl9-sdl12-extr..> | 2025-12-19 22:32 | 183K | |
| linux-rl9-sdl20-2.26..> | 2025-12-18 17:18 | 1.3M | |
| linux-rl9-sdl20-extr..> | 2025-12-20 02:03 | 311K | |
| linux-rl9-sdl_net-1...> | 2025-12-22 13:48 | 12K | |
| linux-rl9-shaderc-20..> | 2025-12-18 15:54 | 2.0M | |
| linux-rl9-spirv-tool..> | 2025-12-18 15:59 | 3.2M | |
| linux-rl9-strace-6.1..> | 2025-12-19 06:03 | 1.5M | |
| linux-rl9-systemd-li..> | 2025-12-18 02:12 | 1.2M | |
| linux-rl9-tcl86-8.6...> | 2025-12-20 00:10 | 1.0M | |
| linux-rl9-tcp_wrappe..> | 2025-12-19 09:54 | 55K | |
| linux-rl9-tk86-8.6.1..> | 2025-12-23 15:19 | 1.5M | |
| linux-rl9-trousers-0..> | 2025-12-20 08:56 | 285K | |
| linux-rl9-vmaf-2.3.0..> | 2025-12-18 13:13 | 168K | |
| linux-rl9-vulkan-loa..> | 2025-12-18 18:42 | 268K | |
| linux-rl9-wayland-1...> | 2025-12-18 03:57 | 110K | |
| linux-rl9-wget-1.21...> | 2025-12-19 15:11 | 747K | |
| linux-rl9-xcb-util-0..> | 2025-12-19 09:04 | 93K | |
| linux-rl9-xorg-libs-..> | 2025-12-18 02:54 | 4.2M | |
| linux-steam-utils-20..> | 2025-12-30 09:27 | 349K | |
| linux-sublime-merge-..> | 2025-12-28 10:20 | 5.4M | |
| linux-sublime-text4-..> | 2025-12-30 12:14 | 17M | |
| linux-sublime3-3.2.2..> | 2025-12-28 10:04 | 12M | |
| linux-tradingview-2...> | 2025-12-27 20:41 | 93M | |
| linux-tsmuxer-1.10.6..> | 2025-12-23 04:31 | 5.2M | |
| linux-unigine-heaven..> | 2025-12-23 12:54 | 265M | |
| linux-unigine-sanctu..> | 2025-12-24 07:18 | 27M | |
| linux-unigine-superp..> | 2025-12-21 00:30 | 1.4G | |
| linux-unigine-tropic..> | 2025-12-23 04:59 | 55M | |
| linux-unigine-valley..> | 2025-12-22 17:06 | 374M | |
| linux-vieb-12.5.0.pkg | 2025-12-27 22:38 | 86M | |
| linux-virtual-jay-pe..> | 2025-12-21 16:48 | 4.9M | |
| linux-widevine-cdm-4..> | 2025-08-20 18:19 | 13M | |
| linux-wps-office-11...> | 2025-12-28 07:15 | 351M | |
| linux-wps-office-zh_..> | 2025-12-23 17:39 | 352M | |
| linux-zotero-6.0.10_..> | 2025-12-30 00:22 | 57M | |
| linux_base-c7-7.9.20..> | 2025-08-13 04:05 | 40M | |
| linux_base-rl9-9.7.pkg | 2025-12-18 00:41 | 58M | |
| linux_dvbwrapper-kmo..> | 2025-08-17 17:38 | 3.6K | |
| linux_libusb-c7-13.1..> | 2025-08-16 22:11 | 63K | |
| linux_libusb-rl9-13...> | 2025-12-19 21:03 | 34K | |
| linuxdcpp-1.1.0_22.pkg | 2025-12-28 03:09 | 937K | |
| linuxdoc-1.1_2.pkg | 2025-08-13 23:42 | 6.7K | |
| linuxdoc-tools-0.9.8..> | 2025-12-18 18:46 | 420K | |
| linuxfdisk-2.11z_2.pkg | 2025-08-18 07:59 | 100K | |
| linuxlibertine-4.7.5..> | 2025-12-28 07:43 | 3.8M | |
| linuxlibertine-g-201..> | 2025-12-26 20:16 | 3.2M | |
| linuxsampler-2.4.0_1..> | 2025-12-27 19:22 | 2.3M | |
| linuxwave-0.3.0_1.pkg | 2025-12-30 14:47 | 390K | |
| linwarrior-20100320_..> | 2025-12-21 21:20 | 1.9M | |
| liquibase-4.3.5.pkg | 2025-12-30 10:29 | 6.4M | |
| liquid-dsp-1.6.0.pkg | 2025-08-15 11:26 | 647K | |
| liquidsfz-0.3.2.pkg | 2025-12-30 02:08 | 200K | |
| lirc-0.9.0_14,1.pkg | 2025-12-23 05:01 | 395K | |
| lis-2.1.10.pkg | 2025-12-23 18:49 | 435K | |
| listadmin-2.40_1.pkg | 2025-12-23 01:23 | 20K | |
| listener-2.2_3.pkg | 2025-12-27 21:53 | 21K | |
| listres-1.0.6.pkg | 2025-12-21 03:17 | 6.7K | |
| listserialc-1.1.0.pkg | 2025-12-27 06:04 | 4.3K | |
| lite-editor-1.11.pkg | 2025-12-30 17:39 | 244K | |
| lite-xl-2.1.4.pkg | 2025-12-29 21:55 | 576K | |
| litecoin-0.21.4_10.pkg | 2025-12-28 02:38 | 5.0M | |
| litecoin-daemon-0.21..> | 2025-12-24 07:24 | 2.7M | |
| litecoin-utils-0.21...> | 2025-12-20 17:58 | 1.7M | |
| liteide-38.4_4.pkg | 2025-12-28 08:20 | 9.6M | |
| litestream-0.5.5.pkg | 2025-12-28 06:14 | 9.5M | |
| litmus-0.13_2.pkg | 2025-12-29 17:21 | 44K | |
| littlefly-lv2-1.0.pkg | 2025-12-29 03:21 | 95K | |
| littlejet-0.2.0.pkg | 2025-12-23 14:53 | 33K | |
| liveMedia-2025.11.06..> | 2025-12-18 16:11 | 549K | |
| livego-0.0.15_34.pkg | 2025-12-22 15:39 | 2.7M | |
| lives-3.2.0_24.pkg | 2025-12-28 20:56 | 3.0M | |
| lizard-2.1.pkg | 2025-08-18 09:27 | 161K | |
| lizardfs-3.12.0_28.pkg | 2025-12-23 06:42 | 2.6M | |
| lizzie-0.6.105_2.pkg | 2025-12-28 07:16 | 3.4M | |
| ljclive-0.4.10_3.pkg | 2025-08-21 02:53 | 24K | |
| ljdeps-1.0_7.pkg | 2025-12-30 10:00 | 1.3K | |
| lla-0.99.1_1.pkg | 2025-12-22 04:15 | 3.3K | |
| llama-cpp-7134.pkg | 2025-12-27 17:49 | 13M | |
| llama.el-1.0.2.pkg | 2025-12-26 23:04 | 12K | |
| llama.el-emacs_canna..> | 2025-12-26 22:06 | 12K | |
| llama.el-emacs_devel..> | 2025-12-27 01:35 | 12K | |
| llama.el-emacs_devel..> | 2025-12-18 23:56 | 12K | |
| llama.el-emacs_nox-1..> | 2025-12-18 20:01 | 12K | |
| llama.el-emacs_wayla..> | 2025-12-26 20:41 | 12K | |
| llbuild-s.2017.12.10..> | 2025-12-22 05:20 | 370K | |
| lldap-0.6.1_6.pkg | 2025-12-29 13:56 | 14M | |
| lldb-mi-g20250923.pkg | 2025-12-19 01:02 | 207K | |
| lldpd-1.0.19_1.pkg | 2025-12-27 15:19 | 243K | |
| lldpd-tiny-1.0.19_1.pkg | 2025-08-18 19:22 | 220K | |
| llhttp-9.3.0.pkg | 2025-08-10 21:30 | 41K | |
| lll_spect-1.0_4.pkg | 2025-12-30 16:53 | 19K | |
| llvm-19_1,1.pkg | 2025-12-17 03:01 | 11K | |
| llvm-cheri-17.0.d202..> | 2025-12-17 07:50 | 143M | |
| llvm-cheriot-21.1.d2..> | 2025-12-16 09:20 | 89M | |
| llvm-devel-22.0.d202..> | 2025-12-17 21:30 | 373M | |
| llvm-devel-lite-22.0..> | 2025-12-17 03:01 | 117M | |
| llvm-morello-17.0.d2..> | 2025-12-17 23:46 | 139M | |
| llvm11-11.0.1_11.pkg | 2025-12-17 16:40 | 113M | |
| llvm12-12.0.1_14.pkg | 2025-12-17 19:52 | 126M | |
| llvm13-13.0.1_8.pkg | 2025-12-16 19:55 | 176M | |
| llvm14-14.0.6_6.pkg | 2025-12-16 23:14 | 189M | |
| llvm15-15.0.7_10.pkg | 2025-12-17 22:55 | 152M | |
| llvm15-lite-15.0.7_1..> | 2025-12-17 09:47 | 71M | |
| llvm16-16.0.6_11.pkg | 2025-12-16 09:25 | 212M | |
| llvm16-lite-16.0.6_1..> | 2025-12-16 23:34 | 82M | |
| llvm17-17.0.6_8.pkg | 2025-12-17 07:07 | 241M | |
| llvm17-lite-17.0.6_8..> | 2025-12-16 07:05 | 84M | |
| llvm18-18.1.8_2.pkg | 2025-12-17 12:47 | 265M | |
| llvm18-lite-18.1.8_2..> | 2025-12-17 18:01 | 88M | |
| llvm19-19.1.7_1.pkg | 2025-12-16 04:11 | 271M | |
| llvm19-lite-19.1.7_1..> | 2025-12-16 11:21 | 88M | |
| llvm20-20.1.8.pkg | 2025-12-16 06:46 | 253M | |
| llvm20-lite-20.1.8.pkg | 2025-12-17 21:10 | 91M | |
| llvm21-21.1.8.pkg | 2025-12-25 00:52 | 273M | |
| llvm21-lite-21.1.8.pkg | 2025-12-25 02:34 | 96M | |
| lm-solve-0.14.2.pkg | 2025-12-22 05:21 | 55K | |
| lm4tools-0.1.3.20180..> | 2025-08-20 18:37 | 14K | |
| lmarbles-1.0.8_6.pkg | 2025-12-21 00:58 | 700K | |
| lmbench-3.0.a9_4,1.pkg | 2025-12-23 15:22 | 451K | |
| lmclock-1.2_2.pkg | 2025-08-18 05:18 | 5.4K | |
| lmdb-0.9.33,1.pkg | 2025-08-13 04:09 | 112K | |
| lmdbg-1.3.0_1.pkg | 2025-08-18 21:53 | 52K | |
| lmfit-10.0.pkg | 2025-12-18 22:47 | 48K | |
| lmmon-0.65_2.pkg | 2025-08-15 23:28 | 6.9K | |
| lmon-1.2_1.pkg | 2025-12-20 15:03 | 9.7K | |
| lms-3.72.1_1.pkg | 2025-12-29 23:57 | 1.8M | |
| lnav-0.12.3.pkg | 2025-12-23 01:54 | 2.9M | |
| lnd-0.17.3.b_18.pkg | 2025-12-23 16:28 | 18M | |
| lndir-1.0.5.pkg | 2025-08-18 03:08 | 7.1K | |
| lnphost-1.0a_1.pkg | 2025-08-16 17:28 | 13K | |
| lo-libreoffice-25.8...> | 2025-12-27 11:46 | 2.8M | |
| loaders-update-1.2.2..> | 2025-12-23 20:43 | 8.1K | |
| local-php-security-c..> | 2025-12-20 23:02 | 2.4M | |
| locale-en_DK-0.1.1.pkg | 2025-08-16 12:07 | 1.7K | |
| localedata-5.4_2.pkg | 2025-08-13 21:37 | 71K | |
| localize-0.0.1_13.pkg | 2025-12-27 09:40 | 29K | |
| localsearch-3.8.2_4.pkg | 2025-12-26 19:17 | 689K | |
| locarna-2.0.0_1.pkg | 2025-12-22 16:17 | 2.0M | |
| locator-0.1.pkg | 2025-08-18 06:41 | 6.5K | |
| loccount-2.16_17.pkg | 2025-12-22 05:25 | 1.0M | |
| lockfile-progs-0.2.0..> | 2025-08-15 21:04 | 10K | |
| lockfree-malloc-0.0...> | 2025-12-29 04:16 | 7.6K | |
| loco-web-framework-0..> | 2025-12-29 23:09 | 142K | |
| loderunner-ng-0.1.4.pkg | 2025-12-28 23:57 | 516K | |
| log4c-1.2.4_2.pkg | 2025-12-21 00:59 | 78K | |
| log4cplus-2.1.2.pkg | 2025-08-14 18:17 | 338K | |
| log4cpp-1.1.5.pkg | 2025-12-19 00:18 | 184K | |
| log4cxx-1.6.0.pkg | 2025-12-27 15:15 | 662K | |
| log4j-1.2.17.pkg | 2025-12-27 12:04 | 1.3M | |
| log4net-1.2.10_5.pkg | 2025-12-19 23:41 | 531K | |
| log4sh-1.4.2.pkg | 2025-08-19 00:32 | 29K | |
| log4shib-2.0.1_1.pkg | 2025-08-13 14:45 | 93K | |
| loganalyzer-php81-4...> | 2025-12-30 11:41 | 3.7M | |
| loganalyzer-php82-4...> | 2025-12-30 13:42 | 3.7M | |
| loganalyzer-php83-4...> | 2025-12-30 09:30 | 3.7M | |
| loganalyzer-php84-4...> | 2025-12-30 18:26 | 3.7M | |
| loganalyzer-php85-4...> | 2025-12-28 15:21 | 3.7M | |
| logcheck-1.4.7.pkg | 2025-12-23 01:22 | 93K | |
| logisim-2.7.1.pkg | 2025-12-30 15:29 | 5.6M | |
| logrotate-3.13.0_2.pkg | 2025-12-18 20:30 | 36K | |
| logseq-0.10.15_1.pkg | 2025-12-29 14:01 | 115M | |
| logstalgia-1.1.4_11.pkg | 2025-12-30 04:43 | 1.8M | |
| logstash7-7.17.11.pkg | 2025-12-27 19:48 | 145M | |
| logstash8-8.11.3.pkg | 2025-12-27 13:04 | 133M | |
| logsurfer-1.8_3.pkg | 2025-08-19 11:53 | 48K | |
| logswan-2.1.14.pkg | 2025-08-17 21:51 | 12K | |
| logtool-1.3.1_2.pkg | 2025-08-17 11:27 | 30K | |
| logtools-0.13e_3.pkg | 2025-08-22 07:14 | 28K | |
| loguru-2.1.0.49.pkg | 2025-08-18 06:15 | 26K | |
| logwatch-7.13_1.pkg | 2025-12-21 12:42 | 367K | |
| lokalize-25.12.0.pkg | 2025-12-27 02:45 | 2.2M | |
| lolcat-1.5.pkg | 2025-08-20 04:30 | 8.6K | |
| lollypop-1.4.41_1.pkg | 2025-12-28 09:25 | 491K | |
| lookat-1.4.4_1.pkg | 2025-08-22 12:17 | 44K | |
| lookatme-2.5.5_3.pkg | 2025-12-22 16:19 | 84K | |
| lookout-1.4_2.pkg | 2025-12-21 12:33 | 9.4K | |
| loook-0.9.1.pkg | 2025-12-29 17:02 | 14K | |
| lordsawar-0.3.2_5.pkg | 2025-12-28 13:41 | 23M | |
| loudmouth-1.5.4_1.pkg | 2025-12-19 16:39 | 81K | |
| lout-3.43.2.pkg | 2025-12-29 09:56 | 1.4M | |
| love-11.5_2.pkg | 2025-12-27 09:49 | 1.6M | |
| love07-0.7.2_26.pkg | 2025-12-27 03:14 | 312K | |
| love08-0.8.0_20.pkg | 2025-12-29 22:06 | 376K | |
| love5-0.5.0_31.pkg | 2025-12-28 03:27 | 357K | |
| love10-0.10.2_6.pkg | 2025-12-27 17:54 | 1.0M | |
| lowdown-2.0.4.pkg | 2025-12-19 02:23 | 288K | |
| lp_solve-5.5.2.5_1.pkg | 2025-08-13 16:06 | 530K | |
| lpairs-1.0.5.pkg | 2025-12-22 20:23 | 235K | |
| lpc21isp-1.97.pkg | 2025-08-18 00:38 | 225K | |
| lpcnet-0.5,1.pkg | 2025-08-14 13:26 | 7.3M | |
| lprps-2.5_2.pkg | 2025-08-20 01:15 | 30K | |
| lr-2.0.1.pkg | 2025-12-23 12:58 | 28K | |
| lrcalc-2.1.pkg | 2025-08-15 06:16 | 70K | |
| lrng-20130314.pkg | 2025-08-17 06:35 | 382K | |
| lrslib-7.3,1.pkg | 2025-08-15 17:31 | 177K | |
| lrzip-0.651_1.pkg | 2025-12-22 15:20 | 180K | |
| lrzsz-0.12.20_7.pkg | 2025-12-20 03:04 | 68K | |
| ls-lint-2.3.1_1.pkg | 2025-12-20 17:47 | 1.0M | |
| ls-qpack-2.6.2.pkg | 2025-08-15 23:41 | 91K | |
| lsblk-4.0.pkg | 2025-08-13 22:30 | 6.4K | |
| lscolors-0.21.0_1.pkg | 2025-12-30 08:29 | 248K | |
| lscpu-1.3.0.pkg | 2025-08-13 11:03 | 8.1K | |
| lsd-1.1.5_9.pkg | 2025-12-29 01:35 | 1.1M | |
| lsdvd-0.17_6.pkg | 2025-12-20 16:43 | 14K | |
| lsix-1.8.2.pkg | 2025-12-30 16:40 | 525K | |
| lsix-nox11-1.8.2.pkg | 2025-12-28 01:13 | 525K | |
| lskat-25.12.0.pkg | 2025-12-26 22:40 | 1.4M | |
| lsknobs-1.0.pkg | 2025-08-17 16:14 | 2.1K | |
| lsof-4.99.5,8.pkg | 2025-12-18 12:03 | 117K | |
| lsop-0.2.pkg | 2025-08-22 11:30 | 5.8K | |
| lsp-plugins-lv2-1.2...> | 2025-12-29 01:23 | 6.0M | |
| lstr-0.2.1_3.pkg | 2025-12-30 03:56 | 1.0M | |
| lsw-0.3_3.pkg | 2025-08-16 06:01 | 3.6K | |
| lsyncd-2.2.3_1.pkg | 2025-12-20 18:08 | 56K | |
| lt-aspell-1.2.1.0_1,..> | 2025-12-21 16:48 | 732K | |
| lt-hyphen-2004.04.15..> | 2025-08-17 20:55 | 4.1K | |
| lt-libreoffice-25.8...> | 2025-12-27 10:40 | 3.3M | |
| ltfs-2.4.8.1.pkg | 2025-12-20 19:28 | 1.2M | |
| ltl2ba-1.3.pkg | 2025-08-17 11:29 | 25K | |
| ltrace-0.6.0_1.pkg | 2025-08-20 22:43 | 74K | |
| ltris-1.2.1,1.pkg | 2025-12-23 11:16 | 1.2M | |
| lttng-ust-2.13.9.pkg | 2025-12-23 03:06 | 334K | |
| lttoolbox-3.8.0_1.pkg | 2025-12-18 20:32 | 327K | |
| lua-language-server-..> | 2025-12-21 14:14 | 1.8M | |
| lua-mode-20210802_11..> | 2025-12-28 10:19 | 22K | |
| lua-mode-emacs_canna..> | 2025-12-29 23:26 | 22K | |
| lua-mode-emacs_devel..> | 2025-12-30 17:53 | 22K | |
| lua-mode-emacs_devel..> | 2025-12-20 20:47 | 22K | |
| lua-mode-emacs_nox-2..> | 2025-12-22 17:37 | 22K | |
| lua-mode-emacs_wayla..> | 2025-12-30 10:11 | 22K | |
| lua-rds-parser-0.06.pkg | 2025-12-21 12:51 | 5.6K | |
| lua-resty-core-0.1.3..> | 2025-12-19 13:45 | 32K | |
| lua-resty-dns-0.23.pkg | 2025-12-21 11:31 | 11K | |
| lua-resty-hmac-0.06.pkg | 2025-12-19 01:54 | 4.3K | |
| lua-resty-http-0.17...> | 2025-12-19 10:38 | 17K | |
| lua-resty-jwt-0.2.3.pkg | 2025-12-19 13:02 | 20K | |
| lua-resty-lrucache-0..> | 2025-12-18 20:37 | 7.4K | |
| lua-resty-openidc-1...> | 2025-12-23 13:36 | 23K | |
| lua-resty-openssl-1...> | 2025-12-23 16:55 | 85K | |
| lua-resty-redis-0.29..> | 2025-12-23 14:13 | 3.9K | |
| lua-resty-session-4...> | 2025-12-20 17:50 | 52K | |
| lua-resty-session3-3..> | 2025-12-19 13:19 | 25K | |
| lua-resty-string-0.1..> | 2025-12-18 16:23 | 6.7K | |
| lua51-5.1.5_10.pkg | 2025-12-18 18:20 | 180K | |
| lua51-argon2-3.0.1.pkg | 2025-12-23 02:30 | 4.6K | |
| lua51-argparse-0.7.1..> | 2025-12-24 07:29 | 12K | |
| lua51-bitlib-24_1.pkg | 2025-12-20 11:01 | 2.9K | |
| lua51-bitop-1.0.3.pkg | 2025-12-18 19:23 | 3.7K | |
| lua51-cjson-2.1.0_1.pkg | 2025-12-19 15:38 | 14K | |
| lua51-cqueues-202007..> | 2025-12-19 20:16 | 324K | |
| lua51-gettext-1.6.pkg | 2025-12-21 21:57 | 3.4K | |
| lua51-iconv-7.1.0.pkg | 2025-12-24 04:49 | 3.9K | |
| lua51-icu-utils-0.0...> | 2025-12-20 23:16 | 5.2K | |
| lua51-json-1.3.4_1.pkg | 2025-12-22 17:15 | 13K | |
| lua51-lgi-0.9.2_3.pkg | 2025-12-19 01:02 | 79K | |
| lua51-libevent-0.4.6..> | 2025-12-23 16:14 | 13K | |
| lua51-lpeg-1.1.0.pkg | 2025-12-18 20:19 | 26K | |
| lua51-lsqlite3-0.9.6..> | 2025-12-20 07:04 | 579K | |
| lua51-lua-gd-2.0.33r..> | 2025-12-30 01:50 | 389K | |
| lua51-luadbi-0.7.4_1..> | 2025-12-21 16:25 | 9.1K | |
| lua51-luaexpat-1.5.2..> | 2025-12-20 18:02 | 15K | |
| lua51-luafilesystem-..> | 2025-12-19 16:23 | 25K | |
| lua51-lualdap-1.3.1.pkg | 2025-12-20 17:06 | 15K | |
| lua51-luarocks-3.12...> | 2025-12-21 13:07 | 122K | |
| lua51-luasec-1.3.2.pkg | 2025-12-23 19:56 | 29K | |
| lua51-luasocket-3.1...> | 2025-12-19 10:53 | 165K | |
| lua51-luasql-firebir..> | 2025-12-21 07:43 | 9.4K | |
| lua51-luasql-mysql-2..> | 2025-12-22 09:30 | 7.9K | |
| lua51-luasql-odbc-2...> | 2025-12-20 18:21 | 9.7K | |
| lua51-luasql-postgre..> | 2025-12-22 08:40 | 7.3K | |
| lua51-luasql-sqlite3..> | 2025-12-21 05:20 | 7.9K | |
| lua51-luaunbound-1.0..> | 2025-12-21 15:08 | 5.9K | |
| lua51-lyaml-6.2.4_1.pkg | 2025-12-21 07:33 | 25K | |
| lua51-lzlib-0.4.3_1.pkg | 2025-12-22 13:58 | 14K | |
| lua51-mpd-0.1_2.pkg | 2025-12-20 17:11 | 11K | |
| lua51-pty-1.26.pkg | 2025-12-20 20:46 | 5.6K | |
| lua51-puremagic-1.0...> | 2025-12-23 16:05 | 5.7K | |
| lua51-stdlib-41.2.2_..> | 2025-12-21 19:53 | 75K | |
| lua51-stdlib-debug-1..> | 2025-12-18 23:01 | 7.3K | |
| lua51-stdlib-normali..> | 2025-12-19 19:45 | 26K | |
| lua51-xapian-1.4.30.pkg | 2025-12-21 17:40 | 532K | |
| lua51-zlib-1.2_1.pkg | 2025-12-22 15:36 | 5.9K | |
| lua52-5.2.4_1.pkg | 2025-12-18 14:38 | 192K | |
| lua52-argon2-3.0.1.pkg | 2025-12-22 17:40 | 4.5K | |
| lua52-argparse-0.7.1..> | 2025-12-23 05:26 | 12K | |
| lua52-bitlib-24_1.pkg | 2025-12-23 03:05 | 2.9K | |
| lua52-bitop-1.0.3.pkg | 2025-12-22 06:27 | 3.4K | |
| lua52-cjson-2.1.0_1.pkg | 2025-12-21 11:57 | 14K | |
| lua52-cqueues-202007..> | 2025-12-23 03:15 | 320K | |
| lua52-iconv-7.1.0.pkg | 2025-12-23 19:45 | 3.9K | |
| lua52-icu-utils-0.0...> | 2025-12-21 11:26 | 5.2K | |
| lua52-json-1.3.4_1.pkg | 2025-12-22 22:07 | 13K | |
| lua52-lgi-0.9.2_3.pkg | 2025-12-21 02:25 | 79K | |
| lua52-libevent-0.4.6..> | 2025-12-22 22:12 | 13K | |
| lua52-lpeg-1.1.0.pkg | 2025-12-19 03:45 | 26K | |
| lua52-lsqlite3-0.9.6..> | 2025-12-20 20:11 | 579K | |
| lua52-lua-gd-2.0.33r..> | 2025-12-30 09:29 | 390K | |
| lua52-luadbi-0.7.4_1..> | 2025-12-23 19:58 | 9.1K | |
| lua52-luaexpat-1.5.2..> | 2025-12-24 04:22 | 15K | |
| lua52-luafilesystem-..> | 2025-12-24 06:56 | 25K | |
| lua52-lualdap-1.3.1.pkg | 2025-12-21 00:07 | 15K | |
| lua52-luarocks-3.12...> | 2025-12-22 17:56 | 122K | |
| lua52-luasec-1.3.2.pkg | 2025-12-24 07:24 | 29K | |
| lua52-luasocket-3.1...> | 2025-12-19 03:02 | 164K | |
| lua52-luasql-firebir..> | 2025-12-20 09:26 | 9.1K | |
| lua52-luasql-mysql-2..> | 2025-12-23 08:39 | 7.7K | |
| lua52-luasql-odbc-2...> | 2025-12-22 17:30 | 9.5K | |
| lua52-luasql-postgre..> | 2025-12-20 17:05 | 7.0K | |
| lua52-luasql-sqlite3..> | 2025-12-23 21:52 | 7.7K | |
| lua52-luaunbound-1.0..> | 2025-12-23 12:47 | 5.9K | |
| lua52-lyaml-6.2.4_1.pkg | 2025-12-20 08:45 | 25K | |
| lua52-lzlib-0.4.3_1.pkg | 2025-12-23 21:06 | 14K | |
| lua52-posix-36.3.pkg | 2025-12-23 19:43 | 73K | |
| lua52-puremagic-1.0...> | 2025-12-21 04:35 | 5.7K | |
| lua52-stdlib-41.2.2_..> | 2025-12-23 06:50 | 75K | |
| lua52-stdlib-debug-1..> | 2025-12-18 23:20 | 7.3K | |
| lua52-stdlib-normali..> | 2025-12-19 05:01 | 26K | |
| lua52-sysctl-2.1.pkg | 2025-12-23 09:35 | 8.1K | |
| lua52-xapian-1.4.30.pkg | 2025-12-22 10:54 | 532K | |
| lua53-5.3.6_1.pkg | 2025-12-16 01:29 | 300K | |
| lua53-argon2-3.0.1.pkg | 2025-12-21 14:09 | 4.5K | |
| lua53-argparse-0.7.1..> | 2025-12-23 05:05 | 12K | |
| lua53-bcrypt-2.3.1.pkg | 2025-12-21 11:17 | 11K | |
| lua53-bitlib-24_1.pkg | 2025-12-22 20:41 | 2.9K | |
| lua53-bitop-1.0.3.pkg | 2025-12-21 22:54 | 3.4K | |
| lua53-cjson-2.1.0_1.pkg | 2025-12-21 01:24 | 14K | |
| lua53-cqueues-202007..> | 2025-12-24 04:57 | 317K | |
| lua53-iconv-7.1.0.pkg | 2025-12-21 17:40 | 3.9K | |
| lua53-icu-utils-0.0...> | 2025-12-20 04:25 | 5.2K | |
| lua53-json-1.3.4_1.pkg | 2025-12-22 06:58 | 13K | |
| lua53-lgi-0.9.2_3.pkg | 2025-12-18 22:36 | 79K | |
| lua53-libevent-0.4.6..> | 2025-12-21 04:31 | 13K | |
| lua53-lpeg-1.1.0.pkg | 2025-12-20 00:18 | 26K | |
| lua53-lsqlite3-0.9.6..> | 2025-12-23 05:38 | 580K | |
| lua53-lua-gd-2.0.33r..> | 2025-12-28 21:01 | 389K | |
| lua53-luadbi-0.7.4_1..> | 2025-12-22 12:28 | 9.2K | |
| lua53-luaexpat-1.5.2..> | 2025-12-21 11:09 | 15K | |
| lua53-luafilesystem-..> | 2025-12-20 10:56 | 25K | |
| lua53-lualdap-1.3.1.pkg | 2025-12-21 16:42 | 15K | |
| lua53-luarocks-3.12...> | 2025-12-19 20:56 | 122K | |
| lua53-luasec-1.3.2.pkg | 2025-12-23 05:03 | 29K | |
| lua53-luasocket-3.1...> | 2025-12-19 16:31 | 164K | |
| lua53-luasql-firebir..> | 2025-12-21 11:22 | 9.1K | |
| lua53-luasql-mysql-2..> | 2025-12-20 08:34 | 7.6K | |
| lua53-luasql-odbc-2...> | 2025-12-23 19:29 | 9.5K | |
| lua53-luasql-postgre..> | 2025-12-23 01:23 | 7.0K | |
| lua53-luasql-sqlite3..> | 2025-12-22 06:56 | 7.7K | |
| lua53-luaunbound-1.0..> | 2025-12-21 07:39 | 5.9K | |
| lua53-lyaml-6.2.4_1.pkg | 2025-12-22 11:08 | 25K | |
| lua53-pgsql-1.6.8_1.pkg | 2025-12-22 07:22 | 16K | |
| lua53-posix-36.3.pkg | 2025-12-22 17:30 | 73K | |
| lua53-puremagic-1.0...> | 2025-12-21 21:57 | 5.7K | |
| lua53-stdlib-41.2.2_..> | 2025-12-20 23:26 | 75K | |
| lua53-stdlib-debug-1..> | 2025-12-18 22:59 | 7.3K | |
| lua53-stdlib-normali..> | 2025-12-19 20:48 | 26K | |
| lua53-sysctl-2.1.pkg | 2025-12-24 04:51 | 8.2K | |
| lua53-xapian-1.4.30.pkg | 2025-12-22 12:31 | 533K | |
| lua54-5.4.8.pkg | 2025-12-16 01:29 | 346K | |
| lua54-Penlight-1.13...> | 2025-12-23 12:49 | 102K | |
| lua54-argon2-3.0.1.pkg | 2025-12-23 06:23 | 4.5K | |
| lua54-argparse-0.7.1..> | 2025-12-18 19:37 | 12K | |
| lua54-bcrypt-2.3.1.pkg | 2025-12-24 06:08 | 11K | |
| lua54-bitlib-24_1.pkg | 2025-12-21 03:17 | 2.9K | |
| lua54-bitop-1.0.3.pkg | 2025-12-21 11:56 | 3.4K | |
| lua54-cjson-2.1.0_1.pkg | 2025-12-23 16:51 | 14K | |
| lua54-cqueues-202007..> | 2025-12-20 16:33 | 317K | |
| lua54-iconv-7.1.0.pkg | 2025-12-22 09:19 | 3.9K | |
| lua54-icu-utils-0.0...> | 2025-12-21 04:35 | 5.2K | |
| lua54-json-1.3.4_1.pkg | 2025-12-23 15:28 | 13K | |
| lua54-lgi-0.9.2_3.pkg | 2025-12-23 15:01 | 79K | |
| lua54-libevent-0.4.6..> | 2025-12-18 16:56 | 13K | |
| lua54-lpeg-1.1.0.pkg | 2025-12-20 02:20 | 26K | |
| lua54-lsqlite3-0.9.6..> | 2025-12-21 09:43 | 580K | |
| lua54-lua-gd-2.0.33r..> | 2025-12-30 18:29 | 389K | |
| lua54-luacheck-0.25...> | 2025-12-19 15:38 | 70K | |
| lua54-luadbi-0.7.4_1..> | 2025-12-23 16:09 | 9.2K | |
| lua54-luaexpat-1.5.2..> | 2025-12-18 18:05 | 15K | |
| lua54-luafilesystem-..> | 2025-12-18 17:00 | 25K | |
| lua54-lualdap-1.3.1.pkg | 2025-12-21 05:24 | 15K | |
| lua54-luarocks-3.12...> | 2025-12-19 05:31 | 122K | |
| lua54-luasec-1.3.2.pkg | 2025-12-18 16:35 | 29K | |
| lua54-luasocket-3.1...> | 2025-12-18 13:35 | 164K | |
| lua54-luasql-firebir..> | 2025-12-22 07:28 | 9.3K | |
| lua54-luasql-mysql-2..> | 2025-12-22 06:36 | 7.8K | |
| lua54-luasql-odbc-2...> | 2025-12-23 21:17 | 9.7K | |
| lua54-luasql-postgre..> | 2025-12-22 15:10 | 7.1K | |
| lua54-luasql-sqlite3..> | 2025-12-20 07:56 | 7.8K | |
| lua54-luastatic-0.0...> | 2025-12-21 11:51 | 121K | |
| lua54-luaunbound-1.0..> | 2025-12-18 14:40 | 6.0K | |
| lua54-lunit-0.5.pkg | 2025-12-21 11:44 | 11K | |
| lua54-lunitx-0.8.1.pkg | 2025-12-23 16:09 | 9.8K | |
| lua54-lyaml-6.2.4_1.pkg | 2025-12-21 19:47 | 25K | |
| lua54-pgsql-1.6.8_1.pkg | 2025-12-21 13:10 | 17K | |
| lua54-posix-36.3.pkg | 2025-12-20 09:24 | 74K | |
| lua54-puremagic-1.0...> | 2025-12-23 16:09 | 5.7K | |
| lua54-stdlib-41.2.2_..> | 2025-12-23 11:30 | 75K | |
| lua54-stdlib-debug-1..> | 2025-12-19 02:23 | 7.3K | |
| lua54-stdlib-normali..> | 2025-12-19 23:54 | 26K | |
| lua54-sysctl-2.1.pkg | 2025-12-21 04:36 | 8.2K | |
| lua54-xapian-1.4.30.pkg | 2025-12-20 00:29 | 534K | |
| luabind-0.9.1_17.pkg | 2025-12-20 05:43 | 171K | |
| luajava-1.1_2.pkg | 2025-12-29 16:23 | 149K | |
| luajit-2.1.0.2025120..> | 2025-12-18 11:34 | 482K | |
| luajit-openresty-2.1..> | 2025-12-18 12:53 | 1.4M | |
| luakit-2.4.0_2,1.pkg | 2025-12-30 09:28 | 428K | |
| luakit-devel-2.3.6.7..> | 2025-12-28 18:20 | 429K | |
| luanti-5.14.0.pkg | 2025-12-27 06:20 | 7.5M | |
| lucene++-3.0.9_4.pkg | 2025-12-19 13:11 | 1.8M | |
| lucene-3.6.2.pkg | 2025-12-27 14:02 | 16M | |
| lucene5-5.5.5.pkg | 2025-12-27 01:30 | 17M | |
| luckybackup-0.5.0_3.pkg | 2025-12-30 16:46 | 4.7M | |
| lugaru-1.2_2,1.pkg | 2025-12-29 18:44 | 33M | |
| luit-20240102_1.pkg | 2025-08-13 11:27 | 40K | |
| lumina-1.6.2_1,3.pkg | 2025-12-29 04:40 | 965 | |
| lumina-archiver-1.6...> | 2025-12-27 16:21 | 184K | |
| lumina-calculator-1...> | 2025-12-27 03:37 | 36K | |
| lumina-core-1.6.2_10..> | 2025-12-27 14:32 | 8.0M | |
| lumina-coreutils-1.6..> | 2025-12-27 16:15 | 593K | |
| lumina-fileinfo-1.6...> | 2025-12-27 02:42 | 177K | |
| lumina-fm-1.6.2_1.pkg | 2025-12-27 02:11 | 390K | |
| lumina-mediaplayer-1..> | 2025-12-27 11:39 | 215K | |
| lumina-pdf-1.6.2_20.pkg | 2025-12-27 11:58 | 72K | |
| lumina-photo-1.6.2_1..> | 2025-12-27 16:43 | 146K | |
| lumina-screenshot-1...> | 2025-12-27 17:49 | 185K | |
| lumina-textedit-1.6...> | 2025-12-27 16:51 | 206K | |
| lumina-themes-201710..> | 2025-08-17 05:59 | 202M | |
| luna-1.9.pkg | 2025-08-16 02:54 | 11K | |
| lunasvg-3.5.0.pkg | 2025-12-27 13:06 | 90K | |
| luola-1.3.2_7.pkg | 2025-12-30 04:15 | 4.6M | |
| lupe-0.08c_1.pkg | 2025-08-19 06:59 | 13K | |
| luppp-1.2.1_4.pkg | 2025-12-29 22:09 | 120K | |
| lurch-0.7.0_1.pkg | 2025-12-29 13:56 | 25K | |
| lurker-2.3_4.pkg | 2025-08-18 00:30 | 399K | |
| luscus-0.8.6_4.pkg | 2025-12-30 15:11 | 217K | |
| lusernet-0.4.2_13.pkg | 2025-12-27 16:28 | 95K | |
| lutok-0.6.1.pkg | 2025-12-19 06:03 | 226K | |
| luv-1.51.0.1_1.pkg | 2025-12-18 22:05 | 85K | |
| lux-0.23.0_7.pkg | 2025-12-30 02:03 | 5.5M | |
| lux-pv-1.2.2_2.pkg | 2025-12-29 19:31 | 3.7M | |
| lv-4.51.20200728_1.pkg | 2025-08-18 07:07 | 407K | |
| lv-aspell-0.5.5.1_1,..> | 2025-12-22 00:28 | 198K | |
| lv-libreoffice-25.8...> | 2025-12-27 04:04 | 3.0M | |
| lv2-1.18.10_3.pkg | 2025-12-26 16:26 | 120K | |
| lv2file-0.95_1.pkg | 2025-12-29 08:55 | 13K | |
| lv2lint-0.16.2_2.pkg | 2025-12-27 18:00 | 28K | |
| lv2proc-0.5.1_3.pkg | 2025-12-27 22:05 | 11K | |
| lvtk-2.0.0.r1.14.pkg | 2025-08-21 02:53 | 29K | |
| lwjgl-2.9.4.20161208..> | 2025-12-27 10:58 | 1.4M | |
| lwjgl3-3.3.6_3.pkg | 2025-12-27 10:38 | 33M | |
| lwp-2.8.pkg | 2025-08-14 12:28 | 29K | |
| lxappearance-0.6.3_3..> | 2025-12-26 20:25 | 85K | |
| lxappearance-obconf-..> | 2025-12-27 06:10 | 52K | |
| lxde-common-0.99.2_3..> | 2025-12-27 16:47 | 792K | |
| lxde-icon-theme-0.5...> | 2025-08-13 23:21 | 4.3M | |
| lxde-meta-1.0_8.pkg | 2025-12-30 01:49 | 1.0K | |
| lxhotkey-0.1.1_3.pkg | 2025-12-27 16:03 | 60K | |
| lxi-tools-2.8.pkg | 2025-12-21 12:27 | 22K | |
| lximage-qt-2.3.0.pkg | 2025-12-27 18:44 | 247K | |
| lxinput-0.3.5_2.pkg | 2025-12-27 10:08 | 57K | |
| lxmenu-data-0.1.5.pkg | 2025-12-19 00:24 | 49K | |
| lxmf-0.8.0.pkg | 2025-12-27 17:54 | 133K | |
| lxpanel-0.9.3_5.pkg | 2025-12-27 18:47 | 1.2M | |
| lxqt-2.3.0_1.pkg | 2025-12-29 05:07 | 1.3K | |
| lxqt-about-2.3.0_1.pkg | 2025-12-27 16:09 | 64K | |
| lxqt-admin-2.3.0_1.pkg | 2025-12-27 12:00 | 99K | |
| lxqt-archiver-1.3.0_..> | 2025-12-27 02:57 | 241K | |
| lxqt-build-tools-0.1..> | 2025-12-18 16:27 | 21K | |
| lxqt-config-2.3.0_1.pkg | 2025-12-27 11:38 | 533K | |
| lxqt-globalkeys-2.3...> | 2025-12-27 01:14 | 205K | |
| lxqt-menu-data-2.3.0..> | 2025-12-18 17:02 | 48K | |
| lxqt-notificationd-2..> | 2025-12-27 09:54 | 98K | |
| lxqt-openssh-askpass..> | 2025-12-27 16:18 | 15K | |
| lxqt-panel-2.3.1.pkg | 2025-12-27 17:39 | 1.0M | |
| lxqt-policykit-2.3.0..> | 2025-12-27 03:30 | 27K | |
| lxqt-powermanagement..> | 2025-12-27 16:39 | 168K | |
| lxqt-qt6plugin-2.3.0..> | 2025-12-27 10:19 | 39K | |
| lxqt-qtplugin-1.4.1.pkg | 2025-12-27 17:06 | 31K | |
| lxqt-runner-2.3.0_1.pkg | 2025-12-27 18:49 | 106K | |
| lxqt-session-2.3.0_1..> | 2025-12-27 00:19 | 194K | |
| lxqt-sudo-2.3.0_3.pkg | 2025-12-27 12:10 | 46K | |
| lxqt-themes-2.3.0.pkg | 2025-12-20 00:02 | 26M | |
| lxqt-wayland-session..> | 2025-12-27 06:27 | 335K | |
| lxqt2-build-tools-2...> | 2025-12-26 13:56 | 21K | |
| lxrandr-0.3.2_2.pkg | 2025-12-27 02:59 | 53K | |
| lxsession-0.5.5_1.pkg | 2025-12-27 02:08 | 287K | |
| lxsplit-0.2.4_3.pkg | 2025-08-20 16:32 | 7.6K | |
| lxtask-0.1.10_2.pkg | 2025-12-27 13:08 | 62K | |
| lxterminal-0.4.0_3.pkg | 2025-12-27 17:07 | 96K | |
| ly-0.6.0.pkg | 2025-08-21 08:48 | 40K | |
| lychee-0.18.0_8.pkg | 2025-12-29 14:12 | 3.8M | |
| lycheeorg-6.7.0.pkg | 2025-12-28 13:49 | 11M | |
| lynis-3.1.6.pkg | 2025-12-20 21:07 | 263K | |
| lynx-2.8.9.1_3,1.pkg | 2025-12-18 14:50 | 1.7M | |
| lynx-current-2.9.2_1..> | 2025-12-23 14:16 | 1.7M | |
| lyra-1.6.1.pkg | 2025-08-16 13:57 | 25K | |
| lysdr-0.0.6_5.pkg | 2025-12-28 18:28 | 15K | |
| lyx-2.4.4_1.pkg | 2025-12-30 09:20 | 18M | |
| lz4json-20191229_2.pkg | 2025-12-20 05:11 | 3.7K | |
| lzbench-2.2.pkg | 2025-12-22 10:19 | 1.9M | |
| lzfse-1.0,1.pkg | 2025-08-15 16:26 | 22K | |
| lzip-1.25.pkg | 2025-08-16 17:17 | 68K | |
| lziprecover-1.25.pkg | 2025-08-22 09:33 | 142K | |
| lzlib-1.15.pkg | 2025-08-15 15:56 | 58K | |
| lzma-19.00.pkg | 2025-08-21 18:21 | 102K | |
| lzo2-2.10_1.pkg | 2025-08-10 21:11 | 121K | |
| lzop-1.04_1.pkg | 2025-08-14 07:29 | 68K | |
| lzr-1_21.pkg | 2025-12-21 19:37 | 2.0M | |
| lzsa-1.4.1.pkg | 2025-08-14 05:24 | 82K | |
| m-aneos-1.0.1_1.pkg | 2025-12-30 01:00 | 130K | |
| m2vrequantiser-1.1.pkg | 2025-08-20 10:19 | 13K | |
| m4-1.4.20,1.pkg | 2025-12-16 01:33 | 321K | |
| m17n-db-1.8.10.pkg | 2025-12-18 22:36 | 1.7M | |
| m17n-docs-1.8.4.pkg | 2025-08-17 06:25 | 3.4M | |
| m17n-lib-1.8.5_1.pkg | 2025-12-27 15:22 | 460K | |
| mDNSResponder-2600.1..> | 2025-08-14 08:16 | 453K | |
| mDNSResponder_nss-26..> | 2025-08-18 01:41 | 13K | |
| mac-11.90.pkg | 2025-12-26 18:11 | 129K | |
| mac-robber-1.02.pkg | 2025-08-17 11:34 | 5.8K | |
| mac-telnet-0.6.3,1.pkg | 2025-12-20 11:19 | 52K | |
| mac_nonet-kmod-g2015..> | 2025-08-18 16:29 | 2.7K | |
| mac_rtprio-kmod-g201..> | 2025-08-21 03:05 | 2.5K | |
| macchanger-1.7.0_3.pkg | 2025-08-19 00:36 | 190K | |
| mackerel-agent-0.85...> | 2025-12-29 13:55 | 2.4M | |
| macopix-1.7.4_17.pkg | 2025-12-30 05:16 | 3.8M | |
| mad_fcl-1.7_1.pkg | 2025-12-21 16:34 | 97K | |
| madbomber-0.2.5_15.pkg | 2025-12-29 06:24 | 2.2M | |
| madfufw-1.0_1.pkg | 2025-08-17 15:55 | 17K | |
| madness-0.10.1.20180..> | 2025-12-28 10:29 | 7.7M | |
| madonctl-3.0.3_4.pkg | 2025-12-20 16:02 | 3.4M | |
| madplay-0.15.2b_11.pkg | 2025-12-18 21:12 | 52K | |
| madronalib-1.6.1016_..> | 2025-12-28 10:30 | 184K | |
| maelstrom-3.0.6_14.pkg | 2025-12-22 05:27 | 736K | |
| maeparser-1.3.3_1.pkg | 2025-12-18 10:19 | 86K | |
| mafft-7.267_1.pkg | 2025-08-15 17:26 | 1.0M | |
| mage-1.15.0_20,1.pkg | 2025-12-19 02:00 | 1.4M | |
| magia-0.2.0_34.pkg | 2025-12-29 21:27 | 1.3M | |
| magic-8.3.570.pkg | 2025-12-27 10:40 | 1.7M | |
| magic_enum-0.9.7.pkg | 2025-08-14 19:48 | 24K | |
| magiccube4d-2.2_3.pkg | 2025-12-20 19:30 | 60K | |
| magicfilter-2.3.i_2.pkg | 2025-12-30 00:56 | 25K | |
| magicpoint-1.13a_20.pkg | 2025-12-30 06:24 | 624K | |
| magicrescue-1.1.10_1..> | 2025-12-20 17:54 | 63K | |
| magit-4.4.2_1.pkg | 2025-12-27 04:42 | 616K | |
| magit-emacs_canna-4...> | 2025-12-27 09:12 | 617K | |
| magit-emacs_devel-4...> | 2025-12-27 04:12 | 616K | |
| magit-emacs_devel_no..> | 2025-12-19 11:36 | 616K | |
| magit-emacs_nox-4.4...> | 2025-12-20 04:20 | 617K | |
| magit-emacs_wayland-..> | 2025-12-27 16:46 | 617K | |
| magnum-2020.06.3075_..> | 2025-12-26 22:02 | 1.9M | |
| magnum-extras-2020.0..> | 2025-12-27 03:08 | 459K | |
| magnum-plugins-2020...> | 2025-12-28 06:59 | 671K | |
| magpie-0.9.4.pkg | 2025-12-26 18:56 | 1.9M | |
| mahjong-1.17.2.pkg | 2025-12-30 02:43 | 195K | |
| mai-libreoffice-25.8..> | 2025-12-27 09:47 | 244K | |
| mail-expire-0.9.2_1.pkg | 2025-12-20 11:15 | 11K | |
| mail2nntp-1.0.pkg | 2025-12-21 23:46 | 3.4K | |
| mail2sms-1.3.5_2.pkg | 2025-08-20 22:38 | 54K | |
| mailagent-3.1.106_2.pkg | 2025-12-23 04:11 | 310K | |
| mailcommon-25.12.0.pkg | 2025-12-26 17:28 | 881K | |
| maildrop-3.2.1.pkg | 2025-12-20 17:55 | 506K | |
| mailest-0.9.24_22.pkg | 2025-12-30 16:18 | 50K | |
| mailest-emacs_canna-..> | 2025-12-28 04:00 | 50K | |
| mailest-emacs_devel-..> | 2025-12-29 00:53 | 50K | |
| mailest-emacs_devel_..> | 2025-12-23 06:27 | 50K | |
| mailest-emacs_nox-0...> | 2025-12-23 23:54 | 50K | |
| mailest-emacs_waylan..> | 2025-12-29 00:45 | 50K | |
| mailfromd-9.0.pkg | 2025-12-20 01:51 | 791K | |
| mailfront-2.22.pkg | 2025-12-23 08:26 | 99K | |
| mailgraph-1.14_10.pkg | 2025-12-30 07:10 | 15K | |
| mailhog-1.0.1_33.pkg | 2025-12-21 17:06 | 3.6M | |
| mailimporter-25.12.0..> | 2025-12-26 13:54 | 265K | |
| mailio-0.25.3.pkg | 2025-12-21 01:03 | 396K | |
| mailman-2.1.39_4.pkg | 2025-12-29 07:30 | 3.6M | |
| mailman-exim4-2.1.39..> | 2025-12-27 19:47 | 3.6M | |
| mailman-postfix-2.1...> | 2025-12-30 04:13 | 3.6M | |
| mailpit-1.28.0_1.pkg | 2025-12-20 07:37 | 7.7M | |
| mailslurper-1.15.0_7..> | 2025-12-22 01:28 | 5.6M | |
| mailutils-3.21.pkg | 2025-12-18 06:53 | 2.0M | |
| mailx-0.5_2.pkg | 2025-12-23 14:50 | 58K | |
| mailzu-php82-0.8.r3_..> | 2025-12-30 16:39 | 382K | |
| mailzu-php83-0.8.r3_..> | 2025-12-30 00:28 | 382K | |
| mailzu-php84-0.8.r3_..> | 2025-12-29 20:26 | 382K | |
| mailzu-php85-0.8.r3_..> | 2025-12-27 21:23 | 382K | |
| maim-5.8.0_2.pkg | 2025-12-29 19:39 | 77K | |
| mairix-0.24_1.pkg | 2025-08-18 21:21 | 82K | |
| maitretarot-0.1.98_8..> | 2025-12-20 02:45 | 16K | |
| makedepend-1.0.9,1.pkg | 2025-08-13 05:43 | 21K | |
| makefaq-2.5_2.pkg | 2025-12-21 10:36 | 25K | |
| makeindex-3.0.8_3.pkg | 2025-08-19 02:40 | 38K | |
| makemkv-1.17.7.pkg | 2025-08-18 22:44 | 12M | |
| makenl-3.5.1.pkg | 2025-08-16 20:22 | 79K | |
| makepasswd-1.10_8.pkg | 2025-12-23 01:21 | 8.3K | |
| makepatch-2.05_1.pkg | 2025-12-23 12:02 | 31K | |
| makeself-2.7.1.pkg | 2025-12-21 07:32 | 20K | |
| mako-1.10.0.pkg | 2025-12-29 20:29 | 49K | |
| malbolge-0.1.1.pkg | 2025-08-18 11:04 | 8.5K | |
| maliit-framework-2.3..> | 2025-12-27 03:10 | 362K | |
| maliit-keyboard-2.3...> | 2025-12-28 08:07 | 31M | |
| malint-0.2.pkg | 2025-08-18 16:12 | 16K | |
| malloy-0.12.0_2.pkg | 2025-12-23 19:52 | 1.2M | |
| malo-firmware-kmod-3..> | 2025-08-17 10:28 | 31K | |
| maltrail-0.86.pkg | 2025-12-22 04:53 | 9.9M | |
| mamba-2.5.pkg | 2025-12-30 09:26 | 393K | |
| mame-0.282.pkg | 2025-12-27 20:46 | 79M | |
| man2html-3.1.2024010..> | 2025-12-18 01:40 | 19K | |
| man2web-0.88_3.pkg | 2025-08-21 21:25 | 22K | |
| mancala-1.0.3.pkg | 2025-12-30 10:57 | 13K | |
| manck-1.2_3.pkg | 2025-12-22 03:22 | 9.9K | |
| mandelbulber-2.33_1.pkg | 2025-12-29 20:40 | 111M | |
| mandoc-1.14.6_2.pkg | 2025-12-22 13:22 | 613K | |
| mangband-1.5.3.pkg | 2025-12-20 07:06 | 1.7M | |
| mangowc-0.10.8.pkg | 2025-12-30 09:56 | 115K | |
| manrope-4.20211221.pkg | 2025-12-28 18:17 | 812K | |
| mantis-php81-2.26.0,..> | 2025-12-29 17:29 | 14M | |
| mantis-php82-2.26.0,..> | 2025-12-30 17:09 | 14M | |
| mantis-php83-2.26.0,..> | 2025-12-30 17:25 | 14M | |
| mantis-php84-2.26.0,..> | 2025-12-29 19:00 | 14M | |
| mantis-php85-2.26.0,..> | 2025-12-28 12:04 | 14M | |
| mantra-0.1.1.pkg | 2025-12-21 11:52 | 2.8K | |
| manu-gothica-0_5.pkg | 2025-12-30 07:58 | 37K | |
| mapcache-1.14.1_2.pkg | 2025-12-29 21:40 | 175K | |
| mapchan-3.2_4.pkg | 2025-08-17 19:25 | 22K | |
| mapdir-1.2.1_1.pkg | 2025-12-23 16:00 | 8.4K | |
| mapm3-3.0_1.pkg | 2025-08-16 17:25 | 299K | |
| mapnik-4.1.3_2.pkg | 2025-12-28 13:07 | 4.5M | |
| mapserver-8.6.0_1.pkg | 2025-12-29 17:27 | 1.4M | |
| mapyrus-1.802.pkg | 2025-12-29 14:31 | 3.0M | |
| mar-0.5.pkg | 2025-08-18 07:05 | 25K | |
| maradns-2.0.15_1.pkg | 2025-08-22 23:02 | 457K | |
| marble-25.12.0.pkg | 2025-12-27 01:35 | 40M | |
| marblemarcher-1.4.6.pkg | 2025-12-27 22:58 | 48M | |
| marco-1.28.1.pkg | 2025-12-26 17:55 | 1.2M | |
| marginalia.el-2.4_1.pkg | 2025-12-29 12:02 | 30K | |
| marginalia.el-emacs_..> | 2025-12-30 12:05 | 30K | |
| marginalia.el-emacs_..> | 2025-12-30 00:05 | 30K | |
| marginalia.el-emacs_..> | 2025-12-20 15:36 | 30K | |
| marginalia.el-emacs_..> | 2025-12-20 12:25 | 30K | |
| marginalia.el-emacs_..> | 2025-12-29 13:43 | 30K | |
| mari0-1.6.2.pkg | 2025-12-29 19:47 | 3.2M | |
| mariadb-connector-c-..> | 2025-12-18 20:22 | 362K | |
| mariadb-connector-od..> | 2025-12-21 00:57 | 259K | |
| mariadb-java-client-..> | 2025-12-30 10:05 | 682K | |
| mariadb106-client-10..> | 2025-12-20 04:04 | 2.3M | |
| mariadb106-server-10..> | 2025-12-20 05:39 | 47M | |
| mariadb114-client-11..> | 2025-12-20 00:19 | 2.7M | |
| mariadb114-server-11..> | 2025-12-20 12:55 | 49M | |
| mariadb118-client-11..> | 2025-12-19 11:28 | 2.8M | |
| mariadb118-server-11..> | 2025-12-21 13:10 | 50M | |
| mariadb1011-client-1..> | 2025-12-19 16:58 | 2.7M | |
| mariadb1011-server-1..> | 2025-12-21 16:22 | 49M | |
| marisa-trie-0.3.1_1,..> | 2025-12-18 14:18 | 82K | |
| markdown-1.0.1_2.pkg | 2025-12-24 05:53 | 16K | |
| markdown-mode.el-2.7..> | 2025-12-27 13:05 | 168K | |
| markdown-mode.el-ema..> | 2025-12-27 02:19 | 168K | |
| markdown-mode.el-ema..> | 2025-12-27 06:58 | 168K | |
| markdown-mode.el-ema..> | 2025-12-19 20:49 | 168K | |
| markdown-mode.el-ema..> | 2025-12-19 21:02 | 168K | |
| markdown-mode.el-ema..> | 2025-12-27 07:34 | 168K | |
| markdownfmt-1.1.67_3..> | 2025-12-24 04:09 | 1.0M | |
| markdownpart-25.12.0..> | 2025-12-28 01:26 | 42K | |
| marker-2023.05.02_3.pkg | 2025-12-30 08:00 | 2.4M | |
| marl-g20231218.pkg | 2025-08-16 15:03 | 58K | |
| marmite-0.2.6_4.pkg | 2025-12-28 19:36 | 9.8M | |
| mashmap-3.1.3.pkg | 2025-12-22 11:39 | 173K | |
| masqmail-0.3.5_1.pkg | 2025-12-23 16:30 | 114K | |
| massadmin-2.3_2.pkg | 2025-12-22 03:58 | 12K | |
| masscan-1.3.2_1.pkg | 2025-08-19 18:21 | 201K | |
| massif-visualizer-25..> | 2025-12-29 06:15 | 183K | |
| massxpert-6.0.3_1.pkg | 2025-12-27 19:57 | 1.1M | |
| mastermind-0.1.0.pkg | 2025-08-16 08:33 | 6.7K | |
| masterserver-0.4.1.pkg | 2025-08-16 06:03 | 29K | |
| mastodon-4.3.6_1.pkg | 2025-12-30 14:45 | 33M | |
| match-1.0_1.pkg | 2025-08-17 07:56 | 36K | |
| matcha-gtk-themes-20..> | 2025-12-26 18:55 | 2.1M | |
| mate-1.28.2_1.pkg | 2025-12-29 15:02 | 1.2K | |
| mate-applet-appmenu-..> | 2025-12-29 17:28 | 58K | |
| mate-applets-1.28.1_..> | 2025-12-27 13:15 | 6.9M | |
| mate-backgrounds-1.2..> | 2025-12-18 20:57 | 44M | |
| mate-base-1.28.2_1.pkg | 2025-12-27 02:42 | 1.1K | |
| mate-calc-1.28.0_1.pkg | 2025-12-27 02:21 | 779K | |
| mate-common-1.28.0.pkg | 2025-08-16 19:27 | 12K | |
| mate-control-center-..> | 2025-12-26 23:57 | 1.7M | |
| mate-desktop-1.28.2.pkg | 2025-12-26 16:55 | 804K | |
| mate-dock-applet-21...> | 2025-12-30 17:09 | 222K | |
| mate-icon-theme-1.28..> | 2025-08-13 20:04 | 13M | |
| mate-icon-theme-faen..> | 2025-08-19 18:52 | 19M | |
| mate-indicator-apple..> | 2025-12-29 00:46 | 89K | |
| mate-media-1.28.1_1.pkg | 2025-12-27 15:59 | 244K | |
| mate-menus-1.28.0.pkg | 2025-12-18 12:40 | 141K | |
| mate-notification-da..> | 2025-12-26 22:54 | 132K | |
| mate-pam-helper-1.3.pkg | 2025-08-14 09:19 | 3.5K | |
| mate-panel-1.28.4_2,..> | 2025-12-26 19:09 | 2.1M | |
| mate-polkit-1.28.1.pkg | 2025-12-26 20:36 | 54K | |
| mate-power-manager-1..> | 2025-12-27 19:44 | 5.9M | |
| mate-screensaver-1.2..> | 2025-12-27 17:44 | 4.5M | |
| mate-session-manager..> | 2025-12-26 22:06 | 349K | |
| mate-settings-daemon..> | 2025-12-26 18:27 | 620K | |
| mate-system-monitor-..> | 2025-12-27 08:02 | 1.9M | |
| mate-terminal-1.28.1..> | 2025-12-27 07:29 | 1.4M | |
| mate-themes-3.22.23_..> | 2025-12-26 21:12 | 5.5M | |
| mate-user-guide-1.28..> | 2025-12-26 23:00 | 8.0M | |
| mate-utils-1.28.0.pkg | 2025-12-27 18:46 | 6.7M | |
| materia-gtk-theme-20..> | 2025-12-30 18:58 | 243K | |
| material-icons-ttf-6..> | 2025-12-29 15:24 | 152K | |
| materialdesign-ttf-7..> | 2025-12-30 01:48 | 497K | |
| materialx-1.39.4.pkg | 2025-12-29 20:17 | 80M | |
| math77-6.0_10.pkg | 2025-12-30 18:28 | 1.3M | |
| mathex-0.3.b.pkg | 2025-08-13 11:02 | 39K | |
| mathgl-2.5_6.pkg | 2025-12-30 17:32 | 11M | |
| mathicsscript-9.0.0.pkg | 2025-12-28 21:04 | 84K | |
| mathml-xsd-2_3.pkg | 2025-08-21 19:01 | 12K | |
| mathomatic-16.0.5_3.pkg | 2025-12-22 07:49 | 244K | |
| mathopd-1.5p8_1.pkg | 2025-08-21 12:29 | 59K | |
| mathpresso-g20230108..> | 2025-08-17 21:48 | 33K | |
| matio-1.5.28.pkg | 2025-12-26 10:23 | 233K | |
| matomo-php81-5.5.1.pkg | 2025-12-28 09:13 | 17M | |
| matomo-php82-5.5.1.pkg | 2025-12-30 15:11 | 17M | |
| matomo-php83-5.5.1.pkg | 2025-12-30 15:10 | 17M | |
| matomo-php84-5.5.1.pkg | 2025-12-30 11:51 | 17M | |
| matomo-php85-5.5.1.pkg | 2025-12-30 12:46 | 17M | |
| matplotlib-cpp-g2021..> | 2025-12-29 09:59 | 14K | |
| matplotplusplus-1.2...> | 2025-12-28 01:00 | 3.6M | |
| matreshka-21.0_2.pkg | 2025-12-20 10:59 | 22M | |
| matrix-conduit-0.10...> | 2025-12-29 18:37 | 8.3M | |
| matterbridge-1.26.0_..> | 2025-12-21 00:48 | 11M | |
| matterircd-0.28.0_19..> | 2025-12-21 16:25 | 4.4M | |
| mattermost-server-10..> | 2025-12-23 10:06 | 32M | |
| mattermost-webapp-10..> | 2025-12-19 15:08 | 51M | |
| maude-2.7.1_2.pkg | 2025-12-21 04:33 | 940K | |
| mautrix-whatsapp-0.1..> | 2025-12-22 19:12 | 7.8M | |
| maven-3.8.9.pkg | 2025-12-26 16:00 | 7.6M | |
| maven-wrapper-2.pkg | 2025-08-13 13:11 | 1.0K | |
| maven39-3.9.12.pkg | 2025-12-26 20:23 | 8.4M | |
| maven363-3.6.3.pkg | 2025-12-27 06:09 | 8.6M | |
| mawk-1.3.4.20250131.pkg | 2025-08-15 06:21 | 101K | |
| maxcso-1.13.0.36.pkg | 2025-12-20 17:05 | 99K | |
| maxima-5.48.1_1.pkg | 2025-12-27 03:59 | 21M | |
| maxr-0.2.17.pkg | 2025-12-27 21:34 | 12M | |
| mb2md-3.20_1.pkg | 2025-12-21 16:46 | 15K | |
| mbasecalc-1.1_8.pkg | 2025-12-30 09:41 | 8.8K | |
| mbdyn-1.7.3_19.pkg | 2025-12-30 19:04 | 1.9M | |
| mbedtls3-3.6.5.pkg | 2025-12-18 18:42 | 1.2M | |
| mbelib-1.3.0.pkg | 2025-08-15 11:13 | 52K | |
| mbgtools-f.1.0.0.140..> | 2025-08-17 09:42 | 129K | |
| mblaze-1.2_1.pkg | 2025-08-18 21:49 | 138K | |
| mbox-importer-25.12...> | 2025-12-26 18:59 | 33K | |
| mbox2imap-1.0_2.pkg | 2025-12-20 06:13 | 4.4K | |
| mbox2mdir-1.4.pkg | 2025-08-19 15:16 | 4.4K | |
| mboxgrep-0.7.13.pkg | 2025-12-22 19:07 | 22K | |
| mboxstats-3.1.pkg | 2025-08-22 16:45 | 28K | |
| mbpurple-0.3.0_7.pkg | 2025-12-30 00:10 | 78K | |
| mbrowse-0.4.3_3.pkg | 2025-12-28 04:58 | 22K | |
| mbuffer-20250809.pkg | 2025-12-19 12:10 | 39K | |
| mbx2mbox-0.34_1.pkg | 2025-12-22 10:43 | 5.4K | |
| mc-4.8.32.pkg | 2025-12-29 05:41 | 1.8M | |
| mca-calling-0.1.0.pkg | 2025-12-28 00:13 | 867 | |
| mcabber-1.1.2_3.pkg | 2025-12-23 15:20 | 248K | |
| mcast-bridge-1.3.0.pkg | 2025-12-29 03:51 | 27K | |
| mcelog-178_1.pkg | 2025-08-16 00:46 | 47K | |
| mcfly-0.9.3_8.pkg | 2025-12-30 18:40 | 1.7M | |
| mcjoin-2.12.pkg | 2025-08-21 17:23 | 27K | |
| mclk-lv2-0.2.3.pkg | 2025-08-18 02:17 | 7.4K | |
| mcmc-jags-4.3.1_5.pkg | 2025-12-28 06:25 | 1.6M | |
| mcp-probe-0.3.0_4.pkg | 2025-12-30 01:50 | 2.7M | |
| mcpl-2.2.0.pkg | 2025-08-21 09:13 | 91K | |
| mcpp-2.7.2.1.pkg | 2025-08-14 07:20 | 290K | |
| mcron-1.2.3_1.pkg | 2025-12-23 15:18 | 491K | |
| mcrypt-2.6.8_4.pkg | 2025-12-21 22:02 | 54K | |
| mcsim-6.2.0_2.pkg | 2025-08-21 15:33 | 443K | |
| mcstas-2.5.pkg | 2025-08-15 15:52 | 162K | |
| mcstas-comps-2.5_3.pkg | 2025-12-30 05:35 | 43M | |
| mctc-lib-0.5.0.pkg | 2025-12-26 15:29 | 362K | |
| mcwm-20130209_1.pkg | 2025-08-16 14:50 | 25K | |
| mcxtrace-1.2_1.pkg | 2025-08-15 03:07 | 170K | |
| mcxtrace-comps-1.2.pkg | 2025-08-21 15:53 | 1.5M | |
| md2roff-2.14.3.0.202..> | 2025-12-19 23:25 | 1.1M | |
| md4c-0.5.2.20240225.pkg | 2025-12-21 07:51 | 73K | |
| md5deep-4.4_4.pkg | 2025-08-16 16:34 | 103K | |
| mda-lv2-1.2.10.pkg | 2025-08-20 07:40 | 2.0M | |
| mdal-1.3.1.pkg | 2025-12-27 02:10 | 935K | |
| mdata-client-2015100..> | 2025-08-15 13:39 | 44K | |
| mdb-20250623.pkg | 2025-08-16 07:27 | 784K | |
| mdbook-0.5.1_1.pkg | 2025-12-27 15:37 | 3.1M | |
| mdbook-linkcheck-0.7..> | 2025-12-27 05:31 | 2.5M | |
| mdbook-mermaid-0.17...> | 2025-12-28 10:59 | 1.5M | |
| mdbtools-1.0.1.pkg | 2025-12-27 17:06 | 194K | |
| mdbx-0.13.9.pkg | 2025-12-21 12:18 | 1.7M | |
| mdcached-1.0.9_2.pkg | 2025-08-20 01:42 | 90K | |
| mdcat-2.7.1_9.pkg | 2025-12-29 21:03 | 2.7M | |
| mdds-3.1.0.pkg | 2025-12-18 11:16 | 116K | |
| mdf2iso-0.3.1_1.pkg | 2025-08-19 17:56 | 5.7K | |
| mdk-1.3.0_3.pkg | 2025-12-28 13:54 | 232K | |
| mdns-bridge-2.4.0.pkg | 2025-12-29 19:17 | 19K | |
| mdns-repeater-1.11.pkg | 2025-08-21 02:24 | 6.9K | |
| mdnsd-0.7.g.107_1,1.pkg | 2025-08-16 23:10 | 19K | |
| mdp-1.0.18.pkg | 2025-08-21 07:27 | 19K | |
| mdpop3d-0.97_1.pkg | 2025-08-19 12:14 | 16K | |
| mdq-0.6.1_6.pkg | 2025-12-28 11:51 | 891K | |
| mdspan-0.6.0.pkg | 2025-08-22 02:06 | 26K | |
| mdtest-1.9.3_16.pkg | 2025-12-27 21:04 | 29K | |
| mdtt-0.3.1_6.pkg | 2025-12-23 09:57 | 2.1M | |
| mdynamix-5.3.0.pkg | 2025-12-30 00:27 | 202K | |
| meandmyshadow-0.5a_3..> | 2025-12-30 12:53 | 15M | |
| meanwhile-1.1.1.pkg | 2025-12-21 05:12 | 125K | |
| measurement-kit-0.10..> | 2025-12-20 16:54 | 2.2M | |
| mediaelch-qt5-2.12.0..> | 2025-12-28 04:05 | 2.5M | |
| mediaelch-qt6-2.12.0..> | 2025-12-28 09:59 | 2.5M | |
| mediainfo-25.10.pkg | 2025-12-19 01:38 | 20K | |
| mediamtx-1.15.5.pkg | 2025-12-22 15:38 | 8.4M | |
| mediawiki139-php81-1..> | 2025-12-29 03:41 | 41M | |
| mediawiki139-php82-1..> | 2025-12-30 14:47 | 41M | |
| mediawiki139-php83-1..> | 2025-12-29 23:08 | 41M | |
| mediawiki139-php84-1..> | 2025-12-28 03:30 | 41M | |
| mediawiki139-php85-1..> | 2025-12-29 08:43 | 41M | |
| mediawiki143-php81-1..> | 2025-12-30 02:57 | 61M | |
| mediawiki143-php82-1..> | 2025-12-28 21:25 | 61M | |
| mediawiki143-php83-1..> | 2025-12-29 12:02 | 61M | |
| mediawiki143-php84-1..> | 2025-12-30 05:44 | 61M | |
| mediawiki143-php85-1..> | 2025-12-30 06:47 | 61M | |
| mediawiki144-php81-1..> | 2025-12-30 02:26 | 62M | |
| mediawiki144-php82-1..> | 2025-12-29 07:29 | 62M | |
| mediawiki144-php83-1..> | 2025-12-28 11:49 | 62M | |
| mediawiki144-php84-1..> | 2025-12-30 00:48 | 62M | |
| mediawiki144-php85-1..> | 2025-12-29 01:18 | 62M | |
| mediawiki145-php81-1..> | 2025-12-27 22:03 | 51M | |
| mediawiki145-php82-1..> | 2025-12-28 16:15 | 51M | |
| mediawiki145-php83-1..> | 2025-12-28 03:50 | 51M | |
| mediawiki145-php84-1..> | 2025-12-27 19:55 | 51M | |
| mediawiki145-php85-1..> | 2025-12-29 22:10 | 51M | |
| medit-2012.02.05_5.pkg | 2025-08-18 14:18 | 1.7M | |
| mednafen-1.32.1_2,1.pkg | 2025-12-29 02:24 | 4.5M | |
| medusa-2.2_3.pkg | 2025-08-19 04:52 | 167K | |
| meek-0.37.0_30.pkg | 2025-12-19 21:10 | 3.3M | |
| meep-1.29.0_7.pkg | 2025-12-30 01:47 | 2.5M | |
| megacli-8.07.14.pkg | 2025-08-18 17:25 | 727K | |
| megacmd-1.7.0_1.pkg | 2025-12-21 20:23 | 3.3M | |
| megaglest-3.13.0_15.pkg | 2025-12-29 03:29 | 2.6M | |
| megaglest-data-3.13...> | 2025-08-15 03:12 | 297M | |
| megahit-1.2.9.20.pkg | 2025-12-22 21:20 | 519K | |
| megamario-1.7_5.pkg | 2025-12-29 12:43 | 24M | |
| megatools-1.11.1.202..> | 2025-12-21 05:34 | 113K | |
| meh-0.3.27_3.pkg | 2025-12-30 04:41 | 15K | |
| meilisearch-1.9.0_15..> | 2025-12-30 16:36 | 74M | |
| meld-3.22.0_2,1.pkg | 2025-12-29 17:24 | 564K | |
| melonds-qt6-1.1.pkg | 2025-12-28 13:58 | 1.4M | |
| memcached-1.6.40.pkg | 2025-12-27 07:39 | 199K | |
| memdump-1.01_1.pkg | 2025-08-21 23:35 | 7.5K | |
| memfetch-0.05b.pkg | 2025-12-23 09:09 | 9.0K | |
| memonix-1.6.070713_1..> | 2025-12-30 18:47 | 6.4M | |
| memtest86-4.3.7.pkg | 2025-08-21 03:11 | 400K | |
| memtester-4.7.1.pkg | 2025-08-16 02:19 | 12K | |
| mencal-3.0.pkg | 2025-12-20 04:28 | 5.0K | |
| mencoder-1.5.0.20250..> | 2025-12-27 15:38 | 871K | |
| menhir-20240715.pkg | 2025-08-13 23:17 | 2.4M | |
| menu-cache-1.1.0.pkg | 2025-12-18 15:42 | 40K | |
| menumaker-0.99.14.pkg | 2025-12-20 08:15 | 93K | |
| menyoki-1.7.0_17.pkg | 2025-12-30 17:37 | 1.5M | |
| mepo-1.3.4_2.pkg | 2025-12-30 06:43 | 1.3M | |
| meqcc-1.4.pkg | 2025-08-18 20:07 | 45K | |
| mercurial-6.9.5.pkg | 2025-12-18 19:51 | 6.3M | |
| mercury-rpc-2.3.1.pkg | 2025-08-19 07:31 | 130K | |
| mergelog-4.5_3.pkg | 2025-08-16 16:05 | 7.6K | |
| mergify-g20180512_1.pkg | 2025-12-21 18:42 | 4.9K | |
| meritous-1.5.pkg | 2025-12-29 06:12 | 1.0M | |
| merkuro-25.12.0.pkg | 2025-12-28 20:29 | 1.8M | |
| mesa-demos-8.5.0.pkg | 2025-08-13 20:47 | 11M | |
| mesa-devel-25.3.b.25..> | 2025-12-30 18:15 | 27M | |
| mesa-dri-24.1.7_10.pkg | 2025-12-24 23:50 | 15M | |
| mesa-gallium-va-24.1..> | 2025-12-21 12:21 | 2.7M | |
| mesa-gallium-vdpau-2..> | 2025-12-22 07:44 | 2.6M | |
| mesa-gallium-xa-24.1..> | 2025-12-19 04:42 | 1.3M | |
| mesa-libs-24.1.7_1.pkg | 2025-12-16 04:17 | 309K | |
| mesen-0.9.9.pkg | 2025-12-28 13:46 | 7.0M | |
| meshdev-0.5_1.pkg | 2025-08-19 10:49 | 41K | |
| meshoptimizer-0.23.pkg | 2025-08-15 16:32 | 77K | |
| meslo-1.2.1_1.pkg | 2025-12-30 15:07 | 506K | |
| meson-1.7.0.pkg | 2025-12-24 20:07 | 2.0M | |
| mesquite-mesh-toolki..> | 2025-08-13 12:25 | 768K | |
| mess822-0.58_4.pkg | 2025-08-16 07:39 | 73K | |
| messagelib-25.12.0.pkg | 2025-12-26 17:17 | 2.7M | |
| metabase-0.55.4.1.pkg | 2025-12-29 20:18 | 463M | |
| metacam-1.2_1.pkg | 2025-08-22 02:24 | 35K | |
| metacity-3.58.0.pkg | 2025-12-27 18:08 | 529K | |
| metacity-aluminumall..> | 2025-08-20 20:25 | 16K | |
| metacity-aluminumall..> | 2025-08-20 06:22 | 13K | |
| metacity-aluminumall..> | 2025-08-17 03:53 | 13K | |
| metacity-aluminumall..> | 2025-08-17 05:25 | 14K | |
| metacity-aquaextreme..> | 2025-08-16 03:58 | 9.8K | |
| metacity-digital-cre..> | 2025-08-18 21:11 | 7.2K | |
| metacity-digital-har..> | 2025-08-18 11:08 | 6.9K | |
| metacity-longhornins..> | 2025-08-20 17:56 | 8.6K | |
| metacity-milk-theme-..> | 2025-08-17 10:11 | 9.5K | |
| metacity-theme-micro..> | 2025-08-15 14:13 | 14K | |
| metacity-themes-2004..> | 2025-08-21 05:58 | 770 | |
| metaeuk-7.pkg | 2025-08-21 03:59 | 3.6M | |
| metalink-checker-1.3..> | 2025-12-21 18:48 | 6.6K | |
| metalink-tools-0.3.6..> | 2025-12-20 14:44 | 41K | |
| metalock-0.8.0_7.pkg | 2025-12-30 02:28 | 389K | |
| metalog-3_2,1.pkg | 2025-08-21 21:54 | 46K | |
| metamail-2.7_16.pkg | 2025-08-15 14:04 | 138K | |
| metapixel-1.0.2_13.pkg | 2025-12-28 08:23 | 57K | |
| metasploit-6.4.58_9.pkg | 2025-12-28 01:16 | 54M | |
| metauml-0.2.5_5.pkg | 2025-12-28 13:24 | 1.1M | |
| meteo-0.9.9.3_2.pkg | 2025-12-29 06:30 | 94K | |
| metis-5.1.0.p13_1,1.pkg | 2025-08-13 13:04 | 276K | |
| metronome-0.9.0_26.pkg | 2025-12-21 10:51 | 277K | |
| mew-6.10_1.pkg | 2025-12-27 16:21 | 834K | |
| mew-devel-6.10.49.pkg | 2025-12-28 00:37 | 834K | |
| mew-devel-emacs_cann..> | 2025-12-29 05:09 | 834K | |
| mew-devel-emacs_deve..> | 2025-12-29 05:16 | 834K | |
| mew-devel-emacs_deve..> | 2025-12-21 04:09 | 834K | |
| mew-devel-emacs_nox-..> | 2025-12-20 15:36 | 834K | |
| mew-devel-emacs_wayl..> | 2025-12-30 12:14 | 834K | |
| mew-emacs_canna-6.10..> | 2025-12-27 12:30 | 834K | |
| mew-emacs_devel-6.10..> | 2025-12-27 14:14 | 833K | |
| mew-emacs_devel_nox-..> | 2025-12-19 21:03 | 833K | |
| mew-emacs_nox-6.10_1..> | 2025-12-19 23:17 | 834K | |
| mew-emacs_wayland-6...> | 2025-12-27 18:00 | 834K | |
| mfem-4.8.pkg | 2025-12-27 00:53 | 4.8M | |
| mfid-0.03_1.pkg | 2025-08-18 00:21 | 8.3K | |
| mfmod_ldap-1.3.pkg | 2025-08-18 02:16 | 28K | |
| mfmod_openmetrics-1...> | 2025-12-22 04:59 | 27K | |
| mfmod_pcre-1.1.1.pkg | 2025-12-21 17:48 | 24K | |
| mftrace-1.2.20_1.pkg | 2025-12-27 01:17 | 23K | |
| mg-20241008,1.pkg | 2025-08-16 06:20 | 112K | |
| mg-static-20241008,1..> | 2025-08-22 00:24 | 611K | |
| mgba-0.10.5_1.pkg | 2025-12-30 07:25 | 2.5M | |
| mgdiff-1.0_8.pkg | 2025-12-28 00:20 | 40K | |
| mgetty-1.1.37_3.pkg | 2025-12-21 11:30 | 430K | |
| mgopen-1.1_1.pkg | 2025-12-28 10:20 | 605K | |
| mhash-0.9.9.9_6.pkg | 2025-08-14 08:28 | 132K | |
| mhonarc-2.6.24_1.pkg | 2025-12-19 23:38 | 1.0M | |
| mhwaveedit-1.4.24_8.pkg | 2025-12-27 20:12 | 306K | |
| mi-aspell-0.50.0_1,1..> | 2025-12-23 05:05 | 153K | |
| mickey-0.1.13.pkg | 2025-12-30 17:08 | 28K | |
| micro-2.0.14_11.pkg | 2025-12-22 07:31 | 4.2M | |
| micro_httpd-2014.08...> | 2025-08-19 13:43 | 7.7K | |
| micro_inetd-2014.08...> | 2025-08-21 06:02 | 4.5K | |
| micro_proxy-20140814..> | 2025-08-20 14:45 | 7.4K | |
| microbin-2.0.4_22.pkg | 2025-12-29 10:51 | 3.7M | |
| microdc2-0.15.6_11.pkg | 2025-12-22 04:49 | 140K | |
| micropython-1.17_2.pkg | 2025-12-30 17:05 | 229K | |
| microsocks-1.0.5.pkg | 2025-08-19 02:58 | 7.7K | |
| microsoft-edit-1.2.0..> | 2025-12-30 17:22 | 234K | |
| microsoft-gsl-4.2.0.pkg | 2025-08-13 22:08 | 17K | |
| microtex-g20240805_1..> | 2025-12-29 18:46 | 1.0M | |
| middleman-1.9.1_3.pkg | 2025-08-21 10:54 | 170K | |
| midi-matrix-lv2-0.28..> | 2025-08-17 15:30 | 239K | |
| midifile-g20200602_1..> | 2025-08-15 17:47 | 223K | |
| midiomatic-lv2-0.2.1..> | 2025-08-16 10:14 | 109K | |
| midipp-2.1.7_1.pkg | 2025-12-29 11:34 | 253K | |
| midisharelight-g2020..> | 2025-08-14 08:52 | 23K | |
| midivisualizer-7.3_1..> | 2025-12-29 02:27 | 1.1M | |
| midori-9.0_14.pkg | 2025-12-30 06:31 | 802K | |
| midpoint-4.4.1.pkg | 2025-12-30 06:44 | 165M | |
| migrate-5.0.6_2.pkg | 2025-08-18 08:08 | 650K | |
| mihomo-1.19.16_1.pkg | 2025-12-20 11:31 | 7.8M | |
| mikmod-3.2.9.pkg | 2025-08-22 06:47 | 83K | |
| miktex-25.4_2.pkg | 2025-12-30 05:45 | 18M | |
| mikutter-5.0.4.pkg | 2025-12-29 04:05 | 1.8M | |
| milkytracker-1.06.pkg | 2025-12-30 15:28 | 1.1M | |
| mill-0.11.10.pkg | 2025-12-30 06:48 | 55M | |
| miller-6.15.0_4.pkg | 2025-12-20 04:14 | 3.7M | |
| milter-bogom-1.9.2_5..> | 2025-12-20 10:33 | 19K | |
| milter-callback-1.6...> | 2025-12-30 11:40 | 34K | |
| milter-greylist-4.6...> | 2025-12-20 22:31 | 129K | |
| milter-manager-2.1.6..> | 2025-12-23 21:32 | 586K | |
| milter-regex-2.7_3.pkg | 2025-08-19 12:55 | 22K | |
| milton-1.9.1_3.pkg | 2025-12-28 12:01 | 605K | |
| mimalloc-3.1.5.pkg | 2025-08-15 12:29 | 105K | |
| mime-construct-1.11_..> | 2025-12-19 11:16 | 16K | |
| mime-support-3.66_1.pkg | 2025-08-14 02:07 | 25K | |
| mime4j-0.7.2_1.pkg | 2025-12-30 10:35 | 358K | |
| mimedefang-2.86_1.pkg | 2025-12-30 04:49 | 189K | |
| mimelib-1.1.2_2.pkg | 2025-08-21 22:57 | 198K | |
| mimetex-20120331.1.7..> | 2025-08-16 13:42 | 583K | |
| mimetreeparser-25.12..> | 2025-12-26 21:09 | 241K | |
| mimir-2.15_2.pkg | 2025-08-20 05:06 | 68K | |
| min12xxw-0.0.9_1.pkg | 2025-08-21 09:37 | 19K | |
| minc2-2.2.00_15,1.pkg | 2025-12-29 09:51 | 761K | |
| minder-2.0.2_4.pkg | 2025-12-22 14:00 | 24K | |
| minder-app-1.17.0_2.pkg | 2025-12-29 19:22 | 786K | |
| mindfocus-0.88_2.pkg | 2025-12-20 10:43 | 48K | |
| mindterm-binary-1.2...> | 2025-08-16 10:43 | 214K | |
| minecraft-server-1.2..> | 2025-12-28 03:10 | 56M | |
| mined-2022.27_4.pkg | 2025-12-23 12:16 | 3.5M | |
| minerbold-1.4_2.pkg | 2025-12-30 02:58 | 170K | |
| minetest_game-5.8.0...> | 2025-12-29 12:15 | 2.1M | |
| mingw32-binutils-2.4..> | 2025-12-23 00:19 | 2.5M | |
| mini_httpd-1.30_4.pkg | 2025-08-22 00:18 | 36K | |
| mini_sendmail-1.3.9_..> | 2025-08-17 22:39 | 430K | |
| miniaudio-0.11.21,1.pkg | 2025-08-15 20:21 | 484K | |
| minicom-2.10.pkg | 2025-12-22 11:46 | 300K | |
| minidlna-1.3.3_10,1.pkg | 2025-12-30 13:48 | 147K | |
| minidnn-g20200330_1.pkg | 2025-12-30 10:29 | 92K | |
| miniflux-2.2.11_6.pkg | 2025-12-21 18:38 | 6.0M | |
| minify-2.24.8.pkg | 2025-12-27 09:36 | 1.8M | |
| minikube-1.37.0_4.pkg | 2025-12-19 03:38 | 19M | |
| minimalist-2.5.3.pkg | 2025-12-21 16:14 | 34K | |
| minimap2-2.30.pkg | 2025-08-14 13:04 | 144K | |
| minimp3-g20211130_1,..> | 2025-12-19 09:05 | 27K | |
| minimunin-0.6.pkg | 2025-08-21 03:21 | 4.7K | |
| minio-2025.10.15.17...> | 2025-12-21 17:13 | 30M | |
| minio-client-2025.05..> | 2025-12-24 07:07 | 8.5M | |
| minipot-0.2.5.pkg | 2025-12-30 12:21 | 4.1K | |
| minipro-0.7.4.pkg | 2025-12-21 02:49 | 297K | |
| minirsyslogd-1.02_3.pkg | 2025-08-18 04:26 | 23K | |
| minisat-2.2.1_2.pkg | 2025-08-13 22:57 | 214K | |
| minisatip-2.0.45,1.pkg | 2025-12-30 06:41 | 301K | |
| minised-1.16.pkg | 2025-08-18 07:14 | 16K | |
| miniserve-0.32.0_3.pkg | 2025-12-29 00:32 | 2.4M | |
| minisign-0.12.pkg | 2025-08-16 19:11 | 13K | |
| minissdpd-1.6.0_1.pkg | 2025-08-21 17:42 | 20K | |
| minitube-3.9.3_3.pkg | 2025-12-28 06:48 | 1.0M | |
| miniupnpc-2.3.3_1.pkg | 2025-12-19 01:11 | 57K | |
| miniupnpd-2.3.9_1,1.pkg | 2025-12-23 03:07 | 74K | |
| minixmlto-0.1.0.pkg | 2025-12-18 11:38 | 1.6K | |
| minizinc-2.8.7.pkg | 2025-12-27 10:45 | 2.0M | |
| minizinc-ide-2.8.7.pkg | 2025-12-28 01:31 | 871K | |
| minizinc-solvers-202..> | 2025-12-30 01:41 | 677 | |
| minizip-1.3.1.pkg | 2025-08-13 03:55 | 42K | |
| minizip-ng-4.0.10.pkg | 2025-12-18 14:21 | 71K | |
| minorminer-0.2.19.pkg | 2025-12-23 01:32 | 45K | |
| mint-themes-0.0.41cf..> | 2025-08-19 11:20 | 97K | |
| minuet-25.12.0.pkg | 2025-12-26 21:23 | 28M | |
| mio2jack-g20180501_3..> | 2025-12-29 00:18 | 3.6K | |
| mips-binutils-2.44,1..> | 2025-12-23 09:34 | 2.3M | |
| mips64-binutils-2.44..> | 2025-12-22 08:49 | 2.3M | |
| mir-core-1.1.62_4.pkg | 2025-08-13 17:18 | 60K | |
| miracl-5.6_8,1.pkg | 2025-12-28 05:28 | 132K | |
| miredo-1.2.6_7.pkg | 2025-12-23 04:09 | 83K | |
| mirmon-2.11_1.pkg | 2025-12-23 16:09 | 34K | |
| mirror-2.9_3.pkg | 2025-12-21 05:11 | 53K | |
| mirrormagic-3.3.1_1.pkg | 2025-12-28 01:32 | 3.1M | |
| mirrorselect-0.9.0_3..> | 2025-12-23 07:01 | 2.9M | |
| mirtk-2.0.0.179_1.pkg | 2025-12-27 22:58 | 4.6M | |
| miruo-0.9.6b.pkg | 2025-08-16 19:47 | 19K | |
| miscom-1.0_1.pkg | 2025-08-18 15:27 | 89K | |
| mise-2025.12.9.pkg | 2025-12-29 18:05 | 11M | |
| missey-1.2.0_1.pkg | 2025-08-19 20:56 | 18K | |
| mit-scheme-12.1.pkg | 2025-12-21 10:08 | 38M | |
| mixal-1.11_1.pkg | 2025-08-20 06:21 | 34K | |
| mixer-1.0.pkg | 2025-08-22 00:23 | 856 | |
| mixer.app-1.8.0_3.pkg | 2025-12-20 19:28 | 15K | |
| mixertui-1.5.pkg | 2025-08-30 07:35 | 13K | |
| mixxx-qt5-2.5.3_2.pkg | 2025-12-29 16:25 | 13M | |
| mixxx-qt6-2.5.3_2.pkg | 2025-12-29 17:48 | 13M | |
| mizuma-2025.06.pkg | 2025-12-30 08:09 | 7.9K | |
| mjpegtools-2.2.1.pkg | 2025-12-26 22:26 | 1.0M | |
| mk-aspell-0.50.0_1,1..> | 2025-12-20 18:02 | 1.3M | |
| mk-configure-0.40.0.pkg | 2025-08-13 20:08 | 194K | |
| mk-libreoffice-25.8...> | 2025-12-27 17:04 | 2.8M | |
| mk-livestatus-1.2.8p..> | 2025-12-27 16:51 | 180K | |
| mkbold-1.0_2.pkg | 2025-12-21 13:01 | 1.8K | |
| mkbold-mkitalic-0.11..> | 2025-08-14 04:05 | 16K | |
| mkbrr-1.18.0_2.pkg | 2025-12-20 05:40 | 3.2M | |
| mkcatalog-1.1.pkg | 2025-08-20 06:04 | 3.4K | |
| mkclean-0.9.0.pkg | 2025-08-19 06:08 | 147K | |
| mkcomposecache-1.2.1..> | 2025-08-18 05:36 | 4.1K | |
| mkcue-1.8.pkg | 2025-08-17 20:35 | 5.3K | |
| mkdesktop-5.0_1.pkg | 2025-08-18 13:06 | 4.7K | |
| mkfontscale-1.2.3.pkg | 2025-12-24 20:24 | 20K | |
| mkfwimage-r1_1.pkg | 2025-08-18 15:50 | 5.2K | |
| mkgmap-r4923.pkg | 2025-12-30 14:10 | 3.1M | |
| mkgmap-splitter-r654..> | 2025-12-28 14:20 | 1.4M | |
| mkhexgrid-0.1.1_22.pkg | 2025-12-30 14:48 | 49K | |
| mkitalic-1.0_2.pkg | 2025-12-22 02:57 | 3.6K | |
| mkjail-0.0.8.pkg | 2025-08-17 17:21 | 7.8K | |
| mknmz-wwwoffle-0.7.2..> | 2025-12-21 18:25 | 20K | |
| mkntpwd-1.0.pkg | 2025-08-22 17:52 | 7.9K | |
| mkp224o-1.7.0.pkg | 2025-08-20 12:21 | 62K | |
| mkpasswd-2.1.pkg | 2025-12-22 15:05 | 1.9K | |
| mkr-0.63.0.pkg | 2025-12-23 06:43 | 4.7M | |
| mkreadmes-1.3_1.pkg | 2025-08-19 00:25 | 14K | |
| mksh-59c_2.pkg | 2025-08-15 02:24 | 209K | |
| mktorrent-1.1_1.pkg | 2025-08-22 16:00 | 9.1K | |
| mkvalidator-0.6.0.pkg | 2025-08-21 00:55 | 244K | |
| mkvtoolnix-96.0.pkg | 2025-12-27 19:40 | 9.8M | |
| mkvtoolnix-nogui-96...> | 2025-12-27 16:35 | 3.9M | |
| ml-aspell-0.04.1.pkg | 2025-12-20 07:37 | 1.1M | |
| ml-libreoffice-25.8...> | 2025-12-27 13:14 | 375K | |
| ml1-4.12_2.pkg | 2025-08-19 12:41 | 736K | |
| mlclock-1.1_3.pkg | 2025-08-22 14:05 | 8.0K | |
| mldonkey-3.1.7.2.pkg | 2025-12-29 20:29 | 12M | |
| mldonkey-core-3.1.7...> | 2025-12-30 12:39 | 3.3M | |
| mldonkey-gui-3.1.7.2..> | 2025-12-29 06:30 | 2.9M | |
| mle-1.7.2.pkg | 2025-12-23 17:11 | 98K | |
| mlkit-4.7.13.pkg | 2025-12-28 12:04 | 33M | |
| mlmmj-1.6.0.pkg | 2025-08-22 15:49 | 220K | |
| mlmmj-archive-mid-0...> | 2025-12-21 00:53 | 4.6K | |
| mlmmj-archiver-0.4.pkg | 2025-12-23 12:51 | 85K | |
| mlmmj-webview-0.0.7_..> | 2025-12-21 06:56 | 13K | |
| mlpack-4.6.2.pkg | 2025-12-28 10:30 | 7.8M | |
| mls-1.4.b1.pkg | 2025-08-20 14:10 | 41K | |
| mlt7-7.34.1_1.pkg | 2025-12-26 15:36 | 674K | |
| mlt7-glaxnimate-qt5-..> | 2025-12-30 00:53 | 1.0M | |
| mlt7-glaxnimate-qt6-..> | 2025-12-26 17:54 | 1.0M | |
| mlt7-qt5-7.34.1.pkg | 2025-12-28 09:54 | 135K | |
| mlt7-qt6-7.34.1.pkg | 2025-12-26 18:10 | 136K | |
| mlterm-3.9.4_1.pkg | 2025-12-29 20:02 | 2.7M | |
| mlton-20210816_1.pkg | 2025-12-19 14:58 | 5.7M | |
| mlvpn-2.3.1_4.pkg | 2025-08-16 01:40 | 40K | |
| mm-1.4.2_2.pkg | 2025-08-15 22:49 | 26K | |
| mmail-0.52_1.pkg | 2025-08-18 17:25 | 120K | |
| mmake-2.3_2.pkg | 2025-12-23 12:48 | 13K | |
| mmc-utils-20230807_1..> | 2025-08-22 20:26 | 40K | |
| mmdb2-2.0.22.pkg | 2025-08-14 07:13 | 459K | |
| mmdnn-0.3.1_3.pkg | 2025-12-29 16:40 | 605K | |
| mmencode-2.7_1.pkg | 2025-08-22 21:31 | 9.2K | |
| mmex-1.2.7_19.pkg | 2025-12-29 14:25 | 4.0M | |
| mmg-5.8.0.pkg | 2025-12-26 14:16 | 891K | |
| mmh-0.4_1.pkg | 2025-08-18 07:13 | 533K | |
| mmix-20160804_1.pkg | 2025-08-22 01:28 | 369K | |
| mmr-1.6.0_1.pkg | 2025-08-16 09:46 | 58K | |
| mmtc-0.3.2_25.pkg | 2025-12-30 09:39 | 543K | |
| mmtf-cpp-1.1.0_1.pkg | 2025-08-14 03:10 | 19K | |
| mmv-1.01b.19_2.pkg | 2025-08-15 19:36 | 22K | |
| mmve-0.2.0.pkg | 2025-12-21 19:38 | 1.8K | |
| mn-aspell-0.06.2,2.pkg | 2025-12-23 07:44 | 3.9M | |
| mn-freebsd-doc-20251..> | 2025-12-19 20:32 | 7.4M | |
| mn-libreoffice-25.8...> | 2025-12-27 14:26 | 639K | |
| mni-libreoffice-25.8..> | 2025-12-27 15:51 | 286K | |
| mnn-2.9.0_7.pkg | 2025-08-21 02:37 | 3.3M | |
| moab-5.5.1_2.pkg | 2025-12-27 15:58 | 1.7M | |
| moagg-1.95b_1.pkg | 2025-12-30 02:58 | 2.4M | |
| moar-1.31.3.pkg | 2025-08-15 14:17 | 1.9M | |
| mobile-broadband-pro..> | 2025-12-20 10:39 | 60K | |
| moc-2.5.2_13.pkg | 2025-12-23 08:25 | 183K | |
| mod_dav_svn-1.14.5.pkg | 2025-12-23 08:27 | 85K | |
| mod_php81-8.1.34.pkg | 2025-12-28 03:57 | 1.6M | |
| mod_php82-8.2.30.pkg | 2025-12-30 02:34 | 1.6M | |
| mod_php83-8.3.29.pkg | 2025-12-29 02:26 | 1.7M | |
| mod_php84-8.4.16.pkg | 2025-12-27 17:42 | 1.7M | |
| mod_php85-8.5.1.pkg | 2025-12-30 12:31 | 2.9M | |
| mod_rivet-3.2.0.pkg | 2025-12-23 08:48 | 109K | |
| mod_webauth-4.7.0_3.pkg | 2025-12-24 03:40 | 133K | |
| modd-0.8_36.pkg | 2025-12-24 04:28 | 1.7M | |
| modernish-0.16.5.pkg | 2025-08-18 14:08 | 254K | |
| modlogan-0.8.13_20.pkg | 2025-12-30 01:50 | 474K | |
| modman-1.12.pkg | 2025-12-20 18:00 | 11K | |
| modplug-tools-0.5.6.pkg | 2025-12-23 06:21 | 6.8K | |
| mods-1.8.1.pkg | 2025-12-21 12:36 | 8.0M | |
| modsecurity3-3.0.14_..> | 2025-12-19 12:07 | 914K | |
| modsecurity3-nginx-1..> | 2025-12-22 14:00 | 9.1K | |
| modules-5.6.1.pkg | 2025-12-23 04:27 | 770K | |
| modules2tuple-2.2.4_..> | 2025-12-24 04:47 | 2.7M | |
| mog-0.6.0_3.pkg | 2025-12-23 20:32 | 13K | |
| mohawk-2.1.0.pkg | 2025-08-21 12:02 | 43K | |
| moin2-2.0.0.b3_1.pkg | 2025-12-29 21:55 | 2.0M | |
| moinmoin-1.9.11_1.pkg | 2025-12-28 23:34 | 8.9M | |
| moinmoincli-4.6.0_1.pkg | 2025-12-22 17:11 | 6.7K | |
| mojave-gtk-themes-20..> | 2025-12-28 01:44 | 3.3M | |
| mol2ps-0.4c_2.pkg | 2025-12-22 06:15 | 316K | |
| mold-2.40.3.pkg | 2025-12-29 11:45 | 1.6M | |
| molden-7.1_1,1.pkg | 2025-12-30 10:35 | 3.7M | |
| molequeue-0.9.0.17.pkg | 2025-12-27 05:29 | 461K | |
| molgif-g20180108_34.pkg | 2025-12-21 07:28 | 849K | |
| molsketch-0.8.2.pkg | 2025-12-30 17:12 | 1.6M | |
| monaspace-1.101.pkg | 2025-12-29 15:27 | 6.2M | |
| mondulkiri-2_3.pkg | 2025-12-29 22:15 | 276K | |
| monero-cli-0.18.4.3.pkg | 2025-12-20 16:52 | 15M | |
| mongo-c-driver-1.30...> | 2025-12-18 19:34 | 2.0M | |
| mongo-cxx-driver-4.0..> | 2025-12-23 12:59 | 335K | |
| mongodb-tools-100.13..> | 2025-12-20 23:33 | 29M | |
| mongodb40-tools-4.0...> | 2025-12-21 11:09 | 5.6M | |
| mongodb42-tools-4.2...> | 2025-12-22 10:29 | 14M | |
| mongodb70-7.0.28.pkg | 2025-12-27 15:44 | 47M | |
| mongodb80-8.0.12_5.pkg | 2025-12-29 03:43 | 55M | |
| mongodb_exporter-0.4..> | 2025-12-21 14:46 | 5.5M | |
| mongoose-5.6_1.pkg | 2025-12-20 08:52 | 36K | |
| monit-5.35.2.pkg | 2025-08-20 04:32 | 329K | |
| monitord-0.4.1_8.pkg | 2025-08-16 01:31 | 10K | |
| monitoring-plugins-2..> | 2025-12-19 15:12 | 378K | |
| monitorix-3.15.0.pkg | 2025-12-28 22:43 | 246K | |
| monkeysphere-0.43_2.pkg | 2025-12-23 19:45 | 80K | |
| mono-5.20.pkg | 2025-12-23 11:49 | 1.0K | |
| mono-addins-1.3_5.pkg | 2025-12-27 15:49 | 479K | |
| mono-basic-4.7_3.pkg | 2025-12-20 18:29 | 760K | |
| mono5.20-5.20.1.34_4..> | 2025-12-18 16:56 | 78M | |
| monocypher-4.0.2.pkg | 2025-08-21 09:07 | 103K | |
| monoid-0.61_1.pkg | 2025-12-30 07:37 | 238K | |
| monolith-2.10.1_2.pkg | 2025-12-30 14:10 | 2.9M | |
| mons-0.8.2_1.pkg | 2025-08-22 17:42 | 18K | |
| monsterz-0.9_1.pkg | 2025-12-27 21:03 | 1.8M | |
| montecarlo_fonts-1.0..> | 2025-12-29 11:33 | 5.3K | |
| montserrat-7.222.pkg | 2025-12-27 16:06 | 2.3M | |
| moo-1.5_2.pkg | 2025-08-16 15:19 | 13K | |
| moodbar-1.3.0.pkg | 2025-12-27 03:41 | 18K | |
| moodle44-php81-4.4.1..> | 2025-12-30 07:09 | 45M | |
| moodle44-php82-4.4.1..> | 2025-12-29 22:48 | 45M | |
| moodle44-php83-4.4.1..> | 2025-12-29 04:42 | 45M | |
| moodle44-php84-4.4.1..> | 2025-12-28 20:21 | 45M | |
| moodle44-php85-4.4.1..> | 2025-12-30 16:00 | 45M | |
| moodle45-php81-4.5.8..> | 2025-12-29 23:47 | 46M | |
| moodle45-php82-4.5.8..> | 2025-12-29 19:23 | 46M | |
| moodle45-php83-4.5.8..> | 2025-12-28 10:41 | 46M | |
| moodle45-php84-4.5.8..> | 2025-12-28 11:10 | 46M | |
| moodle45-php85-4.5.8..> | 2025-12-28 19:01 | 46M | |
| moodle50-php81-5.0.4..> | 2025-12-28 06:20 | 46M | |
| moodle50-php82-5.0.4..> | 2025-12-30 02:27 | 46M | |
| moodle50-php83-5.0.4..> | 2025-12-28 12:33 | 46M | |
| moodle50-php84-5.0.4..> | 2025-12-29 12:25 | 46M | |
| moodle50-php85-5.0.4..> | 2025-12-29 15:41 | 46M | |
| moodle51-php81-5.1.1..> | 2025-12-30 15:54 | 47M | |
| moodle51-php82-5.1.1..> | 2025-12-28 12:13 | 47M | |
| moodle51-php83-5.1.1..> | 2025-12-29 13:04 | 47M | |
| moodle51-php84-5.1.1..> | 2025-12-28 08:29 | 47M | |
| moodle51-php85-5.1.1..> | 2025-12-30 14:52 | 47M | |
| moon-buggy-1.0.51_5.pkg | 2025-08-17 17:36 | 38K | |
| moonlander-1.0_14.pkg | 2025-12-29 07:19 | 1.3M | |
| moonlight-embedded-2..> | 2025-12-27 22:49 | 142K | |
| moonlight-embedded-d..> | 2025-12-29 12:58 | 176K | |
| moonlight-qt-6.1.0_3..> | 2025-12-28 10:23 | 1.0M | |
| moony-lv2-0.36.0_1.pkg | 2025-08-19 15:55 | 613K | |
| moor-2.9.6.pkg | 2025-12-27 14:27 | 4.3M | |
| moosefs2-cgi-2.0.91_..> | 2025-12-19 10:17 | 45K | |
| moosefs2-cgiserv-2.0..> | 2025-12-21 03:05 | 8.8K | |
| moosefs2-chunkserver..> | 2025-08-18 17:02 | 103K | |
| moosefs2-cli-2.0.91_..> | 2025-12-24 05:23 | 36K | |
| moosefs2-client-2.0...> | 2025-08-16 05:07 | 125K | |
| moosefs2-master-2.0...> | 2025-08-18 06:40 | 221K | |
| moosefs2-metalogger-..> | 2025-08-19 15:12 | 32K | |
| moosefs2-netdump-2.0..> | 2025-08-17 23:53 | 9.4K | |
| moosefs3-cgi-3.0.117..> | 2025-12-19 07:09 | 54K | |
| moosefs3-cgiserv-3.0..> | 2025-12-22 18:44 | 9.0K | |
| moosefs3-chunkserver..> | 2025-08-18 14:02 | 172K | |
| moosefs3-cli-3.0.117..> | 2025-12-24 07:11 | 46K | |
| moosefs3-client-3.0...> | 2025-08-21 11:14 | 907K | |
| moosefs3-master-3.0...> | 2025-08-22 01:08 | 325K | |
| moosefs3-metalogger-..> | 2025-08-18 02:40 | 34K | |
| moosefs3-netdump-3.0..> | 2025-08-17 23:22 | 11K | |
| mopac-23.2.2,1.pkg | 2025-12-29 07:43 | 2.0M | |
| mopd-2.5.3_3.pkg | 2025-08-18 14:00 | 63K | |
| moregroupware-0.7.4_..> | 2025-12-29 23:24 | 1.6M | |
| moreutils-0.70.pkg | 2025-12-23 12:18 | 50K | |
| morewaita-icon-theme..> | 2025-12-24 05:10 | 6.7M | |
| moria-5.5.2_1.pkg | 2025-08-16 15:47 | 231K | |
| morty-0.2.0.12_34.pkg | 2025-12-23 01:01 | 2.3M | |
| mosdns-5.3.3_2.pkg | 2025-08-19 14:53 | 4.9M | |
| mosh-1.4.0_9.pkg | 2025-12-22 05:40 | 164K | |
| mosh-scheme-0.2.9.r1..> | 2025-08-18 23:11 | 1.1M | |
| mosml-2.10.1_1.pkg | 2025-12-24 07:06 | 1.5M | |
| mosquitto-2.0.22_1.pkg | 2025-12-18 19:28 | 323K | |
| most-5.2.0_1.pkg | 2025-12-30 00:22 | 55K | |
| mothur-1.48.2.pkg | 2025-12-23 05:19 | 5.0M | |
| motion-4.7.1.pkg | 2025-12-29 04:15 | 457K | |
| motsognir-1.0.13_1.pkg | 2025-08-18 00:32 | 33K | |
| mountsmb2-0.90.2.pkg | 2025-12-23 10:01 | 7.5K | |
| mourier-g20170925_1.pkg | 2025-12-29 15:06 | 6.4K | |
| mousai-0.7.9_2.pkg | 2025-12-28 10:24 | 1.3M | |
| mouseclock-1.0_5.pkg | 2025-08-17 20:17 | 6.1K | |
| mousepad-0.6.5_1.pkg | 2025-12-27 11:32 | 451K | |
| moveable-type-fonts-..> | 2025-12-29 18:20 | 536K | |
| movine-0.11.0_27.pkg | 2025-12-29 17:56 | 1.5M | |
| movingmotif-2.3.0_3.pkg | 2025-12-30 18:46 | 78K | |
| movit-1.7.2.pkg | 2025-12-18 10:56 | 374K | |
| mox-mail-server-0.0...> | 2025-08-21 06:22 | 7.0M | |
| mozjpeg-4.1.5.pkg | 2025-12-27 21:25 | 598K | |
| mozo-1.28.0_1.pkg | 2025-12-27 07:26 | 122K | |
| mp-5.62.pkg | 2025-12-21 02:19 | 271K | |
| mp-a4-3.0.1_1.pkg | 2025-08-22 16:08 | 24K | |
| mp-letter-3.0.1_1.pkg | 2025-08-15 22:23 | 24K | |
| mp-player-0.6_1.pkg | 2025-08-17 00:29 | 30K | |
| mp2d-f20190610.pkg | 2025-08-22 11:57 | 37K | |
| mp3-archive-tools-0...> | 2025-12-21 04:08 | 55K | |
| mp3_check-1.98_1.pkg | 2025-08-17 19:01 | 13K | |
| mp3asm-0.1.3.1_1.pkg | 2025-08-18 17:01 | 17K | |
| mp3blaster-3.2.6_3.pkg | 2025-08-18 10:06 | 154K | |
| mp3burn-0.4.2_2.pkg | 2025-12-30 01:13 | 9.6K | |
| mp3cd-1.027_1,1.pkg | 2025-12-21 12:28 | 15K | |
| mp3gain-1.6.2.pkg | 2025-12-27 10:50 | 34K | |
| mp3guessenc-0.27.5.pkg | 2025-08-18 19:25 | 26K | |
| mp3lint-0.9_2.pkg | 2025-12-20 08:46 | 56K | |
| mp3mover-2.1.1_1.pkg | 2025-12-20 10:31 | 11K | |
| mp3riot-1.3_1.pkg | 2025-12-20 06:55 | 34K | |
| mp3splt-2.6.2_1.pkg | 2025-12-22 14:09 | 40K | |
| mp3stat-2.6.01_13.pkg | 2025-12-28 02:12 | 30K | |
| mp3unicode-1.2.1_4.pkg | 2025-08-21 23:37 | 13K | |
| mp3val-0.1.8.pkg | 2025-08-15 13:53 | 13K | |
| mp3wrap-0.5_1.pkg | 2025-08-18 10:04 | 12K | |
| mp4v2-2.1.3_1.pkg | 2025-08-15 08:35 | 381K | |
| mp_doccer-1.2.2.pkg | 2025-12-20 01:03 | 7.5K | |
| mpack-1.6_4.pkg | 2025-08-15 02:29 | 32K | |
| mpage-2.5.8.pkg | 2025-08-15 10:27 | 44K | |
| mpatrol-1.4.8_6.pkg | 2025-12-24 07:18 | 2.6M | |
| mpb-1.12.0.pkg | 2025-12-27 16:06 | 198K | |
| mpc-1.3.1_1.pkg | 2025-08-11 00:01 | 110K | |
| mpc-qt-25.07.pkg | 2025-12-30 08:31 | 934K | |
| mpd-l2tp-ipv6pd-clie..> | 2025-08-18 01:42 | 4.3K | |
| mpd5-5.9_18.pkg | 2025-08-15 19:41 | 424K | |
| mpdas-0.4.5_4.pkg | 2025-12-24 03:16 | 34K | |
| mpdcon-1.5.1_13.pkg | 2025-12-27 17:50 | 100K | |
| mpdecimal-4.0.1.pkg | 2025-08-10 21:07 | 156K | |
| mpdscribble-0.22_2.pkg | 2025-12-23 08:49 | 24K | |
| mpexpr-1.2_2.pkg | 2025-08-28 22:50 | 67K | |
| mpfi-1.5.4.pkg | 2025-08-13 00:16 | 77K | |
| mpfr-4.2.2,1.pkg | 2025-08-10 21:14 | 512K | |
| mpfrc++-3.7.2.pkg | 2025-12-22 14:39 | 17K | |
| mpfrcx-0.6.3_1.pkg | 2025-08-14 06:18 | 70K | |
| mpg123-1.33.4.pkg | 2025-12-24 20:08 | 347K | |
| mpg123.el-1.65_4.pkg | 2025-12-27 09:40 | 33K | |
| mpg123.el-emacs_cann..> | 2025-12-28 03:08 | 33K | |
| mpg123.el-emacs_deve..> | 2025-12-30 05:40 | 33K | |
| mpg123.el-emacs_deve..> | 2025-12-29 17:01 | 33K | |
| mpg123.el-emacs_nox-..> | 2025-12-28 02:42 | 33K | |
| mpg123.el-emacs_wayl..> | 2025-12-30 12:16 | 33K | |
| mpg321-0.2.10_13.pkg | 2025-12-20 18:21 | 25K | |
| mph-1.2.pkg | 2025-08-22 13:07 | 11K | |
| mpich-4.3.2.pkg | 2025-12-26 09:19 | 7.5M | |
| mpifx-1.5.pkg | 2025-12-26 20:12 | 326K | |
| mping-2.01_1.pkg | 2025-08-22 05:36 | 18K | |
| mping-fraubsd-0.1.4.pkg | 2025-08-16 02:58 | 4.1K | |
| mpir-3.0.0_1.pkg | 2025-08-13 20:40 | 526K | |
| mplayer-1.5.0.202508..> | 2025-12-26 23:08 | 1.1M | |
| mplayer-skins-1.1.5.pkg | 2025-08-13 22:02 | 215K | |
| mplex-1.1_1.pkg | 2025-08-18 15:47 | 17K | |
| mpop-1.4.21.pkg | 2025-12-23 17:16 | 155K | |
| mppp-1.0.3_7.pkg | 2025-12-26 18:30 | 161K | |
| mpqc-2.3.1_52.pkg | 2025-12-26 23:16 | 32M | |
| mprime-30.19b21.pkg | 2025-12-29 15:31 | 1.7M | |
| mprocs-0.7.3_6.pkg | 2025-12-30 12:34 | 867K | |
| mps-0.20.16_5.pkg | 2025-12-29 15:35 | 62K | |
| mpsolve-3.2.1_3.pkg | 2025-12-30 09:25 | 267K | |
| mptd-0.01_1.pkg | 2025-08-21 06:06 | 9.3K | |
| mptsd-1.1.27.pkg | 2025-08-16 19:25 | 66K | |
| mpv-0.40.0_6,1.pkg | 2025-12-26 17:54 | 1.6M | |
| mpv-mpris-1.1.pkg | 2025-12-28 09:39 | 11K | |
| mpvpaper-1.8.pkg | 2025-12-29 22:09 | 41K | |
| mpvqt-1.1.1.pkg | 2025-12-27 12:37 | 28K | |
| mpz-1.0.26.pkg | 2025-12-28 18:16 | 395K | |
| mqtt2prometheus-0.1...> | 2025-12-23 15:18 | 3.7M | |
| mr-aspell-0.10.0_2,2..> | 2025-12-23 13:23 | 508K | |
| mr-libreoffice-25.8...> | 2025-12-27 03:18 | 405K | |
| mrbayes-3.2.7_2.pkg | 2025-12-21 03:14 | 4.9M | |
| mrboom-5.5.pkg | 2025-12-30 03:54 | 1.7M | |
| mrc-1.3.16.pkg | 2025-12-20 00:44 | 53K | |
| mrchem-1.1.4.pkg | 2025-12-27 14:49 | 740K | |
| mrcpp-1.5.0_1.pkg | 2025-12-26 21:45 | 29M | |
| mroonga-14.13.pkg | 2025-12-21 00:12 | 3.2M | |
| mrouted-3.9.8_2.pkg | 2025-08-16 04:57 | 103K | |
| mrtg-2.17.10_3,1.pkg | 2025-12-26 20:33 | 374K | |
| mrtg-ping-probe-2.2...> | 2025-12-27 04:18 | 14K | |
| mrxvt-0.5.4.pkg | 2025-12-28 12:39 | 201K | |
| ms-aspell-0.50.0_1,1..> | 2025-12-20 18:01 | 118K | |
| msbuild-15.8.p_2.pkg | 2025-12-19 13:10 | 7.9M | |
| mscgen-0.20_9.pkg | 2025-12-30 14:55 | 49K | |
| mscompress-0.4_1.pkg | 2025-08-16 10:08 | 7.3K | |
| msend-3.0_4.pkg | 2025-12-22 06:26 | 21K | |
| msglint-1.04.pkg | 2025-08-21 07:59 | 27K | |
| msgpack-c-6.1.0.pkg | 2025-08-13 20:33 | 35K | |
| msgpack-cxx-6.1.1.pkg | 2025-08-13 19:14 | 226K | |
| msgpack-d-1.0.4_4.pkg | 2025-08-18 17:40 | 102K | |
| msgpuck-2.0_6.pkg | 2025-08-15 19:24 | 34K | |
| msgraph-0.2.3.pkg | 2025-12-28 03:17 | 1.1M | |
| msiklm-g20211104.pkg | 2025-12-22 20:57 | 11K | |
| msitools-0.106.pkg | 2025-12-28 10:40 | 419K | |
| msktutil-1.2.2.pkg | 2025-08-16 12:07 | 79K | |
| msl-1.8.2.pkg | 2025-12-30 02:12 | 2.8M | |
| msms-2.6.1_1.pkg | 2025-08-16 05:03 | 395K | |
| msmtp-1.8.32.pkg | 2025-12-20 06:24 | 174K | |
| msoak-0.8_1.pkg | 2025-12-24 01:20 | 18K | |
| msort-8.53_6.pkg | 2025-12-30 16:19 | 124K | |
| msp430-debug-stack-3..> | 2025-12-19 15:13 | 3.3M | |
| mspdebug-0.25.202004..> | 2025-12-22 01:42 | 446K | |
| mstch-1.0.2.1_4.pkg | 2025-08-21 12:19 | 35K | |
| mstflint-4.34.1.2.pkg | 2025-12-29 04:11 | 3.2M | |
| mstore-0.3.0.pkg | 2025-12-26 20:01 | 279K | |
| mt-aspell-0.50.0_1,1..> | 2025-12-23 14:17 | 5.3M | |
| mt_dolphin_ia-0.1.98..> | 2025-12-19 15:15 | 5.8K | |
| mt_gtk_client-0.1.98..> | 2025-12-29 13:43 | 32K | |
| mtasc-1.14_3.pkg | 2025-12-28 03:59 | 617K | |
| mtaserver-0.5_2.pkg | 2025-12-24 07:18 | 66K | |
| mtbl-1.7.1.pkg | 2025-12-18 22:40 | 90K | |
| mtf-0.2.1_1.pkg | 2025-08-20 01:01 | 17K | |
| mtm-1.2.1.pkg | 2025-08-17 11:16 | 20K | |
| mtools-4.0.49.pkg | 2025-12-18 19:31 | 190K | |
| mtop-0.6.6_6.pkg | 2025-12-23 16:08 | 30K | |
| mtpaint-3.50.09_6.pkg | 2025-12-30 05:29 | 664K | |
| mtpfs-1.1_5.pkg | 2025-12-23 00:27 | 13K | |
| mtr-0.96.pkg | 2025-12-30 02:27 | 59K | |
| mtr-nox11-0.96.pkg | 2025-08-14 21:56 | 51K | |
| mtrace-5.2_2.pkg | 2025-08-18 04:51 | 27K | |
| mtrxmath-1.0.2.pkg | 2025-08-22 07:17 | 6.9K | |
| mtx-1.3.12_2.pkg | 2025-08-20 21:53 | 51K | |
| mtxclient-0.10.1_2.pkg | 2025-12-19 12:00 | 890K | |
| mtxorbd-1.0.2_1.pkg | 2025-08-15 23:47 | 20K | |
| mu-1.12.13.pkg | 2025-12-22 09:09 | 779K | |
| mucommander-1.5.2.1.pkg | 2025-12-30 07:39 | 109M | |
| muffin-6.4.1_1.pkg | 2025-12-27 03:44 | 2.0M | |
| muh-2.2a.pkg | 2025-08-18 14:28 | 33K | |
| mujs-1.3.8.pkg | 2025-12-19 05:34 | 288K | |
| mulberry-4.0.8_2.pkg | 2025-08-20 08:50 | 4.1M | |
| mult-0.2.0_5.pkg | 2025-12-23 09:45 | 1.1M | |
| multican-0.0.5_3.pkg | 2025-08-18 20:52 | 29K | |
| multicat-2.3_2.pkg | 2025-08-17 08:16 | 38K | |
| multicharge-0.4.0.pkg | 2025-12-26 21:51 | 122K | |
| multichoose-1.0.3.2.pkg | 2025-12-18 19:36 | 27K | |
| multimarkdown-6.7.0.pkg | 2025-12-23 16:52 | 1.5M | |
| multimc-0.6.11.pkg | 2025-12-29 23:29 | 1.9M | |
| multimon-ng-1.1.0_2.pkg | 2025-08-21 09:24 | 39K | |
| multisort-1.1.pkg | 2025-08-17 01:43 | 3.7K | |
| multisuck-1.0.4.pkg | 2025-08-21 19:31 | 13K | |
| multitail-7.1.5_1.pkg | 2025-08-17 08:01 | 127K | |
| multiwatch-1.0.0_3.pkg | 2025-12-21 15:34 | 6.0K | |
| multiwfn-3.8_5.pkg | 2025-12-28 09:46 | 6.8M | |
| mumble-1.5.735_3.pkg | 2025-12-27 22:41 | 4.8M | |
| mumble-server-1.5.73..> | 2025-12-23 19:03 | 359K | |
| mummer-4.0.1.pkg | 2025-12-19 15:11 | 462K | |
| mumps-edf-5.1.2.a7_6..> | 2025-12-26 14:52 | 3.3M | |
| mumps4-4.10.0_6.pkg | 2025-12-29 01:07 | 2.9M | |
| munge-0.5.17.pkg | 2025-12-18 01:32 | 114K | |
| munger-5.12_1.pkg | 2025-12-19 17:20 | 205K | |
| munin-common-2.0.76.pkg | 2025-12-18 23:34 | 20K | |
| munin-contrib-g.2024..> | 2025-12-24 01:09 | 8.0M | |
| munin-master-2.0.76.pkg | 2025-12-29 04:22 | 553K | |
| munin-node-2.0.76_1.pkg | 2025-12-19 22:24 | 265K | |
| munkres-cpp-1.0.0.6.pkg | 2025-08-22 20:49 | 16K | |
| muon-0.5.0_1.pkg | 2025-12-21 01:50 | 374K | |
| muparser-2.3.5.pkg | 2025-08-14 09:24 | 170K | |
| muparserx-4.0.12.pkg | 2025-08-17 06:09 | 216K | |
| mupdf-1.27.0,1.pkg | 2025-12-27 16:41 | 29M | |
| mupen64plus-2.6.0.pkg | 2025-12-30 18:00 | 1.0K | |
| mupen64plus-audio-sd..> | 2025-12-27 16:48 | 9.3K | |
| mupen64plus-core-2.6..> | 2025-12-26 20:53 | 514K | |
| mupen64plus-input-sd..> | 2025-12-27 02:56 | 21K | |
| mupen64plus-plugins-..> | 2025-12-28 06:36 | 640 | |
| mupen64plus-qt-1.14_..> | 2025-12-30 02:54 | 257K | |
| mupen64plus-rsp-cxd4..> | 2025-12-27 19:25 | 24K | |
| mupen64plus-rsp-hle-..> | 2025-12-27 06:23 | 38K | |
| mupen64plus-rsp-z64-..> | 2025-12-27 16:50 | 27K | |
| mupen64plus-ui-conso..> | 2025-12-27 09:08 | 23K | |
| mupen64plus-video-ar..> | 2025-12-27 17:11 | 63K | |
| mupen64plus-video-gl..> | 2025-12-27 11:40 | 257K | |
| mupen64plus-video-gl..> | 2025-12-27 02:12 | 434K | |
| mupen64plus-video-ri..> | 2025-12-27 17:53 | 236K | |
| mupen64plus-video-z6..> | 2025-12-27 17:36 | 36K | |
| murex-6.0.1000_16.pkg | 2025-12-20 07:45 | 4.1M | |
| murmur-1.3.4_11.pkg | 2025-12-22 10:45 | 465K | |
| murmur-cli-0.0.0.202..> | 2025-12-21 13:02 | 3.0M | |
| muscle-3.8.1551.pkg | 2025-08-20 16:54 | 149K | |
| muse-emacs-3.20_31.pkg | 2025-12-29 16:46 | 359K | |
| muse-emacs_canna-3.2..> | 2025-12-30 02:45 | 359K | |
| muse-emacs_devel-3.2..> | 2025-12-29 02:34 | 359K | |
| muse-emacs_devel_nox..> | 2025-12-23 09:17 | 359K | |
| muse-emacs_nox-3.20_..> | 2025-12-23 12:43 | 359K | |
| muse-emacs_wayland-3..> | 2025-12-28 02:57 | 359K | |
| muse-sequencer-4.2.1..> | 2025-12-30 04:04 | 6.8M | |
| musepack-2011.08.10.pkg | 2025-08-22 21:59 | 136K | |
| musescore-4.6.5_1.pkg | 2025-12-27 09:00 | 70M | |
| musiccontrol-0.3_3.pkg | 2025-12-29 06:36 | 32K | |
| musicpc-0.35_1.pkg | 2025-08-16 15:52 | 190K | |
| musicpd-0.24.6_2.pkg | 2025-12-27 10:27 | 523K | |
| musikcube-3.0.5_1.pkg | 2025-12-28 09:50 | 2.4M | |
| musique-1.12.pkg | 2025-12-28 06:58 | 592K | |
| mustache-4.1.pkg | 2025-08-13 22:59 | 71K | |
| mutagen-0.18.1_1.pkg | 2025-12-22 19:37 | 6.2M | |
| mutationpp-1.0.6.d2.pkg | 2025-08-22 17:36 | 592K | |
| mutt-2.2.16.pkg | 2025-12-19 20:34 | 1.8M | |
| mutt_vc_query-002_1.pkg | 2025-08-22 02:50 | 7.9K | |
| mutter-47.10.pkg | 2025-12-26 20:04 | 2.2M | |
| muttprint-0.73_7.pkg | 2025-12-28 03:57 | 1.6M | |
| mvdsv-1.11,2.pkg | 2025-12-20 02:41 | 319K | |
| mvfst-2025.12.15.00.pkg | 2025-12-27 00:58 | 1.4M | |
| mxascii-1.1.pkg | 2025-12-29 05:55 | 9.4K | |
| mxflib-1.0.1.pkg | 2025-08-17 23:05 | 1.8M | |
| mxico-1.0.1_3.pkg | 2025-08-21 05:37 | 46K | |
| mxkill-1.2.pkg | 2025-12-29 03:47 | 28K | |
| mxml-3.3.1.pkg | 2025-08-14 04:23 | 773K | |
| mxp-1.3_5.pkg | 2025-12-20 23:27 | 33K | |
| my-libreoffice-25.8...> | 2025-12-27 07:26 | 325K | |
| mybashburn-1.0.2_6.pkg | 2025-12-30 00:55 | 74K | |
| mybb-1.8.33.pkg | 2025-12-29 21:44 | 1.3M | |
| mybee-qt-25.02.1.pkg | 2025-12-30 04:53 | 2.0M | |
| mydumper-0.21.2.3.pkg | 2025-12-29 19:49 | 139K | |
| mygui-3.4.3_1.pkg | 2025-12-27 06:00 | 558K | |
| mygui-dummy-3.4.3_1.pkg | 2025-12-30 07:58 | 10K | |
| mygui-ogre-3.4.3_1.pkg | 2025-12-29 22:36 | 51K | |
| mygui-opengl-3.4.3_1..> | 2025-12-28 06:35 | 161K | |
| mymoon-1.2.a_5.pkg | 2025-08-20 17:44 | 5.1K | |
| mypaint-2.0.1_6.pkg | 2025-12-29 13:31 | 4.9M | |
| mypaint-brushes-1.3...> | 2025-08-13 21:33 | 1.3M | |
| mypaint-brushes2-2.0..> | 2025-08-15 17:46 | 1.4M | |
| myrddin-0.3.1_2.pkg | 2025-12-20 22:15 | 669K | |
| myrepos-1.20180726.pkg | 2025-12-24 07:31 | 30K | |
| myrescue-0.9.4_1.pkg | 2025-08-18 05:18 | 8.8K | |
| mysql++-3.3.0.pkg | 2025-12-20 01:56 | 177K | |
| mysql-connector-c++-..> | 2025-12-23 13:35 | 1.1M | |
| mysql-connector-j-9...> | 2025-12-27 22:33 | 2.4M | |
| mysql-connector-java..> | 2025-12-30 17:18 | 1.0M | |
| mysql-connector-odbc..> | 2025-12-30 18:50 | 2.1M | |
| mysql-connector-odbc..> | 2025-12-29 00:50 | 2.1M | |
| mysql-snmp-1.2.17_2.pkg | 2025-12-30 06:47 | 34K | |
| mysql2pgsql-1.2,1.pkg | 2025-12-21 19:39 | 14K | |
| mysql80-client-8.0.4..> | 2025-12-18 00:32 | 6.3M | |
| mysql80-server-8.0.4..> | 2025-12-18 01:15 | 25M | |
| mysql84-client-8.4.7..> | 2025-12-19 08:30 | 5.9M | |
| mysql84-server-8.4.7..> | 2025-12-20 21:53 | 26M | |
| mysql91-client-9.1.0..> | 2025-12-20 00:44 | 6.0M | |
| mysql91-server-9.1.0..> | 2025-12-21 04:58 | 27M | |
| mysql94-client-9.4.0..> | 2025-12-19 12:37 | 6.7M | |
| mysql94-server-9.4.0..> | 2025-12-24 05:54 | 29M | |
| mysqlbackup-2.8.pkg | 2025-12-23 18:04 | 16K | |
| mysqld_exporter-0.17..> | 2025-08-19 07:17 | 3.8M | |
| mysqldump-secure-0.1..> | 2025-12-21 22:36 | 33K | |
| mysqlphp2postgres-0...> | 2025-08-17 01:47 | 8.2K | |
| mysqlreport-3.5_4.pkg | 2025-12-20 08:45 | 38K | |
| mysqlsla-2.03_4.pkg | 2025-12-21 10:13 | 30K | |
| mysqltcl-3.052_3.pkg | 2025-12-22 07:20 | 26K | |
| mysqltuner-2.6.0.pkg | 2025-12-21 18:48 | 57K | |
| mytetra-1.44.183.pkg | 2025-12-30 05:48 | 2.0M | |
| mythes-1.2.4_7.pkg | 2025-12-18 17:16 | 10K | |
| mythplugin-mythweb-3..> | 2025-12-30 00:59 | 1.0M | |
| mytop-1.7_2.pkg | 2025-12-22 12:39 | 25K | |
| myxer-1.3.0_16.pkg | 2025-12-29 16:31 | 227K | |
| n2n-2.8_1.pkg | 2025-12-23 16:36 | 66K | |
| n98-magerun-1.98.0.pkg | 2025-12-30 08:31 | 4.2M | |
| nInvaders-0.1.1_1.pkg | 2025-08-21 18:19 | 21K | |
| naabu-2.3.7_1.pkg | 2025-12-22 18:26 | 8.5M | |
| naev-0.12.4_4.pkg | 2025-12-29 05:08 | 442M | |
| nagcon-0.0.32.pkg | 2025-08-21 05:53 | 15K | |
| nagios-3.5.1_12.pkg | 2025-12-27 12:34 | 1.0M | |
| nagios-certexp-plugi..> | 2025-12-21 03:20 | 3.2K | |
| nagios-check_bacula1..> | 2025-12-23 04:05 | 6.7K | |
| nagios-check_bacula1..> | 2025-12-20 08:46 | 6.7K | |
| nagios-check_clamav-..> | 2025-12-30 14:52 | 3.6K | |
| nagios-check_cpu_usa..> | 2025-08-17 07:59 | 1.8K | |
| nagios-check_dhcp.pl..> | 2025-12-20 21:25 | 2.5K | |
| nagios-check_email_d..> | 2025-12-22 16:24 | 33K | |
| nagios-check_hdd_hea..> | 2025-12-20 05:56 | 3.4K | |
| nagios-check_hp_blad..> | 2025-12-23 18:06 | 13K | |
| nagios-check_mysql_s..> | 2025-12-21 16:22 | 6.8K | |
| nagios-check_netsnmp..> | 2025-12-21 23:12 | 4.3K | |
| nagios-check_ports-0..> | 2025-08-19 17:05 | 4.1K | |
| nagios-check_postgre..> | 2025-12-24 04:22 | 140K | |
| nagios-check_postgre..> | 2025-12-20 05:35 | 2.6K | |
| nagios-check_puppet-..> | 2025-08-20 23:20 | 6.8K | |
| nagios-check_redis-0..> | 2025-12-20 08:47 | 1.7K | |
| nagios-check_relayd_..> | 2025-12-22 17:57 | 2.5K | |
| nagios-check_smartmo..> | 2025-12-21 22:36 | 3.8K | |
| nagios-check_tftp-1...> | 2025-12-22 05:24 | 8.1K | |
| nagios-check_zpools-..> | 2025-12-21 22:02 | 2.4K | |
| nagios-geom-1.3.pkg | 2025-12-22 21:17 | 2.1K | |
| nagios-monplugins-3...> | 2025-12-28 21:51 | 1.0M | |
| nagios-openldap-plug..> | 2025-12-20 23:17 | 13K | |
| nagios-pf-plugin-0.1..> | 2025-08-18 06:29 | 3.9K | |
| nagios-plugins-2.4.4..> | 2025-12-18 17:49 | 422K | |
| nagios-snmp-plugins-..> | 2025-12-30 06:35 | 15K | |
| nagios-snmp-plugins-..> | 2025-12-20 10:09 | 40K | |
| nagios-statd-3.12_3.pkg | 2025-12-21 23:42 | 12K | |
| nagios4-4.5.1,1.pkg | 2025-12-27 01:37 | 1.5M | |
| nagiosgraph-1.5.2_3.pkg | 2025-12-30 07:50 | 78K | |
| nagiosql-3.5.0.20241..> | 2025-12-27 22:40 | 871K | |
| nagnu-1.1.3_2.pkg | 2025-12-22 09:23 | 8.2K | |
| nagstamon-3.16.2_1.pkg | 2025-12-29 16:09 | 823K | |
| nagtail-0.0.31_1.pkg | 2025-08-19 00:37 | 13K | |
| nagvis-1.9.36.pkg | 2025-12-28 12:06 | 1.4M | |
| najitool-0.8.4_2.pkg | 2025-08-19 00:45 | 66K | |
| naludump-0.1.1_1.pkg | 2025-12-22 17:52 | 50K | |
| namazu2-2.0.21_3.pkg | 2025-12-19 03:32 | 386K | |
| namecoin-24.0_19,1.pkg | 2025-12-30 06:22 | 6.4M | |
| namecoin-daemon-24.0..> | 2025-12-22 04:13 | 4.0M | |
| namecoin-utils-24.0_..> | 2025-12-21 01:43 | 9.9M | |
| namefix-4.0.2_2.pkg | 2025-12-28 13:14 | 116K | |
| namesilo_ddns-2.3.1.pkg | 2025-12-23 17:21 | 3.3K | |
| nana-2.5_2.pkg | 2025-08-19 18:43 | 59K | |
| nano-8.7.pkg | 2025-12-20 00:34 | 669K | |
| nano-signal-slot-2.0..> | 2025-08-20 03:44 | 4.3K | |
| nanobind-2.4.0.pkg | 2025-08-14 22:33 | 128K | |
| nanoblogger-3.4.2_1.pkg | 2025-12-19 11:20 | 71K | |
| nanoblogger-extra-3...> | 2025-12-21 22:41 | 59K | |
| nanocoder-1.17.3.pkg | 2025-12-28 09:46 | 11M | |
| nanodbc-2.14.0.pkg | 2025-12-22 11:11 | 100K | |
| nanoflann-1.6.3.pkg | 2025-08-14 19:22 | 19K | |
| nanogui-g20220215_2.pkg | 2025-12-28 03:32 | 1.0M | |
| nanomsg-1.1.5_3.pkg | 2025-08-15 02:50 | 159K | |
| nanonote-1.4.1.pkg | 2025-12-29 02:25 | 70K | |
| nanopb-0.4.9.1.pkg | 2025-12-19 11:50 | 122K | |
| nanort-g20201207.pkg | 2025-08-17 00:48 | 17K | |
| nanosvg-20241219.pkg | 2025-08-14 22:53 | 27K | |
| nanovna-saver-0.5.3_..> | 2025-12-29 22:10 | 327K | |
| nant-0.92_4.pkg | 2025-12-24 07:12 | 1.2M | |
| narcissu2-1.1_3.pkg | 2025-12-29 08:02 | 269M | |
| narrowlink-0.2.6_13.pkg | 2025-12-27 20:25 | 2.7M | |
| nas-1.9.4_4.pkg | 2025-12-18 18:11 | 447K | |
| nasawash-0.50.pkg | 2025-08-16 08:08 | 7.6K | |
| nasm-2.16.03,2.pkg | 2025-08-10 21:10 | 590K | |
| nast-0.2.1.g20210616..> | 2025-08-21 13:02 | 55K | |
| nativefiledialog-ext..> | 2025-12-20 03:52 | 20K | |
| nats-nkeys-0.4.12_1.pkg | 2025-12-21 09:29 | 920K | |
| nats-nsc-2.12.0_4.pkg | 2025-12-20 18:23 | 4.2M | |
| nats-server-2.12.2_1..> | 2025-12-24 04:43 | 4.9M | |
| nats-streaming-serve..> | 2025-12-22 14:24 | 5.5M | |
| nats-surveyor-0.9.5_..> | 2025-12-22 10:15 | 4.8M | |
| nats-top-0.6.3_8.pkg | 2025-12-20 15:01 | 2.5M | |
| natscli-0.3.0_4.pkg | 2025-12-21 05:57 | 8.9M | |
| naturaldocs-1.52_2,1..> | 2025-12-22 14:00 | 280K | |
| nautilus-47.5.pkg | 2025-12-26 21:26 | 2.3M | |
| nautilus-python-4.0...> | 2025-12-29 11:57 | 9.1K | |
| nautilus-sendto-3.8...> | 2025-12-21 09:28 | 55K | |
| nauty-2.8.6_1,1.pkg | 2025-08-13 11:54 | 2.0M | |
| navi-2.24.0_8.pkg | 2025-12-29 08:49 | 1.0M | |
| navidrome-0.56.1_7.pkg | 2025-12-28 03:12 | 12M | |
| nawk-20121220_3.pkg | 2025-08-22 22:25 | 61K | |
| nazghul-0.7.1_5.pkg | 2025-12-30 17:52 | 6.6M | |
| nb-aspell-0.50.1.0_1..> | 2025-12-21 12:55 | 3.1M | |
| nb-libreoffice-25.8...> | 2025-12-27 09:45 | 3.3M | |
| nbd-client-kmod-g202..> | 2025-12-21 05:35 | 32K | |
| nbd-server-3.24_1,1.pkg | 2025-12-23 00:53 | 52K | |
| nbdkit-1.46.0.pkg | 2025-12-30 17:54 | 767K | |
| nbench-2.2.3.pkg | 2025-08-18 23:21 | 300K | |
| nbfc-0.1_1.pkg | 2025-08-22 04:08 | 14K | |
| nbosd-0.5.0_7.pkg | 2025-08-17 10:11 | 5.9K | |
| nbsdgames-5.pkg | 2025-08-17 21:37 | 109K | |
| nbsmtp-1.00_4.pkg | 2025-08-21 09:44 | 15K | |
| nbtscan-1.7.2.pkg | 2025-08-15 04:29 | 15K | |
| nc-1.0.1_2.pkg | 2025-08-22 11:36 | 7.4K | |
| ncbi-blast+-2.17.0.pkg | 2025-12-20 01:49 | 237M | |
| ncbi-cxx-toolkit-29...> | 2025-12-23 10:36 | 35M | |
| ncbi-entrez-direct-1..> | 2025-12-19 04:45 | 2.1M | |
| ncbi-toolkit-2017.01..> | 2025-12-29 05:43 | 101M | |
| ncc-2.8_4.pkg | 2025-12-24 07:37 | 110K | |
| ncdc-1.24.1.pkg | 2025-12-23 14:21 | 185K | |
| ncdu-1.22.pkg | 2025-08-22 06:43 | 42K | |
| ncdu2-2.9.2.pkg | 2025-12-23 17:36 | 311K | |
| ncftp-3.2.6_3.pkg | 2025-08-19 04:14 | 309K | |
| ncgopher-0.4.0_17.pkg | 2025-12-29 17:36 | 1.1M | |
| nchat-5.11.32.pkg | 2025-12-22 05:22 | 9.1M | |
| ncmpc-0.51_2.pkg | 2025-12-21 07:53 | 394K | |
| ncmpcpp-0.10.1_5.pkg | 2025-12-24 04:32 | 687K | |
| ncnf-3.0.1_5.pkg | 2025-08-20 15:20 | 90K | |
| ncnn-20250503.pkg | 2025-08-17 07:37 | 12M | |
| ncp-1.2.4_1.pkg | 2025-08-19 18:38 | 21K | |
| ncpamixer-1.3.9.pkg | 2025-12-29 19:02 | 37K | |
| ncrack-0.7_2.pkg | 2025-08-20 06:36 | 645K | |
| ncrypt-0.8.1_1.pkg | 2025-08-19 06:23 | 44K | |
| ncrystal-4.2.8.pkg | 2025-08-19 14:13 | 1.8M | |
| ncspot-1.3.2_1.pkg | 2025-12-30 08:42 | 3.8M | |
| ncurses-6.5.pkg | 2025-08-13 19:17 | 1.2M | |
| ndiff-2.00_5.pkg | 2025-08-17 09:52 | 74K | |
| ndisc6-1.0.8.pkg | 2025-12-23 23:46 | 64K | |
| ndmpd-1.2_1.pkg | 2025-08-16 08:18 | 68K | |
| ndoutils-2.1.5.pkg | 2025-12-27 22:14 | 1.5M | |
| ndpi-4.14.d20250609,..> | 2025-12-27 17:07 | 1.5M | |
| ndpmon-1.4.0_10.pkg | 2025-12-20 10:30 | 27K | |
| ndproxy-3.2.1403000_..> | 2025-08-19 20:41 | 13K | |
| nds-aspell-0.01.0_1,..> | 2025-12-22 10:40 | 37K | |
| ne-3.3.3_1.pkg | 2025-08-18 12:07 | 792K | |
| ne-libreoffice-25.8...> | 2025-12-27 17:27 | 3.0M | |
| neXtaw-0.15.1_5.pkg | 2025-08-15 15:54 | 281K | |
| neatvnc-0.9.5_2.pkg | 2025-12-27 02:15 | 77K | |
| nebula-1.8.2_18.pkg | 2025-12-20 19:05 | 5.6M | |
| nec2c-1.3.3.pkg | 2025-08-17 13:35 | 106K | |
| nedit-5.7_1.pkg | 2025-12-30 10:02 | 499K | |
| nehquake-1.0_9.pkg | 2025-12-21 05:07 | 305K | |
| nemesis-1.8.5_2,1.pkg | 2025-08-18 09:06 | 58K | |
| nemo-6.4.5_3.pkg | 2025-12-27 09:44 | 1.1M | |
| nemu-3.4.0.pkg | 2025-12-23 05:58 | 94K | |
| nenscript-1.13.3_1.pkg | 2025-08-22 13:12 | 17K | |
| neo-0.6.1.pkg | 2025-08-19 21:49 | 30K | |
| neo-cowsay-2.0.4_32.pkg | 2025-12-22 16:15 | 1.1M | |
| neo4j-4.4.44_1.pkg | 2025-12-29 03:54 | 117M | |
| neochat-25.12.0.pkg | 2025-12-28 23:51 | 2.8M | |
| neocmakelsp-0.9.0.pkg | 2025-12-21 06:24 | 1.6M | |
| neofetch-7.1.0_1.pkg | 2025-12-20 10:58 | 81K | |
| neolink-0.3.0_39.pkg | 2025-12-28 23:29 | 815K | |
| neomutt-20250905.pkg | 2025-12-23 10:46 | 1.7M | |
| neon-0.34.0_1.pkg | 2025-12-18 10:15 | 213K | |
| neovim-0.11.5.pkg | 2025-12-19 11:16 | 7.7M | |
| neovim-gtk-1.0.4_25.pkg | 2025-12-30 14:45 | 1.0M | |
| neovim-qt-0.2.19.pkg | 2025-12-29 10:06 | 784K | |
| nerd-fonts-3.3.0.pkg | 2025-12-27 11:16 | 918M | |
| nerdctl-2.2.0_1.pkg | 2025-12-20 11:01 | 8.5M | |
| nerdlog-1.10.0_7.pkg | 2025-12-22 04:58 | 2.3M | |
| nesasm-20040314_1.pkg | 2025-08-18 01:09 | 59K | |
| nest-3.8_5.pkg | 2025-12-21 20:34 | 13M | |
| nestopia-1.53.2.pkg | 2025-12-27 20:08 | 878K | |
| net-snmp-5.9.4_6,1.pkg | 2025-12-26 19:06 | 2.4M | |
| netatalk4-4.3.2.pkg | 2025-12-22 08:38 | 472K | |
| netbeans-17.pkg | 2025-12-28 04:13 | 385M | |
| netbird-0.60.9.pkg | 2025-12-29 12:19 | 8.7M | |
| netbox-4.4.8.pkg | 2025-12-30 15:09 | 14M | |
| netcat-1.10_4.pkg | 2025-08-17 23:15 | 459K | |
| netcdf-4.9.3.pkg | 2025-12-26 06:36 | 1.1M | |
| netcdf-cxx-4.3.1_3.pkg | 2025-12-27 13:19 | 178K | |
| netcdf-fortran-4.6.2..> | 2025-12-27 01:17 | 328K | |
| netdata-2.8.4.pkg | 2025-12-29 04:25 | 40M | |
| netdata-go-0.58.1_9.pkg | 2025-08-17 10:58 | 13M | |
| netdisco-mibs-4.034.pkg | 2025-08-18 17:35 | 39M | |
| netdiscover-0.21.pkg | 2025-12-21 23:42 | 477K | |
| netdumpd-20220406_1.pkg | 2025-08-22 14:56 | 19K | |
| netease-music-tui-0...> | 2025-12-29 22:12 | 1.6M | |
| netembryo-0.1.1_2.pkg | 2025-12-22 17:04 | 18K | |
| netevent-0.2.1.79_3.pkg | 2025-08-22 16:12 | 49K | |
| netgen-6.2.2505.pkg | 2025-12-30 16:32 | 3.2M | |
| netgen-lvs-1.5.305.pkg | 2025-12-27 03:36 | 240K | |
| nethack32-3.2.3_8.pkg | 2025-12-20 21:04 | 897K | |
| nethack33-3.3.1_12.pkg | 2025-12-20 20:47 | 1.1M | |
| nethack33-nox11-3.3...> | 2025-08-19 11:12 | 1.0M | |
| nethack34-3.4.3_10.pkg | 2025-12-20 15:34 | 1.2M | |
| nethack34-nox11-3.4...> | 2025-08-17 11:12 | 1.1M | |
| nethack36-3.6.7_1.pkg | 2025-12-22 07:59 | 1.7M | |
| nethack36-nox11-3.6...> | 2025-08-19 00:49 | 1.7M | |
| netherearth-0.51_12.pkg | 2025-12-23 12:47 | 294K | |
| nethogs-0.8.8.pkg | 2025-08-18 00:09 | 30K | |
| netio-1.33.pkg | 2025-08-22 13:30 | 12K | |
| netleak-0.1a_3.pkg | 2025-12-20 10:11 | 14K | |
| netmagis-common-2.3...> | 2025-12-19 17:27 | 119K | |
| netmagis-database-2...> | 2025-12-22 10:04 | 44K | |
| netmagis-detecteq-2...> | 2025-12-22 07:39 | 5.3K | |
| netmagis-metro-2.3.6..> | 2025-12-30 09:46 | 52K | |
| netmagis-servers-2.3..> | 2025-12-21 13:11 | 11K | |
| netmagis-topo-2.3.6_..> | 2025-12-23 19:43 | 189K | |
| netmagis-utils-2.3.6..> | 2025-12-21 08:23 | 4.9K | |
| netmagis-www-2.3.6_1..> | 2025-12-29 14:34 | 195K | |
| netmap-0.1.3_2.pkg | 2025-12-27 21:30 | 39K | |
| netmask-2.4_3.pkg | 2025-08-16 17:45 | 7.6K | |
| netpbm-11.04.02_2.pkg | 2025-12-26 18:52 | 1.3M | |
| netpeek-0.2.6.pkg | 2025-12-28 18:08 | 197K | |
| netperf-2.7.1.p20210..> | 2025-08-18 10:34 | 194K | |
| netperfmeter-1.9.7.pkg | 2025-08-16 21:44 | 122K | |
| netpipes-4.2_1.pkg | 2025-08-17 02:41 | 50K | |
| netqmail-1.06_7.pkg | 2025-08-13 21:34 | 255K | |
| netqmail-mysql-1.06...> | 2025-12-20 10:43 | 265K | |
| netqmail-tls-1.06.20..> | 2025-08-22 02:49 | 269K | |
| netradiant-20150621_..> | 2025-12-29 17:32 | 1.9M | |
| netrek-BRMH-2.2.2_2.pkg | 2025-08-20 04:06 | 277K | |
| netrek-client-cow-3...> | 2025-12-29 01:13 | 1.1M | |
| netrik-1.16.1_1.pkg | 2025-12-22 06:24 | 159K | |
| netron-4.1.9_1.pkg | 2025-12-21 05:58 | 938K | |
| netscript-1.7.1_4.pkg | 2025-08-20 17:47 | 51K | |
| netsed-1.4.pkg | 2025-08-19 13:47 | 13K | |
| netselect-0.4_1.pkg | 2025-08-22 11:53 | 12K | |
| netspoc-3.2_1.pkg | 2025-12-20 15:30 | 183K | |
| netstiff-20080331_1.pkg | 2025-12-20 07:52 | 19K | |
| netstrain-3.0.pkg | 2025-08-16 14:26 | 10K | |
| netsurf-3.11_2.pkg | 2025-12-27 19:57 | 1.2M | |
| netsurf-buildsystem-..> | 2025-12-18 11:32 | 14K | |
| nettle-3.10.2.pkg | 2025-08-10 21:36 | 1.6M | |
| nettoe-1.5.1_2.pkg | 2025-08-19 17:51 | 22K | |
| netty-4.1.53.pkg | 2025-08-15 21:49 | 12M | |
| netwalk-0.4.11_3.pkg | 2025-12-29 01:20 | 73K | |
| netwib-5.38.0_3.pkg | 2025-08-18 21:45 | 337K | |
| networkmanager-shim-..> | 2025-12-18 23:16 | 92K | |
| networkmgr-6.7_1.pkg | 2025-12-30 04:06 | 1.2M | |
| netxms-3.9.420.pkg | 2025-12-21 03:14 | 1.1M | |
| neuralrack-lv2-0.2.0..> | 2025-12-27 21:27 | 855K | |
| nevada-toolset-g2020..> | 2025-08-20 10:17 | 209K | |
| neverball-1.6.0_4.pkg | 2025-12-29 10:05 | 55M | |
| newfile-1.0.14_7.pkg | 2025-12-21 12:55 | 39K | |
| newlisp-10.7.5_4.pkg | 2025-12-22 18:16 | 704K | |
| newmat-1.1_1.pkg | 2025-08-17 11:16 | 252K | |
| newsboat-2.41_2.pkg | 2025-12-30 16:35 | 1.8M | |
| newsfetch-1.21_3.pkg | 2025-08-21 10:59 | 12K | |
| newsfish-1.2.6_1.pkg | 2025-08-21 10:59 | 20K | |
| newsgrab-0.4.0_1.pkg | 2025-12-24 04:21 | 12K | |
| newspost-2.1.1_2.pkg | 2025-08-16 14:08 | 39K | |
| newsraft-0.34.pkg | 2025-12-23 14:18 | 124K | |
| newsstar-1.5.6_5.pkg | 2025-12-22 16:43 | 89K | |
| newsx-1.6_5.pkg | 2025-12-29 13:54 | 89K | |
| newt-0.52.25.pkg | 2025-12-26 15:55 | 101K | |
| newtonsoft-json-9.0...> | 2025-12-20 02:11 | 252K | |
| newvox-1.0_8.pkg | 2025-12-22 03:58 | 5.4K | |
| nexfontsel-3.1.pkg | 2025-12-23 19:27 | 24K | |
| nextcloud-appointmen..> | 2025-12-29 08:44 | 1.5M | |
| nextcloud-appointmen..> | 2025-12-29 10:34 | 1.5M | |
| nextcloud-appointmen..> | 2025-12-29 15:25 | 1.5M | |
| nextcloud-appointmen..> | 2025-12-30 00:04 | 1.5M | |
| nextcloud-appointmen..> | 2025-12-28 12:22 | 1.5M | |
| nextcloud-calendar-p..> | 2025-12-28 18:54 | 13M | |
| nextcloud-calendar-p..> | 2025-12-28 10:02 | 13M | |
| nextcloud-calendar-p..> | 2025-12-30 05:08 | 13M | |
| nextcloud-calendar-p..> | 2025-12-27 20:48 | 13M | |
| nextcloud-calendar-p..> | 2025-12-30 10:11 | 13M | |
| nextcloud-contacts-p..> | 2025-12-29 16:31 | 3.3M | |
| nextcloud-contacts-p..> | 2025-12-27 19:47 | 3.3M | |
| nextcloud-contacts-p..> | 2025-12-28 11:46 | 3.3M | |
| nextcloud-contacts-p..> | 2025-12-29 08:57 | 3.3M | |
| nextcloud-contacts-p..> | 2025-12-29 18:52 | 3.3M | |
| nextcloud-cospend-ph..> | 2025-12-29 22:21 | 3.3M | |
| nextcloud-cospend-ph..> | 2025-12-29 11:02 | 3.3M | |
| nextcloud-cospend-ph..> | 2025-12-30 06:41 | 3.3M | |
| nextcloud-cospend-ph..> | 2025-12-29 18:27 | 3.3M | |
| nextcloud-cospend-ph..> | 2025-12-28 19:13 | 3.3M | |
| nextcloud-deck-php81..> | 2025-12-29 06:13 | 9.5M | |
| nextcloud-deck-php82..> | 2025-12-30 08:08 | 9.5M | |
| nextcloud-deck-php83..> | 2025-12-30 04:06 | 9.5M | |
| nextcloud-deck-php84..> | 2025-12-30 00:51 | 9.5M | |
| nextcloud-deck-php85..> | 2025-12-28 19:36 | 9.5M | |
| nextcloud-end_to_end..> | 2025-12-28 09:52 | 1.4M | |
| nextcloud-end_to_end..> | 2025-12-28 06:12 | 1.4M | |
| nextcloud-end_to_end..> | 2025-12-30 10:08 | 1.4M | |
| nextcloud-end_to_end..> | 2025-12-28 12:27 | 1.4M | |
| nextcloud-end_to_end..> | 2025-12-27 20:28 | 1.4M | |
| nextcloud-forms-php8..> | 2025-12-29 09:16 | 3.7M | |
| nextcloud-forms-php8..> | 2025-12-28 12:23 | 3.7M | |
| nextcloud-forms-php8..> | 2025-12-29 19:57 | 3.7M | |
| nextcloud-forms-php8..> | 2025-12-29 04:12 | 3.7M | |
| nextcloud-forms-php8..> | 2025-12-29 11:32 | 3.7M | |
| nextcloud-groupfolde..> | 2025-12-29 15:40 | 3.9M | |
| nextcloud-groupfolde..> | 2025-12-28 09:51 | 3.9M | |
| nextcloud-groupfolde..> | 2025-12-29 06:48 | 3.9M | |
| nextcloud-groupfolde..> | 2025-12-30 00:01 | 3.9M | |
| nextcloud-groupfolde..> | 2025-12-28 00:27 | 3.9M | |
| nextcloud-mail-php81..> | 2025-12-28 13:10 | 12M | |
| nextcloud-mail-php82..> | 2025-12-28 21:01 | 12M | |
| nextcloud-mail-php83..> | 2025-12-29 20:12 | 12M | |
| nextcloud-mail-php84..> | 2025-12-28 21:38 | 12M | |
| nextcloud-mail-php85..> | 2025-12-29 00:19 | 12M | |
| nextcloud-news-php81..> | 2025-12-29 20:18 | 2.1M | |
| nextcloud-news-php82..> | 2025-12-29 23:43 | 2.1M | |
| nextcloud-news-php83..> | 2025-12-30 02:40 | 2.1M | |
| nextcloud-news-php84..> | 2025-12-30 02:39 | 2.1M | |
| nextcloud-news-php85..> | 2025-12-30 12:17 | 2.1M | |
| nextcloud-notes-php8..> | 2025-12-29 00:38 | 3.4M | |
| nextcloud-notes-php8..> | 2025-12-28 10:19 | 3.4M | |
| nextcloud-notes-php8..> | 2025-12-29 18:52 | 3.4M | |
| nextcloud-notes-php8..> | 2025-12-27 21:38 | 3.4M | |
| nextcloud-notes-php8..> | 2025-12-28 05:21 | 3.4M | |
| nextcloud-passman-ph..> | 2025-12-27 20:37 | 1.7M | |
| nextcloud-passman-ph..> | 2025-12-28 00:53 | 1.7M | |
| nextcloud-passman-ph..> | 2025-12-29 13:18 | 1.7M | |
| nextcloud-passman-ph..> | 2025-12-28 12:39 | 1.7M | |
| nextcloud-passman-ph..> | 2025-12-28 02:50 | 1.7M | |
| nextcloud-php81-32.0..> | 2025-12-27 18:15 | 214M | |
| nextcloud-php82-32.0..> | 2025-12-27 17:56 | 214M | |
| nextcloud-php83-32.0..> | 2025-12-27 09:34 | 214M | |
| nextcloud-php84-32.0..> | 2025-12-27 10:08 | 214M | |
| nextcloud-php85-32.0..> | 2025-12-27 12:42 | 214M | |
| nextcloud-spreed-sig..> | 2025-12-21 11:57 | 13M | |
| nextcloud-talk-php81..> | 2025-12-28 10:19 | 38M | |
| nextcloud-talk-php82..> | 2025-12-28 21:37 | 38M | |
| nextcloud-talk-php83..> | 2025-12-29 16:07 | 38M | |
| nextcloud-talk-php84..> | 2025-12-28 12:16 | 38M | |
| nextcloud-talk-php85..> | 2025-12-29 13:08 | 38M | |
| nextcloud-tasks-php8..> | 2025-12-29 15:48 | 2.1M | |
| nextcloud-tasks-php8..> | 2025-12-30 09:04 | 2.1M | |
| nextcloud-tasks-php8..> | 2025-12-28 09:29 | 2.1M | |
| nextcloud-tasks-php8..> | 2025-12-30 18:53 | 2.1M | |
| nextcloud-tasks-php8..> | 2025-12-30 18:31 | 2.1M | |
| nextcloud-twofactor_..> | 2025-12-28 07:43 | 351K | |
| nextcloud-twofactor_..> | 2025-12-29 18:07 | 351K | |
| nextcloud-twofactor_..> | 2025-12-29 23:01 | 351K | |
| nextcloud-twofactor_..> | 2025-12-29 23:23 | 351K | |
| nextcloud-twofactor_..> | 2025-12-28 15:35 | 351K | |
| nextcloud-twofactor_..> | 2025-12-29 22:26 | 9.5M | |
| nextcloud-twofactor_..> | 2025-12-29 00:25 | 9.5M | |
| nextcloud-twofactor_..> | 2025-12-28 14:19 | 9.5M | |
| nextcloud-twofactor_..> | 2025-12-30 07:20 | 9.5M | |
| nextcloud-twofactor_..> | 2025-12-27 22:36 | 9.5M | |
| nextcloudclient-4.0...> | 2025-12-29 23:59 | 4.8M | |
| nextdns-1.42.0_18.pkg | 2025-12-23 03:42 | 2.7M | |
| nextest-0.9.115_1.pkg | 2025-12-29 19:59 | 7.1M | |
| nextgo-3.0_12.pkg | 2025-12-27 02:40 | 127K | |
| nextpnr-0.9_1,1.pkg | 2025-12-30 10:33 | 51M | |
| nexuiz-2.5.2_21.pkg | 2025-12-30 02:26 | 879M | |
| nexus2-oss-2.15.1_1.pkg | 2025-12-28 16:56 | 81M | |
| nezd-0.1.0_1.pkg | 2025-12-28 06:09 | 27K | |
| nfcutils-0.1.2_1.pkg | 2025-12-21 22:56 | 5.1K | |
| nfdump-1.7.6.pkg | 2025-12-27 08:54 | 546K | |
| nfft-3.5.3_1.pkg | 2025-08-21 07:43 | 2.3M | |
| nflib-1.0.0.23_4.pkg | 2025-08-17 06:07 | 85K | |
| nfpm-2.44.0_1.pkg | 2025-12-21 07:14 | 4.5M | |
| nfs-exporter-0.4.5_2..> | 2025-12-30 02:49 | 765K | |
| nfsen-1.3.11.pkg | 2025-12-30 06:45 | 163K | |
| nfsshell-20130510_4.pkg | 2025-12-23 18:08 | 24K | |
| nfstrace-0.4.3.2_2.pkg | 2025-08-20 22:01 | 278K | |
| nfy-0.2.pkg | 2025-12-29 17:14 | 5.5K | |
| ng_ipacct-20210316.1..> | 2025-12-23 04:55 | 21K | |
| ng_mikrotik_eoip-1.0..> | 2025-08-20 11:57 | 3.3K | |
| ngbuddy-1.0.pkg | 2025-08-19 10:36 | 9.9K | |
| nget-0.27.1_8.pkg | 2025-08-16 01:01 | 253K | |
| nghttp2-1.68.0.pkg | 2025-12-20 00:01 | 611K | |
| nginx-1.28.0_8,3.pkg | 2025-12-19 04:39 | 567K | |
| nginx-devel-1.29.3_2..> | 2025-12-19 20:28 | 572K | |
| nginx-devel-acme-0.1..> | 2025-12-30 17:54 | 407K | |
| nginx-full-1.28.0_8,..> | 2025-12-28 10:34 | 13M | |
| nginx-lite-1.28.0_8,..> | 2025-12-23 08:49 | 372K | |
| nginx-naxsi-1.28.0_8..> | 2025-12-20 16:22 | 611K | |
| nginx-prometheus-exp..> | 2025-12-22 20:43 | 3.9M | |
| nginx-ui-2.3.2.pkg | 2025-12-28 04:50 | 32M | |
| nginx-ultimate-bad-b..> | 2025-12-21 16:07 | 11K | |
| nginx-vts-exporter-0..> | 2025-12-21 03:52 | 3.0M | |
| ngircd-27_1,1.pkg | 2025-08-19 00:09 | 184K | |
| ngraph-6.3.54_1.pkg | 2025-12-30 05:44 | 949K | |
| ngrep-1.48.3.pkg | 2025-12-30 02:16 | 30K | |
| ngrok-2.2.8_1.pkg | 2025-08-18 04:10 | 3.0M | |
| ngs-sdk-3.0.1.pkg | 2025-08-19 13:36 | 92K | |
| ngspice_rework-44.2.pkg | 2025-12-27 09:42 | 2.1M | |
| ngspice_rework-shlib..> | 2025-12-19 02:06 | 2.3M | |
| nheko-0.12.0_3.pkg | 2025-12-27 20:56 | 3.1M | |
| nickle-2.97_1.pkg | 2025-12-22 23:19 | 395K | |
| nifmon-1.4_1.pkg | 2025-08-18 12:52 | 12K | |
| nift-3.0.3_2.pkg | 2025-12-23 15:45 | 1.0M | |
| nifticlib-2.0.0_2.pkg | 2025-08-14 21:58 | 237K | |
| nightfall-1.92_6.pkg | 2025-12-29 13:18 | 442K | |
| nighthawk-3.0.0_7.pkg | 2025-08-18 15:17 | 625K | |
| nikto-2.1.6_1,1.pkg | 2025-12-21 10:02 | 350K | |
| nim-2.2.6.pkg | 2025-12-18 19:04 | 7.2M | |
| nimble-0.20.0.pkg | 2025-12-19 09:53 | 771K | |
| nimuh-1.02_12.pkg | 2025-12-29 07:40 | 47M | |
| nini-1.1.0_3.pkg | 2025-12-19 04:17 | 343K | |
| ninix-aya-5.0.9.pkg | 2025-12-30 09:34 | 237K | |
| ninja-1.13.2,4.pkg | 2025-12-24 20:07 | 135K | |
| nip2-8.7.1_16.pkg | 2025-12-29 16:12 | 3.7M | |
| niri-25.11_1.pkg | 2025-12-28 18:52 | 5.6M | |
| nist-kat-0.0.2015.02..> | 2025-08-21 01:57 | 13M | |
| nitpicker-1.2.1,1.pkg | 2025-08-19 11:18 | 14K | |
| nitro-0.3.pkg | 2025-12-22 19:19 | 19K | |
| nitrogen-1.6.1_6.pkg | 2025-12-27 10:29 | 153K | |
| nitrokey-app-1.4.2_1..> | 2025-12-29 07:17 | 389K | |
| nitroshare-0.3.4.642..> | 2025-12-28 11:34 | 295K | |
| njam-1.25_12.pkg | 2025-12-29 22:35 | 1.3M | |
| njs-0.9.4.pkg | 2025-12-21 11:41 | 354K | |
| nl-aspell-0.50.2_1,1..> | 2025-12-22 17:59 | 1.5M | |
| nl-freebsd-doc-20251..> | 2025-12-19 16:31 | 6.6M | |
| nl-hunspell-2.20.23.pkg | 2025-12-28 20:10 | 694K | |
| nl-hyphen-2005.10.16..> | 2025-08-19 09:48 | 49K | |
| nl-libreoffice-25.8...> | 2025-12-27 02:38 | 3.5M | |
| nl-mythes-2015.12.10..> | 2025-08-20 01:23 | 816K | |
| nlarn-0.7.6.pkg | 2025-12-24 05:00 | 257K | |
| nlcglib-1.1.0_3.pkg | 2025-12-27 20:29 | 282K | |
| nll-20250805a.pkg | 2025-12-30 02:46 | 155K | |
| nll-nosdl-20250805a.pkg | 2025-12-23 16:21 | 153K | |
| nll-sdl1-20250805a.pkg | 2025-12-21 21:13 | 155K | |
| nload-0.7.4_2.pkg | 2025-08-16 17:02 | 49K | |
| nlohmann-json-3.12.0..> | 2025-08-13 04:09 | 115K | |
| nlopt-2.10.0_1.pkg | 2025-12-26 11:48 | 411K | |
| nlopt-minimal-2.10.0..> | 2025-12-19 13:58 | 287K | |
| nmap-7.94_3.pkg | 2025-08-11 00:10 | 5.9M | |
| nmap-devel-7.95.2025..> | 2025-12-22 03:41 | 6.3M | |
| nmdaemon-0.2.pkg | 2025-08-20 09:19 | 263K | |
| nmealib-0.5.3.pkg | 2025-08-21 02:58 | 21K | |
| nmh-1.8.pkg | 2025-12-19 12:10 | 1.2M | |
| nmh-devel-2025.08.24..> | 2025-12-21 18:53 | 1.2M | |
| nmrpflash-0.9.25.pkg | 2025-08-21 14:33 | 22K | |
| nms-1.0.1,1.pkg | 2025-08-18 04:00 | 11K | |
| nmsg-1.3.3.pkg | 2025-12-18 23:24 | 444K | |
| nn-6.7.3_3.pkg | 2025-08-18 14:45 | 323K | |
| nn-aspell-0.50.1.1_1..> | 2025-12-20 10:04 | 2.0M | |
| nn-insight-1.0.7_16.pkg | 2025-12-28 07:45 | 959K | |
| nn-libreoffice-25.8...> | 2025-12-27 12:46 | 3.3M | |
| nnap-1.1.pkg | 2025-08-22 16:55 | 5.3K | |
| nncp-8.13.0_4.pkg | 2025-12-20 06:10 | 4.2M | |
| nng-1.11.pkg | 2025-08-14 05:27 | 198K | |
| nnn-5.1.pkg | 2025-12-23 23:38 | 124K | |
| nntp-1.5.12.2_14.pkg | 2025-08-17 01:11 | 105K | |
| noaa-apt-1.4.1_17.pkg | 2025-12-30 07:14 | 1.6M | |
| noattach-1.2_5.pkg | 2025-08-22 00:54 | 18K | |
| nocc-1.9.13.pkg | 2025-12-29 12:20 | 877K | |
| node-24.12.0_3.pkg | 2025-12-25 00:27 | 652 | |
| node-sqlcipher-2.4.4..> | 2025-12-19 07:25 | 934K | |
| node-thrift-0.22.0_1..> | 2025-12-30 09:45 | 63K | |
| node20-20.19.6_1.pkg | 2025-12-26 19:04 | 9.7M | |
| node22-22.21.1.pkg | 2025-12-24 23:41 | 13M | |
| node24-24.12.0.pkg | 2025-12-25 00:19 | 12M | |
| node25-25.2.1_1.pkg | 2025-12-27 11:12 | 12M | |
| node_exporter-1.9.1_..> | 2025-12-23 16:28 | 4.3M | |
| nodeeditor-3.0.11.pkg | 2025-12-29 19:32 | 119K | |
| noffle-1.1.5_4.pkg | 2025-12-20 05:59 | 94K | |
| noip-2.1.9_5.pkg | 2025-08-18 10:00 | 30K | |
| noise-repellent-lv2-..> | 2025-08-19 02:59 | 9.3K | |
| noise-suppression-fo..> | 2025-12-29 10:02 | 14M | |
| nologinmsg-1.0_2.pkg | 2025-08-21 03:03 | 4.3K | |
| nomacs-3.16_12.pkg | 2025-12-28 16:14 | 2.0M | |
| nomad-1.9.6_1.pkg | 2025-12-18 23:36 | 21M | |
| nomad-driver-podman-..> | 2025-12-20 15:05 | 7.0M | |
| nomad-pot-driver-0.1..> | 2025-12-27 02:47 | 4.3M | |
| nomadnet-0.8.0_1.pkg | 2025-12-27 23:43 | 321K | |
| nomarch-1.4.pkg | 2025-08-22 19:14 | 22K | |
| nomyso-4.3.pkg | 2025-12-23 20:06 | 19K | |
| nonsense-0.6_3.pkg | 2025-08-18 05:30 | 101K | |
| nordic-theme-2.2.0.pkg | 2025-08-18 00:05 | 4.5M | |
| norm-1.5r6_3.pkg | 2025-08-13 03:42 | 247K | |
| normalize-0.7.7_12.pkg | 2025-12-19 18:10 | 47K | |
| normalizemime-1.19_1..> | 2025-08-16 18:39 | 30K | |
| normcap-0.5.8_1.pkg | 2025-12-29 13:59 | 3.9M | |
| nosefart-1.92f_1.pkg | 2025-08-22 19:06 | 40K | |
| noson-2.12.10.pkg | 2025-08-14 16:39 | 356K | |
| noson-app-5.6.13.pkg | 2025-12-29 23:27 | 957K | |
| nosqlbench-0.0.20151..> | 2025-08-19 03:09 | 325K | |
| nostromo-1.9.6_1.pkg | 2025-08-17 05:17 | 36K | |
| nostt-1.1.1_2.pkg | 2025-12-23 16:25 | 9.8K | |
| notcurses-3.0.16_1.pkg | 2025-12-27 07:25 | 6.4M | |
| notekit-0.2.0_2.pkg | 2025-12-29 15:40 | 202K | |
| notepadnext-0.12.pkg | 2025-12-29 17:28 | 1.6M | |
| notepadnext-devel-20..> | 2025-12-28 12:00 | 1.6M | |
| notes-2.1.0.pkg | 2025-12-30 08:15 | 2.3M | |
| noti-3.8.0_9.pkg | 2025-12-27 22:45 | 3.3M | |
| notification-daemon-..> | 2025-12-27 15:47 | 47K | |
| notify-osd-0.9.34_5.pkg | 2025-12-27 17:01 | 110K | |
| notify-sharp-3.0.3_2..> | 2025-12-30 12:35 | 13K | |
| notion-4.0.3.pkg | 2025-12-24 04:15 | 410K | |
| notmuch-0.39_1.pkg | 2025-12-18 23:31 | 230K | |
| notmuch-emacs-0.39_7..> | 2025-12-29 05:21 | 233K | |
| notmuch-emacs_canna-..> | 2025-12-28 09:32 | 233K | |
| notmuch-emacs_devel-..> | 2025-12-28 04:55 | 233K | |
| notmuch-emacs_devel_..> | 2025-12-23 01:34 | 233K | |
| notmuch-emacs_nox-0...> | 2025-12-23 16:14 | 233K | |
| notmuch-emacs_waylan..> | 2025-12-30 03:08 | 233K | |
| notmuch-mutt-0.39_1.pkg | 2025-12-28 02:59 | 7.3K | |
| noto-2.0.pkg | 2025-12-27 17:38 | 1.0K | |
| noto-basic-2.0_4.pkg | 2025-12-24 23:54 | 906 | |
| noto-emoji-2.051.pkg | 2025-12-26 19:50 | 9.2M | |
| noto-extra-2.0_7.pkg | 2025-12-26 21:22 | 1.2K | |
| noto-hk-2.004.pkg | 2025-12-26 21:42 | 810 | |
| noto-jp-2.004.pkg | 2025-12-26 21:48 | 801 | |
| noto-kr-2.004.pkg | 2025-12-27 01:25 | 802 | |
| noto-kufi-arabic-2.1..> | 2025-12-26 18:49 | 431K | |
| noto-music-2.003.pkg | 2025-12-26 18:42 | 44K | |
| noto-naskh-arabic-2...> | 2025-12-26 19:03 | 302K | |
| noto-naskh-arabic-ui..> | 2025-12-26 18:50 | 261K | |
| noto-sans-2.015.pkg | 2025-12-24 22:20 | 11M | |
| noto-sans-arabic-2.0..> | 2025-12-26 18:50 | 1.7M | |
| noto-sans-arabic-ui-..> | 2025-12-26 18:26 | 2.0M | |
| noto-sans-armenian-2..> | 2025-12-26 20:09 | 245K | |
| noto-sans-bengali-3...> | 2025-12-26 19:08 | 1.1M | |
| noto-sans-cham-2.005..> | 2025-12-26 19:08 | 88K | |
| noto-sans-cherokee-2..> | 2025-12-26 18:46 | 313K | |
| noto-sans-devanagari..> | 2025-12-26 18:52 | 3.1M | |
| noto-sans-ethiopic-2..> | 2025-12-26 18:35 | 1.9M | |
| noto-sans-georgian-2..> | 2025-12-26 19:13 | 520K | |
| noto-sans-hebrew-3.0..> | 2025-12-26 18:33 | 162K | |
| noto-sans-hk-2.004.pkg | 2025-12-26 18:44 | 132M | |
| noto-sans-jp-2.004.pkg | 2025-12-26 19:04 | 127M | |
| noto-sans-kannada-2...> | 2025-12-26 20:04 | 1.2M | |
| noto-sans-khmer-2.00..> | 2025-12-26 19:14 | 628K | |
| noto-sans-kr-2.004.pkg | 2025-12-26 19:14 | 126M | |
| noto-sans-lao-2.003.pkg | 2025-12-26 18:48 | 265K | |
| noto-sans-math-3.000..> | 2025-12-26 20:10 | 402K | |
| noto-sans-mono-2.014..> | 2025-12-24 22:20 | 4.8M | |
| noto-sans-myanmar-2...> | 2025-12-26 18:26 | 1.5M | |
| noto-sans-runic-2.00..> | 2025-12-26 19:02 | 6.5K | |
| noto-sans-sc-2.004.pkg | 2025-12-26 20:18 | 146M | |
| noto-sans-sign-writi..> | 2025-12-26 19:58 | 1.2M | |
| noto-sans-sinhala-3...> | 2025-12-26 18:08 | 4.1M | |
| noto-sans-symbols-2...> | 2025-12-24 22:20 | 567K | |
| noto-sans-symbols2-2..> | 2025-12-24 22:20 | 272K | |
| noto-sans-tamil-2.00..> | 2025-12-26 19:14 | 729K | |
| noto-sans-tc-2.004.pkg | 2025-12-26 20:16 | 132M | |
| noto-sans-telugu-2.0..> | 2025-12-26 18:27 | 2.5M | |
| noto-sans-thai-2.002..> | 2025-12-26 18:56 | 260K | |
| noto-sc-2.004.pkg | 2025-12-27 00:32 | 803 | |
| noto-serif-2.015.pkg | 2025-12-24 23:51 | 13M | |
| noto-serif-armenian-..> | 2025-12-26 18:35 | 270K | |
| noto-serif-bengali-3..> | 2025-12-26 20:19 | 2.3M | |
| noto-serif-devanagar..> | 2025-12-26 20:11 | 1.9M | |
| noto-serif-display-2..> | 2025-12-26 18:49 | 12M | |
| noto-serif-ethiopic-..> | 2025-12-26 19:59 | 2.4M | |
| noto-serif-georgian-..> | 2025-12-26 18:35 | 648K | |
| noto-serif-hebrew-2...> | 2025-12-26 20:06 | 224K | |
| noto-serif-hk-2.003.pkg | 2025-12-26 18:34 | 154M | |
| noto-serif-jp-2.003.pkg | 2025-12-26 19:29 | 146M | |
| noto-serif-kannada-2..> | 2025-12-26 18:50 | 377K | |
| noto-serif-khmer-2.0..> | 2025-12-26 17:57 | 938K | |
| noto-serif-kr-2.003.pkg | 2025-12-26 19:08 | 146M | |
| noto-serif-lao-2.003..> | 2025-12-26 18:28 | 321K | |
| noto-serif-myanmar-2..> | 2025-12-26 20:21 | 1.7M | |
| noto-serif-sc-2.003.pkg | 2025-12-26 19:30 | 173M | |
| noto-serif-sinhala-2..> | 2025-12-26 20:20 | 2.1M | |
| noto-serif-tamil-2.0..> | 2025-12-26 18:28 | 1.3M | |
| noto-serif-tc-2.003.pkg | 2025-12-26 20:09 | 154M | |
| noto-serif-telugu-2...> | 2025-12-26 19:38 | 588K | |
| noto-serif-thai-2.00..> | 2025-12-26 18:51 | 343K | |
| noto-tc-2.004.pkg | 2025-12-26 21:28 | 804 | |
| novelWriter-2.8.pkg | 2025-12-29 12:11 | 1.3M | |
| novnc-1.6.0.pkg | 2025-08-16 08:45 | 630K | |
| nox-2025.2.9.pkg | 2025-12-29 12:10 | 122K | |
| npadmin-0.8.7_2.pkg | 2025-08-16 11:33 | 54K | |
| npc-0.83.pkg | 2025-08-18 06:49 | 26K | |
| nplot-0.9.11_3.pkg | 2025-12-29 19:16 | 51K | |
| npm-11.7.0.pkg | 2025-12-26 10:49 | 580 | |
| npm-node12-11.7.0.pkg | 2025-12-28 16:15 | 583 | |
| npm-node20-11.7.0.pkg | 2025-12-26 20:28 | 2.2M | |
| npm-node22-11.7.0.pkg | 2025-12-24 23:41 | 2.2M | |
| npm-node24-11.7.0.pkg | 2025-12-26 09:25 | 2.2M | |
| npm-node25-11.7.0.pkg | 2025-12-29 04:40 | 2.2M | |
| npmount-0.1.1.3_1.pkg | 2025-12-27 07:26 | 6.0K | |
| npretty-0.9.3.1_5.pkg | 2025-12-30 03:04 | 32K | |
| npth-1.8.pkg | 2025-08-12 23:47 | 13K | |
| npush-0.7.pkg | 2025-08-17 01:20 | 80K | |
| nq-1.0.pkg | 2025-08-22 20:50 | 12K | |
| nqc-3.1.r6_2.pkg | 2025-08-16 15:01 | 148K | |
| nqptp-1.2.4.pkg | 2025-08-14 12:54 | 13K | |
| nqueens-1.0.pkg | 2025-08-16 15:09 | 3.7K | |
| nr-libreoffice-25.8...> | 2025-12-27 16:05 | 215K | |
| nrg2iso-0.4.pkg | 2025-08-22 13:49 | 3.7K | |
| nrpe-4.1.3.pkg | 2025-12-23 21:06 | 44K | |
| nrpe-monplugins-4.1...> | 2025-12-22 07:40 | 44K | |
| nsca-2.9.2_1.pkg | 2025-12-22 17:37 | 24K | |
| nsca-client-2.9.2_1.pkg | 2025-12-21 06:37 | 18K | |
| nsca-ng-1.6_1.pkg | 2025-12-23 10:29 | 41K | |
| nsca-ng-client-1.6_1..> | 2025-08-21 10:55 | 37K | |
| nsca27-2.7.2_8.pkg | 2025-12-21 07:04 | 22K | |
| nsca27-client-2.7.2_..> | 2025-12-22 06:29 | 17K | |
| nscde-2.3_1.pkg | 2025-12-30 14:13 | 25M | |
| nsd-4.14.0.pkg | 2025-12-23 09:32 | 758K | |
| nsd_exporter-0.3.1_1..> | 2025-12-24 06:34 | 2.5M | |
| nsf-1.0_1.pkg | 2025-08-20 22:43 | 9.5K | |
| nsgenbind-0.9.pkg | 2025-08-16 12:51 | 50K | |
| nsh-0.4.2_38.pkg | 2025-12-29 16:07 | 3.8M | |
| nslint-3.2.pkg | 2025-08-22 20:30 | 27K | |
| nsnake-3.0.0.pkg | 2025-08-18 20:45 | 10K | |
| nsnotifyd-2.3.pkg | 2025-08-21 02:51 | 25K | |
| nso-libreoffice-25.8..> | 2025-12-27 04:46 | 243K | |
| nsping-0.8_3.pkg | 2025-08-17 11:42 | 8.7K | |
| nspr-4.38.2.pkg | 2025-12-16 03:13 | 254K | |
| nsq-1.3.0_18.pkg | 2025-12-21 07:50 | 11M | |
| nss-3.119.1_1.pkg | 2025-12-16 04:06 | 2.3M | |
| nss-pam-ldapd-0.9.13..> | 2025-08-21 12:32 | 99K | |
| nss-pam-ldapd-sasl-0..> | 2025-08-21 01:39 | 99K | |
| nss_compat_ossl-0.9...> | 2025-12-20 15:52 | 40K | |
| nss_ldap-1.265_15.pkg | 2025-08-19 11:23 | 51K | |
| nss_mdns-0.14.1.2020..> | 2025-12-21 10:37 | 19K | |
| nss_ndb-1.0.24_1.pkg | 2025-08-18 17:31 | 37K | |
| nss_resinit-20060412..> | 2025-08-21 01:23 | 4.8K | |
| nss_wrapper-1.1.16.pkg | 2025-12-20 02:40 | 29K | |
| nstat-g20250705,1.pkg | 2025-12-29 04:06 | 7.5K | |
| nsxiv-33.pkg | 2025-12-27 07:58 | 46K | |
| nsync-1.27.0.pkg | 2025-08-13 23:23 | 38K | |
| nsysctl-2.2.pkg | 2025-08-20 05:46 | 19K | |
| ntfs2btrfs-20230501_..> | 2025-12-23 15:59 | 141K | |
| ntfy-2.7.0.14_1.pkg | 2025-12-30 07:18 | 65K | |
| ntimed-0.0.2015.01.3..> | 2025-08-16 09:17 | 24K | |
| ntk-1.3.1001_1.pkg | 2025-12-27 02:57 | 873K | |
| ntl-11.6.0.pkg | 2025-12-26 11:44 | 2.5M | |
| ntopng-6.4.d20250813..> | 2025-12-30 12:47 | 5.5M | |
| ntp-4.2.8p18_5.pkg | 2025-12-20 05:06 | 1.8M | |
| ntpa-0.8.2_7.pkg | 2025-12-23 07:25 | 508K | |
| ntpd-rs-1.6.2_3.pkg | 2025-12-29 17:13 | 2.2M | |
| ntpsec-1.2.3.pkg | 2025-12-22 00:41 | 1.8M | |
| ntpstat-0.6_1.pkg | 2025-12-21 04:33 | 3.8K | |
| ntraceroute-6.4.2_3.pkg | 2025-08-18 05:09 | 14K | |
| nttcp-1.47_4.pkg | 2025-08-21 06:30 | 23K | |
| nu_plugin_formats-0...> | 2025-12-28 13:39 | 1.8M | |
| nu_plugin_gstat-0.10..> | 2025-12-30 18:22 | 1.8M | |
| nu_plugin_inc-0.109...> | 2025-12-28 16:01 | 806K | |
| nu_plugin_polars-0.1..> | 2025-12-29 00:37 | 13M | |
| nu_plugin_query-0.10..> | 2025-12-29 22:08 | 1.7M | |
| nuclearchess-1.0.0_1..> | 2025-12-28 12:19 | 1.2M | |
| nuclei-3.6.0.pkg | 2025-12-22 14:36 | 27M | |
| nucleus-0.77_6.pkg | 2025-12-30 02:58 | 180K | |
| nuitka-py311-2.8.pkg | 2025-12-19 13:13 | 4.0M | |
| nuklear-4.12.0.pkg | 2025-08-22 14:03 | 180K | |
| nullmailer-2.2_2,1.pkg | 2025-08-17 04:14 | 77K | |
| numbat-1.16.0_7.pkg | 2025-12-28 09:25 | 1.9M | |
| numchar-1.0.pkg | 2025-08-16 10:04 | 5.3K | |
| numdiff-5.9.0_2.pkg | 2025-12-23 11:11 | 532K | |
| numix-gtk-theme-2.6...> | 2025-12-28 06:52 | 106K | |
| numix-icon-theme-25...> | 2025-12-21 22:38 | 2.3M | |
| numix-icon-theme-cir..> | 2025-12-19 14:52 | 2.0M | |
| numlockx-1.2.pkg | 2025-08-14 06:57 | 4.3K | |
| numptyphysics-0.3.r2..> | 2025-12-27 17:48 | 259K | |
| numptyphysics-npcomp..> | 2025-12-30 10:05 | 283K | |
| numsa-0.2.0.pkg | 2025-12-27 17:07 | 117K | |
| nurbs++-3.0.11_11.pkg | 2025-12-30 16:40 | 1.1M | |
| nushell-0.109.1_1.pkg | 2025-12-29 19:49 | 7.8M | |
| nusoap-0.9.5.pkg | 2025-12-29 21:26 | 74K | |
| nuspell-5.1.7.pkg | 2025-12-20 11:17 | 161K | |
| nut-2.8.2_1.pkg | 2025-12-27 19:47 | 2.1M | |
| nut-devel-2025.11.17..> | 2025-12-30 17:59 | 2.3M | |
| nut_exporter-3.0.0_2..> | 2025-12-22 10:23 | 3.6M | |
| nuttcp-8.2.2_1.pkg | 2025-12-23 03:14 | 73K | |
| nvc-1.18.1.pkg | 2025-12-20 07:51 | 3.9M | |
| nvclock-0.8.b4_8.pkg | 2025-12-30 10:34 | 250K | |
| nvi-m17n-1.79.200406..> | 2025-12-21 22:18 | 286K | |
| nvi2-2.2.2.pkg | 2025-12-22 17:11 | 191K | |
| nvidia-driver-304-30..> | 2025-12-29 16:28 | 10M | |
| nvidia-driver-340-34..> | 2025-12-30 09:38 | 19M | |
| nvidia-driver-390-39..> | 2025-12-29 19:09 | 17M | |
| nvidia-driver-470-47..> | 2025-12-30 02:43 | 46M | |
| nvidia-driver-580.10..> | 2025-12-27 03:25 | 79M | |
| nvidia-driver-devel-..> | 2025-12-27 11:02 | 79M | |
| nvidia-drm-61-kmod-5..> | 2025-12-20 00:46 | 46K | |
| nvidia-drm-61-kmod-d..> | 2025-12-19 09:59 | 46K | |
| nvidia-drm-515-kmod-..> | 2025-12-22 00:36 | 46K | |
| nvidia-drm-515-kmod-..> | 2025-12-20 07:51 | 46K | |
| nvidia-drm-kmod-580...> | 2025-12-28 03:16 | 758 | |
| nvidia-drm-kmod-deve..> | 2025-12-29 22:45 | 763 | |
| nvidia-kmod-304-304...> | 2025-12-19 07:10 | 3.6M | |
| nvidia-kmod-340-340...> | 2025-12-19 08:03 | 3.7M | |
| nvidia-kmod-390-390...> | 2025-12-19 22:58 | 8.9M | |
| nvidia-kmod-470-470...> | 2025-12-20 04:22 | 24M | |
| nvidia-kmod-580.105...> | 2025-12-19 01:18 | 151M | |
| nvidia-kmod-devel-58..> | 2025-12-18 23:14 | 151M | |
| nvidia-settings-580...> | 2025-12-26 20:16 | 766K | |
| nvidia-texture-tools..> | 2025-08-14 23:09 | 377K | |
| nvidia-xconfig-580.1..> | 2025-12-21 00:00 | 77K | |
| nvidia_gpu_prometheu..> | 2025-12-23 14:10 | 2.3M | |
| nvimpager-0.13.0.pkg | 2025-12-22 14:24 | 15K | |
| nvme-cli-2.11.0.3.pkg | 2025-08-20 01:39 | 701K | |
| nvramtool-r6440_1.pkg | 2025-08-22 17:07 | 23K | |
| nwcc-0.8.3.pkg | 2025-08-18 22:12 | 1.0M | |
| nwchem-7.3.1.pkg | 2025-12-29 18:50 | 26M | |
| nwchem-data-7.3.1.pkg | 2025-12-19 04:58 | 5.8M | |
| nwg-bar-0.1.6_19.pkg | 2025-12-28 21:52 | 1.3M | |
| nwg-dock-0.4.3_12.pkg | 2025-12-28 08:01 | 1.5M | |
| nwg-dock-hyprland-0...> | 2025-12-29 07:34 | 2.8M | |
| nwg-drawer-0.7.4_6.pkg | 2025-12-29 12:02 | 6.2M | |
| nwg-launchers-0.7.1...> | 2025-12-30 00:30 | 292K | |
| nwg-look-1.0.6_6.pkg | 2025-12-28 02:59 | 1.2M | |
| nwg-menu-0.1.9_6.pkg | 2025-12-28 13:08 | 1.4M | |
| nwndata-1.29_3.pkg | 2025-08-15 07:43 | 1.0G | |
| nwreckdum-0.0.6_2.pkg | 2025-08-18 16:14 | 7.2K | |
| nx-2.4.0_1.pkg | 2025-09-01 08:19 | 3.2M | |
| nxcomp-3.5.0.32_3.pkg | 2025-12-26 19:30 | 492K | |
| nxengine-2.6.5.1_3.pkg | 2025-12-29 23:16 | 1.3M | |
| nxproxy-3.5.99.20_1.pkg | 2025-12-27 01:22 | 7.7K | |
| ny-aspell-0.01.0_1,2..> | 2025-12-22 21:21 | 44K | |
| nyan-lang-0.3.1.pkg | 2025-08-14 17:07 | 270K | |
| nyancat-1.5.2,1.pkg | 2025-08-20 00:43 | 10K | |
| nylon-1.21_11.pkg | 2025-08-22 11:30 | 19K | |
| nyquist-3.23.pkg | 2025-12-30 07:10 | 4.9M | |
| nyx-2.1.0_3.pkg | 2025-12-28 23:08 | 202K | |
| nyxt-3.12.0_3.pkg | 2025-12-27 22:43 | 27M | |
| nzbget-25.4.pkg | 2025-12-20 20:42 | 4.4M | |
| nzbhydra2-7.9.0.pkg | 2025-12-28 10:29 | 72M | |
| nzbperl-0.6.8_1.pkg | 2025-12-24 04:54 | 26K | |
| o2em-1.17_4.pkg | 2025-12-30 04:45 | 682K | |
| o3read-0.0.4_2.pkg | 2025-08-18 03:14 | 15K | |
| oak-1.5.0.pkg | 2025-08-21 05:32 | 15K | |
| oama-0.18.pkg | 2025-12-22 15:52 | 7.0M | |
| oaml-1.3.4_2.pkg | 2025-08-19 23:48 | 177K | |
| oath-toolkit-2.6.13.pkg | 2025-12-20 00:43 | 298K | |
| oatpp-1.3.1.pkg | 2025-12-20 18:10 | 411K | |
| oauth2-proxy-7.13.0.pkg | 2025-12-30 14:28 | 6.9M | |
| ob-rust-g20220824_1.pkg | 2025-12-30 05:29 | 2.4K | |
| obake-0.7.0.24_25.pkg | 2025-12-26 22:57 | 182K | |
| obconf-2.0.4_7.pkg | 2025-12-27 16:16 | 136K | |
| obconf-qt-0.16.6.pkg | 2025-12-27 15:46 | 147K | |
| obexapp-1.4.15_5.pkg | 2025-12-22 17:10 | 79K | |
| obfs4proxy-tor-0.0.1..> | 2025-12-20 01:54 | 2.2M | |
| obhttpd-7.4.20231129..> | 2025-08-17 23:24 | 792K | |
| objconv-2.56.pkg | 2025-12-20 19:32 | 530K | |
| objecthash-20160802_..> | 2025-08-21 04:33 | 5.5K | |
| objfw-1.4.1.pkg | 2025-12-20 14:45 | 2.4M | |
| oblige-7.70_1.pkg | 2025-12-30 18:38 | 1.8M | |
| obliterate-0.5_1.pkg | 2025-08-18 10:10 | 6.6K | |
| obpager-1.8.pkg | 2025-08-19 19:53 | 18K | |
| obs-multi-rtmp-0.7.3..> | 2025-12-29 12:22 | 158K | |
| obs-studio-32.0.2_3.pkg | 2025-12-27 15:44 | 6.4M | |
| obs-text-pthread-2.0..> | 2025-12-30 09:15 | 16K | |
| observium-php82-24.1..> | 2025-12-30 10:00 | 74M | |
| observium-php83-24.1..> | 2025-12-29 06:08 | 74M | |
| observium-php84-24.1..> | 2025-12-28 00:52 | 74M | |
| observium-php85-24.1..> | 2025-12-29 11:20 | 74M | |
| obsidian-1.9.14_7.pkg | 2025-12-29 22:28 | 82M | |
| obuparse-2.0.1.pkg | 2025-12-18 17:58 | 22K | |
| oc-4.9_36.pkg | 2025-12-23 16:08 | 21M | |
| oc-libreoffice-25.8...> | 2025-12-27 16:12 | 548K | |
| ocaml-4.14.2.pkg | 2025-08-13 04:49 | 135M | |
| ocaml-annexlib-0.13...> | 2025-12-27 20:07 | 107K | |
| ocaml-astring-0.8.5_..> | 2025-08-13 15:04 | 647K | |
| ocaml-autoconf-1.1_1..> | 2025-08-21 08:17 | 6.0K | |
| ocaml-base-0.16.3_2.pkg | 2025-08-13 09:52 | 9.8M | |
| ocaml-base64-3.5.1_2..> | 2025-12-29 19:59 | 204K | |
| ocaml-bos-0.2.1_3.pkg | 2025-12-26 21:08 | 554K | |
| ocaml-bz2-0.8.0.pkg | 2025-08-20 00:48 | 31K | |
| ocaml-cairo-0.6.5.pkg | 2025-12-27 00:40 | 448K | |
| ocaml-calendar-2.04.pkg | 2025-12-30 14:48 | 173K | |
| ocaml-camlidl-1.12.pkg | 2025-08-21 18:53 | 1.1M | |
| ocaml-camljava-0.5.pkg | 2025-12-28 01:16 | 45K | |
| ocaml-camlp-streams-..> | 2025-08-14 08:05 | 24K | |
| ocaml-camlp4-4.14+1_..> | 2025-08-13 08:09 | 38M | |
| ocaml-camlp5-8.02.01..> | 2025-12-20 01:24 | 5.1M | |
| ocaml-camomile-1.0.2..> | 2025-08-18 08:56 | 4.6M | |
| ocaml-camomile-examp..> | 2025-08-18 18:00 | 20K | |
| ocaml-cfg-2.2.0_3.pkg | 2025-08-15 20:46 | 290K | |
| ocaml-classes-4.00_3..> | 2025-12-30 00:55 | 18K | |
| ocaml-cmdliner-1.0.4..> | 2025-08-13 11:03 | 452K | |
| ocaml-compiler-libs-..> | 2025-08-13 06:56 | 96K | |
| ocaml-cppo-1.6.9_3.pkg | 2025-08-13 07:05 | 459K | |
| ocaml-cryptgps-0.2.1..> | 2025-12-30 00:03 | 164K | |
| ocaml-cryptokit-1.19..> | 2025-12-29 13:00 | 1.1M | |
| ocaml-csexp-1.5.2_2.pkg | 2025-08-20 13:48 | 124K | |
| ocaml-cstruct-6.2.0_..> | 2025-12-27 11:14 | 4.0M | |
| ocaml-csv-1.2.1_4.pkg | 2025-12-29 23:12 | 32K | |
| ocaml-curses-1.0.11.pkg | 2025-08-14 22:34 | 296K | |
| ocaml-dbm-1.3.pkg | 2025-08-16 08:11 | 13K | |
| ocaml-dolmen-0.9_2.pkg | 2025-12-27 10:19 | 32M | |
| ocaml-domain-name-0...> | 2025-08-15 00:44 | 145K | |
| ocaml-dune-3.7.1_3.pkg | 2025-08-13 05:23 | 8.5M | |
| ocaml-expat-0.9.1_6.pkg | 2025-12-28 08:31 | 25K | |
| ocaml-extlib-1.7.9_3..> | 2025-12-27 02:08 | 1.4M | |
| ocaml-farith-0.1_1.pkg | 2025-12-26 20:24 | 693K | |
| ocaml-findlib-1.9.6_..> | 2025-12-26 11:48 | 887K | |
| ocaml-fmt-0.9.0_1.pkg | 2025-08-13 15:04 | 221K | |
| ocaml-fpath-0.7.3_1.pkg | 2025-12-26 19:46 | 162K | |
| ocaml-gen-1.1.pkg | 2025-08-14 08:59 | 614K | |
| ocaml-graphics-5.1.2..> | 2025-08-22 21:01 | 173K | |
| ocaml-gsl-1.25.1.pkg | 2025-12-27 02:49 | 1.8M | |
| ocaml-hmap-0.8.1.pkg | 2025-08-13 16:23 | 41K | |
| ocaml-images-5.0.4_3..> | 2025-12-27 09:02 | 2.4M | |
| ocaml-ipaddr-5.6.1.pkg | 2025-12-29 01:40 | 628K | |
| ocaml-jsonm-1.0.2_3.pkg | 2025-12-30 10:36 | 539K | |
| ocaml-lablgl-1.05_7,..> | 2025-12-26 23:41 | 315K | |
| ocaml-lablgtk2-2.18...> | 2025-12-27 02:18 | 3.1M | |
| ocaml-lablgtk3-3.1.5..> | 2025-12-27 18:22 | 15M | |
| ocaml-labltk-8.06.12..> | 2025-12-26 10:25 | 2.2M | |
| ocaml-lacaml-11.0.10..> | 2025-12-29 07:31 | 4.8M | |
| ocaml-linol-0.6_2.pkg | 2025-12-26 21:20 | 482K | |
| ocaml-logs-0.7.0_3.pkg | 2025-12-26 20:22 | 140K | |
| ocaml-lsp-1.19.0_2.pkg | 2025-12-26 18:49 | 7.7M | |
| ocaml-lwt-5.7.0_2.pkg | 2025-12-26 14:53 | 6.3M | |
| ocaml-lwt_ssl-1.2.0_..> | 2025-12-30 02:00 | 58K | |
| ocaml-magic-0.7.3_7.pkg | 2025-12-28 03:19 | 259K | |
| ocaml-mtime-2.0.0_1.pkg | 2025-08-13 16:07 | 62K | |
| ocaml-num-1.4_3.pkg | 2025-08-13 19:46 | 288K | |
| ocaml-ocamlbuild-0.1..> | 2025-08-13 06:09 | 1.5M | |
| ocaml-ocamlgraph-2.1..> | 2025-08-14 16:58 | 5.8M | |
| ocaml-ocplib-endian-..> | 2025-08-13 12:25 | 233K | |
| ocaml-ocplib-simplex..> | 2025-12-27 09:38 | 841K | |
| ocaml-octavius-1.2.2..> | 2025-08-13 09:00 | 2.6M | |
| ocaml-ocurl-0.9.2_5.pkg | 2025-12-30 02:30 | 490K | |
| ocaml-opam-2.4.1.pkg | 2025-12-18 08:21 | 3.6M | |
| ocaml-ounit-2.2.7.pkg | 2025-08-22 04:35 | 1.1M | |
| ocaml-parmap-1.2.4_2..> | 2025-12-26 20:31 | 284K | |
| ocaml-parsexp-0.16.0..> | 2025-08-13 20:52 | 876K | |
| ocaml-pcre-7.2.3_4.pkg | 2025-12-26 22:50 | 364K | |
| ocaml-pcre2-7.5.2_1.pkg | 2025-12-18 20:12 | 1.0M | |
| ocaml-pomap-4.1.1_3.pkg | 2025-08-18 22:02 | 419K | |
| ocaml-pp_loc-2.1.0.pkg | 2025-08-14 00:27 | 157K | |
| ocaml-ppx-tools-6.6_..> | 2025-12-30 16:06 | 16M | |
| ocaml-ppx_blob-0.9.0..> | 2025-08-15 11:47 | 3.2M | |
| ocaml-ppx_compare-0...> | 2025-12-26 15:10 | 246K | |
| ocaml-ppx_derivers-1..> | 2025-08-13 06:53 | 16K | |
| ocaml-ppx_deriving-6..> | 2025-12-26 14:44 | 4.8M | |
| ocaml-ppx_hash-0.16...> | 2025-12-26 20:13 | 217K | |
| ocaml-ppx_js_style-0..> | 2025-08-13 12:19 | 3.7M | |
| ocaml-ppx_sexp_conv-..> | 2025-08-13 15:48 | 1.2M | |
| ocaml-ppx_yojson_con..> | 2025-08-13 15:23 | 706K | |
| ocaml-ppx_yojson_con..> | 2025-08-13 12:10 | 120K | |
| ocaml-ppxlib-0.33.0_..> | 2025-08-13 08:49 | 19M | |
| ocaml-psmt2-frontend..> | 2025-08-15 22:15 | 2.9M | |
| ocaml-re-1.11.0_2.pkg | 2025-08-14 01:33 | 1.0M | |
| ocaml-react-1.2.2.pkg | 2025-12-26 14:26 | 118K | |
| ocaml-res-5.0.1_2.pkg | 2025-08-15 09:59 | 642K | |
| ocaml-result-1.5_2.pkg | 2025-08-18 15:10 | 12K | |
| ocaml-rresult-0.7.0_..> | 2025-08-13 21:40 | 54K | |
| ocaml-sdl-0.9.1_7.pkg | 2025-12-27 13:16 | 214K | |
| ocaml-sem-0.0.2_6.pkg | 2025-12-29 19:20 | 21K | |
| ocaml-sexplib-0.16.0..> | 2025-08-13 23:12 | 852K | |
| ocaml-sexplib0-0.17...> | 2025-08-13 06:47 | 379K | |
| ocaml-spelll-0.4.pkg | 2025-08-14 05:33 | 190K | |
| ocaml-sqlite3-5.2.0.pkg | 2025-12-23 03:56 | 223K | |
| ocaml-ssl-0.7.0.pkg | 2025-08-15 16:23 | 219K | |
| ocaml-stdio-0.17.0_1..> | 2025-08-14 09:29 | 91K | |
| ocaml-text-0.8_3.pkg | 2025-12-27 21:43 | 520K | |
| ocaml-topkg-1.0.7_3.pkg | 2025-12-26 14:06 | 713K | |
| ocaml-trace-0.7_1.pkg | 2025-08-13 20:57 | 3.5M | |
| ocaml-uchar-0.0.2_4.pkg | 2025-08-13 12:14 | 743 | |
| ocaml-ulex-1.1_4.pkg | 2025-12-28 11:11 | 32K | |
| ocaml-uutf-1.0.3_3.pkg | 2025-12-26 17:47 | 912K | |
| ocaml-xstr-0.2.1_5.pkg | 2025-12-27 22:11 | 73K | |
| ocaml-xstrp4-1.8.2_3..> | 2025-12-29 00:13 | 37K | |
| ocaml-yojson-2.2.2_1..> | 2025-08-13 09:26 | 1.9M | |
| ocaml-zarith-1.13_2.pkg | 2025-12-26 18:32 | 220K | |
| ocaml-zip-1.11_3.pkg | 2025-12-27 15:47 | 250K | |
| ocean-spectroscopy-c..> | 2025-12-29 16:27 | 1.9M | |
| ocijail-0.4.0_1.pkg | 2025-08-14 09:23 | 248K | |
| ocl-icd-2.3.4.pkg | 2025-12-18 12:34 | 46K | |
| oclgrind-21.10,1.pkg | 2025-12-23 15:27 | 12M | |
| oclock-1.0.4_1.pkg | 2025-08-21 11:00 | 10K | |
| ocp-3.0.1_1,1.pkg | 2025-12-27 21:39 | 1.6M | |
| ocrad-0.29.pkg | 2025-12-27 07:29 | 196K | |
| ocrs-0.10.4_4.pkg | 2025-12-30 16:41 | 1.8M | |
| ocserv-1.3.0_3.pkg | 2025-12-21 07:02 | 449K | |
| ocsinventory-agent-2..> | 2025-12-29 18:47 | 149K | |
| ocsinventory-ocsrepo..> | 2025-12-27 05:26 | 3.2M | |
| ocsinventory-server-..> | 2025-12-29 10:40 | 97K | |
| octave-10.3.0_2.pkg | 2025-12-26 10:54 | 20M | |
| octave-forge-actuari..> | 2025-12-27 12:27 | 35K | |
| octave-forge-audio-2..> | 2025-12-27 11:39 | 517K | |
| octave-forge-automat..> | 2025-12-27 18:43 | 35K | |
| octave-forge-base-1...> | 2025-12-26 13:40 | 3.2K | |
| octave-forge-benchma..> | 2025-12-27 12:39 | 13K | |
| octave-forge-bioinfo..> | 2025-12-29 06:38 | 13K | |
| octave-forge-biosig-..> | 2025-12-27 16:04 | 1.4M | |
| octave-forge-bsltl-1..> | 2025-12-27 18:42 | 59K | |
| octave-forge-cfitsio..> | 2025-12-27 10:26 | 516K | |
| octave-forge-cgi-0.1..> | 2025-12-27 10:43 | 11K | |
| octave-forge-civil-e..> | 2025-12-27 16:11 | 32K | |
| octave-forge-coder-1..> | 2025-12-27 17:16 | 726K | |
| octave-forge-communi..> | 2025-12-27 18:18 | 961K | |
| octave-forge-control..> | 2025-12-26 19:33 | 6.5M | |
| octave-forge-csg-dat..> | 2025-12-27 02:26 | 91M | |
| octave-forge-csg-too..> | 2025-12-27 11:40 | 2.3M | |
| octave-forge-datafra..> | 2025-12-27 09:59 | 68K | |
| octave-forge-datatyp..> | 2025-12-26 21:21 | 508K | |
| octave-forge-dicom-0..> | 2025-12-27 11:41 | 1.2M | |
| octave-forge-divand-..> | 2025-12-27 15:48 | 1.1M | |
| octave-forge-doctest..> | 2025-12-27 14:56 | 36K | |
| octave-forge-fda-1.0..> | 2025-12-27 11:46 | 2.8M | |
| octave-forge-femocta..> | 2025-12-27 05:35 | 36M | |
| octave-forge-fenv-0...> | 2025-12-27 10:49 | 35K | |
| octave-forge-fileio-..> | 2025-12-27 01:46 | 1.4M | |
| octave-forge-financi..> | 2025-12-27 19:23 | 75K | |
| octave-forge-fl-core..> | 2025-12-27 17:12 | 32K | |
| octave-forge-fpl-1.3..> | 2025-12-26 20:19 | 20K | |
| octave-forge-fuzzy-l..> | 2025-12-27 19:42 | 766K | |
| octave-forge-ga-0.10..> | 2025-12-27 04:06 | 30K | |
| octave-forge-general..> | 2025-12-27 03:00 | 111K | |
| octave-forge-generat..> | 2025-12-27 06:10 | 60K | |
| octave-forge-geograp..> | 2025-12-27 06:11 | 97K | |
| octave-forge-geometr..> | 2025-12-27 01:39 | 580K | |
| octave-forge-gsl-2.1..> | 2025-12-27 09:00 | 354K | |
| octave-forge-hdf5oct..> | 2025-12-27 10:10 | 251K | |
| octave-forge-ident-1..> | 2025-12-27 15:51 | 29K | |
| octave-forge-image-2..> | 2025-12-27 17:59 | 1.0M | |
| octave-forge-integra..> | 2025-12-27 13:48 | 37K | |
| octave-forge-interna..> | 2025-12-27 11:31 | 156K | |
| octave-forge-interva..> | 2025-12-27 18:36 | 3.1M | |
| octave-forge-io-2.7...> | 2025-12-26 22:03 | 364K | |
| octave-forge-joystic..> | 2025-12-27 16:53 | 412K | |
| octave-forge-linear-..> | 2025-12-27 08:28 | 44K | |
| octave-forge-lssa-0...> | 2025-12-27 16:53 | 98K | |
| octave-forge-ltfat-2..> | 2025-12-27 16:48 | 4.6M | |
| octave-forge-mapping..> | 2025-12-27 17:56 | 3.6M | |
| octave-forge-matgeom..> | 2025-12-26 19:50 | 534K | |
| octave-forge-mboct-f..> | 2025-12-27 09:50 | 2.6M | |
| octave-forge-mboct-m..> | 2025-12-26 21:43 | 764K | |
| octave-forge-mboct-n..> | 2025-12-26 19:09 | 415K | |
| octave-forge-mboct-o..> | 2025-12-26 15:35 | 380K | |
| octave-forge-mccabe-..> | 2025-12-27 18:45 | 97K | |
| octave-forge-miscell..> | 2025-12-27 18:32 | 297K | |
| octave-forge-missing..> | 2025-12-27 09:52 | 6.5K | |
| octave-forge-mqtt-0...> | 2025-12-27 12:43 | 464K | |
| octave-forge-multico..> | 2025-12-27 08:12 | 34K | |
| octave-forge-mvn-1.1..> | 2025-12-27 17:28 | 21K | |
| octave-forge-nan-3.7..> | 2025-12-26 20:25 | 491K | |
| octave-forge-ncarray..> | 2025-12-27 11:12 | 35K | |
| octave-forge-netcdf-..> | 2025-12-27 01:16 | 627K | |
| octave-forge-nurbs-1..> | 2025-12-26 19:17 | 406K | |
| octave-forge-oct2mat..> | 2025-12-27 11:11 | 9.1K | |
| octave-forge-octave-..> | 2025-12-27 11:41 | 13K | |
| octave-forge-octave_..> | 2025-12-27 03:02 | 653K | |
| octave-forge-octave_..> | 2025-12-27 16:37 | 645K | |
| octave-forge-octave_..> | 2025-12-27 00:18 | 642K | |
| octave-forge-octave_..> | 2025-12-27 15:46 | 712K | |
| octave-forge-octclip..> | 2025-12-27 18:44 | 2.2M | |
| octave-forge-octproj..> | 2025-12-27 17:02 | 7.6M | |
| octave-forge-odbc-0...> | 2025-12-27 09:09 | 320K | |
| octave-forge-odebvp-..> | 2025-12-27 13:45 | 18K | |
| octave-forge-optics-..> | 2025-12-27 14:42 | 46K | |
| octave-forge-optimin..> | 2025-12-27 14:39 | 95K | |
| octave-forge-outlier..> | 2025-12-27 17:58 | 33K | |
| octave-forge-paralle..> | 2025-12-27 15:30 | 1.4M | |
| octave-forge-pde1dm-..> | 2025-12-27 19:26 | 374K | |
| octave-forge-pkg-oct..> | 2025-12-27 02:40 | 106K | |
| octave-forge-ponchon..> | 2025-12-27 08:38 | 144K | |
| octave-forge-prompt-..> | 2025-12-27 12:10 | 18K | |
| octave-forge-psychro..> | 2025-12-27 09:44 | 611K | |
| octave-forge-pythoni..> | 2025-12-27 15:11 | 322K | |
| octave-forge-quatern..> | 2025-12-27 13:15 | 43K | |
| octave-forge-queuein..> | 2025-12-27 17:16 | 410K | |
| octave-forge-rtree-0..> | 2025-12-27 15:32 | 320K | |
| octave-forge-secs2d-..> | 2025-12-27 17:40 | 123K | |
| octave-forge-signal-..> | 2025-12-26 20:34 | 657K | |
| octave-forge-simp-1...> | 2025-12-27 06:53 | 128K | |
| octave-forge-sockets..> | 2025-12-26 22:50 | 354K | |
| octave-forge-sparser..> | 2025-12-27 11:14 | 212K | |
| octave-forge-special..> | 2025-12-27 17:53 | 8.4K | |
| octave-forge-splines..> | 2025-12-26 17:36 | 35K | |
| octave-forge-sqlite-..> | 2025-12-27 08:54 | 393K | |
| octave-forge-statist..> | 2025-12-27 00:38 | 1.7M | |
| octave-forge-statist..> | 2025-12-27 12:09 | 2.1M | |
| octave-forge-stk-2.8..> | 2025-12-27 07:26 | 499K | |
| octave-forge-strings..> | 2025-12-27 11:08 | 58K | |
| octave-forge-struct-..> | 2025-12-26 23:31 | 122K | |
| octave-forge-symboli..> | 2025-12-27 02:10 | 288K | |
| octave-forge-tablici..> | 2025-12-27 17:09 | 8.6M | |
| octave-forge-tcl-oct..> | 2025-12-27 09:01 | 23K | |
| octave-forge-timer-0..> | 2025-12-27 05:06 | 16K | |
| octave-forge-tsa-4.6..> | 2025-12-27 14:40 | 81K | |
| octave-forge-velas-1..> | 2025-12-27 17:14 | 3.6M | |
| octave-forge-websock..> | 2025-12-27 16:37 | 14K | |
| octave-forge-zenity-..> | 2025-12-27 02:52 | 27K | |
| octave-forge-zeromq-..> | 2025-12-27 11:04 | 471K | |
| octomap-1.10.0_1.pkg | 2025-12-26 14:48 | 280K | |
| octopkg-0.4.1.pkg | 2025-12-29 20:47 | 379K | |
| octopus-16.0.pkg | 2025-12-28 04:06 | 29M | |
| octosql-0.13.0_13.pkg | 2025-12-21 03:37 | 6.0M | |
| oculante-0.9.2_9.pkg | 2025-12-30 12:15 | 19M | |
| odamex-0.7.0_3.pkg | 2025-12-29 22:00 | 3.0M | |
| odbc-cpp-wrapper-1.1..> | 2025-12-22 17:52 | 107K | |
| ode-double-0.16.6_1,..> | 2025-12-26 22:33 | 407K | |
| ode-single-0.16.6_1,..> | 2025-12-29 22:35 | 405K | |
| odin-lang-2025.12.pkg | 2025-12-30 06:33 | 40M | |
| odin2-synthesizer-2...> | 2025-12-28 02:47 | 132M | |
| odo-0.2.2_1.pkg | 2025-08-16 12:32 | 5.4K | |
| ods2-1.3_1.pkg | 2025-08-20 22:57 | 40K | |
| ods2reader-19930601_..> | 2025-08-16 09:17 | 7.7K | |
| ods2sql-0.4.0_47.pkg | 2025-12-30 08:13 | 721K | |
| odt2txt-0.5.pkg | 2025-08-18 01:01 | 12K | |
| office-code-pro-1.00..> | 2025-12-29 23:28 | 176K | |
| offpunk-2.7.1.pkg | 2025-12-29 01:12 | 162K | |
| oftpd-0.3.7_1.pkg | 2025-08-18 05:13 | 34K | |
| ogdf-2020.02.pkg | 2025-08-18 23:31 | 3.9M | |
| ogg2mp3-0.6.1_4.pkg | 2025-12-28 00:51 | 4.7K | |
| oggvideotools-0.9.1_..> | 2025-12-28 16:12 | 277K | |
| ogmtools-1.5_18.pkg | 2025-12-19 09:05 | 107K | |
| ogre3d-14.4.1.pkg | 2025-12-27 17:25 | 86M | |
| ogre3d19-1.9.1.pkg | 2025-12-27 16:44 | 106M | |
| oha-1.9.0_5.pkg | 2025-12-28 12:49 | 3.2M | |
| ohmu-1.1.0_6.pkg | 2025-12-23 12:55 | 30K | |
| ohmyzsh-20241128.pkg | 2025-08-19 17:51 | 2.8M | |
| ohsnap-1.8.0_1.pkg | 2025-12-29 07:35 | 31K | |
| ohsnap-otb-1.8.0_1.pkg | 2025-12-29 09:54 | 28K | |
| oidentd-2.5.1_1.pkg | 2025-08-18 11:35 | 30K | |
| oidn-2.3.3.pkg | 2025-12-29 23:41 | 48M | |
| oils-shell-0.34.0.pkg | 2025-12-22 07:23 | 675K | |
| oink-g20250105_2.pkg | 2025-12-22 16:55 | 291K | |
| oinkmaster-2.0_2.pkg | 2025-12-20 23:26 | 37K | |
| ois-1.5.1.pkg | 2025-08-22 13:48 | 57K | |
| okc321-1.1.pkg | 2025-08-21 15:34 | 30K | |
| oksh-7.8,1.pkg | 2025-12-21 14:11 | 165K | |
| oksh-static-7.8,1.pkg | 2025-12-23 12:56 | 621K | |
| okteta-0.26.24,1.pkg | 2025-12-27 15:08 | 1.4M | |
| okular-25.12.0.pkg | 2025-12-26 23:53 | 6.8M | |
| ola-0.10.9_10.pkg | 2025-12-19 07:24 | 2.8M | |
| oldrunner-20120131_1..> | 2025-08-21 16:06 | 29K | |
| oldschool-pc-fonts-2..> | 2025-12-27 12:34 | 4.3M | |
| oleo-1.99.16_15.pkg | 2025-12-23 12:37 | 169K | |
| ollama-0.13.1.r0_2.pkg | 2025-12-27 07:24 | 15M | |
| ollama-hpp-0.9.4.pkg | 2025-08-20 19:26 | 160K | |
| olm-3.2.13.pkg | 2025-08-14 04:27 | 101K | |
| olsrd-0.9.8_2.pkg | 2025-08-17 03:19 | 209K | |
| om-libreoffice-25.8...> | 2025-12-27 08:20 | 2.9M | |
| omada5-5.15.24.19.pkg | 2025-12-29 19:41 | 274M | |
| omake-0.10.6_2.pkg | 2025-12-19 22:22 | 1.6M | |
| omega-0.90.4_2.pkg | 2025-08-19 13:18 | 283K | |
| omegaT-6.0.1.pkg | 2025-12-30 10:28 | 161M | |
| omi-20030719.pkg | 2025-08-20 06:42 | 57K | |
| omniORB-4.3.3.pkg | 2025-12-19 00:16 | 4.8M | |
| omnibackup-0.2.1_1.pkg | 2025-12-29 07:58 | 39K | |
| omnilinter-0.7.0_15.pkg | 2025-12-30 12:43 | 560K | |
| omnitty-0.3.0_5.pkg | 2025-08-17 12:07 | 13K | |
| omping-0.0.4_1.pkg | 2025-08-21 04:28 | 84K | |
| ompl-1.6.0_8.pkg | 2025-12-28 06:17 | 1.8M | |
| ondir-0.2.4_2.pkg | 2025-08-17 11:41 | 9.0K | |
| oneVPL-2022.1.5.pkg | 2025-12-19 10:51 | 3.4M | |
| onednn-3.10.pkg | 2025-12-21 22:08 | 9.0M | |
| onednn252-2.5.2.pkg | 2025-08-14 22:20 | 5.8M | |
| onedrive-2.5.9.pkg | 2025-12-27 11:33 | 1.1M | |
| onedrivegui-1.3.0.pkg | 2025-12-28 23:12 | 89K | |
| onefetch-2.25.0_2.pkg | 2025-12-27 20:58 | 4.0M | |
| oneko-sakura-1.2_3.pkg | 2025-08-16 12:07 | 29K | |
| onenetd-13.pkg | 2025-08-21 12:40 | 9.8K | |
| oneshot-1.5.1_35.pkg | 2025-12-22 12:13 | 3.1M | |
| onetbb-2022.3.0.pkg | 2025-12-26 11:02 | 333K | |
| oniguruma-6.9.10.pkg | 2025-08-10 22:31 | 253K | |
| onioncat-4.10.0_1.pkg | 2025-12-21 20:15 | 55K | |
| onionscan-0.2_36.pkg | 2025-12-23 07:43 | 3.3M | |
| onis-0.8.2.pkg | 2025-12-23 15:28 | 95K | |
| onlyoffice-documents..> | 2025-12-30 04:54 | 626M | |
| onnx-1.19.1_1.pkg | 2025-12-18 03:31 | 1.1M | |
| onnxruntime-1.23.2.pkg | 2025-12-18 19:52 | 4.5M | |
| onscripter-1byte-202..> | 2025-12-28 03:19 | 175K | |
| onscripter-20230825.pkg | 2025-12-27 23:44 | 192K | |
| oo2c-2.1.11_15.pkg | 2025-12-28 04:23 | 1.7M | |
| ookla-speedtest-1.2...> | 2025-12-22 04:07 | 671K | |
| oolite-1.88_6.pkg | 2025-12-28 08:29 | 96M | |
| ooni-mini-0.23.0_33.pkg | 2025-12-21 21:13 | 5.1M | |
| ooni-probe-cli-3.28...> | 2025-12-23 04:58 | 19M | |
| oonsoo-1.2_3.pkg | 2025-08-16 18:22 | 65K | |
| ooo-0.1.2_13.pkg | 2025-12-28 06:23 | 785K | |
| op-1.34_3.pkg | 2025-08-16 05:23 | 35K | |
| opa-1.10.1_2.pkg | 2025-12-21 03:26 | 9.5M | |
| open-1.4_1.pkg | 2025-08-22 00:04 | 6.1K | |
| open-adventure-1.16_..> | 2025-12-23 13:36 | 52K | |
| open-beagle-3.0.3_1.pkg | 2025-08-20 13:23 | 1.4M | |
| open-isns-0.101_1.pkg | 2025-08-16 10:06 | 128K | |
| open-motif-2.3.8_8.pkg | 2025-12-26 14:01 | 3.8M | |
| open-motif-devel-202..> | 2025-12-28 08:37 | 3.8M | |
| open-simh-4.1.0.2024..> | 2025-12-28 20:36 | 11M | |
| open-vm-kmod-13.0.5...> | 2025-12-19 15:38 | 16K | |
| open-vm-tools-13.0.5..> | 2025-12-30 00:09 | 1.1M | |
| open-vm-tools-nox11-..> | 2025-12-23 21:20 | 786K | |
| open62541-1.4.13.pkg | 2025-12-21 05:23 | 1.0M | |
| openage-0.6.0_1.pkg | 2025-12-28 21:17 | 3.4M | |
| openal-soft-1.24.3.pkg | 2025-12-18 01:47 | 712K | |
| openapi-1.9.0_2.pkg | 2025-12-21 22:26 | 4.1M | |
| openapi-tui-0.10.2_4..> | 2025-12-30 16:25 | 2.4M | |
| openarc-1.0.0.b3.202..> | 2025-08-21 09:55 | 115K | |
| openarena-0.8.8.s191..> | 2025-12-20 04:04 | 717K | |
| openarena-data-0.8.8..> | 2025-08-13 21:05 | 378M | |
| openarena-oax-B51_1.pkg | 2025-12-23 20:24 | 471K | |
| openarena-server-0.8..> | 2025-08-14 06:56 | 318K | |
| openbabel-3.1.1.178_..> | 2025-12-26 19:21 | 4.1M | |
| openbao-2.4.1_4.pkg | 2025-12-21 18:38 | 25M | |
| openbgpd7-7.9.pkg | 2025-08-21 15:41 | 257K | |
| openbgpd8-8.8.pkg | 2025-08-16 19:12 | 279K | |
| openblas-0.3.30,2.pkg | 2025-12-26 05:40 | 8.5M | |
| openblas64-0.3.30.pkg | 2025-12-27 23:40 | 9.8M | |
| openbmp-0.14.0_12.pkg | 2025-12-23 03:15 | 868K | |
| openbor-7757.pkg | 2025-12-30 04:00 | 622K | |
| openbor3482-3482_2.pkg | 2025-12-27 19:46 | 632K | |
| openbor3711-3711_2.pkg | 2025-12-29 20:03 | 618K | |
| openbor3979-3979_2.pkg | 2025-12-30 11:34 | 636K | |
| openbor4432-4432_7.pkg | 2025-12-30 08:42 | 793K | |
| openbor7144-7144_2.pkg | 2025-12-28 21:38 | 625K | |
| openbox-3.6_14.pkg | 2025-12-26 20:24 | 391K | |
| openbox-arc-theme-20..> | 2025-12-30 07:07 | 3.0K | |
| openbsm-1.1.p2_2.pkg | 2025-08-16 05:47 | 192K | |
| openbubbles-1.2_5.pkg | 2025-12-28 09:29 | 864K | |
| openbve-1.11.0.6.pkg | 2025-12-30 17:40 | 13M | |
| openca-ocspd-3.1.3_1..> | 2025-12-22 07:42 | 34K | |
| opencart-4.1.0.3.pkg | 2025-12-29 19:18 | 15M | |
| opencbm-0.4.99.104_2..> | 2025-08-14 18:38 | 822K | |
| opencbm-kmod-0.4.99...> | 2025-08-15 06:20 | 10K | |
| opencbm-plugin-xa154..> | 2025-08-17 15:59 | 5.8K | |
| opencity-0.0.6.5_5.pkg | 2025-12-30 18:57 | 7.5M | |
| opencl-3.0.19.pkg | 2025-12-16 01:30 | 84K | |
| opencl-clang-llvm11-..> | 2025-12-20 00:37 | 89K | |
| opencl-clang-llvm12-..> | 2025-12-19 22:39 | 89K | |
| opencl-clang-llvm13-..> | 2025-12-19 09:09 | 90K | |
| opencl-clang-llvm14-..> | 2025-12-19 13:00 | 95K | |
| opencl-clang-llvm15-..> | 2025-12-23 14:12 | 92K | |
| openclonk-8.1_9.pkg | 2025-12-28 11:24 | 109M | |
| opencoarrays-2.10.1_..> | 2025-12-29 06:31 | 59K | |
| opencollada-1.6.68_5..> | 2025-12-20 01:18 | 5.0M | |
| opencolorio-2.4.2_2.pkg | 2025-12-18 18:34 | 2.4M | |
| opencolorio-tools-2...> | 2025-12-27 21:09 | 4.4M | |
| opencoloriov1-1.1.1.pkg | 2025-08-19 06:05 | 292K | |
| openconnect-9.12_2.pkg | 2025-12-20 03:07 | 229K | |
| openconnect-freebsd-..> | 2025-12-20 17:32 | 2.8K | |
| openconnect-gui-1.5...> | 2025-12-28 23:36 | 329K | |
| opencore-amr-0.1.6.pkg | 2025-08-14 08:03 | 212K | |
| opencpn-5.2.4_10.pkg | 2025-12-28 10:07 | 33M | |
| opencryptoki-3.19.0_..> | 2025-08-14 12:51 | 638K | |
| opencsg-1.6.0_1.pkg | 2025-12-27 16:52 | 75K | |
| openct-0.6.20_3.pkg | 2025-08-20 08:59 | 208K | |
| openctm-1.0.3_4.pkg | 2025-12-30 05:25 | 203K | |
| opencv-4.11.0_4.pkg | 2025-12-26 14:38 | 24M | |
| opencvs-20151230_1.pkg | 2025-08-19 04:23 | 131K | |
| opencyc-0.7.0_3.pkg | 2025-12-21 10:30 | 31M | |
| opendbviewer-1.2.0.pkg | 2025-12-29 00:34 | 386K | |
| opendbx-1.4.6_6.pkg | 2025-12-22 18:09 | 79K | |
| opendchub-0.8.3_1.pkg | 2025-12-21 21:42 | 73K | |
| opendht-3.3.1_3.pkg | 2025-12-19 03:25 | 1.0M | |
| opendircolors-0.0.2_..> | 2025-08-18 11:02 | 9.1K | |
| opendkim-2.10.3_20.pkg | 2025-12-19 20:57 | 325K | |
| opendkim-devel-2.11...> | 2025-12-21 06:18 | 329K | |
| opendmarc-1.4.2_4.pkg | 2025-12-18 19:32 | 123K | |
| opendnssec2-2.1.14_1..> | 2025-12-30 07:12 | 442K | |
| opendoas-6.8.2.pkg | 2025-08-20 05:06 | 18K | |
| opendx-4.4.4_40.pkg | 2025-12-26 16:40 | 12M | |
| openemr-php81-7.0.3.pkg | 2025-12-28 11:07 | 146M | |
| openemr-php82-7.0.3.pkg | 2025-12-28 03:24 | 146M | |
| openemr-php83-7.0.3.pkg | 2025-12-28 01:05 | 146M | |
| openemr-php84-7.0.3.pkg | 2025-12-30 13:49 | 146M | |
| openemr-php85-7.0.3.pkg | 2025-12-29 02:33 | 146M | |
| openems-0.0.36_7.pkg | 2025-12-27 09:01 | 394K | |
| openexr-3.4.4.pkg | 2025-12-24 21:51 | 882K | |
| openexr-website-docs..> | 2025-12-22 08:38 | 1.5M | |
| openfec-1.4.2.12_1.pkg | 2025-12-23 09:36 | 223K | |
| openfhe-1.2.4.pkg | 2025-12-29 15:57 | 1.9M | |
| openfire-5.0.2,1.pkg | 2025-12-29 05:19 | 60M | |
| openfortivpn-1.24.0.pkg | 2025-12-29 18:46 | 47K | |
| openfpgaloader-1.0.0..> | 2025-12-22 06:51 | 2.5M | |
| openfst-vosk-2021020..> | 2025-08-13 19:43 | 844K | |
| openfts-0.40_5.pkg | 2025-12-21 13:18 | 86K | |
| openfx-misc-2.4.3.pkg | 2025-08-15 06:28 | 3.1M | |
| opengist-1.11.1.pkg | 2025-12-22 00:34 | 14M | |
| opengl-man-657.2_1.pkg | 2025-08-21 06:04 | 357K | |
| openglad-0.98_10.pkg | 2025-12-21 20:05 | 492K | |
| opengrok-1.14.1.pkg | 2025-12-30 01:59 | 51M | |
| opengv-g20200806_1.pkg | 2025-08-20 20:41 | 744K | |
| openh264-2.6.0,2.pkg | 2025-08-11 00:05 | 589K | |
| openhab-4.3.9.pkg | 2025-12-27 13:07 | 101M | |
| openhab-addons-4.3.9..> | 2025-12-29 09:15 | 430M | |
| openhab2-2.5.12.pkg | 2025-12-27 04:16 | 74M | |
| openhab2-addons-2.5...> | 2025-12-29 18:07 | 187M | |
| openhantek-3.4.0.202..> | 2025-12-30 04:42 | 465K | |
| openicc-config-0.1.0..> | 2025-12-18 19:53 | 52K | |
| openiked-7.4_1.pkg | 2025-08-21 12:41 | 216K | |
| openimageio-2.5.13.1..> | 2025-12-26 22:45 | 3.2M | |
| openipmi-2.0.29_1.pkg | 2025-12-19 23:04 | 1.0M | |
| openjade-1.3.3p1_5.pkg | 2025-12-18 18:10 | 1.7M | |
| openjazz-20240919.pkg | 2025-12-29 06:09 | 158K | |
| openjdk-jre-25.0.1+8..> | 2025-12-28 04:52 | 40M | |
| openjdk8-8.472.08.1.pkg | 2025-12-26 09:55 | 84M | |
| openjdk8-jre-8.472.0..> | 2025-12-28 11:38 | 29M | |
| openjdk11-11.0.29+7...> | 2025-12-26 16:54 | 164M | |
| openjdk11-jre-11.0.2..> | 2025-12-29 18:41 | 26M | |
| openjdk17-17.0.17+10..> | 2025-12-26 18:27 | 158M | |
| openjdk17-jre-17.0.1..> | 2025-12-30 10:59 | 28M | |
| openjdk18-18.0.2+9.1..> | 2025-12-26 10:45 | 158M | |
| openjdk19-19.0.2+7.1..> | 2025-12-26 11:39 | 164M | |
| openjdk20-20.0.2+9.1..> | 2025-12-26 14:37 | 164M | |
| openjdk21-21.0.9+10...> | 2025-12-26 18:00 | 168M | |
| openjdk21-jre-21.0.9..> | 2025-12-29 12:41 | 31M | |
| openjdk22-22.0.2+9.1..> | 2025-12-26 18:27 | 168M | |
| openjdk23-23.0.2+7.2..> | 2025-12-27 02:07 | 176M | |
| openjdk24-24.0.2+12...> | 2025-12-27 08:27 | 187M | |
| openjdk25-25.0.1+8.f..> | 2025-12-28 04:18 | 188M | |
| openjdk25-headless-2..> | 2025-12-30 03:46 | 188M | |
| openjdk25-jre-headle..> | 2025-12-30 00:23 | 39M | |
| openjk-g20221013_1.pkg | 2025-12-28 19:40 | 3.1M | |
| openjpeg-2.5.4_1.pkg | 2025-12-26 03:18 | 332K | |
| openjpeg15-1.5.2_4.pkg | 2025-12-26 22:18 | 147K | |
| openjph-0.25.3.pkg | 2025-12-24 21:49 | 209K | |
| openkim-models-2021...> | 2025-12-26 23:25 | 64M | |
| openldap25-client-2...> | 2025-08-15 01:08 | 1.1M | |
| openldap25-server-2...> | 2025-08-22 06:05 | 1.3M | |
| openldap26-client-2...> | 2025-08-13 01:47 | 1.1M | |
| openldap26-server-2...> | 2025-08-15 15:24 | 1.4M | |
| openlibm-0.8.7.pkg | 2025-08-14 08:19 | 109K | |
| openlldp-0.4.a_3.pkg | 2025-08-16 03:12 | 25K | |
| openmdns-0.7_3.pkg | 2025-08-17 23:18 | 2.4M | |
| openmesh-11.0.0.pkg | 2025-12-30 09:30 | 1.1M | |
| openmodelica-1.25.7.pkg | 2025-12-28 02:11 | 20M | |
| openmolcas-25.10.pkg | 2025-12-30 03:10 | 44M | |
| openmortal-0.7_13.pkg | 2025-12-28 03:29 | 48M | |
| openmpi-5.0.9_1.pkg | 2025-12-26 09:42 | 6.9M | |
| openmpi4-4.1.8_1.pkg | 2025-12-26 09:34 | 2.9M | |
| openmsx-20.0.pkg | 2025-12-27 17:25 | 4.8M | |
| openmvg-2.1_7.pkg | 2025-12-28 14:20 | 2.9M | |
| openmvs-2.3.0_1.pkg | 2025-12-29 01:00 | 1.6M | |
| openmw-0.50.0_1.pkg | 2025-12-30 14:42 | 13M | |
| openmx-3.9.9_2.pkg | 2025-12-28 16:54 | 91M | |
| opennn-6.0.4.pkg | 2025-08-21 22:07 | 1.5M | |
| openntpd-6.8p1_10,2.pkg | 2025-12-21 15:23 | 51K | |
| opennurbs-20130711_3..> | 2025-08-14 00:13 | 14M | |
| openobex-1.7.2.pkg | 2025-08-15 20:42 | 135K | |
| openocd-0.12.0_5.pkg | 2025-12-18 18:54 | 1.6M | |
| openocd-devel-g20250..> | 2025-12-21 20:26 | 1.8M | |
| openomf-0.8.3_1.pkg | 2025-12-28 16:36 | 5.8M | |
| openpgl-0.6.0_1.pkg | 2025-12-28 04:42 | 241K | |
| openpgm-5.2.122_6.pkg | 2025-08-13 03:40 | 331K | |
| openprinting-1.0_6.pkg | 2025-12-20 09:26 | 88K | |
| openr2-1.3.3_1.pkg | 2025-08-14 00:38 | 76K | |
| openra-20210321_1.pkg | 2025-12-28 02:31 | 22M | |
| openradius-0.9.14.pkg | 2025-08-18 20:24 | 120K | |
| openrct2-0.4.29.pkg | 2025-12-29 17:09 | 69M | |
| openresolv-3.17.3.pkg | 2025-12-22 00:48 | 26K | |
| openresty-1.27.1.2.pkg | 2025-12-21 23:09 | 1.3M | |
| openrgb-0.8_2.pkg | 2025-12-28 17:25 | 1.5M | |
| openrm-1.6.0.2_4.pkg | 2025-12-29 19:02 | 3.7M | |
| openroad-2.0.2025021..> | 2025-12-27 17:37 | 17M | |
| openrsync-0.0.202501..> | 2025-08-21 12:17 | 67K | |
| opensaml-3.3.1.pkg | 2025-12-19 00:45 | 1.1M | |
| opensbi-1.7.pkg | 2025-08-15 09:48 | 89K | |
| opensc-0.26.1.pkg | 2025-12-23 06:36 | 1.7M | |
| openscad-2025.05.08_..> | 2025-12-28 10:02 | 6.1M | |
| openscad-devel-2025...> | 2025-12-28 12:00 | 6.3M | |
| openscop-0.9.7.pkg | 2025-08-15 05:04 | 135K | |
| openseachest-23.12_2..> | 2025-08-18 17:59 | 1.0M | |
| opensearch-3.2.0_1.pkg | 2025-12-30 06:08 | 772M | |
| opensearch-dashboard..> | 2025-12-30 17:52 | 208M | |
| opensearch-dashboard..> | 2025-12-27 05:05 | 181M | |
| opensearch13-1.3.10.pkg | 2025-12-30 11:59 | 218M | |
| opensearch210-2.10.0..> | 2025-12-29 19:23 | 573M | |
| opensearch213-2.13.0..> | 2025-12-29 11:44 | 614M | |
| opensearch216-2.16.0..> | 2025-12-28 05:47 | 636M | |
| opensearch219-2.19.3..> | 2025-12-27 18:23 | 724M | |
| openshadinglanguage-..> | 2025-12-27 08:48 | 2.0M | |
| openslide-4.0.0_3.pkg | 2025-12-27 02:08 | 114K | |
| openslp-2.0.0_1.pkg | 2025-08-13 09:56 | 396K | |
| opensmtpd-7.6.0,1.pkg | 2025-08-13 23:30 | 368K | |
| opensmtpd-extras-6.7..> | 2025-12-20 05:29 | 709 | |
| opensmtpd-extras-que..> | 2025-08-20 11:15 | 18K | |
| opensmtpd-extras-sch..> | 2025-08-22 20:51 | 20K | |
| opensmtpd-extras-tab..> | 2025-08-15 08:43 | 27K | |
| opensmtpd-extras-tab..> | 2025-12-19 14:06 | 19K | |
| opensmtpd-extras-tab..> | 2025-08-15 21:05 | 18K | |
| opensmtpd-extras-tab..> | 2025-12-19 10:20 | 18K | |
| opensmtpd-extras-tab..> | 2025-08-14 13:26 | 20K | |
| opensmtpd-extras-tab..> | 2025-08-15 02:35 | 17K | |
| opensmtpd-extras-tab..> | 2025-12-19 21:12 | 21K | |
| opensmtpd-filter-dki..> | 2025-12-22 13:55 | 15K | |
| opensmtpd-filter-rsp..> | 2025-12-21 01:15 | 2.0M | |
| opensmtpd-filter-sen..> | 2025-12-23 17:59 | 828K | |
| opensmtpd-table-sqli..> | 2025-12-22 09:10 | 14K | |
| opensonic-0.1.4_5.pkg | 2025-12-30 02:45 | 9.5M | |
| openspades-0.1.3_5.pkg | 2025-12-27 20:27 | 11M | |
| openssh-portable-10...> | 2025-12-30 11:05 | 1.1M | |
| openssh-portable-gss..> | 2025-12-30 07:28 | 1.1M | |
| openssh-portable-hpn..> | 2025-12-27 20:13 | 1.1M | |
| openssl-3.0.18,1.pkg | 2025-12-22 20:53 | 5.9M | |
| openssl-agent-0.17.0..> | 2025-12-21 12:26 | 67K | |
| openssl-oqsprovider-..> | 2025-12-30 08:31 | 84K | |
| openssl-quictls-3.0...> | 2025-08-18 01:53 | 5.8M | |
| openssl-unsafe-1.0.2..> | 2025-08-14 14:13 | 2.1M | |
| openssl32-3.2.5.pkg | 2025-08-20 17:54 | 6.8M | |
| openssl33-3.3.5.pkg | 2025-12-23 16:56 | 6.9M | |
| openssl33-quictls-3...> | 2025-08-17 04:49 | 6.9M | |
| openssl34-3.4.3.pkg | 2025-12-22 10:53 | 7.0M | |
| openssl35-3.5.4.pkg | 2025-12-20 23:25 | 7.8M | |
| openssl36-3.6.0.pkg | 2025-12-21 01:21 | 7.9M | |
| openssl111-1.1.1w_2.pkg | 2025-08-19 00:35 | 3.7M | |
| openssn-1.4_7.pkg | 2025-12-27 21:01 | 5.6M | |
| opensubdiv-3.6.0_3.pkg | 2025-12-27 11:35 | 31M | |
| opensurge-0.1.r765_8..> | 2025-12-30 04:27 | 159M | |
| opensycl-0.9.4.pkg | 2025-12-20 20:05 | 528K | |
| opentelemetry-cpp-1...> | 2025-12-18 04:49 | 741K | |
| opentelemetry-proto-..> | 2025-12-22 02:17 | 19K | |
| opentimelineio-0.18...> | 2025-12-18 16:28 | 239K | |
| opentimer-2.1.0.2025..> | 2025-12-23 18:17 | 11M | |
| opentofu-1.11.2.pkg | 2025-12-30 18:24 | 24M | |
| opentoonz-1.5.0_11.pkg | 2025-12-28 02:28 | 22M | |
| openttd-14.1_1.pkg | 2025-12-30 08:46 | 6.5M | |
| openttd-opengfx-7.1.pkg | 2025-08-17 05:23 | 3.0M | |
| openttd-openmsx-0.4...> | 2025-08-19 00:26 | 97K | |
| openttd-opensfx-1.0...> | 2025-08-22 01:25 | 10M | |
| openturns-1.25.1_1.pkg | 2025-12-27 00:18 | 18M | |
| opentyrian-2.1.20221..> | 2025-12-29 18:13 | 240K | |
| openuniverse-1.0.b3_..> | 2025-12-29 17:24 | 3.9M | |
| openupsd-0.3.1_1.pkg | 2025-08-22 22:41 | 31K | |
| openvanilla-framewor..> | 2025-08-14 19:37 | 5.3K | |
| openvas-23.31.4.pkg | 2025-12-26 20:38 | 264K | |
| openvdb-13.0.0.pkg | 2025-12-26 18:26 | 7.1M | |
| openvkl-2.0.1_2.pkg | 2025-12-30 18:28 | 5.0M | |
| openvmps-1.4.06_1.pkg | 2025-08-16 17:50 | 17K | |
| openvox-agent8-8.22...> | 2025-12-26 22:24 | 1.2M | |
| openvox-server8-8.11..> | 2025-12-29 19:44 | 60M | |
| openvoxdb-terminus8-..> | 2025-12-22 09:16 | 19K | |
| openvoxdb8-8.11.0.pkg | 2025-12-30 11:52 | 53M | |
| openvpn-2.6.16.pkg | 2025-12-27 18:06 | 638K | |
| openvpn-admin-1.9.4_..> | 2025-12-30 12:43 | 50K | |
| openvpn-auth-ldap-2...> | 2025-08-16 15:49 | 57K | |
| openvpn-auth-oauth2-..> | 2025-12-20 23:28 | 3.8M | |
| openvpn-auth-radius-..> | 2025-12-29 03:01 | 97K | |
| openvpn-auth-script-..> | 2025-08-17 10:27 | 3.7K | |
| openvpn-devel-g20251..> | 2025-12-30 00:38 | 638K | |
| openvsp-3.46.0_1.pkg | 2025-12-28 00:17 | 56M | |
| openvswitch-2.17.12.pkg | 2025-12-21 17:04 | 1.9M | |
| openxcom-1.0_12.pkg | 2025-12-29 13:42 | 1.3M | |
| openxr-1.1.54.pkg | 2025-12-26 23:43 | 244K | |
| openyahtzee-1.9.3_9.pkg | 2025-12-29 12:42 | 137K | |
| openzfs-2.3.5,1.pkg | 2025-12-23 14:49 | 3.3M | |
| openzfs-kmod-2.3.5.1..> | 2025-12-19 20:50 | 7.6M | |
| openzl-0.1.0.pkg | 2025-12-20 15:22 | 2.4M | |
| openzwave-1.4.3254.pkg | 2025-08-20 22:40 | 627K | |
| ophcrack-3.8.0_1.pkg | 2025-12-28 06:42 | 196K | |
| opie-1.20230501_1.pkg | 2025-08-19 10:42 | 58K | |
| opkg-openwrt-2018080..> | 2025-08-17 01:48 | 72K | |
| opkssh-0.10.0.pkg | 2025-12-20 17:17 | 4.1M | |
| opsin-3.0.20190223_1..> | 2025-12-29 00:42 | 6.6M | |
| optar-2015.02.09_3.pkg | 2025-12-29 13:04 | 35K | |
| optench-1.2.5.pkg | 2025-12-28 01:47 | 1.2M | |
| optipng-0.7.8_1.pkg | 2025-12-26 22:07 | 103K | |
| optpp-2.4_2.pkg | 2025-12-28 11:48 | 727K | |
| opus-1.6.pkg | 2025-12-24 20:08 | 4.2M | |
| opus-tools-0.2_4.pkg | 2025-12-27 09:46 | 57K | |
| opusfile-0.12_1.pkg | 2025-12-26 11:31 | 85K | |
| opustags-1.10.1.13.pkg | 2025-12-22 05:44 | 36K | |
| oq-0.0.21.pkg | 2025-12-28 08:22 | 3.3M | |
| or-aspell-0.03.1_1,2..> | 2025-12-22 07:31 | 16K | |
| or-libreoffice-25.8...> | 2025-12-27 14:45 | 416K | |
| or-tools-9.14_1.pkg | 2025-12-26 22:00 | 7.5M | |
| ora2pg-25.0.pkg | 2025-12-21 23:05 | 385K | |
| orage-4.20.2.pkg | 2025-12-28 12:39 | 1.0M | |
| orangehrm-5.8.pkg | 2025-12-29 12:16 | 12M | |
| orbit-lv2-0.1.661.pkg | 2025-08-18 02:55 | 46K | |
| orbital_eunuchs_snip..> | 2025-12-30 05:25 | 3.7M | |
| orbiton-2.68.8_3.pkg | 2025-08-17 09:27 | 4.0M | |
| orbitron-g20110525.pkg | 2025-12-30 12:02 | 45K | |
| orc-0.4.41_1.pkg | 2025-08-10 21:44 | 445K | |
| orca-47.5.pkg | 2025-12-27 10:24 | 1.9M | |
| orcania-2.3.3.pkg | 2025-08-13 13:15 | 21K | |
| ord-crypto-wallet-0...> | 2025-12-30 02:55 | 5.6M | |
| orderless.el-1.5_1.pkg | 2025-12-28 21:29 | 23K | |
| orderless.el-emacs_c..> | 2025-12-30 16:53 | 23K | |
| orderless.el-emacs_d..> | 2025-12-29 01:22 | 23K | |
| orderless.el-emacs_d..> | 2025-12-22 16:49 | 23K | |
| orderless.el-emacs_n..> | 2025-12-22 00:29 | 23K | |
| orderless.el-emacs_w..> | 2025-12-28 12:25 | 23K | |
| oregano-0.84.43_7.pkg | 2025-12-29 16:05 | 1.2M | |
| oroborus-2.0.20_1.pkg | 2025-12-20 15:31 | 133K | |
| orpie-1.6.1.pkg | 2025-08-18 10:13 | 1.1M | |
| orthanc-1.12.10.pkg | 2025-12-27 17:44 | 2.4M | |
| orthanc-dicomweb-1.2..> | 2025-12-29 13:28 | 1.2M | |
| orthanc-mysql-5.2_1.pkg | 2025-12-29 13:38 | 539K | |
| orthanc-postgresql-1..> | 2025-12-29 00:27 | 617K | |
| orthanc-webviewer-2...> | 2025-12-29 16:59 | 667K | |
| orthorobot-1.1.1.1_1..> | 2025-12-29 12:22 | 3.3M | |
| ortp-5.4.28.pkg | 2025-12-18 15:51 | 157K | |
| orville-write-2.55_2..> | 2025-08-21 03:31 | 44K | |
| osbf-lua-2.0.4.pkg | 2025-12-21 11:50 | 41K | |
| osc-1.21.0.pkg | 2025-12-30 00:47 | 884K | |
| oscam-1.20.20210729_..> | 2025-12-21 22:22 | 633K | |
| osdclock-0.5_11.pkg | 2025-08-22 12:07 | 4.5K | |
| osdlyrics-0.4.3_7.pkg | 2025-12-28 20:59 | 241K | |
| osdmixer-0.9_7.pkg | 2025-08-15 22:52 | 4.2K | |
| osg-3.6.5_84.pkg | 2025-12-26 21:14 | 7.1M | |
| osgg-1.0_2.pkg | 2025-12-28 18:19 | 147K | |
| osinfo-db-20251212.pkg | 2025-12-18 09:44 | 199K | |
| osinfo-db-tools-1.12..> | 2025-12-18 06:42 | 41K | |
| osm-gps-map-1.1.0_2.pkg | 2025-12-27 13:28 | 112K | |
| osm2mp-r475_2.pkg | 2025-12-30 08:13 | 46K | |
| osm2pgrouting-3.0.0.pkg | 2025-12-21 18:51 | 122K | |
| osm2pgsql-2.2.0_1.pkg | 2025-12-29 14:36 | 680K | |
| osmium-tool-1.16.0_5..> | 2025-12-23 03:40 | 580K | |
| osmosis-0.49.2.pkg | 2025-12-28 02:42 | 13M | |
| osqp-0.6.3.pkg | 2025-08-14 19:25 | 57K | |
| osrm-backend-6.0.0.g..> | 2025-12-29 17:34 | 8.0M | |
| osrtspproxy-2.0_1.pkg | 2025-08-18 21:37 | 44K | |
| oss-4.2.b2019.140300..> | 2025-12-26 23:13 | 1.0M | |
| ossec-hids-3.8.0.pkg | 2025-12-20 21:25 | 760 | |
| ossec-hids-agent-3.8..> | 2025-12-19 09:29 | 291K | |
| ossec-hids-agent-con..> | 2025-12-21 03:47 | 4.8K | |
| ossec-hids-local-3.8..> | 2025-12-18 22:39 | 662K | |
| ossec-hids-local-con..> | 2025-12-19 22:29 | 6.6K | |
| ossec-hids-server-3...> | 2025-12-19 11:37 | 663K | |
| ossec-hids-server-co..> | 2025-12-21 00:00 | 7.6K | |
| ossim-2.12.0_3.pkg | 2025-12-29 21:20 | 5.0M | |
| osslsigncode-2.10.pkg | 2025-12-29 17:14 | 79K | |
| ossp-uuid-1.6.2_11.pkg | 2025-08-14 06:59 | 78K | |
| osticket-php84-1.18...> | 2025-12-29 15:58 | 39M | |
| osv-scanner-2.3.0_1.pkg | 2025-12-23 10:49 | 14M | |
| ot-recorder-1.0.1.pkg | 2025-12-24 01:21 | 368K | |
| otelcol-contrib-0.13..> | 2025-12-23 17:37 | 61M | |
| otf2bdf-3.1_1.pkg | 2025-12-29 19:56 | 15K | |
| otk-0.96_4.pkg | 2025-08-21 03:21 | 91K | |
| otpw-1.5_1.pkg | 2025-08-17 00:40 | 36K | |
| otree-0.6.3_1.pkg | 2025-12-30 08:13 | 1.3M | |
| otrs-6.0.29_3.pkg | 2025-12-28 17:32 | 7.4M | |
| ots-9.2.0.pkg | 2025-12-26 20:48 | 324K | |
| ott-0.33.pkg | 2025-08-17 09:53 | 1.3M | |
| otter-3.3f_4.pkg | 2025-08-17 22:29 | 833K | |
| ouch-0.6.1_6.pkg | 2025-12-27 21:00 | 1.7M | |
| oura-1.8.4_17.pkg | 2025-12-28 17:10 | 1.3M | |
| outcome-2.2.12.pkg | 2025-08-19 13:31 | 78K | |
| outside-0.5.0_4.pkg | 2025-12-30 10:31 | 1.3M | |
| ov-0.45.1_2.pkg | 2025-12-22 15:39 | 2.5M | |
| ovhcloud-cli-0.9.0.pkg | 2025-12-21 04:47 | 5.7M | |
| ovs-1.06.pkg | 2025-12-30 10:02 | 25K | |
| owamp-3.3_1.pkg | 2025-08-18 07:39 | 263K | |
| owasp-dependency-che..> | 2025-12-30 12:12 | 12M | |
| owfs-3.2p4_3.pkg | 2025-08-18 01:47 | 623K | |
| owl-lisp-0.2.2_1.pkg | 2025-08-15 23:31 | 263K | |
| owncast-0.2.1_4.pkg | 2025-12-30 08:56 | 27M | |
| owncloud-php81-10.16..> | 2025-12-29 03:33 | 49M | |
| owncloud-php82-10.16..> | 2025-12-28 06:40 | 49M | |
| owncloud-php83-10.16..> | 2025-12-29 04:37 | 49M | |
| owncloud-php84-10.16..> | 2025-12-29 08:46 | 49M | |
| owncloud-php85-10.16..> | 2025-12-29 01:27 | 49M | |
| owncloudclient-2.8.2..> | 2025-12-29 02:33 | 1.5M | |
| owntone-29.0_1.pkg | 2025-12-28 06:34 | 788K | |
| owrep-1.2_1.pkg | 2025-12-23 05:39 | 15K | |
| ox-gfm.el-1.0p202312..> | 2025-08-30 06:47 | 4.9K | |
| ox-text-editor-0.7.7..> | 2025-12-28 14:37 | 1.3M | |
| oxipng-10.0.0_1.pkg | 2025-12-27 14:36 | 520K | |
| oxygen-fonts-5.4.3.pkg | 2025-08-17 22:35 | 51K | |
| oxygen-icons-6.1.0.pkg | 2025-08-13 11:37 | 31M | |
| oyranos-0.9.6_19.pkg | 2025-12-27 15:00 | 1.0M | |
| oysttyer-2.10.0.pkg | 2025-12-21 05:07 | 70K | |
| p0f-3.09b_1.pkg | 2025-08-18 07:27 | 74K | |
| p4-2025.2.2852709.pkg | 2025-12-27 16:17 | 2.6M | |
| p4.el-10.6_1.pkg | 2025-12-30 03:05 | 27K | |
| p4api-2025.2.2852709..> | 2025-12-27 18:00 | 1.7M | |
| p4delta-1.3.2_1.pkg | 2025-12-28 01:45 | 13K | |
| p4genpatch-1.pkg | 2025-12-28 05:20 | 4.3K | |
| p5-AI-Categorizer-0...> | 2025-12-20 05:41 | 89K | |
| p5-AI-DecisionTree-0..> | 2025-12-19 07:49 | 22K | |
| p5-AI-Genetic-0.05_1..> | 2025-12-21 16:11 | 29K | |
| p5-AI-NeuralNet-Back..> | 2025-12-20 07:52 | 35K | |
| p5-AI-Pathfinding-AS..> | 2025-12-24 05:52 | 6.8K | |
| p5-AI-Perceptron-1.0..> | 2025-12-20 08:19 | 8.2K | |
| p5-AI-Prolog-0.741_1..> | 2025-12-21 10:05 | 97K | |
| p5-AMF-Perl-0.15_3.pkg | 2025-12-19 08:54 | 33K | |
| p5-ARGV-Struct-0.06.pkg | 2025-12-20 00:38 | 7.1K | |
| p5-AWS-Signature4-1...> | 2025-12-20 03:45 | 8.4K | |
| p5-AcePerl-1.92_5.pkg | 2025-12-22 19:57 | 257K | |
| p5-Acme-6502-0.77_2.pkg | 2025-12-20 22:58 | 17K | |
| p5-Acme-ButFirst-1.0..> | 2025-12-21 17:18 | 4.2K | |
| p5-Acme-Comment-1.04..> | 2025-12-21 04:09 | 8.4K | |
| p5-Acme-Damn-0.06.pkg | 2025-12-18 22:32 | 10K | |
| p5-Acme-GuessNumber-..> | 2025-12-20 16:59 | 5.5K | |
| p5-Acme-HTTP-0.10.pkg | 2025-12-19 12:35 | 6.0K | |
| p5-Acme-MetaSyntacti..> | 2025-12-20 04:52 | 54K | |
| p5-Acme-Monta-0.01_1..> | 2025-12-19 22:02 | 3.7K | |
| p5-Acme-Steganograph..> | 2025-12-27 09:55 | 6.6K | |
| p5-Adapter-Async-0.0..> | 2025-12-18 18:01 | 19K | |
| p5-AddressBook-0.16_..> | 2025-12-20 12:03 | 43K | |
| p5-Agent-3.20_1.pkg | 2025-12-23 10:38 | 18K | |
| p5-Algorithm-Account..> | 2025-12-27 18:44 | 11K | |
| p5-Algorithm-Annotat..> | 2025-12-19 01:39 | 3.0K | |
| p5-Algorithm-Backoff..> | 2025-12-20 02:39 | 32K | |
| p5-Algorithm-BinPack..> | 2025-12-22 02:44 | 6.0K | |
| p5-Algorithm-Bucketi..> | 2025-12-21 11:28 | 13K | |
| p5-Algorithm-C3-0.11..> | 2025-12-18 00:36 | 8.0K | |
| p5-Algorithm-CheckDi..> | 2025-12-21 21:19 | 107K | |
| p5-Algorithm-ChooseS..> | 2025-12-21 12:44 | 4.4K | |
| p5-Algorithm-Cluster..> | 2025-12-20 11:23 | 40K | |
| p5-Algorithm-Combina..> | 2025-12-18 18:49 | 19K | |
| p5-Algorithm-Cron-0...> | 2025-12-21 05:18 | 7.9K | |
| p5-Algorithm-CurveFi..> | 2025-12-22 10:12 | 9.6K | |
| p5-Algorithm-Depende..> | 2025-12-19 20:49 | 31K | |
| p5-Algorithm-Depende..> | 2025-12-22 02:23 | 7.3K | |
| p5-Algorithm-Diff-1...> | 2025-12-18 03:47 | 36K | |
| p5-Algorithm-Evoluti..> | 2025-12-30 08:12 | 204K | |
| p5-Algorithm-FloodCo..> | 2025-12-19 04:20 | 13K | |
| p5-Algorithm-Include..> | 2025-12-20 19:49 | 6.6K | |
| p5-Algorithm-Interva..> | 2025-12-23 13:56 | 4.5K | |
| p5-Algorithm-LCS-1.0..> | 2025-12-24 03:15 | 10K | |
| p5-Algorithm-LUHN-1...> | 2025-12-20 14:46 | 6.3K | |
| p5-Algorithm-Line-Br..> | 2025-12-21 21:45 | 4.2K | |
| p5-Algorithm-MarkovC..> | 2025-12-22 01:39 | 6.7K | |
| p5-Algorithm-Merge-0..> | 2025-12-20 02:41 | 9.6K | |
| p5-Algorithm-MinMax-..> | 2025-12-24 05:14 | 3.3K | |
| p5-Algorithm-Munkres..> | 2025-12-21 03:27 | 8.5K | |
| p5-Algorithm-NaiveBa..> | 2025-12-20 00:46 | 10K | |
| p5-Algorithm-Network..> | 2025-12-21 02:55 | 35K | |
| p5-Algorithm-Numeric..> | 2025-12-20 18:17 | 5.9K | |
| p5-Algorithm-Pair-Be..> | 2025-12-21 21:29 | 10K | |
| p5-Algorithm-Pair-Sw..> | 2025-12-21 02:08 | 8.0K | |
| p5-Algorithm-Permute..> | 2025-12-19 20:33 | 14K | |
| p5-Algorithm-RabinKa..> | 2025-12-22 17:40 | 9.7K | |
| p5-Algorithm-SVM-0.1..> | 2025-12-19 12:45 | 57K | |
| p5-Alias-2.32_3.pkg | 2025-12-24 04:51 | 16K | |
| p5-Alien-Base-Module..> | 2025-12-18 11:41 | 68K | |
| p5-Alien-Build-2.84.pkg | 2025-12-18 08:40 | 375K | |
| p5-Alien-GSL-1.07_1.pkg | 2025-12-19 09:39 | 4.7K | |
| p5-Alien-Gimp-0.10.pkg | 2025-12-29 18:04 | 3.3K | |
| p5-Alien-LibGumbo-0...> | 2025-12-18 18:25 | 6.6K | |
| p5-Alien-SDL-1.446_1..> | 2025-12-26 21:18 | 12K | |
| p5-Alien-cmake3-0.10..> | 2025-12-30 08:27 | 7.7K | |
| p5-Alien-wxWidgets-0..> | 2025-12-30 04:05 | 12K | |
| p5-Alt-Crypt-RSA-Big..> | 2025-12-18 16:35 | 52K | |
| p5-Alzabo-0.92_1.pkg | 2025-12-19 02:47 | 265K | |
| p5-Amazon-SQS-Simple..> | 2025-12-21 04:14 | 16K | |
| p5-Amazon-SimpleDB-0..> | 2025-12-21 06:56 | 20K | |
| p5-Amon2-6.16.pkg | 2025-12-18 20:36 | 422K | |
| p5-Amon2-DBI-0.33.pkg | 2025-12-23 18:22 | 4.4K | |
| p5-Amon2-Lite-0.13.pkg | 2025-12-24 05:47 | 9.6K | |
| p5-Amon2-Plugin-LogD..> | 2025-12-20 08:05 | 3.1K | |
| p5-Amon2-Plugin-Web-..> | 2025-12-19 20:18 | 4.6K | |
| p5-Amon2-Plugin-Web-..> | 2025-12-21 15:41 | 9.4K | |
| p5-Any-Daemon-0.96,1..> | 2025-12-30 06:28 | 8.8K | |
| p5-Any-Moose-0.27.pkg | 2025-12-18 11:57 | 6.0K | |
| p5-Any-Moose-Convert..> | 2025-12-22 12:57 | 3.9K | |
| p5-Any-Template-1.01..> | 2025-12-19 07:59 | 19K | |
| p5-Any-URI-Escape-0...> | 2025-12-18 21:21 | 3.0K | |
| p5-AnyData-0.12.pkg | 2025-12-19 20:19 | 68K | |
| p5-AnyEvent-7.17,1.pkg | 2025-12-18 10:19 | 355K | |
| p5-AnyEvent-AIO-1.1_..> | 2025-12-18 12:30 | 3.0K | |
| p5-AnyEvent-BDB-1.1_..> | 2025-12-21 18:46 | 3.1K | |
| p5-AnyEvent-CacheDNS..> | 2025-12-18 13:14 | 4.5K | |
| p5-AnyEvent-Connecti..> | 2025-12-19 04:56 | 8.2K | |
| p5-AnyEvent-Connecto..> | 2025-12-19 05:10 | 7.9K | |
| p5-AnyEvent-CouchDB-..> | 2025-12-21 14:56 | 28K | |
| p5-AnyEvent-DBD-Pg-0..> | 2025-12-23 14:10 | 6.1K | |
| p5-AnyEvent-DBI-3.04..> | 2025-12-19 21:03 | 13K | |
| p5-AnyEvent-DBI-Abst..> | 2025-12-23 11:36 | 3.0K | |
| p5-AnyEvent-DBus-0.3..> | 2025-12-27 17:12 | 4.7K | |
| p5-AnyEvent-DNS-EtcH..> | 2025-12-22 13:32 | 6.6K | |
| p5-AnyEvent-Filesys-..> | 2025-12-19 12:14 | 21K | |
| p5-AnyEvent-Fork-1.3..> | 2025-12-19 01:02 | 33K | |
| p5-AnyEvent-Gearman-..> | 2025-12-21 03:12 | 22K | |
| p5-AnyEvent-Graphite..> | 2025-12-21 19:37 | 6.3K | |
| p5-AnyEvent-HTTP-2.2..> | 2025-12-18 13:44 | 27K | |
| p5-AnyEvent-HTTP-LWP..> | 2025-12-22 21:16 | 9.1K | |
| p5-AnyEvent-HTTPD-0...> | 2025-12-20 00:10 | 23K | |
| p5-AnyEvent-I3-0.19.pkg | 2025-12-19 00:30 | 9.6K | |
| p5-AnyEvent-IRC-0.97..> | 2025-12-23 15:28 | 40K | |
| p5-AnyEvent-MPRPC-0...> | 2025-12-23 19:43 | 14K | |
| p5-AnyEvent-MQTT-1.1..> | 2025-12-20 22:24 | 21K | |
| p5-AnyEvent-Memcache..> | 2025-12-22 01:43 | 16K | |
| p5-AnyEvent-MessageP..> | 2025-12-19 09:01 | 3.0K | |
| p5-AnyEvent-RPC-0.05..> | 2025-12-20 07:50 | 8.1K | |
| p5-AnyEvent-RabbitMQ..> | 2025-12-20 01:52 | 55K | |
| p5-AnyEvent-Redis-0...> | 2025-12-23 14:26 | 11K | |
| p5-AnyEvent-ReverseH..> | 2025-12-19 10:17 | 4.6K | |
| p5-AnyEvent-Run-0.01..> | 2025-12-23 11:01 | 7.2K | |
| p5-AnyEvent-SCGI-1.1..> | 2025-12-20 03:04 | 5.5K | |
| p5-AnyEvent-SNMP-6.0..> | 2025-12-19 19:19 | 8.1K | |
| p5-AnyEvent-Subproce..> | 2025-12-20 04:20 | 65K | |
| p5-AnyEvent-Task-0.8..> | 2025-12-23 08:54 | 25K | |
| p5-AnyEvent-Twitter-..> | 2025-12-19 15:31 | 9.4K | |
| p5-AnyEvent-Twitter-..> | 2025-12-19 21:17 | 7.3K | |
| p5-AnyEvent-WebSocke..> | 2025-12-24 00:09 | 18K | |
| p5-AnyEvent-Worker-0..> | 2025-12-24 07:07 | 9.2K | |
| p5-AnyEvent-XMPP-0.5..> | 2025-12-21 13:33 | 188K | |
| p5-AnyMQ-0.35_1.pkg | 2025-12-19 08:31 | 11K | |
| p5-AnyMQ-AMQP-0.30_1..> | 2025-12-22 14:46 | 4.6K | |
| p5-Apache-ASP-2.63.pkg | 2025-12-23 02:24 | 230K | |
| p5-Apache-Admin-Conf..> | 2025-12-18 20:20 | 18K | |
| p5-Apache-AuthCookie..> | 2025-12-20 02:43 | 69K | |
| p5-Apache-AuthTicket..> | 2025-12-20 06:49 | 28K | |
| p5-Apache-Clean-2.00..> | 2025-12-21 21:08 | 5.1K | |
| p5-Apache-Config-Pre..> | 2025-12-19 09:50 | 26K | |
| p5-Apache-ConfigFile..> | 2025-12-20 15:55 | 22K | |
| p5-Apache-ConfigPars..> | 2025-12-23 17:56 | 27K | |
| p5-Apache-DBI-1.12_2..> | 2025-12-19 05:03 | 30K | |
| p5-Apache-Defaults-1..> | 2025-12-20 00:25 | 8.8K | |
| p5-Apache-Htgroup-1...> | 2025-12-22 14:16 | 5.7K | |
| p5-Apache-Htpasswd-1..> | 2025-12-18 21:34 | 10K | |
| p5-Apache-LogFormat-..> | 2025-12-18 04:35 | 7.2K | |
| p5-Apache-MP3-4.00_4..> | 2025-12-22 12:50 | 140K | |
| p5-Apache-ParseFormD..> | 2025-12-22 15:39 | 8.1K | |
| p5-Apache-ParseLog-1..> | 2025-12-20 20:47 | 32K | |
| p5-Apache-Profiler-0..> | 2025-12-21 04:46 | 6.5K | |
| p5-Apache-Session-1...> | 2025-12-18 20:36 | 70K | |
| p5-Apache-Session-PH..> | 2025-12-23 17:20 | 6.4K | |
| p5-Apache-Session-SQ..> | 2025-12-22 04:48 | 4.5K | |
| p5-Apache-Session-Sh..> | 2025-12-22 04:57 | 6.0K | |
| p5-Apache-Session-Wr..> | 2025-12-19 13:00 | 17K | |
| p5-Apache-SessionX-2..> | 2025-12-23 04:46 | 13K | |
| p5-Apache-Singleton-..> | 2025-12-22 13:32 | 7.9K | |
| p5-Apache-Solr-1.11.pkg | 2025-12-30 10:08 | 41K | |
| p5-Apache2-SOAP-0.73..> | 2025-12-19 10:58 | 5.7K | |
| p5-Apache2-SiteContr..> | 2025-12-20 12:25 | 31K | |
| p5-ApacheBench-0.73_..> | 2025-12-23 05:12 | 43K | |
| p5-App-Acmeman-3.10.pkg | 2025-12-23 12:41 | 38K | |
| p5-App-Build-0.74_1.pkg | 2025-12-22 09:16 | 15K | |
| p5-App-CLI-0.500.pkg | 2025-12-18 20:22 | 16K | |
| p5-App-CLI-Extension..> | 2025-12-20 07:14 | 18K | |
| p5-App-Cache-0.37_1.pkg | 2025-12-19 23:10 | 6.3K | |
| p5-App-ClusterSSH-4...> | 2025-12-29 13:05 | 112K | |
| p5-App-Cmd-0.338.pkg | 2025-12-18 21:36 | 56K | |
| p5-App-Control-1.07.pkg | 2025-12-18 23:31 | 6.6K | |
| p5-App-DSC-DataTool-..> | 2025-12-23 15:19 | 69K | |
| p5-App-FatPacker-0.0..> | 2025-12-24 01:45 | 14K | |
| p5-App-Genpass-2.401..> | 2025-12-21 04:33 | 15K | |
| p5-App-GitGot-1.339.pkg | 2025-12-23 21:41 | 60K | |
| p5-App-GitHub-1.0.1_..> | 2025-12-22 12:34 | 10K | |
| p5-App-Info-0.57_1.pkg | 2025-12-23 13:38 | 103K | |
| p5-App-Nopaste-1.013..> | 2025-12-18 13:09 | 40K | |
| p5-App-Options-1.12_..> | 2025-12-18 23:56 | 41K | |
| p5-App-Rad-1.05_1.pkg | 2025-12-19 11:36 | 44K | |
| p5-App-Regather-0.85..> | 2025-12-22 14:24 | 41K | |
| p5-App-RunCron-0.08.pkg | 2025-12-21 22:22 | 14K | |
| p5-App-SD-0.75_2.pkg | 2025-12-23 16:54 | 100K | |
| p5-App-SVN-Bisect-1...> | 2025-12-22 15:08 | 18K | |
| p5-App-Sqitch-1.3.0.pkg | 2025-12-20 06:13 | 600K | |
| p5-App-TLSMe-0.11000..> | 2025-12-22 13:18 | 15K | |
| p5-App-Trace-0.50_2.pkg | 2025-12-19 13:04 | 8.7K | |
| p5-App-ZFSCurses-1.2..> | 2025-12-21 06:24 | 29K | |
| p5-App-cpanminus-1.7..> | 2025-12-19 07:57 | 230K | |
| p5-App-cpanminus-rep..> | 2025-12-21 06:12 | 14K | |
| p5-App-cpanoutdated-..> | 2025-12-24 03:37 | 7.0K | |
| p5-App-gist-0.16_1.pkg | 2025-12-23 13:19 | 6.5K | |
| p5-App-local-lib-hel..> | 2025-12-23 16:08 | 20K | |
| p5-App-perlbrew-1.02..> | 2025-12-23 15:01 | 50K | |
| p5-App-scan_prereqs_..> | 2025-12-23 21:06 | 7.4K | |
| p5-AppConfig-1.71.pkg | 2025-12-18 10:14 | 60K | |
| p5-AppConfig-Std-1.1..> | 2025-12-19 20:01 | 7.0K | |
| p5-Archive-Any-0.094..> | 2025-12-19 13:45 | 13K | |
| p5-Archive-Any-Lite-..> | 2025-12-18 22:52 | 5.3K | |
| p5-Archive-Any-Plugi..> | 2025-12-21 22:18 | 3.0K | |
| p5-Archive-Extract-0..> | 2025-12-18 11:26 | 19K | |
| p5-Archive-Extract-L..> | 2025-12-22 16:37 | 7.8K | |
| p5-Archive-Libarchiv..> | 2025-12-21 18:27 | 91K | |
| p5-Archive-Peek-0.37..> | 2025-12-19 23:51 | 3.6K | |
| p5-Archive-Rar-2.02_..> | 2025-12-19 14:44 | 20K | |
| p5-Archive-SimpleExt..> | 2025-12-23 16:02 | 8.2K | |
| p5-Archive-Tar-3.04.pkg | 2025-12-24 04:26 | 44K | |
| p5-Archive-Tar-Wrapp..> | 2025-12-21 21:22 | 18K | |
| p5-Archive-Zip-1.68.pkg | 2025-12-18 13:41 | 77K | |
| p5-Ark-0.1.r1_2.pkg | 2025-12-20 06:08 | 29K | |
| p5-Array-Compare-3.0..> | 2025-12-19 02:28 | 9.6K | |
| p5-Array-Diff-0.09.pkg | 2025-12-19 02:04 | 4.9K | |
| p5-Array-FileReader-..> | 2025-12-23 05:04 | 3.9K | |
| p5-Array-Group-4.2.pkg | 2025-12-18 09:37 | 4.9K | |
| p5-Array-Heap-3.22.pkg | 2025-12-21 17:01 | 16K | |
| p5-Array-IntSpan-2.0..> | 2025-12-20 19:49 | 20K | |
| p5-Array-Iterator-0...> | 2025-12-18 20:31 | 21K | |
| p5-Array-LineReader-..> | 2025-12-23 12:47 | 7.5K | |
| p5-Array-PrintCols-2..> | 2025-12-19 05:08 | 6.2K | |
| p5-Array-RefElem-1.0..> | 2025-12-19 09:30 | 7.0K | |
| p5-Array-Unique-0.09..> | 2025-12-19 12:57 | 14K | |
| p5-Array-Utils-0.5.pkg | 2025-12-22 16:13 | 4.1K | |
| p5-Array-Window-1.02..> | 2025-12-19 22:17 | 8.8K | |
| p5-AsciiDB-TagFile-1..> | 2025-12-21 21:19 | 8.2K | |
| p5-Asm-Preproc-1.03.pkg | 2025-12-18 23:14 | 18K | |
| p5-Asterisk-FastAGI-..> | 2025-12-22 22:16 | 4.9K | |
| p5-Astro-0.78.pkg | 2025-12-21 04:34 | 41K | |
| p5-Astro-ADS-1.91.pkg | 2025-12-21 16:38 | 20K | |
| p5-Astro-App-Satpass..> | 2025-12-22 13:16 | 301K | |
| p5-Astro-Catalog-4.3..> | 2025-12-23 12:58 | 171K | |
| p5-Astro-Constants-0..> | 2025-12-20 23:26 | 25K | |
| p5-Astro-Coords-0.23..> | 2025-12-19 12:14 | 83K | |
| p5-Astro-DSS-1.6.1_1..> | 2025-12-21 05:04 | 8.5K | |
| p5-Astro-FITS-CFITSI..> | 2025-12-19 14:58 | 127K | |
| p5-Astro-FITS-Header..> | 2025-12-18 18:42 | 45K | |
| p5-Astro-Flux-0.01_1..> | 2025-12-19 08:39 | 14K | |
| p5-Astro-Hipparcos-0..> | 2025-12-21 13:53 | 36K | |
| p5-Astro-MoonPhase-0..> | 2025-12-23 16:21 | 11K | |
| p5-Astro-PAL-1.09.pkg | 2025-12-18 17:22 | 189K | |
| p5-Astro-SIMBAD-2.0...> | 2025-12-23 17:25 | 21K | |
| p5-Astro-SIMBAD-Clie..> | 2025-12-19 13:57 | 34K | |
| p5-Astro-SpaceTrack-..> | 2025-12-21 01:24 | 88K | |
| p5-Astro-SunTime-0.0..> | 2025-12-22 07:17 | 2.4K | |
| p5-Astro-Sunrise-0.9..> | 2025-12-22 12:36 | 21K | |
| p5-Astro-Telescope-0..> | 2025-12-18 23:51 | 47K | |
| p5-Astro-WaveBand-0...> | 2025-12-19 02:19 | 14K | |
| p5-Astro-satpass-0.1..> | 2025-12-19 08:32 | 305K | |
| p5-Async-Interrupt-1..> | 2025-12-21 16:50 | 27K | |
| p5-Async-MergePoint-..> | 2025-12-21 21:31 | 7.0K | |
| p5-AtExit-2.05.pkg | 2025-12-24 01:19 | 11K | |
| p5-Attribute-Handler..> | 2025-12-18 21:33 | 18K | |
| p5-Attribute-Handler..> | 2025-12-19 03:38 | 16K | |
| p5-Attribute-Persist..> | 2025-12-21 16:48 | 4.3K | |
| p5-Audio-CD-0.04_3.pkg | 2025-12-21 02:37 | 16K | |
| p5-Audio-Ecasound-1...> | 2025-12-21 07:04 | 25K | |
| p5-Audio-FLAC-Header..> | 2025-12-19 17:39 | 23K | |
| p5-Audio-M4P-0.57.pkg | 2025-12-20 08:11 | 31K | |
| p5-Audio-MPD-2.004_2..> | 2025-12-22 05:21 | 29K | |
| p5-Audio-MPD-Common-..> | 2025-12-19 15:09 | 23K | |
| p5-Audio-Mixer-0.7_3..> | 2025-12-21 16:38 | 11K | |
| p5-Audio-Musepack-1...> | 2025-12-21 19:42 | 6.0K | |
| p5-Audio-Scan-1.01.pkg | 2025-12-19 17:03 | 115K | |
| p5-Audio-Scrobbler-0..> | 2025-12-22 13:11 | 11K | |
| p5-Audio-WMA-1.3_1.pkg | 2025-12-20 06:05 | 13K | |
| p5-Audio-Wav-0.14_2.pkg | 2025-12-20 01:36 | 22K | |
| p5-Auth-YubikeyDecry..> | 2025-12-23 05:35 | 5.6K | |
| p5-AuthCAS-1.6_2.pkg | 2025-12-24 00:35 | 9.8K | |
| p5-Authen-Bitcard-0...> | 2025-12-23 12:37 | 9.2K | |
| p5-Authen-Captcha-1...> | 2025-12-29 16:51 | 89K | |
| p5-Authen-CyrusSASL-..> | 2025-12-22 05:00 | 4.9K | |
| p5-Authen-DecHpwd-2...> | 2025-12-18 16:34 | 12K | |
| p5-Authen-Htpasswd-0..> | 2025-12-19 19:20 | 11K | |
| p5-Authen-Krb5-1.9_2..> | 2025-12-22 07:45 | 36K | |
| p5-Authen-Krb5-Simpl..> | 2025-12-19 10:56 | 8.4K | |
| p5-Authen-Libwrap-0...> | 2025-12-20 01:52 | 10K | |
| p5-Authen-NTLM-1.09_..> | 2025-12-18 02:55 | 11K | |
| p5-Authen-OATH-1.0.0..> | 2025-12-23 05:07 | 5.4K | |
| p5-Authen-PAAS-1.1.1..> | 2025-12-22 20:13 | 31K | |
| p5-Authen-PAM-0.16_2..> | 2025-12-19 00:50 | 21K | |
| p5-Authen-Passphrase..> | 2025-12-19 01:10 | 79K | |
| p5-Authen-PluggableC..> | 2025-12-24 04:19 | 56K | |
| p5-Authen-Radius-0.3..> | 2025-12-19 07:27 | 40K | |
| p5-Authen-SASL-2.190..> | 2025-12-16 01:30 | 41K | |
| p5-Authen-SASL-Cyrus..> | 2025-12-22 03:47 | 50K | |
| p5-Authen-SASL-SASLp..> | 2025-12-18 18:25 | 3.7K | |
| p5-Authen-SCRAM-0.01..> | 2025-12-18 19:00 | 17K | |
| p5-Authen-Simple-0.5..> | 2025-12-18 22:54 | 13K | |
| p5-Authen-Simple-DBI..> | 2025-12-23 16:15 | 4.3K | |
| p5-Authen-Simple-DBM..> | 2025-12-21 21:42 | 4.9K | |
| p5-Authen-Simple-HTT..> | 2025-12-21 17:20 | 4.2K | |
| p5-Authen-Simple-Ker..> | 2025-12-23 14:10 | 3.6K | |
| p5-Authen-Simple-LDA..> | 2025-12-22 06:36 | 7.6K | |
| p5-Authen-Simple-Net..> | 2025-12-22 12:11 | 7.8K | |
| p5-Authen-Simple-PAM..> | 2025-12-22 17:52 | 3.8K | |
| p5-Authen-Simple-Pas..> | 2025-12-19 20:49 | 4.6K | |
| p5-Authen-Simple-RAD..> | 2025-12-21 12:19 | 4.0K | |
| p5-Authen-Simple-SMB..> | 2025-12-20 06:34 | 3.9K | |
| p5-Authen-Smb-0.91_1..> | 2025-12-19 20:57 | 70K | |
| p5-Authen-TacacsPlus..> | 2025-12-20 09:43 | 16K | |
| p5-Authen-Ticket-0.0..> | 2025-12-22 13:57 | 27K | |
| p5-Authen-TypeKey-0...> | 2025-12-23 12:23 | 6.5K | |
| p5-AutoLoader-5.74.pkg | 2025-12-22 13:07 | 22K | |
| p5-AutoXS-Header-1.0..> | 2025-12-18 21:26 | 4.1K | |
| p5-Avro-1.12.1.pkg | 2025-12-20 00:38 | 18K | |
| p5-B-C-1.57.pkg | 2025-12-23 05:04 | 279K | |
| p5-B-COW-0.007.pkg | 2025-12-20 04:42 | 6.6K | |
| p5-B-Compiling-0.06.pkg | 2025-12-18 19:20 | 6.7K | |
| p5-B-Debug-1.26.pkg | 2025-12-22 14:23 | 10K | |
| p5-B-Deobfuscate-0.2..> | 2025-12-22 00:20 | 19K | |
| p5-B-Flags-0.17.pkg | 2025-12-19 23:15 | 9.3K | |
| p5-B-Generate-1.56.pkg | 2025-12-21 20:02 | 23K | |
| p5-B-Graph-0.51_1.pkg | 2025-12-23 19:28 | 15K | |
| p5-B-Hooks-AtRuntime..> | 2025-12-19 16:32 | 13K | |
| p5-B-Hooks-EndOfScop..> | 2025-12-18 01:09 | 12K | |
| p5-B-Hooks-OP-Annota..> | 2025-12-18 23:14 | 10K | |
| p5-B-Hooks-OP-Check-..> | 2025-12-18 02:46 | 7.4K | |
| p5-B-Hooks-OP-Check-..> | 2025-12-21 20:46 | 9.9K | |
| p5-B-Hooks-OP-PPAddr..> | 2025-12-18 18:52 | 7.6K | |
| p5-B-Hooks-Parser-0...> | 2025-12-18 18:31 | 11K | |
| p5-B-Keywords-1.29.pkg | 2025-12-18 13:05 | 8.6K | |
| p5-B-OPCheck-0.32.pkg | 2025-12-19 10:54 | 8.3K | |
| p5-B-Size2-2.07_1.pkg | 2025-12-19 22:39 | 16K | |
| p5-B-Utils-0.27.pkg | 2025-12-18 10:00 | 25K | |
| p5-BBS-Client-0.03_1..> | 2025-12-21 06:07 | 7.5K | |
| p5-BBS-UserInfo-0.01..> | 2025-12-20 11:00 | 2.7K | |
| p5-BBS-UserInfo-Mapl..> | 2025-12-22 17:40 | 3.8K | |
| p5-BBS-UserInfo-Mapl..> | 2025-12-22 19:19 | 3.8K | |
| p5-BBS-UserInfo-Ptt-..> | 2025-12-22 07:56 | 3.8K | |
| p5-BBS-UserInfo-SOB-..> | 2025-12-20 17:05 | 3.8K | |
| p5-BBS-UserInfo-Wret..> | 2025-12-20 15:06 | 3.9K | |
| p5-BDB-1.92.pkg | 2025-12-19 03:23 | 51K | |
| p5-BFD-0.31_1.pkg | 2025-12-18 13:00 | 3.9K | |
| p5-BIND-Conf_Parser-..> | 2025-12-22 10:04 | 12K | |
| p5-BIND-Config-Parse..> | 2025-12-21 06:18 | 4.9K | |
| p5-BS-Event-0.3_2.pkg | 2025-12-19 17:33 | 7.8K | |
| p5-BSD-Jail-Object-0..> | 2025-12-21 18:39 | 13K | |
| p5-BSD-Process-0.07_..> | 2025-12-23 15:03 | 31K | |
| p5-BSD-Resource-1.29..> | 2025-12-18 14:41 | 22K | |
| p5-BSD-Sysctl-0.12.3..> | 2025-12-18 19:11 | 21K | |
| p5-BSD-devstat-0.02_..> | 2025-12-22 03:58 | 9.7K | |
| p5-BSD-getloadavg-0...> | 2025-12-23 03:28 | 8.2K | |
| p5-BSD-stat-1.36.pkg | 2025-12-22 06:28 | 15K | |
| p5-BSON-1.12.2.pkg | 2025-12-18 17:44 | 83K | |
| p5-BSON-XS-0.8.4.pkg | 2025-12-18 20:19 | 66K | |
| p5-BZ-Client-1.04_3.pkg | 2025-12-22 02:32 | 23K | |
| p5-BackupPC-XS-0.62.pkg | 2025-12-19 23:46 | 90K | |
| p5-Badger-0.16.pkg | 2025-12-18 12:41 | 452K | |
| p5-Barcode-ZBar-0.10..> | 2025-12-28 12:38 | 34K | |
| p5-Baseball-Sabermet..> | 2025-12-22 19:20 | 12K | |
| p5-Bash-Completion-0..> | 2025-12-23 04:55 | 22K | |
| p5-Beanstalk-Client-..> | 2025-12-19 16:22 | 18K | |
| p5-Benchmark-Forking..> | 2025-12-23 03:32 | 9.6K | |
| p5-Benchmark-Stopwat..> | 2025-12-23 09:36 | 6.3K | |
| p5-Benchmark-Timer-0..> | 2025-12-20 00:37 | 12K | |
| p5-Bencode-1.502.pkg | 2025-12-23 19:39 | 6.5K | |
| p5-BerkeleyDB-0.66.pkg | 2025-12-19 03:01 | 115K | |
| p5-Best-0.17.pkg | 2025-12-18 21:04 | 11K | |
| p5-BibTeX-Parser-1.9..> | 2025-12-20 11:16 | 16K | |
| p5-BigIP-ParseConfig..> | 2025-12-22 01:14 | 6.5K | |
| p5-BigIP-iControl-0...> | 2025-12-22 01:14 | 22K | |
| p5-Bigtop-0.38_3.pkg | 2025-12-22 11:06 | 401K | |
| p5-Bio-ASN1-EntrezGe..> | 2025-12-27 06:03 | 36K | |
| p5-Bio-Cluster-1.7.3..> | 2025-12-26 23:01 | 48K | |
| p5-Bio-Coordinate-1...> | 2025-12-27 04:43 | 51K | |
| p5-Bio-DB-EMBL-1.7.4..> | 2025-12-29 19:36 | 5.5K | |
| p5-Bio-DB-NCBIHelper..> | 2025-12-30 12:15 | 51K | |
| p5-Bio-Das-1.17_4.pkg | 2025-12-30 05:56 | 112K | |
| p5-Bio-Das-Lite-2.11..> | 2025-12-21 19:42 | 18K | |
| p5-Bio-FeatureIO-1.6..> | 2025-12-27 16:10 | 49K | |
| p5-Bio-GFF3-2.0_2.pkg | 2025-12-22 11:19 | 22K | |
| p5-Bio-Glite-0.10_2.pkg | 2025-12-21 03:29 | 16K | |
| p5-Bio-Graphics-2.40..> | 2025-12-30 05:17 | 503K | |
| p5-Bio-MAGETAB-1.31_..> | 2025-12-22 01:18 | 158K | |
| p5-Bio-NEXUS-0.78_1.pkg | 2025-12-22 14:59 | 155K | |
| p5-Bio-Phylo-2.0.1.pkg | 2025-12-29 18:06 | 531K | |
| p5-Bio-SCF-1.03_2.pkg | 2025-12-19 06:40 | 15K | |
| p5-Bio-Variation-1.7..> | 2025-12-26 20:00 | 67K | |
| p5-BioPerl-1.007008.pkg | 2025-12-26 16:11 | 2.6M | |
| p5-BioPerl-Run-1.007..> | 2025-12-29 08:56 | 531K | |
| p5-Bit-ShiftReg-2.0_..> | 2025-12-22 14:38 | 13K | |
| p5-Bit-Vector-7.4_1.pkg | 2025-12-18 07:18 | 125K | |
| p5-Bit-Vector-Minima..> | 2025-12-19 01:51 | 4.2K | |
| p5-Blog-Spam-1.0.2_2..> | 2025-12-22 17:30 | 58K | |
| p5-Bloom-Filter-1.2.pkg | 2025-12-22 17:56 | 5.8K | |
| p5-Border-Style-0.01..> | 2025-12-22 02:23 | 7.0K | |
| p5-BorderStyle-3.0.3..> | 2025-12-18 16:13 | 29K | |
| p5-BorderStyleBase-0..> | 2025-12-22 15:36 | 10K | |
| p5-BorderStyles-Stan..> | 2025-12-19 01:26 | 77K | |
| p5-Bot-BasicBot-0.93..> | 2025-12-19 07:02 | 22K | |
| p5-Bot-Training-0.07..> | 2025-12-19 11:00 | 6.7K | |
| p5-Bot-Training-Mega..> | 2025-12-21 01:26 | 11K | |
| p5-Bot-Training-Star..> | 2025-12-23 19:49 | 4.7K | |
| p5-Boulder-1.30_1.pkg | 2025-12-24 04:59 | 115K | |
| p5-Brannigan-1.1.000..> | 2025-12-18 19:10 | 45K | |
| p5-Bread-Board-0.37.pkg | 2025-12-19 17:27 | 107K | |
| p5-Bread-Board-Decla..> | 2025-12-22 09:20 | 23K | |
| p5-Browser-Open-0.04..> | 2025-12-18 11:01 | 4.5K | |
| p5-Bucardo-5.6.0.pkg | 2025-12-21 21:43 | 205K | |
| p5-Bundle-Perl6-0.12..> | 2025-12-23 17:13 | 5.3K | |
| p5-Business-CreditCa..> | 2025-12-19 22:18 | 11K | |
| p5-Business-EDI-0.05..> | 2025-12-22 22:17 | 559K | |
| p5-Business-Hours-0...> | 2025-12-18 21:10 | 7.7K | |
| p5-Business-IS-PIN-0..> | 2025-12-23 12:37 | 6.7K | |
| p5-Business-ISBN-3.0..> | 2025-12-27 14:42 | 16K | |
| p5-Business-ISBN-Dat..> | 2025-12-26 21:41 | 20K | |
| p5-Business-ISIN-0.2..> | 2025-12-21 05:49 | 5.8K | |
| p5-Business-ISMN-1.1..> | 2025-12-19 14:29 | 11K | |
| p5-Business-ISSN-1.0..> | 2025-12-19 05:27 | 5.5K | |
| p5-Business-MaxMind-..> | 2025-12-23 17:05 | 12K | |
| p5-Business-OCV-0.1_..> | 2025-12-19 17:17 | 23K | |
| p5-Business-OnlinePa..> | 2025-12-24 06:57 | 5.4K | |
| p5-Business-OnlinePa..> | 2025-12-19 13:15 | 25K | |
| p5-Business-OnlinePa..> | 2025-12-22 04:25 | 25K | |
| p5-Business-OnlinePa..> | 2025-12-23 19:38 | 6.8K | |
| p5-Business-OnlinePa..> | 2025-12-22 09:15 | 6.1K | |
| p5-Business-OnlinePa..> | 2025-12-23 14:22 | 4.9K | |
| p5-Business-OnlinePa..> | 2025-12-21 21:46 | 5.8K | |
| p5-Business-OnlinePa..> | 2025-12-22 03:14 | 5.9K | |
| p5-Business-OnlinePa..> | 2025-12-22 20:41 | 8.5K | |
| p5-Business-OnlinePa..> | 2025-12-23 10:50 | 5.1K | |
| p5-Business-OnlinePa..> | 2025-12-21 12:07 | 4.1K | |
| p5-Business-OnlinePa..> | 2025-12-20 06:17 | 4.4K | |
| p5-Business-OnlinePa..> | 2025-12-21 18:05 | 6.3K | |
| p5-Business-OnlinePa..> | 2025-12-21 21:24 | 5.4K | |
| p5-Business-OnlinePa..> | 2025-12-21 12:57 | 9.5K | |
| p5-Business-OnlinePa..> | 2025-12-23 09:32 | 5.3K | |
| p5-Business-OnlinePa..> | 2025-12-23 11:30 | 10K | |
| p5-Business-OnlinePa..> | 2025-12-22 17:54 | 4.4K | |
| p5-Business-OnlinePa..> | 2025-12-22 16:15 | 6.6K | |
| p5-Business-PayPal-0..> | 2025-12-23 07:21 | 18K | |
| p5-Business-PayPal-E..> | 2025-12-20 23:32 | 9.9K | |
| p5-Business-PayPal-I..> | 2025-12-22 10:42 | 12K | |
| p5-Business-Stripe-0..> | 2025-12-23 05:06 | 13K | |
| p5-Business-TW-Invoi..> | 2025-12-23 18:18 | 5.2K | |
| p5-Business-TW-TSIB-..> | 2025-12-20 08:35 | 5.6K | |
| p5-Business-TW-TSIB-..> | 2025-12-22 14:52 | 6.0K | |
| p5-Business-UPS-2.02..> | 2025-12-21 19:14 | 9.5K | |
| p5-Business-WorldPay..> | 2025-12-20 18:18 | 13K | |
| p5-Bytes-Random-Secu..> | 2025-12-18 17:47 | 24K | |
| p5-Bytes-Random-Secu..> | 2025-12-18 16:33 | 16K | |
| p5-C-Scan-0.74_1.pkg | 2025-12-23 01:08 | 13K | |
| p5-CACertOrg-CA-2021..> | 2025-12-20 01:23 | 8.4K | |
| p5-CAD-Calc-0.27_2.pkg | 2025-12-18 21:31 | 17K | |
| p5-CAD-Drawing-0.26_..> | 2025-12-27 09:47 | 69K | |
| p5-CAD-Drawing-Templ..> | 2025-12-28 09:34 | 11K | |
| p5-CAM-PDF-1.60_1.pkg | 2025-12-18 11:57 | 137K | |
| p5-CBOR-XS-1.30.pkg | 2025-12-18 21:52 | 44K | |
| p5-CDB_File-1.02.pkg | 2025-12-18 19:22 | 20K | |
| p5-CDB_File-Generato..> | 2025-12-23 14:59 | 5.5K | |
| p5-CDDB-1.222_1.pkg | 2025-12-23 01:35 | 25K | |
| p5-CDDB-File-1.05_2.pkg | 2025-12-19 17:17 | 5.6K | |
| p5-CDDB_get-2.28_3,1..> | 2025-12-19 12:55 | 12K | |
| p5-CGI-4.71.pkg | 2025-12-18 07:47 | 152K | |
| p5-CGI-Ajax-0.707_1.pkg | 2025-12-20 06:24 | 23K | |
| p5-CGI-Application-4..> | 2025-12-18 13:44 | 57K | |
| p5-CGI-Application-D..> | 2025-12-20 01:10 | 36K | |
| p5-CGI-Application-D..> | 2025-12-22 22:53 | 6.0K | |
| p5-CGI-Application-P..> | 2025-12-23 07:45 | 3.1K | |
| p5-CGI-Application-P..> | 2025-12-23 19:10 | 52K | |
| p5-CGI-Application-P..> | 2025-12-20 16:17 | 15K | |
| p5-CGI-Application-P..> | 2025-12-19 17:53 | 89K | |
| p5-CGI-Application-P..> | 2025-12-22 10:43 | 34K | |
| p5-CGI-Application-P..> | 2025-12-18 14:34 | 14K | |
| p5-CGI-Application-P..> | 2025-12-22 05:21 | 4.6K | |
| p5-CGI-Application-P..> | 2025-12-22 20:44 | 6.7K | |
| p5-CGI-Application-P..> | 2025-12-23 09:03 | 6.9K | |
| p5-CGI-Application-P..> | 2025-12-21 00:43 | 6.2K | |
| p5-CGI-Application-P..> | 2025-12-19 00:13 | 17K | |
| p5-CGI-Application-P..> | 2025-12-18 19:31 | 6.8K | |
| p5-CGI-Application-P..> | 2025-12-23 13:26 | 8.6K | |
| p5-CGI-Application-P..> | 2025-12-22 03:04 | 4.5K | |
| p5-CGI-Application-P..> | 2025-12-23 11:04 | 5.7K | |
| p5-CGI-Application-P..> | 2025-12-21 02:57 | 12K | |
| p5-CGI-Application-P..> | 2025-12-23 06:26 | 11K | |
| p5-CGI-Application-P..> | 2025-12-21 02:28 | 11K | |
| p5-CGI-Application-P..> | 2025-12-19 08:39 | 5.2K | |
| p5-CGI-Application-P..> | 2025-12-19 06:59 | 12K | |
| p5-CGI-Application-P..> | 2025-12-21 17:20 | 5.8K | |
| p5-CGI-Application-P..> | 2025-12-19 16:40 | 17K | |
| p5-CGI-Application-P..> | 2025-12-23 19:36 | 9.7K | |
| p5-CGI-Application-P..> | 2025-12-19 16:12 | 7.3K | |
| p5-CGI-Application-S..> | 2025-12-20 06:15 | 6.0K | |
| p5-CGI-ArgChecker-0...> | 2025-12-22 14:03 | 5.0K | |
| p5-CGI-Builder-1.36_..> | 2025-12-19 15:38 | 57K | |
| p5-CGI-Builder-TT2-0..> | 2025-12-23 05:11 | 13K | |
| p5-CGI-Cache-1.4214.pkg | 2025-12-23 14:45 | 16K | |
| p5-CGI-Compile-0.26.pkg | 2025-12-19 14:09 | 11K | |
| p5-CGI-Compress-Gzip..> | 2025-12-23 16:25 | 15K | |
| p5-CGI-Cookie-Splitt..> | 2025-12-19 00:00 | 6.1K | |
| p5-CGI-Cookie-XS-0.1..> | 2025-12-19 09:17 | 44K | |
| p5-CGI-Deurl-XS-0.08..> | 2025-12-18 17:23 | 8.6K | |
| p5-CGI-Emulate-PSGI-..> | 2025-12-18 22:09 | 7.3K | |
| p5-CGI-EncryptForm-1..> | 2025-12-23 08:35 | 11K | |
| p5-CGI-Enurl-1.07_2.pkg | 2025-12-21 03:34 | 6.2K | |
| p5-CGI-Ex-2.55.pkg | 2025-12-23 16:30 | 218K | |
| p5-CGI-Expand-2.05_1..> | 2025-12-19 14:10 | 10K | |
| p5-CGI-ExtDirect-3.2..> | 2025-12-23 03:05 | 14K | |
| p5-CGI-FCKeditor-0.0..> | 2025-12-20 09:51 | 4.4K | |
| p5-CGI-Fast-2.17.pkg | 2025-12-19 22:37 | 8.2K | |
| p5-CGI-FastTemplate-..> | 2025-12-23 11:48 | 19K | |
| p5-CGI-FormBuilder-3..> | 2025-12-19 21:41 | 161K | |
| p5-CGI-Framework-0.2..> | 2025-12-23 22:32 | 38K | |
| p5-CGI-Kwiki-0.18_4.pkg | 2025-12-23 06:56 | 77K | |
| p5-CGI-Lite-3.03.pkg | 2025-12-24 00:03 | 22K | |
| p5-CGI-Minimal-1.30.pkg | 2025-12-20 09:08 | 25K | |
| p5-CGI-PSGI-0.15_1.pkg | 2025-12-18 15:54 | 7.1K | |
| p5-CGI-Pager-1.01_1.pkg | 2025-12-23 00:46 | 8.5K | |
| p5-CGI-Prototype-0.9..> | 2025-12-23 06:47 | 21K | |
| p5-CGI-Response-0.03..> | 2025-12-23 04:57 | 11K | |
| p5-CGI-SSI-0.92_2.pkg | 2025-12-20 05:35 | 12K | |
| p5-CGI-Session-4.48_..> | 2025-12-19 02:02 | 84K | |
| p5-CGI-Session-Drive..> | 2025-12-23 16:53 | 3.7K | |
| p5-CGI-Session-Expir..> | 2025-12-22 19:50 | 11K | |
| p5-CGI-Simple-1.282.pkg | 2025-12-18 11:06 | 89K | |
| p5-CGI-SpeedyCGI-2.2..> | 2025-12-18 20:11 | 77K | |
| p5-CGI-Struct-1.21_1..> | 2025-12-18 10:25 | 12K | |
| p5-CGI-Thin-0.52_1.pkg | 2025-12-21 09:50 | 9.5K | |
| p5-CGI-Tiny-1.003.pkg | 2025-12-22 13:32 | 49K | |
| p5-CGI-Untaint-1.26_..> | 2025-12-18 19:50 | 15K | |
| p5-CGI-Untaint-date-..> | 2025-12-19 13:03 | 4.0K | |
| p5-CGI-Untaint-email..> | 2025-12-19 10:19 | 2.9K | |
| p5-CGI-Upload-1.14.pkg | 2025-12-23 12:24 | 9.3K | |
| p5-CGI-Utils-0.12_1.pkg | 2025-12-23 06:52 | 22K | |
| p5-CGI-XMLApplicatio..> | 2025-12-22 07:41 | 29K | |
| p5-CGP-CLI-2.7.5_1.pkg | 2025-12-22 17:42 | 13K | |
| p5-CHI-0.600.pkg | 2025-12-18 21:49 | 97K | |
| p5-CHI-Driver-DBI-1...> | 2025-12-23 10:54 | 7.1K | |
| p5-CHI-Driver-Memcac..> | 2025-12-21 16:20 | 8.5K | |
| p5-CHI-Driver-Redis-..> | 2025-12-20 06:23 | 4.6K | |
| p5-CHI-Driver-TokyoT..> | 2025-12-20 19:05 | 4.4K | |
| p5-CIF-Client-0.21_3..> | 2025-12-20 05:10 | 16K | |
| p5-CLASS-1.1.8.pkg | 2025-12-20 18:07 | 3.2K | |
| p5-CLI-Osprey-0.08.pkg | 2025-12-18 17:30 | 22K | |
| p5-CPAN-Audit-202508..> | 2025-12-21 13:01 | 23K | |
| p5-CPAN-Changes-0.50..> | 2025-12-19 07:13 | 27K | |
| p5-CPAN-Checksums-2...> | 2025-12-19 01:37 | 8.3K | |
| p5-CPAN-Common-Index..> | 2025-12-18 21:51 | 17K | |
| p5-CPAN-DistnameInfo..> | 2025-12-18 13:34 | 5.1K | |
| p5-CPAN-Inject-1.14_..> | 2025-12-19 09:03 | 11K | |
| p5-CPAN-Meta-2.15001..> | 2025-12-21 12:55 | 113K | |
| p5-CPAN-Meta-Check-0..> | 2025-12-20 02:39 | 4.3K | |
| p5-CPAN-Meta-Require..> | 2025-12-22 10:16 | 15K | |
| p5-CPAN-Meta-YAML-0...> | 2025-12-21 22:13 | 10K | |
| p5-CPAN-Mini-1.11101..> | 2025-12-20 06:07 | 21K | |
| p5-CPAN-Perl-Release..> | 2025-12-19 10:57 | 6.1K | |
| p5-CPAN-Recent-Uploa..> | 2025-12-22 20:16 | 6.4K | |
| p5-CPAN-Reporter-1.2..> | 2025-12-19 12:36 | 50K | |
| p5-CPAN-Reporter-Smo..> | 2025-12-23 16:48 | 19K | |
| p5-CPAN-Requirements..> | 2025-12-18 01:27 | 6.3K | |
| p5-CPAN-SQLite-0.199..> | 2025-12-20 21:25 | 50K | |
| p5-CPAN-Site-1.15.pkg | 2025-12-27 20:43 | 14K | |
| p5-CPAN-Testers-Comm..> | 2025-12-19 22:14 | 35K | |
| p5-CPAN-Testers-Repo..> | 2025-12-18 22:07 | 20K | |
| p5-CPAN-Uploader-0.1..> | 2025-12-19 01:54 | 11K | |
| p5-CPAN-YACSmoke-0.0..> | 2025-12-22 08:36 | 17K | |
| p5-CPANPLUS-0.9916.pkg | 2025-12-19 08:36 | 207K | |
| p5-CPANPLUS-Dist-Bui..> | 2025-12-21 11:42 | 13K | |
| p5-CPANSA-DB-2025010..> | 2025-12-20 01:14 | 253K | |
| p5-CPS-0.19.pkg | 2025-12-20 16:36 | 28K | |
| p5-CPU-Z80-Assembler..> | 2025-12-19 15:14 | 89K | |
| p5-CQL-Parser-1.13_1..> | 2025-12-19 13:02 | 35K | |
| p5-CSP-0.34_1.pkg | 2025-12-21 11:17 | 20K | |
| p5-CSS-1.09_1.pkg | 2025-12-19 01:26 | 42K | |
| p5-CSS-Compressor-0...> | 2025-12-22 02:23 | 7.6K | |
| p5-CSS-Croco-0.09_3.pkg | 2025-12-21 06:57 | 29K | |
| p5-CSS-DOM-0.17.pkg | 2025-12-18 13:54 | 100K | |
| p5-CSS-Inliner-4027.pkg | 2025-12-18 23:23 | 22K | |
| p5-CSS-Minifier-0.01..> | 2025-12-19 16:50 | 6.1K | |
| p5-CSS-Minifier-XS-0..> | 2025-12-18 22:04 | 11K | |
| p5-CSS-Packer-2.09.pkg | 2025-12-19 03:25 | 6.6K | |
| p5-CSS-SAC-0.08_2.pkg | 2025-12-20 22:27 | 64K | |
| p5-CSS-Sass-3.6.4.pkg | 2025-12-20 19:54 | 1.1M | |
| p5-CSS-Simple-3220.pkg | 2025-12-20 15:28 | 8.2K | |
| p5-CSS-Squish-0.10_1..> | 2025-12-19 01:32 | 9.2K | |
| p5-CSS-Tiny-1.20.pkg | 2025-12-19 16:23 | 7.9K | |
| p5-Cache-2.11.pkg | 2025-12-18 11:09 | 53K | |
| p5-Cache-AgainstFile..> | 2025-12-20 17:40 | 23K | |
| p5-Cache-BDB-0.04_1.pkg | 2025-12-22 03:38 | 17K | |
| p5-Cache-Cache-1.08.pkg | 2025-12-18 13:08 | 53K | |
| p5-Cache-FastMmap-1...> | 2025-12-18 19:43 | 41K | |
| p5-Cache-LRU-0.04_1.pkg | 2025-12-18 17:45 | 3.7K | |
| p5-Cache-Memcached-1..> | 2025-12-18 11:41 | 18K | |
| p5-Cache-Memcached-F..> | 2025-12-19 13:45 | 48K | |
| p5-Cache-Memcached-M..> | 2025-12-18 17:31 | 39K | |
| p5-Cache-Memcached-T..> | 2025-12-23 19:18 | 3.4K | |
| p5-Cache-Memcached-X..> | 2025-12-24 05:13 | 15K | |
| p5-Cache-Memcached-l..> | 2025-12-20 05:45 | 12K | |
| p5-Cache-Mmap-0.11_1..> | 2025-12-20 19:48 | 18K | |
| p5-Cache-Simple-Time..> | 2025-12-18 16:09 | 3.7K | |
| p5-Cairo-1.109_2.pkg | 2025-12-26 13:04 | 73K | |
| p5-Cairo-GObject-1.0..> | 2025-12-26 17:58 | 6.6K | |
| p5-Calendar-Simple-2..> | 2025-12-18 21:33 | 6.7K | |
| p5-Call-Context-0.02..> | 2025-12-18 17:56 | 3.3K | |
| p5-Callback-Frame-1...> | 2025-12-20 03:39 | 14K | |
| p5-Canary-Stability-..> | 2025-12-18 10:36 | 1.0K | |
| p5-Captcha-reCAPTCHA..> | 2025-12-23 12:09 | 11K | |
| p5-Captcha-reCAPTCHA..> | 2025-12-23 19:37 | 7.3K | |
| p5-Capture-Tiny-0.50..> | 2025-12-18 08:12 | 16K | |
| p5-Capture-Tiny-Exte..> | 2025-12-21 08:15 | 12K | |
| p5-Carp-1.50.pkg | 2025-12-19 20:17 | 19K | |
| p5-Carp-Always-0.16.pkg | 2025-12-19 16:20 | 5.2K | |
| p5-Carp-Always-Color..> | 2025-12-23 18:44 | 6.9K | |
| p5-Carp-Assert-0.22.pkg | 2025-12-18 17:17 | 13K | |
| p5-Carp-Assert-More-..> | 2025-12-19 02:05 | 14K | |
| p5-Carp-Clan-6.08.pkg | 2025-12-18 01:43 | 8.3K | |
| p5-Carp-Clan-Share-0..> | 2025-12-18 22:32 | 4.1K | |
| p5-Carp-Datum-0.1.3_..> | 2025-12-20 23:17 | 52K | |
| p5-Carp-REPL-0.18.pkg | 2025-12-18 23:23 | 9.2K | |
| p5-Catalyst-Action-R..> | 2025-12-18 23:21 | 47K | |
| p5-Catalyst-Action-R..> | 2025-12-18 16:24 | 5.6K | |
| p5-Catalyst-Action-S..> | 2025-12-23 13:34 | 4.7K | |
| p5-Catalyst-ActionRo..> | 2025-12-19 11:11 | 7.5K | |
| p5-Catalyst-Authenti..> | 2025-12-19 22:42 | 13K | |
| p5-Catalyst-Authenti..> | 2025-12-24 05:23 | 14K | |
| p5-Catalyst-Authenti..> | 2025-12-20 02:05 | 24K | |
| p5-Catalyst-Authenti..> | 2025-12-22 02:35 | 22K | |
| p5-Catalyst-Componen..> | 2025-12-18 19:10 | 6.1K | |
| p5-Catalyst-Componen..> | 2025-12-18 16:26 | 3.5K | |
| p5-Catalyst-Controll..> | 2025-12-18 19:13 | 6.2K | |
| p5-Catalyst-Controll..> | 2025-12-23 22:22 | 6.4K | |
| p5-Catalyst-Controll..> | 2025-12-24 07:21 | 14K | |
| p5-Catalyst-Controll..> | 2025-12-19 23:34 | 29K | |
| p5-Catalyst-Controll..> | 2025-12-23 01:49 | 4.6K | |
| p5-Catalyst-Controll..> | 2025-12-23 19:50 | 8.9K | |
| p5-Catalyst-Controll..> | 2025-12-29 03:03 | 30K | |
| p5-Catalyst-Devel-1...> | 2025-12-18 19:12 | 59K | |
| p5-Catalyst-Dispatch..> | 2025-12-19 15:04 | 10K | |
| p5-Catalyst-Engine-A..> | 2025-12-20 19:47 | 16K | |
| p5-Catalyst-Engine-H..> | 2025-12-21 17:00 | 9.6K | |
| p5-Catalyst-Engine-P..> | 2025-12-20 07:26 | 11K | |
| p5-Catalyst-Enzyme-0..> | 2025-12-24 04:50 | 41K | |
| p5-Catalyst-Helper-C..> | 2025-12-20 19:46 | 4.7K | |
| p5-Catalyst-Manual-5..> | 2025-12-19 20:35 | 345K | |
| p5-Catalyst-Model-Ad..> | 2025-12-20 02:52 | 16K | |
| p5-Catalyst-Model-CD..> | 2025-12-19 12:37 | 6.6K | |
| p5-Catalyst-Model-CD..> | 2025-12-22 12:50 | 5.6K | |
| p5-Catalyst-Model-CD..> | 2025-12-21 11:26 | 3.5K | |
| p5-Catalyst-Model-DB..> | 2025-12-21 18:34 | 5.4K | |
| p5-Catalyst-Model-DB..> | 2025-12-18 20:01 | 33K | |
| p5-Catalyst-Model-Dy..> | 2025-12-22 20:17 | 3.5K | |
| p5-Catalyst-Model-LD..> | 2025-12-20 11:19 | 18K | |
| p5-Catalyst-Model-Me..> | 2025-12-22 01:36 | 5.3K | |
| p5-Catalyst-Model-Or..> | 2025-12-20 23:32 | 5.7K | |
| p5-Catalyst-Model-Ta..> | 2025-12-23 08:15 | 3.7K | |
| p5-Catalyst-Model-XM..> | 2025-12-22 15:39 | 8.9K | |
| p5-Catalyst-Model-Xa..> | 2025-12-23 18:46 | 8.2K | |
| p5-Catalyst-Plugin-A..> | 2025-12-21 07:35 | 9.8K | |
| p5-Catalyst-Plugin-A..> | 2025-12-18 19:23 | 79K | |
| p5-Catalyst-Plugin-A..> | 2025-12-22 19:35 | 6.0K | |
| p5-Catalyst-Plugin-A..> | 2025-12-21 18:47 | 6.4K | |
| p5-Catalyst-Plugin-A..> | 2025-12-21 02:25 | 8.1K | |
| p5-Catalyst-Plugin-A..> | 2025-12-23 21:05 | 15K | |
| p5-Catalyst-Plugin-A..> | 2025-12-19 16:58 | 5.2K | |
| p5-Catalyst-Plugin-A..> | 2025-12-21 11:27 | 69K | |
| p5-Catalyst-Plugin-B..> | 2025-12-21 10:52 | 3.3K | |
| p5-Catalyst-Plugin-C..> | 2025-12-20 07:52 | 5.7K | |
| p5-Catalyst-Plugin-C..> | 2025-12-19 08:34 | 21K | |
| p5-Catalyst-Plugin-C..> | 2025-12-19 17:27 | 3.6K | |
| p5-Catalyst-Plugin-C..> | 2025-12-21 04:14 | 3.4K | |
| p5-Catalyst-Plugin-C..> | 2025-12-23 18:46 | 3.2K | |
| p5-Catalyst-Plugin-C..> | 2025-12-30 00:54 | 4.4K | |
| p5-Catalyst-Plugin-C..> | 2025-12-18 15:59 | 13K | |
| p5-Catalyst-Plugin-C..> | 2025-12-22 08:56 | 6.4K | |
| p5-Catalyst-Plugin-C..> | 2025-12-20 18:24 | 4.4K | |
| p5-Catalyst-Plugin-D..> | 2025-12-23 00:11 | 3.9K | |
| p5-Catalyst-Plugin-D..> | 2025-12-20 04:10 | 3.6K | |
| p5-Catalyst-Plugin-E..> | 2025-12-21 21:36 | 5.0K | |
| p5-Catalyst-Plugin-E..> | 2025-12-24 07:04 | 25K | |
| p5-Catalyst-Plugin-F..> | 2025-12-20 21:11 | 5.7K | |
| p5-Catalyst-Plugin-F..> | 2025-12-19 20:04 | 3.5K | |
| p5-Catalyst-Plugin-I..> | 2025-12-19 18:09 | 14K | |
| p5-Catalyst-Plugin-L..> | 2025-12-21 05:54 | 5.7K | |
| p5-Catalyst-Plugin-L..> | 2025-12-22 13:16 | 5.2K | |
| p5-Catalyst-Plugin-L..> | 2025-12-22 19:45 | 4.4K | |
| p5-Catalyst-Plugin-P..> | 2025-12-22 18:53 | 15K | |
| p5-Catalyst-Plugin-P..> | 2025-12-22 13:48 | 5.7K | |
| p5-Catalyst-Plugin-P..> | 2025-12-22 15:43 | 3.3K | |
| p5-Catalyst-Plugin-P..> | 2025-12-22 06:05 | 5.3K | |
| p5-Catalyst-Plugin-R..> | 2025-12-22 14:23 | 6.0K | |
| p5-Catalyst-Plugin-S..> | 2025-12-22 14:46 | 13K | |
| p5-Catalyst-Plugin-S..> | 2025-12-24 04:28 | 28K | |
| p5-Catalyst-Plugin-S..> | 2025-12-18 15:56 | 34K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 15:11 | 5.0K | |
| p5-Catalyst-Plugin-S..> | 2025-12-20 04:32 | 6.3K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 22:15 | 7.1K | |
| p5-Catalyst-Plugin-S..> | 2025-12-22 14:59 | 9.9K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 13:01 | 2.9K | |
| p5-Catalyst-Plugin-S..> | 2025-12-20 05:54 | 7.9K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 09:37 | 9.6K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 01:59 | 6.5K | |
| p5-Catalyst-Plugin-S..> | 2025-12-21 23:04 | 6.0K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 17:25 | 5.1K | |
| p5-Catalyst-Plugin-S..> | 2025-12-23 05:05 | 4.8K | |
| p5-Catalyst-Plugin-S..> | 2025-12-22 04:14 | 3.8K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 09:48 | 4.9K | |
| p5-Catalyst-Plugin-S..> | 2025-12-22 17:31 | 7.4K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 05:56 | 6.1K | |
| p5-Catalyst-Plugin-S..> | 2025-12-21 16:02 | 3.9K | |
| p5-Catalyst-Plugin-S..> | 2025-12-18 16:40 | 14K | |
| p5-Catalyst-Plugin-S..> | 2025-12-22 10:42 | 6.8K | |
| p5-Catalyst-Plugin-S..> | 2025-12-19 23:10 | 4.5K | |
| p5-Catalyst-Plugin-T..> | 2025-12-23 19:23 | 2.8K | |
| p5-Catalyst-Plugin-U..> | 2025-12-23 16:45 | 4.0K | |
| p5-Catalyst-Plugin-X..> | 2025-12-22 03:28 | 7.2K | |
| p5-Catalyst-Runtime-..> | 2025-12-18 13:12 | 328K | |
| p5-Catalyst-TraitFor..> | 2025-12-23 15:18 | 6.8K | |
| p5-Catalyst-TraitFor..> | 2025-12-20 02:32 | 3.2K | |
| p5-Catalyst-View-Cle..> | 2025-12-23 23:14 | 6.5K | |
| p5-Catalyst-View-Ema..> | 2025-12-19 10:13 | 17K | |
| p5-Catalyst-View-Gra..> | 2025-12-30 12:51 | 13K | |
| p5-Catalyst-View-HTM..> | 2025-12-23 07:33 | 5.4K | |
| p5-Catalyst-View-HTM..> | 2025-12-23 05:10 | 7.8K | |
| p5-Catalyst-View-JSO..> | 2025-12-19 19:15 | 15K | |
| p5-Catalyst-View-Jem..> | 2025-12-23 19:38 | 6.3K | |
| p5-Catalyst-View-Mas..> | 2025-12-21 21:19 | 8.3K | |
| p5-Catalyst-View-RES..> | 2025-12-22 12:37 | 2.9K | |
| p5-Catalyst-View-RRD..> | 2025-12-30 01:16 | 7.2K | |
| p5-Catalyst-View-TT-..> | 2025-12-18 22:05 | 23K | |
| p5-Catalyst-View-TT-..> | 2025-12-21 05:33 | 11K | |
| p5-Catalyst-View-TT-..> | 2025-12-19 07:35 | 6.4K | |
| p5-Catalyst-View-Tem..> | 2025-12-20 19:31 | 7.9K | |
| p5-Catalyst-View-Tem..> | 2025-12-20 01:35 | 6.5K | |
| p5-Catalyst-View-XML..> | 2025-12-22 05:41 | 7.3K | |
| p5-Catalyst-View-XML..> | 2025-12-22 10:14 | 3.4K | |
| p5-Catalyst-View-XSL..> | 2025-12-20 15:52 | 11K | |
| p5-Catalyst-View-vCa..> | 2025-12-21 07:39 | 4.0K | |
| p5-CatalystX-AppBuil..> | 2025-12-22 08:40 | 8.1K | |
| p5-CatalystX-Compone..> | 2025-12-18 17:55 | 5.8K | |
| p5-CatalystX-InjectC..> | 2025-12-18 22:06 | 4.5K | |
| p5-CatalystX-LeakChe..> | 2025-12-19 15:09 | 4.5K | |
| p5-CatalystX-Profile..> | 2025-12-19 08:00 | 5.1K | |
| p5-CatalystX-REPL-0...> | 2025-12-19 04:56 | 4.5K | |
| p5-CatalystX-RoleApp..> | 2025-12-19 01:58 | 3.3K | |
| p5-CatalystX-SimpleL..> | 2025-12-19 03:28 | 31K | |
| p5-CatalystX-Virtual..> | 2025-12-21 18:36 | 5.9K | |
| p5-Cflow-1.053_2.pkg | 2025-12-19 20:56 | 34K | |
| p5-Chart-2.4.10.pkg | 2025-12-26 20:45 | 66K | |
| p5-Chart-Clicker-2.9..> | 2025-12-30 09:04 | 101K | |
| p5-Chart-Gnuplot-0.2..> | 2025-12-30 18:19 | 34K | |
| p5-Chart-Graph-3.2_1..> | 2025-12-27 10:25 | 69K | |
| p5-Chart-Math-Axis-1..> | 2025-12-19 16:46 | 8.1K | |
| p5-Chart-PNGgraph-1...> | 2025-12-29 03:41 | 6.0K | |
| p5-Chatbot-Eliza-1.0..> | 2025-12-19 17:28 | 23K | |
| p5-Check-ISA-0.09.pkg | 2025-12-18 12:47 | 7.7K | |
| p5-Chemistry-3DBuild..> | 2025-12-19 21:42 | 5.3K | |
| p5-Chemistry-Bond-Fi..> | 2025-12-18 13:33 | 12K | |
| p5-Chemistry-Canonic..> | 2025-12-18 12:19 | 6.5K | |
| p5-Chemistry-Element..> | 2025-12-20 23:05 | 12K | |
| p5-Chemistry-File-MD..> | 2025-12-19 11:32 | 10K | |
| p5-Chemistry-File-Mo..> | 2025-12-19 22:55 | 5.7K | |
| p5-Chemistry-File-PD..> | 2025-12-18 23:00 | 6.6K | |
| p5-Chemistry-File-SL..> | 2025-12-19 22:41 | 11K | |
| p5-Chemistry-File-SM..> | 2025-12-18 19:30 | 7.3K | |
| p5-Chemistry-File-SM..> | 2025-12-18 17:25 | 11K | |
| p5-Chemistry-File-VR..> | 2025-12-19 08:39 | 10K | |
| p5-Chemistry-File-XY..> | 2025-12-19 15:22 | 4.1K | |
| p5-Chemistry-Formula..> | 2025-12-19 05:53 | 9.0K | |
| p5-Chemistry-Interna..> | 2025-12-18 20:19 | 10K | |
| p5-Chemistry-Isotope..> | 2025-12-19 11:57 | 25K | |
| p5-Chemistry-MacroMo..> | 2025-12-18 17:14 | 6.8K | |
| p5-Chemistry-MidasPa..> | 2025-12-19 21:41 | 10K | |
| p5-Chemistry-Mok-0.2..> | 2025-12-20 02:38 | 15K | |
| p5-Chemistry-Mol-0.4..> | 2025-12-18 10:12 | 60K | |
| p5-Chemistry-OpenSMI..> | 2025-12-21 05:55 | 29K | |
| p5-Chemistry-Pattern..> | 2025-12-18 14:38 | 12K | |
| p5-Chemistry-Reactio..> | 2025-12-19 14:36 | 7.0K | |
| p5-Chemistry-Ring-0...> | 2025-12-18 13:07 | 11K | |
| p5-Chess-PGN-Parse-0..> | 2025-12-21 12:26 | 21K | |
| p5-Child-0.013.pkg | 2025-12-22 02:40 | 24K | |
| p5-Chooser-2.0.0_2.pkg | 2025-12-23 07:36 | 11K | |
| p5-Cisco-CopyConfig-..> | 2025-12-21 16:24 | 8.1K | |
| p5-Cisco-Hash-0.02_1..> | 2025-12-24 05:33 | 4.6K | |
| p5-Cisco-IPPhone-0.0..> | 2025-12-22 17:57 | 14K | |
| p5-Cisco-Reconfig-0...> | 2025-12-19 12:38 | 15K | |
| p5-Cisco-UCS-0.51_1,..> | 2025-12-23 06:49 | 95K | |
| p5-Clamd-1.04_5.pkg | 2025-12-30 02:15 | 6.9K | |
| p5-Class-Accessor-0...> | 2025-12-18 07:54 | 18K | |
| p5-Class-Accessor-Ch..> | 2025-12-18 11:56 | 4.7K | |
| p5-Class-Accessor-Ch..> | 2025-12-21 05:16 | 5.4K | |
| p5-Class-Accessor-Co..> | 2025-12-18 23:58 | 16K | |
| p5-Class-Accessor-Co..> | 2025-12-19 09:28 | 11K | |
| p5-Class-Accessor-Fa..> | 2025-12-20 04:25 | 4.4K | |
| p5-Class-Accessor-Fa..> | 2025-12-20 02:44 | 10K | |
| p5-Class-Accessor-Gr..> | 2025-12-18 10:16 | 16K | |
| p5-Class-Accessor-In..> | 2025-12-18 18:41 | 7.1K | |
| p5-Class-Accessor-Li..> | 2025-12-18 12:29 | 5.6K | |
| p5-Class-Accessor-Lv..> | 2025-12-20 04:22 | 5.1K | |
| p5-Class-Accessor-Na..> | 2025-12-18 21:11 | 5.4K | |
| p5-Class-Adapter-1.0..> | 2025-12-18 19:31 | 15K | |
| p5-Class-AlzaboWrapp..> | 2025-12-19 20:42 | 13K | |
| p5-Class-ArrayObject..> | 2025-12-19 12:58 | 11K | |
| p5-Class-AutoClass-1..> | 2025-12-22 13:01 | 24K | |
| p5-Class-Autouse-2.0..> | 2025-12-18 22:41 | 21K | |
| p5-Class-Base-0.09.pkg | 2025-12-19 06:52 | 14K | |
| p5-Class-BlackHole-0..> | 2025-12-20 10:12 | 4.5K | |
| p5-Class-C3-0.35.pkg | 2025-12-18 00:55 | 16K | |
| p5-Class-C3-Adopt-NE..> | 2025-12-18 10:04 | 7.3K | |
| p5-Class-C3-Componen..> | 2025-12-18 10:22 | 7.9K | |
| p5-Class-C3-XS-0.15.pkg | 2025-12-18 21:31 | 13K | |
| p5-Class-CSV-1.03_1.pkg | 2025-12-19 10:46 | 9.1K | |
| p5-Class-Closure-0.3..> | 2025-12-20 17:18 | 10K | |
| p5-Class-CodeStyler-..> | 2025-12-22 13:10 | 4.7K | |
| p5-Class-Component-0..> | 2025-12-23 07:45 | 20K | |
| p5-Class-Constant-0...> | 2025-12-21 03:04 | 7.3K | |
| p5-Class-Container-0..> | 2025-12-18 12:32 | 16K | |
| p5-Class-Contract-1...> | 2025-12-23 17:15 | 36K | |
| p5-Class-DBI-3.0.17_..> | 2025-12-18 18:41 | 86K | |
| p5-Class-DBI-Abstrac..> | 2025-12-19 14:42 | 4.4K | |
| p5-Class-DBI-AsForm-..> | 2025-12-20 01:59 | 5.0K | |
| p5-Class-DBI-AutoLoa..> | 2025-12-23 22:23 | 6.8K | |
| p5-Class-DBI-BaseDSN..> | 2025-12-19 11:32 | 3.8K | |
| p5-Class-DBI-DATA-Sc..> | 2025-12-19 16:40 | 4.8K | |
| p5-Class-DBI-DDL-1.0..> | 2025-12-22 01:39 | 11K | |
| p5-Class-DBI-FromCGI..> | 2025-12-23 19:26 | 7.4K | |
| p5-Class-DBI-FromFor..> | 2025-12-19 14:34 | 3.4K | |
| p5-Class-DBI-LazyInf..> | 2025-12-24 05:21 | 4.0K | |
| p5-Class-DBI-Loader-..> | 2025-12-19 01:29 | 16K | |
| p5-Class-DBI-Loader-..> | 2025-12-19 16:39 | 4.3K | |
| p5-Class-DBI-Oracle-..> | 2025-12-19 16:47 | 4.9K | |
| p5-Class-DBI-Pager-0..> | 2025-12-19 12:02 | 4.7K | |
| p5-Class-DBI-Pg-0.09..> | 2025-12-19 10:20 | 5.8K | |
| p5-Class-DBI-Plugin-..> | 2025-12-19 01:58 | 4.3K | |
| p5-Class-DBI-Plugin-..> | 2025-12-19 23:34 | 4.3K | |
| p5-Class-DBI-Plugin-..> | 2025-12-23 03:00 | 6.1K | |
| p5-Class-DBI-Plugin-..> | 2025-12-23 03:05 | 7.5K | |
| p5-Class-DBI-Plugin-..> | 2025-12-22 10:50 | 12K | |
| p5-Class-DBI-Plugin-..> | 2025-12-20 02:05 | 3.9K | |
| p5-Class-DBI-Plugin-..> | 2025-12-21 11:49 | 6.6K | |
| p5-Class-DBI-Plugin-..> | 2025-12-18 20:17 | 3.2K | |
| p5-Class-DBI-Replica..> | 2025-12-20 10:34 | 4.8K | |
| p5-Class-DBI-SAK-1.4..> | 2025-12-21 17:56 | 5.1K | |
| p5-Class-DBI-SQLite-..> | 2025-12-19 14:52 | 4.4K | |
| p5-Class-DBI-Sweet-0..> | 2025-12-19 22:41 | 19K | |
| p5-Class-DBI-ToSax-0..> | 2025-12-21 14:11 | 6.4K | |
| p5-Class-DBI-Untaint..> | 2025-12-20 23:28 | 3.6K | |
| p5-Class-DBI-mysql-1..> | 2025-12-19 22:22 | 6.2K | |
| p5-Class-Data-Config..> | 2025-12-18 19:22 | 4.6K | |
| p5-Class-Data-Inheri..> | 2025-12-18 01:26 | 5.2K | |
| p5-Class-Data-Lite-0..> | 2025-12-19 11:31 | 3.9K | |
| p5-Class-Date-1.1.17..> | 2025-12-18 18:01 | 31K | |
| p5-Class-Declare-0.1..> | 2025-12-21 13:24 | 43K | |
| p5-Class-Default-1.5..> | 2025-12-19 02:12 | 7.2K | |
| p5-Class-Delegation-..> | 2025-12-23 20:06 | 21K | |
| p5-Class-EHierarchy-..> | 2025-12-19 12:26 | 22K | |
| p5-Class-ErrorHandle..> | 2025-12-18 09:05 | 3.8K | |
| p5-Class-Factory-1.0..> | 2025-12-19 00:46 | 15K | |
| p5-Class-Factory-Uti..> | 2025-12-18 14:53 | 3.9K | |
| p5-Class-Field-0.24.pkg | 2025-12-20 04:09 | 5.1K | |
| p5-Class-Fields-0.20..> | 2025-12-19 12:36 | 25K | |
| p5-Class-Forward-0.1..> | 2025-12-20 08:52 | 6.3K | |
| p5-Class-Generate-1...> | 2025-12-19 04:51 | 65K | |
| p5-Class-Gomor-1.03.pkg | 2025-12-18 12:00 | 13K | |
| p5-Class-Handle-1.07..> | 2025-12-19 22:51 | 9.0K | |
| p5-Class-Hook-0.06.pkg | 2025-12-20 10:13 | 6.0K | |
| p5-Class-ISA-0.36_1.pkg | 2025-12-18 10:25 | 6.8K | |
| p5-Class-Inflate-0.0..> | 2025-12-21 06:35 | 10K | |
| p5-Class-Inner-0.200..> | 2025-12-20 03:05 | 5.5K | |
| p5-Class-InsideOut-1..> | 2025-12-18 11:42 | 29K | |
| p5-Class-Inspector-1..> | 2025-12-18 01:37 | 13K | |
| p5-Class-Interfaces-..> | 2025-12-18 23:57 | 9.7K | |
| p5-Class-Load-0.25.pkg | 2025-12-18 01:19 | 9.3K | |
| p5-Class-Load-XS-0.1..> | 2025-12-18 01:38 | 6.7K | |
| p5-Class-Loader-2.03..> | 2025-12-18 06:54 | 6.1K | |
| p5-Class-MakeMethods..> | 2025-12-19 09:22 | 267K | |
| p5-Class-Measure-0.1..> | 2025-12-18 14:41 | 9.0K | |
| p5-Class-Method-Modi..> | 2025-12-18 01:25 | 12K | |
| p5-Class-Method-Modi..> | 2025-12-19 21:03 | 4.8K | |
| p5-Class-MethodMaker..> | 2025-12-18 11:04 | 162K | |
| p5-Class-MethodMappe..> | 2025-12-22 05:41 | 8.1K | |
| p5-Class-Mix-0.006.pkg | 2025-12-18 12:44 | 6.5K | |
| p5-Class-Mixin-1.00_..> | 2025-12-24 00:04 | 5.3K | |
| p5-Class-MixinFactor..> | 2025-12-19 11:17 | 24K | |
| p5-Class-Multimethod..> | 2025-12-18 18:56 | 23K | |
| p5-Class-Multimethod..> | 2025-12-20 01:57 | 20K | |
| p5-Class-NamedParms-..> | 2025-12-18 19:55 | 8.2K | |
| p5-Class-Null-2.1107..> | 2025-12-22 10:41 | 6.3K | |
| p5-Class-OOorNO-0.01..> | 2025-12-21 19:42 | 12K | |
| p5-Class-ObjectTempl..> | 2025-12-19 15:13 | 6.0K | |
| p5-Class-ObjectTempl..> | 2025-12-22 15:40 | 5.9K | |
| p5-Class-Observable-..> | 2025-12-18 20:37 | 13K | |
| p5-Class-ParmList-1...> | 2025-12-18 19:12 | 12K | |
| p5-Class-Prototyped-..> | 2025-12-19 20:42 | 44K | |
| p5-Class-ReturnValue..> | 2025-12-18 16:04 | 6.5K | |
| p5-Class-Roles-0.30_..> | 2025-12-23 04:24 | 7.3K | |
| p5-Class-STL-Contain..> | 2025-12-19 23:21 | 16K | |
| p5-Class-Singleton-1..> | 2025-12-18 02:13 | 9.2K | |
| p5-Class-Spiffy-0.15..> | 2025-12-24 03:50 | 18K | |
| p5-Class-StateMachin..> | 2025-12-21 11:50 | 13K | |
| p5-Class-Std-0.013.pkg | 2025-12-18 13:49 | 39K | |
| p5-Class-Std-Fast-0...> | 2025-12-18 23:58 | 16K | |
| p5-Class-Std-Utils-0..> | 2025-12-19 16:26 | 7.3K | |
| p5-Class-StrongSingl..> | 2025-12-18 20:25 | 11K | |
| p5-Class-Tangram-1.5..> | 2025-12-19 12:56 | 47K | |
| p5-Class-Throwable-0..> | 2025-12-19 02:31 | 14K | |
| p5-Class-Tiny-1.008.pkg | 2025-12-18 01:42 | 13K | |
| p5-Class-Tiny-Chaine..> | 2025-12-18 14:50 | 3.3K | |
| p5-Class-Tom-3.02_3.pkg | 2025-12-19 16:44 | 5.5K | |
| p5-Class-Trigger-0.1..> | 2025-12-18 12:29 | 8.0K | |
| p5-Class-Unload-0.12..> | 2025-12-18 11:37 | 3.3K | |
| p5-Class-Virtual-0.0..> | 2025-12-18 20:33 | 8.0K | |
| p5-Class-WhiteHole-0..> | 2025-12-23 02:05 | 3.6K | |
| p5-Class-Workflow-0...> | 2025-12-20 10:42 | 58K | |
| p5-Class-XPath-1.4_1..> | 2025-12-19 01:57 | 11K | |
| p5-Class-XSAccessor-..> | 2025-12-18 04:20 | 31K | |
| p5-ClearSilver-0.10...> | 2025-12-19 11:18 | 89K | |
| p5-Clipboard-0.32.pkg | 2025-12-18 10:27 | 33K | |
| p5-Clone-0.47.pkg | 2025-12-18 01:34 | 8.1K | |
| p5-Clone-Choose-0.01..> | 2025-12-18 03:44 | 6.2K | |
| p5-Clone-Fast-0.97_1..> | 2025-12-19 16:58 | 19K | |
| p5-Clone-More-0.90.2..> | 2025-12-23 22:22 | 21K | |
| p5-Clone-PP-1.08.pkg | 2025-12-18 01:38 | 6.2K | |
| p5-Code-Perl-0.03_2.pkg | 2025-12-19 03:16 | 13K | |
| p5-Color-ANSI-Util-0..> | 2025-12-18 14:32 | 9.5K | |
| p5-Color-Calc-1.074_..> | 2025-12-18 23:20 | 14K | |
| p5-Color-Library-0.0..> | 2025-12-18 12:53 | 373K | |
| p5-Color-Palette-0.1..> | 2025-12-23 14:32 | 11K | |
| p5-Color-RGB-Util-0...> | 2025-12-18 12:53 | 14K | |
| p5-Color-Rgb-1.4_1.pkg | 2025-12-22 04:57 | 6.8K | |
| p5-Color-Scheme-1.08..> | 2025-12-20 02:03 | 14K | |
| p5-Color-Theme-Role-..> | 2025-12-21 22:12 | 8.2K | |
| p5-ColorThemeBase-St..> | 2025-12-18 16:08 | 16K | |
| p5-ColorThemeUtil-AN..> | 2025-12-18 22:39 | 3.8K | |
| p5-ColorThemes-Stand..> | 2025-12-18 22:53 | 4.8K | |
| p5-Command-Runner-0...> | 2025-12-23 02:33 | 7.0K | |
| p5-Commandable-0.14.pkg | 2025-12-19 00:00 | 35K | |
| p5-Commands-Guarded-..> | 2025-12-21 11:51 | 21K | |
| p5-CommitBit-0.02_3.pkg | 2025-12-22 15:08 | 18K | |
| p5-Compiler-Lexer-0...> | 2025-12-18 20:33 | 67K | |
| p5-Complete-Common-0..> | 2025-12-18 09:13 | 6.4K | |
| p5-Complete-Path-0.2..> | 2025-12-20 11:00 | 8.0K | |
| p5-Complete-Sah-0.01..> | 2025-12-18 17:29 | 7.8K | |
| p5-Complete-Sequence..> | 2025-12-18 16:35 | 6.7K | |
| p5-Complete-Util-0.6..> | 2025-12-18 12:48 | 18K | |
| p5-Compress-Bzip2-2...> | 2025-12-18 15:50 | 45K | |
| p5-Compress-LZ4-0.25..> | 2025-12-19 23:32 | 39K | |
| p5-Compress-LZF-3.80..> | 2025-12-20 00:18 | 14K | |
| p5-Compress-LZO-1.09..> | 2025-12-20 01:52 | 9.9K | |
| p5-Compress-LZW-0.04..> | 2025-12-19 11:05 | 9.6K | |
| p5-Compress-LeadingB..> | 2025-12-23 14:22 | 5.2K | |
| p5-Compress-Raw-Bzip..> | 2025-12-18 12:55 | 45K | |
| p5-Compress-Raw-Lzma..> | 2025-12-19 00:13 | 31K | |
| p5-Compress-Raw-Zlib..> | 2025-12-18 12:53 | 40K | |
| p5-Compress-Snappy-0..> | 2025-12-19 01:33 | 9.9K | |
| p5-Compress-Zstd-0.2..> | 2025-12-18 23:21 | 266K | |
| p5-Config-AST-1.07.pkg | 2025-12-18 17:45 | 33K | |
| p5-Config-AWS-0.12.pkg | 2025-12-19 13:06 | 7.5K | |
| p5-Config-Any-0.33.pkg | 2025-12-18 11:26 | 24K | |
| p5-Config-ApacheForm..> | 2025-12-23 09:17 | 18K | |
| p5-Config-Auto-0.44_..> | 2025-12-19 13:01 | 13K | |
| p5-Config-AutoConf-0..> | 2025-12-18 18:47 | 35K | |
| p5-Config-Fast-1.07_..> | 2025-12-23 18:42 | 11K | |
| p5-Config-General-2...> | 2025-12-18 07:55 | 50K | |
| p5-Config-GitLike-1...> | 2025-12-18 11:02 | 31K | |
| p5-Config-Grammar-1...> | 2025-12-19 15:41 | 19K | |
| p5-Config-INI-0.029.pkg | 2025-12-18 16:27 | 19K | |
| p5-Config-INI-Reader..> | 2025-12-20 03:05 | 3.9K | |
| p5-Config-INI-Simple..> | 2025-12-19 07:34 | 3.9K | |
| p5-Config-Identity-0..> | 2025-12-19 01:26 | 7.3K | |
| p5-Config-IniFiles-3..> | 2025-12-18 19:36 | 35K | |
| p5-Config-IniHash-3...> | 2025-12-26 22:21 | 9.7K | |
| p5-Config-IniRegEx-0..> | 2025-12-21 05:19 | 6.2K | |
| p5-Config-JFDI-0.065..> | 2025-12-19 17:14 | 11K | |
| p5-Config-JSON-1.520..> | 2025-12-22 14:05 | 9.9K | |
| p5-Config-MVP-2.2000..> | 2025-12-18 14:36 | 39K | |
| p5-Config-MVP-Reader..> | 2025-12-19 00:27 | 3.1K | |
| p5-Config-Merge-1.04..> | 2025-12-19 22:41 | 22K | |
| p5-Config-Model-2.15..> | 2025-12-19 09:28 | 346K | |
| p5-Config-Model-Back..> | 2025-12-23 16:04 | 7.0K | |
| p5-Config-Model-Test..> | 2025-12-21 17:20 | 27K | |
| p5-Config-MySQL-0.02..> | 2025-12-20 02:47 | 9.7K | |
| p5-Config-Objective-..> | 2025-12-23 04:04 | 30K | |
| p5-Config-Options-0...> | 2025-12-18 22:32 | 9.3K | |
| p5-Config-Parser-1.0..> | 2025-12-18 20:27 | 16K | |
| p5-Config-Parser-lda..> | 2025-12-19 11:57 | 5.2K | |
| p5-Config-Perl-V-0.3..> | 2025-12-18 19:01 | 9.8K | |
| p5-Config-Properties..> | 2025-12-21 16:25 | 13K | |
| p5-Config-Record-1.1..> | 2025-12-19 06:04 | 10K | |
| p5-Config-Setting-0...> | 2025-12-22 13:02 | 16K | |
| p5-Config-Simple-4.5..> | 2025-12-18 17:40 | 24K | |
| p5-Config-Std-0.903.pkg | 2025-12-18 17:06 | 20K | |
| p5-Config-Tiny-2.30.pkg | 2025-12-18 06:47 | 12K | |
| p5-Config-Validator-..> | 2025-12-23 14:45 | 14K | |
| p5-Config-Versioned-..> | 2025-12-19 02:13 | 17K | |
| p5-Config-Wrest-1.03..> | 2025-12-22 20:56 | 28K | |
| p5-Config-YAML-1.42_..> | 2025-12-19 16:31 | 6.7K | |
| p5-ConfigReader-0.5_..> | 2025-12-21 18:38 | 8.0K | |
| p5-ConfigReader-Simp..> | 2025-12-18 21:33 | 11K | |
| p5-Connector-1.55.pkg | 2025-12-20 02:23 | 109K | |
| p5-Const-Exporter-1...> | 2025-12-18 17:01 | 8.8K | |
| p5-Const-Fast-0.014_..> | 2025-12-18 13:57 | 5.4K | |
| p5-Context-Preserve-..> | 2025-12-18 05:29 | 5.3K | |
| p5-Contextual-Return..> | 2025-12-18 20:16 | 50K | |
| p5-Continuity-1.6.pkg | 2025-12-18 23:20 | 43K | |
| p5-Convert-ASCII-Arm..> | 2025-12-18 13:50 | 6.8K | |
| p5-Convert-ASN1-0.34..> | 2025-12-18 11:02 | 28K | |
| p5-Convert-Age-0.04.pkg | 2025-12-23 04:05 | 4.3K | |
| p5-Convert-BER-1.32_..> | 2025-12-21 05:18 | 26K | |
| p5-Convert-Base32-0...> | 2025-12-21 01:23 | 4.2K | |
| p5-Convert-Bencode-1..> | 2025-12-19 12:48 | 4.4K | |
| p5-Convert-Bencode_X..> | 2025-12-23 00:32 | 13K | |
| p5-Convert-BinHex-1...> | 2025-12-18 10:10 | 27K | |
| p5-Convert-Binary-C-..> | 2025-12-19 20:52 | 248K | |
| p5-Convert-Color-0.1..> | 2025-12-18 13:05 | 33K | |
| p5-Convert-Color-XTe..> | 2025-12-18 17:18 | 4.6K | |
| p5-Convert-Cyrillic-..> | 2025-12-23 09:05 | 19K | |
| p5-Convert-IBM390-0...> | 2025-12-23 07:21 | 60K | |
| p5-Convert-Moji-0.11..> | 2025-12-19 09:23 | 11K | |
| p5-Convert-Morse-0.0..> | 2025-12-21 02:51 | 6.1K | |
| p5-Convert-NLS_DATE_..> | 2025-12-18 11:03 | 4.8K | |
| p5-Convert-PEM-0.13.pkg | 2025-12-18 12:08 | 18K | |
| p5-Convert-Recode-1...> | 2025-12-20 02:30 | 4.0K | |
| p5-Convert-Scalar-1...> | 2025-12-18 19:31 | 15K | |
| p5-Convert-TNEF-0.18..> | 2025-12-19 02:04 | 11K | |
| p5-Convert-UU-0.52.0..> | 2025-12-23 15:39 | 8.2K | |
| p5-Convert-UUlib-1.7..> | 2025-12-18 23:19 | 97K | |
| p5-Cookie-Baker-0.12..> | 2025-12-18 04:33 | 6.0K | |
| p5-Coro-6.570,1.pkg | 2025-12-18 18:10 | 189K | |
| p5-Corona-0.1004_1.pkg | 2025-12-20 20:05 | 7.1K | |
| p5-CouchDB-View-0.00..> | 2025-12-19 14:00 | 9.4K | |
| p5-Cpanel-JSON-XS-4...> | 2025-12-18 02:25 | 108K | |
| p5-Crypt-Anubis-1.0...> | 2025-12-21 17:30 | 18K | |
| p5-Crypt-AppleTwoFis..> | 2025-12-20 11:07 | 30K | |
| p5-Crypt-Argon2-0.02..> | 2025-12-20 01:23 | 26K | |
| p5-Crypt-Bcrypt-0.01..> | 2025-12-23 19:23 | 18K | |
| p5-Crypt-Blowfish-2...> | 2025-12-18 12:29 | 13K | |
| p5-Crypt-Blowfish_PP..> | 2025-12-19 12:38 | 10K | |
| p5-Crypt-CAST5-0.05_..> | 2025-12-19 07:10 | 22K | |
| p5-Crypt-CAST5_PP-1...> | 2025-12-18 17:36 | 17K | |
| p5-Crypt-CBC-3.07.pkg | 2025-12-18 11:05 | 28K | |
| p5-Crypt-CBCeasy-0.2..> | 2025-12-21 00:34 | 8.1K | |
| p5-Crypt-CFB-0.02_1.pkg | 2025-12-19 11:00 | 5.5K | |
| p5-Crypt-Caesar-0.01..> | 2025-12-23 12:10 | 3.0K | |
| p5-Crypt-Camellia_PP..> | 2025-12-23 12:43 | 7.3K | |
| p5-Crypt-Chimera-1.0..> | 2025-12-22 19:20 | 5.3K | |
| p5-Crypt-CipherSaber..> | 2025-12-19 16:40 | 6.6K | |
| p5-Crypt-Cracklib-1...> | 2025-12-21 00:46 | 25K | |
| p5-Crypt-Ctr-0.01_2.pkg | 2025-12-21 05:23 | 4.2K | |
| p5-Crypt-Curve25519-..> | 2025-12-18 15:25 | 13K | |
| p5-Crypt-DES-2.07_2.pkg | 2025-12-18 07:19 | 11K | |
| p5-Crypt-DES_EDE3-0...> | 2025-12-18 10:32 | 4.0K | |
| p5-Crypt-DES_PP-1.00..> | 2025-12-19 09:38 | 7.8K | |
| p5-Crypt-DH-0.07_1.pkg | 2025-12-20 00:56 | 6.8K | |
| p5-Crypt-DH-GMP-0.00..> | 2025-12-18 15:21 | 16K | |
| p5-Crypt-DSA-1.19.pkg | 2025-12-18 17:06 | 24K | |
| p5-Crypt-ECB-2.23.pkg | 2025-12-18 19:22 | 12K | |
| p5-Crypt-Eksblowfish..> | 2025-12-18 18:14 | 39K | |
| p5-Crypt-Enigma-1.4_..> | 2025-12-22 13:23 | 8.1K | |
| p5-Crypt-Format-0.12..> | 2025-12-18 17:22 | 3.6K | |
| p5-Crypt-GCrypt-1.26..> | 2025-12-21 12:55 | 28K | |
| p5-Crypt-GOST-1.00_1..> | 2025-12-19 22:53 | 11K | |
| p5-Crypt-GOST_PP-1.1..> | 2025-12-22 21:37 | 4.3K | |
| p5-Crypt-GPG-1.64.pkg | 2025-12-19 06:15 | 18K | |
| p5-Crypt-GeneratePas..> | 2025-12-21 05:10 | 172K | |
| p5-Crypt-GpgME-0.09_..> | 2025-12-21 00:19 | 28K | |
| p5-Crypt-HCE_MD5-0.7..> | 2025-12-20 10:30 | 4.6K | |
| p5-Crypt-HCE_SHA-0.7..> | 2025-12-19 20:54 | 4.2K | |
| p5-Crypt-HSXKPasswd-..> | 2025-12-21 06:19 | 4.8M | |
| p5-Crypt-IDEA-1.10_1..> | 2025-12-18 17:26 | 9.5K | |
| p5-Crypt-Imail-0.01_..> | 2025-12-23 12:48 | 3.8K | |
| p5-Crypt-JWT-0.037.pkg | 2025-12-19 16:40 | 28K | |
| p5-Crypt-Juniper-0.0..> | 2025-12-23 18:00 | 4.2K | |
| p5-Crypt-Khazad-1.0...> | 2025-12-20 21:58 | 20K | |
| p5-Crypt-LE-0.39.pkg | 2025-12-23 16:54 | 42K | |
| p5-Crypt-LibSCEP-0.0..> | 2025-12-28 14:14 | 28K | |
| p5-Crypt-License-2.0..> | 2025-12-20 13:16 | 21K | |
| p5-Crypt-Lite-0.82.1..> | 2025-12-20 14:49 | 7.1K | |
| p5-Crypt-Loki97-1.0...> | 2025-12-23 19:08 | 14K | |
| p5-Crypt-MySQL-0.04_..> | 2025-12-18 18:48 | 7.0K | |
| p5-Crypt-NULL-1.02_1..> | 2025-12-23 18:42 | 3.3K | |
| p5-Crypt-OFB-0.01_1.pkg | 2025-12-22 09:14 | 4.3K | |
| p5-Crypt-OTP-2.00_1.pkg | 2025-12-21 11:00 | 5.4K | |
| p5-Crypt-OpenPGP-1.1..> | 2025-12-18 20:19 | 119K | |
| p5-Crypt-OpenSSL-AES..> | 2025-12-19 10:32 | 11K | |
| p5-Crypt-OpenSSL-Big..> | 2025-12-18 11:01 | 20K | |
| p5-Crypt-OpenSSL-CA-..> | 2025-12-20 10:59 | 81K | |
| p5-Crypt-OpenSSL-DSA..> | 2025-12-18 21:31 | 16K | |
| p5-Crypt-OpenSSL-EC-..> | 2025-12-19 12:16 | 34K | |
| p5-Crypt-OpenSSL-ECD..> | 2025-12-22 07:59 | 10K | |
| p5-Crypt-OpenSSL-Gue..> | 2025-12-18 06:55 | 5.7K | |
| p5-Crypt-OpenSSL-PKC..> | 2025-12-19 13:05 | 17K | |
| p5-Crypt-OpenSSL-RSA..> | 2025-12-18 11:57 | 20K | |
| p5-Crypt-OpenSSL-Ran..> | 2025-12-18 10:31 | 7.3K | |
| p5-Crypt-OpenSSL-Ver..> | 2025-12-19 01:38 | 11K | |
| p5-Crypt-OpenSSL-X50..> | 2025-12-19 02:28 | 26K | |
| p5-Crypt-PBKDF2-0.16..> | 2025-12-18 08:10 | 18K | |
| p5-Crypt-PKCS10-2.00..> | 2025-12-19 12:54 | 32K | |
| p5-Crypt-PassGen-0.0..> | 2025-12-23 06:53 | 26K | |
| p5-Crypt-Passwd-XS-0..> | 2025-12-23 15:20 | 23K | |
| p5-Crypt-PasswdMD5-1..> | 2025-12-18 18:25 | 5.2K | |
| p5-Crypt-Password-Ut..> | 2025-12-19 12:54 | 7.6K | |
| p5-Crypt-Perl-0.38.pkg | 2025-12-18 21:15 | 128K | |
| p5-Crypt-RC4-2.02_1.pkg | 2025-12-18 10:31 | 5.4K | |
| p5-Crypt-RC5-2.00_1.pkg | 2025-12-20 08:25 | 3.9K | |
| p5-Crypt-RC6-1.0_1.pkg | 2025-12-18 22:38 | 9.2K | |
| p5-Crypt-RHash-1.05.pkg | 2025-12-18 22:33 | 139K | |
| p5-Crypt-RIPEMD160-0..> | 2025-12-18 17:57 | 16K | |
| p5-Crypt-RSA-Parse-0..> | 2025-12-18 20:01 | 6.1K | |
| p5-Crypt-RSA-Yandex-..> | 2025-12-23 01:07 | 27K | |
| p5-Crypt-Rabbit-1.0...> | 2025-12-23 16:42 | 10K | |
| p5-Crypt-RandPasswd-..> | 2025-12-18 23:56 | 19K | |
| p5-Crypt-Random-Seed..> | 2025-12-18 12:22 | 17K | |
| p5-Crypt-Random-Sour..> | 2025-12-18 23:00 | 27K | |
| p5-Crypt-Random-TESH..> | 2025-12-18 09:49 | 14K | |
| p5-Crypt-Rijndael-1...> | 2025-12-18 16:14 | 17K | |
| p5-Crypt-Rijndael_PP..> | 2025-12-20 02:01 | 25K | |
| p5-Crypt-SKey-0.10_3..> | 2025-12-20 07:19 | 11K | |
| p5-Crypt-SMIME-0.31.pkg | 2025-12-19 21:40 | 24K | |
| p5-Crypt-SSLeay-0.72..> | 2025-12-18 15:58 | 34K | |
| p5-Crypt-SSSS-0.3.pkg | 2025-12-21 15:44 | 5.2K | |
| p5-Crypt-Salt-0.01_1..> | 2025-12-20 08:45 | 3.2K | |
| p5-Crypt-SaltedHash-..> | 2025-12-19 00:03 | 10K | |
| p5-Crypt-Serpent-1.0..> | 2025-12-23 04:43 | 17K | |
| p5-Crypt-Shark-1.0.1..> | 2025-12-22 05:37 | 46K | |
| p5-Crypt-Simple-0.06..> | 2025-12-21 01:16 | 5.9K | |
| p5-Crypt-SmbHash-0.1..> | 2025-12-19 22:50 | 9.8K | |
| p5-Crypt-Sodium-0.11..> | 2025-12-21 21:05 | 14K | |
| p5-Crypt-Solitaire-2..> | 2025-12-22 23:25 | 5.9K | |
| p5-Crypt-SysRandom-0..> | 2025-12-18 12:26 | 3.4K | |
| p5-Crypt-TEA-1.26.pkg | 2025-12-19 03:16 | 9.2K | |
| p5-Crypt-T_e_a-2.12_..> | 2025-12-23 15:14 | 17K | |
| p5-Crypt-Tea_JS-2.23..> | 2025-12-23 12:58 | 23K | |
| p5-Crypt-TripleDES-0..> | 2025-12-21 16:06 | 7.0K | |
| p5-Crypt-Twofish-2.1..> | 2025-12-18 16:27 | 14K | |
| p5-Crypt-Twofish2-1...> | 2025-12-19 10:59 | 15K | |
| p5-Crypt-Twofish_PP-..> | 2025-12-20 17:05 | 24K | |
| p5-Crypt-URandom-0.5..> | 2025-12-16 01:30 | 11K | |
| p5-Crypt-URandom-Tok..> | 2025-12-18 19:08 | 4.2K | |
| p5-Crypt-UnixCrypt-1..> | 2025-12-18 20:42 | 8.7K | |
| p5-Crypt-UnixCrypt_X..> | 2025-12-18 16:09 | 15K | |
| p5-Crypt-X509-0.55.pkg | 2025-12-19 13:03 | 17K | |
| p5-Crypt-X509-CRL-0...> | 2025-12-20 00:33 | 14K | |
| p5-Crypt-XTEA-0.0108..> | 2025-12-21 11:27 | 8.1K | |
| p5-Crypt-xDBM_File-1..> | 2025-12-21 13:06 | 4.8K | |
| p5-CryptX-0.087.pkg | 2025-12-18 06:47 | 616K | |
| p5-Cstools-3.44.pkg | 2025-12-22 13:32 | 33K | |
| p5-Curses-1.45.pkg | 2025-12-18 06:42 | 75K | |
| p5-Curses-Applicatio..> | 2025-12-21 06:58 | 11K | |
| p5-Curses-Forms-1.99..> | 2025-12-19 11:07 | 21K | |
| p5-Curses-UI-0.9609_..> | 2025-12-20 04:24 | 162K | |
| p5-Curses-Widgets-1...> | 2025-12-19 00:28 | 62K | |
| p5-Cvs-0.07_2.pkg | 2025-12-22 00:57 | 56K | |
| p5-Cwd-Guard-0.05.pkg | 2025-12-23 06:39 | 3.1K | |
| p5-DBD-AnyData-0.110..> | 2025-12-21 08:58 | 29K | |
| p5-DBD-CSV-0.62,1.pkg | 2025-12-19 15:37 | 28K | |
| p5-DBD-Excel-0.06_1.pkg | 2025-12-21 21:09 | 19K | |
| p5-DBD-Google-0.51_2..> | 2025-12-21 02:11 | 20K | |
| p5-DBD-InterBase-0.4..> | 2025-12-21 00:53 | 68K | |
| p5-DBD-LDAP-1.00.pkg | 2025-12-22 19:30 | 29K | |
| p5-DBD-MariaDB-1.23.pkg | 2025-12-22 07:41 | 102K | |
| p5-DBD-Mock-1.59_1.pkg | 2025-12-19 22:38 | 41K | |
| p5-DBD-Multi-0.16_1.pkg | 2025-12-23 19:59 | 10K | |
| p5-DBD-ODBC-1.61.pkg | 2025-12-22 07:12 | 163K | |
| p5-DBD-Pg-3.18.0.pkg | 2025-12-18 23:28 | 180K | |
| p5-DBD-PgLite-0.11_2..> | 2025-12-23 11:15 | 35K | |
| p5-DBD-PgPP-0.08_1.pkg | 2025-12-22 07:56 | 18K | |
| p5-DBD-SQLite-1.76.pkg | 2025-12-18 12:20 | 2.6M | |
| p5-DBD-SQLite2-0.38.pkg | 2025-12-22 08:20 | 170K | |
| p5-DBD-Sybase-1.26.pkg | 2025-12-22 14:46 | 93K | |
| p5-DBD-XBase-1.08.pkg | 2025-12-22 19:08 | 77K | |
| p5-DBD-cego-1.5.4.pkg | 2025-12-29 01:26 | 26K | |
| p5-DBD-mysql-5.008.pkg | 2025-12-18 15:33 | 95K | |
| p5-DBD-mysql4-4.052.pkg | 2025-12-20 20:47 | 97K | |
| p5-DBI-1.647_1.pkg | 2025-12-18 08:34 | 798K | |
| p5-DBI-Shell-11.98.pkg | 2025-12-19 04:56 | 46K | |
| p5-DBICx-Deploy-0.02..> | 2025-12-21 12:55 | 6.6K | |
| p5-DBICx-MapMaker-0...> | 2025-12-24 07:19 | 5.5K | |
| p5-DBICx-Sugar-0.020..> | 2025-12-18 20:25 | 8.4K | |
| p5-DBICx-TestDatabas..> | 2025-12-19 10:53 | 6.1K | |
| p5-DBICx-TxnInsert-0..> | 2025-12-23 18:25 | 3.8K | |
| p5-DBIWrapper-0.30_1..> | 2025-12-22 19:19 | 48K | |
| p5-DBIx-Abstract-1.0..> | 2025-12-20 22:31 | 18K | |
| p5-DBIx-Admin-Create..> | 2025-12-18 19:33 | 12K | |
| p5-DBIx-Admin-DSNMan..> | 2025-12-18 21:31 | 10K | |
| p5-DBIx-Admin-TableI..> | 2025-12-19 23:09 | 17K | |
| p5-DBIx-AnyDBD-2.03.pkg | 2025-12-20 02:38 | 10K | |
| p5-DBIx-Browse-2.09_..> | 2025-12-21 08:05 | 18K | |
| p5-DBIx-Class-0.0828..> | 2025-12-18 12:59 | 666K | |
| p5-DBIx-Class-AsFdat..> | 2025-12-23 00:59 | 3.1K | |
| p5-DBIx-Class-AuditL..> | 2025-12-22 04:18 | 25K | |
| p5-DBIx-Class-BitFie..> | 2025-12-23 04:59 | 8.0K | |
| p5-DBIx-Class-Candy-..> | 2025-12-18 23:13 | 15K | |
| p5-DBIx-Class-Cursor..> | 2025-12-18 18:01 | 3.8K | |
| p5-DBIx-Class-Custom..> | 2025-12-22 06:45 | 6.8K | |
| p5-DBIx-Class-DateTi..> | 2025-12-19 21:03 | 4.8K | |
| p5-DBIx-Class-Deploy..> | 2025-12-19 06:08 | 90K | |
| p5-DBIx-Class-Digest..> | 2025-12-21 22:09 | 6.9K | |
| p5-DBIx-Class-Dynami..> | 2025-12-18 16:22 | 4.1K | |
| p5-DBIx-Class-Dynami..> | 2025-12-20 04:52 | 5.2K | |
| p5-DBIx-Class-Encode..> | 2025-12-23 16:18 | 3.1K | |
| p5-DBIx-Class-Encode..> | 2025-12-20 00:21 | 19K | |
| p5-DBIx-Class-Fixtur..> | 2025-12-20 01:08 | 24K | |
| p5-DBIx-Class-Frozen..> | 2025-12-22 19:50 | 7.7K | |
| p5-DBIx-Class-Helper..> | 2025-12-19 04:57 | 156K | |
| p5-DBIx-Class-Inflat..> | 2025-12-20 01:10 | 4.3K | |
| p5-DBIx-Class-Inflat..> | 2025-12-20 04:28 | 7.5K | |
| p5-DBIx-Class-Inflat..> | 2025-12-21 14:11 | 5.1K | |
| p5-DBIx-Class-Inflat..> | 2025-12-20 03:14 | 9.4K | |
| p5-DBIx-Class-Intros..> | 2025-12-18 20:38 | 4.6K | |
| p5-DBIx-Class-Loader..> | 2025-12-23 16:41 | 18K | |
| p5-DBIx-Class-Migrat..> | 2025-12-24 04:57 | 229K | |
| p5-DBIx-Class-MooseC..> | 2025-12-21 16:29 | 11K | |
| p5-DBIx-Class-Passph..> | 2025-12-20 00:02 | 6.8K | |
| p5-DBIx-Class-QueryL..> | 2025-12-20 16:36 | 15K | |
| p5-DBIx-Class-QueryP..> | 2025-12-22 07:10 | 4.3K | |
| p5-DBIx-Class-Result..> | 2025-12-21 05:40 | 4.0K | |
| p5-DBIx-Class-Result..> | 2025-12-19 14:20 | 17K | |
| p5-DBIx-Class-Schema..> | 2025-12-20 02:39 | 8.7K | |
| p5-DBIx-Class-Schema..> | 2025-12-18 16:15 | 149K | |
| p5-DBIx-Class-Schema..> | 2025-12-20 04:16 | 40K | |
| p5-DBIx-Class-Storag..> | 2025-12-22 11:19 | 5.3K | |
| p5-DBIx-Class-TimeSt..> | 2025-12-19 03:00 | 3.8K | |
| p5-DBIx-Class-Tree-0..> | 2025-12-20 01:53 | 13K | |
| p5-DBIx-Class-Tree-N..> | 2025-12-23 02:27 | 15K | |
| p5-DBIx-Class-UUIDCo..> | 2025-12-19 23:01 | 16K | |
| p5-DBIx-Class-Virtua..> | 2025-12-19 16:22 | 7.0K | |
| p5-DBIx-Class-WebFor..> | 2025-12-20 19:55 | 3.6K | |
| p5-DBIx-Connector-0...> | 2025-12-18 17:26 | 34K | |
| p5-DBIx-ContextualFe..> | 2025-12-18 09:17 | 5.3K | |
| p5-DBIx-Custom-0.400..> | 2025-12-20 07:21 | 47K | |
| p5-DBIx-DBHResolver-..> | 2025-12-19 20:50 | 18K | |
| p5-DBIx-DBSchema-0.4..> | 2025-12-18 17:23 | 50K | |
| p5-DBIx-DataSource-0..> | 2025-12-23 01:32 | 8.9K | |
| p5-DBIx-DisconnectAl..> | 2025-12-19 02:35 | 2.9K | |
| p5-DBIx-Dump-0.04_2.pkg | 2025-12-23 06:37 | 4.2K | |
| p5-DBIx-HA-1.1_1.pkg | 2025-12-23 19:30 | 17K | |
| p5-DBIx-Handler-0.15..> | 2025-12-19 23:01 | 7.0K | |
| p5-DBIx-Inspector-0...> | 2025-12-19 23:38 | 12K | |
| p5-DBIx-Introspector..> | 2025-12-18 23:47 | 13K | |
| p5-DBIx-Lite-0.36.pkg | 2025-12-21 05:41 | 32K | |
| p5-DBIx-Log4perl-0.2..> | 2025-12-20 15:22 | 25K | |
| p5-DBIx-MySQLSequenc..> | 2025-12-24 07:33 | 12K | |
| p5-DBIx-NoSQL-0.0021..> | 2025-12-20 22:59 | 24K | |
| p5-DBIx-Password-1.9..> | 2025-12-24 07:22 | 4.2K | |
| p5-DBIx-Perlish-1.06..> | 2025-12-21 20:34 | 48K | |
| p5-DBIx-QueryLog-0.4..> | 2025-12-22 10:17 | 9.9K | |
| p5-DBIx-QuickDB-0.00..> | 2025-12-19 04:58 | 59K | |
| p5-DBIx-Recordset-0...> | 2025-12-23 21:09 | 93K | |
| p5-DBIx-RetryOverDis..> | 2025-12-20 10:35 | 8.7K | |
| p5-DBIx-SQLEngine-0...> | 2025-12-20 17:51 | 232K | |
| p5-DBIx-SQLite-Simpl..> | 2025-12-19 23:17 | 8.8K | |
| p5-DBIx-Safe-1.2.5_3..> | 2025-12-19 12:52 | 9.9K | |
| p5-DBIx-SearchBuilde..> | 2025-12-18 21:48 | 92K | |
| p5-DBIx-Sequence-1.5..> | 2025-12-23 16:08 | 11K | |
| p5-DBIx-Simple-1.37.pkg | 2025-12-18 14:50 | 30K | |
| p5-DBIx-Skinny-0.074..> | 2025-12-19 23:41 | 61K | |
| p5-DBIx-Skinny-Infla..> | 2025-12-21 22:28 | 6.3K | |
| p5-DBIx-Skinny-Mixin..> | 2025-12-21 14:56 | 2.8K | |
| p5-DBIx-Skinny-Pager..> | 2025-12-22 11:11 | 14K | |
| p5-DBIx-Skinny-Schem..> | 2025-12-20 23:16 | 8.5K | |
| p5-DBIx-Sunny-0.9993..> | 2025-12-21 05:30 | 13K | |
| p5-DBIx-TableHash-1...> | 2025-12-20 21:43 | 21K | |
| p5-DBIx-Tracer-0.03.pkg | 2025-12-20 00:44 | 5.0K | |
| p5-DBIx-TransactionM..> | 2025-12-18 20:00 | 7.2K | |
| p5-DBIx-Tree-1.98.pkg | 2025-12-20 18:00 | 13K | |
| p5-DBIx-VersionedDDL..> | 2025-12-21 12:05 | 13K | |
| p5-DBIx-Wrapper-0.29..> | 2025-12-20 10:32 | 41K | |
| p5-DBIx-XHTML_Table-..> | 2025-12-20 11:26 | 27K | |
| p5-DBIx-XML_RDB-0.05..> | 2025-12-21 11:54 | 8.2K | |
| p5-DBM-Deep-2.0019.pkg | 2025-12-19 02:06 | 91K | |
| p5-DB_File-Lock-0.05..> | 2025-12-21 16:56 | 8.5K | |
| p5-DJabberd-0.85_2.pkg | 2025-12-21 09:22 | 110K | |
| p5-DNS-Config-0.66_1..> | 2025-12-22 12:50 | 12K | |
| p5-DNS-EasyDNS-0.04_..> | 2025-12-21 12:28 | 7.6K | |
| p5-DNS-Zone-0.85_1.pkg | 2025-12-23 16:26 | 7.8K | |
| p5-DNS-ZoneParse-1.1..> | 2025-12-22 22:24 | 17K | |
| p5-DNS-ldns-1.9.0.pkg | 2025-12-30 14:51 | 102K | |
| p5-DNS-nsdiff-1.85_1..> | 2025-12-27 23:46 | 22K | |
| p5-DR-Tarantool-0.44..> | 2025-12-20 02:25 | 73K | |
| p5-DWH_File-0.24_2.pkg | 2025-12-20 15:55 | 45K | |
| p5-Daemon-Control-0...> | 2025-12-19 01:34 | 18K | |
| p5-Daemon-Generic-0...> | 2025-12-20 14:54 | 20K | |
| p5-Dancer-1.3520.pkg | 2025-12-19 00:09 | 369K | |
| p5-Dancer-Debug-0.04..> | 2025-12-23 07:46 | 11K | |
| p5-Dancer-Logger-Log..> | 2025-12-20 05:44 | 7.5K | |
| p5-Dancer-Logger-Sys..> | 2025-12-20 19:18 | 4.1K | |
| p5-Dancer-Plugin-Aut..> | 2025-12-22 11:19 | 26K | |
| p5-Dancer-Plugin-COR..> | 2025-12-22 19:07 | 10K | |
| p5-Dancer-Plugin-DBI..> | 2025-12-20 18:20 | 7.5K | |
| p5-Dancer-Plugin-Dat..> | 2025-12-22 12:41 | 12K | |
| p5-Dancer-Plugin-Dat..> | 2025-12-19 00:12 | 20K | |
| p5-Dancer-Plugin-Ema..> | 2025-12-22 10:52 | 8.2K | |
| p5-Dancer-Plugin-Ext..> | 2025-12-20 05:25 | 5.8K | |
| p5-Dancer-Plugin-Fee..> | 2025-12-21 08:12 | 5.3K | |
| p5-Dancer-Plugin-Fla..> | 2025-12-21 05:12 | 5.5K | |
| p5-Dancer-Plugin-Lex..> | 2025-12-20 10:07 | 9.3K | |
| p5-Dancer-Plugin-Mem..> | 2025-12-23 10:36 | 5.2K | |
| p5-Dancer-Plugin-RES..> | 2025-12-19 09:08 | 6.1K | |
| p5-Dancer-Plugin-RPC..> | 2025-12-21 17:06 | 38K | |
| p5-Dancer-Plugin-Red..> | 2025-12-23 09:40 | 4.8K | |
| p5-Dancer-Plugin-Sit..> | 2025-12-23 21:07 | 7.9K | |
| p5-Dancer-Plugin-Swa..> | 2025-12-21 09:52 | 775K | |
| p5-Dancer-Plugin-Val..> | 2025-12-23 13:23 | 4.1K | |
| p5-Dancer-Session-Co..> | 2025-12-23 13:24 | 6.8K | |
| p5-Dancer-Session-Me..> | 2025-12-23 20:02 | 3.7K | |
| p5-Dancer-Template-X..> | 2025-12-23 19:51 | 4.2K | |
| p5-Dancer2-2.0.1.pkg | 2025-12-19 01:23 | 410K | |
| p5-Dancer2-Plugin-Aj..> | 2025-12-23 11:15 | 4.1K | |
| p5-Dancer2-Plugin-Au..> | 2025-12-19 23:10 | 54K | |
| p5-Dancer2-Plugin-Au..> | 2025-12-21 01:46 | 11K | |
| p5-Dancer2-Plugin-Au..> | 2025-12-21 16:47 | 13K | |
| p5-Dancer2-Plugin-Au..> | 2025-12-21 11:29 | 5.7K | |
| p5-Dancer2-Plugin-DB..> | 2025-12-19 12:36 | 6.7K | |
| p5-Dancer2-Plugin-Da..> | 2025-12-19 17:17 | 13K | |
| p5-Dancer2-Plugin-De..> | 2025-12-19 15:46 | 5.9K | |
| p5-Dancer2-Plugin-Em..> | 2025-12-21 14:57 | 8.0K | |
| p5-Dancer2-Plugin-Fo..> | 2025-12-20 11:10 | 18K | |
| p5-Dancer2-Plugin-Lo..> | 2025-12-30 05:46 | 34K | |
| p5-Dancer2-Plugin-Pa..> | 2025-12-21 18:50 | 4.5K | |
| p5-Dancer2-Session-D..> | 2025-12-22 07:30 | 13K | |
| p5-Danga-Socket-1.62..> | 2025-12-18 18:55 | 18K | |
| p5-Danga-Socket-Call..> | 2025-12-19 01:02 | 4.3K | |
| p5-Data-ACL-0.02_1.pkg | 2025-12-21 06:16 | 4.2K | |
| p5-Data-AMF-0.09_1.pkg | 2025-12-19 03:20 | 29K | |
| p5-Data-Alias-1.28.pkg | 2025-12-19 09:05 | 31K | |
| p5-Data-Binary-0.01.pkg | 2025-12-18 20:34 | 3.4K | |
| p5-Data-Bind-0.30_2.pkg | 2025-12-20 00:09 | 13K | |
| p5-Data-Buffer-0.06.pkg | 2025-12-18 12:48 | 8.7K | |
| p5-Data-Capture-0.27..> | 2025-12-19 00:14 | 3.1K | |
| p5-Data-Censor-0.04.pkg | 2025-12-18 18:27 | 7.4K | |
| p5-Data-ClearSilver-..> | 2025-12-21 12:42 | 6.5K | |
| p5-Data-Clone-0.006.pkg | 2025-12-18 18:25 | 11K | |
| p5-Data-Cmp-0.010.pkg | 2025-12-20 02:26 | 12K | |
| p5-Data-Compare-1.22..> | 2025-12-18 09:45 | 15K | |
| p5-Data-Currency-0.0..> | 2025-12-23 17:14 | 7.2K | |
| p5-Data-Diver-1.0101..> | 2025-12-23 04:50 | 11K | |
| p5-Data-Dmp-0.242.pkg | 2025-12-18 07:54 | 11K | |
| p5-Data-Domain-1.16.pkg | 2025-12-20 01:19 | 44K | |
| p5-Data-Dump-1.25.pkg | 2025-12-18 10:10 | 22K | |
| p5-Data-Dump-Color-0..> | 2025-12-24 06:57 | 199K | |
| p5-Data-Dump-Streame..> | 2025-12-18 13:43 | 60K | |
| p5-Data-DumpXML-1.06..> | 2025-12-23 19:42 | 10K | |
| p5-Data-Dumper-2.183..> | 2025-12-18 21:59 | 39K | |
| p5-Data-Dumper-Conci..> | 2025-12-18 11:31 | 11K | |
| p5-Data-Dumper-Inter..> | 2025-12-23 12:48 | 44K | |
| p5-Data-Dumper-Perlt..> | 2025-12-22 03:27 | 5.9K | |
| p5-Data-Dumper-Simpl..> | 2025-12-20 04:01 | 9.2K | |
| p5-Data-Float-0.015.pkg | 2025-12-20 14:44 | 22K | |
| p5-Data-Flow-1.02_1.pkg | 2025-12-19 12:53 | 7.2K | |
| p5-Data-FormValidato..> | 2025-12-19 01:55 | 70K | |
| p5-Data-FormValidato..> | 2025-12-22 23:23 | 11K | |
| p5-Data-Frame-0.0060..> | 2025-12-30 02:23 | 751K | |
| p5-Data-GUID-0.051.pkg | 2025-12-18 11:54 | 7.7K | |
| p5-Data-Google-Visua..> | 2025-12-22 23:23 | 13K | |
| p5-Data-Google-Visua..> | 2025-12-19 14:44 | 15K | |
| p5-Data-Grouper-0.06..> | 2025-12-21 03:26 | 13K | |
| p5-Data-HashArray-1...> | 2025-12-20 00:33 | 9.0K | |
| p5-Data-HexDump-0.04..> | 2025-12-18 23:48 | 6.1K | |
| p5-Data-HexDump-Rang..> | 2025-12-19 23:02 | 40K | |
| p5-Data-Hexdumper-3...> | 2025-12-23 06:50 | 10K | |
| p5-Data-Hexify-1.00_..> | 2025-12-24 00:26 | 6.4K | |
| p5-Data-Hierarchy-0...> | 2025-12-18 23:19 | 9.3K | |
| p5-Data-ICal-0.24.pkg | 2025-12-19 01:03 | 50K | |
| p5-Data-ICal-DateTim..> | 2025-12-22 12:30 | 9.5K | |
| p5-Data-IEEE754-0.02..> | 2025-12-18 21:44 | 4.1K | |
| p5-Data-IPV4-Range-P..> | 2025-12-19 12:45 | 5.7K | |
| p5-Data-Inherited-1...> | 2025-12-19 02:28 | 5.7K | |
| p5-Data-Inspect-0.05..> | 2025-12-19 02:08 | 8.0K | |
| p5-Data-Integer-0.00..> | 2025-12-18 12:52 | 16K | |
| p5-Data-JavaScript-1..> | 2025-12-24 01:53 | 7.4K | |
| p5-Data-JavaScript-A..> | 2025-12-23 08:12 | 9.2K | |
| p5-Data-Lazy-0.6_1.pkg | 2025-12-18 17:51 | 10K | |
| p5-Data-Localize-0.0..> | 2025-12-22 12:37 | 39K | |
| p5-Data-Lock-1.03.pkg | 2025-12-21 06:17 | 8.9K | |
| p5-Data-MessagePack-..> | 2025-12-18 13:46 | 25K | |
| p5-Data-MessagePack-..> | 2025-12-18 20:19 | 7.8K | |
| p5-Data-Miscellany-1..> | 2025-12-18 17:37 | 8.6K | |
| p5-Data-ModeMerge-0...> | 2025-12-18 22:53 | 37K | |
| p5-Data-Model-0.0000..> | 2025-12-20 08:56 | 62K | |
| p5-Data-Munge-0.100.pkg | 2025-12-18 14:19 | 10K | |
| p5-Data-Object-2.05.pkg | 2025-12-21 12:05 | 73K | |
| p5-Data-Object-Args-..> | 2025-12-20 08:46 | 5.0K | |
| p5-Data-Object-Attri..> | 2025-12-18 19:23 | 7.2K | |
| p5-Data-Object-Cast-..> | 2025-12-19 01:06 | 5.5K | |
| p5-Data-Object-Class..> | 2025-12-18 20:19 | 3.6K | |
| p5-Data-Object-Class..> | 2025-12-20 02:01 | 3.0K | |
| p5-Data-Object-Data-..> | 2025-12-21 17:18 | 6.6K | |
| p5-Data-Object-Excep..> | 2025-12-18 23:15 | 4.7K | |
| p5-Data-Object-Kind-..> | 2025-12-19 07:11 | 3.7K | |
| p5-Data-Object-Name-..> | 2025-12-18 13:46 | 4.7K | |
| p5-Data-Object-Opts-..> | 2025-12-24 04:50 | 5.5K | |
| p5-Data-Object-Plugi..> | 2025-12-19 10:57 | 3.2K | |
| p5-Data-Object-Role-..> | 2025-12-20 03:39 | 3.7K | |
| p5-Data-Object-Role-..> | 2025-12-23 01:48 | 4.3K | |
| p5-Data-Object-Role-..> | 2025-12-19 08:29 | 4.0K | |
| p5-Data-Object-Role-..> | 2025-12-19 14:44 | 4.0K | |
| p5-Data-Object-Role-..> | 2025-12-21 18:25 | 4.4K | |
| p5-Data-Object-Role-..> | 2025-12-21 17:04 | 4.6K | |
| p5-Data-Object-Role-..> | 2025-12-19 12:39 | 3.4K | |
| p5-Data-Object-Role-..> | 2025-12-23 19:50 | 3.6K | |
| p5-Data-Object-Role-..> | 2025-12-19 16:43 | 3.8K | |
| p5-Data-Object-Role-..> | 2025-12-19 19:44 | 3.5K | |
| p5-Data-Object-Role-..> | 2025-12-19 21:00 | 3.5K | |
| p5-Data-Object-Role-..> | 2025-12-19 04:37 | 3.8K | |
| p5-Data-Object-RoleH..> | 2025-12-19 12:39 | 3.0K | |
| p5-Data-Object-Space..> | 2025-12-18 17:21 | 14K | |
| p5-Data-Object-State..> | 2025-12-23 14:53 | 4.1K | |
| p5-Data-Object-Struc..> | 2025-12-21 11:56 | 3.4K | |
| p5-Data-Object-Try-2..> | 2025-12-19 01:33 | 6.4K | |
| p5-Data-Object-Types..> | 2025-12-19 00:46 | 19K | |
| p5-Data-Object-Vars-..> | 2025-12-22 09:15 | 4.9K | |
| p5-Data-ObjectDriver..> | 2025-12-19 02:06 | 98K | |
| p5-Data-OptList-0.11..> | 2025-12-18 00:29 | 7.4K | |
| p5-Data-Page-2.03.pkg | 2025-12-18 18:55 | 6.4K | |
| p5-Data-Page-NoTotal..> | 2025-12-19 22:57 | 3.9K | |
| p5-Data-Page-Pageset..> | 2025-12-18 20:33 | 6.0K | |
| p5-Data-Pageset-1.06..> | 2025-12-23 07:08 | 6.9K | |
| p5-Data-ParseBinary-..> | 2025-12-20 17:20 | 59K | |
| p5-Data-Password-1.1..> | 2025-12-19 06:08 | 6.2K | |
| p5-Data-Path-1.4.1_1..> | 2025-12-20 11:02 | 4.8K | |
| p5-Data-Peek-0.53.pkg | 2025-12-19 19:17 | 19K | |
| p5-Data-Perl-0.00201..> | 2025-12-18 10:16 | 36K | |
| p5-Data-Phrasebook-0..> | 2025-12-18 22:30 | 33K | |
| p5-Data-Phrasebook-L..> | 2025-12-19 15:53 | 8.1K | |
| p5-Data-Printer-1.00..> | 2025-12-19 00:04 | 114K | |
| p5-Data-Properties-1..> | 2025-12-21 13:43 | 7.7K | |
| p5-Data-Rand-0.0.4_1..> | 2025-12-19 22:23 | 10K | |
| p5-Data-Rand-Obscure..> | 2025-12-19 03:31 | 9.1K | |
| p5-Data-Random-0.14.pkg | 2025-12-19 00:42 | 127K | |
| p5-Data-Range-Compar..> | 2025-12-19 03:03 | 28K | |
| p5-Data-Record-0.02_..> | 2025-12-18 18:36 | 8.9K | |
| p5-Data-Recursive-En..> | 2025-12-22 17:56 | 4.5K | |
| p5-Data-Remember-0.1..> | 2025-12-20 18:24 | 34K | |
| p5-Data-Report-1.001..> | 2025-12-23 16:10 | 21K | |
| p5-Data-Rmap-0.65.pkg | 2025-12-18 11:06 | 12K | |
| p5-Data-RoundRobin-0..> | 2025-12-22 09:14 | 3.4K | |
| p5-Data-Rx-0.200008.pkg | 2025-12-23 08:48 | 41K | |
| p5-Data-SExpression-..> | 2025-12-19 09:47 | 15K | |
| p5-Data-Sah-0.917.pkg | 2025-12-30 08:10 | 217K | |
| p5-Data-Sah-Coerce-0..> | 2025-12-19 20:52 | 99K | |
| p5-Data-Sah-DefaultV..> | 2025-12-27 03:18 | 22K | |
| p5-Data-Sah-Filter-0..> | 2025-12-27 16:14 | 118K | |
| p5-Data-Sah-Normaliz..> | 2025-12-18 12:02 | 5.6K | |
| p5-Data-Sah-Resolve-..> | 2025-12-19 06:15 | 8.4K | |
| p5-Data-Section-0.20..> | 2025-12-18 16:00 | 9.5K | |
| p5-Data-Section-Simp..> | 2025-12-19 00:03 | 4.8K | |
| p5-Data-Serializable..> | 2025-12-22 17:11 | 7.1K | |
| p5-Data-Serializer-0..> | 2025-12-18 17:01 | 43K | |
| p5-Data-Serializer-S..> | 2025-12-22 01:36 | 3.8K | |
| p5-Data-ShowTable-4...> | 2025-12-19 14:43 | 45K | |
| p5-Data-SpreadPagina..> | 2025-12-20 19:01 | 6.5K | |
| p5-Data-Stag-0.14_2.pkg | 2025-12-18 10:56 | 128K | |
| p5-Data-Stream-Bulk-..> | 2025-12-18 13:15 | 31K | |
| p5-Data-Structure-Ut..> | 2025-12-19 02:22 | 20K | |
| p5-Data-Table-1.78.pkg | 2025-12-23 16:12 | 53K | |
| p5-Data-Taxonomy-Tag..> | 2025-12-21 12:02 | 7.3K | |
| p5-Data-TemporaryBag..> | 2025-12-18 16:38 | 6.0K | |
| p5-Data-Throttler-0...> | 2025-12-18 17:39 | 10K | |
| p5-Data-Throttler-Me..> | 2025-12-19 02:31 | 6.4K | |
| p5-Data-TreeDumper-0..> | 2025-12-18 14:35 | 32K | |
| p5-Data-TreeDumper-R..> | 2025-12-22 18:08 | 8.8K | |
| p5-Data-TreeDumper-R..> | 2025-12-27 03:29 | 6.1K | |
| p5-Data-Types-0.17.pkg | 2025-12-18 20:40 | 8.3K | |
| p5-Data-URIEncode-0...> | 2025-12-23 17:14 | 10K | |
| p5-Data-UUID-1.227.pkg | 2025-12-18 10:21 | 13K | |
| p5-Data-Uniqid-0.12_..> | 2025-12-19 16:22 | 3.8K | |
| p5-Data-Unixish-1.57..> | 2025-12-19 16:50 | 120K | |
| p5-Data-Util-0.67.pkg | 2025-12-18 19:21 | 50K | |
| p5-Data-Validate-0.0..> | 2025-12-23 15:28 | 9.2K | |
| p5-Data-Validate-Dom..> | 2025-12-19 17:40 | 8.8K | |
| p5-Data-Validate-Ema..> | 2025-12-23 05:11 | 7.0K | |
| p5-Data-Validate-IP-..> | 2025-12-19 02:01 | 11K | |
| p5-Data-Validate-URI..> | 2025-12-22 13:27 | 9.2K | |
| p5-Data-Validator-1...> | 2025-12-19 22:58 | 18K | |
| p5-Data-Visitor-0.32..> | 2025-12-18 11:03 | 15K | |
| p5-Data-Visitor-Enco..> | 2025-12-20 04:33 | 5.9K | |
| p5-Data-Visitor-Tiny..> | 2025-12-22 08:39 | 5.2K | |
| p5-Data-Walk-2.01.pkg | 2025-12-21 03:19 | 10K | |
| p5-DataStruct-Flat-0..> | 2025-12-19 12:41 | 3.3K | |
| p5-Date-Business-1.3..> | 2025-12-21 07:11 | 7.9K | |
| p5-Date-Calc-6.4.pkg | 2025-12-18 11:31 | 165K | |
| p5-Date-Calc-Iterato..> | 2025-12-22 23:58 | 6.1K | |
| p5-Date-Calc-XS-6.4.pkg | 2025-12-21 18:25 | 39K | |
| p5-Date-Chinese-1.12..> | 2025-12-22 16:13 | 4.8K | |
| p5-Date-DayOfWeek-1...> | 2025-12-20 08:11 | 14K | |
| p5-Date-Easter-1.22.pkg | 2025-12-19 16:44 | 5.0K | |
| p5-Date-Extract-0.07..> | 2025-12-18 23:37 | 8.7K | |
| p5-Date-EzDate-1.16.pkg | 2025-12-21 11:30 | 36K | |
| p5-Date-Handler-1.2_..> | 2025-12-21 05:11 | 33K | |
| p5-Date-Holidays-DK-..> | 2025-12-22 15:20 | 4.1K | |
| p5-Date-ICal-2.682.pkg | 2025-12-19 17:12 | 24K | |
| p5-Date-ISO-1.31_1.pkg | 2025-12-23 19:09 | 7.0K | |
| p5-Date-Leapyear-1.7..> | 2025-12-19 00:18 | 2.6K | |
| p5-Date-Manip-6.98_1..> | 2025-12-18 11:19 | 914K | |
| p5-Date-Pcalc-6.1_1.pkg | 2025-12-19 15:36 | 187K | |
| p5-Date-Piece-0.0.3_..> | 2025-12-20 13:56 | 16K | |
| p5-Date-Range-1.41_1..> | 2025-12-18 15:21 | 5.4K | |
| p5-Date-Roman-1.06_1..> | 2025-12-23 14:10 | 18K | |
| p5-Date-Simple-3.03_..> | 2025-12-18 13:43 | 29K | |
| p5-DateConvert-0.16_..> | 2025-12-20 23:20 | 16K | |
| p5-DateTime-1.66.pkg | 2025-12-18 03:47 | 85K | |
| p5-DateTime-Astro-1...> | 2025-12-18 11:37 | 33K | |
| p5-DateTime-Calendar..> | 2025-12-18 19:12 | 12K | |
| p5-DateTime-Calendar..> | 2025-12-19 11:32 | 17K | |
| p5-DateTime-Calendar..> | 2025-12-20 05:42 | 10K | |
| p5-DateTime-Calendar..> | 2025-12-23 16:02 | 87K | |
| p5-DateTime-Calendar..> | 2025-12-23 20:02 | 17K | |
| p5-DateTime-Calendar..> | 2025-12-19 12:39 | 12K | |
| p5-DateTime-Calendar..> | 2025-12-18 19:30 | 6.6K | |
| p5-DateTime-Calendar..> | 2025-12-20 14:53 | 8.7K | |
| p5-DateTime-Calendar..> | 2025-12-23 12:38 | 16K | |
| p5-DateTime-Cron-Sim..> | 2025-12-23 08:54 | 3.8K | |
| p5-DateTime-Event-Ch..> | 2025-12-18 18:48 | 4.6K | |
| p5-DateTime-Event-Cr..> | 2025-12-19 22:44 | 11K | |
| p5-DateTime-Event-Ea..> | 2025-12-23 16:04 | 19K | |
| p5-DateTime-Event-IC..> | 2025-12-18 10:27 | 9.8K | |
| p5-DateTime-Event-Lu..> | 2025-12-22 00:57 | 6.4K | |
| p5-DateTime-Event-Na..> | 2025-12-22 03:45 | 17K | |
| p5-DateTime-Event-Ra..> | 2025-12-20 01:52 | 7.8K | |
| p5-DateTime-Event-Re..> | 2025-12-18 07:19 | 16K | |
| p5-DateTime-Event-Su..> | 2025-12-18 20:32 | 21K | |
| p5-DateTime-Event-Zo..> | 2025-12-22 10:21 | 5.6K | |
| p5-DateTime-Fiscal-Y..> | 2025-12-21 10:33 | 5.3K | |
| p5-DateTime-Format-B..> | 2025-12-22 06:48 | 10K | |
| p5-DateTime-Format-B..> | 2025-12-20 13:16 | 3.5K | |
| p5-DateTime-Format-B..> | 2025-12-18 10:18 | 51K | |
| p5-DateTime-Format-D..> | 2025-12-22 05:25 | 5.8K | |
| p5-DateTime-Format-D..> | 2025-12-18 11:41 | 7.8K | |
| p5-DateTime-Format-D..> | 2025-12-18 19:52 | 5.1K | |
| p5-DateTime-Format-D..> | 2025-12-18 23:17 | 16K | |
| p5-DateTime-Format-E..> | 2025-12-22 06:56 | 29K | |
| p5-DateTime-Format-E..> | 2025-12-22 16:11 | 8.2K | |
| p5-DateTime-Format-F..> | 2025-12-18 13:46 | 27K | |
| p5-DateTime-Format-H..> | 2025-12-19 01:26 | 7.4K | |
| p5-DateTime-Format-I..> | 2025-12-20 05:59 | 7.1K | |
| p5-DateTime-Format-I..> | 2025-12-18 12:03 | 9.0K | |
| p5-DateTime-Format-I..> | 2025-12-18 18:25 | 14K | |
| p5-DateTime-Format-M..> | 2025-12-18 15:21 | 10K | |
| p5-DateTime-Format-M..> | 2025-12-18 12:53 | 4.3K | |
| p5-DateTime-Format-N..> | 2025-12-18 12:32 | 53K | |
| p5-DateTime-Format-O..> | 2025-12-18 11:58 | 7.5K | |
| p5-DateTime-Format-P..> | 2025-12-18 11:59 | 14K | |
| p5-DateTime-Format-R..> | 2025-12-21 10:43 | 4.9K | |
| p5-DateTime-Format-R..> | 2025-12-23 18:50 | 3.7K | |
| p5-DateTime-Format-R..> | 2025-12-21 16:51 | 6.7K | |
| p5-DateTime-Format-S..> | 2025-12-18 17:49 | 5.2K | |
| p5-DateTime-Format-S..> | 2025-12-18 06:46 | 19K | |
| p5-DateTime-Format-W..> | 2025-12-18 15:58 | 5.7K | |
| p5-DateTime-Format-X..> | 2025-12-20 04:19 | 3.1K | |
| p5-DateTime-Function..> | 2025-12-23 08:22 | 3.8K | |
| p5-DateTime-HiRes-0...> | 2025-12-18 10:04 | 3.8K | |
| p5-DateTime-Incomple..> | 2025-12-19 20:44 | 19K | |
| p5-DateTime-Locale-1..> | 2025-12-18 02:32 | 3.2M | |
| p5-DateTime-Precise-..> | 2025-12-19 08:20 | 35K | |
| p5-DateTime-Set-0.39..> | 2025-12-18 05:42 | 38K | |
| p5-DateTime-TimeZone..> | 2025-12-18 02:49 | 251K | |
| p5-DateTime-TimeZone..> | 2025-12-20 07:01 | 7.2K | |
| p5-DateTime-TimeZone..> | 2025-12-23 15:24 | 8.8K | |
| p5-DateTime-Util-Cal..> | 2025-12-18 19:53 | 7.9K | |
| p5-DateTimeX-Easy-0...> | 2025-12-18 17:13 | 12K | |
| p5-Debug-Client-0.34..> | 2025-12-22 02:22 | 14K | |
| p5-Decision-ACL-0.02..> | 2025-12-22 05:03 | 13K | |
| p5-Declare-Constrain..> | 2025-12-19 03:25 | 40K | |
| p5-DefHash-2.0.1.pkg | 2025-12-21 19:28 | 7.9K | |
| p5-DelimMatch-1.06.pkg | 2025-12-20 03:04 | 11K | |
| p5-Dev-Bollocks-0.06..> | 2025-12-19 20:50 | 10K | |
| p5-Devel-ArgNames-0...> | 2025-12-18 06:56 | 3.9K | |
| p5-Devel-Autoflush-0..> | 2025-12-18 21:56 | 3.9K | |
| p5-Devel-Backtrace-0..> | 2025-12-21 07:39 | 17K | |
| p5-Devel-CallChecker..> | 2025-12-18 07:49 | 12K | |
| p5-Devel-Caller-2.07..> | 2025-12-18 06:40 | 7.7K | |
| p5-Devel-Caller-Igno..> | 2025-12-19 14:44 | 3.9K | |
| p5-Devel-Caller-Perl..> | 2025-12-19 11:19 | 3.4K | |
| p5-Devel-Callsite-1...> | 2025-12-19 11:03 | 9.0K | |
| p5-Devel-CheckBin-0...> | 2025-12-18 19:50 | 3.2K | |
| p5-Devel-CheckCompil..> | 2025-12-18 05:37 | 5.4K | |
| p5-Devel-CheckLib-1...> | 2025-12-18 12:45 | 14K | |
| p5-Devel-CheckOS-2.0..> | 2025-12-18 23:18 | 75K | |
| p5-Devel-Confess-0.0..> | 2025-12-21 02:50 | 15K | |
| p5-Devel-Constants-1..> | 2025-12-22 15:15 | 7.4K | |
| p5-Devel-CoreStack-1..> | 2025-12-23 14:09 | 3.4K | |
| p5-Devel-Cover-1.51.pkg | 2025-12-18 18:26 | 174K | |
| p5-Devel-Cover-Repor..> | 2025-12-23 21:07 | 9.0K | |
| p5-Devel-Cycle-1.12.pkg | 2025-12-18 20:49 | 8.3K | |
| p5-Devel-DProfPP-1.3..> | 2025-12-23 06:27 | 6.4K | |
| p5-Devel-Declare-0.0..> | 2025-12-18 04:39 | 30K | |
| p5-Devel-Declare-Par..> | 2025-12-19 03:16 | 23K | |
| p5-Devel-Diagram-1.0..> | 2025-12-22 12:14 | 17K | |
| p5-Devel-Ditto-0.06_..> | 2025-12-21 05:58 | 6.0K | |
| p5-Devel-Dumpvar-1.0..> | 2025-12-23 03:49 | 7.3K | |
| p5-Devel-EvalContext..> | 2025-12-22 16:58 | 5.5K | |
| p5-Devel-Events-0.10..> | 2025-12-19 15:30 | 46K | |
| p5-Devel-Events-Obje..> | 2025-12-23 05:27 | 11K | |
| p5-Devel-FindPerl-0...> | 2025-12-20 05:36 | 6.1K | |
| p5-Devel-Gladiator-0..> | 2025-12-21 07:05 | 7.4K | |
| p5-Devel-GlobalDestr..> | 2025-12-18 01:36 | 4.3K | |
| p5-Devel-GlobalDestr..> | 2025-12-20 19:03 | 4.8K | |
| p5-Devel-Hide-0.0015..> | 2025-12-18 13:22 | 9.5K | |
| p5-Devel-InheritName..> | 2025-12-19 11:21 | 5.5K | |
| p5-Devel-KYTProf-0.9..> | 2025-12-20 19:01 | 8.2K | |
| p5-Devel-Leak-0.03_2..> | 2025-12-19 15:05 | 7.5K | |
| p5-Devel-Leak-Cb-0.0..> | 2025-12-20 10:56 | 5.6K | |
| p5-Devel-Leak-Object..> | 2025-12-24 05:21 | 6.6K | |
| p5-Devel-LeakGuard-O..> | 2025-12-21 12:38 | 14K | |
| p5-Devel-LeakTrace-0..> | 2025-12-20 09:42 | 6.7K | |
| p5-Devel-LexAlias-0...> | 2025-12-18 11:08 | 6.2K | |
| p5-Devel-MAT-0.53.pkg | 2025-12-19 22:34 | 137K | |
| p5-Devel-MAT-Dumper-..> | 2025-12-19 00:00 | 27K | |
| p5-Devel-Messenger-0..> | 2025-12-19 08:32 | 10K | |
| p5-Devel-Modlist-0.8..> | 2025-12-22 15:02 | 11K | |
| p5-Devel-NYTProf-6.1..> | 2025-12-18 20:19 | 351K | |
| p5-Devel-OverloadInf..> | 2025-12-18 01:37 | 5.3K | |
| p5-Devel-PPPort-3.68..> | 2025-12-22 09:20 | 178K | |
| p5-Devel-PackagePath..> | 2025-12-19 18:10 | 5.2K | |
| p5-Devel-PartialDump..> | 2025-12-18 02:26 | 10K | |
| p5-Devel-PatchPerl-2..> | 2025-12-19 03:03 | 150K | |
| p5-Devel-Platform-In..> | 2025-12-18 21:10 | 29K | |
| p5-Devel-Pointer-1.0..> | 2025-12-22 23:35 | 7.0K | |
| p5-Devel-Profile-1.0..> | 2025-12-22 06:51 | 9.4K | |
| p5-Devel-REPL-1.0030..> | 2025-12-18 17:02 | 81K | |
| p5-Devel-Refactor-0...> | 2025-12-22 15:00 | 10K | |
| p5-Devel-Refcount-0...> | 2025-12-19 07:14 | 9.3K | |
| p5-Devel-Required-0...> | 2025-12-21 16:48 | 8.7K | |
| p5-Devel-RingBuffer-..> | 2025-12-19 15:38 | 31K | |
| p5-Devel-STrace-0.31..> | 2025-12-22 21:29 | 14K | |
| p5-Devel-SimpleTrace..> | 2025-12-20 08:57 | 6.2K | |
| p5-Devel-Size-0.85.pkg | 2025-12-18 17:33 | 15K | |
| p5-Devel-Size-Report..> | 2025-12-22 17:25 | 13K | |
| p5-Devel-SmallProf-2..> | 2025-12-23 04:29 | 9.5K | |
| p5-Devel-StackTrace-..> | 2025-12-18 01:11 | 15K | |
| p5-Devel-StackTrace-..> | 2025-12-18 06:12 | 5.5K | |
| p5-Devel-StackTrace-..> | 2025-12-18 17:02 | 4.6K | |
| p5-Devel-StealthDebu..> | 2025-12-22 19:28 | 9.5K | |
| p5-Devel-StrictMode-..> | 2025-12-19 20:17 | 5.3K | |
| p5-Devel-Symdump-2.1..> | 2025-12-18 10:10 | 8.8K | |
| p5-Devel-Timer-0.14.pkg | 2025-12-21 20:19 | 8.6K | |
| p5-Devel-Trace-0.12_..> | 2025-12-18 18:56 | 4.5K | |
| p5-Devel-TraceCalls-..> | 2025-12-19 12:54 | 20K | |
| p5-Devel-TraceSAX-0...> | 2025-12-21 22:31 | 7.1K | |
| p5-Devel-TraceUse-2...> | 2025-12-20 20:59 | 13K | |
| p5-Devel-ebug-0.64.pkg | 2025-12-21 19:28 | 47K | |
| p5-Devel-ptkdb-1.109..> | 2025-12-29 06:30 | 41K | |
| p5-Device-Gsm-1.61.pkg | 2025-12-19 17:31 | 51K | |
| p5-Device-Modem-1.59..> | 2025-12-19 02:05 | 50K | |
| p5-Device-RAID-Polle..> | 2025-12-21 22:02 | 27K | |
| p5-Device-SerialPort..> | 2025-12-18 17:02 | 47K | |
| p5-Device-USB-0.35_2..> | 2025-12-21 18:36 | 50K | |
| p5-Digest-1.20.pkg | 2025-12-19 11:11 | 14K | |
| p5-Digest-Adler32-0...> | 2025-12-23 04:10 | 3.1K | |
| p5-Digest-Bcrypt-1.2..> | 2025-12-22 20:38 | 8.0K | |
| p5-Digest-BubbleBabb..> | 2025-12-18 17:58 | 4.6K | |
| p5-Digest-CRC-0.24.pkg | 2025-12-18 13:37 | 11K | |
| p5-Digest-Crc32-0.01..> | 2025-12-22 14:04 | 3.0K | |
| p5-Digest-DJB-1.00_1..> | 2025-12-23 07:44 | 6.5K | |
| p5-Digest-DMAC-1.1.4..> | 2025-12-23 01:32 | 5.5K | |
| p5-Digest-EMAC-1.2_2..> | 2025-12-20 21:25 | 5.4K | |
| p5-Digest-Elf-1.42.pkg | 2025-12-23 11:01 | 6.5K | |
| p5-Digest-FNV-2.00_1..> | 2025-12-21 00:19 | 11K | |
| p5-Digest-GOST-0.06.pkg | 2025-12-23 12:39 | 16K | |
| p5-Digest-HMAC-1.05.pkg | 2025-12-16 01:30 | 7.0K | |
| p5-Digest-Hashcash-0..> | 2025-12-22 11:10 | 16K | |
| p5-Digest-Haval256-1..> | 2025-12-19 03:03 | 21K | |
| p5-Digest-JHash-0.10..> | 2025-12-18 18:41 | 8.2K | |
| p5-Digest-MD2-2.04_2..> | 2025-12-18 13:07 | 9.1K | |
| p5-Digest-MD4-1.9_2.pkg | 2025-12-18 18:23 | 25K | |
| p5-Digest-MD5-2.59_1..> | 2025-12-18 23:30 | 18K | |
| p5-Digest-MD5-File-0..> | 2025-12-18 20:47 | 6.6K | |
| p5-Digest-MD5-M4p-0...> | 2025-12-18 23:19 | 11K | |
| p5-Digest-MD5-Revers..> | 2025-12-20 17:31 | 4.4K | |
| p5-Digest-ManberHash..> | 2025-12-24 00:38 | 8.5K | |
| p5-Digest-MurmurHash..> | 2025-12-22 09:34 | 7.6K | |
| p5-Digest-Nilsimsa-0..> | 2025-12-22 18:08 | 14K | |
| p5-Digest-Pearson-1...> | 2025-12-22 14:00 | 7.8K | |
| p5-Digest-Pearson-Pu..> | 2025-12-23 06:50 | 3.8K | |
| p5-Digest-Perl-MD4-1..> | 2025-12-24 07:24 | 8.8K | |
| p5-Digest-Perl-MD5-1..> | 2025-12-18 09:42 | 8.9K | |
| p5-Digest-SHA-6.04.pkg | 2025-12-18 21:12 | 35K | |
| p5-Digest-SHA-PurePe..> | 2025-12-22 03:37 | 22K | |
| p5-Digest-SHA1-2.13_..> | 2025-12-18 11:00 | 15K | |
| p5-Digest-SHA3-1.05.pkg | 2025-12-18 06:32 | 28K | |
| p5-Digest-SV1-0.01_1..> | 2025-12-21 19:08 | 5.7K | |
| p5-Digest-Tiger-0.03..> | 2025-12-20 20:12 | 17K | |
| p5-Digest-TransformP..> | 2025-12-19 07:02 | 6.6K | |
| p5-Digest-Whirlpool-..> | 2025-12-21 16:47 | 23K | |
| p5-Dir-Project-3.026..> | 2025-12-23 17:26 | 17K | |
| p5-Dir-Purge-1.02_1.pkg | 2025-12-20 14:50 | 7.8K | |
| p5-Dir-Self-0.11_1.pkg | 2025-12-18 18:42 | 3.6K | |
| p5-Dir-Watch-0.0.0_1..> | 2025-12-24 01:20 | 3.9K | |
| p5-Directory-Queue-2..> | 2025-12-23 14:09 | 30K | |
| p5-Directory-Scratch..> | 2025-12-18 17:39 | 14K | |
| p5-Directory-Scratch..> | 2025-12-19 00:00 | 5.5K | |
| p5-Dist-CheckConflic..> | 2025-12-18 00:41 | 7.4K | |
| p5-Dist-Joseki-0.20_..> | 2025-12-19 10:56 | 44K | |
| p5-Dist-Metadata-0.9..> | 2025-12-22 12:53 | 28K | |
| p5-Dist-Zilla-6.033.pkg | 2025-12-19 11:44 | 321K | |
| p5-DocSet-0.19_3.pkg | 2025-12-20 08:47 | 125K | |
| p5-Doxygen-Filter-Pe..> | 2025-12-29 15:43 | 18K | |
| p5-Dumbbench-0.505.pkg | 2025-12-23 01:08 | 38K | |
| p5-DynaLoader-Functi..> | 2025-12-18 05:39 | 9.3K | |
| p5-EV-4.34,1.pkg | 2025-12-18 13:10 | 222K | |
| p5-Email-Abstract-3...> | 2025-12-18 13:32 | 18K | |
| p5-Email-Address-1.9..> | 2025-12-18 16:24 | 13K | |
| p5-Email-Address-Lis..> | 2025-12-19 00:23 | 7.9K | |
| p5-Email-Address-Loo..> | 2025-12-22 05:39 | 7.5K | |
| p5-Email-Address-Use..> | 2025-12-22 06:28 | 2.9K | |
| p5-Email-Address-XS-..> | 2025-12-18 12:32 | 26K | |
| p5-Email-AddressPars..> | 2025-12-21 00:43 | 14K | |
| p5-Email-Date-1.104.pkg | 2025-12-20 22:55 | 4.7K | |
| p5-Email-Date-Format..> | 2025-12-18 06:58 | 4.6K | |
| p5-Email-Delete-2.00..> | 2025-12-22 01:43 | 7.6K | |
| p5-Email-Filter-1.03..> | 2025-12-21 12:24 | 9.6K | |
| p5-Email-Find-0.10_1..> | 2025-12-18 06:32 | 9.2K | |
| p5-Email-Folder-0.86..> | 2025-12-18 21:05 | 16K | |
| p5-Email-Folder-IMAP..> | 2025-12-19 12:12 | 4.0K | |
| p5-Email-Folder-IMAP..> | 2025-12-22 20:44 | 3.7K | |
| p5-Email-Folder-POP3..> | 2025-12-22 14:04 | 3.4K | |
| p5-Email-FolderType-..> | 2025-12-18 17:37 | 9.9K | |
| p5-Email-FolderType-..> | 2025-12-19 02:02 | 3.4K | |
| p5-Email-LocalDelive..> | 2025-12-18 21:16 | 9.0K | |
| p5-Email-LocalDelive..> | 2025-12-22 07:56 | 3.4K | |
| p5-Email-MIME-1.954.pkg | 2025-12-18 17:46 | 33K | |
| p5-Email-MIME-Attach..> | 2025-12-23 19:21 | 4.9K | |
| p5-Email-MIME-Conten..> | 2025-12-18 12:04 | 9.3K | |
| p5-Email-MIME-Create..> | 2025-12-18 19:45 | 22K | |
| p5-Email-MIME-Creato..> | 2025-12-22 20:26 | 5.4K | |
| p5-Email-MIME-Encodi..> | 2025-12-18 13:40 | 4.5K | |
| p5-Email-MIME-RFC204..> | 2025-12-23 12:59 | 23K | |
| p5-Email-MessageID-1..> | 2025-12-18 12:27 | 5.0K | |
| p5-Email-Outlook-Mes..> | 2025-12-19 02:21 | 19K | |
| p5-Email-Reply-1.204..> | 2025-12-20 05:22 | 8.2K | |
| p5-Email-Send-2.202.pkg | 2025-12-18 19:31 | 22K | |
| p5-Email-Sender-2.60..> | 2025-12-18 16:57 | 62K | |
| p5-Email-Sender-Tran..> | 2025-12-21 16:26 | 5.5K | |
| p5-Email-Sender-Tran..> | 2025-12-22 20:45 | 4.9K | |
| p5-Email-Simple-2.21..> | 2025-12-18 11:16 | 17K | |
| p5-Email-Simple-From..> | 2025-12-21 07:26 | 6.4K | |
| p5-Email-Stuffer-0.0..> | 2025-12-18 23:20 | 15K | |
| p5-Email-Valid-1.204..> | 2025-12-18 05:38 | 13K | |
| p5-Email-Valid-Loose..> | 2025-12-19 01:54 | 3.3K | |
| p5-Emplacken-0.01_2.pkg | 2025-12-21 17:59 | 15K | |
| p5-Encode-3.21.pkg | 2025-12-20 04:22 | 1.2M | |
| p5-Encode-Base32-Cro..> | 2025-12-23 05:41 | 5.9K | |
| p5-Encode-Base32-GMP..> | 2025-12-21 16:34 | 7.4K | |
| p5-Encode-Base58-GMP..> | 2025-12-22 03:44 | 7.3K | |
| p5-Encode-CNMap-0.32..> | 2025-12-20 20:44 | 217K | |
| p5-Encode-Detect-1.0..> | 2025-12-18 17:34 | 71K | |
| p5-Encode-Detect-CJK..> | 2025-12-18 22:33 | 21K | |
| p5-Encode-DoubleEnco..> | 2025-12-21 10:02 | 4.0K | |
| p5-Encode-HanConvert..> | 2025-12-21 18:51 | 649K | |
| p5-Encode-HanExtra-0..> | 2025-12-18 23:22 | 1.6M | |
| p5-Encode-IMAPUTF7-1..> | 2025-12-20 02:01 | 5.7K | |
| p5-Encode-JIS2K-0.05..> | 2025-12-19 01:56 | 293K | |
| p5-Encode-Locale-1.0..> | 2025-12-18 01:36 | 9.3K | |
| p5-Encode-Punycode-1..> | 2025-12-23 19:27 | 3.8K | |
| p5-Encode-compat-0.0..> | 2025-12-22 23:45 | 11K | |
| p5-Encoding-BER-1.02..> | 2025-12-20 17:22 | 22K | |
| p5-Encoding-FixLatin..> | 2025-12-20 17:33 | 14K | |
| p5-Env-PS1-0.06_1.pkg | 2025-12-21 06:19 | 11K | |
| p5-Env-Path-0.19_1.pkg | 2025-12-18 16:30 | 16K | |
| p5-Error-0.17030.pkg | 2025-12-16 02:19 | 20K | |
| p5-Error-Helper-2.1...> | 2025-12-19 02:06 | 9.2K | |
| p5-Escape-Houdini-0...> | 2025-12-20 01:32 | 17K | |
| p5-Eval-Closure-0.14..> | 2025-12-18 01:27 | 7.9K | |
| p5-Eval-Context-0.09..> | 2025-12-20 01:49 | 19K | |
| p5-Eval-LineNumbers-..> | 2025-12-19 16:24 | 4.1K | |
| p5-Eval-Quosure-0.00..> | 2025-12-19 20:52 | 4.9K | |
| p5-Eval-WithLexicals..> | 2025-12-19 18:11 | 9.2K | |
| p5-Event-1.28.pkg | 2025-12-18 14:22 | 66K | |
| p5-Event-ExecFlow-0...> | 2025-12-22 15:24 | 31K | |
| p5-Event-Join-0.06_1..> | 2025-12-18 20:51 | 5.2K | |
| p5-Event-Lib-1.03_7.pkg | 2025-12-21 11:29 | 39K | |
| p5-Event-Notify-0.00..> | 2025-12-18 21:13 | 5.0K | |
| p5-Event-RPC-1.03_3.pkg | 2025-12-22 10:43 | 48K | |
| p5-Event-tcp-0.14_1.pkg | 2025-12-22 15:19 | 7.3K | |
| p5-Every-0.08_1.pkg | 2025-12-22 12:28 | 4.3K | |
| p5-Excel-Template-0...> | 2025-12-22 00:40 | 69K | |
| p5-Excel-Writer-XLSX..> | 2025-12-18 16:37 | 430K | |
| p5-Exception-Class-1..> | 2025-12-18 01:34 | 21K | |
| p5-Exception-Class-D..> | 2025-12-20 08:59 | 13K | |
| p5-Exception-Class-T..> | 2025-12-20 08:11 | 9.4K | |
| p5-Exception-Handler..> | 2025-12-21 06:56 | 3.8K | |
| p5-Expect-1.38.pkg | 2025-12-19 03:02 | 49K | |
| p5-Expect-Simple-0.0..> | 2025-12-19 20:30 | 8.3K | |
| p5-ExportTo-0.03.pkg | 2025-12-19 15:04 | 5.4K | |
| p5-Exporter-5.68_1.pkg | 2025-12-18 17:20 | 19K | |
| p5-Exporter-Declare-..> | 2025-12-19 22:31 | 30K | |
| p5-Exporter-Easy-0.1..> | 2025-12-18 16:18 | 12K | |
| p5-Exporter-Lite-0.0..> | 2025-12-18 13:42 | 7.2K | |
| p5-Exporter-Tidy-0.0..> | 2025-12-19 23:23 | 6.9K | |
| p5-Exporter-Tiny-1.0..> | 2025-12-18 03:23 | 31K | |
| p5-ExtUtils-AutoInst..> | 2025-12-19 18:11 | 17K | |
| p5-ExtUtils-Builder-..> | 2025-12-20 00:41 | 43K | |
| p5-ExtUtils-Builder-..> | 2025-12-22 15:48 | 34K | |
| p5-ExtUtils-CBuilder..> | 2025-12-23 07:36 | 22K | |
| p5-ExtUtils-CChecker..> | 2025-12-18 03:50 | 12K | |
| p5-ExtUtils-Config-0..> | 2025-12-18 01:17 | 6.3K | |
| p5-ExtUtils-Constant..> | 2025-12-21 05:54 | 34K | |
| p5-ExtUtils-CppGuess..> | 2025-12-18 21:03 | 8.8K | |
| p5-ExtUtils-Depends-..> | 2025-12-18 01:50 | 12K | |
| p5-ExtUtils-F77-1.26..> | 2025-12-27 00:37 | 11K | |
| p5-ExtUtils-H2PM-0.1..> | 2025-12-19 21:43 | 14K | |
| p5-ExtUtils-HasCompi..> | 2025-12-23 14:03 | 5.9K | |
| p5-ExtUtils-Helpers-..> | 2025-12-18 01:38 | 9.4K | |
| p5-ExtUtils-Install-..> | 2025-12-21 05:11 | 30K | |
| p5-ExtUtils-InstallP..> | 2025-12-18 01:37 | 11K | |
| p5-ExtUtils-LibBuild..> | 2025-12-18 20:19 | 5.3K | |
| p5-ExtUtils-MakeMake..> | 2025-12-18 12:49 | 241K | |
| p5-ExtUtils-MakeMake..> | 2025-12-18 13:10 | 5.3K | |
| p5-ExtUtils-MakeMake..> | 2025-12-19 02:24 | 7.8K | |
| p5-ExtUtils-Manifest..> | 2025-12-20 10:43 | 13K | |
| p5-ExtUtils-ParseXS-..> | 2025-12-21 03:17 | 55K | |
| p5-ExtUtils-PkgConfi..> | 2025-12-18 07:49 | 6.5K | |
| p5-ExtUtils-XSBuilde..> | 2025-12-18 19:21 | 57K | |
| p5-ExtUtils-XSpp-0.1..> | 2025-12-19 10:26 | 79K | |
| p5-FAQ-OMatic-2.719_..> | 2025-12-21 09:47 | 183K | |
| p5-FCGI-0.82.pkg | 2025-12-18 23:19 | 28K | |
| p5-FCGI-Async-0.22_2..> | 2025-12-24 04:40 | 9.1K | |
| p5-FCGI-Client-0.09.pkg | 2025-12-21 09:22 | 13K | |
| p5-FCGI-Engine-0.22.pkg | 2025-12-23 19:37 | 39K | |
| p5-FCGI-ProcManager-..> | 2025-12-19 20:48 | 14K | |
| p5-FCGI-Spawn-0.16.7..> | 2025-12-22 10:29 | 33K | |
| p5-FEAR-API-0.489_3.pkg | 2025-12-20 16:42 | 39K | |
| p5-FFI-C-0.15.pkg | 2025-12-19 08:38 | 44K | |
| p5-FFI-C-Stat-0.03.pkg | 2025-12-19 07:15 | 8.1K | |
| p5-FFI-CheckLib-0.31..> | 2025-12-18 08:21 | 14K | |
| p5-FFI-Platypus-2.10..> | 2025-12-18 21:10 | 283K | |
| p5-FFI-Platypus-Decl..> | 2025-12-21 02:09 | 9.0K | |
| p5-FFI-Platypus-Lang..> | 2025-12-24 07:19 | 22K | |
| p5-FFI-Platypus-Type..> | 2025-12-18 21:56 | 7.7K | |
| p5-FFI-Platypus-Type..> | 2025-12-19 23:41 | 5.1K | |
| p5-FFmpeg-Command-0...> | 2025-12-29 23:52 | 7.0K | |
| p5-FLV-Info-0.24_1.pkg | 2025-12-22 20:40 | 59K | |
| p5-FSA-Rules-0.35.pkg | 2025-12-30 09:33 | 22K | |
| p5-Facebook-Graph-1...> | 2025-12-24 07:27 | 68K | |
| p5-Fax-Hylafax-Clien..> | 2025-12-24 04:47 | 11K | |
| p5-Feature-Compat-De..> | 2025-12-18 15:26 | 5.3K | |
| p5-Feature-Compat-Tr..> | 2025-12-18 10:25 | 7.4K | |
| p5-Feed-Find-0.07_1.pkg | 2025-12-18 22:22 | 5.2K | |
| p5-Feersum-1.410.pkg | 2025-12-20 17:04 | 59K | |
| p5-Fennec-Lite-0.004..> | 2025-12-21 04:35 | 11K | |
| p5-File-Append-TempF..> | 2025-12-20 07:26 | 7.5K | |
| p5-File-Assets-0.064..> | 2025-12-21 03:16 | 27K | |
| p5-File-Attributes-0..> | 2025-12-19 15:38 | 12K | |
| p5-File-Attributes-R..> | 2025-12-21 05:55 | 5.2K | |
| p5-File-BOM-0.18.pkg | 2025-12-22 13:40 | 12K | |
| p5-File-BackupCopy-1..> | 2025-12-19 07:56 | 7.9K | |
| p5-File-BaseDir-0.09..> | 2025-12-18 18:55 | 12K | |
| p5-File-BasicFlock-9..> | 2025-12-21 11:00 | 3.1K | |
| p5-File-Binary-1.7_2..> | 2025-12-22 04:35 | 6.8K | |
| p5-File-Cache-0.16_1..> | 2025-12-22 00:20 | 21K | |
| p5-File-Cat-1.2_1.pkg | 2025-12-21 19:10 | 3.2K | |
| p5-File-ChangeNotify..> | 2025-12-18 14:29 | 23K | |
| p5-File-Cmp-1.09.pkg | 2025-12-23 11:07 | 11K | |
| p5-File-ConfigDir-0...> | 2025-12-18 10:19 | 9.2K | |
| p5-File-Copy-Link-0...> | 2025-12-24 07:19 | 10K | |
| p5-File-Copy-Recursi..> | 2025-12-18 13:03 | 14K | |
| p5-File-Copy-Recursi..> | 2025-12-22 16:46 | 11K | |
| p5-File-CountLines-0..> | 2025-12-18 17:35 | 6.2K | |
| p5-File-CounterFile-..> | 2025-12-20 01:28 | 5.2K | |
| p5-File-CreationTime..> | 2025-12-23 12:56 | 4.7K | |
| p5-File-DesktopEntry..> | 2025-12-19 02:12 | 14K | |
| p5-File-Dir-Dumper-0..> | 2025-12-23 16:08 | 17K | |
| p5-File-DirCompare-0..> | 2025-12-22 20:44 | 6.3K | |
| p5-File-DirSync-1.22..> | 2025-12-24 07:21 | 19K | |
| p5-File-ExtAttr-1.09..> | 2025-12-22 09:22 | 20K | |
| p5-File-FcntlLock-0...> | 2025-12-18 19:54 | 31K | |
| p5-File-Fetch-1.08.pkg | 2025-12-23 17:58 | 19K | |
| p5-File-Find-Closure..> | 2025-12-19 03:03 | 7.5K | |
| p5-File-Find-Object-..> | 2025-12-18 21:48 | 20K | |
| p5-File-Find-Object-..> | 2025-12-19 22:19 | 28K | |
| p5-File-Find-Rule-0...> | 2025-12-18 06:58 | 21K | |
| p5-File-Find-Rule-Fi..> | 2025-12-19 23:31 | 4.1K | |
| p5-File-Find-Rule-Pe..> | 2025-12-18 23:16 | 5.7K | |
| p5-File-Find-Rule-VC..> | 2025-12-19 11:36 | 5.8K | |
| p5-File-Finder-1.01.pkg | 2025-12-22 04:58 | 20K | |
| p5-File-Flat-1.07.pkg | 2025-12-19 15:58 | 15K | |
| p5-File-Flock-2014.0..> | 2025-12-19 16:49 | 13K | |
| p5-File-Flock-Retry-..> | 2025-12-18 14:24 | 6.4K | |
| p5-File-FnMatch-0.02..> | 2025-12-19 23:37 | 9.2K | |
| p5-File-Format-RIFF-..> | 2025-12-22 01:27 | 15K | |
| p5-File-Grep-0.02_1.pkg | 2025-12-19 11:00 | 6.2K | |
| p5-File-HStore-0.10_..> | 2025-12-21 11:58 | 6.6K | |
| p5-File-HomeDir-1.00..> | 2025-12-17 23:38 | 33K | |
| p5-File-HomeDir-Path..> | 2025-12-23 06:34 | 4.3K | |
| p5-File-HomeDir-Tiny..> | 2025-12-20 01:15 | 4.6K | |
| p5-File-Inplace-0.20..> | 2025-12-23 15:49 | 6.2K | |
| p5-File-Iterator-0.1..> | 2025-12-20 05:00 | 5.8K | |
| p5-File-KeePass-2.03..> | 2025-12-20 03:55 | 32K | |
| p5-File-KeePass-Agen..> | 2025-12-20 19:30 | 20K | |
| p5-File-LibMagic-1.2..> | 2025-12-19 02:04 | 21K | |
| p5-File-Listing-6.16..> | 2025-12-18 02:48 | 8.7K | |
| p5-File-LoadLines-1...> | 2025-12-24 05:47 | 7.9K | |
| p5-File-Locate-0.62.pkg | 2025-12-21 12:25 | 15K | |
| p5-File-Log-1.05_1.pkg | 2025-12-20 22:26 | 11K | |
| p5-File-MMagic-1.30_..> | 2025-12-18 18:04 | 20K | |
| p5-File-MMagic-XS-0...> | 2025-12-19 08:01 | 30K | |
| p5-File-Map-0.71.pkg | 2025-12-18 17:30 | 23K | |
| p5-File-MimeInfo-0.3..> | 2025-12-20 00:39 | 38K | |
| p5-File-Modified-0.1..> | 2025-12-22 05:26 | 8.8K | |
| p5-File-Monitor-1.00..> | 2025-12-23 05:32 | 28K | |
| p5-File-Mork-0.3_1.pkg | 2025-12-22 10:54 | 13K | |
| p5-File-NCopy-0.36_2..> | 2025-12-20 01:56 | 10K | |
| p5-File-NFSLock-1.29..> | 2025-12-18 08:09 | 13K | |
| p5-File-Next-1.18.pkg | 2025-12-18 12:10 | 11K | |
| p5-File-Path-2.18.pkg | 2025-12-23 15:51 | 23K | |
| p5-File-Path-Expand-..> | 2025-12-18 18:46 | 2.9K | |
| p5-File-Path-Tiny-1...> | 2025-12-22 14:05 | 11K | |
| p5-File-PathConvert-..> | 2025-12-20 05:59 | 14K | |
| p5-File-Pid-1.01_2.pkg | 2025-12-19 12:20 | 4.5K | |
| p5-File-Pid-Quick-1...> | 2025-12-21 22:35 | 6.8K | |
| p5-File-Policy-1.005..> | 2025-12-18 18:42 | 10K | |
| p5-File-Random-0.21.pkg | 2025-12-21 11:33 | 10K | |
| p5-File-ReadBackward..> | 2025-12-18 12:54 | 8.2K | |
| p5-File-Remove-1.58.pkg | 2025-12-18 07:15 | 9.8K | |
| p5-File-Rename-2.01.pkg | 2025-12-22 07:42 | 17K | |
| p5-File-Rsync-0.49_1..> | 2025-12-21 04:21 | 16K | |
| p5-File-RsyncP-0.76.pkg | 2025-12-23 05:00 | 83K | |
| p5-File-SafeDO-0.14_..> | 2025-12-19 01:20 | 5.0K | |
| p5-File-Scan-1.43_1.pkg | 2025-12-23 04:58 | 34K | |
| p5-File-Scan-ClamAV-..> | 2025-12-27 04:23 | 8.3K | |
| p5-File-SearchPath-0..> | 2025-12-19 12:14 | 7.5K | |
| p5-File-Share-0.27.pkg | 2025-12-18 18:42 | 4.5K | |
| p5-File-ShareDir-1.1..> | 2025-12-18 01:48 | 12K | |
| p5-File-ShareDir-Dis..> | 2025-12-19 05:05 | 14K | |
| p5-File-ShareDir-Ins..> | 2025-12-18 02:10 | 7.6K | |
| p5-File-ShareDir-PAR..> | 2025-12-22 20:21 | 7.6K | |
| p5-File-ShareDir-Pat..> | 2025-12-19 09:58 | 4.3K | |
| p5-File-ShareDir-Pro..> | 2025-12-20 00:10 | 14K | |
| p5-File-ShareDir-Tar..> | 2025-12-20 00:40 | 4.3K | |
| p5-File-ShareDir-Tin..> | 2025-12-23 16:33 | 5.7K | |
| p5-File-Signature-1...> | 2025-12-19 22:46 | 11K | |
| p5-File-Slurp-9999.2..> | 2025-12-18 13:04 | 15K | |
| p5-File-Slurp-Tiny-0..> | 2025-12-18 07:58 | 4.7K | |
| p5-File-Slurp-Tree-1..> | 2025-12-21 16:43 | 4.3K | |
| p5-File-Slurper-0.01..> | 2025-12-18 17:55 | 5.8K | |
| p5-File-Sort-1.01_1.pkg | 2025-12-19 10:35 | 18K | |
| p5-File-Spec-Native-..> | 2025-12-19 13:06 | 4.8K | |
| p5-File-Stat-Bits-1...> | 2025-12-18 22:31 | 6.1K | |
| p5-File-Stat-ModeStr..> | 2025-12-19 16:55 | 4.7K | |
| p5-File-Stream-2.30_..> | 2025-12-20 17:46 | 9.3K | |
| p5-File-Sync-0.11_1.pkg | 2025-12-19 22:29 | 7.9K | |
| p5-File-Tail-1.3.pkg | 2025-12-19 14:43 | 14K | |
| p5-File-Tail-Dir-0.1..> | 2025-12-19 06:15 | 13K | |
| p5-File-Tail-Multi-0..> | 2025-12-21 06:19 | 17K | |
| p5-File-Tail-Scribe-..> | 2025-12-23 21:15 | 12K | |
| p5-File-Tee-0.07_1.pkg | 2025-12-23 14:15 | 8.7K | |
| p5-File-Temp-0.2312.pkg | 2025-12-19 13:21 | 39K | |
| p5-File-Tempdir-0.02..> | 2025-12-18 21:38 | 3.6K | |
| p5-File-Touch-0.12.pkg | 2025-12-23 00:43 | 5.5K | |
| p5-File-TreeCreate-0..> | 2025-12-22 15:19 | 5.9K | |
| p5-File-Type-0.22_1.pkg | 2025-12-18 15:54 | 12K | |
| p5-File-Util-4.16195..> | 2025-12-19 11:54 | 107K | |
| p5-File-Which-1.27.pkg | 2025-12-17 23:25 | 10K | |
| p5-File-Write-Rotate..> | 2025-12-19 02:52 | 16K | |
| p5-File-chdir-0.1011..> | 2025-12-18 07:18 | 9.1K | |
| p5-File-chmod-0.42.pkg | 2025-12-18 20:20 | 9.3K | |
| p5-File-pushd-1.016.pkg | 2025-12-19 02:52 | 7.2K | |
| p5-FileHandle-Fmode-..> | 2025-12-18 14:56 | 7.5K | |
| p5-FileHandle-Unget-..> | 2025-12-18 23:38 | 9.5K | |
| p5-Filesys-Df-0.92_1..> | 2025-12-19 17:18 | 11K | |
| p5-Filesys-DfPortabl..> | 2025-12-20 07:19 | 9.9K | |
| p5-Filesys-DiskFree-..> | 2025-12-20 10:48 | 5.8K | |
| p5-Filesys-DiskSpace..> | 2025-12-22 06:12 | 5.9K | |
| p5-Filesys-DiskUsage..> | 2025-12-24 07:04 | 8.4K | |
| p5-Filesys-Notify-KQ..> | 2025-12-19 09:10 | 4.2K | |
| p5-Filesys-Notify-Si..> | 2025-12-18 05:44 | 5.4K | |
| p5-Filesys-Statvfs-0..> | 2025-12-22 19:51 | 7.7K | |
| p5-Filesys-Virtual-0..> | 2025-12-18 18:33 | 3.9K | |
| p5-Filesys-Virtual-D..> | 2025-12-21 01:16 | 4.8K | |
| p5-Filesys-Virtual-P..> | 2025-12-18 19:12 | 8.2K | |
| p5-Filesys-ZFS-1.5.pkg | 2025-12-22 19:57 | 9.0K | |
| p5-Filesys-ZFS-Stat-..> | 2025-12-23 07:32 | 4.6K | |
| p5-Filter-1.65.pkg | 2025-12-18 07:42 | 53K | |
| p5-Filter-CBC-0.10_2..> | 2025-12-20 06:07 | 10K | |
| p5-Filter-Crypto-2.1..> | 2025-12-23 04:48 | 64K | |
| p5-Filter-Simple-0.9..> | 2025-12-18 20:40 | 15K | |
| p5-Filter-Template-1..> | 2025-12-19 20:34 | 14K | |
| p5-Finance-Amortizat..> | 2025-12-20 12:03 | 5.7K | |
| p5-Finance-Bitcoin-0..> | 2025-12-23 18:49 | 13K | |
| p5-Finance-Currency-..> | 2025-12-21 05:57 | 7.0K | |
| p5-Finance-Currency-..> | 2025-12-20 02:08 | 4.5K | |
| p5-Finance-Currency-..> | 2025-12-22 11:11 | 13K | |
| p5-Finance-Quote-1.6..> | 2025-12-18 21:10 | 168K | |
| p5-Finance-QuoteHist..> | 2025-12-23 18:25 | 29K | |
| p5-Finance-QuoteTW-0..> | 2025-12-23 08:44 | 16K | |
| p5-Finance-TW-Emergi..> | 2025-12-23 17:05 | 3.9K | |
| p5-Finance-TW-TSEQuo..> | 2025-12-20 13:06 | 6.8K | |
| p5-Finance-YahooQuot..> | 2025-12-21 12:14 | 14K | |
| p5-Find-Lib-1.04_1.pkg | 2025-12-24 06:57 | 8.2K | |
| p5-FindBin-libs-2.11..> | 2025-12-18 23:01 | 19K | |
| p5-Firefox-Marionett..> | 2025-12-22 04:39 | 324K | |
| p5-Flea-0.04_2.pkg | 2025-12-20 17:05 | 8.3K | |
| p5-Flickr-API-1.29.pkg | 2025-12-18 13:03 | 36K | |
| p5-Flickr-Upload-1.6..> | 2025-12-18 17:12 | 20K | |
| p5-Fliggy-0.009003_1..> | 2025-12-23 15:25 | 7.1K | |
| p5-Font-AFM-1.20_1.pkg | 2025-12-18 06:42 | 10K | |
| p5-Font-FreeType-0.1..> | 2025-12-29 13:58 | 49K | |
| p5-Font-TTF-1.06.pkg | 2025-12-18 17:13 | 297K | |
| p5-Font-TTFMetrics-0..> | 2025-12-24 07:11 | 17K | |
| p5-Forest-0.10_1.pkg | 2025-12-18 18:07 | 45K | |
| p5-Form-Sensible-0.2..> | 2025-12-24 07:05 | 117K | |
| p5-FormValidator-Lit..> | 2025-12-19 07:03 | 27K | |
| p5-Format-Human-Byte..> | 2025-12-19 21:19 | 4.9K | |
| p5-FreeBSD-Ports-0.0..> | 2025-12-24 06:53 | 13K | |
| p5-FreeBSD-Ports-IND..> | 2025-12-23 07:52 | 5.6K | |
| p5-FreezeThaw-0.5001..> | 2025-12-18 17:31 | 13K | |
| p5-Frontier-RPC-0.07..> | 2025-12-22 03:27 | 23K | |
| p5-Function-Fallback..> | 2025-12-19 02:39 | 5.3K | |
| p5-Function-Paramete..> | 2025-12-18 07:33 | 51K | |
| p5-Furl-3.14_1.pkg | 2025-12-18 20:25 | 36K | |
| p5-FurlX-Coro-1.02_1..> | 2025-12-20 10:30 | 5.0K | |
| p5-Fuse-0.16.1_2.pkg | 2025-12-19 05:02 | 39K | |
| p5-Fuse-Simple-1.00_..> | 2025-12-20 18:18 | 14K | |
| p5-FusionInventory-A..> | 2025-12-28 03:01 | 818K | |
| p5-Future-0.52.pkg | 2025-12-18 07:55 | 67K | |
| p5-Future-AsyncAwait..> | 2025-12-26 13:42 | 45K | |
| p5-Future-IO-0.17.pkg | 2025-12-23 05:09 | 18K | |
| p5-FuzzyOcr-devel-3...> | 2025-12-29 11:27 | 106K | |
| p5-GD-2.83.pkg | 2025-12-26 17:31 | 116K | |
| p5-GD-Arrow-0.01_5.pkg | 2025-12-27 03:40 | 4.4K | |
| p5-GD-Barcode-2.01.pkg | 2025-12-28 21:01 | 551K | |
| p5-GD-Graph-1.56.pkg | 2025-12-27 00:34 | 78K | |
| p5-GD-Graph-histogra..> | 2025-12-29 17:28 | 6.1K | |
| p5-GD-Graph-ohlc-0.9..> | 2025-12-30 06:22 | 10K | |
| p5-GD-Graph3d-0.63_6..> | 2025-12-27 12:33 | 18K | |
| p5-GD-SVG-0.33_6.pkg | 2025-12-27 06:11 | 40K | |
| p5-GD-SecurityImage-..> | 2025-12-27 10:15 | 30K | |
| p5-GD-TextUtil-0.86_..> | 2025-12-26 19:09 | 23K | |
| p5-GD-Thumbnail-1.46..> | 2025-12-27 18:47 | 12K | |
| p5-GDBM-1.14_5.pkg | 2025-12-19 11:46 | 10K | |
| p5-GDS2-3.35.pkg | 2025-12-30 00:40 | 44K | |
| p5-GIS-Distance-0.20..> | 2025-12-18 23:27 | 27K | |
| p5-GIS-Distance-Fast..> | 2025-12-18 18:20 | 16K | |
| p5-GIS-Distance-Lite..> | 2025-12-22 23:11 | 3.5K | |
| p5-GMail-IMAPD-0.94_..> | 2025-12-22 03:34 | 11K | |
| p5-GPS-0.17_1.pkg | 2025-12-23 21:05 | 27K | |
| p5-GPS-Babel-0.11_1.pkg | 2025-12-23 05:41 | 16K | |
| p5-GPS-OID-0.07_1.pkg | 2025-12-21 17:08 | 4.7K | |
| p5-GPS-Point-0.20.pkg | 2025-12-19 09:06 | 9.3K | |
| p5-GSSAPI-0.28_2.pkg | 2025-12-21 03:17 | 33K | |
| p5-Games-Alak-0.19_1..> | 2025-12-20 15:52 | 9.6K | |
| p5-Games-AlphaBeta-0..> | 2025-12-22 17:35 | 20K | |
| p5-Games-Bingo-0.18_..> | 2025-12-19 11:40 | 22K | |
| p5-Games-Bingo-Bot-0..> | 2025-12-21 16:28 | 8.3K | |
| p5-Games-Bingo-Print..> | 2025-12-21 19:45 | 9.3K | |
| p5-Games-Dice-0.046.pkg | 2025-12-22 02:57 | 9.5K | |
| p5-Games-Dissociate-..> | 2025-12-22 16:39 | 12K | |
| p5-Games-GuessWord-0..> | 2025-12-19 13:27 | 5.1K | |
| p5-Games-Tournament-..> | 2025-12-24 07:19 | 12K | |
| p5-Gantry-3.64_1.pkg | 2025-12-19 04:56 | 2.2M | |
| p5-Gazelle-0.49.pkg | 2025-12-23 11:35 | 25K | |
| p5-Gearman-2.004.015..> | 2025-12-20 00:44 | 42K | |
| p5-Gearman-Client-As..> | 2025-12-23 04:43 | 7.1K | |
| p5-Gearman-Server-1...> | 2025-12-22 05:03 | 20K | |
| p5-Genezzo-0.72_2.pkg | 2025-12-20 11:01 | 450K | |
| p5-Geo-Address-Forma..> | 2025-12-22 19:07 | 12K | |
| p5-Geo-BUFR-1.40.pkg | 2025-12-22 15:20 | 110K | |
| p5-Geo-Cache-0.11_1.pkg | 2025-12-20 04:16 | 5.2K | |
| p5-Geo-Caching-0.11_..> | 2025-12-20 18:21 | 5.8K | |
| p5-Geo-Calc-0.12.pkg | 2025-12-21 16:20 | 11K | |
| p5-Geo-Coder-Bing-0...> | 2025-12-21 16:43 | 7.1K | |
| p5-Geo-Coder-Google-..> | 2025-12-19 12:38 | 11K | |
| p5-Geo-Coder-Googlev..> | 2025-12-20 07:51 | 6.7K | |
| p5-Geo-Coder-Mapques..> | 2025-12-20 23:26 | 7.1K | |
| p5-Geo-Coder-Multima..> | 2025-12-22 01:43 | 5.4K | |
| p5-Geo-Coder-Multipl..> | 2025-12-21 04:39 | 8.5K | |
| p5-Geo-Coder-Navteq-..> | 2025-12-22 17:40 | 7.5K | |
| p5-Geo-Coder-OSM-0.0..> | 2025-12-24 05:54 | 6.7K | |
| p5-Geo-Coder-OpenCag..> | 2025-12-23 07:56 | 6.8K | |
| p5-Geo-Coder-Ovi-0.0..> | 2025-12-21 02:59 | 6.5K | |
| p5-Geo-Coder-PlaceFi..> | 2025-12-22 22:53 | 6.7K | |
| p5-Geo-Coder-TomTom-..> | 2025-12-20 17:05 | 6.1K | |
| p5-Geo-Coordinates-C..> | 2025-12-18 21:23 | 16K | |
| p5-Geo-Coordinates-C..> | 2025-12-19 08:57 | 2.9M | |
| p5-Geo-Coordinates-T..> | 2025-12-18 20:13 | 5.5K | |
| p5-Geo-Coordinates-U..> | 2025-12-21 17:18 | 13K | |
| p5-Geo-Distance-0.25..> | 2025-12-19 03:03 | 11K | |
| p5-Geo-Distance-XS-0..> | 2025-12-21 16:15 | 11K | |
| p5-Geo-EOP-0.50.pkg | 2025-12-28 06:10 | 46K | |
| p5-Geo-GDAL-FFI-0.14..> | 2025-12-28 23:59 | 60K | |
| p5-Geo-GML-0.18.pkg | 2025-12-27 02:57 | 542K | |
| p5-Geo-GeoNames-1.14..> | 2025-12-20 23:27 | 12K | |
| p5-Geo-Gpx-1.11.pkg | 2025-12-20 02:15 | 27K | |
| p5-Geo-IP-PurePerl-1..> | 2025-12-18 20:16 | 16K | |
| p5-Geo-IPfree-1.1600..> | 2025-12-22 16:18 | 472K | |
| p5-Geo-JSON-0.007.pkg | 2025-12-23 21:41 | 28K | |
| p5-Geo-LibProj-FFI-1..> | 2025-12-29 13:07 | 13K | |
| p5-Geo-METAR-1.15_1.pkg | 2025-12-21 16:58 | 17K | |
| p5-Geo-Parse-OSM-0.4..> | 2025-12-23 04:57 | 12K | |
| p5-Geo-Postcodes-0.3..> | 2025-12-19 21:12 | 42K | |
| p5-Geo-Postcodes-DK-..> | 2025-12-21 02:13 | 23K | |
| p5-Geo-Postcodes-NO-..> | 2025-12-23 16:25 | 48K | |
| p5-Geo-ShapeFile-3.0..> | 2025-12-23 12:51 | 30K | |
| p5-Geo-Weather-1.41_..> | 2025-12-20 08:39 | 10K | |
| p5-Geo-WebService-El..> | 2025-12-21 06:19 | 15K | |
| p5-GeoIP2-2.006002.pkg | 2025-12-23 18:06 | 76K | |
| p5-Geography-Countri..> | 2025-12-18 10:16 | 12K | |
| p5-Geometry-Primitiv..> | 2025-12-18 15:54 | 24K | |
| p5-Getargs-Long-1.10..> | 2025-12-19 11:49 | 19K | |
| p5-Getopt-ArgvFile-1..> | 2025-12-18 23:29 | 20K | |
| p5-Getopt-Attribute-..> | 2025-12-19 00:06 | 5.1K | |
| p5-Getopt-Compact-0...> | 2025-12-18 19:45 | 13K | |
| p5-Getopt-Compact-Wi..> | 2025-12-19 12:38 | 13K | |
| p5-Getopt-Declare-1...> | 2025-12-19 14:37 | 52K | |
| p5-Getopt-EX-1.15.1_..> | 2025-12-19 12:41 | 47K | |
| p5-Getopt-Euclid-0.4..> | 2025-12-19 22:22 | 38K | |
| p5-Getopt-GUI-Long-0..> | 2025-12-24 07:31 | 20K | |
| p5-Getopt-Long-2.58.pkg | 2025-12-18 06:27 | 43K | |
| p5-Getopt-Long-Descr..> | 2025-12-18 07:33 | 23K | |
| p5-Getopt-Lucid-1.10..> | 2025-12-19 02:28 | 26K | |
| p5-Getopt-Tabular-0...> | 2025-12-20 04:19 | 36K | |
| p5-Giovanni-1.12.pkg | 2025-12-24 05:23 | 14K | |
| p5-Git-PurePerl-0.53..> | 2025-12-18 17:57 | 14K | |
| p5-Git-Repository-1...> | 2025-12-18 19:38 | 42K | |
| p5-Git-Repository-Pl..> | 2025-12-20 06:00 | 11K | |
| p5-Git-Sub-0.163320.pkg | 2025-12-21 18:47 | 4.2K | |
| p5-Git-Version-Compa..> | 2025-12-18 17:20 | 7.7K | |
| p5-Git-Wrapper-0.048..> | 2025-12-19 22:43 | 26K | |
| p5-GitDDL-0.03.pkg | 2025-12-19 09:19 | 6.0K | |
| p5-GitDDL-Migrator-0..> | 2025-12-21 05:07 | 6.7K | |
| p5-Glib-1.3294_1.pkg | 2025-12-18 11:03 | 306K | |
| p5-Glib-Object-Intro..> | 2025-12-18 17:10 | 60K | |
| p5-GnuPG-0.19_1.pkg | 2025-12-23 13:39 | 23K | |
| p5-GnuPG-Interface-1..> | 2025-12-18 21:56 | 49K | |
| p5-Goo-0.09_3.pkg | 2025-12-22 08:17 | 211K | |
| p5-Goo-Canvas2-0.06_..> | 2025-12-27 16:08 | 6.8K | |
| p5-Google-Chart-0.05..> | 2025-12-22 12:41 | 42K | |
| p5-Google-Checkout-1..> | 2025-12-21 07:01 | 106K | |
| p5-Google-Data-JSON-..> | 2025-12-23 04:59 | 9.1K | |
| p5-Google-ProtocolBu..> | 2025-12-19 22:20 | 30K | |
| p5-Google-SAML-Reque..> | 2025-12-19 08:32 | 6.8K | |
| p5-Google-SAML-Respo..> | 2025-12-22 04:48 | 11K | |
| p5-Google-Search-0.0..> | 2025-12-23 19:34 | 13K | |
| p5-Graph-0.9735,1.pkg | 2025-12-18 10:06 | 96K | |
| p5-Graph-Easy-0.76.pkg | 2025-12-23 07:52 | 241K | |
| p5-Graph-ReadWrite-2..> | 2025-12-18 18:33 | 38K | |
| p5-Graph-SocialMap-0..> | 2025-12-27 06:34 | 6.0K | |
| p5-Graph-Writer-Grap..> | 2025-12-26 20:57 | 4.3K | |
| p5-GraphQL-0.54.pkg | 2025-12-21 07:48 | 103K | |
| p5-GraphViz-2.25.pkg | 2025-12-26 19:20 | 51K | |
| p5-GraphViz-DBI-1.10..> | 2025-12-29 06:28 | 5.7K | |
| p5-GraphViz-Data-Str..> | 2025-12-30 16:51 | 23K | |
| p5-GraphViz-Traverse..> | 2025-12-30 07:53 | 9.0K | |
| p5-GraphViz2-2.67.pkg | 2025-12-27 10:17 | 47K | |
| p5-GraphViz2-DBI-2.5..> | 2025-12-29 18:07 | 7.2K | |
| p5-GraphViz2-Data-Gr..> | 2025-12-29 02:22 | 6.8K | |
| p5-GraphViz2-Parse-I..> | 2025-12-27 21:59 | 5.9K | |
| p5-GraphViz2-Parse-R..> | 2025-12-29 04:05 | 6.2K | |
| p5-GraphViz2-Parse-X..> | 2025-12-29 15:16 | 5.0K | |
| p5-Graphics-Color-0...> | 2025-12-18 16:55 | 21K | |
| p5-Graphics-ColorNam..> | 2025-12-18 12:30 | 25K | |
| p5-Graphics-ColorNam..> | 2025-12-18 18:01 | 13K | |
| p5-Graphics-ColorUti..> | 2025-12-19 01:33 | 21K | |
| p5-Graphics-GnuplotI..> | 2025-12-22 05:20 | 18K | |
| p5-Graphics-Primitiv..> | 2025-12-18 23:24 | 61K | |
| p5-Graphics-Primitiv..> | 2025-12-27 16:20 | 12K | |
| p5-Graphics-TIFF-21.pkg | 2025-12-27 03:11 | 26K | |
| p5-Gravatar-URL-1.07..> | 2025-12-21 17:39 | 12K | |
| p5-Growl-GNTP-0.21.pkg | 2025-12-24 00:26 | 8.0K | |
| p5-Grutatxt-2.20.pkg | 2025-12-19 23:51 | 20K | |
| p5-Gtk2-1.24993_5.pkg | 2025-12-26 19:43 | 1.2M | |
| p5-Gtk2-Chmod-0.0.0_..> | 2025-12-29 18:13 | 6.0K | |
| p5-Gtk2-Ex-FormFacto..> | 2025-12-30 04:07 | 167K | |
| p5-Gtk2-Ex-PodViewer..> | 2025-12-27 06:24 | 23K | |
| p5-Gtk2-Ex-Simple-Li..> | 2025-12-27 00:19 | 14K | |
| p5-Gtk2-Ex-Utils-0.0..> | 2025-12-29 16:08 | 9.6K | |
| p5-Gtk2-ImageView-0...> | 2025-12-30 16:19 | 51K | |
| p5-Gtk2-Notify-0.05_..> | 2025-12-27 12:45 | 17K | |
| p5-Gtk2-PathButtonBa..> | 2025-12-30 06:35 | 7.5K | |
| p5-Gtk2-Spell-1.05.pkg | 2025-12-30 00:48 | 9.9K | |
| p5-Gtk3-0.034_4.pkg | 2025-12-26 22:51 | 25K | |
| p5-Gtk3-ImageView-12..> | 2025-12-27 02:52 | 13K | |
| p5-Gtk3-SimpleList-0..> | 2025-12-27 12:34 | 14K | |
| p5-Guard-1.023_2.pkg | 2025-12-18 12:11 | 11K | |
| p5-Gungho-0.09008_2.pkg | 2025-12-19 14:43 | 114K | |
| p5-GunghoX-FollowLin..> | 2025-12-23 05:39 | 23K | |
| p5-Gzip-Faster-0.22.pkg | 2025-12-21 08:58 | 29K | |
| p5-HOP-Lexer-0.032_2..> | 2025-12-23 05:07 | 23K | |
| p5-HOP-Stream-0.03_1..> | 2025-12-19 05:56 | 11K | |
| p5-HTML-Adsense-0.2_..> | 2025-12-20 05:36 | 5.0K | |
| p5-HTML-Breadcrumbs-..> | 2025-12-22 10:38 | 11K | |
| p5-HTML-CalendarMont..> | 2025-12-20 16:16 | 20K | |
| p5-HTML-Chunks-1.55...> | 2025-12-21 03:04 | 18K | |
| p5-HTML-Clean-1.4.pkg | 2025-12-20 00:19 | 14K | |
| p5-HTML-ContentExtra..> | 2025-12-21 11:29 | 6.6K | |
| p5-HTML-Copy-1.31_1.pkg | 2025-12-23 05:34 | 9.2K | |
| p5-HTML-DOM-0.058.pkg | 2025-12-18 14:38 | 228K | |
| p5-HTML-Declare-2.6.pkg | 2025-12-20 00:00 | 5.9K | |
| p5-HTML-Defang-1.07.pkg | 2025-12-20 06:24 | 29K | |
| p5-HTML-Defaultify-1..> | 2025-12-20 13:16 | 19K | |
| p5-HTML-Diff-0.60_1,..> | 2025-12-23 14:08 | 6.5K | |
| p5-HTML-Display-0.40..> | 2025-12-19 03:28 | 24K | |
| p5-HTML-Element-Exte..> | 2025-12-18 11:01 | 28K | |
| p5-HTML-Element-Libr..> | 2025-12-18 13:07 | 32K | |
| p5-HTML-Element-Repl..> | 2025-12-20 02:06 | 4.0K | |
| p5-HTML-Email-Obfusc..> | 2025-12-19 05:49 | 7.5K | |
| p5-HTML-Encoding-0.6..> | 2025-12-18 11:34 | 17K | |
| p5-HTML-Entities-Imo..> | 2025-12-20 19:08 | 9.3K | |
| p5-HTML-Entities-Int..> | 2025-12-18 16:14 | 3.7K | |
| p5-HTML-Entities-Num..> | 2025-12-26 11:52 | 7.9K | |
| p5-HTML-Escape-1.11.pkg | 2025-12-19 14:57 | 6.2K | |
| p5-HTML-EscapeEvil-0..> | 2025-12-21 16:37 | 8.3K | |
| p5-HTML-ExtractConte..> | 2025-12-23 03:32 | 6.8K | |
| p5-HTML-ExtractMain-..> | 2025-12-21 17:48 | 5.6K | |
| p5-HTML-Field-1.19_1..> | 2025-12-24 03:29 | 18K | |
| p5-HTML-FillInForm-2..> | 2025-12-18 11:14 | 13K | |
| p5-HTML-FillInForm-F..> | 2025-12-22 23:11 | 3.1K | |
| p5-HTML-FillInForm-L..> | 2025-12-18 16:23 | 21K | |
| p5-HTML-Form-6.12.pkg | 2025-12-18 04:33 | 29K | |
| p5-HTML-FormFu-2.07.pkg | 2025-12-18 17:58 | 354K | |
| p5-HTML-FormFu-Image..> | 2025-12-30 18:52 | 8.3K | |
| p5-HTML-FormFu-Model..> | 2025-12-19 20:47 | 24K | |
| p5-HTML-FormFu-Multi..> | 2025-12-18 21:28 | 8.1K | |
| p5-HTML-FormHandler-..> | 2025-12-19 02:31 | 405K | |
| p5-HTML-FormHandler-..> | 2025-12-20 07:47 | 22K | |
| p5-HTML-Format-2.12.pkg | 2025-12-18 11:19 | 33K | |
| p5-HTML-FormatExtern..> | 2025-12-19 01:39 | 37K | |
| p5-HTML-FormatText-W..> | 2025-12-18 18:42 | 8.1K | |
| p5-HTML-FormatText-W..> | 2025-12-19 01:29 | 8.0K | |
| p5-HTML-Fraction-0.5..> | 2025-12-19 12:14 | 4.7K | |
| p5-HTML-FromANSI-2.0..> | 2025-12-23 04:58 | 10K | |
| p5-HTML-FromANSI-Tin..> | 2025-12-19 08:03 | 10K | |
| p5-HTML-FromText-2.0..> | 2025-12-18 11:20 | 13K | |
| p5-HTML-GenToc-3.20_..> | 2025-12-20 08:18 | 36K | |
| p5-HTML-GenerateUtil..> | 2025-12-19 11:51 | 20K | |
| p5-HTML-GoogleMaps-1..> | 2025-12-21 10:33 | 8.1K | |
| p5-HTML-Gumbo-0.18_1..> | 2025-12-18 20:31 | 18K | |
| p5-HTML-HTML5-Entiti..> | 2025-12-19 07:57 | 19K | |
| p5-HTML-HTML5-Parser..> | 2025-12-23 16:21 | 81K | |
| p5-HTML-HTMLDoc-0.10..> | 2025-12-29 05:39 | 18K | |
| p5-HTML-Highlight-0...> | 2025-12-21 00:47 | 8.1K | |
| p5-HTML-LinkExtracto..> | 2025-12-19 08:16 | 11K | |
| p5-HTML-LinkList-0.1..> | 2025-12-19 06:38 | 17K | |
| p5-HTML-Lint-2.32.pkg | 2025-12-18 18:46 | 27K | |
| p5-HTML-Location-1.0..> | 2025-12-19 03:12 | 7.3K | |
| p5-HTML-Macro-1.30.pkg | 2025-12-23 14:10 | 27K | |
| p5-HTML-Mason-1.60.pkg | 2025-12-18 16:13 | 294K | |
| p5-HTML-Mason-PSGIHa..> | 2025-12-19 00:07 | 4.8K | |
| p5-HTML-MobileConver..> | 2025-12-20 19:00 | 5.3K | |
| p5-HTML-Packer-2.11.pkg | 2025-12-22 18:50 | 8.4K | |
| p5-HTML-Pager-0.03_1..> | 2025-12-21 09:38 | 12K | |
| p5-HTML-Parser-3.83.pkg | 2025-12-18 02:51 | 78K | |
| p5-HTML-Parser-Simpl..> | 2025-12-22 14:14 | 25K | |
| p5-HTML-Perlinfo-1.7..> | 2025-12-20 15:53 | 41K | |
| p5-HTML-PrettyPrinte..> | 2025-12-19 11:51 | 21K | |
| p5-HTML-Prototype-1...> | 2025-12-19 01:37 | 56K | |
| p5-HTML-QRCode-0.01_..> | 2025-12-29 04:13 | 3.5K | |
| p5-HTML-Query-0.09_1..> | 2025-12-18 14:40 | 21K | |
| p5-HTML-QuickCheck-1..> | 2025-12-20 17:39 | 5.4K | |
| p5-HTML-Quoted-0.05.pkg | 2025-12-19 02:19 | 5.4K | |
| p5-HTML-RSSAutodisco..> | 2025-12-19 13:26 | 6.7K | |
| p5-HTML-ResolveLink-..> | 2025-12-19 22:15 | 4.6K | |
| p5-HTML-Restrict-3.0..> | 2025-12-22 03:08 | 14K | |
| p5-HTML-RewriteAttri..> | 2025-12-18 23:19 | 11K | |
| p5-HTML-RobotsMETA-0..> | 2025-12-18 23:24 | 5.7K | |
| p5-HTML-SBC-0.15_2.pkg | 2025-12-22 23:23 | 12K | |
| p5-HTML-Scrubber-0.1..> | 2025-12-18 13:41 | 14K | |
| p5-HTML-Seamstress-6..> | 2025-12-23 13:26 | 58K | |
| p5-HTML-Selector-XPa..> | 2025-12-18 09:03 | 7.8K | |
| p5-HTML-Shakan-2.10_..> | 2025-12-23 09:01 | 39K | |
| p5-HTML-SimpleLinkEx..> | 2025-12-18 16:53 | 10K | |
| p5-HTML-SimpleParse-..> | 2025-12-19 11:16 | 11K | |
| p5-HTML-StickyQuery-..> | 2025-12-18 23:38 | 6.5K | |
| p5-HTML-StickyQuery-..> | 2025-12-24 05:27 | 4.8K | |
| p5-HTML-Stream-1.60_..> | 2025-12-19 22:29 | 28K | |
| p5-HTML-Strip-2.12.pkg | 2025-12-19 04:52 | 14K | |
| p5-HTML-StripScripts..> | 2025-12-18 23:17 | 27K | |
| p5-HTML-StripScripts..> | 2025-12-19 16:18 | 4.9K | |
| p5-HTML-Summary-0.02..> | 2025-12-19 20:00 | 13K | |
| p5-HTML-SuperForm-1...> | 2025-12-18 17:38 | 31K | |
| p5-HTML-T5-0.014_1.pkg | 2025-12-19 06:35 | 19K | |
| p5-HTML-Table-2.08a_..> | 2025-12-19 21:02 | 24K | |
| p5-HTML-TableContent..> | 2025-12-23 17:56 | 7.8K | |
| p5-HTML-TableExtract..> | 2025-12-18 13:51 | 24K | |
| p5-HTML-TableLayout-..> | 2025-12-20 10:07 | 24K | |
| p5-HTML-TableParser-..> | 2025-12-23 05:06 | 21K | |
| p5-HTML-TableTiler-1..> | 2025-12-19 07:34 | 10K | |
| p5-HTML-TagCloud-0.3..> | 2025-12-19 22:30 | 6.5K | |
| p5-HTML-TagCloud-Ext..> | 2025-12-22 08:36 | 8.6K | |
| p5-HTML-TagFilter-1...> | 2025-12-21 17:02 | 22K | |
| p5-HTML-TagParser-0...> | 2025-12-19 16:28 | 10K | |
| p5-HTML-Tagset-3.24.pkg | 2025-12-18 01:50 | 9.3K | |
| p5-HTML-Template-2.9..> | 2025-12-18 09:51 | 53K | |
| p5-HTML-Template-Ass..> | 2025-12-23 10:54 | 15K | |
| p5-HTML-Template-Com..> | 2025-12-19 12:28 | 86K | |
| p5-HTML-Template-Exp..> | 2025-12-20 17:03 | 12K | |
| p5-HTML-Template-Has..> | 2025-12-20 04:19 | 5.6K | |
| p5-HTML-Template-JIT..> | 2025-12-22 10:32 | 16K | |
| p5-HTML-Template-Plu..> | 2025-12-19 09:02 | 16K | |
| p5-HTML-Template-Pro..> | 2025-12-24 04:53 | 81K | |
| p5-HTML-Tidy5-1.06.pkg | 2025-12-19 08:14 | 18K | |
| p5-HTML-Tiny-1.05_1.pkg | 2025-12-19 09:29 | 15K | |
| p5-HTML-Toc-1.12_1.pkg | 2025-12-19 12:14 | 29K | |
| p5-HTML-TokeParser-S..> | 2025-12-18 13:02 | 27K | |
| p5-HTML-Tree-5.07.pkg | 2025-12-18 04:41 | 183K | |
| p5-HTML-TreeBuilder-..> | 2025-12-18 10:08 | 9.2K | |
| p5-HTML-TreeBuilder-..> | 2025-12-18 07:54 | 9.4K | |
| p5-HTML-Truncate-0.2..> | 2025-12-23 05:07 | 14K | |
| p5-HTML-Widgets-Sele..> | 2025-12-23 20:30 | 9.7K | |
| p5-HTML-WikiConverte..> | 2025-12-19 13:00 | 43K | |
| p5-HTML-WikiConverte..> | 2025-12-24 04:10 | 5.1K | |
| p5-HTML-WikiConverte..> | 2025-12-20 04:27 | 6.1K | |
| p5-HTML-WikiConverte..> | 2025-12-24 06:07 | 4.1K | |
| p5-HTML-WikiConverte..> | 2025-12-21 02:58 | 8.5K | |
| p5-HTML-WikiConverte..> | 2025-12-23 04:56 | 7.9K | |
| p5-HTML-WikiConverte..> | 2025-12-21 07:44 | 5.6K | |
| p5-HTML-WikiConverte..> | 2025-12-22 05:38 | 5.2K | |
| p5-HTML-WikiConverte..> | 2025-12-20 23:51 | 5.2K | |
| p5-HTML-WikiConverte..> | 2025-12-20 08:51 | 4.3K | |
| p5-HTML-WikiConverte..> | 2025-12-21 07:39 | 4.5K | |
| p5-HTML-WikiConverte..> | 2025-12-21 16:37 | 4.1K | |
| p5-HTML-WikiConverte..> | 2025-12-23 05:11 | 4.5K | |
| p5-HTML-WikiConverte..> | 2025-12-23 08:15 | 4.3K | |
| p5-HTML-WikiConverte..> | 2025-12-20 12:04 | 4.1K | |
| p5-HTML-WikiConverte..> | 2025-12-21 22:28 | 4.3K | |
| p5-HTML-WikiConverte..> | 2025-12-24 04:54 | 4.3K | |
| p5-HTML5-DOM-1.26.pkg | 2025-12-22 19:45 | 565K | |
| p5-HTTP-AnyUA-0.904.pkg | 2025-12-23 09:36 | 48K | |
| p5-HTTP-Async-0.33.pkg | 2025-12-19 19:44 | 18K | |
| p5-HTTP-Body-1.23.pkg | 2025-12-18 10:20 | 17K | |
| p5-HTTP-BrowserDetec..> | 2025-12-18 23:42 | 33K | |
| p5-HTTP-Cache-Transp..> | 2025-12-18 17:19 | 9.5K | |
| p5-HTTP-CookieJar-0...> | 2025-12-18 12:50 | 12K | |
| p5-HTTP-Cookies-6.11..> | 2025-12-18 02:38 | 20K | |
| p5-HTTP-Cookies-Mozi..> | 2025-12-23 19:43 | 6.1K | |
| p5-HTTP-Cookies-iCab..> | 2025-12-23 04:27 | 4.2K | |
| p5-HTTP-Cookies-w3m-..> | 2025-12-22 08:56 | 3.0K | |
| p5-HTTP-DAV-0.50.pkg | 2025-12-22 02:17 | 83K | |
| p5-HTTP-Daemon-6.16.pkg | 2025-12-18 16:24 | 17K | |
| p5-HTTP-Daemon-SSL-1..> | 2025-12-21 12:24 | 5.8K | |
| p5-HTTP-Date-6.06.pkg | 2025-12-18 01:32 | 7.8K | |
| p5-HTTP-Engine-0.030..> | 2025-12-19 01:59 | 51K | |
| p5-HTTP-Engine-Middl..> | 2025-12-19 06:59 | 35K | |
| p5-HTTP-Entity-Parse..> | 2025-12-18 06:31 | 13K | |
| p5-HTTP-Exception-0...> | 2025-12-18 18:59 | 23K | |
| p5-HTTP-HeaderParser..> | 2025-12-19 16:26 | 20K | |
| p5-HTTP-Headers-Acti..> | 2025-12-18 18:48 | 54K | |
| p5-HTTP-Headers-Fast..> | 2025-12-18 06:27 | 8.1K | |
| p5-HTTP-Link-Parser-..> | 2025-12-19 11:35 | 8.0K | |
| p5-HTTP-Lite-2.44.pkg | 2025-12-19 11:40 | 14K | |
| p5-HTTP-MHTTP-0.15_1..> | 2025-12-22 10:50 | 19K | |
| p5-HTTP-Message-7.01..> | 2025-12-18 01:49 | 72K | |
| p5-HTTP-MobileAgent-..> | 2025-12-19 02:31 | 29K | |
| p5-HTTP-MobileAgent-..> | 2025-12-20 00:34 | 3.2K | |
| p5-HTTP-MobileAgent-..> | 2025-12-22 06:12 | 6.8K | |
| p5-HTTP-MultiPartPar..> | 2025-12-18 04:18 | 7.1K | |
| p5-HTTP-Negotiate-6...> | 2025-12-18 03:12 | 10K | |
| p5-HTTP-OAI-4.12_1.pkg | 2025-12-23 19:14 | 67K | |
| p5-HTTP-Parser-0.06_..> | 2025-12-18 17:50 | 7.4K | |
| p5-HTTP-Parser-XS-0...> | 2025-12-18 16:23 | 17K | |
| p5-HTTP-Proxy-0.304.pkg | 2025-12-19 02:00 | 74K | |
| p5-HTTP-ProxyPAC-0.3..> | 2025-12-24 05:53 | 13K | |
| p5-HTTP-Recorder-0.0..> | 2025-12-19 22:55 | 13K | |
| p5-HTTP-Request-AsCG..> | 2025-12-18 20:42 | 6.3K | |
| p5-HTTP-Request-Para..> | 2025-12-18 22:32 | 4.7K | |
| p5-HTTP-Response-Enc..> | 2025-12-19 21:12 | 5.3K | |
| p5-HTTP-Router-0.05_..> | 2025-12-24 04:09 | 15K | |
| p5-HTTP-Server-Simpl..> | 2025-12-18 12:09 | 19K | |
| p5-HTTP-Server-Simpl..> | 2025-12-22 12:12 | 4.3K | |
| p5-HTTP-Server-Simpl..> | 2025-12-23 19:28 | 8.2K | |
| p5-HTTP-Server-Simpl..> | 2025-12-18 18:44 | 4.2K | |
| p5-HTTP-Server-Simpl..> | 2025-12-19 02:20 | 5.5K | |
| p5-HTTP-Server-Simpl..> | 2025-12-19 12:12 | 5.3K | |
| p5-HTTP-Session-0.49..> | 2025-12-19 08:38 | 23K | |
| p5-HTTP-Session-Stat..> | 2025-12-22 14:42 | 3.6K | |
| p5-HTTP-Session-Stor..> | 2025-12-20 08:37 | 4.4K | |
| p5-HTTP-Session2-1.1..> | 2025-12-18 16:03 | 16K | |
| p5-HTTP-Simple-0.004..> | 2025-12-19 05:02 | 6.8K | |
| p5-HTTP-SimpleLinkCh..> | 2025-12-18 23:49 | 7.7K | |
| p5-HTTP-Size-1.153.pkg | 2025-12-19 00:27 | 5.7K | |
| p5-HTTP-Thin-0.006.pkg | 2025-12-19 02:24 | 4.2K | |
| p5-HTTP-Throwable-0...> | 2025-12-23 04:09 | 90K | |
| p5-HTTP-Tiny-0.090.pkg | 2025-12-18 18:48 | 31K | |
| p5-HTTP-Tiny-Multipa..> | 2025-12-18 19:35 | 4.2K | |
| p5-HTTP-Tiny-Paranoi..> | 2025-12-19 01:34 | 4.1K | |
| p5-HTTP-Tiny-UA-0.00..> | 2025-12-19 00:02 | 8.5K | |
| p5-HTTP-Tiny-UNIX-0...> | 2025-12-21 16:19 | 4.7K | |
| p5-HTTP-WebTest-2.04..> | 2025-12-22 17:54 | 99K | |
| p5-HTTP-XSCookies-0...> | 2025-12-18 14:50 | 14K | |
| p5-HTTPD-Log-Filter-..> | 2025-12-21 10:31 | 11K | |
| p5-HTTPD-User-Manage..> | 2025-12-20 08:53 | 51K | |
| p5-Hailo-0.75_1.pkg | 2025-12-19 01:07 | 60K | |
| p5-Hash-AsObject-0.1..> | 2025-12-19 16:38 | 8.3K | |
| p5-Hash-AutoHash-1.1..> | 2025-12-18 19:09 | 26K | |
| p5-Hash-AutoHash-Arg..> | 2025-12-19 22:50 | 21K | |
| p5-Hash-Case-1.030.pkg | 2025-12-26 19:03 | 12K | |
| p5-Hash-Diff-0.007.pkg | 2025-12-22 03:18 | 3.4K | |
| p5-Hash-FieldHash-0...> | 2025-12-21 02:50 | 13K | |
| p5-Hash-Flatten-1.19..> | 2025-12-18 12:25 | 8.0K | |
| p5-Hash-Merge-0.302.pkg | 2025-12-18 06:00 | 9.7K | |
| p5-Hash-Merge-Extra-..> | 2025-12-19 11:29 | 4.0K | |
| p5-Hash-Merge-Simple..> | 2025-12-18 18:49 | 5.5K | |
| p5-Hash-MoreUtils-0...> | 2025-12-18 16:08 | 8.1K | |
| p5-Hash-MultiKey-0.0..> | 2025-12-20 17:22 | 8.8K | |
| p5-Hash-MultiValue-0..> | 2025-12-18 03:55 | 11K | |
| p5-Hash-NoRef-0.03_2..> | 2025-12-22 23:33 | 6.5K | |
| p5-Hash-Objectify-0...> | 2025-12-22 13:39 | 6.7K | |
| p5-Hash-Ordered-0.01..> | 2025-12-18 11:06 | 24K | |
| p5-Hash-SharedMem-0...> | 2025-12-18 20:07 | 56K | |
| p5-Hash-Slice-0.03.pkg | 2025-12-19 16:25 | 5.2K | |
| p5-Hash-Union-0.03_1..> | 2025-12-22 15:17 | 6.0K | |
| p5-Hash-Util-FieldHa..> | 2025-12-18 11:19 | 6.4K | |
| p5-Hash-WithDefaults..> | 2025-12-18 14:38 | 6.1K | |
| p5-Hatena-Keyword-0...> | 2025-12-21 10:05 | 8.1K | |
| p5-Heap-0.80_1.pkg | 2025-12-18 07:58 | 29K | |
| p5-Heap-Simple-0.13_..> | 2025-12-19 23:24 | 24K | |
| p5-Heap-Simple-Perl-..> | 2025-12-23 12:10 | 13K | |
| p5-Heap-Simple-XS-0...> | 2025-12-23 09:47 | 33K | |
| p5-Heimdal-Kadm5-0.0..> | 2025-12-22 07:27 | 25K | |
| p5-Hijk-0.28.pkg | 2025-12-19 20:45 | 17K | |
| p5-Hook-LexWrap-0.26..> | 2025-12-18 14:32 | 9.2K | |
| p5-I18N-AcceptLangua..> | 2025-12-21 04:39 | 10K | |
| p5-I18N-Charset-1.39..> | 2025-12-19 14:43 | 25K | |
| p5-I18N-LangTags-0.3..> | 2025-12-23 05:59 | 42K | |
| p5-IMAP-Admin-1.6.8.pkg | 2025-12-23 21:18 | 14K | |
| p5-IMAP-Client-0.13_..> | 2025-12-23 03:33 | 49K | |
| p5-IMAP-Sieve-0.4.9_..> | 2025-12-23 01:52 | 3.7K | |
| p5-IMDB-Film-0.53_1.pkg | 2025-12-22 12:16 | 26K | |
| p5-IO-AIO-4.81.pkg | 2025-12-18 10:15 | 105K | |
| p5-IO-All-0.87.pkg | 2025-12-18 18:05 | 55K | |
| p5-IO-All-LWP-0.14_2..> | 2025-12-20 18:02 | 12K | |
| p5-IO-Any-0.09_2.pkg | 2025-12-20 18:28 | 7.9K | |
| p5-IO-Async-0.804.pkg | 2025-12-18 22:40 | 221K | |
| p5-IO-Async-Resolver..> | 2025-12-19 20:34 | 9.1K | |
| p5-IO-Async-SSL-0.25..> | 2025-12-19 22:59 | 11K | |
| p5-IO-BufferedSelect..> | 2025-12-20 01:55 | 5.5K | |
| p5-IO-CSVHeaderFile-..> | 2025-12-22 15:11 | 4.9K | |
| p5-IO-Callback-2.00.pkg | 2025-12-23 23:08 | 10K | |
| p5-IO-Capture-0.05_1..> | 2025-12-18 12:07 | 25K | |
| p5-IO-CaptureOutput-..> | 2025-12-18 18:50 | 9.4K | |
| p5-IO-Compress-2.213..> | 2025-12-18 15:56 | 201K | |
| p5-IO-Compress-Brotl..> | 2025-12-19 20:16 | 14K | |
| p5-IO-Compress-Lzf-2..> | 2025-12-23 14:16 | 26K | |
| p5-IO-Compress-Lzma-..> | 2025-12-19 08:00 | 56K | |
| p5-IO-Compress-Lzop-..> | 2025-12-23 02:23 | 28K | |
| p5-IO-Digest-0.11_2.pkg | 2025-12-18 14:01 | 3.1K | |
| p5-IO-Event-0.813_1.pkg | 2025-12-18 22:24 | 27K | |
| p5-IO-FDPass-1.3.pkg | 2025-12-18 18:34 | 8.3K | |
| p5-IO-File-AtomicCha..> | 2025-12-18 21:37 | 5.9K | |
| p5-IO-HTML-1.004.pkg | 2025-12-18 01:35 | 13K | |
| p5-IO-Handle-Util-0...> | 2025-12-18 16:10 | 18K | |
| p5-IO-Interactive-1...> | 2025-12-18 12:25 | 8.0K | |
| p5-IO-Interface-1.09..> | 2025-12-18 10:27 | 17K | |
| p5-IO-KQueue-0.39.pkg | 2025-12-18 19:37 | 12K | |
| p5-IO-Lambda-1.23_1.pkg | 2025-12-20 17:29 | 120K | |
| p5-IO-LockedFile-0.2..> | 2025-12-18 22:58 | 11K | |
| p5-IO-MultiPipe-0.0...> | 2025-12-22 16:50 | 5.1K | |
| p5-IO-Multiplex-1.16..> | 2025-12-18 13:49 | 15K | |
| p5-IO-NestedCapture-..> | 2025-12-22 14:39 | 11K | |
| p5-IO-Null-1.01_1.pkg | 2025-12-19 15:45 | 4.9K | |
| p5-IO-Pager-2.10.pkg | 2025-12-18 19:13 | 48K | |
| p5-IO-Pipely-0.006.pkg | 2025-12-18 07:55 | 11K | |
| p5-IO-Prompt-0.99700..> | 2025-12-19 22:39 | 15K | |
| p5-IO-Prompt-Simple-..> | 2025-12-19 21:10 | 7.7K | |
| p5-IO-Prompt-Tiny-0...> | 2025-12-19 09:18 | 5.0K | |
| p5-IO-Prompter-0.005..> | 2025-12-19 15:11 | 58K | |
| p5-IO-Pty-Easy-0.10.pkg | 2025-12-19 09:11 | 7.9K | |
| p5-IO-SessionData-1...> | 2025-12-18 13:14 | 4.4K | |
| p5-IO-Socket-INET6-2..> | 2025-12-18 11:51 | 11K | |
| p5-IO-Socket-IP-0.43..> | 2025-12-24 04:54 | 21K | |
| p5-IO-Socket-Multica..> | 2025-12-19 03:03 | 16K | |
| p5-IO-Socket-Multica..> | 2025-12-19 08:54 | 12K | |
| p5-IO-Socket-SSL-2.0..> | 2025-12-16 02:18 | 194K | |
| p5-IO-Socket-Socks-0..> | 2025-12-20 00:14 | 22K | |
| p5-IO-Socket-Socks-W..> | 2025-12-23 19:56 | 15K | |
| p5-IO-Socket-Timeout..> | 2025-12-19 01:09 | 7.0K | |
| p5-IO-Socket-UNIX-Ut..> | 2025-12-19 04:53 | 4.2K | |
| p5-IO-String-1.08_1.pkg | 2025-12-18 08:10 | 7.6K | |
| p5-IO-Stringy-2.113.pkg | 2025-12-18 07:44 | 42K | |
| p5-IO-Stty-0.04.pkg | 2025-12-21 06:19 | 11K | |
| p5-IO-Tee-0.66.pkg | 2025-12-18 16:35 | 6.4K | |
| p5-IO-TieCombine-1.0..> | 2025-12-18 16:38 | 7.7K | |
| p5-IO-Toolkit-1.008_..> | 2025-12-19 06:03 | 8.5K | |
| p5-IO-Tty-1.20_1.pkg | 2025-12-18 07:44 | 27K | |
| p5-IO-Util-1.5_2,1.pkg | 2025-12-18 20:38 | 17K | |
| p5-IO-YAML-0.10_1.pkg | 2025-12-22 12:51 | 12K | |
| p5-IO-Zlib-1.15.pkg | 2025-12-20 14:47 | 9.7K | |
| p5-IOC-0.29_3.pkg | 2025-12-20 00:26 | 79K | |
| p5-IP-Anonymous-0.04..> | 2025-12-19 12:52 | 7.3K | |
| p5-IP-Country-2.28_1..> | 2025-12-19 21:53 | 272K | |
| p5-IPC-Cache-0.02_1.pkg | 2025-12-19 22:16 | 7.4K | |
| p5-IPC-Cmd-1.04.pkg | 2025-12-18 19:39 | 27K | |
| p5-IPC-DirQueue-1.0_..> | 2025-12-20 05:35 | 35K | |
| p5-IPC-Locker-1.502.pkg | 2025-12-20 00:32 | 42K | |
| p5-IPC-MM-0.03_1.pkg | 2025-12-23 19:48 | 22K | |
| p5-IPC-MMA-0.81_2.pkg | 2025-12-22 02:06 | 53K | |
| p5-IPC-Mmap-0.21_1.pkg | 2025-12-18 21:59 | 13K | |
| p5-IPC-Mmap-Share-0...> | 2025-12-22 07:22 | 6.5K | |
| p5-IPC-Open3-Simple-..> | 2025-12-21 03:52 | 6.2K | |
| p5-IPC-PerlSSH-0.17.pkg | 2025-12-23 06:20 | 27K | |
| p5-IPC-PubSub-0.29_2..> | 2025-12-23 17:20 | 11K | |
| p5-IPC-Run-20231003...> | 2025-12-18 10:19 | 103K | |
| p5-IPC-Run-SafeHandl..> | 2025-12-21 20:41 | 4.4K | |
| p5-IPC-Run3-0.049.pkg | 2025-12-18 13:06 | 26K | |
| p5-IPC-Session-0.05_..> | 2025-12-20 10:57 | 7.6K | |
| p5-IPC-ShareLite-0.1..> | 2025-12-18 11:26 | 19K | |
| p5-IPC-Shareable-1.1..> | 2025-12-21 06:21 | 24K | |
| p5-IPC-SharedCache-1..> | 2025-12-22 00:48 | 18K | |
| p5-IPC-ShellCmd-0.00..> | 2025-12-18 19:33 | 19K | |
| p5-IPC-Signal-1.00_1..> | 2025-12-18 10:39 | 3.8K | |
| p5-IPC-System-Option..> | 2025-12-18 18:19 | 13K | |
| p5-IPC-System-Simple..> | 2025-12-18 14:18 | 19K | |
| p5-IPv6-Address-0.20..> | 2025-12-22 05:01 | 11K | |
| p5-IRC-Bot-Hangman-0..> | 2025-12-23 18:50 | 31K | |
| p5-IRC-Utils-0.12_1.pkg | 2025-12-18 17:37 | 15K | |
| p5-IRI-0.013.pkg | 2025-12-18 17:35 | 8.1K | |
| p5-Ima-DBI-0.35_1.pkg | 2025-12-18 13:08 | 17K | |
| p5-Image-Base-1.17_1..> | 2025-12-19 11:22 | 15K | |
| p5-Image-Base-SVG-5.pkg | 2025-12-22 10:44 | 8.2K | |
| p5-Image-Caa-1.01_1.pkg | 2025-12-23 04:33 | 198K | |
| p5-Image-Compare-1.0..> | 2025-12-30 12:48 | 29K | |
| p5-Image-Delivery-0...> | 2025-12-22 07:04 | 14K | |
| p5-Image-ExifTool-13..> | 2025-12-19 00:14 | 5.6M | |
| p5-Image-ExifTool-de..> | 2025-12-28 18:47 | 5.7M | |
| p5-Image-Grab-1.4.2_..> | 2025-12-22 16:15 | 12K | |
| p5-Image-Heatmap-0.5..> | 2025-12-30 01:42 | 29K | |
| p5-Image-IPTCInfo-1...> | 2025-12-21 07:47 | 35K | |
| p5-Image-Imgur-0.01_..> | 2025-12-20 15:53 | 4.2K | |
| p5-Image-Imlib2-2.03..> | 2025-12-27 18:03 | 32K | |
| p5-Image-Info-1.45.pkg | 2025-12-19 19:47 | 61K | |
| p5-Image-LibExif-0.0..> | 2025-12-21 18:40 | 8.2K | |
| p5-Image-Magick-Iter..> | 2025-12-27 22:35 | 7.5K | |
| p5-Image-Math-Constr..> | 2025-12-19 21:02 | 7.5K | |
| p5-Image-MetaData-GQ..> | 2025-12-21 17:04 | 7.9K | |
| p5-Image-MetaData-JP..> | 2025-12-19 10:57 | 194K | |
| p5-Image-OCR-Tessera..> | 2025-12-30 07:49 | 9.8K | |
| p5-Image-PBMlib-2.00..> | 2025-12-20 01:29 | 21K | |
| p5-Image-PNG-Libpng-..> | 2025-12-26 20:45 | 114K | |
| p5-Image-PNG-QRCode-..> | 2025-12-28 05:02 | 27K | |
| p5-Image-Pngslimmer-..> | 2025-12-20 08:47 | 16K | |
| p5-Image-Sane-5_1.pkg | 2025-12-27 11:15 | 24K | |
| p5-Image-Scale-0.14_..> | 2025-12-30 06:02 | 41K | |
| p5-Image-Size-3.300.pkg | 2025-12-18 16:29 | 29K | |
| p5-Imager-1.029.pkg | 2025-12-26 19:06 | 795K | |
| p5-Imager-Graph-0.10..> | 2025-12-26 21:20 | 52K | |
| p5-Imager-Plot-0.09_..> | 2025-12-30 16:19 | 14K | |
| p5-Imager-QRCode-0.0..> | 2025-12-29 00:44 | 36K | |
| p5-Imlib2-1.0.0_15.pkg | 2025-12-29 06:14 | 14K | |
| p5-Import-Base-1.004..> | 2025-12-20 06:06 | 15K | |
| p5-Import-Into-1.002..> | 2025-12-18 11:09 | 8.2K | |
| p5-Importer-0.026.pkg | 2025-12-18 16:35 | 22K | |
| p5-Inline-0.87.pkg | 2025-12-18 11:57 | 70K | |
| p5-Inline-ASM-0.03_2..> | 2025-12-21 10:33 | 11K | |
| p5-Inline-C-0.82.pkg | 2025-12-18 18:22 | 65K | |
| p5-Inline-CPP-0.80.pkg | 2025-12-20 02:48 | 50K | |
| p5-Inline-Files-0.71..> | 2025-12-19 08:30 | 18K | |
| p5-Inline-Filters-0...> | 2025-12-21 05:09 | 9.1K | |
| p5-Inline-Java-0.540..> | 2025-12-27 21:01 | 129K | |
| p5-Inline-Python-0.5..> | 2025-12-20 21:25 | 40K | |
| p5-Inline-TT-0.07_1.pkg | 2025-12-19 17:53 | 7.2K | |
| p5-Inline-Tcl-0.09_1..> | 2025-12-23 10:26 | 12K | |
| p5-InlineX-C2XS-0.27..> | 2025-12-21 03:46 | 28K | |
| p5-InlineX-CPP2XS-0...> | 2025-12-21 16:28 | 27K | |
| p5-Input-Validator-0..> | 2025-12-24 04:21 | 33K | |
| p5-Interchange6-Sche..> | 2025-12-23 04:58 | 171K | |
| p5-Interpolation-0.7..> | 2025-12-22 10:22 | 13K | |
| p5-Ioctl-0.81_1.pkg | 2025-12-20 01:08 | 9.0K | |
| p5-Iodef-Pb-Simple-0..> | 2025-12-22 03:20 | 28K | |
| p5-Iterator-0.03_2.pkg | 2025-12-19 00:13 | 17K | |
| p5-Iterator-DBI-0.02..> | 2025-12-20 17:11 | 5.9K | |
| p5-Iterator-File-1.0..> | 2025-12-22 07:39 | 21K | |
| p5-Iterator-IO-0.02_..> | 2025-12-21 21:31 | 8.9K | |
| p5-Iterator-Misc-0.0..> | 2025-12-21 13:20 | 7.9K | |
| p5-Iterator-Simple-0..> | 2025-12-18 13:36 | 11K | |
| p5-Iterator-Simple-L..> | 2025-12-18 18:21 | 5.3K | |
| p5-Iterator-Util-0.0..> | 2025-12-19 12:41 | 12K | |
| p5-JE-0.066_2.pkg | 2025-12-19 02:10 | 160K | |
| p5-JIRA-REST-0.024.pkg | 2025-12-19 20:29 | 16K | |
| p5-JQuery-1.06_2.pkg | 2025-12-23 05:33 | 286K | |
| p5-JSAN-0.07_8.pkg | 2025-12-20 09:07 | 9.8K | |
| p5-JSON-4.10.pkg | 2025-12-18 05:37 | 75K | |
| p5-JSON-API-1.1.1.pkg | 2025-12-21 11:34 | 8.9K | |
| p5-JSON-Any-1.40.pkg | 2025-12-18 12:37 | 11K | |
| p5-JSON-DWIW-0.47_1.pkg | 2025-12-22 05:24 | 55K | |
| p5-JSON-Hyper-0.011_..> | 2025-12-19 12:37 | 12K | |
| p5-JSON-MaybeXS-1.00..> | 2025-12-18 04:17 | 9.1K | |
| p5-JSON-PP-4.16_1.pkg | 2025-12-21 06:29 | 51K | |
| p5-JSON-Parse-0.62.pkg | 2025-12-19 05:34 | 77K | |
| p5-JSON-Path-1.0.6.pkg | 2025-12-18 22:29 | 25K | |
| p5-JSON-Pointer-0.07..> | 2025-12-23 05:04 | 14K | |
| p5-JSON-RPC-1.06_1.pkg | 2025-12-18 19:32 | 40K | |
| p5-JSON-RPC-Common-0..> | 2025-12-21 19:43 | 40K | |
| p5-JSON-RPC-Dispatch..> | 2025-12-23 17:22 | 16K | |
| p5-JSON-Schema-0.016..> | 2025-12-21 19:03 | 23K | |
| p5-JSON-Tiny-0.58.pkg | 2025-12-23 13:38 | 10K | |
| p5-JSON-Validator-5...> | 2025-12-19 02:52 | 81K | |
| p5-JSON-WebToken-0.1..> | 2025-12-19 10:44 | 7.9K | |
| p5-JSON-XS-4.04.pkg | 2025-12-18 17:19 | 78K | |
| p5-JSON-XS-VersionOn..> | 2025-12-19 16:13 | 3.1K | |
| p5-Jabber-Lite-0.8.1..> | 2025-12-22 14:23 | 56K | |
| p5-Jabber-SimpleSend..> | 2025-12-22 13:13 | 4.4K | |
| p5-Java-4.7_5.pkg | 2025-12-27 04:15 | 51K | |
| p5-JavaScript-Minifi..> | 2025-12-19 07:25 | 7.9K | |
| p5-JavaScript-Minifi..> | 2025-12-18 20:08 | 12K | |
| p5-JavaScript-Packer..> | 2025-12-20 02:26 | 10K | |
| p5-JavaScript-QuickJ..> | 2025-12-19 02:02 | 33K | |
| p5-JavaScript-RPC-0...> | 2025-12-21 09:29 | 7.8K | |
| p5-JavaScript-Squish..> | 2025-12-21 14:24 | 17K | |
| p5-JavaScript-Value-..> | 2025-12-19 14:10 | 4.3K | |
| p5-Jemplate-0.300.pkg | 2025-12-19 13:19 | 53K | |
| p5-Jifty-1.50430.pkg | 2025-12-20 01:57 | 1.2M | |
| p5-Jifty-DBI-0.78.pkg | 2025-12-18 21:43 | 140K | |
| p5-Jonk-0.05_1.pkg | 2025-12-23 01:46 | 15K | |
| p5-Kafka-0.8010_2.pkg | 2025-12-22 04:57 | 79K | |
| p5-Keyword-Declare-0..> | 2025-12-19 15:51 | 48K | |
| p5-Keyword-Pluggable..> | 2025-12-19 07:03 | 11K | |
| p5-Keyword-Simple-0...> | 2025-12-18 22:05 | 9.0K | |
| p5-KinoSearch1-1.01_..> | 2025-12-20 01:02 | 221K | |
| p5-Kwalify-1.24.pkg | 2025-12-20 01:54 | 13K | |
| p5-KyotoCabinet-1.20..> | 2025-12-20 07:45 | 41K | |
| p5-LEGO-RCX-1.01_1.pkg | 2025-12-22 07:28 | 12K | |
| p5-LMAP-CID2SPF-0.9_..> | 2025-12-22 19:12 | 3.3K | |
| p5-LMDB_File-0.14.pkg | 2025-12-23 00:52 | 51K | |
| p5-LV-0.006_1.pkg | 2025-12-18 17:54 | 6.0K | |
| p5-LWP-Authen-Negoti..> | 2025-12-21 08:35 | 6.6K | |
| p5-LWP-Authen-OAuth-..> | 2025-12-20 07:53 | 7.0K | |
| p5-LWP-Authen-OAuth2..> | 2025-12-21 17:02 | 72K | |
| p5-LWP-Authen-Wsse-0..> | 2025-12-23 12:56 | 4.7K | |
| p5-LWP-ConnCache-Max..> | 2025-12-19 12:43 | 3.2K | |
| p5-LWP-MediaTypes-6...> | 2025-12-18 01:37 | 18K | |
| p5-LWP-Online-1.08_1..> | 2025-12-21 22:26 | 9.4K | |
| p5-LWP-Protocol-PSGI..> | 2025-12-21 19:53 | 7.7K | |
| p5-LWP-Protocol-conn..> | 2025-12-20 00:07 | 5.1K | |
| p5-LWP-Protocol-http..> | 2025-12-23 18:01 | 5.6K | |
| p5-LWP-Protocol-http..> | 2025-12-18 13:54 | 5.0K | |
| p5-LWP-Protocol-sock..> | 2025-12-21 09:31 | 7.3K | |
| p5-LWP-UserAgent-Cac..> | 2025-12-19 06:40 | 9.2K | |
| p5-LWP-UserAgent-Det..> | 2025-12-19 02:08 | 6.8K | |
| p5-LWP-UserAgent-POE..> | 2025-12-20 13:36 | 6.1K | |
| p5-LWP-UserAgent-Wit..> | 2025-12-23 16:16 | 3.5K | |
| p5-LWPx-ParanoidAgen..> | 2025-12-20 03:07 | 15K | |
| p5-LWPx-TimedHTTP-1...> | 2025-12-20 10:07 | 7.6K | |
| p5-LaTeX-Driver-1.2...> | 2025-12-27 11:12 | 28K | |
| p5-LaTeX-Encode-0.09..> | 2025-12-19 10:06 | 20K | |
| p5-LaTeX-Pod-0.23.pkg | 2025-12-23 21:54 | 9.7K | |
| p5-LaTeX-TOM-1.06.pkg | 2025-12-19 07:00 | 27K | |
| p5-LaTeX-Table-1.0.6..> | 2025-12-30 03:50 | 55K | |
| p5-LaTeX-ToUnicode-0..> | 2025-12-19 09:55 | 10K | |
| p5-LaTeXML-0.8.8.pkg | 2025-12-24 05:21 | 2.0M | |
| p5-Language-Expr-0.2..> | 2025-12-27 17:13 | 44K | |
| p5-Layout-Manager-0...> | 2025-12-19 22:43 | 22K | |
| p5-Lchown-1.01_2.pkg | 2025-12-19 03:26 | 5.8K | |
| p5-Lexical-Alias-0.0..> | 2025-12-19 22:26 | 8.8K | |
| p5-Lexical-Import-0...> | 2025-12-22 10:05 | 10K | |
| p5-Lexical-Persisten..> | 2025-12-18 11:43 | 13K | |
| p5-Lexical-SealRequi..> | 2025-12-19 13:45 | 12K | |
| p5-Lexical-Var-0.010..> | 2025-12-18 09:15 | 19K | |
| p5-Library-CallNumbe..> | 2025-12-20 06:48 | 9.5K | |
| p5-Lingua-Conjunctio..> | 2025-12-23 01:48 | 7.1K | |
| p5-Lingua-DetectCyri..> | 2025-12-22 14:52 | 27K | |
| p5-Lingua-EN-Address..> | 2025-12-21 05:57 | 26K | |
| p5-Lingua-EN-Fathom-..> | 2025-12-21 05:29 | 9.5K | |
| p5-Lingua-EN-FindNum..> | 2025-12-18 04:34 | 4.3K | |
| p5-Lingua-EN-Gender-..> | 2025-12-23 14:42 | 4.0K | |
| p5-Lingua-EN-Infinit..> | 2025-12-23 11:22 | 11K | |
| p5-Lingua-EN-Inflect..> | 2025-12-18 04:44 | 46K | |
| p5-Lingua-EN-Inflect..> | 2025-12-18 08:02 | 4.3K | |
| p5-Lingua-EN-Inflect..> | 2025-12-18 11:08 | 6.7K | |
| p5-Lingua-EN-MatchNa..> | 2025-12-21 02:05 | 6.1K | |
| p5-Lingua-EN-NameCas..> | 2025-12-21 05:29 | 8.2K | |
| p5-Lingua-EN-NamePar..> | 2025-12-19 16:46 | 24K | |
| p5-Lingua-EN-NamedEn..> | 2025-12-22 16:40 | 1.3M | |
| p5-Lingua-EN-Nicknam..> | 2025-12-19 10:57 | 27K | |
| p5-Lingua-EN-Number-..> | 2025-12-18 07:55 | 4.1K | |
| p5-Lingua-EN-Numbers..> | 2025-12-19 13:14 | 7.6K | |
| p5-Lingua-EN-Numbers..> | 2025-12-20 11:11 | 5.2K | |
| p5-Lingua-EN-Numbers..> | 2025-12-18 18:27 | 5.0K | |
| p5-Lingua-EN-PluralT..> | 2025-12-18 19:22 | 12K | |
| p5-Lingua-EN-Sentenc..> | 2025-12-19 03:16 | 10K | |
| p5-Lingua-EN-Squeeze..> | 2025-12-20 18:27 | 16K | |
| p5-Lingua-EN-Summari..> | 2025-12-23 17:03 | 7.4K | |
| p5-Lingua-EN-Syllabl..> | 2025-12-19 20:48 | 5.0K | |
| p5-Lingua-EN-Tagger-..> | 2025-12-18 07:23 | 474K | |
| p5-Lingua-EN-Words2N..> | 2025-12-18 03:51 | 5.6K | |
| p5-Lingua-Han-PinYin..> | 2025-12-21 06:52 | 152K | |
| p5-Lingua-Han-Utils-..> | 2025-12-19 12:26 | 4.9K | |
| p5-Lingua-Ident-1.7_..> | 2025-12-20 14:51 | 8.9K | |
| p5-Lingua-Identify-0..> | 2025-12-23 18:12 | 129K | |
| p5-Lingua-Ispell-0.0..> | 2025-12-22 23:29 | 11K | |
| p5-Lingua-JA-Fold-0...> | 2025-12-22 08:05 | 6.8K | |
| p5-Lingua-JA-Romaniz..> | 2025-12-20 10:14 | 73K | |
| p5-Lingua-KO-Hangul-..> | 2025-12-19 06:14 | 10K | |
| p5-Lingua-KO-Romaniz..> | 2025-12-19 06:57 | 4.7K | |
| p5-Lingua-PT-Stemmer..> | 2025-12-18 03:52 | 7.1K | |
| p5-Lingua-Preferred-..> | 2025-12-18 16:06 | 6.6K | |
| p5-Lingua-RU-Charset..> | 2025-12-22 00:51 | 5.2K | |
| p5-Lingua-Stem-2.31.pkg | 2025-12-18 04:46 | 41K | |
| p5-Lingua-Stem-Fr-0...> | 2025-12-18 03:47 | 7.5K | |
| p5-Lingua-Stem-It-0...> | 2025-12-18 03:53 | 6.2K | |
| p5-Lingua-Stem-Ru-0...> | 2025-12-18 03:47 | 5.4K | |
| p5-Lingua-Stem-Snowb..> | 2025-12-18 21:56 | 64K | |
| p5-Lingua-Stem-Snowb..> | 2025-12-18 03:53 | 4.8K | |
| p5-Lingua-Stem-Snowb..> | 2025-12-18 03:30 | 6.6K | |
| p5-Lingua-Stem-Snowb..> | 2025-12-18 04:11 | 6.5K | |
| p5-Lingua-StopWords-..> | 2025-12-18 20:36 | 14K | |
| p5-Lingua-Translit-0..> | 2025-12-19 04:57 | 22K | |
| p5-Lingua-Treebank-0..> | 2025-12-21 13:19 | 42K | |
| p5-Lingua-ZH-HanDete..> | 2025-12-22 03:25 | 4.7K | |
| p5-Lingua-ZH-Keyword..> | 2025-12-24 03:55 | 4.3K | |
| p5-Lingua-ZH-Numbers..> | 2025-12-23 19:49 | 7.7K | |
| p5-Lingua-ZH-Romaniz..> | 2025-12-19 22:25 | 119K | |
| p5-Lingua-ZH-Segment..> | 2025-12-21 16:37 | 3.3K | |
| p5-Lingua-ZH-Summari..> | 2025-12-22 01:29 | 4.9K | |
| p5-Lingua-ZH-TaBE-0...> | 2025-12-19 02:36 | 19K | |
| p5-Lingua-ZH-Toke-0...> | 2025-12-19 19:52 | 6.2K | |
| p5-Lingua-ZH-WordSeg..> | 2025-12-21 09:34 | 1.0M | |
| p5-Lingua-ZH-Wrap-0...> | 2025-12-19 09:11 | 4.5K | |
| p5-Linux-Cpuinfo-1.1..> | 2025-12-23 17:08 | 8.5K | |
| p5-List-AllUtils-0.1..> | 2025-12-18 18:35 | 31K | |
| p5-List-BinarySearch..> | 2025-12-18 13:17 | 19K | |
| p5-List-Compare-0.53..> | 2025-12-18 18:43 | 62K | |
| p5-List-Cycle-1.04.pkg | 2025-12-22 02:38 | 5.0K | |
| p5-List-Flatten-0.01..> | 2025-12-20 00:09 | 3.7K | |
| p5-List-Gen-0.976.pkg | 2025-12-21 10:34 | 121K | |
| p5-List-Group-1.3_1.pkg | 2025-12-20 21:11 | 3.7K | |
| p5-List-MoreUtils-0...> | 2025-12-18 04:16 | 35K | |
| p5-List-MoreUtils-XS..> | 2025-12-18 02:48 | 34K | |
| p5-List-Objects-Type..> | 2025-12-24 04:27 | 5.5K | |
| p5-List-Objects-With..> | 2025-12-19 03:19 | 68K | |
| p5-List-Pairwise-1.0..> | 2025-12-19 04:37 | 8.7K | |
| p5-List-Permutor-0.0..> | 2025-12-23 16:05 | 3.7K | |
| p5-List-PowerSet-0.0..> | 2025-12-24 07:22 | 4.5K | |
| p5-List-Regexp-1.05.pkg | 2025-12-21 16:14 | 8.2K | |
| p5-List-Rotation-Cyc..> | 2025-12-18 11:07 | 3.5K | |
| p5-List-SomeUtils-0...> | 2025-12-18 13:43 | 24K | |
| p5-List-SomeUtils-XS..> | 2025-12-18 11:19 | 25K | |
| p5-List-Uniq-0.20_1.pkg | 2025-12-23 16:08 | 5.2K | |
| p5-List-Util-Weighte..> | 2025-12-19 11:52 | 3.8K | |
| p5-List-UtilsBy-0.12..> | 2025-12-18 09:56 | 12K | |
| p5-List-UtilsBy-XS-0..> | 2025-12-19 00:13 | 15K | |
| p5-Locale-Codes-3.64..> | 2025-12-19 02:24 | 286K | |
| p5-Locale-Currency-F..> | 2025-12-19 12:41 | 13K | |
| p5-Locale-Geocode-1...> | 2025-12-22 09:21 | 54K | |
| p5-Locale-Maketext-1..> | 2025-12-21 17:05 | 80K | |
| p5-Locale-Maketext-F..> | 2025-12-18 23:03 | 9.0K | |
| p5-Locale-Maketext-G..> | 2025-12-18 18:14 | 28K | |
| p5-Locale-Maketext-L..> | 2025-12-18 19:30 | 77K | |
| p5-Locale-Maketext-S..> | 2025-12-22 17:44 | 8.3K | |
| p5-Locale-Msgfmt-0.1..> | 2025-12-22 11:18 | 8.6K | |
| p5-Locale-PGetText-0..> | 2025-12-20 06:18 | 6.1K | |
| p5-Locale-PO-0.27_1.pkg | 2025-12-18 16:09 | 10K | |
| p5-Locale-SubCountry..> | 2025-12-19 20:51 | 67K | |
| p5-Locale-US-3.04.pkg | 2025-12-22 12:11 | 4.8K | |
| p5-Locale-XGettext-0..> | 2025-12-19 22:19 | 38K | |
| p5-Locale-gettext-1...> | 2025-12-16 01:30 | 9.5K | |
| p5-Locale-libintl-1...> | 2025-12-16 01:31 | 677K | |
| p5-Lock-File-1.03.pkg | 2025-12-19 04:53 | 11K | |
| p5-LockFile-Simple-0..> | 2025-12-19 02:13 | 15K | |
| p5-Log-Accounting-SV..> | 2025-12-27 20:58 | 8.2K | |
| p5-Log-Accounting-SV..> | 2025-12-29 23:08 | 3.6K | |
| p5-Log-Agent-1.005.pkg | 2025-12-18 20:38 | 92K | |
| p5-Log-Agent-Logger-..> | 2025-12-21 16:48 | 9.9K | |
| p5-Log-Any-1.718.pkg | 2025-12-18 13:00 | 68K | |
| p5-Log-Any-Adapter-D..> | 2025-12-18 19:36 | 3.4K | |
| p5-Log-Any-Adapter-L..> | 2025-12-20 02:50 | 4.3K | |
| p5-Log-Any-App-0.540..> | 2025-12-20 04:49 | 34K | |
| p5-Log-Any-IfLOG-0.0..> | 2025-12-19 12:01 | 5.2K | |
| p5-Log-Colorize-Help..> | 2025-12-22 22:38 | 8.2K | |
| p5-Log-Contextual-0...> | 2025-12-18 23:13 | 42K | |
| p5-Log-Defer-0.312.pkg | 2025-12-19 20:46 | 12K | |
| p5-Log-Dispatch-2.71..> | 2025-12-18 12:41 | 55K | |
| p5-Log-Dispatch-Arra..> | 2025-12-18 17:42 | 3.4K | |
| p5-Log-Dispatch-Arra..> | 2025-12-19 09:38 | 5.0K | |
| p5-Log-Dispatch-Colo..> | 2025-12-20 15:41 | 4.3K | |
| p5-Log-Dispatch-Conf..> | 2025-12-18 16:00 | 14K | |
| p5-Log-Dispatch-Conf..> | 2025-12-18 19:33 | 6.0K | |
| p5-Log-Dispatch-Conf..> | 2025-12-23 14:33 | 3.3K | |
| p5-Log-Dispatch-DBI-..> | 2025-12-21 20:09 | 4.5K | |
| p5-Log-Dispatch-Dir-..> | 2025-12-19 16:21 | 8.9K | |
| p5-Log-Dispatch-Emai..> | 2025-12-22 06:28 | 4.7K | |
| p5-Log-Dispatch-File..> | 2025-12-24 05:22 | 7.2K | |
| p5-Log-Dispatch-File..> | 2025-12-21 09:28 | 5.0K | |
| p5-Log-Dispatch-File..> | 2025-12-23 19:42 | 20K | |
| p5-Log-Dispatch-File..> | 2025-12-22 12:36 | 9.2K | |
| p5-Log-Dispatch-File..> | 2025-12-19 22:32 | 4.7K | |
| p5-Log-Dispatch-Perl..> | 2025-12-23 14:12 | 5.4K | |
| p5-Log-Dispatch-Scre..> | 2025-12-23 16:01 | 4.0K | |
| p5-Log-Dispatch-Scri..> | 2025-12-19 17:36 | 14K | |
| p5-Log-Dispatchouli-..> | 2025-12-18 23:16 | 20K | |
| p5-Log-Dump-0.14_1.pkg | 2025-12-19 20:50 | 10K | |
| p5-Log-Handler-0.90.pkg | 2025-12-19 04:32 | 72K | |
| p5-Log-Log4perl-1.57..> | 2025-12-18 11:38 | 321K | |
| p5-Log-Log4perl-Appe..> | 2025-12-22 14:17 | 6.1K | |
| p5-Log-Log4perl-Appe..> | 2025-12-20 05:46 | 3.6K | |
| p5-Log-Log4perl-Layo..> | 2025-12-19 21:41 | 11K | |
| p5-Log-Log4perl-Tiny..> | 2025-12-21 17:04 | 27K | |
| p5-Log-Message-0.08_..> | 2025-12-18 11:56 | 20K | |
| p5-Log-Message-Simpl..> | 2025-12-18 18:49 | 5.4K | |
| p5-Log-Minimal-0.19_..> | 2025-12-19 09:39 | 7.9K | |
| p5-Log-Procmail-0.14..> | 2025-12-20 14:51 | 9.5K | |
| p5-Log-Report-1.43.pkg | 2025-12-26 13:40 | 127K | |
| p5-Log-Report-Lexico..> | 2025-12-26 22:54 | 91K | |
| p5-Log-Report-Option..> | 2025-12-26 10:55 | 19K | |
| p5-Log-Report-Templa..> | 2025-12-27 10:58 | 33K | |
| p5-Log-Simple-1.8_1.pkg | 2025-12-20 08:51 | 4.7K | |
| p5-Log-Syslog-Consta..> | 2025-12-19 22:19 | 4.6K | |
| p5-Log-Syslog-Fast-0..> | 2025-12-22 05:23 | 21K | |
| p5-Log-Trace-1.070_1..> | 2025-12-18 12:55 | 26K | |
| p5-Log-TraceMessages..> | 2025-12-18 12:06 | 5.4K | |
| p5-Log-ger-0.042.pkg | 2025-12-18 11:14 | 38K | |
| p5-Logfile-Rotate-1...> | 2025-12-21 21:17 | 10K | |
| p5-Long-Jump-0.00000..> | 2025-12-19 00:07 | 4.8K | |
| p5-Luka-1.08_2.pkg | 2025-12-22 14:04 | 25K | |
| p5-Lvalue-0.21_3.pkg | 2025-12-22 00:18 | 5.7K | |
| p5-MARC-Charset-1.35..> | 2025-12-19 08:20 | 526K | |
| p5-MARC-Lint-1.46_1.pkg | 2025-12-30 00:22 | 38K | |
| p5-MARC-Record-2.0.7..> | 2025-12-19 16:58 | 75K | |
| p5-MARC-XML-1.0.3_1.pkg | 2025-12-21 20:57 | 13K | |
| p5-MCE-1.902.pkg | 2025-12-19 14:52 | 252K | |
| p5-MCE-Shared-1.893.pkg | 2025-12-23 06:45 | 165K | |
| p5-MD5-2.03_1.pkg | 2025-12-19 13:01 | 2.9K | |
| p5-MIDI-Perl-0.84.pkg | 2025-12-20 07:23 | 91K | |
| p5-MIME-AltWords-0.1..> | 2025-12-23 05:36 | 21K | |
| p5-MIME-Base32-1.303..> | 2025-12-16 01:30 | 5.3K | |
| p5-MIME-Base64-3.16.pkg | 2025-12-16 01:30 | 15K | |
| p5-MIME-Base64-URLSa..> | 2025-12-18 21:38 | 3.8K | |
| p5-MIME-Charset-1.01..> | 2025-12-18 02:56 | 27K | |
| p5-MIME-EcoEncode-0...> | 2025-12-21 23:40 | 17K | |
| p5-MIME-EncWords-1.0..> | 2025-12-19 22:35 | 36K | |
| p5-MIME-Explode-0.39..> | 2025-12-20 02:30 | 20K | |
| p5-MIME-Lite-3.033.pkg | 2025-12-18 19:21 | 67K | |
| p5-MIME-Lite-HTML-1...> | 2025-12-19 20:58 | 17K | |
| p5-MIME-Lite-TT-0.02..> | 2025-12-22 10:46 | 3.7K | |
| p5-MIME-Lite-TT-HTML..> | 2025-12-22 22:29 | 5.0K | |
| p5-MIME-Tools-5.515,..> | 2025-12-18 12:37 | 176K | |
| p5-MIME-Types-2.29.pkg | 2025-12-18 11:57 | 62K | |
| p5-MKDoc-XML-0.75_2.pkg | 2025-12-18 17:00 | 47K | |
| p5-MLDBM-2.05_1.pkg | 2025-12-18 23:36 | 13K | |
| p5-MLDBM-Sync-0.30_1..> | 2025-12-19 09:39 | 13K | |
| p5-MP3-Find-0.07_1.pkg | 2025-12-23 08:45 | 27K | |
| p5-MP3-ID3v1Tag-1.11..> | 2025-12-22 09:20 | 7.9K | |
| p5-MP3-Info-1.26.pkg | 2025-12-19 15:46 | 30K | |
| p5-MP3-Tag-1.16.pkg | 2025-12-19 19:45 | 268K | |
| p5-MP3-Tag-Utils-0.0..> | 2025-12-23 14:01 | 8.7K | |
| p5-MP4-Info-1.13_2.pkg | 2025-12-19 17:37 | 13K | |
| p5-MPEG-ID3v2Tag-0.3..> | 2025-12-21 17:18 | 19K | |
| p5-MR-Tarantool-0.0...> | 2025-12-24 01:21 | 61K | |
| p5-MRO-Compat-0.15.pkg | 2025-12-18 01:19 | 8.0K | |
| p5-MRO-Define-0.02_1..> | 2025-12-19 14:53 | 8.4K | |
| p5-MRTG-Parse-0.03_1..> | 2025-12-21 09:52 | 6.2K | |
| p5-Mac-FileSpec-Unix..> | 2025-12-22 20:42 | 10K | |
| p5-Mac-Macbinary-0.0..> | 2025-12-24 07:02 | 6.1K | |
| p5-Mac-PropertyList-..> | 2025-12-23 06:11 | 23K | |
| p5-Mail-Address-Mobi..> | 2025-12-21 09:45 | 3.8K | |
| p5-Mail-Alias-1.15.pkg | 2025-12-20 11:15 | 8.3K | |
| p5-Mail-Audit-2.228.pkg | 2025-12-19 12:54 | 37K | |
| p5-Mail-Audit-Attach..> | 2025-12-20 10:08 | 8.0K | |
| p5-Mail-Authenticati..> | 2025-12-18 11:46 | 36K | |
| p5-Mail-BIMI-3.20250..> | 2025-12-19 10:57 | 102K | |
| p5-Mail-Box-4.01.pkg | 2025-12-27 06:13 | 320K | |
| p5-Mail-Box-IMAP4-3...> | 2025-12-29 22:57 | 79K | |
| p5-Mail-Box-IMAP4-SS..> | 2025-12-30 06:45 | 5.3K | |
| p5-Mail-Box-POP3-3.0..> | 2025-12-30 01:58 | 42K | |
| p5-Mail-Box-Parser-C..> | 2025-12-28 03:05 | 13K | |
| p5-Mail-Bulkmail-3.1..> | 2025-12-22 11:29 | 105K | |
| p5-Mail-CheckUser-1...> | 2025-12-23 05:08 | 15K | |
| p5-Mail-DKIM-1.20240..> | 2025-12-18 18:10 | 129K | |
| p5-Mail-DMARC-1.2024..> | 2025-12-19 01:10 | 388K | |
| p5-Mail-DataFeed-Abu..> | 2025-12-19 22:30 | 4.7K | |
| p5-Mail-DeliveryStat..> | 2025-12-20 10:32 | 20K | |
| p5-Mail-DomainKeys-1..> | 2025-12-24 06:35 | 9.2K | |
| p5-Mail-Ezmlm-0.08.2..> | 2025-12-24 05:56 | 28K | |
| p5-Mail-Field-Receiv..> | 2025-12-21 09:35 | 10K | |
| p5-Mail-FilterXML-0...> | 2025-12-23 02:33 | 5.4K | |
| p5-Mail-Folder-0.07_..> | 2025-12-23 22:39 | 46K | |
| p5-Mail-Freshmeat-1...> | 2025-12-20 08:48 | 8.4K | |
| p5-Mail-GnuPG-0.23.pkg | 2025-12-21 12:42 | 11K | |
| p5-Mail-Graph-0.14_8..> | 2025-12-30 02:39 | 25K | |
| p5-Mail-IMAPClient-3..> | 2025-12-19 09:23 | 142K | |
| p5-Mail-IMAPTalk-4.0..> | 2025-12-21 09:14 | 65K | |
| p5-Mail-LMLM-0.6807.pkg | 2025-12-20 22:26 | 45K | |
| p5-Mail-ListDetector..> | 2025-12-22 11:03 | 42K | |
| p5-Mail-Mbox-Message..> | 2025-12-19 10:17 | 28K | |
| p5-Mail-MboxParser-0..> | 2025-12-22 10:12 | 42K | |
| p5-Mail-Message-4.01..> | 2025-12-26 18:36 | 407K | |
| p5-Mail-Milter-Authe..> | 2025-12-22 12:51 | 185K | |
| p5-Mail-OpenDKIM-420..> | 2025-12-22 16:38 | 48K | |
| p5-Mail-OpenRelay-Si..> | 2025-12-23 17:03 | 3.9K | |
| p5-Mail-POP3Client-2..> | 2025-12-19 20:52 | 16K | |
| p5-Mail-Procmail-1.0..> | 2025-12-21 13:22 | 15K | |
| p5-Mail-Procmailrc-1..> | 2025-12-20 06:00 | 16K | |
| p5-Mail-RBL-1.10_2.pkg | 2025-12-21 12:51 | 6.0K | |
| p5-Mail-RFC822-Addre..> | 2025-12-18 22:33 | 6.1K | |
| p5-Mail-SPF-3.202505..> | 2025-12-18 17:02 | 108K | |
| p5-Mail-SRS-0.31_2.pkg | 2025-12-19 06:52 | 35K | |
| p5-Mail-SendEasy-1.2..> | 2025-12-19 13:06 | 16K | |
| p5-Mail-Sender-0.903..> | 2025-12-22 05:03 | 36K | |
| p5-Mail-Sendmail-0.8..> | 2025-12-18 09:13 | 18K | |
| p5-Mail-Spool-0.50_1..> | 2025-12-22 17:10 | 23K | |
| p5-Mail-Tools-2.22.pkg | 2025-12-18 03:52 | 71K | |
| p5-Mail-Transport-4...> | 2025-12-27 00:37 | 41K | |
| p5-Mail-Transport-Db..> | 2025-12-23 19:13 | 30K | |
| p5-Mail-Verify-0.02_..> | 2025-12-22 06:24 | 4.0K | |
| p5-Mail-Verp-0.06_1.pkg | 2025-12-21 17:13 | 5.1K | |
| p5-Mail-Webmail-Gmai..> | 2025-12-20 01:41 | 19K | |
| p5-Make-2.011.pkg | 2025-12-23 00:03 | 25K | |
| p5-Makefile-DOM-0.00..> | 2025-12-19 08:04 | 59K | |
| p5-Makefile-Parser-0..> | 2025-12-21 12:46 | 47K | |
| p5-Mango-1.30_4.pkg | 2025-12-22 08:36 | 61K | |
| p5-Markapl-0.14_1.pkg | 2025-12-21 05:03 | 16K | |
| p5-Markdown-Perl-1.1..> | 2025-12-20 15:03 | 55K | |
| p5-Markdown-Render-1..> | 2025-12-24 07:03 | 9.3K | |
| p5-Markup-Perl-0.5_1..> | 2025-12-20 21:24 | 7.9K | |
| p5-Marpa-0.208_1.pkg | 2025-12-22 08:43 | 249K | |
| p5-Marpa-HTML-0.112_..> | 2025-12-22 07:41 | 45K | |
| p5-Marpa-PP-0.014_2.pkg | 2025-12-19 11:18 | 158K | |
| p5-Marpa-XS-1.008000..> | 2025-12-19 19:54 | 206K | |
| p5-Mason-2.24.pkg | 2025-12-21 06:58 | 146K | |
| p5-MasonX-Interp-Wit..> | 2025-12-23 19:24 | 20K | |
| p5-MasonX-Profiler-0..> | 2025-12-23 15:21 | 4.4K | |
| p5-MasonX-Request-Wi..> | 2025-12-23 02:31 | 11K | |
| p5-MasonX-WebApp-0.1..> | 2025-12-21 07:02 | 19K | |
| p5-Math-Algebra-Symb..> | 2025-12-21 04:44 | 38K | |
| p5-Math-Base36-0.14,..> | 2025-12-20 03:15 | 3.4K | |
| p5-Math-Base85-0.5.pkg | 2025-12-20 16:09 | 4.0K | |
| p5-Math-BaseCalc-1.0..> | 2025-12-22 21:29 | 5.8K | |
| p5-Math-BaseCnv-1.14..> | 2025-12-22 11:46 | 15K | |
| p5-Math-Bezier-0.01_..> | 2025-12-21 15:40 | 4.8K | |
| p5-Math-Bezier-Conve..> | 2025-12-19 01:10 | 6.2K | |
| p5-Math-BigInt-2.005..> | 2025-12-18 10:54 | 180K | |
| p5-Math-BigInt-FastC..> | 2025-12-22 05:01 | 11K | |
| p5-Math-BigInt-GMP-1..> | 2025-12-18 11:57 | 15K | |
| p5-Math-BigInt-Lite-..> | 2025-12-22 19:18 | 14K | |
| p5-Math-CDF-0.1_2.pkg | 2025-12-19 05:48 | 51K | |
| p5-Math-Calc-Units-1..> | 2025-12-18 20:37 | 22K | |
| p5-Math-Cephes-0.530..> | 2025-12-20 06:38 | 188K | |
| p5-Math-Combinatoric..> | 2025-12-20 22:38 | 14K | |
| p5-Math-Complex-1.59..> | 2025-12-19 23:38 | 36K | |
| p5-Math-ConvexHull-1..> | 2025-12-22 15:05 | 5.8K | |
| p5-Math-Currency-0.5..> | 2025-12-21 18:51 | 29K | |
| p5-Math-Derivative-1..> | 2025-12-19 01:37 | 4.7K | |
| p5-Math-Evol-1.13.pkg | 2025-12-20 22:18 | 18K | |
| p5-Math-Expr-0.4_1.pkg | 2025-12-21 00:49 | 28K | |
| p5-Math-FFT-1.36.pkg | 2025-12-21 17:20 | 44K | |
| p5-Math-Financial-0...> | 2025-12-22 14:14 | 9.7K | |
| p5-Math-FixedPrecisi..> | 2025-12-20 00:08 | 5.8K | |
| p5-Math-Fleximal-0.0..> | 2025-12-22 00:02 | 9.6K | |
| p5-Math-GMP-2.25.pkg | 2025-12-18 18:41 | 24K | |
| p5-Math-GMPf-0.53.pkg | 2025-12-23 17:52 | 61K | |
| p5-Math-GMPq-0.67.pkg | 2025-12-23 15:42 | 59K | |
| p5-Math-GMPz-0.67.pkg | 2025-12-19 21:06 | 94K | |
| p5-Math-GSL-0.43_1.pkg | 2025-12-20 08:17 | 2.1M | |
| p5-Math-Geometry-0.0..> | 2025-12-21 17:28 | 4.8K | |
| p5-Math-Geometry-Pla..> | 2025-12-19 01:56 | 28K | |
| p5-Math-Geometry-Pla..> | 2025-12-18 18:05 | 27K | |
| p5-Math-Geometry-Pla..> | 2025-12-19 00:17 | 23K | |
| p5-Math-Geometry-Pla..> | 2025-12-18 18:33 | 9.3K | |
| p5-Math-Geometry-Vor..> | 2025-12-20 08:39 | 21K | |
| p5-Math-Gradient-0.0..> | 2025-12-21 18:26 | 5.7K | |
| p5-Math-Int64-0.57.pkg | 2025-12-19 02:20 | 33K | |
| p5-Math-Int128-0.22_..> | 2025-12-20 02:08 | 29K | |
| p5-Math-Interpolate-..> | 2025-12-21 21:05 | 10K | |
| p5-Math-Intersection..> | 2025-12-20 09:07 | 5.4K | |
| p5-Math-Logic-1.19_1..> | 2025-12-21 06:35 | 15K | |
| p5-Math-MPC-1.33.pkg | 2025-12-22 06:29 | 91K | |
| p5-Math-MPFR-4.45.pkg | 2025-12-19 20:30 | 170K | |
| p5-Math-Matrix-0.94.pkg | 2025-12-19 12:07 | 48K | |
| p5-Math-MatrixReal-2..> | 2025-12-18 21:13 | 63K | |
| p5-Math-NumberCrunch..> | 2025-12-20 22:55 | 71K | |
| p5-Math-Polygon-2.00..> | 2025-12-27 17:49 | 35K | |
| p5-Math-Polygon-Tree..> | 2025-12-19 23:08 | 7.8K | |
| p5-Math-Polynomial-S..> | 2025-12-23 17:54 | 27K | |
| p5-Math-Prime-Util-0..> | 2025-12-18 12:45 | 411K | |
| p5-Math-Prime-Util-G..> | 2025-12-18 10:11 | 226K | |
| p5-Math-Prime-XS-0.2..> | 2025-12-21 12:26 | 11K | |
| p5-Math-ProvablePrim..> | 2025-12-18 18:41 | 17K | |
| p5-Math-RPN-1.11_1.pkg | 2025-12-23 10:52 | 11K | |
| p5-Math-Random-0.75.pkg | 2025-12-19 05:03 | 44K | |
| p5-Math-Random-ISAAC..> | 2025-12-18 13:47 | 13K | |
| p5-Math-Random-ISAAC..> | 2025-12-18 10:22 | 8.6K | |
| p5-Math-Random-MT-1...> | 2025-12-23 15:29 | 9.5K | |
| p5-Math-Random-MT-Au..> | 2025-12-20 05:23 | 45K | |
| p5-Math-Random-OO-0...> | 2025-12-20 02:24 | 17K | |
| p5-Math-Random-Secur..> | 2025-12-19 16:58 | 13K | |
| p5-Math-RandomOrg-0...> | 2025-12-23 13:23 | 5.7K | |
| p5-Math-Round-0.08.pkg | 2025-12-18 13:38 | 6.3K | |
| p5-Math-Round-Var-1...> | 2025-12-18 18:33 | 5.8K | |
| p5-Math-Sequence-1.0..> | 2025-12-20 02:38 | 7.1K | |
| p5-Math-Series-1.01_..> | 2025-12-23 01:34 | 8.1K | |
| p5-Math-SigFigs-1.21..> | 2025-12-22 12:28 | 8.1K | |
| p5-Math-SimpleVariab..> | 2025-12-23 11:02 | 5.1K | |
| p5-Math-Spline-0.02_..> | 2025-12-20 02:52 | 4.8K | |
| p5-Math-String-1.30.pkg | 2025-12-18 19:36 | 71K | |
| p5-Math-Symbolic-0.6..> | 2025-12-18 16:56 | 122K | |
| p5-Math-Symbolic-Cus..> | 2025-12-20 00:27 | 7.4K | |
| p5-Math-Symbolic-Cus..> | 2025-12-18 19:10 | 4.0K | |
| p5-Math-Symbolic-Cus..> | 2025-12-20 02:48 | 4.3K | |
| p5-Math-Symbolic-Cus..> | 2025-12-23 06:20 | 8.2K | |
| p5-Math-Symbolic-Cus..> | 2025-12-18 19:11 | 13K | |
| p5-Math-Symbolic-Cus..> | 2025-12-19 14:26 | 5.4K | |
| p5-Math-Symbolic-Cus..> | 2025-12-19 19:51 | 16K | |
| p5-Math-SymbolicX-Bi..> | 2025-12-19 07:56 | 5.4K | |
| p5-Math-SymbolicX-Co..> | 2025-12-19 12:02 | 6.4K | |
| p5-Math-SymbolicX-Er..> | 2025-12-22 16:01 | 5.5K | |
| p5-Math-SymbolicX-In..> | 2025-12-19 11:28 | 10K | |
| p5-Math-SymbolicX-No..> | 2025-12-20 01:58 | 5.2K | |
| p5-Math-SymbolicX-Pa..> | 2025-12-18 19:54 | 7.3K | |
| p5-Math-SymbolicX-St..> | 2025-12-20 00:37 | 10K | |
| p5-Math-TrulyRandom-..> | 2025-12-21 11:40 | 7.2K | |
| p5-Math-Units-1.3_1.pkg | 2025-12-19 23:51 | 11K | |
| p5-Math-Utils-1.14.pkg | 2025-12-19 09:22 | 15K | |
| p5-Math-Vec-1.01_1.pkg | 2025-12-18 17:50 | 14K | |
| p5-Math-VecStat-0.08..> | 2025-12-20 10:13 | 7.0K | |
| p5-Math-VectorReal-1..> | 2025-12-18 07:15 | 15K | |
| p5-MathML-Entities-0..> | 2025-12-22 00:21 | 15K | |
| p5-MaxMind-DB-Common..> | 2025-12-18 21:08 | 9.6K | |
| p5-MaxMind-DB-Reader..> | 2025-12-20 01:50 | 14K | |
| p5-MaxMind-DB-Reader..> | 2025-12-20 05:41 | 13K | |
| p5-Maypole-2.13_6.pkg | 2025-12-22 06:46 | 247K | |
| p5-Maypole-Authentic..> | 2025-12-22 03:45 | 6.5K | |
| p5-Maypole-Component..> | 2025-12-21 02:11 | 3.1K | |
| p5-McBain-2.001000.pkg | 2025-12-19 13:59 | 33K | |
| p5-McBain-WithPSGI-2..> | 2025-12-24 04:21 | 8.5K | |
| p5-Mcrypt-2.5.7.0_4.pkg | 2025-12-22 06:46 | 11K | |
| p5-Mcstas-Tools-2.5_..> | 2025-12-30 16:40 | 150K | |
| p5-Media-Type-Simple..> | 2025-12-21 02:05 | 12K | |
| p5-MediaWiki-1.13_1.pkg | 2025-12-30 10:15 | 21K | |
| p5-MediaWiki-API-0.5..> | 2025-12-22 10:38 | 20K | |
| p5-Memcached-libmemc..> | 2025-12-20 02:10 | 114K | |
| p5-Memoize-1.17.pkg | 2025-12-20 17:05 | 36K | |
| p5-Memoize-ExpireLRU..> | 2025-12-18 05:33 | 7.3K | |
| p5-Meta-Builder-0.00..> | 2025-12-19 01:39 | 14K | |
| p5-MetaCPAN-Client-2..> | 2025-12-18 19:22 | 57K | |
| p5-Metabase-Client-S..> | 2025-12-18 22:34 | 6.4K | |
| p5-Metabase-Fact-0.0..> | 2025-12-18 17:46 | 55K | |
| p5-Metadata-0.24_1.pkg | 2025-12-24 05:36 | 21K | |
| p5-Method-Alias-1.03..> | 2025-12-19 01:27 | 5.0K | |
| p5-Method-Signatures..> | 2025-12-23 16:36 | 39K | |
| p5-Method-Signatures..> | 2025-12-20 02:57 | 7.2K | |
| p5-Metrics-Any-0.10.pkg | 2025-12-18 19:22 | 35K | |
| p5-Minilla-3.0.15_1.pkg | 2025-12-20 07:05 | 63K | |
| p5-Minion-11.0.pkg | 2025-12-21 06:18 | 1.2M | |
| p5-Misc-Quality-0.1_..> | 2025-12-19 03:01 | 2.5K | |
| p5-Mixin-Event-Dispa..> | 2025-12-18 12:00 | 17K | |
| p5-Mixin-Linewise-0...> | 2025-12-18 12:48 | 10K | |
| p5-Mknod-0.02_1.pkg | 2025-12-20 20:05 | 7.3K | |
| p5-Mo-0.40,1.pkg | 2025-12-18 18:05 | 44K | |
| p5-Mobile-UserAgent-..> | 2025-12-23 01:27 | 16K | |
| p5-Mock-MonkeyPatch-..> | 2025-12-20 17:11 | 8.1K | |
| p5-Mock-Quick-1.111.pkg | 2025-12-21 12:09 | 23K | |
| p5-Mock-Sub-1.09.pkg | 2025-12-24 04:40 | 13K | |
| p5-ModPerl-VersionUt..> | 2025-12-19 10:52 | 3.7K | |
| p5-Modern-Perl-1.202..> | 2025-12-19 00:06 | 8.0K | |
| p5-Module-Build-0.42..> | 2025-12-18 01:50 | 170K | |
| p5-Module-Build-Conv..> | 2025-12-21 16:56 | 19K | |
| p5-Module-Build-Kwal..> | 2025-12-24 04:28 | 7.0K | |
| p5-Module-Build-Pars..> | 2025-12-19 03:28 | 3.4K | |
| p5-Module-Build-Plug..> | 2025-12-18 18:55 | 13K | |
| p5-Module-Build-Plug..> | 2025-12-18 18:56 | 3.6K | |
| p5-Module-Build-Plug..> | 2025-12-19 10:43 | 3.4K | |
| p5-Module-Build-Prer..> | 2025-12-18 21:43 | 4.6K | |
| p5-Module-Build-Tiny..> | 2025-12-18 01:46 | 7.8K | |
| p5-Module-Build-Usin..> | 2025-12-18 10:21 | 8.0K | |
| p5-Module-Build-With..> | 2025-12-23 16:05 | 13K | |
| p5-Module-Build-XSUt..> | 2025-12-18 07:48 | 6.8K | |
| p5-Module-CPANTS-Ana..> | 2025-12-19 09:52 | 49K | |
| p5-Module-CPANfile-1..> | 2025-12-18 11:16 | 21K | |
| p5-Module-CheckDeps-..> | 2025-12-24 05:13 | 5.7K | |
| p5-Module-CheckVersi..> | 2025-12-21 13:21 | 101K | |
| p5-Module-Collect-0...> | 2025-12-19 02:02 | 5.7K | |
| p5-Module-Compile-0...> | 2025-12-19 23:32 | 19K | |
| p5-Module-CoreList-5..> | 2025-12-18 18:24 | 79K | |
| p5-Module-Dependency..> | 2025-12-20 17:30 | 42K | |
| p5-Module-Depends-0...> | 2025-12-20 14:54 | 6.6K | |
| p5-Module-Extract-0...> | 2025-12-20 01:11 | 7.0K | |
| p5-Module-Extract-Us..> | 2025-12-19 13:06 | 6.0K | |
| p5-Module-Extract-VE..> | 2025-12-19 21:27 | 4.2K | |
| p5-Module-ExtractUse..> | 2025-12-20 19:19 | 25K | |
| p5-Module-Find-0.17.pkg | 2025-12-18 10:22 | 8.4K | |
| p5-Module-Functions-..> | 2025-12-23 03:42 | 4.0K | |
| p5-Module-Implementa..> | 2025-12-18 00:34 | 6.5K | |
| p5-Module-Info-0.37.pkg | 2025-12-19 06:01 | 22K | |
| p5-Module-Info-File-..> | 2025-12-23 07:25 | 7.1K | |
| p5-Module-Inspector-..> | 2025-12-21 05:27 | 8.9K | |
| p5-Module-Install-1...> | 2025-12-18 13:38 | 123K | |
| p5-Module-Install-Au..> | 2025-12-21 02:25 | 4.0K | |
| p5-Module-Install-Au..> | 2025-12-18 23:42 | 3.9K | |
| p5-Module-Install-Re..> | 2025-12-18 23:34 | 5.7K | |
| p5-Module-Install-Re..> | 2025-12-21 19:41 | 3.7K | |
| p5-Module-Install-Te..> | 2025-12-23 15:22 | 7.0K | |
| p5-Module-Install-Te..> | 2025-12-19 11:03 | 3.3K | |
| p5-Module-Install-XS..> | 2025-12-22 14:00 | 12K | |
| p5-Module-Installed-..> | 2025-12-18 12:30 | 9.0K | |
| p5-Module-List-0.004..> | 2025-12-18 19:06 | 6.7K | |
| p5-Module-Load-0.36.pkg | 2025-12-19 00:06 | 7.4K | |
| p5-Module-Load-Condi..> | 2025-12-23 09:07 | 11K | |
| p5-Module-Load-Util-..> | 2025-12-18 20:08 | 9.2K | |
| p5-Module-Loaded-0.0..> | 2025-12-21 22:28 | 4.0K | |
| p5-Module-Loader-0.0..> | 2025-12-19 12:57 | 6.2K | |
| p5-Module-Manifest-1..> | 2025-12-19 23:35 | 9.2K | |
| p5-Module-Math-Depen..> | 2025-12-19 10:06 | 5.0K | |
| p5-Module-Metadata-1..> | 2025-12-20 03:13 | 17K | |
| p5-Module-Path-0.19.pkg | 2025-12-18 17:21 | 7.9K | |
| p5-Module-Path-More-..> | 2025-12-24 04:21 | 8.9K | |
| p5-Module-Pluggable-..> | 2025-12-18 07:02 | 17K | |
| p5-Module-Pluggable-..> | 2025-12-18 16:58 | 4.1K | |
| p5-Module-Pluggable-..> | 2025-12-19 05:48 | 5.7K | |
| p5-Module-Reader-0.0..> | 2025-12-19 09:21 | 10K | |
| p5-Module-Recursive-..> | 2025-12-19 22:07 | 4.1K | |
| p5-Module-Refresh-0...> | 2025-12-18 13:50 | 5.4K | |
| p5-Module-Release-2...> | 2025-12-23 07:14 | 45K | |
| p5-Module-Reload-1.1..> | 2025-12-23 13:49 | 4.3K | |
| p5-Module-Reload-Sel..> | 2025-12-23 19:04 | 14K | |
| p5-Module-Runtime-0...> | 2025-12-18 00:31 | 13K | |
| p5-Module-Runtime-Co..> | 2025-12-18 01:34 | 3.7K | |
| p5-Module-ScanDeps-1..> | 2025-12-18 09:15 | 27K | |
| p5-Module-Setup-0.09..> | 2025-12-19 12:27 | 91K | |
| p5-Module-Signature-..> | 2025-12-18 18:07 | 17K | |
| p5-Module-Starter-1...> | 2025-12-19 10:57 | 33K | |
| p5-Module-Starter-PB..> | 2025-12-23 20:51 | 11K | |
| p5-Module-Starter-Pl..> | 2025-12-20 23:51 | 8.0K | |
| p5-Module-Starter-Pl..> | 2025-12-23 17:26 | 6.4K | |
| p5-Module-Used-v1.2...> | 2025-12-19 17:44 | 10K | |
| p5-Module-Util-1.09_..> | 2025-12-18 11:16 | 11K | |
| p5-Module-Version-0...> | 2025-12-19 12:57 | 10K | |
| p5-Module-Versions-0..> | 2025-12-20 01:34 | 15K | |
| p5-Module-Versions-R..> | 2025-12-18 20:23 | 5.8K | |
| p5-MogileFS-Client-1..> | 2025-12-19 02:01 | 25K | |
| p5-MogileFS-Network-..> | 2025-12-23 19:27 | 9.9K | |
| p5-MogileFS-Server-2..> | 2025-12-20 02:06 | 155K | |
| p5-MogileFS-Utils-2...> | 2025-12-21 09:47 | 59K | |
| p5-Mojo-DOM58-3.002.pkg | 2025-12-23 06:50 | 44K | |
| p5-Mojo-IOLoop-Delay..> | 2025-12-18 22:29 | 7.2K | |
| p5-Mojo-IOLoop-ForkC..> | 2025-12-20 02:30 | 12K | |
| p5-Mojo-Log-Clearabl..> | 2025-12-19 17:31 | 5.2K | |
| p5-Mojo-Pg-4.28.pkg | 2025-12-21 19:03 | 36K | |
| p5-Mojo-RabbitMQ-Cli..> | 2025-12-23 18:50 | 40K | |
| p5-Mojo-Server-FastC..> | 2025-12-21 05:28 | 7.7K | |
| p5-Mojo-UserAgent-Mo..> | 2025-12-21 10:44 | 20K | |
| p5-Mojo-Weixin-1.4.6..> | 2025-12-22 07:12 | 104K | |
| p5-MojoMojo-1.12_1.pkg | 2025-12-29 22:22 | 897K | |
| p5-MojoX-Log-Dispatc..> | 2025-12-20 10:34 | 8.4K | |
| p5-MojoX-Renderer-Xs..> | 2025-12-22 13:22 | 6.2K | |
| p5-Mojolicious-9.42.pkg | 2025-12-18 17:21 | 912K | |
| p5-Mojolicious-Plugi..> | 2025-12-21 16:19 | 12K | |
| p5-Mojolicious-Plugi..> | 2025-12-23 03:56 | 12K | |
| p5-Mojolicious-Plugi..> | 2025-12-24 04:54 | 5.6K | |
| p5-Mojolicious-Plugi..> | 2025-12-22 07:29 | 5.2K | |
| p5-Mojolicious-Plugi..> | 2025-12-20 17:02 | 11K | |
| p5-Mojolicious-Plugi..> | 2025-12-22 04:05 | 6.8K | |
| p5-Mojolicious-Plugi..> | 2025-12-21 03:24 | 9.2K | |
| p5-Mojolicious-Plugi..> | 2025-12-23 21:16 | 55K | |
| p5-Mojolicious-Plugi..> | 2025-12-24 06:56 | 5.5K | |
| p5-Mojolicious-Plugi..> | 2025-12-22 05:21 | 5.0K | |
| p5-Mojolicious-Plugi..> | 2025-12-20 14:49 | 12K | |
| p5-Mojolicious-Plugi..> | 2025-12-21 18:36 | 3.5K | |
| p5-Mon-0.11_1.pkg | 2025-12-23 20:06 | 21K | |
| p5-MongoDB-2.2.2.pkg | 2025-12-19 05:48 | 282K | |
| p5-Mongoose-2.00.pkg | 2025-12-23 12:23 | 50K | |
| p5-Monitor-Simple-0...> | 2025-12-23 15:22 | 56K | |
| p5-Monitoring-Livest..> | 2025-12-21 12:51 | 22K | |
| p5-Monitoring-Plugin..> | 2025-12-20 18:51 | 48K | |
| p5-Monoceros-0.29.pkg | 2025-12-21 07:12 | 16K | |
| p5-Moo-2.005005.pkg | 2025-12-18 06:27 | 43K | |
| p5-MooX-Aliases-0.00..> | 2025-12-19 02:36 | 4.6K | |
| p5-MooX-Attribute-EN..> | 2025-12-19 22:43 | 4.8K | |
| p5-MooX-Cmd-0.017.pkg | 2025-12-22 14:58 | 19K | |
| p5-MooX-ConfigFromFi..> | 2025-12-18 18:41 | 17K | |
| p5-MooX-File-ConfigD..> | 2025-12-18 14:21 | 6.0K | |
| p5-MooX-HandlesVia-0..> | 2025-12-18 13:21 | 15K | |
| p5-MooX-Locale-Passt..> | 2025-12-18 16:36 | 4.0K | |
| p5-MooX-Options-4.10..> | 2025-12-18 19:31 | 33K | |
| p5-MooX-Role-Paramet..> | 2025-12-21 19:45 | 14K | |
| p5-MooX-Singleton-1...> | 2025-12-19 12:03 | 3.2K | |
| p5-MooX-StrictConstr..> | 2025-12-18 16:03 | 13K | |
| p5-MooX-Thunking-0.0..> | 2025-12-19 15:14 | 3.6K | |
| p5-MooX-Traits-0.005..> | 2025-12-18 21:12 | 8.8K | |
| p5-MooX-TypeTiny-0.0..> | 2025-12-18 12:03 | 4.3K | |
| p5-MooX-Types-MooseL..> | 2025-12-18 07:55 | 13K | |
| p5-MooX-Types-MooseL..> | 2025-12-18 18:35 | 3.4K | |
| p5-MooX-late-0.100.pkg | 2025-12-18 17:19 | 7.1K | |
| p5-Moos-0.30_1.pkg | 2025-12-21 17:06 | 21K | |
| p5-Moose-2.4000,1.pkg | 2025-12-18 01:52 | 684K | |
| p5-Moose-Autobox-0.1..> | 2025-12-19 01:25 | 30K | |
| p5-Moose-Policy-0.05..> | 2025-12-19 17:18 | 12K | |
| p5-Moose-Test-0.01_1..> | 2025-12-22 04:57 | 5.5K | |
| p5-MooseX-Aliases-0...> | 2025-12-18 11:42 | 9.8K | |
| p5-MooseX-App-1.43.pkg | 2025-12-22 13:33 | 80K | |
| p5-MooseX-App-Cmd-0...> | 2025-12-19 11:44 | 7.6K | |
| p5-MooseX-ArrayRef-0..> | 2025-12-18 14:47 | 6.5K | |
| p5-MooseX-Async-0.07..> | 2025-12-23 10:54 | 9.8K | |
| p5-MooseX-Attribute-..> | 2025-12-18 11:57 | 13K | |
| p5-MooseX-Attribute-..> | 2025-12-19 15:17 | 6.1K | |
| p5-MooseX-AttributeH..> | 2025-12-19 04:45 | 67K | |
| p5-MooseX-AttributeS..> | 2025-12-20 08:16 | 30K | |
| p5-MooseX-Authorized..> | 2025-12-21 13:00 | 8.9K | |
| p5-MooseX-ClassAttri..> | 2025-12-18 17:22 | 25K | |
| p5-MooseX-Clone-0.06..> | 2025-12-18 12:00 | 15K | |
| p5-MooseX-CompileTim..> | 2025-12-18 12:08 | 3.6K | |
| p5-MooseX-ConfigFrom..> | 2025-12-18 07:19 | 6.0K | |
| p5-MooseX-CoverableM..> | 2025-12-23 11:36 | 3.5K | |
| p5-MooseX-Daemonize-..> | 2025-12-19 19:51 | 28K | |
| p5-MooseX-Declare-0...> | 2025-12-18 11:20 | 59K | |
| p5-MooseX-Emulate-Cl..> | 2025-12-18 10:58 | 8.0K | |
| p5-MooseX-Extended-0..> | 2025-12-20 08:38 | 66K | |
| p5-MooseX-FollowPBP-..> | 2025-12-19 15:08 | 5.7K | |
| p5-MooseX-Getopt-0.7..> | 2025-12-18 11:01 | 35K | |
| p5-MooseX-Has-Option..> | 2025-12-22 15:51 | 10K | |
| p5-MooseX-Has-Sugar-..> | 2025-12-19 01:57 | 12K | |
| p5-MooseX-HasDefault..> | 2025-12-20 00:07 | 3.9K | |
| p5-MooseX-IOC-0.03_3..> | 2025-12-23 18:12 | 6.4K | |
| p5-MooseX-InsideOut-..> | 2025-12-18 22:12 | 5.4K | |
| p5-MooseX-LazyRequir..> | 2025-12-18 04:46 | 6.0K | |
| p5-MooseX-Lists-0.05..> | 2025-12-22 10:41 | 5.6K | |
| p5-MooseX-Log-Log4pe..> | 2025-12-19 07:36 | 8.8K | |
| p5-MooseX-MarkAsMeth..> | 2025-12-18 18:10 | 8.0K | |
| p5-MooseX-Meta-TypeC..> | 2025-12-18 04:36 | 4.1K | |
| p5-MooseX-Meta-TypeC..> | 2025-12-19 20:42 | 8.7K | |
| p5-MooseX-MetaDescri..> | 2025-12-19 22:31 | 12K | |
| p5-MooseX-Method-Sig..> | 2025-12-18 07:48 | 18K | |
| p5-MooseX-MethodAttr..> | 2025-12-18 09:45 | 27K | |
| p5-MooseX-MultiInitA..> | 2025-12-24 07:31 | 6.3K | |
| p5-MooseX-MultiMetho..> | 2025-12-23 16:54 | 6.0K | |
| p5-MooseX-MungeHas-0..> | 2025-12-20 01:58 | 8.4K | |
| p5-MooseX-NonMoose-0..> | 2025-12-18 15:52 | 15K | |
| p5-MooseX-Object-Plu..> | 2025-12-18 12:29 | 9.0K | |
| p5-MooseX-OneArgNew-..> | 2025-12-18 12:00 | 4.7K | |
| p5-MooseX-POE-0.215_..> | 2025-12-19 01:57 | 24K | |
| p5-MooseX-Params-Val..> | 2025-12-19 02:08 | 12K | |
| p5-MooseX-RelatedCla..> | 2025-12-18 14:28 | 3.7K | |
| p5-MooseX-Role-Logga..> | 2025-12-21 16:25 | 7.2K | |
| p5-MooseX-Role-Match..> | 2025-12-19 22:23 | 6.9K | |
| p5-MooseX-Role-Param..> | 2025-12-18 08:02 | 27K | |
| p5-MooseX-Role-Stric..> | 2025-12-21 01:59 | 7.0K | |
| p5-MooseX-Role-WarnO..> | 2025-12-19 03:25 | 5.7K | |
| p5-MooseX-Runnable-0..> | 2025-12-20 23:44 | 20K | |
| p5-MooseX-SemiAfford..> | 2025-12-20 01:06 | 6.0K | |
| p5-MooseX-SetOnce-0...> | 2025-12-18 20:47 | 4.0K | |
| p5-MooseX-SimpleConf..> | 2025-12-19 16:49 | 5.6K | |
| p5-MooseX-Singleton-..> | 2025-12-18 18:35 | 13K | |
| p5-MooseX-Storage-0...> | 2025-12-18 12:55 | 56K | |
| p5-MooseX-StrictCons..> | 2025-12-18 13:09 | 9.2K | |
| p5-MooseX-Test-Role-..> | 2025-12-23 12:38 | 6.7K | |
| p5-MooseX-TraitFor-M..> | 2025-12-19 02:02 | 5.2K | |
| p5-MooseX-Traits-0.1..> | 2025-12-18 04:17 | 6.6K | |
| p5-MooseX-Traits-Plu..> | 2025-12-18 12:50 | 6.6K | |
| p5-MooseX-Transactio..> | 2025-12-21 03:24 | 6.7K | |
| p5-MooseX-Types-0.51..> | 2025-12-18 02:28 | 38K | |
| p5-MooseX-Types-Comm..> | 2025-12-18 17:39 | 9.4K | |
| p5-MooseX-Types-Date..> | 2025-12-18 18:25 | 5.6K | |
| p5-MooseX-Types-Date..> | 2025-12-20 01:05 | 6.5K | |
| p5-MooseX-Types-Date..> | 2025-12-18 22:28 | 5.1K | |
| p5-MooseX-Types-Date..> | 2025-12-20 01:56 | 3.2K | |
| p5-MooseX-Types-Date..> | 2025-12-22 15:35 | 4.8K | |
| p5-MooseX-Types-ISO8..> | 2025-12-23 16:51 | 8.7K | |
| p5-MooseX-Types-JSON..> | 2025-12-22 12:31 | 3.4K | |
| p5-MooseX-Types-Load..> | 2025-12-18 14:41 | 4.4K | |
| p5-MooseX-Types-Path..> | 2025-12-18 12:33 | 5.1K | |
| p5-MooseX-Types-Path..> | 2025-12-18 06:25 | 5.9K | |
| p5-MooseX-Types-Perl..> | 2025-12-19 01:18 | 5.8K | |
| p5-MooseX-Types-Port..> | 2025-12-20 00:47 | 4.7K | |
| p5-MooseX-Types-Set-..> | 2025-12-19 00:57 | 3.8K | |
| p5-MooseX-Types-Sign..> | 2025-12-18 23:28 | 5.3K | |
| p5-MooseX-Types-Stri..> | 2025-12-18 03:53 | 4.4K | |
| p5-MooseX-Types-Stru..> | 2025-12-18 03:54 | 26K | |
| p5-MooseX-Types-URI-..> | 2025-12-18 20:28 | 5.0K | |
| p5-MooseX-Types-Vari..> | 2025-12-19 12:14 | 9.1K | |
| p5-MooseX-Util-0.006..> | 2025-12-19 20:12 | 8.3K | |
| p5-Mouse-2.5.11,1.pkg | 2025-12-18 11:06 | 127K | |
| p5-MouseX-App-Cmd-0...> | 2025-12-20 08:35 | 7.3K | |
| p5-MouseX-AttributeH..> | 2025-12-22 02:06 | 22K | |
| p5-MouseX-ConfigFrom..> | 2025-12-19 03:19 | 4.6K | |
| p5-MouseX-Foreign-1...> | 2025-12-20 01:53 | 9.1K | |
| p5-MouseX-Getopt-0.3..> | 2025-12-18 18:35 | 25K | |
| p5-MouseX-NativeTrai..> | 2025-12-18 19:11 | 46K | |
| p5-MouseX-StrictCons..> | 2025-12-18 21:52 | 3.0K | |
| p5-MouseX-Traits-0.1..> | 2025-12-18 23:20 | 5.7K | |
| p5-MouseX-Types-0.06..> | 2025-12-18 17:29 | 7.2K | |
| p5-MouseX-Types-Path..> | 2025-12-18 20:21 | 3.5K | |
| p5-Mozilla-CA-202506..> | 2025-12-16 01:30 | 123K | |
| p5-Mozilla-PublicSuf..> | 2025-12-19 23:17 | 42K | |
| p5-Msgcat-1.03_1.pkg | 2025-12-22 16:02 | 8.7K | |
| p5-Multiplex-CMD-0.0..> | 2025-12-21 17:52 | 5.2K | |
| p5-Music-Audioscrobb..> | 2025-12-22 15:14 | 18K | |
| p5-Music-Audioscrobb..> | 2025-12-19 08:21 | 12K | |
| p5-MusicBrainz-DiscI..> | 2025-12-19 23:57 | 12K | |
| p5-Mutex-1.011.pkg | 2025-12-18 15:56 | 13K | |
| p5-MySQL-Diff-0.50_1..> | 2025-12-21 13:22 | 22K | |
| p5-NEXT-0.69.pkg | 2025-12-19 16:12 | 11K | |
| p5-NNTPClient-0.37_1..> | 2025-12-19 20:00 | 19K | |
| p5-NSNMP-0.5_1.pkg | 2025-12-20 07:17 | 22K | |
| p5-Nagios-Object-0.2..> | 2025-12-21 20:15 | 45K | |
| p5-Nagios-Plugin-0.3..> | 2025-12-20 03:08 | 47K | |
| p5-Nagios-Plugin-Bea..> | 2025-12-23 09:03 | 6.0K | |
| p5-Nagios-Plugin-LDA..> | 2025-12-23 05:08 | 6.3K | |
| p5-Nagios-Plugins-Me..> | 2025-12-21 12:09 | 7.5K | |
| p5-Net-3.15,1.pkg | 2025-12-20 19:00 | 99K | |
| p5-Net-ACL-0.07_2.pkg | 2025-12-22 17:26 | 56K | |
| p5-Net-ACME2-0.35.pkg | 2025-12-20 02:39 | 44K | |
| p5-Net-AMQP-0.06_1.pkg | 2025-12-18 20:57 | 72K | |
| p5-Net-AMQP-RabbitMQ..> | 2025-12-19 23:25 | 71K | |
| p5-Net-AOLIM-1.61_2.pkg | 2025-12-21 20:04 | 28K | |
| p5-Net-APNS-0.0202_1..> | 2025-12-23 22:20 | 5.8K | |
| p5-Net-APNs-Extended..> | 2025-12-24 04:35 | 8.3K | |
| p5-Net-ARP-1.0.12.pkg | 2025-12-20 15:54 | 8.5K | |
| p5-Net-Abuse-Utils-0..> | 2025-12-23 18:49 | 14K | |
| p5-Net-Abuse-Utils-S..> | 2025-12-22 07:29 | 4.9K | |
| p5-Net-Address-Ether..> | 2025-12-20 10:58 | 8.4K | |
| p5-Net-Address-IPv4-..> | 2025-12-20 00:42 | 3.8K | |
| p5-Net-Akismet-0.05_..> | 2025-12-24 01:51 | 6.4K | |
| p5-Net-Amazon-0.62_1..> | 2025-12-23 06:55 | 415K | |
| p5-Net-Amazon-AWIS-0..> | 2025-12-21 07:47 | 10K | |
| p5-Net-Amazon-AWSSig..> | 2025-12-20 17:04 | 6.0K | |
| p5-Net-Amazon-EC2-0...> | 2025-12-23 14:31 | 109K | |
| p5-Net-Amazon-Mechan..> | 2025-12-21 08:26 | 64K | |
| p5-Net-Amazon-Route5..> | 2025-12-22 20:54 | 24K | |
| p5-Net-Amazon-S3-0.9..> | 2025-12-19 10:06 | 257K | |
| p5-Net-Amazon-Signat..> | 2025-12-22 20:29 | 4.6K | |
| p5-Net-Amazon-Signat..> | 2025-12-22 19:30 | 4.5K | |
| p5-Net-Amazon-Signat..> | 2025-12-19 19:17 | 6.3K | |
| p5-Net-Amazon-Thumbn..> | 2025-12-20 21:10 | 7.8K | |
| p5-Net-Analysis-0.41..> | 2025-12-24 04:33 | 57K | |
| p5-Net-Appliance-Phr..> | 2025-12-21 21:22 | 9.0K | |
| p5-Net-Appliance-Ses..> | 2025-12-22 06:59 | 22K | |
| p5-Net-Async-Cassand..> | 2025-12-22 14:59 | 23K | |
| p5-Net-Async-FastCGI..> | 2025-12-19 19:49 | 22K | |
| p5-Net-Async-HTTP-0...> | 2025-12-23 19:10 | 26K | |
| p5-Net-Async-XMPP-0...> | 2025-12-20 23:29 | 12K | |
| p5-Net-BGP-0.18.pkg | 2025-12-20 16:58 | 61K | |
| p5-Net-Blogger-1.03.pkg | 2025-12-20 18:21 | 45K | |
| p5-Net-Bonjour-0.96_..> | 2025-12-18 21:21 | 14K | |
| p5-Net-CIDR-0.27.pkg | 2025-12-18 19:32 | 12K | |
| p5-Net-CIDR-Lite-0.2..> | 2025-12-18 14:56 | 9.1K | |
| p5-Net-CIDR-MobileJP..> | 2025-12-20 04:20 | 6.0K | |
| p5-Net-CIDR-Set-0.13..> | 2025-12-23 20:03 | 17K | |
| p5-Net-CLI-Interact-..> | 2025-12-19 17:16 | 91K | |
| p5-Net-CSTA-0.04_1.pkg | 2025-12-20 21:59 | 11K | |
| p5-Net-CUPS-0.64.pkg | 2025-12-29 07:08 | 42K | |
| p5-Net-CascadeCopy-0..> | 2025-12-23 02:34 | 13K | |
| p5-Net-Cassandra-0.3..> | 2025-12-23 16:26 | 19K | |
| p5-Net-Cassandra-Eas..> | 2025-12-22 15:05 | 34K | |
| p5-Net-Connection-0...> | 2025-12-18 20:38 | 8.3K | |
| p5-Net-Connection-Ma..> | 2025-12-20 00:37 | 52K | |
| p5-Net-Connection-So..> | 2025-12-20 03:04 | 35K | |
| p5-Net-Connection-ls..> | 2025-12-20 04:04 | 5.5K | |
| p5-Net-Connection-nc..> | 2025-12-24 01:08 | 11K | |
| p5-Net-Curl-0.57_1.pkg | 2025-12-24 07:21 | 85K | |
| p5-Net-DAAP-Client-0..> | 2025-12-20 00:13 | 11K | |
| p5-Net-DAAP-DMAP-1.2..> | 2025-12-18 20:46 | 9.3K | |
| p5-Net-DAV-Server-1...> | 2025-12-22 12:21 | 21K | |
| p5-Net-DBus-1.2.0_2.pkg | 2025-12-27 02:03 | 157K | |
| p5-Net-DHCP-0.700.pkg | 2025-12-22 15:00 | 38K | |
| p5-Net-DHCP-Watch-2...> | 2025-12-19 19:18 | 7.1K | |
| p5-Net-DHCPClient-1...> | 2025-12-23 12:42 | 8.6K | |
| p5-Net-DLookup-1.01_..> | 2025-12-21 11:56 | 13K | |
| p5-Net-DNS-1.53,1.pkg | 2025-12-18 03:50 | 314K | |
| p5-Net-DNS-Async-1.0..> | 2025-12-21 03:26 | 5.9K | |
| p5-Net-DNS-Check-0.4..> | 2025-12-23 12:57 | 54K | |
| p5-Net-DNS-Codes-0.1..> | 2025-12-18 17:19 | 9.2K | |
| p5-Net-DNS-Lite-0.12..> | 2025-12-21 16:25 | 8.6K | |
| p5-Net-DNS-Match-0.0..> | 2025-12-21 15:40 | 4.2K | |
| p5-Net-DNS-Paranoid-..> | 2025-12-18 17:56 | 5.9K | |
| p5-Net-DNS-RR-SRV-He..> | 2025-12-19 16:02 | 4.8K | |
| p5-Net-DNS-Resolver-..> | 2025-12-19 22:07 | 4.3K | |
| p5-Net-DNS-Resolver-..> | 2025-12-19 15:13 | 8.9K | |
| p5-Net-DNS-SEC-1.26.pkg | 2025-12-19 07:22 | 35K | |
| p5-Net-DNS-TestNS-1...> | 2025-12-21 07:44 | 16K | |
| p5-Net-DNS-ToolKit-0..> | 2025-12-18 19:30 | 148K | |
| p5-Net-DNS-Zone-Pars..> | 2025-12-22 04:57 | 18K | |
| p5-Net-DNS-ZoneFile-..> | 2025-12-21 05:25 | 3.4K | |
| p5-Net-DNSBL-MultiDa..> | 2025-12-19 19:21 | 33K | |
| p5-Net-DNSBL-Statist..> | 2025-12-21 21:43 | 10K | |
| p5-Net-DRI-0.96_2.pkg | 2025-12-23 06:16 | 565K | |
| p5-Net-Daemon-0.48_1..> | 2025-12-18 21:31 | 30K | |
| p5-Net-Daemon-SSL-1...> | 2025-12-23 19:27 | 4.8K | |
| p5-Net-Delicious-1.1..> | 2025-12-22 07:17 | 38K | |
| p5-Net-Dict-2.22.pkg | 2025-12-24 00:53 | 14K | |
| p5-Net-DirectConnect..> | 2025-12-19 20:00 | 118K | |
| p5-Net-Divert-0.01_2..> | 2025-12-22 02:53 | 7.3K | |
| p5-Net-Domain-Expire..> | 2025-12-22 08:40 | 8.6K | |
| p5-Net-Domain-TLD-1...> | 2025-12-18 03:48 | 27K | |
| p5-Net-Dropbox-API-1..> | 2025-12-23 05:08 | 7.9K | |
| p5-Net-EPP-0.28.pkg | 2025-12-20 03:13 | 100K | |
| p5-Net-EPP-Proxy-0.0..> | 2025-12-24 03:55 | 8.9K | |
| p5-Net-FS-Flickr-0.1..> | 2025-12-29 18:25 | 36K | |
| p5-Net-FS-Gmail-0.2_..> | 2025-12-20 17:05 | 6.9K | |
| p5-Net-FTP-AutoRecon..> | 2025-12-20 02:24 | 6.7K | |
| p5-Net-FTP-Common-7...> | 2025-12-21 00:51 | 17K | |
| p5-Net-FTP-File-0.06..> | 2025-12-19 11:49 | 10K | |
| p5-Net-FTP-Recursive..> | 2025-12-21 20:06 | 17K | |
| p5-Net-FTPSSL-0.42.pkg | 2025-12-20 07:20 | 67K | |
| p5-Net-FTPServer-1.1..> | 2025-12-21 07:27 | 135K | |
| p5-Net-FastCGI-0.14_..> | 2025-12-19 02:08 | 25K | |
| p5-Net-Finger-1.06_1..> | 2025-12-23 05:33 | 5.2K | |
| p5-Net-FireEagle-1.6..> | 2025-12-21 04:12 | 11K | |
| p5-Net-Flickr-API-1...> | 2025-12-18 22:27 | 7.8K | |
| p5-Net-Flickr-Backup..> | 2025-12-23 19:58 | 21K | |
| p5-Net-Flickr-RDF-2...> | 2025-12-19 15:37 | 22K | |
| p5-Net-Flow-1.003.pkg | 2025-12-24 07:04 | 24K | |
| p5-Net-Frame-1.21.pkg | 2025-12-19 01:55 | 39K | |
| p5-Net-Frame-Device-..> | 2025-12-21 03:19 | 8.5K | |
| p5-Net-Frame-Dump-1...> | 2025-12-19 05:50 | 21K | |
| p5-Net-Frame-Layer-I..> | 2025-12-19 14:41 | 29K | |
| p5-Net-Frame-Layer-I..> | 2025-12-19 20:27 | 20K | |
| p5-Net-Frame-Simple-..> | 2025-12-19 11:59 | 8.8K | |
| p5-Net-FreeDB-0.10_1..> | 2025-12-22 14:24 | 15K | |
| p5-Net-FreshBooks-AP..> | 2025-12-22 16:01 | 59K | |
| p5-Net-GPSD3-0.19.pkg | 2025-12-21 11:27 | 40K | |
| p5-Net-GeoPlanet-0.2..> | 2025-12-21 11:48 | 6.3K | |
| p5-Net-GitHub-1.05.pkg | 2025-12-19 12:26 | 58K | |
| p5-Net-Gnats-0.22.pkg | 2025-12-23 08:26 | 90K | |
| p5-Net-Google-1.0.1_..> | 2025-12-19 05:37 | 27K | |
| p5-Net-Google-Analyt..> | 2025-12-23 16:06 | 20K | |
| p5-Net-Google-AuthSu..> | 2025-12-19 02:01 | 10K | |
| p5-Net-Google-Calend..> | 2025-12-23 18:23 | 32K | |
| p5-Net-Google-Code-0..> | 2025-12-19 13:07 | 45K | |
| p5-Net-Google-DataAP..> | 2025-12-19 16:03 | 21K | |
| p5-Net-Google-Picasa..> | 2025-12-28 20:10 | 40K | |
| p5-Net-Google-SafeBr..> | 2025-12-21 07:12 | 40K | |
| p5-Net-Google-Spread..> | 2025-12-21 11:17 | 22K | |
| p5-Net-Groonga-HTTP-..> | 2025-12-20 16:33 | 8.2K | |
| p5-Net-Growl-0.99_1.pkg | 2025-12-21 12:51 | 5.7K | |
| p5-Net-GrowlClient-0..> | 2025-12-22 13:15 | 8.3K | |
| p5-Net-HL7-0.76.pkg | 2025-12-22 04:15 | 32K | |
| p5-Net-HTTP-6.24.pkg | 2025-12-18 02:26 | 20K | |
| p5-Net-HTTP-Spore-0...> | 2025-12-19 14:59 | 62K | |
| p5-Net-HTTP-Spore-Mi..> | 2025-12-23 04:52 | 3.3K | |
| p5-Net-HTTPS-Any-0.1..> | 2025-12-18 22:46 | 5.7K | |
| p5-Net-HTTPS-NB-0.15..> | 2025-12-18 21:27 | 6.2K | |
| p5-Net-Hiveminder-0...> | 2025-12-22 11:20 | 11K | |
| p5-Net-IDN-Encode-2...> | 2025-12-18 18:48 | 80K | |
| p5-Net-IDN-Nameprep-..> | 2025-12-21 18:26 | 4.1K | |
| p5-Net-ILO-0.54_1.pkg | 2025-12-23 05:28 | 22K | |
| p5-Net-IMAP-Client-0..> | 2025-12-21 01:15 | 41K | |
| p5-Net-IMAP-Server-1..> | 2025-12-21 05:14 | 53K | |
| p5-Net-IMAP-Simple-1..> | 2025-12-18 17:19 | 38K | |
| p5-Net-IMAP-Simple-S..> | 2025-12-19 16:51 | 2.9K | |
| p5-Net-INET6Glue-0.6..> | 2025-12-21 19:40 | 8.3K | |
| p5-Net-IP-1.26_1.pkg | 2025-12-18 18:56 | 24K | |
| p5-Net-IP-Match-Rege..> | 2025-12-20 04:03 | 12K | |
| p5-Net-IP-Match-XS-0..> | 2025-12-19 19:50 | 8.1K | |
| p5-Net-IP-Minimal-0...> | 2025-12-18 12:09 | 4.2K | |
| p5-Net-IP-RangeCompa..> | 2025-12-23 20:56 | 11K | |
| p5-Net-IP-Resolver-0..> | 2025-12-23 16:50 | 4.7K | |
| p5-Net-IP-XS-0.22.pkg | 2025-12-18 18:43 | 48K | |
| p5-Net-IPAddress-1.1..> | 2025-12-20 04:19 | 5.3K | |
| p5-Net-IPTrie-0.7_2.pkg | 2025-12-22 00:49 | 10K | |
| p5-Net-IPv4Addr-0.10..> | 2025-12-22 17:11 | 9.0K | |
| p5-Net-IPv6Addr-1.02..> | 2025-12-18 16:57 | 17K | |
| p5-Net-IRR-0.10.pkg | 2025-12-21 11:22 | 8.1K | |
| p5-Net-Ident-1.23_1.pkg | 2025-12-19 17:24 | 19K | |
| p5-Net-Ifconfig-Wrap..> | 2025-12-19 15:30 | 12K | |
| p5-Net-Interface-1.0..> | 2025-12-22 08:56 | 59K | |
| p5-Net-Jabber-2.0_1.pkg | 2025-12-19 04:57 | 84K | |
| p5-Net-Jifty-0.14_1.pkg | 2025-12-19 17:18 | 14K | |
| p5-Net-LDAP-AutoDNs-..> | 2025-12-20 07:37 | 5.8K | |
| p5-Net-LDAP-AutoServ..> | 2025-12-23 19:49 | 6.9K | |
| p5-Net-LDAP-Express-..> | 2025-12-23 09:06 | 11K | |
| p5-Net-LDAP-FilterBu..> | 2025-12-21 02:09 | 5.9K | |
| p5-Net-LDAP-LDAPhash..> | 2025-12-20 04:57 | 3.9K | |
| p5-Net-LDAP-Makepath..> | 2025-12-21 14:34 | 4.6K | |
| p5-Net-LDAP-Server-0..> | 2025-12-19 19:17 | 7.0K | |
| p5-Net-LDAP-Server-T..> | 2025-12-21 01:50 | 12K | |
| p5-Net-LDAP-posixAcc..> | 2025-12-18 19:10 | 6.0K | |
| p5-Net-LDAP-posixGro..> | 2025-12-18 21:39 | 4.8K | |
| p5-Net-LMTP-0.02.pkg | 2025-12-22 12:23 | 9.4K | |
| p5-Net-LibIDN-0.12_6..> | 2025-12-18 17:13 | 14K | |
| p5-Net-LibIDN2-1.02.pkg | 2025-12-21 07:02 | 13K | |
| p5-Net-LibLO-0.06_3.pkg | 2025-12-20 23:26 | 25K | |
| p5-Net-Libdnet-0.990..> | 2025-12-18 17:55 | 38K | |
| p5-Net-Libdnet6-0.28..> | 2025-12-19 19:49 | 5.1K | |
| p5-Net-LimeLight-Pur..> | 2025-12-23 06:41 | 9.2K | |
| p5-Net-MAC-2.103622_..> | 2025-12-21 03:49 | 14K | |
| p5-Net-MAC-Vendor-1...> | 2025-12-23 00:31 | 8.2K | |
| p5-Net-MQTT-1.143260..> | 2025-12-19 22:58 | 44K | |
| p5-Net-ManageSieve-0..> | 2025-12-21 06:37 | 16K | |
| p5-Net-Mosso-CloudFi..> | 2025-12-23 16:05 | 15K | |
| p5-Net-MovableType-1..> | 2025-12-20 20:42 | 18K | |
| p5-Net-NBName-0.26_1..> | 2025-12-20 07:47 | 17K | |
| p5-Net-NBsocket-0.24..> | 2025-12-19 00:05 | 12K | |
| p5-Net-NIS-0.44_1.pkg | 2025-12-19 20:48 | 24K | |
| p5-Net-NIS-Listgroup..> | 2025-12-22 23:34 | 11K | |
| p5-Net-NSCA-Client-0..> | 2025-12-24 01:44 | 38K | |
| p5-Net-NTP-1.5.pkg | 2025-12-23 12:58 | 8.1K | |
| p5-Net-Nessus-XMLRPC..> | 2025-12-20 12:06 | 10K | |
| p5-Net-NetSend-0.12_..> | 2025-12-21 01:17 | 12K | |
| p5-Net-Netcat-0.05.pkg | 2025-12-23 18:03 | 6.1K | |
| p5-Net-Netmask-2.000..> | 2025-12-18 17:26 | 19K | |
| p5-Net-Nmsg-0.17_5.pkg | 2025-12-20 07:27 | 67K | |
| p5-Net-Nslookup-2.04..> | 2025-12-22 13:34 | 6.3K | |
| p5-Net-OAuth-0.31.pkg | 2025-12-18 10:10 | 42K | |
| p5-Net-OAuth-Simple-..> | 2025-12-20 01:52 | 13K | |
| p5-Net-OAuth2-0.67.pkg | 2025-12-18 19:21 | 32K | |
| p5-Net-OSCAR-1.928_1..> | 2025-12-20 17:50 | 117K | |
| p5-Net-OpenID-Common..> | 2025-12-18 21:38 | 30K | |
| p5-Net-OpenID-Consum..> | 2025-12-19 08:53 | 48K | |
| p5-Net-OpenID-JanRai..> | 2025-12-20 12:02 | 44K | |
| p5-Net-OpenID-Server..> | 2025-12-20 11:11 | 17K | |
| p5-Net-OpenSSH-0.84.pkg | 2025-12-19 16:03 | 90K | |
| p5-Net-OpenSSH-Paral..> | 2025-12-23 06:47 | 24K | |
| p5-Net-OpenStack-Att..> | 2025-12-21 06:07 | 6.4K | |
| p5-Net-OpenVPN-Manag..> | 2025-12-20 17:45 | 13K | |
| p5-Net-POP3-SSLWrapp..> | 2025-12-23 15:58 | 3.0K | |
| p5-Net-Packet-3.27_1..> | 2025-12-18 23:00 | 134K | |
| p5-Net-Packet-Target..> | 2025-12-19 19:52 | 5.1K | |
| p5-Net-ParseWhois-0...> | 2025-12-23 04:51 | 23K | |
| p5-Net-Patricia-1.24..> | 2025-12-19 13:13 | 23K | |
| p5-Net-Pcap-0.21.pkg | 2025-12-18 12:33 | 44K | |
| p5-Net-PcapUtils-0.0..> | 2025-12-19 22:20 | 6.9K | |
| p5-Net-Ping-2.76.pkg | 2025-12-23 17:47 | 31K | |
| p5-Net-Ping-External..> | 2025-12-24 04:24 | 9.1K | |
| p5-Net-Plurk-0.11_1.pkg | 2025-12-20 14:54 | 13K | |
| p5-Net-Printer-1.12_..> | 2025-12-20 10:06 | 9.9K | |
| p5-Net-Proxy-0.13_1.pkg | 2025-12-21 15:37 | 53K | |
| p5-Net-PubSubHubbub-..> | 2025-12-21 12:21 | 4.3K | |
| p5-Net-QMTP-0.06_1.pkg | 2025-12-21 08:45 | 11K | |
| p5-Net-RBLClient-0.5..> | 2025-12-20 14:43 | 12K | |
| p5-Net-RNDC-0.003.pkg | 2025-12-20 21:04 | 16K | |
| p5-Net-RTP-0.09_2.pkg | 2025-12-22 17:44 | 23K | |
| p5-Net-RabbitFoot-1...> | 2025-12-23 16:17 | 29K | |
| p5-Net-RabbitMQ-0.2...> | 2025-12-20 23:41 | 44K | |
| p5-Net-Radius-2.103_..> | 2025-12-19 09:04 | 20K | |
| p5-Net-Radius-Server..> | 2025-12-21 21:45 | 87K | |
| p5-Net-Random-2.32.pkg | 2025-12-20 22:43 | 9.7K | |
| p5-Net-RawIP-0.25_1,..> | 2025-12-19 11:45 | 43K | |
| p5-Net-Rendezvous-Pu..> | 2025-12-21 07:48 | 6.1K | |
| p5-Net-Riak-0.1702.pkg | 2025-12-22 10:38 | 53K | |
| p5-Net-Rsh-0.05_1.pkg | 2025-12-23 07:38 | 2.8K | |
| p5-Net-SAML2-0.82.pkg | 2025-12-21 09:22 | 65K | |
| p5-Net-SAP-0.10_4.pkg | 2025-12-22 10:44 | 15K | |
| p5-Net-SCP-0.08_2.pkg | 2025-12-21 16:06 | 9.3K | |
| p5-Net-SCP-Expect-0...> | 2025-12-23 13:20 | 12K | |
| p5-Net-SDP-0.07_2.pkg | 2025-12-19 17:33 | 27K | |
| p5-Net-SFTP-Foreign-..> | 2025-12-20 02:50 | 90K | |
| p5-Net-SIP-0.839.pkg | 2025-12-24 04:20 | 211K | |
| p5-Net-SMPP-1.19_2.pkg | 2025-12-22 18:48 | 45K | |
| p5-Net-SMS-Clickatel..> | 2025-12-22 12:30 | 6.0K | |
| p5-Net-SMS-Mollie-0...> | 2025-12-23 18:04 | 7.1K | |
| p5-Net-SMS-PChome-0...> | 2025-12-22 19:18 | 7.4K | |
| p5-Net-SMTP-Server-1..> | 2025-12-22 20:15 | 13K | |
| p5-Net-SMTP-TLS-0.12..> | 2025-12-19 02:03 | 7.6K | |
| p5-Net-SMTP-TLS-ButM..> | 2025-12-20 01:57 | 8.5K | |
| p5-Net-SMTPS-0.03_2.pkg | 2025-12-18 18:41 | 5.2K | |
| p5-Net-SMTP_auth-0.0..> | 2025-12-21 02:03 | 5.9K | |
| p5-Net-SNMP-6.0.1_1.pkg | 2025-12-18 20:23 | 77K | |
| p5-Net-SNMP-Util-1.0..> | 2025-12-23 08:53 | 36K | |
| p5-Net-SNMPTrapd-0.1..> | 2025-12-20 15:53 | 18K | |
| p5-Net-SNPP-1.17_2.pkg | 2025-12-20 10:43 | 21K | |
| p5-Net-SSH-0.09_1.pkg | 2025-12-19 20:45 | 7.7K | |
| p5-Net-SSH-Authorize..> | 2025-12-21 22:37 | 20K | |
| p5-Net-SSH-Expect-1...> | 2025-12-21 12:28 | 22K | |
| p5-Net-SSH-Mechanize..> | 2025-12-22 14:58 | 25K | |
| p5-Net-SSH2-0.74.pkg | 2025-12-19 02:05 | 91K | |
| p5-Net-SSL-ExpireDat..> | 2025-12-21 05:20 | 8.2K | |
| p5-Net-SSLGlue-1.058..> | 2025-12-20 00:42 | 24K | |
| p5-Net-SSLeay-1.94.pkg | 2025-12-16 01:30 | 279K | |
| p5-Net-STF-Client-1...> | 2025-12-21 04:48 | 9.3K | |
| p5-Net-STOMP-Client-..> | 2025-12-22 20:58 | 57K | |
| p5-Net-SenderBase-1...> | 2025-12-19 21:55 | 10K | |
| p5-Net-Server-2.014.pkg | 2025-12-18 18:48 | 156K | |
| p5-Net-Server-Coro-1..> | 2025-12-19 15:37 | 8.9K | |
| p5-Net-Server-Mail-0..> | 2025-12-19 08:32 | 32K | |
| p5-Net-Server-Mail-E..> | 2025-12-22 16:29 | 4.7K | |
| p5-Net-Server-SS-Pre..> | 2025-12-24 03:55 | 3.6K | |
| p5-Net-SinFP-2.10.pkg | 2025-12-20 19:29 | 30K | |
| p5-Net-Snort-Parser-..> | 2025-12-20 05:00 | 20K | |
| p5-Net-Stomp-0.62.pkg | 2025-12-23 11:36 | 23K | |
| p5-Net-Subnet-1.03_1..> | 2025-12-21 00:59 | 6.4K | |
| p5-Net-Syslog-0.04_1..> | 2025-12-21 11:30 | 4.4K | |
| p5-Net-TCLink-3.4_2.pkg | 2025-12-20 00:09 | 14K | |
| p5-Net-TacacsPlus-1...> | 2025-12-24 04:28 | 32K | |
| p5-Net-TcpDumpLog-0...> | 2025-12-23 16:57 | 7.3K | |
| p5-Net-Telnet-3.05.pkg | 2025-12-18 19:49 | 51K | |
| p5-Net-Telnet-Cisco-..> | 2025-12-19 09:39 | 19K | |
| p5-Net-Telnet-Cisco-..> | 2025-12-21 04:29 | 7.1K | |
| p5-Net-Telnet-Netscr..> | 2025-12-20 15:53 | 9.8K | |
| p5-Net-TiVo-0.11_1.pkg | 2025-12-21 02:51 | 12K | |
| p5-Net-Todoist-0.06_..> | 2025-12-24 02:17 | 6.5K | |
| p5-Net-Trac-0.16_1.pkg | 2025-12-19 20:07 | 27K | |
| p5-Net-Traceroute-1...> | 2025-12-19 14:02 | 17K | |
| p5-Net-Traceroute-Pu..> | 2025-12-21 07:53 | 19K | |
| p5-Net-Traceroute6-0..> | 2025-12-23 13:37 | 14K | |
| p5-Net-Trackback-1.0..> | 2025-12-22 07:25 | 22K | |
| p5-Net-Twitter-4.010..> | 2025-12-18 20:36 | 119K | |
| p5-Net-Twitter-Lite-..> | 2025-12-22 18:51 | 72K | |
| p5-Net-UPS-0.16_1.pkg | 2025-12-22 16:12 | 40K | |
| p5-Net-UPnP-1.4.6.pkg | 2025-12-18 23:49 | 38K | |
| p5-Net-VNC-0.40_3.pkg | 2025-12-29 23:04 | 17K | |
| p5-Net-Wake-0.02_1.pkg | 2025-12-21 04:39 | 3.7K | |
| p5-Net-WhitePages-1...> | 2025-12-20 00:19 | 5.1K | |
| p5-Net-Whois-1.9_1.pkg | 2025-12-20 00:26 | 8.2K | |
| p5-Net-Whois-ARIN-0...> | 2025-12-23 11:07 | 18K | |
| p5-Net-Whois-IP-1.19..> | 2025-12-20 01:30 | 6.8K | |
| p5-Net-Whois-RIPE-2...> | 2025-12-21 17:46 | 183K | |
| p5-Net-Whois-Raw-2.9..> | 2025-12-19 10:10 | 48K | |
| p5-Net-Works-0.22.pkg | 2025-12-23 03:56 | 20K | |
| p5-Net-Write-1.10.pkg | 2025-12-18 15:22 | 14K | |
| p5-Net-XMPP-1.05_1.pkg | 2025-12-19 02:57 | 89K | |
| p5-Net-XMPP2-0.14_2.pkg | 2025-12-20 17:05 | 182K | |
| p5-Net-XWhois-0.90_5..> | 2025-12-19 14:36 | 17K | |
| p5-Net-YAP-0.6_1.pkg | 2025-12-23 12:57 | 3.4K | |
| p5-Net-YASA-0.03_1.pkg | 2025-12-21 05:42 | 8.3K | |
| p5-Net-Yadis-1.0_2.pkg | 2025-12-20 01:06 | 7.8K | |
| p5-Net-Z3950-SimpleS..> | 2025-12-22 09:19 | 51K | |
| p5-Net-Z3950-ZOOM-1...> | 2025-12-20 14:49 | 69K | |
| p5-Net-eBay-0.66.pkg | 2025-12-21 03:29 | 27K | |
| p5-Net-ext-1.011_2.pkg | 2025-12-21 05:11 | 113K | |
| p5-Net-sFlow-0.11_1.pkg | 2025-12-22 15:48 | 19K | |
| p5-Net-uFTP-0.161_1.pkg | 2025-12-24 02:00 | 12K | |
| p5-Net-vCard-0.5_1.pkg | 2025-12-22 01:21 | 14K | |
| p5-NetAddr-IP-4.079.pkg | 2025-12-18 11:43 | 77K | |
| p5-NetAddr-IP-Count-..> | 2025-12-20 22:19 | 5.5K | |
| p5-NetAddr-IP-Find-0..> | 2025-12-22 13:39 | 4.1K | |
| p5-NetAddr-IP-Lite-1..> | 2025-12-21 09:14 | 32K | |
| p5-NetAddr-MAC-0.98.pkg | 2025-12-20 20:03 | 16K | |
| p5-NetApp-500.002_1.pkg | 2025-12-20 15:22 | 57K | |
| p5-NetCDF-1.2.4_9.pkg | 2025-12-28 13:18 | 20K | |
| p5-NetPacket-1.7.2.pkg | 2025-12-19 19:52 | 52K | |
| p5-News-Article-1.27..> | 2025-12-19 10:53 | 29K | |
| p5-News-Article-NoCe..> | 2025-12-21 07:39 | 5.7K | |
| p5-News-Newsrc-1.11_..> | 2025-12-20 03:13 | 14K | |
| p5-Newsletter-0.033.pkg | 2025-12-21 16:02 | 27K | |
| p5-Nexmo-SMS-0.06_2.pkg | 2025-12-19 15:08 | 21K | |
| p5-Nginx-ReadBody-0...> | 2025-12-21 16:15 | 13K | |
| p5-Nginx-Simple-0.07..> | 2025-12-20 18:57 | 22K | |
| p5-Nmap-Parser-1.37.pkg | 2025-12-27 13:22 | 24K | |
| p5-Nmap-Scanner-1.0_..> | 2025-12-23 00:31 | 59K | |
| p5-No-Worries-1.7.pkg | 2025-12-19 13:10 | 65K | |
| p5-Nodejs-Util-0.012..> | 2025-12-26 22:30 | 7.4K | |
| p5-Number-Bytes-Huma..> | 2025-12-19 10:16 | 12K | |
| p5-Number-Compare-0...> | 2025-12-18 06:01 | 3.8K | |
| p5-Number-Format-1.7..> | 2025-12-18 13:36 | 21K | |
| p5-Number-Format-Met..> | 2025-12-19 01:34 | 4.5K | |
| p5-Number-Fraction-3..> | 2025-12-22 15:50 | 13K | |
| p5-Number-Misc-1.2.pkg | 2025-12-21 14:07 | 7.0K | |
| p5-Number-Nary-1.100..> | 2025-12-22 17:39 | 7.9K | |
| p5-Number-RecordLoca..> | 2025-12-19 06:14 | 4.9K | |
| p5-Number-Spell-0.04..> | 2025-12-19 16:38 | 5.1K | |
| p5-Number-Tolerant-1..> | 2025-12-19 16:44 | 34K | |
| p5-Number-Uncertaint..> | 2025-12-18 22:52 | 5.8K | |
| p5-Number-WithError-..> | 2025-12-19 16:44 | 18K | |
| p5-Number-WithError-..> | 2025-12-21 23:05 | 7.3K | |
| p5-OAI-Harvester-1.2..> | 2025-12-22 07:04 | 54K | |
| p5-ODF-lpOD-2.001.pkg | 2025-12-27 02:41 | 348K | |
| p5-ODF-lpOD_Helper-6..> | 2025-12-28 09:26 | 46K | |
| p5-OLE-Storage_Lite-..> | 2025-12-18 10:20 | 15K | |
| p5-OOTools-2.40.pkg | 2025-12-18 19:54 | 49K | |
| p5-ORLite-1.98_1.pkg | 2025-12-20 04:22 | 27K | |
| p5-ORLite-Migrate-1...> | 2025-12-23 12:47 | 16K | |
| p5-OSLV-Monitor-1.0...> | 2025-12-24 07:30 | 21K | |
| p5-OSSP-uuid-1.6.2_1..> | 2025-12-19 10:36 | 16K | |
| p5-Object-AUTHORITY-..> | 2025-12-19 03:44 | 5.3K | |
| p5-Object-Accessor-0..> | 2025-12-18 18:47 | 14K | |
| p5-Object-Array-0.06..> | 2025-12-19 14:42 | 10K | |
| p5-Object-Container-..> | 2025-12-19 20:44 | 16K | |
| p5-Object-Declare-0...> | 2025-12-18 18:41 | 9.9K | |
| p5-Object-Destroyer-..> | 2025-12-19 22:43 | 11K | |
| p5-Object-Enum-0.07...> | 2025-12-24 05:46 | 6.2K | |
| p5-Object-Event-1.22..> | 2025-12-18 22:32 | 14K | |
| p5-Object-Import-1.0..> | 2025-12-22 07:29 | 18K | |
| p5-Object-InsideOut-..> | 2025-12-19 08:00 | 112K | |
| p5-Object-MultiType-..> | 2025-12-19 11:34 | 10K | |
| p5-Object-Pad-0.82.1..> | 2025-12-26 15:45 | 122K | |
| p5-Object-Pluggable-..> | 2025-12-18 13:13 | 19K | |
| p5-Object-Realize-La..> | 2025-12-27 01:07 | 13K | |
| p5-Object-Role-0.001..> | 2025-12-19 02:11 | 4.8K | |
| p5-Object-Signature-..> | 2025-12-18 13:17 | 7.0K | |
| p5-Object-Simple-3.1..> | 2025-12-19 08:30 | 12K | |
| p5-Object-Tiny-1.09.pkg | 2025-12-18 22:45 | 8.9K | |
| p5-Object-Tiny-Lvalu..> | 2025-12-20 05:52 | 3.1K | |
| p5-Object-Tiny-RW-1...> | 2025-12-22 14:31 | 3.7K | |
| p5-Ogg-Vorbis-Header..> | 2025-12-19 10:10 | 18K | |
| p5-Ogg-Vorbis-Header..> | 2025-12-22 10:29 | 8.6K | |
| p5-Olson-Abbreviatio..> | 2025-12-18 22:52 | 6.0K | |
| p5-Opcodes-0.16.pkg | 2025-12-19 03:13 | 13K | |
| p5-OpenAI-API-0.37.pkg | 2025-12-20 22:55 | 40K | |
| p5-OpenAPI-Client-1...> | 2025-12-22 13:34 | 13K | |
| p5-OpenCA-CRL-0.9.6_..> | 2025-12-23 16:50 | 9.4K | |
| p5-OpenCA-CRR-0.0.2_..> | 2025-12-21 00:43 | 5.5K | |
| p5-OpenCA-REQ-0.9.60..> | 2025-12-20 14:54 | 10K | |
| p5-OpenCA-X509-0.9.1..> | 2025-12-22 19:57 | 7.9K | |
| p5-OpenOffice-OODoc-..> | 2025-12-30 07:45 | 423K | |
| p5-OpenTelemetry-0.0..> | 2025-12-26 22:14 | 149K | |
| p5-OpenTelemetry-Exp..> | 2025-12-27 18:39 | 32K | |
| p5-OpenTelemetry-SDK..> | 2025-12-30 17:14 | 70K | |
| p5-OrePAN2-0.53.pkg | 2025-12-19 20:52 | 27K | |
| p5-Oryx-0.24_2.pkg | 2025-12-19 04:38 | 124K | |
| p5-Ouch-0.0501.pkg | 2025-12-19 04:56 | 9.7K | |
| p5-OurNet-BBS-1.66_6..> | 2025-12-30 04:15 | 76K | |
| p5-OurNet-BBSAgent-1..> | 2025-12-19 05:28 | 23K | |
| p5-PAR-1.021.pkg | 2025-12-18 22:50 | 50K | |
| p5-PAR-Dist-0.53.pkg | 2025-12-18 11:02 | 19K | |
| p5-PAR-Packer-1.064.pkg | 2025-12-20 01:10 | 2.6M | |
| p5-PBKDF2-Tiny-0.005..> | 2025-12-18 18:12 | 7.0K | |
| p5-PCSC-Card-1.4.15.pkg | 2025-12-19 22:33 | 29K | |
| p5-PDF-API2-2.048.pkg | 2025-12-18 19:22 | 1.6M | |
| p5-PDF-API2-Simple-1..> | 2025-12-22 15:35 | 14K | |
| p5-PDF-API2-XS-1.002..> | 2025-12-18 17:33 | 6.7K | |
| p5-PDF-API3-3.001_1.pkg | 2025-12-21 14:57 | 3.8M | |
| p5-PDF-Builder-3.027..> | 2025-12-19 17:41 | 2.0M | |
| p5-PDF-Create-1.46.pkg | 2025-12-22 07:28 | 48K | |
| p5-PDF-FromHTML-0.34..> | 2025-12-29 04:49 | 71K | |
| p5-PDF-Reuse-0.39_1.pkg | 2025-12-21 23:58 | 74K | |
| p5-PDF-Table-1.007.pkg | 2025-12-22 20:58 | 47K | |
| p5-PDF-Template-0.22..> | 2025-12-20 11:17 | 58K | |
| p5-PDF-Tiny-0.09.pkg | 2025-12-21 19:42 | 33K | |
| p5-PDF-Writer-0.06_1..> | 2025-12-19 16:28 | 9.1K | |
| p5-PDFLib-0.14_1.pkg | 2025-12-19 19:57 | 21K | |
| p5-PDL-2.100.pkg | 2025-12-26 20:57 | 2.9M | |
| p5-PDL-DateTime-0.00..> | 2025-12-27 15:35 | 15K | |
| p5-PDL-Fit-2.100.pkg | 2025-12-27 16:18 | 35K | |
| p5-PDL-GSL-2.101.pkg | 2025-12-28 05:35 | 321K | |
| p5-PDL-Graphics-IIS-..> | 2025-12-28 08:34 | 24K | |
| p5-PDL-Graphics-Limi..> | 2025-12-28 08:30 | 18K | |
| p5-PDL-Graphics-PLpl..> | 2025-12-29 18:04 | 174K | |
| p5-PDL-IO-Browser-0...> | 2025-12-28 12:06 | 12K | |
| p5-PDL-IO-Dicom-2.09..> | 2025-12-29 05:19 | 6.2K | |
| p5-PDL-IO-ENVI-2.098..> | 2025-12-29 23:28 | 7.0K | |
| p5-PDL-IO-GD-2.103.pkg | 2025-12-28 14:17 | 54K | |
| p5-PDL-IO-HDF-2.003.pkg | 2025-12-29 04:32 | 38K | |
| p5-PDL-IO-IDL-2.098.pkg | 2025-12-30 17:28 | 10K | |
| p5-PDL-LinearAlgebra..> | 2025-12-29 15:02 | 329K | |
| p5-PDL-Minuit-0.001.pkg | 2025-12-28 20:09 | 108K | |
| p5-PDL-Opt-Simplex-2..> | 2025-12-30 08:01 | 8.5K | |
| p5-PDL-Perldl2-2.002..> | 2025-12-30 15:55 | 20K | |
| p5-PDL-Transform-Pro..> | 2025-12-28 01:10 | 27K | |
| p5-PGP-0.3a_2.pkg | 2025-12-21 09:09 | 16K | |
| p5-PGP-Sign-1.04.pkg | 2025-12-18 22:48 | 17K | |
| p5-PGPLOT-2.35.pkg | 2025-12-27 03:21 | 186K | |
| p5-PHP-Serialization..> | 2025-12-20 09:51 | 6.7K | |
| p5-PHP-Session-0.27_..> | 2025-12-20 00:37 | 11K | |
| p5-POD2-Base-0.043_1..> | 2025-12-23 15:50 | 16K | |
| p5-POE-1.370.pkg | 2025-12-18 09:52 | 429K | |
| p5-POE-API-Hooks-1.0..> | 2025-12-23 04:17 | 6.5K | |
| p5-POE-API-Peek-2.20..> | 2025-12-18 23:37 | 11K | |
| p5-POE-Component-Chi..> | 2025-12-20 17:39 | 12K | |
| p5-POE-Component-Cli..> | 2025-12-18 16:27 | 13K | |
| p5-POE-Component-Cli..> | 2025-12-19 12:27 | 8.0K | |
| p5-POE-Component-Cli..> | 2025-12-20 03:10 | 6.8K | |
| p5-POE-Component-Cli..> | 2025-12-23 19:38 | 17K | |
| p5-POE-Component-Cli..> | 2025-12-19 01:16 | 44K | |
| p5-POE-Component-Cli..> | 2025-12-19 01:58 | 14K | |
| p5-POE-Component-Cli..> | 2025-12-18 18:40 | 21K | |
| p5-POE-Component-Cli..> | 2025-12-19 05:28 | 18K | |
| p5-POE-Component-Cli..> | 2025-12-22 10:29 | 20K | |
| p5-POE-Component-Cli..> | 2025-12-21 11:40 | 16K | |
| p5-POE-Component-Cli..> | 2025-12-21 04:59 | 15K | |
| p5-POE-Component-Cli..> | 2025-12-23 00:59 | 8.2K | |
| p5-POE-Component-Cli..> | 2025-12-20 04:49 | 19K | |
| p5-POE-Component-Cli..> | 2025-12-21 06:54 | 4.0K | |
| p5-POE-Component-Cli..> | 2025-12-22 23:26 | 12K | |
| p5-POE-Component-Cli..> | 2025-12-21 00:43 | 15K | |
| p5-POE-Component-Con..> | 2025-12-21 03:46 | 15K | |
| p5-POE-Component-Cro..> | 2025-12-22 11:27 | 3.7K | |
| p5-POE-Component-DBI..> | 2025-12-23 14:59 | 20K | |
| p5-POE-Component-Dae..> | 2025-12-23 04:28 | 63K | |
| p5-POE-Component-Deb..> | 2025-12-23 13:38 | 8.2K | |
| p5-POE-Component-Dir..> | 2025-12-21 22:08 | 17K | |
| p5-POE-Component-Eas..> | 2025-12-20 20:47 | 32K | |
| p5-POE-Component-Gen..> | 2025-12-19 11:02 | 38K | |
| p5-POE-Component-Hai..> | 2025-12-19 16:02 | 5.9K | |
| p5-POE-Component-IKC..> | 2025-12-20 23:11 | 75K | |
| p5-POE-Component-IRC..> | 2025-12-18 23:29 | 186K | |
| p5-POE-Component-IRC..> | 2025-12-23 01:48 | 5.4K | |
| p5-POE-Component-IRC..> | 2025-12-20 15:20 | 6.3K | |
| p5-POE-Component-IRC..> | 2025-12-20 04:41 | 4.4K | |
| p5-POE-Component-IRC..> | 2025-12-21 01:15 | 5.9K | |
| p5-POE-Component-IRC..> | 2025-12-21 22:31 | 11K | |
| p5-POE-Component-IRC..> | 2025-12-20 06:58 | 11K | |
| p5-POE-Component-IRC..> | 2025-12-22 07:16 | 6.0K | |
| p5-POE-Component-IRC..> | 2025-12-23 14:10 | 6.4K | |
| p5-POE-Component-IRC..> | 2025-12-22 07:10 | 5.6K | |
| p5-POE-Component-IRC..> | 2025-12-21 22:54 | 5.8K | |
| p5-POE-Component-Jab..> | 2025-12-22 11:30 | 37K | |
| p5-POE-Component-Job..> | 2025-12-21 20:27 | 12K | |
| p5-POE-Component-LaD..> | 2025-12-23 13:36 | 27K | |
| p5-POE-Component-Log..> | 2025-12-24 07:29 | 6.3K | |
| p5-POE-Component-Pca..> | 2025-12-20 05:00 | 7.0K | |
| p5-POE-Component-Plu..> | 2025-12-19 00:45 | 19K | |
| p5-POE-Component-Pub..> | 2025-12-20 01:41 | 12K | |
| p5-POE-Component-RRD..> | 2025-12-28 12:05 | 9.5K | |
| p5-POE-Component-RSS..> | 2025-12-23 04:58 | 6.7K | |
| p5-POE-Component-RSS..> | 2025-12-22 06:26 | 7.3K | |
| p5-POE-Component-Res..> | 2025-12-18 14:21 | 15K | |
| p5-POE-Component-SMT..> | 2025-12-23 01:35 | 9.7K | |
| p5-POE-Component-SNM..> | 2025-12-24 04:58 | 19K | |
| p5-POE-Component-SSL..> | 2025-12-18 18:44 | 25K | |
| p5-POE-Component-Sch..> | 2025-12-19 17:27 | 6.9K | |
| p5-POE-Component-Ser..> | 2025-12-21 10:48 | 11K | |
| p5-POE-Component-Ser..> | 2025-12-19 20:33 | 12K | |
| p5-POE-Component-Ser..> | 2025-12-23 19:49 | 30K | |
| p5-POE-Component-Ser..> | 2025-12-19 17:52 | 70K | |
| p5-POE-Component-Ser..> | 2025-12-20 10:37 | 15K | |
| p5-POE-Component-Ser..> | 2025-12-23 19:39 | 4.0K | |
| p5-POE-Component-Ser..> | 2025-12-24 07:01 | 19K | |
| p5-POE-Component-Ser..> | 2025-12-20 04:23 | 27K | |
| p5-POE-Component-Ser..> | 2025-12-22 22:36 | 34K | |
| p5-POE-Component-Ser..> | 2025-12-20 18:07 | 6.3K | |
| p5-POE-Component-Syn..> | 2025-12-18 18:35 | 15K | |
| p5-POE-Component-TST..> | 2025-12-19 17:07 | 3.3K | |
| p5-POE-Devel-Profile..> | 2025-12-21 03:29 | 11K | |
| p5-POE-Filter-Bzip2-..> | 2025-12-21 03:30 | 4.0K | |
| p5-POE-Filter-DNS-TC..> | 2025-12-19 06:05 | 4.0K | |
| p5-POE-Filter-HTTP-P..> | 2025-12-18 19:00 | 6.1K | |
| p5-POE-Filter-IRCD-2..> | 2025-12-18 16:23 | 6.3K | |
| p5-POE-Filter-LZF-1...> | 2025-12-23 05:09 | 3.8K | |
| p5-POE-Filter-LZO-1...> | 2025-12-21 12:29 | 4.1K | |
| p5-POE-Filter-LZW-1...> | 2025-12-23 04:40 | 3.9K | |
| p5-POE-Filter-SSL-0...> | 2025-12-21 05:57 | 26K | |
| p5-POE-Filter-Transp..> | 2025-12-19 09:23 | 8.3K | |
| p5-POE-Filter-XML-1...> | 2025-12-19 23:31 | 16K | |
| p5-POE-Filter-Zlib-2..> | 2025-12-19 02:01 | 7.3K | |
| p5-POE-Loop-AnyEvent..> | 2025-12-20 00:28 | 5.3K | |
| p5-POE-Loop-Glib-0.0..> | 2025-12-19 19:36 | 7.4K | |
| p5-POE-Loop-Tk-1.305..> | 2025-12-29 15:32 | 11K | |
| p5-POE-Quickie-0.18_..> | 2025-12-20 05:00 | 10K | |
| p5-POE-Session-Irssi..> | 2025-12-22 17:11 | 7.2K | |
| p5-POE-Session-Multi..> | 2025-12-19 16:25 | 7.9K | |
| p5-POE-Stage-0.0600_..> | 2025-12-23 10:01 | 70K | |
| p5-POE-Test-Loops-1...> | 2025-12-18 07:18 | 57K | |
| p5-POE-XS-Loop-Poll-..> | 2025-12-23 12:10 | 13K | |
| p5-POE-XS-Queue-Arra..> | 2025-12-21 09:45 | 18K | |
| p5-POEx-Role-PSGISer..> | 2025-12-19 13:13 | 15K | |
| p5-POEx-Role-Session..> | 2025-12-18 17:18 | 25K | |
| p5-POEx-Role-Streami..> | 2025-12-18 22:33 | 6.5K | |
| p5-POEx-Role-TCPServ..> | 2025-12-18 22:58 | 5.6K | |
| p5-POEx-Types-1.1009..> | 2025-12-18 12:56 | 3.8K | |
| p5-POSIX-Regex-1.000..> | 2025-12-23 11:28 | 11K | |
| p5-POSIX-Run-Capture..> | 2025-12-22 00:50 | 20K | |
| p5-POSIX-Socket-0.09..> | 2025-12-22 12:11 | 11K | |
| p5-POSIX-getpeername..> | 2025-12-19 14:40 | 5.2K | |
| p5-POSIX-strftime-Co..> | 2025-12-18 03:45 | 7.6K | |
| p5-POSIX-strptime-0...> | 2025-12-21 09:10 | 7.6K | |
| p5-PPI-1.283_1.pkg | 2025-12-18 04:21 | 280K | |
| p5-PPI-HTML-1.08_1.pkg | 2025-12-24 07:24 | 9.2K | |
| p5-PPI-XS-0.910.pkg | 2025-12-21 02:10 | 6.5K | |
| p5-PPIx-EditorTools-..> | 2025-12-23 15:14 | 31K | |
| p5-PPIx-QuoteLike-0...> | 2025-12-19 00:24 | 56K | |
| p5-PPIx-Regexp-0.091..> | 2025-12-18 23:44 | 221K | |
| p5-PPIx-Utilities-1...> | 2025-12-21 09:32 | 12K | |
| p5-PPIx-Utils-0.004.pkg | 2025-12-18 19:10 | 24K | |
| p5-PPR-0.001010.pkg | 2025-12-19 01:09 | 61K | |
| p5-PPerl-0.25_4.pkg | 2025-12-22 23:39 | 19K | |
| p5-PSGI-1.102_1.pkg | 2025-12-19 03:27 | 39K | |
| p5-PV-1.5_1.pkg | 2025-12-22 11:47 | 14K | |
| p5-Package-Constants..> | 2025-12-18 21:41 | 3.7K | |
| p5-Package-Deprecati..> | 2025-12-18 01:39 | 8.1K | |
| p5-Package-Generator..> | 2025-12-19 02:13 | 7.3K | |
| p5-Package-MoreUtil-..> | 2025-12-18 22:41 | 5.3K | |
| p5-Package-Stash-0.4..> | 2025-12-18 00:48 | 14K | |
| p5-Package-Stash-XS-..> | 2025-12-18 00:43 | 14K | |
| p5-Package-Util-Lite..> | 2025-12-19 02:09 | 4.4K | |
| p5-Package-Variant-1..> | 2025-12-18 13:36 | 10K | |
| p5-PadWalker-2.5.pkg | 2025-12-18 06:30 | 12K | |
| p5-Pango-1.227_3.pkg | 2025-12-26 15:10 | 138K | |
| p5-Parallel-Async-0...> | 2025-12-23 23:55 | 8.8K | |
| p5-Parallel-Fork-Bos..> | 2025-12-23 14:31 | 7.4K | |
| p5-Parallel-ForkMana..> | 2025-12-18 19:25 | 22K | |
| p5-Parallel-Iterator..> | 2025-12-18 14:20 | 13K | |
| p5-Parallel-Prefork-..> | 2025-12-18 18:48 | 11K | |
| p5-Parallel-Pvm-1.4...> | 2025-12-22 23:31 | 37K | |
| p5-Parallel-Scoreboa..> | 2025-12-20 04:06 | 8.7K | |
| p5-ParallelUserAgent..> | 2025-12-19 22:08 | 60K | |
| p5-Params-CallbackRe..> | 2025-12-19 12:54 | 44K | |
| p5-Params-Check-0.38..> | 2025-12-23 16:57 | 13K | |
| p5-Params-Classify-0..> | 2025-12-18 09:44 | 17K | |
| p5-Params-Coerce-0.1..> | 2025-12-19 23:33 | 10K | |
| p5-Params-Util-1.102..> | 2025-12-18 00:16 | 18K | |
| p5-Params-Validate-1..> | 2025-12-18 02:48 | 41K | |
| p5-Params-Validate-D..> | 2025-12-20 17:19 | 17K | |
| p5-Params-Validation..> | 2025-12-18 01:50 | 17K | |
| p5-Paranoid-2.10.pkg | 2025-12-19 17:14 | 185K | |
| p5-Paranoid-Log-Emai..> | 2025-12-23 01:35 | 5.0K | |
| p5-Paranoid-Log-Sysl..> | 2025-12-20 19:02 | 4.6K | |
| p5-Parse-ANSIColor-T..> | 2025-12-18 20:57 | 11K | |
| p5-Parse-BooleanLogi..> | 2025-12-23 03:44 | 12K | |
| p5-Parse-CPAN-Packag..> | 2025-12-22 02:54 | 12K | |
| p5-Parse-CPAN-Packag..> | 2025-12-18 19:26 | 6.3K | |
| p5-Parse-CSV-2.07.pkg | 2025-12-21 21:40 | 11K | |
| p5-Parse-Distname-0...> | 2025-12-18 15:42 | 7.4K | |
| p5-Parse-EDID-1.0.7.pkg | 2025-12-22 03:36 | 9.2K | |
| p5-Parse-ErrorString..> | 2025-12-20 17:43 | 15K | |
| p5-Parse-ExuberantCT..> | 2025-12-20 06:13 | 17K | |
| p5-Parse-FixedLength..> | 2025-12-22 16:02 | 17K | |
| p5-Parse-Flex-0.12_1..> | 2025-12-21 13:24 | 11K | |
| p5-Parse-HTTP-UserAg..> | 2025-12-23 21:34 | 25K | |
| p5-Parse-IRC-1.22.pkg | 2025-12-22 16:15 | 8.4K | |
| p5-Parse-LocalDistri..> | 2025-12-18 23:58 | 8.0K | |
| p5-Parse-MIME-1.006.pkg | 2025-12-21 02:05 | 5.8K | |
| p5-Parse-Method-Sign..> | 2025-12-18 06:25 | 20K | |
| p5-Parse-Netstat-0.1..> | 2025-12-23 01:21 | 28K | |
| p5-Parse-PMFile-0.47..> | 2025-12-18 16:56 | 13K | |
| p5-Parse-PerlConfig-..> | 2025-12-24 07:03 | 14K | |
| p5-Parse-PhoneNumber..> | 2025-12-22 13:18 | 5.3K | |
| p5-Parse-PlainConfig..> | 2025-12-23 12:58 | 41K | |
| p5-Parse-Range-0.96_..> | 2025-12-19 07:09 | 5.1K | |
| p5-Parse-RecDescent-..> | 2025-12-18 10:28 | 129K | |
| p5-Parse-Snort-0.9.pkg | 2025-12-20 15:28 | 12K | |
| p5-Parse-Syslog-1.11..> | 2025-12-19 22:31 | 9.6K | |
| p5-Parse-Syslog-Mail..> | 2025-12-21 09:37 | 7.6K | |
| p5-Parse-VarName-0.0..> | 2025-12-19 03:02 | 4.0K | |
| p5-Parse-Win32Regist..> | 2025-12-20 06:05 | 71K | |
| p5-Parse-Yapp-1.21.pkg | 2025-12-18 06:14 | 34K | |
| p5-ParseLex-2.21_1.pkg | 2025-12-19 04:53 | 46K | |
| p5-ParseTemplate-3.0..> | 2025-12-19 00:26 | 12K | |
| p5-Parser-MGC-0.23.pkg | 2025-12-18 13:57 | 38K | |
| p5-PatchReader-0.9.6..> | 2025-12-19 02:05 | 11K | |
| p5-Path-Abstract-0.0..> | 2025-12-19 02:22 | 12K | |
| p5-Path-Class-0.37.pkg | 2025-12-18 10:30 | 30K | |
| p5-Path-Class-File-L..> | 2025-12-23 20:49 | 5.6K | |
| p5-Path-Class-URI-0...> | 2025-12-23 11:02 | 6.4K | |
| p5-Path-Dispatcher-1..> | 2025-12-18 16:27 | 47K | |
| p5-Path-Dispatcher-D..> | 2025-12-18 22:33 | 7.0K | |
| p5-Path-Extended-0.2..> | 2025-12-23 19:56 | 27K | |
| p5-Path-FindDev-0.5...> | 2025-12-18 23:14 | 8.7K | |
| p5-Path-IsDev-1.0010..> | 2025-12-18 17:14 | 56K | |
| p5-Path-Iterator-Rul..> | 2025-12-18 20:10 | 36K | |
| p5-Path-Resource-0.0..> | 2025-12-19 15:15 | 9.7K | |
| p5-Path-Tiny-0.150.pkg | 2025-12-18 03:53 | 45K | |
| p5-PathTools-3.7500.pkg | 2025-12-18 21:31 | 63K | |
| p5-Paws-0.45_1.pkg | 2025-12-21 03:24 | 45M | |
| p5-PayflowPro-4706.pkg | 2025-12-21 00:53 | 146K | |
| p5-Pegex-0.75.pkg | 2025-12-18 12:33 | 96K | |
| p5-Perl-Critic-1.156..> | 2025-12-19 12:37 | 636K | |
| p5-Perl-Critic-Bangs..> | 2025-12-23 07:41 | 23K | |
| p5-Perl-Critic-Depre..> | 2025-12-21 16:58 | 19K | |
| p5-Perl-Critic-Itch-..> | 2025-12-20 19:31 | 5.7K | |
| p5-Perl-Critic-Moose..> | 2025-12-22 23:28 | 19K | |
| p5-Perl-Critic-More-..> | 2025-12-23 01:23 | 22K | |
| p5-Perl-Critic-Pulp-..> | 2025-12-21 11:56 | 192K | |
| p5-Perl-Critic-Swift..> | 2025-12-22 13:05 | 11K | |
| p5-Perl-Critic-Tics-..> | 2025-12-22 14:39 | 12K | |
| p5-Perl-Lint-0.25_1.pkg | 2025-12-21 05:55 | 60K | |
| p5-Perl-Metrics-Lite..> | 2025-12-22 02:41 | 19K | |
| p5-Perl-Metrics-Simp..> | 2025-12-21 04:11 | 29K | |
| p5-Perl-MinimumVersi..> | 2025-12-19 22:14 | 18K | |
| p5-Perl-OSType-1.010..> | 2025-12-19 02:05 | 5.2K | |
| p5-Perl-PrereqScanne..> | 2025-12-18 18:57 | 23K | |
| p5-Perl-PrereqScanne..> | 2025-12-20 02:05 | 11K | |
| p5-Perl-PrereqScanne..> | 2025-12-18 21:30 | 79K | |
| p5-Perl-Tidy-2025091..> | 2025-12-18 19:51 | 662K | |
| p5-Perl-Unsafe-Signa..> | 2025-12-20 09:43 | 6.4K | |
| p5-Perl-Version-1.01..> | 2025-12-19 20:19 | 25K | |
| p5-Perl-osnames-0.12..> | 2025-12-18 23:42 | 6.8K | |
| p5-Perl4-CoreLibs-0...> | 2025-12-20 00:32 | 35K | |
| p5-Perl6-Builtins-0...> | 2025-12-21 02:57 | 5.9K | |
| p5-Perl6-Export-0.07..> | 2025-12-18 16:13 | 4.8K | |
| p5-Perl6-Export-Attr..> | 2025-12-19 20:29 | 9.5K | |
| p5-Perl6-Form-0.04_2..> | 2025-12-19 00:23 | 87K | |
| p5-Perl6-Junction-1...> | 2025-12-18 14:42 | 6.5K | |
| p5-Perl6-Rules-0.03_..> | 2025-12-20 11:13 | 43K | |
| p5-Perl6-Say-0.16_1.pkg | 2025-12-21 16:47 | 6.7K | |
| p5-Perl6-Slurp-0.051..> | 2025-12-23 04:26 | 9.3K | |
| p5-Perl6-Subs-0.05_2..> | 2025-12-22 01:24 | 17K | |
| p5-PerlCryptLib-1.12..> | 2025-12-23 12:48 | 39K | |
| p5-PerlIO-Layers-0.0..> | 2025-12-18 13:20 | 9.9K | |
| p5-PerlIO-Util-0.72_..> | 2025-12-19 22:57 | 31K | |
| p5-PerlIO-eol-0.19.pkg | 2025-12-19 01:24 | 11K | |
| p5-PerlIO-gzip-0.20.pkg | 2025-12-18 15:31 | 11K | |
| p5-PerlIO-locale-0.1..> | 2025-12-21 10:14 | 6.5K | |
| p5-PerlIO-utf8_stric..> | 2025-12-18 11:26 | 8.0K | |
| p5-PerlIO-via-Bzip2-..> | 2025-12-18 22:34 | 3.8K | |
| p5-PerlIO-via-MD5-0...> | 2025-12-21 19:45 | 4.3K | |
| p5-PerlIO-via-Timeou..> | 2025-12-18 16:39 | 5.3K | |
| p5-PerlIO-via-Unidec..> | 2025-12-21 21:56 | 7.9K | |
| p5-PerlIO-via-dynami..> | 2025-12-18 09:14 | 4.6K | |
| p5-PerlIO-via-symlin..> | 2025-12-18 20:21 | 3.3K | |
| p5-PerlMol-0.3500_2.pkg | 2025-12-21 22:31 | 6.4K | |
| p5-PerlPoint-Convert..> | 2025-12-23 13:32 | 458K | |
| p5-PerlPoint-Package..> | 2025-12-19 23:59 | 282K | |
| p5-PerlX-Maybe-1.202..> | 2025-12-19 01:16 | 9.0K | |
| p5-PerlX-Maybe-XS-1...> | 2025-12-22 17:52 | 6.1K | |
| p5-Perlanet-3.3.3.pkg | 2025-12-22 04:57 | 38K | |
| p5-Perlbal-1.80_1.pkg | 2025-12-19 02:27 | 219K | |
| p5-Perlbal-Plugin-PS..> | 2025-12-24 07:09 | 4.3K | |
| p5-Petal-2.26.pkg | 2025-12-19 01:58 | 67K | |
| p5-Petal-CodePerl-0...> | 2025-12-21 01:32 | 28K | |
| p5-Petal-Mail-0.31_2..> | 2025-12-21 16:15 | 10K | |
| p5-Petal-Utils-0.06_..> | 2025-12-19 20:29 | 14K | |
| p5-Pg-2.1.1_6,1.pkg | 2025-12-20 23:20 | 28K | |
| p5-Phone-Info-0.0.1_..> | 2025-12-22 18:55 | 8.8K | |
| p5-Physics-Unit-0.60..> | 2025-12-22 10:23 | 58K | |
| p5-Pid-File-Flock-0...> | 2025-12-19 19:15 | 6.3K | |
| p5-Pipeline-3.12_2.pkg | 2025-12-22 17:57 | 40K | |
| p5-Pithub-0.01043.pkg | 2025-12-20 00:39 | 125K | |
| p5-PkgConfig-0.26026..> | 2025-12-18 12:27 | 26K | |
| p5-PkgConfig-LibPkgC..> | 2025-12-21 11:56 | 28K | |
| p5-PlRPC-0.2020_2.pkg | 2025-12-19 08:54 | 23K | |
| p5-Plack-1.0051.pkg | 2025-12-18 07:19 | 212K | |
| p5-Plack-App-Proxy-0..> | 2025-12-22 17:57 | 20K | |
| p5-Plack-Builder-Con..> | 2025-12-20 07:29 | 5.1K | |
| p5-Plack-Handler-Any..> | 2025-12-23 06:26 | 4.8K | |
| p5-Plack-Handler-Any..> | 2025-12-22 09:19 | 3.5K | |
| p5-Plack-Handler-Any..> | 2025-12-22 21:51 | 3.4K | |
| p5-Plack-Handler-CLI..> | 2025-12-20 17:26 | 5.6K | |
| p5-Plack-Handler-SCG..> | 2025-12-21 04:59 | 3.5K | |
| p5-Plack-Middleware-..> | 2025-12-20 05:51 | 4.3K | |
| p5-Plack-Middleware-..> | 2025-12-22 20:46 | 3.0K | |
| p5-Plack-Middleware-..> | 2025-12-21 07:42 | 5.5K | |
| p5-Plack-Middleware-..> | 2025-12-20 18:21 | 9.0K | |
| p5-Plack-Middleware-..> | 2025-12-22 20:53 | 3.3K | |
| p5-Plack-Middleware-..> | 2025-12-21 03:15 | 10K | |
| p5-Plack-Middleware-..> | 2025-12-19 14:47 | 2.8K | |
| p5-Plack-Middleware-..> | 2025-12-24 05:21 | 57K | |
| p5-Plack-Middleware-..> | 2025-12-19 02:20 | 5.7K | |
| p5-Plack-Middleware-..> | 2025-12-20 19:40 | 4.6K | |
| p5-Plack-Middleware-..> | 2025-12-21 20:40 | 11K | |
| p5-Plack-Middleware-..> | 2025-12-22 04:18 | 4.7K | |
| p5-Plack-Middleware-..> | 2025-12-18 10:11 | 3.7K | |
| p5-Plack-Middleware-..> | 2025-12-20 21:11 | 2.9K | |
| p5-Plack-Middleware-..> | 2025-12-19 19:20 | 2.8K | |
| p5-Plack-Middleware-..> | 2025-12-23 07:44 | 4.5K | |
| p5-Plack-Middleware-..> | 2025-12-22 08:00 | 3.1K | |
| p5-Plack-Middleware-..> | 2025-12-20 18:31 | 57K | |
| p5-Plack-Middleware-..> | 2025-12-21 17:04 | 3.4K | |
| p5-Plack-Middleware-..> | 2025-12-21 22:02 | 4.7K | |
| p5-Plack-Middleware-..> | 2025-12-18 11:21 | 5.6K | |
| p5-Plack-Middleware-..> | 2025-12-21 05:11 | 3.9K | |
| p5-Plack-Middleware-..> | 2025-12-24 02:09 | 5.8K | |
| p5-Plack-Middleware-..> | 2025-12-18 10:54 | 3.2K | |
| p5-Plack-Middleware-..> | 2025-12-20 04:45 | 6.1K | |
| p5-Plack-Middleware-..> | 2025-12-18 11:21 | 3.4K | |
| p5-Plack-Middleware-..> | 2025-12-22 05:07 | 8.3K | |
| p5-Plack-Middleware-..> | 2025-12-22 05:38 | 11K | |
| p5-Plack-Middleware-..> | 2025-12-18 17:26 | 32K | |
| p5-Plack-Middleware-..> | 2025-12-23 13:24 | 19K | |
| p5-Plack-Middleware-..> | 2025-12-23 05:28 | 3.0K | |
| p5-Plack-Middleware-..> | 2025-12-21 09:40 | 5.1K | |
| p5-Plack-Middleware-..> | 2025-12-20 04:26 | 11K | |
| p5-Plack-Middleware-..> | 2025-12-22 16:29 | 3.5K | |
| p5-Plack-Server-Coro..> | 2025-12-23 05:44 | 4.4K | |
| p5-Plack-Server-POE-..> | 2025-12-22 03:36 | 4.1K | |
| p5-Plack-Server-Reve..> | 2025-12-23 04:41 | 3.4K | |
| p5-Plack-Test-Extern..> | 2025-12-18 10:21 | 3.6K | |
| p5-Plagger-0.7.17_6.pkg | 2025-12-21 19:15 | 368K | |
| p5-Plucene-1.25_5.pkg | 2025-12-19 17:16 | 124K | |
| p5-Plucene-Analysis-..> | 2025-12-22 12:37 | 6.2K | |
| p5-Plucene-Plugin-An..> | 2025-12-24 06:35 | 5.7K | |
| p5-Plucene-Simple-1...> | 2025-12-23 11:34 | 5.9K | |
| p5-Plugtools-1.3.0_2..> | 2025-12-27 11:17 | 25K | |
| p5-Plugtools-Plugins..> | 2025-12-30 06:22 | 6.9K | |
| p5-PocketIO-0.17000.pkg | 2025-12-21 22:25 | 33K | |
| p5-Pod-Abstract-0.20..> | 2025-12-20 00:33 | 59K | |
| p5-Pod-Autopod-1.215..> | 2025-12-20 05:35 | 17K | |
| p5-Pod-Constants-0.1..> | 2025-12-21 08:34 | 10K | |
| p5-Pod-Coverage-0.23..> | 2025-12-18 13:02 | 17K | |
| p5-Pod-Coverage-Moos..> | 2025-12-21 09:29 | 5.6K | |
| p5-Pod-Coverage-Trus..> | 2025-12-21 14:34 | 5.0K | |
| p5-Pod-DocBook-1.2_3..> | 2025-12-22 15:42 | 23K | |
| p5-Pod-Elemental-0.1..> | 2025-12-19 12:13 | 57K | |
| p5-Pod-Escapes-1.07.pkg | 2025-12-19 19:21 | 10K | |
| p5-Pod-Eventual-0.09..> | 2025-12-18 22:33 | 9.8K | |
| p5-Pod-HtmlEasy-1.01..> | 2025-12-20 08:25 | 27K | |
| p5-Pod-LaTeX-0.61.pkg | 2025-12-18 19:22 | 26K | |
| p5-Pod-Markdown-3.40..> | 2025-12-18 15:21 | 26K | |
| p5-Pod-MinimumVersio..> | 2025-12-19 14:45 | 14K | |
| p5-Pod-POM-2.01.pkg | 2025-12-19 01:09 | 68K | |
| p5-Pod-POM-View-HTML..> | 2025-12-22 12:29 | 21K | |
| p5-Pod-POM-View-Rest..> | 2025-12-23 11:23 | 12K | |
| p5-Pod-Parser-1.67.pkg | 2025-12-18 10:16 | 75K | |
| p5-Pod-Perldoc-3.25_..> | 2025-12-21 12:05 | 55K | |
| p5-Pod-ProjectDocs-0..> | 2025-12-23 22:41 | 14K | |
| p5-Pod-Readme-1.2.3.pkg | 2025-12-24 07:23 | 28K | |
| p5-Pod-Section-0.02.pkg | 2025-12-21 03:29 | 7.2K | |
| p5-Pod-Simple-3.47.pkg | 2025-12-18 20:39 | 184K | |
| p5-Pod-Site-0.56_1.pkg | 2025-12-20 07:53 | 50K | |
| p5-Pod-Spell-1.27.pkg | 2025-12-19 02:18 | 21K | |
| p5-Pod-Strip-1.100.pkg | 2025-12-19 11:44 | 3.4K | |
| p5-Pod-Stripper-0.22..> | 2025-12-23 13:22 | 7.2K | |
| p5-Pod-Tests-1.20.pkg | 2025-12-22 15:10 | 11K | |
| p5-Pod-Tree-1.31.pkg | 2025-12-21 03:29 | 71K | |
| p5-Pod-Usage-2.05.pkg | 2025-12-21 11:25 | 18K | |
| p5-Pod-WSDL-0.063_1.pkg | 2025-12-21 13:18 | 38K | |
| p5-Pod-WikiDoc-0.21.pkg | 2025-12-20 02:01 | 34K | |
| p5-Pod-XML-0.99_4.pkg | 2025-12-21 17:03 | 9.5K | |
| p5-Pod-Xhtml-1.61_1.pkg | 2025-12-18 19:31 | 18K | |
| p5-PodToHTML-0.08_2.pkg | 2025-12-18 12:12 | 12K | |
| p5-PostScript-0.06_2..> | 2025-12-21 11:50 | 21K | |
| p5-PostScript-PPD-0...> | 2025-12-21 21:42 | 8.8K | |
| p5-PostScript-Simple..> | 2025-12-21 22:26 | 30K | |
| p5-PostgreSQL-PLPerl..> | 2025-12-20 17:54 | 10K | |
| p5-PostgreSQL-PLPerl..> | 2025-12-22 14:09 | 4.9K | |
| p5-Pragmatic-1.7_1.pkg | 2025-12-22 23:31 | 7.1K | |
| p5-Prima-1.68.002_3.pkg | 2025-12-28 15:14 | 2.3M | |
| p5-Probe-Perl-0.03.pkg | 2025-12-19 02:02 | 6.3K | |
| p5-Proc-BackOff-0.02..> | 2025-12-20 08:38 | 12K | |
| p5-Proc-Background-1..> | 2025-12-19 04:20 | 28K | |
| p5-Proc-ChildError-0..> | 2025-12-18 13:07 | 4.4K | |
| p5-Proc-Daemon-0.23.pkg | 2025-12-19 07:34 | 17K | |
| p5-Proc-FastSpawn-1...> | 2025-12-18 18:22 | 9.3K | |
| p5-Proc-Find-Parents..> | 2025-12-18 10:04 | 4.9K | |
| p5-Proc-Fork-0.808.pkg | 2025-12-21 05:17 | 7.2K | |
| p5-Proc-Guard-0.07.pkg | 2025-12-18 23:15 | 4.6K | |
| p5-Proc-InvokeEditor..> | 2025-12-18 19:11 | 7.9K | |
| p5-Proc-PID-File-1.2..> | 2025-12-18 18:43 | 9.7K | |
| p5-Proc-PidUtil-0.09..> | 2025-12-21 16:03 | 4.7K | |
| p5-Proc-Pidfile-1.10..> | 2025-12-19 15:41 | 6.7K | |
| p5-Proc-ProcessTable..> | 2025-12-18 07:35 | 25K | |
| p5-Proc-ProcessTable..> | 2025-12-20 13:17 | 14K | |
| p5-Proc-ProcessTable..> | 2025-12-19 05:02 | 5.4K | |
| p5-Proc-ProcessTable..> | 2025-12-20 00:44 | 63K | |
| p5-Proc-ProcessTable..> | 2025-12-23 03:05 | 11K | |
| p5-Proc-Queue-1.23_1..> | 2025-12-20 00:18 | 11K | |
| p5-Proc-Reliable-1.1..> | 2025-12-22 11:18 | 17K | |
| p5-Proc-SafeExec-1.5..> | 2025-12-18 20:29 | 20K | |
| p5-Proc-Simple-1.32.pkg | 2025-12-18 19:48 | 13K | |
| p5-Proc-Wait3-0.05_1..> | 2025-12-18 12:40 | 6.4K | |
| p5-Proc-WaitStat-1.0..> | 2025-12-18 21:48 | 4.6K | |
| p5-Process-Status-0...> | 2025-12-22 13:55 | 5.6K | |
| p5-Proclet-0.35_2.pkg | 2025-12-22 14:46 | 14K | |
| p5-Progress-Any-0.22..> | 2025-12-21 03:16 | 22K | |
| p5-Project-Gantt-1.0..> | 2025-12-28 00:20 | 53K | |
| p5-Project-Libs-0.02..> | 2025-12-20 01:34 | 5.1K | |
| p5-Prometheus-Tiny-0..> | 2025-12-18 19:48 | 8.3K | |
| p5-Prometheus-Tiny-S..> | 2025-12-20 04:23 | 5.8K | |
| p5-Promises-0.94.pkg | 2025-12-22 05:00 | 57K | |
| p5-Prophet-0.751_2.pkg | 2025-12-19 11:16 | 258K | |
| p5-Protocol-Cassandr..> | 2025-12-19 20:17 | 33K | |
| p5-Protocol-HTTP2-1...> | 2025-12-22 07:31 | 33K | |
| p5-Protocol-SocketIO..> | 2025-12-19 14:01 | 7.9K | |
| p5-Protocol-WebSocke..> | 2025-12-19 14:06 | 35K | |
| p5-Protocol-XMLRPC-0..> | 2025-12-23 10:21 | 31K | |
| p5-Protocol-XMPP-0.0..> | 2025-12-19 17:33 | 55K | |
| p5-Pthread-GetThread..> | 2025-12-23 12:24 | 4.9K | |
| p5-Pugs-Compiler-Rul..> | 2025-12-23 21:06 | 81K | |
| p5-Qmail-Envelope-0...> | 2025-12-23 16:11 | 5.5K | |
| p5-Quantum-Superposi..> | 2025-12-18 22:37 | 18K | |
| p5-Qudo-0.0214_1.pkg | 2025-12-20 19:20 | 32K | |
| p5-Queue-Beanstalk-0..> | 2025-12-20 07:23 | 8.7K | |
| p5-Quota-1.8.2.pkg | 2025-12-19 13:05 | 19K | |
| p5-RADIUS-UserFile-1..> | 2025-12-23 04:26 | 12K | |
| p5-RDF-Core-0.51_1.pkg | 2025-12-18 20:40 | 91K | |
| p5-RDF-Notation3-0.9..> | 2025-12-19 07:35 | 29K | |
| p5-RDF-Query-2.919.pkg | 2025-12-19 04:56 | 249K | |
| p5-RDF-Simple-0.421.pkg | 2025-12-18 21:33 | 20K | |
| p5-RDF-Trine-1.019_1..> | 2025-12-19 01:42 | 227K | |
| p5-RDFStore-0.51_3.pkg | 2025-12-19 01:13 | 410K | |
| p5-RDR-Collector-1.0..> | 2025-12-22 14:18 | 18K | |
| p5-REST-Application-..> | 2025-12-22 03:37 | 19K | |
| p5-REST-Client-281.pkg | 2025-12-18 19:12 | 8.0K | |
| p5-REST-Google-1.0.8..> | 2025-12-23 19:53 | 23K | |
| p5-REST-Google-Apps-..> | 2025-12-22 02:32 | 8.5K | |
| p5-RPC-EPC-Service-0..> | 2025-12-21 07:06 | 9.5K | |
| p5-RPC-ExtDirect-3.2..> | 2025-12-20 04:16 | 109K | |
| p5-RPC-Simple-1.002_..> | 2025-12-23 21:36 | 33K | |
| p5-RPC-XML-0.82_1.pkg | 2025-12-20 03:02 | 157K | |
| p5-RPSL-Parser-0.040..> | 2025-12-19 11:16 | 11K | |
| p5-RRD-Simple-1.44_7..> | 2025-12-30 18:53 | 30K | |
| p5-RRDTool-OO-0.36_1..> | 2025-12-27 06:47 | 32K | |
| p5-RT-Client-REST-0...> | 2025-12-19 14:18 | 60K | |
| p5-RT-Extension-Comm..> | 2025-12-29 06:41 | 17K | |
| p5-RT-Extension-Grav..> | 2025-12-29 01:05 | 4.4K | |
| p5-RT-Extension-LDAP..> | 2025-12-28 12:16 | 22K | |
| p5-RT-Extension-Repe..> | 2025-12-29 00:15 | 19K | |
| p5-RT-Extension-Repe..> | 2025-12-30 00:38 | 23K | |
| p5-RT44-RT-Extension..> | 2025-12-30 07:16 | 28K | |
| p5-RT50-RT-Extension..> | 2025-12-29 05:50 | 28K | |
| p5-RTF-Parser-1.12_1..> | 2025-12-21 00:43 | 37K | |
| p5-RTF-Tokenizer-1.2..> | 2025-12-19 22:53 | 12K | |
| p5-RTF-Writer-1.11_1..> | 2025-12-20 10:11 | 54K | |
| p5-RTx-Calendar-1.10..> | 2025-12-30 04:07 | 26K | |
| p5-Rcs-1.05_1.pkg | 2025-12-21 16:02 | 23K | |
| p5-Rcs-Agent-1.05_1.pkg | 2025-12-20 06:03 | 18K | |
| p5-Reaction-0.002005..> | 2025-12-23 01:09 | 338K | |
| p5-Readonly-2.05.pkg | 2025-12-18 09:14 | 16K | |
| p5-Readonly-XS-1.05_..> | 2025-12-21 11:57 | 6.7K | |
| p5-ReadonlyX-1.04.pkg | 2025-12-21 07:33 | 11K | |
| p5-Reaper-1.00_1.pkg | 2025-12-21 17:09 | 7.2K | |
| p5-Reddit-0.30.03.pkg | 2025-12-22 11:39 | 6.2K | |
| p5-Reddit-Client-1.3..> | 2025-12-22 19:30 | 64K | |
| p5-Redis-1.9950.pkg | 2025-12-19 09:27 | 37K | |
| p5-Redis-Fast-0.36.pkg | 2025-12-23 14:35 | 67K | |
| p5-Redis-JobQueue-1...> | 2025-12-22 17:14 | 41K | |
| p5-Redis-RateLimit-1..> | 2025-12-23 19:42 | 7.9K | |
| p5-Redis-hiredis-0.1..> | 2025-12-21 00:59 | 23K | |
| p5-RedisDB-2.57.pkg | 2025-12-23 19:28 | 41K | |
| p5-RedisDB-Parser-2...> | 2025-12-19 04:50 | 19K | |
| p5-Ref-Util-0.204.pkg | 2025-12-18 12:31 | 12K | |
| p5-Ref-Util-XS-0.117..> | 2025-12-18 03:25 | 9.7K | |
| p5-Reflex-0.100.pkg | 2025-12-22 14:52 | 297K | |
| p5-Regex-PreSuf-1.17..> | 2025-12-22 23:30 | 5.6K | |
| p5-Regexp-Assemble-0..> | 2025-12-19 00:26 | 52K | |
| p5-Regexp-Assemble-C..> | 2025-12-21 18:32 | 3.6K | |
| p5-Regexp-Bind-0.05_..> | 2025-12-20 01:35 | 6.0K | |
| p5-Regexp-Common-202..> | 2025-12-18 14:21 | 157K | |
| p5-Regexp-Common-Ema..> | 2025-12-22 03:22 | 3.2K | |
| p5-Regexp-Common-net..> | 2025-12-18 23:14 | 2.9K | |
| p5-Regexp-Common-pro..> | 2025-12-22 20:46 | 11K | |
| p5-Regexp-Common-tim..> | 2025-12-21 20:37 | 20K | |
| p5-Regexp-Copy-0.06_..> | 2025-12-22 12:57 | 7.9K | |
| p5-Regexp-Debugger-0..> | 2025-12-22 12:53 | 41K | |
| p5-Regexp-DefaultFla..> | 2025-12-19 08:31 | 3.8K | |
| p5-Regexp-Grammars-1..> | 2025-12-18 20:10 | 105K | |
| p5-Regexp-IPv6-0.03_..> | 2025-12-18 23:47 | 3.3K | |
| p5-Regexp-Lexer-0.05..> | 2025-12-19 17:27 | 7.6K | |
| p5-Regexp-Log-0.06_1..> | 2025-12-20 01:35 | 11K | |
| p5-Regexp-Log-Common..> | 2025-12-22 10:17 | 9.9K | |
| p5-Regexp-Pattern-Pe..> | 2025-12-18 18:56 | 11K | |
| p5-Regexp-RegGrp-2.0..> | 2025-12-18 19:23 | 7.4K | |
| p5-Regexp-Shellish-0..> | 2025-12-18 13:47 | 4.9K | |
| p5-Regexp-Stringify-..> | 2025-12-18 06:30 | 5.0K | |
| p5-Regexp-Subst-Para..> | 2025-12-22 05:00 | 5.0K | |
| p5-Regexp-Trie-0.02.pkg | 2025-12-18 16:14 | 3.9K | |
| p5-Relations-0.95_1.pkg | 2025-12-19 19:57 | 16K | |
| p5-Relations-Query-0..> | 2025-12-21 05:18 | 12K | |
| p5-Religion-1.04_1.pkg | 2025-12-23 06:45 | 7.7K | |
| p5-Reply-0.42.pkg | 2025-12-23 09:05 | 58K | |
| p5-ResourcePool-1.01..> | 2025-12-20 01:15 | 61K | |
| p5-ResourcePool-Reso..> | 2025-12-22 00:16 | 17K | |
| p5-ResourcePool-Reso..> | 2025-12-23 12:35 | 2.3K | |
| p5-ResourcePool-Reso..> | 2025-12-23 15:22 | 8.4K | |
| p5-Resources-1.04_1.pkg | 2025-12-20 16:16 | 27K | |
| p5-Return-MultiLevel..> | 2025-12-18 17:19 | 6.0K | |
| p5-Return-Type-0.007..> | 2025-12-19 22:56 | 6.7K | |
| p5-Return-Value-1.66..> | 2025-12-18 18:41 | 9.2K | |
| p5-Rex-1.16.1.pkg | 2025-12-21 07:27 | 342K | |
| p5-Rinci-1.1.104.pkg | 2025-12-20 07:14 | 81K | |
| p5-Role-Basic-0.16.pkg | 2025-12-18 20:33 | 23K | |
| p5-Role-HasMessage-0..> | 2025-12-18 13:21 | 5.5K | |
| p5-Role-Hooks-0.008.pkg | 2025-12-18 11:14 | 8.3K | |
| p5-Role-Identifiable..> | 2025-12-18 13:23 | 4.8K | |
| p5-Role-REST-Client-..> | 2025-12-23 14:08 | 11K | |
| p5-Role-Tiny-2.00200..> | 2025-12-18 01:34 | 13K | |
| p5-Roman-1.24.pkg | 2025-12-20 00:14 | 4.5K | |
| p5-Rose-DB-0.786,1.pkg | 2025-12-18 17:22 | 114K | |
| p5-Rose-DB-Object-0...> | 2025-12-19 00:12 | 467K | |
| p5-Rose-DBx-Object-M..> | 2025-12-19 23:02 | 7.5K | |
| p5-Rose-DBx-Object-R..> | 2025-12-21 11:10 | 42K | |
| p5-Rose-DateTime-0.5..> | 2025-12-18 11:46 | 17K | |
| p5-Rose-HTML-Objects..> | 2025-12-21 00:06 | 270K | |
| p5-Rose-Object-0.860..> | 2025-12-18 11:25 | 50K | |
| p5-Rose-URI-1.02.pkg | 2025-12-19 08:50 | 11K | |
| p5-Router-Boom-1.03.pkg | 2025-12-18 15:31 | 10K | |
| p5-Router-R3-0.01100..> | 2025-12-29 22:15 | 23K | |
| p5-Router-Simple-0.1..> | 2025-12-18 17:49 | 16K | |
| p5-Router-Simple-Sin..> | 2025-12-21 13:13 | 3.8K | |
| p5-Routes-Tiny-0.21.pkg | 2025-12-23 08:27 | 12K | |
| p5-RunApp-0.13_1.pkg | 2025-12-19 04:38 | 24K | |
| p5-RundeckAPI-1.3.8...> | 2025-12-23 03:56 | 6.5K | |
| p5-S3-20071102_2.pkg | 2025-12-21 02:56 | 9.1K | |
| p5-SCGI-0.6_1.pkg | 2025-12-20 00:33 | 7.5K | |
| p5-SDL-2.548_6.pkg | 2025-12-27 18:34 | 589K | |
| p5-SES-1.01_2.pkg | 2025-12-22 11:45 | 6.5K | |
| p5-SGML-DTDParse-2.0..> | 2025-12-20 21:25 | 53K | |
| p5-SGML-Parser-OpenS..> | 2025-12-19 12:41 | 40K | |
| p5-SGMLSpm-1.03_2.pkg | 2025-12-18 10:10 | 27K | |
| p5-SHA-2.01_1.pkg | 2025-12-21 21:43 | 3.4K | |
| p5-SMS-SMS77-0.01_2.pkg | 2025-12-21 02:51 | 6.5K | |
| p5-SMS-Send-1.06_1.pkg | 2025-12-19 17:27 | 15K | |
| p5-SMS-Send-DeviceGs..> | 2025-12-20 16:31 | 4.9K | |
| p5-SMS-Send-NexmoUni..> | 2025-12-20 08:37 | 4.0K | |
| p5-SMS-Send-TW-HiAir..> | 2025-12-21 21:19 | 4.3K | |
| p5-SMS-Send-TW-PChom..> | 2025-12-24 02:09 | 4.4K | |
| p5-SMS-Send-TW-Socke..> | 2025-12-22 17:09 | 5.1K | |
| p5-SMS-Send-TW-chtsn..> | 2025-12-22 01:39 | 5.1K | |
| p5-SMS-Send-TW-emome..> | 2025-12-20 14:53 | 4.3K | |
| p5-SNMP-Info-3.97.00..> | 2025-12-29 18:03 | 593K | |
| p5-SNMP-MIB-Compiler..> | 2025-12-22 16:37 | 24K | |
| p5-SNMP-Persist-0.05..> | 2025-12-20 06:45 | 6.4K | |
| p5-SNMP-Simple-0.02_..> | 2025-12-27 21:47 | 6.8K | |
| p5-SNMP-Trapinfo-1.0..> | 2025-12-22 00:20 | 9.8K | |
| p5-SNMP-Util-1.8_2.pkg | 2025-12-30 06:12 | 19K | |
| p5-SNMP_Session-1.13..> | 2025-12-18 17:25 | 35K | |
| p5-SOAP-0.28_1.pkg | 2025-12-21 04:35 | 67K | |
| p5-SOAP-Amazon-S3-0...> | 2025-12-23 05:46 | 7.6K | |
| p5-SOAP-Data-Builder..> | 2025-12-19 16:18 | 9.5K | |
| p5-SOAP-Lite-1.27.pkg | 2025-12-18 18:50 | 179K | |
| p5-SOAP-MySOAP-0.023..> | 2025-12-20 00:00 | 2.8K | |
| p5-SOAP-Transport-FT..> | 2025-12-22 14:42 | 3.8K | |
| p5-SOAP-Transport-HT..> | 2025-12-23 10:59 | 6.0K | |
| p5-SOAP-Transport-JA..> | 2025-12-21 09:31 | 6.7K | |
| p5-SOAP-WSDL-3.004_1..> | 2025-12-19 03:02 | 224K | |
| p5-SOAP-XML-Client-2..> | 2025-12-23 07:44 | 19K | |
| p5-SOCKS-0.03_1.pkg | 2025-12-19 22:48 | 9.1K | |
| p5-SPOPS-0.87.pkg | 2025-12-21 03:07 | 399K | |
| p5-SQL-Abstract-2.00..> | 2025-12-18 07:46 | 98K | |
| p5-SQL-Abstract-Clas..> | 2025-12-18 11:05 | 45K | |
| p5-SQL-Abstract-Limi..> | 2025-12-19 00:03 | 16K | |
| p5-SQL-Abstract-More..> | 2025-12-19 22:14 | 40K | |
| p5-SQL-Abstract-Pg-1..> | 2025-12-20 03:39 | 7.1K | |
| p5-SQL-Abstract-Plug..> | 2025-12-19 15:08 | 5.4K | |
| p5-SQL-Interp-1.28.pkg | 2025-12-19 07:34 | 27K | |
| p5-SQL-Maker-1.22_1.pkg | 2025-12-19 08:53 | 30K | |
| p5-SQL-NamedPlacehol..> | 2025-12-19 11:57 | 3.5K | |
| p5-SQL-ReservedWords..> | 2025-12-18 12:50 | 28K | |
| p5-SQL-SplitStatemen..> | 2025-12-19 01:27 | 29K | |
| p5-SQL-Statement-1.4..> | 2025-12-18 19:38 | 152K | |
| p5-SQL-Tokenizer-0.2..> | 2025-12-21 06:58 | 4.9K | |
| p5-SQL-Translator-1...> | 2025-12-18 18:50 | 345K | |
| p5-SQLite-Work-0.16...> | 2025-12-20 13:56 | 49K | |
| p5-SRU-1.01_1.pkg | 2025-12-21 17:30 | 41K | |
| p5-SSN-Validate-0.18..> | 2025-12-21 03:27 | 10K | |
| p5-STF-Dispatcher-PS..> | 2025-12-23 03:06 | 16K | |
| p5-SUPER-1.20190531.pkg | 2025-12-18 17:56 | 6.6K | |
| p5-SVG-2.87.pkg | 2025-12-19 02:39 | 55K | |
| p5-SVG-DOM2-1.00_2.pkg | 2025-12-21 16:32 | 17K | |
| p5-SVG-Graph-0.04_1.pkg | 2025-12-22 13:18 | 38K | |
| p5-SVG-Metadata-0.28..> | 2025-12-27 20:31 | 25K | |
| p5-SVG-Parser-1.03_1..> | 2025-12-19 03:40 | 17K | |
| p5-SVN-ACL-0.02_7.pkg | 2025-12-22 13:16 | 4.1K | |
| p5-SVN-Access-0.11_1..> | 2025-12-20 00:35 | 15K | |
| p5-SVN-Agent-0.04_4.pkg | 2025-12-20 11:00 | 4.8K | |
| p5-SVN-Dump-0.08.pkg | 2025-12-18 22:51 | 20K | |
| p5-SVN-Dumpfile-0.13..> | 2025-12-21 18:46 | 35K | |
| p5-SVN-Hook-0.28_1.pkg | 2025-12-22 12:37 | 8.1K | |
| p5-SVN-Hooks-1.36_1.pkg | 2025-12-22 12:24 | 59K | |
| p5-SVN-Log-0.03_7.pkg | 2025-12-19 20:33 | 7.0K | |
| p5-SVN-Look-0.43_1.pkg | 2025-12-19 05:02 | 9.0K | |
| p5-SVN-Mirror-0.75_4..> | 2025-12-18 20:37 | 23K | |
| p5-SVN-Notify-2.87.pkg | 2025-12-20 02:02 | 72K | |
| p5-SVN-Notify-Config..> | 2025-12-20 07:20 | 6.1K | |
| p5-SVN-Notify-Filter..> | 2025-12-23 06:24 | 6.7K | |
| p5-SVN-Notify-Filter..> | 2025-12-21 10:47 | 6.3K | |
| p5-SVN-Notify-Filter..> | 2025-12-21 18:51 | 4.0K | |
| p5-SVN-Notify-Filter..> | 2025-12-22 03:53 | 5.9K | |
| p5-SVN-Notify-Mirror..> | 2025-12-20 18:02 | 23K | |
| p5-SVN-Notify-Snapsh..> | 2025-12-21 20:27 | 10K | |
| p5-SVN-S4-1.062_1.pkg | 2025-12-22 13:55 | 77K | |
| p5-SVN-Simple-0.28_4..> | 2025-12-18 17:21 | 7.0K | |
| p5-SVN-Statistics-0...> | 2025-12-29 03:20 | 3.5K | |
| p5-SVN-Web-0.63_4.pkg | 2025-12-21 09:22 | 116K | |
| p5-SWF-Builder-0.16_..> | 2025-12-19 18:11 | 84K | |
| p5-SWF-Chart-1.4_1.pkg | 2025-12-20 20:59 | 11K | |
| p5-SWF-File-0.42_2,1..> | 2025-12-19 02:02 | 51K | |
| p5-Safe-Hole-0.13_1.pkg | 2025-12-21 02:05 | 12K | |
| p5-Safe-Isa-1.000010..> | 2025-12-18 02:39 | 5.6K | |
| p5-Sah-0.9.51.pkg | 2025-12-23 12:11 | 72K | |
| p5-Samba-LDAP-0.05_2..> | 2025-12-23 16:35 | 36K | |
| p5-Samba-SIDhelper-0..> | 2025-12-23 20:11 | 4.9K | |
| p5-Sane-0.05_1.pkg | 2025-12-21 21:58 | 25K | |
| p5-Scalar-Defer-0.23..> | 2025-12-18 16:35 | 7.4K | |
| p5-Scalar-Does-0.203..> | 2025-12-19 02:14 | 19K | |
| p5-Scalar-List-Utils..> | 2025-12-18 01:35 | 51K | |
| p5-Scalar-Listify-0...> | 2025-12-18 08:38 | 3.8K | |
| p5-Scalar-String-0.0..> | 2025-12-18 13:43 | 11K | |
| p5-Scalar-Util-Looks..> | 2025-12-18 19:10 | 4.8K | |
| p5-Scalar-Util-Numer..> | 2025-12-19 15:16 | 8.2K | |
| p5-Scalar-Util-Numer..> | 2025-12-20 01:31 | 3.8K | |
| p5-Schedule-At-1.15_..> | 2025-12-23 01:32 | 7.3K | |
| p5-Schedule-Cron-1.0..> | 2025-12-23 16:15 | 28K | |
| p5-Schedule-Cron-Eve..> | 2025-12-19 12:36 | 13K | |
| p5-Schedule-Load-3.0..> | 2025-12-23 23:55 | 92K | |
| p5-Schedule-Match-0...> | 2025-12-20 11:15 | 9.7K | |
| p5-Scope-Container-0..> | 2025-12-19 10:33 | 3.8K | |
| p5-Scope-Container-D..> | 2025-12-20 14:45 | 5.6K | |
| p5-Scope-Guard-0.21.pkg | 2025-12-18 10:17 | 4.6K | |
| p5-Scope-Upper-0.34.pkg | 2025-12-18 12:50 | 36K | |
| p5-Scrappy-0.9411209..> | 2025-12-23 15:07 | 64K | |
| p5-Script-isAperlScr..> | 2025-12-19 17:12 | 5.2K | |
| p5-Search-Elasticsea..> | 2025-12-19 15:48 | 235K | |
| p5-Search-Elasticsea..> | 2025-12-20 08:56 | 56K | |
| p5-Search-Elasticsea..> | 2025-12-24 03:38 | 72K | |
| p5-Search-Elasticsea..> | 2025-12-21 01:16 | 75K | |
| p5-Search-Elasticsea..> | 2025-12-21 05:02 | 75K | |
| p5-Search-Elasticsea..> | 2025-12-23 18:44 | 114K | |
| p5-Search-Elasticsea..> | 2025-12-23 16:25 | 129K | |
| p5-Search-Estraier-0..> | 2025-12-21 03:36 | 32K | |
| p5-Search-InvertedIn..> | 2025-12-22 05:21 | 53K | |
| p5-Search-Namazu-0.9..> | 2025-12-20 05:00 | 15K | |
| p5-Search-Odeum-0.02..> | 2025-12-22 19:28 | 16K | |
| p5-Search-QueryParse..> | 2025-12-19 12:55 | 11K | |
| p5-Search-QueryParse..> | 2025-12-20 23:16 | 14K | |
| p5-Search-Sitemap-2...> | 2025-12-21 14:09 | 30K | |
| p5-Search-VectorSpac..> | 2025-12-30 12:31 | 6.7K | |
| p5-Search-Xapian-1.2..> | 2025-12-20 03:13 | 163K | |
| p5-Selenium-Remote-D..> | 2025-12-21 10:01 | 766K | |
| p5-Sendmail-AccessDB..> | 2025-12-21 06:59 | 7.9K | |
| p5-Sendmail-Milter-0..> | 2025-12-21 23:40 | 31K | |
| p5-Sendmail-PMilter-..> | 2025-12-23 09:01 | 37K | |
| p5-Senna-0.51_5.pkg | 2025-12-27 18:34 | 47K | |
| p5-Sentinel-0.07.pkg | 2025-12-18 17:37 | 8.7K | |
| p5-Sepia-0.992_30.pkg | 2025-12-28 12:39 | 75K | |
| p5-Sepia-emacs_canna..> | 2025-12-29 15:25 | 75K | |
| p5-Sepia-emacs_devel..> | 2025-12-28 11:21 | 75K | |
| p5-Sepia-emacs_devel..> | 2025-12-22 12:37 | 75K | |
| p5-Sepia-emacs_nox-0..> | 2025-12-20 15:17 | 75K | |
| p5-Sepia-emacs_wayla..> | 2025-12-29 01:29 | 75K | |
| p5-Sereal-5.004.pkg | 2025-12-18 20:12 | 6.3K | |
| p5-Sereal-Decoder-5...> | 2025-12-18 18:34 | 96K | |
| p5-Sereal-Encoder-5...> | 2025-12-18 16:27 | 96K | |
| p5-Server-Starter-0...> | 2025-12-18 18:55 | 12K | |
| p5-Session-Storage-S..> | 2025-12-19 20:33 | 13K | |
| p5-Session-Token-1.5..> | 2025-12-18 20:20 | 26K | |
| p5-Set-Array-0.30_1.pkg | 2025-12-19 12:03 | 22K | |
| p5-Set-ConsistentHas..> | 2025-12-20 09:07 | 7.3K | |
| p5-Set-Crontab-1.03_..> | 2025-12-18 20:51 | 4.2K | |
| p5-Set-CrossProduct-..> | 2025-12-18 11:57 | 11K | |
| p5-Set-Infinite-0.65..> | 2025-12-18 03:53 | 37K | |
| p5-Set-IntSpan-1.19_..> | 2025-12-18 13:40 | 22K | |
| p5-Set-IntSpan-Fast-..> | 2025-12-19 03:44 | 16K | |
| p5-Set-NestedGroups-..> | 2025-12-19 11:01 | 9.1K | |
| p5-Set-Object-1.43.pkg | 2025-12-18 07:49 | 35K | |
| p5-Set-Partition-0.0..> | 2025-12-21 05:54 | 6.6K | |
| p5-Set-Scalar-1.29.pkg | 2025-12-18 10:10 | 24K | |
| p5-Set-Tiny-0.06.pkg | 2025-12-24 03:47 | 7.6K | |
| p5-Set-Window-1.01_1..> | 2025-12-21 05:23 | 6.9K | |
| p5-Shell-Base-0.05_1..> | 2025-12-22 10:29 | 24K | |
| p5-Shell-Command-0.0..> | 2025-12-18 23:22 | 3.2K | |
| p5-Shell-Config-Gene..> | 2025-12-18 11:25 | 12K | |
| p5-Shell-EnvImporter..> | 2025-12-22 15:03 | 18K | |
| p5-Shell-GetEnv-0.10..> | 2025-12-18 23:14 | 14K | |
| p5-Shell-Guess-0.10.pkg | 2025-12-18 07:44 | 9.2K | |
| p5-Shell-Parser-0.04..> | 2025-12-18 19:54 | 9.0K | |
| p5-Shell-Perl-0.0040..> | 2025-12-18 20:41 | 19K | |
| p5-Shell-Source-0.01..> | 2025-12-22 21:51 | 4.5K | |
| p5-ShipIt-0.60_1.pkg | 2025-12-19 23:17 | 35K | |
| p5-ShipIt-Step-Manif..> | 2025-12-20 19:48 | 3.6K | |
| p5-Shout-2.1_2.pkg | 2025-12-22 10:28 | 20K | |
| p5-Signal-Mask-0.008..> | 2025-12-18 12:50 | 5.2K | |
| p5-Sisimai-5.5.0.pkg | 2025-12-19 17:25 | 344K | |
| p5-Slurp-0.4_1.pkg | 2025-12-20 23:33 | 3.8K | |
| p5-Smart-Comments-1...> | 2025-12-18 17:31 | 18K | |
| p5-Snort-Rule-1.07_1..> | 2025-12-19 18:21 | 6.8K | |
| p5-Socket-2.040.pkg | 2025-12-24 04:49 | 33K | |
| p5-Socket-Class-2.25..> | 2025-12-21 10:50 | 103K | |
| p5-Socket-GetAddrInf..> | 2025-12-18 07:01 | 26K | |
| p5-Socket-Multicast6..> | 2025-12-18 19:11 | 10K | |
| p5-Socket-Netlink-0...> | 2025-12-20 15:16 | 29K | |
| p5-Socket6-0.29.pkg | 2025-12-18 11:01 | 17K | |
| p5-Software-License-..> | 2025-12-18 23:43 | 116K | |
| p5-Software-License-..> | 2025-12-23 00:04 | 47K | |
| p5-Solr-0.03_1.pkg | 2025-12-21 04:00 | 13K | |
| p5-Sort-ArbBiLex-4.0..> | 2025-12-21 00:04 | 23K | |
| p5-Sort-Array-0.26_1..> | 2025-12-21 19:45 | 7.4K | |
| p5-Sort-ArrayOfArray..> | 2025-12-23 12:38 | 6.9K | |
| p5-Sort-Fields-1.003..> | 2025-12-22 03:26 | 6.9K | |
| p5-Sort-Key-1.33_2.pkg | 2025-12-19 00:01 | 32K | |
| p5-Sort-Key-DateTime..> | 2025-12-23 12:32 | 4.0K | |
| p5-Sort-Key-IPv4-0.0..> | 2025-12-23 07:14 | 9.3K | |
| p5-Sort-Key-Top-0.08..> | 2025-12-22 05:00 | 17K | |
| p5-Sort-Maker-0.06_1..> | 2025-12-18 20:24 | 28K | |
| p5-Sort-Naturally-1...> | 2025-12-18 12:47 | 11K | |
| p5-Sort-Sub-0.121.pkg | 2025-12-18 22:59 | 55K | |
| p5-Sort-Tree-1.09_1.pkg | 2025-12-23 17:56 | 9.3K | |
| p5-Sort-Versions-1.6..> | 2025-12-18 11:08 | 5.5K | |
| p5-Specio-0.53.pkg | 2025-12-18 01:46 | 120K | |
| p5-Sphinx-Config-0.1..> | 2025-12-19 20:19 | 12K | |
| p5-Sphinx-Manager-0...> | 2025-12-23 06:45 | 9.4K | |
| p5-Sphinx-Search-0.3..> | 2025-12-23 23:55 | 30K | |
| p5-Spiffy-0.46_1.pkg | 2025-12-18 15:54 | 20K | |
| p5-Spoon-0.24_2.pkg | 2025-12-21 07:39 | 36K | |
| p5-Spreadsheet-Gener..> | 2025-12-18 20:31 | 6.5K | |
| p5-Spreadsheet-Parse..> | 2025-12-18 12:28 | 101K | |
| p5-Spreadsheet-Parse..> | 2025-12-27 18:46 | 19K | |
| p5-Spreadsheet-Read-..> | 2025-12-28 10:46 | 53K | |
| p5-Spreadsheet-ReadG..> | 2025-12-20 00:28 | 21K | |
| p5-Spreadsheet-ReadS..> | 2025-12-27 05:25 | 28K | |
| p5-Spreadsheet-Write..> | 2025-12-19 20:16 | 475K | |
| p5-Spreadsheet-Write..> | 2025-12-21 16:07 | 12K | |
| p5-Spreadsheet-Write..> | 2025-12-23 01:49 | 7.7K | |
| p5-Spreadsheet-Write..> | 2025-12-20 20:42 | 127K | |
| p5-Spreadsheet-XLSX-..> | 2025-12-19 06:59 | 19K | |
| p5-SpringGraph-0.05_..> | 2025-12-27 16:04 | 11K | |
| p5-Squatting-0.83.pkg | 2025-12-19 20:50 | 59K | |
| p5-Squatting-On-PSGI..> | 2025-12-20 19:46 | 3.2K | |
| p5-Starlet-0.31.pkg | 2025-12-19 00:12 | 11K | |
| p5-Starlink-AST-1.05..> | 2025-12-21 08:19 | 1.5M | |
| p5-Starman-0.4017.pkg | 2025-12-18 22:52 | 20K | |
| p5-Stat-lsMode-0.51.pkg | 2025-12-21 07:42 | 6.4K | |
| p5-Statistics-Basic-..> | 2025-12-19 23:46 | 53K | |
| p5-Statistics-Benfor..> | 2025-12-21 05:16 | 6.4K | |
| p5-Statistics-CaseRe..> | 2025-12-19 21:37 | 19K | |
| p5-Statistics-ChiSqu..> | 2025-12-18 07:47 | 17K | |
| p5-Statistics-Contin..> | 2025-12-19 04:20 | 9.2K | |
| p5-Statistics-Descri..> | 2025-12-18 17:35 | 50K | |
| p5-Statistics-Descri..> | 2025-12-22 20:49 | 14K | |
| p5-Statistics-Distri..> | 2025-12-18 17:35 | 7.3K | |
| p5-Statistics-Foreca..> | 2025-12-23 15:49 | 4.7K | |
| p5-Statistics-Freque..> | 2025-12-22 14:23 | 2.9K | |
| p5-Statistics-LTU-2...> | 2025-12-20 06:13 | 18K | |
| p5-Statistics-LineFi..> | 2025-12-24 06:58 | 14K | |
| p5-Statistics-Lite-3..> | 2025-12-24 03:38 | 6.0K | |
| p5-Statistics-OLS-0...> | 2025-12-23 05:05 | 11K | |
| p5-Statistics-R-0.34..> | 2025-12-29 14:04 | 18K | |
| p5-Statistics-Regres..> | 2025-12-18 10:04 | 12K | |
| p5-Statistics-TTest-..> | 2025-12-18 23:19 | 10K | |
| p5-Storable-3.25.pkg | 2025-12-20 02:11 | 68K | |
| p5-Storable-AMF-1.00..> | 2025-12-22 01:12 | 29K | |
| p5-Store-CouchDB-4.3..> | 2025-12-22 16:50 | 14K | |
| p5-Stream-1.00_1.pkg | 2025-12-19 02:36 | 3.9K | |
| p5-Stream-Buffered-0..> | 2025-12-18 03:53 | 3.8K | |
| p5-Stream-Reader-0.0..> | 2025-12-23 10:57 | 8.6K | |
| p5-String-Approx-3.2..> | 2025-12-18 12:03 | 27K | |
| p5-String-BufferStac..> | 2025-12-18 17:56 | 8.2K | |
| p5-String-CRC32-2.10..> | 2025-12-18 10:19 | 7.7K | |
| p5-String-CamelCase-..> | 2025-12-18 16:13 | 4.0K | |
| p5-String-Checker-0...> | 2025-12-19 16:40 | 7.5K | |
| p5-String-Compare-Co..> | 2025-12-19 02:05 | 9.9K | |
| p5-String-Diff-0.11.pkg | 2025-12-19 17:00 | 6.0K | |
| p5-String-Divert-0.9..> | 2025-12-20 18:00 | 15K | |
| p5-String-Dump-0.09_..> | 2025-12-21 03:07 | 9.8K | |
| p5-String-Ediff-0.09..> | 2025-12-19 16:25 | 12K | |
| p5-String-Errf-0.007..> | 2025-12-18 10:54 | 8.7K | |
| p5-String-Escape-201..> | 2025-12-18 19:33 | 14K | |
| p5-String-Flogger-1...> | 2025-12-18 18:39 | 4.8K | |
| p5-String-Format-1.1..> | 2025-12-18 23:38 | 6.9K | |
| p5-String-Formatter-..> | 2025-12-18 07:43 | 16K | |
| p5-String-Fraction-0..> | 2025-12-21 16:15 | 3.0K | |
| p5-String-HexConvert..> | 2025-12-19 04:56 | 3.3K | |
| p5-String-Interpolat..> | 2025-12-21 12:51 | 10K | |
| p5-String-KeyboardDi..> | 2025-12-21 13:19 | 8.6K | |
| p5-String-Koremutake..> | 2025-12-18 19:07 | 4.9K | |
| p5-String-LCSS-1.00.pkg | 2025-12-22 06:36 | 3.9K | |
| p5-String-LRC-1.01_2..> | 2025-12-20 03:51 | 9.4K | |
| p5-String-MkPasswd-0..> | 2025-12-23 10:39 | 9.3K | |
| p5-String-Multibyte-..> | 2025-12-22 10:45 | 42K | |
| p5-String-Pad-0.021.pkg | 2025-12-18 19:27 | 5.0K | |
| p5-String-Parity-1.3..> | 2025-12-20 00:46 | 4.6K | |
| p5-String-Print-1.02..> | 2025-12-26 10:01 | 32K | |
| p5-String-Random-0.3..> | 2025-12-18 11:52 | 11K | |
| p5-String-RewritePre..> | 2025-12-18 10:16 | 4.7K | |
| p5-String-RexxParse-..> | 2025-12-24 04:47 | 11K | |
| p5-String-Scanf-2.1_..> | 2025-12-20 15:33 | 5.6K | |
| p5-String-ShellQuote..> | 2025-12-18 12:40 | 9.4K | |
| p5-String-ShowDiff-0..> | 2025-12-20 19:30 | 6.4K | |
| p5-String-Similarity..> | 2025-12-23 21:27 | 9.7K | |
| p5-String-Strip-1.02..> | 2025-12-22 04:49 | 7.7K | |
| p5-String-TT-0.03_1.pkg | 2025-12-19 11:40 | 5.8K | |
| p5-String-Tagged-0.2..> | 2025-12-18 15:54 | 27K | |
| p5-String-Tagged-Ter..> | 2025-12-18 22:46 | 11K | |
| p5-String-ToIdentifi..> | 2025-12-18 12:46 | 8.5K | |
| p5-String-Tokenizer-..> | 2025-12-18 20:11 | 12K | |
| p5-String-Trim-0.005..> | 2025-12-23 04:58 | 5.2K | |
| p5-String-Truncate-1..> | 2025-12-19 02:37 | 7.4K | |
| p5-String-TtyLength-..> | 2025-12-18 18:00 | 4.5K | |
| p5-String-Urandom-0...> | 2025-12-21 20:20 | 6.8K | |
| p5-String-Util-1.35.pkg | 2025-12-18 17:37 | 10K | |
| p5-Struct-Dumb-0.16.pkg | 2025-12-18 11:14 | 11K | |
| p5-Sub-Alias-1.0.0.pkg | 2025-12-21 20:51 | 5.0K | |
| p5-Sub-Current-0.03.pkg | 2025-12-23 03:07 | 5.1K | |
| p5-Sub-Delete-1.0000..> | 2025-12-18 11:08 | 4.8K | |
| p5-Sub-Exporter-0.99..> | 2025-12-18 00:41 | 45K | |
| p5-Sub-Exporter-ForM..> | 2025-12-18 01:49 | 5.3K | |
| p5-Sub-Exporter-Glob..> | 2025-12-18 15:21 | 4.9K | |
| p5-Sub-Exporter-Lexi..> | 2025-12-21 08:47 | 6.1K | |
| p5-Sub-Exporter-Prog..> | 2025-12-18 00:44 | 4.7K | |
| p5-Sub-HandlesVia-0...> | 2025-12-18 12:36 | 113K | |
| p5-Sub-Identify-0.14..> | 2025-12-18 01:27 | 7.4K | |
| p5-Sub-Infix-0.004_1..> | 2025-12-18 18:24 | 5.1K | |
| p5-Sub-Info-0.002.pkg | 2025-12-24 07:31 | 4.8K | |
| p5-Sub-Install-0.929..> | 2025-12-18 00:23 | 7.6K | |
| p5-Sub-Installer-0.0..> | 2025-12-22 00:36 | 6.4K | |
| p5-Sub-Multi-0.003_1..> | 2025-12-20 05:43 | 3.9K | |
| p5-Sub-Name-0.28,1.pkg | 2025-12-18 04:18 | 8.1K | |
| p5-Sub-Override-0.12..> | 2025-12-18 11:20 | 9.6K | |
| p5-Sub-Prototype-0.0..> | 2025-12-19 03:16 | 5.4K | |
| p5-Sub-Quote-2.00600..> | 2025-12-18 01:35 | 18K | |
| p5-Sub-Signatures-0...> | 2025-12-22 14:24 | 13K | |
| p5-Sub-Uplevel-0.280..> | 2025-12-18 06:12 | 9.3K | |
| p5-Sub-WrapPackages-..> | 2025-12-21 03:16 | 12K | |
| p5-Subtitles-1.04_1.pkg | 2025-12-23 10:57 | 18K | |
| p5-Sudo-0.33_1.pkg | 2025-12-22 12:37 | 8.7K | |
| p5-Switch-2.17_1.pkg | 2025-12-18 15:42 | 16K | |
| p5-Symbol-Get-0.08.pkg | 2025-12-18 17:58 | 4.3K | |
| p5-Symbol-Global-Nam..> | 2025-12-18 20:22 | 3.6K | |
| p5-Symbol-Util-0.020..> | 2025-12-22 14:33 | 9.7K | |
| p5-Syntax-Highlight-..> | 2025-12-23 14:25 | 357K | |
| p5-Syntax-Highlight-..> | 2025-12-19 15:37 | 8.3K | |
| p5-Syntax-Highlight-..> | 2025-12-18 19:06 | 31K | |
| p5-Syntax-Highlight-..> | 2025-12-19 08:29 | 7.3K | |
| p5-Syntax-Keyword-De..> | 2025-12-22 14:55 | 12K | |
| p5-Syntax-Keyword-Dy..> | 2025-12-18 12:04 | 11K | |
| p5-Syntax-Keyword-Ga..> | 2025-12-19 22:57 | 6.9K | |
| p5-Syntax-Keyword-Ju..> | 2025-12-18 17:07 | 14K | |
| p5-Syntax-Keyword-Ma..> | 2025-12-19 00:04 | 18K | |
| p5-Syntax-Keyword-Tr..> | 2025-12-18 07:33 | 22K | |
| p5-Sys-CPU-0.61.pkg | 2025-12-20 02:41 | 5.6K | |
| p5-Sys-CpuLoad-0.32.pkg | 2025-12-21 12:55 | 7.3K | |
| p5-Sys-Filesystem-1...> | 2025-12-23 20:32 | 39K | |
| p5-Sys-Gamin-0.1_3.pkg | 2025-12-20 10:33 | 17K | |
| p5-Sys-Group-GIDhelp..> | 2025-12-18 17:31 | 4.3K | |
| p5-Sys-HostIP-1.9.3_..> | 2025-12-18 18:41 | 7.2K | |
| p5-Sys-Hostname-FQDN..> | 2025-12-24 05:08 | 9.3K | |
| p5-Sys-Hostname-Long..> | 2025-12-18 08:37 | 8.1K | |
| p5-Sys-Info-0.7811.pkg | 2025-12-23 22:42 | 4.9K | |
| p5-Sys-Info-Base-0.7..> | 2025-12-18 23:01 | 24K | |
| p5-Sys-Info-Driver-B..> | 2025-12-20 03:05 | 11K | |
| p5-Sys-Load-0.2_1.pkg | 2025-12-23 12:13 | 6.5K | |
| p5-Sys-MemInfo-0.99.pkg | 2025-12-19 14:18 | 7.0K | |
| p5-Sys-Mmap-0.20.pkg | 2025-12-19 05:34 | 14K | |
| p5-Sys-RunAlone-0.13..> | 2025-12-21 21:30 | 6.6K | |
| p5-Sys-RunAlways-0.0..> | 2025-12-22 03:05 | 4.9K | |
| p5-Sys-Sendfile-0.19..> | 2025-12-23 07:53 | 6.5K | |
| p5-Sys-Sendfile-Free..> | 2025-12-18 19:51 | 7.2K | |
| p5-Sys-Sig-0.05_1.pkg | 2025-12-23 19:13 | 4.4K | |
| p5-Sys-SigAction-0.2..> | 2025-12-18 13:08 | 14K | |
| p5-Sys-Syscall-0.25_..> | 2025-12-18 13:55 | 6.1K | |
| p5-Sys-Syslog-0.36.pkg | 2025-12-23 14:11 | 29K | |
| p5-Sys-Trace-0.03_1.pkg | 2025-12-20 05:29 | 12K | |
| p5-Sys-User-UIDhelpe..> | 2025-12-18 17:50 | 4.3K | |
| p5-Sys-Virt-11.10.0.pkg | 2025-12-22 10:23 | 266K | |
| p5-Sysadm-Install-0...> | 2025-12-19 17:37 | 22K | |
| p5-SyslogScan-0.32_3..> | 2025-12-22 09:16 | 52K | |
| p5-System-Command-1...> | 2025-12-18 17:56 | 19K | |
| p5-System-Info-0.058..> | 2025-12-22 13:02 | 36K | |
| p5-System-Sub-0.1628..> | 2025-12-19 16:55 | 12K | |
| p5-System2-0.85.1.pkg | 2025-12-22 04:35 | 6.3K | |
| p5-T2-0.10_3.pkg | 2025-12-21 04:35 | 45K | |
| p5-TAP-Formatter-JUn..> | 2025-12-22 13:47 | 16K | |
| p5-TAP-Harness-JUnit..> | 2025-12-23 10:56 | 9.0K | |
| p5-TAP-SimpleOutput-..> | 2025-12-20 09:25 | 8.9K | |
| p5-TFTP-1.0.pkg | 2025-12-19 16:39 | 7.5K | |
| p5-TOML-0.97.pkg | 2025-12-19 14:01 | 5.3K | |
| p5-TOML-Parser-0.91_..> | 2025-12-18 21:56 | 7.4K | |
| p5-Tail-Stat-0.26.pkg | 2025-12-24 04:15 | 36K | |
| p5-Taint-Runtime-0.0..> | 2025-12-21 13:16 | 13K | |
| p5-Taint-Util-0.08_2..> | 2025-12-21 10:35 | 9.0K | |
| p5-Tangram-2.12.pkg | 2025-12-18 20:33 | 186K | |
| p5-Task-Catalyst-4.0..> | 2025-12-21 07:43 | 4.4K | |
| p5-Task-Math-Symboli..> | 2025-12-20 04:27 | 3.2K | |
| p5-Task-Plack-0.28.pkg | 2025-12-20 11:03 | 4.5K | |
| p5-Task-Tiny-0.002.pkg | 2025-12-21 08:24 | 3.3K | |
| p5-Task-Weaken-1.06.pkg | 2025-12-18 03:23 | 4.6K | |
| p5-Tatsumaki-0.1013_..> | 2025-12-21 18:52 | 13K | |
| p5-Tcl-1.53.pkg | 2025-12-23 18:44 | 39K | |
| p5-TeX-Encode-2.010.pkg | 2025-12-19 07:02 | 20K | |
| p5-TeX-Hyphen-1.18.pkg | 2025-12-23 05:11 | 26K | |
| p5-Tee-0.14_2.pkg | 2025-12-23 13:46 | 9.0K | |
| p5-Template-Alloy-1...> | 2025-12-19 10:47 | 155K | |
| p5-Template-AutoFilt..> | 2025-12-24 07:26 | 8.5K | |
| p5-Template-DBI-2.65..> | 2025-12-22 13:56 | 17K | |
| p5-Template-Declare-..> | 2025-12-18 23:17 | 61K | |
| p5-Template-Extract-..> | 2025-12-19 04:18 | 23K | |
| p5-Template-GD-2.66_..> | 2025-12-19 00:13 | 42K | |
| p5-Template-Iterator..> | 2025-12-20 22:17 | 4.7K | |
| p5-Template-Magic-1...> | 2025-12-20 21:20 | 71K | |
| p5-Template-Multilin..> | 2025-12-23 04:04 | 9.9K | |
| p5-Template-Mustache..> | 2025-12-23 21:01 | 34K | |
| p5-Template-Plugin-A..> | 2025-12-23 07:43 | 5.9K | |
| p5-Template-Plugin-C..> | 2025-12-20 06:58 | 3.1K | |
| p5-Template-Plugin-C..> | 2025-12-20 01:56 | 3.5K | |
| p5-Template-Plugin-C..> | 2025-12-19 03:02 | 4.1K | |
| p5-Template-Plugin-C..> | 2025-12-19 10:34 | 4.7K | |
| p5-Template-Plugin-C..> | 2025-12-21 18:47 | 3.1K | |
| p5-Template-Plugin-D..> | 2025-12-20 20:44 | 5.2K | |
| p5-Template-Plugin-F..> | 2025-12-20 13:36 | 3.2K | |
| p5-Template-Plugin-F..> | 2025-12-20 23:16 | 3.3K | |
| p5-Template-Plugin-F..> | 2025-12-23 04:58 | 3.3K | |
| p5-Template-Plugin-F..> | 2025-12-20 09:51 | 3.4K | |
| p5-Template-Plugin-F..> | 2025-12-20 14:51 | 3.5K | |
| p5-Template-Plugin-G..> | 2025-12-23 10:26 | 18K | |
| p5-Template-Plugin-H..> | 2025-12-18 19:46 | 3.5K | |
| p5-Template-Plugin-J..> | 2025-12-22 13:32 | 4.1K | |
| p5-Template-Plugin-J..> | 2025-12-19 16:38 | 3.1K | |
| p5-Template-Plugin-L..> | 2025-12-23 07:31 | 7.5K | |
| p5-Template-Plugin-M..> | 2025-12-22 02:17 | 5.9K | |
| p5-Template-Plugin-M..> | 2025-12-23 15:22 | 2.8K | |
| p5-Template-Plugin-M..> | 2025-12-22 04:21 | 3.2K | |
| p5-Template-Plugin-N..> | 2025-12-19 14:55 | 6.4K | |
| p5-Template-Plugin-S..> | 2025-12-20 07:22 | 4.5K | |
| p5-Template-Plugin-S..> | 2025-12-19 05:55 | 6.7K | |
| p5-Template-Plugin-V..> | 2025-12-23 05:19 | 7.3K | |
| p5-Template-Plugin-X..> | 2025-12-23 21:36 | 3.1K | |
| p5-Template-Plugin-Y..> | 2025-12-23 14:21 | 4.0K | |
| p5-Template-Provider..> | 2025-12-23 04:46 | 4.7K | |
| p5-Template-Provider..> | 2025-12-19 22:37 | 7.6K | |
| p5-Template-Provider..> | 2025-12-21 05:10 | 5.4K | |
| p5-Template-Semantic..> | 2025-12-23 11:02 | 20K | |
| p5-Template-Simple-0..> | 2025-12-22 05:40 | 17K | |
| p5-Template-Stash-Au..> | 2025-12-22 22:53 | 5.6K | |
| p5-Template-Timer-1...> | 2025-12-18 18:35 | 4.6K | |
| p5-Template-Tiny-1.1..> | 2025-12-18 17:20 | 8.2K | |
| p5-Template-Toolkit-..> | 2025-12-18 13:41 | 479K | |
| p5-Template-Toolkit-..> | 2025-12-19 13:14 | 9.1K | |
| p5-Teng-0.34.pkg | 2025-12-22 23:19 | 51K | |
| p5-Tenjin-1.000001.pkg | 2025-12-22 03:32 | 31K | |
| p5-Term-ANSIColor-5...> | 2025-12-19 00:05 | 32K | |
| p5-Term-ANSIScreen-1..> | 2025-12-21 10:14 | 11K | |
| p5-Term-Animation-2...> | 2025-12-19 09:53 | 24K | |
| p5-Term-App-Roles-0...> | 2025-12-18 20:42 | 7.3K | |
| p5-Term-App-Util-Col..> | 2025-12-18 14:24 | 5.3K | |
| p5-Term-App-Util-Int..> | 2025-12-18 12:08 | 4.2K | |
| p5-Term-App-Util-Siz..> | 2025-12-18 17:20 | 5.2K | |
| p5-Term-Bash-Complet..> | 2025-12-18 21:37 | 9.4K | |
| p5-Term-CallEditor-1..> | 2025-12-19 11:19 | 11K | |
| p5-Term-Choose-1.777..> | 2025-12-18 12:29 | 38K | |
| p5-Term-Choose-LineF..> | 2025-12-18 10:10 | 11K | |
| p5-Term-Choose-Util-..> | 2025-12-18 14:41 | 16K | |
| p5-Term-Clui-1.76.pkg | 2025-12-19 16:25 | 29K | |
| p5-Term-Detect-Softw..> | 2025-12-18 13:57 | 9.5K | |
| p5-Term-EditLine-0.1..> | 2025-12-20 08:16 | 19K | |
| p5-Term-Encoding-0.0..> | 2025-12-18 21:33 | 3.2K | |
| p5-Term-Form-0.562.pkg | 2025-12-18 22:33 | 18K | |
| p5-Term-Menus-3.041.pkg | 2025-12-23 09:07 | 68K | |
| p5-Term-ProgressBar-..> | 2025-12-18 12:12 | 20K | |
| p5-Term-ProgressBar-..> | 2025-12-18 17:49 | 3.2K | |
| p5-Term-ProgressBar-..> | 2025-12-18 20:20 | 5.8K | |
| p5-Term-Prompt-1.04_..> | 2025-12-19 23:36 | 13K | |
| p5-Term-QRCode-0.01_..> | 2025-12-28 01:13 | 3.9K | |
| p5-Term-Query-2.0_1.pkg | 2025-12-21 08:12 | 24K | |
| p5-Term-RawInput-1.2..> | 2025-12-19 05:10 | 5.8K | |
| p5-Term-ReadKey-2.38..> | 2025-12-18 07:13 | 18K | |
| p5-Term-ReadLine-1.1..> | 2025-12-20 04:07 | 9.7K | |
| p5-Term-ReadLine-Gnu..> | 2025-12-18 20:31 | 77K | |
| p5-Term-ReadLine-Per..> | 2025-12-18 14:37 | 38K | |
| p5-Term-ReadLine-TTY..> | 2025-12-22 06:34 | 40K | |
| p5-Term-ReadLine-Zoi..> | 2025-12-22 17:35 | 48K | |
| p5-Term-ReadPassword..> | 2025-12-19 01:37 | 8.5K | |
| p5-Term-Screen-1.06.pkg | 2025-12-18 23:24 | 9.8K | |
| p5-Term-ScreenColor-..> | 2025-12-20 00:02 | 11K | |
| p5-Term-Shell-0.13.pkg | 2025-12-19 09:05 | 27K | |
| p5-Term-ShellUI-0.92..> | 2025-12-19 11:39 | 40K | |
| p5-Term-Size-0.211.pkg | 2025-12-18 12:02 | 8.3K | |
| p5-Term-Size-Any-0.0..> | 2025-12-18 18:05 | 4.5K | |
| p5-Term-Size-Perl-0...> | 2025-12-18 11:33 | 5.2K | |
| p5-Term-Sk-0.18.pkg | 2025-12-18 18:01 | 11K | |
| p5-Term-Table-0.025.pkg | 2025-12-18 19:25 | 25K | |
| p5-Term-TablePrint-0..> | 2025-12-19 17:07 | 18K | |
| p5-Term-TermKey-0.19..> | 2025-12-19 17:16 | 29K | |
| p5-Term-Title-0.09.pkg | 2025-12-19 14:47 | 5.1K | |
| p5-Term-UI-0.50.pkg | 2025-12-19 02:18 | 16K | |
| p5-Term-VT102-0.91_1..> | 2025-12-19 00:03 | 27K | |
| p5-Term-VT102-Boundl..> | 2025-12-19 23:36 | 4.0K | |
| p5-Term-Visual-0.08_..> | 2025-12-20 11:17 | 22K | |
| p5-Test-API-0.010.pkg | 2025-12-19 14:00 | 6.6K | |
| p5-Test-Able-0.11_1.pkg | 2025-12-19 16:52 | 28K | |
| p5-Test-Able-Runner-..> | 2025-12-21 03:35 | 8.4K | |
| p5-Test-Aggregate-0...> | 2025-12-21 12:22 | 29K | |
| p5-Test-Archive-Liba..> | 2025-12-23 16:43 | 5.6K | |
| p5-Test-Assertions-1..> | 2025-12-20 10:33 | 25K | |
| p5-Test-Auto-0.14.pkg | 2025-12-20 06:03 | 11K | |
| p5-Test-Base-0.89.pkg | 2025-12-19 01:10 | 28K | |
| p5-Test-Benchmark-0...> | 2025-12-23 07:41 | 6.4K | |
| p5-Test-BinaryData-0..> | 2025-12-23 19:23 | 8.2K | |
| p5-Test-Bits-0.02_1.pkg | 2025-12-23 14:16 | 4.9K | |
| p5-Test-CPAN-Meta-0...> | 2025-12-23 12:23 | 13K | |
| p5-Test-CPAN-Meta-YA..> | 2025-12-19 23:10 | 13K | |
| p5-Test-CPANfile-0.0..> | 2025-12-19 17:17 | 5.9K | |
| p5-Test-CheckDeps-0...> | 2025-12-24 04:33 | 4.2K | |
| p5-Test-CheckManifes..> | 2025-12-19 20:45 | 7.2K | |
| p5-Test-Class-0.52_1..> | 2025-12-18 17:23 | 43K | |
| p5-Test-Class-Most-0..> | 2025-12-24 01:44 | 7.4K | |
| p5-Test-ClassAPI-1.0..> | 2025-12-19 12:11 | 8.1K | |
| p5-Test-Classy-0.11.pkg | 2025-12-21 20:05 | 14K | |
| p5-Test-CleanNamespa..> | 2025-12-20 10:49 | 6.1K | |
| p5-Test-Cmd-1.09.pkg | 2025-12-19 15:47 | 33K | |
| p5-Test-Command-0.11..> | 2025-12-23 04:58 | 11K | |
| p5-Test-Command-Simp..> | 2025-12-20 08:39 | 7.0K | |
| p5-Test-Compile-3.3...> | 2025-12-20 04:36 | 12K | |
| p5-Test-Corpus-Audio..> | 2025-12-20 19:09 | 23K | |
| p5-Test-Cukes-0.11_1..> | 2025-12-20 07:57 | 7.4K | |
| p5-Test-DBIC-Expecte..> | 2025-12-23 16:57 | 13K | |
| p5-Test-DBIx-Class-0..> | 2025-12-22 10:29 | 74K | |
| p5-Test-Data-1.248.pkg | 2025-12-21 21:27 | 14K | |
| p5-Test-Database-1.1..> | 2025-12-21 05:40 | 39K | |
| p5-Test-DatabaseRow-..> | 2025-12-22 10:28 | 27K | |
| p5-Test-Debugger-0.1..> | 2025-12-19 20:56 | 11K | |
| p5-Test-Declare-0.06..> | 2025-12-22 14:59 | 4.1K | |
| p5-Test-Deep-1.205.pkg | 2025-12-18 05:34 | 74K | |
| p5-Test-Deep-Unorder..> | 2025-12-21 06:16 | 5.9K | |
| p5-Test-Dependencies..> | 2025-12-23 05:04 | 8.7K | |
| p5-Test-DependentMod..> | 2025-12-22 07:28 | 11K | |
| p5-Test-DiagINC-0.01..> | 2025-12-23 15:28 | 7.5K | |
| p5-Test-Differences-..> | 2025-12-18 07:19 | 13K | |
| p5-Test-Dir-1.16.pkg | 2025-12-23 21:17 | 8.2K | |
| p5-Test-Distribution..> | 2025-12-20 06:19 | 11K | |
| p5-Test-EOL-1.5_1.pkg | 2025-12-23 19:49 | 6.7K | |
| p5-Test-Email-0.07_2..> | 2025-12-22 13:17 | 11K | |
| p5-Test-Exception-0...> | 2025-12-18 07:03 | 11K | |
| p5-Test-Exit-0.11.pkg | 2025-12-22 09:34 | 4.2K | |
| p5-Test-Expect-0.34.pkg | 2025-12-23 13:36 | 4.7K | |
| p5-Test-ExpectAndChe..> | 2025-12-23 16:16 | 13K | |
| p5-Test-FailWarnings..> | 2025-12-18 16:18 | 5.7K | |
| p5-Test-Fake-HTTPD-0..> | 2025-12-21 09:36 | 5.9K | |
| p5-Test-Fatal-0.017.pkg | 2025-12-19 04:51 | 8.7K | |
| p5-Test-File-1.44.4.pkg | 2025-12-23 03:05 | 14K | |
| p5-Test-File-Content..> | 2025-12-19 16:03 | 7.8K | |
| p5-Test-File-ShareDi..> | 2025-12-18 18:55 | 23K | |
| p5-Test-Filename-0.0..> | 2025-12-23 11:09 | 4.9K | |
| p5-Test-Fixme-0.17.pkg | 2025-12-21 22:56 | 7.9K | |
| p5-Test-Fixture-DBI-..> | 2025-12-20 10:56 | 15K | |
| p5-Test-Fixture-DBIC..> | 2025-12-20 05:51 | 4.1K | |
| p5-Test-Future-IO-Im..> | 2025-12-24 07:13 | 6.0K | |
| p5-Test-Groonga-0.06..> | 2025-12-23 01:32 | 3.5K | |
| p5-Test-Group-0.20.pkg | 2025-12-24 04:22 | 35K | |
| p5-Test-HTTP-0.22.pkg | 2025-12-20 07:14 | 12K | |
| p5-Test-HTTP-LocalSe..> | 2025-12-22 06:32 | 17K | |
| p5-Test-HTTP-Server-..> | 2025-12-18 18:56 | 6.9K | |
| p5-Test-Harness-3.52..> | 2025-12-23 03:27 | 204K | |
| p5-Test-Harness-Stra..> | 2025-12-18 19:07 | 17K | |
| p5-Test-HasVersion-0..> | 2025-12-22 00:35 | 6.3K | |
| p5-Test-HexDifferenc..> | 2025-12-23 15:01 | 9.2K | |
| p5-Test-HexString-0...> | 2025-12-21 05:33 | 4.8K | |
| p5-Test-Identity-0.0..> | 2025-12-23 15:18 | 3.7K | |
| p5-Test-If-0.01_1.pkg | 2025-12-20 17:04 | 3.5K | |
| p5-Test-InDistDir-1...> | 2025-12-22 12:24 | 4.2K | |
| p5-Test-Inline-2.214..> | 2025-12-21 12:52 | 47K | |
| p5-Test-Inter-1.12.pkg | 2025-12-18 16:56 | 37K | |
| p5-Test-JSON-0.11_2.pkg | 2025-12-22 22:44 | 4.9K | |
| p5-Test-Kwalitee-1.2..> | 2025-12-23 13:34 | 11K | |
| p5-Test-LWP-UserAgen..> | 2025-12-18 20:10 | 16K | |
| p5-Test-Lazy-0.061_1..> | 2025-12-23 17:56 | 13K | |
| p5-Test-LeakTrace-0...> | 2025-12-23 03:43 | 23K | |
| p5-Test-LectroTest-0..> | 2025-12-21 04:11 | 62K | |
| p5-Test-Lib-0.003.pkg | 2025-12-23 05:34 | 3.1K | |
| p5-Test-Lives-1.003.pkg | 2025-12-24 05:16 | 3.6K | |
| p5-Test-LoadAllModul..> | 2025-12-19 12:26 | 3.1K | |
| p5-Test-Log-Log4perl..> | 2025-12-19 23:17 | 9.6K | |
| p5-Test-Log4perl-0.1..> | 2025-12-20 16:53 | 9.5K | |
| p5-Test-LongString-0..> | 2025-12-18 17:21 | 8.7K | |
| p5-Test-Manifest-2.0..> | 2025-12-18 17:50 | 8.8K | |
| p5-Test-ManyParams-0..> | 2025-12-22 10:41 | 11K | |
| p5-Test-Memory-Cycle..> | 2025-12-19 08:50 | 5.3K | |
| p5-Test-Metrics-Any-..> | 2025-12-23 19:37 | 4.9K | |
| p5-Test-Mini-1.1.3_1..> | 2025-12-19 23:26 | 27K | |
| p5-Test-Mini-Unit-v1..> | 2025-12-23 07:43 | 8.7K | |
| p5-Test-Mock-Guard-0..> | 2025-12-23 16:11 | 5.3K | |
| p5-Test-Mock-LWP-0.0..> | 2025-12-18 23:27 | 9.5K | |
| p5-Test-Mock-LWP-Dis..> | 2025-12-20 23:04 | 7.2K | |
| p5-Test-Mock-One-0.0..> | 2025-12-21 16:46 | 9.3K | |
| p5-Test-Mock-Redis-0..> | 2025-12-21 00:39 | 13K | |
| p5-Test-MockDateTime..> | 2025-12-24 03:21 | 4.5K | |
| p5-Test-MockModule-0..> | 2025-12-18 22:51 | 11K | |
| p5-Test-MockObject-1..> | 2025-12-18 13:15 | 21K | |
| p5-Test-MockRandom-1..> | 2025-12-20 17:28 | 12K | |
| p5-Test-MockTime-0.1..> | 2025-12-19 03:31 | 5.5K | |
| p5-Test-MockTime-HiR..> | 2025-12-21 11:31 | 3.6K | |
| p5-Test-Modern-0.013..> | 2025-12-21 07:15 | 22K | |
| p5-Test-Module-Used-..> | 2025-12-23 05:10 | 7.3K | |
| p5-Test-Moose-More-0..> | 2025-12-23 12:58 | 19K | |
| p5-Test-More-UTF8-0...> | 2025-12-19 15:03 | 3.4K | |
| p5-Test-Most-0.38.pkg | 2025-12-18 11:16 | 19K | |
| p5-Test-Name-FromLin..> | 2025-12-23 00:27 | 3.1K | |
| p5-Test-Needs-0.0020..> | 2025-12-21 17:06 | 6.6K | |
| p5-Test-Net-LDAP-0.0..> | 2025-12-24 07:23 | 21K | |
| p5-Test-Net-RabbitMQ..> | 2025-12-20 23:15 | 7.9K | |
| p5-Test-Nginx-0.30.pkg | 2025-12-22 04:39 | 90K | |
| p5-Test-NoTabs-1.4.pkg | 2025-12-23 07:24 | 5.9K | |
| p5-Test-NoWarnings-1..> | 2025-12-18 12:45 | 7.9K | |
| p5-Test-Number-Delta..> | 2025-12-19 02:02 | 8.6K | |
| p5-Test-Object-0.08.pkg | 2025-12-20 06:07 | 5.3K | |
| p5-Test-OpenLDAP-0.7..> | 2025-12-23 02:05 | 21K | |
| p5-Test-Output-1.036..> | 2025-12-18 17:47 | 8.7K | |
| p5-Test-POE-Client-T..> | 2025-12-22 14:28 | 12K | |
| p5-Test-POE-Server-T..> | 2025-12-19 00:12 | 12K | |
| p5-Test-Parser-1.9_1..> | 2025-12-29 22:34 | 69K | |
| p5-Test-Perl-Critic-..> | 2025-12-21 08:35 | 11K | |
| p5-Test-PerlTidy-202..> | 2025-12-23 12:10 | 11K | |
| p5-Test-Pod-1.52.pkg | 2025-12-18 22:04 | 6.6K | |
| p5-Test-Pod-Coverage..> | 2025-12-18 23:18 | 7.0K | |
| p5-Test-Pod-Coverage..> | 2025-12-21 11:51 | 6.4K | |
| p5-Test-Pod-Links-0...> | 2025-12-21 06:52 | 9.0K | |
| p5-Test-Portability-..> | 2025-12-23 09:40 | 8.1K | |
| p5-Test-Prereq-2.005..> | 2025-12-22 14:37 | 8.7K | |
| p5-Test-RandomResult..> | 2025-12-20 08:57 | 5.3K | |
| p5-Test-Refcount-0.1..> | 2025-12-23 06:50 | 8.7K | |
| p5-Test-Regexp-20170..> | 2025-12-20 08:58 | 15K | |
| p5-Test-Reporter-1.6..> | 2025-12-19 01:06 | 21K | |
| p5-Test-Reporter-Tra..> | 2025-12-19 06:09 | 6.5K | |
| p5-Test-Requires-0.1..> | 2025-12-19 12:40 | 4.1K | |
| p5-Test-Requires-Git..> | 2025-12-22 04:47 | 6.6K | |
| p5-Test-RequiresInte..> | 2025-12-18 11:29 | 4.0K | |
| p5-Test-Roo-1.004.pkg | 2025-12-23 16:49 | 24K | |
| p5-Test-Script-1.31.pkg | 2025-12-23 16:41 | 10K | |
| p5-Test-Script-Run-0..> | 2025-12-20 02:48 | 8.1K | |
| p5-Test-SharedFork-0..> | 2025-12-18 13:29 | 5.3K | |
| p5-Test-Signature-1...> | 2025-12-22 11:06 | 7.8K | |
| p5-Test-Simple-1.302..> | 2025-12-18 07:01 | 691K | |
| p5-Test-Singleton-1...> | 2025-12-21 17:02 | 4.1K | |
| p5-Test-Snapshot-0.0..> | 2025-12-22 15:48 | 5.4K | |
| p5-Test-Spec-0.54.pkg | 2025-12-22 07:00 | 36K | |
| p5-Test-Spelling-0.2..> | 2025-12-19 10:44 | 11K | |
| p5-Test-Strict-0.54.pkg | 2025-12-20 06:32 | 10K | |
| p5-Test-SubCalls-1.1..> | 2025-12-23 04:08 | 5.1K | |
| p5-Test-Synopsis-0.0..> | 2025-12-20 07:37 | 4.9K | |
| p5-Test-Sys-Info-0.2..> | 2025-12-22 06:46 | 5.4K | |
| p5-Test-TAP-HTMLMatr..> | 2025-12-21 12:56 | 16K | |
| p5-Test-TAP-Model-0...> | 2025-12-19 09:58 | 20K | |
| p5-Test-TCP-2.22.pkg | 2025-12-18 16:27 | 14K | |
| p5-Test-TableDriven-..> | 2025-12-18 20:14 | 5.8K | |
| p5-Test-Taint-1.08.pkg | 2025-12-20 05:41 | 9.8K | |
| p5-Test-TempDir-Tiny..> | 2025-12-22 13:19 | 8.5K | |
| p5-Test-Time-0.092.pkg | 2025-12-22 17:48 | 3.2K | |
| p5-Test-Timer-2.12.pkg | 2025-12-24 07:11 | 14K | |
| p5-Test-TinyMocker-0..> | 2025-12-21 23:48 | 6.2K | |
| p5-Test-Tk-3.04.pkg | 2025-12-26 22:56 | 6.5K | |
| p5-Test-TrailingSpac..> | 2025-12-22 17:10 | 8.4K | |
| p5-Test-Trap-0.3.5.pkg | 2025-12-19 16:50 | 36K | |
| p5-Test-UNIXSock-0.4..> | 2025-12-23 04:11 | 5.4K | |
| p5-Test-URI-1.087.pkg | 2025-12-23 03:49 | 4.3K | |
| p5-Test-Unit-0.27.pkg | 2025-12-22 05:01 | 78K | |
| p5-Test-UseAllModule..> | 2025-12-18 19:06 | 5.0K | |
| p5-Test-Version-2.09..> | 2025-12-21 03:35 | 8.0K | |
| p5-Test-WWW-Declare-..> | 2025-12-22 10:07 | 8.4K | |
| p5-Test-WWW-Mechaniz..> | 2025-12-20 01:55 | 22K | |
| p5-Test-WWW-Mechaniz..> | 2025-12-22 17:10 | 2.9K | |
| p5-Test-WWW-Mechaniz..> | 2025-12-23 20:03 | 6.7K | |
| p5-Test-WWW-Mechaniz..> | 2025-12-20 07:55 | 11K | |
| p5-Test-WWW-Mechaniz..> | 2025-12-24 07:06 | 10K | |
| p5-Test-WWW-Selenium..> | 2025-12-22 15:08 | 52K | |
| p5-Test-Warn-0.37.pkg | 2025-12-18 07:21 | 10K | |
| p5-Test-Warnings-0.0..> | 2025-12-19 23:37 | 15K | |
| p5-Test-Weaken-3.022..> | 2025-12-22 20:49 | 32K | |
| p5-Test-Without-Modu..> | 2025-12-21 19:42 | 4.9K | |
| p5-Test-XML-0.08_1.pkg | 2025-12-21 22:32 | 14K | |
| p5-Test-XML-Valid-0...> | 2025-12-23 05:39 | 3.2K | |
| p5-Test-XPath-0.20.pkg | 2025-12-21 02:03 | 14K | |
| p5-Test-YAML-1.07.pkg | 2025-12-23 15:47 | 4.6K | |
| p5-Test-YAML-Meta-0...> | 2025-12-23 10:21 | 3.4K | |
| p5-Test-YAML-Valid-0..> | 2025-12-18 19:26 | 5.5K | |
| p5-Test-mysqld-1.003..> | 2025-12-23 16:48 | 7.7K | |
| p5-Test-postgresql-0..> | 2025-12-20 08:46 | 6.1K | |
| p5-Test-utf8-1.03.pkg | 2025-12-20 06:47 | 8.0K | |
| p5-Test2-Harness-1.0..> | 2025-12-19 15:43 | 518K | |
| p5-Test2-Harness-UI-..> | 2025-12-21 01:46 | 488K | |
| p5-Test2-Plugin-Cove..> | 2025-12-18 20:08 | 21K | |
| p5-Test2-Plugin-DBIP..> | 2025-12-19 01:34 | 4.0K | |
| p5-Test2-Plugin-IOEv..> | 2025-12-18 23:15 | 5.1K | |
| p5-Test2-Plugin-MemU..> | 2025-12-18 22:58 | 3.7K | |
| p5-Test2-Plugin-NoWa..> | 2025-12-21 11:36 | 6.4K | |
| p5-Test2-Plugin-UUID..> | 2025-12-19 02:04 | 9.0K | |
| p5-Test2-Tools-Expla..> | 2025-12-21 13:11 | 5.8K | |
| p5-Test2-Tools-FFI-0..> | 2025-12-21 21:54 | 11K | |
| p5-Test2-Tools-LoadM..> | 2025-12-21 00:19 | 14K | |
| p5-Test2-Tools-Memor..> | 2025-12-21 07:16 | 4.5K | |
| p5-Test2-Tools-PDL-0..> | 2025-12-29 10:56 | 4.9K | |
| p5-TestGen4Web-Runne..> | 2025-12-21 10:02 | 10K | |
| p5-Text-ANSI-Util-0...> | 2025-12-18 16:32 | 20K | |
| p5-Text-ANSI-WideUti..> | 2025-12-19 00:05 | 6.3K | |
| p5-Text-ANSITable-0...> | 2025-12-19 11:06 | 97K | |
| p5-Text-ASCIIMathML-..> | 2025-12-24 07:23 | 23K | |
| p5-Text-ASCIITable-0..> | 2025-12-18 13:36 | 21K | |
| p5-Text-Affixes-0.09..> | 2025-12-19 08:21 | 5.0K | |
| p5-Text-Aligner-0.16..> | 2025-12-18 10:28 | 9.6K | |
| p5-Text-AsciiTeX-0.0..> | 2025-12-23 19:57 | 24K | |
| p5-Text-Aspell-0.09_..> | 2025-12-19 08:00 | 19K | |
| p5-Text-Authinfo-0.0..> | 2025-12-23 08:15 | 6.5K | |
| p5-Text-Autoformat-1..> | 2025-12-18 08:42 | 27K | |
| p5-Text-Balanced-2.0..> | 2025-12-20 19:48 | 35K | |
| p5-Text-Bastardize-0..> | 2025-12-21 07:44 | 5.0K | |
| p5-Text-BibTeX-0.91.pkg | 2025-12-20 04:24 | 210K | |
| p5-Text-Bidi-2.18.pkg | 2025-12-23 14:46 | 50K | |
| p5-Text-Bind-0.04_1.pkg | 2025-12-22 09:14 | 11K | |
| p5-Text-Brew-0.02_1.pkg | 2025-12-18 19:30 | 6.1K | |
| p5-Text-CSV-2.06.pkg | 2025-12-18 17:30 | 108K | |
| p5-Text-CSV-Encoded-..> | 2025-12-23 00:27 | 18K | |
| p5-Text-CSV-Hashify-..> | 2025-12-22 17:40 | 11K | |
| p5-Text-CSV-Simple-1..> | 2025-12-21 17:26 | 6.7K | |
| p5-Text-CSV_XS-1.61.pkg | 2025-12-18 18:41 | 106K | |
| p5-Text-Capitalize-1..> | 2025-12-23 11:38 | 17K | |
| p5-Text-CharWidth-0...> | 2025-12-18 06:47 | 6.5K | |
| p5-Text-Chomp-0.02_1..> | 2025-12-23 20:46 | 4.5K | |
| p5-Text-Colorizer-0...> | 2025-12-18 20:37 | 12K | |
| p5-Text-Context-3.7_..> | 2025-12-19 12:14 | 7.7K | |
| p5-Text-Context-Eith..> | 2025-12-19 00:17 | 6.0K | |
| p5-Text-DHCPLeases-1..> | 2025-12-24 04:49 | 13K | |
| p5-Text-Decorator-1...> | 2025-12-21 17:04 | 16K | |
| p5-Text-Delimited-2...> | 2025-12-21 17:09 | 7.0K | |
| p5-Text-Diff-1.45.pkg | 2025-12-18 04:34 | 22K | |
| p5-Text-Diff-Formatt..> | 2025-12-23 19:25 | 6.0K | |
| p5-Text-Diff-HTML-0...> | 2025-12-20 00:18 | 5.7K | |
| p5-Text-Diff-Parser-..> | 2025-12-22 15:09 | 9.9K | |
| p5-Text-Diff3-0.10_1..> | 2025-12-21 01:23 | 32K | |
| p5-Text-Distill-0.2.pkg | 2025-12-22 13:17 | 16K | |
| p5-Text-DoubleMetaph..> | 2025-12-23 15:01 | 16K | |
| p5-Text-Emoticon-0.0..> | 2025-12-18 23:49 | 3.1K | |
| p5-Text-Emoticon-Goo..> | 2025-12-23 15:46 | 3.0K | |
| p5-Text-Emoticon-MSN..> | 2025-12-19 12:45 | 4.6K | |
| p5-Text-EtText-2.2_2..> | 2025-12-21 08:36 | 26K | |
| p5-Text-Extract-Word..> | 2025-12-19 17:24 | 8.6K | |
| p5-Text-ExtractWords..> | 2025-12-19 10:44 | 11K | |
| p5-Text-FIGlet-2.19...> | 2025-12-23 19:41 | 55K | |
| p5-Text-FillIn-0.05_..> | 2025-12-24 01:19 | 14K | |
| p5-Text-Filter-1.10_..> | 2025-12-19 16:28 | 16K | |
| p5-Text-Filter-Chain..> | 2025-12-20 05:42 | 5.6K | |
| p5-Text-FindIndent-0..> | 2025-12-22 14:59 | 10K | |
| p5-Text-FixEOL-1.08.pkg | 2025-12-20 23:02 | 13K | |
| p5-Text-FixedLength-..> | 2025-12-19 05:55 | 6.5K | |
| p5-Text-FixedLength-..> | 2025-12-21 03:16 | 5.7K | |
| p5-Text-Flow-0.01_1.pkg | 2025-12-18 21:41 | 9.0K | |
| p5-Text-Flowchart-1...> | 2025-12-21 06:01 | 20K | |
| p5-Text-Flowed-0.14_..> | 2025-12-23 20:58 | 6.1K | |
| p5-Text-Format+NWrap..> | 2025-12-20 06:49 | 15K | |
| p5-Text-Format-0.63.pkg | 2025-12-20 02:20 | 15K | |
| p5-Text-FormatTable-..> | 2025-12-19 07:34 | 6.9K | |
| p5-Text-German-0.06_..> | 2025-12-18 03:52 | 13K | |
| p5-Text-Glob-0.11.pkg | 2025-12-18 06:31 | 4.8K | |
| p5-Text-Graphics-1.0..> | 2025-12-20 07:17 | 8.9K | |
| p5-Text-Greeking-0.1..> | 2025-12-23 00:42 | 6.6K | |
| p5-Text-Greeking-zh_..> | 2025-12-23 16:44 | 8.5K | |
| p5-Text-Haml-0.99011..> | 2025-12-19 11:07 | 15K | |
| p5-Text-Hatena-0.20_..> | 2025-12-20 15:00 | 9.7K | |
| p5-Text-Highlight-0...> | 2025-12-23 07:31 | 48K | |
| p5-Text-HikiDoc-1.02..> | 2025-12-24 04:49 | 13K | |
| p5-Text-Hogan-2.03.pkg | 2025-12-19 15:33 | 15K | |
| p5-Text-Hyphen-0.2,1..> | 2025-12-19 08:39 | 19K | |
| p5-Text-Hyphen-RU-0...> | 2025-12-20 04:53 | 19K | |
| p5-Text-Iconv-1.7_4.pkg | 2025-12-18 07:28 | 11K | |
| p5-Text-LTSV-0.08_1.pkg | 2025-12-23 09:06 | 6.3K | |
| p5-Text-Language-Gue..> | 2025-12-23 19:34 | 7.7K | |
| p5-Text-Levenshtein-..> | 2025-12-22 17:56 | 7.2K | |
| p5-Text-Levenshtein-..> | 2025-12-18 20:11 | 8.7K | |
| p5-Text-Levenshtein-..> | 2025-12-22 10:17 | 7.2K | |
| p5-Text-LevenshteinX..> | 2025-12-21 12:28 | 6.3K | |
| p5-Text-Locus-1.04.pkg | 2025-12-18 14:21 | 7.3K | |
| p5-Text-Lorem-0.34.pkg | 2025-12-23 06:13 | 4.5K | |
| p5-Text-Markdown-1.0..> | 2025-12-19 02:11 | 24K | |
| p5-Text-MarkdownTabl..> | 2025-12-19 23:27 | 5.8K | |
| p5-Text-Match-FastAl..> | 2025-12-22 02:17 | 15K | |
| p5-Text-Metaphone-20..> | 2025-12-19 11:08 | 11K | |
| p5-Text-MicroMason-2..> | 2025-12-20 16:35 | 138K | |
| p5-Text-MicroTemplat..> | 2025-12-19 23:51 | 12K | |
| p5-Text-MicroTemplat..> | 2025-12-21 20:51 | 19K | |
| p5-Text-MultiMarkdow..> | 2025-12-20 02:04 | 23K | |
| p5-Text-MultiMarkdow..> | 2025-12-23 10:59 | 5.0K | |
| p5-Text-NSP-1.31.pkg | 2025-12-22 06:06 | 681K | |
| p5-Text-NeatTemplate..> | 2025-12-20 02:04 | 13K | |
| p5-Text-Netstring-0...> | 2025-12-20 02:51 | 5.3K | |
| p5-Text-Ngram-0.15_1..> | 2025-12-19 07:34 | 9.8K | |
| p5-Text-Ngrams-2.007..> | 2025-12-23 10:21 | 21K | |
| p5-Text-NonWideChar-..> | 2025-12-18 21:51 | 3.9K | |
| p5-Text-Original-1.5..> | 2025-12-21 05:56 | 4.4K | |
| p5-Text-Outdent-0.01..> | 2025-12-18 21:59 | 5.0K | |
| p5-Text-PDF-0.31.pkg | 2025-12-18 10:25 | 75K | |
| p5-Text-Padding-1.11..> | 2025-12-20 08:34 | 4.6K | |
| p5-Text-ParagraphDif..> | 2025-12-22 12:11 | 11K | |
| p5-Text-ParseWords-3..> | 2025-12-18 18:43 | 6.8K | |
| p5-Text-Password-Pro..> | 2025-12-18 23:12 | 5.3K | |
| p5-Text-Patch-1.8_1.pkg | 2025-12-18 17:42 | 6.1K | |
| p5-Text-Pipe-0.10_1.pkg | 2025-12-23 05:31 | 88K | |
| p5-Text-Prefix-XS-0...> | 2025-12-23 19:57 | 19K | |
| p5-Text-QRCode-0.05_..> | 2025-12-27 12:58 | 7.5K | |
| p5-Text-Query-0.09_1..> | 2025-12-19 20:00 | 31K | |
| p5-Text-Query-SQL-0...> | 2025-12-24 03:34 | 17K | |
| p5-Text-Quote-0.33.pkg | 2025-12-19 07:21 | 14K | |
| p5-Text-Quoted-2.10.pkg | 2025-12-19 01:54 | 6.1K | |
| p5-Text-RecordParser..> | 2025-12-18 14:01 | 33K | |
| p5-Text-Reflow-1.17.pkg | 2025-12-18 15:51 | 21K | |
| p5-Text-Reform-1.20_..> | 2025-12-18 07:00 | 30K | |
| p5-Text-Report-1.004..> | 2025-12-23 15:28 | 29K | |
| p5-Text-Repository-1..> | 2025-12-21 04:44 | 8.5K | |
| p5-Text-Roman-3.5.pkg | 2025-12-20 00:31 | 6.9K | |
| p5-Text-Sass-0.97_2.pkg | 2025-12-20 04:05 | 14K | |
| p5-Text-Shellwords-1..> | 2025-12-19 20:45 | 3.6K | |
| p5-Text-Similarity-0..> | 2025-12-19 12:52 | 25K | |
| p5-Text-SimpleTable-..> | 2025-12-18 10:22 | 5.5K | |
| p5-Text-SimpleTable-..> | 2025-12-21 13:18 | 5.8K | |
| p5-Text-SimpleTempla..> | 2025-12-19 10:56 | 8.0K | |
| p5-Text-Soundex-3.05..> | 2025-12-18 13:49 | 11K | |
| p5-Text-SpellChecker..> | 2025-12-21 07:04 | 7.5K | |
| p5-Text-Striphigh-0...> | 2025-12-20 11:13 | 5.5K | |
| p5-Text-Table-1.135.pkg | 2025-12-18 14:17 | 25K | |
| p5-Text-Table-ASV-0...> | 2025-12-20 03:11 | 5.3K | |
| p5-Text-Table-Any-0...> | 2025-12-29 05:23 | 12K | |
| p5-Text-Table-CSV-0...> | 2025-12-19 09:37 | 4.8K | |
| p5-Text-Table-HTML-0..> | 2025-12-19 03:19 | 8.9K | |
| p5-Text-Table-HTML-D..> | 2025-12-19 13:45 | 193K | |
| p5-Text-Table-LTSV-0..> | 2025-12-19 21:45 | 4.7K | |
| p5-Text-Table-Manifo..> | 2025-12-18 23:18 | 20K | |
| p5-Text-Table-More-0..> | 2025-12-19 05:46 | 20K | |
| p5-Text-Table-Org-0...> | 2025-12-20 01:49 | 6.3K | |
| p5-Text-Table-Paragr..> | 2025-12-19 04:38 | 5.2K | |
| p5-Text-Table-Sprint..> | 2025-12-19 12:27 | 8.0K | |
| p5-Text-Table-TSV-0...> | 2025-12-19 05:55 | 4.6K | |
| p5-Text-Table-Tickit..> | 2025-12-27 04:18 | 3.8K | |
| p5-Text-Table-Tiny-1..> | 2025-12-19 16:26 | 9.5K | |
| p5-Text-Table-TinyBo..> | 2025-12-19 09:32 | 6.7K | |
| p5-Text-Table-TinyCo..> | 2025-12-19 20:44 | 4.9K | |
| p5-Text-Table-TinyCo..> | 2025-12-19 11:55 | 5.2K | |
| p5-Text-Table-TinyWi..> | 2025-12-19 15:37 | 4.9K | |
| p5-Text-Table-XLSX-0..> | 2025-12-20 02:38 | 3.8K | |
| p5-Text-Tabs+Wrap-20..> | 2025-12-18 11:52 | 11K | |
| p5-Text-TabularDispl..> | 2025-12-18 11:02 | 9.5K | |
| p5-Text-Tags-0.04_1.pkg | 2025-12-19 14:06 | 9.5K | |
| p5-Text-Template-1.6..> | 2025-12-18 18:24 | 44K | |
| p5-Text-Template-Sim..> | 2025-12-18 17:38 | 69K | |
| p5-Text-TestBase-0.1..> | 2025-12-23 15:38 | 11K | |
| p5-Text-Textile-2.13..> | 2025-12-19 14:50 | 40K | |
| p5-Text-Tmpl-0.33_1.pkg | 2025-12-23 22:28 | 39K | |
| p5-Text-Trac-0.24.pkg | 2025-12-19 00:18 | 13K | |
| p5-Text-Trim-1.04.pkg | 2025-12-18 23:00 | 5.6K | |
| p5-Text-Truncate-1.0..> | 2025-12-19 14:43 | 4.0K | |
| p5-Text-Typography-0..> | 2025-12-20 00:20 | 10K | |
| p5-Text-Unaccent-1.0..> | 2025-12-21 09:21 | 21K | |
| p5-Text-Unaccent-Pur..> | 2025-12-21 11:39 | 55K | |
| p5-Text-UnicodeBox-0..> | 2025-12-20 01:41 | 23K | |
| p5-Text-Unidecode-1...> | 2025-12-16 01:30 | 101K | |
| p5-Text-VimColor-0.2..> | 2025-12-23 05:23 | 28K | |
| p5-Text-VisualWidth-..> | 2025-12-21 03:29 | 11K | |
| p5-Text-WideChar-Uti..> | 2025-12-18 17:42 | 11K | |
| p5-Text-WikiCreole-0..> | 2025-12-22 03:30 | 12K | |
| p5-Text-WikiFormat-0..> | 2025-12-19 00:48 | 19K | |
| p5-Text-WordDiff-0.0..> | 2025-12-18 21:14 | 21K | |
| p5-Text-WrapI18N-0.0..> | 2025-12-18 10:30 | 5.0K | |
| p5-Text-Wrapper-1.05..> | 2025-12-19 02:59 | 7.3K | |
| p5-Text-Xslate-3.4.0..> | 2025-12-18 17:35 | 150K | |
| p5-Text-Xslate-Bridg..> | 2025-12-20 02:01 | 8.3K | |
| p5-Text-sprintfn-0.0..> | 2025-12-18 20:24 | 7.1K | |
| p5-Text-vCard-3.09.pkg | 2025-12-20 02:06 | 33K | |
| p5-Text-vFile-asData..> | 2025-12-18 18:35 | 6.9K | |
| p5-Text-xSV-0.21_1.pkg | 2025-12-20 10:35 | 16K | |
| p5-TheSchwartz-1.12.pkg | 2025-12-20 02:42 | 35K | |
| p5-TheSchwartz-Simpl..> | 2025-12-21 20:04 | 5.2K | |
| p5-TheSchwartz-Worke..> | 2025-12-23 18:10 | 7.2K | |
| p5-Thread-Apartment-..> | 2025-12-21 21:20 | 45K | |
| p5-Thread-Cancel-1.1..> | 2025-12-24 01:03 | 5.1K | |
| p5-Thread-Pool-Simpl..> | 2025-12-22 04:57 | 5.4K | |
| p5-Thread-Queue-3.13..> | 2025-12-21 10:01 | 10K | |
| p5-Thread-Queue-Dupl..> | 2025-12-19 10:54 | 20K | |
| p5-Thread-Suspend-1...> | 2025-12-21 05:14 | 6.4K | |
| p5-Thrift-0.22.0,1.pkg | 2025-12-21 17:21 | 14K | |
| p5-Thrift-XS-1.04_2.pkg | 2025-12-22 10:14 | 45K | |
| p5-Throwable-1.001.pkg | 2025-12-18 13:03 | 11K | |
| p5-Tickit-0.74.pkg | 2025-12-18 14:21 | 120K | |
| p5-Tickit-Widget-Tab..> | 2025-12-26 21:42 | 20K | |
| p5-Tickit-Widgets-0...> | 2025-12-26 18:32 | 95K | |
| p5-Tie-Array-Pack-0...> | 2025-12-22 00:16 | 6.2K | |
| p5-Tie-Array-Sorted-..> | 2025-12-19 01:57 | 6.0K | |
| p5-Tie-CPHash-2.000.pkg | 2025-12-22 14:59 | 7.9K | |
| p5-Tie-Cache-0.21_1.pkg | 2025-12-19 06:15 | 12K | |
| p5-Tie-DBI-1.08.pkg | 2025-12-23 01:28 | 32K | |
| p5-Tie-DB_File-Split..> | 2025-12-19 05:59 | 10K | |
| p5-Tie-DB_FileLock-0..> | 2025-12-20 19:48 | 7.5K | |
| p5-Tie-DNS-1.151560,..> | 2025-12-22 22:43 | 9.8K | |
| p5-Tie-DxHash-1.05_2..> | 2025-12-23 16:32 | 9.4K | |
| p5-Tie-EncryptedHash..> | 2025-12-18 11:33 | 11K | |
| p5-Tie-File-1.07.pkg | 2025-12-18 19:21 | 34K | |
| p5-Tie-File-AsHash-0..> | 2025-12-22 07:04 | 7.5K | |
| p5-Tie-FileLRUCache-..> | 2025-12-20 00:37 | 12K | |
| p5-Tie-Function-0.02..> | 2025-12-18 13:46 | 3.4K | |
| p5-Tie-Handle-Offset..> | 2025-12-18 18:34 | 5.8K | |
| p5-Tie-Hash-Indexed-..> | 2025-12-19 17:17 | 18K | |
| p5-Tie-Hash-MultiVal..> | 2025-12-23 20:53 | 7.2K | |
| p5-Tie-Hash-Regex-1...> | 2025-12-23 04:55 | 4.9K | |
| p5-Tie-Hash-Sorted-0..> | 2025-12-23 10:38 | 7.4K | |
| p5-Tie-Hash-TwoWay-1..> | 2025-12-20 23:32 | 4.8K | |
| p5-Tie-IxHash-1.23_1..> | 2025-12-18 07:49 | 8.6K | |
| p5-Tie-LLHash-1.004.pkg | 2025-12-19 09:03 | 7.2K | |
| p5-Tie-LevelDB-0.07_..> | 2025-12-21 10:34 | 28K | |
| p5-Tie-NetAddr-IP-1...> | 2025-12-20 11:19 | 4.8K | |
| p5-Tie-RefHash-1.41.pkg | 2025-12-21 20:23 | 6.1K | |
| p5-Tie-RefHash-Weak-..> | 2025-12-18 07:13 | 5.7K | |
| p5-Tie-RegexpHash-0...> | 2025-12-22 13:04 | 7.0K | |
| p5-Tie-Restore-0.11_..> | 2025-12-19 16:17 | 3.1K | |
| p5-Tie-ShareLite-0.0..> | 2025-12-23 18:07 | 7.9K | |
| p5-Tie-Simple-1.04.pkg | 2025-12-18 13:21 | 11K | |
| p5-Tie-Sub-1.001.pkg | 2025-12-24 03:50 | 6.4K | |
| p5-Tie-Syslog-2.04.0..> | 2025-12-21 03:15 | 10K | |
| p5-Tie-TinyURL-0.02_..> | 2025-12-20 22:58 | 4.1K | |
| p5-Tie-ToObject-0.03..> | 2025-12-18 07:03 | 3.5K | |
| p5-Tie-Util-0.04.pkg | 2025-12-22 12:04 | 9.1K | |
| p5-Tie-iCal-0.15_1.pkg | 2025-12-22 12:30 | 8.8K | |
| p5-Tiffany-1.01_1.pkg | 2025-12-24 04:47 | 18K | |
| p5-Time-Clock-1.03_1..> | 2025-12-18 12:50 | 9.3K | |
| p5-Time-Crontab-0.04..> | 2025-12-19 03:27 | 4.6K | |
| p5-Time-Duration-1.2..> | 2025-12-18 18:42 | 10K | |
| p5-Time-Duration-Par..> | 2025-12-18 18:34 | 4.4K | |
| p5-Time-Duration-Par..> | 2025-12-18 19:37 | 5.5K | |
| p5-Time-Elapsed-0.34..> | 2025-12-20 02:38 | 14K | |
| p5-Time-Format-1.12_..> | 2025-12-19 03:19 | 22K | |
| p5-Time-HiRes-1.9764..> | 2025-12-19 04:53 | 27K | |
| p5-Time-Human-1.03_1..> | 2025-12-22 03:42 | 5.4K | |
| p5-Time-Interval-1.2..> | 2025-12-24 03:32 | 7.1K | |
| p5-Time-Local-1.35.pkg | 2025-12-21 17:02 | 12K | |
| p5-Time-Mock-0.0.2_1..> | 2025-12-23 07:41 | 6.2K | |
| p5-Time-Moment-0.44.pkg | 2025-12-19 01:27 | 62K | |
| p5-Time-Moment-Role-..> | 2025-12-21 10:52 | 5.1K | |
| p5-Time-Object-1.00_..> | 2025-12-21 02:49 | 18K | |
| p5-Time-Out-1.0.0.pkg | 2025-12-24 01:07 | 6.1K | |
| p5-Time-ParseDate-20..> | 2025-12-20 01:40 | 25K | |
| p5-Time-Period-1.25.pkg | 2025-12-19 10:59 | 11K | |
| p5-Time-Piece-1.41,2..> | 2025-12-18 23:34 | 34K | |
| p5-Time-Piece-MySQL-..> | 2025-12-21 16:36 | 4.5K | |
| p5-Time-Piece-Range-..> | 2025-12-19 22:45 | 3.3K | |
| p5-Time-Progress-2.1..> | 2025-12-18 19:22 | 11K | |
| p5-Time-Stopwatch-1...> | 2025-12-22 08:47 | 6.2K | |
| p5-Time-Warp-0.55.pkg | 2025-12-18 18:38 | 7.4K | |
| p5-Time-modules-2013..> | 2025-12-18 19:36 | 26K | |
| p5-Time-timegm-0.01.pkg | 2025-12-19 06:41 | 5.7K | |
| p5-TimeDate-2.33,1.pkg | 2025-12-18 01:10 | 32K | |
| p5-Tk-804.035_2.pkg | 2025-12-26 17:34 | 1.9M | |
| p5-Tk-Action-1.09339..> | 2025-12-22 17:35 | 4.8K | |
| p5-Tk-Autoscroll-1.1..> | 2025-12-30 09:45 | 6.3K | |
| p5-Tk-Clock-0.41.pkg | 2025-12-30 12:25 | 16K | |
| p5-Tk-ColourChooser-..> | 2025-12-30 01:15 | 8.9K | |
| p5-Tk-Contrib-0.08_1..> | 2025-12-27 17:13 | 16K | |
| p5-Tk-CursorControl-..> | 2025-12-28 02:12 | 15K | |
| p5-Tk-DKW-0.03_6.pkg | 2025-12-30 09:12 | 56K | |
| p5-Tk-Date-0.44_3.pkg | 2025-12-29 12:18 | 20K | |
| p5-Tk-DynaTabFrame-0..> | 2025-12-27 10:44 | 26K | |
| p5-Tk-Enscript-1.10_..> | 2025-12-30 11:06 | 5.6K | |
| p5-Tk-FontDialog-0.1..> | 2025-12-27 02:15 | 12K | |
| p5-Tk-GBARR-2.08_5.pkg | 2025-12-27 15:51 | 20K | |
| p5-Tk-Getopt-0.52.pkg | 2025-12-29 01:19 | 25K | |
| p5-Tk-HistEntry-0.46..> | 2025-12-29 05:09 | 9.3K | |
| p5-Tk-JComboBox-1.14..> | 2025-12-27 14:16 | 63K | |
| p5-Tk-JPEG-Lite-2.01..> | 2025-12-28 14:07 | 14K | |
| p5-Tk-Pod-0.9943.pkg | 2025-12-28 21:12 | 76K | |
| p5-Tk-ResizeButton-0..> | 2025-12-29 16:49 | 5.7K | |
| p5-Tk-Role-Dialog-1...> | 2025-12-28 09:58 | 6.8K | |
| p5-Tk-Role-HasWidget..> | 2025-12-19 09:33 | 4.5K | |
| p5-Tk-Splashscreen-1..> | 2025-12-29 13:19 | 7.1K | |
| p5-Tk-Sugar-1.093190..> | 2025-12-20 01:40 | 6.4K | |
| p5-Tk-TableMatrix-1...> | 2025-12-26 18:11 | 107K | |
| p5-Tk-ToolBar-0.12.pkg | 2025-12-30 14:57 | 57K | |
| p5-Tk-WaitBox-1.3_2.pkg | 2025-12-27 13:08 | 7.6K | |
| p5-Tk-XMLViewer-0.21..> | 2025-12-27 21:40 | 14K | |
| p5-Toader-1.2.1_2.pkg | 2025-12-29 04:02 | 170K | |
| p5-Toadfarm-0.83.pkg | 2025-12-22 14:18 | 38K | |
| p5-TokyoCabinet-1.34..> | 2025-12-21 02:50 | 63K | |
| p5-ToolSet-1.00_1.pkg | 2025-12-22 17:35 | 11K | |
| p5-TraceFuncs-0.1_1.pkg | 2025-12-22 20:45 | 5.7K | |
| p5-Tree-Authz-0.03_1..> | 2025-12-21 16:24 | 17K | |
| p5-Tree-Binary-1.09.pkg | 2025-12-20 00:31 | 44K | |
| p5-Tree-Binary-Dicti..> | 2025-12-23 11:41 | 4.9K | |
| p5-Tree-DAG_Node-1.3..> | 2025-12-18 21:12 | 49K | |
| p5-Tree-Nary-1.30_1,..> | 2025-12-21 21:27 | 12K | |
| p5-Tree-Node-0.08_2.pkg | 2025-12-22 10:44 | 18K | |
| p5-Tree-Parser-0.15_..> | 2025-12-22 19:57 | 16K | |
| p5-Tree-R-0.072.pkg | 2025-12-19 17:06 | 6.2K | |
| p5-Tree-RedBlack-0.5..> | 2025-12-20 10:09 | 8.7K | |
| p5-Tree-Simple-1.34.pkg | 2025-12-18 07:31 | 32K | |
| p5-Tree-Simple-View-..> | 2025-12-19 16:15 | 33K | |
| p5-Tree-Simple-Visit..> | 2025-12-18 10:25 | 61K | |
| p5-Tree-Suffix-0.22.pkg | 2025-12-20 10:37 | 15K | |
| p5-Tree-Trie-1.9.pkg | 2025-12-18 18:25 | 20K | |
| p5-TrimGalore-0.6.10..> | 2025-12-29 16:08 | 23M | |
| p5-Try-Catch-1.1.0.pkg | 2025-12-19 23:58 | 5.4K | |
| p5-Try-Tiny-0.32.pkg | 2025-12-18 00:29 | 17K | |
| p5-Try-Tiny-Retry-0...> | 2025-12-21 16:25 | 8.1K | |
| p5-TryCatch-1.003002..> | 2025-12-23 17:13 | 15K | |
| p5-Twiggy-0.1026.pkg | 2025-12-19 20:19 | 12K | |
| p5-Twiggy-TLS-0.0020..> | 2025-12-23 15:15 | 6.8K | |
| p5-Twitter-API-1.000..> | 2025-12-19 03:02 | 58K | |
| p5-Type-Tiny-2.00800..> | 2025-12-18 06:16 | 363K | |
| p5-Type-Tiny-Signatu..> | 2025-12-23 14:22 | 3.8K | |
| p5-Type-Tiny-XS-0.02..> | 2025-12-18 03:53 | 22K | |
| p5-Type-TinyX-Facets..> | 2025-12-18 21:32 | 8.5K | |
| p5-Types-Core-0.3.2.pkg | 2025-12-23 03:05 | 15K | |
| p5-Types-PDL-0.04.pkg | 2025-12-19 21:42 | 7.3K | |
| p5-Types-Path-Tiny-0..> | 2025-12-18 17:46 | 5.6K | |
| p5-Types-Self-0.002_..> | 2025-12-19 02:27 | 5.9K | |
| p5-Types-Serialiser-..> | 2025-12-18 10:11 | 9.3K | |
| p5-Types-URI-0.007.pkg | 2025-12-18 23:37 | 4.8K | |
| p5-Types-UUID-0.004.pkg | 2025-12-18 18:34 | 4.5K | |
| p5-UDCode-1.03_1.pkg | 2025-12-19 15:52 | 3.8K | |
| p5-UI-Dialog-1.21.pkg | 2025-12-23 12:41 | 110K | |
| p5-UML-Class-Simple-..> | 2025-12-30 01:01 | 26K | |
| p5-UML-Sequence-0.08..> | 2025-12-29 07:09 | 46K | |
| p5-UML-State-0.02_1.pkg | 2025-12-21 12:05 | 21K | |
| p5-UNIVERSAL-can-1.2..> | 2025-12-18 11:20 | 5.4K | |
| p5-UNIVERSAL-isa-1.2..> | 2025-12-18 11:16 | 5.9K | |
| p5-UNIVERSAL-moniker..> | 2025-12-18 14:01 | 3.6K | |
| p5-UNIVERSAL-ref-0.1..> | 2025-12-20 02:11 | 9.0K | |
| p5-UNIVERSAL-require..> | 2025-12-18 10:54 | 6.0K | |
| p5-UNIVERSAL-which-0..> | 2025-12-23 17:37 | 4.3K | |
| p5-URBL-Prepare-0.09..> | 2025-12-19 01:09 | 8.2K | |
| p5-URI-5.34.pkg | 2025-12-16 01:30 | 97K | |
| p5-URI-Based-1.03.pkg | 2025-12-20 15:07 | 4.0K | |
| p5-URI-Encode-0.09_1..> | 2025-12-19 09:38 | 6.5K | |
| p5-URI-Encode-XS-0.1..> | 2025-12-20 02:01 | 9.4K | |
| p5-URI-Escape-JavaSc..> | 2025-12-20 12:49 | 3.9K | |
| p5-URI-Escape-XS-0.1..> | 2025-12-18 18:10 | 12K | |
| p5-URI-Fast-0.55.pkg | 2025-12-21 08:45 | 45K | |
| p5-URI-Fetch-0.130.pkg | 2025-12-19 01:49 | 12K | |
| p5-URI-Find-20160806..> | 2025-12-18 18:41 | 20K | |
| p5-URI-FromHash-0.05..> | 2025-12-18 18:14 | 5.7K | |
| p5-URI-GoogleChart-1..> | 2025-12-21 06:37 | 12K | |
| p5-URI-Match-0.00001..> | 2025-12-19 17:01 | 4.5K | |
| p5-URI-NamespaceMap-..> | 2025-12-24 05:09 | 15K | |
| p5-URI-Nested-0.10.pkg | 2025-12-18 19:46 | 5.6K | |
| p5-URI-Normalize-0.0..> | 2025-12-21 09:46 | 5.2K | |
| p5-URI-OpenURL-0.4.6..> | 2025-12-22 06:13 | 11K | |
| p5-URI-ParseSearchSt..> | 2025-12-22 02:42 | 13K | |
| p5-URI-Query-0.16.pkg | 2025-12-21 13:18 | 9.6K | |
| p5-URI-Sequin-1.2_1.pkg | 2025-12-21 21:55 | 28K | |
| p5-URI-SmartURI-0.03..> | 2025-12-19 12:57 | 9.1K | |
| p5-URI-Template-0.24..> | 2025-12-19 16:42 | 6.3K | |
| p5-URI-Template-Rest..> | 2025-12-19 12:39 | 7.1K | |
| p5-URI-Title-1.904.pkg | 2025-12-20 08:43 | 12K | |
| p5-URI-ToDisk-1.12_2..> | 2025-12-23 11:16 | 6.8K | |
| p5-URI-UTF8-Punycode..> | 2025-12-21 17:02 | 11K | |
| p5-URI-cpan-1.009.pkg | 2025-12-23 05:05 | 11K | |
| p5-URI-db-0.20.pkg | 2025-12-20 02:47 | 16K | |
| p5-URI-imap-1.01_1.pkg | 2025-12-19 00:09 | 2.5K | |
| p5-URI-imaps-1.04.pkg | 2025-12-19 15:09 | 2.4K | |
| p5-URL-Encode-0.03.pkg | 2025-12-18 16:26 | 7.2K | |
| p5-URL-Encode-XS-0.0..> | 2025-12-18 18:01 | 8.7K | |
| p5-URN-OASIS-SAML2-0..> | 2025-12-20 02:41 | 4.3K | |
| p5-UUID-0.37.pkg | 2025-12-20 09:07 | 36K | |
| p5-UUID-Random-0.04_..> | 2025-12-20 03:04 | 2.9K | |
| p5-UUID-Random-Patch..> | 2025-12-21 05:34 | 3.7K | |
| p5-UUID-Tiny-1.04_1.pkg | 2025-12-18 12:09 | 14K | |
| p5-UUID-URandom-0.00..> | 2025-12-18 18:34 | 4.5K | |
| p5-Ubic-1.60.pkg | 2025-12-22 16:39 | 153K | |
| p5-Unicode-CaseFold-..> | 2025-12-18 20:41 | 9.6K | |
| p5-Unicode-CheckUTF8..> | 2025-12-20 17:03 | 7.6K | |
| p5-Unicode-Collate-1..> | 2025-12-21 01:03 | 666K | |
| p5-Unicode-EastAsian..> | 2025-12-16 01:30 | 9.8K | |
| p5-Unicode-Escape-0...> | 2025-12-20 04:26 | 5.8K | |
| p5-Unicode-IMAPUtf7-..> | 2025-12-21 16:36 | 5.8K | |
| p5-Unicode-LineBreak..> | 2025-12-18 03:57 | 103K | |
| p5-Unicode-Map-0.112..> | 2025-12-18 17:23 | 201K | |
| p5-Unicode-Map8-0.13..> | 2025-12-18 17:21 | 47K | |
| p5-Unicode-MapUTF8-1..> | 2025-12-19 02:47 | 11K | |
| p5-Unicode-Normalize..> | 2025-12-18 10:21 | 70K | |
| p5-Unicode-Recursive..> | 2025-12-23 07:35 | 4.2K | |
| p5-Unicode-String-2...> | 2025-12-18 13:46 | 101K | |
| p5-Unicode-Stringpre..> | 2025-12-18 11:59 | 25K | |
| p5-Unicode-Tussle-1...> | 2025-12-21 07:42 | 433K | |
| p5-Unicode-UTF8-0.62..> | 2025-12-19 10:33 | 15K | |
| p5-Unicode-UTF8simpl..> | 2025-12-18 18:33 | 30K | |
| p5-Unicode-Unihan-0...> | 2025-12-19 13:02 | 5.3M | |
| p5-Uniq-0.01_2.pkg | 2025-12-21 20:46 | 4.1K | |
| p5-Unix-ConfigFile-0..> | 2025-12-23 05:38 | 25K | |
| p5-Unix-Groups-0.01.pkg | 2025-12-24 07:22 | 7.9K | |
| p5-Unix-Groups-FFI-1..> | 2025-12-19 11:03 | 5.2K | |
| p5-Unix-Lsof-0.1.0.pkg | 2025-12-20 04:52 | 23K | |
| p5-Unix-Mknod-0.05.pkg | 2025-12-20 12:09 | 11K | |
| p5-Unix-Passwd-File-..> | 2025-12-21 09:45 | 19K | |
| p5-Unix-Processors-2..> | 2025-12-19 02:54 | 12K | |
| p5-Unix-Statgrab-0.1..> | 2025-12-20 16:35 | 80K | |
| p5-Unix-Syslog-1.1_1..> | 2025-12-19 00:00 | 15K | |
| p5-Unix-Uptime-0.370..> | 2025-12-22 13:24 | 12K | |
| p5-Unix-setuid-0.02.pkg | 2025-12-22 17:10 | 4.4K | |
| p5-User-1.9_1.pkg | 2025-12-19 02:58 | 4.3K | |
| p5-User-Identity-4.0..> | 2025-12-26 15:26 | 62K | |
| p5-Util-Any-0.25.pkg | 2025-12-24 05:50 | 19K | |
| p5-VCG-0.5_2.pkg | 2025-12-19 12:52 | 7.0K | |
| p5-VCP-Dest-svk-0.29..> | 2025-12-22 09:24 | 9.1K | |
| p5-VCP-Source-cvsbk-..> | 2025-12-22 11:18 | 5.3K | |
| p5-VCP-autrijus-0.9...> | 2025-12-18 16:24 | 339K | |
| p5-VCS-0.25.pkg | 2025-12-22 05:38 | 25K | |
| p5-VCS-CVS-2.06_1.pkg | 2025-12-22 15:15 | 15K | |
| p5-VCS-Lite-0.12.pkg | 2025-12-20 01:42 | 18K | |
| p5-VM-EC2-1.28_1.pkg | 2025-12-18 16:39 | 619K | |
| p5-VM-EC2-Security-C..> | 2025-12-18 23:27 | 2.9K | |
| p5-VUser-Google-Prov..> | 2025-12-21 07:06 | 32K | |
| p5-Validate-Net-0.6_..> | 2025-12-19 15:14 | 6.2K | |
| p5-Validation-Class-..> | 2025-12-19 23:04 | 231K | |
| p5-Validator-Custom-..> | 2025-12-20 22:11 | 43K | |
| p5-Variable-Disposit..> | 2025-12-18 12:54 | 5.0K | |
| p5-Variable-Eject-0...> | 2025-12-23 12:23 | 4.8K | |
| p5-Variable-Magic-0...> | 2025-12-18 00:46 | 30K | |
| p5-Venus-4.15.pkg | 2025-12-19 14:45 | 500K | |
| p5-Verilog-Perl-3.48..> | 2025-12-23 10:33 | 379K | |
| p5-Version-Next-1.00..> | 2025-12-19 12:38 | 6.0K | |
| p5-Vimana-2010.09303..> | 2025-12-23 15:13 | 52K | |
| p5-Visio-1.010_2.pkg | 2025-12-20 17:56 | 19K | |
| p5-Vroom-0.42.pkg | 2025-12-20 05:43 | 20K | |
| p5-W3C-LinkChecker-4..> | 2025-12-19 08:04 | 33K | |
| p5-W3C-LogValidator-..> | 2025-12-20 11:17 | 43K | |
| p5-WAP-wbxml-1.14_1.pkg | 2025-12-23 20:48 | 47K | |
| p5-WDDX-1.02_2.pkg | 2025-12-22 09:15 | 33K | |
| p5-WWW-2ch-0.07_2.pkg | 2025-12-21 09:23 | 15K | |
| p5-WWW-AtMovies-TV-0..> | 2025-12-21 09:13 | 4.2K | |
| p5-WWW-Babelfish-0.1..> | 2025-12-22 02:17 | 9.1K | |
| p5-WWW-Baseball-NPB-..> | 2025-12-23 19:10 | 5.2K | |
| p5-WWW-BitTorrent-0...> | 2025-12-21 01:03 | 5.7K | |
| p5-WWW-Comic-1.06_2.pkg | 2025-12-21 16:32 | 23K | |
| p5-WWW-Contact-0.51.pkg | 2025-12-23 17:56 | 41K | |
| p5-WWW-Curl-4.17_5.pkg | 2025-12-20 01:04 | 46K | |
| p5-WWW-DHL-0.03_2.pkg | 2025-12-22 03:23 | 4.2K | |
| p5-WWW-Dilbert-1.19_..> | 2025-12-19 03:16 | 5.1K | |
| p5-WWW-Facebook-API-..> | 2025-12-20 11:04 | 105K | |
| p5-WWW-Form-UrlEncod..> | 2025-12-18 03:57 | 7.7K | |
| p5-WWW-FreeProxy-0.0..> | 2025-12-21 20:46 | 9.1K | |
| p5-WWW-GMail-0.07_1.pkg | 2025-12-21 12:21 | 9.0K | |
| p5-WWW-GitHub-Gist-0..> | 2025-12-21 05:57 | 6.8K | |
| p5-WWW-Google-Calcul..> | 2025-12-23 10:18 | 3.6K | |
| p5-WWW-Google-News-0..> | 2025-12-21 23:41 | 7.8K | |
| p5-WWW-Google-News-T..> | 2025-12-22 01:42 | 6.4K | |
| p5-WWW-Google-PageRa..> | 2025-12-22 12:37 | 5.5K | |
| p5-WWW-HatenaDiary-0..> | 2025-12-23 12:03 | 7.4K | |
| p5-WWW-HatenaLogin-0..> | 2025-12-19 16:47 | 5.5K | |
| p5-WWW-HatenaStar-0...> | 2025-12-21 00:36 | 4.1K | |
| p5-WWW-Hotmail-0.10_..> | 2025-12-20 09:00 | 7.6K | |
| p5-WWW-IMDb-0.01_2.pkg | 2025-12-22 07:22 | 7.7K | |
| p5-WWW-Instapaper-Cl..> | 2025-12-22 15:36 | 6.1K | |
| p5-WWW-LongURL-0.05_..> | 2025-12-20 07:52 | 4.1K | |
| p5-WWW-Mechanize-2.1..> | 2025-12-18 07:42 | 88K | |
| p5-WWW-Mechanize-CGI..> | 2025-12-19 17:12 | 4.3K | |
| p5-WWW-Mechanize-Dec..> | 2025-12-21 22:08 | 3.4K | |
| p5-WWW-Mechanize-For..> | 2025-12-19 04:20 | 29K | |
| p5-WWW-Mechanize-GZi..> | 2025-12-19 14:11 | 3.9K | |
| p5-WWW-Mechanize-Met..> | 2025-12-22 03:22 | 4.2K | |
| p5-WWW-Mechanize-Plu..> | 2025-12-19 12:47 | 24K | |
| p5-WWW-Mechanize-Plu..> | 2025-12-22 15:53 | 6.7K | |
| p5-WWW-Mechanize-She..> | 2025-12-24 04:52 | 26K | |
| p5-WWW-Mechanize-Spa..> | 2025-12-22 13:35 | 4.5K | |
| p5-WWW-Mechanize-Tre..> | 2025-12-19 03:38 | 5.5K | |
| p5-WWW-Mediawiki-Cli..> | 2025-12-21 19:09 | 37K | |
| p5-WWW-Mixi-0.50_1.pkg | 2025-12-22 20:36 | 74K | |
| p5-WWW-Mixi-Scraper-..> | 2025-12-20 17:17 | 44K | |
| p5-WWW-Myspace-0.92_..> | 2025-12-21 10:49 | 140K | |
| p5-WWW-NicoVideo-Dow..> | 2025-12-20 06:48 | 4.8K | |
| p5-WWW-NioTV-0.04_2.pkg | 2025-12-23 01:28 | 4.4K | |
| p5-WWW-OAuth-1.003_1..> | 2025-12-18 18:58 | 23K | |
| p5-WWW-OpenSVN-0.1.3..> | 2025-12-24 07:31 | 4.3K | |
| p5-WWW-OpenSearch-0...> | 2025-12-22 14:23 | 19K | |
| p5-WWW-Pastebin-Past..> | 2025-12-18 11:25 | 12K | |
| p5-WWW-Plurk-0.02_3.pkg | 2025-12-20 05:43 | 20K | |
| p5-WWW-Robot-0.026_1..> | 2025-12-23 12:52 | 21K | |
| p5-WWW-RobotRules-6...> | 2025-12-18 02:34 | 10K | |
| p5-WWW-RobotRules-Pa..> | 2025-12-18 22:50 | 4.4K | |
| p5-WWW-Salesforce-0...> | 2025-12-21 10:55 | 27K | |
| p5-WWW-Scraper-ISBN-..> | 2025-12-20 03:03 | 15K | |
| p5-WWW-Scraper-ISBN-..> | 2025-12-21 20:46 | 11K | |
| p5-WWW-Scraper-ISBN-..> | 2025-12-23 21:20 | 5.4K | |
| p5-WWW-Scripter-0.03..> | 2025-12-19 02:31 | 38K | |
| p5-WWW-Scripter-Plug..> | 2025-12-20 21:26 | 12K | |
| p5-WWW-Scripter-Plug..> | 2025-12-19 16:55 | 15K | |
| p5-WWW-Search-2.519.pkg | 2025-12-19 17:38 | 82K | |
| p5-WWW-Search-AltaVi..> | 2025-12-20 23:20 | 35K | |
| p5-WWW-Search-Google..> | 2025-12-20 06:59 | 2.8K | |
| p5-WWW-Search-MSN-0...> | 2025-12-20 21:10 | 4.6K | |
| p5-WWW-Shorten-0rz-0..> | 2025-12-22 05:40 | 3.8K | |
| p5-WWW-Shorten-3.094..> | 2025-12-19 03:01 | 27K | |
| p5-WWW-Shorten-Bitly..> | 2025-12-20 00:24 | 13K | |
| p5-WWW-Shorten-Googl..> | 2025-12-21 20:52 | 4.9K | |
| p5-WWW-Shorten-Yourl..> | 2025-12-23 20:50 | 8.9K | |
| p5-WWW-SourceForge-0..> | 2025-12-23 11:41 | 14K | |
| p5-WWW-Spinn3r-3.007..> | 2025-12-29 22:57 | 12K | |
| p5-WWW-TV-0.14_1.pkg | 2025-12-20 21:24 | 14K | |
| p5-WWW-TWSMS-0.01_1.pkg | 2025-12-24 04:27 | 6.1K | |
| p5-WWW-Telegram-BotA..> | 2025-12-23 19:20 | 14K | |
| p5-WWW-TinySong-1.01..> | 2025-12-22 15:20 | 10K | |
| p5-WWW-Tumblr-5.00_1..> | 2025-12-22 08:57 | 16K | |
| p5-WWW-VenusEnvy-1.1..> | 2025-12-20 02:09 | 5.2K | |
| p5-WWW-WebArchive-0...> | 2025-12-20 06:05 | 9.5K | |
| p5-WWW-Wikipedia-2.0..> | 2025-12-22 03:17 | 12K | |
| p5-WWW-Wordnik-API-0..> | 2025-12-22 15:58 | 11K | |
| p5-WWW-Yandex-TIC-0...> | 2025-12-23 14:24 | 4.8K | |
| p5-WWW-iTunesConnect..> | 2025-12-22 14:06 | 11K | |
| p5-Want-0.29_1.pkg | 2025-12-18 12:11 | 21K | |
| p5-WeakRef-0.01_1.pkg | 2025-12-23 23:06 | 6.1K | |
| p5-Weather-Undergrou..> | 2025-12-22 13:15 | 9.8K | |
| p5-Web-Machine-0.17.pkg | 2025-12-18 19:43 | 44K | |
| p5-Web-Query-1.01.pkg | 2025-12-21 20:01 | 18K | |
| p5-Web-Scraper-0.38.pkg | 2025-12-18 13:10 | 14K | |
| p5-Web-Scraper-Confi..> | 2025-12-18 20:36 | 4.7K | |
| p5-Web-Simple-0.033.pkg | 2025-12-22 07:58 | 52K | |
| p5-Web-oEmbed-0.04_1..> | 2025-12-23 04:40 | 7.0K | |
| p5-WebDAO-2.25.pkg | 2025-12-22 08:43 | 68K | |
| p5-WebDriver-Tiny-0...> | 2025-12-20 17:20 | 14K | |
| p5-WebService-Baseca..> | 2025-12-21 06:25 | 18K | |
| p5-WebService-Blogli..> | 2025-12-19 07:25 | 6.6K | |
| p5-WebService-Buzzur..> | 2025-12-21 11:13 | 12K | |
| p5-WebService-CIA-1...> | 2025-12-23 12:59 | 20K | |
| p5-WebService-Dropbo..> | 2025-12-19 15:09 | 18K | |
| p5-WebService-GData-..> | 2025-12-23 04:09 | 161K | |
| p5-WebService-Google..> | 2025-12-20 15:03 | 19K | |
| p5-WebService-Google..> | 2025-12-23 14:03 | 4.7K | |
| p5-WebService-IMDB-0..> | 2025-12-21 03:16 | 43K | |
| p5-WebService-ISBNDB..> | 2025-12-29 21:26 | 78K | |
| p5-WebService-Linode..> | 2025-12-23 12:38 | 25K | |
| p5-WebService-MovieP..> | 2025-12-22 12:57 | 8.2K | |
| p5-WebService-MusicB..> | 2025-12-19 05:46 | 8.2K | |
| p5-WebService-NoPast..> | 2025-12-20 08:05 | 4.7K | |
| p5-WebService-Prowl-..> | 2025-12-20 16:33 | 9.3K | |
| p5-WebService-Pushov..> | 2025-12-23 19:30 | 9.3K | |
| p5-WebService-Rakute..> | 2025-12-20 22:24 | 11K | |
| p5-WebService-Redmin..> | 2025-12-23 09:35 | 10K | |
| p5-WebService-Simple..> | 2025-12-19 06:57 | 17K | |
| p5-WebService-Techno..> | 2025-12-21 22:09 | 26K | |
| p5-WebService-Valida..> | 2025-12-19 04:48 | 8.6K | |
| p5-WebService-Valida..> | 2025-12-19 04:53 | 13K | |
| p5-WebService-YouTub..> | 2025-12-22 04:48 | 19K | |
| p5-What-1.01_2.pkg | 2025-12-19 13:01 | 8.9K | |
| p5-Woothee-1.10.0.pkg | 2025-12-20 17:26 | 20K | |
| p5-WordNet-QueryData..> | 2025-12-20 00:40 | 16K | |
| p5-WordNet-Similarit..> | 2025-12-20 09:08 | 4.4M | |
| p5-WordPress-XMLRPC-..> | 2025-12-22 19:26 | 19K | |
| p5-Workflow-2.06.pkg | 2025-12-19 14:03 | 173K | |
| p5-X-Tiny-0.22.pkg | 2025-12-18 17:00 | 12K | |
| p5-X11-GUITest-0.28_..> | 2025-12-21 07:32 | 34K | |
| p5-X11-IdleTime-0.09..> | 2025-12-22 15:02 | 5.4K | |
| p5-X11-Protocol-0.56..> | 2025-12-18 21:27 | 84K | |
| p5-X11-Protocol-Othe..> | 2025-12-20 02:20 | 179K | |
| p5-X11-Resolution-0...> | 2025-12-23 05:21 | 4.3K | |
| p5-X11-XCB-0.24.pkg | 2025-12-19 11:51 | 122K | |
| p5-X11-Xlib-0.18_2.pkg | 2025-12-21 12:33 | 160K | |
| p5-X500-DN-0.29_1.pkg | 2025-12-20 03:05 | 7.6K | |
| p5-XML-ApacheFOP-0.0..> | 2025-12-30 06:05 | 9.1K | |
| p5-XML-Atom-0.43.pkg | 2025-12-18 22:29 | 31K | |
| p5-XML-Atom-Ext-Open..> | 2025-12-21 09:10 | 5.3K | |
| p5-XML-Atom-Filter-0..> | 2025-12-22 02:23 | 4.6K | |
| p5-XML-Atom-SimpleFe..> | 2025-12-18 19:31 | 14K | |
| p5-XML-Atom-Stream-0..> | 2025-12-23 15:28 | 6.1K | |
| p5-XML-Atom-Syndicat..> | 2025-12-24 04:34 | 43K | |
| p5-XML-AutoWriter-0...> | 2025-12-18 12:50 | 39K | |
| p5-XML-Bare-0.53_2.pkg | 2025-12-19 14:15 | 35K | |
| p5-XML-CanonicalizeX..> | 2025-12-19 23:02 | 8.0K | |
| p5-XML-Catalog-1.0.3..> | 2025-12-18 21:48 | 6.9K | |
| p5-XML-Clean-1.06_1.pkg | 2025-12-20 06:05 | 5.5K | |
| p5-XML-Code-0.4_1.pkg | 2025-12-21 15:17 | 7.9K | |
| p5-XML-CommonNS-0.06..> | 2025-12-18 17:23 | 5.5K | |
| p5-XML-Compile-1.64.pkg | 2025-12-26 15:39 | 194K | |
| p5-XML-Compile-Cache..> | 2025-12-26 20:12 | 18K | |
| p5-XML-Compile-Dumpe..> | 2025-12-30 07:00 | 7.3K | |
| p5-XML-Compile-SOAP-..> | 2025-12-26 21:07 | 121K | |
| p5-XML-Compile-SOAP-..> | 2025-12-29 19:24 | 9.2K | |
| p5-XML-Compile-SOAP-..> | 2025-12-28 05:02 | 44K | |
| p5-XML-Compile-SOAP-..> | 2025-12-29 22:45 | 14K | |
| p5-XML-Compile-Teste..> | 2025-12-26 21:19 | 7.7K | |
| p5-XML-Compile-WSDL1..> | 2025-12-27 05:26 | 23K | |
| p5-XML-DBMS-1.03_1.pkg | 2025-12-22 15:40 | 20K | |
| p5-XML-DOM-1.46.pkg | 2025-12-18 09:15 | 93K | |
| p5-XML-DOM-Lite-0.16..> | 2025-12-19 14:34 | 31K | |
| p5-XML-DOM-XPath-0.1..> | 2025-12-18 19:31 | 5.6K | |
| p5-XML-DOM2-0.06_2.pkg | 2025-12-23 08:55 | 40K | |
| p5-XML-DOMHandler-1...> | 2025-12-20 16:53 | 5.8K | |
| p5-XML-DT-0.69.pkg | 2025-12-23 19:36 | 24K | |
| p5-XML-DTDParser-2.0..> | 2025-12-19 17:39 | 8.1K | |
| p5-XML-Declare-0.06_..> | 2025-12-20 11:01 | 5.0K | |
| p5-XML-Descent-1.04_..> | 2025-12-19 00:01 | 12K | |
| p5-XML-Directory-1.0..> | 2025-12-23 18:43 | 12K | |
| p5-XML-DoubleEncoded..> | 2025-12-19 00:13 | 4.9K | |
| p5-XML-Driver-HTML-0..> | 2025-12-22 04:57 | 7.3K | |
| p5-XML-Dumper-0.81_1..> | 2025-12-18 22:33 | 13K | |
| p5-XML-Elemental-2.1..> | 2025-12-18 20:13 | 21K | |
| p5-XML-Enc-0.15.pkg | 2025-12-19 16:38 | 10K | |
| p5-XML-Encoding-2.11..> | 2025-12-19 20:50 | 14K | |
| p5-XML-Entities-1.00..> | 2025-12-19 10:32 | 22K | |
| p5-XML-FOAF-0.04_2.pkg | 2025-12-19 12:14 | 8.4K | |
| p5-XML-Fast-0.17.pkg | 2025-12-21 11:40 | 24K | |
| p5-XML-Feed-0.65.pkg | 2025-12-19 16:31 | 23K | |
| p5-XML-Feed-Deduper-..> | 2025-12-23 16:50 | 3.8K | |
| p5-XML-FeedPP-0.95.pkg | 2025-12-19 00:03 | 20K | |
| p5-XML-Filter-Buffer..> | 2025-12-18 07:13 | 4.0K | |
| p5-XML-Filter-DOMFil..> | 2025-12-21 14:14 | 6.6K | |
| p5-XML-Filter-Detect..> | 2025-12-19 21:00 | 8.7K | |
| p5-XML-Filter-Generi..> | 2025-12-21 04:39 | 11K | |
| p5-XML-Filter-Reinde..> | 2025-12-22 08:47 | 6.7K | |
| p5-XML-Filter-SAX1to..> | 2025-12-20 06:54 | 5.1K | |
| p5-XML-Filter-SAXT-0..> | 2025-12-18 19:35 | 4.8K | |
| p5-XML-Filter-XInclu..> | 2025-12-19 03:22 | 4.8K | |
| p5-XML-Filter-XSLT-0..> | 2025-12-19 17:01 | 4.4K | |
| p5-XML-Flow-0.86_1.pkg | 2025-12-19 07:02 | 8.1K | |
| p5-XML-Generator-1.1..> | 2025-12-19 12:54 | 29K | |
| p5-XML-Generator-DBI..> | 2025-12-20 08:51 | 11K | |
| p5-XML-Generator-Per..> | 2025-12-22 21:13 | 18K | |
| p5-XML-Grove-0.46.a_..> | 2025-12-22 19:08 | 40K | |
| p5-XML-Handler-AxPoi..> | 2025-12-23 12:03 | 24K | |
| p5-XML-Handler-Dtd2D..> | 2025-12-22 20:17 | 14K | |
| p5-XML-Handler-Dtd2H..> | 2025-12-19 22:59 | 21K | |
| p5-XML-Handler-HTMLW..> | 2025-12-22 23:31 | 9.1K | |
| p5-XML-Handler-Trees..> | 2025-12-19 11:44 | 11K | |
| p5-XML-Handler-YAWri..> | 2025-12-19 09:09 | 13K | |
| p5-XML-Hash-LX-0.07,..> | 2025-12-19 11:40 | 9.6K | |
| p5-XML-LibXML-2.0210..> | 2025-12-18 06:54 | 275K | |
| p5-XML-LibXML-Cache-..> | 2025-12-20 12:06 | 7.7K | |
| p5-XML-LibXML-Iterat..> | 2025-12-19 06:03 | 15K | |
| p5-XML-LibXML-Pretty..> | 2025-12-22 03:18 | 14K | |
| p5-XML-LibXML-SAX-Ch..> | 2025-12-18 23:17 | 3.3K | |
| p5-XML-LibXML-Simple..> | 2025-12-18 09:03 | 20K | |
| p5-XML-LibXSLT-2.003..> | 2025-12-18 23:37 | 37K | |
| p5-XML-Liberal-0.32.pkg | 2025-12-18 21:43 | 13K | |
| p5-XML-Literal-0.02_..> | 2025-12-21 09:23 | 4.6K | |
| p5-XML-Mini-1.38_1.pkg | 2025-12-22 09:30 | 50K | |
| p5-XML-MyXML-1.08_1,..> | 2025-12-19 13:00 | 18K | |
| p5-XML-Namespace-0.0..> | 2025-12-18 16:34 | 6.7K | |
| p5-XML-NamespaceFact..> | 2025-12-18 11:44 | 4.1K | |
| p5-XML-NamespaceSupp..> | 2025-12-18 02:48 | 10K | |
| p5-XML-Node-0.11_1.pkg | 2025-12-20 04:46 | 6.9K | |
| p5-XML-NodeFilter-0...> | 2025-12-18 19:50 | 11K | |
| p5-XML-OPML-0.26_1.pkg | 2025-12-20 03:05 | 11K | |
| p5-XML-OPML-LibXML-0..> | 2025-12-20 23:20 | 4.3K | |
| p5-XML-Parsepp-0.08.pkg | 2025-12-23 11:08 | 14K | |
| p5-XML-Parser-2.47.pkg | 2025-12-16 01:30 | 150K | |
| p5-XML-Parser-EasyTr..> | 2025-12-20 15:14 | 5.8K | |
| p5-XML-Parser-Lite-0..> | 2025-12-18 12:29 | 7.8K | |
| p5-XML-Parser-Lite-T..> | 2025-12-18 11:09 | 11K | |
| p5-XML-Parser-Style-..> | 2025-12-19 22:51 | 8.4K | |
| p5-XML-Parser-Style-..> | 2025-12-22 15:50 | 7.4K | |
| p5-XML-Pastor-1.0.4_..> | 2025-12-22 04:55 | 165K | |
| p5-XML-Quote-1.02_1.pkg | 2025-12-20 10:30 | 9.5K | |
| p5-XML-RAI-1.3031,2.pkg | 2025-12-22 01:29 | 21K | |
| p5-XML-RPC-2.1.pkg | 2025-12-24 04:53 | 8.1K | |
| p5-XML-RPC-Fast-0.8_..> | 2025-12-24 02:17 | 26K | |
| p5-XML-RSS-1.65.pkg | 2025-12-19 01:58 | 43K | |
| p5-XML-RSS-Feed-2.40..> | 2025-12-19 09:26 | 24K | |
| p5-XML-RSS-JavaScrip..> | 2025-12-22 13:18 | 5.8K | |
| p5-XML-RSS-LibXML-0...> | 2025-12-19 00:00 | 23K | |
| p5-XML-RSS-Liberal-0..> | 2025-12-19 10:35 | 2.8K | |
| p5-XML-RSS-Parser-4...> | 2025-12-19 21:53 | 23K | |
| p5-XML-RSS-SimpleGen..> | 2025-12-19 12:45 | 36K | |
| p5-XML-RSSLite-0.17.pkg | 2025-12-20 05:29 | 8.3K | |
| p5-XML-Reader-0.67.pkg | 2025-12-21 12:55 | 96K | |
| p5-XML-RegExp-0.04_1..> | 2025-12-18 07:19 | 4.3K | |
| p5-XML-Rewrite-0.10_..> | 2025-12-28 12:35 | 23K | |
| p5-XML-Rules-1.16_2.pkg | 2025-12-23 18:20 | 41K | |
| p5-XML-SAX-1.02.pkg | 2025-12-18 03:52 | 42K | |
| p5-XML-SAX-Base-1.09..> | 2025-12-18 02:54 | 19K | |
| p5-XML-SAX-Expat-0.5..> | 2025-12-18 04:33 | 6.8K | |
| p5-XML-SAX-Expat-Inc..> | 2025-12-23 07:31 | 5.5K | |
| p5-XML-SAX-ExpatXS-1..> | 2025-12-22 18:51 | 122K | |
| p5-XML-SAX-Machines-..> | 2025-12-19 07:12 | 66K | |
| p5-XML-SAX-Simple-0...> | 2025-12-20 22:14 | 3.2K | |
| p5-XML-SAX-Writer-0...> | 2025-12-18 10:16 | 16K | |
| p5-XML-SAXDriver-CSV..> | 2025-12-21 10:48 | 5.7K | |
| p5-XML-SAXDriver-Exc..> | 2025-12-22 15:48 | 6.0K | |
| p5-XML-STX-0.43_2.pkg | 2025-12-22 06:32 | 52K | |
| p5-XML-Schematron-1...> | 2025-12-21 16:42 | 14K | |
| p5-XML-SemanticDiff-..> | 2025-12-19 13:01 | 16K | |
| p5-XML-Sig-0.66.pkg | 2025-12-20 03:04 | 20K | |
| p5-XML-Simple-2.25.pkg | 2025-12-18 07:05 | 61K | |
| p5-XML-SimpleObject-..> | 2025-12-18 22:38 | 6.8K | |
| p5-XML-SimpleObject-..> | 2025-12-22 14:58 | 10K | |
| p5-XML-Smart-1.79_1.pkg | 2025-12-21 04:34 | 69K | |
| p5-XML-Stream-1.24.pkg | 2025-12-18 18:01 | 50K | |
| p5-XML-Tiny-2.07.pkg | 2025-12-20 01:34 | 12K | |
| p5-XML-TinyXML-0.34_..> | 2025-12-22 12:11 | 56K | |
| p5-XML-TokeParser-0...> | 2025-12-18 16:24 | 12K | |
| p5-XML-Toolkit-0.15_..> | 2025-12-23 00:04 | 41K | |
| p5-XML-TreeBuilder-5..> | 2025-12-20 04:22 | 12K | |
| p5-XML-TreePP-0.43.pkg | 2025-12-18 16:22 | 16K | |
| p5-XML-Twig-3.54.pkg | 2025-12-26 13:47 | 175K | |
| p5-XML-Validate-1.02..> | 2025-12-20 17:50 | 22K | |
| p5-XML-Validator-Sch..> | 2025-12-19 12:14 | 44K | |
| p5-XML-WBXML-0.09_3.pkg | 2025-12-20 22:25 | 7.5K | |
| p5-XML-Writer-0.900.pkg | 2025-12-18 11:02 | 19K | |
| p5-XML-XBEL-1.4_1.pkg | 2025-12-23 09:47 | 24K | |
| p5-XML-XML2JSON-0.06..> | 2025-12-19 20:47 | 9.5K | |
| p5-XML-XPath-1.48.pkg | 2025-12-18 07:01 | 59K | |
| p5-XML-XPathEngine-0..> | 2025-12-18 04:42 | 28K | |
| p5-XML-XQL-0.68_1.pkg | 2025-12-20 23:21 | 86K | |
| p5-XML-XSLT-0.48_1.pkg | 2025-12-22 01:23 | 28K | |
| p5-XML-XUpdate-LibXM..> | 2025-12-20 23:23 | 14K | |
| p5-XMLRPC-Lite-0.717..> | 2025-12-19 12:14 | 20K | |
| p5-XPC-0.2_2.pkg | 2025-12-21 03:14 | 24K | |
| p5-XS-Object-Magic-0..> | 2025-12-18 20:33 | 13K | |
| p5-XS-Parse-Keyword-..> | 2025-12-18 06:22 | 59K | |
| p5-XS-Parse-Sublike-..> | 2025-12-26 11:47 | 42K | |
| p5-XSLoader-0.24.pkg | 2025-12-20 10:49 | 9.1K | |
| p5-XString-0.005.pkg | 2025-12-18 01:15 | 5.8K | |
| p5-XT-Files-0.002.pkg | 2025-12-19 22:44 | 35K | |
| p5-XTerm-Conf-0.10.pkg | 2025-12-21 14:56 | 12K | |
| p5-XXX-0.38.pkg | 2025-12-18 10:10 | 7.0K | |
| p5-Xapian-1.4.30.0.pkg | 2025-12-19 16:20 | 710K | |
| p5-Xporter-0.1.2_2.pkg | 2025-12-19 12:37 | 7.8K | |
| p5-Xymon-0.01_1.pkg | 2025-12-24 04:54 | 3.3K | |
| p5-Xymon-Client-0.08..> | 2025-12-23 13:37 | 3.7K | |
| p5-Xymon-Server-0.02..> | 2025-12-22 07:27 | 3.3K | |
| p5-YAML-1.31.pkg | 2025-12-18 09:13 | 53K | |
| p5-YAML-AppConfig-0...> | 2025-12-21 01:24 | 12K | |
| p5-YAML-LibYAML-0.90..> | 2025-12-18 07:50 | 65K | |
| p5-YAML-PP-0.39.0.pkg | 2025-12-18 02:36 | 98K | |
| p5-YAML-Shell-0.71.pkg | 2025-12-23 15:19 | 8.5K | |
| p5-YAML-Syck-1.36.pkg | 2025-12-18 12:24 | 65K | |
| p5-YAML-Tiny-1.76.pkg | 2025-12-17 23:29 | 21K | |
| p5-YAML-Tiny-Color-0..> | 2025-12-19 09:33 | 6.0K | |
| p5-YAPE-HTML-1.11_1.pkg | 2025-12-20 08:47 | 22K | |
| p5-YAPE-Regex-4.00_1..> | 2025-12-19 13:13 | 20K | |
| p5-YAPE-Regex-Explai..> | 2025-12-23 00:25 | 8.0K | |
| p5-Yada-Yada-Yada-1...> | 2025-12-23 12:59 | 3.4K | |
| p5-Yahoo-BBAuth-0.50..> | 2025-12-21 06:14 | 7.7K | |
| p5-Yahoo-Search-1.11..> | 2025-12-21 02:32 | 58K | |
| p5-ZML-1.0.0_1.pkg | 2025-12-20 23:23 | 9.6K | |
| p5-ZMQ-FFI-1.17_1.pkg | 2025-12-21 01:16 | 37K | |
| p5-Zen-Koans-0.05_1.pkg | 2025-12-20 06:18 | 41K | |
| p5-Zenoss-1.11_1.pkg | 2025-12-20 12:02 | 78K | |
| p5-Zonemaster-Backen..> | 2025-12-27 02:52 | 68K | |
| p5-Zonemaster-CLI-8...> | 2025-12-28 10:18 | 34K | |
| p5-Zonemaster-Engine..> | 2025-12-26 21:55 | 252K | |
| p5-Zonemaster-GUI-4...> | 2025-12-29 22:25 | 867K | |
| p5-Zonemaster-LDNS-5..> | 2025-12-26 20:16 | 102K | |
| p5-accessors-1.01_1.pkg | 2025-12-19 05:48 | 14K | |
| p5-accessors-fast-0...> | 2025-12-21 21:42 | 6.5K | |
| p5-ack-3.9.0.pkg | 2025-12-21 22:36 | 62K | |
| p5-alias-module-0.00..> | 2025-12-18 21:02 | 4.4K | |
| p5-aliased-0.34.pkg | 2025-12-18 04:17 | 8.8K | |
| p5-arclog-3.04_3.pkg | 2025-12-20 10:46 | 22K | |
| p5-asa-1.03_1.pkg | 2025-12-18 12:49 | 6.7K | |
| p5-asterisk-perl-1.0..> | 2025-12-19 11:49 | 33K | |
| p5-autobox-3.0.2.pkg | 2025-12-18 13:54 | 24K | |
| p5-autobox-Core-1.33..> | 2025-12-18 18:49 | 29K | |
| p5-autobox-Transform..> | 2025-12-19 14:50 | 25K | |
| p5-autodie-2.29.pkg | 2025-12-22 18:50 | 61K | |
| p5-autovivification-..> | 2025-12-19 08:29 | 18K | |
| p5-bareword-filehand..> | 2025-12-18 03:53 | 6.4K | |
| p5-bignum-0.67_1.pkg | 2025-12-21 09:17 | 34K | |
| p5-boolean-0.46.pkg | 2025-12-18 11:03 | 6.1K | |
| p5-bsdconv-11.3.0.pkg | 2025-12-20 08:51 | 11K | |
| p5-capitalization-0...> | 2025-12-18 18:42 | 3.5K | |
| p5-carton-1.0.35.pkg | 2025-12-21 22:33 | 40K | |
| p5-chklinks-3.09_1.pkg | 2025-12-23 19:34 | 12K | |
| p5-common-sense-3.75..> | 2025-12-18 06:40 | 8.0K | |
| p5-constant-1.33.pkg | 2025-12-23 12:24 | 11K | |
| p5-constant-boolean-..> | 2025-12-23 12:58 | 3.8K | |
| p5-constant-def-0.01..> | 2025-12-19 14:45 | 5.5K | |
| p5-constant-defer-6.pkg | 2025-12-18 16:29 | 12K | |
| p5-constant-lexical-..> | 2025-12-18 12:16 | 9.0K | |
| p5-cpan-listchanges-..> | 2025-12-21 03:29 | 5.3K | |
| p5-curry-2.000001.pkg | 2025-12-18 12:52 | 3.8K | |
| p5-dTemplate-2.5_1.pkg | 2025-12-22 13:08 | 27K | |
| p5-dicewaregen-1.4.pkg | 2025-12-22 01:10 | 3.2K | |
| p5-docx2txt-1.4.pkg | 2025-12-23 17:13 | 10K | |
| p5-enum-1.110.pkg | 2025-12-20 03:39 | 8.3K | |
| p5-eperl-2.2.14_1.pkg | 2025-12-20 18:00 | 30K | |
| p5-ex-lib-0.90_1.pkg | 2025-12-18 21:56 | 2.7K | |
| p5-excel2csv-1.07.pkg | 2025-12-21 11:57 | 12K | |
| p5-experimental-0.03..> | 2025-12-19 01:33 | 11K | |
| p5-failures-0.004.pkg | 2025-12-19 15:45 | 13K | |
| p5-feedgnuplot-1.59.pkg | 2025-12-29 06:37 | 39K | |
| p5-forks-0.36_2.pkg | 2025-12-19 07:34 | 83K | |
| p5-github_creator-0...> | 2025-12-23 17:40 | 5.9K | |
| p5-goto-file-0.005.pkg | 2025-12-18 23:16 | 5.0K | |
| p5-iCal-Parser-1.21.pkg | 2025-12-22 09:31 | 10K | |
| p5-indirect-0.39.pkg | 2025-12-18 03:46 | 20K | |
| p5-interface-0.03_1.pkg | 2025-12-20 04:42 | 9.6K | |
| p5-ip2location-perl-..> | 2025-12-23 06:46 | 11K | |
| p5-isa-2.001.pkg | 2025-12-18 14:38 | 5.1K | |
| p5-jQuery-File-Uploa..> | 2025-12-30 09:03 | 27K | |
| p5-jmx4perl-1.11_4.pkg | 2025-12-27 22:49 | 252K | |
| p5-latest-0.03_2.pkg | 2025-12-24 07:05 | 3.3K | |
| p5-ldap2pf-20170424.pkg | 2025-12-21 01:03 | 10K | |
| p5-ldap2pw-20170922.pkg | 2025-12-21 02:13 | 11K | |
| p5-lexical-underscor..> | 2025-12-18 16:23 | 5.1K | |
| p5-lib-abs-0.92_1.pkg | 2025-12-18 17:56 | 5.1K | |
| p5-lib-filter-0.28.1..> | 2025-12-20 10:45 | 17K | |
| p5-libalarm-1.0_2.pkg | 2025-12-23 09:08 | 16K | |
| p5-libapreq2-2.17.pkg | 2025-12-20 00:33 | 86K | |
| p5-libsoldout-0.02_2..> | 2025-12-23 00:34 | 6.3K | |
| p5-libvorbis-0.05_6.pkg | 2025-12-21 07:44 | 12K | |
| p5-libwww-6.81.pkg | 2025-12-18 03:54 | 140K | |
| p5-libxml-0.08_1.pkg | 2025-12-18 07:04 | 59K | |
| p5-libxml-enno-1.02_..> | 2025-12-24 05:23 | 232K | |
| p5-local-lib-2.00002..> | 2025-12-18 07:32 | 51K | |
| p5-match-simple-0.01..> | 2025-12-18 23:19 | 13K | |
| p5-match-simple-XS-0..> | 2025-12-19 00:06 | 7.5K | |
| p5-mem-0.4.7.pkg | 2025-12-18 20:47 | 8.0K | |
| p5-meta-0.015.pkg | 2025-12-18 11:02 | 24K | |
| p5-mixin-0.08.pkg | 2025-12-19 17:39 | 9.3K | |
| p5-mocked-0.09_2.pkg | 2025-12-23 03:42 | 5.6K | |
| p5-multidimensional-..> | 2025-12-18 03:53 | 5.6K | |
| p5-mysql-genocide-0...> | 2025-12-24 05:31 | 9.5K | |
| p5-nagios-plugin-che..> | 2025-12-22 07:32 | 42K | |
| p5-namespace-autocle..> | 2025-12-18 01:50 | 7.8K | |
| p5-namespace-clean-0..> | 2025-12-18 01:34 | 11K | |
| p5-namespace-clean-x..> | 2025-12-20 16:52 | 12K | |
| p5-namespace-sweep-0..> | 2025-12-21 19:35 | 6.3K | |
| p5-openxpki-3.24.2_1..> | 2025-12-22 18:13 | 2.1M | |
| p5-openxpki-clca-1.1..> | 2025-12-23 11:27 | 33K | |
| p5-openxpki-i18n-3.2..> | 2025-12-19 17:27 | 105K | |
| p5-orz-0.13_1.pkg | 2025-12-21 05:57 | 2.6K | |
| p5-pQuery-0.24.pkg | 2025-12-24 07:10 | 21K | |
| p5-parent-0.244.pkg | 2025-12-24 05:50 | 4.2K | |
| p5-perl-ldap-0.6800.pkg | 2025-12-18 15:58 | 288K | |
| p5-pip-1.19_1.pkg | 2025-12-23 11:15 | 15K | |
| p5-plog-0.10.pkg | 2025-12-21 07:24 | 10K | |
| p5-plutil-1.7.pkg | 2025-12-20 07:17 | 6.4K | |
| p5-pod2pdf-0.42_2.pkg | 2025-12-23 20:40 | 14K | |
| p5-podlators-5.01.pkg | 2025-12-19 23:31 | 67K | |
| p5-prefork-1.05.pkg | 2025-12-18 18:42 | 9.4K | |
| p5-qpsmtpd-0.93_3.pkg | 2025-12-23 04:36 | 218K | |
| p5-relative-0.04_1.pkg | 2025-12-21 11:33 | 6.3K | |
| p5-reslog-3.16_3.pkg | 2025-12-22 17:11 | 17K | |
| p5-routines-0.02.pkg | 2025-12-18 11:03 | 6.8K | |
| p5-sdf-2.001_2.pkg | 2025-12-21 12:55 | 504K | |
| p5-self-0.36.pkg | 2025-12-23 09:01 | 7.1K | |
| p5-self-init-0.01_1.pkg | 2025-12-22 10:40 | 4.6K | |
| p5-signatures-0.14.pkg | 2025-12-18 21:33 | 13K | |
| p5-srv2pf-20211010.pkg | 2025-12-22 03:32 | 8.0K | |
| p5-strictures-2.0000..> | 2025-12-18 05:37 | 13K | |
| p5-subatom-0.12.pkg | 2025-12-20 17:05 | 9.3K | |
| p5-subroutines-0.001..> | 2025-12-19 01:58 | 4.2K | |
| p5-subversion-1.14.5..> | 2025-12-18 11:51 | 886K | |
| p5-superclass-0.003.pkg | 2025-12-18 18:34 | 5.0K | |
| p5-syntax-0.004_1.pkg | 2025-12-21 07:15 | 4.5K | |
| p5-tagged-0.40_1.pkg | 2025-12-19 23:37 | 34K | |
| p5-threads-shared-1...> | 2025-12-20 01:51 | 28K | |
| p5-tokyotyrant-1.16_..> | 2025-12-19 17:27 | 22K | |
| p5-transdecoder-5.7...> | 2025-12-21 09:00 | 87K | |
| p5-true-1.0.2.pkg | 2025-12-19 16:55 | 10K | |
| p5-type1inst-0.6.1_7..> | 2025-12-27 15:58 | 21K | |
| p5-uni-perl-0.91_2.pkg | 2025-12-19 05:30 | 3.7K | |
| p5-utf8-all-0.024.pkg | 2025-12-19 15:04 | 8.7K | |
| p5-v6-0.047.pkg | 2025-12-21 16:34 | 61K | |
| p5-version-0.9933.pkg | 2025-12-19 09:10 | 45K | |
| p5-xmltv-0.5.70_1.pkg | 2025-12-26 21:12 | 591K | |
| p8-platform-2.1.0.1_..> | 2025-08-13 11:36 | 62K | |
| p11-kit-0.25.10.pkg | 2025-12-16 01:48 | 651K | |
| p910nd-0.97_2.pkg | 2025-08-20 07:54 | 9.0K | |
| pa-applet-g20181009_..> | 2025-12-30 12:14 | 12K | |
| pa-aspell-0.01.1_1,2..> | 2025-12-23 10:20 | 24K | |
| pa_IN-libreoffice-25..> | 2025-12-27 02:48 | 459K | |
| pacemaker2-2.1.7_6.pkg | 2025-12-29 14:29 | 3.1M | |
| pachi-1.0_8.pkg | 2025-12-23 15:28 | 2.6M | |
| packddir-0.0.6_1.pkg | 2025-08-16 14:46 | 7.6K | |
| packer-1.10.1_17.pkg | 2025-12-24 05:01 | 12M | |
| packetdrill-0.0.2025..> | 2025-12-20 03:03 | 235K | |
| packetq-1.7.3.pkg | 2025-08-21 13:54 | 109K | |
| packit-1.8.1_1.pkg | 2025-08-19 10:19 | 28K | |
| packmol-21.1.4.pkg | 2025-12-27 20:51 | 116K | |
| packmule-1.1_1.pkg | 2025-12-20 23:30 | 11K | |
| packr-2.8.3_33.pkg | 2025-12-20 22:18 | 2.9M | |
| packter-agent-2.5_2.pkg | 2025-12-21 02:07 | 23K | |
| pacman-7.0.0_1.pkg | 2025-12-23 11:08 | 302K | |
| pacman.c-g20251120.pkg | 2025-12-22 16:13 | 81K | |
| pacmanarena-0.15_4.pkg | 2025-12-20 06:47 | 9.9M | |
| pacparser-1.4.6.pkg | 2025-12-21 22:36 | 526K | |
| pacpl-6.1.3_2.pkg | 2025-12-30 05:17 | 64K | |
| padauk-2.8_2.pkg | 2025-12-30 18:17 | 280K | |
| padring-g20210731.pkg | 2025-08-18 18:28 | 89K | |
| pads-1.2_7.pkg | 2025-08-21 09:22 | 102K | |
| padthv1-lv2-1.3.2.pkg | 2025-12-30 08:57 | 355K | |
| paexec-1.1.4_1.pkg | 2025-08-21 05:59 | 121K | |
| pagedgeometry-1.2.0...> | 2025-12-29 01:31 | 173K | |
| pageedit-qt6-1.9.20.pkg | 2025-12-28 10:55 | 580K | |
| pagmo2-2.19.1_7.pkg | 2025-12-26 19:25 | 4.2M | |
| paicc-1.4_1.pkg | 2025-08-17 14:58 | 18K | |
| paje-1.97_13.pkg | 2025-12-27 09:27 | 312K | |
| pal-astronomical-0.9..> | 2025-08-18 07:56 | 66K | |
| paladin-2.0.1_34.pkg | 2025-12-20 13:16 | 798K | |
| palapeli-25.12.0.pkg | 2025-12-27 01:04 | 2.3M | |
| palp-2.21.pkg | 2025-08-19 09:12 | 828K | |
| pam-modules-2.5_1.pkg | 2025-08-17 22:40 | 82K | |
| pam-pgsql-0.7.3.2_2.pkg | 2025-12-23 18:46 | 18K | |
| pam_google_authentic..> | 2025-12-28 10:42 | 38K | |
| pam_helper-1.2.pkg | 2025-08-14 09:15 | 3.3K | |
| pam_howdy-3.0.0.b.20..> | 2025-12-30 09:17 | 17K | |
| pam_jail-0.4_1.pkg | 2025-08-19 17:58 | 5.0K | |
| pam_kde-1.0.pkg | 2025-08-16 13:40 | 895 | |
| pam_krb5-4.11_2.pkg | 2025-08-18 17:35 | 38K | |
| pam_krb5-heimdal-4.1..> | 2025-12-22 06:47 | 38K | |
| pam_krb5-mit-4.11_2.pkg | 2025-12-28 06:59 | 39K | |
| pam_krb5-rh-2.4.13_1..> | 2025-12-22 10:23 | 57K | |
| pam_ldap-186_2.pkg | 2025-08-16 20:02 | 30K | |
| pam_mkhomedir-0.2_1.pkg | 2025-08-14 08:30 | 6.7K | |
| pam_mysql-0.8.2.pkg | 2025-12-21 16:07 | 36K | |
| pam_ocra-1.6_1.pkg | 2025-08-18 01:22 | 22K | |
| pam_p11-0.6.0.pkg | 2025-12-23 15:42 | 16K | |
| pam_pkcs11-0.6.12_1.pkg | 2025-12-20 07:30 | 132K | |
| pam_pwdfile-2.0.pkg | 2025-08-21 20:46 | 4.4K | |
| pam_require-0.7.pkg | 2025-08-17 06:38 | 3.5K | |
| pam_rssh-1.1.0_22.pkg | 2025-12-28 10:54 | 222K | |
| pam_script-1.1.9.pkg | 2025-08-17 15:26 | 23K | |
| pam_search_list-0.1_..> | 2025-08-20 17:49 | 5.9K | |
| pam_ssh_agent_auth-0..> | 2025-08-19 13:59 | 112K | |
| pam_u2f-1.3.0_1.pkg | 2025-12-24 03:53 | 38K | |
| pam_wrapper-1.1.8.pkg | 2025-12-19 04:49 | 37K | |
| pam_xdg-0.8.5.pkg | 2025-08-18 00:57 | 7.7K | |
| pam_yubico-2.27_1.pkg | 2025-12-21 16:56 | 35K | |
| paman-0.9.4_15.pkg | 2025-12-28 10:14 | 60K | |
| pamixer-1.6_3.pkg | 2025-12-29 18:57 | 76K | |
| paml-4.10.9.pkg | 2025-08-16 14:43 | 3.4M | |
| pamtester-0.1.2_1.pkg | 2025-08-16 10:08 | 10K | |
| pan-0.164.pkg | 2025-12-28 21:40 | 1.2M | |
| pancho-9.3.9_1.pkg | 2025-12-23 19:52 | 25K | |
| panda-cclient-201306..> | 2025-08-13 21:31 | 1.2M | |
| panda-imap-20130621_..> | 2025-08-22 03:42 | 532K | |
| pandaresampler-0.2.0..> | 2025-08-16 18:43 | 68K | |
| pandora_agent-6.0.2_..> | 2025-12-21 11:53 | 44K | |
| pandora_console-6.0...> | 2025-12-30 12:04 | 19M | |
| pandora_server-6.0.2..> | 2025-12-29 05:57 | 286K | |
| pango-1.56.4.pkg | 2025-12-24 21:54 | 2.0M | |
| pangolin-0.9.4_1.pkg | 2025-12-27 20:54 | 954K | |
| pangomm-2.46.4.pkg | 2025-12-26 18:46 | 131K | |
| pangomm24-2.56.1.pkg | 2025-12-26 19:58 | 120K | |
| pangox-compat-0.0.2_..> | 2025-12-26 19:33 | 57K | |
| pangzero-1.3_3.pkg | 2025-12-29 10:38 | 3.5M | |
| panicmail-1.1.pkg | 2025-12-24 00:05 | 3.7K | |
| panoglview-0.2.2_10.pkg | 2025-12-28 11:10 | 46K | |
| panomatic-0.9.4_13.pkg | 2025-08-14 22:42 | 435K | |
| pantomime-1.4.0_2.pkg | 2025-12-26 20:22 | 192K | |
| paperkey-1.6_1.pkg | 2025-08-17 14:01 | 26K | |
| papersize-default-a4..> | 2025-08-16 05:22 | 666 | |
| papersize-default-le..> | 2025-08-22 07:09 | 672 | |
| papilio-loader-2.8_2..> | 2025-12-21 23:46 | 35K | |
| papirus-icon-theme-2..> | 2025-08-16 17:19 | 24M | |
| paprefs-1.2_8.pkg | 2025-12-30 02:13 | 59K | |
| paps-0.8.0_4.pkg | 2025-12-30 10:37 | 46K | |
| paq-nvim-2.0.0.pkg | 2025-12-22 14:38 | 14K | |
| par2cmdline-1.0.0.pkg | 2025-08-22 17:57 | 103K | |
| par2cmdline-turbo-1...> | 2025-08-14 22:48 | 314K | |
| par_format-1.53.0_3.pkg | 2025-08-18 04:13 | 27K | |
| parafly-0.1.0_9,1.pkg | 2025-08-18 04:37 | 15K | |
| paraget-0.3.0_3.pkg | 2025-12-21 12:24 | 19K | |
| parallel-20251122.pkg | 2025-12-19 07:13 | 1.9M | |
| parallel-hashmap-2.0..> | 2025-08-16 14:44 | 92K | |
| parallels-tools-0.1...> | 2025-08-18 16:17 | 4.9K | |
| paratype-2.005_2.pkg | 2025-12-29 19:50 | 1.7M | |
| parcellite-1.2.1_2,1..> | 2025-12-29 17:54 | 253K | |
| parchive-1.1.pkg | 2025-08-17 09:43 | 28K | |
| paredit-mode.el-24_2..> | 2025-12-29 09:16 | 25K | |
| paredit-mode.el-emac..> | 2025-12-28 08:31 | 25K | |
| paredit-mode.el-emac..> | 2025-12-27 19:44 | 25K | |
| paredit-mode.el-emac..> | 2025-12-23 17:03 | 25K | |
| paredit-mode.el-emac..> | 2025-12-24 04:19 | 25K | |
| paredit-mode.el-emac..> | 2025-12-29 16:04 | 25K | |
| pari-2.17.3,2.pkg | 2025-12-18 23:44 | 4.9M | |
| pari-elldata-2021.03..> | 2025-12-21 20:57 | 47M | |
| pari-galdata-2008.04..> | 2025-12-21 00:27 | 41K | |
| pari-galpol-2018.06...> | 2025-12-21 01:00 | 8.4M | |
| pari-nflistdata-2022..> | 2025-12-20 17:05 | 3.4M | |
| pari-nftables-2008.0..> | 2025-12-22 20:30 | 6.7M | |
| pari-seadata-2009.06..> | 2025-12-23 18:24 | 17M | |
| parinfer-rust-0.4.3...> | 2025-12-28 07:23 | 419K | |
| paritwine-0.2.2.pkg | 2025-12-29 05:44 | 43K | |
| parkverbot-1.5.pkg | 2025-08-18 23:26 | 7.5K | |
| parley-25.12.0.pkg | 2025-12-26 20:39 | 7.3M | |
| parmgridgen-1.0_17.pkg | 2025-12-28 04:57 | 96K | |
| parol-1.0.1_11.pkg | 2025-12-28 00:49 | 1.3M | |
| parol-ls-1.0.1_12.pkg | 2025-12-30 11:08 | 1.4M | |
| parole-4.20.0.pkg | 2025-12-27 04:11 | 375K | |
| parpd-1.3_1.pkg | 2025-08-16 15:34 | 26K | |
| parsec-3.17.pkg | 2025-12-22 01:43 | 43K | |
| parthenon-24.08_3.pkg | 2025-12-29 12:55 | 1.0M | |
| partio-1.19.2.pkg | 2025-12-19 00:04 | 418K | |
| pasm-0.84.pkg | 2025-08-21 07:41 | 31K | |
| pass-coffin-1.2.1.pkg | 2025-12-30 14:02 | 7.9K | |
| pass-otp-1.2.0_1.pkg | 2025-12-30 08:10 | 6.6K | |
| pass-update-2.1_1.pkg | 2025-12-29 00:15 | 6.4K | |
| passage-4_7.pkg | 2025-12-22 07:28 | 52K | |
| passh-1.0.1.pkg | 2025-08-18 10:37 | 11K | |
| passivedns-1.2.1.25.pkg | 2025-12-30 14:03 | 22K | |
| password-store-1.7.4..> | 2025-12-27 17:53 | 40K | |
| passwordsafe-1.20.0_..> | 2025-12-30 06:05 | 11M | |
| pastebinit-1.7.1.pkg | 2025-12-23 14:49 | 8.3K | |
| pastel-0.11.0_2.pkg | 2025-12-29 17:08 | 3.4M | |
| pastix-6.3.2_2.pkg | 2025-12-29 01:27 | 629K | |
| pasystray-0.8.2_1.pkg | 2025-12-29 04:16 | 44K | |
| patapizza-tetris-1.0..> | 2025-12-30 16:26 | 42K | |
| patch-2.7.6_2.pkg | 2025-08-11 00:26 | 103K | |
| patchage-1.0.10_8.pkg | 2025-12-30 12:13 | 195K | |
| patchelf-0.18.0.pkg | 2025-08-14 01:20 | 92K | |
| patchutils-0.4.3.pkg | 2025-12-18 22:40 | 83K | |
| pathalias-9.16_1.pkg | 2025-08-20 00:17 | 24K | |
| pathchirp-2.4.1_1.pkg | 2025-08-20 16:35 | 22K | |
| pathload-1.3.2.pkg | 2025-08-22 11:25 | 26K | |
| pathneck-1.3.pkg | 2025-08-21 05:12 | 20K | |
| pathological-1.1.3_1..> | 2025-12-29 12:15 | 5.8M | |
| pathrate-2.4.1.pkg | 2025-08-22 15:11 | 20K | |
| patsh-0.2.1_21.pkg | 2025-12-30 15:36 | 457K | |
| pauker-1.8.pkg | 2025-12-29 11:32 | 7.0M | |
| pavucontrol-6.1.pkg | 2025-12-27 07:28 | 182K | |
| pavucontrol-qt-2.3.0..> | 2025-12-29 17:30 | 148K | |
| pavuk-0.9.35_7.pkg | 2025-12-28 16:49 | 371K | |
| pavumeter-0.9.3_15.pkg | 2025-12-29 17:00 | 20K | |
| pax-utils-1.3.4_1.pkg | 2025-08-16 04:45 | 77K | |
| payara-5.2020.4.pkg | 2025-12-29 15:58 | 127M | |
| pbasic-2.1_2.pkg | 2025-08-22 07:07 | 68K | |
| pbbam-0.18.0_13.pkg | 2025-12-21 03:09 | 673K | |
| pbimaker-1.3_1.pkg | 2025-08-16 16:16 | 11K | |
| pbnc-1.0_1.pkg | 2025-12-20 20:54 | 4.2K | |
| pbzip2-1.1.13.pkg | 2025-08-13 22:57 | 30K | |
| pc-mixer-20171212_4.pkg | 2025-12-29 16:02 | 82K | |
| pc-networkmanager-20..> | 2025-12-30 10:36 | 203K | |
| pcal-4.11.0_1.pkg | 2025-08-16 10:02 | 145K | |
| pcalc-5.pkg | 2025-08-20 07:13 | 20K | |
| pcapfix-1.1.7_1.pkg | 2025-08-18 20:51 | 24K | |
| pcaudiolib-1.2_2.pkg | 2025-08-10 22:36 | 7.8K | |
| pcb-4.3.0,1.pkg | 2025-12-28 12:18 | 2.1M | |
| pcb-rnd-3.1.7.b_1.pkg | 2025-12-29 13:36 | 3.1M | |
| pcc-1.1.0_2.pkg | 2025-08-17 09:24 | 266K | |
| pcc-libs-1.1.0.pkg | 2025-08-15 15:03 | 21K | |
| pcdm-201710031254_4.pkg | 2025-12-29 12:45 | 9.5M | |
| pcdtojpeg-1.0.17_1.pkg | 2025-12-30 13:28 | 253K | |
| pcem-17.pkg | 2025-12-30 05:45 | 1.3M | |
| pcemu-1.01b_6.pkg | 2025-12-29 17:15 | 285K | |
| pcf2bdf-1.07.pkg | 2025-08-15 02:39 | 12K | |
| pcg-cpp-0.98.1.70.pkg | 2025-08-20 04:55 | 22K | |
| pcgen-6.06.01_1.pkg | 2025-12-29 19:46 | 56M | |
| pchecker-1.28.pkg | 2025-12-21 16:25 | 8.3K | |
| pciids-20251216.pkg | 2025-12-24 20:09 | 288K | |
| pciutils-3.14.0.pkg | 2025-12-27 13:28 | 59K | |
| pcl-1.6_2.pkg | 2025-08-14 15:47 | 10K | |
| pcl-pointclouds-1.15..> | 2025-12-27 17:48 | 14M | |
| pcmanfm-1.3.2_3.pkg | 2025-12-27 16:20 | 299K | |
| pcmanfm-gtk3-1.3.2_3..> | 2025-12-30 09:32 | 297K | |
| pcmanfm-qt-2.3.0.pkg | 2025-12-27 15:52 | 530K | |
| pcmsolver-1.3.0_2.pkg | 2025-12-28 12:50 | 849K | |
| pcpustat-1.6_1.pkg | 2025-08-18 17:13 | 7.1K | |
| pcre-8.45_4.pkg | 2025-08-10 22:53 | 1.2M | |
| pcre2-10.47_1.pkg | 2025-12-16 01:41 | 1.4M | |
| pcsc-cyberjack-3.99...> | 2025-12-21 06:18 | 177K | |
| pcsc-lite-2.3.3_1,2.pkg | 2025-12-18 10:35 | 114K | |
| pcsc-tools-1.7.3_2.pkg | 2025-12-28 16:55 | 173K | |
| pcsx2-2.4.0_2.pkg | 2025-12-28 14:57 | 5.4M | |
| pd-0.47.1_4.pkg | 2025-12-27 17:52 | 1.5M | |
| pd-cyclone-0.2.b3_1.pkg | 2025-12-30 02:05 | 636K | |
| pdal-2.8.4_5.pkg | 2025-12-26 20:50 | 2.3M | |
| pdcurses-3.9.pkg | 2025-12-21 00:54 | 116K | |
| pdf-renderer-0.9.1_1..> | 2025-12-29 03:49 | 1.6M | |
| pdf-tools-1.1.0_15.pkg | 2025-12-29 04:01 | 225K | |
| pdf-tools-emacs_cann..> | 2025-12-29 17:57 | 225K | |
| pdf-tools-emacs_deve..> | 2025-12-28 18:23 | 225K | |
| pdf-tools-emacs_wayl..> | 2025-12-29 17:58 | 225K | |
| pdf2svg-0.2.4_3.pkg | 2025-12-27 17:34 | 4.5K | |
| pdf4tcl-0.8_1.pkg | 2025-08-31 15:13 | 74K | |
| pdfbox-3.0.4.pkg | 2025-12-26 17:58 | 12M | |
| pdfchain-0.4.4.2_4.pkg | 2025-12-29 10:52 | 255K | |
| pdfcpu-0.11.1_2.pkg | 2025-12-20 11:12 | 7.0M | |
| pdfcrack-0.20_1.pkg | 2025-08-16 15:08 | 30K | |
| pdfgrep-2.1.1_54.pkg | 2025-12-29 11:32 | 36K | |
| pdflib-7.0.5_6.pkg | 2025-08-13 20:22 | 3.6M | |
| pdflib-perl-7.0.5_6.pkg | 2025-12-18 20:35 | 3.9M | |
| pdfmixtool-qt5-1.1.1..> | 2025-12-30 15:29 | 258K | |
| pdfmixtool-qt6-1.1.1..> | 2025-12-28 00:51 | 277K | |
| pdfoutline-5.4_2.pkg | 2025-12-19 22:22 | 5.4K | |
| pdfpc-4.7.0_3.pkg | 2025-12-29 05:57 | 161K | |
| pdfresurrect-0.23_1.pkg | 2025-08-22 07:13 | 13K | |
| pdfrip-2.0.1_4.pkg | 2025-12-30 10:51 | 1.1M | |
| pdfsandwich-0.1.7_45..> | 2025-12-28 10:53 | 398K | |
| pdfstitch-0.6.pkg | 2025-12-21 18:27 | 3.7K | |
| pdftk-3.3.3_1.pkg | 2025-12-27 11:34 | 939K | |
| pdftohtml-0.40a_3.pkg | 2025-12-27 22:04 | 298K | |
| pdixtract-1.5_1.pkg | 2025-08-21 12:25 | 6.5K | |
| pdjson-g20250825.pkg | 2025-12-19 10:32 | 9.2K | |
| pdksh-5.2.14p2_7.pkg | 2025-08-15 02:36 | 157K | |
| pdmenu-1.3.6_1.pkg | 2025-12-29 11:27 | 29K | |
| pdnmesh-0.2.2_24.pkg | 2025-12-28 03:53 | 1.2M | |
| pdnsd-1.2.9a_2.pkg | 2025-08-21 12:06 | 187K | |
| pdsh-2.34_2.pkg | 2025-12-21 05:29 | 79K | |
| pdumpfs-1.3_6.pkg | 2025-12-20 06:22 | 56K | |
| peaclock-0.4.3_8.pkg | 2025-08-18 23:26 | 194K | |
| peak-classifier-0.1...> | 2025-12-27 17:04 | 14K | |
| pear-merger-0.9.6_1.pkg | 2025-08-14 13:50 | 46K | |
| peazip-gtk2-10.7.0.pkg | 2025-12-30 12:15 | 5.3M | |
| peazip-qt5-10.7.0.pkg | 2025-12-28 07:16 | 5.3M | |
| peazip-qt6-10.7.0.pkg | 2025-12-29 04:05 | 5.3M | |
| peco-0.5.11_22.pkg | 2025-12-20 05:42 | 1.1M | |
| peda-1.2.pkg | 2025-12-22 13:01 | 56K | |
| peek-1.5.1_3.pkg | 2025-12-30 00:11 | 146K | |
| peering-manager-1.10..> | 2025-12-29 05:14 | 3.3M | |
| peersuite-1.0.pkg | 2025-08-19 02:03 | 1.1M | |
| pefs-kmod-g20251102...> | 2025-12-28 19:22 | 73K | |
| peg-0.1.19_1.pkg | 2025-08-18 08:48 | 32K | |
| peg-e-1.3.5.pkg | 2025-12-30 18:54 | 241K | |
| pegtl-3.2.8.pkg | 2025-08-22 20:30 | 59K | |
| peksystray-0.4.0_2.pkg | 2025-08-17 08:58 | 7.1K | |
| pekwm-0.3.0_2,1.pkg | 2025-12-29 02:06 | 1.2M | |
| pen-0.34.1_1.pkg | 2025-08-22 13:17 | 77K | |
| pencil2d-0.7.0.pkg | 2025-12-28 23:56 | 1.8M | |
| pengpong-0.3_13.pkg | 2025-12-28 19:07 | 97K | |
| penguin-command-1.6...> | 2025-12-30 08:22 | 892K | |
| penguinsap-0.1.pkg | 2025-08-18 15:34 | 27K | |
| pengupop-2.2.6_3.pkg | 2025-12-20 06:04 | 1.5M | |
| pentobi-26.3.pkg | 2025-12-30 13:52 | 1.2M | |
| perceptualdiff-2.1_3..> | 2025-08-22 03:17 | 20K | |
| percona-orchestrator..> | 2025-12-23 04:59 | 5.3M | |
| percona-toolkit-3.5...> | 2025-12-23 20:50 | 875K | |
| perdition-2.2_2.pkg | 2025-12-21 11:27 | 97K | |
| performance-0.6.0_1.pkg | 2025-12-18 18:14 | 103K | |
| perftest-4.5.0.17.pkg | 2025-08-19 13:24 | 184K | |
| perkeep-0.11_33.pkg | 2025-12-21 13:32 | 20M | |
| perl2html-0.9.2_2.pkg | 2025-08-16 16:58 | 34K | |
| perl5-5.42.0_1.pkg | 2025-12-16 01:30 | 16M | |
| perl5-devel-5.43.5.pkg | 2025-12-22 22:13 | 16M | |
| perl5.38-5.38.5_1.pkg | 2025-08-30 14:40 | 15M | |
| perl5.40-5.40.3_2.pkg | 2025-08-27 22:53 | 16M | |
| perlconsole-0.4_2.pkg | 2025-12-21 20:02 | 8.5K | |
| perlinnoise-3.0.0.pkg | 2025-08-18 21:52 | 4.5K | |
| permlib-0.2.9_2.pkg | 2025-12-20 04:06 | 62K | |
| perp-2.07_1.pkg | 2025-08-16 01:02 | 149K | |
| persepolis-3.2.0_4.pkg | 2025-12-30 09:23 | 611K | |
| personality-1.0_1.pkg | 2025-08-16 00:38 | 6.5K | |
| perspective.el-2.20_..> | 2025-12-29 12:21 | 48K | |
| perspective.el-emacs..> | 2025-12-30 09:50 | 48K | |
| perspective.el-emacs..> | 2025-12-28 18:44 | 48K | |
| perspective.el-emacs..> | 2025-12-23 11:35 | 48K | |
| perspective.el-emacs..> | 2025-12-21 05:09 | 48K | |
| perspective.el-emacs..> | 2025-12-29 01:23 | 48K | |
| peruse-1.80_2.pkg | 2025-12-28 15:23 | 604K | |
| perwindowlayoutd-0.6..> | 2025-08-22 21:05 | 7.7K | |
| pet-1.0.1_2.pkg | 2025-08-16 09:51 | 3.3M | |
| petanque-1.1.0.pkg | 2025-08-18 22:12 | 60K | |
| petiga-g20221208_7.pkg | 2025-12-30 14:55 | 299K | |
| pev-0.80_2.pkg | 2025-08-16 05:20 | 154K | |
| pfbtopfa-1.0_2.pkg | 2025-08-20 09:21 | 4.1K | |
| pfe-0.33.71_3.pkg | 2025-08-17 05:03 | 548K | |
| pfetch-1.9.4.pkg | 2025-12-23 05:45 | 21K | |
| pfetch-rs-2.11.1_6.pkg | 2025-12-30 15:13 | 1.1M | |
| pffft-2022.12.19.pkg | 2025-08-15 15:14 | 64K | |
| pflogsumm-1.1.13,1.pkg | 2025-12-29 08:52 | 46K | |
| pflogx-0.86.pkg | 2025-08-16 17:29 | 34K | |
| pfm-2.12.3_1.pkg | 2025-12-20 21:45 | 221K | |
| pfqueue-0.5.6_2.pkg | 2025-08-22 01:58 | 46K | |
| pfstat-2.5_9.pkg | 2025-12-28 08:23 | 27K | |
| pfstools-2.1.0_25.pkg | 2025-12-29 05:25 | 291K | |
| pftabled-1.09_3.pkg | 2025-12-22 12:39 | 14K | |
| pftables-0.1.1.pkg | 2025-08-19 20:23 | 1.9K | |
| pftop-0.13.pkg | 2025-12-21 15:07 | 63K | |
| pftpd-1.0.3_3.pkg | 2025-08-18 07:01 | 37K | |
| pg-gvm-22.6.11.pkg | 2025-12-26 20:41 | 7.6K | |
| pg.el-0.61.pkg | 2025-12-26 17:56 | 97K | |
| pg.el-emacs_canna-0...> | 2025-12-26 19:51 | 97K | |
| pg.el-emacs_devel-0...> | 2025-12-26 20:11 | 97K | |
| pg.el-emacs_devel_no..> | 2025-12-18 15:54 | 97K | |
| pg.el-emacs_nox-0.61..> | 2025-12-18 18:14 | 97K | |
| pg.el-emacs_wayland-..> | 2025-12-26 19:50 | 97K | |
| pgFormatter-5.8.pkg | 2025-12-20 17:32 | 65K | |
| pg_activity-3.6.1.pkg | 2025-12-21 14:09 | 116K | |
| pg_citus-13.2.0.pkg | 2025-12-22 15:10 | 779K | |
| pg_cron-1.6.7.pkg | 2025-12-19 19:52 | 26K | |
| pg_ed25519-0.2.pkg | 2025-12-22 06:32 | 48K | |
| pg_filedump-17.4.pkg | 2025-12-21 02:33 | 41K | |
| pg_hashids-1.3.pkg | 2025-12-22 10:18 | 9.4K | |
| pg_incremental-1.3.0..> | 2025-12-23 05:31 | 14K | |
| pg_partman-5.2.2.pkg | 2025-12-21 04:12 | 186K | |
| pg_qualstats-2.1.3.pkg | 2025-12-19 23:38 | 27K | |
| pg_stat_kcache-2.3.1..> | 2025-12-20 00:08 | 17K | |
| pg_tileserv-1.0.11_5..> | 2025-08-21 22:35 | 4.5M | |
| pgaccess-1.00.201409..> | 2025-12-30 00:04 | 1.0M | |
| pgactive-2.1.7.pkg | 2025-12-23 19:28 | 300K | |
| pgadmin3-1.23.0.2023..> | 2025-12-28 20:46 | 5.1M | |
| pgagroal-1.6.0.pkg | 2025-12-23 14:01 | 130K | |
| pgbackrest-2.57.0.pkg | 2025-12-20 22:14 | 360K | |
| pgbadger-13.1.pkg | 2025-12-21 08:03 | 331K | |
| pgbarman-py311-3.16...> | 2025-12-21 16:16 | 764K | |
| pgbouncer-1.24.1.pkg | 2025-08-22 21:23 | 214K | |
| pgdbf-0.6.2_1.pkg | 2025-08-20 01:09 | 13K | |
| pget-0.2.1_19.pkg | 2025-12-21 11:32 | 2.7M | |
| pgloader3-3.6.9.pkg | 2025-12-23 14:24 | 22M | |
| pglogd-2.3_4.pkg | 2025-12-21 18:26 | 20K | |
| pglogical-2.4.6.pkg | 2025-12-21 22:38 | 124K | |
| pgmetrics-1.18.0_4.pkg | 2025-12-20 16:44 | 4.2M | |
| pgmodeler-1.2.2.pkg | 2025-12-29 07:09 | 7.8M | |
| pgpdump-0.36.pkg | 2025-08-19 11:25 | 18K | |
| pgpgpg-0.13_5.pkg | 2025-12-18 20:31 | 9.9K | |
| pgpin-010323_1.pkg | 2025-08-15 19:09 | 216K | |
| pgplot-5.2.2_30.pkg | 2025-12-26 21:55 | 390K | |
| pgpmoose-1.19_2.pkg | 2025-08-16 01:16 | 16K | |
| pgpool-II-43-4.3.18.pkg | 2025-12-30 16:47 | 1.4M | |
| pgpool-II-44-4.4.15.pkg | 2025-12-30 00:22 | 1.4M | |
| pgpool-II-45-4.5.10.pkg | 2025-12-29 01:22 | 1.4M | |
| pgpool-II-46-4.6.5.pkg | 2025-12-29 00:46 | 1.4M | |
| pgpool-II-47-4.7.r1.pkg | 2025-12-21 11:54 | 1.5M | |
| pgpool-II42-4.2.12.pkg | 2025-12-22 09:01 | 1.3M | |
| pgreplay-1.5.0.pkg | 2025-12-21 13:33 | 28K | |
| pgroonga-4.0.1.pkg | 2025-12-22 13:48 | 235K | |
| pgrouting-4.0.0.pkg | 2025-12-30 04:38 | 678K | |
| pgschema-1.5.1.pkg | 2025-12-30 09:00 | 3.5M | |
| pgtcl-2.1.1_3.pkg | 2025-12-19 20:12 | 76K | |
| pgtcl-postgresql13-2..> | 2025-12-22 12:28 | 76K | |
| pgtcl-postgresql14-2..> | 2025-12-22 10:08 | 76K | |
| pgtcl-postgresql15-2..> | 2025-12-21 19:40 | 76K | |
| pgtcl-postgresql16-2..> | 2025-12-23 19:07 | 76K | |
| pgtcl-postgresql17-2..> | 2025-12-19 01:58 | 76K | |
| pgtcl-postgresql18-2..> | 2025-12-20 19:15 | 76K | |
| pgtop-0.11.pkg | 2025-12-21 10:05 | 25K | |
| pguri-1.20251029.pkg | 2025-12-29 11:14 | 7.8K | |
| phabricator-php81-20..> | 2025-12-29 16:09 | 6.7M | |
| phabricator-php82-20..> | 2025-12-30 06:25 | 6.7M | |
| phabricator-php83-20..> | 2025-12-29 15:14 | 6.7M | |
| phabricator-php84-20..> | 2025-12-30 14:57 | 6.7M | |
| phalanx-25.pkg | 2025-08-22 10:24 | 327K | |
| pharo-10.2.0_2.pkg | 2025-12-29 15:25 | 585K | |
| phasar-2503_2.pkg | 2025-12-22 04:13 | 1.8M | |
| phd2-2.6.14.pkg | 2025-12-29 07:18 | 13M | |
| phlipple-0.8.5_8.pkg | 2025-12-30 00:22 | 2.5M | |
| pho-1.0_1.pkg | 2025-12-28 15:10 | 32K | |
| phoc-0.51.0.pkg | 2025-12-30 17:29 | 257K | |
| phonon-designerplugi..> | 2025-12-30 04:13 | 18K | |
| phonon-mpv-0.1.0_1.pkg | 2025-12-27 10:59 | 94K | |
| phonon-qt5-4.12.0_3.pkg | 2025-12-26 22:53 | 297K | |
| phonon-qt6-4.12.0_3.pkg | 2025-12-26 11:49 | 234K | |
| phonon-vlc-qt5-0.12...> | 2025-12-28 20:37 | 87K | |
| phonon-vlc-qt6-0.12...> | 2025-12-30 00:27 | 102K | |
| phonopy-2.42.0.pkg | 2025-08-16 11:03 | 28K | |
| phoon_14Aug-2014_1.pkg | 2025-08-18 06:15 | 14K | |
| phorgeit-arcanist-li..> | 2025-12-27 11:00 | 1.6M | |
| phorgeit-arcanist-li..> | 2025-12-27 18:56 | 1.6M | |
| phorgeit-arcanist-li..> | 2025-12-27 18:43 | 1.6M | |
| phorgeit-arcanist-ph..> | 2025-12-29 01:05 | 903 | |
| phorgeit-arcanist-ph..> | 2025-12-29 19:30 | 904 | |
| phorgeit-arcanist-ph..> | 2025-12-28 10:48 | 903 | |
| phorgeitphorge-php81..> | 2025-12-29 17:00 | 6.7M | |
| phorgeitphorge-php82..> | 2025-12-30 10:09 | 6.7M | |
| phorgeitphorge-php83..> | 2025-12-28 12:26 | 6.7M | |
| phoronix-test-suite-..> | 2025-12-27 21:30 | 2.6M | |
| phoronix-test-suite-..> | 2025-12-28 10:08 | 2.6M | |
| phoronix-test-suite-..> | 2025-12-30 02:05 | 2.6M | |
| phoronix-test-suite-..> | 2025-12-30 05:18 | 2.6M | |
| phoronix-test-suite-..> | 2025-12-29 12:51 | 2.6M | |
| photivo-0.0.2015.03...> | 2025-12-30 17:56 | 1.6M | |
| photoflare-1.6.13.pkg | 2025-12-28 03:53 | 734K | |
| photopc-3.07_2.pkg | 2025-08-20 15:49 | 63K | |
| photoprint-0.4.2.p2_..> | 2025-12-29 15:18 | 1.0M | |
| photoqt-3.4_6.pkg | 2025-12-29 07:19 | 1.3M | |
| phototonic-3.1.0.pkg | 2025-12-30 17:21 | 498K | |
| php-Psr_Log-1.0.2.pkg | 2025-08-16 00:40 | 3.9K | |
| php-fpm_exporter-2.2..> | 2025-12-21 22:32 | 3.8M | |
| php-geshi-1.0.9.1.pkg | 2025-12-28 06:06 | 715K | |
| php-mode.el-1.27.0_1..> | 2025-12-28 08:20 | 107K | |
| php-mode.el-emacs_ca..> | 2025-12-27 21:24 | 107K | |
| php-mode.el-emacs_no..> | 2025-12-21 07:38 | 107K | |
| php-mode.el-emacs_wa..> | 2025-12-29 15:15 | 107K | |
| php81-8.1.34.pkg | 2025-12-26 14:53 | 4.3M | |
| php81-Ice37-3.7.10.pkg | 2025-12-30 18:48 | 177K | |
| php81-adminer-5.4.1.pkg | 2025-12-30 14:29 | 358K | |
| php81-aphpunit-2.3.pkg | 2025-12-29 19:53 | 14K | |
| php81-bcmath-8.1.34.pkg | 2025-12-27 00:48 | 21K | |
| php81-brotli-0.18.2_..> | 2025-12-30 04:53 | 14K | |
| php81-bsdconv-11.6.0..> | 2025-12-28 10:38 | 8.6K | |
| php81-bz2-8.1.34.pkg | 2025-12-26 23:32 | 12K | |
| php81-bzip3-0.1.1.pkg | 2025-12-28 12:43 | 5.7K | |
| php81-calendar-8.1.3..> | 2025-12-27 02:18 | 16K | |
| php81-composer-2.9.2..> | 2025-12-27 04:23 | 590K | |
| php81-ctype-8.1.34.pkg | 2025-12-26 20:55 | 6.2K | |
| php81-curl-8.1.34.pkg | 2025-12-26 22:08 | 38K | |
| php81-dba-8.1.34.pkg | 2025-12-30 14:28 | 24K | |
| php81-dddbl-2.0.1.pkg | 2025-12-28 21:08 | 9.5K | |
| php81-deployer-6.4.3..> | 2025-12-29 06:55 | 327K | |
| php81-dom-8.1.34.pkg | 2025-12-26 20:11 | 69K | |
| php81-enchant-8.1.34..> | 2025-12-29 06:55 | 11K | |
| php81-exif-8.1.34.pkg | 2025-12-26 21:38 | 30K | |
| php81-extensions-1.1..> | 2025-12-28 23:33 | 1.1K | |
| php81-facedetect-1.1..> | 2025-12-30 02:36 | 7.9K | |
| php81-ffi-8.1.34.pkg | 2025-12-29 03:39 | 68K | |
| php81-fileinfo-8.1.3..> | 2025-12-26 21:10 | 310K | |
| php81-filter-8.1.34.pkg | 2025-12-27 01:09 | 23K | |
| php81-ftp-8.1.34.pkg | 2025-12-28 04:55 | 27K | |
| php81-gd-8.1.34.pkg | 2025-12-26 22:06 | 35K | |
| php81-geos-1.0.0_1.pkg | 2025-12-30 09:26 | 21K | |
| php81-gettext-8.1.34..> | 2025-12-26 18:50 | 7.0K | |
| php81-gmp-8.1.34.pkg | 2025-12-26 21:11 | 23K | |
| php81-google-api-php..> | 2025-12-27 21:55 | 29K | |
| php81-iconv-8.1.34.pkg | 2025-12-27 00:34 | 19K | |
| php81-imap-8.1.34.pkg | 2025-12-27 16:21 | 37K | |
| php81-intl-8.1.34.pkg | 2025-12-27 01:21 | 140K | |
| php81-kanboard-1.2.4..> | 2025-12-30 02:21 | 2.5M | |
| php81-ldap-8.1.34.pkg | 2025-12-26 20:27 | 34K | |
| php81-libawl-0.64.pkg | 2025-12-27 10:56 | 84K | |
| php81-lz4-0.6.0.pkg | 2025-12-28 23:54 | 8.2K | |
| php81-maxminddb-1.13..> | 2025-12-27 23:42 | 8.2K | |
| php81-mbstring-8.1.3..> | 2025-12-26 18:31 | 869K | |
| php81-mysqli-8.1.34.pkg | 2025-12-27 16:46 | 50K | |
| php81-odbc-8.1.34.pkg | 2025-12-30 02:36 | 28K | |
| php81-opcache-8.1.34..> | 2025-12-26 21:43 | 345K | |
| php81-opencc-0.0.0.2..> | 2025-12-27 20:46 | 5.9K | |
| php81-pcntl-8.1.34.pkg | 2025-12-26 22:03 | 16K | |
| php81-pdo-8.1.34.pkg | 2025-12-26 20:05 | 51K | |
| php81-pdo_dblib-8.1...> | 2025-12-29 19:14 | 13K | |
| php81-pdo_firebird-8..> | 2025-12-28 10:26 | 16K | |
| php81-pdo_mysql-8.1...> | 2025-12-27 01:12 | 18K | |
| php81-pdo_odbc-8.1.3..> | 2025-12-27 21:27 | 14K | |
| php81-pdo_pgsql-8.1...> | 2025-12-27 10:01 | 20K | |
| php81-pdo_sqlite-8.1..> | 2025-12-27 16:03 | 14K | |
| php81-pear-1.10.17.pkg | 2025-12-30 15:07 | 253K | |
| php81-pecl-APCu-5.1...> | 2025-12-27 00:18 | 54K | |
| php81-pecl-amqp-2.1...> | 2025-12-30 00:51 | 53K | |
| php81-pecl-ast-1.1.3..> | 2025-12-28 10:31 | 20K | |
| php81-pecl-bitset-3...> | 2025-12-30 09:43 | 11K | |
| php81-pecl-couchbase..> | 2025-12-28 19:51 | 29K | |
| php81-pecl-crypto-0...> | 2025-12-29 22:44 | 32K | |
| php81-pecl-dio-0.3.0..> | 2025-12-30 02:31 | 12K | |
| php81-pecl-ds-1.6.0.pkg | 2025-12-28 01:49 | 58K | |
| php81-pecl-eio-3.0.0..> | 2025-12-29 15:25 | 29K | |
| php81-pecl-ev-1.2.2.pkg | 2025-12-30 03:49 | 46K | |
| php81-pecl-event-3.1..> | 2025-12-29 20:29 | 45K | |
| php81-pecl-excimer-1..> | 2025-12-29 20:17 | 23K | |
| php81-pecl-expect-0...> | 2025-12-27 20:03 | 7.7K | |
| php81-pecl-geospatia..> | 2025-12-28 10:03 | 17K | |
| php81-pecl-gnupg-1.5..> | 2025-12-27 18:37 | 18K | |
| php81-pecl-grpc-1.76..> | 2025-12-29 08:40 | 3.3M | |
| php81-pecl-horde_lz4..> | 2025-12-29 03:25 | 4.5K | |
| php81-pecl-http-4.3...> | 2025-12-30 09:45 | 142K | |
| php81-pecl-igbinary-..> | 2025-12-29 18:28 | 26K | |
| php81-pecl-imagick-3..> | 2025-12-29 13:24 | 125K | |
| php81-pecl-inotify-3..> | 2025-12-30 11:27 | 7.0K | |
| php81-pecl-json_post..> | 2025-12-28 09:15 | 5.4K | |
| php81-pecl-krb5-1.2...> | 2025-12-29 22:15 | 26K | |
| php81-pecl-leveldb-0..> | 2025-12-28 00:31 | 14K | |
| php81-pecl-libsodium..> | 2025-12-29 11:49 | 24K | |
| php81-pecl-lzf-1.7.0..> | 2025-12-30 11:27 | 8.2K | |
| php81-pecl-mailparse..> | 2025-12-30 11:25 | 27K | |
| php81-pecl-mcrypt-1...> | 2025-12-27 17:13 | 15K | |
| php81-pecl-memcache-..> | 2025-12-27 18:01 | 44K | |
| php81-pecl-memcached..> | 2025-12-28 10:47 | 52K | |
| php81-pecl-mongodb-1..> | 2025-12-30 17:07 | 822K | |
| php81-pecl-msgpack-3..> | 2025-12-27 14:36 | 27K | |
| php81-pecl-mustache-..> | 2025-12-29 03:41 | 26K | |
| php81-pecl-oauth-2.0..> | 2025-12-30 05:51 | 37K | |
| php81-pecl-opentelem..> | 2025-12-29 19:07 | 13K | |
| php81-pecl-pam-2.2.5..> | 2025-12-30 02:58 | 8.8K | |
| php81-pecl-pcov-1.0...> | 2025-12-28 02:16 | 10K | |
| php81-pecl-pkcs11-1...> | 2025-12-29 08:47 | 47K | |
| php81-pecl-proctitle..> | 2025-12-30 14:35 | 4.1K | |
| php81-pecl-protobuf-..> | 2025-12-28 15:25 | 233K | |
| php81-pecl-psr-1.2.0..> | 2025-12-29 12:35 | 16K | |
| php81-pecl-qrencode-..> | 2025-12-30 07:49 | 7.2K | |
| php81-pecl-radius-1...> | 2025-12-28 04:19 | 32K | |
| php81-pecl-raphf-2.0..> | 2025-12-27 06:06 | 11K | |
| php81-pecl-rar-4.2.0..> | 2025-12-30 16:45 | 152K | |
| php81-pecl-rdkafka-6..> | 2025-12-27 21:38 | 43K | |
| php81-pecl-redis-6.3..> | 2025-12-27 18:48 | 236K | |
| php81-pecl-rrd-2.0.3..> | 2025-12-29 13:42 | 14K | |
| php81-pecl-runkit7-4..> | 2025-12-28 02:12 | 40K | |
| php81-pecl-scrypt-2...> | 2025-12-28 04:01 | 18K | |
| php81-pecl-smbclient..> | 2025-12-27 17:15 | 24K | |
| php81-pecl-solr-2.8...> | 2025-12-30 01:02 | 79K | |
| php81-pecl-ssh2-1.3...> | 2025-12-27 14:41 | 27K | |
| php81-pecl-stomp-2.0..> | 2025-12-29 04:17 | 19K | |
| php81-pecl-swoole-6...> | 2025-12-30 03:58 | 864K | |
| php81-pecl-sync-1.1...> | 2025-12-30 17:18 | 14K | |
| php81-pecl-timezoned..> | 2025-12-30 12:16 | 243K | |
| php81-pecl-uploadpro..> | 2025-12-30 02:31 | 7.8K | |
| php81-pecl-uuid-1.3...> | 2025-12-27 02:49 | 8.3K | |
| php81-pecl-uv-0.3.0.pkg | 2025-12-30 16:41 | 49K | |
| php81-pecl-vips-1.0...> | 2025-12-27 20:57 | 17K | |
| php81-pecl-vld-0.19...> | 2025-12-30 07:11 | 17K | |
| php81-pecl-xdebug-3...> | 2025-12-29 07:38 | 135K | |
| php81-pecl-xdiff-2.1..> | 2025-12-29 22:17 | 9.5K | |
| php81-pecl-xlswriter..> | 2025-12-29 11:04 | 167K | |
| php81-pecl-xmlrpc-1...> | 2025-12-27 02:13 | 40K | |
| php81-pecl-xxtea-1.0..> | 2025-12-27 17:25 | 5.8K | |
| php81-pecl-yac-2.3.1..> | 2025-12-30 15:56 | 23K | |
| php81-pecl-yaconf-1...> | 2025-12-29 18:02 | 11K | |
| php81-pecl-yaf-3.3.7..> | 2025-12-28 15:52 | 95K | |
| php81-pecl-yaml-2.3...> | 2025-12-30 00:24 | 21K | |
| php81-pecl-yar-2.3.4..> | 2025-12-30 17:06 | 33K | |
| php81-pecl-zephir_pa..> | 2025-12-27 17:01 | 46K | |
| php81-pecl-zookeeper..> | 2025-12-30 07:25 | 25K | |
| php81-pecl-zstd-0.15..> | 2025-12-28 00:36 | 16K | |
| php81-pgsql-8.1.34.pkg | 2025-12-27 17:53 | 48K | |
| php81-phalcon-5.9.3.pkg | 2025-12-29 12:20 | 1.9M | |
| php81-phar-8.1.34.pkg | 2025-12-26 20:55 | 113K | |
| php81-posix-8.1.34.pkg | 2025-12-26 23:26 | 13K | |
| php81-pspell-8.1.34.pkg | 2025-12-29 17:35 | 9.8K | |
| php81-readline-8.1.3..> | 2025-12-27 11:38 | 14K | |
| php81-session-8.1.34..> | 2025-12-26 18:49 | 39K | |
| php81-shmop-8.1.34.pkg | 2025-12-29 20:25 | 7.4K | |
| php81-simplexml-8.1...> | 2025-12-26 22:35 | 24K | |
| php81-snappy-0.2.3.pkg | 2025-12-27 19:45 | 4.4K | |
| php81-snmp-8.1.34.pkg | 2025-12-27 07:27 | 23K | |
| php81-snuffleupagus-..> | 2025-12-29 13:43 | 73K | |
| php81-soap-8.1.34.pkg | 2025-12-27 06:53 | 125K | |
| php81-sockets-8.1.34..> | 2025-12-27 09:45 | 42K | |
| php81-sodium-8.1.34.pkg | 2025-12-27 01:00 | 29K | |
| php81-sqlite3-8.1.34..> | 2025-12-27 17:12 | 24K | |
| php81-sysvmsg-8.1.34..> | 2025-12-27 11:33 | 9.0K | |
| php81-sysvsem-8.1.34..> | 2025-12-26 22:14 | 7.1K | |
| php81-sysvshm-8.1.34..> | 2025-12-27 21:59 | 8.3K | |
| php81-tarantool-0.4...> | 2025-12-29 22:17 | 51K | |
| php81-tidy-8.1.34.pkg | 2025-12-27 11:58 | 21K | |
| php81-tokenizer-8.1...> | 2025-12-27 04:02 | 13K | |
| php81-xapian-1.4.30.pkg | 2025-12-29 19:58 | 295K | |
| php81-xml-8.1.34_1.pkg | 2025-12-26 20:20 | 21K | |
| php81-xmlreader-8.1...> | 2025-12-26 21:40 | 15K | |
| php81-xmlwriter-8.1...> | 2025-12-26 22:50 | 15K | |
| php81-xsl-8.1.34.pkg | 2025-12-27 01:29 | 15K | |
| php81-zephir-0.17.0.pkg | 2025-12-30 16:47 | 1.4M | |
| php81-zip-8.1.34.pkg | 2025-12-26 20:32 | 28K | |
| php81-zlib-8.1.34.pkg | 2025-12-27 00:59 | 20K | |
| php81-zstd-0.15.2_1.pkg | 2025-12-28 23:59 | 16K | |
| php82-8.2.30.pkg | 2025-12-26 06:18 | 4.4M | |
| php82-Ice37-3.7.10.pkg | 2025-12-28 00:10 | 177K | |
| php82-adminer-5.4.1.pkg | 2025-12-28 10:23 | 358K | |
| php82-aphpunit-2.3.pkg | 2025-12-28 19:15 | 14K | |
| php82-bcmath-8.2.30.pkg | 2025-12-26 13:23 | 21K | |
| php82-brotli-0.18.2_..> | 2025-12-29 16:50 | 14K | |
| php82-bsdconv-11.6.0..> | 2025-12-30 06:45 | 8.6K | |
| php82-bz2-8.2.30.pkg | 2025-12-26 20:46 | 11K | |
| php82-bzip3-0.1.1.pkg | 2025-12-30 14:48 | 5.7K | |
| php82-calendar-8.2.3..> | 2025-12-27 05:43 | 16K | |
| php82-composer-2.9.2..> | 2025-12-27 11:03 | 590K | |
| php82-ctype-8.2.30.pkg | 2025-12-26 14:57 | 6.1K | |
| php82-curl-8.2.30.pkg | 2025-12-26 17:30 | 45K | |
| php82-dba-8.2.30.pkg | 2025-12-29 22:34 | 24K | |
| php82-dddbl-2.0.1.pkg | 2025-12-29 17:12 | 9.5K | |
| php82-deployer-6.4.3..> | 2025-12-30 09:29 | 327K | |
| php82-dom-8.2.30.pkg | 2025-12-26 09:01 | 71K | |
| php82-enchant-8.2.30..> | 2025-12-30 14:29 | 11K | |
| php82-exif-8.2.30.pkg | 2025-12-27 00:18 | 30K | |
| php82-extensions-1.0..> | 2025-12-29 07:12 | 1.1K | |
| php82-ffi-8.2.30.pkg | 2025-12-29 12:43 | 70K | |
| php82-fileinfo-8.2.3..> | 2025-12-26 17:01 | 310K | |
| php82-filter-8.2.30.pkg | 2025-12-26 14:09 | 24K | |
| php82-ftp-8.2.30.pkg | 2025-12-27 10:43 | 27K | |
| php82-gd-8.2.30.pkg | 2025-12-26 15:28 | 36K | |
| php82-geos-1.0.0_1.pkg | 2025-12-30 02:39 | 21K | |
| php82-gettext-8.2.30..> | 2025-12-26 16:56 | 6.9K | |
| php82-gmp-8.2.30.pkg | 2025-12-26 23:45 | 24K | |
| php82-google-api-php..> | 2025-12-30 14:48 | 29K | |
| php82-iconv-8.2.30.pkg | 2025-12-26 16:15 | 19K | |
| php82-ilias-10.3.pkg | 2025-12-29 22:01 | 19M | |
| php82-imap-8.2.30.pkg | 2025-12-27 01:23 | 37K | |
| php82-intl-8.2.30.pkg | 2025-12-26 15:29 | 148K | |
| php82-kanboard-1.2.4..> | 2025-12-28 01:17 | 2.5M | |
| php82-ldap-8.2.30.pkg | 2025-12-26 16:36 | 35K | |
| php82-libawl-0.64.pkg | 2025-12-27 16:19 | 84K | |
| php82-lz4-0.6.0.pkg | 2025-12-30 04:13 | 8.2K | |
| php82-maxminddb-1.13..> | 2025-12-30 01:22 | 8.2K | |
| php82-mbstring-8.2.3..> | 2025-12-26 16:57 | 918K | |
| php82-mysqli-8.2.30.pkg | 2025-12-26 11:02 | 51K | |
| php82-odbc-8.2.30.pkg | 2025-12-29 00:16 | 29K | |
| php82-opcache-8.2.30..> | 2025-12-26 15:31 | 340K | |
| php82-opencc-0.0.0.2..> | 2025-12-29 21:46 | 5.9K | |
| php82-pcntl-8.2.30.pkg | 2025-12-27 01:45 | 19K | |
| php82-pdo-8.2.30.pkg | 2025-12-26 14:06 | 54K | |
| php82-pdo_dblib-8.2...> | 2025-12-29 12:21 | 13K | |
| php82-pdo_firebird-8..> | 2025-12-28 12:20 | 16K | |
| php82-pdo_mysql-8.2...> | 2025-12-26 14:53 | 18K | |
| php82-pdo_odbc-8.2.3..> | 2025-12-27 20:02 | 14K | |
| php82-pdo_pgsql-8.2...> | 2025-12-26 15:28 | 20K | |
| php82-pdo_sqlite-8.2..> | 2025-12-26 15:29 | 14K | |
| php82-pear-1.10.17.pkg | 2025-12-26 06:43 | 253K | |
| php82-pear-Auth-1.6...> | 2025-12-27 07:54 | 48K | |
| php82-pear-Auth_HTTP..> | 2025-12-30 12:44 | 9.3K | |
| php82-pear-Auth_Pref..> | 2025-12-29 03:21 | 12K | |
| php82-pear-Auth_RADI..> | 2025-12-28 06:59 | 9.1K | |
| php82-pear-Auth_SASL..> | 2025-12-26 20:44 | 10K | |
| php82-pear-Auth_SASL..> | 2025-12-30 15:51 | 9.6K | |
| php82-pear-Benchmark..> | 2025-12-30 10:43 | 9.2K | |
| php82-pear-Cache-1.5..> | 2025-12-27 04:06 | 29K | |
| php82-pear-Cache_Lit..> | 2025-12-27 10:00 | 33K | |
| php82-pear-Config-1...> | 2025-12-27 22:03 | 31K | |
| php82-pear-Console_C..> | 2025-12-28 09:40 | 5.7K | |
| php82-pear-Console_C..> | 2025-12-27 11:14 | 38K | |
| php82-pear-Console_G..> | 2025-12-27 09:21 | 17K | |
| php82-pear-Console_T..> | 2025-12-26 19:07 | 12K | |
| php82-pear-Contact_V..> | 2025-12-30 10:37 | 16K | |
| php82-pear-Contact_V..> | 2025-12-28 18:20 | 11K | |
| php82-pear-Crypt_Blo..> | 2025-12-29 17:58 | 17K | |
| php82-pear-Crypt_CBC..> | 2025-12-30 05:18 | 4.5K | |
| php82-pear-Crypt_CHA..> | 2025-12-27 07:27 | 6.2K | |
| php82-pear-Crypt_Dif..> | 2025-12-28 06:11 | 12K | |
| php82-pear-Crypt_GPG..> | 2025-12-28 06:23 | 285K | |
| php82-pear-Crypt_HMA..> | 2025-12-27 18:01 | 8.8K | |
| php82-pear-Crypt_Mic..> | 2025-12-29 21:12 | 3.9K | |
| php82-pear-Crypt_RC4..> | 2025-12-28 17:55 | 3.1K | |
| php82-pear-Crypt_RSA..> | 2025-12-27 21:43 | 20K | |
| php82-pear-Crypt_XXT..> | 2025-12-29 07:15 | 7.2K | |
| php82-pear-DB-1.12.3..> | 2025-12-26 23:14 | 87K | |
| php82-pear-DBA-1.1.1..> | 2025-12-27 16:33 | 13K | |
| php82-pear-DBA_Relat..> | 2025-12-30 04:52 | 19K | |
| php82-pear-DB_DataOb..> | 2025-12-27 16:09 | 70K | |
| php82-pear-DB_DataOb..> | 2025-12-30 02:49 | 60K | |
| php82-pear-DB_Pager-..> | 2025-12-28 10:08 | 4.7K | |
| php82-pear-DB_QueryT..> | 2025-12-28 21:04 | 40K | |
| php82-pear-DB_Sqlite..> | 2025-12-29 16:19 | 19K | |
| php82-pear-DB_Table-..> | 2025-12-29 19:44 | 93K | |
| php82-pear-DB_ldap-1..> | 2025-12-30 15:31 | 10K | |
| php82-pear-DB_ldap2-..> | 2025-12-30 12:01 | 19K | |
| php82-pear-Date-1.4...> | 2025-12-26 21:29 | 43K | |
| php82-pear-Date_Holi..> | 2025-12-27 16:46 | 34K | |
| php82-pear-Date_Holi..> | 2025-12-28 06:35 | 5.8K | |
| php82-pear-Date_Holi..> | 2025-12-28 09:34 | 4.8K | |
| php82-pear-Date_Holi..> | 2025-12-27 21:28 | 4.5K | |
| php82-pear-Date_Holi..> | 2025-12-28 02:12 | 3.8K | |
| php82-pear-Date_Holi..> | 2025-12-29 18:25 | 4.4K | |
| php82-pear-Date_Holi..> | 2025-12-30 17:05 | 12K | |
| php82-pear-Date_Holi..> | 2025-12-28 13:12 | 5.4K | |
| php82-pear-Date_Holi..> | 2025-12-30 02:08 | 5.2K | |
| php82-pear-Date_Holi..> | 2025-12-29 11:02 | 4.7K | |
| php82-pear-Date_Holi..> | 2025-12-29 18:04 | 9.4K | |
| php82-pear-Date_Holi..> | 2025-12-30 02:00 | 5.6K | |
| php82-pear-Date_Holi..> | 2025-12-29 18:56 | 4.1K | |
| php82-pear-Date_Holi..> | 2025-12-30 01:42 | 4.3K | |
| php82-pear-Date_Holi..> | 2025-12-29 00:36 | 3.7K | |
| php82-pear-Date_Holi..> | 2025-12-28 19:09 | 4.3K | |
| php82-pear-Date_Holi..> | 2025-12-28 21:33 | 6.6K | |
| php82-pear-Date_Holi..> | 2025-12-30 01:16 | 9.8K | |
| php82-pear-Date_Holi..> | 2025-12-29 19:49 | 5.4K | |
| php82-pear-Date_Holi..> | 2025-12-29 13:36 | 3.9K | |
| php82-pear-Event_Dis..> | 2025-12-26 23:02 | 9.2K | |
| php82-pear-FSM-1.4.0..> | 2025-12-28 12:35 | 12K | |
| php82-pear-File-1.4...> | 2025-12-27 04:11 | 9.1K | |
| php82-pear-File_Arch..> | 2025-12-28 00:58 | 53K | |
| php82-pear-File_Bitt..> | 2025-12-30 13:41 | 70K | |
| php82-pear-File_DNS-..> | 2025-12-29 00:42 | 10K | |
| php82-pear-File_Find..> | 2025-12-27 17:53 | 8.9K | |
| php82-pear-File_Fort..> | 2025-12-30 08:54 | 14K | |
| php82-pear-File_Fsta..> | 2025-12-29 04:12 | 7.7K | |
| php82-pear-File_Gett..> | 2025-12-30 14:13 | 7.9K | |
| php82-pear-File_HtAc..> | 2025-12-30 15:35 | 5.8K | |
| php82-pear-File_Iter..> | 2025-12-27 05:58 | 3.0K | |
| php82-pear-File_MARC..> | 2025-12-30 07:27 | 79K | |
| php82-pear-File_PDF-..> | 2025-12-28 07:03 | 38K | |
| php82-pear-File_Pass..> | 2025-12-30 01:50 | 21K | |
| php82-pear-File_SMBP..> | 2025-12-28 14:29 | 6.0K | |
| php82-pear-Games_Che..> | 2025-12-29 21:49 | 83K | |
| php82-pear-HTML_AJAX..> | 2025-12-27 17:49 | 91K | |
| php82-pear-HTML_BBCo..> | 2025-12-30 04:55 | 16K | |
| php82-pear-HTML_CSS-..> | 2025-12-30 12:50 | 39K | |
| php82-pear-HTML_Comm..> | 2025-12-26 23:12 | 5.2K | |
| php82-pear-HTML_Comm..> | 2025-12-27 02:48 | 9.7K | |
| php82-pear-HTML_Cryp..> | 2025-12-27 21:39 | 5.2K | |
| php82-pear-HTML_Form..> | 2025-12-28 03:27 | 14K | |
| php82-pear-HTML_Java..> | 2025-12-28 17:54 | 9.1K | |
| php82-pear-HTML_Page..> | 2025-12-29 21:58 | 19K | |
| php82-pear-HTML_Quic..> | 2025-12-27 17:50 | 86K | |
| php82-pear-HTML_Quic..> | 2025-12-30 05:41 | 147K | |
| php82-pear-HTML_Quic..> | 2025-12-30 16:54 | 18K | |
| php82-pear-HTML_Quic..> | 2025-12-29 21:56 | 14K | |
| php82-pear-HTML_Quic..> | 2025-12-28 08:20 | 7.6K | |
| php82-pear-HTML_Quic..> | 2025-12-30 13:48 | 3.2K | |
| php82-pear-HTML_Quic..> | 2025-12-28 09:51 | 29K | |
| php82-pear-HTML_Sele..> | 2025-12-29 21:22 | 6.4K | |
| php82-pear-HTML_Sele..> | 2025-12-30 18:53 | 8.9K | |
| php82-pear-HTML_Tabl..> | 2025-12-27 02:07 | 15K | |
| php82-pear-HTML_TagC..> | 2025-12-28 21:29 | 12K | |
| php82-pear-HTML_Temp..> | 2025-12-27 13:16 | 144K | |
| php82-pear-HTML_Temp..> | 2025-12-27 11:46 | 22K | |
| php82-pear-HTML_Temp..> | 2025-12-28 07:18 | 18K | |
| php82-pear-HTML_Temp..> | 2025-12-30 04:14 | 29K | |
| php82-pear-HTML_Tree..> | 2025-12-27 23:46 | 50K | |
| php82-pear-HTTP-1.4...> | 2025-12-27 01:35 | 9.4K | |
| php82-pear-HTTP_Clie..> | 2025-12-29 19:13 | 11K | |
| php82-pear-HTTP_Down..> | 2025-12-29 11:45 | 15K | |
| php82-pear-HTTP_Floo..> | 2025-12-29 07:06 | 6.8K | |
| php82-pear-HTTP_Head..> | 2025-12-27 14:13 | 11K | |
| php82-pear-HTTP_Requ..> | 2025-12-26 21:48 | 17K | |
| php82-pear-HTTP_Requ..> | 2025-12-27 16:42 | 114K | |
| php82-pear-HTTP_Serv..> | 2025-12-30 00:00 | 7.6K | |
| php82-pear-HTTP_Sess..> | 2025-12-29 13:43 | 16K | |
| php82-pear-HTTP_Uplo..> | 2025-12-30 04:28 | 9.8K | |
| php82-pear-HTTP_WebD..> | 2025-12-29 00:55 | 9.5K | |
| php82-pear-HTTP_WebD..> | 2025-12-29 22:43 | 29K | |
| php82-pear-Horde_Cry..> | 2025-12-29 12:28 | 126K | |
| php82-pear-Horde_Cry..> | 2025-12-26 17:05 | 26K | |
| php82-pear-Horde_Ima..> | 2025-12-29 16:01 | 606K | |
| php82-pear-Horde_Ima..> | 2025-12-27 02:11 | 206K | |
| php82-pear-Horde_Kol..> | 2025-12-27 11:53 | 86K | |
| php82-pear-Horde_Log..> | 2025-12-26 16:14 | 16K | |
| php82-pear-Horde_Map..> | 2025-12-26 16:11 | 18K | |
| php82-pear-Horde_Smt..> | 2025-12-26 19:59 | 33K | |
| php82-pear-Horde_Vfs..> | 2025-12-27 15:30 | 64K | |
| php82-pear-I18N-1.0...> | 2025-12-27 04:03 | 31K | |
| php82-pear-I18Nv2-0...> | 2025-12-27 20:41 | 214K | |
| php82-pear-Image_3D-..> | 2025-12-29 22:33 | 99K | |
| php82-pear-Image_Bar..> | 2025-12-29 14:58 | 14K | |
| php82-pear-Image_Bar..> | 2025-12-30 05:58 | 16K | |
| php82-pear-Image_Can..> | 2025-12-27 10:27 | 39K | |
| php82-pear-Image_Col..> | 2025-12-26 22:59 | 10K | |
| php82-pear-Image_Gra..> | 2025-12-29 12:10 | 328K | |
| php82-pear-Image_Gra..> | 2025-12-30 02:31 | 17K | |
| php82-pear-Image_Tra..> | 2025-12-28 17:51 | 385K | |
| php82-pear-LiveUser-..> | 2025-12-27 15:46 | 64K | |
| php82-pear-LiveUser_..> | 2025-12-29 12:09 | 54K | |
| php82-pear-Log-1.14...> | 2025-12-27 11:45 | 40K | |
| php82-pear-MDB-1.3.0..> | 2025-12-27 17:13 | 126K | |
| php82-pear-MDB2-2.5...> | 2025-12-27 10:01 | 104K | |
| php82-pear-MDB2_Driv..> | 2025-12-28 04:57 | 34K | |
| php82-pear-MDB2_Driv..> | 2025-12-29 13:38 | 30K | |
| php82-pear-MDB2_Sche..> | 2025-12-28 10:13 | 64K | |
| php82-pear-MDB_Query..> | 2025-12-28 23:01 | 43K | |
| php82-pear-MIME_Type..> | 2025-12-27 02:56 | 20K | |
| php82-pear-Mail-2.0...> | 2025-12-27 15:58 | 22K | |
| php82-pear-Mail_Mbox..> | 2025-12-30 10:01 | 14K | |
| php82-pear-Mail_Mime..> | 2025-12-26 22:56 | 37K | |
| php82-pear-Mail_Queu..> | 2025-12-30 10:29 | 21K | |
| php82-pear-Mail_mime..> | 2025-12-27 10:15 | 13K | |
| php82-pear-Math_BigI..> | 2025-12-26 13:06 | 25K | |
| php82-pear-Math_Comb..> | 2025-12-29 11:22 | 6.1K | |
| php82-pear-Math_Frac..> | 2025-12-30 12:05 | 4.9K | |
| php82-pear-Net_Check..> | 2025-12-28 16:11 | 2.8K | |
| php82-pear-Net_Cyrus..> | 2025-12-27 22:51 | 6.4K | |
| php82-pear-Net_DIME-..> | 2025-12-29 05:23 | 7.8K | |
| php82-pear-Net_DNS2-..> | 2025-12-27 20:46 | 68K | |
| php82-pear-Net_DNS21..> | 2025-12-27 16:48 | 72K | |
| php82-pear-Net_DNSBL..> | 2025-12-29 05:03 | 8.7K | |
| php82-pear-Net_Dict-..> | 2025-12-28 12:27 | 6.6K | |
| php82-pear-Net_FTP-1..> | 2025-12-28 08:30 | 31K | |
| php82-pear-Net_Finge..> | 2025-12-28 23:59 | 2.5K | |
| php82-pear-Net_Gearm..> | 2025-12-30 03:48 | 18K | |
| php82-pear-Net_Geo-1..> | 2025-12-29 07:34 | 8.4K | |
| php82-pear-Net_GeoIP..> | 2025-12-29 13:25 | 14K | |
| php82-pear-Net_Growl..> | 2025-12-30 17:24 | 465K | |
| php82-pear-Net_IDNA-..> | 2025-12-27 22:09 | 18K | |
| php82-pear-Net_IMAP-..> | 2025-12-27 17:13 | 36K | |
| php82-pear-Net_IPv4-..> | 2025-12-27 10:28 | 7.0K | |
| php82-pear-Net_IPv6-..> | 2025-12-27 02:40 | 12K | |
| php82-pear-Net_Ident..> | 2025-12-28 17:33 | 4.0K | |
| php82-pear-Net_LDAP-..> | 2025-12-29 19:28 | 65K | |
| php82-pear-Net_LDAP2..> | 2025-12-28 11:46 | 82K | |
| php82-pear-Net_LMTP-..> | 2025-12-28 20:56 | 7.0K | |
| php82-pear-Net_MAC-0..> | 2025-12-28 21:06 | 5.9K | |
| php82-pear-Net_NNTP-..> | 2025-12-29 13:14 | 33K | |
| php82-pear-Net_Nmap-..> | 2025-12-29 04:33 | 25K | |
| php82-pear-Net_POP3-..> | 2025-12-30 10:09 | 10K | |
| php82-pear-Net_Ping-..> | 2025-12-29 15:58 | 9.9K | |
| php82-pear-Net_Ports..> | 2025-12-30 11:17 | 3.5K | |
| php82-pear-Net_SMS-0..> | 2025-12-29 03:06 | 19K | |
| php82-pear-Net_SMTP-..> | 2025-12-26 10:24 | 17K | |
| php82-pear-Net_Serve..> | 2025-12-27 06:01 | 18K | |
| php82-pear-Net_Sieve..> | 2025-12-30 09:39 | 15K | |
| php82-pear-Net_Smart..> | 2025-12-28 16:26 | 105K | |
| php82-pear-Net_Socke..> | 2025-12-26 09:52 | 7.3K | |
| php82-pear-Net_Trace..> | 2025-12-30 16:31 | 7.5K | |
| php82-pear-Net_URL-1..> | 2025-12-26 18:27 | 6.9K | |
| php82-pear-Net_URL2-..> | 2025-12-26 20:29 | 19K | |
| php82-pear-Net_URL_M..> | 2025-12-30 16:39 | 14K | |
| php82-pear-Net_UserA..> | 2025-12-30 07:25 | 12K | |
| php82-pear-Net_UserA..> | 2025-12-30 12:39 | 32K | |
| php82-pear-Net_Vpopm..> | 2025-12-30 04:05 | 21K | |
| php82-pear-Net_Whois..> | 2025-12-28 01:25 | 7.0K | |
| php82-pear-Numbers_R..> | 2025-12-30 09:36 | 6.9K | |
| php82-pear-Numbers_W..> | 2025-12-29 21:24 | 45K | |
| php82-pear-OLE-1.0.1..> | 2025-12-27 01:24 | 14K | |
| php82-pear-PEAR_Info..> | 2025-12-29 23:57 | 46K | |
| php82-pear-PEAR_Pack..> | 2025-12-30 12:50 | 34K | |
| php82-pear-PEAR_Pack..> | 2025-12-28 14:49 | 35K | |
| php82-pear-PEAR_Pack..> | 2025-12-27 12:12 | 21K | |
| php82-pear-PHPTAL-1...> | 2025-12-30 02:58 | 152K | |
| php82-pear-PHPUnit_M..> | 2025-12-30 01:43 | 21K | |
| php82-pear-PHP_Archi..> | 2025-12-29 15:55 | 47K | |
| php82-pear-PHP_Array..> | 2025-12-29 13:18 | 8.5K | |
| php82-pear-PHP_Beaut..> | 2025-12-29 08:20 | 68K | |
| php82-pear-PHP_CodeC..> | 2025-12-28 10:19 | 296K | |
| php82-pear-PHP_CodeS..> | 2025-12-29 19:29 | 612K | |
| php82-pear-PHP_Compa..> | 2025-12-28 08:57 | 43K | |
| php82-pear-PHP_Compa..> | 2025-12-30 12:31 | 136K | |
| php82-pear-PHP_Parse..> | 2025-12-29 03:57 | 87K | |
| php82-pear-PHP_Parse..> | 2025-12-30 10:15 | 140K | |
| php82-pear-PHP_Shell..> | 2025-12-28 05:32 | 84K | |
| php82-pear-PHP_Timer..> | 2025-12-27 10:45 | 2.5K | |
| php82-pear-PHP_Token..> | 2025-12-27 16:52 | 17K | |
| php82-pear-PHP_UML-1..> | 2025-12-28 23:32 | 404K | |
| php82-pear-Pager-2.5..> | 2025-12-26 20:28 | 32K | |
| php82-pear-Payment_D..> | 2025-12-28 20:14 | 39K | |
| php82-pear-PhpDocume..> | 2025-12-30 02:00 | 964K | |
| php82-pear-SOAP-0.14..> | 2025-12-29 22:11 | 74K | |
| php82-pear-Sebastian..> | 2025-12-27 16:22 | 2.0K | |
| php82-pear-Sebastian..> | 2025-12-27 06:27 | 2.0K | |
| php82-pear-Sebastian..> | 2025-12-29 23:25 | 7.0K | |
| php82-pear-Sebastian..> | 2025-12-28 04:23 | 11K | |
| php82-pear-Sebastian..> | 2025-12-27 10:17 | 1.5K | |
| php82-pear-Services_..> | 2025-12-30 16:20 | 15K | |
| php82-pear-Services_..> | 2025-12-30 02:15 | 28K | |
| php82-pear-Services_..> | 2025-12-28 23:53 | 16K | |
| php82-pear-Services_..> | 2025-12-30 01:16 | 3.7K | |
| php82-pear-Services_..> | 2025-12-29 03:32 | 10K | |
| php82-pear-Services_..> | 2025-12-30 02:08 | 22K | |
| php82-pear-Services_..> | 2025-12-30 12:15 | 75K | |
| php82-pear-Services_..> | 2025-12-29 13:19 | 39K | |
| php82-pear-Services_..> | 2025-12-30 07:38 | 4.1K | |
| php82-pear-Services_..> | 2025-12-29 19:55 | 9.9K | |
| php82-pear-Services_..> | 2025-12-28 21:41 | 5.2K | |
| php82-pear-Services_..> | 2025-12-30 14:13 | 9.1K | |
| php82-pear-Services_..> | 2025-12-28 08:23 | 11K | |
| php82-pear-Services_..> | 2025-12-28 01:26 | 4.9K | |
| php82-pear-Services_..> | 2025-12-30 10:59 | 6.1K | |
| php82-pear-Services_..> | 2025-12-29 17:35 | 58K | |
| php82-pear-Services_..> | 2025-12-30 16:32 | 11K | |
| php82-pear-Services_..> | 2025-12-28 16:25 | 14K | |
| php82-pear-Services_..> | 2025-12-29 15:48 | 45K | |
| php82-pear-Services_..> | 2025-12-29 11:34 | 15K | |
| php82-pear-Services_..> | 2025-12-30 16:05 | 13K | |
| php82-pear-Services_..> | 2025-12-28 19:49 | 4.4K | |
| php82-pear-Spreadshe..> | 2025-12-27 16:20 | 49K | |
| php82-pear-Structure..> | 2025-12-26 23:26 | 43K | |
| php82-pear-Structure..> | 2025-12-27 02:44 | 4.2K | |
| php82-pear-Structure..> | 2025-12-30 09:26 | 4.9K | |
| php82-pear-Structure..> | 2025-12-27 21:40 | 3.3K | |
| php82-pear-Structure..> | 2025-12-30 10:05 | 4.9K | |
| php82-pear-Structure..> | 2025-12-29 12:20 | 4.7K | |
| php82-pear-Structure..> | 2025-12-28 21:09 | 3.8K | |
| php82-pear-Structure..> | 2025-12-28 12:23 | 9.6K | |
| php82-pear-Structure..> | 2025-12-30 05:25 | 4.9K | |
| php82-pear-Structure..> | 2025-12-29 20:16 | 6.9K | |
| php82-pear-Structure..> | 2025-12-27 11:48 | 5.1K | |
| php82-pear-Structure..> | 2025-12-27 21:43 | 5.6K | |
| php82-pear-Structure..> | 2025-12-29 13:55 | 4.6K | |
| php82-pear-Structure..> | 2025-12-28 03:07 | 4.5K | |
| php82-pear-Structure..> | 2025-12-29 03:55 | 13K | |
| php82-pear-Symfony_C..> | 2025-12-27 12:42 | 78K | |
| php82-pear-Symfony_C..> | 2025-12-27 00:19 | 34K | |
| php82-pear-Symfony_C..> | 2025-12-28 02:56 | 38K | |
| php82-pear-System_Co..> | 2025-12-30 05:22 | 7.2K | |
| php82-pear-Testing_S..> | 2025-12-29 19:50 | 2.3M | |
| php82-pear-Text_Diff..> | 2025-12-30 09:32 | 21K | |
| php82-pear-Text_Figl..> | 2025-12-27 20:43 | 8.7K | |
| php82-pear-Text_High..> | 2025-12-29 14:59 | 82K | |
| php82-pear-Text_Pass..> | 2025-12-28 13:24 | 6.2K | |
| php82-pear-Text_Spel..> | 2025-12-29 20:20 | 125K | |
| php82-pear-Text_Temp..> | 2025-12-27 09:47 | 1.9K | |
| php82-pear-Text_Wiki..> | 2025-12-29 19:44 | 77K | |
| php82-pear-TheSeer_D..> | 2025-12-28 11:10 | 3.0K | |
| php82-pear-TheSeer_f..> | 2025-12-27 01:39 | 5.1K | |
| php82-pear-TheSeer_f..> | 2025-12-29 08:43 | 6.7K | |
| php82-pear-Translati..> | 2025-12-29 19:14 | 47K | |
| php82-pear-UDDI-0.2...> | 2025-12-30 08:45 | 7.6K | |
| php82-pear-URI_Templ..> | 2025-12-29 11:16 | 7.4K | |
| php82-pear-VFS-0.3.0..> | 2025-12-30 10:35 | 36K | |
| php82-pear-Validate-..> | 2025-12-27 10:24 | 21K | |
| php82-pear-Validate_..> | 2025-12-29 19:55 | 11K | |
| php82-pear-Validate_..> | 2025-12-30 11:16 | 11K | |
| php82-pear-Validate_..> | 2025-12-28 06:23 | 7.2K | |
| php82-pear-Validate_..> | 2025-12-30 17:30 | 6.5K | |
| php82-pear-Validate_..> | 2025-12-29 11:44 | 9.6K | |
| php82-pear-Var_Dump-..> | 2025-12-27 22:39 | 18K | |
| php82-pear-VersionCo..> | 2025-12-29 02:18 | 16K | |
| php82-pear-VersionCo..> | 2025-12-28 16:28 | 28K | |
| php82-pear-XML_Beaut..> | 2025-12-29 00:18 | 14K | |
| php82-pear-XML_DTD-0..> | 2025-12-27 12:17 | 33K | |
| php82-pear-XML_Feed_..> | 2025-12-28 10:48 | 268K | |
| php82-pear-XML_GRDDL..> | 2025-12-30 02:20 | 44K | |
| php82-pear-XML_HTMLS..> | 2025-12-29 06:38 | 16K | |
| php82-pear-XML_NITF-..> | 2025-12-29 19:36 | 8.2K | |
| php82-pear-XML_Parse..> | 2025-12-26 19:56 | 14K | |
| php82-pear-XML_Query..> | 2025-12-27 23:08 | 298K | |
| php82-pear-XML_RPC-1..> | 2025-12-27 15:33 | 24K | |
| php82-pear-XML_RPC2-..> | 2025-12-30 08:31 | 58K | |
| php82-pear-XML_RSS-1..> | 2025-12-27 19:37 | 8.7K | |
| php82-pear-XML_SVG-1..> | 2025-12-29 07:01 | 9.2K | |
| php82-pear-XML_Seria..> | 2025-12-26 21:21 | 31K | |
| php82-pear-XML_Trans..> | 2025-12-30 17:08 | 27K | |
| php82-pear-XML_Tree-..> | 2025-12-29 04:50 | 5.4K | |
| php82-pear-XML_Util-..> | 2025-12-26 19:25 | 18K | |
| php82-pear-XML_Wddx-..> | 2025-12-28 10:26 | 6.9K | |
| php82-pear-YAML-1.0...> | 2025-12-28 18:20 | 10K | |
| php82-pear-channel-e..> | 2025-12-26 19:19 | 1.2K | |
| php82-pear-channel-g..> | 2025-12-27 10:27 | 1.1K | |
| php82-pear-channel-h..> | 2025-12-26 06:55 | 1.1K | |
| php82-pear-channel-o..> | 2025-12-27 22:49 | 1.1K | |
| php82-pear-channel-p..> | 2025-12-27 10:21 | 1.1K | |
| php82-pear-channel-p..> | 2025-12-27 13:01 | 1.1K | |
| php82-pear-channel-p..> | 2025-12-30 18:16 | 1.2K | |
| php82-pear-channel-p..> | 2025-12-29 03:57 | 1.1K | |
| php82-pear-channel-p..> | 2025-12-27 15:44 | 1.2K | |
| php82-pear-channel-s..> | 2025-12-27 02:51 | 1.2K | |
| php82-pear-channel-s..> | 2025-12-26 19:09 | 1.2K | |
| php82-pear-channel-t..> | 2025-12-26 17:56 | 1.1K | |
| php82-pear-channel-t..> | 2025-12-27 09:09 | 1.2K | |
| php82-pear-codegen-1..> | 2025-12-30 03:05 | 43K | |
| php82-pear-ezc_Base-..> | 2025-12-26 22:13 | 212K | |
| php82-pear-ezc_Conso..> | 2025-12-27 10:21 | 746K | |
| php82-pear-geshi-ges..> | 2025-12-30 14:49 | 666K | |
| php82-pear-horde-Hor..> | 2025-12-26 20:21 | 317K | |
| php82-pear-horde-Hor..> | 2025-12-26 20:21 | 39K | |
| php82-pear-horde-Hor..> | 2025-12-28 13:13 | 61K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:20 | 54K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:47 | 16K | |
| php82-pear-horde-Hor..> | 2025-12-27 22:08 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-26 17:27 | 38K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:29 | 27K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:59 | 31K | |
| php82-pear-horde-Hor..> | 2025-12-26 17:13 | 2.1M | |
| php82-pear-horde-Hor..> | 2025-12-26 17:04 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-26 13:04 | 6.7K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:09 | 12K | |
| php82-pear-horde-Hor..> | 2025-12-26 21:49 | 1.2M | |
| php82-pear-horde-Hor..> | 2025-12-26 18:37 | 12K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:03 | 73K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:09 | 45K | |
| php82-pear-horde-Hor..> | 2025-12-26 11:01 | 67K | |
| php82-pear-horde-Hor..> | 2025-12-30 02:21 | 30K | |
| php82-pear-horde-Hor..> | 2025-12-27 06:41 | 192K | |
| php82-pear-horde-Hor..> | 2025-12-26 13:03 | 73K | |
| php82-pear-horde-Hor..> | 2025-12-28 11:01 | 570K | |
| php82-pear-horde-Hor..> | 2025-12-26 09:14 | 26K | |
| php82-pear-horde-Hor..> | 2025-12-29 00:49 | 1.2M | |
| php82-pear-horde-Hor..> | 2025-12-29 12:52 | 148K | |
| php82-pear-horde-Hor..> | 2025-12-26 13:40 | 23K | |
| php82-pear-horde-Hor..> | 2025-12-26 15:50 | 17K | |
| php82-pear-horde-Hor..> | 2025-12-26 20:11 | 26K | |
| php82-pear-horde-Hor..> | 2025-12-26 21:00 | 16K | |
| php82-pear-horde-Hor..> | 2025-12-26 16:07 | 99K | |
| php82-pear-horde-Hor..> | 2025-12-26 10:01 | 11K | |
| php82-pear-horde-Hor..> | 2025-12-29 13:55 | 34K | |
| php82-pear-horde-Hor..> | 2025-12-26 15:27 | 22K | |
| php82-pear-horde-Hor..> | 2025-12-30 03:05 | 36K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:43 | 16K | |
| php82-pear-horde-Hor..> | 2025-12-27 14:40 | 54K | |
| php82-pear-horde-Hor..> | 2025-12-29 23:57 | 22K | |
| php82-pear-horde-Hor..> | 2025-12-30 16:40 | 141K | |
| php82-pear-horde-Hor..> | 2025-12-26 23:08 | 57K | |
| php82-pear-horde-Hor..> | 2025-12-30 09:04 | 18K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:19 | 18K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:33 | 31K | |
| php82-pear-horde-Hor..> | 2025-12-26 12:26 | 36K | |
| php82-pear-horde-Hor..> | 2025-12-28 02:13 | 18K | |
| php82-pear-horde-Hor..> | 2025-12-29 14:11 | 15K | |
| php82-pear-horde-Hor..> | 2025-12-26 14:16 | 125K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:01 | 269K | |
| php82-pear-horde-Hor..> | 2025-12-29 04:33 | 85K | |
| php82-pear-horde-Hor..> | 2025-12-26 10:07 | 225K | |
| php82-pear-horde-Hor..> | 2025-12-26 20:04 | 21K | |
| php82-pear-horde-Hor..> | 2025-12-27 18:06 | 7.2K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:03 | 17K | |
| php82-pear-horde-Hor..> | 2025-12-28 15:33 | 47K | |
| php82-pear-horde-Hor..> | 2025-12-26 16:11 | 38K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:53 | 53K | |
| php82-pear-horde-Hor..> | 2025-12-30 06:28 | 13K | |
| php82-pear-horde-Hor..> | 2025-12-30 05:22 | 34K | |
| php82-pear-horde-Hor..> | 2025-12-26 15:08 | 11K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:50 | 40K | |
| php82-pear-horde-Hor..> | 2025-12-30 06:13 | 39K | |
| php82-pear-horde-Hor..> | 2025-12-28 12:33 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-30 04:23 | 6.0K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:09 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:34 | 16K | |
| php82-pear-horde-Hor..> | 2025-12-28 12:26 | 32K | |
| php82-pear-horde-Hor..> | 2025-12-30 00:21 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-30 05:30 | 11K | |
| php82-pear-horde-Hor..> | 2025-12-29 13:19 | 3.0K | |
| php82-pear-horde-Hor..> | 2025-12-29 03:47 | 192K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:50 | 25K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:49 | 56K | |
| php82-pear-horde-Hor..> | 2025-12-26 14:50 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-30 06:35 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-26 16:57 | 18K | |
| php82-pear-horde-Hor..> | 2025-12-26 09:53 | 14K | |
| php82-pear-horde-Hor..> | 2025-12-26 09:53 | 6.8K | |
| php82-pear-horde-Hor..> | 2025-12-26 11:36 | 25K | |
| php82-pear-horde-Hor..> | 2025-12-27 13:15 | 115K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:08 | 15K | |
| php82-pear-horde-Hor..> | 2025-12-29 06:14 | 29K | |
| php82-pear-horde-Hor..> | 2025-12-26 15:56 | 53K | |
| php82-pear-horde-Hor..> | 2025-12-30 14:02 | 24K | |
| php82-pear-horde-Hor..> | 2025-12-26 12:30 | 15K | |
| php82-pear-horde-Hor..> | 2025-12-27 15:30 | 21K | |
| php82-pear-horde-Hor..> | 2025-12-28 06:12 | 28K | |
| php82-pear-horde-Hor..> | 2025-12-26 18:54 | 32K | |
| php82-pear-horde-Hor..> | 2025-12-26 08:40 | 16K | |
| php82-pear-horde-Hor..> | 2025-12-29 07:15 | 19K | |
| php82-pear-horde-Hor..> | 2025-12-26 15:56 | 17K | |
| php82-pear-horde-Hor..> | 2025-12-26 09:47 | 35K | |
| php82-pear-horde-Hor..> | 2025-12-26 19:09 | 42K | |
| php82-pear-horde-Hor..> | 2025-12-27 13:09 | 12K | |
| php82-pear-horde-Hor..> | 2025-12-26 20:45 | 26K | |
| php82-pear-pdepend_s..> | 2025-12-30 14:04 | 33K | |
| php82-pear-phing-2.6..> | 2025-12-29 03:26 | 361K | |
| php82-pear-pirum-Pir..> | 2025-12-30 05:51 | 15K | |
| php82-pear-twig-twig..> | 2025-12-29 13:33 | 94K | |
| php82-pecl-APCu-5.1...> | 2025-12-27 01:40 | 54K | |
| php82-pecl-amqp-2.1...> | 2025-12-28 01:15 | 53K | |
| php82-pecl-ast-1.1.3..> | 2025-12-28 01:27 | 21K | |
| php82-pecl-bitset-3...> | 2025-12-26 17:00 | 11K | |
| php82-pecl-couchbase..> | 2025-12-27 22:30 | 29K | |
| php82-pecl-crypto-0...> | 2025-12-28 09:59 | 32K | |
| php82-pecl-dio-0.3.0..> | 2025-12-30 05:58 | 12K | |
| php82-pecl-ds-1.6.0.pkg | 2025-12-30 12:26 | 58K | |
| php82-pecl-eio-3.0.0..> | 2025-12-27 23:00 | 29K | |
| php82-pecl-ev-1.2.2.pkg | 2025-12-27 22:07 | 46K | |
| php82-pecl-event-3.1..> | 2025-12-29 05:57 | 46K | |
| php82-pecl-excimer-1..> | 2025-12-29 03:41 | 24K | |
| php82-pecl-expect-0...> | 2025-12-30 04:09 | 7.8K | |
| php82-pecl-geospatia..> | 2025-12-30 01:52 | 17K | |
| php82-pecl-gnupg-1.5..> | 2025-12-27 02:11 | 18K | |
| php82-pecl-grpc-1.76..> | 2025-12-28 16:00 | 3.3M | |
| php82-pecl-horde_lz4..> | 2025-12-28 20:09 | 4.5K | |
| php82-pecl-http-4.3...> | 2025-12-28 21:06 | 143K | |
| php82-pecl-igbinary-..> | 2025-12-27 22:07 | 27K | |
| php82-pecl-imagick-3..> | 2025-12-27 06:26 | 125K | |
| php82-pecl-inotify-3..> | 2025-12-30 00:59 | 7.0K | |
| php82-pecl-json_post..> | 2025-12-29 13:35 | 5.4K | |
| php82-pecl-krb5-1.2...> | 2025-12-29 16:28 | 26K | |
| php82-pecl-leveldb-0..> | 2025-12-30 14:16 | 14K | |
| php82-pecl-libsodium..> | 2025-12-30 11:19 | 24K | |
| php82-pecl-lzf-1.7.0..> | 2025-12-27 22:09 | 8.2K | |
| php82-pecl-mailparse..> | 2025-12-29 03:21 | 27K | |
| php82-pecl-mcrypt-1...> | 2025-12-26 16:05 | 15K | |
| php82-pecl-memcache-..> | 2025-12-26 15:54 | 44K | |
| php82-pecl-memcached..> | 2025-12-26 17:31 | 52K | |
| php82-pecl-mongodb-1..> | 2025-12-30 05:08 | 821K | |
| php82-pecl-msgpack-3..> | 2025-12-27 15:30 | 27K | |
| php82-pecl-mustache-..> | 2025-12-30 02:31 | 27K | |
| php82-pecl-oauth-2.0..> | 2025-12-28 10:53 | 37K | |
| php82-pecl-opentelem..> | 2025-12-29 01:17 | 13K | |
| php82-pecl-pam-2.2.5..> | 2025-12-28 12:06 | 8.8K | |
| php82-pecl-pcov-1.0...> | 2025-12-30 09:26 | 10K | |
| php82-pecl-pkcs11-1...> | 2025-12-30 06:13 | 47K | |
| php82-pecl-proctitle..> | 2025-12-29 16:53 | 4.1K | |
| php82-pecl-protobuf-..> | 2025-12-28 13:09 | 233K | |
| php82-pecl-psr-1.2.0..> | 2025-12-30 07:19 | 16K | |
| php82-pecl-qrencode-..> | 2025-12-30 14:07 | 7.2K | |
| php82-pecl-radius-1...> | 2025-12-27 18:18 | 32K | |
| php82-pecl-raphf-2.0..> | 2025-12-27 02:11 | 11K | |
| php82-pecl-rar-4.2.0..> | 2025-12-30 10:12 | 152K | |
| php82-pecl-rdkafka-6..> | 2025-12-28 14:12 | 42K | |
| php82-pecl-redis-6.3..> | 2025-12-27 13:15 | 238K | |
| php82-pecl-rrd-2.0.3..> | 2025-12-28 14:14 | 14K | |
| php82-pecl-runkit7-4..> | 2025-12-28 05:20 | 40K | |
| php82-pecl-scrypt-2...> | 2025-12-29 17:41 | 18K | |
| php82-pecl-smbclient..> | 2025-12-27 06:20 | 24K | |
| php82-pecl-solr-2.8...> | 2025-12-30 06:26 | 80K | |
| php82-pecl-ssh2-1.3...> | 2025-12-27 18:47 | 27K | |
| php82-pecl-stomp-2.0..> | 2025-12-30 10:43 | 19K | |
| php82-pecl-swoole-6...> | 2025-12-28 19:18 | 865K | |
| php82-pecl-sync-1.1...> | 2025-12-29 19:55 | 14K | |
| php82-pecl-timezoned..> | 2025-12-29 12:04 | 243K | |
| php82-pecl-uploadpro..> | 2025-12-29 03:10 | 7.8K | |
| php82-pecl-uuid-1.3...> | 2025-12-27 05:56 | 8.3K | |
| php82-pecl-uv-0.3.0.pkg | 2025-12-30 14:03 | 49K | |
| php82-pecl-vips-1.0...> | 2025-12-28 10:48 | 17K | |
| php82-pecl-vld-0.19...> | 2025-12-28 10:21 | 18K | |
| php82-pecl-xdebug-3...> | 2025-12-27 21:03 | 135K | |
| php82-pecl-xdiff-2.1..> | 2025-12-30 16:54 | 9.5K | |
| php82-pecl-xlswriter..> | 2025-12-28 02:30 | 167K | |
| php82-pecl-xmlrpc-1...> | 2025-12-27 16:37 | 40K | |
| php82-pecl-xxtea-1.0..> | 2025-12-27 10:11 | 5.8K | |
| php82-pecl-yac-2.3.1..> | 2025-12-27 21:07 | 23K | |
| php82-pecl-yaconf-1...> | 2025-12-28 13:27 | 11K | |
| php82-pecl-yaf-3.3.7..> | 2025-12-28 16:10 | 96K | |
| php82-pecl-yaml-2.3...> | 2025-12-29 11:04 | 21K | |
| php82-pecl-yar-2.3.4..> | 2025-12-29 13:17 | 33K | |
| php82-pecl-zephir_pa..> | 2025-12-27 07:29 | 46K | |
| php82-pecl-zookeeper..> | 2025-12-30 02:29 | 25K | |
| php82-pecl-zstd-0.15..> | 2025-12-29 22:25 | 16K | |
| php82-pgsql-8.2.30.pkg | 2025-12-26 15:28 | 49K | |
| php82-phalcon-5.9.3.pkg | 2025-12-29 19:20 | 1.9M | |
| php82-phar-8.2.30.pkg | 2025-12-26 22:24 | 113K | |
| php82-posix-8.2.30.pkg | 2025-12-26 16:10 | 14K | |
| php82-pspell-8.2.30.pkg | 2025-12-30 14:11 | 9.8K | |
| php82-readline-8.2.3..> | 2025-12-27 09:38 | 14K | |
| php82-session-8.2.30..> | 2025-12-26 13:14 | 39K | |
| php82-shmop-8.2.30.pkg | 2025-12-30 09:37 | 7.3K | |
| php82-simplexml-8.2...> | 2025-12-26 15:32 | 24K | |
| php82-snappy-0.2.3.pkg | 2025-12-29 10:47 | 4.4K | |
| php82-snmp-8.2.30.pkg | 2025-12-27 16:38 | 24K | |
| php82-snuffleupagus-..> | 2025-12-30 01:51 | 73K | |
| php82-soap-8.2.30.pkg | 2025-12-26 15:25 | 127K | |
| php82-sockets-8.2.30..> | 2025-12-26 14:50 | 43K | |
| php82-sodium-8.2.30.pkg | 2025-12-26 20:46 | 32K | |
| php82-sqlite3-8.2.30..> | 2025-12-26 16:13 | 26K | |
| php82-sysvmsg-8.2.30..> | 2025-12-27 16:18 | 9.3K | |
| php82-sysvsem-8.2.30..> | 2025-12-26 22:52 | 7.0K | |
| php82-sysvshm-8.2.30..> | 2025-12-28 11:10 | 8.2K | |
| php82-tarantool-0.4...> | 2025-12-30 00:29 | 51K | |
| php82-tidy-8.2.30.pkg | 2025-12-27 10:18 | 23K | |
| php82-tokenizer-8.2...> | 2025-12-26 21:18 | 14K | |
| php82-xapian-1.4.30.pkg | 2025-12-30 17:34 | 295K | |
| php82-xml-8.2.30.pkg | 2025-12-26 06:24 | 22K | |
| php82-xmlreader-8.2...> | 2025-12-26 22:51 | 16K | |
| php82-xmlwriter-8.2...> | 2025-12-26 23:42 | 15K | |
| php82-xsl-8.2.30.pkg | 2025-12-26 21:28 | 15K | |
| php82-zephir-0.17.0.pkg | 2025-12-29 07:32 | 1.4M | |
| php82-zip-8.2.30.pkg | 2025-12-26 20:54 | 33K | |
| php82-zlib-8.2.30.pkg | 2025-12-26 06:18 | 21K | |
| php82-zstd-0.15.2_1.pkg | 2025-12-30 05:44 | 16K | |
| php83-8.3.29.pkg | 2025-12-26 05:56 | 4.5M | |
| php83-Ice37-3.7.10.pkg | 2025-12-30 12:44 | 177K | |
| php83-adminer-5.4.1.pkg | 2025-12-29 07:13 | 358K | |
| php83-aphpunit-2.3.pkg | 2025-12-29 03:03 | 14K | |
| php83-bcmath-8.3.29.pkg | 2025-12-26 13:46 | 22K | |
| php83-brotli-0.18.2_..> | 2025-12-29 08:50 | 14K | |
| php83-bsdconv-11.6.0..> | 2025-12-28 08:30 | 8.7K | |
| php83-bz2-8.3.29.pkg | 2025-12-26 21:22 | 11K | |
| php83-bzip3-0.1.1.pkg | 2025-12-28 10:09 | 5.7K | |
| php83-calendar-8.3.2..> | 2025-12-27 16:20 | 16K | |
| php83-composer-2.9.2..> | 2025-12-27 19:42 | 590K | |
| php83-ctype-8.3.29.pkg | 2025-12-26 15:54 | 6.1K | |
| php83-curl-8.3.29.pkg | 2025-12-26 16:01 | 47K | |
| php83-dba-8.3.29.pkg | 2025-12-28 06:53 | 24K | |
| php83-dddbl-2.0.1.pkg | 2025-12-28 21:12 | 9.5K | |
| php83-deployer-6.4.3..> | 2025-12-29 03:06 | 327K | |
| php83-dom-8.3.29.pkg | 2025-12-26 08:42 | 78K | |
| php83-enchant-8.3.29..> | 2025-12-29 12:43 | 11K | |
| php83-exif-8.3.29.pkg | 2025-12-26 20:24 | 30K | |
| php83-extensions-1.0..> | 2025-12-28 07:41 | 1.1K | |
| php83-ffi-8.3.29.pkg | 2025-12-27 23:08 | 70K | |
| php83-fileinfo-8.3.2..> | 2025-12-26 14:59 | 343K | |
| php83-filter-8.3.29.pkg | 2025-12-26 14:44 | 24K | |
| php83-ftp-8.3.29.pkg | 2025-12-27 17:03 | 27K | |
| php83-gd-8.3.29.pkg | 2025-12-26 17:13 | 36K | |
| php83-geos-1.0.0_1.pkg | 2025-12-28 13:12 | 21K | |
| php83-gettext-8.3.29..> | 2025-12-26 17:47 | 6.9K | |
| php83-gmp-8.3.29.pkg | 2025-12-26 21:08 | 24K | |
| php83-google-api-php..> | 2025-12-30 17:54 | 29K | |
| php83-iconv-8.3.29.pkg | 2025-12-26 16:30 | 19K | |
| php83-ilias-10.3.pkg | 2025-12-27 22:42 | 19M | |
| php83-imap-8.3.29.pkg | 2025-12-26 22:21 | 37K | |
| php83-intl-8.3.29.pkg | 2025-12-26 17:31 | 151K | |
| php83-kanboard-1.2.4..> | 2025-12-30 07:26 | 2.5M | |
| php83-ldap-8.3.29.pkg | 2025-12-26 14:57 | 36K | |
| php83-libawl-0.64.pkg | 2025-12-27 18:18 | 84K | |
| php83-lz4-0.6.0.pkg | 2025-12-29 23:24 | 8.2K | |
| php83-maxminddb-1.13..> | 2025-12-30 06:44 | 8.2K | |
| php83-mbstring-8.3.2..> | 2025-12-26 16:10 | 922K | |
| php83-mysqli-8.3.29.pkg | 2025-12-26 10:58 | 51K | |
| php83-odbc-8.3.29.pkg | 2025-12-29 03:57 | 29K | |
| php83-opcache-8.3.29..> | 2025-12-26 16:41 | 341K | |
| php83-opencc-0.0.0.2..> | 2025-12-27 23:43 | 5.9K | |
| php83-pcntl-8.3.29.pkg | 2025-12-26 20:27 | 19K | |
| php83-pdo-8.3.29.pkg | 2025-12-26 14:19 | 54K | |
| php83-pdo_dblib-8.3...> | 2025-12-30 10:08 | 13K | |
| php83-pdo_firebird-8..> | 2025-12-30 06:33 | 17K | |
| php83-pdo_mysql-8.3...> | 2025-12-26 17:13 | 15K | |
| php83-pdo_odbc-8.3.2..> | 2025-12-30 12:04 | 15K | |
| php83-pdo_pgsql-8.3...> | 2025-12-26 14:50 | 20K | |
| php83-pdo_sqlite-8.3..> | 2025-12-26 16:14 | 14K | |
| php83-pear-1.10.17.pkg | 2025-12-26 06:43 | 253K | |
| php83-pear-Auth-1.6...> | 2025-12-27 11:59 | 48K | |
| php83-pear-Auth_HTTP..> | 2025-12-28 12:22 | 9.3K | |
| php83-pear-Auth_Pref..> | 2025-12-29 03:35 | 12K | |
| php83-pear-Auth_RADI..> | 2025-12-28 08:29 | 9.1K | |
| php83-pear-Auth_SASL..> | 2025-12-26 22:10 | 10K | |
| php83-pear-Auth_SASL..> | 2025-12-29 05:18 | 9.6K | |
| php83-pear-Benchmark..> | 2025-12-30 14:51 | 9.2K | |
| php83-pear-Cache-1.5..> | 2025-12-27 08:43 | 29K | |
| php83-pear-Cache_Lit..> | 2025-12-27 13:00 | 33K | |
| php83-pear-Config-1...> | 2025-12-28 00:25 | 31K | |
| php83-pear-Console_C..> | 2025-12-30 07:54 | 5.7K | |
| php83-pear-Console_C..> | 2025-12-27 10:02 | 38K | |
| php83-pear-Console_G..> | 2025-12-27 18:06 | 17K | |
| php83-pear-Console_T..> | 2025-12-26 20:05 | 12K | |
| php83-pear-Contact_V..> | 2025-12-29 22:33 | 16K | |
| php83-pear-Contact_V..> | 2025-12-28 10:27 | 11K | |
| php83-pear-Crypt_Blo..> | 2025-12-29 12:37 | 17K | |
| php83-pear-Crypt_CBC..> | 2025-12-27 21:03 | 4.5K | |
| php83-pear-Crypt_CHA..> | 2025-12-27 09:45 | 6.2K | |
| php83-pear-Crypt_Dif..> | 2025-12-28 02:12 | 12K | |
| php83-pear-Crypt_GPG..> | 2025-12-29 02:22 | 285K | |
| php83-pear-Crypt_HMA..> | 2025-12-27 10:09 | 8.7K | |
| php83-pear-Crypt_Mic..> | 2025-12-29 22:41 | 3.9K | |
| php83-pear-Crypt_RC4..> | 2025-12-28 09:00 | 3.1K | |
| php83-pear-Crypt_RSA..> | 2025-12-28 13:08 | 20K | |
| php83-pear-Crypt_XXT..> | 2025-12-29 07:18 | 7.2K | |
| php83-pear-DB-1.12.3..> | 2025-12-26 23:00 | 87K | |
| php83-pear-DBA-1.1.1..> | 2025-12-27 09:59 | 13K | |
| php83-pear-DBA_Relat..> | 2025-12-28 11:47 | 19K | |
| php83-pear-DB_DataOb..> | 2025-12-27 17:26 | 70K | |
| php83-pear-DB_DataOb..> | 2025-12-30 06:08 | 60K | |
| php83-pear-DB_Pager-..> | 2025-12-30 07:23 | 4.7K | |
| php83-pear-DB_QueryT..> | 2025-12-30 06:49 | 40K | |
| php83-pear-DB_Sqlite..> | 2025-12-29 10:04 | 19K | |
| php83-pear-DB_Table-..> | 2025-12-28 15:19 | 93K | |
| php83-pear-DB_ldap-1..> | 2025-12-29 15:39 | 10K | |
| php83-pear-DB_ldap2-..> | 2025-12-28 10:48 | 19K | |
| php83-pear-Date-1.4...> | 2025-12-27 01:36 | 43K | |
| php83-pear-Date_Holi..> | 2025-12-27 16:36 | 34K | |
| php83-pear-Date_Holi..> | 2025-12-30 09:45 | 5.8K | |
| php83-pear-Date_Holi..> | 2025-12-29 12:53 | 4.8K | |
| php83-pear-Date_Holi..> | 2025-12-29 07:41 | 4.5K | |
| php83-pear-Date_Holi..> | 2025-12-28 13:21 | 3.8K | |
| php83-pear-Date_Holi..> | 2025-12-28 03:19 | 4.4K | |
| php83-pear-Date_Holi..> | 2025-12-27 22:17 | 12K | |
| php83-pear-Date_Holi..> | 2025-12-30 14:07 | 5.4K | |
| php83-pear-Date_Holi..> | 2025-12-29 06:44 | 5.2K | |
| php83-pear-Date_Holi..> | 2025-12-30 05:17 | 4.7K | |
| php83-pear-Date_Holi..> | 2025-12-30 14:13 | 9.4K | |
| php83-pear-Date_Holi..> | 2025-12-29 15:25 | 5.6K | |
| php83-pear-Date_Holi..> | 2025-12-28 19:35 | 4.1K | |
| php83-pear-Date_Holi..> | 2025-12-30 06:35 | 4.3K | |
| php83-pear-Date_Holi..> | 2025-12-29 16:11 | 3.7K | |
| php83-pear-Date_Holi..> | 2025-12-29 11:48 | 4.3K | |
| php83-pear-Date_Holi..> | 2025-12-30 04:31 | 6.6K | |
| php83-pear-Date_Holi..> | 2025-12-30 10:08 | 9.8K | |
| php83-pear-Date_Holi..> | 2025-12-28 14:52 | 5.4K | |
| php83-pear-Date_Holi..> | 2025-12-30 17:52 | 3.9K | |
| php83-pear-Event_Dis..> | 2025-12-26 23:49 | 9.2K | |
| php83-pear-FSM-1.4.0..> | 2025-12-28 11:46 | 12K | |
| php83-pear-File-1.4...> | 2025-12-27 06:13 | 9.0K | |
| php83-pear-File_Arch..> | 2025-12-28 10:01 | 53K | |
| php83-pear-File_Bitt..> | 2025-12-29 03:51 | 70K | |
| php83-pear-File_DNS-..> | 2025-12-29 13:56 | 10K | |
| php83-pear-File_Find..> | 2025-12-27 11:10 | 8.9K | |
| php83-pear-File_Fort..> | 2025-12-29 03:57 | 14K | |
| php83-pear-File_Fsta..> | 2025-12-29 10:56 | 7.7K | |
| php83-pear-File_Gett..> | 2025-12-29 06:36 | 7.9K | |
| php83-pear-File_HtAc..> | 2025-12-29 00:59 | 5.8K | |
| php83-pear-File_Iter..> | 2025-12-27 18:24 | 3.0K | |
| php83-pear-File_MARC..> | 2025-12-28 20:36 | 79K | |
| php83-pear-File_PDF-..> | 2025-12-30 09:40 | 38K | |
| php83-pear-File_Pass..> | 2025-12-29 01:32 | 21K | |
| php83-pear-File_SMBP..> | 2025-12-30 03:48 | 6.0K | |
| php83-pear-Games_Che..> | 2025-12-28 05:57 | 83K | |
| php83-pear-HTML_AJAX..> | 2025-12-27 09:51 | 91K | |
| php83-pear-HTML_BBCo..> | 2025-12-28 00:52 | 16K | |
| php83-pear-HTML_CSS-..> | 2025-12-29 21:26 | 39K | |
| php83-pear-HTML_Comm..> | 2025-12-26 22:48 | 5.2K | |
| php83-pear-HTML_Comm..> | 2025-12-27 15:35 | 9.7K | |
| php83-pear-HTML_Cryp..> | 2025-12-30 14:46 | 5.2K | |
| php83-pear-HTML_Form..> | 2025-12-27 22:16 | 14K | |
| php83-pear-HTML_Java..> | 2025-12-29 06:24 | 9.1K | |
| php83-pear-HTML_Page..> | 2025-12-30 14:13 | 19K | |
| php83-pear-HTML_Quic..> | 2025-12-27 16:42 | 86K | |
| php83-pear-HTML_Quic..> | 2025-12-29 09:59 | 147K | |
| php83-pear-HTML_Quic..> | 2025-12-28 17:31 | 18K | |
| php83-pear-HTML_Quic..> | 2025-12-29 05:19 | 14K | |
| php83-pear-HTML_Quic..> | 2025-12-30 10:49 | 7.6K | |
| php83-pear-HTML_Quic..> | 2025-12-30 12:29 | 3.2K | |
| php83-pear-HTML_Quic..> | 2025-12-30 10:01 | 29K | |
| php83-pear-HTML_Sele..> | 2025-12-28 23:59 | 6.4K | |
| php83-pear-HTML_Sele..> | 2025-12-30 07:07 | 8.9K | |
| php83-pear-HTML_Tabl..> | 2025-12-27 18:18 | 15K | |
| php83-pear-HTML_TagC..> | 2025-12-30 09:27 | 12K | |
| php83-pear-HTML_Temp..> | 2025-12-27 09:42 | 144K | |
| php83-pear-HTML_Temp..> | 2025-12-27 12:04 | 22K | |
| php83-pear-HTML_Temp..> | 2025-12-29 10:46 | 18K | |
| php83-pear-HTML_Temp..> | 2025-12-29 20:29 | 29K | |
| php83-pear-HTML_Tree..> | 2025-12-30 07:07 | 50K | |
| php83-pear-HTTP-1.4...> | 2025-12-26 22:34 | 9.4K | |
| php83-pear-HTTP_Clie..> | 2025-12-30 14:48 | 11K | |
| php83-pear-HTTP_Down..> | 2025-12-29 22:48 | 15K | |
| php83-pear-HTTP_Floo..> | 2025-12-27 22:49 | 6.8K | |
| php83-pear-HTTP_Head..> | 2025-12-27 02:50 | 11K | |
| php83-pear-HTTP_Requ..> | 2025-12-26 23:54 | 17K | |
| php83-pear-HTTP_Requ..> | 2025-12-27 07:35 | 114K | |
| php83-pear-HTTP_Serv..> | 2025-12-27 19:55 | 7.6K | |
| php83-pear-HTTP_Sess..> | 2025-12-29 05:21 | 16K | |
| php83-pear-HTTP_Uplo..> | 2025-12-27 22:44 | 9.8K | |
| php83-pear-HTTP_WebD..> | 2025-12-29 16:17 | 9.5K | |
| php83-pear-HTTP_WebD..> | 2025-12-28 04:01 | 29K | |
| php83-pear-Horde_Cry..> | 2025-12-29 14:12 | 126K | |
| php83-pear-Horde_Cry..> | 2025-12-26 16:59 | 26K | |
| php83-pear-Horde_Ima..> | 2025-12-27 21:27 | 606K | |
| php83-pear-Horde_Ima..> | 2025-12-27 19:42 | 206K | |
| php83-pear-Horde_Kol..> | 2025-12-27 12:19 | 86K | |
| php83-pear-Horde_Log..> | 2025-12-26 15:29 | 16K | |
| php83-pear-Horde_Map..> | 2025-12-26 14:52 | 18K | |
| php83-pear-Horde_Smt..> | 2025-12-26 19:50 | 33K | |
| php83-pear-Horde_Vfs..> | 2025-12-27 09:06 | 64K | |
| php83-pear-I18N-1.0...> | 2025-12-27 11:47 | 31K | |
| php83-pear-I18Nv2-0...> | 2025-12-29 17:25 | 214K | |
| php83-pear-Image_3D-..> | 2025-12-29 06:41 | 99K | |
| php83-pear-Image_Bar..> | 2025-12-30 16:47 | 13K | |
| php83-pear-Image_Bar..> | 2025-12-29 14:16 | 16K | |
| php83-pear-Image_Can..> | 2025-12-27 16:48 | 39K | |
| php83-pear-Image_Col..> | 2025-12-26 20:46 | 10K | |
| php83-pear-Image_Gra..> | 2025-12-30 16:01 | 328K | |
| php83-pear-Image_Gra..> | 2025-12-30 06:26 | 17K | |
| php83-pear-Image_Tra..> | 2025-12-27 20:20 | 385K | |
| php83-pear-LiveUser-..> | 2025-12-27 09:09 | 64K | |
| php83-pear-LiveUser_..> | 2025-12-29 17:57 | 54K | |
| php83-pear-Log-1.14...> | 2025-12-27 16:03 | 40K | |
| php83-pear-MDB-1.3.0..> | 2025-12-27 17:52 | 126K | |
| php83-pear-MDB2-2.5...> | 2025-12-27 19:44 | 104K | |
| php83-pear-MDB2_Driv..> | 2025-12-30 15:16 | 34K | |
| php83-pear-MDB2_Driv..> | 2025-12-29 02:51 | 30K | |
| php83-pear-MDB2_Sche..> | 2025-12-28 01:15 | 64K | |
| php83-pear-MDB_Query..> | 2025-12-29 15:38 | 43K | |
| php83-pear-MIME_Type..> | 2025-12-27 05:32 | 20K | |
| php83-pear-Mail-2.0...> | 2025-12-27 11:16 | 22K | |
| php83-pear-Mail_Mbox..> | 2025-12-27 19:55 | 14K | |
| php83-pear-Mail_Mime..> | 2025-12-26 23:26 | 37K | |
| php83-pear-Mail_Queu..> | 2025-12-30 04:53 | 21K | |
| php83-pear-Mail_mime..> | 2025-12-27 19:22 | 13K | |
| php83-pear-Math_BigI..> | 2025-12-26 13:42 | 25K | |
| php83-pear-Math_Comb..> | 2025-12-29 16:52 | 6.1K | |
| php83-pear-Math_Frac..> | 2025-12-30 06:05 | 4.9K | |
| php83-pear-Net_Check..> | 2025-12-28 03:07 | 2.8K | |
| php83-pear-Net_Cyrus..> | 2025-12-27 22:38 | 6.4K | |
| php83-pear-Net_DIME-..> | 2025-12-28 02:50 | 7.8K | |
| php83-pear-Net_DNS2-..> | 2025-12-28 10:07 | 68K | |
| php83-pear-Net_DNS21..> | 2025-12-27 18:50 | 72K | |
| php83-pear-Net_DNSBL..> | 2025-12-27 23:43 | 8.7K | |
| php83-pear-Net_Dict-..> | 2025-12-30 07:20 | 6.6K | |
| php83-pear-Net_FTP-1..> | 2025-12-29 17:01 | 31K | |
| php83-pear-Net_Finge..> | 2025-12-28 14:14 | 2.4K | |
| php83-pear-Net_Gearm..> | 2025-12-30 13:26 | 18K | |
| php83-pear-Net_Geo-1..> | 2025-12-29 11:14 | 8.4K | |
| php83-pear-Net_GeoIP..> | 2025-12-29 18:06 | 14K | |
| php83-pear-Net_Growl..> | 2025-12-29 19:11 | 465K | |
| php83-pear-Net_IDNA-..> | 2025-12-27 22:38 | 18K | |
| php83-pear-Net_IMAP-..> | 2025-12-27 17:07 | 36K | |
| php83-pear-Net_IPv4-..> | 2025-12-27 02:43 | 7.0K | |
| php83-pear-Net_IPv6-..> | 2025-12-27 04:50 | 12K | |
| php83-pear-Net_Ident..> | 2025-12-28 06:11 | 4.0K | |
| php83-pear-Net_LDAP-..> | 2025-12-28 09:40 | 65K | |
| php83-pear-Net_LDAP2..> | 2025-12-28 10:19 | 82K | |
| php83-pear-Net_LMTP-..> | 2025-12-27 22:16 | 7.0K | |
| php83-pear-Net_MAC-0..> | 2025-12-30 14:48 | 5.9K | |
| php83-pear-Net_NNTP-..> | 2025-12-28 12:03 | 33K | |
| php83-pear-Net_Nmap-..> | 2025-12-29 12:10 | 25K | |
| php83-pear-Net_POP3-..> | 2025-12-30 07:15 | 9.9K | |
| php83-pear-Net_Ping-..> | 2025-12-30 07:54 | 9.9K | |
| php83-pear-Net_Ports..> | 2025-12-30 09:12 | 3.5K | |
| php83-pear-Net_SMS-0..> | 2025-12-30 06:24 | 19K | |
| php83-pear-Net_SMTP-..> | 2025-12-26 09:57 | 17K | |
| php83-pear-Net_Serve..> | 2025-12-27 09:44 | 18K | |
| php83-pear-Net_Sieve..> | 2025-12-30 13:59 | 15K | |
| php83-pear-Net_Smart..> | 2025-12-30 07:26 | 105K | |
| php83-pear-Net_Socke..> | 2025-12-26 09:20 | 7.3K | |
| php83-pear-Net_Trace..> | 2025-12-28 23:01 | 7.5K | |
| php83-pear-Net_URL-1..> | 2025-12-26 19:16 | 6.9K | |
| php83-pear-Net_URL2-..> | 2025-12-26 20:41 | 19K | |
| php83-pear-Net_URL_M..> | 2025-12-30 08:56 | 14K | |
| php83-pear-Net_UserA..> | 2025-12-29 13:14 | 12K | |
| php83-pear-Net_UserA..> | 2025-12-28 03:11 | 32K | |
| php83-pear-Net_Vpopm..> | 2025-12-29 16:25 | 21K | |
| php83-pear-Net_Whois..> | 2025-12-28 11:20 | 7.0K | |
| php83-pear-Numbers_R..> | 2025-12-29 19:03 | 6.8K | |
| php83-pear-Numbers_W..> | 2025-12-29 02:35 | 45K | |
| php83-pear-OLE-1.0.1..> | 2025-12-26 20:22 | 14K | |
| php83-pear-PEAR_Info..> | 2025-12-30 16:45 | 46K | |
| php83-pear-PEAR_Pack..> | 2025-12-29 10:02 | 34K | |
| php83-pear-PEAR_Pack..> | 2025-12-28 12:16 | 35K | |
| php83-pear-PEAR_Pack..> | 2025-12-27 16:41 | 21K | |
| php83-pear-PHPTAL-1...> | 2025-12-28 01:20 | 152K | |
| php83-pear-PHPUnit_M..> | 2025-12-29 13:05 | 21K | |
| php83-pear-PHP_Archi..> | 2025-12-29 09:54 | 47K | |
| php83-pear-PHP_Array..> | 2025-12-29 00:03 | 8.5K | |
| php83-pear-PHP_Beaut..> | 2025-12-29 02:35 | 67K | |
| php83-pear-PHP_CodeC..> | 2025-12-30 07:58 | 296K | |
| php83-pear-PHP_CodeS..> | 2025-12-29 22:15 | 612K | |
| php83-pear-PHP_Compa..> | 2025-12-28 11:10 | 43K | |
| php83-pear-PHP_Compa..> | 2025-12-28 13:41 | 136K | |
| php83-pear-PHP_Parse..> | 2025-12-29 06:59 | 87K | |
| php83-pear-PHP_Parse..> | 2025-12-29 23:37 | 140K | |
| php83-pear-PHP_Shell..> | 2025-12-29 20:20 | 84K | |
| php83-pear-PHP_Timer..> | 2025-12-27 16:33 | 2.5K | |
| php83-pear-PHP_Token..> | 2025-12-27 18:40 | 17K | |
| php83-pear-PHP_UML-1..> | 2025-12-27 20:14 | 404K | |
| php83-pear-Pager-2.5..> | 2025-12-26 20:51 | 32K | |
| php83-pear-Payment_D..> | 2025-12-28 08:22 | 39K | |
| php83-pear-PhpDocume..> | 2025-12-28 18:14 | 964K | |
| php83-pear-SOAP-0.14..> | 2025-12-30 01:03 | 74K | |
| php83-pear-Sebastian..> | 2025-12-27 12:31 | 2.0K | |
| php83-pear-Sebastian..> | 2025-12-27 10:01 | 2.0K | |
| php83-pear-Sebastian..> | 2025-12-29 18:51 | 7.0K | |
| php83-pear-Sebastian..> | 2025-12-29 05:52 | 11K | |
| php83-pear-Sebastian..> | 2025-12-27 03:40 | 1.5K | |
| php83-pear-Services_..> | 2025-12-29 12:38 | 15K | |
| php83-pear-Services_..> | 2025-12-29 04:37 | 28K | |
| php83-pear-Services_..> | 2025-12-28 17:31 | 16K | |
| php83-pear-Services_..> | 2025-12-30 05:25 | 3.7K | |
| php83-pear-Services_..> | 2025-12-30 00:28 | 10K | |
| php83-pear-Services_..> | 2025-12-29 22:45 | 22K | |
| php83-pear-Services_..> | 2025-12-28 11:37 | 75K | |
| php83-pear-Services_..> | 2025-12-29 07:09 | 39K | |
| php83-pear-Services_..> | 2025-12-29 19:13 | 4.1K | |
| php83-pear-Services_..> | 2025-12-27 21:42 | 9.9K | |
| php83-pear-Services_..> | 2025-12-28 04:42 | 5.2K | |
| php83-pear-Services_..> | 2025-12-29 22:58 | 9.1K | |
| php83-pear-Services_..> | 2025-12-28 12:43 | 11K | |
| php83-pear-Services_..> | 2025-12-29 15:38 | 4.9K | |
| php83-pear-Services_..> | 2025-12-29 12:10 | 6.1K | |
| php83-pear-Services_..> | 2025-12-29 07:30 | 58K | |
| php83-pear-Services_..> | 2025-12-30 07:44 | 11K | |
| php83-pear-Services_..> | 2025-12-30 14:11 | 14K | |
| php83-pear-Services_..> | 2025-12-29 07:41 | 45K | |
| php83-pear-Services_..> | 2025-12-29 17:35 | 15K | |
| php83-pear-Services_..> | 2025-12-28 01:00 | 13K | |
| php83-pear-Services_..> | 2025-12-29 22:47 | 4.4K | |
| php83-pear-Spreadshe..> | 2025-12-27 10:51 | 49K | |
| php83-pear-Structure..> | 2025-12-26 21:09 | 43K | |
| php83-pear-Structure..> | 2025-12-27 07:26 | 4.2K | |
| php83-pear-Structure..> | 2025-12-29 07:21 | 4.9K | |
| php83-pear-Structure..> | 2025-12-30 10:28 | 3.3K | |
| php83-pear-Structure..> | 2025-12-29 04:36 | 4.9K | |
| php83-pear-Structure..> | 2025-12-27 20:52 | 4.7K | |
| php83-pear-Structure..> | 2025-12-30 09:46 | 3.8K | |
| php83-pear-Structure..> | 2025-12-30 10:02 | 9.6K | |
| php83-pear-Structure..> | 2025-12-28 06:52 | 4.9K | |
| php83-pear-Structure..> | 2025-12-29 20:52 | 6.9K | |
| php83-pear-Structure..> | 2025-12-27 06:02 | 5.1K | |
| php83-pear-Structure..> | 2025-12-28 07:45 | 5.6K | |
| php83-pear-Structure..> | 2025-12-30 02:29 | 4.6K | |
| php83-pear-Structure..> | 2025-12-28 14:35 | 4.5K | |
| php83-pear-Structure..> | 2025-12-27 21:38 | 13K | |
| php83-pear-Symfony_C..> | 2025-12-27 17:37 | 78K | |
| php83-pear-Symfony_C..> | 2025-12-26 22:20 | 34K | |
| php83-pear-Symfony_C..> | 2025-12-29 10:39 | 38K | |
| php83-pear-System_Co..> | 2025-12-29 09:53 | 7.2K | |
| php83-pear-Testing_S..> | 2025-12-30 03:48 | 2.3M | |
| php83-pear-Text_Diff..> | 2025-12-30 10:46 | 21K | |
| php83-pear-Text_Figl..> | 2025-12-29 07:35 | 8.7K | |
| php83-pear-Text_High..> | 2025-12-29 17:16 | 82K | |
| php83-pear-Text_Pass..> | 2025-12-29 02:43 | 6.2K | |
| php83-pear-Text_Spel..> | 2025-12-28 12:31 | 125K | |
| php83-pear-Text_Temp..> | 2025-12-27 09:01 | 1.9K | |
| php83-pear-Text_Wiki..> | 2025-12-29 12:22 | 77K | |
| php83-pear-TheSeer_D..> | 2025-12-28 16:25 | 3.0K | |
| php83-pear-TheSeer_f..> | 2025-12-27 01:13 | 5.1K | |
| php83-pear-TheSeer_f..> | 2025-12-28 19:41 | 6.7K | |
| php83-pear-Translati..> | 2025-12-30 12:15 | 47K | |
| php83-pear-UDDI-0.2...> | 2025-12-30 18:41 | 7.6K | |
| php83-pear-URI_Templ..> | 2025-12-29 05:03 | 7.4K | |
| php83-pear-VFS-0.3.0..> | 2025-12-29 11:10 | 36K | |
| php83-pear-Validate-..> | 2025-12-27 16:22 | 21K | |
| php83-pear-Validate_..> | 2025-12-28 06:02 | 11K | |
| php83-pear-Validate_..> | 2025-12-29 05:21 | 11K | |
| php83-pear-Validate_..> | 2025-12-28 17:34 | 7.2K | |
| php83-pear-Validate_..> | 2025-12-30 18:29 | 6.5K | |
| php83-pear-Validate_..> | 2025-12-28 09:14 | 9.6K | |
| php83-pear-Var_Dump-..> | 2025-12-30 01:02 | 18K | |
| php83-pear-VersionCo..> | 2025-12-29 18:18 | 16K | |
| php83-pear-VersionCo..> | 2025-12-29 12:10 | 28K | |
| php83-pear-XML_Beaut..> | 2025-12-29 17:29 | 14K | |
| php83-pear-XML_DTD-0..> | 2025-12-27 02:52 | 33K | |
| php83-pear-XML_Feed_..> | 2025-12-29 04:50 | 268K | |
| php83-pear-XML_GRDDL..> | 2025-12-27 20:46 | 44K | |
| php83-pear-XML_HTMLS..> | 2025-12-28 23:59 | 16K | |
| php83-pear-XML_NITF-..> | 2025-12-30 03:46 | 8.2K | |
| php83-pear-XML_Parse..> | 2025-12-26 20:22 | 14K | |
| php83-pear-XML_Query..> | 2025-12-29 19:48 | 298K | |
| php83-pear-XML_RPC-1..> | 2025-12-27 10:21 | 24K | |
| php83-pear-XML_RPC2-..> | 2025-12-28 09:40 | 58K | |
| php83-pear-XML_RSS-1..> | 2025-12-27 13:26 | 8.7K | |
| php83-pear-XML_SVG-1..> | 2025-12-29 04:06 | 9.2K | |
| php83-pear-XML_Seria..> | 2025-12-26 22:48 | 31K | |
| php83-pear-XML_Trans..> | 2025-12-29 03:47 | 27K | |
| php83-pear-XML_Tree-..> | 2025-12-28 05:41 | 5.4K | |
| php83-pear-XML_Util-..> | 2025-12-26 19:30 | 18K | |
| php83-pear-XML_Wddx-..> | 2025-12-27 21:04 | 6.9K | |
| php83-pear-YAML-1.0...> | 2025-12-30 01:42 | 10K | |
| php83-pear-channel-e..> | 2025-12-26 18:43 | 1.2K | |
| php83-pear-channel-g..> | 2025-12-27 06:41 | 1.1K | |
| php83-pear-channel-h..> | 2025-12-26 06:48 | 1.1K | |
| php83-pear-channel-o..> | 2025-12-29 20:19 | 1.1K | |
| php83-pear-channel-p..> | 2025-12-27 05:38 | 1.1K | |
| php83-pear-channel-p..> | 2025-12-27 11:33 | 1.1K | |
| php83-pear-channel-p..> | 2025-12-28 01:21 | 1.2K | |
| php83-pear-channel-p..> | 2025-12-29 12:20 | 1.1K | |
| php83-pear-channel-p..> | 2025-12-27 09:26 | 1.2K | |
| php83-pear-channel-s..> | 2025-12-27 11:00 | 1.2K | |
| php83-pear-channel-s..> | 2025-12-26 18:44 | 1.2K | |
| php83-pear-channel-t..> | 2025-12-26 19:29 | 1.1K | |
| php83-pear-channel-t..> | 2025-12-27 09:38 | 1.2K | |
| php83-pear-codegen-1..> | 2025-12-29 16:19 | 43K | |
| php83-pear-ezc_Base-..> | 2025-12-26 23:00 | 212K | |
| php83-pear-ezc_Conso..> | 2025-12-27 15:34 | 746K | |
| php83-pear-geshi-ges..> | 2025-12-29 22:21 | 666K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:13 | 317K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:48 | 39K | |
| php83-pear-horde-Hor..> | 2025-12-28 03:53 | 61K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:21 | 54K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:03 | 16K | |
| php83-pear-horde-Hor..> | 2025-12-29 21:22 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:30 | 38K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:05 | 27K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:43 | 31K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:53 | 2.1M | |
| php83-pear-horde-Hor..> | 2025-12-26 16:34 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-26 14:27 | 6.7K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:17 | 12K | |
| php83-pear-horde-Hor..> | 2025-12-27 00:37 | 1.2M | |
| php83-pear-horde-Hor..> | 2025-12-26 19:03 | 12K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:17 | 73K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:08 | 45K | |
| php83-pear-horde-Hor..> | 2025-12-26 11:01 | 67K | |
| php83-pear-horde-Hor..> | 2025-12-30 16:26 | 30K | |
| php83-pear-horde-Hor..> | 2025-12-27 02:58 | 192K | |
| php83-pear-horde-Hor..> | 2025-12-26 13:49 | 73K | |
| php83-pear-horde-Hor..> | 2025-12-29 09:23 | 570K | |
| php83-pear-horde-Hor..> | 2025-12-26 09:34 | 26K | |
| php83-pear-horde-Hor..> | 2025-12-30 11:45 | 1.2M | |
| php83-pear-horde-Hor..> | 2025-12-28 20:12 | 148K | |
| php83-pear-horde-Hor..> | 2025-12-26 13:05 | 23K | |
| php83-pear-horde-Hor..> | 2025-12-26 16:33 | 17K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:02 | 26K | |
| php83-pear-horde-Hor..> | 2025-12-26 23:54 | 16K | |
| php83-pear-horde-Hor..> | 2025-12-26 17:06 | 99K | |
| php83-pear-horde-Hor..> | 2025-12-26 10:55 | 11K | |
| php83-pear-horde-Hor..> | 2025-12-28 00:52 | 34K | |
| php83-pear-horde-Hor..> | 2025-12-26 17:36 | 22K | |
| php83-pear-horde-Hor..> | 2025-12-28 12:44 | 36K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:05 | 16K | |
| php83-pear-horde-Hor..> | 2025-12-27 09:11 | 54K | |
| php83-pear-horde-Hor..> | 2025-12-30 07:23 | 22K | |
| php83-pear-horde-Hor..> | 2025-12-29 00:59 | 141K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:50 | 58K | |
| php83-pear-horde-Hor..> | 2025-12-29 15:26 | 18K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:29 | 18K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:05 | 31K | |
| php83-pear-horde-Hor..> | 2025-12-26 10:55 | 36K | |
| php83-pear-horde-Hor..> | 2025-12-30 00:27 | 18K | |
| php83-pear-horde-Hor..> | 2025-12-29 00:23 | 15K | |
| php83-pear-horde-Hor..> | 2025-12-26 13:49 | 125K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:20 | 269K | |
| php83-pear-horde-Hor..> | 2025-12-29 13:14 | 85K | |
| php83-pear-horde-Hor..> | 2025-12-26 10:54 | 225K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:06 | 21K | |
| php83-pear-horde-Hor..> | 2025-12-27 08:40 | 7.2K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:07 | 17K | |
| php83-pear-horde-Hor..> | 2025-12-28 12:33 | 47K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:56 | 38K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:19 | 53K | |
| php83-pear-horde-Hor..> | 2025-12-30 09:40 | 13K | |
| php83-pear-horde-Hor..> | 2025-12-27 21:27 | 34K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:30 | 11K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:05 | 40K | |
| php83-pear-horde-Hor..> | 2025-12-30 00:44 | 39K | |
| php83-pear-horde-Hor..> | 2025-12-28 10:10 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-30 11:23 | 6.0K | |
| php83-pear-horde-Hor..> | 2025-12-26 20:19 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:59 | 16K | |
| php83-pear-horde-Hor..> | 2025-12-29 16:18 | 32K | |
| php83-pear-horde-Hor..> | 2025-12-28 14:30 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-29 16:41 | 11K | |
| php83-pear-horde-Hor..> | 2025-12-28 05:14 | 3.0K | |
| php83-pear-horde-Hor..> | 2025-12-29 18:56 | 192K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:19 | 25K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:26 | 56K | |
| php83-pear-horde-Hor..> | 2025-12-26 14:57 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-29 01:02 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:25 | 18K | |
| php83-pear-horde-Hor..> | 2025-12-26 10:25 | 14K | |
| php83-pear-horde-Hor..> | 2025-12-26 09:57 | 6.8K | |
| php83-pear-horde-Hor..> | 2025-12-26 11:38 | 25K | |
| php83-pear-horde-Hor..> | 2025-12-27 06:01 | 115K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:05 | 15K | |
| php83-pear-horde-Hor..> | 2025-12-28 13:10 | 29K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:52 | 53K | |
| php83-pear-horde-Hor..> | 2025-12-28 19:37 | 24K | |
| php83-pear-horde-Hor..> | 2025-12-26 11:14 | 15K | |
| php83-pear-horde-Hor..> | 2025-12-27 11:27 | 21K | |
| php83-pear-horde-Hor..> | 2025-12-30 05:23 | 28K | |
| php83-pear-horde-Hor..> | 2025-12-26 19:04 | 32K | |
| php83-pear-horde-Hor..> | 2025-12-26 09:06 | 16K | |
| php83-pear-horde-Hor..> | 2025-12-28 13:14 | 19K | |
| php83-pear-horde-Hor..> | 2025-12-26 15:28 | 17K | |
| php83-pear-horde-Hor..> | 2025-12-26 09:43 | 35K | |
| php83-pear-horde-Hor..> | 2025-12-26 18:28 | 42K | |
| php83-pear-horde-Hor..> | 2025-12-27 17:26 | 12K | |
| php83-pear-horde-Hor..> | 2025-12-27 00:55 | 26K | |
| php83-pear-pdepend_s..> | 2025-12-29 06:59 | 33K | |
| php83-pear-phing-2.6..> | 2025-12-29 12:16 | 361K | |
| php83-pear-pirum-Pir..> | 2025-12-30 08:36 | 15K | |
| php83-pear-twig-twig..> | 2025-12-29 19:08 | 94K | |
| php83-pecl-APCu-5.1...> | 2025-12-26 23:09 | 54K | |
| php83-pecl-amqp-2.1...> | 2025-12-29 11:14 | 53K | |
| php83-pecl-ast-1.1.3..> | 2025-12-28 11:12 | 21K | |
| php83-pecl-bitset-3...> | 2025-12-26 14:53 | 11K | |
| php83-pecl-couchbase..> | 2025-12-30 07:07 | 29K | |
| php83-pecl-crypto-0...> | 2025-12-29 06:55 | 32K | |
| php83-pecl-dio-0.3.0..> | 2025-12-29 13:55 | 12K | |
| php83-pecl-ds-1.6.0.pkg | 2025-12-28 07:46 | 57K | |
| php83-pecl-eio-3.0.0..> | 2025-12-28 10:46 | 29K | |
| php83-pecl-ev-1.2.2.pkg | 2025-12-28 21:01 | 46K | |
| php83-pecl-event-3.1..> | 2025-12-30 18:33 | 46K | |
| php83-pecl-excimer-1..> | 2025-12-29 22:01 | 24K | |
| php83-pecl-expect-0...> | 2025-12-27 20:47 | 7.8K | |
| php83-pecl-geospatia..> | 2025-12-29 18:52 | 17K | |
| php83-pecl-gnupg-1.5..> | 2025-12-27 12:34 | 18K | |
| php83-pecl-grpc-1.76..> | 2025-12-29 18:51 | 3.3M | |
| php83-pecl-horde_lz4..> | 2025-12-30 17:21 | 4.5K | |
| php83-pecl-http-4.3...> | 2025-12-28 06:35 | 143K | |
| php83-pecl-igbinary-..> | 2025-12-28 11:18 | 27K | |
| php83-pecl-imagick-3..> | 2025-12-27 18:07 | 125K | |
| php83-pecl-inotify-3..> | 2025-12-29 17:32 | 7.0K | |
| php83-pecl-json_post..> | 2025-12-28 20:12 | 5.4K | |
| php83-pecl-krb5-1.2...> | 2025-12-29 17:36 | 26K | |
| php83-pecl-leveldb-0..> | 2025-12-28 18:38 | 14K | |
| php83-pecl-libsodium..> | 2025-12-29 04:51 | 24K | |
| php83-pecl-lzf-1.7.0..> | 2025-12-28 13:52 | 8.2K | |
| php83-pecl-mailparse..> | 2025-12-29 23:44 | 27K | |
| php83-pecl-mcrypt-1...> | 2025-12-26 15:29 | 15K | |
| php83-pecl-memcache-..> | 2025-12-26 15:52 | 44K | |
| php83-pecl-memcached..> | 2025-12-26 15:43 | 52K | |
| php83-pecl-mongodb-1..> | 2025-12-29 08:22 | 824K | |
| php83-pecl-msgpack-3..> | 2025-12-27 02:12 | 27K | |
| php83-pecl-mustache-..> | 2025-12-28 09:39 | 27K | |
| php83-pecl-oauth-2.0..> | 2025-12-30 05:46 | 37K | |
| php83-pecl-opentelem..> | 2025-12-28 22:32 | 13K | |
| php83-pecl-pam-2.2.5..> | 2025-12-30 15:10 | 8.8K | |
| php83-pecl-pcov-1.0...> | 2025-12-28 18:11 | 10K | |
| php83-pecl-pkcs11-1...> | 2025-12-28 05:32 | 47K | |
| php83-pecl-proctitle..> | 2025-12-29 20:29 | 4.1K | |
| php83-pecl-protobuf-..> | 2025-12-28 09:16 | 233K | |
| php83-pecl-psr-1.2.0..> | 2025-12-29 16:05 | 16K | |
| php83-pecl-qrencode-..> | 2025-12-28 13:12 | 7.2K | |
| php83-pecl-radius-1...> | 2025-12-27 08:48 | 32K | |
| php83-pecl-raphf-2.0..> | 2025-12-27 18:22 | 11K | |
| php83-pecl-rar-4.2.0..> | 2025-12-29 01:14 | 152K | |
| php83-pecl-rdkafka-6..> | 2025-12-30 16:35 | 43K | |
| php83-pecl-redis-6.3..> | 2025-12-27 10:22 | 238K | |
| php83-pecl-rrd-2.0.3..> | 2025-12-29 05:21 | 14K | |
| php83-pecl-scrypt-2...> | 2025-12-30 08:07 | 18K | |
| php83-pecl-smbclient..> | 2025-12-27 05:25 | 24K | |
| php83-pecl-solr-2.8...> | 2025-12-30 12:01 | 80K | |
| php83-pecl-ssh2-1.3...> | 2025-12-27 10:41 | 27K | |
| php83-pecl-stomp-2.0..> | 2025-12-28 05:30 | 19K | |
| php83-pecl-swoole-6...> | 2025-12-29 05:27 | 867K | |
| php83-pecl-sync-1.1...> | 2025-12-29 12:34 | 14K | |
| php83-pecl-timezoned..> | 2025-12-29 03:48 | 243K | |
| php83-pecl-uploadpro..> | 2025-12-29 16:03 | 7.8K | |
| php83-pecl-uuid-1.3...> | 2025-12-27 16:46 | 8.3K | |
| php83-pecl-uv-0.3.0.pkg | 2025-12-28 21:51 | 49K | |
| php83-pecl-vips-1.0...> | 2025-12-29 12:21 | 17K | |
| php83-pecl-vld-0.19...> | 2025-12-30 10:08 | 18K | |
| php83-pecl-xdebug-3...> | 2025-12-29 05:21 | 135K | |
| php83-pecl-xdiff-2.1..> | 2025-12-28 09:45 | 9.5K | |
| php83-pecl-xlswriter..> | 2025-12-29 21:12 | 167K | |
| php83-pecl-xmlrpc-1...> | 2025-12-27 10:42 | 40K | |
| php83-pecl-xxtea-1.0..> | 2025-12-27 09:39 | 5.8K | |
| php83-pecl-yac-2.3.1..> | 2025-12-28 05:28 | 23K | |
| php83-pecl-yaconf-1...> | 2025-12-27 22:37 | 11K | |
| php83-pecl-yaf-3.3.7..> | 2025-12-30 02:28 | 96K | |
| php83-pecl-yaml-2.3...> | 2025-12-29 03:47 | 21K | |
| php83-pecl-yar-2.3.4..> | 2025-12-27 21:24 | 33K | |
| php83-pecl-zephir_pa..> | 2025-12-27 11:20 | 46K | |
| php83-pecl-zookeeper..> | 2025-12-29 16:04 | 25K | |
| php83-pecl-zstd-0.15..> | 2025-12-29 18:39 | 16K | |
| php83-pgsql-8.3.29.pkg | 2025-12-26 16:58 | 50K | |
| php83-phalcon-5.9.3.pkg | 2025-12-30 06:35 | 1.9M | |
| php83-phar-8.3.29.pkg | 2025-12-26 20:38 | 114K | |
| php83-posix-8.3.29.pkg | 2025-12-26 16:14 | 15K | |
| php83-pspell-8.3.29.pkg | 2025-12-27 23:44 | 9.8K | |
| php83-readline-8.3.2..> | 2025-12-27 16:51 | 14K | |
| php83-session-8.3.29..> | 2025-12-26 14:45 | 40K | |
| php83-shmop-8.3.29.pkg | 2025-12-29 06:36 | 7.3K | |
| php83-simplexml-8.3...> | 2025-12-26 16:01 | 25K | |
| php83-snappy-0.2.3.pkg | 2025-12-29 03:50 | 4.4K | |
| php83-snmp-8.3.29.pkg | 2025-12-27 06:26 | 25K | |
| php83-snuffleupagus-..> | 2025-12-29 15:43 | 73K | |
| php83-soap-8.3.29.pkg | 2025-12-26 15:38 | 128K | |
| php83-sockets-8.3.29..> | 2025-12-26 17:32 | 44K | |
| php83-sodium-8.3.29.pkg | 2025-12-26 23:06 | 32K | |
| php83-sqlite3-8.3.29..> | 2025-12-26 14:50 | 27K | |
| php83-sysvmsg-8.3.29..> | 2025-12-27 09:00 | 9.3K | |
| php83-sysvsem-8.3.29..> | 2025-12-26 20:46 | 7.0K | |
| php83-sysvshm-8.3.29..> | 2025-12-29 15:14 | 8.2K | |
| php83-tarantool-0.4...> | 2025-12-29 08:52 | 51K | |
| php83-tidy-8.3.29.pkg | 2025-12-27 17:06 | 23K | |
| php83-tokenizer-8.3...> | 2025-12-26 21:36 | 14K | |
| php83-xapian-1.4.30.pkg | 2025-12-27 21:42 | 296K | |
| php83-xml-8.3.29.pkg | 2025-12-26 06:23 | 22K | |
| php83-xmlreader-8.3...> | 2025-12-27 00:46 | 16K | |
| php83-xmlwriter-8.3...> | 2025-12-26 20:41 | 15K | |
| php83-xsl-8.3.29.pkg | 2025-12-26 21:39 | 15K | |
| php83-zephir-0.17.0.pkg | 2025-12-30 07:26 | 1.4M | |
| php83-zip-8.3.29.pkg | 2025-12-26 20:56 | 35K | |
| php83-zlib-8.3.29.pkg | 2025-12-26 06:20 | 21K | |
| php83-zstd-0.15.2_1.pkg | 2025-12-30 18:27 | 16K | |
| php84-8.4.16.pkg | 2025-12-26 06:13 | 4.7M | |
| php84-Ice37-3.7.10.pkg | 2025-12-29 00:34 | 177K | |
| php84-adminer-5.4.1.pkg | 2025-12-29 01:25 | 358K | |
| php84-aphpunit-2.3.pkg | 2025-12-30 02:29 | 14K | |
| php84-bcmath-8.4.16.pkg | 2025-12-26 13:01 | 33K | |
| php84-brotli-0.18.2_..> | 2025-12-30 07:17 | 14K | |
| php84-bsdconv-11.6.0..> | 2025-12-30 04:14 | 8.7K | |
| php84-bz2-8.4.16.pkg | 2025-12-27 00:31 | 11K | |
| php84-bzip3-0.1.1.pkg | 2025-12-30 04:13 | 5.6K | |
| php84-calendar-8.4.1..> | 2025-12-27 04:24 | 16K | |
| php84-composer-2.9.2..> | 2025-12-27 04:02 | 590K | |
| php84-ctype-8.4.16.pkg | 2025-12-26 15:11 | 6.1K | |
| php84-curl-8.4.16.pkg | 2025-12-26 17:47 | 49K | |
| php84-dba-8.4.16.pkg | 2025-12-30 04:06 | 26K | |
| php84-dddbl-2.0.1.pkg | 2025-12-29 14:58 | 9.5K | |
| php84-deployer-6.4.3..> | 2025-12-30 18:57 | 327K | |
| php84-dom-8.4.16.pkg | 2025-12-26 08:51 | 592K | |
| php84-enchant-8.4.16..> | 2025-12-29 04:06 | 12K | |
| php84-exif-8.4.16.pkg | 2025-12-26 22:38 | 30K | |
| php84-extensions-1.0..> | 2025-12-29 21:43 | 1.1K | |
| php84-facedetect-1.1..> | 2025-12-28 12:02 | 7.9K | |
| php84-ffi-8.4.16.pkg | 2025-12-30 02:31 | 71K | |
| php84-fileinfo-8.4.1..> | 2025-12-26 14:55 | 364K | |
| php84-filter-8.4.16.pkg | 2025-12-26 13:41 | 24K | |
| php84-ftp-8.4.16.pkg | 2025-12-27 19:09 | 27K | |
| php84-gd-8.4.16.pkg | 2025-12-26 15:07 | 42K | |
| php84-geos-1.0.0_1.pkg | 2025-12-29 02:29 | 21K | |
| php84-gettext-8.4.16..> | 2025-12-26 15:07 | 7.8K | |
| php84-gmp-8.4.16.pkg | 2025-12-26 22:55 | 24K | |
| php84-google-api-php..> | 2025-12-28 14:14 | 29K | |
| php84-iconv-8.4.16.pkg | 2025-12-26 15:37 | 19K | |
| php84-ilias-10.3.pkg | 2025-12-28 01:41 | 19M | |
| php84-intl-8.4.16.pkg | 2025-12-26 15:11 | 163K | |
| php84-kanboard-1.2.4..> | 2025-12-28 23:51 | 2.5M | |
| php84-ldap-8.4.16.pkg | 2025-12-26 15:39 | 37K | |
| php84-libawl-0.64.pkg | 2025-12-27 09:13 | 84K | |
| php84-lz4-0.6.0.pkg | 2025-12-27 22:05 | 8.2K | |
| php84-maxminddb-1.13..> | 2025-12-29 19:08 | 8.2K | |
| php84-mbstring-8.4.1..> | 2025-12-26 17:32 | 931K | |
| php84-mysqli-8.4.16.pkg | 2025-12-26 10:55 | 52K | |
| php84-odbc-8.4.16.pkg | 2025-12-27 17:44 | 32K | |
| php84-opcache-8.4.16..> | 2025-12-26 14:54 | 483K | |
| php84-opencc-0.0.0.2..> | 2025-12-29 19:38 | 5.9K | |
| php84-pcntl-8.4.16.pkg | 2025-12-26 23:28 | 22K | |
| php84-pdo-8.4.16.pkg | 2025-12-26 14:46 | 57K | |
| php84-pdo_dblib-8.4...> | 2025-12-28 23:54 | 15K | |
| php84-pdo_firebird-8..> | 2025-12-28 13:11 | 20K | |
| php84-pdo_mysql-8.4...> | 2025-12-26 16:57 | 18K | |
| php84-pdo_odbc-8.4.1..> | 2025-12-27 12:33 | 16K | |
| php84-pdo_pgsql-8.4...> | 2025-12-26 15:54 | 25K | |
| php84-pdo_sqlite-8.4..> | 2025-12-26 14:50 | 19K | |
| php84-pear-1.10.17.pkg | 2025-12-26 06:33 | 253K | |
| php84-pear-Auth-1.6...> | 2025-12-27 10:59 | 48K | |
| php84-pear-Auth_HTTP..> | 2025-12-30 16:04 | 9.3K | |
| php84-pear-Auth_Pref..> | 2025-12-28 12:25 | 12K | |
| php84-pear-Auth_RADI..> | 2025-12-28 11:01 | 9.1K | |
| php84-pear-Auth_SASL..> | 2025-12-26 20:42 | 10K | |
| php84-pear-Auth_SASL..> | 2025-12-28 09:12 | 9.6K | |
| php84-pear-Benchmark..> | 2025-12-28 05:47 | 9.2K | |
| php84-pear-Cache-1.5..> | 2025-12-27 07:40 | 29K | |
| php84-pear-Cache_Lit..> | 2025-12-27 19:39 | 33K | |
| php84-pear-Config-1...> | 2025-12-28 04:56 | 31K | |
| php84-pear-Console_C..> | 2025-12-28 11:25 | 5.7K | |
| php84-pear-Console_C..> | 2025-12-27 11:39 | 38K | |
| php84-pear-Console_G..> | 2025-12-27 12:31 | 17K | |
| php84-pear-Console_T..> | 2025-12-26 18:29 | 12K | |
| php84-pear-Contact_V..> | 2025-12-29 12:25 | 16K | |
| php84-pear-Contact_V..> | 2025-12-29 05:17 | 11K | |
| php84-pear-Crypt_Blo..> | 2025-12-28 07:43 | 17K | |
| php84-pear-Crypt_CBC..> | 2025-12-29 02:27 | 4.5K | |
| php84-pear-Crypt_CHA..> | 2025-12-27 15:03 | 6.2K | |
| php84-pear-Crypt_Dif..> | 2025-12-29 07:32 | 12K | |
| php84-pear-Crypt_GPG..> | 2025-12-28 10:04 | 285K | |
| php84-pear-Crypt_HMA..> | 2025-12-27 12:30 | 8.8K | |
| php84-pear-Crypt_Mic..> | 2025-12-28 08:23 | 3.9K | |
| php84-pear-Crypt_RC4..> | 2025-12-28 20:45 | 3.1K | |
| php84-pear-Crypt_RSA..> | 2025-12-28 03:57 | 20K | |
| php84-pear-Crypt_XXT..> | 2025-12-29 13:47 | 7.2K | |
| php84-pear-DB-1.12.3..> | 2025-12-26 20:24 | 87K | |
| php84-pear-DBA-1.1.1..> | 2025-12-27 09:40 | 13K | |
| php84-pear-DBA_Relat..> | 2025-12-30 01:03 | 19K | |
| php84-pear-DB_DataOb..> | 2025-12-27 02:48 | 70K | |
| php84-pear-DB_DataOb..> | 2025-12-28 09:42 | 60K | |
| php84-pear-DB_Pager-..> | 2025-12-27 21:28 | 4.7K | |
| php84-pear-DB_QueryT..> | 2025-12-29 16:18 | 40K | |
| php84-pear-DB_Sqlite..> | 2025-12-28 21:34 | 19K | |
| php84-pear-DB_Table-..> | 2025-12-29 17:10 | 93K | |
| php84-pear-DB_ldap-1..> | 2025-12-29 02:51 | 10K | |
| php84-pear-DB_ldap2-..> | 2025-12-29 17:36 | 19K | |
| php84-pear-Date-1.4...> | 2025-12-27 00:54 | 43K | |
| php84-pear-Date_Holi..> | 2025-12-27 02:18 | 34K | |
| php84-pear-Date_Holi..> | 2025-12-30 03:54 | 5.8K | |
| php84-pear-Date_Holi..> | 2025-12-29 16:52 | 4.8K | |
| php84-pear-Date_Holi..> | 2025-12-30 09:29 | 4.5K | |
| php84-pear-Date_Holi..> | 2025-12-30 04:42 | 3.8K | |
| php84-pear-Date_Holi..> | 2025-12-30 02:00 | 4.4K | |
| php84-pear-Date_Holi..> | 2025-12-29 06:53 | 12K | |
| php84-pear-Date_Holi..> | 2025-12-30 05:19 | 5.4K | |
| php84-pear-Date_Holi..> | 2025-12-30 08:24 | 5.2K | |
| php84-pear-Date_Holi..> | 2025-12-29 21:22 | 4.7K | |
| php84-pear-Date_Holi..> | 2025-12-30 12:31 | 9.4K | |
| php84-pear-Date_Holi..> | 2025-12-30 12:50 | 5.6K | |
| php84-pear-Date_Holi..> | 2025-12-30 18:19 | 4.1K | |
| php84-pear-Date_Holi..> | 2025-12-29 06:05 | 4.3K | |
| php84-pear-Date_Holi..> | 2025-12-30 18:41 | 3.7K | |
| php84-pear-Date_Holi..> | 2025-12-29 16:16 | 4.3K | |
| php84-pear-Date_Holi..> | 2025-12-29 17:57 | 6.6K | |
| php84-pear-Date_Holi..> | 2025-12-30 18:47 | 9.8K | |
| php84-pear-Date_Holi..> | 2025-12-29 10:39 | 5.4K | |
| php84-pear-Date_Holi..> | 2025-12-30 08:40 | 3.9K | |
| php84-pear-Event_Dis..> | 2025-12-26 23:47 | 9.2K | |
| php84-pear-FSM-1.4.0..> | 2025-12-28 10:06 | 12K | |
| php84-pear-File-1.4...> | 2025-12-27 09:26 | 9.1K | |
| php84-pear-File_Arch..> | 2025-12-29 16:40 | 53K | |
| php84-pear-File_Bitt..> | 2025-12-29 00:31 | 70K | |
| php84-pear-File_DNS-..> | 2025-12-28 03:47 | 10K | |
| php84-pear-File_Find..> | 2025-12-27 02:11 | 8.9K | |
| php84-pear-File_Fort..> | 2025-12-29 18:39 | 14K | |
| php84-pear-File_Fsta..> | 2025-12-27 21:42 | 7.7K | |
| php84-pear-File_Gett..> | 2025-12-29 15:15 | 7.9K | |
| php84-pear-File_HtAc..> | 2025-12-28 06:06 | 5.8K | |
| php84-pear-File_Iter..> | 2025-12-27 09:43 | 3.0K | |
| php84-pear-File_MARC..> | 2025-12-29 09:52 | 79K | |
| php84-pear-File_PDF-..> | 2025-12-29 05:49 | 38K | |
| php84-pear-File_Pass..> | 2025-12-30 09:27 | 21K | |
| php84-pear-File_SMBP..> | 2025-12-27 20:27 | 6.0K | |
| php84-pear-Games_Che..> | 2025-12-28 12:31 | 83K | |
| php84-pear-HTML_AJAX..> | 2025-12-27 12:35 | 91K | |
| php84-pear-HTML_BBCo..> | 2025-12-30 00:35 | 16K | |
| php84-pear-HTML_CSS-..> | 2025-12-29 07:39 | 39K | |
| php84-pear-HTML_Comm..> | 2025-12-26 20:52 | 5.2K | |
| php84-pear-HTML_Comm..> | 2025-12-27 09:25 | 9.7K | |
| php84-pear-HTML_Cryp..> | 2025-12-30 09:45 | 5.2K | |
| php84-pear-HTML_Form..> | 2025-12-27 20:58 | 14K | |
| php84-pear-HTML_Java..> | 2025-12-30 02:54 | 9.1K | |
| php84-pear-HTML_Page..> | 2025-12-30 05:46 | 19K | |
| php84-pear-HTML_Quic..> | 2025-12-27 10:22 | 86K | |
| php84-pear-HTML_Quic..> | 2025-12-28 02:30 | 147K | |
| php84-pear-HTML_Quic..> | 2025-12-29 22:01 | 18K | |
| php84-pear-HTML_Quic..> | 2025-12-28 15:25 | 14K | |
| php84-pear-HTML_Quic..> | 2025-12-28 19:18 | 7.6K | |
| php84-pear-HTML_Quic..> | 2025-12-30 16:32 | 3.2K | |
| php84-pear-HTML_Quic..> | 2025-12-29 22:02 | 29K | |
| php84-pear-HTML_Sele..> | 2025-12-29 21:58 | 6.4K | |
| php84-pear-HTML_Sele..> | 2025-12-30 04:48 | 8.9K | |
| php84-pear-HTML_Tabl..> | 2025-12-27 19:37 | 15K | |
| php84-pear-HTML_TagC..> | 2025-12-29 00:31 | 12K | |
| php84-pear-HTML_Temp..> | 2025-12-27 14:13 | 144K | |
| php84-pear-HTML_Temp..> | 2025-12-27 16:20 | 22K | |
| php84-pear-HTML_Temp..> | 2025-12-28 01:42 | 18K | |
| php84-pear-HTML_Temp..> | 2025-12-28 01:26 | 29K | |
| php84-pear-HTML_Tree..> | 2025-12-29 06:36 | 50K | |
| php84-pear-HTTP-1.4...> | 2025-12-27 00:45 | 9.4K | |
| php84-pear-HTTP_Clie..> | 2025-12-29 04:06 | 11K | |
| php84-pear-HTTP_Down..> | 2025-12-29 10:52 | 15K | |
| php84-pear-HTTP_Floo..> | 2025-12-29 00:08 | 6.8K | |
| php84-pear-HTTP_Head..> | 2025-12-27 17:13 | 11K | |
| php84-pear-HTTP_Requ..> | 2025-12-27 02:02 | 17K | |
| php84-pear-HTTP_Requ..> | 2025-12-27 18:47 | 114K | |
| php84-pear-HTTP_Serv..> | 2025-12-30 08:12 | 7.6K | |
| php84-pear-HTTP_Sess..> | 2025-12-29 09:46 | 16K | |
| php84-pear-HTTP_Uplo..> | 2025-12-29 19:14 | 9.8K | |
| php84-pear-HTTP_WebD..> | 2025-12-28 02:31 | 9.5K | |
| php84-pear-HTTP_WebD..> | 2025-12-28 23:59 | 29K | |
| php84-pear-Horde_Cry..> | 2025-12-29 09:02 | 126K | |
| php84-pear-Horde_Cry..> | 2025-12-26 15:53 | 26K | |
| php84-pear-Horde_Ima..> | 2025-12-30 14:51 | 606K | |
| php84-pear-Horde_Ima..> | 2025-12-27 02:52 | 206K | |
| php84-pear-Horde_Kol..> | 2025-12-27 16:02 | 86K | |
| php84-pear-Horde_Log..> | 2025-12-26 17:47 | 16K | |
| php84-pear-Horde_Map..> | 2025-12-26 16:34 | 18K | |
| php84-pear-Horde_Smt..> | 2025-12-26 18:05 | 33K | |
| php84-pear-Horde_Vfs..> | 2025-12-27 04:46 | 64K | |
| php84-pear-I18N-1.0...> | 2025-12-27 07:35 | 31K | |
| php84-pear-I18Nv2-0...> | 2025-12-27 22:11 | 214K | |
| php84-pear-Image_3D-..> | 2025-12-29 03:20 | 102K | |
| php84-pear-Image_Bar..> | 2025-12-28 21:37 | 13K | |
| php84-pear-Image_Bar..> | 2025-12-28 16:22 | 16K | |
| php84-pear-Image_Can..> | 2025-12-27 09:24 | 39K | |
| php84-pear-Image_Col..> | 2025-12-27 00:37 | 10K | |
| php84-pear-Image_Gra..> | 2025-12-29 09:03 | 328K | |
| php84-pear-Image_Gra..> | 2025-12-29 07:16 | 17K | |
| php84-pear-Image_Tra..> | 2025-12-29 09:04 | 385K | |
| php84-pear-LiveUser-..> | 2025-12-27 09:37 | 64K | |
| php84-pear-LiveUser_..> | 2025-12-30 07:23 | 54K | |
| php84-pear-Log-1.14...> | 2025-12-27 13:16 | 40K | |
| php84-pear-MDB-1.3.0..> | 2025-12-27 18:32 | 126K | |
| php84-pear-MDB2-2.5...> | 2025-12-27 02:21 | 104K | |
| php84-pear-MDB2_Driv..> | 2025-12-28 21:07 | 34K | |
| php84-pear-MDB2_Driv..> | 2025-12-29 13:37 | 30K | |
| php84-pear-MDB2_Sche..> | 2025-12-30 02:29 | 64K | |
| php84-pear-MDB_Query..> | 2025-12-29 13:55 | 43K | |
| php84-pear-MIME_Type..> | 2025-12-27 18:32 | 20K | |
| php84-pear-Mail-2.0...> | 2025-12-27 10:58 | 22K | |
| php84-pear-Mail_Mbox..> | 2025-12-28 12:51 | 14K | |
| php84-pear-Mail_Mime..> | 2025-12-26 22:20 | 37K | |
| php84-pear-Mail_Queu..> | 2025-12-30 04:09 | 21K | |
| php84-pear-Mail_mime..> | 2025-12-27 17:09 | 13K | |
| php84-pear-Math_BigI..> | 2025-12-26 14:38 | 25K | |
| php84-pear-Math_Comb..> | 2025-12-28 10:47 | 6.0K | |
| php84-pear-Math_Frac..> | 2025-12-28 12:39 | 4.9K | |
| php84-pear-Net_Check..> | 2025-12-30 10:09 | 2.8K | |
| php84-pear-Net_Cyrus..> | 2025-12-30 16:40 | 6.4K | |
| php84-pear-Net_DIME-..> | 2025-12-30 00:20 | 7.8K | |
| php84-pear-Net_DNS2-..> | 2025-12-30 14:51 | 68K | |
| php84-pear-Net_DNS21..> | 2025-12-27 02:28 | 72K | |
| php84-pear-Net_DNSBL..> | 2025-12-29 05:52 | 8.7K | |
| php84-pear-Net_Dict-..> | 2025-12-28 10:17 | 6.6K | |
| php84-pear-Net_FTP-1..> | 2025-12-29 05:03 | 31K | |
| php84-pear-Net_Finge..> | 2025-12-29 02:18 | 2.4K | |
| php84-pear-Net_Gearm..> | 2025-12-30 16:25 | 18K | |
| php84-pear-Net_Geo-1..> | 2025-12-30 00:48 | 8.4K | |
| php84-pear-Net_GeoIP..> | 2025-12-29 15:25 | 14K | |
| php84-pear-Net_Growl..> | 2025-12-30 16:35 | 465K | |
| php84-pear-Net_IDNA-..> | 2025-12-30 12:24 | 18K | |
| php84-pear-Net_IMAP-..> | 2025-12-27 12:40 | 36K | |
| php84-pear-Net_IPv4-..> | 2025-12-27 12:44 | 7.0K | |
| php84-pear-Net_IPv6-..> | 2025-12-27 18:20 | 12K | |
| php84-pear-Net_Ident..> | 2025-12-29 03:51 | 4.0K | |
| php84-pear-Net_LDAP-..> | 2025-12-30 02:00 | 65K | |
| php84-pear-Net_LDAP2..> | 2025-12-30 07:19 | 82K | |
| php84-pear-Net_LMTP-..> | 2025-12-28 12:35 | 7.0K | |
| php84-pear-Net_MAC-0..> | 2025-12-30 02:05 | 5.9K | |
| php84-pear-Net_NNTP-..> | 2025-12-28 06:32 | 33K | |
| php84-pear-Net_Nmap-..> | 2025-12-30 16:17 | 25K | |
| php84-pear-Net_POP3-..> | 2025-12-27 21:59 | 9.9K | |
| php84-pear-Net_Ping-..> | 2025-12-30 06:45 | 9.9K | |
| php84-pear-Net_Ports..> | 2025-12-27 20:44 | 3.5K | |
| php84-pear-Net_SMS-0..> | 2025-12-29 12:32 | 19K | |
| php84-pear-Net_SMTP-..> | 2025-12-26 10:09 | 17K | |
| php84-pear-Net_Serve..> | 2025-12-27 19:25 | 18K | |
| php84-pear-Net_Sieve..> | 2025-12-30 09:27 | 15K | |
| php84-pear-Net_Smart..> | 2025-12-30 01:44 | 105K | |
| php84-pear-Net_Socke..> | 2025-12-26 09:26 | 7.3K | |
| php84-pear-Net_Trace..> | 2025-12-28 10:29 | 7.5K | |
| php84-pear-Net_URL-1..> | 2025-12-26 19:53 | 6.9K | |
| php84-pear-Net_URL2-..> | 2025-12-26 23:32 | 19K | |
| php84-pear-Net_URL_M..> | 2025-12-30 07:31 | 14K | |
| php84-pear-Net_UserA..> | 2025-12-29 01:04 | 12K | |
| php84-pear-Net_UserA..> | 2025-12-29 04:31 | 32K | |
| php84-pear-Net_Vpopm..> | 2025-12-28 12:26 | 21K | |
| php84-pear-Net_Whois..> | 2025-12-30 14:51 | 7.0K | |
| php84-pear-Numbers_R..> | 2025-12-28 19:01 | 6.9K | |
| php84-pear-Numbers_W..> | 2025-12-29 21:46 | 45K | |
| php84-pear-OLE-1.0.1..> | 2025-12-26 21:03 | 14K | |
| php84-pear-PEAR_Info..> | 2025-12-30 09:20 | 46K | |
| php84-pear-PEAR_Pack..> | 2025-12-28 10:53 | 34K | |
| php84-pear-PEAR_Pack..> | 2025-12-30 11:08 | 35K | |
| php84-pear-PEAR_Pack..> | 2025-12-27 17:03 | 21K | |
| php84-pear-PHPTAL-1...> | 2025-12-29 22:44 | 152K | |
| php84-pear-PHPUnit_M..> | 2025-12-30 06:12 | 21K | |
| php84-pear-PHP_Archi..> | 2025-12-29 16:59 | 47K | |
| php84-pear-PHP_Array..> | 2025-12-28 11:09 | 8.5K | |
| php84-pear-PHP_Beaut..> | 2025-12-29 08:56 | 67K | |
| php84-pear-PHP_CodeC..> | 2025-12-29 04:38 | 296K | |
| php84-pear-PHP_CodeS..> | 2025-12-30 04:36 | 612K | |
| php84-pear-PHP_Compa..> | 2025-12-30 04:13 | 43K | |
| php84-pear-PHP_Compa..> | 2025-12-27 19:44 | 136K | |
| php84-pear-PHP_Parse..> | 2025-12-30 10:35 | 86K | |
| php84-pear-PHP_Parse..> | 2025-12-30 00:29 | 140K | |
| php84-pear-PHP_Shell..> | 2025-12-28 10:38 | 84K | |
| php84-pear-PHP_Timer..> | 2025-12-27 03:12 | 2.5K | |
| php84-pear-PHP_Token..> | 2025-12-27 15:34 | 17K | |
| php84-pear-PHP_UML-1..> | 2025-12-30 06:05 | 404K | |
| php84-pear-Pager-2.5..> | 2025-12-26 22:06 | 32K | |
| php84-pear-Payment_D..> | 2025-12-29 20:25 | 39K | |
| php84-pear-PhpDocume..> | 2025-12-28 00:57 | 964K | |
| php84-pear-SOAP-0.14..> | 2025-12-27 22:58 | 74K | |
| php84-pear-Sebastian..> | 2025-12-27 17:49 | 2.0K | |
| php84-pear-Sebastian..> | 2025-12-27 16:21 | 2.0K | |
| php84-pear-Sebastian..> | 2025-12-29 09:48 | 7.0K | |
| php84-pear-Sebastian..> | 2025-12-30 08:56 | 11K | |
| php84-pear-Sebastian..> | 2025-12-27 07:26 | 1.5K | |
| php84-pear-Services_..> | 2025-12-30 09:31 | 15K | |
| php84-pear-Services_..> | 2025-12-30 08:22 | 28K | |
| php84-pear-Services_..> | 2025-12-29 07:20 | 16K | |
| php84-pear-Services_..> | 2025-12-29 11:04 | 3.7K | |
| php84-pear-Services_..> | 2025-12-28 15:21 | 10K | |
| php84-pear-Services_..> | 2025-12-29 16:46 | 22K | |
| php84-pear-Services_..> | 2025-12-28 19:32 | 75K | |
| php84-pear-Services_..> | 2025-12-28 10:28 | 39K | |
| php84-pear-Services_..> | 2025-12-28 23:59 | 4.1K | |
| php84-pear-Services_..> | 2025-12-30 01:16 | 9.9K | |
| php84-pear-Services_..> | 2025-12-28 05:32 | 5.2K | |
| php84-pear-Services_..> | 2025-12-29 15:25 | 9.1K | |
| php84-pear-Services_..> | 2025-12-28 10:52 | 11K | |
| php84-pear-Services_..> | 2025-12-28 01:15 | 4.9K | |
| php84-pear-Services_..> | 2025-12-30 16:52 | 6.1K | |
| php84-pear-Services_..> | 2025-12-28 01:18 | 58K | |
| php84-pear-Services_..> | 2025-12-28 00:34 | 11K | |
| php84-pear-Services_..> | 2025-12-28 03:51 | 14K | |
| php84-pear-Services_..> | 2025-12-29 06:59 | 45K | |
| php84-pear-Services_..> | 2025-12-29 13:11 | 15K | |
| php84-pear-Services_..> | 2025-12-29 02:33 | 13K | |
| php84-pear-Services_..> | 2025-12-30 10:52 | 4.4K | |
| php84-pear-Spreadshe..> | 2025-12-27 05:38 | 49K | |
| php84-pear-Structure..> | 2025-12-27 01:00 | 43K | |
| php84-pear-Structure..> | 2025-12-27 09:05 | 4.2K | |
| php84-pear-Structure..> | 2025-12-28 03:18 | 4.9K | |
| php84-pear-Structure..> | 2025-12-27 19:47 | 3.3K | |
| php84-pear-Structure..> | 2025-12-28 09:47 | 4.9K | |
| php84-pear-Structure..> | 2025-12-28 18:07 | 4.7K | |
| php84-pear-Structure..> | 2025-12-28 17:33 | 3.8K | |
| php84-pear-Structure..> | 2025-12-29 15:47 | 9.6K | |
| php84-pear-Structure..> | 2025-12-28 18:38 | 4.9K | |
| php84-pear-Structure..> | 2025-12-29 11:01 | 6.9K | |
| php84-pear-Structure..> | 2025-12-27 16:49 | 5.1K | |
| php84-pear-Structure..> | 2025-12-29 14:59 | 5.6K | |
| php84-pear-Structure..> | 2025-12-27 20:35 | 4.6K | |
| php84-pear-Structure..> | 2025-12-29 17:29 | 4.5K | |
| php84-pear-Structure..> | 2025-12-28 14:57 | 13K | |
| php84-pear-Symfony_C..> | 2025-12-27 06:13 | 78K | |
| php84-pear-Symfony_C..> | 2025-12-26 21:41 | 34K | |
| php84-pear-Symfony_C..> | 2025-12-29 16:28 | 38K | |
| php84-pear-System_Co..> | 2025-12-29 03:59 | 7.2K | |
| php84-pear-Testing_S..> | 2025-12-27 22:14 | 2.3M | |
| php84-pear-Text_Diff..> | 2025-12-30 15:10 | 21K | |
| php84-pear-Text_Figl..> | 2025-12-29 23:02 | 8.7K | |
| php84-pear-Text_High..> | 2025-12-30 09:31 | 82K | |
| php84-pear-Text_Pass..> | 2025-12-28 03:19 | 6.2K | |
| php84-pear-Text_Spel..> | 2025-12-29 13:08 | 125K | |
| php84-pear-Text_Temp..> | 2025-12-27 11:13 | 1.9K | |
| php84-pear-Text_Wiki..> | 2025-12-29 00:17 | 77K | |
| php84-pear-TheSeer_D..> | 2025-12-30 05:46 | 3.0K | |
| php84-pear-TheSeer_f..> | 2025-12-27 01:09 | 5.1K | |
| php84-pear-TheSeer_f..> | 2025-12-30 16:52 | 6.7K | |
| php84-pear-Translati..> | 2025-12-30 07:01 | 47K | |
| php84-pear-UDDI-0.2...> | 2025-12-28 06:06 | 7.6K | |
| php84-pear-URI_Templ..> | 2025-12-30 04:54 | 7.4K | |
| php84-pear-VFS-0.3.0..> | 2025-12-28 01:25 | 36K | |
| php84-pear-Validate-..> | 2025-12-27 11:17 | 21K | |
| php84-pear-Validate_..> | 2025-12-29 05:16 | 11K | |
| php84-pear-Validate_..> | 2025-12-29 03:51 | 11K | |
| php84-pear-Validate_..> | 2025-12-28 16:35 | 7.2K | |
| php84-pear-Validate_..> | 2025-12-28 04:41 | 6.5K | |
| php84-pear-Validate_..> | 2025-12-30 04:17 | 9.6K | |
| php84-pear-Var_Dump-..> | 2025-12-29 00:36 | 18K | |
| php84-pear-VersionCo..> | 2025-12-30 04:53 | 16K | |
| php84-pear-VersionCo..> | 2025-12-29 06:23 | 28K | |
| php84-pear-XML_Beaut..> | 2025-12-30 05:18 | 14K | |
| php84-pear-XML_DTD-0..> | 2025-12-27 03:18 | 33K | |
| php84-pear-XML_Feed_..> | 2025-12-30 09:37 | 268K | |
| php84-pear-XML_GRDDL..> | 2025-12-30 17:39 | 44K | |
| php84-pear-XML_HTMLS..> | 2025-12-30 11:28 | 16K | |
| php84-pear-XML_NITF-..> | 2025-12-30 07:26 | 8.2K | |
| php84-pear-XML_Parse..> | 2025-12-26 18:10 | 14K | |
| php84-pear-XML_Query..> | 2025-12-30 14:29 | 298K | |
| php84-pear-XML_RPC-1..> | 2025-12-27 18:01 | 24K | |
| php84-pear-XML_RPC2-..> | 2025-12-30 06:14 | 58K | |
| php84-pear-XML_RSS-1..> | 2025-12-27 19:23 | 8.7K | |
| php84-pear-XML_SVG-1..> | 2025-12-29 07:35 | 9.2K | |
| php84-pear-XML_Seria..> | 2025-12-26 23:47 | 31K | |
| php84-pear-XML_Trans..> | 2025-12-30 12:31 | 27K | |
| php84-pear-XML_Tree-..> | 2025-12-28 02:49 | 5.4K | |
| php84-pear-XML_Util-..> | 2025-12-26 18:37 | 18K | |
| php84-pear-XML_Wddx-..> | 2025-12-30 06:28 | 6.9K | |
| php84-pear-YAML-1.0...> | 2025-12-29 04:07 | 10K | |
| php84-pear-channel-e..> | 2025-12-26 18:50 | 1.2K | |
| php84-pear-channel-g..> | 2025-12-27 17:06 | 1.1K | |
| php84-pear-channel-h..> | 2025-12-26 06:44 | 1.1K | |
| php84-pear-channel-o..> | 2025-12-28 16:36 | 1.1K | |
| php84-pear-channel-p..> | 2025-12-27 12:31 | 1.1K | |
| php84-pear-channel-p..> | 2025-12-27 18:42 | 1.1K | |
| php84-pear-channel-p..> | 2025-12-29 20:00 | 1.2K | |
| php84-pear-channel-p..> | 2025-12-30 17:07 | 1.1K | |
| php84-pear-channel-p..> | 2025-12-27 17:58 | 1.2K | |
| php84-pear-channel-s..> | 2025-12-27 18:31 | 1.2K | |
| php84-pear-channel-s..> | 2025-12-26 18:47 | 1.2K | |
| php84-pear-channel-t..> | 2025-12-26 19:57 | 1.1K | |
| php84-pear-channel-t..> | 2025-12-27 13:16 | 1.2K | |
| php84-pear-codegen-1..> | 2025-12-29 23:25 | 43K | |
| php84-pear-ezc_Base-..> | 2025-12-26 21:24 | 212K | |
| php84-pear-ezc_Conso..> | 2025-12-27 06:49 | 746K | |
| php84-pear-geshi-ges..> | 2025-12-30 09:34 | 666K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:56 | 317K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:13 | 39K | |
| php84-pear-horde-Hor..> | 2025-12-28 05:58 | 61K | |
| php84-pear-horde-Hor..> | 2025-12-26 17:53 | 54K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:53 | 16K | |
| php84-pear-horde-Hor..> | 2025-12-29 06:34 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:55 | 38K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:12 | 27K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:19 | 31K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:05 | 2.1M | |
| php84-pear-horde-Hor..> | 2025-12-26 14:55 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-26 13:51 | 6.7K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:17 | 12K | |
| php84-pear-horde-Hor..> | 2025-12-27 01:06 | 1.2M | |
| php84-pear-horde-Hor..> | 2025-12-26 18:12 | 12K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:55 | 73K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:20 | 45K | |
| php84-pear-horde-Hor..> | 2025-12-26 11:44 | 67K | |
| php84-pear-horde-Hor..> | 2025-12-27 21:13 | 30K | |
| php84-pear-horde-Hor..> | 2025-12-27 12:00 | 192K | |
| php84-pear-horde-Hor..> | 2025-12-26 14:09 | 73K | |
| php84-pear-horde-Hor..> | 2025-12-29 13:36 | 570K | |
| php84-pear-horde-Hor..> | 2025-12-26 09:22 | 26K | |
| php84-pear-horde-Hor..> | 2025-12-28 18:16 | 1.2M | |
| php84-pear-horde-Hor..> | 2025-12-28 18:56 | 148K | |
| php84-pear-horde-Hor..> | 2025-12-26 13:56 | 23K | |
| php84-pear-horde-Hor..> | 2025-12-26 14:53 | 17K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:59 | 26K | |
| php84-pear-horde-Hor..> | 2025-12-26 21:39 | 16K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:01 | 99K | |
| php84-pear-horde-Hor..> | 2025-12-26 10:25 | 11K | |
| php84-pear-horde-Hor..> | 2025-12-30 02:40 | 34K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:39 | 22K | |
| php84-pear-horde-Hor..> | 2025-12-28 19:07 | 36K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:41 | 16K | |
| php84-pear-horde-Hor..> | 2025-12-27 18:46 | 54K | |
| php84-pear-horde-Hor..> | 2025-12-30 08:10 | 22K | |
| php84-pear-horde-Hor..> | 2025-12-30 16:35 | 141K | |
| php84-pear-horde-Hor..> | 2025-12-27 00:40 | 58K | |
| php84-pear-horde-Hor..> | 2025-12-30 10:28 | 18K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:41 | 18K | |
| php84-pear-horde-Hor..> | 2025-12-26 17:54 | 31K | |
| php84-pear-horde-Hor..> | 2025-12-26 10:55 | 36K | |
| php84-pear-horde-Hor..> | 2025-12-28 01:12 | 18K | |
| php84-pear-horde-Hor..> | 2025-12-30 02:31 | 15K | |
| php84-pear-horde-Hor..> | 2025-12-26 14:44 | 125K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:09 | 269K | |
| php84-pear-horde-Hor..> | 2025-12-29 22:53 | 85K | |
| php84-pear-horde-Hor..> | 2025-12-26 10:54 | 225K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:50 | 21K | |
| php84-pear-horde-Hor..> | 2025-12-27 18:33 | 7.2K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:39 | 17K | |
| php84-pear-horde-Hor..> | 2025-12-29 12:21 | 47K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:56 | 38K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:16 | 53K | |
| php84-pear-horde-Hor..> | 2025-12-28 10:35 | 13K | |
| php84-pear-horde-Hor..> | 2025-12-30 09:13 | 34K | |
| php84-pear-horde-Hor..> | 2025-12-26 15:27 | 11K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:46 | 40K | |
| php84-pear-horde-Hor..> | 2025-12-28 21:08 | 39K | |
| php84-pear-horde-Hor..> | 2025-12-28 23:56 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-30 02:10 | 6.0K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:22 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:00 | 16K | |
| php84-pear-horde-Hor..> | 2025-12-29 01:23 | 32K | |
| php84-pear-horde-Hor..> | 2025-12-29 04:37 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-30 16:34 | 11K | |
| php84-pear-horde-Hor..> | 2025-12-29 19:15 | 3.0K | |
| php84-pear-horde-Hor..> | 2025-12-28 10:38 | 192K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:06 | 25K | |
| php84-pear-horde-Hor..> | 2025-12-26 19:12 | 56K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:05 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-30 12:44 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-26 17:29 | 18K | |
| php84-pear-horde-Hor..> | 2025-12-26 10:08 | 14K | |
| php84-pear-horde-Hor..> | 2025-12-26 10:54 | 6.8K | |
| php84-pear-horde-Hor..> | 2025-12-26 11:38 | 25K | |
| php84-pear-horde-Hor..> | 2025-12-27 02:42 | 115K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:30 | 15K | |
| php84-pear-horde-Hor..> | 2025-12-29 22:01 | 29K | |
| php84-pear-horde-Hor..> | 2025-12-26 17:30 | 53K | |
| php84-pear-horde-Hor..> | 2025-12-28 11:11 | 24K | |
| php84-pear-horde-Hor..> | 2025-12-26 11:12 | 15K | |
| php84-pear-horde-Hor..> | 2025-12-27 09:22 | 21K | |
| php84-pear-horde-Hor..> | 2025-12-30 12:24 | 28K | |
| php84-pear-horde-Hor..> | 2025-12-26 20:21 | 32K | |
| php84-pear-horde-Hor..> | 2025-12-26 08:48 | 16K | |
| php84-pear-horde-Hor..> | 2025-12-28 19:48 | 19K | |
| php84-pear-horde-Hor..> | 2025-12-26 16:56 | 17K | |
| php84-pear-horde-Hor..> | 2025-12-26 09:21 | 35K | |
| php84-pear-horde-Hor..> | 2025-12-26 18:10 | 42K | |
| php84-pear-horde-Hor..> | 2025-12-27 16:09 | 12K | |
| php84-pear-horde-Hor..> | 2025-12-27 01:09 | 26K | |
| php84-pear-pdepend_s..> | 2025-12-29 17:26 | 33K | |
| php84-pear-phing-2.6..> | 2025-12-30 08:01 | 361K | |
| php84-pear-pirum-Pir..> | 2025-12-28 06:29 | 15K | |
| php84-pear-twig-twig..> | 2025-12-29 15:42 | 94K | |
| php84-pecl-APCu-5.1...> | 2025-12-26 21:00 | 54K | |
| php84-pecl-amqp-2.1...> | 2025-12-29 22:01 | 53K | |
| php84-pecl-ast-1.1.3..> | 2025-12-28 00:38 | 21K | |
| php84-pecl-bitset-3...> | 2025-12-26 15:28 | 11K | |
| php84-pecl-couchbase..> | 2025-12-29 07:54 | 29K | |
| php84-pecl-crypto-0...> | 2025-12-28 12:21 | 32K | |
| php84-pecl-dio-0.3.0..> | 2025-12-29 13:05 | 12K | |
| php84-pecl-ds-1.6.0.pkg | 2025-12-30 10:06 | 58K | |
| php84-pecl-eio-3.0.0..> | 2025-12-30 18:18 | 29K | |
| php84-pecl-ev-1.2.2.pkg | 2025-12-29 04:37 | 46K | |
| php84-pecl-event-3.1..> | 2025-12-28 04:07 | 46K | |
| php84-pecl-excimer-1..> | 2025-12-29 11:48 | 24K | |
| php84-pecl-expect-0...> | 2025-12-29 07:18 | 7.8K | |
| php84-pecl-geospatia..> | 2025-12-30 01:22 | 17K | |
| php84-pecl-gnupg-1.5..> | 2025-12-27 08:31 | 18K | |
| php84-pecl-grpc-1.76..> | 2025-12-30 12:03 | 3.3M | |
| php84-pecl-horde_lz4..> | 2025-12-28 20:36 | 4.6K | |
| php84-pecl-http-4.3...> | 2025-12-29 23:31 | 143K | |
| php84-pecl-igbinary-..> | 2025-12-28 16:49 | 27K | |
| php84-pecl-imagick-3..> | 2025-12-27 06:03 | 126K | |
| php84-pecl-imap-1.0...> | 2025-12-26 21:20 | 37K | |
| php84-pecl-inotify-3..> | 2025-12-30 04:07 | 7.0K | |
| php84-pecl-json_post..> | 2025-12-28 12:37 | 5.4K | |
| php84-pecl-krb5-1.2...> | 2025-12-28 06:12 | 25K | |
| php84-pecl-leveldb-0..> | 2025-12-27 21:28 | 14K | |
| php84-pecl-libsodium..> | 2025-12-29 01:31 | 24K | |
| php84-pecl-lzf-1.7.0..> | 2025-12-30 18:16 | 8.2K | |
| php84-pecl-mailparse..> | 2025-12-30 07:07 | 27K | |
| php84-pecl-mcrypt-1...> | 2025-12-26 16:34 | 15K | |
| php84-pecl-memcache-..> | 2025-12-26 15:28 | 44K | |
| php84-pecl-memcached..> | 2025-12-26 14:59 | 52K | |
| php84-pecl-mongodb-1..> | 2025-12-29 16:19 | 821K | |
| php84-pecl-msgpack-3..> | 2025-12-27 12:34 | 27K | |
| php84-pecl-mustache-..> | 2025-12-29 16:32 | 27K | |
| php84-pecl-oauth-2.0..> | 2025-12-27 22:07 | 37K | |
| php84-pecl-opentelem..> | 2025-12-30 02:06 | 14K | |
| php84-pecl-pam-2.2.5..> | 2025-12-30 01:48 | 8.8K | |
| php84-pecl-pcov-1.0...> | 2025-12-30 00:21 | 10K | |
| php84-pecl-pkcs11-1...> | 2025-12-29 11:31 | 47K | |
| php84-pecl-proctitle..> | 2025-12-29 11:13 | 4.1K | |
| php84-pecl-protobuf-..> | 2025-12-30 12:39 | 233K | |
| php84-pecl-pspell-1...> | 2025-12-28 08:32 | 9.6K | |
| php84-pecl-psr-1.2.0..> | 2025-12-28 23:30 | 16K | |
| php84-pecl-qrencode-..> | 2025-12-29 13:56 | 7.2K | |
| php84-pecl-radius-1...> | 2025-12-27 18:03 | 32K | |
| php84-pecl-raphf-2.0..> | 2025-12-27 06:00 | 11K | |
| php84-pecl-rar-4.2.0..> | 2025-12-29 10:57 | 152K | |
| php84-pecl-rdkafka-6..> | 2025-12-28 06:09 | 43K | |
| php84-pecl-redis-6.3..> | 2025-12-27 10:51 | 239K | |
| php84-pecl-rrd-2.0.3..> | 2025-12-30 06:49 | 14K | |
| php84-pecl-scrypt-2...> | 2025-12-29 07:09 | 18K | |
| php84-pecl-smbclient..> | 2025-12-27 16:59 | 24K | |
| php84-pecl-solr-2.8...> | 2025-12-29 03:41 | 80K | |
| php84-pecl-ssh2-1.3...> | 2025-12-27 15:56 | 27K | |
| php84-pecl-stomp-2.0..> | 2025-12-29 23:52 | 19K | |
| php84-pecl-swoole-6...> | 2025-12-29 05:24 | 866K | |
| php84-pecl-sync-1.1...> | 2025-12-30 12:53 | 14K | |
| php84-pecl-timezoned..> | 2025-12-29 18:13 | 243K | |
| php84-pecl-uploadpro..> | 2025-12-28 12:04 | 7.8K | |
| php84-pecl-uuid-1.3...> | 2025-12-27 03:44 | 8.3K | |
| php84-pecl-uv-0.3.0.pkg | 2025-12-28 04:59 | 49K | |
| php84-pecl-vips-1.0...> | 2025-12-30 02:40 | 17K | |
| php84-pecl-vld-0.19...> | 2025-12-30 08:09 | 18K | |
| php84-pecl-xdebug-3...> | 2025-12-29 20:18 | 136K | |
| php84-pecl-xdiff-2.1..> | 2025-12-28 06:42 | 9.5K | |
| php84-pecl-xlswriter..> | 2025-12-29 17:01 | 167K | |
| php84-pecl-xmlrpc-1...> | 2025-12-27 17:06 | 40K | |
| php84-pecl-xxtea-1.0..> | 2025-12-27 19:24 | 5.8K | |
| php84-pecl-yac-2.3.1..> | 2025-12-29 09:20 | 23K | |
| php84-pecl-yaconf-1...> | 2025-12-29 00:49 | 12K | |
| php84-pecl-yaf-3.3.7..> | 2025-12-30 05:59 | 96K | |
| php84-pecl-yaml-2.3...> | 2025-12-30 08:07 | 21K | |
| php84-pecl-yar-2.3.4..> | 2025-12-30 18:47 | 33K | |
| php84-pecl-zephir_pa..> | 2025-12-27 10:22 | 46K | |
| php84-pecl-zookeeper..> | 2025-12-28 12:19 | 25K | |
| php84-pecl-zstd-0.15..> | 2025-12-30 05:23 | 16K | |
| php84-pgsql-8.4.16.pkg | 2025-12-26 15:47 | 60K | |
| php84-phalcon-5.9.3.pkg | 2025-12-28 09:58 | 1.9M | |
| php84-phar-8.4.16.pkg | 2025-12-27 00:02 | 114K | |
| php84-posix-8.4.16.pkg | 2025-12-26 16:57 | 16K | |
| php84-readline-8.4.1..> | 2025-12-27 03:19 | 14K | |
| php84-session-8.4.16..> | 2025-12-26 14:09 | 41K | |
| php84-shmop-8.4.16.pkg | 2025-12-28 04:01 | 7.9K | |
| php84-simplexml-8.4...> | 2025-12-26 16:37 | 24K | |
| php84-snappy-0.2.3.pkg | 2025-12-29 17:28 | 4.4K | |
| php84-snmp-8.4.16.pkg | 2025-12-27 07:28 | 25K | |
| php84-soap-8.4.16.pkg | 2025-12-26 17:00 | 129K | |
| php84-sockets-8.4.16..> | 2025-12-26 16:56 | 48K | |
| php84-sodium-8.4.16.pkg | 2025-12-27 01:17 | 33K | |
| php84-sqlite3-8.4.16..> | 2025-12-26 15:04 | 27K | |
| php84-sysvmsg-8.4.16..> | 2025-12-27 07:41 | 9.3K | |
| php84-sysvsem-8.4.16..> | 2025-12-26 21:41 | 6.9K | |
| php84-sysvshm-8.4.16..> | 2025-12-27 09:13 | 8.2K | |
| php84-tarantool-0.4...> | 2025-12-28 23:23 | 51K | |
| php84-tidy-8.4.16.pkg | 2025-12-27 15:59 | 23K | |
| php84-tokenizer-8.4...> | 2025-12-26 21:41 | 14K | |
| php84-xapian-1.4.30.pkg | 2025-12-27 18:41 | 297K | |
| php84-xml-8.4.16.pkg | 2025-12-26 06:24 | 26K | |
| php84-xmlreader-8.4...> | 2025-12-26 22:10 | 18K | |
| php84-xmlwriter-8.4...> | 2025-12-26 20:28 | 16K | |
| php84-xsl-8.4.16.pkg | 2025-12-26 22:36 | 16K | |
| php84-zephir-0.17.0.pkg | 2025-12-29 05:57 | 1.4M | |
| php84-zip-8.4.16.pkg | 2025-12-26 21:09 | 36K | |
| php84-zlib-8.4.16.pkg | 2025-12-26 06:30 | 21K | |
| php84-zstd-0.15.2_1.pkg | 2025-12-30 16:52 | 16K | |
| php85-8.5.1.pkg | 2025-12-26 06:05 | 12M | |
| php85-Ice37-3.7.10.pkg | 2025-12-28 06:52 | 177K | |
| php85-adminer-5.4.1.pkg | 2025-12-29 22:17 | 358K | |
| php85-aphpunit-2.3.pkg | 2025-12-28 14:31 | 14K | |
| php85-bcmath-8.5.1.pkg | 2025-12-26 13:50 | 45K | |
| php85-brotli-0.18.2_..> | 2025-12-29 16:04 | 14K | |
| php85-bsdconv-11.6.0..> | 2025-12-28 06:33 | 8.7K | |
| php85-bz2-8.5.1.pkg | 2025-12-26 21:11 | 12K | |
| php85-bzip3-0.1.1.pkg | 2025-12-30 08:31 | 5.6K | |
| php85-calendar-8.5.1..> | 2025-12-27 06:27 | 16K | |
| php85-composer-2.9.2..> | 2025-12-27 19:26 | 590K | |
| php85-ctype-8.5.1.pkg | 2025-12-26 15:08 | 6.1K | |
| php85-curl-8.5.1.pkg | 2025-12-26 15:36 | 51K | |
| php85-dba-8.5.1.pkg | 2025-12-27 23:42 | 26K | |
| php85-dddbl-2.0.1.pkg | 2025-12-29 02:46 | 9.5K | |
| php85-deployer-6.4.3..> | 2025-12-30 05:25 | 327K | |
| php85-dom-8.5.1.pkg | 2025-12-26 08:50 | 156K | |
| php85-enchant-8.5.1.pkg | 2025-12-27 23:15 | 12K | |
| php85-exif-8.5.1.pkg | 2025-12-27 01:22 | 31K | |
| php85-extensions-1.0..> | 2025-12-29 22:09 | 1.1K | |
| php85-facedetect-1.1..> | 2025-12-29 20:25 | 7.9K | |
| php85-ffi-8.5.1.pkg | 2025-12-28 04:23 | 71K | |
| php85-fileinfo-8.5.1..> | 2025-12-26 15:27 | 399K | |
| php85-filter-8.5.1.pkg | 2025-12-26 12:56 | 26K | |
| php85-ftp-8.5.1.pkg | 2025-12-27 08:45 | 28K | |
| php85-gd-8.5.1.pkg | 2025-12-26 17:01 | 42K | |
| php85-geos-1.0.0_1.pkg | 2025-12-29 08:50 | 21K | |
| php85-gettext-8.5.1.pkg | 2025-12-26 17:00 | 7.8K | |
| php85-gmp-8.5.1.pkg | 2025-12-26 20:22 | 23K | |
| php85-google-api-php..> | 2025-12-29 12:19 | 29K | |
| php85-iconv-8.5.1.pkg | 2025-12-26 15:51 | 19K | |
| php85-ilias-10.3.pkg | 2025-12-30 17:34 | 19M | |
| php85-intl-8.5.1.pkg | 2025-12-26 16:33 | 167K | |
| php85-kanboard-1.2.4..> | 2025-12-28 09:59 | 2.5M | |
| php85-ldap-8.5.1.pkg | 2025-12-26 14:49 | 37K | |
| php85-libawl-0.64.pkg | 2025-12-27 19:26 | 84K | |
| php85-lz4-0.6.0.pkg | 2025-12-29 07:30 | 8.2K | |
| php85-maxminddb-1.13..> | 2025-12-30 14:56 | 8.2K | |
| php85-mbstring-8.5.1..> | 2025-12-26 14:48 | 931K | |
| php85-mysqli-8.5.1.pkg | 2025-12-26 10:56 | 53K | |
| php85-odbc-8.5.1.pkg | 2025-12-27 21:26 | 31K | |
| php85-opencc-0.0.0.2..> | 2025-12-30 05:53 | 5.9K | |
| php85-pcntl-8.5.1.pkg | 2025-12-26 20:48 | 22K | |
| php85-pdo-8.5.1.pkg | 2025-12-26 12:53 | 57K | |
| php85-pdo_dblib-8.5...> | 2025-12-27 21:07 | 15K | |
| php85-pdo_firebird-8..> | 2025-12-28 11:43 | 20K | |
| php85-pdo_mysql-8.5...> | 2025-12-26 15:07 | 18K | |
| php85-pdo_odbc-8.5.1..> | 2025-12-29 18:00 | 16K | |
| php85-pdo_pgsql-8.5...> | 2025-12-26 15:33 | 27K | |
| php85-pdo_sqlite-8.5..> | 2025-12-26 15:35 | 21K | |
| php85-pear-1.10.17.pkg | 2025-12-26 06:40 | 253K | |
| php85-pear-Auth-1.6...> | 2025-12-27 10:22 | 48K | |
| php85-pear-Auth_HTTP..> | 2025-12-29 18:20 | 9.3K | |
| php85-pear-Auth_Pref..> | 2025-12-30 10:29 | 12K | |
| php85-pear-Auth_RADI..> | 2025-12-28 08:46 | 9.1K | |
| php85-pear-Auth_SASL..> | 2025-12-27 00:51 | 10K | |
| php85-pear-Auth_SASL..> | 2025-12-30 12:39 | 9.6K | |
| php85-pear-Benchmark..> | 2025-12-29 03:41 | 9.2K | |
| php85-pear-Cache-1.5..> | 2025-12-27 13:45 | 29K | |
| php85-pear-Cache_Lit..> | 2025-12-27 16:39 | 33K | |
| php85-pear-Config-1...> | 2025-12-27 22:43 | 31K | |
| php85-pear-Console_C..> | 2025-12-29 18:43 | 5.7K | |
| php85-pear-Console_C..> | 2025-12-27 03:31 | 38K | |
| php85-pear-Console_G..> | 2025-12-27 16:02 | 17K | |
| php85-pear-Console_T..> | 2025-12-26 20:00 | 12K | |
| php85-pear-Contact_V..> | 2025-12-28 09:30 | 16K | |
| php85-pear-Contact_V..> | 2025-12-30 15:07 | 11K | |
| php85-pear-Crypt_Blo..> | 2025-12-30 13:52 | 17K | |
| php85-pear-Crypt_CBC..> | 2025-12-28 09:59 | 4.5K | |
| php85-pear-Crypt_CHA..> | 2025-12-27 09:02 | 6.2K | |
| php85-pear-Crypt_Dif..> | 2025-12-28 00:23 | 12K | |
| php85-pear-Crypt_GPG..> | 2025-12-30 13:46 | 285K | |
| php85-pear-Crypt_HMA..> | 2025-12-27 03:40 | 8.8K | |
| php85-pear-Crypt_Mic..> | 2025-12-29 13:44 | 3.9K | |
| php85-pear-Crypt_RC4..> | 2025-12-28 20:22 | 3.1K | |
| php85-pear-Crypt_RSA..> | 2025-12-30 08:56 | 20K | |
| php85-pear-Crypt_XXT..> | 2025-12-29 19:14 | 7.2K | |
| php85-pear-DB-1.12.3..> | 2025-12-26 20:27 | 87K | |
| php85-pear-DBA-1.1.1..> | 2025-12-27 10:56 | 13K | |
| php85-pear-DBA_Relat..> | 2025-12-29 19:21 | 19K | |
| php85-pear-DB_DataOb..> | 2025-12-27 18:04 | 70K | |
| php85-pear-DB_DataOb..> | 2025-12-28 06:22 | 60K | |
| php85-pear-DB_Pager-..> | 2025-12-28 21:28 | 4.7K | |
| php85-pear-DB_QueryT..> | 2025-12-29 02:46 | 40K | |
| php85-pear-DB_Sqlite..> | 2025-12-29 05:14 | 19K | |
| php85-pear-DB_Table-..> | 2025-12-28 23:08 | 93K | |
| php85-pear-DB_ldap-1..> | 2025-12-28 10:45 | 10K | |
| php85-pear-DB_ldap2-..> | 2025-12-28 21:02 | 19K | |
| php85-pear-Date-1.4...> | 2025-12-26 21:32 | 43K | |
| php85-pear-Date_Holi..> | 2025-12-27 09:03 | 34K | |
| php85-pear-Date_Holi..> | 2025-12-29 20:02 | 5.8K | |
| php85-pear-Date_Holi..> | 2025-12-28 09:59 | 4.8K | |
| php85-pear-Date_Holi..> | 2025-12-30 02:24 | 4.5K | |
| php85-pear-Date_Holi..> | 2025-12-29 09:16 | 3.8K | |
| php85-pear-Date_Holi..> | 2025-12-28 01:42 | 4.4K | |
| php85-pear-Date_Holi..> | 2025-12-30 12:05 | 12K | |
| php85-pear-Date_Holi..> | 2025-12-28 20:33 | 5.4K | |
| php85-pear-Date_Holi..> | 2025-12-29 23:41 | 5.2K | |
| php85-pear-Date_Holi..> | 2025-12-29 23:59 | 4.7K | |
| php85-pear-Date_Holi..> | 2025-12-30 00:11 | 9.4K | |
| php85-pear-Date_Holi..> | 2025-12-28 02:28 | 5.6K | |
| php85-pear-Date_Holi..> | 2025-12-27 20:03 | 4.1K | |
| php85-pear-Date_Holi..> | 2025-12-29 23:23 | 4.3K | |
| php85-pear-Date_Holi..> | 2025-12-28 16:15 | 3.7K | |
| php85-pear-Date_Holi..> | 2025-12-28 03:30 | 4.3K | |
| php85-pear-Date_Holi..> | 2025-12-29 18:58 | 6.6K | |
| php85-pear-Date_Holi..> | 2025-12-29 03:06 | 9.8K | |
| php85-pear-Date_Holi..> | 2025-12-29 19:23 | 5.4K | |
| php85-pear-Date_Holi..> | 2025-12-28 21:37 | 3.9K | |
| php85-pear-Event_Dis..> | 2025-12-26 22:43 | 9.2K | |
| php85-pear-FSM-1.4.0..> | 2025-12-29 04:36 | 12K | |
| php85-pear-File-1.4...> | 2025-12-27 08:38 | 9.1K | |
| php85-pear-File_Arch..> | 2025-12-28 12:27 | 53K | |
| php85-pear-File_Bitt..> | 2025-12-28 23:10 | 70K | |
| php85-pear-File_DNS-..> | 2025-12-29 09:02 | 10K | |
| php85-pear-File_Find..> | 2025-12-27 03:05 | 8.9K | |
| php85-pear-File_Fort..> | 2025-12-28 10:32 | 14K | |
| php85-pear-File_Fsta..> | 2025-12-29 08:19 | 7.7K | |
| php85-pear-File_Gett..> | 2025-12-28 06:21 | 7.9K | |
| php85-pear-File_HtAc..> | 2025-12-29 04:04 | 5.8K | |
| php85-pear-File_Iter..> | 2025-12-27 06:34 | 3.0K | |
| php85-pear-File_MARC..> | 2025-12-30 16:53 | 79K | |
| php85-pear-File_PDF-..> | 2025-12-29 00:38 | 38K | |
| php85-pear-File_Pass..> | 2025-12-30 01:42 | 21K | |
| php85-pear-File_SMBP..> | 2025-12-27 21:42 | 6.0K | |
| php85-pear-Games_Che..> | 2025-12-29 14:56 | 83K | |
| php85-pear-HTML_AJAX..> | 2025-12-27 15:34 | 91K | |
| php85-pear-HTML_BBCo..> | 2025-12-28 12:54 | 16K | |
| php85-pear-HTML_CSS-..> | 2025-12-29 12:27 | 39K | |
| php85-pear-HTML_Comm..> | 2025-12-26 23:05 | 5.2K | |
| php85-pear-HTML_Comm..> | 2025-12-27 07:54 | 9.7K | |
| php85-pear-HTML_Cryp..> | 2025-12-29 10:47 | 5.2K | |
| php85-pear-HTML_Form..> | 2025-12-29 05:57 | 14K | |
| php85-pear-HTML_Java..> | 2025-12-30 18:29 | 9.1K | |
| php85-pear-HTML_Page..> | 2025-12-29 19:02 | 19K | |
| php85-pear-HTML_Quic..> | 2025-12-27 17:45 | 86K | |
| php85-pear-HTML_Quic..> | 2025-12-29 20:46 | 147K | |
| php85-pear-HTML_Quic..> | 2025-12-30 08:06 | 18K | |
| php85-pear-HTML_Quic..> | 2025-12-30 08:16 | 14K | |
| php85-pear-HTML_Quic..> | 2025-12-29 13:05 | 7.6K | |
| php85-pear-HTML_Quic..> | 2025-12-30 10:41 | 3.2K | |
| php85-pear-HTML_Quic..> | 2025-12-27 21:01 | 29K | |
| php85-pear-HTML_Sele..> | 2025-12-29 13:47 | 6.4K | |
| php85-pear-HTML_Sele..> | 2025-12-29 15:56 | 8.9K | |
| php85-pear-HTML_Tabl..> | 2025-12-27 16:09 | 15K | |
| php85-pear-HTML_TagC..> | 2025-12-27 21:59 | 12K | |
| php85-pear-HTML_Temp..> | 2025-12-27 10:41 | 144K | |
| php85-pear-HTML_Temp..> | 2025-12-27 12:31 | 22K | |
| php85-pear-HTML_Temp..> | 2025-12-30 07:20 | 18K | |
| php85-pear-HTML_Temp..> | 2025-12-28 03:12 | 29K | |
| php85-pear-HTML_Tree..> | 2025-12-30 08:15 | 50K | |
| php85-pear-HTTP-1.4...> | 2025-12-27 01:10 | 9.4K | |
| php85-pear-HTTP_Clie..> | 2025-12-30 12:25 | 11K | |
| php85-pear-HTTP_Down..> | 2025-12-30 07:00 | 15K | |
| php85-pear-HTTP_Floo..> | 2025-12-29 12:59 | 6.7K | |
| php85-pear-HTTP_Head..> | 2025-12-27 10:32 | 11K | |
| php85-pear-HTTP_Requ..> | 2025-12-26 22:10 | 17K | |
| php85-pear-HTTP_Requ..> | 2025-12-27 18:29 | 114K | |
| php85-pear-HTTP_Serv..> | 2025-12-30 04:54 | 7.6K | |
| php85-pear-HTTP_Sess..> | 2025-12-28 23:53 | 16K | |
| php85-pear-HTTP_Uplo..> | 2025-12-30 16:16 | 9.8K | |
| php85-pear-HTTP_WebD..> | 2025-12-28 10:09 | 9.5K | |
| php85-pear-HTTP_WebD..> | 2025-12-28 18:55 | 29K | |
| php85-pear-Horde_Cry..> | 2025-12-28 10:23 | 126K | |
| php85-pear-Horde_Cry..> | 2025-12-26 16:30 | 26K | |
| php85-pear-Horde_Ima..> | 2025-12-28 10:48 | 606K | |
| php85-pear-Horde_Ima..> | 2025-12-27 16:12 | 206K | |
| php85-pear-Horde_Kol..> | 2025-12-27 06:04 | 86K | |
| php85-pear-Horde_Log..> | 2025-12-26 17:34 | 16K | |
| php85-pear-Horde_Map..> | 2025-12-26 14:54 | 18K | |
| php85-pear-Horde_Smt..> | 2025-12-26 18:05 | 33K | |
| php85-pear-Horde_Vfs..> | 2025-12-27 15:43 | 64K | |
| php85-pear-I18N-1.0...> | 2025-12-27 17:44 | 31K | |
| php85-pear-I18Nv2-0...> | 2025-12-30 04:55 | 214K | |
| php85-pear-Image_3D-..> | 2025-12-28 01:23 | 99K | |
| php85-pear-Image_Bar..> | 2025-12-29 18:54 | 14K | |
| php85-pear-Image_Bar..> | 2025-12-30 02:55 | 16K | |
| php85-pear-Image_Can..> | 2025-12-27 09:45 | 39K | |
| php85-pear-Image_Col..> | 2025-12-26 22:35 | 10K | |
| php85-pear-Image_Gra..> | 2025-12-29 15:25 | 328K | |
| php85-pear-Image_Gra..> | 2025-12-30 14:56 | 17K | |
| php85-pear-Image_Tra..> | 2025-12-30 14:28 | 385K | |
| php85-pear-LiveUser-..> | 2025-12-27 17:06 | 64K | |
| php85-pear-LiveUser_..> | 2025-12-28 02:38 | 54K | |
| php85-pear-Log-1.14...> | 2025-12-27 04:00 | 40K | |
| php85-pear-MDB-1.3.0..> | 2025-12-27 06:20 | 126K | |
| php85-pear-MDB2-2.5...> | 2025-12-27 16:24 | 104K | |
| php85-pear-MDB2_Driv..> | 2025-12-30 16:29 | 34K | |
| php85-pear-MDB2_Driv..> | 2025-12-30 13:43 | 30K | |
| php85-pear-MDB2_Sche..> | 2025-12-29 17:00 | 64K | |
| php85-pear-MDB_Query..> | 2025-12-28 23:55 | 43K | |
| php85-pear-MIME_Type..> | 2025-12-27 15:10 | 20K | |
| php85-pear-Mail-2.0...> | 2025-12-27 05:59 | 22K | |
| php85-pear-Mail_Mbox..> | 2025-12-30 02:40 | 14K | |
| php85-pear-Mail_Mime..> | 2025-12-27 00:40 | 37K | |
| php85-pear-Mail_Queu..> | 2025-12-29 23:03 | 21K | |
| php85-pear-Mail_mime..> | 2025-12-27 16:18 | 13K | |
| php85-pear-Math_BigI..> | 2025-12-26 13:55 | 25K | |
| php85-pear-Math_Comb..> | 2025-12-28 01:09 | 6.0K | |
| php85-pear-Math_Frac..> | 2025-12-28 00:26 | 4.9K | |
| php85-pear-Net_Check..> | 2025-12-30 11:25 | 2.8K | |
| php85-pear-Net_Cyrus..> | 2025-12-29 18:12 | 6.4K | |
| php85-pear-Net_DIME-..> | 2025-12-30 16:42 | 7.8K | |
| php85-pear-Net_DNS2-..> | 2025-12-29 11:02 | 68K | |
| php85-pear-Net_DNS21..> | 2025-12-27 17:13 | 72K | |
| php85-pear-Net_DNSBL..> | 2025-12-28 01:05 | 8.7K | |
| php85-pear-Net_Dict-..> | 2025-12-28 03:03 | 6.6K | |
| php85-pear-Net_FTP-1..> | 2025-12-30 01:52 | 31K | |
| php85-pear-Net_Finge..> | 2025-12-30 01:41 | 2.4K | |
| php85-pear-Net_Gearm..> | 2025-12-29 17:35 | 18K | |
| php85-pear-Net_Geo-1..> | 2025-12-30 10:09 | 8.4K | |
| php85-pear-Net_GeoIP..> | 2025-12-30 00:04 | 14K | |
| php85-pear-Net_Growl..> | 2025-12-30 04:54 | 465K | |
| php85-pear-Net_IDNA-..> | 2025-12-29 23:17 | 18K | |
| php85-pear-Net_IMAP-..> | 2025-12-27 10:40 | 36K | |
| php85-pear-Net_IPv4-..> | 2025-12-27 03:12 | 7.0K | |
| php85-pear-Net_IPv6-..> | 2025-12-27 14:36 | 12K | |
| php85-pear-Net_Ident..> | 2025-12-30 00:51 | 4.0K | |
| php85-pear-Net_LDAP-..> | 2025-12-29 06:36 | 65K | |
| php85-pear-Net_LDAP2..> | 2025-12-29 10:02 | 82K | |
| php85-pear-Net_LMTP-..> | 2025-12-27 20:31 | 7.0K | |
| php85-pear-Net_MAC-0..> | 2025-12-28 14:39 | 5.9K | |
| php85-pear-Net_NNTP-..> | 2025-12-29 07:30 | 33K | |
| php85-pear-Net_Nmap-..> | 2025-12-29 22:58 | 25K | |
| php85-pear-Net_POP3-..> | 2025-12-30 06:25 | 9.9K | |
| php85-pear-Net_Ping-..> | 2025-12-29 12:20 | 9.9K | |
| php85-pear-Net_Ports..> | 2025-12-30 09:32 | 3.5K | |
| php85-pear-Net_SMS-0..> | 2025-12-29 12:28 | 19K | |
| php85-pear-Net_SMTP-..> | 2025-12-26 10:18 | 17K | |
| php85-pear-Net_Serve..> | 2025-12-27 10:01 | 18K | |
| php85-pear-Net_Sieve..> | 2025-12-29 12:20 | 15K | |
| php85-pear-Net_Smart..> | 2025-12-29 22:48 | 105K | |
| php85-pear-Net_Socke..> | 2025-12-26 09:22 | 7.3K | |
| php85-pear-Net_Trace..> | 2025-12-30 05:17 | 7.5K | |
| php85-pear-Net_URL-1..> | 2025-12-26 18:44 | 6.9K | |
| php85-pear-Net_URL2-..> | 2025-12-27 00:20 | 19K | |
| php85-pear-Net_URL_M..> | 2025-12-28 17:05 | 14K | |
| php85-pear-Net_UserA..> | 2025-12-27 21:55 | 12K | |
| php85-pear-Net_UserA..> | 2025-12-29 16:08 | 32K | |
| php85-pear-Net_Vpopm..> | 2025-12-29 17:25 | 21K | |
| php85-pear-Net_Whois..> | 2025-12-30 08:23 | 7.0K | |
| php85-pear-Numbers_R..> | 2025-12-30 07:07 | 6.8K | |
| php85-pear-Numbers_W..> | 2025-12-29 06:24 | 45K | |
| php85-pear-OLE-1.0.1..> | 2025-12-26 21:45 | 14K | |
| php85-pear-PEAR_Info..> | 2025-12-28 15:08 | 46K | |
| php85-pear-PEAR_Pack..> | 2025-12-30 11:35 | 34K | |
| php85-pear-PEAR_Pack..> | 2025-12-30 02:00 | 35K | |
| php85-pear-PEAR_Pack..> | 2025-12-27 07:27 | 21K | |
| php85-pear-PHPTAL-1...> | 2025-12-28 11:05 | 152K | |
| php85-pear-PHPUnit_M..> | 2025-12-29 21:46 | 21K | |
| php85-pear-PHP_Archi..> | 2025-12-30 15:02 | 47K | |
| php85-pear-PHP_Array..> | 2025-12-30 10:40 | 8.5K | |
| php85-pear-PHP_Beaut..> | 2025-12-30 05:54 | 67K | |
| php85-pear-PHP_CodeC..> | 2025-12-29 15:40 | 296K | |
| php85-pear-PHP_CodeS..> | 2025-12-28 13:47 | 612K | |
| php85-pear-PHP_Compa..> | 2025-12-29 19:14 | 43K | |
| php85-pear-PHP_Compa..> | 2025-12-28 18:18 | 136K | |
| php85-pear-PHP_Parse..> | 2025-12-28 12:27 | 87K | |
| php85-pear-PHP_Parse..> | 2025-12-30 09:28 | 140K | |
| php85-pear-PHP_Shell..> | 2025-12-27 19:46 | 84K | |
| php85-pear-PHP_Timer..> | 2025-12-27 17:48 | 2.5K | |
| php85-pear-PHP_Token..> | 2025-12-27 02:50 | 17K | |
| php85-pear-PHP_UML-1..> | 2025-12-27 23:08 | 404K | |
| php85-pear-Pager-2.5..> | 2025-12-26 22:24 | 32K | |
| php85-pear-Payment_D..> | 2025-12-30 16:27 | 39K | |
| php85-pear-PhpDocume..> | 2025-12-29 16:51 | 963K | |
| php85-pear-SOAP-0.14..> | 2025-12-30 14:45 | 74K | |
| php85-pear-Sebastian..> | 2025-12-27 11:16 | 2.0K | |
| php85-pear-Sebastian..> | 2025-12-27 04:16 | 2.0K | |
| php85-pear-Sebastian..> | 2025-12-29 18:23 | 7.0K | |
| php85-pear-Sebastian..> | 2025-12-28 09:30 | 11K | |
| php85-pear-Sebastian..> | 2025-12-27 18:45 | 1.5K | |
| php85-pear-Services_..> | 2025-12-30 15:00 | 15K | |
| php85-pear-Services_..> | 2025-12-28 12:43 | 28K | |
| php85-pear-Services_..> | 2025-12-30 08:28 | 16K | |
| php85-pear-Services_..> | 2025-12-30 06:11 | 3.7K | |
| php85-pear-Services_..> | 2025-12-29 03:26 | 10K | |
| php85-pear-Services_..> | 2025-12-27 22:50 | 22K | |
| php85-pear-Services_..> | 2025-12-30 10:20 | 75K | |
| php85-pear-Services_..> | 2025-12-30 08:22 | 39K | |
| php85-pear-Services_..> | 2025-12-28 12:05 | 4.1K | |
| php85-pear-Services_..> | 2025-12-28 13:12 | 9.9K | |
| php85-pear-Services_..> | 2025-12-30 04:40 | 5.2K | |
| php85-pear-Services_..> | 2025-12-30 04:54 | 9.1K | |
| php85-pear-Services_..> | 2025-12-30 15:54 | 11K | |
| php85-pear-Services_..> | 2025-12-29 00:41 | 4.9K | |
| php85-pear-Services_..> | 2025-12-28 04:42 | 6.1K | |
| php85-pear-Services_..> | 2025-12-28 08:57 | 58K | |
| php85-pear-Services_..> | 2025-12-30 17:55 | 11K | |
| php85-pear-Services_..> | 2025-12-28 12:00 | 14K | |
| php85-pear-Services_..> | 2025-12-28 01:16 | 45K | |
| php85-pear-Services_..> | 2025-12-30 08:40 | 15K | |
| php85-pear-Services_..> | 2025-12-29 16:04 | 13K | |
| php85-pear-Services_..> | 2025-12-30 10:08 | 4.4K | |
| php85-pear-Spreadshe..> | 2025-12-27 18:46 | 49K | |
| php85-pear-Structure..> | 2025-12-26 22:53 | 43K | |
| php85-pear-Structure..> | 2025-12-27 04:25 | 4.2K | |
| php85-pear-Structure..> | 2025-12-28 21:57 | 4.9K | |
| php85-pear-Structure..> | 2025-12-28 12:25 | 3.3K | |
| php85-pear-Structure..> | 2025-12-29 11:01 | 4.9K | |
| php85-pear-Structure..> | 2025-12-29 00:36 | 4.7K | |
| php85-pear-Structure..> | 2025-12-30 16:47 | 3.8K | |
| php85-pear-Structure..> | 2025-12-29 19:53 | 9.6K | |
| php85-pear-Structure..> | 2025-12-29 12:16 | 4.9K | |
| php85-pear-Structure..> | 2025-12-29 18:21 | 6.9K | |
| php85-pear-Structure..> | 2025-12-27 15:50 | 5.1K | |
| php85-pear-Structure..> | 2025-12-29 19:32 | 5.6K | |
| php85-pear-Structure..> | 2025-12-30 15:16 | 4.6K | |
| php85-pear-Structure..> | 2025-12-29 01:01 | 4.5K | |
| php85-pear-Structure..> | 2025-12-28 05:28 | 13K | |
| php85-pear-Symfony_C..> | 2025-12-27 10:24 | 78K | |
| php85-pear-Symfony_C..> | 2025-12-26 22:57 | 34K | |
| php85-pear-Symfony_C..> | 2025-12-29 19:36 | 38K | |
| php85-pear-System_Co..> | 2025-12-28 22:32 | 7.2K | |
| php85-pear-Testing_S..> | 2025-12-30 01:20 | 2.3M | |
| php85-pear-Text_Diff..> | 2025-12-29 22:45 | 21K | |
| php85-pear-Text_Figl..> | 2025-12-29 22:45 | 8.7K | |
| php85-pear-Text_High..> | 2025-12-30 11:35 | 82K | |
| php85-pear-Text_Pass..> | 2025-12-29 13:18 | 6.2K | |
| php85-pear-Text_Spel..> | 2025-12-28 10:58 | 125K | |
| php85-pear-Text_Temp..> | 2025-12-27 16:28 | 1.9K | |
| php85-pear-Text_Wiki..> | 2025-12-29 19:08 | 77K | |
| php85-pear-TheSeer_D..> | 2025-12-29 01:22 | 3.0K | |
| php85-pear-TheSeer_f..> | 2025-12-26 20:44 | 5.1K | |
| php85-pear-TheSeer_f..> | 2025-12-30 09:04 | 6.7K | |
| php85-pear-Translati..> | 2025-12-29 03:47 | 47K | |
| php85-pear-UDDI-0.2...> | 2025-12-29 22:23 | 7.6K | |
| php85-pear-URI_Templ..> | 2025-12-28 03:09 | 7.4K | |
| php85-pear-VFS-0.3.0..> | 2025-12-29 03:07 | 36K | |
| php85-pear-Validate-..> | 2025-12-27 16:10 | 21K | |
| php85-pear-Validate_..> | 2025-12-27 21:48 | 11K | |
| php85-pear-Validate_..> | 2025-12-29 15:15 | 11K | |
| php85-pear-Validate_..> | 2025-12-28 04:36 | 7.2K | |
| php85-pear-Validate_..> | 2025-12-30 06:37 | 6.5K | |
| php85-pear-Validate_..> | 2025-12-30 16:34 | 9.6K | |
| php85-pear-Var_Dump-..> | 2025-12-28 06:10 | 18K | |
| php85-pear-VersionCo..> | 2025-12-30 02:21 | 15K | |
| php85-pear-VersionCo..> | 2025-12-30 08:31 | 28K | |
| php85-pear-XML_Beaut..> | 2025-12-29 14:04 | 14K | |
| php85-pear-XML_DTD-0..> | 2025-12-27 06:06 | 33K | |
| php85-pear-XML_Feed_..> | 2025-12-29 10:38 | 268K | |
| php85-pear-XML_GRDDL..> | 2025-12-28 19:15 | 44K | |
| php85-pear-XML_HTMLS..> | 2025-12-30 07:58 | 16K | |
| php85-pear-XML_NITF-..> | 2025-12-29 22:24 | 8.2K | |
| php85-pear-XML_Parse..> | 2025-12-26 20:02 | 14K | |
| php85-pear-XML_Query..> | 2025-12-27 22:43 | 298K | |
| php85-pear-XML_RPC-1..> | 2025-12-27 03:47 | 24K | |
| php85-pear-XML_RPC2-..> | 2025-12-30 16:19 | 58K | |
| php85-pear-XML_RSS-1..> | 2025-12-27 15:38 | 8.7K | |
| php85-pear-XML_SVG-1..> | 2025-12-29 20:46 | 9.2K | |
| php85-pear-XML_Seria..> | 2025-12-27 01:02 | 31K | |
| php85-pear-XML_Trans..> | 2025-12-28 09:47 | 27K | |
| php85-pear-XML_Tree-..> | 2025-12-28 10:09 | 5.4K | |
| php85-pear-XML_Util-..> | 2025-12-26 17:48 | 18K | |
| php85-pear-XML_Wddx-..> | 2025-12-28 05:28 | 6.9K | |
| php85-pear-YAML-1.0...> | 2025-12-28 06:35 | 10K | |
| php85-pear-channel-e..> | 2025-12-26 18:46 | 1.2K | |
| php85-pear-channel-g..> | 2025-12-27 16:11 | 1.1K | |
| php85-pear-channel-h..> | 2025-12-26 06:54 | 1.1K | |
| php85-pear-channel-o..> | 2025-12-28 21:40 | 1.1K | |
| php85-pear-channel-p..> | 2025-12-27 16:53 | 1.1K | |
| php85-pear-channel-p..> | 2025-12-27 17:59 | 1.1K | |
| php85-pear-channel-p..> | 2025-12-29 04:01 | 1.2K | |
| php85-pear-channel-p..> | 2025-12-29 04:39 | 1.1K | |
| php85-pear-channel-p..> | 2025-12-27 02:18 | 1.2K | |
| php85-pear-channel-s..> | 2025-12-27 12:27 | 1.2K | |
| php85-pear-channel-s..> | 2025-12-26 19:26 | 1.2K | |
| php85-pear-channel-t..> | 2025-12-26 17:48 | 1.1K | |
| php85-pear-channel-t..> | 2025-12-27 17:03 | 1.2K | |
| php85-pear-codegen-1..> | 2025-12-29 08:22 | 43K | |
| php85-pear-ezc_Base-..> | 2025-12-27 01:02 | 212K | |
| php85-pear-ezc_Conso..> | 2025-12-27 10:01 | 746K | |
| php85-pear-geshi-ges..> | 2025-12-28 08:11 | 666K | |
| php85-pear-horde-Hor..> | 2025-12-26 20:04 | 317K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:42 | 39K | |
| php85-pear-horde-Hor..> | 2025-12-27 21:20 | 61K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:13 | 54K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:08 | 16K | |
| php85-pear-horde-Hor..> | 2025-12-30 12:25 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:30 | 38K | |
| php85-pear-horde-Hor..> | 2025-12-26 17:57 | 27K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:37 | 31K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:40 | 2.1M | |
| php85-pear-horde-Hor..> | 2025-12-26 15:37 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-26 13:51 | 6.7K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:03 | 12K | |
| php85-pear-horde-Hor..> | 2025-12-26 22:21 | 1.2M | |
| php85-pear-horde-Hor..> | 2025-12-26 19:57 | 12K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:01 | 73K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:56 | 45K | |
| php85-pear-horde-Hor..> | 2025-12-26 11:02 | 67K | |
| php85-pear-horde-Hor..> | 2025-12-30 06:35 | 30K | |
| php85-pear-horde-Hor..> | 2025-12-27 10:19 | 192K | |
| php85-pear-horde-Hor..> | 2025-12-26 14:16 | 73K | |
| php85-pear-horde-Hor..> | 2025-12-28 05:18 | 570K | |
| php85-pear-horde-Hor..> | 2025-12-26 09:52 | 26K | |
| php85-pear-horde-Hor..> | 2025-12-28 07:24 | 1.2M | |
| php85-pear-horde-Hor..> | 2025-12-27 22:19 | 148K | |
| php85-pear-horde-Hor..> | 2025-12-26 14:46 | 23K | |
| php85-pear-horde-Hor..> | 2025-12-26 14:48 | 17K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:26 | 26K | |
| php85-pear-horde-Hor..> | 2025-12-26 21:28 | 16K | |
| php85-pear-horde-Hor..> | 2025-12-26 17:47 | 99K | |
| php85-pear-horde-Hor..> | 2025-12-26 10:04 | 11K | |
| php85-pear-horde-Hor..> | 2025-12-29 06:53 | 34K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:58 | 22K | |
| php85-pear-horde-Hor..> | 2025-12-28 04:36 | 36K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:09 | 16K | |
| php85-pear-horde-Hor..> | 2025-12-27 08:29 | 54K | |
| php85-pear-horde-Hor..> | 2025-12-28 09:45 | 22K | |
| php85-pear-horde-Hor..> | 2025-12-29 04:37 | 141K | |
| php85-pear-horde-Hor..> | 2025-12-26 23:48 | 58K | |
| php85-pear-horde-Hor..> | 2025-12-27 22:44 | 18K | |
| php85-pear-horde-Hor..> | 2025-12-26 20:09 | 18K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:33 | 31K | |
| php85-pear-horde-Hor..> | 2025-12-26 11:26 | 36K | |
| php85-pear-horde-Hor..> | 2025-12-29 00:03 | 18K | |
| php85-pear-horde-Hor..> | 2025-12-30 17:28 | 15K | |
| php85-pear-horde-Hor..> | 2025-12-26 13:21 | 125K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:59 | 269K | |
| php85-pear-horde-Hor..> | 2025-12-29 00:50 | 85K | |
| php85-pear-horde-Hor..> | 2025-12-26 10:54 | 225K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:59 | 21K | |
| php85-pear-horde-Hor..> | 2025-12-27 07:58 | 7.2K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:33 | 17K | |
| php85-pear-horde-Hor..> | 2025-12-30 02:10 | 47K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:39 | 38K | |
| php85-pear-horde-Hor..> | 2025-12-26 20:22 | 53K | |
| php85-pear-horde-Hor..> | 2025-12-30 07:00 | 13K | |
| php85-pear-horde-Hor..> | 2025-12-29 10:54 | 34K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:50 | 11K | |
| php85-pear-horde-Hor..> | 2025-12-26 20:10 | 40K | |
| php85-pear-horde-Hor..> | 2025-12-29 22:43 | 39K | |
| php85-pear-horde-Hor..> | 2025-12-28 01:14 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-30 14:15 | 6.0K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:09 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-26 17:49 | 16K | |
| php85-pear-horde-Hor..> | 2025-12-29 17:02 | 32K | |
| php85-pear-horde-Hor..> | 2025-12-29 05:54 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-28 15:08 | 11K | |
| php85-pear-horde-Hor..> | 2025-12-28 21:10 | 3.0K | |
| php85-pear-horde-Hor..> | 2025-12-28 14:49 | 192K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:19 | 25K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:02 | 56K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:10 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-29 12:15 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:39 | 18K | |
| php85-pear-horde-Hor..> | 2025-12-26 09:54 | 14K | |
| php85-pear-horde-Hor..> | 2025-12-26 10:15 | 6.8K | |
| php85-pear-horde-Hor..> | 2025-12-26 11:32 | 25K | |
| php85-pear-horde-Hor..> | 2025-12-27 10:41 | 115K | |
| php85-pear-horde-Hor..> | 2025-12-26 20:16 | 15K | |
| php85-pear-horde-Hor..> | 2025-12-30 12:29 | 29K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:53 | 53K | |
| php85-pear-horde-Hor..> | 2025-12-30 10:41 | 24K | |
| php85-pear-horde-Hor..> | 2025-12-26 10:55 | 15K | |
| php85-pear-horde-Hor..> | 2025-12-27 11:38 | 21K | |
| php85-pear-horde-Hor..> | 2025-12-30 11:04 | 28K | |
| php85-pear-horde-Hor..> | 2025-12-26 18:30 | 32K | |
| php85-pear-horde-Hor..> | 2025-12-26 09:05 | 16K | |
| php85-pear-horde-Hor..> | 2025-12-29 22:22 | 19K | |
| php85-pear-horde-Hor..> | 2025-12-26 15:29 | 17K | |
| php85-pear-horde-Hor..> | 2025-12-26 09:20 | 35K | |
| php85-pear-horde-Hor..> | 2025-12-26 19:29 | 42K | |
| php85-pear-horde-Hor..> | 2025-12-27 12:32 | 12K | |
| php85-pear-horde-Hor..> | 2025-12-27 01:14 | 26K | |
| php85-pear-pdepend_s..> | 2025-12-28 12:22 | 33K | |
| php85-pear-phing-2.6..> | 2025-12-28 10:48 | 361K | |
| php85-pear-pirum-Pir..> | 2025-12-29 15:15 | 15K | |
| php85-pear-twig-twig..> | 2025-12-30 15:16 | 94K | |
| php85-pecl-APCu-5.1...> | 2025-12-26 21:07 | 54K | |
| php85-pecl-ast-1.1.3..> | 2025-12-29 10:39 | 21K | |
| php85-pecl-bitset-3...> | 2025-12-26 16:11 | 11K | |
| php85-pecl-couchbase..> | 2025-12-29 20:32 | 29K | |
| php85-pecl-crypto-0...> | 2025-12-28 10:44 | 32K | |
| php85-pecl-dio-0.3.0..> | 2025-12-28 20:12 | 12K | |
| php85-pecl-ds-1.6.0.pkg | 2025-12-28 01:05 | 58K | |
| php85-pecl-eio-3.0.0..> | 2025-12-28 16:28 | 29K | |
| php85-pecl-ev-1.2.2.pkg | 2025-12-30 17:39 | 46K | |
| php85-pecl-event-3.1..> | 2025-12-28 12:37 | 46K | |
| php85-pecl-excimer-1..> | 2025-12-28 13:13 | 24K | |
| php85-pecl-expect-0...> | 2025-12-28 14:58 | 7.8K | |
| php85-pecl-geospatia..> | 2025-12-29 01:18 | 17K | |
| php85-pecl-gnupg-1.5..> | 2025-12-27 16:49 | 18K | |
| php85-pecl-horde_lz4..> | 2025-12-30 09:36 | 4.6K | |
| php85-pecl-http-4.3...> | 2025-12-30 10:05 | 143K | |
| php85-pecl-igbinary-..> | 2025-12-29 00:49 | 27K | |
| php85-pecl-imagick-3..> | 2025-12-27 11:25 | 126K | |
| php85-pecl-imap-1.0...> | 2025-12-26 22:09 | 37K | |
| php85-pecl-inotify-3..> | 2025-12-29 22:10 | 7.0K | |
| php85-pecl-json_post..> | 2025-12-27 21:15 | 5.4K | |
| php85-pecl-krb5-1.2...> | 2025-12-30 12:29 | 26K | |
| php85-pecl-leveldb-0..> | 2025-12-29 18:56 | 14K | |
| php85-pecl-libsodium..> | 2025-12-29 07:18 | 24K | |
| php85-pecl-lzf-1.7.0..> | 2025-12-29 13:48 | 8.3K | |
| php85-pecl-mailparse..> | 2025-12-30 08:23 | 27K | |
| php85-pecl-mcrypt-1...> | 2025-12-26 15:38 | 15K | |
| php85-pecl-memcache-..> | 2025-12-26 15:29 | 44K | |
| php85-pecl-memcached..> | 2025-12-26 15:25 | 52K | |
| php85-pecl-mongodb-1..> | 2025-12-28 18:19 | 818K | |
| php85-pecl-msgpack-3..> | 2025-12-27 06:02 | 27K | |
| php85-pecl-mustache-..> | 2025-12-29 03:11 | 27K | |
| php85-pecl-oauth-2.0..> | 2025-12-30 11:54 | 37K | |
| php85-pecl-opentelem..> | 2025-12-30 03:57 | 13K | |
| php85-pecl-pam-2.2.5..> | 2025-12-29 21:54 | 8.8K | |
| php85-pecl-pcov-1.0...> | 2025-12-29 07:30 | 10K | |
| php85-pecl-pkcs11-1...> | 2025-12-27 22:18 | 47K | |
| php85-pecl-proctitle..> | 2025-12-30 14:05 | 4.1K | |
| php85-pecl-protobuf-..> | 2025-12-28 00:29 | 233K | |
| php85-pecl-pspell-1...> | 2025-12-28 02:14 | 9.6K | |
| php85-pecl-psr-1.2.0..> | 2025-12-29 07:16 | 16K | |
| php85-pecl-qrencode-..> | 2025-12-29 13:36 | 7.2K | |
| php85-pecl-radius-1...> | 2025-12-27 16:11 | 32K | |
| php85-pecl-raphf-2.0..> | 2025-12-27 15:34 | 11K | |
| php85-pecl-rar-4.2.0..> | 2025-12-30 13:28 | 154K | |
| php85-pecl-rdkafka-6..> | 2025-12-28 06:58 | 43K | |
| php85-pecl-redis-6.3..> | 2025-12-27 10:25 | 239K | |
| php85-pecl-rrd-2.0.3..> | 2025-12-28 05:57 | 14K | |
| php85-pecl-scrypt-2...> | 2025-12-29 07:34 | 18K | |
| php85-pecl-smbclient..> | 2025-12-27 10:56 | 24K | |
| php85-pecl-solr-2.8...> | 2025-12-29 20:11 | 80K | |
| php85-pecl-ssh2-1.3...> | 2025-12-27 15:33 | 27K | |
| php85-pecl-stomp-2.0..> | 2025-12-29 19:12 | 19K | |
| php85-pecl-sync-1.1...> | 2025-12-29 11:33 | 14K | |
| php85-pecl-timezoned..> | 2025-12-28 02:49 | 243K | |
| php85-pecl-uploadpro..> | 2025-12-29 01:27 | 7.8K | |
| php85-pecl-uuid-1.3...> | 2025-12-27 13:41 | 8.3K | |
| php85-pecl-uv-0.3.0.pkg | 2025-12-28 02:49 | 49K | |
| php85-pecl-vips-1.0...> | 2025-12-29 02:39 | 17K | |
| php85-pecl-vld-0.19...> | 2025-12-29 05:22 | 18K | |
| php85-pecl-xdiff-2.1..> | 2025-12-29 19:17 | 9.5K | |
| php85-pecl-xlswriter..> | 2025-12-29 13:05 | 167K | |
| php85-pecl-xmlrpc-1...> | 2025-12-27 11:15 | 40K | |
| php85-pecl-xxtea-1.0..> | 2025-12-27 16:12 | 5.8K | |
| php85-pecl-yac-2.3.1..> | 2025-12-29 22:44 | 23K | |
| php85-pecl-yaconf-1...> | 2025-12-29 16:32 | 12K | |
| php85-pecl-yaf-3.3.7..> | 2025-12-30 00:00 | 96K | |
| php85-pecl-yaml-2.3...> | 2025-12-30 14:49 | 21K | |
| php85-pecl-yar-2.3.4..> | 2025-12-29 22:08 | 33K | |
| php85-pecl-zephir_pa..> | 2025-12-27 04:50 | 53K | |
| php85-pecl-zookeeper..> | 2025-12-30 15:12 | 25K | |
| php85-pecl-zstd-0.15..> | 2025-12-28 06:42 | 16K | |
| php85-pgsql-8.5.1.pkg | 2025-12-26 16:26 | 61K | |
| php85-phalcon-5.9.3.pkg | 2025-12-30 03:14 | 1.9M | |
| php85-phar-8.5.1.pkg | 2025-12-27 00:48 | 114K | |
| php85-posix-8.5.1.pkg | 2025-12-26 16:40 | 16K | |
| php85-readline-8.5.1..> | 2025-12-27 09:43 | 14K | |
| php85-session-8.5.1.pkg | 2025-12-26 13:40 | 42K | |
| php85-shmop-8.5.1.pkg | 2025-12-28 06:26 | 7.8K | |
| php85-simplexml-8.5...> | 2025-12-26 17:35 | 24K | |
| php85-snappy-0.2.3.pkg | 2025-12-28 06:16 | 4.4K | |
| php85-snmp-8.5.1.pkg | 2025-12-27 09:19 | 24K | |
| php85-soap-8.5.1.pkg | 2025-12-26 17:01 | 130K | |
| php85-sockets-8.5.1.pkg | 2025-12-26 16:05 | 49K | |
| php85-sodium-8.5.1.pkg | 2025-12-27 01:26 | 33K | |
| php85-sqlite3-8.5.1.pkg | 2025-12-26 15:30 | 28K | |
| php85-sysvmsg-8.5.1.pkg | 2025-12-27 16:10 | 9.3K | |
| php85-sysvsem-8.5.1.pkg | 2025-12-26 23:01 | 6.9K | |
| php85-sysvshm-8.5.1.pkg | 2025-12-28 09:00 | 8.2K | |
| php85-tarantool-0.4...> | 2025-12-29 09:02 | 51K | |
| php85-tidy-8.5.1.pkg | 2025-12-27 15:15 | 24K | |
| php85-tokenizer-8.5...> | 2025-12-27 02:03 | 14K | |
| php85-xapian-1.4.30.pkg | 2025-12-28 10:50 | 297K | |
| php85-xml-8.5.1.pkg | 2025-12-26 06:20 | 26K | |
| php85-xmlreader-8.5...> | 2025-12-26 22:50 | 18K | |
| php85-xmlwriter-8.5...> | 2025-12-26 22:24 | 16K | |
| php85-xsl-8.5.1.pkg | 2025-12-26 22:38 | 17K | |
| php85-zephir-0.17.0.pkg | 2025-12-28 21:09 | 1.4M | |
| php85-zip-8.5.1.pkg | 2025-12-26 21:59 | 36K | |
| php85-zlib-8.5.1.pkg | 2025-12-26 06:24 | 21K | |
| php85-zstd-0.15.2_1.pkg | 2025-12-30 16:52 | 16K | |
| phpLiteAdmin-1.9.8.2..> | 2025-12-28 01:14 | 49K | |
| phpMyAdmin-php81-4.9..> | 2025-12-29 22:44 | 6.3M | |
| phpMyAdmin-php82-4.9..> | 2025-12-30 05:51 | 6.3M | |
| phpMyAdmin-php83-4.9..> | 2025-12-27 21:03 | 6.3M | |
| phpMyAdmin-php84-4.9..> | 2025-12-27 21:06 | 6.3M | |
| phpMyAdmin-php85-4.9..> | 2025-12-29 15:48 | 6.3M | |
| phpMyAdmin5-php81-5...> | 2025-12-29 18:03 | 8.0M | |
| phpMyAdmin5-php82-5...> | 2025-12-30 07:19 | 8.0M | |
| phpMyAdmin5-php83-5...> | 2025-12-29 19:27 | 8.0M | |
| phpMyAdmin5-php84-5...> | 2025-12-30 11:17 | 8.0M | |
| phpMyAdmin5-php85-5...> | 2025-12-30 11:04 | 8.0M | |
| phpbb3-3.3.14.pkg | 2025-12-29 07:38 | 3.6M | |
| phpeclipse-1.2.3_8.pkg | 2025-12-29 21:45 | 13M | |
| phpfpm_exporter-0.6...> | 2025-12-20 10:39 | 3.1M | |
| phpfpmtop-0.2_21.pkg | 2025-12-21 01:00 | 2.1M | |
| phpgroupware-0.9.16...> | 2025-12-30 04:02 | 14M | |
| phpicalendar-RC7-2.4..> | 2025-12-28 14:27 | 229K | |
| phpipam-1.6.0.pkg | 2025-12-30 04:07 | 12M | |
| phpldapadmin-php81-1..> | 2025-12-30 11:17 | 871K | |
| phpldapadmin-php82-1..> | 2025-12-28 00:24 | 871K | |
| phpldapadmin-php83-1..> | 2025-12-30 10:14 | 871K | |
| phpldapadmin-php84-1..> | 2025-12-30 06:14 | 871K | |
| phpldapadmin-php85-1..> | 2025-12-27 23:08 | 871K | |
| phplist-php82-3.6.16..> | 2025-12-29 23:13 | 13M | |
| phplist-php83-3.6.16..> | 2025-12-30 17:08 | 13M | |
| phplist-php84-3.6.16..> | 2025-12-28 04:01 | 13M | |
| phplist-php85-3.6.16..> | 2025-12-29 21:23 | 13M | |
| phplot-6.2.0_2.pkg | 2025-12-29 16:00 | 897K | |
| phpmailer-5.2.28.pkg | 2025-12-29 05:23 | 115K | |
| phpmailer6-6.12.0.pkg | 2025-12-29 01:18 | 78K | |
| phpmailer7-7.0.0.pkg | 2025-12-30 16:01 | 79K | |
| phpminiadmin-php81-1..> | 2025-12-29 03:47 | 14K | |
| phpminiadmin-php82-1..> | 2025-12-28 21:34 | 14K | |
| phpminiadmin-php83-1..> | 2025-12-29 05:54 | 14K | |
| phpminiadmin-php84-1..> | 2025-12-30 17:40 | 14K | |
| phpminiadmin-php85-1..> | 2025-12-29 05:39 | 14K | |
| phpmyfaq-php82-4.0.1..> | 2025-12-28 06:29 | 11M | |
| phpmyfaq-php83-4.0.1..> | 2025-12-27 21:06 | 11M | |
| phpmyfaq-php84-4.0.1..> | 2025-12-30 02:45 | 11M | |
| phpmyfaq-php85-4.0.1..> | 2025-12-30 16:39 | 11M | |
| phppgadmin-php81-7.1..> | 2025-12-29 15:06 | 829K | |
| phppgadmin-php82-7.1..> | 2025-12-27 21:55 | 829K | |
| phppgadmin-php83-7.1..> | 2025-12-29 09:20 | 829K | |
| phppgadmin-php84-7.1..> | 2025-12-30 08:46 | 829K | |
| phppgadmin-php85-7.1..> | 2025-12-28 16:53 | 829K | |
| phprecipebook-3.01_5..> | 2025-12-28 23:32 | 642K | |
| phpsysinfo-php84-3.4..> | 2025-12-30 06:28 | 946K | |
| phpunit8-php81-8.5.4..> | 2025-12-28 18:17 | 409K | |
| phpunit8-php82-8.5.4..> | 2025-12-29 18:44 | 409K | |
| phpunit8-php83-8.5.4..> | 2025-12-29 11:49 | 409K | |
| phpunit8-php84-8.5.4..> | 2025-12-30 08:59 | 409K | |
| phpunit8-php85-8.5.4..> | 2025-12-29 20:26 | 409K | |
| phpunit9-php81-9.6.3..> | 2025-12-28 17:32 | 557K | |
| phpunit9-php82-9.6.3..> | 2025-12-27 13:00 | 557K | |
| phpunit9-php83-9.6.3..> | 2025-12-27 18:55 | 557K | |
| phpunit9-php84-9.6.3..> | 2025-12-27 14:18 | 557K | |
| phpunit9-php85-9.6.3..> | 2025-12-27 10:49 | 557K | |
| phpunit10-php81-10.5..> | 2025-12-28 10:29 | 506K | |
| phpunit10-php82-10.5..> | 2025-12-28 12:32 | 506K | |
| phpunit10-php83-10.5..> | 2025-12-28 10:25 | 506K | |
| phpunit10-php84-10.5..> | 2025-12-29 21:27 | 506K | |
| phpunit10-php85-10.5..> | 2025-12-30 00:27 | 505K | |
| phpunit11-php82-11.5..> | 2025-12-27 21:15 | 538K | |
| phpunit11-php83-11.5..> | 2025-12-30 08:34 | 538K | |
| phpunit11-php84-11.5..> | 2025-12-29 16:27 | 538K | |
| phpunit11-php85-11.5..> | 2025-12-27 21:28 | 538K | |
| phpunit12-php83-12.5..> | 2025-12-29 05:54 | 630K | |
| phpunit12-php84-12.5..> | 2025-12-27 21:40 | 630K | |
| phpunit12-php85-12.5..> | 2025-12-27 21:39 | 630K | |
| phpvirtualbox-70-php..> | 2025-12-30 05:51 | 2.8M | |
| phpvirtualbox-70-php..> | 2025-12-28 13:47 | 2.8M | |
| phpvirtualbox-70-php..> | 2025-12-30 05:51 | 2.8M | |
| phpvirtualbox-70-php..> | 2025-12-28 10:59 | 2.8M | |
| phpvirtualbox-70-php..> | 2025-12-29 11:10 | 2.8M | |
| phpvirtualbox-71-php..> | 2025-12-28 02:40 | 3.3M | |
| phpvirtualbox-71-php..> | 2025-12-28 10:37 | 3.3M | |
| phpvirtualbox-71-php..> | 2025-12-29 17:15 | 3.3M | |
| phpvirtualbox-71-php..> | 2025-12-30 00:51 | 3.3M | |
| phpvirtualbox-71-php..> | 2025-12-30 15:43 | 3.3M | |
| phpvirtualbox-72-php..> | 2025-12-29 00:13 | 3.2M | |
| phpvirtualbox-72-php..> | 2025-12-29 08:52 | 3.2M | |
| phpvirtualbox-72-php..> | 2025-12-29 07:33 | 3.2M | |
| phpvirtualbox-72-php..> | 2025-12-27 19:44 | 3.2M | |
| phpvirtualbox-72-php..> | 2025-12-28 09:59 | 3.2M | |
| phpvirtualbox-legacy..> | 2025-12-28 21:28 | 2.7M | |
| phpvirtualbox-legacy..> | 2025-12-29 18:28 | 2.7M | |
| phpvirtualbox-legacy..> | 2025-12-29 19:52 | 2.7M | |
| phpvirtualbox-legacy..> | 2025-12-28 09:29 | 2.7M | |
| phpvirtualbox-legacy..> | 2025-12-27 21:53 | 2.7M | |
| phpvirtualbox-php81-..> | 2025-12-30 14:29 | 2.8M | |
| phpvirtualbox-php82-..> | 2025-12-30 06:47 | 2.8M | |
| phpvirtualbox-php83-..> | 2025-12-30 13:29 | 2.8M | |
| phpvirtualbox-php84-..> | 2025-12-28 06:17 | 2.8M | |
| phpvirtualbox-php85-..> | 2025-12-29 15:16 | 2.8M | |
| phpwebftp-3.3b.pkg | 2025-12-30 07:18 | 71K | |
| phybs-20140717_1.pkg | 2025-08-18 01:18 | 6.5K | |
| phyml-3.3.20220408_1..> | 2025-08-22 04:57 | 898K | |
| physcalc-2.4_1.pkg | 2025-08-16 20:48 | 30K | |
| physfs-3.2.0.pkg | 2025-12-18 16:26 | 149K | |
| pianobar-2024.12.21_..> | 2025-12-30 09:07 | 39K | |
| pianobooster-1.0.0_7..> | 2025-12-29 22:12 | 1.1M | |
| pianod2-329_7.pkg | 2025-12-29 00:03 | 432K | |
| pic2fig-1.4_3.pkg | 2025-08-19 17:18 | 37K | |
| picard-2.13.3.pkg | 2025-12-29 18:53 | 2.7M | |
| picard-plugins-2.0.2..> | 2025-12-19 16:55 | 795K | |
| picard-tools-2.22.9.pkg | 2025-12-27 11:45 | 15M | |
| pick-4.0.0_1.pkg | 2025-08-18 16:01 | 12K | |
| pickle-5.01.pkg | 2025-12-23 03:04 | 45K | |
| picmi-25.12.0.pkg | 2025-12-26 23:51 | 1.3M | |
| pico-alpine-2.26_3.pkg | 2025-12-22 10:48 | 375K | |
| picoc-2.1_2.pkg | 2025-12-23 04:18 | 46K | |
| picocom-3.1_1.pkg | 2025-08-21 12:24 | 34K | |
| picocrypt-1.49_6.pkg | 2025-12-29 00:44 | 2.6M | |
| picojson-1.3.1.20210..> | 2025-08-19 19:55 | 11K | |
| picolisp-25.9.pkg | 2025-12-22 11:14 | 465K | |
| picom-12.5_1.pkg | 2025-12-21 20:29 | 253K | |
| picosat-965.pkg | 2025-08-15 10:04 | 117K | |
| picosha2-1.0.0.23.pkg | 2025-08-17 05:52 | 4.2K | |
| picpas-gtk2-0.9.0_20..> | 2025-12-28 20:14 | 2.0M | |
| picpas-qt5-0.9.0_20.pkg | 2025-12-28 12:51 | 2.0M | |
| picpas-qt6-0.9.0_20.pkg | 2025-12-30 05:35 | 2.0M | |
| picprog-1.9.1_1.pkg | 2025-08-21 17:16 | 66K | |
| picpuz-2.1.1_8.pkg | 2025-12-29 04:40 | 205K | |
| pict-3.7.4.pkg | 2025-08-20 00:27 | 147K | |
| pidgin-2.14.14_1.pkg | 2025-12-27 06:06 | 1.1M | |
| pidgin-bot-sentry-1...> | 2025-12-29 14:12 | 13K | |
| pidgin-encryption-3...> | 2025-12-27 22:54 | 92K | |
| pidgin-fetion-0.98.5..> | 2025-12-30 12:29 | 32K | |
| pidgin-hotkeys-0.2.4..> | 2025-12-30 13:46 | 41K | |
| pidgin-latex-1.0_15.pkg | 2025-12-29 05:23 | 7.0K | |
| pidgin-libnotify-0.1..> | 2025-12-30 08:46 | 26K | |
| pidgin-manualsize-0...> | 2025-12-28 11:15 | 4.8K | |
| pidgin-otr-4.0.2_3.pkg | 2025-12-30 15:10 | 109K | |
| pidgin-sipe-1.24.0_7..> | 2025-12-28 10:03 | 331K | |
| pidgin-skypeweb-1.7_..> | 2025-12-29 16:33 | 77K | |
| pidgin-twitter-0.9.2..> | 2025-12-30 04:55 | 35K | |
| pidgin-window_merge-..> | 2025-12-30 11:00 | 8.6K | |
| pidof-20050501.pkg | 2025-08-14 05:08 | 2.8K | |
| pies-1.8.pkg | 2025-12-20 07:20 | 347K | |
| piewm-1.04_5.pkg | 2025-12-23 17:17 | 120K | |
| piglit-20200910_2.pkg | 2025-12-27 21:36 | 38M | |
| pigz-2.8.pkg | 2025-08-13 19:10 | 73K | |
| pijul-1.0.0.b9_16.pkg | 2025-12-29 07:26 | 4.0M | |
| pika-0.34.0_2.pkg | 2025-12-30 17:24 | 883K | |
| pikchr-0.0.s20250512..> | 2025-08-17 09:55 | 45K | |
| pikopixel-1.0.b10_3,..> | 2025-12-27 16:15 | 450K | |
| pim-data-exporter-25..> | 2025-12-27 00:36 | 505K | |
| pim-sieve-editor-25...> | 2025-12-26 18:54 | 563K | |
| pimcommon-25.12.0.pkg | 2025-12-26 08:49 | 484K | |
| pimd-2.3.2b_1.pkg | 2025-08-21 11:15 | 89K | |
| pimdd-0.2.1.0_2.pkg | 2025-08-19 00:31 | 40K | |
| pinball-0.3.20230219..> | 2025-12-28 01:27 | 4.5M | |
| pine-pgp-filters-1.8..> | 2025-12-23 00:59 | 12K | |
| pinentry-1.3.2_1.pkg | 2025-12-17 22:56 | 16K | |
| pinentry-curses-1.3...> | 2025-12-17 22:56 | 32K | |
| pinentry-efl-1.3.2.pkg | 2025-12-29 19:29 | 36K | |
| pinentry-fltk-1.3.2.pkg | 2025-12-28 06:34 | 40K | |
| pinentry-gnome-1.3.2..> | 2025-12-26 14:05 | 35K | |
| pinentry-gtk2-1.3.2.pkg | 2025-12-29 17:36 | 37K | |
| pinentry-qt5-1.3.2.pkg | 2025-12-26 10:00 | 67K | |
| pinentry-qt6-1.3.2.pkg | 2025-12-29 03:19 | 71K | |
| pinentry-tty-1.3.2.pkg | 2025-12-23 04:11 | 26K | |
| pinfo-0.6.13_2.pkg | 2025-12-24 03:37 | 75K | |
| ping_exporter-1.1.4_..> | 2025-12-23 10:07 | 3.5M | |
| pingus-0.7.6_24.pkg | 2025-12-30 00:59 | 12M | |
| pink-pony-1.4.1_50.pkg | 2025-12-30 09:51 | 10M | |
| pinot-1.23.pkg | 2025-12-29 01:23 | 1.2M | |
| pinpoint-0.1.4_8.pkg | 2025-12-28 03:05 | 24K | |
| pinta-1.7.1_4.pkg | 2025-12-29 23:45 | 861K | |
| pioneer-20250501_3.pkg | 2025-12-30 00:42 | 557M | |
| pioneers-15.6_6.pkg | 2025-12-29 01:24 | 3.2M | |
| pipe-2.5_2.pkg | 2025-12-29 22:10 | 1.7M | |
| pipe-viewer-0.5.6.pkg | 2025-12-28 11:35 | 104K | |
| pipebench-0.40_1.pkg | 2025-08-19 12:44 | 6.3K | |
| pipecolor-0.4.4_16.pkg | 2025-12-28 06:07 | 640K | |
| pipeform-0.2.1_6.pkg | 2025-12-20 08:43 | 1.9M | |
| pipeglade-4.7.0_6.pkg | 2025-12-29 17:07 | 46K | |
| pipelight-0.10.0_3.pkg | 2025-12-29 01:17 | 2.2M | |
| pipemeter-1.1.5.pkg | 2025-08-16 20:47 | 9.3K | |
| pipenightdreams-0.10..> | 2025-12-29 15:26 | 1.3M | |
| pipepanic-0.1.3_6.pkg | 2025-12-23 00:39 | 63K | |
| piper-2023.11.14_3.pkg | 2025-12-22 20:31 | 132K | |
| piper-phonemize-2023..> | 2025-12-19 22:04 | 9.3M | |
| pipestatus-0.7.0.pkg | 2025-08-14 19:45 | 2.3K | |
| pipewalker-1.0_1.pkg | 2025-12-28 04:01 | 734K | |
| pipewire-1.4.9.pkg | 2025-12-25 00:32 | 2.0M | |
| pipewire-module-xrdp..> | 2025-12-29 04:01 | 19K | |
| pipewire-spa-oss-g20..> | 2025-12-30 08:58 | 575K | |
| piranha-0.11_8.pkg | 2025-12-21 19:04 | 245K | |
| pire-0.0.6.pkg | 2025-08-21 12:41 | 278K | |
| pisg-0.73_1.pkg | 2025-12-21 20:19 | 125K | |
| pit-0.1.0.pkg | 2025-08-22 13:17 | 18K | |
| pithos-1.5.1_2.pkg | 2025-12-29 04:13 | 89K | |
| pitivi-2023.03_2.pkg | 2025-12-29 13:42 | 3.2M | |
| piwigo-php81-16.1.0.pkg | 2025-12-29 06:33 | 12M | |
| piwigo-php82-16.1.0.pkg | 2025-12-27 21:43 | 12M | |
| piwigo-php83-16.1.0.pkg | 2025-12-29 09:11 | 12M | |
| piwigo-php84-16.1.0.pkg | 2025-12-29 04:32 | 12M | |
| piwigo-php85-16.1.0.pkg | 2025-12-28 02:29 | 12M | |
| pixd-1.0.0_4.pkg | 2025-08-21 07:44 | 6.5K | |
| pixelize-1.0.0_5.pkg | 2025-12-29 14:25 | 24K | |
| pixie-2.2.6_44.pkg | 2025-12-30 01:47 | 4.4M | |
| pixiewps-1.4.1.pkg | 2025-08-17 10:36 | 37K | |
| pixman-0.46.2.pkg | 2025-08-10 21:24 | 269K | |
| pixz-1.0.7_1.pkg | 2025-12-20 20:59 | 18K | |
| pizauth-1.0.7_5.pkg | 2025-12-30 12:36 | 1.7M | |
| pjsip-2.14.1.pkg | 2025-12-27 22:15 | 1.9M | |
| pkcrack-1.2.3_1.pkg | 2025-08-17 04:49 | 106K | |
| pkcs11-dump-0.3.4_1.pkg | 2025-08-21 18:34 | 21K | |
| pkcs11-gateway-1.4.pkg | 2025-12-23 19:38 | 62K | |
| pkcs11-helper-1.31.0..> | 2025-12-18 23:33 | 103K | |
| pkcs11-tools-2.6.0.pkg | 2025-12-22 16:07 | 377K | |
| pkesh-1.0.pkg | 2025-08-15 00:58 | 2.9K | |
| pkfonts118-1.0.pkg | 2025-08-18 05:10 | 1.5M | |
| pkfonts240-1.0.pkg | 2025-08-21 20:47 | 3.0M | |
| pkfonts300-1.0.pkg | 2025-08-16 06:03 | 5.4M | |
| pkfonts360-1.0.pkg | 2025-08-20 19:56 | 4.4M | |
| pkfonts400-1.0.pkg | 2025-08-16 11:50 | 5.4M | |
| pkfonts600-1.0.pkg | 2025-08-21 04:02 | 5.8M | |
| pkg-2.5.1.pkg | 2025-12-24 20:05 | 6.0M | |
| pkg-appstream-1.0.4.pkg | 2025-08-21 17:57 | 3.0K | |
| pkg-devel-2.5.99.0.pkg | 2025-12-30 05:19 | 12M | |
| pkg-graph-g20180614_..> | 2025-12-29 10:06 | 182K | |
| pkg-info.el-0.6_19.pkg | 2025-12-27 03:05 | 3.7K | |
| pkg-info.el-emacs_ca..> | 2025-12-27 18:42 | 3.7K | |
| pkg-info.el-emacs_de..> | 2025-12-27 04:06 | 3.8K | |
| pkg-info.el-emacs_de..> | 2025-12-20 01:04 | 3.8K | |
| pkg-info.el-emacs_no..> | 2025-12-19 09:53 | 3.7K | |
| pkg-info.el-emacs_wa..> | 2025-12-27 03:04 | 3.7K | |
| pkg-provides-0.7.4.pkg | 2025-12-21 21:02 | 12K | |
| pkg-rmleaf-0.4.pkg | 2025-08-18 23:19 | 2.0K | |
| pkg_cleanup-2.1_1.pkg | 2025-08-16 03:55 | 6.3K | |
| pkg_cutleaves-201812..> | 2025-12-19 12:41 | 6.6K | |
| pkg_jail-2.15.pkg | 2025-08-18 14:35 | 20K | |
| pkg_replace-20240819..> | 2025-08-19 00:31 | 19K | |
| pkg_rmleaves-2023121..> | 2025-08-19 10:52 | 3.8K | |
| pkg_search-1.3_1.pkg | 2025-08-21 04:08 | 4.3K | |
| pkg_tree-1.1_6.pkg | 2025-12-20 01:56 | 4.2K | |
| pkgcompare-1.1_2.pkg | 2025-12-28 12:44 | 4.8K | |
| pkgconf-2.4.3,1.pkg | 2025-08-10 21:06 | 84K | |
| pkgs_which-0.4.1_2.pkg | 2025-12-23 06:36 | 9.1K | |
| pkl-0.26.0.pkg | 2025-12-29 17:02 | 12M | |
| pks-0.9.6.20040312_1..> | 2025-08-16 04:23 | 109K | |
| pkt-gen-g2025.10.08.pkg | 2025-12-23 12:44 | 65K | |
| pktanon-1.4.0_28.pkg | 2025-12-23 19:25 | 100K | |
| pktstat-1.8.5_2.pkg | 2025-08-19 20:30 | 25K | |
| pl-aspell-6.0.200611..> | 2025-12-22 06:13 | 1.9M | |
| pl-fortunepl-2009112..> | 2025-08-17 10:51 | 750K | |
| pl-freebsd-doc-20251..> | 2025-12-20 04:19 | 6.7M | |
| pl-hunspell-20251201..> | 2025-12-20 04:48 | 1.0M | |
| pl-hyphen-2007.04.16..> | 2025-08-22 16:58 | 11K | |
| pl-libgadu-1.12.2_2,..> | 2025-12-23 07:42 | 99K | |
| pl-libreoffice-25.8...> | 2025-12-27 17:15 | 3.5M | |
| pl-mythes-1.5_1.pkg | 2025-08-20 14:06 | 765K | |
| pl-napi-2.0.1_1.pkg | 2025-12-23 08:54 | 33K | |
| pl-qnapi-0.2.3_9.pkg | 2025-12-30 12:38 | 469K | |
| pl-trf-0.4.pkg | 2025-08-18 14:45 | 11K | |
| pl-webalizer-2.23.8_..> | 2025-12-30 12:12 | 136K | |
| plakar-1.0.6_1.pkg | 2025-12-20 12:22 | 15M | |
| plan-1.12_1.pkg | 2025-12-28 08:38 | 275K | |
| plan9port-20250218.pkg | 2025-12-28 11:43 | 36M | |
| planarity-4.0.1.0.pkg | 2025-12-22 09:14 | 142K | |
| plank-0.11.158.pkg | 2025-12-28 19:15 | 596K | |
| plans-8.2.1_3.pkg | 2025-12-22 03:19 | 684K | |
| plantri-5.5.pkg | 2025-08-22 14:41 | 128K | |
| plantuml-1.2025.10.pkg | 2025-12-27 05:32 | 23M | |
| plasma-g20180708_3.pkg | 2025-12-23 05:05 | 320K | |
| plasma-kmod-0.1.1403..> | 2025-08-21 18:34 | 4.2K | |
| plasma-pass-1.3.0_1.pkg | 2025-12-29 22:11 | 61K | |
| plasma-wayland-proto..> | 2025-12-17 23:47 | 35K | |
| plasma5-libksysguard..> | 2025-12-27 17:00 | 1.0M | |
| plasma6-aurorae-6.5...> | 2025-12-26 11:38 | 104K | |
| plasma6-breeze-6.5.4..> | 2025-12-26 11:36 | 39M | |
| plasma6-breeze-gtk-6..> | 2025-12-27 01:02 | 183K | |
| plasma6-breeze-qt5-6..> | 2025-12-26 20:41 | 163K | |
| plasma6-discover-6.5..> | 2025-12-26 23:30 | 1.2M | |
| plasma6-kactivityman..> | 2025-12-27 01:38 | 192K | |
| plasma6-kde-cli-tool..> | 2025-12-26 19:52 | 881K | |
| plasma6-kde-gtk-conf..> | 2025-12-27 01:11 | 78K | |
| plasma6-kdecoration-..> | 2025-12-26 10:02 | 89K | |
| plasma6-kdeplasma-ad..> | 2025-12-26 21:08 | 1.7M | |
| plasma6-kgamma-6.5.4..> | 2025-12-26 21:11 | 147K | |
| plasma6-kglobalaccel..> | 2025-12-26 11:15 | 98K | |
| plasma6-kinfocenter-..> | 2025-12-27 00:40 | 894K | |
| plasma6-kmenuedit-6...> | 2025-12-26 23:04 | 1.0M | |
| plasma6-knighttime-6..> | 2025-12-26 11:58 | 56K | |
| plasma6-kpipewire-6...> | 2025-12-26 11:51 | 128K | |
| plasma6-kscreen-6.5...> | 2025-12-27 01:06 | 1.8M | |
| plasma6-kscreenlocke..> | 2025-12-26 11:55 | 244K | |
| plasma6-ksshaskpass-..> | 2025-12-26 20:31 | 30K | |
| plasma6-ksystemstats..> | 2025-12-26 19:11 | 213K | |
| plasma6-kwallet-pam-..> | 2025-12-26 20:26 | 9.2K | |
| plasma6-kwayland-6.5..> | 2025-12-26 12:26 | 239K | |
| plasma6-kwin-6.5.4_2..> | 2025-12-26 12:53 | 9.9M | |
| plasma6-kwin-x11-6.5..> | 2025-12-26 14:44 | 7.4M | |
| plasma6-kwrited-6.5...> | 2025-12-26 22:08 | 16K | |
| plasma6-layer-shell-..> | 2025-12-26 10:50 | 37K | |
| plasma6-libkscreen-6..> | 2025-12-26 10:50 | 263K | |
| plasma6-libksysguard..> | 2025-12-26 17:04 | 586K | |
| plasma6-libplasma-6...> | 2025-12-26 06:30 | 2.5M | |
| plasma6-milou-6.5.4.pkg | 2025-12-26 21:47 | 79K | |
| plasma6-ocean-sound-..> | 2025-12-18 20:55 | 1.9M | |
| plasma6-oxygen-6.5.4..> | 2025-12-26 21:25 | 3.2M | |
| plasma6-oxygen-sound..> | 2025-12-18 11:40 | 1.8M | |
| plasma6-plasma-6.5.4..> | 2025-12-27 16:37 | 1.4K | |
| plasma6-plasma-activ..> | 2025-12-26 06:00 | 106K | |
| plasma6-plasma-activ..> | 2025-12-26 10:59 | 81K | |
| plasma6-plasma-brows..> | 2025-12-27 01:12 | 146K | |
| plasma6-plasma-deskt..> | 2025-12-26 23:06 | 17M | |
| plasma6-plasma-disks..> | 2025-12-26 21:53 | 141K | |
| plasma6-plasma-integ..> | 2025-12-26 22:06 | 114K | |
| plasma6-plasma-integ..> | 2025-12-26 21:40 | 135K | |
| plasma6-plasma-pa-6...> | 2025-12-27 01:06 | 412K | |
| plasma6-plasma-sdk-6..> | 2025-12-27 00:30 | 566K | |
| plasma6-plasma-syste..> | 2025-12-26 23:04 | 446K | |
| plasma6-plasma-works..> | 2025-12-26 17:26 | 21M | |
| plasma6-plasma-works..> | 2025-12-26 19:06 | 178M | |
| plasma6-plasma5suppo..> | 2025-12-26 17:07 | 1.0M | |
| plasma6-polkit-kde-a..> | 2025-12-26 22:36 | 66K | |
| plasma6-powerdevil-6..> | 2025-12-26 21:59 | 1.5M | |
| plasma6-print-manage..> | 2025-12-26 22:12 | 507K | |
| plasma6-qqc2-breeze-..> | 2025-12-27 00:32 | 448K | |
| plasma6-sddm-kcm-6.5..> | 2025-12-26 22:52 | 134K | |
| plasma6-spectacle-6...> | 2025-12-26 20:32 | 2.1M | |
| plasma6-systemsettin..> | 2025-12-26 19:51 | 353K | |
| plasma6-xdg-desktop-..> | 2025-12-26 18:47 | 529K | |
| plasmatube-25.12.0.pkg | 2025-12-28 21:47 | 529K | |
| plata-theme-0.9.9_6.pkg | 2025-12-30 09:50 | 598K | |
| playerctl-2.3.1_2.pkg | 2025-12-19 12:56 | 128K | |
| playgsf-0.7.1_5.pkg | 2025-12-22 09:19 | 86K | |
| playmidi-2.5_2.pkg | 2025-08-20 02:26 | 33K | |
| playonbsd-4.2.10_17.pkg | 2025-12-28 19:16 | 2.1M | |
| playumidi-0.8.3_1.pkg | 2025-12-22 12:54 | 13K | |
| plconfig-0.2.pkg | 2025-08-16 10:21 | 7.8K | |
| pldebugger-1.8,1.pkg | 2025-12-21 00:43 | 24K | |
| please-3.0_1.pkg | 2025-08-16 06:49 | 4.8K | |
| please.build-17.27.0..> | 2025-12-23 11:21 | 22M | |
| plex-ttf-6.4.0.pkg | 2025-12-28 10:24 | 39M | |
| plexil-4.5.0_2.pkg | 2025-08-18 21:35 | 778K | |
| plexmediaserver-1.42..> | 2025-12-24 04:33 | 76M | |
| plexmediaserver-plex..> | 2025-12-23 12:49 | 76M | |
| plib-1.8.5_8.pkg | 2025-08-14 00:49 | 668K | |
| plink-1.90.b6.17_5.pkg | 2025-12-29 21:04 | 852K | |
| plman-2.5.1_2.pkg | 2025-12-29 06:36 | 1.1M | |
| pload-0.9.5_7.pkg | 2025-12-20 05:00 | 11K | |
| plocate-1.1.22.pkg | 2025-12-23 06:11 | 131K | |
| plopfolio-0.1.0_13.pkg | 2025-12-27 12:38 | 41K | |
| plotutils-2.6_10,1.pkg | 2025-12-27 01:21 | 1.3M | |
| plow-1.3.2_11.pkg | 2025-12-24 04:26 | 4.5M | |
| plplot-5.15.0_8.pkg | 2025-12-27 09:12 | 728K | |
| plugdaemon-2.5.5_2.pkg | 2025-08-16 08:56 | 14K | |
| pluma-1.28.0_2.pkg | 2025-12-27 17:59 | 2.7M | |
| pluma-plugins-1.28.0..> | 2025-12-30 02:27 | 262K | |
| plumed-2.9.3_1.pkg | 2025-12-27 00:54 | 5.4M | |
| plutobook-0.12.0.pkg | 2025-12-28 21:16 | 625K | |
| plutosvg-0.0.7_2.pkg | 2025-12-26 14:23 | 31K | |
| plutovg-1.3.2.pkg | 2025-12-26 10:59 | 137K | |
| plzip-1.12.pkg | 2025-08-17 02:17 | 65K | |
| pm-lib-20091202_1.pkg | 2025-08-20 19:17 | 161K | |
| pmacct-1.7.8_1.pkg | 2025-12-20 05:00 | 1.0M | |
| pmars-0.9.2_4.pkg | 2025-08-19 19:24 | 165K | |
| pmars-sdl-0.9.2_7.pkg | 2025-12-23 14:22 | 68K | |
| pmccabe-2.6_1.pkg | 2025-08-20 11:47 | 21K | |
| pmd-7.16.0.pkg | 2025-12-28 20:13 | 65M | |
| pmenu-2.5.0_3.pkg | 2025-12-29 10:33 | 17K | |
| pmix-5.0.9.pkg | 2025-12-26 06:46 | 5.8M | |
| pms-0.42_15.pkg | 2025-12-22 20:20 | 153K | |
| pms-devel-0.0.202312..> | 2025-12-22 13:23 | 3.1M | |
| pmt-0.2.pkg | 2025-08-20 14:10 | 6.0K | |
| pmwiki-2.4.1,1.pkg | 2025-12-28 16:11 | 434K | |
| pnetcdf-mpich-1.14.1..> | 2025-12-27 16:09 | 1.2M | |
| pnetcdf-openmpi-1.14..> | 2025-12-29 00:22 | 1.2M | |
| pnews-2.6.6,1.pkg | 2025-12-30 08:16 | 194K | |
| png++-0.2.10.pkg | 2025-12-27 12:27 | 22K | |
| png-1.6.53.pkg | 2025-12-24 20:15 | 306K | |
| png2html-1.1_12.pkg | 2025-12-30 07:24 | 4.3K | |
| png2ico-2002.12.08_6..> | 2025-12-29 09:20 | 21K | |
| pngcheck-3.0.3.pkg | 2025-08-17 10:27 | 52K | |
| pnglite-0.1.17_1.pkg | 2025-08-14 19:24 | 8.7K | |
| pngnq-1.1_4.pkg | 2025-12-30 03:48 | 24K | |
| pngphoon-1.4.pkg | 2025-12-29 16:30 | 54K | |
| pngquant-2.18.0_3.pkg | 2025-12-26 20:22 | 20K | |
| pngrewrite-1.4.0_2.pkg | 2025-12-30 00:35 | 7.9K | |
| pngwriter-0.7.0_2.pkg | 2025-12-28 13:14 | 226K | |
| pnm2ppa-1.13_7.pkg | 2025-12-28 03:03 | 90K | |
| pnp-0.6.26_4.pkg | 2025-12-28 20:37 | 2.3M | |
| pnp-icinga2-0.6.26_4..> | 2025-12-28 05:20 | 2.3M | |
| pnscan-1.14.1_1.pkg | 2025-08-16 06:10 | 13K | |
| po4a-0.68_1.pkg | 2025-12-18 12:33 | 1.9M | |
| pocket-id-1.16.0.pkg | 2025-12-22 07:30 | 15M | |
| pocketsphinx-5.0.4.pkg | 2025-08-18 11:17 | 27M | |
| pocl-7.1_1.pkg | 2025-12-28 01:39 | 30M | |
| poco-1.13.3.pkg | 2025-12-18 15:50 | 3.3M | |
| pod2mdoc-0.2_1.pkg | 2025-08-20 05:54 | 19K | |
| podcastamatic-1.3_1.pkg | 2025-12-23 03:10 | 13K | |
| podcastdl-0.3.3.pkg | 2025-12-28 10:02 | 6.0K | |
| podman-5.7.1.pkg | 2025-12-19 09:21 | 49M | |
| podman-desktop-1.21...> | 2025-12-27 22:18 | 99M | |
| podman-suite-2025121..> | 2025-12-22 10:44 | 795 | |
| podofo-0.10.4_2.pkg | 2025-12-27 06:08 | 1.0M | |
| podofo09-0.9.8_5.pkg | 2025-12-27 04:50 | 1.2M | |
| poe-0.5.1_16.pkg | 2025-12-27 13:25 | 62K | |
| poedit-3.4.2_8.pkg | 2025-12-30 15:18 | 1.5M | |
| pointcloud-1.2.5_1.pkg | 2025-12-21 00:51 | 59K | |
| poke-3.2_1.pkg | 2025-12-22 00:58 | 814K | |
| polari-46.0.pkg | 2025-12-28 18:28 | 482K | |
| policyd2-2.0.14_4.pkg | 2025-12-28 06:31 | 88K | |
| polkit-125_1.pkg | 2025-12-16 01:50 | 161K | |
| polkit-gnome-0.105_5..> | 2025-12-27 11:11 | 58K | |
| polkit-qt-1-qt5-0.20..> | 2025-12-26 06:33 | 69K | |
| polkit-qt-1-qt6-0.20..> | 2025-12-26 03:41 | 75K | |
| pollinfo-0.2.1_6.pkg | 2025-12-30 01:18 | 273K | |
| polo-18.8.b_5.pkg | 2025-12-30 18:52 | 1.3M | |
| poly-lv2-g20210408_1..> | 2025-08-17 18:32 | 80K | |
| poly2tri-g20191130_1..> | 2025-12-29 06:05 | 30K | |
| polyclipper-1.2.4.pkg | 2025-08-15 09:02 | 17K | |
| polyclipping-6.4.2.pkg | 2025-08-13 18:40 | 60K | |
| polyglot-1.4.70.b_2.pkg | 2025-08-20 04:13 | 101K | |
| polygraph-4.13.0_5.pkg | 2025-12-28 11:12 | 3.0M | |
| polylib-5.22.5.pkg | 2025-08-14 09:19 | 139K | |
| polyml-5.9.2.pkg | 2025-12-23 11:07 | 1.6M | |
| polyphone-2.5.1_1.pkg | 2025-12-28 05:53 | 1.7M | |
| polytope-0.7.4_1.pkg | 2025-12-27 18:01 | 1.4M | |
| pomerium-0.8.4_18,1.pkg | 2025-12-23 14:30 | 7.7M | |
| pomsky-0.10_21.pkg | 2025-12-28 21:34 | 347K | |
| pongix-0.4_13.pkg | 2025-12-29 22:41 | 106K | |
| ponscripter-07th-mod..> | 2025-12-27 07:27 | 331K | |
| pooler-1.89.pkg | 2025-12-20 07:49 | 77K | |
| pop-gtk-themes-5.3.1..> | 2025-12-23 08:39 | 237K | |
| pop-icon-theme-20210..> | 2025-08-16 14:08 | 7.5M | |
| popa3d-1.0.3_1.pkg | 2025-08-19 12:20 | 20K | |
| popa3d-before-sendma..> | 2025-08-20 01:56 | 23K | |
| popcheck-1.3_1.pkg | 2025-08-21 20:28 | 9.5K | |
| popeye-0.22.1_4.pkg | 2025-08-18 21:32 | 21M | |
| popfile-1.1.3_1.pkg | 2025-12-21 02:51 | 307K | |
| poppler-25.10.0.pkg | 2025-12-26 03:23 | 1.3M | |
| poppler-data-0.4.12.pkg | 2025-08-13 00:20 | 1.9M | |
| poppler-glib-25.10.0..> | 2025-12-26 10:48 | 241K | |
| poppler-qt5-25.10.0.pkg | 2025-12-26 18:00 | 202K | |
| poppler-qt6-25.10.0.pkg | 2025-12-26 10:54 | 193K | |
| poppler-utils-25.10...> | 2025-12-26 17:39 | 198K | |
| poppwd-2.0_1.pkg | 2025-08-21 03:05 | 8.5K | |
| popstar-0.0.2_2.pkg | 2025-12-30 07:24 | 7.4M | |
| popt-1.19_1.pkg | 2025-12-18 04:33 | 71K | |
| poptop-1.4.0_2.pkg | 2025-08-18 15:32 | 34K | |
| popular-1.5.5_9.pkg | 2025-12-23 05:09 | 122K | |
| popup-stacks-1.0.pkg | 2025-08-16 09:46 | 83K | |
| porch-1.2.pkg | 2025-12-21 17:30 | 54K | |
| port-authoring-tools..> | 2025-12-28 09:41 | 614 | |
| port-index-uniquifie..> | 2025-08-17 03:05 | 609 | |
| port-maintenance-too..> | 2025-12-22 13:01 | 739 | |
| portacl-rc-0.9.0_1.pkg | 2025-08-18 10:06 | 4.2K | |
| portal-0.4_6.pkg | 2025-08-21 13:57 | 33K | |
| portaudio-19.6.0_7,1..> | 2025-12-18 04:14 | 168K | |
| portconf-1.6_1.pkg | 2025-08-15 16:41 | 2.4K | |
| portconfig-0.6.2_2.pkg | 2025-08-26 23:54 | 48K | |
| portdowngrade-1.7.pkg | 2025-08-14 17:25 | 2.9K | |
| portest-0.1.9_1.pkg | 2025-08-18 04:29 | 7.6K | |
| portfind-1.6.3_1.pkg | 2025-12-23 19:19 | 7.6K | |
| portfmt-1.1.6.pkg | 2025-08-17 03:58 | 211K | |
| portfwd-0.29_2.pkg | 2025-08-18 15:19 | 46K | |
| portgraph-0.1.0_1.pkg | 2025-12-28 09:14 | 11K | |
| portgrep-1.4.1_27.pkg | 2025-12-22 07:29 | 1.2M | |
| portless-0.2.7_2.pkg | 2025-12-21 21:41 | 5.2K | |
| portlint-2.23.0.pkg | 2025-12-27 00:00 | 34K | |
| portmaster-3.30.pkg | 2025-08-16 13:06 | 42K | |
| portmidi-2.0.6,1.pkg | 2025-08-14 06:36 | 34K | |
| portmon-2.0_2.pkg | 2025-08-19 00:13 | 14K | |
| portoptscli-0.0.1_1.pkg | 2025-08-16 01:01 | 8.8K | |
| portrac-0.6.pkg | 2025-12-29 22:33 | 25K | |
| ports-tools-1.8.pkg | 2025-08-17 08:06 | 22K | |
| portscout-0.8.1.6_3.pkg | 2025-12-22 15:08 | 54K | |
| portsdb-0.3_1.pkg | 2025-12-21 02:59 | 12K | |
| portsearch-1.3.5.pkg | 2025-08-16 05:47 | 13K | |
| portshaker-1.0.19_5.pkg | 2025-12-19 16:43 | 17K | |
| portshaker-config-1...> | 2025-12-21 17:52 | 2.6K | |
| portsnap-1.1_3.pkg | 2025-08-17 06:21 | 21K | |
| portsreinstall-4.1.1..> | 2025-08-22 11:02 | 110K | |
| porttools-1.11_2.pkg | 2025-12-27 07:38 | 21K | |
| porttree-1.1.r114_4.pkg | 2025-12-30 07:08 | 9.0K | |
| portupdate-scan-0.4_..> | 2025-12-22 10:38 | 7.1K | |
| portupgrade-2.4.16_4..> | 2025-12-19 05:48 | 94K | |
| portupgrade-devel-20..> | 2025-12-23 16:16 | 94K | |
| poser-1.2.2.pkg | 2025-12-19 05:42 | 48K | |
| posixtestsuite-1.5.2..> | 2025-08-21 01:26 | 837 | |
| postal-0.76_1.pkg | 2025-08-17 01:37 | 53K | |
| posterazor-1.9.7_1.pkg | 2025-12-29 19:50 | 132K | |
| postfinger-1.30.pkg | 2025-08-18 05:17 | 3.9K | |
| postfix-3.10.6,1.pkg | 2025-12-19 09:29 | 1.7M | |
| postfix-current-3.11..> | 2025-12-20 15:00 | 1.8M | |
| postfix-current-ldap..> | 2025-12-21 06:37 | 1.8M | |
| postfix-current-mong..> | 2025-12-22 12:34 | 1.8M | |
| postfix-current-mysq..> | 2025-12-22 09:15 | 1.8M | |
| postfix-current-pgsq..> | 2025-12-20 19:00 | 1.8M | |
| postfix-current-sasl..> | 2025-12-23 20:06 | 1.8M | |
| postfix-current-sqli..> | 2025-12-22 17:56 | 1.8M | |
| postfix-ldap-3.10.6,..> | 2025-12-22 19:46 | 1.7M | |
| postfix-logwatch-1.4..> | 2025-12-23 01:13 | 84K | |
| postfix-mongo-3.10.6..> | 2025-12-22 13:55 | 1.7M | |
| postfix-mysql-3.10.6..> | 2025-12-21 07:49 | 1.7M | |
| postfix-pgsql-3.10.6..> | 2025-12-20 08:47 | 1.7M | |
| postfix-policyd-sf-1..> | 2025-12-21 02:59 | 60K | |
| postfix-policyd-spf-..> | 2025-12-21 02:49 | 4.9K | |
| postfix-policyd-weig..> | 2025-12-24 04:24 | 34K | |
| postfix-postfwd-2.03..> | 2025-12-22 16:49 | 144K | |
| postfix-sasl-3.10.6,..> | 2025-12-24 03:49 | 1.7M | |
| postfix-sqlite-3.10...> | 2025-12-23 02:31 | 1.7M | |
| postfixadmin-lite-ph..> | 2025-12-30 16:54 | 4.2M | |
| postfixadmin-lite-ph..> | 2025-12-28 14:58 | 4.2M | |
| postfixadmin-lite-ph..> | 2025-12-29 10:54 | 4.2M | |
| postfixadmin-lite-ph..> | 2025-12-29 17:07 | 4.2M | |
| postfixadmin-lite-ph..> | 2025-12-29 23:59 | 4.2M | |
| postfixadmin-php81-3..> | 2025-12-28 21:41 | 4.2M | |
| postfixadmin-php82-3..> | 2025-12-30 14:29 | 4.2M | |
| postfixadmin-php83-3..> | 2025-12-29 18:09 | 4.2M | |
| postfixadmin-php84-3..> | 2025-12-30 10:12 | 4.2M | |
| postfixadmin-php85-3..> | 2025-12-29 17:41 | 4.2M | |
| postfixadmin33-lite-..> | 2025-12-30 14:02 | 1.3M | |
| postfixadmin33-lite-..> | 2025-12-28 22:44 | 1.3M | |
| postfixadmin33-lite-..> | 2025-12-29 19:01 | 1.3M | |
| postfixadmin33-lite-..> | 2025-12-29 19:55 | 1.3M | |
| postfixadmin33-lite-..> | 2025-12-30 18:28 | 1.3M | |
| postfixadmin33-php81..> | 2025-12-28 12:39 | 1.4M | |
| postfixadmin33-php82..> | 2025-12-28 05:47 | 1.4M | |
| postfixadmin33-php83..> | 2025-12-30 10:10 | 1.4M | |
| postfixadmin33-php84..> | 2025-12-30 11:14 | 1.4M | |
| postfixadmin33-php85..> | 2025-12-30 15:43 | 1.4M | |
| postgis-3.6.1_1.pkg | 2025-12-27 20:46 | 1.8M | |
| postgis-jdbc-2.1.7.pkg | 2025-12-30 05:53 | 69K | |
| postgis33-3.3.8_6.pkg | 2025-12-27 09:02 | 1.8M | |
| postgis34-3.4.4_6.pkg | 2025-12-28 13:26 | 2.1M | |
| postgis35-3.5.4_1.pkg | 2025-12-27 18:03 | 1.9M | |
| postgresql-jdbc-42.7..> | 2025-12-27 02:51 | 1.0M | |
| postgresql-libpgeasy..> | 2025-12-22 21:55 | 10K | |
| postgresql-libpqxx-7..> | 2025-12-19 12:56 | 266K | |
| postgresql-odbc-16.0..> | 2025-12-22 03:18 | 329K | |
| postgresql-orafce-4...> | 2025-12-23 04:51 | 117K | |
| postgresql-plproxy-2..> | 2025-12-24 05:01 | 33K | |
| postgresql-relay-1.3..> | 2025-08-18 21:52 | 12K | |
| postgresql13-client-..> | 2025-12-19 01:56 | 2.9M | |
| postgresql13-contrib..> | 2025-12-20 08:19 | 497K | |
| postgresql13-cstore_..> | 2025-12-20 23:30 | 30K | |
| postgresql13-docs-13..> | 2025-12-22 18:07 | 1.9M | |
| postgresql13-pg_simi..> | 2025-12-20 04:42 | 29K | |
| postgresql13-plperl-..> | 2025-12-21 03:51 | 146K | |
| postgresql13-plpytho..> | 2025-12-22 20:38 | 56K | |
| postgresql13-pltcl-1..> | 2025-12-20 18:18 | 22K | |
| postgresql13-server-..> | 2025-12-20 01:34 | 12M | |
| postgresql13-wal2jso..> | 2025-12-22 07:28 | 18K | |
| postgresql14-client-..> | 2025-12-18 19:41 | 3.0M | |
| postgresql14-contrib..> | 2025-12-20 16:01 | 507K | |
| postgresql14-docs-14..> | 2025-12-20 21:59 | 1.9M | |
| postgresql14-plperl-..> | 2025-12-22 09:14 | 146K | |
| postgresql14-plpytho..> | 2025-12-21 07:42 | 56K | |
| postgresql14-pltcl-1..> | 2025-12-20 11:18 | 22K | |
| postgresql14-server-..> | 2025-12-19 12:13 | 13M | |
| postgresql15-client-..> | 2025-12-18 19:09 | 3.1M | |
| postgresql15-contrib..> | 2025-12-20 07:16 | 519K | |
| postgresql15-docs-15..> | 2025-12-20 17:10 | 2.0M | |
| postgresql15-plperl-..> | 2025-12-21 04:24 | 146K | |
| postgresql15-plpytho..> | 2025-12-20 21:40 | 55K | |
| postgresql15-pltcl-1..> | 2025-12-20 22:37 | 22K | |
| postgresql15-server-..> | 2025-12-20 03:16 | 13M | |
| postgresql16-client-..> | 2025-12-18 19:36 | 3.4M | |
| postgresql16-contrib..> | 2025-12-21 05:38 | 521K | |
| postgresql16-docs-16..> | 2025-12-20 15:18 | 2.0M | |
| postgresql16-plperl-..> | 2025-12-21 16:02 | 145K | |
| postgresql16-plpytho..> | 2025-12-21 23:54 | 54K | |
| postgresql16-pltcl-1..> | 2025-12-23 13:45 | 23K | |
| postgresql16-server-..> | 2025-12-19 07:33 | 14M | |
| postgresql17-client-..> | 2025-12-18 01:33 | 3.6M | |
| postgresql17-contrib..> | 2025-12-18 22:57 | 521K | |
| postgresql17-docs-17..> | 2025-12-20 04:55 | 2.0M | |
| postgresql17-idn-0.2..> | 2025-12-22 12:38 | 9.0K | |
| postgresql17-mysql_f..> | 2025-12-24 04:33 | 36K | |
| postgresql17-ogr_fdw..> | 2025-12-30 18:53 | 32K | |
| postgresql17-pg-safe..> | 2025-12-20 08:42 | 2.9K | |
| postgresql17-pg_dirt..> | 2025-12-21 17:03 | 5.9K | |
| postgresql17-pg_repa..> | 2025-12-30 02:14 | 54K | |
| postgresql17-pgaudit..> | 2025-12-23 04:25 | 12K | |
| postgresql17-pgjwt-0..> | 2025-12-21 00:59 | 1.9K | |
| postgresql17-pgsql-h..> | 2025-12-21 13:13 | 14K | |
| postgresql17-pgvecto..> | 2025-12-23 05:03 | 79K | |
| postgresql17-plperl-..> | 2025-12-20 17:11 | 145K | |
| postgresql17-plpgsql..> | 2025-12-22 10:47 | 80K | |
| postgresql17-plpytho..> | 2025-12-22 21:10 | 54K | |
| postgresql17-pltcl-1..> | 2025-12-20 01:46 | 23K | |
| postgresql17-plv8js-..> | 2025-12-22 10:43 | 55K | |
| postgresql17-prefix-..> | 2025-12-22 18:55 | 17K | |
| postgresql17-repmgr-..> | 2025-12-24 01:11 | 256K | |
| postgresql17-rum-1.3..> | 2025-12-23 16:52 | 90K | |
| postgresql17-semver-..> | 2025-12-22 06:19 | 17K | |
| postgresql17-server-..> | 2025-12-18 19:50 | 15M | |
| postgresql17-tds_fdw..> | 2025-12-20 16:54 | 34K | |
| postgresql17-zhparse..> | 2025-12-21 19:28 | 4.2M | |
| postgresql18-client-..> | 2025-12-18 20:39 | 3.7M | |
| postgresql18-contrib..> | 2025-12-22 12:08 | 547K | |
| postgresql18-docs-18..> | 2025-12-23 20:11 | 2.0M | |
| postgresql18-plperl-..> | 2025-12-21 13:05 | 145K | |
| postgresql18-plpytho..> | 2025-12-21 06:29 | 54K | |
| postgresql18-pltcl-1..> | 2025-12-22 14:22 | 23K | |
| postgresql18-server-..> | 2025-12-19 21:12 | 15M | |
| postgrey-1.37_4.pkg | 2025-12-23 05:05 | 40K | |
| postmark-1.53_1.pkg | 2025-08-19 14:30 | 12K | |
| postsrsd-2.0.11,1.pkg | 2025-12-23 13:38 | 30K | |
| pot-0.16.1.pkg | 2025-12-26 22:50 | 65K | |
| potnet-0.5.0_18.pkg | 2025-12-26 19:11 | 553K | |
| potrace-1.16_1.pkg | 2025-08-13 21:00 | 86K | |
| poudriere-3.4.4.pkg | 2025-12-20 05:12 | 900K | |
| poudriere-devel-3.4...> | 2025-12-21 13:54 | 750K | |
| poudriere-dsh2dsh-3...> | 2025-12-22 09:23 | 750K | |
| pounce-3.1_2.pkg | 2025-08-17 02:13 | 35K | |
| pound-4.18.pkg | 2025-12-21 12:18 | 300K | |
| povray-meta-0.1_3.pkg | 2025-12-27 11:58 | 706 | |
| povray37-3.7.0.10_24..> | 2025-12-27 00:12 | 21M | |
| povray38-3.8.0.b.2_2..> | 2025-12-28 06:20 | 23M | |
| powa-archivist-5.1.1..> | 2025-12-23 14:12 | 53K | |
| powder-118.pkg | 2025-12-23 01:48 | 656K | |
| powder-toy-99.3.384_..> | 2025-12-29 23:51 | 1.1M | |
| powder-toy-devel-s.3..> | 2025-12-30 12:41 | 1.1M | |
| poweralertd-0.3.0.pkg | 2025-08-20 13:27 | 8.4K | |
| powerarchitect-1.0.9..> | 2025-12-28 12:23 | 23M | |
| powerdns-5.0.1.pkg | 2025-12-24 04:57 | 2.7M | |
| powerdns-recursor-5...> | 2025-12-29 03:05 | 5.6M | |
| powerdxx-0.4.4_3.pkg | 2025-08-21 09:02 | 1.0M | |
| powerline-fonts-0.0...> | 2025-12-29 03:10 | 6.1M | |
| powerman-2.3.20_3.pkg | 2025-12-19 17:12 | 124K | |
| powermanga-0.93.1_1.pkg | 2025-12-27 22:32 | 9.4M | |
| powermon-1.0.0_3.pkg | 2025-12-23 04:55 | 8.1K | |
| powerpc-binutils-2.4..> | 2025-12-19 08:35 | 2.5M | |
| powerpc-freebsd-sysr..> | 2025-12-19 20:10 | 54M | |
| powerpc-gcc12-12.3.0..> | 2025-12-20 16:31 | 33M | |
| powerpc-gcc13-13.2.0..> | 2025-12-23 03:27 | 35M | |
| powerpc-gcc14-14.1.0..> | 2025-12-22 05:41 | 39M | |
| powerpc-rust-bootstr..> | 2025-12-29 09:28 | 79M | |
| powerpc64-binutils-2..> | 2025-12-19 15:56 | 2.5M | |
| powerpc64-freebsd-sy..> | 2025-12-19 22:57 | 47M | |
| powerpc64-gcc12-12.3..> | 2025-12-22 23:08 | 33M | |
| powerpc64-gcc13-13.2..> | 2025-12-20 07:49 | 35M | |
| powerpc64-gcc14-14.1..> | 2025-12-23 06:49 | 39M | |
| powerpc64-rust-boots..> | 2025-12-29 15:23 | 78M | |
| powerpc64le-binutils..> | 2025-12-19 04:34 | 2.5M | |
| powerpc64le-freebsd-..> | 2025-12-19 11:25 | 48M | |
| powerpc64le-gcc13-13..> | 2025-12-23 18:23 | 35M | |
| powerpc64le-gcc14-14..> | 2025-12-21 06:16 | 39M | |
| powerpc64le-rust-boo..> | 2025-12-28 19:31 | 81M | |
| powerpcspe-freebsd-s..> | 2025-12-22 14:59 | 42M | |
| powershell-7.5.4.pkg | 2025-12-29 12:12 | 36M | |
| powwow-1.2.23_1.pkg | 2025-08-21 10:41 | 130K | |
| poxml-25.12.0.pkg | 2025-12-27 02:46 | 115K | |
| pp-1.03_1.pkg | 2025-08-18 16:12 | 8.5K | |
| pp3-1.3.3_6.pkg | 2025-12-29 05:40 | 1.0M | |
| ppa6-0.1.0_3.pkg | 2025-12-30 08:26 | 1.7M | |
| ppl-1.2_1.pkg | 2025-08-14 00:13 | 10M | |
| ppmcaption-1.1_1.pkg | 2025-08-20 18:12 | 64K | |
| ppmd-20050811_1.pkg | 2025-08-21 16:38 | 22K | |
| ppminfo-0.1_5.pkg | 2025-12-29 03:03 | 4.3K | |
| ppower4-0.9.4_8.pkg | 2025-12-27 22:16 | 372K | |
| pprof-2024.12.09_3.pkg | 2025-08-22 02:53 | 3.2M | |
| ppsei-0.3.pkg | 2025-08-22 09:28 | 4.5K | |
| ppsspp-1.19.3_1.pkg | 2025-12-30 15:10 | 16M | |
| ppsspp-qt5-1.19.3_1.pkg | 2025-12-29 19:01 | 16M | |
| pptpclient-1.10.0.pkg | 2025-12-20 23:23 | 32K | |
| ppunpack-1.0.pkg | 2025-08-16 07:46 | 4.7K | |
| pqiv-2.13.3_2.pkg | 2025-12-29 18:52 | 85K | |
| pqrs-0.3.2_14.pkg | 2025-12-29 00:08 | 2.2M | |
| pr-1.1_1.pkg | 2025-08-19 20:35 | 4.7K | |
| praat-6.4.37.pkg | 2025-12-28 08:23 | 14M | |
| pragha-1.3.3_14.pkg | 2025-12-30 09:29 | 306K | |
| pragtical-3.3.1_1.pkg | 2025-12-29 12:41 | 581K | |
| prboom-plus-2.5.1.3_..> | 2025-12-29 03:39 | 653K | |
| predict-2.3.1.pkg | 2025-08-21 06:56 | 1.4M | |
| preferences-1.2.0_14..> | 2025-12-26 20:27 | 49K | |
| prelude-lv2-g2021021..> | 2025-12-29 12:41 | 3.1M | |
| premake4-4.4.b5.pkg | 2025-08-15 10:15 | 116K | |
| premake5-5.0.0.b7.pkg | 2025-08-15 11:50 | 857K | |
| prepflog-0.4.1.pkg | 2025-12-22 15:11 | 9.4K | |
| presage-0.9.1_2.pkg | 2025-12-27 06:26 | 12M | |
| preseq-3.2.0.pkg | 2025-12-21 09:10 | 271K | |
| prestashop-8.2.3.pkg | 2025-12-29 16:56 | 52M | |
| price-1.3.0_9.pkg | 2025-12-27 18:37 | 139K | |
| primateplunge-1.1_8.pkg | 2025-12-23 10:52 | 4.2M | |
| primecount-7.20.pkg | 2025-12-20 02:09 | 162K | |
| primegen-0.97_1.pkg | 2025-08-19 00:51 | 12K | |
| primer3-2.3.6.pkg | 2025-08-14 05:53 | 99K | |
| primesieve-12.9,1.pkg | 2025-08-13 18:26 | 131K | |
| primesum-1.7.19.pkg | 2025-08-15 23:34 | 151K | |
| primme-3.2.3_1.pkg | 2025-12-27 16:03 | 664K | |
| printscreen-1.4_1.pkg | 2025-12-29 23:36 | 1.6K | |
| prips-1.2.2.pkg | 2025-12-20 03:34 | 15K | |
| prisma-engines-6.19...> | 2025-12-30 01:59 | 15M | |
| prismlauncher-9.4.pkg | 2025-12-28 13:00 | 4.7M | |
| priv_wrapper-1.0.1.pkg | 2025-08-14 10:03 | 6.2K | |
| privatebin-2.0.3.pkg | 2025-12-28 06:32 | 636K | |
| privoxy-4.0.0.pkg | 2025-12-21 10:00 | 475K | |
| prng-3.0.2_3.pkg | 2025-08-21 09:08 | 260K | |
| proby-1.0.2_49.pkg | 2025-12-29 05:17 | 953K | |
| procenv-0.60_1.pkg | 2025-08-18 16:03 | 50K | |
| process-viewer-g2022..> | 2025-12-29 16:26 | 411K | |
| processing-1.5.1,1.pkg | 2025-12-30 00:51 | 33M | |
| prociono-g20110526_1..> | 2025-12-30 07:22 | 24K | |
| procmail-3.22_11.pkg | 2025-08-15 15:22 | 140K | |
| procmail-bgrb-3.24_2..> | 2025-08-18 05:35 | 141K | |
| procmap-1.0_2.pkg | 2025-08-20 17:50 | 4.4K | |
| procs-0.14.10_7.pkg | 2025-12-30 10:41 | 1.2M | |
| prodigal-2.6.3.16.pkg | 2025-08-16 14:46 | 499K | |
| prodigy-lig-1.1.3_1.pkg | 2025-12-30 02:49 | 22K | |
| profanity-0.15.1.pkg | 2025-12-29 07:35 | 442K | |
| profont-400_5.pkg | 2025-12-29 16:00 | 40K | |
| proftpd-1.3.8c_1.pkg | 2025-12-19 01:13 | 5.2M | |
| proftpd-mod_clamav-0..> | 2025-12-30 11:22 | 37K | |
| proftpd-mod_ldap-1.3..> | 2025-12-20 04:26 | 101K | |
| proftpd-mod_sql_mysq..> | 2025-12-19 04:54 | 44K | |
| proftpd-mod_sql_odbc..> | 2025-12-20 10:36 | 44K | |
| proftpd-mod_sql_post..> | 2025-12-23 09:09 | 38K | |
| proftpd-mod_sql_sqli..> | 2025-12-20 12:03 | 37K | |
| proftpd-mod_sql_tds-..> | 2025-12-21 03:16 | 36K | |
| proftpd-mod_vroot-0...> | 2025-12-23 17:24 | 63K | |
| profxp-3p2_2.pkg | 2025-12-21 09:36 | 16K | |
| proggy_fonts-1.0_5.pkg | 2025-12-30 09:03 | 76K | |
| proggy_fonts-ttf-1.0..> | 2025-12-29 00:23 | 19K | |
| progress-0.17.pkg | 2025-12-23 18:50 | 13K | |
| progsreiserfs-0.3.1...> | 2025-12-20 11:20 | 97K | |
| proguard-7.0.0.pkg | 2025-12-30 10:40 | 4.4M | |
| proj-9.7.1_1,1.pkg | 2025-12-26 06:23 | 2.7M | |
| proj-data-1.24.pkg | 2025-12-22 15:58 | 754M | |
| projectcenter-0.6.2_..> | 2025-12-30 14:15 | 419K | |
| projectlibre-1.9.8.pkg | 2025-12-28 09:54 | 19M | |
| prometheus-2.55.1_7.pkg | 2025-12-20 05:00 | 41M | |
| prometheus-bird-expo..> | 2025-12-23 15:23 | 2.8M | |
| prometheus-collectd-..> | 2025-12-20 08:47 | 3.3M | |
| prometheus-cpp-1.3.0..> | 2025-08-19 06:35 | 52K | |
| prometheus-dnssec-ex..> | 2025-12-23 18:23 | 2.5M | |
| prometheus-postgres-..> | 2025-12-21 21:58 | 4.0M | |
| prometheus-postgresq..> | 2025-12-20 09:43 | 4.0M | |
| prometheus1-1.8.2_37..> | 2025-12-20 15:20 | 11M | |
| prometheus3-3.8.1.pkg | 2025-12-27 21:23 | 49M | |
| promscale-0.17.0_25.pkg | 2025-12-21 01:16 | 8.3M | |
| promxy-0.0.93_7.pkg | 2025-12-20 11:54 | 15M | |
| prosearch-0.19.4_11.pkg | 2025-12-28 18:13 | 295K | |
| prosody-13.0.2.pkg | 2025-12-18 19:38 | 429K | |
| prosody-modules-2025..> | 2025-12-20 14:43 | 1.3M | |
| protobuf-29.5,1.pkg | 2025-08-13 08:04 | 2.5M | |
| protobuf-c-1.5.1_3.pkg | 2025-08-13 18:22 | 203K | |
| protobuf-go-1.36.11.pkg | 2025-12-23 18:02 | 1.9M | |
| protobuf-java-4.33.2..> | 2025-12-27 03:17 | 1.7M | |
| protobuf3-3.21.12.pkg | 2025-08-15 16:13 | 3.4M | |
| protobuf25-2.5.0_5.pkg | 2025-08-18 12:02 | 1.0M | |
| protoc-gen-go-grpc-1..> | 2025-12-22 02:45 | 1.8M | |
| protomol-2.0.3_16.pkg | 2025-12-30 09:42 | 1.8M | |
| prototool-1.10.0_33.pkg | 2025-12-24 04:16 | 4.1M | |
| protovalidate-1.1.0.pkg | 2025-12-29 11:28 | 3.1M | |
| protovis-3.3.1.pkg | 2025-08-16 04:16 | 222K | |
| protozero-1.8.1.pkg | 2025-08-14 09:05 | 27K | |
| prowlarr-2.0.5.5160.pkg | 2025-12-28 16:24 | 31M | |
| proxsmtp-1.10_3.pkg | 2025-08-18 14:34 | 43K | |
| proxsuite-0.7.1.pkg | 2025-12-28 21:01 | 151K | |
| proxy-suite-1.9.2.4_..> | 2025-08-19 01:14 | 48K | |
| proxychains-3.1_3.pkg | 2025-12-27 22:40 | 16K | |
| proxychains-ng-4.17.pkg | 2025-08-16 00:37 | 35K | |
| proxycheck-0.49a_1.pkg | 2025-08-19 12:57 | 30K | |
| proxyper-347_1.pkg | 2025-08-17 21:19 | 267K | |
| proxysql-2.6.6_1.pkg | 2025-12-29 04:12 | 4.3M | |
| proxytunnel-1.12.3.pkg | 2025-08-17 14:58 | 24K | |
| prql-compiler-0.13.6..> | 2025-12-30 05:00 | 2.2M | |
| prrte-3.0.12.pkg | 2025-12-26 08:41 | 5.3M | |
| prtunnel-0.2.7_1.pkg | 2025-08-19 14:48 | 24K | |
| pructl-0.2_1.pkg | 2025-12-22 04:48 | 8.3K | |
| ps2eps-1.64_7.pkg | 2025-12-30 07:22 | 58K | |
| pscal-1.16.pkg | 2025-08-21 11:59 | 13K | |
| psdim-1.4_10.pkg | 2025-12-30 06:33 | 14K | |
| psearch-2.1.0_1.pkg | 2025-08-17 06:16 | 16K | |
| psftools-1.0.14.pkg | 2025-08-14 23:56 | 179K | |
| psgml-1.4.0_25.pkg | 2025-12-29 23:41 | 209K | |
| psgml-emacs_canna-1...> | 2025-12-30 08:01 | 209K | |
| psgml-emacs_devel-1...> | 2025-12-27 23:39 | 208K | |
| psgml-emacs_devel_no..> | 2025-12-22 03:26 | 208K | |
| psgml-emacs_nox-1.4...> | 2025-12-22 03:22 | 209K | |
| psgml-emacs_wayland-..> | 2025-12-28 23:59 | 209K | |
| psh-1.8.1_4.pkg | 2025-12-21 05:25 | 169K | |
| psi-1.5_3.pkg | 2025-12-27 20:39 | 2.9M | |
| psi4-1.9.1_4.pkg | 2025-12-29 23:44 | 20M | |
| psi88-1.0_17.pkg | 2025-12-29 06:37 | 60K | |
| psiconv-0.9.9_1.pkg | 2025-08-16 08:14 | 228K | |
| psimd-g20180906.pkg | 2025-08-15 17:24 | 4.4K | |
| psindustrializer-0.2..> | 2025-12-30 18:29 | 43K | |
| pslib-0.4.8.pkg | 2025-12-27 10:41 | 844K | |
| pslist-1.4.0_1.pkg | 2025-12-21 16:25 | 5.2K | |
| psmisc-22.16_2.pkg | 2025-12-22 07:56 | 65K | |
| pspg-5.8.14.pkg | 2025-12-28 06:49 | 148K | |
| pspresent-1.3_8.pkg | 2025-12-29 09:04 | 9.9K | |
| pssh-2.3.5_1.pkg | 2025-12-23 19:53 | 38K | |
| pstack-1.3_1.pkg | 2025-08-16 22:03 | 15K | |
| pstacku-0.10.0.pkg | 2025-12-24 04:42 | 8.2K | |
| pstoedit-4.02.pkg | 2025-12-27 06:01 | 843K | |
| pstotext-1.9_8.pkg | 2025-12-27 04:07 | 25K | |
| pstreams-1.0.4.pkg | 2025-08-21 00:30 | 13K | |
| pstree-2.40_1.pkg | 2025-08-19 18:07 | 8.1K | |
| psurface-2.0.0.13_2.pkg | 2025-12-26 19:12 | 473K | |
| psutils-1.17_6.pkg | 2025-08-13 00:33 | 62K | |
| psvn-20150720.214200..> | 2025-12-30 17:20 | 90K | |
| psvn-emacs_canna-201..> | 2025-12-29 20:16 | 91K | |
| psvn-emacs_devel-201..> | 2025-12-30 16:25 | 90K | |
| psvn-emacs_devel_nox..> | 2025-12-22 12:47 | 90K | |
| psvn-emacs_nox-20150..> | 2025-12-22 03:54 | 91K | |
| psvn-emacs_wayland-2..> | 2025-12-29 07:00 | 90K | |
| pt-freebsd-doc-20251..> | 2025-12-19 23:22 | 16M | |
| pt-hunspell-20251001..> | 2025-12-21 13:29 | 1.3M | |
| pt-hyphen-2004.04.15..> | 2025-08-22 17:50 | 1.1K | |
| pt-libreoffice-25.8...> | 2025-12-27 02:37 | 3.4M | |
| pt-mythes-2006.08.17..> | 2025-08-18 16:44 | 210K | |
| pt2-clone-1.80.1.pkg | 2025-12-29 22:43 | 264K | |
| pt_BR-aspell-2009070..> | 2025-12-21 04:34 | 2.5M | |
| pt_BR-libreoffice-25..> | 2025-12-27 08:04 | 3.4M | |
| pt_BR-webalizer-2.23..> | 2025-12-30 08:17 | 136K | |
| pt_PT-aspell-2007051..> | 2025-12-21 16:07 | 274K | |
| pt_PT-webalizer-2.23..> | 2025-12-29 00:44 | 136K | |
| ptex-2.4.3.pkg | 2025-08-13 18:38 | 685K | |
| pthreadpool-0.1.126.pkg | 2025-08-13 14:56 | 21K | |
| pthsem-2.0.8_4.pkg | 2025-08-16 05:57 | 102K | |
| ptl-2.3.3_6.pkg | 2025-12-27 11:10 | 99K | |
| ptlib-2.10.11_7.pkg | 2025-12-27 16:39 | 1.4M | |
| ptoc-3.58_1.pkg | 2025-08-22 20:31 | 173K | |
| ptpd2-2.3.1_2.pkg | 2025-12-30 06:41 | 691K | |
| ptsort-1.20240913.pkg | 2025-08-16 08:09 | 9.1K | |
| ptunnel-0.72_2.pkg | 2025-08-21 14:46 | 20K | |
| ptx-kmod-0.0.2011121..> | 2025-08-17 03:18 | 18K | |
| ptyxis-47.13.pkg | 2025-12-30 10:11 | 337K | |
| public_suffix_list-2..> | 2025-12-16 01:28 | 79K | |
| pubs-0.9.0_3.pkg | 2025-12-30 02:54 | 125K | |
| puckman-1.0_6.pkg | 2025-12-30 06:42 | 173K | |
| pueue-4.0.1_2.pkg | 2025-12-30 14:18 | 2.7M | |
| puff-1.0.1.pkg | 2025-08-17 15:50 | 28K | |
| pugixml-1.15.pkg | 2025-08-13 12:44 | 90K | |
| pulledpork-0.7.4.pkg | 2025-12-18 22:11 | 35K | |
| pulsar-client-cpp-3...> | 2025-12-20 00:16 | 2.1M | |
| pulseaudio-17.0_4.pkg | 2025-12-24 22:07 | 1.5M | |
| pulseaudio-module-sn..> | 2025-12-30 06:40 | 7.3K | |
| pulseaudio-module-xr..> | 2025-12-29 03:50 | 16K | |
| pulseaudio-qt6-1.7.0..> | 2025-12-26 18:43 | 110K | |
| pulseview-0.4.2_8.pkg | 2025-12-30 17:04 | 583K | |
| punbb-1.4.6.pkg | 2025-12-29 00:55 | 748K | |
| punchy-0.3.0_30.pkg | 2025-12-28 11:46 | 45M | |
| pup-0.4.0.10_34.pkg | 2025-12-23 19:24 | 1.2M | |
| puppet-mode.el-0.2_2..> | 2025-12-28 14:13 | 4.4K | |
| puppet-mode.el-emacs..> | 2025-12-28 11:18 | 4.4K | |
| puppet-mode.el-emacs..> | 2025-12-28 06:24 | 4.4K | |
| puppet-mode.el-emacs..> | 2025-12-22 15:24 | 4.4K | |
| puppet-mode.el-emacs..> | 2025-12-21 21:24 | 4.4K | |
| puppet-mode.el-emacs..> | 2025-12-30 09:30 | 4.4K | |
| puppet8-8.10.0_1.pkg | 2025-12-27 00:32 | 1.2M | |
| puppetdb-terminus8-8..> | 2025-12-24 01:01 | 19K | |
| puppetdb8-8.8.1.pkg | 2025-12-30 07:59 | 53M | |
| puppetserver8-8.7.0_..> | 2025-12-29 21:28 | 60M | |
| pure-ftpd-1.0.52_1.pkg | 2025-08-19 00:10 | 192K | |
| pure-sfv-0.3.pkg | 2025-08-18 15:27 | 39K | |
| puredb-2.1_2.pkg | 2025-08-22 00:05 | 16K | |
| purescript-language-..> | 2025-12-30 07:20 | 190K | |
| purple-discord-g2025..> | 2025-12-29 00:14 | 105K | |
| purple-facebook-0.9...> | 2025-12-30 08:45 | 82K | |
| purple-googlechat-g2..> | 2025-12-29 05:16 | 187K | |
| purple-gowhatsapp-1...> | 2025-12-29 04:38 | 4.0M | |
| purple-mattermost-2...> | 2025-12-30 02:37 | 212K | |
| purple-rocketchat-0...> | 2025-12-29 17:56 | 35K | |
| purple-slack-2021030..> | 2025-12-28 22:45 | 47K | |
| purple-teams-2024082..> | 2025-12-29 20:46 | 408K | |
| pushgateway-1.11.2_2..> | 2025-12-22 19:20 | 5.6M | |
| pushmi-1.0.0_10.pkg | 2025-12-23 05:08 | 20K | |
| putty-0.83.pkg | 2025-12-29 03:20 | 1.0M | |
| putty-nogtk-0.83.pkg | 2025-08-17 05:37 | 711K | |
| puush-0.0.2.pkg | 2025-12-30 08:55 | 30K | |
| pv-1.9.31.pkg | 2025-12-19 05:55 | 100K | |
| pvk-20070406_1.pkg | 2025-08-18 00:40 | 7.9K | |
| pvm-3.4.6_6.pkg | 2025-12-19 20:46 | 849K | |
| pvpgn-1.8.5_2.pkg | 2025-08-16 00:56 | 749K | |
| pwauth-2.3.11.pkg | 2025-08-19 09:49 | 4.7K | |
| pwcbsd-1.4.1.1403000..> | 2025-08-16 08:14 | 22K | |
| pwcview-1.4.1_9.pkg | 2025-12-29 19:24 | 20K | |
| pwd_unmkdb-1.4_1.pkg | 2025-08-16 01:53 | 4.9K | |
| pwdsafety-0.4.1_4.pkg | 2025-12-21 06:24 | 2.0M | |
| pwgen-2.08_1,2.pkg | 2025-08-14 00:55 | 14K | |
| pwhois-2.2.1.0_2.pkg | 2025-12-21 03:51 | 92K | |
| pwm-2007.07.20_4.pkg | 2025-08-18 13:49 | 75K | |
| pwman-0.4.5_5.pkg | 2025-12-23 19:29 | 39K | |
| pwnat-g20171222.pkg | 2025-08-16 22:03 | 15K | |
| pwned-check-2.2_2,1.pkg | 2025-08-19 04:22 | 4.2K | |
| pwol-1.5.2_1.pkg | 2025-08-20 04:08 | 18K | |
| pwsafe-0.2.2.b.196_1..> | 2025-12-21 03:45 | 52K | |
| pwsafe-nox11-0.2.2.b..> | 2025-12-24 04:27 | 47K | |
| pxattr-2.1.0.pkg | 2025-08-16 01:01 | 49K | |
| pxe-1.4.2_2.pkg | 2025-08-17 00:33 | 25K | |
| pxe-pdhcp-0.0.2007_1..> | 2025-08-18 19:21 | 8.6K | |
| pxlib-0.6.8.pkg | 2025-12-22 12:37 | 71K | |
| pxtools-0.0.20_4.pkg | 2025-12-20 16:52 | 23K | |
| py3c-1.4.pkg | 2025-08-13 22:30 | 5.7K | |
| py27-cython-0.29.37_..> | 2025-12-26 21:17 | 1.8M | |
| py27-dnspython1-1.16..> | 2025-12-27 10:57 | 188K | |
| py27-future-0.18.3_1..> | 2025-12-28 21:57 | 659K | |
| py27-game_sdl2-7.4.1..> | 2025-12-29 22:03 | 864K | |
| py27-setuptools44-44..> | 2025-12-26 19:11 | 512K | |
| py310-build-1.3.0.pkg | 2025-12-18 18:25 | 37K | |
| py310-cython-0.29.37..> | 2025-12-21 02:08 | 1.9M | |
| py310-cython3-3.2.3.pkg | 2025-12-29 16:51 | 2.8M | |
| py310-flit-core-3.12..> | 2025-12-18 06:55 | 76K | |
| py310-gdbm-3.10.19_1..> | 2025-12-24 05:33 | 9.0K | |
| py310-installer-0.7...> | 2025-12-18 11:23 | 236K | |
| py310-packaging-25.0..> | 2025-12-18 13:57 | 102K | |
| py310-pyproject-hook..> | 2025-12-18 11:58 | 16K | |
| py310-setuptools-63...> | 2025-12-19 17:33 | 1.1M | |
| py310-sqlite3-3.10.1..> | 2025-12-21 04:46 | 31K | |
| py310-tkinter-3.10.1..> | 2025-12-29 00:48 | 22K | |
| py310-tomli-2.3.0.pkg | 2025-12-18 12:27 | 22K | |
| py310-wheel-0.45.1.pkg | 2025-12-19 16:03 | 109K | |
| py310-wheel044-0.44...> | 2025-12-18 21:28 | 104K | |
| py311-2048-py-0.1.6_..> | 2025-12-23 13:38 | 11K | |
| py311-APScheduler-3...> | 2025-12-18 22:40 | 121K | |
| py311-AnyQt-0.1.1_1.pkg | 2025-12-19 08:29 | 70K | |
| py311-Automat-25.4.1..> | 2025-12-18 01:13 | 99K | |
| py311-AwesomeTkinter..> | 2025-12-27 15:57 | 79K | |
| py311-BTrees-4.11.3_..> | 2025-12-19 08:55 | 511K | |
| py311-Babel-2.17.0_1..> | 2025-12-16 01:39 | 6.8M | |
| py311-Bootstrap-Flas..> | 2025-12-29 03:51 | 1.7M | |
| py311-CommonMark-0.9..> | 2025-12-16 01:44 | 122K | |
| py311-CouchDB-1.1_2.pkg | 2025-12-22 17:52 | 139K | |
| py311-CyLP-0.92.3_2.pkg | 2025-12-30 08:12 | 625K | |
| py311-DTLSSocket-0.1..> | 2025-12-19 09:30 | 68K | |
| py311-Dumper-1.2.0_1..> | 2025-12-20 10:37 | 17K | |
| py311-Elixir-0.7.1_4..> | 2025-12-23 03:28 | 96K | |
| py311-ExifRead-3.0.0..> | 2025-12-20 01:42 | 79K | |
| py311-Extremes-1.1.1..> | 2025-12-23 15:41 | 4.3K | |
| py311-Faker-15.1.1_2..> | 2025-12-18 23:41 | 2.5M | |
| py311-Farama-Notific..> | 2025-12-20 02:47 | 2.6K | |
| py311-FindSystemFont..> | 2025-12-19 12:58 | 50K | |
| py311-Flask-Admin-1...> | 2025-12-30 16:52 | 3.3M | |
| py311-Flask-Assets-2..> | 2025-12-22 11:10 | 16K | |
| py311-Flask-Bcrypt-1..> | 2025-12-27 20:52 | 7.1K | |
| py311-Flask-Bootstra..> | 2025-12-23 15:42 | 394K | |
| py311-Flask-Cache-0...> | 2025-12-19 17:27 | 23K | |
| py311-Flask-Collect-..> | 2025-12-20 04:52 | 15K | |
| py311-Flask-Compress..> | 2025-12-19 09:33 | 12K | |
| py311-Flask-Cors-5.0..> | 2025-12-19 05:59 | 21K | |
| py311-Flask-FlatPage..> | 2025-12-23 12:24 | 15K | |
| py311-Flask-HTTPAuth..> | 2025-12-19 11:00 | 16K | |
| py311-Flask-JWT-0.3...> | 2025-12-28 11:01 | 11K | |
| py311-Flask-Kerberos..> | 2025-12-21 00:57 | 5.2K | |
| py311-Flask-Login-0...> | 2025-12-19 14:42 | 28K | |
| py311-Flask-Moment-1..> | 2025-12-22 08:43 | 10K | |
| py311-Flask-OAuthlib..> | 2025-12-29 13:18 | 73K | |
| py311-Flask-Principa..> | 2025-12-19 19:17 | 11K | |
| py311-Flask-RESTful-..> | 2025-12-23 08:47 | 48K | |
| py311-Flask-SAML-0.5..> | 2025-12-27 23:09 | 9.3K | |
| py311-Flask-SimpleLD..> | 2025-12-24 07:13 | 16K | |
| py311-Flask-Sockets-..> | 2025-12-23 19:37 | 5.5K | |
| py311-Flask-Sphinx-T..> | 2025-12-27 16:16 | 11K | |
| py311-Flask-Uploads-..> | 2025-12-21 18:00 | 14K | |
| py311-Flask_Limiter3..> | 2025-12-19 05:47 | 61K | |
| py311-Flor-1.1.3_1.pkg | 2025-12-19 14:43 | 5.9K | |
| py311-FreeBSD-ports-..> | 2025-12-24 07:13 | 8.0K | |
| py311-Frozen-Flask-0..> | 2025-12-23 07:53 | 35K | |
| py311-Fuzzy-1.2.2_1.pkg | 2025-12-20 18:03 | 40K | |
| py311-GPy-1.13.2_1.pkg | 2025-12-27 06:24 | 1.7M | |
| py311-GPyOpt-1.2.6_2..> | 2025-12-29 08:43 | 146K | |
| py311-Genesis-PyAPI-..> | 2025-12-30 06:42 | 20K | |
| py311-Genshi-0.7.10.pkg | 2025-12-20 03:34 | 374K | |
| py311-GeoIP2-5.1.0.pkg | 2025-12-26 17:47 | 44K | |
| py311-GridDataFormat..> | 2025-12-26 21:26 | 2.0M | |
| py311-HTSeq-2.0.9_2.pkg | 2025-12-30 10:36 | 323K | |
| py311-HepMC3-3.3.0.pkg | 2025-12-22 21:55 | 910K | |
| py311-HofstadterTool..> | 2025-12-30 08:10 | 1.3M | |
| py311-IBMQuantumExpe..> | 2025-12-28 03:42 | 24K | |
| py311-Ice-3.6.5_2.pkg | 2025-12-21 09:21 | 503K | |
| py311-Ice37-3.7.10.pkg | 2025-12-22 14:19 | 809K | |
| py311-Jinja2-3.1.6.pkg | 2025-12-16 01:39 | 304K | |
| py311-Jinja2-doc-3.1..> | 2025-12-20 05:47 | 289K | |
| py311-Js2Py-0.74_1.pkg | 2025-12-20 03:00 | 3.4M | |
| py311-Levenshtein-0...> | 2025-12-26 22:17 | 126K | |
| py311-Louie-2.0_1.pkg | 2025-12-20 15:17 | 34K | |
| py311-MACS3-3.0.3.pkg | 2025-12-28 10:15 | 1.8M | |
| py311-MDAnalysis-2.7..> | 2025-12-27 16:25 | 2.2M | |
| py311-MDAnalysisTest..> | 2025-12-28 11:01 | 47M | |
| py311-ManimPango-0.5..> | 2025-12-29 18:05 | 58K | |
| py311-Mathics3-9.0.0..> | 2025-12-27 09:11 | 4.2M | |
| py311-Mathics_Scanne..> | 2025-12-18 23:27 | 148K | |
| py311-Morfessor-2.0...> | 2025-12-21 12:42 | 80K | |
| py311-MutatorMath-2...> | 2025-12-26 13:47 | 68K | |
| py311-Nasdaq-Data-Li..> | 2025-12-28 10:19 | 49K | |
| py311-OWSLib-0.32.1.pkg | 2025-12-27 09:02 | 445K | |
| py311-OpenFermion-1...> | 2025-12-27 14:17 | 34M | |
| py311-OpenFermion-Di..> | 2025-12-28 00:41 | 31K | |
| py311-POT-0.9.3.pkg | 2025-12-30 15:10 | 434K | |
| py311-PYB11Generator..> | 2025-12-20 11:59 | 29K | |
| py311-Pallets-Sphinx..> | 2025-12-26 19:53 | 34K | |
| py311-Paste-3.10.1_1..> | 2025-12-18 13:44 | 531K | |
| py311-PeachPy-0.0.1_..> | 2025-12-20 06:31 | 673K | |
| py311-Pituophis-1.1_..> | 2025-12-23 11:32 | 19K | |
| py311-Pmw-2.0.1_2.pkg | 2025-12-27 12:57 | 409K | |
| py311-PollyReports-1..> | 2025-12-22 03:44 | 15K | |
| py311-PuLP-3.0.2_1.pkg | 2025-12-26 21:57 | 4.3M | |
| py311-PubChemPy-1.0...> | 2025-12-18 21:38 | 34K | |
| py311-Py-BOBYQA-1.5...> | 2025-12-27 03:32 | 103K | |
| py311-PyExecJS-1.5.1..> | 2025-12-26 20:25 | 26K | |
| py311-PyFR-2.1.pkg | 2025-12-29 07:40 | 745K | |
| py311-PyGithub-2.8.1..> | 2025-12-26 22:29 | 472K | |
| py311-PyGreSQL-6.0_1..> | 2025-12-24 02:16 | 221K | |
| py311-PyHamcrest-2.0..> | 2025-12-20 23:42 | 64K | |
| py311-PyInquirer-1.0..> | 2025-12-22 14:36 | 47K | |
| py311-PyLD-0.7.1_2.pkg | 2025-12-20 15:35 | 92K | |
| py311-PyMetis-2023.1..> | 2025-12-21 13:01 | 244K | |
| py311-PyMuPDF-1.22.5..> | 2025-12-19 23:58 | 11M | |
| py311-PyOgg-0.6.14.a..> | 2025-12-27 11:28 | 82K | |
| py311-PyOpenGL-3.1.7..> | 2025-12-26 16:26 | 1.4M | |
| py311-PyOpenGL-accel..> | 2025-12-27 04:01 | 216K | |
| py311-PyPubSub-4.0.3..> | 2025-12-19 19:52 | 106K | |
| py311-PyQt-builder-1..> | 2025-12-26 09:01 | 3.8M | |
| py311-PyQt5-sip-12.1..> | 2025-12-26 08:44 | 61K | |
| py311-PyQt6-sip-13.1..> | 2025-12-26 15:36 | 57K | |
| py311-PySCIPOpt-5.6...> | 2025-12-27 16:20 | 733K | |
| py311-PyUserInput-0...> | 2025-12-23 14:43 | 64K | |
| py311-PyUtilib-6.0.0..> | 2025-12-24 07:01 | 478K | |
| py311-PyWavefront-1...> | 2025-12-19 20:11 | 39K | |
| py311-Pympler-1.0.1_..> | 2025-12-18 23:20 | 299K | |
| py311-Pyomo-6.8.1_1.pkg | 2025-12-29 12:22 | 6.4M | |
| py311-Pyrseas-0.10.0..> | 2025-12-23 14:19 | 208K | |
| py311-QDarkStyle-3.2..> | 2025-12-19 11:54 | 626K | |
| py311-QSpectrumAnaly..> | 2025-12-30 08:59 | 78K | |
| py311-QtAwesome-1.4...> | 2025-12-20 11:22 | 1.7M | |
| py311-QtPy-2.4.1.pkg | 2025-12-18 12:39 | 125K | |
| py311-SQCommon-0.3.2..> | 2025-12-27 01:25 | 5.6K | |
| py311-SQImFil-0.3.7.pkg | 2025-12-27 16:12 | 52K | |
| py311-SQLAlchemy-Ima..> | 2025-12-29 21:45 | 64K | |
| py311-SQNomad-0.2.3.pkg | 2025-12-27 04:18 | 783K | |
| py311-SQSnobFit-0.4...> | 2025-12-27 12:48 | 69K | |
| py311-SecretStorage-..> | 2025-12-26 14:10 | 26K | |
| py311-SimpleSoapy-1...> | 2025-12-26 22:59 | 15K | |
| py311-SimpleSpectral..> | 2025-12-26 22:55 | 11K | |
| py311-SoapySDR-0.8.1..> | 2025-12-18 18:01 | 382K | |
| py311-SoundFile-0.13..> | 2025-12-26 18:54 | 44K | |
| py311-Speedometer-2...> | 2025-12-23 04:36 | 35K | |
| py311-StrEnum-0.4.15..> | 2025-12-19 00:21 | 12K | |
| py311-SudachiPy-0.6...> | 2025-12-28 08:29 | 1.3M | |
| py311-Tempita-0.5.2_..> | 2025-12-20 02:37 | 35K | |
| py311-Tenjin-1.1.1_1..> | 2025-12-20 05:46 | 85K | |
| py311-TonieToolbox-0..> | 2025-12-27 20:13 | 302K | |
| py311-Tubes-0.2.1.pkg | 2025-12-19 01:37 | 109K | |
| py311-TurboGears2-2...> | 2025-12-21 16:12 | 463K | |
| py311-Unipath-1.1_1.pkg | 2025-12-21 22:35 | 20K | |
| py311-Wand-0.6.13_1.pkg | 2025-12-27 18:42 | 256K | |
| py311-WebError-0.13...> | 2025-12-23 19:26 | 121K | |
| py311-WebFlash-0.1a9..> | 2025-12-20 21:08 | 11K | |
| py311-WsgiDAV-4.3.3.pkg | 2025-12-21 16:48 | 282K | |
| py311-XlsxWriter-3.2..> | 2025-12-18 15:53 | 313K | |
| py311-YouCompleteMe-..> | 2025-12-23 22:25 | 1.4M | |
| py311-YubiOTP-1.0.0_..> | 2025-12-20 02:08 | 22K | |
| py311-ZConfig-4.2.pkg | 2025-12-19 15:26 | 223K | |
| py311-Zopkio-0.2.5_9..> | 2025-12-29 19:47 | 87K | |
| py311-abipy-0.9.8_3.pkg | 2025-12-28 05:33 | 13M | |
| py311-about-time-4.2..> | 2025-12-19 10:26 | 19K | |
| py311-absl-0.7.1_2.pkg | 2025-12-20 13:06 | 201K | |
| py311-absl-py-2.1.0_..> | 2025-12-19 02:06 | 235K | |
| py311-accelerate-1.1..> | 2025-12-26 20:29 | 676K | |
| py311-access-1.1.9_3..> | 2025-12-27 17:34 | 37K | |
| py311-accessible-pyg..> | 2025-12-18 00:44 | 1.3M | |
| py311-acefile-0.6.13..> | 2025-12-20 17:25 | 102K | |
| py311-acme-4.2.0_1,1..> | 2025-12-26 20:42 | 198K | |
| py311-acora-2.5_1.pkg | 2025-12-21 07:29 | 134K | |
| py311-acstore-202404..> | 2025-12-20 00:26 | 45K | |
| py311-actdiag-3.0.0_..> | 2025-12-27 12:43 | 2.1M | |
| py311-adafruit-ampy-..> | 2025-12-20 07:44 | 29K | |
| py311-adal-1.2.7_4.pkg | 2025-12-26 18:35 | 83K | |
| py311-adb-1.3.0.9_1.pkg | 2025-12-29 18:07 | 66K | |
| py311-adblock-0.6.0_..> | 2025-12-27 12:50 | 1.1M | |
| py311-addict-2.4.0_1..> | 2025-12-18 19:11 | 7.4K | |
| py311-adns-1.6.0.pkg | 2025-12-19 15:03 | 17K | |
| py311-advocate-1.0.0..> | 2025-12-21 10:58 | 64K | |
| py311-aeidon-1.15.pkg | 2025-12-19 05:50 | 269K | |
| py311-aenum-2.2.4_1.pkg | 2025-12-19 17:07 | 212K | |
| py311-aesqlapius-0.0..> | 2025-12-22 15:11 | 31K | |
| py311-afdko-4.0.3.pkg | 2025-12-26 19:13 | 1.0M | |
| py311-afew-3.0.1_3.pkg | 2025-12-29 19:16 | 238K | |
| py311-affine-2.4.0_2..> | 2025-12-18 13:55 | 34K | |
| py311-agate-1.14.0.pkg | 2025-12-26 19:21 | 129K | |
| py311-agate-dbf-0.2...> | 2025-12-26 21:07 | 3.4K | |
| py311-agate-excel-0...> | 2025-12-26 20:40 | 11K | |
| py311-agate-sql-0.7...> | 2025-12-27 01:02 | 12K | |
| py311-aggregate6-1.0..> | 2025-12-19 13:02 | 11K | |
| py311-agx-emulsion-0..> | 2025-12-30 00:12 | 9.1M | |
| py311-aider_chat-0.8..> | 2025-12-28 00:14 | 513K | |
| py311-ailment-9.0.54..> | 2025-12-19 08:29 | 34K | |
| py311-aioapns-4.0_1.pkg | 2025-12-29 10:58 | 29K | |
| py311-aioboto3-15.5...> | 2025-12-27 13:19 | 69K | |
| py311-aiobotocore-2...> | 2025-12-26 23:17 | 166K | |
| py311-aiobreaker-1.2..> | 2025-12-23 03:42 | 44K | |
| py311-aiocoap-0.4.17..> | 2025-12-20 02:32 | 426K | |
| py311-aiodataloader-..> | 2025-12-19 11:40 | 16K | |
| py311-aiodns-3.2.0_1..> | 2025-12-18 12:48 | 10K | |
| py311-aiofiles-23.2...> | 2025-12-18 20:20 | 25K | |
| py311-aioftp-0.26.2.pkg | 2025-12-18 21:32 | 105K | |
| py311-aioh2-0.2.3_1.pkg | 2025-12-22 04:29 | 24K | |
| py311-aiohappyeyebal..> | 2025-12-18 02:27 | 23K | |
| py311-aiohttp-3.11.1..> | 2025-12-18 04:03 | 632K | |
| py311-aiohttp-apispe..> | 2025-12-26 22:56 | 1.5M | |
| py311-aiohttp-jinja2..> | 2025-12-18 21:10 | 13K | |
| py311-aiohttp-middle..> | 2025-12-22 17:13 | 24K | |
| py311-aiohttp-oauthl..> | 2025-12-29 04:13 | 14K | |
| py311-aiohttp-securi..> | 2025-12-18 21:12 | 11K | |
| py311-aiohttp-sessio..> | 2025-12-18 17:20 | 20K | |
| py311-aiohttp-socks-..> | 2025-12-18 23:59 | 16K | |
| py311-aiohttp-wsgi-0..> | 2025-12-23 12:35 | 21K | |
| py311-aiohttp_cors-0..> | 2025-12-21 19:05 | 32K | |
| py311-aioice-0.10.2.pkg | 2025-12-27 17:57 | 63K | |
| py311-aioitertools-0..> | 2025-12-18 16:57 | 59K | |
| py311-aiolimiter-1.2..> | 2025-12-21 03:29 | 10K | |
| py311-aiologger-0.7...> | 2025-12-18 19:38 | 49K | |
| py311-aiomcache-0.7...> | 2025-12-18 11:42 | 30K | |
| py311-aiomysql-0.3.2..> | 2025-12-21 03:18 | 110K | |
| py311-aiopg-1.4.0_1.pkg | 2025-12-20 20:42 | 71K | |
| py311-aioquic-1.3.0_..> | 2025-12-26 09:20 | 232K | |
| py311-aioredis-1.3.1..> | 2025-12-18 11:58 | 129K | |
| py311-aioresponses-0..> | 2025-12-21 04:22 | 23K | |
| py311-aiorpcX-0.25.0..> | 2025-12-19 02:18 | 78K | |
| py311-aiorpcX-legacy..> | 2025-12-24 04:48 | 77K | |
| py311-aiorwlock-1.5...> | 2025-12-22 12:36 | 13K | |
| py311-aiosignal-1.4...> | 2025-12-18 03:18 | 8.8K | |
| py311-aiosmtpd-1.4.6..> | 2025-12-19 00:05 | 260K | |
| py311-aiosql-14.1.pkg | 2025-12-19 09:37 | 47K | |
| py311-aiosqlite-0.19..> | 2025-12-18 17:23 | 40K | |
| py311-aiostalk-1.3.1..> | 2025-12-19 14:01 | 10K | |
| py311-aiostream-0.7...> | 2025-12-19 00:50 | 70K | |
| py311-airtable-pytho..> | 2025-12-28 16:22 | 21K | |
| py311-al-0.1.0_1.pkg | 2025-12-23 02:33 | 149K | |
| py311-alabaster-0.7...> | 2025-12-16 01:40 | 14K | |
| py311-albucore-0.0.2..> | 2025-12-27 04:03 | 36K | |
| py311-albumentations..> | 2025-12-29 16:49 | 490K | |
| py311-alembic-1.15.2..> | 2025-12-26 18:36 | 422K | |
| py311-algopy-0.5.7_4..> | 2025-12-28 03:27 | 274K | |
| py311-alive-progress..> | 2025-12-21 20:39 | 132K | |
| py311-all-repos-1.31..> | 2025-12-23 04:31 | 70K | |
| py311-alot-0.9_2.pkg | 2025-12-27 21:01 | 279K | |
| py311-alpha-vantage-..> | 2025-12-30 13:46 | 36K | |
| py311-altair-6.0.0.pkg | 2025-12-26 15:53 | 586K | |
| py311-altgraph-0.17...> | 2025-12-19 23:25 | 37K | |
| py311-amalgamate-0.1..> | 2025-12-23 15:58 | 21K | |
| py311-amaranth-0.5.8..> | 2025-12-30 07:01 | 944K | |
| py311-ambit-0.7.1_3.pkg | 2025-12-29 16:26 | 147K | |
| py311-amply-0.1.6_1.pkg | 2025-12-18 18:26 | 25K | |
| py311-amqp-5.2.0_1.pkg | 2025-12-18 12:03 | 89K | |
| py311-amqplib-1.0.2_..> | 2025-12-23 06:41 | 57K | |
| py311-animatplot-0.4..> | 2025-12-27 16:33 | 26K | |
| py311-animatplot-ng-..> | 2025-12-30 14:47 | 33K | |
| py311-aniso8601-10.0..> | 2025-12-18 23:17 | 99K | |
| py311-aniso86016-6.0..> | 2025-12-18 21:02 | 77K | |
| py311-anndata-0.12.6..> | 2025-12-27 10:02 | 367K | |
| py311-annotated-type..> | 2025-12-18 04:14 | 21K | |
| py311-annoy-1.17.3_1..> | 2025-12-22 02:44 | 53K | |
| py311-ansi-0.3.7.pkg | 2025-12-19 11:03 | 16K | |
| py311-ansi2html-1.8...> | 2025-12-20 02:07 | 33K | |
| py311-ansible-11.7.0..> | 2025-12-27 12:55 | 41M | |
| py311-ansible-compat..> | 2025-12-27 14:45 | 46K | |
| py311-ansible-core-2..> | 2025-12-26 23:55 | 3.2M | |
| py311-ansible-core21..> | 2025-12-30 08:34 | 3.5M | |
| py311-ansible-iocage..> | 2025-12-29 21:55 | 7.0K | |
| py311-ansible-kld-g2..> | 2025-12-30 10:51 | 2.2K | |
| py311-ansible-lint-6..> | 2025-12-29 02:55 | 352K | |
| py311-ansible-runner..> | 2025-12-29 18:24 | 151K | |
| py311-ansible-sysrc-..> | 2025-12-27 22:37 | 3.1K | |
| py311-ansicolors-1.1..> | 2025-12-19 12:28 | 16K | |
| py311-ansiwrap-0.8.4..> | 2025-12-23 16:35 | 12K | |
| py311-anthropic-0.64..> | 2025-12-27 16:59 | 306K | |
| py311-antlr4-python3..> | 2025-12-18 21:56 | 232K | |
| py311-anyascii-0.3.3..> | 2025-12-19 01:09 | 293K | |
| py311-anyconfig-0.9...> | 2025-12-21 07:27 | 103K | |
| py311-anyio-4.12.0.pkg | 2025-12-18 01:46 | 248K | |
| py311-anyio3-3.7.1.pkg | 2025-12-19 15:48 | 176K | |
| py311-anyjson-0.3.3_..> | 2025-12-23 09:46 | 6.8K | |
| py311-anymarkup-0.8...> | 2025-12-24 04:48 | 6.7K | |
| py311-anymarkup-core..> | 2025-12-19 22:07 | 13K | |
| py311-anysqlite-0.0...> | 2025-12-19 02:08 | 6.9K | |
| py311-anytree-2.13.0..> | 2025-12-19 17:17 | 63K | |
| py311-anywidget-0.9...> | 2025-12-28 09:39 | 118K | |
| py311-apache-arrow-2..> | 2025-12-30 11:50 | 4.8M | |
| py311-apache-beam-2...> | 2025-12-30 01:05 | 5.8M | |
| py311-apache_conf_pa..> | 2025-12-22 17:40 | 34K | |
| py311-apetag-1.2_2.pkg | 2025-12-20 08:34 | 23K | |
| py311-apgl-0.8.1_5.pkg | 2025-12-30 10:29 | 227K | |
| py311-apipkg-1.5_1.pkg | 2025-12-23 11:31 | 9.9K | |
| py311-apispec-6.8.2.pkg | 2025-12-26 19:11 | 55K | |
| py311-apispec-webfra..> | 2025-12-28 03:02 | 13K | |
| py311-apitran-g20180..> | 2025-12-30 17:20 | 44M | |
| py311-app-model-0.5...> | 2025-12-26 21:39 | 127K | |
| py311-appdirs-1.4.4_..> | 2025-12-18 01:12 | 15K | |
| py311-applicationins..> | 2025-12-18 17:23 | 73K | |
| py311-apprise-1.8.1.pkg | 2025-12-27 17:51 | 1.2M | |
| py311-apptools-5.3.1..> | 2025-12-26 13:33 | 319K | |
| py311-apsw-3.50.4.0.pkg | 2025-12-19 17:16 | 1.1M | |
| py311-arabic-reshape..> | 2025-12-19 23:00 | 32K | |
| py311-arbor-0.11.0.pkg | 2025-12-30 11:35 | 660K | |
| py311-arch-6.3.0.pkg | 2025-12-30 15:36 | 1.2M | |
| py311-archinfo-9.2.1..> | 2025-12-18 17:54 | 85K | |
| py311-archspec-0.2.5..> | 2025-12-22 13:30 | 65K | |
| py311-argcomplete-3...> | 2025-12-18 17:13 | 73K | |
| py311-argh-0.31.3.pkg | 2025-12-19 15:00 | 59K | |
| py311-argon2-cffi-21..> | 2025-12-18 01:50 | 22K | |
| py311-argon2-cffi-bi..> | 2025-12-18 01:38 | 14K | |
| py311-argparse-1.4.0..> | 2025-12-18 18:47 | 52K | |
| py311-argparse-manpa..> | 2025-12-20 15:12 | 45K | |
| py311-argparse_addon..> | 2025-12-18 18:29 | 4.5K | |
| py311-args-0.1.0_1.pkg | 2025-12-18 21:36 | 8.4K | |
| py311-ariadne-0.22.pkg | 2025-12-20 02:29 | 166K | |
| py311-arouteserver-1..> | 2025-12-28 06:12 | 322K | |
| py311-arpeggio-2.0.3..> | 2025-12-18 21:51 | 67K | |
| py311-array-api-comp..> | 2025-12-18 19:21 | 95K | |
| py311-arrow-1.4.0.pkg | 2025-12-18 01:12 | 133K | |
| py311-artifacts-2024..> | 2025-12-19 14:42 | 96K | |
| py311-arviz-0.23.0.pkg | 2025-12-27 18:33 | 1.9M | |
| py311-arxiv-2.3.1.pkg | 2025-12-27 22:27 | 21K | |
| py311-arybo-1.1.0_3.pkg | 2025-12-30 11:27 | 77K | |
| py311-asap3-3.12.8_4..> | 2025-12-28 10:02 | 797K | |
| py311-ascii-magic-2...> | 2025-12-29 09:54 | 721K | |
| py311-asciimatics-1...> | 2025-12-30 06:12 | 244K | |
| py311-asciinema-2.4...> | 2025-12-21 13:18 | 124K | |
| py311-asciitree-0.3...> | 2025-12-18 18:55 | 8.7K | |
| py311-asdf-5.1.0.pkg | 2025-12-27 13:16 | 950K | |
| py311-asdf-standard-..> | 2025-12-18 18:15 | 31K | |
| py311-asdf-transform..> | 2025-12-19 02:02 | 67K | |
| py311-ase-3.26.0.pkg | 2025-12-26 20:05 | 4.5M | |
| py311-asgi-csrf-0.11..> | 2025-12-20 00:32 | 18K | |
| py311-asgi-lifespan-..> | 2025-12-22 06:12 | 16K | |
| py311-asgiref-3.11.0..> | 2025-12-18 03:53 | 45K | |
| py311-asn1-2.7.0_1,1..> | 2025-12-20 07:52 | 18K | |
| py311-asn1crypto-1.5..> | 2025-12-18 12:29 | 216K | |
| py311-asonic-2.0.0_1..> | 2025-12-20 20:39 | 12K | |
| py311-aspectlib-2.0...> | 2025-12-22 04:28 | 54K | |
| py311-aspy.yaml-1.3...> | 2025-12-22 22:14 | 3.9K | |
| py311-assertpy-1.1_1..> | 2025-12-21 08:33 | 56K | |
| py311-ast-comments-1..> | 2025-12-20 04:07 | 12K | |
| py311-ast-decompiler..> | 2025-12-22 16:43 | 35K | |
| py311-ast2json-0.4_1..> | 2025-12-23 16:31 | 7.5K | |
| py311-asteval-1.0.5_..> | 2025-12-27 00:21 | 50K | |
| py311-astlib-0.11.10..> | 2025-12-30 11:07 | 466K | |
| py311-astor-0.8.1_1.pkg | 2025-12-18 17:37 | 59K | |
| py311-astral-3.2_1.pkg | 2025-12-21 03:08 | 73K | |
| py311-astroML-1.0.2_..> | 2025-12-29 05:14 | 211K | |
| py311-astroid-4.0.2.pkg | 2025-12-18 11:21 | 496K | |
| py311-astroid2-2.15...> | 2025-12-19 02:53 | 496K | |
| py311-astropy-7.1.1,..> | 2025-12-26 16:09 | 8.4M | |
| py311-astropy-healpi..> | 2025-12-29 11:29 | 108K | |
| py311-astropy-helper..> | 2025-12-30 16:51 | 67K | |
| py311-astropy-iers-d..> | 2025-12-18 10:21 | 1.2M | |
| py311-astroquery-0.4..> | 2025-12-30 18:52 | 10M | |
| py311-asttokens-3.0...> | 2025-12-18 01:35 | 40K | |
| py311-astunparse-1.6..> | 2025-12-18 03:54 | 29K | |
| py311-asv-0.6.1_1.pkg | 2025-12-21 02:13 | 314K | |
| py311-asv-runner-0.1..> | 2025-12-19 03:03 | 79K | |
| py311-async-lru-2.0...> | 2025-12-18 03:44 | 12K | |
| py311-async_generato..> | 2025-12-18 01:09 | 43K | |
| py311-async_timeout-..> | 2025-12-18 01:09 | 7.9K | |
| py311-asyncmy-0.2.10..> | 2025-12-24 02:23 | 797K | |
| py311-asyncpg-0.30.0..> | 2025-12-20 02:10 | 570K | |
| py311-asyncssh-2.21...> | 2025-12-26 23:00 | 749K | |
| py311-asynctest-0.13..> | 2025-12-23 05:02 | 56K | |
| py311-atom-0.12.1.pkg | 2025-12-21 20:58 | 147K | |
| py311-atomiclong-0.1..> | 2025-12-20 23:20 | 7.0K | |
| py311-atomium-1.0.11..> | 2025-12-30 17:54 | 110K | |
| py311-atpublic-5.0.pkg | 2025-12-18 18:36 | 7.0K | |
| py311-atspi-2.46.1.pkg | 2025-12-27 01:36 | 73K | |
| py311-attr-0.3.2.pkg | 2025-12-21 09:19 | 3.1K | |
| py311-attrdict-2.0.1..> | 2025-12-22 21:51 | 14K | |
| py311-attrs-25.4.0.pkg | 2025-12-18 00:23 | 111K | |
| py311-attrs-strict-1..> | 2025-12-23 12:10 | 21K | |
| py311-aubio-0.4.9_3.pkg | 2025-12-29 02:26 | 64K | |
| py311-audioread-3.1...> | 2025-12-18 14:32 | 38K | |
| py311-auditok-0.3.0_..> | 2025-12-30 12:42 | 1.3M | |
| py311-authheaders-0...> | 2025-12-26 23:06 | 99K | |
| py311-authlib-1.6.6.pkg | 2025-12-26 16:27 | 356K | |
| py311-authres-1.2.0_..> | 2025-12-18 12:41 | 35K | |
| py311-autobahn-24.4...> | 2025-12-26 21:27 | 932K | |
| py311-autocommand-2...> | 2025-12-18 11:57 | 22K | |
| py311-autoflake-2.3...> | 2025-12-22 04:21 | 74K | |
| py311-autograd-1.6.1..> | 2025-12-27 10:18 | 141K | |
| py311-autokey-0.95.1..> | 2025-12-29 04:49 | 333K | |
| py311-automaton-3.3...> | 2025-12-27 13:22 | 40K | |
| py311-autopage-0.5.2..> | 2025-12-18 12:56 | 65K | |
| py311-autopep8-2.3.2..> | 2025-12-19 01:51 | 108K | |
| py311-autoprop-1.0.1..> | 2025-12-19 13:06 | 7.9K | |
| py311-autoray-0.8.4.pkg | 2025-12-23 10:29 | 1.0M | |
| py311-autotiling-1.9..> | 2025-12-22 00:19 | 11K | |
| py311-avahi-0.8_5.pkg | 2025-12-27 19:18 | 19K | |
| py311-avocado-framew..> | 2025-12-23 17:26 | 785K | |
| py311-avogadrolibs-1..> | 2025-12-28 03:09 | 122K | |
| py311-avro-1.12.1.pkg | 2025-12-19 14:06 | 230K | |
| py311-awesome-slugif..> | 2025-12-23 05:01 | 20K | |
| py311-awesomeversion..> | 2025-12-20 11:17 | 24K | |
| py311-awkward-2.8.11..> | 2025-12-26 21:39 | 1.3M | |
| py311-awkward-cpp-51..> | 2025-12-26 20:24 | 478K | |
| py311-aws-lambda-bui..> | 2025-12-22 13:56 | 170K | |
| py311-aws-requests-a..> | 2025-12-30 10:20 | 11K | |
| py311-aws-sam-transl..> | 2025-12-27 02:40 | 562K | |
| py311-aws-xray-sdk-2..> | 2025-12-29 15:41 | 158K | |
| py311-awscli-1.42.44..> | 2025-12-27 16:18 | 1.9M | |
| py311-awscrt-0.30.0.pkg | 2025-12-30 09:03 | 225K | |
| py311-axisregistry-0..> | 2025-12-27 02:53 | 41K | |
| py311-azure-appconfi..> | 2025-12-27 16:28 | 47K | |
| py311-azure-batch-14..> | 2025-12-27 02:50 | 196K | |
| py311-azure-cli-2.55..> | 2025-12-29 19:08 | 8.8M | |
| py311-azure-cli-acr-..> | 2025-12-29 05:43 | 128K | |
| py311-azure-cli-base..> | 2025-12-18 05:28 | 1.6K | |
| py311-azure-cli-core..> | 2025-12-27 10:15 | 517K | |
| py311-azure-cli-tele..> | 2025-12-18 22:53 | 21K | |
| py311-azure-common-1..> | 2025-12-18 07:57 | 20K | |
| py311-azure-core-1.3..> | 2025-12-26 14:53 | 274K | |
| py311-azure-core-tra..> | 2025-12-30 06:22 | 18K | |
| py311-azure-cosmos-3..> | 2025-12-27 05:25 | 143K | |
| py311-azure-data-tab..> | 2025-12-28 04:22 | 195K | |
| py311-azure-datalake..> | 2025-12-27 09:42 | 111K | |
| py311-azure-function..> | 2025-12-28 09:40 | 61K | |
| py311-azure-graphrba..> | 2025-12-27 12:39 | 76K | |
| py311-azure-identity..> | 2025-12-29 15:56 | 125K | |
| py311-azure-keyvault..> | 2025-12-29 12:25 | 161K | |
| py311-azure-keyvault..> | 2025-12-27 16:06 | 139K | |
| py311-azure-keyvault..> | 2025-12-27 16:16 | 210K | |
| py311-azure-keyvault..> | 2025-12-27 17:02 | 257K | |
| py311-azure-keyvault..> | 2025-12-27 10:45 | 163K | |
| py311-azure-loganaly..> | 2025-12-27 03:12 | 14K | |
| py311-azure-mgmt-adv..> | 2025-12-27 16:12 | 44K | |
| py311-azure-mgmt-api..> | 2025-12-27 11:48 | 541K | |
| py311-azure-mgmt-app..> | 2025-12-27 06:26 | 148K | |
| py311-azure-mgmt-app..> | 2025-12-27 14:49 | 201K | |
| py311-azure-mgmt-app..> | 2025-12-27 19:18 | 157K | |
| py311-azure-mgmt-aut..> | 2025-12-27 03:18 | 443K | |
| py311-azure-mgmt-bat..> | 2025-12-27 16:49 | 180K | |
| py311-azure-mgmt-bat..> | 2025-12-27 03:21 | 93K | |
| py311-azure-mgmt-bil..> | 2025-12-27 12:55 | 124K | |
| py311-azure-mgmt-bot..> | 2025-12-27 09:56 | 83K | |
| py311-azure-mgmt-cdn..> | 2025-12-27 17:03 | 207K | |
| py311-azure-mgmt-cog..> | 2025-12-27 06:02 | 160K | |
| py311-azure-mgmt-com..> | 2025-12-27 12:06 | 4.5M | |
| py311-azure-mgmt-con..> | 2025-12-30 04:06 | 64K | |
| py311-azure-mgmt-con..> | 2025-12-27 17:34 | 121K | |
| py311-azure-mgmt-con..> | 2025-12-27 09:05 | 555K | |
| py311-azure-mgmt-con..> | 2025-12-27 04:24 | 1.4M | |
| py311-azure-mgmt-cor..> | 2025-12-26 23:05 | 25K | |
| py311-azure-mgmt-cos..> | 2025-12-27 16:07 | 328K | |
| py311-azure-mgmt-dat..> | 2025-12-27 19:24 | 338K | |
| py311-azure-mgmt-dat..> | 2025-12-30 08:02 | 146K | |
| py311-azure-mgmt-dat..> | 2025-12-27 18:37 | 52K | |
| py311-azure-mgmt-dat..> | 2025-12-27 18:06 | 182K | |
| py311-azure-mgmt-dep..> | 2025-12-28 17:57 | 45K | |
| py311-azure-mgmt-dev..> | 2025-12-27 05:58 | 126K | |
| py311-azure-mgmt-dns..> | 2025-12-27 13:09 | 73K | |
| py311-azure-mgmt-eve..> | 2025-12-27 03:02 | 171K | |
| py311-azure-mgmt-eve..> | 2025-12-27 16:41 | 230K | |
| py311-azure-mgmt-ext..> | 2025-12-27 17:09 | 40K | |
| py311-azure-mgmt-hdi..> | 2025-12-27 17:48 | 119K | |
| py311-azure-mgmt-ima..> | 2025-12-27 16:41 | 114K | |
| py311-azure-mgmt-iot..> | 2025-12-27 16:36 | 53K | |
| py311-azure-mgmt-iot..> | 2025-12-27 02:15 | 365K | |
| py311-azure-mgmt-iot..> | 2025-12-27 16:52 | 64K | |
| py311-azure-mgmt-key..> | 2025-12-27 15:47 | 297K | |
| py311-azure-mgmt-kus..> | 2025-12-27 18:46 | 53K | |
| py311-azure-mgmt-log..> | 2025-12-27 16:10 | 130K | |
| py311-azure-mgmt-man..> | 2025-12-27 02:55 | 28K | |
| py311-azure-mgmt-man..> | 2025-12-27 16:09 | 57K | |
| py311-azure-mgmt-map..> | 2025-12-27 10:21 | 42K | |
| py311-azure-mgmt-mar..> | 2025-12-27 18:01 | 29K | |
| py311-azure-mgmt-med..> | 2025-12-27 10:32 | 196K | |
| py311-azure-mgmt-mon..> | 2025-12-27 17:01 | 476K | |
| py311-azure-mgmt-msi..> | 2025-12-27 11:39 | 118K | |
| py311-azure-mgmt-net..> | 2025-12-27 12:32 | 212K | |
| py311-azure-mgmt-net..> | 2025-12-28 07:23 | 897K | |
| py311-azure-mgmt-pol..> | 2025-12-27 07:25 | 165K | |
| py311-azure-mgmt-pri..> | 2025-12-27 02:57 | 46K | |
| py311-azure-mgmt-rdb..> | 2025-12-27 03:36 | 422K | |
| py311-azure-mgmt-rec..> | 2025-12-27 09:13 | 129K | |
| py311-azure-mgmt-rec..> | 2025-12-27 03:40 | 352K | |
| py311-azure-mgmt-red..> | 2025-12-27 02:16 | 149K | |
| py311-azure-mgmt-red..> | 2025-12-27 07:28 | 132K | |
| py311-azure-mgmt-rel..> | 2025-12-30 00:25 | 41K | |
| py311-azure-mgmt-res..> | 2025-12-30 02:58 | 154K | |
| py311-azure-mgmt-res..> | 2025-12-27 05:37 | 1.0M | |
| py311-azure-mgmt-sea..> | 2025-12-27 08:45 | 118K | |
| py311-azure-mgmt-sec..> | 2025-12-27 17:34 | 545K | |
| py311-azure-mgmt-ser..> | 2025-12-27 15:16 | 332K | |
| py311-azure-mgmt-ser..> | 2025-12-27 18:43 | 119K | |
| py311-azure-mgmt-ser..> | 2025-12-27 12:34 | 101K | |
| py311-azure-mgmt-ser..> | 2025-12-27 10:10 | 119K | |
| py311-azure-mgmt-sig..> | 2025-12-27 18:42 | 136K | |
| py311-azure-mgmt-sql..> | 2025-12-27 09:09 | 724K | |
| py311-azure-mgmt-sql..> | 2025-12-27 11:32 | 123K | |
| py311-azure-mgmt-sto..> | 2025-12-27 16:41 | 705K | |
| py311-azure-mgmt-syn..> | 2025-12-27 18:34 | 329K | |
| py311-azure-mgmt-tra..> | 2025-12-27 14:32 | 50K | |
| py311-azure-mgmt-web..> | 2025-12-27 16:47 | 4.4M | |
| py311-azure-monitor-..> | 2025-12-28 08:29 | 124K | |
| py311-azure-multiapi..> | 2025-12-27 15:59 | 1.7M | |
| py311-azure-storage-..> | 2025-12-29 16:01 | 222K | |
| py311-azure-storage-..> | 2025-12-26 15:37 | 117K | |
| py311-azure-storage-..> | 2025-12-26 14:02 | 77K | |
| py311-azure-synapse-..> | 2025-12-27 15:46 | 32K | |
| py311-azure-synapse-..> | 2025-12-27 02:16 | 514K | |
| py311-azure-synapse-..> | 2025-12-27 09:35 | 29K | |
| py311-azure-synapse-..> | 2025-12-27 08:14 | 35K | |
| py311-b2-4.4.2.pkg | 2025-12-30 00:29 | 165K | |
| py311-b2sdk-2.9.4.pkg | 2025-12-26 20:30 | 455K | |
| py311-babelfish-0.6...> | 2025-12-19 00:50 | 92K | |
| py311-babelfont-3.1...> | 2025-12-28 15:20 | 527K | |
| py311-babi-1.6.1.pkg | 2025-12-20 23:16 | 132K | |
| py311-babi_grammars-..> | 2025-12-19 12:27 | 252K | |
| py311-backcall-0.2.0..> | 2025-12-21 19:44 | 22K | |
| py311-backoff-2.2.1_..> | 2025-12-18 16:03 | 21K | |
| py311-backports-1.pkg | 2025-12-18 17:17 | 1.1K | |
| py311-backports.cach..> | 2025-12-22 00:02 | 7.3K | |
| py311-backports.csv-..> | 2025-12-22 12:11 | 28K | |
| py311-backports.entr..> | 2025-12-23 17:16 | 11K | |
| py311-backports.tarf..> | 2025-12-18 06:46 | 68K | |
| py311-backports.zone..> | 2025-12-22 10:13 | 50K | |
| py311-backports.zstd..> | 2025-12-26 16:55 | 210K | |
| py311-backrefs-6.1.pkg | 2025-12-18 20:19 | 339K | |
| py311-backtrader-1.9..> | 2025-12-21 02:06 | 554K | |
| py311-badkeys-0.0.11..> | 2025-12-29 03:00 | 374K | |
| py311-banal-1.0.6_1.pkg | 2025-12-18 19:50 | 9.4K | |
| py311-bandit-1.7.10_..> | 2025-12-26 15:05 | 175K | |
| py311-base58-2.1.1_1..> | 2025-12-18 22:55 | 8.8K | |
| py311-bashlex-0.18.pkg | 2025-12-19 14:45 | 124K | |
| py311-baycomp-1.0.3_..> | 2025-12-30 08:14 | 25K | |
| py311-bayesian-optim..> | 2025-12-27 13:17 | 41K | |
| py311-bcbio-gff-0.7...> | 2025-12-19 12:47 | 37K | |
| py311-bcdoc-0.16.0_1..> | 2025-12-21 03:19 | 33K | |
| py311-bcrypt-5.0.0_2..> | 2025-12-26 06:24 | 242K | |
| py311-bdflib-2.1.0_1..> | 2025-12-21 20:40 | 86K | |
| py311-beaker-1.13.0.pkg | 2025-12-16 01:48 | 112K | |
| py311-beartype-0.20...> | 2025-12-27 11:32 | 962K | |
| py311-beautifulsoup-..> | 2025-12-18 01:06 | 345K | |
| py311-beautifultable..> | 2025-12-20 01:52 | 62K | |
| py311-behave-1.3.3.pkg | 2025-12-18 10:19 | 416K | |
| py311-belier-1.2_2.pkg | 2025-12-21 21:37 | 16K | |
| py311-bencode.py-4.0..> | 2025-12-19 15:37 | 15K | |
| py311-bencoder-0.2.1..> | 2025-12-23 15:25 | 5.1K | |
| py311-benford_py-0.5..> | 2025-12-28 05:03 | 62K | |
| py311-beniget-0.4.2...> | 2025-12-18 01:10 | 46K | |
| py311-berkeleydb-18...> | 2025-12-19 16:25 | 136K | |
| py311-betamax-0.9.0_..> | 2025-12-27 15:39 | 58K | |
| py311-better-bencode..> | 2025-12-22 05:39 | 11K | |
| py311-beziers-0.6.0.pkg | 2025-12-18 18:25 | 98K | |
| py311-bibtexparser-1..> | 2025-12-18 18:42 | 71K | |
| py311-bidict-0.22.1.pkg | 2025-12-18 18:34 | 50K | |
| py311-billiard-4.2.1..> | 2025-12-18 17:55 | 209K | |
| py311-binary_file_se..> | 2025-12-23 10:37 | 7.3K | |
| py311-binarycookies-..> | 2025-12-23 13:33 | 22K | |
| py311-binaryornot-0...> | 2025-12-18 21:31 | 8.9K | |
| py311-bincopy-17.14...> | 2025-12-18 21:49 | 44K | |
| py311-biom-format-2...> | 2025-12-27 11:13 | 8.6M | |
| py311-biopython-1.85..> | 2025-12-26 22:14 | 3.1M | |
| py311-biosig-2.6.1_1..> | 2025-12-30 04:42 | 5.1K | |
| py311-biplist-1.0.3_..> | 2025-12-22 00:18 | 27K | |
| py311-biscuits-0.3.2..> | 2025-12-20 05:25 | 38K | |
| py311-bistring-0.5.0..> | 2025-12-20 19:12 | 48K | |
| py311-bitarray-3.0.0..> | 2025-12-18 11:41 | 250K | |
| py311-bitbox02-7.0.0..> | 2025-12-27 09:40 | 108K | |
| py311-bitcoin-1.1.42..> | 2025-12-23 07:52 | 86K | |
| py311-bitmath-1.3.3...> | 2025-12-21 01:04 | 35K | |
| py311-bitrot-1.0.0_1..> | 2025-12-23 04:58 | 21K | |
| py311-bitsandbytes-0..> | 2025-12-29 11:30 | 217K | |
| py311-bitshuffle-0.5..> | 2025-12-29 16:34 | 157K | |
| py311-bitstring-4.3...> | 2025-12-18 18:01 | 170K | |
| py311-bitvector-3.5...> | 2025-12-20 07:27 | 85K | |
| py311-bjoern-3.2.2_1..> | 2025-12-21 09:32 | 24K | |
| py311-black-25.12.0.pkg | 2025-12-26 15:07 | 386K | |
| py311-bleach-6.3.0_1..> | 2025-12-18 01:34 | 329K | |
| py311-blessed-1.21.0..> | 2025-12-18 19:12 | 100K | |
| py311-blessings-1.7_..> | 2025-12-19 13:12 | 27K | |
| py311-blinker-1.9.0.pkg | 2025-12-18 06:58 | 16K | |
| py311-blinkstick-g20..> | 2025-12-19 11:01 | 35K | |
| py311-blis-1.3.3.pkg | 2025-12-26 20:01 | 798K | |
| py311-blobfile-3.1.0..> | 2025-12-27 00:18 | 190K | |
| py311-blockbuster-1...> | 2025-12-23 13:19 | 22K | |
| py311-blockdiag-3.0...> | 2025-12-26 18:12 | 2.4M | |
| py311-blockdiagcontr..> | 2025-12-29 15:32 | 4.6M | |
| py311-blosc-1.11.3.pkg | 2025-12-22 18:27 | 43K | |
| py311-blosc2-3.12.2.pkg | 2025-12-28 02:33 | 544K | |
| py311-bluelet-0.2.0_..> | 2025-12-20 22:12 | 20K | |
| py311-bokeh-2.4.3_5.pkg | 2025-12-27 13:06 | 9.0M | |
| py311-boltons-25.0.0..> | 2025-12-18 19:50 | 313K | |
| py311-bonsai-1.5.3_1..> | 2025-12-21 00:19 | 133K | |
| py311-boolean.py-4.0..> | 2025-12-18 18:43 | 207K | |
| py311-booleanOperati..> | 2025-12-26 10:55 | 41K | |
| py311-boost-histogra..> | 2025-12-27 10:18 | 824K | |
| py311-boost-libs-1.8..> | 2025-12-18 17:42 | 191K | |
| py311-boost-libs-mpi..> | 2025-12-29 17:24 | 108K | |
| py311-borgbackup-1.4..> | 2025-12-19 04:28 | 1.2M | |
| py311-borgbackup12-1..> | 2025-12-23 02:33 | 1.5M | |
| py311-borgmatic-1.8...> | 2025-12-30 14:29 | 216K | |
| py311-boto3-1.42.12.pkg | 2025-12-26 10:26 | 156K | |
| py311-botocore-1.42...> | 2025-12-26 08:44 | 7.8M | |
| py311-botocore-stubs..> | 2025-12-19 16:56 | 27K | |
| py311-bottle-0.13.4.pkg | 2025-12-18 13:13 | 128K | |
| py311-bottle-cork-0...> | 2025-12-23 14:33 | 47K | |
| py311-bottleneck-1.3..> | 2025-12-26 06:54 | 132K | |
| py311-boutdata-0.1.1..> | 2025-12-27 09:54 | 158K | |
| py311-boututils-0.1...> | 2025-12-26 21:21 | 130K | |
| py311-box2d-py-2.3.8..> | 2025-12-21 01:47 | 415K | |
| py311-bps_restpy-9.0..> | 2025-12-30 16:47 | 99K | |
| py311-bracex-2.6.pkg | 2025-12-18 16:13 | 20K | |
| py311-branca-0.8.2.pkg | 2025-12-19 16:09 | 51K | |
| py311-bravado-12.0.1..> | 2025-12-27 01:08 | 67K | |
| py311-bravado-core-6..> | 2025-12-26 19:08 | 112K | |
| py311-breathe-4.35.0..> | 2025-12-26 16:15 | 1.9M | |
| py311-brial-1.2.12_1..> | 2025-12-29 04:49 | 148K | |
| py311-brotli-1.2.0.pkg | 2025-12-18 01:29 | 14K | |
| py311-brotlicffi-1.2..> | 2025-12-19 02:15 | 25K | |
| py311-brotlipy-0.7.0..> | 2025-12-22 04:49 | 321K | |
| py311-brz-3.2.2_3.pkg | 2025-12-30 17:39 | 7.2M | |
| py311-bsdconv-11.3.0..> | 2025-12-19 19:24 | 7.4K | |
| py311-bt-1.1.2_1.pkg | 2025-12-28 09:30 | 233K | |
| py311-btchip-python-..> | 2025-12-19 23:39 | 61K | |
| py311-btest-1.2.pkg | 2025-12-18 22:30 | 41K | |
| py311-bugwarrior-2.0..> | 2025-12-28 23:15 | 252K | |
| py311-build-1.3.0.pkg | 2025-12-16 01:36 | 48K | |
| py311-buildbot-4.3.0..> | 2025-12-30 16:02 | 1.8M | |
| py311-buildbot-badge..> | 2025-12-23 03:32 | 7.5K | |
| py311-buildbot-conso..> | 2025-12-18 20:33 | 21K | |
| py311-buildbot-grid-..> | 2025-12-18 19:35 | 9.6K | |
| py311-buildbot-pkg-4..> | 2025-12-18 16:09 | 9.8K | |
| py311-buildbot-water..> | 2025-12-18 22:40 | 31K | |
| py311-buildbot-worke..> | 2025-12-29 16:16 | 287K | |
| py311-buildbot-wsgi-..> | 2025-12-18 23:19 | 373K | |
| py311-buildbot-www-4..> | 2025-12-27 16:21 | 359K | |
| py311-bullet3-3.25_2..> | 2025-12-30 14:17 | 59M | |
| py311-bump2version-1..> | 2025-12-21 13:33 | 44K | |
| py311-bup-0.32.pkg | 2025-12-22 09:18 | 209K | |
| py311-bx-python-0.14..> | 2025-12-26 23:08 | 871K | |
| py311-bytecode-0.17...> | 2025-12-19 16:22 | 98K | |
| py311-bz2file-0.98_1..> | 2025-12-21 19:43 | 14K | |
| py311-cabby-0.1.20_1..> | 2025-12-29 17:28 | 58K | |
| py311-cachecontrol-0..> | 2025-12-26 20:13 | 40K | |
| py311-cached-propert..> | 2025-12-18 23:44 | 10K | |
| py311-cachelib-0.10...> | 2025-12-18 20:17 | 37K | |
| py311-cachetools-6.2..> | 2025-12-26 09:17 | 30K | |
| py311-cachey-0.2.1_1..> | 2025-12-19 01:16 | 9.9K | |
| py311-cacheyou-23.3.pkg | 2025-12-29 18:00 | 41K | |
| py311-cachier-4.0.0.pkg | 2025-12-21 00:50 | 55K | |
| py311-cachy-0.3.0_3.pkg | 2025-12-22 14:06 | 34K | |
| py311-cadquery-pywra..> | 2025-12-28 19:55 | 56K | |
| py311-caffeine-ng-4...> | 2025-12-30 05:30 | 84K | |
| py311-cairo-1.28.0,1..> | 2025-12-26 03:17 | 95K | |
| py311-cairocffi-1.7...> | 2025-12-26 16:27 | 130K | |
| py311-cairosvg-2.8.2..> | 2025-12-26 18:51 | 104K | |
| py311-caldav-2.1.2.pkg | 2025-12-27 06:24 | 175K | |
| py311-calendar_cli-1..> | 2025-12-28 05:18 | 41K | |
| py311-calibreweb-0.6..> | 2025-12-29 18:08 | 5.3M | |
| py311-calver-2025.10..> | 2025-12-16 01:38 | 8.8K | |
| py311-camel-converte..> | 2025-12-18 23:29 | 8.8K | |
| py311-canonicaljson-..> | 2025-12-18 21:07 | 8.8K | |
| py311-capstone-5.0.6..> | 2025-12-18 23:58 | 184K | |
| py311-capturer-3.0_1..> | 2025-12-22 12:30 | 26K | |
| py311-cart-1.2.3.pkg | 2025-12-22 14:04 | 24K | |
| py311-cartopy-0.23.0..> | 2025-12-30 14:16 | 9.9M | |
| py311-case-1.5.3_1.pkg | 2025-12-23 14:12 | 37K | |
| py311-cassandra-driv..> | 2025-12-22 13:08 | 2.2M | |
| py311-castellan-5.5...> | 2025-12-27 03:39 | 138K | |
| py311-casttube-0.2.1..> | 2025-12-27 17:45 | 11K | |
| py311-catalogue-2.0...> | 2025-12-18 10:11 | 36K | |
| py311-cattrs-25.3.0.pkg | 2025-12-18 06:54 | 135K | |
| py311-cattrs23-23.2...> | 2025-12-18 18:01 | 113K | |
| py311-cbeams-1.0.3_1..> | 2025-12-23 19:50 | 16K | |
| py311-cbor-1.0.0_1.pkg | 2025-12-23 15:08 | 34K | |
| py311-cbor2-5.7.1.pkg | 2025-12-18 14:35 | 91K | |
| py311-cchardet-2.1.7..> | 2025-12-23 02:30 | 108K | |
| py311-cclib-1.7.1_2.pkg | 2025-12-29 13:44 | 524K | |
| py311-ccxt-4.4.30_1.pkg | 2025-12-27 19:42 | 7.3M | |
| py311-cdg-0.1.3_2.pkg | 2025-12-20 10:48 | 7.4K | |
| py311-cdo-1.6.0_1.pkg | 2025-12-29 01:29 | 27K | |
| py311-cec-0.2.8_2.pkg | 2025-12-23 18:10 | 21K | |
| py311-cel-python-0.4..> | 2025-12-29 07:25 | 158K | |
| py311-cel-python02-0..> | 2025-12-20 02:02 | 133K | |
| py311-celery-5.3.6_2..> | 2025-12-19 00:58 | 857K | |
| py311-celery-progres..> | 2025-12-29 13:29 | 17K | |
| py311-celery-singlet..> | 2025-12-21 00:05 | 12K | |
| py311-censys-2.2.17.pkg | 2025-12-30 07:59 | 124K | |
| py311-cepa-1.8.4_1.pkg | 2025-12-27 18:47 | 679K | |
| py311-cerberus-1.3.8..> | 2025-12-19 01:26 | 71K | |
| py311-cerealizer-0.7..> | 2025-12-23 04:29 | 18K | |
| py311-cereslib-1.0.9..> | 2025-12-26 19:06 | 40K | |
| py311-cert-human-1.0..> | 2025-12-27 10:12 | 29K | |
| py311-certbot-4.2.0,..> | 2025-12-27 10:13 | 886K | |
| py311-certbot-apache..> | 2025-12-29 20:18 | 315K | |
| py311-certbot-dns-cl..> | 2025-12-30 00:22 | 23K | |
| py311-certbot-dns-cp..> | 2025-12-28 12:43 | 12K | |
| py311-certbot-dns-di..> | 2025-12-29 16:04 | 19K | |
| py311-certbot-dns-dn..> | 2025-12-29 12:52 | 11K | |
| py311-certbot-dns-dn..> | 2025-12-29 23:30 | 12K | |
| py311-certbot-dns-ga..> | 2025-12-27 21:07 | 11K | |
| py311-certbot-dns-ge..> | 2025-12-30 05:41 | 12K | |
| py311-certbot-dns-go..> | 2025-12-28 15:25 | 35K | |
| py311-certbot-dns-li..> | 2025-12-30 04:55 | 12K | |
| py311-certbot-dns-lu..> | 2025-12-30 15:31 | 12K | |
| py311-certbot-dns-ns..> | 2025-12-28 12:38 | 12K | |
| py311-certbot-dns-ov..> | 2025-12-29 19:52 | 13K | |
| py311-certbot-dns-po..> | 2025-12-30 12:01 | 8.9K | |
| py311-certbot-dns-rf..> | 2025-12-30 04:06 | 24K | |
| py311-certbot-dns-ro..> | 2025-12-29 02:51 | 21K | |
| py311-certbot-dns-sa..> | 2025-12-29 20:00 | 12K | |
| py311-certbot-dns-st..> | 2025-12-29 22:22 | 9.2K | |
| py311-certbot-nginx-..> | 2025-12-30 17:08 | 187K | |
| py311-certifi-2025.1..> | 2025-12-16 01:40 | 151K | |
| py311-certipy-0.2.2.pkg | 2025-12-28 19:01 | 41K | |
| py311-certomancer-0...> | 2025-12-28 23:57 | 154K | |
| py311-certsrv-2.1.1_..> | 2025-12-30 04:15 | 11K | |
| py311-certstream-1.1..> | 2025-12-23 20:58 | 8.3K | |
| py311-cf-xarray-0.10..> | 2025-12-28 01:40 | 155K | |
| py311-cffi-1.17.1.pkg | 2025-12-18 00:33 | 282K | |
| py311-cffsubr-0.4.0.pkg | 2025-12-26 22:52 | 17K | |
| py311-cfgrib-0.9.15...> | 2025-12-30 09:51 | 86K | |
| py311-cfgv-3.5.0.pkg | 2025-12-18 06:41 | 15K | |
| py311-cfn-lint-1.32...> | 2025-12-30 14:04 | 1.7M | |
| py311-cftime-1.6.5.pkg | 2025-12-26 15:40 | 326K | |
| py311-cfv-3.2.0.pkg | 2025-12-23 03:05 | 105K | |
| py311-cgen-2025.1.pkg | 2025-12-29 09:54 | 47K | |
| py311-chai-1.1.2_2.pkg | 2025-12-23 05:36 | 47K | |
| py311-chainer-7.8.1_..> | 2025-12-27 16:09 | 1.5M | |
| py311-chainer-chemis..> | 2025-12-30 16:51 | 282K | |
| py311-chainmap-1.0.3..> | 2025-12-20 23:05 | 8.5K | |
| py311-chalice-1.32.0..> | 2025-12-29 07:42 | 438K | |
| py311-chameleon-4.6...> | 2025-12-22 15:53 | 256K | |
| py311-channels-4.3.2..> | 2025-12-20 04:21 | 61K | |
| py311-channels-redis..> | 2025-12-20 10:43 | 37K | |
| py311-chaospy-4.3.11..> | 2025-12-26 17:57 | 356K | |
| py311-characteristic..> | 2025-12-22 14:39 | 30K | |
| py311-chardet-5.2.0,..> | 2025-12-18 10:27 | 252K | |
| py311-charset-normal..> | 2025-12-16 01:40 | 95K | |
| py311-chart-studio-1..> | 2025-12-27 03:40 | 112K | |
| py311-check-jsonsche..> | 2025-12-28 21:04 | 212K | |
| py311-check-manifest..> | 2025-12-19 17:14 | 39K | |
| py311-check-sdist-1...> | 2025-12-30 13:28 | 22K | |
| py311-check-wheel-co..> | 2025-12-20 06:47 | 48K | |
| py311-checkdmarc-5.1..> | 2025-12-27 08:40 | 116K | |
| py311-cheetah3-3.2.6..> | 2025-12-18 17:22 | 363K | |
| py311-chempy-0.10.1.pkg | 2025-12-28 06:50 | 503K | |
| py311-cheroot-11.1.2..> | 2025-12-18 21:05 | 210K | |
| py311-cherrypy-18.10..> | 2025-12-19 05:06 | 593K | |
| py311-chevron-0.14.0..> | 2025-12-23 11:02 | 20K | |
| py311-cibuildwheel-2..> | 2025-12-30 10:51 | 167K | |
| py311-cinemagoer-202..> | 2025-12-29 19:48 | 374K | |
| py311-circuitbreaker..> | 2025-12-18 19:08 | 12K | |
| py311-circuits-3.2_1..> | 2025-12-21 03:39 | 293K | |
| py311-cirq-aqt-1.6.1..> | 2025-12-28 02:42 | 52K | |
| py311-cirq-core-1.6...> | 2025-12-26 22:33 | 3.2M | |
| py311-cirq-google-1...> | 2025-12-26 18:10 | 864K | |
| py311-cirq-ionq-1.6...> | 2025-12-30 04:55 | 125K | |
| py311-cirq-pasqal-1...> | 2025-12-28 13:59 | 43K | |
| py311-cirq-web-1.6.1..> | 2025-12-21 19:38 | 178K | |
| py311-ciscoconfparse..> | 2025-12-29 19:43 | 294K | |
| py311-ciso8601-2.3.3..> | 2025-12-23 15:28 | 15K | |
| py311-citeproc-py-0...> | 2025-12-20 02:05 | 150K | |
| py311-cjdns-0.2.4_1.pkg | 2025-12-23 15:13 | 18K | |
| py311-cjkwrap-2.2_1.pkg | 2025-12-22 23:24 | 6.1K | |
| py311-ckanapi-4.9.pkg | 2025-12-30 08:09 | 89K | |
| py311-ckcc-protocol-..> | 2025-12-19 22:22 | 75K | |
| py311-clang-11.0_1.pkg | 2025-12-20 01:34 | 67K | |
| py311-clarabel-0.9.0..> | 2025-12-27 11:38 | 727K | |
| py311-claripy-9.0.54..> | 2025-12-27 15:44 | 341K | |
| py311-cld-20150113_1..> | 2025-12-21 23:07 | 14K | |
| py311-cle-9.0.5405_1..> | 2025-12-20 00:33 | 272K | |
| py311-cleo-2.2.1.pkg | 2025-12-26 20:03 | 174K | |
| py311-cli-helpers-2...> | 2025-12-19 11:42 | 39K | |
| py311-cliapp-1.20180..> | 2025-12-19 17:05 | 95K | |
| py311-click-8.1.7_1.pkg | 2025-12-18 00:32 | 203K | |
| py311-click-command-..> | 2025-12-19 01:35 | 5.2K | |
| py311-click-completi..> | 2025-12-23 20:32 | 19K | |
| py311-click-creds-0...> | 2025-12-18 23:36 | 10K | |
| py311-click-default-..> | 2025-12-18 00:39 | 6.6K | |
| py311-click-default-..> | 2025-12-23 16:34 | 1.3K | |
| py311-click-didyoume..> | 2025-12-18 17:18 | 3.6K | |
| py311-click-help-col..> | 2025-12-20 02:09 | 12K | |
| py311-click-log-0.3...> | 2025-12-18 22:28 | 6.4K | |
| py311-click-option-g..> | 2025-12-19 02:14 | 24K | |
| py311-click-plugins-..> | 2025-12-18 04:37 | 7.5K | |
| py311-click-repl-0.3..> | 2025-12-18 17:23 | 20K | |
| py311-click-threadin..> | 2025-12-22 17:52 | 9.5K | |
| py311-click7-7.1.2_1..> | 2025-12-20 00:13 | 167K | |
| py311-click_aliases-..> | 2025-12-19 23:31 | 6.4K | |
| py311-cliff-4.13.0.pkg | 2025-12-18 17:46 | 147K | |
| py311-cligj-0.7.2_1.pkg | 2025-12-18 05:27 | 10K | |
| py311-clikit-0.6.2_2..> | 2025-12-23 19:36 | 172K | |
| py311-clingcon-5.2.1..> | 2025-12-22 15:06 | 160K | |
| py311-clingo-5.7.1_1..> | 2025-12-20 01:49 | 1.4M | |
| py311-clint-0.5.1_1.pkg | 2025-12-19 21:52 | 63K | |
| py311-clldutils-3.24..> | 2025-12-20 03:24 | 1.2M | |
| py311-cloc-0.2.5_1.pkg | 2025-12-26 16:40 | 33K | |
| py311-cloud-init-25...> | 2025-12-30 04:41 | 1.4M | |
| py311-cloud-init-dev..> | 2025-12-28 16:13 | 1.3M | |
| py311-cloud_sptheme-..> | 2025-12-29 08:56 | 104K | |
| py311-cloudflare-2.2..> | 2025-12-27 15:17 | 206K | |
| py311-cloudflare-scr..> | 2025-12-30 00:25 | 18K | |
| py311-cloudflare-scr..> | 2025-12-29 01:02 | 15K | |
| py311-cloudpathlib-0..> | 2025-12-18 17:07 | 120K | |
| py311-cloudpickle-3...> | 2025-12-18 12:31 | 38K | |
| py311-cloudscraper-1..> | 2025-12-29 22:22 | 110K | |
| py311-cluster-1.4.1_..> | 2025-12-20 17:59 | 26K | |
| py311-clustershell-1..> | 2025-12-22 17:55 | 330K | |
| py311-cma-4.0.0.pkg | 2025-12-27 03:08 | 549K | |
| py311-cmaes-0.12.0.pkg | 2025-12-29 19:17 | 102K | |
| py311-cmakedoc-1.0.1..> | 2025-12-22 23:29 | 6.3K | |
| py311-cmap-0.6.2.pkg | 2025-12-29 15:25 | 1.8M | |
| py311-cmarkgfm-2025...> | 2025-12-18 12:41 | 118K | |
| py311-cmd2-2.5.11.pkg | 2025-12-18 12:18 | 286K | |
| py311-cmdtest-0.33.s..> | 2025-12-23 21:48 | 35K | |
| py311-cmyt-2.0.2_1.pkg | 2025-12-27 09:00 | 56K | |
| py311-coards-1.0.5_4..> | 2025-12-22 10:06 | 8.5K | |
| py311-cobble-0.1.4_1..> | 2025-12-20 00:46 | 8.7K | |
| py311-cocotb-1.9.2.pkg | 2025-12-27 21:10 | 382K | |
| py311-codecarbon-3.0..> | 2025-12-27 01:13 | 340K | |
| py311-codegen-1.0_1.pkg | 2025-12-23 02:28 | 13K | |
| py311-codesearch-py-..> | 2025-12-23 00:05 | 101K | |
| py311-cogapp-3.5.1.pkg | 2025-12-18 16:27 | 75K | |
| py311-cogdumper-1.1...> | 2025-12-28 10:42 | 19K | |
| py311-coincurve-21.0..> | 2025-12-20 04:00 | 1.3M | |
| py311-collections-ex..> | 2025-12-19 20:46 | 44K | |
| py311-collective.che..> | 2025-12-23 14:45 | 7.9K | |
| py311-collidoscope-0..> | 2025-12-27 16:36 | 19K | |
| py311-colorama-0.4.6..> | 2025-12-18 07:05 | 48K | |
| py311-colorbrewer-0...> | 2025-12-21 06:35 | 11K | |
| py311-colorcet-3.1.0..> | 2025-12-18 12:05 | 484K | |
| py311-colored-2.3.1.pkg | 2025-12-18 10:20 | 34K | |
| py311-colored-traceb..> | 2025-12-19 03:45 | 7.6K | |
| py311-coloredlogs-15..> | 2025-12-19 02:21 | 74K | |
| py311-colorful-0.5.4..> | 2025-12-21 16:15 | 179K | |
| py311-colorlog-6.9.0..> | 2025-12-18 16:39 | 17K | |
| py311-colormath-3.0...> | 2025-12-26 18:27 | 81K | |
| py311-colorspacious-..> | 2025-12-26 21:20 | 71K | |
| py311-colorthief-0.2..> | 2025-12-27 21:18 | 13K | |
| py311-colorz-1.0.3_2..> | 2025-12-28 14:37 | 10K | |
| py311-colorzero-2.0.pkg | 2025-12-23 07:31 | 49K | |
| py311-colour-0.1.5_1..> | 2025-12-19 10:44 | 27K | |
| py311-colour-science..> | 2025-12-27 15:33 | 3.2M | |
| py311-columnize-0.3...> | 2025-12-19 08:00 | 12K | |
| py311-comicapi-3.2.0..> | 2025-12-29 03:07 | 117K | |
| py311-comm-0.2.3.pkg | 2025-12-18 02:53 | 12K | |
| py311-commandlines-0..> | 2025-12-18 20:19 | 21K | |
| py311-commentjson-0...> | 2025-12-18 21:56 | 20K | |
| py311-commoncode-32...> | 2025-12-26 21:28 | 153K | |
| py311-compreffor-0.5..> | 2025-12-26 23:43 | 98K | |
| py311-compressed-rtf..> | 2025-12-24 04:19 | 13K | |
| py311-concurrent-log..> | 2025-12-20 01:15 | 23K | |
| py311-condense-json-..> | 2025-12-18 21:34 | 10K | |
| py311-conditional-1...> | 2025-12-23 22:16 | 5.5K | |
| py311-confection-0.1..> | 2025-12-26 18:01 | 87K | |
| py311-configargparse..> | 2025-12-18 15:21 | 45K | |
| py311-configobj-5.0...> | 2025-12-18 08:32 | 69K | |
| py311-configparser-3..> | 2025-12-18 19:32 | 42K | |
| py311-configupdater-..> | 2025-12-19 20:57 | 59K | |
| py311-confluent-kafk..> | 2025-12-21 22:36 | 91K | |
| py311-confusable_hom..> | 2025-12-20 04:16 | 112K | |
| py311-confuse-2.1.0.pkg | 2025-12-19 05:28 | 50K | |
| py311-conllu-6.0.0.pkg | 2025-12-24 05:50 | 33K | |
| py311-connection_poo..> | 2025-12-19 15:15 | 7.1K | |
| py311-connexion-3.2...> | 2025-12-30 01:00 | 201K | |
| py311-cons-0.4.6_1.pkg | 2025-12-18 18:10 | 12K | |
| py311-constantly-23...> | 2025-12-18 01:17 | 26K | |
| py311-construct-2.10..> | 2025-12-18 16:34 | 136K | |
| py311-construct-clas..> | 2025-12-18 22:00 | 7.6K | |
| py311-container-insp..> | 2025-12-29 16:35 | 63K | |
| py311-contextily-1.7..> | 2025-12-27 08:58 | 29K | |
| py311-contextlib-chd..> | 2025-12-21 20:19 | 3.0K | |
| py311-contextlib2-21..> | 2025-12-19 02:05 | 18K | |
| py311-contourpy-1.3...> | 2025-12-26 08:33 | 268K | |
| py311-convertdate-2...> | 2025-12-22 12:47 | 68K | |
| py311-conway-polynom..> | 2025-12-23 05:00 | 208K | |
| py311-cookiecutter-2..> | 2025-12-27 16:23 | 65K | |
| py311-copier-9.11.0.pkg | 2025-12-29 17:34 | 113K | |
| py311-corner-2.2.3.pkg | 2025-12-28 13:18 | 33K | |
| py311-country-22.3.5..> | 2025-12-18 17:23 | 4.1M | |
| py311-cov-core-1.15...> | 2025-12-21 11:26 | 11K | |
| py311-covdefaults-2...> | 2025-12-23 16:28 | 8.4K | |
| py311-coverage-7.9.2..> | 2025-12-18 09:43 | 371K | |
| py311-coverage_enabl..> | 2025-12-24 07:31 | 2.2K | |
| py311-coveralls-4.0...> | 2025-12-27 08:43 | 27K | |
| py311-cpe-1.3.1_1.pkg | 2025-12-21 09:29 | 77K | |
| py311-cpfx-g20240515..> | 2025-12-22 02:23 | 3.0K | |
| py311-cppheaderparse..> | 2025-12-19 08:21 | 84K | |
| py311-cppman-0.6.0.pkg | 2025-12-28 14:57 | 1.3M | |
| py311-cppy-1.3.1.pkg | 2025-12-18 01:34 | 8.7K | |
| py311-cram-0.7_1.pkg | 2025-12-21 03:39 | 36K | |
| py311-cramjam-2.11.0..> | 2025-12-27 12:33 | 1.5M | |
| py311-crank-0.8.1_1.pkg | 2025-12-19 11:54 | 25K | |
| py311-crashtest-0.4...> | 2025-12-18 12:05 | 13K | |
| py311-crc32c-2.4.1_1..> | 2025-12-21 03:21 | 16K | |
| py311-crcmod-1.7_3.pkg | 2025-12-19 01:42 | 73K | |
| py311-creole-1.4.10_..> | 2025-12-21 01:45 | 136K | |
| py311-crick-0.0.8.pkg | 2025-12-22 04:29 | 306K | |
| py311-cron-converter..> | 2025-12-18 14:40 | 27K | |
| py311-cron-descripto..> | 2025-12-19 02:00 | 39K | |
| py311-croniter-6.0.0..> | 2025-12-18 08:02 | 45K | |
| py311-croniter2-2.0...> | 2025-12-18 21:43 | 38K | |
| py311-cronsim-2.6.pkg | 2025-12-20 00:22 | 30K | |
| py311-crontab-1.0.5.pkg | 2025-12-19 11:40 | 29K | |
| py311-crosshair-tool..> | 2025-12-26 18:26 | 1.0M | |
| py311-crossmap-0.7.3..> | 2025-12-27 11:54 | 77K | |
| py311-crossplane-0.5..> | 2025-12-22 05:03 | 55K | |
| py311-crudini-0.9.6.pkg | 2025-12-22 16:45 | 43K | |
| py311-cryptography-4..> | 2025-12-26 05:53 | 1.3M | |
| py311-cryptography-l..> | 2025-12-21 13:11 | 472K | |
| py311-cryptography-v..> | 2025-12-24 03:49 | 27M | |
| py311-cryptojwt-1.10..> | 2025-12-30 03:49 | 177K | |
| py311-cryptominisat-..> | 2025-12-29 13:17 | 601K | |
| py311-cson-0.8_1.pkg | 2025-12-18 23:14 | 16K | |
| py311-css-html-js-mi..> | 2025-12-19 22:43 | 39K | |
| py311-css-parser-1.0..> | 2025-12-19 20:30 | 318K | |
| py311-csscompressor-..> | 2025-12-18 18:56 | 70K | |
| py311-cssmin-0.2.0_3..> | 2025-12-22 07:43 | 8.2K | |
| py311-cssselect-1.3...> | 2025-12-18 17:18 | 2.6M | |
| py311-cssselect2-0.8..> | 2025-12-18 13:21 | 36K | |
| py311-cssutils-2.11...> | 2025-12-19 23:49 | 633K | |
| py311-csv23-0.3.4_1.pkg | 2025-12-20 08:41 | 30K | |
| py311-csvkit-2.2.0.pkg | 2025-12-27 17:49 | 111K | |
| py311-csvw-3.7.0.pkg | 2025-12-27 10:17 | 145K | |
| py311-csxcad-0.6.3_1..> | 2025-12-27 14:57 | 247K | |
| py311-ctypescrypto-0..> | 2025-12-20 23:05 | 63K | |
| py311-ctypesgen-1.1...> | 2025-12-20 20:08 | 256K | |
| py311-cu2qu-1.6.7p2_..> | 2025-12-26 23:00 | 49K | |
| py311-cucumber-expre..> | 2025-12-18 07:19 | 45K | |
| py311-cucumber-tag-e..> | 2025-12-18 07:04 | 16K | |
| py311-curio-1.6_1.pkg | 2025-12-18 01:09 | 132K | |
| py311-cursive-0.2.3_..> | 2025-12-30 10:00 | 53K | |
| py311-curtsies-0.4.3..> | 2025-12-19 17:05 | 85K | |
| py311-custodian-2024..> | 2025-12-27 18:35 | 221K | |
| py311-custom_inherit..> | 2025-12-19 06:58 | 21K | |
| py311-customtkinter-..> | 2025-12-27 13:46 | 330K | |
| py311-cutadapt-5.2.pkg | 2025-12-20 04:24 | 272K | |
| py311-cvss-2.2_1.pkg | 2025-12-21 16:48 | 28K | |
| py311-cvxopt-1.3.2_1..> | 2025-12-30 16:38 | 381K | |
| py311-cvxpy-1.6.4.pkg | 2025-12-30 06:34 | 1.4M | |
| py311-cwcwidth-0.1.1..> | 2025-12-18 22:41 | 20K | |
| py311-cxx-7.1.8_1.pkg | 2025-12-19 21:45 | 55K | |
| py311-cybox-2.1.0.21..> | 2025-12-19 14:36 | 1.0M | |
| py311-cycler-0.12.1.pkg | 2025-12-18 01:47 | 15K | |
| py311-cyclonedx-pyth..> | 2025-12-19 21:00 | 287K | |
| py311-cyclopts-3.23...> | 2025-12-23 15:19 | 187K | |
| py311-cyipopt-1.5.0_..> | 2025-12-30 08:34 | 151K | |
| py311-cykhash-2.0.1_..> | 2025-12-18 21:41 | 312K | |
| py311-cymbal-1.0.0_1..> | 2025-12-19 23:59 | 6.3K | |
| py311-cymem-2.0.8_1.pkg | 2025-12-18 13:10 | 25K | |
| py311-cymruwhois-1.6..> | 2025-12-19 13:06 | 12K | |
| py311-cymysql-1.0.10..> | 2025-12-22 21:39 | 430K | |
| py311-cypari2-2.2.4.pkg | 2025-12-24 02:06 | 1.3M | |
| py311-cysignals-1.12..> | 2025-12-20 01:36 | 304K | |
| py311-cython-0.29.37..> | 2025-12-18 00:47 | 2.3M | |
| py311-cython-test-ex..> | 2025-12-22 00:20 | 11K | |
| py311-cython3-3.2.3.pkg | 2025-12-24 20:08 | 3.3M | |
| py311-cytoolz-1.0.1.pkg | 2025-12-23 11:34 | 319K | |
| py311-d2to1-0.2.12.p..> | 2025-12-18 19:52 | 51K | |
| py311-dacite-1.9.2.pkg | 2025-12-20 19:12 | 29K | |
| py311-daemon-2.3.0_1..> | 2025-12-19 02:54 | 29K | |
| py311-daemon-runner-..> | 2025-12-23 01:52 | 9.8K | |
| py311-daemonize-2.5...> | 2025-12-19 03:16 | 9.4K | |
| py311-daemons-1.3.2_..> | 2025-12-22 20:58 | 22K | |
| py311-daiquiri-3.4.0..> | 2025-12-20 21:09 | 36K | |
| py311-dal-20081016_4..> | 2025-12-21 17:01 | 56K | |
| py311-daphne-4.2.1_1..> | 2025-12-29 16:52 | 58K | |
| py311-daqp-0.6.0_1.pkg | 2025-12-19 21:03 | 89K | |
| py311-darts.util.lru..> | 2025-12-22 13:27 | 18K | |
| py311-dash-3.3.0.pkg | 2025-12-29 03:57 | 5.3M | |
| py311-dask-2025.12.0..> | 2025-12-26 19:07 | 3.4M | |
| py311-dask-awkward-2..> | 2025-12-27 16:04 | 195K | |
| py311-dask-expr-2.0...> | 2025-12-27 21:28 | 3.6K | |
| py311-dask-histogram..> | 2025-12-28 23:12 | 49K | |
| py311-databases-0.9...> | 2025-12-26 22:59 | 48K | |
| py311-databricks-sql..> | 2025-12-28 04:56 | 371K | |
| py311-dataclass-arra..> | 2025-12-28 13:21 | 73K | |
| py311-dataclasses-js..> | 2025-12-18 23:22 | 49K | |
| py311-datadog-0.52.1..> | 2025-12-30 13:09 | 213K | |
| py311-dataflows-tabu..> | 2025-12-26 22:18 | 85K | |
| py311-datafusion-50...> | 2025-12-30 13:41 | 20M | |
| py311-datapackage-1...> | 2025-12-29 07:39 | 78K | |
| py311-datasets-4.1.1..> | 2025-12-27 22:03 | 851K | |
| py311-datasette-0.64..> | 2025-12-23 16:00 | 346K | |
| py311-datatest-0.11...> | 2025-12-21 06:32 | 244K | |
| py311-dateparser-1.2..> | 2025-12-19 09:17 | 402K | |
| py311-dateutils-0.6...> | 2025-12-21 21:04 | 12K | |
| py311-datrie-0.8.3.pkg | 2025-12-19 22:45 | 112K | |
| py311-dbf-0.99.3_1.pkg | 2025-12-22 12:55 | 265K | |
| py311-dbfread-2.0.7_..> | 2025-12-18 17:49 | 36K | |
| py311-dbt-core-1.7.1..> | 2025-12-27 12:33 | 1.4M | |
| py311-dbt-duckdb-1.7..> | 2025-12-29 23:26 | 77K | |
| py311-dbt-extractor-..> | 2025-12-26 20:53 | 3.8M | |
| py311-dbt-semantic-i..> | 2025-12-26 20:47 | 256K | |
| py311-dbus-1.3.2.pkg | 2025-12-16 01:54 | 113K | |
| py311-dbutils-3.1.0.pkg | 2025-12-20 23:28 | 41K | |
| py311-ddgs-9.6.1.pkg | 2025-12-30 10:26 | 68K | |
| py311-ddsketch-3.0.1..> | 2025-12-23 15:46 | 34K | |
| py311-ddt-1.7.2_1.pkg | 2025-12-23 05:28 | 13K | |
| py311-ddtrace-2.21.1..> | 2025-12-29 00:41 | 3.8M | |
| py311-deap-1.4.1_1.pkg | 2025-12-30 00:51 | 186K | |
| py311-debian-inspect..> | 2025-12-29 20:54 | 71K | |
| py311-debtcollector-..> | 2025-12-18 06:25 | 33K | |
| py311-debugpy-1.8.3.pkg | 2025-12-18 02:38 | 2.1M | |
| py311-debugtools-0.2..> | 2025-12-19 10:54 | 4.0K | |
| py311-decli-0.6.3.pkg | 2025-12-19 08:36 | 11K | |
| py311-decopatch-1.4...> | 2025-12-27 17:06 | 28K | |
| py311-decorator-5.2...> | 2025-12-18 01:50 | 18K | |
| py311-decoratortools..> | 2025-12-23 06:45 | 19K | |
| py311-deepTools-3.5...> | 2025-12-27 18:43 | 387K | |
| py311-deepdiff-8.0.1..> | 2025-12-26 22:59 | 176K | |
| py311-deepmerge-1.1...> | 2025-12-18 22:38 | 13K | |
| py311-deeptoolsinter..> | 2025-12-18 22:36 | 68K | |
| py311-defcon-0.10.2_..> | 2025-12-26 11:23 | 313K | |
| py311-defusedxml-0.7..> | 2025-12-18 01:35 | 32K | |
| py311-degiro-connect..> | 2025-12-30 12:26 | 108K | |
| py311-dehinter-4.0.0..> | 2025-12-27 19:23 | 19K | |
| py311-demjson-3.0.6_..> | 2025-12-20 01:41 | 127K | |
| py311-dep-logic-0.5...> | 2025-12-19 14:11 | 73K | |
| py311-dependency-gro..> | 2025-12-19 14:08 | 14K | |
| py311-deprecat-2.1.3..> | 2025-12-19 20:44 | 17K | |
| py311-deprecated-1.3..> | 2025-12-18 13:51 | 16K | |
| py311-deprecation-2...> | 2025-12-18 03:44 | 14K | |
| py311-deptry-0.24.0_..> | 2025-12-30 00:55 | 1.5M | |
| py311-descartes-1.1...> | 2025-12-29 20:17 | 7.7K | |
| py311-detect-secrets..> | 2025-12-29 19:36 | 187K | |
| py311-detecta-0.0.5_..> | 2025-12-30 12:16 | 19K | |
| py311-devedeng-4.21...> | 2025-12-28 01:14 | 1.6M | |
| py311-devtools-0.12...> | 2025-12-23 04:49 | 45K | |
| py311-dexml2-0.5.3_1..> | 2025-12-24 07:04 | 62K | |
| py311-dfdatetime-202..> | 2025-12-19 02:01 | 70K | |
| py311-dftbplus-24.1_..> | 2025-12-28 13:53 | 8.7K | |
| py311-dftd4-3.7.0.pkg | 2025-12-29 11:45 | 159K | |
| py311-dfvfs-20240505..> | 2025-12-27 03:19 | 363K | |
| py311-dfwinreg-20240..> | 2025-12-19 09:23 | 55K | |
| py311-dgl-1.1.2_2.pkg | 2025-12-27 09:06 | 1.2M | |
| py311-dhall-0.1.15_1..> | 2025-12-30 12:51 | 2.8M | |
| py311-dialect-2.6.1.pkg | 2025-12-29 20:19 | 507K | |
| py311-dict-toolbox-2..> | 2025-12-18 23:22 | 53K | |
| py311-dict2xml-1.7.7..> | 2025-12-20 01:10 | 13K | |
| py311-diff-cover-9.7..> | 2025-12-19 22:20 | 91K | |
| py311-diff-match-pat..> | 2025-12-19 22:21 | 72K | |
| py311-diffcp-1.0.23.pkg | 2025-12-28 14:29 | 232K | |
| py311-diffoscope-306..> | 2025-12-21 14:55 | 355K | |
| py311-diffusers-0.35..> | 2025-12-30 07:54 | 3.8M | |
| py311-dill-0.4.0.pkg | 2025-12-18 03:48 | 235K | |
| py311-dimod-0.12.21.pkg | 2025-12-26 14:15 | 1.9M | |
| py311-dionysus-topol..> | 2025-12-22 17:34 | 335K | |
| py311-diplib-3.5.1.pkg | 2025-12-30 15:16 | 798K | |
| py311-dipy-1.10.0.pkg | 2025-12-29 12:53 | 6.3M | |
| py311-director-0.16...> | 2025-12-28 12:22 | 54K | |
| py311-dirhash-0.2.1_..> | 2025-12-18 19:51 | 20K | |
| py311-dirspec-13.10_..> | 2025-12-23 04:09 | 10K | |
| py311-dirsync-2.2.6.pkg | 2025-12-22 13:20 | 25K | |
| py311-dirty-equals-0..> | 2025-12-19 23:00 | 52K | |
| py311-discid-1.2.0_1..> | 2025-12-19 13:58 | 17K | |
| py311-discogs-client..> | 2025-12-27 06:22 | 32K | |
| py311-discord.py-2.3..> | 2025-12-19 16:50 | 1.3M | |
| py311-disjoint-set-0..> | 2025-12-21 18:34 | 8.1K | |
| py311-diskcache-5.6...> | 2025-12-18 12:29 | 80K | |
| py311-dispy-4.10.6_2..> | 2025-12-21 06:08 | 262K | |
| py311-distlib-0.3.9_..> | 2025-12-18 04:45 | 426K | |
| py311-distributed-20..> | 2025-12-27 18:04 | 1.6M | |
| py311-distro-1.9.0.pkg | 2025-12-18 06:58 | 32K | |
| py311-distro2sbom-0...> | 2025-12-28 02:14 | 44K | |
| py311-dj-database-ur..> | 2025-12-23 10:19 | 13K | |
| py311-dj51-channels-..> | 2025-12-19 16:21 | 61K | |
| py311-dj51-channels-..> | 2025-12-23 11:01 | 37K | |
| py311-dj51-django-al..> | 2025-12-29 04:07 | 1.2M | |
| py311-dj51-django-au..> | 2025-12-23 19:47 | 78K | |
| py311-dj51-django-au..> | 2025-12-23 00:04 | 219K | |
| py311-dj51-django-ce..> | 2025-12-21 18:41 | 46K | |
| py311-dj51-django-ch..> | 2025-12-19 23:07 | 12K | |
| py311-dj51-django-co..> | 2025-12-20 14:45 | 11K | |
| py311-dj51-django-co..> | 2025-12-20 05:00 | 19K | |
| py311-dj51-django-de..> | 2025-12-19 14:02 | 205K | |
| py311-dj51-django-ex..> | 2025-12-22 19:19 | 354K | |
| py311-dj51-django-fi..> | 2025-12-24 07:10 | 93K | |
| py311-dj51-django-gu..> | 2025-12-19 09:52 | 165K | |
| py311-dj51-django-ht..> | 2025-12-20 11:20 | 60K | |
| py311-dj51-django-js..> | 2025-12-19 13:07 | 9.0K | |
| py311-dj51-django-mp..> | 2025-12-22 20:32 | 124K | |
| py311-dj51-django-mu..> | 2025-12-22 06:56 | 16K | |
| py311-dj51-django-ne..> | 2025-12-22 02:32 | 27K | |
| py311-dj51-django-pr..> | 2025-12-29 16:00 | 45K | |
| py311-dj51-django-re..> | 2025-12-24 06:44 | 62K | |
| py311-dj51-django-ri..> | 2025-12-23 21:14 | 17K | |
| py311-dj51-django-rq..> | 2025-12-22 04:39 | 97K | |
| py311-dj51-django-so..> | 2025-12-23 04:05 | 18K | |
| py311-dj51-django-ta..> | 2025-12-21 05:11 | 110K | |
| py311-dj51-django-ta..> | 2025-12-23 14:21 | 64K | |
| py311-dj51-django-ti..> | 2025-12-20 15:13 | 20K | |
| py311-dj51-djangores..> | 2025-12-20 02:06 | 1.0M | |
| py311-dj51-djangores..> | 2025-12-20 05:59 | 8.0K | |
| py311-dj51-drf-spect..> | 2025-12-30 09:32 | 202K | |
| py311-dj51-drf-spect..> | 2025-12-19 19:51 | 1.9M | |
| py311-dj51-drf-writa..> | 2025-12-23 04:56 | 17K | |
| py311-dj51-social-au..> | 2025-12-30 05:25 | 47K | |
| py311-dj51-strawberr..> | 2025-12-19 06:42 | 555K | |
| py311-dj51-strawberr..> | 2025-12-23 01:30 | 230K | |
| py311-dj52-channels-..> | 2025-12-18 21:33 | 60K | |
| py311-dj52-channels-..> | 2025-12-20 02:58 | 37K | |
| py311-dj52-django-al..> | 2025-12-27 10:00 | 1.2M | |
| py311-dj52-django-au..> | 2025-12-20 01:51 | 78K | |
| py311-dj52-django-au..> | 2025-12-20 19:48 | 219K | |
| py311-dj52-django-ce..> | 2025-12-20 00:19 | 45K | |
| py311-dj52-django-ch..> | 2025-12-18 19:53 | 12K | |
| py311-dj52-django-co..> | 2025-12-19 14:36 | 10K | |
| py311-dj52-django-co..> | 2025-12-20 02:27 | 19K | |
| py311-dj52-django-de..> | 2025-12-19 00:45 | 205K | |
| py311-dj52-django-ex..> | 2025-12-20 01:08 | 354K | |
| py311-dj52-django-fi..> | 2025-12-19 02:03 | 93K | |
| py311-dj52-django-gu..> | 2025-12-18 21:04 | 166K | |
| py311-dj52-django-ht..> | 2025-12-19 10:10 | 59K | |
| py311-dj52-django-js..> | 2025-12-19 02:50 | 8.8K | |
| py311-dj52-django-mo..> | 2025-12-18 21:12 | 57K | |
| py311-dj52-django-mp..> | 2025-12-20 00:06 | 124K | |
| py311-dj52-django-mu..> | 2025-12-19 22:23 | 16K | |
| py311-dj52-django-ne..> | 2025-12-19 20:19 | 27K | |
| py311-dj52-django-ot..> | 2025-12-20 02:01 | 72K | |
| py311-dj52-django-pe..> | 2025-12-18 19:13 | 7.4K | |
| py311-dj52-django-pr..> | 2025-12-27 17:13 | 44K | |
| py311-dj52-django-re..> | 2025-12-19 14:03 | 62K | |
| py311-dj52-django-ri..> | 2025-12-20 01:02 | 17K | |
| py311-dj52-django-rq..> | 2025-12-27 16:21 | 77K | |
| py311-dj52-django-so..> | 2025-12-19 12:57 | 18K | |
| py311-dj52-django-st..> | 2025-12-19 03:27 | 69K | |
| py311-dj52-django-st..> | 2025-12-26 15:26 | 14K | |
| py311-dj52-django-ta..> | 2025-12-19 21:04 | 110K | |
| py311-dj52-django-ta..> | 2025-12-18 23:48 | 63K | |
| py311-dj52-django-ta..> | 2025-12-26 20:16 | 69K | |
| py311-dj52-django-ti..> | 2025-12-19 21:29 | 20K | |
| py311-dj52-django-tr..> | 2025-12-19 01:44 | 459K | |
| py311-dj52-django-tr..> | 2025-12-27 09:01 | 39K | |
| py311-dj52-djangores..> | 2025-12-18 15:59 | 1.0M | |
| py311-dj52-djangores..> | 2025-12-19 15:03 | 7.8K | |
| py311-dj52-drf-spect..> | 2025-12-27 02:50 | 201K | |
| py311-dj52-drf-spect..> | 2025-12-18 21:04 | 1.9M | |
| py311-dj52-drf-writa..> | 2025-12-19 11:22 | 17K | |
| py311-dj52-laces-0.1..> | 2025-12-19 01:54 | 33K | |
| py311-dj52-social-au..> | 2025-12-27 11:46 | 47K | |
| py311-dj52-sorl-thum..> | 2025-12-27 02:41 | 245K | |
| py311-dj52-strawberr..> | 2025-12-18 23:17 | 555K | |
| py311-dj52-strawberr..> | 2025-12-20 02:24 | 230K | |
| py311-django-admin-r..> | 2025-12-21 18:25 | 17K | |
| py311-django-advance..> | 2025-12-24 01:13 | 77K | |
| py311-django-allauth..> | 2025-12-27 02:06 | 1.2M | |
| py311-django-annoyin..> | 2025-12-22 17:57 | 18K | |
| py311-django-appconf..> | 2025-12-18 23:22 | 9.4K | |
| py311-django-assets-..> | 2025-12-22 10:40 | 36K | |
| py311-django-auditlo..> | 2025-12-21 06:27 | 63K | |
| py311-django-auth-ke..> | 2025-12-22 15:38 | 5.6K | |
| py311-django-auth-ld..> | 2025-12-21 18:52 | 219K | |
| py311-django-autocom..> | 2025-12-22 08:59 | 407K | |
| py311-django-bakery-..> | 2025-12-27 10:22 | 64K | |
| py311-django-bitfiel..> | 2025-12-20 22:07 | 35K | |
| py311-django-bleach-..> | 2025-12-20 08:38 | 24K | |
| py311-django-bootstr..> | 2025-12-21 00:07 | 42K | |
| py311-django-bootstr..> | 2025-12-23 05:08 | 43K | |
| py311-django-braces-..> | 2025-12-19 19:54 | 27K | |
| py311-django-cacheop..> | 2025-12-23 00:08 | 81K | |
| py311-django-celery-..> | 2025-12-23 00:04 | 45K | |
| py311-django-choices..> | 2025-12-19 07:35 | 12K | |
| py311-django-ckedito..> | 2025-12-20 06:23 | 1.1M | |
| py311-django-classy-..> | 2025-12-19 02:08 | 29K | |
| py311-django-cms-5.0..> | 2025-12-20 10:15 | 2.1M | |
| py311-django-compres..> | 2025-12-22 16:54 | 10K | |
| py311-django-configu..> | 2025-12-23 09:07 | 245K | |
| py311-django-constan..> | 2025-12-21 09:46 | 52K | |
| py311-django-contact..> | 2025-12-20 21:08 | 17K | |
| py311-django-context..> | 2025-12-21 09:15 | 4.1K | |
| py311-django-contrib..> | 2025-12-20 10:33 | 162K | |
| py311-django-cors-he..> | 2025-12-18 12:10 | 19K | |
| py311-django-countri..> | 2025-12-23 03:55 | 414K | |
| py311-django-crispy-..> | 2025-12-19 05:59 | 57K | |
| py311-django-cron-0...> | 2025-12-23 17:21 | 36K | |
| py311-django-csp-4.0..> | 2025-12-24 01:21 | 53K | |
| py311-django-debreac..> | 2025-12-19 07:42 | 10K | |
| py311-django-debug-t..> | 2025-12-19 16:55 | 205K | |
| py311-django-easy-th..> | 2025-12-27 08:19 | 294K | |
| py311-django-extensi..> | 2025-12-19 09:48 | 354K | |
| py311-django-filer-3..> | 2025-12-28 03:18 | 939K | |
| py311-django-filter-..> | 2025-12-19 07:27 | 93K | |
| py311-django-formset..> | 2025-12-22 01:21 | 10K | |
| py311-django-formtoo..> | 2025-12-19 10:01 | 62K | |
| py311-django-graphiq..> | 2025-12-21 02:16 | 8.2K | |
| py311-django-graphql..> | 2025-12-30 03:57 | 52K | |
| py311-django-graphql..> | 2025-12-26 15:39 | 51K | |
| py311-django-gravata..> | 2025-12-19 02:20 | 12K | |
| py311-django-guardia..> | 2025-12-19 21:06 | 165K | |
| py311-django-hashid-..> | 2025-12-21 15:42 | 33K | |
| py311-django-haystac..> | 2025-12-19 23:59 | 227K | |
| py311-django-hierark..> | 2025-12-21 10:05 | 18K | |
| py311-django-htmlmin..> | 2025-12-20 22:46 | 13K | |
| py311-django-htmx-1...> | 2025-12-23 07:52 | 59K | |
| py311-django-i18nfie..> | 2025-12-22 15:48 | 20K | |
| py311-django-jquery-..> | 2025-12-19 17:33 | 97K | |
| py311-django-js-asse..> | 2025-12-19 16:55 | 8.8K | |
| py311-django-jsonvie..> | 2025-12-22 14:42 | 20K | |
| py311-django-libsass..> | 2025-12-22 08:16 | 8.0K | |
| py311-django-mailbox..> | 2025-12-22 09:59 | 2.8M | |
| py311-django-mailman..> | 2025-12-27 13:08 | 439K | |
| py311-django-markdow..> | 2025-12-29 19:14 | 43K | |
| py311-django-markwha..> | 2025-12-21 07:38 | 11K | |
| py311-django-mezzani..> | 2025-12-23 01:01 | 93K | |
| py311-django-mezzani..> | 2025-12-23 22:14 | 72K | |
| py311-django-model-u..> | 2025-12-20 00:43 | 54K | |
| py311-django-modelcl..> | 2025-12-23 10:08 | 57K | |
| py311-django-mptt-0...> | 2025-12-21 17:56 | 124K | |
| py311-django-multise..> | 2025-12-23 09:34 | 16K | |
| py311-django-netfiel..> | 2025-12-22 14:33 | 27K | |
| py311-django-object-..> | 2025-12-23 06:25 | 13K | |
| py311-django-otp-1.6..> | 2025-12-20 01:02 | 72K | |
| py311-django-otp-yub..> | 2025-12-20 12:23 | 17K | |
| py311-django-permiss..> | 2025-12-21 09:28 | 7.4K | |
| py311-django-pglocks..> | 2025-12-19 12:54 | 6.4K | |
| py311-django-photolo..> | 2025-12-28 05:30 | 186K | |
| py311-django-picklef..> | 2025-12-18 20:21 | 13K | |
| py311-django-pipelin..> | 2025-12-20 22:59 | 62K | |
| py311-django-polymor..> | 2025-12-20 01:56 | 94K | |
| py311-django-post_of..> | 2025-12-23 19:50 | 131K | |
| py311-django-prometh..> | 2025-12-29 16:49 | 44K | |
| py311-django-pyscss-..> | 2025-12-22 19:57 | 12K | |
| py311-django-q2-1.9...> | 2025-12-19 12:20 | 166K | |
| py311-django-radius-..> | 2025-12-22 18:15 | 12K | |
| py311-django-ranged-..> | 2025-12-18 21:33 | 5.4K | |
| py311-django-redis-6..> | 2025-12-22 05:40 | 61K | |
| py311-django-registr..> | 2025-12-22 17:10 | 50K | |
| py311-django-registr..> | 2025-12-20 06:07 | 114K | |
| py311-django-request..> | 2025-12-23 08:27 | 11K | |
| py311-django-reversi..> | 2025-12-21 22:30 | 2.7M | |
| py311-django-reversi..> | 2025-12-22 08:57 | 52K | |
| py311-django-rich-2...> | 2025-12-22 09:52 | 17K | |
| py311-django-rq-3.2...> | 2025-12-18 11:57 | 77K | |
| py311-django-sekizai..> | 2025-12-20 02:12 | 15K | |
| py311-django-simple-..> | 2025-12-27 03:50 | 277K | |
| py311-django-simple-..> | 2025-12-23 09:36 | 212K | |
| py311-django-smart-s..> | 2025-12-21 09:13 | 28K | |
| py311-django-soft-de..> | 2025-12-22 14:57 | 18K | |
| py311-django-solo-2...> | 2025-12-21 06:54 | 19K | |
| py311-django-sortedm..> | 2025-12-19 23:17 | 40K | |
| py311-django-star-ra..> | 2025-12-22 17:12 | 41K | |
| py311-django-statici..> | 2025-12-19 23:06 | 12K | |
| py311-django-statici..> | 2025-12-21 02:50 | 20K | |
| py311-django-storage..> | 2025-12-18 13:35 | 69K | |
| py311-django-stubs-e..> | 2025-12-20 04:06 | 14K | |
| py311-django-tables2..> | 2025-12-20 08:43 | 110K | |
| py311-django-tagging..> | 2025-12-23 16:01 | 66K | |
| py311-django-taggit-..> | 2025-12-21 23:02 | 63K | |
| py311-django-tasks-0..> | 2025-12-20 12:00 | 69K | |
| py311-django-tastypi..> | 2025-12-23 06:23 | 151K | |
| py311-django-templat..> | 2025-12-23 06:24 | 7.1K | |
| py311-django-timezon..> | 2025-12-23 13:37 | 20K | |
| py311-django-tinymce..> | 2025-12-23 11:07 | 778K | |
| py311-django-tree-qu..> | 2025-12-22 12:11 | 49K | |
| py311-django-treebea..> | 2025-12-18 12:08 | 459K | |
| py311-django-unfold-..> | 2025-12-30 01:45 | 1.1M | |
| py311-django-voting-..> | 2025-12-23 00:11 | 22K | |
| py311-django-webpack..> | 2025-12-19 04:40 | 25K | |
| py311-django-widget-..> | 2025-12-21 09:43 | 12K | |
| py311-django42-4.2.2..> | 2025-12-18 04:51 | 4.9M | |
| py311-django51-5.1.1..> | 2025-12-19 00:01 | 5.1M | |
| py311-django52-5.2.9..> | 2025-12-18 10:13 | 5.1M | |
| py311-django60-6.0.pkg | 2025-12-22 13:59 | 5.2M | |
| py311-django_compres..> | 2025-12-19 17:01 | 175K | |
| py311-djangocms-admi..> | 2025-12-20 02:41 | 254K | |
| py311-djangoql-0.18...> | 2025-12-20 03:35 | 225K | |
| py311-djangorestfram..> | 2025-12-18 07:47 | 1.0M | |
| py311-djangorestfram..> | 2025-12-23 11:00 | 22K | |
| py311-djangorestfram..> | 2025-12-23 04:24 | 20K | |
| py311-djangorestfram..> | 2025-12-23 11:02 | 7.8K | |
| py311-djangorestfram..> | 2025-12-23 09:08 | 6.7K | |
| py311-djangosaml2-1...> | 2025-12-27 10:40 | 89K | |
| py311-dkimpy-1.1.8_1..> | 2025-12-26 20:14 | 78K | |
| py311-dkimpy-milter-..> | 2025-12-27 20:43 | 59K | |
| py311-dlib-20.0.0_1.pkg | 2025-12-26 20:37 | 2.9M | |
| py311-dlinfo-2.0.0.pkg | 2025-12-21 16:57 | 4.4K | |
| py311-dlipower-1.0.1..> | 2025-12-29 12:42 | 21K | |
| py311-dm-tree-0.1.8_..> | 2025-12-18 20:53 | 109K | |
| py311-dna-features-v..> | 2025-12-28 06:43 | 54K | |
| py311-dnaio-1.2.4.pkg | 2025-12-18 23:37 | 108K | |
| py311-dns-crawler-1...> | 2025-12-27 21:31 | 75K | |
| py311-dns-lexicon-3...> | 2025-12-27 03:40 | 391K | |
| py311-dnsdiag-2.1.0_..> | 2025-12-29 04:36 | 18K | |
| py311-dnslib-0.9.26.pkg | 2025-12-19 06:03 | 124K | |
| py311-dnspython-2.8...> | 2025-12-26 10:00 | 537K | |
| py311-docformatter-1..> | 2025-12-19 11:00 | 53K | |
| py311-docker-7.1.0.pkg | 2025-12-26 21:22 | 235K | |
| py311-docker-pycreds..> | 2025-12-18 14:42 | 8.5K | |
| py311-dockerfile-par..> | 2025-12-19 05:59 | 32K | |
| py311-dockerpty-0.4...> | 2025-12-27 11:38 | 22K | |
| py311-docopt-0.6.2_2..> | 2025-12-18 23:35 | 30K | |
| py311-docplex-2.28.2..> | 2025-12-22 14:59 | 1.3M | |
| py311-docrepr-0.2.0_..> | 2025-12-28 08:11 | 133K | |
| py311-docstring-to-m..> | 2025-12-27 00:37 | 41K | |
| py311-docstring_pars..> | 2025-12-18 18:35 | 73K | |
| py311-doctest-ignore..> | 2025-12-21 01:41 | 4.1K | |
| py311-docutils-0.21...> | 2025-12-16 01:40 | 919K | |
| py311-docx-generator..> | 2025-12-29 18:39 | 37K | |
| py311-docx2txt-0.8_1..> | 2025-12-20 08:59 | 5.6K | |
| py311-docxcompose-1...> | 2025-12-18 21:53 | 46K | |
| py311-docxtpl-0.20.0..> | 2025-12-19 09:11 | 38K | |
| py311-dodgy-0.2.1_1.pkg | 2025-12-19 22:31 | 10K | |
| py311-dogpile.cache-..> | 2025-12-18 12:52 | 108K | |
| py311-doit-0.36.0_1.pkg | 2025-12-18 19:12 | 167K | |
| py311-domdf-python-t..> | 2025-12-18 19:37 | 172K | |
| py311-dominate-2.9.1..> | 2025-12-19 06:14 | 47K | |
| py311-donfig-0.8.1.p..> | 2025-12-23 13:39 | 44K | |
| py311-donut-shellcod..> | 2025-12-18 22:35 | 43K | |
| py311-dot2tex-2.11.3..> | 2025-12-27 15:13 | 88K | |
| py311-dotmap-1.3.30.pkg | 2025-12-19 22:56 | 31K | |
| py311-dotted-0.1.8_1..> | 2025-12-22 10:43 | 20K | |
| py311-dotty-dict-1.3..> | 2025-12-19 23:34 | 12K | |
| py311-dparse-0.6.4.pkg | 2025-12-29 19:50 | 26K | |
| py311-dpcontracts-0...> | 2025-12-19 02:59 | 13K | |
| py311-dpkt-1.9.6_1.pkg | 2025-12-19 17:33 | 346K | |
| py311-draftjs-export..> | 2025-12-18 23:10 | 44K | |
| py311-drf-spectacula..> | 2025-12-28 06:42 | 201K | |
| py311-drf-spectacula..> | 2025-12-19 17:17 | 1.9M | |
| py311-drf-writable-n..> | 2025-12-23 11:01 | 17K | |
| py311-drf-yasg-1.21...> | 2025-12-29 18:13 | 2.7M | |
| py311-drmaa-0.4b3_2.pkg | 2025-12-20 08:59 | 30K | |
| py311-dropbox-11.36...> | 2025-12-26 21:41 | 1.0M | |
| py311-dshell-3.2.3_1..> | 2025-12-29 06:29 | 223K | |
| py311-dtfabric-20240..> | 2025-12-19 00:44 | 73K | |
| py311-dtflickr-1.5_2..> | 2025-12-21 04:46 | 33K | |
| py311-ducc0-0.34.0_1..> | 2025-12-29 15:54 | 2.9M | |
| py311-duckdb-1.3.2.pkg | 2025-12-27 16:59 | 12M | |
| py311-duckdb_engine-..> | 2025-12-30 06:47 | 89K | |
| py311-duecredit-0.10..> | 2025-12-30 15:44 | 137K | |
| py311-duet-0.2.9_1.pkg | 2025-12-18 15:56 | 57K | |
| py311-dugong-3.7.5_1..> | 2025-12-22 17:10 | 40K | |
| py311-dukpy-0.5.0.pkg | 2025-12-19 09:06 | 1.0M | |
| py311-dulwich-0.24.1..> | 2025-12-26 14:46 | 1.4M | |
| py311-dunamai-1.25.0..> | 2025-12-18 11:06 | 58K | |
| py311-durationpy-0.1..> | 2025-12-19 17:28 | 5.5K | |
| py311-durus-3.9_2.pkg | 2025-12-23 01:35 | 122K | |
| py311-dwave-cloud-cl..> | 2025-12-26 20:22 | 276K | |
| py311-dwave-gate-0.3..> | 2025-12-27 11:38 | 423K | |
| py311-dwave-greedy-0..> | 2025-12-30 02:27 | 6.9K | |
| py311-dwave-hybrid-0..> | 2025-12-27 15:42 | 130K | |
| py311-dwave-inspecto..> | 2025-12-27 12:38 | 48K | |
| py311-dwave-neal-0.6..> | 2025-12-27 19:24 | 3.9K | |
| py311-dwave-networkx..> | 2025-12-26 16:32 | 135K | |
| py311-dwave-ocean-sd..> | 2025-12-30 07:29 | 7.9K | |
| py311-dwave-optimiza..> | 2025-12-26 20:14 | 1.0M | |
| py311-dwave-preproce..> | 2025-12-26 20:06 | 407K | |
| py311-dwave-samplers..> | 2025-12-26 19:53 | 691K | |
| py311-dwave-system-1..> | 2025-12-26 22:56 | 165K | |
| py311-dwave-tabu-0.5..> | 2025-12-30 06:40 | 4.2K | |
| py311-dwavebinarycsp..> | 2025-12-29 22:11 | 39K | |
| py311-dynrules-0.1.0..> | 2025-12-20 10:29 | 102K | |
| py311-e3-core-22.10...> | 2025-12-28 04:06 | 577K | |
| py311-earthpy-0.9.4_..> | 2025-12-28 12:39 | 1.3M | |
| py311-easydict-1.13_..> | 2025-12-20 23:30 | 5.6K | |
| py311-easygui-0.98.3..> | 2025-12-27 14:40 | 121K | |
| py311-easyocr-1.7.2.pkg | 2025-12-28 09:38 | 58M | |
| py311-easyprocess-0...> | 2025-12-26 22:56 | 13K | |
| py311-easyzone-1.2.2..> | 2025-12-30 01:41 | 13K | |
| py311-ebaysdk-2.2.0_..> | 2025-12-18 18:34 | 98K | |
| py311-ebcdic-1.1.1_1..> | 2025-12-20 08:36 | 12K | |
| py311-eccodes-2.44.0..> | 2025-12-27 10:01 | 175K | |
| py311-ecdsa-0.19.1.pkg | 2025-12-18 21:53 | 302K | |
| py311-ecos-2.0.14_1.pkg | 2025-12-27 07:29 | 61K | |
| py311-ed2k-tools-0.1..> | 2025-12-23 20:48 | 8.6K | |
| py311-ed25519ll-0.6_..> | 2025-12-21 03:29 | 74K | |
| py311-edalize-0.6.1.pkg | 2025-12-27 15:35 | 226K | |
| py311-editables-0.5.pkg | 2025-12-22 13:59 | 8.9K | |
| py311-editdistance-0..> | 2025-12-21 12:11 | 19K | |
| py311-editor-1.6.6.pkg | 2025-12-19 02:21 | 5.2K | |
| py311-editorconfig-0..> | 2025-12-18 17:21 | 21K | |
| py311-eemeter-4.0.7_..> | 2025-12-29 23:25 | 1.3M | |
| py311-einops-0.8.1.pkg | 2025-12-18 17:59 | 151K | |
| py311-ejson-0.1.6_2.pkg | 2025-12-19 01:11 | 12K | |
| py311-elastic-transp..> | 2025-12-26 20:20 | 98K | |
| py311-elasticsearch-..> | 2025-12-26 21:40 | 813K | |
| py311-elasticsearch-..> | 2025-12-29 20:57 | 19K | |
| py311-elasticsearch-..> | 2025-12-29 20:46 | 110K | |
| py311-elasticsearch-..> | 2025-12-26 19:12 | 108K | |
| py311-elasticsearch5..> | 2025-12-27 22:48 | 87K | |
| py311-elasticsearch6..> | 2025-12-26 15:42 | 112K | |
| py311-elasticsearch7..> | 2025-12-30 02:30 | 237K | |
| py311-electrum-aiono..> | 2025-12-19 04:58 | 62K | |
| py311-electrum-ecc-0..> | 2025-12-19 02:27 | 28K | |
| py311-elelabs-zigbee..> | 2025-12-21 09:13 | 578K | |
| py311-elementpath-5...> | 2025-12-18 13:00 | 573K | |
| py311-elf_diff-0.7.1..> | 2025-12-21 03:28 | 153K | |
| py311-eliot-1.17.5.pkg | 2025-12-27 13:08 | 234K | |
| py311-email-reply-pa..> | 2025-12-22 06:36 | 6.3K | |
| py311-email-validato..> | 2025-12-26 20:16 | 46K | |
| py311-emcee-3.1.6.pkg | 2025-12-27 10:46 | 96K | |
| py311-emeraldtree-0...> | 2025-12-19 22:23 | 51K | |
| py311-emmet-core-0.6..> | 2025-12-27 11:16 | 295K | |
| py311-emoji-2.15.0.pkg | 2025-12-19 23:29 | 470K | |
| py311-empy-3.3.4_1.pkg | 2025-12-19 17:28 | 75K | |
| py311-enchant-3.3.0.pkg | 2025-12-18 22:39 | 79K | |
| py311-enlighten-1.12..> | 2025-12-19 14:06 | 59K | |
| py311-enmerkar-0.7.1..> | 2025-12-19 20:16 | 18K | |
| py311-enrich-1.2.7_1..> | 2025-12-19 19:18 | 14K | |
| py311-entrypoint2-1...> | 2025-12-18 22:35 | 16K | |
| py311-entrypoints-0...> | 2025-12-18 12:05 | 11K | |
| py311-enum-compat-0...> | 2025-12-19 11:17 | 1.5K | |
| py311-envier-0.6.1.pkg | 2025-12-20 02:12 | 24K | |
| py311-envisage-7.0.4..> | 2025-12-26 15:35 | 299K | |
| py311-envs-1.3_1.pkg | 2025-12-19 17:03 | 24K | |
| py311-enzyme-0.5.2.pkg | 2025-12-19 13:13 | 36K | |
| py311-epc-0.0.5_1.pkg | 2025-12-22 13:22 | 51K | |
| py311-epdb-0.15.1_1.pkg | 2025-12-22 01:17 | 56K | |
| py311-ephem-4.2_1.pkg | 2025-12-23 22:16 | 1.3M | |
| py311-ephemeral-port..> | 2025-12-21 06:18 | 5.0K | |
| py311-epsilon-0.8.0_..> | 2025-12-30 15:03 | 217K | |
| py311-epy-reader-202..> | 2025-12-22 23:26 | 292K | |
| py311-err-backend-di..> | 2025-12-23 11:17 | 38K | |
| py311-err-backend-ma..> | 2025-12-30 06:31 | 40K | |
| py311-errbot-6.2.0_2..> | 2025-12-27 23:09 | 306K | |
| py311-errbot-backend..> | 2025-12-22 12:55 | 60K | |
| py311-esda-2.8.0.pkg | 2025-12-26 19:17 | 288K | |
| py311-esptool-4.9.0.pkg | 2025-12-28 17:54 | 521K | |
| py311-essentials-1.1..> | 2025-12-20 00:01 | 34K | |
| py311-essentials-ope..> | 2025-12-20 19:48 | 75K | |
| py311-et_xmlfile-2.0..> | 2025-12-18 12:55 | 23K | |
| py311-etcd3gw-2.4.2.pkg | 2025-12-27 17:39 | 38K | |
| py311-ete3-3.1.3_3.pkg | 2025-12-29 06:59 | 2.3M | |
| py311-etils-1.13.0.pkg | 2025-12-27 16:12 | 245K | |
| py311-etuples-0.3.10..> | 2025-12-18 23:10 | 21K | |
| py311-eval-type-back..> | 2025-12-24 04:45 | 11K | |
| py311-evalidate-2.0...> | 2025-12-19 12:38 | 11K | |
| py311-evdev-1.9.1_1.pkg | 2025-12-16 01:48 | 70K | |
| py311-eventlet-0.40...> | 2025-12-26 17:47 | 550K | |
| py311-eventlib-0.1.5..> | 2025-12-19 13:59 | 22K | |
| py311-evtx2splunk-2...> | 2025-12-27 15:03 | 25K | |
| py311-ewah-bool-util..> | 2025-12-27 09:46 | 240K | |
| py311-ewmh-0.1.6_2.pkg | 2025-12-19 22:32 | 11K | |
| py311-exabgp4-4.2.22..> | 2025-12-23 19:37 | 1.0M | |
| py311-exam-0.10.6_1.pkg | 2025-12-20 06:14 | 16K | |
| py311-exceptiongroup..> | 2025-12-19 16:23 | 33K | |
| py311-exchange-calen..> | 2025-12-27 02:27 | 249K | |
| py311-exchangelib-5...> | 2025-12-30 01:00 | 471K | |
| py311-execnet-2.1.2.pkg | 2025-12-18 11:33 | 100K | |
| py311-executing-2.2...> | 2025-12-18 01:37 | 60K | |
| py311-expandvars-0.1..> | 2025-12-18 01:34 | 12K | |
| py311-expecttest-0.2..> | 2025-12-22 15:14 | 15K | |
| py311-expiringdict-1..> | 2025-12-18 22:36 | 8.4K | |
| py311-exscript-2.6_2..> | 2025-12-29 02:52 | 282K | |
| py311-extension-help..> | 2025-12-18 10:27 | 49K | |
| py311-extractcode-31..> | 2025-12-30 16:52 | 90K | |
| py311-extras-1.0.0_2..> | 2025-12-21 19:04 | 10K | |
| py311-extruct-0.18.0..> | 2025-12-28 11:46 | 44K | |
| py311-eyed3-0.9.8.pkg | 2025-12-19 14:43 | 314K | |
| py311-ezc3d-1.6.3.pkg | 2025-12-28 21:11 | 647K | |
| py311-ezdxf-1.0.2_3.pkg | 2025-12-29 05:49 | 2.1M | |
| py311-fabric-3.2.2_2..> | 2025-12-27 13:28 | 85K | |
| py311-fabric3-1.14_1..> | 2025-12-19 14:17 | 153K | |
| py311-face-22.0.0_1.pkg | 2025-12-19 15:24 | 113K | |
| py311-face_recogniti..> | 2025-12-29 00:23 | 21K | |
| py311-face_recogniti..> | 2025-12-20 00:04 | 88M | |
| py311-facenet-pytorc..> | 2025-12-29 15:59 | 1.8M | |
| py311-factory-boy-3...> | 2025-12-19 05:54 | 75K | |
| py311-fail2ban-1.1.0..> | 2025-12-21 03:52 | 848K | |
| py311-faiss-1.13.1.pkg | 2025-12-28 08:34 | 1.1M | |
| py311-fake-useragent..> | 2025-12-20 01:10 | 120K | |
| py311-fakeredis-2.32..> | 2025-12-21 15:34 | 290K | |
| py311-falcon-3.1.3_1..> | 2025-12-18 19:45 | 1.2M | |
| py311-fam-1.1.1_4.pkg | 2025-12-22 17:55 | 6.0K | |
| py311-fast-histogram..> | 2025-12-27 09:08 | 28K | |
| py311-fastapi-0.115...> | 2025-12-26 23:59 | 175K | |
| py311-fastapi-sso-0...> | 2025-12-28 09:45 | 38K | |
| py311-fastavro-1.10...> | 2025-12-18 23:42 | 436K | |
| py311-fastbencode-0...> | 2025-12-19 16:30 | 39K | |
| py311-fastcache-1.1...> | 2025-12-24 04:27 | 29K | |
| py311-fastcluster-1...> | 2025-12-27 17:44 | 41K | |
| py311-fasteners-0.20..> | 2025-12-18 11:19 | 31K | |
| py311-fastentrypoint..> | 2025-12-23 12:24 | 6.2K | |
| py311-fastest_pkg-0...> | 2025-12-30 01:42 | 12K | |
| py311-fastf1-3.5.3_1..> | 2025-12-30 06:31 | 264K | |
| py311-fastimport-0.9..> | 2025-12-21 02:51 | 71K | |
| py311-fastjsonschema..> | 2025-12-18 01:05 | 46K | |
| py311-fastmcp-2.12.1..> | 2025-12-23 19:49 | 508K | |
| py311-fastnumbers-5...> | 2025-12-22 23:30 | 116K | |
| py311-fastparquet-20..> | 2025-12-28 09:45 | 438K | |
| py311-fastprogress-1..> | 2025-12-19 10:55 | 20K | |
| py311-fastscapelib-0..> | 2025-12-30 09:02 | 467K | |
| py311-fasttext-predi..> | 2025-12-19 19:45 | 95K | |
| py311-fastuuid-0.14...> | 2025-12-26 23:35 | 202K | |
| py311-faust-cchardet..> | 2025-12-21 18:36 | 116K | |
| py311-fbmq-2.5.0_1.pkg | 2025-12-29 05:16 | 28K | |
| py311-fclist-cffi-1...> | 2025-12-19 20:48 | 7.5K | |
| py311-fdb-2.0.1_4.pkg | 2025-12-23 07:57 | 351K | |
| py311-feedgen-1.0.0_..> | 2025-12-19 20:27 | 69K | |
| py311-feedgenerator-..> | 2025-12-19 20:46 | 36K | |
| py311-feedparser-6.0..> | 2025-12-18 10:25 | 133K | |
| py311-fenics-basix-0..> | 2025-12-29 04:39 | 163K | |
| py311-fenics-ffcx-0...> | 2025-12-23 04:36 | 217K | |
| py311-fenics-ufl-202..> | 2025-12-23 01:41 | 433K | |
| py311-ffn-1.1.2_1.pkg | 2025-12-27 16:22 | 59K | |
| py311-fiddle-0.3.0.pkg | 2025-12-28 03:51 | 664K | |
| py311-fido2-2.0.0.pkg | 2025-12-26 17:47 | 308K | |
| py311-fields-5.0.0_1..> | 2025-12-20 10:33 | 25K | |
| py311-fife-0.4.2_13.pkg | 2025-12-27 09:57 | 3.0M | |
| py311-file-read-back..> | 2025-12-19 01:20 | 11K | |
| py311-filebytes-0.10..> | 2025-12-18 21:28 | 55K | |
| py311-filedepot-0.11..> | 2025-12-21 21:20 | 67K | |
| py311-filelike-0.4.1..> | 2025-12-22 11:20 | 82K | |
| py311-filelock-3.20...> | 2025-12-26 09:22 | 27K | |
| py311-filemagic-1.6_..> | 2025-12-19 02:01 | 17K | |
| py311-files-to-promp..> | 2025-12-20 21:59 | 16K | |
| py311-filetype-1.2.0..> | 2025-12-18 18:15 | 37K | |
| py311-financedatabas..> | 2025-12-27 02:58 | 38K | |
| py311-financetoolkit..> | 2025-12-26 21:02 | 512K | |
| py311-find-libpython..> | 2025-12-19 16:39 | 14K | |
| py311-findlibs-0.1.2..> | 2025-12-18 22:48 | 16K | |
| py311-findpython-0.7..> | 2025-12-18 18:53 | 42K | |
| py311-fingerprints-1..> | 2025-12-22 06:29 | 29K | |
| py311-finnhub-python..> | 2025-12-30 07:32 | 16K | |
| py311-finviz-1.4.6_3..> | 2025-12-30 18:17 | 37K | |
| py311-finvizfinance-..> | 2025-12-29 22:32 | 78K | |
| py311-fiona-1.10.1_3..> | 2025-12-26 11:12 | 658K | |
| py311-fire-0.7.0_1.pkg | 2025-12-19 02:51 | 200K | |
| py311-fireREST-1.1.0..> | 2025-12-28 04:24 | 103K | |
| py311-firebirdsql-1...> | 2025-12-23 19:01 | 185K | |
| py311-first-2.0.2_1.pkg | 2025-12-22 05:20 | 5.8K | |
| py311-fitsio-1.3.0.pkg | 2025-12-29 04:00 | 260K | |
| py311-fixtures-4.2.4..> | 2025-12-18 19:20 | 88K | |
| py311-flake8-7.3.0.pkg | 2025-12-18 12:07 | 107K | |
| py311-flake8-black-0..> | 2025-12-29 12:28 | 14K | |
| py311-flake8-bugbear..> | 2025-12-20 06:50 | 71K | |
| py311-flake8-builtin..> | 2025-12-21 17:06 | 17K | |
| py311-flake8-compreh..> | 2025-12-20 21:26 | 13K | |
| py311-flake8-docstri..> | 2025-12-21 04:17 | 7.5K | |
| py311-flake8-future-..> | 2025-12-21 19:53 | 14K | |
| py311-flake8-import-..> | 2025-12-23 01:01 | 26K | |
| py311-flake8-polyfil..> | 2025-12-21 15:42 | 8.0K | |
| py311-flake8-print-5..> | 2025-12-22 02:53 | 7.5K | |
| py311-flake8-pyi-25...> | 2025-12-23 00:08 | 67K | |
| py311-flake8-quotes-..> | 2025-12-20 09:25 | 14K | |
| py311-flake8_simplif..> | 2025-12-21 07:44 | 46K | |
| py311-flaky-3.8.1_1.pkg | 2025-12-21 21:29 | 26K | |
| py311-flanker-0.9.11..> | 2025-12-29 19:01 | 255K | |
| py311-flasgger-0.9.7..> | 2025-12-26 21:51 | 2.4M | |
| py311-flask-3.1.2_2.pkg | 2025-12-18 14:21 | 167K | |
| py311-flask-api-3.0_..> | 2025-12-21 11:51 | 134K | |
| py311-flask-apschedu..> | 2025-12-19 14:01 | 25K | |
| py311-flask-babel-4...> | 2025-12-19 00:17 | 20K | |
| py311-flask-babelex-..> | 2025-12-21 01:43 | 15K | |
| py311-flask-caching-..> | 2025-12-19 15:28 | 49K | |
| py311-flask-dance-7...> | 2025-12-29 11:46 | 314K | |
| py311-flask-json-0.4..> | 2025-12-19 09:38 | 16K | |
| py311-flask-jwt-exte..> | 2025-12-30 12:11 | 40K | |
| py311-flask-mail-0.1..> | 2025-12-22 20:37 | 20K | |
| py311-flask-marshmal..> | 2025-12-21 12:51 | 16K | |
| py311-flask-migrate-..> | 2025-12-30 06:40 | 26K | |
| py311-flask-mongoeng..> | 2025-12-30 16:27 | 46K | |
| py311-flask-peewee-3..> | 2025-12-30 10:32 | 226K | |
| py311-flask-pymongo-..> | 2025-12-22 17:11 | 20K | |
| py311-flask-restx-1...> | 2025-12-27 13:00 | 1.6M | |
| py311-flask-script-2..> | 2025-12-24 06:08 | 30K | |
| py311-flask-session-..> | 2025-12-23 05:03 | 37K | |
| py311-flask-smorest-..> | 2025-12-30 07:54 | 55K | |
| py311-flask-socketio..> | 2025-12-27 07:26 | 32K | |
| py311-flask-sqlalche..> | 2025-12-27 17:58 | 44K | |
| py311-flask-sqlalche..> | 2025-12-20 04:21 | 43K | |
| py311-flask-theme-0...> | 2025-12-19 08:00 | 14K | |
| py311-flask_limiter-..> | 2025-12-20 17:54 | 64K | |
| py311-flask_wtf-1.2...> | 2025-12-27 10:22 | 24K | |
| py311-flatbuffers-25..> | 2025-12-18 17:42 | 62K | |
| py311-flatdict-4.0.1..> | 2025-12-21 18:47 | 14K | |
| py311-flatland-0.9.1..> | 2025-12-20 02:32 | 133K | |
| py311-flatten-dict-0..> | 2025-12-18 20:14 | 17K | |
| py311-flax-0.6.8_3.pkg | 2025-12-29 22:18 | 361K | |
| py311-fleep-1.0.1_1.pkg | 2025-12-20 17:17 | 7.9K | |
| py311-flex-6.14.1_1.pkg | 2025-12-30 05:35 | 113K | |
| py311-flexmock-0.12...> | 2025-12-20 15:20 | 47K | |
| py311-flit-3.12.0.pkg | 2025-12-26 14:48 | 87K | |
| py311-flit-core-3.12..> | 2025-12-16 01:35 | 100K | |
| py311-flit-scm-1.7.0..> | 2025-12-18 22:47 | 4.3K | |
| py311-flower-2.0.1_2..> | 2025-12-27 12:29 | 371K | |
| py311-fluent-0.10.0_..> | 2025-12-20 11:31 | 40K | |
| py311-fluent-logger-..> | 2025-12-22 12:35 | 23K | |
| py311-fluent.syntax-..> | 2025-12-19 16:15 | 45K | |
| py311-flufl.bounce-4..> | 2025-12-18 21:34 | 114K | |
| py311-flufl.i18n-4.1..> | 2025-12-19 01:58 | 18K | |
| py311-flufl.lock-7.1..> | 2025-12-19 00:05 | 19K | |
| py311-flup6-1.1.1_1.pkg | 2025-12-18 21:13 | 86K | |
| py311-flynt-1.0.6.pkg | 2025-12-22 08:40 | 73K | |
| py311-fmoo-audiotool..> | 2025-12-29 00:46 | 2.2M | |
| py311-focker-2.0_2.pkg | 2025-12-22 16:21 | 10K | |
| py311-folium-0.20.0.pkg | 2025-12-29 23:26 | 153K | |
| py311-font-v-2.1.0_1..> | 2025-12-29 23:28 | 39K | |
| py311-fontMath-0.9.3..> | 2025-12-26 12:27 | 79K | |
| py311-fontaine-1.4.0..> | 2025-12-29 12:09 | 3.1M | |
| py311-fontbakery-1.1..> | 2025-12-28 03:08 | 697K | |
| py311-fontfeatures-1..> | 2025-12-29 12:56 | 217K | |
| py311-fonticon-fonta..> | 2025-12-21 10:24 | 566K | |
| py311-fontmake-3.5.1..> | 2025-12-29 03:06 | 79K | |
| py311-fontparts-0.12..> | 2025-12-26 13:06 | 327K | |
| py311-fontpens-0.2.4..> | 2025-12-26 11:14 | 31K | |
| py311-fonttools-4.61..> | 2025-12-26 06:48 | 2.8M | |
| py311-foolscap-23.3...> | 2025-12-27 09:04 | 640K | |
| py311-forbiddenfruit..> | 2025-12-20 02:18 | 25K | |
| py311-forcediphttpsa..> | 2025-12-27 16:39 | 7.6K | |
| py311-formencode-2.1..> | 2025-12-18 17:53 | 258K | |
| py311-formulaic-1.0...> | 2025-12-26 23:09 | 177K | |
| py311-formulaic_cont..> | 2025-12-27 17:01 | 16K | |
| py311-fotokilof-5.1...> | 2025-12-28 01:26 | 112K | |
| py311-fpdf-1.7.2_1.pkg | 2025-12-24 07:30 | 111K | |
| py311-fpylll-0.6.4.pkg | 2025-12-29 06:55 | 572K | |
| py311-fqdn-1.4.0_1.pkg | 2025-12-18 01:34 | 4.8K | |
| py311-fraction-2.2.0..> | 2025-12-21 05:09 | 8.9K | |
| py311-frappe-bench-5..> | 2025-12-28 05:57 | 232K | |
| py311-fredapi-0.5.2_..> | 2025-12-30 07:50 | 14K | |
| py311-free-proxy-1.1..> | 2025-12-27 17:44 | 9.6K | |
| py311-freebsd-0.9.5_..> | 2025-12-20 17:55 | 25K | |
| py311-freebsd-sysctl..> | 2025-12-21 14:09 | 13K | |
| py311-freeimagepy-2...> | 2025-12-23 13:56 | 815K | |
| py311-freenas.utils-..> | 2025-12-21 18:43 | 21K | |
| py311-freenit-0.3.20..> | 2025-12-29 19:15 | 74K | |
| py311-freetype-py-2...> | 2025-12-26 15:46 | 104K | |
| py311-freezegun-1.5...> | 2025-12-18 18:24 | 38K | |
| py311-frescobaldi-4...> | 2025-12-29 01:14 | 6.0M | |
| py311-fresnel-0.13.8..> | 2025-12-29 13:01 | 567K | |
| py311-frictionless-5..> | 2025-12-27 10:21 | 842K | |
| py311-frictionless-c..> | 2025-12-21 08:03 | 14K | |
| py311-fritzconnectio..> | 2025-12-30 10:32 | 124K | |
| py311-frozendict-2.4..> | 2025-12-18 12:02 | 25K | |
| py311-frozenlist-1.8..> | 2025-12-18 01:50 | 41K | |
| py311-fs-0.5.4_2.pkg | 2025-12-23 19:58 | 573K | |
| py311-fs2-2.4.16_1.pkg | 2025-12-18 20:32 | 255K | |
| py311-fsph-0.3.0.pkg | 2025-12-28 13:51 | 80K | |
| py311-fsspec-2025.12..> | 2025-12-18 04:21 | 413K | |
| py311-fsspec-xrootd-..> | 2025-12-23 04:23 | 32K | |
| py311-ftfy-6.3.1.pkg | 2025-12-19 00:44 | 60K | |
| py311-ftputil-5.1.0_..> | 2025-12-23 19:27 | 73K | |
| py311-fudge-1.1.1_1.pkg | 2025-12-19 11:20 | 79K | |
| py311-fugashi-1.4.0_..> | 2025-12-20 12:06 | 49K | |
| py311-fuglu-1.4.0_2.pkg | 2025-12-29 05:21 | 1.0M | |
| py311-funcparserlib-..> | 2025-12-18 12:00 | 25K | |
| py311-funcsigs-1.0.2..> | 2025-12-18 03:46 | 23K | |
| py311-funcy-2.0_1.pkg | 2025-12-19 17:18 | 66K | |
| py311-fundamentalana..> | 2025-12-30 16:49 | 3.2K | |
| py311-furl-2.1.0_1.pkg | 2025-12-20 00:16 | 41K | |
| py311-furo-2025.9.25..> | 2025-12-26 06:19 | 83K | |
| py311-fury-0.12.0_2.pkg | 2025-12-28 20:05 | 868K | |
| py311-fusepy-3.0.1_1..> | 2025-12-22 01:15 | 27K | |
| py311-future-0.18.3_..> | 2025-12-16 01:41 | 832K | |
| py311-futurist-3.2.1..> | 2025-12-18 17:37 | 78K | |
| py311-fuzzywuzzy-0.1..> | 2025-12-27 07:29 | 20K | |
| py311-fvcore-0.1.5.p..> | 2025-12-27 11:18 | 115K | |
| py311-fypp-3.2_1.pkg | 2025-12-18 13:51 | 65K | |
| py311-gTTS-2.5.4.pkg | 2025-12-27 19:38 | 53K | |
| py311-gambit-elastic..> | 2025-12-24 05:21 | 4.2K | |
| py311-game-2.6.1_3.pkg | 2025-12-26 22:05 | 8.8M | |
| py311-game_sdl2-7.4...> | 2025-12-30 08:36 | 923K | |
| py311-gapic-generato..> | 2025-12-29 21:12 | 300K | |
| py311-gast-0.7.0.pkg | 2025-12-18 00:58 | 62K | |
| py311-gau2grid-2.0.7..> | 2025-12-27 10:11 | 287K | |
| py311-gcsfs-2025.12...> | 2025-12-30 05:58 | 89K | |
| py311-gdal-3.11.5.pkg | 2025-12-26 08:52 | 1.3M | |
| py311-gdbm-3.11.14_1..> | 2025-12-18 11:09 | 8.8K | |
| py311-gdown-5.2.0.pkg | 2025-12-28 01:26 | 35K | |
| py311-gdspy-1.6.13.pkg | 2025-12-27 11:39 | 374K | |
| py311-gdstk-0.9.61.pkg | 2025-12-27 21:16 | 283K | |
| py311-gelidum-0.8.2.pkg | 2025-12-19 10:38 | 85K | |
| py311-gemmi-0.7.3.pkg | 2025-12-22 12:21 | 1.2M | |
| py311-gensim-4.3.3.pkg | 2025-12-29 16:11 | 19M | |
| py311-genson-1.3.0.pkg | 2025-12-21 04:35 | 32K | |
| py311-genty-1.3.2_1.pkg | 2025-12-21 05:57 | 21K | |
| py311-geoalchemy2-0...> | 2025-12-22 13:10 | 108K | |
| py311-geocoder-1.38...> | 2025-12-26 21:13 | 132K | |
| py311-geojson-3.2.0_..> | 2025-12-20 00:42 | 27K | |
| py311-geolinks-0.2.3..> | 2025-12-19 23:25 | 7.6K | |
| py311-geomdl-5.2.10_..> | 2025-12-27 16:20 | 283K | |
| py311-geomet-1.1.0.pkg | 2025-12-22 06:34 | 51K | |
| py311-geometer-0.4.2..> | 2025-12-29 05:50 | 126K | |
| py311-geometric-1.1_..> | 2025-12-27 21:48 | 704K | |
| py311-geopandas-0.14..> | 2025-12-26 14:44 | 1.4M | |
| py311-geopy-2.4.1_1.pkg | 2025-12-18 15:50 | 150K | |
| py311-geosnap-0.16.0..> | 2025-12-28 12:54 | 249K | |
| py311-get-reader-1.0..> | 2025-12-19 23:17 | 19K | |
| py311-getmail6-6.19...> | 2025-12-21 22:31 | 225K | |
| py311-gevent-25.8.2.pkg | 2025-12-18 16:15 | 1.7M | |
| py311-gevent-websock..> | 2025-12-18 22:29 | 41K | |
| py311-geventhttpclie..> | 2025-12-27 11:38 | 85K | |
| py311-gffutils-0.13_..> | 2025-12-22 19:16 | 1.1M | |
| py311-gflanguages-0...> | 2025-12-18 22:09 | 739K | |
| py311-gfsubsets-2025..> | 2025-12-19 22:51 | 221K | |
| py311-gguf-0.17.1.71..> | 2025-12-29 00:58 | 253K | |
| py311-gherkin-offici..> | 2025-12-21 05:26 | 72K | |
| py311-ghp-import-2.1..> | 2025-12-18 10:18 | 18K | |
| py311-gi-docgen-2025..> | 2025-12-16 01:40 | 1.2M | |
| py311-giddy-2.3.8.pkg | 2025-12-26 23:32 | 122K | |
| py311-gimmik-3.2.1_1..> | 2025-12-27 03:17 | 18K | |
| py311-git-semver-0.3..> | 2025-12-27 06:48 | 5.7K | |
| py311-git-up-2.3.0_1..> | 2025-12-29 19:00 | 59K | |
| py311-git-url-parse-..> | 2025-12-20 13:52 | 5.6K | |
| py311-gitdb-4.0.12.pkg | 2025-12-18 06:59 | 116K | |
| py311-gitlab-webhook..> | 2025-12-29 01:25 | 13K | |
| py311-gitless-0.8.8_..> | 2025-12-22 21:31 | 89K | |
| py311-gitpython-3.1...> | 2025-12-26 14:42 | 365K | |
| py311-giturlparse-0...> | 2025-12-19 15:37 | 24K | |
| py311-gixy-0.1.21.pkg | 2025-12-20 08:47 | 104K | |
| py311-gizeh-0.1.11_4..> | 2025-12-29 07:38 | 23K | |
| py311-gladtex-3.1.pkg | 2025-12-27 20:48 | 117K | |
| py311-glance-store-4..> | 2025-12-28 08:57 | 395K | |
| py311-glances-3.3.1_..> | 2025-12-22 20:41 | 680K | |
| py311-glcontext-3.0...> | 2025-12-19 00:12 | 15K | |
| py311-glfw-2.10.0.pkg | 2025-12-27 23:44 | 64K | |
| py311-glob2-0.7_1.pkg | 2025-12-22 08:56 | 17K | |
| py311-glom-23.5.0_1.pkg | 2025-12-20 08:42 | 227K | |
| py311-glooey-0.3.3_3..> | 2025-12-20 19:01 | 7.2M | |
| py311-glyphsLib-6.3...> | 2025-12-26 19:13 | 684K | |
| py311-glyphsets-1.1...> | 2025-12-27 11:32 | 84K | |
| py311-glyphtools-0.8..> | 2025-12-27 01:18 | 19K | |
| py311-gmpy2-2.2.1_1.pkg | 2025-12-18 01:46 | 140K | |
| py311-gntp-1.0.3_1.pkg | 2025-12-18 21:07 | 173K | |
| py311-gnupg-3.1.1_1.pkg | 2025-12-21 23:09 | 129K | |
| py311-gnutls-3.1.3_1..> | 2025-12-19 14:21 | 93K | |
| py311-goatools-1.1.6..> | 2025-12-27 16:17 | 36M | |
| py311-goodreads-0.3...> | 2025-12-30 07:26 | 25K | |
| py311-google-3.0.0_1..> | 2025-12-21 09:29 | 46K | |
| py311-google-ai-gene..> | 2025-12-27 17:53 | 626K | |
| py311-google-api-cor..> | 2025-12-26 11:14 | 195K | |
| py311-google-api-pyt..> | 2025-12-26 16:04 | 4.9M | |
| py311-google-auth-2...> | 2025-12-26 10:54 | 271K | |
| py311-google-auth-ht..> | 2025-12-26 13:33 | 12K | |
| py311-google-auth-oa..> | 2025-12-27 14:15 | 24K | |
| py311-google-cloud-a..> | 2025-12-28 02:34 | 4.4M | |
| py311-google-cloud-a..> | 2025-12-27 15:47 | 15K | |
| py311-google-cloud-a..> | 2025-12-19 15:37 | 44K | |
| py311-google-cloud-b..> | 2025-12-27 17:07 | 383K | |
| py311-google-cloud-b..> | 2025-12-29 00:47 | 153K | |
| py311-google-cloud-b..> | 2025-12-29 13:11 | 581K | |
| py311-google-cloud-c..> | 2025-12-30 12:15 | 1.9M | |
| py311-google-cloud-c..> | 2025-12-26 13:51 | 40K | |
| py311-google-cloud-d..> | 2025-12-30 05:45 | 218K | |
| py311-google-cloud-d..> | 2025-12-28 14:32 | 278K | |
| py311-google-cloud-i..> | 2025-12-30 17:05 | 221K | |
| py311-google-cloud-k..> | 2025-12-29 21:24 | 213K | |
| py311-google-cloud-l..> | 2025-12-29 02:29 | 211K | |
| py311-google-cloud-r..> | 2025-12-27 18:32 | 182K | |
| py311-google-cloud-s..> | 2025-12-29 05:28 | 211K | |
| py311-google-cloud-s..> | 2025-12-26 15:25 | 364K | |
| py311-google-cloud-s..> | 2025-12-27 16:23 | 107K | |
| py311-google-cloud-t..> | 2025-12-28 01:15 | 30K | |
| py311-google-cloud-t..> | 2025-12-27 05:32 | 9.5K | |
| py311-google-cloud-v..> | 2025-12-30 07:18 | 224K | |
| py311-google-compute..> | 2025-12-29 21:58 | 100K | |
| py311-google-crc32c-..> | 2025-12-26 11:53 | 18K | |
| py311-google-genai-1..> | 2025-12-30 01:17 | 448K | |
| py311-google-i18n-ad..> | 2025-12-26 19:12 | 325K | |
| py311-google-pasta-0..> | 2025-12-19 01:24 | 107K | |
| py311-google-re2-1.1..> | 2025-12-18 22:58 | 125K | |
| py311-google-resumab..> | 2025-12-26 13:23 | 72K | |
| py311-google_cloud_p..> | 2025-12-29 17:32 | 313K | |
| py311-googleapis-com..> | 2025-12-18 03:52 | 152K | |
| py311-gotenberg-clie..> | 2025-12-19 09:02 | 75K | |
| py311-gpaw-24.6.0_4.pkg | 2025-12-30 07:51 | 4.2M | |
| py311-gpg-2.0.0.pkg | 2025-12-20 03:05 | 250K | |
| py311-gphoto2-2.5.1_..> | 2025-12-27 16:44 | 247K | |
| py311-gprof2dot-2025..> | 2025-12-19 10:30 | 96K | |
| py311-gpsoauth-0.4.2..> | 2025-12-28 00:28 | 8.5K | |
| py311-gptscript-0.9...> | 2025-12-30 15:43 | 55K | |
| py311-gpxpy-1.5.0_1.pkg | 2025-12-23 16:01 | 83K | |
| py311-gql-3.5.3_1.pkg | 2025-12-27 02:04 | 141K | |
| py311-graal-1.1.2_1.pkg | 2025-12-26 20:04 | 73K | |
| py311-grab-0.6.41_4.pkg | 2025-12-21 07:43 | 166K | |
| py311-grafana-dashbo..> | 2025-12-28 06:17 | 18K | |
| py311-grammalecte-fr..> | 2025-12-23 21:09 | 4.9M | |
| py311-grandalf-0.8_1..> | 2025-12-24 06:56 | 78K | |
| py311-granian-2.6.0_..> | 2025-12-27 05:15 | 2.0M | |
| py311-graphemeu-0.9...> | 2025-12-19 08:05 | 26K | |
| py311-graphene-3.4.pkg | 2025-12-18 08:02 | 97K | |
| py311-graphene-djang..> | 2025-12-18 10:57 | 266K | |
| py311-graphene-djang..> | 2025-12-19 16:40 | 211K | |
| py311-graphene-sqlal..> | 2025-12-21 10:43 | 94K | |
| py311-graphene2-2.1...> | 2025-12-19 03:16 | 102K | |
| py311-graphillion-1...> | 2025-12-23 03:29 | 235K | |
| py311-graphite-api-1..> | 2025-12-30 18:53 | 192K | |
| py311-graphlib-backp..> | 2025-12-24 04:49 | 11K | |
| py311-graphql-core-3..> | 2025-12-18 03:51 | 380K | |
| py311-graphql-core2-..> | 2025-12-18 14:50 | 259K | |
| py311-graphql-relay-..> | 2025-12-18 06:31 | 27K | |
| py311-graphql-relay2..> | 2025-12-18 20:27 | 37K | |
| py311-graphviz-0.10...> | 2025-12-26 14:40 | 31K | |
| py311-graphy-1.0.pkg | 2025-12-21 13:17 | 60K | |
| py311-greenbone-feed..> | 2025-12-18 18:42 | 79K | |
| py311-greenlet-3.3.0..> | 2025-12-18 11:03 | 218K | |
| py311-greenstalk-2.1..> | 2025-12-18 23:48 | 17K | |
| py311-grep-ast-0.7.2..> | 2025-12-20 04:11 | 19K | |
| py311-grequests-0.7...> | 2025-12-27 22:07 | 7.4K | |
| py311-griffe-1.15.0.pkg | 2025-12-18 19:53 | 303K | |
| py311-grimoire-elk-1..> | 2025-12-26 22:02 | 399K | |
| py311-grimoirelab-1...> | 2025-12-30 06:29 | 19K | |
| py311-grimoirelab-pa..> | 2025-12-18 23:17 | 187K | |
| py311-grimoirelab-to..> | 2025-12-18 11:25 | 22K | |
| py311-grip-4.6.2_1.pkg | 2025-12-30 00:53 | 132K | |
| py311-grizzled-0.9.4..> | 2025-12-19 22:44 | 133K | |
| py311-grpc-google-ia..> | 2025-12-19 00:46 | 25K | |
| py311-grpc-stubs-1.5..> | 2025-12-23 16:17 | 12K | |
| py311-grpcio-1.76.0.pkg | 2025-12-18 04:30 | 4.2M | |
| py311-grpcio-gcp-0.2..> | 2025-12-24 06:56 | 26K | |
| py311-grpcio-reflect..> | 2025-12-28 21:41 | 27K | |
| py311-grpcio-status-..> | 2025-12-18 05:38 | 14K | |
| py311-grpcio-tools-1..> | 2025-12-18 20:47 | 2.2M | |
| py311-gs_api_client-..> | 2025-12-22 10:17 | 394K | |
| py311-gsd-3.4.1_1.pkg | 2025-12-26 20:41 | 210K | |
| py311-gspread-6.2.1.pkg | 2025-12-29 05:08 | 109K | |
| py311-gssapi-1.10.1.pkg | 2025-12-18 19:30 | 360K | |
| py311-gstat_exporter..> | 2025-12-30 14:21 | 4.2K | |
| py311-gstreamer1-1.2..> | 2025-12-27 03:39 | 48K | |
| py311-gtfparse-2.5.0..> | 2025-12-29 16:32 | 20K | |
| py311-guardpost-1.0...> | 2025-12-22 14:24 | 37K | |
| py311-guess-language..> | 2025-12-21 13:18 | 84K | |
| py311-guessit-3.8.0_..> | 2025-12-19 19:45 | 277K | |
| py311-gunicorn-23.0...> | 2025-12-19 02:19 | 180K | |
| py311-guppy3-3.1.5_2..> | 2025-12-27 23:51 | 718K | |
| py311-gvgen-1.0_1.pkg | 2025-12-21 07:29 | 123K | |
| py311-gvm-tools-25.4..> | 2025-12-20 02:51 | 258K | |
| py311-gym-0.26.2_2.pkg | 2025-12-27 17:43 | 926K | |
| py311-gym-notices-0...> | 2025-12-18 19:45 | 3.4K | |
| py311-gymnasium-1.2...> | 2025-12-29 15:25 | 1.1M | |
| py311-gyp-20200512_2..> | 2025-12-18 16:17 | 586K | |
| py311-gyp-next-0.21...> | 2025-12-21 02:45 | 639K | |
| py311-h2-4.1.0_1.pkg | 2025-12-18 01:13 | 94K | |
| py311-h3-3.7.7_1.pkg | 2025-12-27 02:50 | 224K | |
| py311-h5json-1.1.3_2..> | 2025-12-30 01:41 | 88K | |
| py311-h5netcdf-1.6.1..> | 2025-12-27 00:55 | 128K | |
| py311-h5py-3.15.1.pkg | 2025-12-26 15:43 | 1.2M | |
| py311-h5pyd-0.18.0_1..> | 2025-12-28 06:32 | 309K | |
| py311-h11-0.16.0.pkg | 2025-12-18 00:55 | 57K | |
| py311-habanero-1.2.6..> | 2025-12-27 03:04 | 46K | |
| py311-hacking-8.0.0.pkg | 2025-12-23 00:24 | 55K | |
| py311-haishoku-1.1.8..> | 2025-12-29 12:45 | 9.2K | |
| py311-halo-0.0.31_1.pkg | 2025-12-18 21:45 | 19K | |
| py311-hammett-0.10.0..> | 2025-12-20 07:44 | 52K | |
| py311-haproxy-cli-0...> | 2025-12-21 05:35 | 30K | |
| py311-haproxy-log-an..> | 2025-12-23 02:38 | 217K | |
| py311-haproxyctl-0.5..> | 2025-12-23 20:39 | 12K | |
| py311-hared-1.3_1.pkg | 2025-12-20 11:00 | 4.9K | |
| py311-hash_ring-1.3...> | 2025-12-23 16:29 | 8.1K | |
| py311-hashids-1.3.1_..> | 2025-12-19 18:10 | 12K | |
| py311-hatch-1.16.2.pkg | 2025-12-26 19:46 | 289K | |
| py311-hatch-autorun-..> | 2025-12-23 12:06 | 7.6K | |
| py311-hatch-docstrin..> | 2025-12-18 16:59 | 17K | |
| py311-hatch-fancy-py..> | 2025-12-18 00:09 | 17K | |
| py311-hatch-jupyter-..> | 2025-12-18 01:09 | 35K | |
| py311-hatch-mypyc-0...> | 2025-12-28 20:45 | 15K | |
| py311-hatch-nodejs-v..> | 2025-12-18 00:53 | 15K | |
| py311-hatch-regex-co..> | 2025-12-18 20:02 | 12K | |
| py311-hatch-requirem..> | 2025-12-19 00:30 | 9.4K | |
| py311-hatch-semver-2..> | 2025-12-23 11:35 | 12K | |
| py311-hatch-vcs-0.5...> | 2025-12-16 01:39 | 11K | |
| py311-hatchling-1.28..> | 2025-12-16 01:39 | 154K | |
| py311-haystack_ai-2...> | 2025-12-27 09:44 | 812K | |
| py311-haystack_exper..> | 2025-12-30 10:57 | 69K | |
| py311-hcloud-2.13.0.pkg | 2025-12-28 19:10 | 161K | |
| py311-hdbscan-0.8.33..> | 2025-12-27 22:33 | 454K | |
| py311-hdfs-2.7.3_1.pkg | 2025-12-27 09:03 | 65K | |
| py311-hdmedians-0.14..> | 2025-12-27 17:06 | 106K | |
| py311-healthchecks-3..> | 2025-12-28 10:09 | 8.0M | |
| py311-heapdict-1.0.1..> | 2025-12-18 18:49 | 6.7K | |
| py311-helpdev-0.7.1_..> | 2025-12-18 21:21 | 23K | |
| py311-hepstats-0.7.0..> | 2025-12-29 06:47 | 74K | |
| py311-hexdump-3.3_1.pkg | 2025-12-19 02:27 | 14K | |
| py311-hf-doc-builder..> | 2025-12-29 23:02 | 113K | |
| py311-hf-xet-1.2.0_2..> | 2025-12-26 14:50 | 2.0M | |
| py311-hg-evolve-11.1..> | 2025-12-21 17:13 | 446K | |
| py311-hglib-2.6.2_2.pkg | 2025-12-19 10:29 | 50K | |
| py311-hgsvn-0.6.0_3.pkg | 2025-12-20 07:47 | 158K | |
| py311-hgtools-6.3_1.pkg | 2025-12-21 16:58 | 41K | |
| py311-hiPhive-1.5.pkg | 2025-12-29 11:56 | 185K | |
| py311-hid-1.0.8.pkg | 2025-12-19 15:39 | 10K | |
| py311-hidapi-0.14.0_..> | 2025-12-18 19:38 | 50K | |
| py311-hidraw-0.2.1_2..> | 2025-12-20 19:03 | 4.8K | |
| py311-hieroglyph-2.1..> | 2025-12-29 20:03 | 785K | |
| py311-highspy-1.11.0..> | 2025-12-30 14:13 | 1.8M | |
| py311-hijri-converte..> | 2025-12-23 09:57 | 21K | |
| py311-hiplot-0.1.33_..> | 2025-12-23 16:50 | 455K | |
| py311-hiredis-3.2.1.pkg | 2025-12-19 10:49 | 14K | |
| py311-hishel-1.1.7.pkg | 2025-12-21 09:32 | 108K | |
| py311-hishel0-0.1.5.pkg | 2025-12-19 21:02 | 156K | |
| py311-hist-2.8.0.pkg | 2025-12-29 19:36 | 86K | |
| py311-histoprint-2.5..> | 2025-12-27 16:22 | 30K | |
| py311-hits-0.1_1.pkg | 2025-12-22 15:04 | 1.0M | |
| py311-hjson-3.0.2_1.pkg | 2025-12-18 18:55 | 91K | |
| py311-hkdf-0.0.3_1.pkg | 2025-12-18 23:37 | 5.2K | |
| py311-hmmlearn-0.3.3..> | 2025-12-27 15:56 | 194K | |
| py311-holidays-0.9.1..> | 2025-12-23 14:15 | 93K | |
| py311-hologram-0.0.1..> | 2025-12-29 13:05 | 27K | |
| py311-homebase-1.0.1..> | 2025-12-18 11:58 | 24K | |
| py311-honcho-2.0.0.pkg | 2025-12-19 07:02 | 42K | |
| py311-hoomd-blue-6.0..> | 2025-12-28 08:18 | 4.6M | |
| py311-horizon-25.5.1..> | 2025-12-30 08:22 | 3.9M | |
| py311-horoscopegener..> | 2025-12-28 03:04 | 8.6K | |
| py311-howdoi-2.0.20_..> | 2025-12-29 07:39 | 31K | |
| py311-hpack-4.0.0_1.pkg | 2025-12-18 00:58 | 57K | |
| py311-hpilo-4.4.3_1.pkg | 2025-12-21 00:06 | 76K | |
| py311-hsaudiotag3k-1..> | 2025-12-22 17:42 | 51K | |
| py311-hsluv-5.0.4_1.pkg | 2025-12-18 13:43 | 9.8K | |
| py311-hstspreload-20..> | 2025-12-19 09:23 | 1.1M | |
| py311-html-text-0.7...> | 2025-12-19 22:31 | 11K | |
| py311-html2json-0.2...> | 2025-12-22 03:36 | 5.6K | |
| py311-html2text-2024..> | 2025-12-18 17:57 | 42K | |
| py311-html3-1.18_1.pkg | 2025-12-21 12:15 | 14K | |
| py311-html5-parser-0..> | 2025-12-18 15:52 | 156K | |
| py311-html5lib-1.1_1..> | 2025-12-16 05:38 | 251K | |
| py311-html5lib-moder..> | 2025-12-19 07:22 | 272K | |
| py311-html5rdf-1.2.pkg | 2025-12-23 05:06 | 256K | |
| py311-htmldate-1.9.4..> | 2025-12-30 02:56 | 57K | |
| py311-htmlmin2-0.1.1..> | 2025-12-18 16:34 | 56K | |
| py311-htpasswd-2019...> | 2025-12-21 07:23 | 2.3K | |
| py311-httmock-1.4.0_..> | 2025-12-29 18:05 | 9.8K | |
| py311-http-parser-0...> | 2025-12-22 08:57 | 75K | |
| py311-http-prompt-2...> | 2025-12-27 22:46 | 55K | |
| py311-http-sf-1.0.7.pkg | 2025-12-18 12:35 | 45K | |
| py311-httpbin-0.10.1..> | 2025-12-27 02:57 | 118K | |
| py311-httpcore-1.0.9..> | 2025-12-18 02:55 | 111K | |
| py311-httpie-3.2.4_1..> | 2025-12-27 17:08 | 239K | |
| py311-httplib2-0.22...> | 2025-12-18 07:46 | 126K | |
| py311-httpretty-1.1...> | 2025-12-22 03:18 | 55K | |
| py311-httpstat-1.3.0..> | 2025-12-21 12:28 | 14K | |
| py311-httptools-0.6...> | 2025-12-20 03:45 | 68K | |
| py311-httpx-0.28.1_1..> | 2025-12-18 03:53 | 159K | |
| py311-httpx-aiohttp-..> | 2025-12-21 22:40 | 11K | |
| py311-httpx-auth-0.2..> | 2025-12-21 17:03 | 63K | |
| py311-httpx-oauth-0...> | 2025-12-19 08:53 | 28K | |
| py311-httpx-retries-..> | 2025-12-20 01:52 | 15K | |
| py311-httpx-socks-0...> | 2025-12-20 00:40 | 14K | |
| py311-httpx-sse-0.4...> | 2025-12-18 18:37 | 11K | |
| py311-httpx-ws-0.8.2..> | 2025-12-23 18:22 | 37K | |
| py311-httpx_gssapi-0..> | 2025-12-21 20:31 | 17K | |
| py311-huepy-1.2.1_2.pkg | 2025-12-21 07:51 | 16K | |
| py311-huggingface-hu..> | 2025-12-26 19:58 | 748K | |
| py311-humanfriendly-..> | 2025-12-18 18:23 | 147K | |
| py311-humanize-4.14...> | 2025-12-18 19:22 | 75K | |
| py311-hunspell-0.5.5..> | 2025-12-20 00:11 | 11K | |
| py311-hunter-3.7.0.pkg | 2025-12-21 02:55 | 264K | |
| py311-hupper-1.12.1_..> | 2025-12-19 12:39 | 50K | |
| py311-hvac-2.4.0.pkg | 2025-12-27 17:17 | 184K | |
| py311-hy-1.1.0.pkg | 2025-12-23 03:46 | 215K | |
| py311-hypatia_engine..> | 2025-12-29 19:30 | 66K | |
| py311-hypercorn-0.18..> | 2025-12-18 22:43 | 131K | |
| py311-hyperframe-6.0..> | 2025-12-18 00:46 | 23K | |
| py311-hyperkitty-1.3..> | 2025-12-29 15:25 | 1.9M | |
| py311-hyperlink-21.0..> | 2025-12-18 01:25 | 127K | |
| py311-hypernetx-2.4...> | 2025-12-29 01:12 | 532K | |
| py311-hypothesis-6.1..> | 2025-12-27 12:22 | 1.0M | |
| py311-hypothesis-cro..> | 2025-12-26 20:41 | 30K | |
| py311-hypothesmith-0..> | 2025-12-30 06:41 | 21K | |
| py311-i3-gnome-pomod..> | 2025-12-29 15:36 | 24K | |
| py311-i3-quickterm-1..> | 2025-12-20 17:27 | 17K | |
| py311-i3ipc-2.2.1_2.pkg | 2025-12-19 12:39 | 48K | |
| py311-icalendar-6.1...> | 2025-12-18 14:17 | 309K | |
| py311-icet-3.2.pkg | 2025-12-29 21:23 | 502K | |
| py311-icmplib-3.0.4.pkg | 2025-12-20 22:31 | 34K | |
| py311-icoextract-0.1..> | 2025-12-29 13:04 | 13K | |
| py311-id-1.5.0.pkg | 2025-12-26 20:04 | 17K | |
| py311-identify-2.6.1..> | 2025-12-18 07:32 | 82K | |
| py311-idna-3.11.pkg | 2025-12-16 01:40 | 104K | |
| py311-ifaddr-0.2.0_1..> | 2025-12-18 19:29 | 17K | |
| py311-igraph-0.11.9.pkg | 2025-12-28 22:02 | 1.4M | |
| py311-ijson-3.4.0.pkg | 2025-12-18 18:54 | 56K | |
| py311-imagecodecs-20..> | 2025-12-28 21:19 | 778K | |
| py311-imageio-2.37.0..> | 2025-12-26 18:07 | 592K | |
| py311-imageio-ffmpeg..> | 2025-12-26 16:59 | 32K | |
| py311-imagesize-1.4...> | 2025-12-16 01:41 | 12K | |
| py311-imap-tools-1.1..> | 2025-12-19 16:55 | 62K | |
| py311-imapclient-3.0..> | 2025-12-20 00:00 | 83K | |
| py311-imaplib2-3.6_1..> | 2025-12-20 01:42 | 59K | |
| py311-img2pdf-0.6.3_..> | 2025-12-26 22:33 | 103K | |
| py311-iminuit-2.30.1..> | 2025-12-30 10:19 | 472K | |
| py311-immutabledict-..> | 2025-12-19 16:02 | 6.2K | |
| py311-immutables-0.2..> | 2025-12-22 11:58 | 46K | |
| py311-impacket-0.12...> | 2025-12-26 18:05 | 2.5M | |
| py311-importlab-0.8_..> | 2025-12-27 03:08 | 43K | |
| py311-importlib-meta..> | 2025-12-18 04:14 | 49K | |
| py311-importlib-meta..> | 2025-12-21 19:43 | 44K | |
| py311-importlib-meta..> | 2025-12-23 12:23 | 45K | |
| py311-importlib-reso..> | 2025-12-18 01:49 | 77K | |
| py311-imutils-0.5.4_..> | 2025-12-30 04:14 | 42K | |
| py311-in-n-out-0.2.1..> | 2025-12-18 16:04 | 39K | |
| py311-incremental-24..> | 2025-12-18 00:39 | 39K | |
| py311-indiweb-0.1.8_..> | 2025-12-27 19:19 | 343K | |
| py311-inequality-1.1..> | 2025-12-27 16:54 | 40K | |
| py311-infinity-1.5_1..> | 2025-12-19 13:03 | 5.3K | |
| py311-inflate64-1.0...> | 2025-12-19 23:33 | 24K | |
| py311-inflect-7.0.0.pkg | 2025-12-20 04:22 | 72K | |
| py311-inflection-0.5..> | 2025-12-19 02:13 | 9.2K | |
| py311-influxdb-5.0.0..> | 2025-12-30 14:29 | 132K | |
| py311-ini2toml-0.15.pkg | 2025-12-24 07:19 | 108K | |
| py311-iniconfig-1.1...> | 2025-12-16 01:41 | 7.9K | |
| py311-inifile-0.4_1.pkg | 2025-12-22 07:17 | 17K | |
| py311-iniparse-0.5_1..> | 2025-12-19 22:22 | 37K | |
| py311-inline-snapsho..> | 2025-12-28 01:04 | 155K | |
| py311-inlinestyler-0..> | 2025-12-28 06:31 | 32K | |
| py311-inotify-simple..> | 2025-12-19 00:12 | 11K | |
| py311-inotifyrecursi..> | 2025-12-19 19:58 | 8.4K | |
| py311-inquirer-3.4.1..> | 2025-12-19 15:38 | 36K | |
| py311-installer-0.7...> | 2025-12-16 01:35 | 245K | |
| py311-instructor-1.1..> | 2025-12-27 15:59 | 285K | |
| py311-intbitset-4.1...> | 2025-12-28 00:19 | 71K | |
| py311-intelhex-2.3.0..> | 2025-12-18 12:57 | 81K | |
| py311-interegular-0...> | 2025-12-18 00:50 | 60K | |
| py311-interface-meta..> | 2025-12-18 18:50 | 23K | |
| py311-internetarchiv..> | 2025-12-30 01:05 | 158K | |
| py311-intervals-0.9...> | 2025-12-23 21:36 | 20K | |
| py311-intervaltree-3..> | 2025-12-18 13:22 | 39K | |
| py311-intspan-1.6.1_..> | 2025-12-20 08:42 | 15K | |
| py311-investiny-0.7...> | 2025-12-22 18:11 | 12K | |
| py311-investpy-1.0.8..> | 2025-12-29 22:03 | 3.4M | |
| py311-invoke-2.2.1.pkg | 2025-12-18 12:28 | 292K | |
| py311-iocage-1.12.pkg | 2025-12-30 06:46 | 365K | |
| py311-iocage-devel-1..> | 2025-12-28 13:25 | 365K | |
| py311-ioflo-2.0.0_1.pkg | 2025-12-20 23:05 | 627K | |
| py311-iohexperimente..> | 2025-12-28 05:10 | 480K | |
| py311-iopath-0.1.10_..> | 2025-12-18 21:10 | 53K | |
| py311-iowait-0.2_1.pkg | 2025-12-21 13:34 | 13K | |
| py311-ioztat-2.0.1_1..> | 2025-12-20 06:06 | 12K | |
| py311-ipaddr-2.2.0_1..> | 2025-12-20 01:32 | 31K | |
| py311-ipadic-1.0.0_1..> | 2025-12-23 19:53 | 10M | |
| py311-ipcalc-1.99.0_..> | 2025-12-22 14:39 | 20K | |
| py311-ipdb-0.13.13_1..> | 2025-12-23 18:49 | 18K | |
| py311-iplib-1.2.1_1.pkg | 2025-12-24 07:23 | 21K | |
| py311-iptools-0.7.0_..> | 2025-12-23 10:00 | 22K | |
| py311-ipy-1.1_1.pkg | 2025-12-19 12:20 | 37K | |
| py311-ipydatawidgets..> | 2025-12-30 09:38 | 130K | |
| py311-ipyfastscape-0..> | 2025-12-29 06:09 | 45K | |
| py311-ipygany-0.5.0_..> | 2025-12-27 16:23 | 1.0M | |
| py311-ipykernel-7.1...> | 2025-12-26 09:45 | 214K | |
| py311-ipympl-0.9.8.pkg | 2025-12-29 22:12 | 210K | |
| py311-ipyopt-0.12.10..> | 2025-12-30 10:52 | 144K | |
| py311-ipyparallel-9...> | 2025-12-27 02:43 | 613K | |
| py311-ipython-8.18.1..> | 2025-12-18 02:39 | 2.3M | |
| py311-ipython_genuti..> | 2025-12-18 06:41 | 46K | |
| py311-ipywidgets-8.1..> | 2025-12-26 14:23 | 251K | |
| py311-irc-20.5.0.pkg | 2025-12-20 05:23 | 117K | |
| py311-iris-check-mod..> | 2025-12-28 12:39 | 4.9K | |
| py311-iris-client-2...> | 2025-12-30 07:32 | 138K | |
| py311-iris-evtx-modu..> | 2025-12-29 06:50 | 13K | |
| py311-iris-intelowl-..> | 2025-12-30 04:13 | 15K | |
| py311-iris-misp-modu..> | 2025-12-30 02:35 | 20K | |
| py311-iris-module-in..> | 2025-12-19 11:11 | 15K | |
| py311-iris-vt-module..> | 2025-12-27 23:50 | 18K | |
| py311-iris-webhooks-..> | 2025-12-27 21:48 | 14K | |
| py311-irrd4-4.2.9_3.pkg | 2025-12-30 05:36 | 348K | |
| py311-isbnlib-3.10.1..> | 2025-12-19 19:18 | 91K | |
| py311-isbntools-4.3...> | 2025-12-23 16:24 | 60K | |
| py311-islpy-2024.2.pkg | 2025-12-29 19:55 | 930K | |
| py311-iso-639-0.4.5_..> | 2025-12-20 02:36 | 134K | |
| py311-iso3166-2.1.1_..> | 2025-12-20 02:52 | 17K | |
| py311-iso8601-2.1.0.pkg | 2025-12-18 05:32 | 14K | |
| py311-isodate-0.7.2.pkg | 2025-12-18 13:51 | 35K | |
| py311-isoduration-20..> | 2025-12-18 01:27 | 19K | |
| py311-isort-7.0.0.pkg | 2025-12-18 08:42 | 193K | |
| py311-isosurfaces-0...> | 2025-12-29 13:07 | 21K | |
| py311-itanium_demang..> | 2025-12-19 12:43 | 18K | |
| py311-itemadapter-0...> | 2025-12-18 23:21 | 18K | |
| py311-itemloaders-1...> | 2025-12-19 11:42 | 20K | |
| py311-iterable-io-1...> | 2025-12-19 01:44 | 6.9K | |
| py311-iteration-util..> | 2025-12-23 06:53 | 155K | |
| py311-itertree-1.1.3..> | 2025-12-22 13:54 | 255K | |
| py311-itsdangerous-2..> | 2025-12-18 09:14 | 28K | |
| py311-j2cli-0.3.12.b..> | 2025-12-23 01:41 | 17K | |
| py311-jacobi-0.9.2.pkg | 2025-12-30 10:14 | 20K | |
| py311-jaconv-0.4.1.pkg | 2025-12-21 03:04 | 25K | |
| py311-jadm-1.0_3.pkg | 2025-12-30 08:08 | 33K | |
| py311-jailconf-0.2.2..> | 2025-12-21 07:50 | 12K | |
| py311-janus-2.0.0.pkg | 2025-12-20 01:10 | 18K | |
| py311-jaraco.classes..> | 2025-12-18 09:50 | 11K | |
| py311-jaraco.collect..> | 2025-12-19 01:17 | 21K | |
| py311-jaraco.context..> | 2025-12-18 09:05 | 11K | |
| py311-jaraco.env-1.0..> | 2025-12-19 06:05 | 3.7K | |
| py311-jaraco.envs-2...> | 2025-12-23 00:23 | 5.7K | |
| py311-jaraco.functoo..> | 2025-12-18 10:20 | 16K | |
| py311-jaraco.itertoo..> | 2025-12-22 02:17 | 24K | |
| py311-jaraco.logging..> | 2025-12-19 07:33 | 9.0K | |
| py311-jaraco.packagi..> | 2025-12-27 16:22 | 12K | |
| py311-jaraco.path-3...> | 2025-12-21 06:35 | 14K | |
| py311-jaraco.stream-..> | 2025-12-19 16:55 | 11K | |
| py311-jaraco.text-4...> | 2025-12-18 18:08 | 18K | |
| py311-jaraco.util-15..> | 2025-12-23 06:52 | 9.8K | |
| py311-jarowinkler-2...> | 2025-12-30 17:21 | 6.5K | |
| py311-javaproperties..> | 2025-12-19 22:14 | 28K | |
| py311-jax-0.4.38.pkg | 2025-12-27 17:48 | 4.4M | |
| py311-jaxtyping-0.3...> | 2025-12-30 14:56 | 103K | |
| py311-jc-1.25.2_1.pkg | 2025-12-29 13:18 | 822K | |
| py311-jdcal-1.4.1_1.pkg | 2025-12-23 20:58 | 7.8K | |
| py311-jedi-0.19.1_1.pkg | 2025-12-18 01:43 | 1.0M | |
| py311-jeepney-0.9.0.pkg | 2025-12-18 07:28 | 104K | |
| py311-jellyfish-0.11..> | 2025-12-27 15:43 | 267K | |
| py311-jenkins-job-bu..> | 2025-12-30 17:22 | 523K | |
| py311-jep-4.3.1.pkg | 2025-12-29 05:22 | 236K | |
| py311-jh2-5.0.10_2.pkg | 2025-12-26 15:12 | 382K | |
| py311-jij-cimod-1.7...> | 2025-12-28 16:59 | 715K | |
| py311-jinja2-ansible..> | 2025-12-19 04:51 | 30K | |
| py311-jinja2-cli-0.8..> | 2025-12-21 22:30 | 14K | |
| py311-jinja2-time-0...> | 2025-12-23 13:24 | 5.7K | |
| py311-jinjanator-25...> | 2025-12-21 16:49 | 32K | |
| py311-jinjanator-plu..> | 2025-12-19 10:54 | 13K | |
| py311-jira-3.0.1_1.pkg | 2025-12-27 15:44 | 119K | |
| py311-jiter-0.12.0_1..> | 2025-12-26 19:48 | 216K | |
| py311-jitterentropy-..> | 2025-12-23 19:53 | 5.3K | |
| py311-jiwer-4.0.0.pkg | 2025-12-30 16:25 | 35K | |
| py311-jmespath-1.0.1..> | 2025-12-18 01:43 | 44K | |
| py311-joblib-1.5.1.pkg | 2025-12-18 07:02 | 545K | |
| py311-johnnydep-1.20..> | 2025-12-27 22:37 | 46K | |
| py311-jonpy-0.14_1.pkg | 2025-12-20 20:47 | 73K | |
| py311-josepy-2.2.0.pkg | 2025-12-26 20:17 | 63K | |
| py311-joserfc-1.6.0.pkg | 2025-12-30 12:50 | 134K | |
| py311-jplephem-2.23.pkg | 2025-12-26 13:03 | 72K | |
| py311-jq-1.10.0.pkg | 2025-12-29 22:28 | 50K | |
| py311-jsbeautifier-1..> | 2025-12-18 21:38 | 159K | |
| py311-jschema-to-pyt..> | 2025-12-18 11:02 | 17K | |
| py311-jschon-0.11.1_..> | 2025-12-27 17:12 | 145K | |
| py311-jsmin-3.0.1_1.pkg | 2025-12-18 16:37 | 22K | |
| py311-json-repair-0...> | 2025-12-22 17:59 | 41K | |
| py311-json2html-1.3...> | 2025-12-18 23:01 | 9.4K | |
| py311-json5-0.9.11_1..> | 2025-12-18 03:23 | 41K | |
| py311-json_tricks-3...> | 2025-12-23 21:17 | 49K | |
| py311-jsonargparse-3..> | 2025-12-19 22:46 | 284K | |
| py311-jsondiff-2.0.0..> | 2025-12-19 12:42 | 17K | |
| py311-jsonform-0.0.2..> | 2025-12-27 17:49 | 6.7K | |
| py311-jsonlines-4.0...> | 2025-12-18 15:56 | 17K | |
| py311-jsonnet-0.21.0..> | 2025-12-23 09:09 | 8.1K | |
| py311-jsonpatch-1.33..> | 2025-12-18 11:33 | 23K | |
| py311-jsonpath-ng-1...> | 2025-12-19 16:44 | 47K | |
| py311-jsonpath-rw-1...> | 2025-12-24 07:10 | 29K | |
| py311-jsonpickle-4.1..> | 2025-12-18 07:44 | 94K | |
| py311-jsonpointer-2...> | 2025-12-18 01:34 | 10K | |
| py311-jsonref-1.1.0.pkg | 2025-12-26 17:47 | 20K | |
| py311-jsonrpclib-pel..> | 2025-12-19 03:20 | 70K | |
| py311-jsonschema-4.2..> | 2025-12-26 05:57 | 192K | |
| py311-jsonschema-pat..> | 2025-12-26 11:38 | 24K | |
| py311-jsonschema-spe..> | 2025-12-27 02:44 | 24K | |
| py311-jsonschema-spe..> | 2025-12-26 05:51 | 11K | |
| py311-jsonschema3-3...> | 2025-12-19 17:17 | 122K | |
| py311-jsonsir-0.0.2_..> | 2025-12-20 00:13 | 7.8K | |
| py311-jsonslicer-0.1..> | 2025-12-19 22:43 | 15K | |
| py311-jstyleson-0.0...> | 2025-12-19 15:16 | 4.3K | |
| py311-jsx-lexer-2.0...> | 2025-12-21 13:27 | 4.6K | |
| py311-junit-xml-1.9_..> | 2025-12-19 14:07 | 13K | |
| py311-junitparser-4...> | 2025-12-21 01:45 | 31K | |
| py311-junos-eznc-2.7..> | 2025-12-27 01:09 | 291K | |
| py311-jupyter-1.1.1_..> | 2025-12-26 23:05 | 3.3K | |
| py311-jupyter-client..> | 2025-12-26 06:20 | 202K | |
| py311-jupyter-collab..> | 2025-12-30 09:25 | 3.9K | |
| py311-jupyter-collab..> | 2025-12-27 02:16 | 33K | |
| py311-jupyter-core-5..> | 2025-12-18 00:46 | 62K | |
| py311-jupyter-docpro..> | 2025-12-27 16:21 | 26K | |
| py311-jupyter-events..> | 2025-12-26 07:03 | 33K | |
| py311-jupyter-jsmol-..> | 2025-12-30 01:45 | 3.4M | |
| py311-jupyter-kernel..> | 2025-12-28 13:41 | 81K | |
| py311-jupyter-kernel..> | 2025-12-28 13:37 | 22K | |
| py311-jupyter-lsp-2...> | 2025-12-26 09:22 | 107K | |
| py311-jupyter-packag..> | 2025-12-18 04:35 | 31K | |
| py311-jupyter-rfb-0...> | 2025-12-27 15:33 | 36K | |
| py311-jupyter-server..> | 2025-12-26 09:01 | 518K | |
| py311-jupyter-server..> | 2025-12-26 23:26 | 33K | |
| py311-jupyter-server..> | 2025-12-27 11:31 | 1.9M | |
| py311-jupyter-server..> | 2025-12-18 01:43 | 21K | |
| py311-jupyter-server..> | 2025-12-27 17:25 | 60K | |
| py311-jupyter-sphinx..> | 2025-12-30 03:13 | 40K | |
| py311-jupyter-teleme..> | 2025-12-30 07:37 | 11K | |
| py311-jupyter-ydoc-3..> | 2025-12-27 00:46 | 22K | |
| py311-jupyter_consol..> | 2025-12-26 18:26 | 50K | |
| py311-jupyterlab-4.5..> | 2025-12-26 10:24 | 9.4M | |
| py311-jupyterlab-lsp..> | 2025-12-28 09:58 | 581K | |
| py311-jupyterlab-pyg..> | 2025-12-18 01:27 | 13K | |
| py311-jupyterlab-ser..> | 2025-12-26 09:17 | 106K | |
| py311-jupyterlab-wid..> | 2025-12-26 11:16 | 574K | |
| py311-jupyterlab_lau..> | 2025-12-27 22:09 | 46K | |
| py311-jwcrypto-1.5.6..> | 2025-12-27 13:15 | 174K | |
| py311-kafka-python-1..> | 2025-12-22 00:36 | 451K | |
| py311-kahip-3.22.pkg | 2025-12-30 05:58 | 52K | |
| py311-kaitaistruct-0..> | 2025-12-20 02:20 | 13K | |
| py311-kaptan-0.5.12_..> | 2025-12-22 17:52 | 17K | |
| py311-kartograph-0.6..> | 2025-12-27 20:47 | 166K | |
| py311-kazoo-2.5.0_1.pkg | 2025-12-19 19:44 | 260K | |
| py311-keep-2.11.pkg | 2025-12-27 02:07 | 30K | |
| py311-keepkey-7.2.1_..> | 2025-12-19 08:41 | 193K | |
| py311-keras-3.12.0.pkg | 2025-12-29 16:17 | 2.2M | |
| py311-keras-applicat..> | 2025-12-28 06:36 | 60K | |
| py311-keras-preproce..> | 2025-12-28 14:13 | 70K | |
| py311-kerberos-1.3.1..> | 2025-12-18 17:54 | 15K | |
| py311-kerchunk-0.2.7..> | 2025-12-28 02:40 | 138K | |
| py311-keyring-25.6.0..> | 2025-12-26 15:26 | 70K | |
| py311-keyrings.alt-4..> | 2025-12-21 05:17 | 42K | |
| py311-keystone-engin..> | 2025-12-18 22:36 | 1.2M | |
| py311-keystoneauth1-..> | 2025-12-26 15:29 | 512K | |
| py311-keystonemiddle..> | 2025-12-29 06:35 | 250K | |
| py311-khal-0.11.4.pkg | 2025-12-29 01:12 | 452K | |
| py311-khard-0.20.0.pkg | 2025-12-28 04:42 | 149K | |
| py311-kidash-1.0.10.pkg | 2025-12-26 21:19 | 46K | |
| py311-kim-query-3.0...> | 2025-12-29 02:26 | 14K | |
| py311-kimpy-2.1.3.pkg | 2025-12-27 04:31 | 379K | |
| py311-kinematics-0.1..> | 2025-12-28 04:19 | 21K | |
| py311-kiss-headers-2..> | 2025-12-23 10:50 | 82K | |
| py311-kitchen-1.2.6_..> | 2025-12-18 23:14 | 66K | |
| py311-kivy-2.3.0_2.pkg | 2025-12-29 06:16 | 24M | |
| py311-kiwisolver-1.4..> | 2025-12-18 02:12 | 61K | |
| py311-klein-24.8.0.pkg | 2025-12-27 16:28 | 191K | |
| py311-klepto-0.2.7.pkg | 2025-12-19 02:05 | 155K | |
| py311-kliff-0.4.4_1.pkg | 2025-12-29 19:50 | 382K | |
| py311-kms-g20221207.pkg | 2025-12-21 08:49 | 835K | |
| py311-knack-0.11.0_2..> | 2025-12-19 01:06 | 125K | |
| py311-knowit-0.5.11.pkg | 2025-12-22 07:28 | 81K | |
| py311-kombu-5.3.7_1.pkg | 2025-12-18 18:29 | 391K | |
| py311-korean-lunar-c..> | 2025-12-19 02:13 | 16K | |
| py311-kosmorrolib-1...> | 2025-12-27 10:27 | 42K | |
| py311-kpLib-1.1.1_3.pkg | 2025-12-29 04:01 | 142K | |
| py311-krb5-0.9.0.pkg | 2025-12-18 21:45 | 367K | |
| py311-kubernetes-33...> | 2025-12-30 03:13 | 1.1M | |
| py311-kyotocabinet-1..> | 2025-12-22 16:22 | 261K | |
| py311-l18n-2021.3_1.pkg | 2025-12-21 16:07 | 62K | |
| py311-laces-0.1.2.pkg | 2025-12-23 03:52 | 33K | |
| py311-langchain-0.3...> | 2025-12-27 21:41 | 939K | |
| py311-langchain-anth..> | 2025-12-30 06:00 | 57K | |
| py311-langchain-core..> | 2025-12-26 21:51 | 822K | |
| py311-langchain-goog..> | 2025-12-28 00:57 | 104K | |
| py311-langchain-open..> | 2025-12-29 03:32 | 117K | |
| py311-langchain-test..> | 2025-12-28 03:16 | 88K | |
| py311-langchain-text..> | 2025-12-27 13:18 | 63K | |
| py311-langcodes-3.5...> | 2025-12-24 04:28 | 215K | |
| py311-langdetect-1.0..> | 2025-12-19 23:10 | 862K | |
| py311-langgraph-chec..> | 2025-12-30 07:47 | 92K | |
| py311-langgraph-sdk-..> | 2025-12-29 08:19 | 82K | |
| py311-langid-1.1.6.2..> | 2025-12-26 22:01 | 1.8M | |
| py311-langsmith-0.4...> | 2025-12-26 20:11 | 680K | |
| py311-language-data-..> | 2025-12-19 04:58 | 6.2M | |
| py311-language-tags-..> | 2025-12-18 23:00 | 154K | |
| py311-lark-1.3.1.pkg | 2025-12-18 01:13 | 264K | |
| py311-laserhammer-2...> | 2025-12-23 12:38 | 9.2K | |
| py311-laspy-2.5.4.pkg | 2025-12-27 16:48 | 185K | |
| py311-laszip-0.2.3.pkg | 2025-12-18 21:27 | 109K | |
| py311-latex2mathml-3..> | 2025-12-21 05:29 | 91K | |
| py311-latexcodec-3.0..> | 2025-12-18 16:06 | 29K | |
| py311-launchpadlib-1..> | 2025-12-27 02:20 | 171K | |
| py311-lazr.config-2...> | 2025-12-18 23:24 | 42K | |
| py311-lazr.delegates..> | 2025-12-18 18:34 | 17K | |
| py311-lazr.restfulcl..> | 2025-12-26 21:21 | 82K | |
| py311-lazr.uri-1.0.6..> | 2025-12-18 13:14 | 24K | |
| py311-lazrs-0.7.0_4.pkg | 2025-12-27 00:37 | 418K | |
| py311-lazy-1.4_1.pkg | 2025-12-18 19:30 | 11K | |
| py311-lazy-object-pr..> | 2025-12-18 07:44 | 32K | |
| py311-lazy_imports-1..> | 2025-12-19 02:01 | 24K | |
| py311-lazy_loader-0...> | 2025-12-18 18:49 | 20K | |
| py311-lcapy-g2017120..> | 2025-12-29 03:38 | 655K | |
| py311-ldap0-1.4.7_1.pkg | 2025-12-19 14:59 | 198K | |
| py311-ldap3-2.9.1_1.pkg | 2025-12-18 10:20 | 582K | |
| py311-ldapdomaindump..> | 2025-12-26 14:57 | 41K | |
| py311-ldappool-3.0.0..> | 2025-12-24 04:52 | 23K | |
| py311-ldns-1.9.0.pkg | 2025-12-30 14:13 | 351K | |
| py311-leather-0.4.1.pkg | 2025-12-26 14:55 | 50K | |
| py311-legacy-api-wra..> | 2025-12-19 01:23 | 12K | |
| py311-legacy-cgi-2.6..> | 2025-12-23 19:52 | 39K | |
| py311-lerc-4.0.1_1.pkg | 2025-12-21 01:04 | 193K | |
| py311-lesscpy-0.14.0..> | 2025-12-21 17:56 | 97K | |
| py311-leveldb-0.201_..> | 2025-12-23 16:50 | 18K | |
| py311-leviathan-0.1...> | 2025-12-21 23:26 | 6.2K | |
| py311-lia-web-0.2.3.pkg | 2025-12-18 18:05 | 25K | |
| py311-liac-arff-2.5...> | 2025-12-21 02:57 | 27K | |
| py311-lib4sbom-0.8.7..> | 2025-12-27 07:27 | 870K | |
| py311-libarchive-c-5..> | 2025-12-19 21:26 | 36K | |
| py311-libceed-0.12.0..> | 2025-12-28 03:01 | 264K | |
| py311-libcloud-3.8.0..> | 2025-12-26 22:30 | 1.9M | |
| py311-libcst-1.8.2_5..> | 2025-12-26 22:58 | 2.1M | |
| py311-libcst03-0.3.2..> | 2025-12-23 05:38 | 916K | |
| py311-libdnet-1.13_5..> | 2025-12-21 11:36 | 85K | |
| py311-libevdev-0.11_..> | 2025-12-16 01:47 | 39K | |
| py311-libgetar-1.1.7..> | 2025-12-29 03:14 | 634K | |
| py311-libimobiledevi..> | 2025-12-21 23:57 | 360K | |
| py311-libioc-0.8.2_3..> | 2025-12-29 21:39 | 340K | |
| py311-libknot-3.5.2.pkg | 2025-12-23 09:36 | 25K | |
| py311-libnacl-2.1.0_..> | 2025-12-19 11:05 | 40K | |
| py311-libnuml-1.1.7.pkg | 2025-12-21 05:24 | 225K | |
| py311-libopenshot-0...> | 2025-12-27 16:08 | 1.1M | |
| py311-liboqs-python-..> | 2025-12-21 16:35 | 18K | |
| py311-libpeas-2.0.7.pkg | 2025-12-27 11:24 | 10K | |
| py311-libpeas1-1.36...> | 2025-12-27 15:42 | 10K | |
| py311-libplist-2.7.0..> | 2025-12-19 19:21 | 75K | |
| py311-libpysal-4.13...> | 2025-12-26 14:50 | 2.5M | |
| py311-librosa-0.11.0..> | 2025-12-26 21:07 | 375K | |
| py311-librt-0.7.2.pkg | 2025-12-26 14:53 | 30K | |
| py311-libsass-0.23.0..> | 2025-12-18 16:05 | 78K | |
| py311-libscrc-1.8.1_..> | 2025-12-20 17:25 | 51K | |
| py311-libsedml-2.0.3..> | 2025-12-23 00:06 | 583K | |
| py311-libtaxii-1.1.1..> | 2025-12-19 14:06 | 201K | |
| py311-libtmux-0.53.0..> | 2025-12-27 11:18 | 131K | |
| py311-libusb-package..> | 2025-12-18 13:17 | 12K | |
| py311-libusb1-3.3.1.pkg | 2025-12-19 02:11 | 109K | |
| py311-libusbsio-2.1...> | 2025-12-19 00:27 | 225K | |
| py311-libversion-1.2..> | 2025-12-21 12:06 | 7.2K | |
| py311-libvirt-11.10...> | 2025-12-20 03:15 | 211K | |
| py311-libxml2-python..> | 2025-12-19 12:55 | 194K | |
| py311-libzfs-1.1.202..> | 2025-12-27 12:44 | 376K | |
| py311-license-expres..> | 2025-12-18 21:14 | 124K | |
| py311-lief-0.12.3_1.pkg | 2025-12-21 16:02 | 2.5M | |
| py311-lifelines-0.19..> | 2025-12-30 16:04 | 310K | |
| py311-lightgbm-4.4.0..> | 2025-12-28 17:48 | 1.6M | |
| py311-lightning-util..> | 2025-12-26 20:30 | 52K | |
| py311-limits-5.6.0.pkg | 2025-12-18 19:09 | 94K | |
| py311-limnoria-2021...> | 2025-12-23 16:10 | 1.4M | |
| py311-line-profiler-..> | 2025-12-21 05:26 | 129K | |
| py311-line-protocol-..> | 2025-12-21 11:35 | 12K | |
| py311-linear-tsv-1.1..> | 2025-12-18 14:53 | 11K | |
| py311-linearmodels-6..> | 2025-12-29 23:25 | 1.7M | |
| py311-linecache2-1.0..> | 2025-12-18 19:31 | 34K | |
| py311-lineedit-0.1.6..> | 2025-12-21 12:55 | 618K | |
| py311-linkify-it-py-..> | 2025-12-19 05:55 | 35K | |
| py311-lion-pytorch-0..> | 2025-12-30 09:04 | 10K | |
| py311-liquidctl-1.15..> | 2025-12-28 12:31 | 265K | |
| py311-litecli-1.11.1..> | 2025-12-23 16:04 | 103K | |
| py311-litellm-1.80.0..> | 2025-12-27 16:51 | 10M | |
| py311-litellm-proxy-..> | 2025-12-20 10:50 | 26K | |
| py311-litestar-2.18...> | 2025-12-29 16:28 | 849K | |
| py311-littleutils-0...> | 2025-12-22 07:28 | 17K | |
| py311-livemark-0.110..> | 2025-12-30 09:25 | 117K | |
| py311-livereload-2.7..> | 2025-12-19 07:03 | 37K | |
| py311-lizard-1.17.10..> | 2025-12-18 13:45 | 125K | |
| py311-llama-cpp-pyth..> | 2025-12-28 15:10 | 1.8M | |
| py311-llfuse-1.5.1_1..> | 2025-12-19 02:25 | 167K | |
| py311-llm-0.27.pkg | 2025-12-27 06:02 | 199K | |
| py311-llm-claude-3-0..> | 2025-12-30 13:43 | 12K | |
| py311-llvmcpy-0.1.6_..> | 2025-12-21 07:18 | 30K | |
| py311-llvmlite-0.44...> | 2025-12-26 13:53 | 381K | |
| py311-lmdb-0.97_1.pkg | 2025-12-23 11:00 | 72K | |
| py311-lmfit-1.3.3.pkg | 2025-12-27 02:40 | 191K | |
| py311-lml-0.2.0.pkg | 2025-12-18 18:44 | 18K | |
| py311-localstack-cli..> | 2025-12-30 14:20 | 17K | |
| py311-localzone-0.9...> | 2025-12-30 18:26 | 16K | |
| py311-locket-1.0.0_1..> | 2025-12-18 10:32 | 8.5K | |
| py311-lockfile-0.12...> | 2025-12-18 18:41 | 20K | |
| py311-locust-2.37.10..> | 2025-12-30 15:02 | 1.9M | |
| py311-locust-cloud-1..> | 2025-12-27 02:42 | 420K | |
| py311-log_symbols-0...> | 2025-12-18 18:21 | 3.3K | |
| py311-logan-0.7.2_5.pkg | 2025-12-18 23:47 | 14K | |
| py311-logbook-1.8.2_..> | 2025-12-18 23:13 | 184K | |
| py311-logfury-1.0.1_..> | 2025-12-18 18:48 | 12K | |
| py311-logical-unific..> | 2025-12-18 12:30 | 23K | |
| py311-logilab-common..> | 2025-12-20 08:31 | 326K | |
| py311-logistro-1.0.1..> | 2025-12-20 18:00 | 14K | |
| py311-loguru-0.7.2_1..> | 2025-12-19 20:44 | 116K | |
| py311-logutils-0.3.5..> | 2025-12-19 20:58 | 38K | |
| py311-logzero-1.7.0_..> | 2025-12-19 06:15 | 26K | |
| py311-loompy-3.0.7_2..> | 2025-12-29 05:23 | 120K | |
| py311-looseversion-1..> | 2025-12-18 19:06 | 9.3K | |
| py311-lrcalc-2.1_2.pkg | 2025-12-21 09:38 | 38K | |
| py311-lru-dict-1.3.0..> | 2025-12-20 16:32 | 12K | |
| py311-lsprotocol-202..> | 2025-12-18 11:19 | 138K | |
| py311-luminol-0.4_2.pkg | 2025-12-26 20:27 | 44K | |
| py311-lunardate-0.2...> | 2025-12-21 03:03 | 10K | |
| py311-lupa-2.6.pkg | 2025-12-24 03:39 | 119K | |
| py311-lxml-6.0.1.pkg | 2025-12-17 23:41 | 2.0M | |
| py311-lxml-html-clea..> | 2025-12-18 16:55 | 23K | |
| py311-lxml-stubs-0.5..> | 2025-12-20 07:56 | 7.5K | |
| py311-lxml5-5.4.0_2.pkg | 2025-12-23 04:12 | 1.1M | |
| py311-lz4-4.3.3_1.pkg | 2025-12-19 01:13 | 30K | |
| py311-lzma-0.5.0_1.pkg | 2025-12-19 19:53 | 85K | |
| py311-lzstring-1.0.4..> | 2025-12-23 13:27 | 8.7K | |
| py311-m2crypto-0.46...> | 2025-12-19 03:25 | 290K | |
| py311-m2r-0.3.1_2.pkg | 2025-12-21 03:16 | 22K | |
| py311-m64py-0.3.0.20..> | 2025-12-29 20:00 | 24M | |
| py311-mac-vendor-loo..> | 2025-12-21 16:26 | 9.2K | |
| py311-macholib-1.16...> | 2025-12-21 04:33 | 86K | |
| py311-macs2-2.2.9.1_..> | 2025-12-27 10:21 | 1.0M | |
| py311-madoka-0.7.2.1..> | 2025-12-20 02:40 | 93K | |
| py311-maec-4.1.0.17_..> | 2025-12-22 23:26 | 283K | |
| py311-magic-5.46.pkg | 2025-12-18 18:42 | 9.2K | |
| py311-magic-wormhole..> | 2025-12-27 16:10 | 407K | |
| py311-magicgui-0.10...> | 2025-12-26 20:43 | 269K | |
| py311-magnet2torrent..> | 2025-12-20 20:00 | 62K | |
| py311-mahotas-1.4.15..> | 2025-12-29 06:35 | 1.7M | |
| py311-mail-parser-3...> | 2025-12-19 10:51 | 38K | |
| py311-mailcap_fix-1...> | 2025-12-23 20:06 | 11K | |
| py311-mailman-3.3.10..> | 2025-12-27 11:38 | 2.0M | |
| py311-mailman-hyperk..> | 2025-12-30 08:05 | 19K | |
| py311-mailmanclient-..> | 2025-12-27 01:44 | 120K | |
| py311-mailnag-2.2.0_..> | 2025-12-30 16:48 | 260K | |
| py311-mailsuite-1.10..> | 2025-12-30 08:47 | 34K | |
| py311-makefun-1.16.0..> | 2025-12-26 22:25 | 39K | |
| py311-mako-1.3.5_1.pkg | 2025-12-16 02:17 | 168K | |
| py311-mammoth-1.11.0..> | 2025-12-23 07:44 | 122K | |
| py311-managesieve3-1..> | 2025-12-21 12:24 | 15K | |
| py311-mando-0.8.2.pkg | 2025-12-21 07:40 | 57K | |
| py311-manpageblog-1...> | 2025-12-22 09:07 | 13K | |
| py311-manuel-1.13.0_..> | 2025-12-22 07:59 | 52K | |
| py311-mapbox-earcut-..> | 2025-12-29 16:18 | 74K | |
| py311-mapclassify-2...> | 2025-12-26 18:07 | 842K | |
| py311-mariadb-1.1.14..> | 2025-12-21 18:27 | 97K | |
| py311-marisa-trie-1...> | 2025-12-18 21:11 | 144K | |
| py311-markdown-3.10.pkg | 2025-12-16 01:39 | 187K | |
| py311-markdown-callo..> | 2025-12-18 17:35 | 11K | |
| py311-markdown-inclu..> | 2025-12-23 12:50 | 21K | |
| py311-markdown-it-py..> | 2025-12-16 01:40 | 140K | |
| py311-markdown2-2.4...> | 2025-12-19 00:44 | 88K | |
| py311-markdownify-0...> | 2025-12-21 19:28 | 22K | |
| py311-marko-2.2.1.pkg | 2025-12-18 21:12 | 101K | |
| py311-markuppy-1.14_..> | 2025-12-21 03:07 | 16K | |
| py311-markups-4.0.0_..> | 2025-12-19 23:07 | 25K | |
| py311-markupsafe-3.0..> | 2025-12-16 01:39 | 18K | |
| py311-marrow.mailer-..> | 2025-12-29 16:07 | 67K | |
| py311-marrow.util-1...> | 2025-12-19 07:10 | 51K | |
| py311-marshmallow-3...> | 2025-12-18 14:18 | 104K | |
| py311-marshmallow-en..> | 2025-12-18 18:01 | 6.7K | |
| py311-marshmallow-sq..> | 2025-12-27 21:43 | 34K | |
| py311-mashumaro-3.17..> | 2025-12-18 20:20 | 183K | |
| py311-mat2-0.14.0_1.pkg | 2025-12-27 16:16 | 75K | |
| py311-mathics_pygmen..> | 2025-12-19 03:29 | 75K | |
| py311-matplotlib-3.8..> | 2025-12-26 09:03 | 7.0M | |
| py311-matplotlib-inl..> | 2025-12-18 01:46 | 14K | |
| py311-matplotlib-sca..> | 2025-12-26 23:33 | 27K | |
| py311-matrix-angular..> | 2025-12-20 05:17 | 646K | |
| py311-matrix-common-..> | 2025-12-19 12:20 | 10K | |
| py311-matrix-synapse..> | 2025-12-29 11:31 | 7.8M | |
| py311-matrix-synapse..> | 2025-12-30 14:05 | 24K | |
| py311-mattermostdriv..> | 2025-12-27 04:00 | 42K | |
| py311-maturin-1.10.2..> | 2025-12-26 04:57 | 2.9M | |
| py311-maxminddb-2.8...> | 2025-12-18 12:00 | 28K | |
| py311-mayavi-4.8.2_6..> | 2025-12-26 19:05 | 18M | |
| py311-mccabe-0.7.0_2..> | 2025-12-18 11:27 | 14K | |
| py311-mcomix-3.1.1_1..> | 2025-12-30 08:30 | 762K | |
| py311-mcp-1.23.2.pkg | 2025-12-27 02:07 | 400K | |
| py311-mdformat-0.7.2..> | 2025-12-22 13:24 | 277K | |
| py311-mdit-py-plugin..> | 2025-12-16 01:44 | 85K | |
| py311-mdp-3.5_5.pkg | 2025-12-30 02:12 | 657K | |
| py311-mdurl-0.1.2_2.pkg | 2025-12-16 01:40 | 17K | |
| py311-mdv-1.7.5_3.pkg | 2025-12-19 11:48 | 79K | |
| py311-mdx_wikilink_p..> | 2025-12-19 09:37 | 14K | |
| py311-mechanicalsoup..> | 2025-12-27 21:32 | 33K | |
| py311-mechanize-0.4...> | 2025-12-18 23:48 | 231K | |
| py311-mediafile-0.13..> | 2025-12-20 00:39 | 52K | |
| py311-mediapy-1.2.4_..> | 2025-12-28 13:22 | 54K | |
| py311-medikit-0.8.0_..> | 2025-12-28 10:02 | 107K | |
| py311-meilisearch-0...> | 2025-12-27 02:52 | 53K | |
| py311-mem0ai-0.1.118..> | 2025-12-29 01:41 | 373K | |
| py311-memory-graph-0..> | 2025-12-28 05:10 | 83K | |
| py311-memory-profile..> | 2025-12-22 00:28 | 68K | |
| py311-memory_allocat..> | 2025-12-20 13:15 | 116K | |
| py311-menulibre-2.4...> | 2025-12-26 23:14 | 329K | |
| py311-mercantile-1.2..> | 2025-12-18 20:25 | 30K | |
| py311-merge3-0.0.13_..> | 2025-12-23 07:45 | 13K | |
| py311-mergedeep-1.3...> | 2025-12-18 06:57 | 6.0K | |
| py311-merkletools-1...> | 2025-12-19 17:17 | 5.6K | |
| py311-merossiot-0.4...> | 2025-12-29 16:27 | 168K | |
| py311-meshio-5.3.5.pkg | 2025-12-27 18:11 | 336K | |
| py311-meson-python-0..> | 2025-12-26 03:18 | 70K | |
| py311-metadata-clean..> | 2025-12-29 07:26 | 1.3M | |
| py311-metar-1.11.0_1..> | 2025-12-23 15:58 | 199K | |
| py311-methodtools-0...> | 2025-12-21 12:26 | 4.1K | |
| py311-metpy-1.6.2_2.pkg | 2025-12-30 14:57 | 586K | |
| py311-mf2py-2.0.1.pkg | 2025-12-27 11:16 | 45K | |
| py311-mffpy-0.10.0_3..> | 2025-12-27 22:38 | 171K | |
| py311-mgwr-2.2.1_1.pkg | 2025-12-27 04:26 | 89K | |
| py311-microsoft-secu..> | 2025-12-22 06:28 | 18K | |
| py311-microversion-p..> | 2025-12-22 01:23 | 27K | |
| py311-mido-1.3.3.pkg | 2025-12-19 10:06 | 104K | |
| py311-mike-2.1.3.pkg | 2025-12-22 16:39 | 65K | |
| py311-milc-1.8.0.pkg | 2025-12-19 22:38 | 50K | |
| py311-mime-0.1.0_1.pkg | 2025-12-22 11:29 | 50K | |
| py311-miniKanren-1.0..> | 2025-12-20 01:11 | 48K | |
| py311-minidb-2.0.8_1..> | 2025-12-19 07:20 | 30K | |
| py311-minidump-0.0.2..> | 2025-12-18 21:30 | 139K | |
| py311-minigalaxy-1.4..> | 2025-12-27 21:13 | 263K | |
| py311-minimal-snowpl..> | 2025-12-26 22:57 | 20K | |
| py311-minimongo-0.2...> | 2025-12-22 10:38 | 34K | |
| py311-minio-4.0.21_2..> | 2025-12-27 06:02 | 102K | |
| py311-miniupnpc-2.3...> | 2025-12-21 09:17 | 28K | |
| py311-minorminer-0.2..> | 2025-12-26 18:04 | 725K | |
| py311-mip-1.15.0.pkg | 2025-12-20 10:48 | 159K | |
| py311-misaka-2.1.1_1..> | 2025-12-23 17:03 | 55K | |
| py311-mistletoe-1.5...> | 2025-12-27 16:05 | 115K | |
| py311-mistune-3.1.4.pkg | 2025-12-18 01:38 | 112K | |
| py311-mistune0-0.8.4..> | 2025-12-20 01:39 | 31K | |
| py311-mitogen-0.3.27..> | 2025-12-23 10:30 | 441K | |
| py311-mixbox-1.0.5_4..> | 2025-12-19 02:24 | 98K | |
| py311-mixpanel-4.10...> | 2025-12-19 11:50 | 15K | |
| py311-mixsimulator-0..> | 2025-12-23 13:19 | 101K | |
| py311-mkdocs-1.6.1.pkg | 2025-12-18 12:31 | 3.5M | |
| py311-mkdocs-autoref..> | 2025-12-18 16:26 | 44K | |
| py311-mkdocs-exclude..> | 2025-12-19 11:11 | 4.4K | |
| py311-mkdocs-get-dep..> | 2025-12-18 09:51 | 18K | |
| py311-mkdocs-git-rev..> | 2025-12-27 22:36 | 28K | |
| py311-mkdocs-include..> | 2025-12-19 17:16 | 52K | |
| py311-mkdocs-macros-..> | 2025-12-27 10:51 | 45K | |
| py311-mkdocs-materia..> | 2025-12-27 12:07 | 4.4M | |
| py311-mkdocs-materia..> | 2025-12-19 01:13 | 14K | |
| py311-mkdocs-mermaid..> | 2025-12-27 12:59 | 14K | |
| py311-mkdocs-minify-..> | 2025-12-19 01:39 | 12K | |
| py311-mkdocs-nature-..> | 2025-12-21 10:35 | 45K | |
| py311-mkdocs-redirec..> | 2025-12-19 01:37 | 7.6K | |
| py311-mkdocs-rss-plu..> | 2025-12-26 21:04 | 53K | |
| py311-mkdocs-simple-..> | 2025-12-19 20:30 | 5.5K | |
| py311-mkdocstrings-1..> | 2025-12-27 06:41 | 64K | |
| py311-mkdocstrings-c..> | 2025-12-18 19:36 | 43K | |
| py311-mkdocstrings-p..> | 2025-12-19 15:15 | 77K | |
| py311-mkdocstrings-p..> | 2025-12-23 06:46 | 28K | |
| py311-ml-collections..> | 2025-12-22 19:56 | 104K | |
| py311-ml-dtypes-0.5...> | 2025-12-26 23:01 | 207K | |
| py311-mmcif-0.90.0_1..> | 2025-12-28 12:54 | 580K | |
| py311-mmcv-2.2.0_3.pkg | 2025-12-29 14:36 | 1.0M | |
| py311-mmdet-3.3.0_2.pkg | 2025-12-30 18:17 | 2.4M | |
| py311-mmengine-0.10...> | 2025-12-27 12:06 | 717K | |
| py311-mmh3-5.2.0.pkg | 2025-12-21 13:17 | 32K | |
| py311-mmsegmentation..> | 2025-12-30 01:45 | 2.3M | |
| py311-mmtf-python-1...> | 2025-12-26 21:22 | 42K | |
| py311-mne-1.11.0.pkg | 2025-12-29 20:25 | 8.7M | |
| py311-mnemonic-0.21.pkg | 2025-12-18 19:02 | 88K | |
| py311-mnemosyne-proj..> | 2025-12-28 19:41 | 1.0M | |
| py311-mnnpy-0.1.9.5_..> | 2025-12-30 02:14 | 80K | |
| py311-moarchiving-1...> | 2025-12-22 04:20 | 113K | |
| py311-mock-5.2.0_1.pkg | 2025-12-18 04:38 | 73K | |
| py311-modelsearch-1...> | 2025-12-26 21:27 | 206K | |
| py311-moderngl-5.12...> | 2025-12-27 10:21 | 125K | |
| py311-moderngl-windo..> | 2025-12-29 23:18 | 473K | |
| py311-modin-0.37.1.pkg | 2025-12-30 06:38 | 2.0M | |
| py311-molecule-5.0.1..> | 2025-12-30 04:39 | 258K | |
| py311-molequeue-0.9...> | 2025-12-21 14:45 | 3.8K | |
| py311-molmod-1.4.8_2..> | 2025-12-29 19:16 | 1.5M | |
| py311-momepy-0.10.0.pkg | 2025-12-27 14:51 | 1.8M | |
| py311-mondrian-0.8.1..> | 2025-12-20 03:39 | 22K | |
| py311-mongoengine-0...> | 2025-12-19 16:59 | 233K | |
| py311-mongokit-0.9.1..> | 2025-12-22 10:10 | 98K | |
| py311-monkeytype-23...> | 2025-12-29 10:04 | 85K | |
| py311-monotable-3.2...> | 2025-12-19 15:00 | 64K | |
| py311-monotonic-1.5_..> | 2025-12-18 17:51 | 6.4K | |
| py311-monty-2025.3.3..> | 2025-12-26 18:29 | 98K | |
| py311-more-itertools..> | 2025-12-18 08:09 | 107K | |
| py311-moreorless-0.5..> | 2025-12-18 19:23 | 32K | |
| py311-morse3-2.9_1.pkg | 2025-12-23 21:15 | 4.0K | |
| py311-moto-5.0.28.pkg | 2025-12-29 02:59 | 6.3M | |
| py311-motor-1.0_1.pkg | 2025-12-22 10:29 | 63K | |
| py311-mouseinfo-0.1...> | 2025-12-26 18:34 | 23K | |
| py311-moviepy-2.2.1_..> | 2025-12-27 16:13 | 205K | |
| py311-mox-0.5.3_3.pkg | 2025-12-22 20:45 | 41K | |
| py311-mp-api-0.34.0_..> | 2025-12-30 07:45 | 126K | |
| py311-mpcontribs-cli..> | 2025-12-27 18:44 | 69K | |
| py311-mpd-0.3.0_2.pkg | 2025-12-20 05:39 | 13K | |
| py311-mpi4py-4.1.1.pkg | 2025-12-26 09:57 | 720K | |
| py311-mpi4py-mpich-4..> | 2025-12-27 02:10 | 711K | |
| py311-mpl-interactio..> | 2025-12-30 16:31 | 80K | |
| py311-mpl-scatter-de..> | 2025-12-29 15:25 | 640K | |
| py311-mplfinance-0.1..> | 2025-12-30 08:12 | 141K | |
| py311-mplhep-0.3.59_..> | 2025-12-28 13:52 | 89K | |
| py311-mplhep-data-0...> | 2025-12-19 03:19 | 5.3M | |
| py311-mpmath-1.3.0_2..> | 2025-12-18 02:24 | 1.0M | |
| py311-mqttwarn-0.35...> | 2025-12-30 09:06 | 179K | |
| py311-mrcfile-1.5.3_..> | 2025-12-26 18:27 | 60K | |
| py311-mrchem-1.1.4.pkg | 2025-12-28 23:11 | 108K | |
| py311-mrkd-0.2.0_4.pkg | 2025-12-22 15:24 | 12K | |
| py311-mrtparse-2.0.0..> | 2025-12-20 18:03 | 40K | |
| py311-msal-1.24.0.b2..> | 2025-12-26 18:28 | 142K | |
| py311-msal-extension..> | 2025-12-26 22:01 | 30K | |
| py311-msgpack-1.1.2.pkg | 2025-12-18 07:55 | 82K | |
| py311-msgspec-0.20.0..> | 2025-12-19 17:26 | 193K | |
| py311-msoffcrypto-to..> | 2025-12-27 16:58 | 63K | |
| py311-msrest-0.7.1_1..> | 2025-12-26 19:07 | 126K | |
| py311-msrestazure-0...> | 2025-12-26 23:31 | 61K | |
| py311-msrplib-0.21.1..> | 2025-12-29 18:03 | 63K | |
| py311-muacrypt-0.9.1..> | 2025-12-20 06:39 | 137K | |
| py311-mulpyplexer-0...> | 2025-12-19 08:54 | 7.5K | |
| py311-multi_key_dict..> | 2025-12-18 20:22 | 20K | |
| py311-multidict-6.7...> | 2025-12-18 01:50 | 62K | |
| py311-multimethod-1...> | 2025-12-21 13:56 | 24K | |
| py311-multipart-1.3...> | 2025-12-18 17:49 | 32K | |
| py311-multipledispat..> | 2025-12-18 11:22 | 17K | |
| py311-multiprocess-0..> | 2025-12-18 23:27 | 334K | |
| py311-multiqc-1.25.2..> | 2025-12-27 12:03 | 4.1M | |
| py311-multiset-3.2.0..> | 2025-12-22 13:22 | 21K | |
| py311-multitasking-0..> | 2025-12-18 12:30 | 18K | |
| py311-multivolumefil..> | 2025-12-19 07:12 | 23K | |
| py311-munch-4.0.0.pkg | 2025-12-18 05:37 | 16K | |
| py311-munkres-1.1.4_..> | 2025-12-19 09:03 | 15K | |
| py311-murmurhash-1.0..> | 2025-12-18 12:34 | 16K | |
| py311-music21-9.7.1.pkg | 2025-12-30 09:14 | 17M | |
| py311-musicbrainzngs..> | 2025-12-19 08:54 | 54K | |
| py311-mutagen-1.47.0..> | 2025-12-18 11:09 | 394K | |
| py311-mutf8-1.0.6.pkg | 2025-12-20 23:19 | 10K | |
| py311-mutmut-3.3.1.pkg | 2025-12-29 12:19 | 84K | |
| py311-mwoauth-0.4.0_..> | 2025-12-29 06:20 | 19K | |
| py311-mwparserfromhe..> | 2025-12-20 01:24 | 134K | |
| py311-mycli-1.28.0.pkg | 2025-12-29 01:02 | 151K | |
| py311-mygpoclient-1...> | 2025-12-20 02:50 | 72K | |
| py311-mypy-1.19.1.pkg | 2025-12-26 19:09 | 3.6M | |
| py311-mypy-boto3-s3-..> | 2025-12-19 10:57 | 90K | |
| py311-mypy-protobuf-..> | 2025-12-26 22:49 | 40K | |
| py311-mypy_extension..> | 2025-12-18 09:43 | 9.2K | |
| py311-mysql-connecto..> | 2025-12-24 03:32 | 566K | |
| py311-mysqlclient-2...> | 2025-12-18 13:14 | 104K | |
| py311-myst-parser-4...> | 2025-12-24 20:08 | 191K | |
| py311-mystic-0.4.4.pkg | 2025-12-27 12:04 | 734K | |
| py311-naarad-1.0.15_..> | 2025-12-27 06:20 | 267K | |
| py311-nagios-check_m..> | 2025-12-24 00:01 | 11K | |
| py311-nagiosplugin-1..> | 2025-12-19 15:35 | 82K | |
| py311-naiveBayesClas..> | 2025-12-20 10:09 | 9.6K | |
| py311-namex-0.1.0.pkg | 2025-12-19 13:03 | 12K | |
| py311-nanobind-2.4.0..> | 2025-12-18 11:42 | 182K | |
| py311-nanotime-0.5.2..> | 2025-12-23 18:01 | 5.6K | |
| py311-napalm-5.0.0_4..> | 2025-12-27 09:55 | 450K | |
| py311-napalm-logs-0...> | 2025-12-28 09:47 | 118K | |
| py311-napari-0.6.6.pkg | 2025-12-27 12:57 | 4.5M | |
| py311-napari-console..> | 2025-12-26 20:29 | 15K | |
| py311-napari-plugin-..> | 2025-12-18 22:39 | 65K | |
| py311-napari-svg-0.2..> | 2025-12-26 22:03 | 31K | |
| py311-narwhals-2.14...> | 2025-12-26 13:25 | 769K | |
| py311-natsort-8.4.0_..> | 2025-12-18 16:18 | 59K | |
| py311-natten-0.21.0_..> | 2025-12-26 21:19 | 156K | |
| py311-natural-0.2.0_..> | 2025-12-21 19:47 | 51K | |
| py311-nbclassic-1.3...> | 2025-12-29 13:20 | 5.4M | |
| py311-nbclient-0.10...> | 2025-12-26 06:34 | 49K | |
| py311-nbconvert-7.16..> | 2025-12-26 07:49 | 281K | |
| py311-nbdime-4.0.2.pkg | 2025-12-30 16:32 | 4.4M | |
| py311-nbformat-5.10...> | 2025-12-26 06:22 | 98K | |
| py311-nbsphinx-0.9.8..> | 2025-12-27 17:13 | 61K | |
| py311-nbval-0.11.0_2..> | 2025-12-29 03:38 | 42K | |
| py311-nbxmpp-6.2.0.pkg | 2025-12-27 02:16 | 417K | |
| py311-ncclient-0.6.1..> | 2025-12-26 19:38 | 126K | |
| py311-ncrystal-4.2.8..> | 2025-12-29 05:14 | 2.4M | |
| py311-ndg-httpsclien..> | 2025-12-27 15:16 | 48K | |
| py311-ndindex-1.10.1..> | 2025-12-20 03:11 | 232K | |
| py311-neo-0.14.3.pkg | 2025-12-29 08:50 | 1.3M | |
| py311-nest-asyncio-1..> | 2025-12-18 02:27 | 10K | |
| py311-netCDF4-1.7.2.pkg | 2025-12-26 18:10 | 527K | |
| py311-netaddr-1.3.0.pkg | 2025-12-18 05:32 | 1.6M | |
| py311-netbox-agent-0..> | 2025-12-30 15:30 | 105K | |
| py311-netbox-secrets..> | 2025-12-23 00:46 | 108K | |
| py311-netcdf-flatten..> | 2025-12-29 02:18 | 27K | |
| py311-nethsm-1.4.1.pkg | 2025-12-27 15:44 | 363K | |
| py311-netifaces-0.11..> | 2025-12-18 16:36 | 11K | |
| py311-netifaces-plus..> | 2025-12-19 12:46 | 12K | |
| py311-netmiko-4.6.0.pkg | 2025-12-26 23:08 | 375K | |
| py311-netsnmpagent-0..> | 2025-12-22 02:38 | 32K | |
| py311-netutils-1.15...> | 2025-12-27 00:02 | 1.1M | |
| py311-networkx-3.5_3..> | 2025-12-26 09:19 | 3.6M | |
| py311-nevergrad-0.14..> | 2025-12-28 08:22 | 1.0M | |
| py311-nevow-0.14.0_2..> | 2025-12-28 01:49 | 801K | |
| py311-newick-1.10.0.pkg | 2025-12-19 12:52 | 27K | |
| py311-nglview-4.0.pkg | 2025-12-26 15:42 | 7.8M | |
| py311-nh3-0.3.2_1.pkg | 2025-12-26 17:32 | 587K | |
| py311-nibabel-5.3.2.pkg | 2025-12-26 20:45 | 3.5M | |
| py311-nicegui-nogui-..> | 2025-12-29 23:10 | 14M | |
| py311-nicotine-plus-..> | 2025-12-29 00:59 | 1.9M | |
| py311-nikola-8.3.3.pkg | 2025-12-30 15:16 | 2.6M | |
| py311-niquests-3.15...> | 2025-12-26 22:01 | 285K | |
| py311-nitrokey-0.3.2..> | 2025-12-27 04:03 | 296K | |
| py311-nkdfu-0.2.pkg | 2025-12-20 02:52 | 30K | |
| py311-nlopt-2.9.1.pkg | 2025-12-27 16:38 | 322K | |
| py311-nltk-3.8.1,2.pkg | 2025-12-26 22:54 | 2.5M | |
| py311-nnpy-1.4.2_1.pkg | 2025-12-24 07:20 | 18K | |
| py311-node-semver-0...> | 2025-12-19 02:19 | 29K | |
| py311-nodeenv-1.9.1.pkg | 2025-12-18 07:16 | 42K | |
| py311-noiseprotocol-..> | 2025-12-26 21:29 | 37K | |
| py311-normality-2.5...> | 2025-12-19 16:45 | 31K | |
| py311-nose-1.3.7_2.pkg | 2025-12-18 12:52 | 277K | |
| py311-nose-cov-1.6_1..> | 2025-12-21 17:18 | 6.2K | |
| py311-nose-timer-1.0..> | 2025-12-21 09:22 | 15K | |
| py311-nose2-0.10.0_1..> | 2025-12-19 15:44 | 264K | |
| py311-nose3-1.3.8_1.pkg | 2025-12-22 03:18 | 289K | |
| py311-noseofyeti-2.4..> | 2025-12-21 05:07 | 54K | |
| py311-nosexcover-1.0..> | 2025-12-23 17:21 | 5.8K | |
| py311-notebook-7.5.0..> | 2025-12-26 13:02 | 8.6M | |
| py311-notebook-shim-..> | 2025-12-26 09:35 | 21K | |
| py311-notify2-0.3.1_..> | 2025-12-19 04:24 | 11K | |
| py311-notmuch-0.39_1..> | 2025-12-19 22:34 | 211K | |
| py311-notmuch0-0.39_..> | 2025-12-23 13:37 | 69K | |
| py311-notus-scanner-..> | 2025-12-27 03:41 | 304K | |
| py311-npTDMS-1.9.0.pkg | 2025-12-27 16:17 | 239K | |
| py311-npe2-0.7.9.pkg | 2025-12-26 21:27 | 188K | |
| py311-ns1-python-0.2..> | 2025-12-29 04:29 | 71K | |
| py311-ntc-templates-..> | 2025-12-18 16:23 | 299K | |
| py311-ntlm-auth-1.5...> | 2025-12-22 13:23 | 47K | |
| py311-ntplib-0.3.4_1..> | 2025-12-20 19:01 | 12K | |
| py311-num2words-0.5...> | 2025-12-18 18:31 | 195K | |
| py311-numba-0.61.2.pkg | 2025-12-26 15:04 | 5.5M | |
| py311-numba-stats-1...> | 2025-12-28 11:14 | 33K | |
| py311-numcodecs-0.13..> | 2025-12-26 18:53 | 711K | |
| py311-numexpr-2.14.1..> | 2025-12-26 07:59 | 197K | |
| py311-numpoly-1.2.3_..> | 2025-12-26 15:55 | 140K | |
| py311-numpy-1.26.4_1..> | 2025-12-26 06:27 | 14M | |
| py311-numpy-groupies..> | 2025-12-27 19:23 | 87K | |
| py311-numpy-stl-2.11..> | 2025-12-27 09:07 | 55K | |
| py311-numpydoc-1.6.0..> | 2025-12-26 21:35 | 136K | |
| py311-nvchecker-2.19..> | 2025-12-23 16:30 | 127K | |
| py311-nvdlib-0.8.3.pkg | 2025-12-29 07:35 | 24K | |
| py311-nwdiag-3.0.0_3..> | 2025-12-27 03:59 | 2.2M | |
| py311-nwg-displays-0..> | 2025-12-30 08:10 | 57K | |
| py311-nxapi-plumbing..> | 2025-12-30 07:57 | 13K | |
| py311-oauth-1.0.1_3.pkg | 2025-12-21 10:34 | 18K | |
| py311-oauth2-1.9.0.p..> | 2025-12-22 01:47 | 28K | |
| py311-oauthlib-3.3.1..> | 2025-12-26 12:54 | 194K | |
| py311-objgraph-3.6.2..> | 2025-12-29 17:35 | 30K | |
| py311-objprint-0.3.0..> | 2025-12-22 18:37 | 78K | |
| py311-objsize-0.7.0.pkg | 2025-12-19 10:46 | 16K | |
| py311-obspy-1.4.2_3.pkg | 2025-12-29 23:45 | 13M | |
| py311-oci-2.164.2.pkg | 2025-12-27 05:50 | 20M | |
| py311-oci-cli-3.71.4..> | 2025-12-28 12:06 | 5.2M | |
| py311-ocrmypdf-16.11..> | 2025-12-27 17:08 | 296K | |
| py311-oddt-0.7_3.pkg | 2025-12-30 12:16 | 1.8M | |
| py311-odfpy-1.4.1_3.pkg | 2025-12-18 21:56 | 233K | |
| py311-odoo-18.0.2025..> | 2025-12-26 20:58 | 115M | |
| py311-odoo-addon-ope..> | 2025-12-27 10:49 | 56K | |
| py311-odoo-addon-ope..> | 2025-12-27 18:46 | 55K | |
| py311-odoo-addon-ope..> | 2025-12-27 10:28 | 57K | |
| py311-odoo-addon-ope..> | 2025-12-29 21:20 | 331K | |
| py311-odoo-addon-ope..> | 2025-12-29 02:58 | 420K | |
| py311-odoo-addon-ope..> | 2025-12-27 20:49 | 307K | |
| py311-odoo16-16.0.20..> | 2025-12-26 23:26 | 98M | |
| py311-odoo17-17.0.20..> | 2025-12-26 22:10 | 104M | |
| py311-offlineimap3-8..> | 2025-12-29 19:10 | 540K | |
| py311-offtrac-0.1.0_..> | 2025-12-19 23:37 | 5.0K | |
| py311-ofxparse-0.21_..> | 2025-12-18 18:10 | 77K | |
| py311-olefile-0.46_1..> | 2025-12-18 01:37 | 56K | |
| py311-ollama-0.4.7.pkg | 2025-12-20 00:25 | 33K | |
| py311-omegaconf-2.3...> | 2025-12-18 06:00 | 196K | |
| py311-omemo-dr-1.0.1..> | 2025-12-27 14:16 | 167K | |
| py311-omnijson-0.1.2..> | 2025-12-21 22:22 | 36K | |
| py311-omniorb-4.3.3.pkg | 2025-12-19 16:45 | 1.1M | |
| py311-oncalendar-1.1..> | 2025-12-19 08:34 | 15K | |
| py311-onetimepass-1...> | 2025-12-19 05:34 | 7.7K | |
| py311-onigurumacffi-..> | 2025-12-20 02:06 | 17K | |
| py311-onionbalance-0..> | 2025-12-29 23:01 | 118K | |
| py311-onionprobe-1.1..> | 2025-12-29 17:11 | 75K | |
| py311-onnx-1.17.0_2.pkg | 2025-12-27 03:16 | 9.3M | |
| py311-onnx-tf-1.10.0..> | 2025-12-28 18:38 | 263K | |
| py311-onnxconverter-..> | 2025-12-30 08:54 | 208K | |
| py311-ont-fast5-api-..> | 2025-12-27 07:30 | 95K | |
| py311-opcodes-0.3.14..> | 2025-12-19 22:28 | 135K | |
| py311-openEMS-0.0.36..> | 2025-12-28 11:35 | 89K | |
| py311-openTSNE-1.0.2..> | 2025-12-29 12:52 | 311K | |
| py311-openai-1.109.1..> | 2025-12-26 20:27 | 814K | |
| py311-openai-whisper..> | 2025-12-30 04:08 | 703K | |
| py311-openapi-core-0..> | 2025-12-30 17:07 | 170K | |
| py311-openapi-pydant..> | 2025-12-28 04:30 | 73K | |
| py311-openapi-schema..> | 2025-12-26 11:38 | 15K | |
| py311-openapi-spec-v..> | 2025-12-26 13:03 | 53K | |
| py311-openbabel-3.1...> | 2025-12-28 23:59 | 616K | |
| py311-openbrokerapi-..> | 2025-12-20 23:20 | 40K | |
| py311-opencensus-0.1..> | 2025-12-28 01:31 | 149K | |
| py311-opencensus-con..> | 2025-12-19 23:00 | 7.5K | |
| py311-opencolorio-2...> | 2025-12-23 13:04 | 699K | |
| py311-opendht-3.3.1.pkg | 2025-12-21 00:50 | 129K | |
| py311-openimageio-2...> | 2025-12-27 04:36 | 496K | |
| py311-openpaperwork-..> | 2025-12-19 12:55 | 148K | |
| py311-openpaperwork-..> | 2025-12-30 04:05 | 109K | |
| py311-openpiv-0.25.3..> | 2025-12-30 18:45 | 30M | |
| py311-openpyxl-3.1.5..> | 2025-12-18 17:14 | 460K | |
| py311-opensearch-py-..> | 2025-12-27 17:06 | 293K | |
| py311-openshadinglan..> | 2025-12-28 09:09 | 89K | |
| py311-openslide-pyth..> | 2025-12-27 20:56 | 38K | |
| py311-openssh-wrappe..> | 2025-12-30 04:01 | 13K | |
| py311-openstackdocst..> | 2025-12-27 10:21 | 909K | |
| py311-openstacksdk-4..> | 2025-12-26 18:05 | 2.1M | |
| py311-openstep-plist..> | 2025-12-18 12:33 | 99K | |
| py311-opentelemetry-..> | 2025-12-26 09:55 | 93K | |
| py311-opentelemetry-..> | 2025-12-28 21:07 | 3.8K | |
| py311-opentelemetry-..> | 2025-12-26 13:05 | 7.9K | |
| py311-opentelemetry-..> | 2025-12-27 14:00 | 6.5K | |
| py311-opentelemetry-..> | 2025-12-26 13:05 | 25K | |
| py311-opentelemetry-..> | 2025-12-26 22:06 | 27K | |
| py311-opentelemetry-..> | 2025-12-26 15:42 | 21K | |
| py311-opentelemetry-..> | 2025-12-26 19:29 | 49K | |
| py311-opentelemetry-..> | 2025-12-26 22:49 | 27K | |
| py311-opentelemetry-..> | 2025-12-27 10:09 | 21K | |
| py311-opentelemetry-..> | 2025-12-28 12:03 | 29K | |
| py311-opentelemetry-..> | 2025-12-30 01:01 | 17K | |
| py311-opentelemetry-..> | 2025-12-28 12:06 | 22K | |
| py311-opentelemetry-..> | 2025-12-29 04:47 | 13K | |
| py311-opentelemetry-..> | 2025-12-29 21:29 | 17K | |
| py311-opentelemetry-..> | 2025-12-29 23:21 | 17K | |
| py311-opentelemetry-..> | 2025-12-30 18:48 | 18K | |
| py311-opentelemetry-..> | 2025-12-27 16:04 | 21K | |
| py311-opentelemetry-..> | 2025-12-26 10:59 | 50K | |
| py311-opentelemetry-..> | 2025-12-26 13:55 | 196K | |
| py311-opentelemetry-..> | 2025-12-26 11:46 | 179K | |
| py311-opentelemetry-..> | 2025-12-26 18:59 | 16K | |
| py311-opentimelineio..> | 2025-12-20 06:01 | 614K | |
| py311-opentracing-2...> | 2025-12-19 16:29 | 56K | |
| py311-opentype-sanit..> | 2025-12-27 14:34 | 8.1K | |
| py311-opentypespec-1..> | 2025-12-20 01:56 | 46K | |
| py311-openupgradelib..> | 2025-12-18 21:59 | 131K | |
| py311-openvdb-13.0.0..> | 2025-12-28 00:58 | 953K | |
| py311-opn-cli-1.7.0_..> | 2025-12-30 00:00 | 285K | |
| py311-opster-5.0_1.pkg | 2025-12-23 06:24 | 32K | |
| py311-opt-einsum-3.4..> | 2025-12-18 21:32 | 165K | |
| py311-optik-1.5.3_1.pkg | 2025-12-23 01:35 | 86K | |
| py311-optimize-image..> | 2025-12-28 06:58 | 48K | |
| py311-optking-0.3.0_..> | 2025-12-27 15:31 | 340K | |
| py311-optree-0.18.0.pkg | 2025-12-19 11:10 | 368K | |
| py311-optuna-4.3.0.pkg | 2025-12-27 01:23 | 632K | |
| py311-opuslib-3.0.1_..> | 2025-12-27 17:43 | 21K | |
| py311-or-tools-9.6_1..> | 2025-12-27 17:28 | 4.8M | |
| py311-orca-1.8_2.pkg | 2025-12-26 23:05 | 42K | |
| py311-ordered-set-4...> | 2025-12-18 18:47 | 14K | |
| py311-ordereddict-1...> | 2025-12-19 18:11 | 5.7K | |
| py311-orderedmultidi..> | 2025-12-18 21:37 | 23K | |
| py311-orderly-set-5...> | 2025-12-18 16:24 | 24K | |
| py311-orjson-3.11.4_..> | 2025-12-26 13:56 | 242K | |
| py311-ormar-0.20.2.pkg | 2025-12-27 07:29 | 280K | |
| py311-ormsgpack-1.12..> | 2025-12-27 09:42 | 182K | |
| py311-os-api-ref-3.1..> | 2025-12-28 10:07 | 90K | |
| py311-os-brick-6.10...> | 2025-12-27 13:08 | 545K | |
| py311-os-client-conf..> | 2025-12-27 01:17 | 52K | |
| py311-os-service-typ..> | 2025-12-18 10:19 | 31K | |
| py311-os-vif-4.2.1.pkg | 2025-12-29 17:26 | 176K | |
| py311-os-win-5.9.0_1..> | 2025-12-26 20:31 | 527K | |
| py311-osc-lib-3.2.0.pkg | 2025-12-26 21:40 | 153K | |
| py311-oscrypto-1.3.0..> | 2025-12-18 18:41 | 314K | |
| py311-oslex-0.1.3.pkg | 2025-12-19 22:53 | 4.7K | |
| py311-oslo.cache-3.1..> | 2025-12-27 19:40 | 101K | |
| py311-oslo.concurren..> | 2025-12-18 13:35 | 78K | |
| py311-oslo.config-9...> | 2025-12-18 11:27 | 282K | |
| py311-oslo.context-5..> | 2025-12-18 10:19 | 36K | |
| py311-oslo.db-17.1.0..> | 2025-12-29 06:38 | 303K | |
| py311-oslo.i18n-6.5...> | 2025-12-18 04:33 | 56K | |
| py311-oslo.limit-2.6..> | 2025-12-29 03:54 | 37K | |
| py311-oslo.log-7.0.0..> | 2025-12-26 15:37 | 127K | |
| py311-oslo.messaging..> | 2025-12-27 01:09 | 357K | |
| py311-oslo.metrics-0..> | 2025-12-26 19:06 | 19K | |
| py311-oslo.middlewar..> | 2025-12-26 19:30 | 94K | |
| py311-oslo.policy-4...> | 2025-12-26 23:27 | 166K | |
| py311-oslo.privsep-3..> | 2025-12-27 01:00 | 65K | |
| py311-oslo.reports-3..> | 2025-12-21 18:39 | 68K | |
| py311-oslo.rootwrap-..> | 2025-12-19 22:23 | 72K | |
| py311-oslo.serializa..> | 2025-12-18 10:30 | 44K | |
| py311-oslo.service-4..> | 2025-12-26 19:09 | 136K | |
| py311-oslo.upgradech..> | 2025-12-27 10:28 | 20K | |
| py311-oslo.utils-8.0..> | 2025-12-18 07:36 | 241K | |
| py311-oslo.versioned..> | 2025-12-27 11:11 | 188K | |
| py311-oslo.vmware-4...> | 2025-12-27 13:00 | 286K | |
| py311-oslotest-6.0.0..> | 2025-12-20 15:22 | 38K | |
| py311-osmnet-0.1.7_2..> | 2025-12-27 18:06 | 37K | |
| py311-ospd-openvas-2..> | 2025-12-27 09:26 | 224K | |
| py311-osprofiler-4.3..> | 2025-12-27 13:20 | 148K | |
| py311-osqp-0.6.2.pos..> | 2025-12-27 19:38 | 213K | |
| py311-oterm-0.9.3_2.pkg | 2025-12-29 17:54 | 90K | |
| py311-outcome-1.3.0_..> | 2025-12-18 00:51 | 9.7K | |
| py311-overlord-0.22...> | 2025-12-29 02:35 | 229K | |
| py311-overrides-7.7...> | 2025-12-18 01:50 | 32K | |
| py311-ovs-2.9.0_1.pkg | 2025-12-18 19:04 | 188K | |
| py311-ovsdbapp-2.14...> | 2025-12-19 14:31 | 281K | |
| py311-oyaml-1.0_2.pkg | 2025-12-20 01:32 | 4.7K | |
| py311-p4python-2025...> | 2025-12-30 00:20 | 1.3M | |
| py311-packageurl-pyt..> | 2025-12-19 01:39 | 64K | |
| py311-packaging-25.0..> | 2025-12-16 01:36 | 128K | |
| py311-packet-python-..> | 2025-12-30 12:46 | 17K | |
| py311-pafy-0.5.5_3.pkg | 2025-12-29 20:22 | 69K | |
| py311-pager-3.3_2.pkg | 2025-12-22 02:41 | 16K | |
| py311-paginate-0.5.7..> | 2025-12-18 23:49 | 17K | |
| py311-paho-mqtt-2.1...> | 2025-12-18 23:35 | 130K | |
| py311-paida-3.2.1.2...> | 2025-12-20 06:52 | 437K | |
| py311-palettable-3.3..> | 2025-12-18 16:24 | 167K | |
| py311-pamqp-1.6.1_1.pkg | 2025-12-19 20:50 | 52K | |
| py311-pandana-0.6.1_..> | 2025-12-27 18:26 | 152K | |
| py311-pandarm-0.0.3.pkg | 2025-12-27 16:53 | 192K | |
| py311-pandas-2.3.3,1..> | 2025-12-26 08:48 | 13M | |
| py311-pandas-charm-0..> | 2025-12-29 18:19 | 8.7K | |
| py311-pandas-datarea..> | 2025-12-27 02:01 | 179K | |
| py311-pandas-market-..> | 2025-12-30 07:16 | 180K | |
| py311-pandas-ta-0.3...> | 2025-12-27 16:52 | 245K | |
| py311-pandoc-plantum..> | 2025-12-29 15:16 | 6.6K | |
| py311-pandocfilters-..> | 2025-12-18 01:35 | 12K | |
| py311-pangocffi-0.13..> | 2025-12-26 21:08 | 61K | |
| py311-paperless-2.7...> | 2025-12-30 16:45 | 4.4M | |
| py311-paperless-ngx-..> | 2025-12-30 00:58 | 78M | |
| py311-papermill-2.6...> | 2025-12-30 02:21 | 79K | |
| py311-paragrep-3.3.0..> | 2025-12-24 03:23 | 12K | |
| py311-parallax-1.0.8..> | 2025-12-19 03:28 | 36K | |
| py311-param-2.1.1.pkg | 2025-12-19 08:39 | 257K | |
| py311-parameterized-..> | 2025-12-19 03:25 | 42K | |
| py311-paramiko-3.5.1..> | 2025-12-26 11:39 | 347K | |
| py311-paramz-0.9.6_1..> | 2025-12-26 23:31 | 177K | |
| py311-parfive-2.2.0.pkg | 2025-12-19 13:11 | 77K | |
| py311-parse-1.20.2.pkg | 2025-12-18 05:37 | 32K | |
| py311-parse-type-0.6..> | 2025-12-18 07:32 | 48K | |
| py311-parsedatetime-..> | 2025-12-18 13:44 | 73K | |
| py311-parsel-1.10.0_..> | 2025-12-18 23:25 | 34K | |
| py311-parsimonious-0..> | 2025-12-20 00:14 | 87K | |
| py311-parsley-1.3_1.pkg | 2025-12-19 01:56 | 202K | |
| py311-parso-0.8.4_1.pkg | 2025-12-18 01:32 | 179K | |
| py311-partd-1.4.2.pkg | 2025-12-18 13:03 | 44K | |
| py311-parver-0.5.pkg | 2025-12-23 04:51 | 34K | |
| py311-pass-audit-1.2..> | 2025-12-30 06:26 | 22K | |
| py311-pass-git-helpe..> | 2025-12-20 07:58 | 18K | |
| py311-passhole-1.10...> | 2025-12-30 17:23 | 64K | |
| py311-passlib-1.7.4_..> | 2025-12-18 18:31 | 820K | |
| py311-pastedeploy-3...> | 2025-12-18 11:49 | 34K | |
| py311-pastel-0.2.1_2..> | 2025-12-19 06:15 | 13K | |
| py311-patch-1.16_1.pkg | 2025-12-22 20:46 | 30K | |
| py311-patch-ng-1.18...> | 2025-12-18 20:57 | 36K | |
| py311-path-17.1.1.pkg | 2025-12-19 22:18 | 50K | |
| py311-path-and-addre..> | 2025-12-19 05:31 | 4.5K | |
| py311-path.py-11.5.2..> | 2025-12-19 02:24 | 40K | |
| py311-pathable-0.4.4..> | 2025-12-18 04:31 | 17K | |
| py311-pathlib2-2.3.7..> | 2025-12-18 10:00 | 43K | |
| py311-pathos-0.3.4.pkg | 2025-12-19 08:38 | 114K | |
| py311-pathspec-0.12...> | 2025-12-16 01:38 | 45K | |
| py311-pathtools-0.1...> | 2025-12-19 22:57 | 155K | |
| py311-pathvalidate-3..> | 2025-12-19 23:07 | 43K | |
| py311-patiencediff-0..> | 2025-12-19 05:59 | 33K | |
| py311-patool-4.0.1.pkg | 2025-12-23 12:49 | 91K | |
| py311-patsy-1.0.2.pkg | 2025-12-26 14:46 | 363K | |
| py311-paver-1.3.4_1.pkg | 2025-12-18 17:45 | 319K | |
| py311-pbkdf2-1.3_1.pkg | 2025-12-18 17:37 | 10K | |
| py311-pbr-7.0.3.pkg | 2025-12-18 03:51 | 178K | |
| py311-pbs-installer-..> | 2025-12-26 19:25 | 80K | |
| py311-pcapy-0.11.1_1..> | 2025-12-18 11:38 | 17K | |
| py311-pcapy-ng-1.0.9..> | 2025-12-19 21:46 | 24K | |
| py311-pcodec-0.3.5_5..> | 2025-12-28 04:20 | 383K | |
| py311-pcpp-1.30_1.pkg | 2025-12-19 08:31 | 172K | |
| py311-pdagent-1.7.4.pkg | 2025-12-20 03:11 | 45K | |
| py311-pdagent-integr..> | 2025-12-22 06:26 | 6.3K | |
| py311-pdal-3.4.5_1.pkg | 2025-12-30 05:01 | 162K | |
| py311-pdd-1.7.pkg | 2025-12-23 14:22 | 29K | |
| py311-pdf-redact-too..> | 2025-12-29 01:11 | 3.7K | |
| py311-pdf2docx-0.5.8..> | 2025-12-29 22:48 | 213K | |
| py311-pdf2image-1.17..> | 2025-12-27 11:03 | 21K | |
| py311-pdfarranger-1...> | 2025-12-29 19:06 | 333K | |
| py311-pdfminer.six-2..> | 2025-12-26 18:34 | 4.5M | |
| py311-pdfminer3k-1.3..> | 2025-12-23 08:42 | 256K | |
| py311-pdfrw-0.4_1.pkg | 2025-12-23 06:54 | 100K | |
| py311-pdftotext-3.0...> | 2025-12-27 04:42 | 6.7K | |
| py311-pdm-2.26.2.pkg | 2025-12-29 07:58 | 617K | |
| py311-pdm-autoexport..> | 2025-12-23 05:13 | 6.0K | |
| py311-pdm-backend-2...> | 2025-12-18 11:24 | 224K | |
| py311-pdm-build-lock..> | 2025-12-19 11:05 | 16K | |
| py311-pdm-pep517-1.1..> | 2025-12-18 10:57 | 359K | |
| py311-pdoc-15.0.4.pkg | 2025-12-22 13:18 | 240K | |
| py311-pebble-5.1.3.pkg | 2025-12-19 04:20 | 59K | |
| py311-pecan-1.3.3_2.pkg | 2025-12-20 07:51 | 270K | |
| py311-peewee-3.15.0_..> | 2025-12-18 12:33 | 436K | |
| py311-peewee_migrate..> | 2025-12-22 02:54 | 48K | |
| py311-pefile-2024.8...> | 2025-12-18 16:17 | 164K | |
| py311-peft-0.17.1.pkg | 2025-12-30 08:23 | 627K | |
| py311-pelican-4.11.0..> | 2025-12-30 00:48 | 627K | |
| py311-pem-23.1.0.pkg | 2025-12-18 20:37 | 16K | |
| py311-penaltymodel-1..> | 2025-12-27 09:49 | 47K | |
| py311-pendulum-3.1.0..> | 2025-12-26 19:54 | 378K | |
| py311-pep8-1.7.1_4.pkg | 2025-12-19 16:38 | 65K | |
| py311-pep8-naming-0...> | 2025-12-18 22:52 | 20K | |
| py311-pep440-0.1.2_2..> | 2025-12-23 17:22 | 5.7K | |
| py311-pep517-0.13.1.pkg | 2025-12-19 14:42 | 37K | |
| py311-pep562-1.1_1.pkg | 2025-12-21 11:15 | 9.4K | |
| py311-pep621-0.4.0_3..> | 2025-12-21 05:13 | 17K | |
| py311-perceval-1.1.1..> | 2025-12-26 15:10 | 299K | |
| py311-perceval-mozil..> | 2025-12-26 20:21 | 40K | |
| py311-perceval-opnfv..> | 2025-12-26 18:48 | 21K | |
| py311-perceval-puppe..> | 2025-12-26 17:48 | 23K | |
| py311-perceval-webla..> | 2025-12-26 18:34 | 24K | |
| py311-period-0.6.1_1..> | 2025-12-22 06:36 | 17K | |
| py311-periodictable-..> | 2025-12-30 01:47 | 631K | |
| py311-periscope-0.2...> | 2025-12-22 04:06 | 68K | |
| py311-permutation-0...> | 2025-12-21 11:10 | 17K | |
| py311-persistent-4.9..> | 2025-12-18 20:01 | 201K | |
| py311-petl-1.7.17_2.pkg | 2025-12-19 00:02 | 454K | |
| py311-petname-2.6_1.pkg | 2025-12-21 15:39 | 13K | |
| py311-petsc4py-3.22...> | 2025-12-27 08:38 | 1.0M | |
| py311-pew-1.2.0_1.pkg | 2025-12-29 03:49 | 37K | |
| py311-pex-1.2.7_1.pkg | 2025-12-22 08:43 | 202K | |
| py311-pexpect-4.9.0_..> | 2025-12-16 01:45 | 100K | |
| py311-pg8000-1.31.5.pkg | 2025-12-21 22:11 | 87K | |
| py311-pgcli-4.3.0_1.pkg | 2025-12-20 11:11 | 177K | |
| py311-pgdbconn-0.8.0..> | 2025-12-23 12:23 | 7.4K | |
| py311-pglast-5.8_1.pkg | 2025-12-23 11:43 | 951K | |
| py311-pglite-1.0.13_..> | 2025-12-20 05:40 | 14K | |
| py311-pgmigrate-1.0...> | 2025-12-23 06:58 | 28K | |
| py311-pgpdump-1.5_1.pkg | 2025-12-23 19:21 | 44K | |
| py311-pgpy-0.5.3_1.pkg | 2025-12-30 06:40 | 188K | |
| py311-pgsanity-0.2.9..> | 2025-12-20 04:53 | 11K | |
| py311-pgspecial-2.2...> | 2025-12-19 12:57 | 71K | |
| py311-phabricator-0...> | 2025-12-19 05:42 | 31K | |
| py311-phidl-1.0.1_3.pkg | 2025-12-27 21:30 | 153K | |
| py311-phmdoctest-1.4..> | 2025-12-21 16:11 | 69K | |
| py311-phonebox-plugi..> | 2025-12-21 12:33 | 33K | |
| py311-phonenumbers-8..> | 2025-12-18 16:19 | 4.3M | |
| py311-phono3py-3.9.0..> | 2025-12-30 11:59 | 575K | |
| py311-phonopy-2.42.0..> | 2025-12-26 19:07 | 817K | |
| py311-photocollage-1..> | 2025-12-28 14:29 | 192K | |
| py311-photofilmstrip..> | 2025-12-30 00:17 | 465K | |
| py311-phply-1.2.6_3.pkg | 2025-12-19 15:39 | 125K | |
| py311-phpserialize-1..> | 2025-12-20 02:27 | 13K | |
| py311-phx-class-regi..> | 2025-12-20 03:12 | 22K | |
| py311-pick-2.4.0.pkg | 2025-12-20 19:15 | 11K | |
| py311-pickledb-0.9.2..> | 2025-12-20 19:29 | 8.2K | |
| py311-pickleshare-0...> | 2025-12-22 19:10 | 11K | |
| py311-pid-3.0.4_1.pkg | 2025-12-20 02:47 | 15K | |
| py311-piddle-1.0.15_..> | 2025-12-23 23:58 | 531K | |
| py311-piexif-1.1.3_1..> | 2025-12-19 03:06 | 46K | |
| py311-pika-1.3.2_1.pkg | 2025-12-20 00:34 | 265K | |
| py311-pika-pool-0.1...> | 2025-12-22 11:29 | 11K | |
| py311-pikepdf-9.9.0_..> | 2025-12-26 20:21 | 651K | |
| py311-pillow-11.3.0_..> | 2025-12-26 07:58 | 893K | |
| py311-pillow-heif-1...> | 2025-12-26 20:19 | 67K | |
| py311-pinocchio-0.4...> | 2025-12-20 21:28 | 26K | |
| py311-pint-0.23.pkg | 2025-12-18 13:52 | 643K | |
| py311-pint-pandas-0...> | 2025-12-30 16:41 | 64K | |
| py311-pip-23.3.2_4.pkg | 2025-12-18 01:29 | 3.5M | |
| py311-pip-api-0.0.34..> | 2025-12-20 04:06 | 254K | |
| py311-pip-audit-2.10..> | 2025-12-28 09:39 | 94K | |
| py311-pip-check-3.2.pkg | 2025-12-24 01:31 | 14K | |
| py311-pip-licenses-4..> | 2025-12-21 17:04 | 35K | |
| py311-pip-requiremen..> | 2025-12-19 23:04 | 68K | |
| py311-pip-run-12.6.1..> | 2025-12-22 09:20 | 30K | |
| py311-pip-shims-0.7...> | 2025-12-23 23:58 | 72K | |
| py311-pip-tools-7.5...> | 2025-12-21 17:18 | 128K | |
| py311-pip-tools4-4.5..> | 2025-12-20 01:52 | 78K | |
| py311-pipdeptree-2.3..> | 2025-12-21 03:16 | 61K | |
| py311-pipenv-2026.0...> | 2025-12-27 12:44 | 3.6M | |
| py311-pipreqs-0.5.0.pkg | 2025-12-27 23:09 | 43K | |
| py311-pipx-1.8.0.pkg | 2025-12-18 20:57 | 161K | |
| py311-pivy-0.6.10.pkg | 2025-12-27 08:36 | 2.4M | |
| py311-pkbar-0.5_1.pkg | 2025-12-27 20:46 | 9.5K | |
| py311-pkgconfig-1.5...> | 2025-12-18 01:09 | 12K | |
| py311-pkginfo-1.12.1..> | 2025-12-18 17:58 | 67K | |
| py311-plac-1.4.3_1.pkg | 2025-12-20 04:21 | 52K | |
| py311-placekey-0.0.2..> | 2025-12-29 11:32 | 28K | |
| py311-plan-0.5_1.pkg | 2025-12-21 08:07 | 40K | |
| py311-planet-3.4.0.pkg | 2025-12-30 06:50 | 193K | |
| py311-planet-auth-2...> | 2025-12-27 11:27 | 197K | |
| py311-plaso-20240826..> | 2025-12-29 07:20 | 2.3M | |
| py311-plastex-3.1_2.pkg | 2025-12-29 18:51 | 885K | |
| py311-platformdirs-4..> | 2025-12-18 00:41 | 32K | |
| py311-playsound-1.3...> | 2025-12-19 22:18 | 12K | |
| py311-playwright-1.5..> | 2025-12-28 09:06 | 1.8M | |
| py311-plette-2.1.0_1..> | 2025-12-27 15:58 | 25K | |
| py311-plex-1.1.5_1.pkg | 2025-12-23 21:27 | 68K | |
| py311-plotly-5.24.1_..> | 2025-12-18 16:10 | 7.1M | |
| py311-ploy-2.0.1_2.pkg | 2025-12-27 10:59 | 134K | |
| py311-ploy_ezjail-2...> | 2025-12-29 22:45 | 31K | |
| py311-plucky-0.4.3_1..> | 2025-12-18 12:52 | 14K | |
| py311-pluggy-1.6.0.pkg | 2025-12-16 01:38 | 43K | |
| py311-pluginbase-1.0..> | 2025-12-18 18:58 | 15K | |
| py311-plugincode-32...> | 2025-12-27 12:00 | 21K | |
| py311-plumbum-1.10.0..> | 2025-12-18 18:46 | 238K | |
| py311-plux-1.13.0.pkg | 2025-12-21 16:50 | 63K | |
| py311-ply-3.11_1.pkg | 2025-12-16 02:48 | 161K | |
| py311-pnetcdf-1.0.0_..> | 2025-12-28 04:28 | 306K | |
| py311-png-0.0.17_1.pkg | 2025-12-18 13:19 | 63K | |
| py311-pnio-dcp-1.2.0..> | 2025-12-19 14:53 | 42K | |
| py311-pnu-certwatch-..> | 2025-12-28 13:21 | 32K | |
| py311-pnu-libpnu-1.3..> | 2025-12-18 22:54 | 11K | |
| py311-pnu-portstreel..> | 2025-12-22 00:51 | 50K | |
| py311-pnu-vuxml-1.2...> | 2025-12-19 17:14 | 27K | |
| py311-pockets-0.9.1_..> | 2025-12-18 06:54 | 40K | |
| py311-pocketsphinx-0..> | 2025-12-29 14:37 | 27M | |
| py311-podcastparser-..> | 2025-12-20 03:11 | 28K | |
| py311-podman-compose..> | 2025-12-20 01:59 | 114K | |
| py311-poetry-2.2.1.pkg | 2025-12-26 23:02 | 544K | |
| py311-poetry-core-2...> | 2025-12-18 00:49 | 680K | |
| py311-poetry-dynamic..> | 2025-12-18 13:07 | 42K | |
| py311-poetry-plugin-..> | 2025-12-28 12:37 | 22K | |
| py311-poetry-plugin-..> | 2025-12-23 22:22 | 21K | |
| py311-poetry-plugin-..> | 2025-12-30 07:31 | 11K | |
| py311-poetry-semver-..> | 2025-12-23 21:09 | 27K | |
| py311-poetry-types-0..> | 2025-12-29 19:49 | 16K | |
| py311-poetry2setup-1..> | 2025-12-24 04:54 | 3.8K | |
| py311-point-annotato..> | 2025-12-30 02:23 | 877K | |
| py311-pointpats-2.5...> | 2025-12-26 21:05 | 137K | |
| py311-polars-1.33.1.pkg | 2025-12-26 18:26 | 27M | |
| py311-polib-1.2.0_1.pkg | 2025-12-18 14:36 | 42K | |
| py311-polyfactory-3...> | 2025-12-20 00:18 | 121K | |
| py311-pondpond-1.4.1..> | 2025-12-21 04:16 | 21K | |
| py311-pony-0.7.19_1.pkg | 2025-12-23 07:20 | 817K | |
| py311-pooch-1.8.2.pkg | 2025-12-26 18:43 | 111K | |
| py311-pook-2.1.3.pkg | 2025-12-29 23:27 | 5.0K | |
| py311-pop-20.1.1_2.pkg | 2025-12-19 22:54 | 74K | |
| py311-pop-config-8.0..> | 2025-12-18 19:28 | 45K | |
| py311-port-for-0.4_1..> | 2025-12-21 01:50 | 41K | |
| py311-portalocker-2...> | 2025-12-18 17:44 | 27K | |
| py311-portend-2.5_2.pkg | 2025-12-18 21:31 | 8.2K | |
| py311-positional-1.2..> | 2025-12-23 01:49 | 9.2K | |
| py311-posix_ipc-1.3...> | 2025-12-20 11:52 | 15K | |
| py311-postfix-mta-st..> | 2025-12-20 21:26 | 59K | |
| py311-postgresql-1.3..> | 2025-12-21 23:48 | 534K | |
| py311-posthog-4.0.1.pkg | 2025-12-26 23:00 | 200K | |
| py311-postorius-1.3...> | 2025-12-30 07:27 | 1.6M | |
| py311-potr-1.0.1_2.pkg | 2025-12-19 15:03 | 54K | |
| py311-powa-collector..> | 2025-12-24 07:21 | 47K | |
| py311-powa-web-5.1.2..> | 2025-12-20 10:35 | 571K | |
| py311-power-1.3_1.pkg | 2025-12-23 12:39 | 24K | |
| py311-powerline-stat..> | 2025-12-20 19:29 | 3.2M | |
| py311-pox-0.3.6.pkg | 2025-12-18 17:51 | 45K | |
| py311-poyo-0.5.0_1.pkg | 2025-12-18 22:31 | 17K | |
| py311-ppft-1.7.7.pkg | 2025-12-18 21:59 | 69K | |
| py311-pplpy-0.8.10.pkg | 2025-12-21 05:59 | 262K | |
| py311-pprintpp-0.4.0..> | 2025-12-19 16:45 | 25K | |
| py311-prance-23.6.21..> | 2025-12-26 15:26 | 58K | |
| py311-praw-7.8.1.pkg | 2025-12-26 23:02 | 284K | |
| py311-prawcore-3.0.2..> | 2025-12-26 20:09 | 32K | |
| py311-pre-commit-4.5..> | 2025-12-26 13:49 | 299K | |
| py311-pre-commit-hoo..> | 2025-12-30 14:29 | 66K | |
| py311-precis_i18n-1...> | 2025-12-19 00:01 | 36K | |
| py311-prefixed-0.9.0..> | 2025-12-19 02:53 | 13K | |
| py311-premailer-3.1...> | 2025-12-30 06:33 | 30K | |
| py311-preppy-2.4.1_1..> | 2025-12-20 13:06 | 42K | |
| py311-preshed-4.0.0.pkg | 2025-12-21 21:20 | 85K | |
| py311-preshed3-3.0.1..> | 2025-12-18 17:33 | 77K | |
| py311-pretend-1.0.9_..> | 2025-12-21 13:09 | 6.8K | |
| py311-pretty_midi-0...> | 2025-12-29 05:54 | 5.4M | |
| py311-prettytable-3...> | 2025-12-18 12:30 | 74K | |
| py311-prettytable0-0..> | 2025-12-18 11:37 | 35K | |
| py311-primecountpy-0..> | 2025-12-21 16:43 | 29K | |
| py311-primme-3.2.3_1..> | 2025-12-29 00:24 | 771K | |
| py311-primp-0.15.0_3..> | 2025-12-27 02:24 | 2.7M | |
| py311-printree-0.2.1..> | 2025-12-21 04:11 | 16K | |
| py311-priority-2.0.0..> | 2025-12-18 18:45 | 15K | |
| py311-priority1-1.3...> | 2025-12-18 01:10 | 14K | |
| py311-prisma-0.15.0.pkg | 2025-12-28 19:50 | 289K | |
| py311-process-tests-..> | 2025-12-23 19:29 | 11K | |
| py311-proglog-0.1.12..> | 2025-12-19 02:05 | 13K | |
| py311-progress-1.6_1..> | 2025-12-20 01:33 | 14K | |
| py311-progressbar-2...> | 2025-12-18 23:00 | 20K | |
| py311-progressbar2-4..> | 2025-12-19 15:01 | 124K | |
| py311-projpicker-0.3..> | 2025-12-21 16:11 | 602K | |
| py311-prometheus-cli..> | 2025-12-26 06:48 | 113K | |
| py311-prometheus-zfs..> | 2025-12-30 01:17 | 2.3K | |
| py311-promise-2.3_1.pkg | 2025-12-18 06:46 | 43K | |
| py311-prompt-toolkit..> | 2025-12-18 01:45 | 723K | |
| py311-prompt-toolkit..> | 2025-12-19 14:06 | 645K | |
| py311-propcache-0.4...> | 2025-12-18 01:52 | 39K | |
| py311-property-cache..> | 2025-12-20 02:16 | 9.2K | |
| py311-proplot-0.9.7_..> | 2025-12-27 03:30 | 5.3M | |
| py311-proselint-0.14..> | 2025-12-18 04:45 | 156K | |
| py311-prospector-1.1..> | 2025-12-29 01:02 | 156K | |
| py311-protego-0.1.16..> | 2025-12-19 21:41 | 38K | |
| py311-proto-plus-1.2..> | 2025-12-26 09:55 | 70K | |
| py311-protobuf-6.33...> | 2025-12-18 02:56 | 446K | |
| py311-protobuf-compi..> | 2025-12-21 21:19 | 13K | |
| py311-protoc-gen-val..> | 2025-12-23 20:50 | 28K | |
| py311-protovalidate-..> | 2025-12-29 07:01 | 65K | |
| py311-proxmoxer-2.2...> | 2025-12-30 11:27 | 38K | |
| py311-proxy_tools-0...> | 2025-12-18 17:14 | 6.8K | |
| py311-psautohint-2.4..> | 2025-12-27 21:48 | 180K | |
| py311-pscript-0.8.0.pkg | 2025-12-18 17:55 | 129K | |
| py311-pss-1.45_1.pkg | 2025-12-22 16:15 | 56K | |
| py311-psutil-7.1.3.pkg | 2025-12-18 02:46 | 515K | |
| py311-psycogreen-1.0..> | 2025-12-21 00:57 | 4.7K | |
| py311-psycopg-3.2.13..> | 2025-12-18 20:02 | 391K | |
| py311-psycopg-c-3.2...> | 2025-12-18 16:10 | 267K | |
| py311-psycopg-pool-3..> | 2025-12-18 17:20 | 61K | |
| py311-psycopg2-2.9.1..> | 2025-12-18 18:35 | 162K | |
| py311-psycopg2cffi-2..> | 2025-12-19 14:17 | 159K | |
| py311-psygnal-0.15.0..> | 2025-12-18 14:29 | 169K | |
| py311-ptable-0.9.2_2..> | 2025-12-19 14:03 | 46K | |
| py311-ptpython-3.0.3..> | 2025-12-21 09:45 | 139K | |
| py311-ptvsd-3.1.0_1.pkg | 2025-12-22 05:42 | 129K | |
| py311-ptyprocess-0.7..> | 2025-12-16 01:43 | 26K | |
| py311-publicsuffix-1..> | 2025-12-21 15:40 | 86K | |
| py311-publicsuffix2-..> | 2025-12-18 18:31 | 96K | |
| py311-publicsuffixli..> | 2025-12-26 22:38 | 108K | |
| py311-pudb-2025.1.5.pkg | 2025-12-29 13:49 | 198K | |
| py311-puddletag-2.5...> | 2025-12-30 09:02 | 962K | |
| py311-pulsar-client-..> | 2025-12-20 16:55 | 322K | |
| py311-pulsectl-24.12..> | 2025-12-27 03:02 | 87K | |
| py311-pum-0.9.14_2.pkg | 2025-12-20 08:54 | 37K | |
| py311-puppetboard-6...> | 2025-12-28 17:04 | 1.9M | |
| py311-pupynere-1.0.1..> | 2025-12-28 01:15 | 21K | |
| py311-pure-eval-0.2...> | 2025-12-18 01:38 | 25K | |
| py311-puremagic-1.24..> | 2025-12-18 22:35 | 41K | |
| py311-purl-1.6_1.pkg | 2025-12-20 22:31 | 20K | |
| py311-pwlf-2.5.1.pkg | 2025-12-28 14:09 | 27K | |
| py311-pwntools-4.15...> | 2025-12-28 06:17 | 1.6M | |
| py311-py-1.11.0_2.pkg | 2025-12-18 19:50 | 214K | |
| py311-py-OpenFermion..> | 2025-12-29 21:22 | 16K | |
| py311-py-cpuinfo-9.0..> | 2025-12-18 13:43 | 59K | |
| py311-py-deviceid-0...> | 2025-12-22 00:50 | 8.3K | |
| py311-py-find-1st-1...> | 2025-12-27 16:05 | 8.6K | |
| py311-py-partiql-par..> | 2025-12-23 14:43 | 53K | |
| py311-py-restclient-..> | 2025-12-20 17:11 | 39K | |
| py311-py-serializabl..> | 2025-12-19 00:24 | 49K | |
| py311-py-stackexchan..> | 2025-12-23 12:44 | 61K | |
| py311-py-ubjson-0.16..> | 2025-12-18 17:19 | 47K | |
| py311-py2bit-0.3.0_1..> | 2025-12-18 21:54 | 19K | |
| py311-py3Dmol-2.4.2_..> | 2025-12-23 16:51 | 13K | |
| py311-py3dns-4.0.2.pkg | 2025-12-19 02:18 | 64K | |
| py311-py3nvml-0.2.7_..> | 2025-12-21 00:06 | 85K | |
| py311-py3status-3.63..> | 2025-12-23 21:39 | 588K | |
| py311-py7zr-0.22.0.pkg | 2025-12-30 16:32 | 151K | |
| py311-pyBigWig-0.3.2..> | 2025-12-18 22:39 | 57K | |
| py311-pyClamd-0.3.17..> | 2025-12-20 16:41 | 21K | |
| py311-pyEDFlib-0.1.4..> | 2025-12-28 14:09 | 1.1M | |
| py311-pyFFTW-0.15.0_..> | 2025-12-26 20:47 | 157K | |
| py311-pyIOSXR-0.53_4..> | 2025-12-29 00:59 | 20K | |
| py311-pyModbusTCP-0...> | 2025-12-30 04:53 | 53K | |
| py311-pyPEG2-2.15.2_..> | 2025-12-24 04:49 | 47K | |
| py311-pyRdfa3-3.6.4.pkg | 2025-12-27 18:05 | 158K | |
| py311-pyTooling-8.3...> | 2025-12-20 04:28 | 251K | |
| py311-pyVTK-0.5.18_1..> | 2025-12-24 03:53 | 46K | |
| py311-py_interface-2..> | 2025-12-23 16:54 | 84K | |
| py311-pyacoustid-1.3..> | 2025-12-27 08:48 | 25K | |
| py311-pyaes-1.6.1_1.pkg | 2025-12-18 21:52 | 41K | |
| py311-pyaff4-0.26.p6..> | 2025-12-20 10:16 | 138K | |
| py311-pyahocorasick-..> | 2025-12-29 19:48 | 30K | |
| py311-pyairtable-3.3..> | 2025-12-29 06:24 | 209K | |
| py311-pyairtable2-2...> | 2025-12-27 10:59 | 132K | |
| py311-pyaixi-1.0.4_2..> | 2025-12-22 04:58 | 76K | |
| py311-pyaml-25.5.0.pkg | 2025-12-19 00:44 | 54K | |
| py311-pyaml-env-1.2...> | 2025-12-19 14:09 | 11K | |
| py311-pyang-1.7.8_4.pkg | 2025-12-21 13:10 | 502K | |
| py311-pyarrow-21.0.0..> | 2025-12-26 15:25 | 4.9M | |
| py311-pyasn1-0.6.0.pkg | 2025-12-18 00:41 | 168K | |
| py311-pyasn1-modules..> | 2025-12-18 00:49 | 286K | |
| py311-pyaudi-1.9.2.1..> | 2025-12-30 00:50 | 615K | |
| py311-pyaudio-0.2.14..> | 2025-12-18 17:22 | 179K | |
| py311-pyautogui-0.9...> | 2025-12-27 00:31 | 63K | |
| py311-pyaxo-0.8.2_4.pkg | 2025-12-19 20:45 | 24K | |
| py311-pybcj-1.0.7.pkg | 2025-12-19 16:40 | 27K | |
| py311-pyberny-0.6.3_..> | 2025-12-30 15:08 | 54K | |
| py311-pybind11-3.0.1..> | 2025-12-18 01:34 | 215K | |
| py311-pybix-0.0.8_1.pkg | 2025-12-28 17:36 | 22K | |
| py311-pybloom-3.0.0_..> | 2025-12-20 17:51 | 20K | |
| py311-pybonjour-1.1...> | 2025-12-19 20:34 | 27K | |
| py311-pybreaker-1.4...> | 2025-12-19 07:10 | 25K | |
| py311-pybtex-0.25.1.pkg | 2025-12-18 23:43 | 199K | |
| py311-pybtex-docutil..> | 2025-12-19 03:31 | 10K | |
| py311-pybugz-0.14_3.pkg | 2025-12-19 21:39 | 45K | |
| py311-pycadf-4.0.1.pkg | 2025-12-19 20:12 | 53K | |
| py311-pycalendar-2.0..> | 2025-12-20 05:51 | 176K | |
| py311-pycallgraph-1...> | 2025-12-28 14:30 | 58K | |
| py311-pycapsicum-1.0..> | 2025-12-23 18:06 | 18K | |
| py311-pycares-4.3.0_..> | 2025-12-18 09:13 | 84K | |
| py311-pycddl-0.6.3_6..> | 2025-12-27 08:58 | 1.0M | |
| py311-pycerberus-0.6..> | 2025-12-21 04:39 | 76K | |
| py311-pycha-0.8.1_2.pkg | 2025-12-27 06:13 | 84K | |
| py311-pychromecast-1..> | 2025-12-29 12:22 | 139K | |
| py311-pyclipper-1.3...> | 2025-12-18 06:00 | 113K | |
| py311-pycmd-1.2_2.pkg | 2025-12-21 19:42 | 23K | |
| py311-pycnite-2024.7..> | 2025-12-19 11:39 | 44K | |
| py311-pycocotools-2...> | 2025-12-27 12:45 | 96K | |
| py311-pycodeexport-0..> | 2025-12-27 19:42 | 24K | |
| py311-pycodestyle-2...> | 2025-12-18 11:01 | 68K | |
| py311-pycognito-2024..> | 2025-12-29 06:29 | 46K | |
| py311-pycoin-0.92.20..> | 2025-12-22 20:41 | 330K | |
| py311-pycoingecko-3...> | 2025-12-27 12:53 | 13K | |
| py311-pycollada-0.6_..> | 2025-12-27 00:42 | 197K | |
| py311-pycompilation-..> | 2025-12-27 00:51 | 45K | |
| py311-pycomplete-0.4..> | 2025-12-21 16:39 | 25K | |
| py311-pycomposefile-..> | 2025-12-19 23:02 | 32K | |
| py311-pyconify-0.1.6..> | 2025-12-22 05:42 | 33K | |
| py311-pycos-4.8.11_3..> | 2025-12-20 04:19 | 329K | |
| py311-pycosat-0.6.3_..> | 2025-12-22 09:57 | 16K | |
| py311-pycount-0.0.6_..> | 2025-12-21 04:34 | 5.2K | |
| py311-pycountry-24.6..> | 2025-12-18 16:26 | 3.0M | |
| py311-pycparser-2.23..> | 2025-12-18 00:25 | 231K | |
| py311-pycrdt-0.12.44..> | 2025-12-26 17:01 | 674K | |
| py311-pycrdt-store-0..> | 2025-12-26 19:26 | 25K | |
| py311-pycrdt-websock..> | 2025-12-26 21:07 | 28K | |
| py311-pycryptodome-3..> | 2025-12-18 13:36 | 1.6M | |
| py311-pycryptodome-t..> | 2025-12-22 19:59 | 10M | |
| py311-pycryptodomex-..> | 2025-12-18 10:18 | 1.6M | |
| py311-pycsw-2.6.2_2.pkg | 2025-12-27 23:08 | 428K | |
| py311-pyct-0.5.0_1.pkg | 2025-12-23 06:53 | 31K | |
| py311-pycups-2.0.4.pkg | 2025-12-19 13:19 | 67K | |
| py311-pycurl-7.45.7.pkg | 2025-12-19 17:07 | 68K | |
| py311-pydantic-1.10...> | 2025-12-18 11:39 | 327K | |
| py311-pydantic-compa..> | 2025-12-26 18:31 | 22K | |
| py311-pydantic-core-..> | 2025-12-26 09:25 | 1.7M | |
| py311-pydantic-extra..> | 2025-12-26 23:00 | 72K | |
| py311-pydantic-resol..> | 2025-12-21 06:52 | 62K | |
| py311-pydantic-setti..> | 2025-12-26 18:48 | 69K | |
| py311-pydantic-vault..> | 2025-12-30 07:26 | 17K | |
| py311-pydantic-yaml-..> | 2025-12-29 06:14 | 27K | |
| py311-pydantic2-2.12..> | 2025-12-26 10:12 | 830K | |
| py311-pydash-4.8.0_1..> | 2025-12-23 20:52 | 138K | |
| py311-pydata-sphinx-..> | 2025-12-27 18:42 | 1.5M | |
| py311-pydbus-0.6.0_2..> | 2025-12-27 18:43 | 36K | |
| py311-pydecor-2.0.1_..> | 2025-12-22 22:37 | 33K | |
| py311-pydemumble-0.0..> | 2025-12-23 06:47 | 149K | |
| py311-pydenticon-0.3..> | 2025-12-30 10:10 | 10K | |
| py311-pyderasn-9.3_2..> | 2025-12-19 01:13 | 115K | |
| py311-pydeseq2-0.5.2..> | 2025-12-28 21:01 | 85K | |
| py311-pydevd-2.10.0_..> | 2025-12-20 23:27 | 1.9M | |
| py311-pydicom-3.0.1.pkg | 2025-12-20 10:09 | 2.9M | |
| py311-pydispatcher-2..> | 2025-12-19 10:53 | 20K | |
| py311-pydnstable-0.8..> | 2025-12-22 05:38 | 35K | |
| py311-pydocstyle-6.3..> | 2025-12-18 23:13 | 83K | |
| py311-pydot-4.0.1.pkg | 2025-12-26 09:05 | 74K | |
| py311-pydotplus-2.0...> | 2025-12-19 14:43 | 52K | |
| py311-pydub-0.25.1_3..> | 2025-12-27 09:39 | 76K | |
| py311-pydyf-0.9.0_1.pkg | 2025-12-19 22:07 | 18K | |
| py311-pyeapi-1.0.4_1..> | 2025-12-19 00:02 | 131K | |
| py311-pyee-13.0.0.pkg | 2025-12-19 04:53 | 26K | |
| py311-pyee11-11.1.1.pkg | 2025-12-18 20:14 | 26K | |
| py311-pyelftools-0.3..> | 2025-12-18 12:50 | 348K | |
| py311-pyelliptic-2.0..> | 2025-12-27 10:56 | 31K | |
| py311-pyenet-1.3.13...> | 2025-12-19 10:41 | 73K | |
| py311-pyepsg-0.4.0_1..> | 2025-12-29 03:47 | 22K | |
| py311-pyerfa-2.0.0.3..> | 2025-12-26 13:49 | 355K | |
| py311-pyexcel-0.7.4.pkg | 2025-12-23 02:33 | 134K | |
| py311-pyexcel-ezodf-..> | 2025-12-18 19:34 | 106K | |
| py311-pyexcel-io-0.6..> | 2025-12-18 23:18 | 72K | |
| py311-pyexcel-ods3-0..> | 2025-12-19 15:52 | 14K | |
| py311-pyexcel-xls-0...> | 2025-12-19 12:42 | 18K | |
| py311-pyexcel-xlsx-0..> | 2025-12-19 20:47 | 14K | |
| py311-pyface-8.0.0.pkg | 2025-12-26 10:13 | 1.6M | |
| py311-pyfaidx-0.5.9...> | 2025-12-19 05:48 | 53K | |
| py311-pyfakefs-5.10...> | 2025-12-24 07:24 | 544K | |
| py311-pyfasta-0.5.2_..> | 2025-12-30 07:20 | 29K | |
| py311-pyfcm-1.5.1_1.pkg | 2025-12-29 15:16 | 22K | |
| py311-pyfda-0.1_15.pkg | 2025-12-30 15:12 | 309K | |
| py311-pyfiglet-1.0.4..> | 2025-12-19 11:22 | 1.2M | |
| py311-pyfixbuf-0.9.0..> | 2025-12-23 07:45 | 150K | |
| py311-pyflakes-3.4.0..> | 2025-12-18 10:04 | 145K | |
| py311-pyfltk-1.3.9_2..> | 2025-12-28 09:51 | 1.6M | |
| py311-pyformance-0.4..> | 2025-12-21 04:58 | 62K | |
| py311-pyftpdlib-1.5...> | 2025-12-30 18:36 | 285K | |
| py311-pyfzf-0.3.1.pkg | 2025-12-19 12:55 | 5.3K | |
| py311-pyganim-0.9.2_..> | 2025-12-27 19:30 | 24K | |
| py311-pygccxml-3.0.2..> | 2025-12-18 16:38 | 243K | |
| py311-pygdbmi-0.11.0..> | 2025-12-22 19:28 | 34K | |
| py311-pygeoapi-0.22...> | 2025-12-29 09:53 | 654K | |
| py311-pygeodesy-23.4..> | 2025-12-20 22:57 | 1.4M | |
| py311-pygeoip-0.3.2_..> | 2025-12-21 09:38 | 40K | |
| py311-pygeometa-0.15..> | 2025-12-30 01:03 | 68K | |
| py311-pygeos-0.14.pkg | 2025-12-29 01:23 | 409K | |
| py311-pygit2-1.18.2.pkg | 2025-12-19 11:44 | 284K | |
| py311-pyglet-2.0.21.pkg | 2025-12-19 21:43 | 1.7M | |
| py311-pyglet1-1.5.31..> | 2025-12-18 23:19 | 1.7M | |
| py311-pyglm-2.8.0_1.pkg | 2025-12-19 11:09 | 1.1M | |
| py311-pygls-1.3.1.pkg | 2025-12-18 11:46 | 103K | |
| py311-pygltflib-1.16..> | 2025-12-20 04:00 | 51K | |
| py311-pygments-2.19...> | 2025-12-16 01:39 | 1.9M | |
| py311-pygmo2-2.19.7_..> | 2025-12-27 10:21 | 680K | |
| py311-pygobject-3.50..> | 2025-12-26 03:19 | 330K | |
| py311-pygost-5.13_1.pkg | 2025-12-20 00:39 | 199K | |
| py311-pygpx-0.2_2.pkg | 2025-12-24 04:50 | 6.5K | |
| py311-pygraph-0.3.0_..> | 2025-12-19 07:13 | 57K | |
| py311-pygraphviz-1.6..> | 2025-12-26 08:54 | 83K | |
| py311-pygsheets-2.0...> | 2025-12-29 00:15 | 200K | |
| py311-pygsl-2.3.3_1.pkg | 2025-12-28 01:26 | 730K | |
| py311-pygslodeiv2-0...> | 2025-12-27 17:08 | 145K | |
| py311-pygtail-0.6.1_..> | 2025-12-23 19:02 | 11K | |
| py311-pyhanko-0.32.0..> | 2025-12-27 10:28 | 838K | |
| py311-pyhanko-certva..> | 2025-12-26 22:58 | 208K | |
| py311-pyhanko-cli-0...> | 2025-12-30 03:47 | 74K | |
| py311-pyhashxx-0.1.3..> | 2025-12-23 05:26 | 14K | |
| py311-pyhcl-0.4.5_1.pkg | 2025-12-18 18:58 | 94K | |
| py311-pyhdfe-0.2.0_1..> | 2025-12-27 02:52 | 42K | |
| py311-pyhull-2015.2...> | 2025-12-27 20:17 | 188K | |
| py311-pyhumps-3.9.0.pkg | 2025-12-24 04:32 | 9.4K | |
| py311-pyicap-1.0.b1_..> | 2025-12-21 06:07 | 19K | |
| py311-pyicu-2.15.3.pkg | 2025-12-18 13:40 | 329K | |
| py311-pyina-0.3.1.pkg | 2025-12-30 16:29 | 68K | |
| py311-pyinfra-3.5.pkg | 2025-12-29 21:46 | 455K | |
| py311-pyinotify-0.9...> | 2025-12-18 23:26 | 53K | |
| py311-pyinsane2-2.0...> | 2025-12-27 16:16 | 60K | |
| py311-pyinstaller-6...> | 2025-12-23 14:41 | 4.2M | |
| py311-pyinstaller-ho..> | 2025-12-19 05:48 | 217K | |
| py311-pyintelowl-4.4..> | 2025-12-27 17:49 | 85K | |
| py311-pyisemail-2.0...> | 2025-12-26 22:52 | 36K | |
| py311-pyixapi-0.2.7.pkg | 2025-12-27 17:03 | 31K | |
| py311-pyjacklib-0.1...> | 2025-12-27 15:36 | 34K | |
| py311-pyjsparser-2.7..> | 2025-12-18 20:51 | 68K | |
| py311-pyjwt-2.10.1.pkg | 2025-12-26 09:52 | 51K | |
| py311-pyjwt1-1.7.1_1..> | 2025-12-21 05:25 | 36K | |
| py311-pykdtree-1.4.3..> | 2025-12-28 08:22 | 73K | |
| py311-pyked-0.4.1.16..> | 2025-12-29 09:46 | 123K | |
| py311-pykeepass-4.1...> | 2025-12-19 00:29 | 100K | |
| py311-pykeepass-cach..> | 2025-12-20 01:19 | 8.5K | |
| py311-pykep-2.6.2_7.pkg | 2025-12-29 19:18 | 7.5M | |
| py311-pykml-0.2.0_3.pkg | 2025-12-19 16:47 | 55K | |
| py311-pykwalify-1.8...> | 2025-12-30 07:11 | 57K | |
| py311-pyla-1.1.7.1_2..> | 2025-12-20 06:16 | 592K | |
| py311-pylama-7.7.1_1..> | 2025-12-20 23:35 | 59K | |
| py311-pylast-7.0.0.pkg | 2025-12-19 21:10 | 60K | |
| py311-pylatexenc-2.1..> | 2025-12-19 22:27 | 223K | |
| py311-pyleri-1.5.0.pkg | 2025-12-18 20:24 | 58K | |
| py311-pylev-1.4.0_1.pkg | 2025-12-19 08:32 | 8.5K | |
| py311-pylibacl-0.7.0..> | 2025-12-23 02:11 | 18K | |
| py311-pyliblo3-0.16...> | 2025-12-22 18:18 | 94K | |
| py311-pylibmc-1.6.3_..> | 2025-12-24 07:14 | 39K | |
| py311-pylibsrtp-0.12..> | 2025-12-19 03:02 | 17K | |
| py311-pylink-square-..> | 2025-12-26 15:28 | 138K | |
| py311-pylint-django-..> | 2025-12-19 20:48 | 55K | |
| py311-pylint-flask-0..> | 2025-12-22 08:58 | 12K | |
| py311-pylint-plugin-..> | 2025-12-19 00:48 | 14K | |
| py311-pylint-venv-3...> | 2025-12-21 06:58 | 7.7K | |
| py311-pyln-bolt7-1.0..> | 2025-12-22 17:55 | 19K | |
| py311-pyln-client-23..> | 2025-12-22 14:52 | 86K | |
| py311-pyln-proto-23...> | 2025-12-21 16:56 | 88K | |
| py311-pylons-sphinx-..> | 2025-12-18 11:18 | 133K | |
| py311-pylru-1.2.0_1.pkg | 2025-12-23 16:10 | 15K | |
| py311-pylru-cache-0...> | 2025-12-20 03:12 | 6.8K | |
| py311-pyls-spyder-0...> | 2025-12-29 00:17 | 9.6K | |
| py311-pylsqpack-0.3...> | 2025-12-18 02:47 | 82K | |
| py311-pyluach-2.2.0_..> | 2025-12-18 23:20 | 52K | |
| py311-pymacaroons-0...> | 2025-12-19 15:30 | 38K | |
| py311-pymad-0.11.3.pkg | 2025-12-18 13:43 | 8.1K | |
| py311-pymaging-20130..> | 2025-12-20 04:10 | 43K | |
| py311-pymaging-png-2..> | 2025-12-22 08:47 | 68K | |
| py311-pymailq-0.9.0_..> | 2025-12-21 12:36 | 54K | |
| py311-pymarc-5.2.3,1..> | 2025-12-20 11:04 | 305K | |
| py311-pymatgen-2025...> | 2025-12-27 00:34 | 4.8M | |
| py311-pymatgen-analy..> | 2025-12-27 17:08 | 68K | |
| py311-pymatreader-1...> | 2025-12-27 17:44 | 13K | |
| py311-pymaven-patch-..> | 2025-12-30 04:54 | 47K | |
| py311-pymbd-0.12.5_2..> | 2025-12-28 04:23 | 52K | |
| py311-pymc3-3.11.5_3..> | 2025-12-30 09:40 | 1.3M | |
| py311-pymdown-extens..> | 2025-12-26 23:04 | 481K | |
| py311-pymediainfo-6...> | 2025-12-19 15:53 | 16K | |
| py311-pymeeus-0.5.12..> | 2025-12-19 13:01 | 1.1M | |
| py311-pymemcache-4.0..> | 2025-12-20 00:02 | 125K | |
| py311-pymetar-1.4_1.pkg | 2025-12-23 00:05 | 32K | |
| py311-pymilter-1.0.6..> | 2025-12-19 09:51 | 111K | |
| py311-pyminizip-0.2...> | 2025-12-20 23:16 | 67K | |
| py311-pymisp-2.4.162..> | 2025-12-27 16:04 | 427K | |
| py311-pymodbus-3.5.2..> | 2025-12-20 00:31 | 323K | |
| py311-pymol-3.0.0_2.pkg | 2025-12-29 06:34 | 6.0M | |
| py311-pymongo-3.13.0..> | 2025-12-18 17:19 | 601K | |
| py311-pymsgbox-1.0.9..> | 2025-12-18 16:35 | 14K | |
| py311-pymssql-2.1.5_..> | 2025-12-23 06:50 | 172K | |
| py311-pymsteams-0.2...> | 2025-12-29 16:08 | 15K | |
| py311-pymtbl-0.6.0_3..> | 2025-12-24 03:24 | 54K | |
| py311-pymtl3-3.1.16_..> | 2025-12-28 16:25 | 930K | |
| py311-pymysql-1.1.1.pkg | 2025-12-19 04:58 | 95K | |
| py311-pynacl-1.5.0_2..> | 2025-12-18 04:33 | 107K | |
| py311-pynamecheap-0...> | 2025-12-30 08:30 | 13K | |
| py311-pynauty-2.8.6_..> | 2025-12-21 16:24 | 253K | |
| py311-pyneqsys-0.5.7..> | 2025-12-27 15:03 | 55K | |
| py311-pynest2d-5.3.0..> | 2025-12-27 09:43 | 174K | |
| py311-pynetbox-7.5.0..> | 2025-12-27 09:13 | 2.7M | |
| py311-pynitrokey-0.9..> | 2025-12-29 05:09 | 326K | |
| py311-pynleq2-0.0.2_..> | 2025-12-28 10:25 | 48K | |
| py311-pynmsg-0.5.1_4..> | 2025-12-23 13:22 | 88K | |
| py311-pynn-0.12.3_1.pkg | 2025-12-30 15:14 | 551K | |
| py311-pynndescent-0...> | 2025-12-27 12:33 | 125K | |
| py311-pynput-1.7.7_1..> | 2025-12-19 12:20 | 152K | |
| py311-pynrrd-1.1.3.pkg | 2025-12-30 18:29 | 37K | |
| py311-pynsq-0.9.1_1.pkg | 2025-12-21 03:28 | 59K | |
| py311-pynvim-0.6.0.pkg | 2025-12-21 02:59 | 88K | |
| py311-pynvml-12.0.0.pkg | 2025-12-18 17:14 | 62K | |
| py311-pynxos-0.0.5_2..> | 2025-12-27 21:24 | 22K | |
| py311-pynzb-0.1.0_5.pkg | 2025-12-19 05:53 | 11K | |
| py311-pyocclient-0.6..> | 2025-12-29 01:39 | 63K | |
| py311-pyocd-0.36.0.pkg | 2025-12-26 20:19 | 13M | |
| py311-pyocd-pemicro-..> | 2025-12-27 01:24 | 15K | |
| py311-pyocr-0.8.5_1.pkg | 2025-12-27 00:32 | 56K | |
| py311-pyodbc-5.3.0.pkg | 2025-12-21 09:34 | 64K | |
| py311-pyodeint-0.10...> | 2025-12-27 18:47 | 185K | |
| py311-pyodesys-0.14...> | 2025-12-27 16:48 | 249K | |
| py311-pyogrio-0.12.1..> | 2025-12-30 02:21 | 595K | |
| py311-pyopencl-2018...> | 2025-12-27 11:07 | 697K | |
| py311-pyopenssl-25.3..> | 2025-12-26 06:20 | 105K | |
| py311-pyosf-1.0.5_1.pkg | 2025-12-28 02:32 | 50K | |
| py311-pyotp-2.9.0_1.pkg | 2025-12-18 23:48 | 20K | |
| py311-pyotp2289-1.2...> | 2025-12-23 22:16 | 38K | |
| py311-pyowm-3.5.0.pkg | 2025-12-29 04:38 | 4.4M | |
| py311-pypa-docs-them..> | 2025-12-22 06:32 | 3.1K | |
| py311-pypacker-5.0_1..> | 2025-12-19 23:24 | 488K | |
| py311-pypandoc-1.14_..> | 2025-12-18 18:22 | 35K | |
| py311-pyparsing-3.2...> | 2025-12-18 01:44 | 227K | |
| py311-pyparsing2-2.4..> | 2025-12-22 14:28 | 146K | |
| py311-pypatent-1.2.0..> | 2025-12-29 03:51 | 14K | |
| py311-pypcap-1.3.0_1..> | 2025-12-20 02:24 | 69K | |
| py311-pypdf-6.0.0.pkg | 2025-12-18 18:36 | 696K | |
| py311-pypemicro-0.1...> | 2025-12-18 18:30 | 33K | |
| py311-pyperclip-1.7...> | 2025-12-18 09:03 | 17K | |
| py311-pyperf-2.9.0.pkg | 2025-12-22 02:05 | 262K | |
| py311-pyperscan-0.3...> | 2025-12-28 23:53 | 226K | |
| py311-pyphen-0.17.0.pkg | 2025-12-19 07:39 | 1.1M | |
| py311-pyphot-1.6.0.pkg | 2025-12-30 18:04 | 6.4M | |
| py311-pypillowfight-..> | 2025-12-28 17:50 | 33K | |
| py311-pyplusplus-1.8..> | 2025-12-21 10:47 | 405K | |
| py311-pypowerwall-0...> | 2025-12-28 22:32 | 1.3M | |
| py311-pyppmd-1.3.1.pkg | 2025-12-19 22:29 | 2.7M | |
| py311-pyprind-2.11.3..> | 2025-12-20 00:30 | 14K | |
| py311-pyprobables-0...> | 2025-12-20 10:45 | 85K | |
| py311-pyproj-3.7.2_1..> | 2025-12-26 11:13 | 477K | |
| py311-pyproject-api-..> | 2025-12-18 14:23 | 27K | |
| py311-pyproject-flak..> | 2025-12-21 13:37 | 9.5K | |
| py311-pyproject-fmt-..> | 2025-12-30 07:21 | 1.0M | |
| py311-pyproject-fmt-..> | 2025-12-29 01:22 | 1.1M | |
| py311-pyproject-hook..> | 2025-12-16 01:35 | 21K | |
| py311-pyproject-meta..> | 2025-12-17 22:58 | 41K | |
| py311-pyprowl-3.0.1_..> | 2025-12-22 04:30 | 5.6K | |
| py311-pypugjs-5.9.12..> | 2025-12-23 13:24 | 84K | |
| py311-pypuppetdb-3.2..> | 2025-12-19 11:08 | 54K | |
| py311-pyqir-0.10.7_7..> | 2025-12-27 17:36 | 1.3M | |
| py311-pyqrcode-1.2.1..> | 2025-12-19 01:37 | 64K | |
| py311-pyqtgraph-0.13..> | 2025-12-26 18:35 | 2.2M | |
| py311-pyqtree-0.24_1..> | 2025-12-22 10:32 | 8.2K | |
| py311-pyqubo-1.4.0_3..> | 2025-12-29 09:04 | 223K | |
| py311-pyquery-2.0.1_..> | 2025-12-19 02:36 | 52K | |
| py311-pyquil-4.6.1_5..> | 2025-12-29 17:02 | 380K | |
| py311-pyrad-2.4_1.pkg | 2025-12-20 01:03 | 75K | |
| py311-pyradio-0.9.3...> | 2025-12-30 11:16 | 1.6M | |
| py311-pyral-1.7.0.pkg | 2025-12-29 16:32 | 149K | |
| py311-pyramid-1.7.3_..> | 2025-12-19 07:35 | 1.0M | |
| py311-pyramid-mako-1..> | 2025-12-21 16:37 | 28K | |
| py311-pyramid_rpc-0...> | 2025-12-22 16:40 | 54K | |
| py311-pyreadr-0.5.4.pkg | 2025-12-29 13:28 | 156K | |
| py311-pyreadstat-1.3..> | 2025-12-30 04:16 | 303K | |
| py311-pyrepl-0.9.0_1..> | 2025-12-22 02:23 | 112K | |
| py311-pyrfc3339-1.1_..> | 2025-12-18 16:32 | 9.5K | |
| py311-pyrfr-0.9.0.pkg | 2025-12-20 06:07 | 399K | |
| py311-pyright-1.1.40..> | 2025-12-19 04:48 | 3.4M | |
| py311-pyrodigal-3.6...> | 2025-12-23 04:41 | 2.6M | |
| py311-pyroma-4.3.3.pkg | 2025-12-27 18:42 | 44K | |
| py311-pyroute2-0.7.1..> | 2025-12-20 03:16 | 880K | |
| py311-pyroute2.minim..> | 2025-12-20 15:34 | 528K | |
| py311-pyroute2.proto..> | 2025-12-23 13:20 | 32K | |
| py311-pyrr-0.10.3_2.pkg | 2025-12-27 14:42 | 72K | |
| py311-pyrsgis-0.4.1_..> | 2025-12-27 06:13 | 42K | |
| py311-pyrsistent-0.1..> | 2025-12-19 02:57 | 110K | |
| py311-pyrss2gen-1.1.pkg | 2025-12-19 21:01 | 11K | |
| py311-pysal-25.7.pkg | 2025-12-29 16:09 | 23K | |
| py311-pysam-0.23.0_1..> | 2025-12-18 20:36 | 3.1M | |
| py311-pysaml2-7.5.4_..> | 2025-12-26 22:49 | 721K | |
| py311-pysasl-0.10.0_..> | 2025-12-18 21:27 | 31K | |
| py311-pyscaffold-4.6..> | 2025-12-23 01:42 | 183K | |
| py311-pyscard-2.3.1.pkg | 2025-12-19 02:01 | 144K | |
| py311-pysces-1.2.2_1..> | 2025-12-29 19:21 | 1.3M | |
| py311-pyscf-2.8.0_2.pkg | 2025-12-27 15:07 | 11M | |
| py311-pyscreenshot-0..> | 2025-12-27 02:46 | 32K | |
| py311-pyscreeze-1.0...> | 2025-12-26 19:06 | 24K | |
| py311-pyscss-1.4.0_1..> | 2025-12-19 11:55 | 291K | |
| py311-pysdl2-0.9.16_..> | 2025-12-27 07:03 | 786K | |
| py311-pysendfile-2.0..> | 2025-12-19 07:02 | 7.2K | |
| py311-pyserial-3.5_4..> | 2025-12-18 01:09 | 186K | |
| py311-pyserial-async..> | 2025-12-20 11:10 | 13K | |
| py311-pysftp-0.2.9_2..> | 2025-12-30 08:17 | 25K | |
| py311-pyshark-0.6_3.pkg | 2025-12-20 14:44 | 77K | |
| py311-pyshp-2.3.1_1.pkg | 2025-12-19 09:59 | 80K | |
| py311-pyside6-6.10.1..> | 2025-12-27 00:09 | 11M | |
| py311-pyside6-tools-..> | 2025-12-27 18:20 | 3.0M | |
| py311-pysimdjson-6.0..> | 2025-12-22 13:25 | 159K | |
| py311-pysimplesoap-1..> | 2025-12-23 14:21 | 107K | |
| py311-pysmartdl-1.3...> | 2025-12-20 18:23 | 37K | |
| py311-pysmb-1.1.27_1..> | 2025-12-23 20:50 | 327K | |
| py311-pysmi-1.6.2.pkg | 2025-12-26 22:23 | 148K | |
| py311-pysmt-0.9.6_1.pkg | 2025-12-18 19:57 | 615K | |
| py311-pysndfile-1.4...> | 2025-12-29 03:49 | 92K | |
| py311-pysnmp-4.4.9_3..> | 2025-12-27 04:51 | 599K | |
| py311-pysnmp-mibs-0...> | 2025-12-30 00:40 | 3.7M | |
| py311-pysocks-1.7.1_..> | 2025-12-16 01:39 | 32K | |
| py311-pysodium-0.7.1..> | 2025-12-24 07:30 | 34K | |
| py311-pysofa-0.1.1_4..> | 2025-12-30 04:01 | 40K | |
| py311-pysol-cards-0...> | 2025-12-18 13:36 | 26K | |
| py311-pysolar-0.13.pkg | 2025-12-30 17:37 | 60K | |
| py311-pyspacewar-1.2..> | 2025-12-29 16:20 | 846K | |
| py311-pysparklines-1..> | 2025-12-21 11:31 | 8.8K | |
| py311-pyspf-2.0.14_3..> | 2025-12-26 20:47 | 52K | |
| py311-pyspnego-0.12...> | 2025-12-26 19:12 | 255K | |
| py311-pysrp-1.0.22_1..> | 2025-12-23 16:01 | 39K | |
| py311-pysrt-1.1.2_1.pkg | 2025-12-23 12:09 | 30K | |
| py311-pystache-0.6.0..> | 2025-12-18 23:10 | 126K | |
| py311-pystash-0.0.14..> | 2025-12-29 18:16 | 18K | |
| py311-pystemmer-2.0...> | 2025-12-16 01:42 | 91K | |
| py311-pystorm-3.1.4_..> | 2025-12-19 03:19 | 36K | |
| py311-pystun-0.1.0_2..> | 2025-12-22 16:13 | 11K | |
| py311-pystun3-2.0.0.pkg | 2025-12-30 01:41 | 13K | |
| py311-pysubs2-1.7.2.pkg | 2025-12-19 13:04 | 72K | |
| py311-pysym-0.2.3_4.pkg | 2025-12-30 10:28 | 42K | |
| py311-pytanque-1.1.0..> | 2025-12-19 20:59 | 186K | |
| py311-pyte-0.8.2_1.pkg | 2025-12-19 05:28 | 55K | |
| py311-pytensor-2.26...> | 2025-12-27 22:36 | 2.3M | |
| py311-pyteomics-4.7...> | 2025-12-30 06:30 | 452K | |
| py311-pytesseract-0...> | 2025-12-27 23:46 | 22K | |
| py311-pytest-8.4.2,1..> | 2025-12-16 01:47 | 741K | |
| py311-pytest-aiohttp..> | 2025-12-20 10:29 | 11K | |
| py311-pytest-alembic..> | 2025-12-28 12:32 | 56K | |
| py311-pytest-arraydi..> | 2025-12-27 17:00 | 16K | |
| py311-pytest-astropy..> | 2025-12-28 01:42 | 5.4K | |
| py311-pytest-astropy..> | 2025-12-19 03:04 | 10K | |
| py311-pytest-asyncio..> | 2025-12-20 02:03 | 29K | |
| py311-pytest-azurepi..> | 2025-12-24 02:17 | 11K | |
| py311-pytest-benchma..> | 2025-12-20 01:24 | 96K | |
| py311-pytest-black-0..> | 2025-12-27 07:27 | 7.9K | |
| py311-pytest-black-m..> | 2025-12-28 15:26 | 3.6K | |
| py311-pytest-cache-1..> | 2025-12-20 15:30 | 12K | |
| py311-pytest-canonic..> | 2025-12-20 07:34 | 8.7K | |
| py311-pytest-capture..> | 2025-12-23 04:10 | 7.4K | |
| py311-pytest-cases-3..> | 2025-12-28 08:38 | 184K | |
| py311-pytest-checkdo..> | 2025-12-30 01:50 | 5.8K | |
| py311-pytest-codspee..> | 2025-12-19 05:05 | 105K | |
| py311-pytest-console..> | 2025-12-21 05:55 | 18K | |
| py311-pytest-cov-5.0..> | 2025-12-19 11:35 | 35K | |
| py311-pytest-cpp-2.5..> | 2025-12-21 16:29 | 28K | |
| py311-pytest-datadir..> | 2025-12-19 07:24 | 7.8K | |
| py311-pytest-depende..> | 2025-12-22 22:17 | 8.5K | |
| py311-pytest-django-..> | 2025-12-22 01:24 | 49K | |
| py311-pytest-doctest..> | 2025-12-19 03:25 | 45K | |
| py311-pytest-drop-du..> | 2025-12-21 19:46 | 4.9K | |
| py311-pytest-enabler..> | 2025-12-21 02:50 | 6.8K | |
| py311-pytest-env-0.6..> | 2025-12-22 10:55 | 3.2K | |
| py311-pytest-example..> | 2025-12-28 06:32 | 39K | |
| py311-pytest-factory..> | 2025-12-21 01:02 | 27K | |
| py311-pytest-filter-..> | 2025-12-19 03:27 | 7.1K | |
| py311-pytest-fixture..> | 2025-12-19 22:36 | 7.6K | |
| py311-pytest-flake8-..> | 2025-12-22 10:27 | 12K | |
| py311-pytest-flakes-..> | 2025-12-21 07:53 | 11K | |
| py311-pytest-flask-1..> | 2025-12-22 13:32 | 19K | |
| py311-pytest-forked-..> | 2025-12-23 10:58 | 7.0K | |
| py311-pytest-freezer..> | 2025-12-22 04:20 | 4.3K | |
| py311-pytest-helpers..> | 2025-12-22 09:15 | 13K | |
| py311-pytest-html-4...> | 2025-12-23 05:13 | 37K | |
| py311-pytest-httpbin..> | 2025-12-29 09:20 | 14K | |
| py311-pytest-httpser..> | 2025-12-20 22:14 | 38K | |
| py311-pytest-httpx-0..> | 2025-12-21 10:49 | 23K | |
| py311-pytest-instafa..> | 2025-12-22 15:38 | 6.1K | |
| py311-pytest-isort-4..> | 2025-12-23 13:35 | 11K | |
| py311-pytest-jupyter..> | 2025-12-29 05:42 | 29K | |
| py311-pytest-lazy-fi..> | 2025-12-23 00:04 | 9.4K | |
| py311-pytest-lazy-fi..> | 2025-12-23 12:59 | 16K | |
| py311-pytest-localse..> | 2025-12-23 01:46 | 26K | |
| py311-pytest-markdow..> | 2025-12-20 10:32 | 6.7K | |
| py311-pytest-metadat..> | 2025-12-19 14:07 | 14K | |
| py311-pytest-mock-3...> | 2025-12-19 15:16 | 18K | |
| py311-pytest-mpl-0.1..> | 2025-12-29 09:46 | 43K | |
| py311-pytest-mutagen..> | 2025-12-21 13:19 | 34K | |
| py311-pytest-mypy-0...> | 2025-12-28 22:46 | 14K | |
| py311-pytest-mypy-pl..> | 2025-12-28 11:01 | 41K | |
| py311-pytest-mypy-te..> | 2025-12-28 13:13 | 31K | |
| py311-pytest-nunit-1..> | 2025-12-20 02:19 | 32K | |
| py311-pytest-order-1..> | 2025-12-23 04:15 | 32K | |
| py311-pytest-paralle..> | 2025-12-19 05:09 | 13K | |
| py311-pytest-plus-0...> | 2025-12-20 13:06 | 8.9K | |
| py311-pytest-pretty-..> | 2025-12-20 10:35 | 10K | |
| py311-pytest-profili..> | 2025-12-21 03:46 | 14K | |
| py311-pytest-pycodes..> | 2025-12-20 17:02 | 7.4K | |
| py311-pytest-qt-4.4...> | 2025-12-20 15:41 | 72K | |
| py311-pytest-random-..> | 2025-12-21 18:35 | 18K | |
| py311-pytest-randoml..> | 2025-12-23 17:26 | 13K | |
| py311-pytest-recorde..> | 2025-12-21 12:09 | 18K | |
| py311-pytest-recordi..> | 2025-12-19 13:14 | 24K | |
| py311-pytest-regress..> | 2025-12-21 11:59 | 38K | |
| py311-pytest-regtest..> | 2025-12-22 03:13 | 40K | |
| py311-pytest-relaxed..> | 2025-12-21 11:32 | 22K | |
| py311-pytest-remoted..> | 2025-12-19 10:46 | 13K | |
| py311-pytest-repeat-..> | 2025-12-22 07:28 | 5.7K | |
| py311-pytest-rerunfa..> | 2025-12-22 09:15 | 23K | |
| py311-pytest-ruff-0...> | 2025-12-29 07:39 | 9.0K | |
| py311-pytest-run-par..> | 2025-12-22 07:37 | 35K | |
| py311-pytest-service..> | 2025-12-24 03:37 | 32K | |
| py311-pytest-shutil-..> | 2025-12-19 15:09 | 28K | |
| py311-pytest-socket-..> | 2025-12-19 15:04 | 12K | |
| py311-pytest-subproc..> | 2025-12-22 04:48 | 36K | |
| py311-pytest-subtest..> | 2025-12-20 18:57 | 15K | |
| py311-pytest-sugar-1..> | 2025-12-23 09:51 | 26K | |
| py311-pytest-timeout..> | 2025-12-23 13:37 | 21K | |
| py311-pytest-tornado..> | 2025-12-21 20:46 | 10K | |
| py311-pytest-tornasy..> | 2025-12-21 07:14 | 8.4K | |
| py311-pytest-transla..> | 2025-12-22 07:37 | 13K | |
| py311-pytest-trio-0...> | 2025-12-23 11:01 | 34K | |
| py311-pytest-twisted..> | 2025-12-20 04:49 | 19K | |
| py311-pytest-verbose..> | 2025-12-24 05:15 | 7.6K | |
| py311-pytest-virtual..> | 2025-12-28 09:43 | 15K | |
| py311-pytest-watcher..> | 2025-12-20 11:11 | 10K | |
| py311-pytest-xdist-3..> | 2025-12-19 23:17 | 87K | |
| py311-pytest-xproces..> | 2025-12-21 05:10 | 18K | |
| py311-pythclient-0.1..> | 2025-12-24 03:20 | 83K | |
| py311-python-applica..> | 2025-12-20 02:44 | 93K | |
| py311-python-arango-..> | 2025-12-27 22:41 | 171K | |
| py311-python-augeas-..> | 2025-12-20 03:34 | 15K | |
| py311-python-axolotl..> | 2025-12-28 06:58 | 120K | |
| py311-python-axolotl..> | 2025-12-19 15:46 | 65K | |
| py311-python-barbica..> | 2025-12-26 23:28 | 153K | |
| py311-python-barcode..> | 2025-12-28 06:17 | 215K | |
| py311-python-bareos-..> | 2025-12-21 17:17 | 51K | |
| py311-python-bidi-0...> | 2025-12-27 06:23 | 214K | |
| py311-python-binance..> | 2025-12-30 11:19 | 135K | |
| py311-python-binary-..> | 2025-12-20 18:00 | 34K | |
| py311-python-bitcoin..> | 2025-12-19 16:45 | 216K | |
| py311-python-bitcoin..> | 2025-12-23 05:57 | 8.8K | |
| py311-python-bugzill..> | 2025-12-27 08:02 | 117K | |
| py311-python-cas-1.6..> | 2025-12-27 10:12 | 14K | |
| py311-python-cinderc..> | 2025-12-27 13:22 | 433K | |
| py311-python-coinmar..> | 2025-12-27 22:30 | 14K | |
| py311-python-consul-..> | 2025-12-28 16:24 | 44K | |
| py311-python-crc-7.1..> | 2025-12-23 19:49 | 18K | |
| py311-python-crontab..> | 2025-12-19 05:45 | 48K | |
| py311-python-dateuti..> | 2025-12-18 00:46 | 306K | |
| py311-python-dbusmoc..> | 2025-12-28 10:25 | 121K | |
| py311-python-decoupl..> | 2025-12-22 07:56 | 15K | |
| py311-python-designa..> | 2025-12-30 15:54 | 127K | |
| py311-python-digital..> | 2025-12-27 04:18 | 60K | |
| py311-python-distuti..> | 2025-12-18 16:14 | 45K | |
| py311-python-djvulib..> | 2025-12-29 01:15 | 227K | |
| py311-python-docs-th..> | 2025-12-20 00:00 | 8.4K | |
| py311-python-docx-1...> | 2025-12-18 18:21 | 348K | |
| py311-python-dotenv-..> | 2025-12-18 10:30 | 39K | |
| py311-python-dtrace-..> | 2025-12-23 00:44 | 60K | |
| py311-python-easycon..> | 2025-12-20 03:10 | 7.7K | |
| py311-python-editor-..> | 2025-12-20 21:21 | 9.9K | |
| py311-python-enginei..> | 2025-12-26 19:51 | 102K | |
| py311-python-fcl-0.0..> | 2025-12-27 00:59 | 83K | |
| py311-python-frontma..> | 2025-12-21 21:13 | 15K | |
| py311-python-gdsii-0..> | 2025-12-23 18:49 | 32K | |
| py311-python-geohash..> | 2025-12-24 07:28 | 28K | |
| py311-python-gettext..> | 2025-12-19 14:40 | 16K | |
| py311-python-gflags-..> | 2025-12-21 05:18 | 87K | |
| py311-python-gist-0...> | 2025-12-30 12:42 | 29K | |
| py311-python-gitlab-..> | 2025-12-27 03:05 | 240K | |
| py311-python-glancec..> | 2025-12-27 10:13 | 366K | |
| py311-python-gnupg-0..> | 2025-12-18 19:14 | 47K | |
| py311-python-gvm-26...> | 2025-12-18 19:31 | 602K | |
| py311-python-heatcli..> | 2025-12-30 01:41 | 386K | |
| py311-python-ipware-..> | 2025-12-19 20:57 | 15K | |
| py311-python-iso639-..> | 2025-12-21 05:04 | 137K | |
| py311-python-jenkins..> | 2025-12-27 15:10 | 49K | |
| py311-python-jose-3...> | 2025-12-29 16:11 | 66K | |
| py311-python-json-lo..> | 2025-12-18 01:35 | 24K | |
| py311-python-jsonrpc..> | 2025-12-22 01:51 | 17K | |
| py311-python-keyston..> | 2025-12-26 23:33 | 557K | |
| py311-python-ldap-3...> | 2025-12-18 16:38 | 197K | |
| py311-python-lhafile..> | 2025-12-19 13:02 | 19K | |
| py311-python-libsbml..> | 2025-12-19 14:36 | 5.5M | |
| py311-python-louvain..> | 2025-12-28 20:36 | 16K | |
| py311-python-lsp-bla..> | 2025-12-29 16:41 | 10K | |
| py311-python-lsp-jso..> | 2025-12-19 01:23 | 19K | |
| py311-python-lsp-ser..> | 2025-12-27 16:02 | 148K | |
| py311-python-ly-0.9...> | 2025-12-19 15:03 | 422K | |
| py311-python-lzo-1.1..> | 2025-12-21 17:21 | 8.3K | |
| py311-python-magic-0..> | 2025-12-18 14:21 | 23K | |
| py311-python-markdow..> | 2025-12-18 19:54 | 8.8K | |
| py311-python-memcach..> | 2025-12-19 22:34 | 33K | |
| py311-python-mimepar..> | 2025-12-18 18:53 | 9.1K | |
| py311-python-mpd2-3...> | 2025-12-20 00:16 | 87K | |
| py311-python-mpv-1.0..> | 2025-12-30 04:07 | 78K | |
| py311-python-multipa..> | 2025-12-18 10:21 | 46K | |
| py311-python-neutron..> | 2025-12-27 03:59 | 438K | |
| py311-python-nexus-2..> | 2025-12-23 12:23 | 77K | |
| py311-python-nmap-0...> | 2025-12-19 10:35 | 38K | |
| py311-python-nomad-2..> | 2025-12-30 06:05 | 47K | |
| py311-python-novacli..> | 2025-12-27 12:31 | 571K | |
| py311-python-nss-1.0..> | 2025-12-19 02:01 | 201K | |
| py311-python-obelisk..> | 2025-12-29 06:55 | 83K | |
| py311-python-openid-..> | 2025-12-21 18:33 | 222K | |
| py311-python-opensta..> | 2025-12-28 18:18 | 1.5M | |
| py311-python-pam-1.8..> | 2025-12-19 02:27 | 8.2K | |
| py311-python-picard-..> | 2025-12-29 21:29 | 25K | |
| py311-python-pkcs11-..> | 2025-12-29 23:42 | 269K | |
| py311-python-poppler..> | 2025-12-30 11:19 | 110K | |
| py311-python-pptx-1...> | 2025-12-29 06:14 | 658K | |
| py311-python-ptrace-..> | 2025-12-22 20:12 | 169K | |
| py311-python-pygtrie..> | 2025-12-23 09:09 | 37K | |
| py311-python-rapidjs..> | 2025-12-19 02:59 | 172K | |
| py311-python-registr..> | 2025-12-22 14:36 | 156K | |
| py311-python-rpm-pac..> | 2025-12-22 13:04 | 9.1K | |
| py311-python-semanti..> | 2025-12-29 23:57 | 220K | |
| py311-python-slimta-..> | 2025-12-27 13:41 | 184K | |
| py311-python-slugify..> | 2025-12-18 12:10 | 14K | |
| py311-python-snappy-..> | 2025-12-20 02:49 | 29K | |
| py311-python-socketi..> | 2025-12-27 02:02 | 113K | |
| py311-python-socks-2..> | 2025-12-18 01:30 | 73K | |
| py311-python-sql-1.4..> | 2025-12-21 05:29 | 96K | |
| py311-python-statsd-..> | 2025-12-21 03:18 | 18K | |
| py311-python-subunit..> | 2025-12-19 10:32 | 186K | |
| py311-python-swiftcl..> | 2025-12-27 06:48 | 178K | |
| py311-python-telegra..> | 2025-12-27 18:46 | 707K | |
| py311-python-tools-3..> | 2025-12-21 22:54 | 11K | |
| py311-python-twitter..> | 2025-12-29 05:16 | 106K | |
| py311-python-ulid-3...> | 2025-12-18 18:44 | 22K | |
| py311-python-ulid2-2..> | 2025-12-19 01:49 | 20K | |
| py311-python-utils-3..> | 2025-12-18 19:14 | 47K | |
| py311-python-velbust..> | 2025-12-23 04:59 | 39K | |
| py311-python-xapp-3...> | 2025-12-26 21:19 | 15K | |
| py311-python-xcaplib..> | 2025-12-30 06:47 | 47K | |
| py311-python-xlib-0...> | 2025-12-18 11:49 | 281K | |
| py311-python-xmp-too..> | 2025-12-20 07:54 | 44K | |
| py311-python3-openid..> | 2025-12-18 18:55 | 230K | |
| py311-python3-saml-1..> | 2025-12-18 16:34 | 139K | |
| py311-pythonbrew-1.3..> | 2025-12-20 15:14 | 84K | |
| py311-pythondialog-3..> | 2025-12-20 05:25 | 87K | |
| py311-pythonfinder-3..> | 2025-12-20 10:59 | 53K | |
| py311-pythontidy-1.2..> | 2025-12-24 04:39 | 24K | |
| py311-pythran-0.18.1..> | 2025-12-26 06:39 | 2.0M | |
| py311-pytidylib-0.3...> | 2025-12-24 04:21 | 13K | |
| py311-pytils-0.3_1.pkg | 2025-12-18 19:10 | 77K | |
| py311-pytimeparse-1...> | 2025-12-18 12:48 | 15K | |
| py311-pytkdocs-0.16...> | 2025-12-19 23:28 | 83K | |
| py311-pytokens-0.3.0..> | 2025-12-18 09:52 | 29K | |
| py311-pytomlpp-1.0.1..> | 2025-12-19 14:48 | 157K | |
| py311-pytoolconfig-1..> | 2025-12-26 18:29 | 30K | |
| py311-pytools-2022.1..> | 2025-12-18 23:34 | 156K | |
| py311-pytorch-2.8.0_..> | 2025-12-26 10:48 | 55M | |
| py311-pytorch-lightn..> | 2025-12-28 21:35 | 1.1M | |
| py311-pytradfri-13.0..> | 2025-12-22 20:33 | 76K | |
| py311-pytrends-4.9.2..> | 2025-12-30 02:44 | 27K | |
| py311-pytrie-0.4.0_1..> | 2025-12-18 18:56 | 11K | |
| py311-pytsk-20231007..> | 2025-12-18 23:33 | 363K | |
| py311-pyttsx3-2.98_1..> | 2025-12-21 09:28 | 62K | |
| py311-pytube-15.0.0_..> | 2025-12-19 05:59 | 112K | |
| py311-pytvmaze-2.0.8..> | 2025-12-28 13:56 | 30K | |
| py311-pytweening-1.0..> | 2025-12-18 16:59 | 10K | |
| py311-pytz-2025.2_1,..> | 2025-12-18 01:50 | 172K | |
| py311-pytz-deprecati..> | 2025-12-18 14:13 | 21K | |
| py311-pytzdata-2020...> | 2025-12-21 09:52 | 165K | |
| py311-pyu2f-0.1.5_1.pkg | 2025-12-21 05:57 | 61K | |
| py311-pyuca-1.2_1.pkg | 2025-12-23 18:20 | 596K | |
| py311-pyudev-0.24.1_..> | 2025-12-16 01:45 | 68K | |
| py311-pyunpack-0.3_1..> | 2025-12-27 09:43 | 6.5K | |
| py311-pyupgrade-3.21..> | 2025-12-21 19:40 | 117K | |
| py311-pyusb-1.3.1.pkg | 2025-12-18 10:20 | 104K | |
| py311-pyutil-3.3.6.pkg | 2025-12-20 00:39 | 219K | |
| py311-pyvcd-0.4.1.pkg | 2025-12-20 01:53 | 52K | |
| py311-pyvex-9.0.5405..> | 2025-12-18 21:36 | 1.5M | |
| py311-pyvips-3.1.1.pkg | 2025-12-30 06:01 | 116K | |
| py311-pyvirtualdispl..> | 2025-12-30 04:41 | 21K | |
| py311-pyvisa-1.14.1.pkg | 2025-12-19 22:35 | 349K | |
| py311-pyvisa-py-0.7...> | 2025-12-20 08:37 | 153K | |
| py311-pyvista-0.34.2..> | 2025-12-27 20:50 | 1.6M | |
| py311-pyviz-comms-3...> | 2025-12-20 17:32 | 49K | |
| py311-pyvo-1.7.pkg | 2025-12-27 15:22 | 1.2M | |
| py311-pywal-3.3.0_3.pkg | 2025-12-27 18:39 | 75K | |
| py311-pywapi-0.3.8_1..> | 2025-12-21 09:31 | 24K | |
| py311-pywatchman-202..> | 2025-12-20 14:46 | 70K | |
| py311-pywavelets-1.8..> | 2025-12-28 06:28 | 3.5M | |
| py311-pywdns-0.10.2_..> | 2025-12-22 12:32 | 57K | |
| py311-pyweblib-1.3.1..> | 2025-12-24 00:40 | 54K | |
| py311-pywebview-gtk-..> | 2025-12-30 06:30 | 491K | |
| py311-pywgsim-0.5.2_..> | 2025-12-20 18:52 | 69K | |
| py311-pywikibot-9.6...> | 2025-12-29 19:32 | 1.2M | |
| py311-pywinrm-0.5.0.pkg | 2025-12-27 17:03 | 85K | |
| py311-pywry-0.6.2_20..> | 2025-12-30 03:04 | 642K | |
| py311-pyx-0.16_1.pkg | 2025-12-21 03:40 | 727K | |
| py311-pyx12-2.3.3_1.pkg | 2025-12-20 15:43 | 328K | |
| py311-pyxb-x-1.2.6.2..> | 2025-12-23 05:31 | 615K | |
| py311-pyxlsb2-0.0.9_..> | 2025-12-19 13:01 | 90K | |
| py311-pyyaml-6.0.3.pkg | 2025-12-16 01:42 | 185K | |
| py311-pyyaml-ft-8.0...> | 2025-12-21 13:13 | 184K | |
| py311-pyyaml-include..> | 2025-12-19 22:41 | 34K | |
| py311-pyyaml_env_tag..> | 2025-12-18 09:17 | 6.0K | |
| py311-pyzabbix-1.3.1..> | 2025-12-28 06:22 | 12K | |
| py311-pyzbar-0.1.9_1..> | 2025-12-27 17:12 | 32K | |
| py311-pyzipper-0.3.5..> | 2025-12-21 18:26 | 69K | |
| py311-pyzmail-1.0.3_..> | 2025-12-21 13:19 | 52K | |
| py311-pyzmq-27.1.0.pkg | 2025-12-18 00:51 | 323K | |
| py311-pyznap-1.6.0_1..> | 2025-12-22 09:23 | 53K | |
| py311-pyzor-1.0.0_3.pkg | 2025-12-21 00:07 | 72K | |
| py311-pyzstd-0.19.1.pkg | 2025-12-27 10:46 | 51K | |
| py311-q-2.7_1.pkg | 2025-12-24 01:28 | 16K | |
| py311-qasync-0.28.0.pkg | 2025-12-21 10:48 | 37K | |
| py311-qcelemental-0...> | 2025-12-26 18:57 | 635K | |
| py311-qcengine-0.30...> | 2025-12-26 21:32 | 618K | |
| py311-qcs-api-client..> | 2025-12-28 14:39 | 138K | |
| py311-qcs-sdk-python..> | 2025-12-27 18:03 | 4.2M | |
| py311-qdldl-0.1.7.po..> | 2025-12-26 23:12 | 93K | |
| py311-qdrant-client-..> | 2025-12-27 12:32 | 640K | |
| py311-qh3-1.0.9_12.pkg | 2025-12-30 15:14 | 1.5M | |
| py311-qiskit-2.2.1_2..> | 2025-12-29 06:55 | 6.5M | |
| py311-qmk-1.1.8.pkg | 2025-12-29 04:08 | 30K | |
| py311-qpageview-1.0...> | 2025-12-27 12:39 | 214K | |
| py311-qrcode-8.2_1.pkg | 2025-12-26 18:40 | 99K | |
| py311-qrencode-1.2_1..> | 2025-12-29 18:57 | 7.1K | |
| py311-qspin-2.3.3_1.pkg | 2025-12-30 14:51 | 42K | |
| py311-qstylizer-0.2...> | 2025-12-30 07:56 | 48K | |
| py311-qt5-3d-5.15.7_..> | 2025-12-27 15:56 | 488K | |
| py311-qt5-5.15.11_1.pkg | 2025-12-29 06:16 | 693 | |
| py311-qt5-charts-5.1..> | 2025-12-27 17:49 | 164K | |
| py311-qt5-datavis3d-..> | 2025-12-27 02:34 | 146K | |
| py311-qt5-networkaut..> | 2025-12-27 19:19 | 45K | |
| py311-qt5-pyqt-5.15...> | 2025-12-26 09:51 | 4.2M | |
| py311-qt5-qscintilla..> | 2025-12-27 15:49 | 290K | |
| py311-qt6-3d-6.10.0.pkg | 2025-12-26 23:16 | 510K | |
| py311-qt6-6.10.1.pkg | 2025-12-27 10:46 | 690 | |
| py311-qt6-charts-6.1..> | 2025-12-27 01:18 | 189K | |
| py311-qt6-datavis3d-..> | 2025-12-26 22:12 | 163K | |
| py311-qt6-graphs-6.1..> | 2025-12-26 22:32 | 228K | |
| py311-qt6-networkaut..> | 2025-12-26 22:21 | 76K | |
| py311-qt6-pyqt-6.10...> | 2025-12-26 20:19 | 4.4M | |
| py311-qt6-qscintilla..> | 2025-12-27 04:13 | 300K | |
| py311-qt6-webengine-..> | 2025-12-27 10:24 | 172K | |
| py311-qtconsole-5.6...> | 2025-12-26 19:06 | 241K | |
| py311-qtile-0.33.0.pkg | 2025-12-29 13:48 | 1.0M | |
| py311-qtqr-2.1_1.pkg | 2025-12-30 15:13 | 49K | |
| py311-quadprog-0.1.1..> | 2025-12-30 08:27 | 73K | |
| py311-quantecon-0.10..> | 2025-12-26 17:58 | 483K | |
| py311-quantities-0.1..> | 2025-12-27 19:30 | 188K | |
| py311-quart-0.20.0.pkg | 2025-12-19 05:48 | 161K | |
| py311-quart-trio-0.1..> | 2025-12-20 23:10 | 36K | |
| py311-qudida-0.0.4_2..> | 2025-12-30 14:48 | 4.8K | |
| py311-queries-2.1.1_..> | 2025-12-21 18:34 | 42K | |
| py311-querystring-pa..> | 2025-12-20 05:24 | 15K | |
| py311-questionary-2...> | 2025-12-18 16:35 | 59K | |
| py311-queuelib-1.8.0..> | 2025-12-20 04:01 | 33K | |
| py311-quilt3-7.0.0.pkg | 2025-12-27 09:34 | 217K | |
| py311-quodlibet-4.6...> | 2025-12-30 01:02 | 2.6M | |
| py311-qutip-5.0.4_1.pkg | 2025-12-27 02:16 | 3.7M | |
| py311-qutip-qip-0.3...> | 2025-12-29 15:24 | 234K | |
| py311-rabbitpy-1.0.0..> | 2025-12-20 06:28 | 92K | |
| py311-radicale-3.5.9..> | 2025-12-29 21:56 | 323K | |
| py311-radix-0.10.0_1..> | 2025-12-18 22:05 | 26K | |
| py311-raet-0.6.8_2.pkg | 2025-12-23 04:56 | 337K | |
| py311-railroad-diagr..> | 2025-12-23 09:59 | 39K | |
| py311-ramlfications-..> | 2025-12-28 16:17 | 88K | |
| py311-random2-1.0.1_..> | 2025-12-18 14:19 | 23K | |
| py311-ranger-1.9.4_1..> | 2025-12-21 16:13 | 462K | |
| py311-rapidfuzz-3.14..> | 2025-12-26 14:57 | 1.6M | |
| py311-rapidfuzz-capi..> | 2025-12-18 08:42 | 4.5K | |
| py311-rarfile-4.1_1.pkg | 2025-12-19 12:54 | 75K | |
| py311-rasterio-1.3.1..> | 2025-12-26 20:07 | 837K | |
| py311-rasterstats-0...> | 2025-12-26 21:27 | 33K | |
| py311-ratelim-0.1.6_..> | 2025-12-18 18:29 | 4.8K | |
| py311-ratelimiter-1...> | 2025-12-19 12:25 | 10K | |
| py311-rauth-0.7.2_2.pkg | 2025-12-27 16:03 | 28K | |
| py311-raven-6.10.0_2..> | 2025-12-21 22:27 | 347K | |
| py311-rawkit-0.6.0_1..> | 2025-12-20 01:40 | 47K | |
| py311-rawpy-0.25.1.pkg | 2025-12-30 00:25 | 94K | |
| py311-rb-1.10.0_3.pkg | 2025-12-29 01:20 | 58K | |
| py311-rbtools-2.0_2.pkg | 2025-12-24 03:54 | 456K | |
| py311-rchitect-0.4.7..> | 2025-12-24 07:21 | 101K | |
| py311-rcssmin-1.2.2.pkg | 2025-12-19 02:02 | 23K | |
| py311-rdflib-7.5.0_1..> | 2025-12-18 10:16 | 938K | |
| py311-rdiff-backup-2..> | 2025-12-20 08:51 | 562K | |
| py311-re-assert-1.1...> | 2025-12-24 07:09 | 6.7K | |
| py311-readability-lx..> | 2025-12-19 12:46 | 33K | |
| py311-readchar-4.2.1..> | 2025-12-18 20:31 | 12K | |
| py311-readme-rendere..> | 2025-12-26 20:11 | 17K | |
| py311-readthedocs-sp..> | 2025-12-21 05:59 | 20K | |
| py311-readtime-3.0.0..> | 2025-12-20 06:17 | 9.4K | |
| py311-reals-0.0.5_1.pkg | 2025-12-22 17:10 | 34K | |
| py311-rebulk-3.2.0_1..> | 2025-12-18 21:26 | 124K | |
| py311-recaptcha-1.0...> | 2025-12-21 07:47 | 7.6K | |
| py311-recommonmark-0..> | 2025-12-24 20:08 | 23K | |
| py311-recordclass-0...> | 2025-12-18 21:17 | 162K | |
| py311-rectangle-pack..> | 2025-12-18 12:27 | 47K | |
| py311-recurring-ical..> | 2025-12-18 21:16 | 235K | |
| py311-red-black-tree..> | 2025-12-20 04:46 | 23K | |
| py311-redis-7.1.0.pkg | 2025-12-18 07:20 | 653K | |
| py311-redis2-2.10.6_..> | 2025-12-18 22:34 | 109K | |
| py311-redis5-5.3.1.pkg | 2025-12-27 02:16 | 519K | |
| py311-redis6-6.4.0.pkg | 2025-12-19 14:29 | 523K | |
| py311-redisvl-0.13.2..> | 2025-12-29 07:32 | 310K | |
| py311-rednose-1.3.0_..> | 2025-12-23 05:06 | 26K | |
| py311-redshift-conne..> | 2025-12-30 02:59 | 275K | |
| py311-reedsolo-1.6.0..> | 2025-12-20 00:35 | 191K | |
| py311-referencing-0...> | 2025-12-26 05:36 | 67K | |
| py311-regex-2025.11...> | 2025-12-18 00:46 | 374K | |
| py311-regress-0.4.2_..> | 2025-12-27 13:07 | 290K | |
| py311-reindent-3.5.1..> | 2025-12-22 10:16 | 12K | |
| py311-relatorio-0.11..> | 2025-12-29 19:36 | 324K | |
| py311-remote-pdb-2.1..> | 2025-12-20 10:48 | 9.5K | |
| py311-rencode-1.0.8_..> | 2025-12-18 22:52 | 56K | |
| py311-rendercv-2.5.pkg | 2025-12-29 10:57 | 160K | |
| py311-rendercv-fonts..> | 2025-12-27 12:33 | 24M | |
| py311-reno-4.1.0_2.pkg | 2025-12-26 15:26 | 126K | |
| py311-reportlab-4.4...> | 2025-12-26 15:59 | 3.0M | |
| py311-repoze.lru-0.7..> | 2025-12-18 11:09 | 26K | |
| py311-repoze.tm2-2.1..> | 2025-12-21 03:29 | 17K | |
| py311-repoze.who-2.4..> | 2025-12-20 06:26 | 137K | |
| py311-represent-2.1.pkg | 2025-12-19 08:05 | 17K | |
| py311-requests-2.32...> | 2025-12-24 20:07 | 119K | |
| py311-requests-aws4a..> | 2025-12-27 08:19 | 27K | |
| py311-requests-cache..> | 2025-12-26 23:33 | 119K | |
| py311-requests-cache..> | 2025-12-30 15:43 | 92K | |
| py311-requests-cache..> | 2025-12-27 01:17 | 88K | |
| py311-requests-creds..> | 2025-12-26 22:23 | 23K | |
| py311-requests-file-..> | 2025-12-26 15:54 | 6.9K | |
| py311-requests-ftp-0..> | 2025-12-18 17:13 | 13K | |
| py311-requests-futur..> | 2025-12-26 23:29 | 9.9K | |
| py311-requests-gssap..> | 2025-12-27 12:49 | 19K | |
| py311-requests-kerbe..> | 2025-12-26 21:48 | 17K | |
| py311-requests-mock-..> | 2025-12-30 07:49 | 39K | |
| py311-requests-oauth..> | 2025-12-26 14:48 | 35K | |
| py311-requests-toolb..> | 2025-12-26 16:07 | 81K | |
| py311-requests-unixs..> | 2025-12-27 10:32 | 14K | |
| py311-requests-wsgi-..> | 2025-12-29 05:44 | 8.2K | |
| py311-requests_ntlm-..> | 2025-12-26 21:49 | 11K | |
| py311-requestsexcept..> | 2025-12-18 13:41 | 7.3K | |
| py311-requirements-d..> | 2025-12-19 20:44 | 46K | |
| py311-requirements-p..> | 2025-12-19 22:41 | 19K | |
| py311-requirementsli..> | 2025-12-29 15:55 | 238K | |
| py311-resample-1.7.1..> | 2025-12-29 12:22 | 34K | |
| py311-resampy-0.4.3_..> | 2025-12-28 14:38 | 2.9M | |
| py311-resdk-22.0.0.pkg | 2025-12-29 11:01 | 167K | |
| py311-resend-2.19.0.pkg | 2025-12-28 21:38 | 61K | |
| py311-resolve-march-..> | 2025-12-23 00:04 | 23K | |
| py311-resolvelib-0.8..> | 2025-12-18 18:02 | 25K | |
| py311-resolvelib05-0..> | 2025-12-21 05:26 | 24K | |
| py311-resolvelib07-0..> | 2025-12-20 17:59 | 25K | |
| py311-resolvelib1-1...> | 2025-12-19 10:28 | 34K | |
| py311-resolver-0.2.1..> | 2025-12-19 12:46 | 3.5K | |
| py311-resource-0.2.1..> | 2025-12-29 23:36 | 46K | |
| py311-responses-0.25..> | 2025-12-27 02:50 | 60K | |
| py311-respx-0.22.0.pkg | 2025-12-18 21:53 | 66K | |
| py311-restclient-0.1..> | 2025-12-22 20:49 | 18K | |
| py311-restructuredte..> | 2025-12-23 18:06 | 19K | |
| py311-retry2-0.9.5_1..> | 2025-12-19 22:37 | 6.1K | |
| py311-retrying-1.4.2..> | 2025-12-19 03:00 | 15K | |
| py311-reverend-0.3_1..> | 2025-12-22 08:56 | 33K | |
| py311-rfc3339-6.2_1.pkg | 2025-12-19 06:52 | 9.6K | |
| py311-rfc3339-valida..> | 2025-12-18 01:36 | 4.1K | |
| py311-rfc3986-1.5.0_..> | 2025-12-18 07:55 | 49K | |
| py311-rfc3986-valida..> | 2025-12-18 01:34 | 5.0K | |
| py311-rfc3987-1.3.8_..> | 2025-12-19 10:06 | 25K | |
| py311-rfc3987-syntax..> | 2025-12-18 01:27 | 9.8K | |
| py311-rfc6555-0.1.0_..> | 2025-12-20 01:40 | 11K | |
| py311-rich-14.2.0.pkg | 2025-12-18 06:31 | 530K | |
| py311-rich-argparse-..> | 2025-12-22 12:23 | 46K | |
| py311-rich-cli-1.8.1..> | 2025-12-30 06:52 | 33K | |
| py311-rich-click-1.6..> | 2025-12-18 23:47 | 31K | |
| py311-rich-pixels-3...> | 2025-12-27 07:38 | 11K | |
| py311-rich-rst-1.3.2..> | 2025-12-19 15:33 | 28K | |
| py311-rich-toolkit-0..> | 2025-12-21 00:59 | 65K | |
| py311-riot-0.20.1.pkg | 2025-12-28 00:24 | 45K | |
| py311-ripe.atlas.cou..> | 2025-12-27 05:54 | 51K | |
| py311-ripe.atlas.sag..> | 2025-12-27 02:11 | 79K | |
| py311-ripe.atlas.too..> | 2025-12-30 13:50 | 147K | |
| py311-rjieba-0.1.13_..> | 2025-12-29 06:13 | 2.9M | |
| py311-rjsmin-1.2.5.pkg | 2025-12-18 18:04 | 18K | |
| py311-rlpycairo-0.4...> | 2025-12-26 20:04 | 17K | |
| py311-rmf-1.7.0.pkg | 2025-12-28 10:38 | 1.3M | |
| py311-rmsd-1.6.3_1.pkg | 2025-12-27 10:47 | 43K | |
| py311-rnc2rng-2.7.0_..> | 2025-12-19 02:54 | 30K | |
| py311-ro-3.6.9_6.pkg | 2025-12-30 07:08 | 701K | |
| py311-robot-detectio..> | 2025-12-19 06:06 | 12K | |
| py311-robotframework..> | 2025-12-19 00:20 | 1.0M | |
| py311-robotframework..> | 2025-12-19 10:46 | 18K | |
| py311-robotframework..> | 2025-12-29 12:27 | 50K | |
| py311-robotframework..> | 2025-12-23 00:19 | 9.0K | |
| py311-robotframework..> | 2025-12-22 16:15 | 140K | |
| py311-robotframework..> | 2025-12-18 21:31 | 22K | |
| py311-robotframework..> | 2025-12-29 19:27 | 30K | |
| py311-robotframework..> | 2025-12-29 08:21 | 141K | |
| py311-robotframework..> | 2025-12-19 14:42 | 11K | |
| py311-robotremoteser..> | 2025-12-21 17:29 | 23K | |
| py311-rodi-2.0.8.pkg | 2025-12-20 00:14 | 31K | |
| py311-rollbar-0.16.3..> | 2025-12-30 07:58 | 199K | |
| py311-roman-5.1.pkg | 2025-12-19 11:29 | 6.8K | |
| py311-roman-numerals..> | 2025-12-27 12:33 | 11K | |
| py311-roman-numerals..> | 2025-12-30 10:28 | 1.8K | |
| py311-rope-1.7.0_1.pkg | 2025-12-26 21:04 | 483K | |
| py311-ropgadget-7.7.pkg | 2025-12-19 16:58 | 61K | |
| py311-ropper-1.13.7_..> | 2025-12-19 09:59 | 191K | |
| py311-ros-catkin-0.8..> | 2025-12-24 06:34 | 60K | |
| py311-ros-catkin_pkg..> | 2025-12-19 01:37 | 129K | |
| py311-ros-rosdep-0.2..> | 2025-12-22 16:01 | 148K | |
| py311-ros-rosdistro-..> | 2025-12-19 23:18 | 106K | |
| py311-ros-rosinstall..> | 2025-12-21 09:44 | 29K | |
| py311-ros-rospkg-1.4..> | 2025-12-18 21:16 | 68K | |
| py311-ros-vcstool-0...> | 2025-12-22 20:20 | 74K | |
| py311-ros-vcstools-0..> | 2025-12-19 15:44 | 76K | |
| py311-ros-wstool-0.1..> | 2025-12-20 07:34 | 96K | |
| py311-rose-1.0.0_2.pkg | 2025-12-21 03:46 | 3.3K | |
| py311-rouge-score-0...> | 2025-12-29 16:04 | 39K | |
| py311-routes-2.5.1_1..> | 2025-12-18 13:21 | 71K | |
| py311-rpcq-3.11.0_3.pkg | 2025-12-27 10:41 | 75K | |
| py311-rpds-py-0.30.0..> | 2025-12-26 05:25 | 271K | |
| py311-rply-0.7.8_1.pkg | 2025-12-18 18:24 | 36K | |
| py311-rpy2-3.5.17_1.pkg | 2025-12-28 13:16 | 535K | |
| py311-rpyc-6.0.1.pkg | 2025-12-19 02:55 | 155K | |
| py311-rq-2.6.1.pkg | 2025-12-18 10:20 | 234K | |
| py311-rq-scheduler-0..> | 2025-12-22 03:26 | 24K | |
| py311-rq1-1.16.2.pkg | 2025-12-19 11:00 | 192K | |
| py311-rrdtool-0.1.16..> | 2025-12-30 07:47 | 13K | |
| py311-rsa-4.9_1.pkg | 2025-12-18 03:44 | 56K | |
| py311-rss2email-3.14..> | 2025-12-24 04:53 | 92K | |
| py311-rst2ansi-0.1.5..> | 2025-12-19 04:57 | 30K | |
| py311-rst2html5-2.0_..> | 2025-12-24 04:49 | 42K | |
| py311-rstr-3.2.2.pkg | 2025-12-18 19:14 | 16K | |
| py311-rtf-0.45_1.pkg | 2025-12-22 11:27 | 60K | |
| py311-rtree-1.4.1.pkg | 2025-12-18 17:58 | 56K | |
| py311-rtslib-fb-2.1...> | 2025-12-21 07:13 | 104K | |
| py311-ruamel.yaml-0...> | 2025-12-26 13:48 | 269K | |
| py311-ruamel.yaml.cl..> | 2025-12-18 07:48 | 114K | |
| py311-rubymarshal-1...> | 2025-12-23 15:47 | 22K | |
| py311-ruff-0.14.7_1.pkg | 2025-12-26 19:29 | 9.4M | |
| py311-ruffus-2.8.4_1..> | 2025-12-21 10:48 | 412K | |
| py311-rules-2.0.1_1.pkg | 2025-12-20 11:02 | 28K | |
| py311-runloop-api-cl..> | 2025-12-29 16:33 | 298K | |
| py311-runs-1.2.2.pkg | 2025-12-18 17:42 | 8.8K | |
| py311-rush-2021.4.0_..> | 2025-12-20 02:37 | 31K | |
| py311-rustworkx-0.17..> | 2025-12-27 19:23 | 1.4M | |
| py311-rvlib-0.0.6_3.pkg | 2025-12-30 06:13 | 148K | |
| py311-rx-3.2.0_1.pkg | 2025-12-21 08:34 | 280K | |
| py311-rx1-1.6.3.pkg | 2025-12-18 13:38 | 248K | |
| py311-ryu-4.26_6.pkg | 2025-12-30 00:09 | 2.1M | |
| py311-s2-0.12.0.pkg | 2025-12-23 15:19 | 125K | |
| py311-s3cmd-2.4.0_3.pkg | 2025-12-23 19:55 | 247K | |
| py311-s3fs-2025.12.0..> | 2025-12-27 13:06 | 73K | |
| py311-s3transfer-0.1..> | 2025-12-26 09:23 | 145K | |
| py311-s4cmd-2.1.0.11..> | 2025-12-27 20:43 | 58K | |
| py311-sabctools-8.2...> | 2025-12-19 07:42 | 64K | |
| py311-sacremoses-0.1..> | 2025-12-20 06:13 | 206K | |
| py311-safe-0.4_1.pkg | 2025-12-22 13:17 | 54K | |
| py311-safetensors-0...> | 2025-12-26 20:15 | 301K | |
| py311-sagemaker-3.0...> | 2025-12-27 00:46 | 9.1K | |
| py311-sagemaker-core..> | 2025-12-26 11:10 | 1.7M | |
| py311-sagemaker-mlop..> | 2025-12-26 18:57 | 164K | |
| py311-sagemaker-serv..> | 2025-12-26 17:31 | 319K | |
| py311-sagemaker-shim..> | 2025-12-28 14:58 | 48K | |
| py311-sagemaker-trai..> | 2025-12-26 13:50 | 180K | |
| py311-salt-3006.9_6,..> | 2025-12-27 16:23 | 15M | |
| py311-salt-tower-1.1..> | 2025-12-23 04:51 | 48K | |
| py311-saltyrtc.serve..> | 2025-12-28 22:11 | 93K | |
| py311-samplerate-0.2..> | 2025-12-30 11:17 | 104K | |
| py311-saneyaml-0.6.1..> | 2025-12-18 17:31 | 16K | |
| py311-sarge-0.1.6_1.pkg | 2025-12-23 02:24 | 41K | |
| py311-sarif-om-1.0.4..> | 2025-12-18 11:20 | 30K | |
| py311-sarpy-1.3.62.pkg | 2025-12-28 23:52 | 1.8M | |
| py311-scamper-202511..> | 2025-12-21 13:13 | 596K | |
| py311-scandir-1.10.0..> | 2025-12-20 14:43 | 27K | |
| py311-scantree-0.0.2..> | 2025-12-18 18:41 | 39K | |
| py311-scapy-2.6.1_1.pkg | 2025-12-28 09:39 | 4.2M | |
| py311-scarab-0.1.3_1..> | 2025-12-21 20:31 | 37K | |
| py311-scenedetect-0...> | 2025-12-28 17:05 | 226K | |
| py311-scgi-2.2_1.pkg | 2025-12-20 12:06 | 33K | |
| py311-schedule-1.2.2..> | 2025-12-19 18:11 | 22K | |
| py311-schedulefree-1..> | 2025-12-28 00:36 | 56K | |
| py311-scheduler-0.8...> | 2025-12-20 17:20 | 55K | |
| py311-schema-0.7.7_1..> | 2025-12-18 04:33 | 34K | |
| py311-schemachange-4..> | 2025-12-28 23:59 | 56K | |
| py311-schematics-pat..> | 2025-12-20 08:42 | 70K | |
| py311-scholarly-1.7...> | 2025-12-30 00:25 | 80K | |
| py311-scikit-base-0...> | 2025-12-20 16:41 | 268K | |
| py311-scikit-bio-0.6..> | 2025-12-30 06:13 | 4.4M | |
| py311-scikit-build-0..> | 2025-12-18 10:16 | 122K | |
| py311-scikit-build-c..> | 2025-12-18 00:39 | 291K | |
| py311-scikit-fem-11...> | 2025-12-28 06:02 | 304K | |
| py311-scikit-fusion-..> | 2025-12-29 23:23 | 6.5M | |
| py311-scikit-fuzzy-0..> | 2025-12-29 18:39 | 937K | |
| py311-scikit-image-0..> | 2025-12-26 21:26 | 9.7M | |
| py311-scikit-learn-1..> | 2025-12-26 13:45 | 8.4M | |
| py311-scikit-optimiz..> | 2025-12-27 21:18 | 173K | |
| py311-scikit-quant-0..> | 2025-12-30 02:58 | 43K | |
| py311-scikit-sparse-..> | 2025-12-26 08:41 | 265K | |
| py311-scikit-umfpack..> | 2025-12-30 14:58 | 128K | |
| py311-scimath-5.0.0_..> | 2025-12-30 12:42 | 194K | |
| py311-scipy-1.11.1_4..> | 2025-12-26 08:30 | 42M | |
| py311-scooby-0.10.1.pkg | 2025-12-20 02:29 | 31K | |
| py311-scoria-1.0.5_2..> | 2025-12-29 22:52 | 4.2M | |
| py311-scour-0.38.2_1..> | 2025-12-18 23:17 | 110K | |
| py311-scp-0.14.4_2.pkg | 2025-12-26 18:49 | 18K | |
| py311-scramp-1.4.6.pkg | 2025-12-19 19:24 | 24K | |
| py311-scrapy-2.13.3_..> | 2025-12-30 07:22 | 590K | |
| py311-screeninfo-0.8..> | 2025-12-19 04:17 | 23K | |
| py311-scripttest-2.0..> | 2025-12-20 06:00 | 17K | |
| py311-scrypt-0.8.27_..> | 2025-12-20 10:58 | 36K | |
| py311-scs-3.2.9.pkg | 2025-12-27 11:14 | 66K | |
| py311-sdf-0.1_4.pkg | 2025-12-28 21:01 | 266K | |
| py311-sdm_modbus-0.7..> | 2025-12-21 09:29 | 31K | |
| py311-seaborn-0.13.0..> | 2025-12-26 19:31 | 584K | |
| py311-seafdav-11.0.1..> | 2025-12-19 14:09 | 319K | |
| py311-seafobj-11.0.1..> | 2025-12-19 16:13 | 53K | |
| py311-searxng-devel-..> | 2025-12-28 21:28 | 4.6M | |
| py311-secp256k1-0.13..> | 2025-12-19 14:49 | 28K | |
| py311-secure-0.3.0_1..> | 2025-12-18 12:05 | 17K | |
| py311-secure-cookie-..> | 2025-12-18 17:12 | 21K | |
| py311-securesystemsl..> | 2025-12-27 16:36 | 816K | |
| py311-seekpath-2.1.0..> | 2025-12-26 19:13 | 69K | |
| py311-segments-2.3.0..> | 2025-12-28 18:07 | 27K | |
| py311-segno-1.6.1.pkg | 2025-12-19 14:42 | 141K | |
| py311-segregation-2...> | 2025-12-27 16:04 | 137K | |
| py311-segyio-1.9.13_..> | 2025-12-27 22:43 | 102K | |
| py311-selection-0.0...> | 2025-12-19 16:26 | 18K | |
| py311-selector-0.10...> | 2025-12-21 13:11 | 15K | |
| py311-selenium-4.12...> | 2025-12-27 02:03 | 738K | |
| py311-selenium-wire-..> | 2025-12-28 13:10 | 439K | |
| py311-semantic-versi..> | 2025-12-17 23:29 | 36K | |
| py311-semiphemeral-0..> | 2025-12-30 14:28 | 88K | |
| py311-semver-3.0.4.pkg | 2025-12-18 16:56 | 31K | |
| py311-send2trash-1.8..> | 2025-12-18 02:12 | 27K | |
| py311-sense2vec-2.0...> | 2025-12-30 07:29 | 74K | |
| py311-sentence-trans..> | 2025-12-29 10:59 | 609K | |
| py311-sentencepiece-..> | 2025-12-18 21:11 | 99K | |
| py311-sentinelhub-3...> | 2025-12-28 19:14 | 318K | |
| py311-sentry-sdk-1.2..> | 2025-12-26 21:22 | 356K | |
| py311-seqdiag-3.0.0_..> | 2025-12-27 02:07 | 2.2M | |
| py311-serializable-0..> | 2025-12-22 12:43 | 15K | |
| py311-seriate-1.1.2_..> | 2025-12-30 08:56 | 7.9K | |
| py311-serverfiles-0...> | 2025-12-28 13:17 | 16K | |
| py311-service-identi..> | 2025-12-26 06:24 | 20K | |
| py311-session-info-1..> | 2025-12-30 10:20 | 14K | |
| py311-setoptconf-0.3..> | 2025-12-19 18:20 | 25K | |
| py311-setproctitle-1..> | 2025-12-18 18:21 | 12K | |
| py311-setupmeta-3.8...> | 2025-12-20 18:23 | 88K | |
| py311-setuptools-63...> | 2025-12-16 01:38 | 1.4M | |
| py311-setuptools-dec..> | 2025-12-19 09:28 | 11K | |
| py311-setuptools-dso..> | 2025-12-22 03:03 | 49K | |
| py311-setuptools-get..> | 2025-12-20 07:18 | 5.6K | |
| py311-setuptools-git..> | 2025-12-19 02:37 | 18K | |
| py311-setuptools-git..> | 2025-12-19 11:34 | 22K | |
| py311-setuptools-pkg..> | 2025-12-19 04:19 | 22K | |
| py311-setuptools-rus..> | 2025-12-26 04:14 | 55K | |
| py311-setuptools-scm..> | 2025-12-16 01:38 | 83K | |
| py311-setuptools_git..> | 2025-12-18 16:27 | 2.8K | |
| py311-setuptools_hg-..> | 2025-12-21 02:57 | 13K | |
| py311-setuptools_scm..> | 2025-12-18 22:29 | 80K | |
| py311-setuptools_scm..> | 2025-12-18 13:42 | 2.9K | |
| py311-setzer-66_5.pkg | 2025-12-29 22:45 | 3.4M | |
| py311-sexpdata-1.0.2..> | 2025-12-19 21:41 | 18K | |
| py311-sgflib-1.0_1.pkg | 2025-12-19 14:29 | 11K | |
| py311-sgfsummary-1.0..> | 2025-12-20 17:32 | 5.3K | |
| py311-sgmllib3k-1.0...> | 2025-12-18 07:58 | 15K | |
| py311-sgp4-2.25.pkg | 2025-12-18 11:57 | 181K | |
| py311-sgqlc-16.5.pkg | 2025-12-26 16:56 | 137K | |
| py311-sh-2.2.2.pkg | 2025-12-19 03:28 | 80K | |
| py311-shandy-sqlfmt-..> | 2025-12-28 19:12 | 133K | |
| py311-shap2-0.42.0_2..> | 2025-12-30 06:24 | 682K | |
| py311-shapely-2.1.2.pkg | 2025-12-26 10:05 | 616K | |
| py311-shaperglot-1.2..> | 2025-12-27 18:42 | 1.4M | |
| py311-shell-gpt-1.4...> | 2025-12-30 18:15 | 53K | |
| py311-shellingham-1...> | 2025-12-18 10:21 | 16K | |
| py311-sherlock-proje..> | 2025-12-29 21:56 | 51K | |
| py311-shiboken2-5.15..> | 2025-12-26 16:59 | 843K | |
| py311-shiboken6-6.10..> | 2025-12-26 19:11 | 1.7M | |
| py311-shodan-1.31.0_..> | 2025-12-29 17:36 | 101K | |
| py311-shpyx-0.0.34.pkg | 2025-12-20 08:30 | 14K | |
| py311-shtab-1.8.0.pkg | 2025-12-18 14:13 | 32K | |
| py311-signac-2.2.0.pkg | 2025-12-28 22:45 | 243K | |
| py311-signalr-client..> | 2025-12-27 08:04 | 13K | |
| py311-signedjson-1.1..> | 2025-12-19 22:31 | 14K | |
| py311-signxml-4.2.0_..> | 2025-12-30 11:27 | 82K | |
| py311-sigopt-8.8.3_1..> | 2025-12-30 01:22 | 375K | |
| py311-simhash-2.1.2_..> | 2025-12-23 07:53 | 9.8K | |
| py311-simple-parsing..> | 2025-12-18 19:33 | 232K | |
| py311-simple-websock..> | 2025-12-18 13:44 | 23K | |
| py311-simple_term_me..> | 2025-12-20 12:06 | 61K | |
| py311-simpleaudio-1...> | 2025-12-26 23:32 | 1.8M | |
| py311-simplebayes-1...> | 2025-12-23 04:52 | 10K | |
| py311-simpleeval-0.9..> | 2025-12-18 19:32 | 25K | |
| py311-simplegeneric-..> | 2025-12-19 04:51 | 7.5K | |
| py311-simplejpeg-1.8..> | 2025-12-19 02:08 | 353K | |
| py311-simplejson-3.1..> | 2025-12-18 12:40 | 122K | |
| py311-simpleparse-2...> | 2025-12-20 17:54 | 196K | |
| py311-simpletal-4.3_..> | 2025-12-21 05:19 | 65K | |
| py311-simpy-3.0.13_1..> | 2025-12-22 07:56 | 389K | |
| py311-simsimd-6.0.4_..> | 2025-12-18 19:48 | 53K | |
| py311-single-version..> | 2025-12-23 18:46 | 5.3K | |
| py311-siosocks-0.3.0..> | 2025-12-18 16:34 | 29K | |
| py311-sip-6.15.1,1.pkg | 2025-12-26 07:48 | 683K | |
| py311-sirmordred-1.1..> | 2025-12-27 15:57 | 113K | |
| py311-sispy-1.1.0_1.pkg | 2025-12-28 10:02 | 16K | |
| py311-six-1.17.0.pkg | 2025-12-16 01:41 | 27K | |
| py311-sklearn-pandas..> | 2025-12-29 18:33 | 22K | |
| py311-skog-0.1.0_1.pkg | 2025-12-21 18:38 | 9.5K | |
| py311-skrebate-0.62_..> | 2025-12-28 10:07 | 35K | |
| py311-skyfield-1.53_..> | 2025-12-26 18:28 | 543K | |
| py311-skyfield_data-..> | 2025-12-26 20:41 | 16M | |
| py311-slack-sdk-3.39..> | 2025-12-19 13:20 | 467K | |
| py311-slackeventsapi..> | 2025-12-20 02:44 | 11K | |
| py311-slepc4py-3.22...> | 2025-12-29 15:34 | 264K | |
| py311-slimit-0.8.1_3..> | 2025-12-22 15:42 | 125K | |
| py311-slixmpp-1.8.5_..> | 2025-12-22 13:02 | 737K | |
| py311-slumber-0.7.1_..> | 2025-12-27 17:06 | 14K | |
| py311-sly-0.5.pkg | 2025-12-19 01:20 | 63K | |
| py311-smart-open-7.1..> | 2025-12-26 20:12 | 105K | |
| py311-smartypants-2...> | 2025-12-16 01:39 | 13K | |
| py311-smbpasswd-1.0...> | 2025-12-21 18:36 | 9.3K | |
| py311-smbprotocol-1...> | 2025-12-29 01:31 | 243K | |
| py311-smdebug-rulesc..> | 2025-12-18 04:39 | 24K | |
| py311-smile-2.11.0.pkg | 2025-12-28 10:58 | 659K | |
| py311-smmap-5.0.2.pkg | 2025-12-18 06:25 | 45K | |
| py311-snakeviz-2.2.2..> | 2025-12-22 14:17 | 171K | |
| py311-sniffio-1.3.1.pkg | 2025-12-18 00:52 | 12K | |
| py311-snmp_passpersi..> | 2025-12-28 19:10 | 13K | |
| py311-snmpclitools-0..> | 2025-12-28 17:31 | 51K | |
| py311-snowballstemme..> | 2025-12-16 01:42 | 239K | |
| py311-snowddl-0.58.2..> | 2025-12-30 05:58 | 346K | |
| py311-snowflake-conn..> | 2025-12-27 17:04 | 1.2M | |
| py311-snuggs-1.4.7_2..> | 2025-12-26 14:53 | 9.9K | |
| py311-soapy_power-1...> | 2025-12-27 02:29 | 37K | |
| py311-social-auth-ap..> | 2025-12-28 19:36 | 44K | |
| py311-social-auth-co..> | 2025-12-26 22:56 | 516K | |
| py311-socketio-clien..> | 2025-12-26 23:02 | 44K | |
| py311-sockjs-tornado..> | 2025-12-23 14:48 | 49K | |
| py311-socksio-1.0.0_..> | 2025-12-18 02:17 | 23K | |
| py311-soco-0.30.4_3.pkg | 2025-12-27 19:23 | 255K | |
| py311-softlayer-6.2...> | 2025-12-28 07:48 | 786K | |
| py311-sonata-1.7.b1...> | 2025-12-30 02:44 | 510K | |
| py311-sopel-8.0.4.pkg | 2025-12-27 02:17 | 490K | |
| py311-sopel-help-0.5..> | 2025-12-30 11:25 | 21K | |
| py311-sorl-thumbnail..> | 2025-12-28 19:07 | 245K | |
| py311-sortedcontaine..> | 2025-12-18 00:50 | 51K | |
| py311-sortinghat-1.6..> | 2025-12-26 19:12 | 4.0M | |
| py311-soundcloud-0.5..> | 2025-12-27 18:23 | 26K | |
| py311-sounddevice-0...> | 2025-12-27 16:21 | 56K | |
| py311-soundscrape-0...> | 2025-12-28 10:19 | 36K | |
| py311-soupsieve-2.8.pkg | 2025-12-18 00:43 | 85K | |
| py311-sourcemap-0.2...> | 2025-12-22 04:28 | 11K | |
| py311-south-1.0.2_1.pkg | 2025-12-21 07:03 | 251K | |
| py311-soxr-0.5.0.pkg | 2025-12-26 18:05 | 180K | |
| py311-sozipfile-0.3...> | 2025-12-22 06:54 | 70K | |
| py311-spacetrack-0.1..> | 2025-12-28 18:28 | 27K | |
| py311-spacy-3.8.11.pkg | 2025-12-27 02:51 | 4.8M | |
| py311-spacy-legacy-3..> | 2025-12-18 21:21 | 59K | |
| py311-spacy-llm-0.7...> | 2025-12-29 12:22 | 336K | |
| py311-spacy-loggers-..> | 2025-12-18 21:38 | 36K | |
| py311-spaghetti-1.7...> | 2025-12-27 00:01 | 103K | |
| py311-spake2-0.9_1.pkg | 2025-12-18 19:52 | 60K | |
| py311-spark-parser-1..> | 2025-12-19 11:01 | 107K | |
| py311-sparqlwrapper-..> | 2025-12-23 16:26 | 46K | |
| py311-sparse-0.17.0.pkg | 2025-12-30 04:53 | 350K | |
| py311-spdx-tools-0.8..> | 2025-12-30 16:53 | 397K | |
| py311-speaklater-1.3..> | 2025-12-19 17:25 | 7.2K | |
| py311-spectra-0.0.11..> | 2025-12-26 22:35 | 38K | |
| py311-spectral-0.24.pkg | 2025-12-29 01:25 | 359K | |
| py311-speech-dispatc..> | 2025-12-27 00:45 | 71K | |
| py311-speechrecognit..> | 2025-12-30 14:58 | 28M | |
| py311-speedtest-cli-..> | 2025-12-20 07:14 | 48K | |
| py311-speg-0.3_1.pkg | 2025-12-18 17:00 | 6.6K | |
| py311-spf-engine-3.1..> | 2025-12-28 13:27 | 95K | |
| py311-spglib-2.6.0.pkg | 2025-12-26 13:23 | 42K | |
| py311-spglm-1.1.0.pkg | 2025-12-26 20:37 | 81K | |
| py311-sphinx-5.3.0_3..> | 2025-12-24 20:08 | 2.2M | |
| py311-sphinx-argpars..> | 2025-12-26 10:23 | 31K | |
| py311-sphinx-autoapi..> | 2025-12-27 16:26 | 99K | |
| py311-sphinx-autobui..> | 2025-12-27 16:04 | 23K | |
| py311-sphinx-autodoc..> | 2025-12-26 17:30 | 37K | |
| py311-sphinx-basic-n..> | 2025-12-26 06:01 | 14K | |
| py311-sphinx-book-th..> | 2025-12-29 09:20 | 102K | |
| py311-sphinx-copybut..> | 2025-12-26 06:23 | 14K | |
| py311-sphinx-design-..> | 2025-12-26 16:12 | 915K | |
| py311-sphinx-example..> | 2025-12-28 15:09 | 7.1K | |
| py311-sphinx-gallery..> | 2025-12-29 05:44 | 586K | |
| py311-sphinx-inline-..> | 2025-12-26 06:24 | 11K | |
| py311-sphinx-intl-2...> | 2025-12-28 17:29 | 27K | |
| py311-sphinx-issues-..> | 2025-12-26 19:47 | 13K | |
| py311-sphinx-last-up..> | 2025-12-27 09:03 | 15K | |
| py311-sphinx-markdow..> | 2025-12-16 01:44 | 3.9K | |
| py311-sphinx-me-0.3_..> | 2025-12-22 12:24 | 9.9K | |
| py311-sphinx-multive..> | 2025-12-30 08:16 | 20K | |
| py311-sphinx-multive..> | 2025-12-27 11:54 | 21K | |
| py311-sphinx-notfoun..> | 2025-12-26 15:46 | 14K | |
| py311-sphinx-sitemap..> | 2025-12-28 00:37 | 10K | |
| py311-sphinx-tabs-3...> | 2025-12-26 16:13 | 17K | |
| py311-sphinx-theme-b..> | 2025-12-30 08:53 | 830K | |
| py311-sphinx_materia..> | 2025-12-30 07:08 | 706K | |
| py311-sphinx_press_t..> | 2025-12-26 16:03 | 75K | |
| py311-sphinx_rtd_the..> | 2025-12-18 02:38 | 2.5M | |
| py311-sphinx_wikiped..> | 2025-12-29 22:12 | 1.4K | |
| py311-sphinxcontrib-..> | 2025-12-29 17:43 | 13K | |
| py311-sphinxcontrib-..> | 2025-12-30 02:08 | 17K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:41 | 28K | |
| py311-sphinxcontrib-..> | 2025-12-27 12:32 | 165K | |
| py311-sphinxcontrib-..> | 2025-12-30 05:07 | 71K | |
| py311-sphinxcontrib-..> | 2025-12-27 08:18 | 5.5K | |
| py311-sphinxcontrib-..> | 2025-12-30 08:14 | 12K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:41 | 21K | |
| py311-sphinxcontrib-..> | 2025-12-29 01:21 | 31K | |
| py311-sphinxcontrib-..> | 2025-12-27 07:40 | 5.1K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:40 | 33K | |
| py311-sphinxcontrib-..> | 2025-12-30 16:17 | 45K | |
| py311-sphinxcontrib-..> | 2025-12-28 04:53 | 18K | |
| py311-sphinxcontrib-..> | 2025-12-27 18:48 | 105K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:40 | 6.3K | |
| py311-sphinxcontrib-..> | 2025-12-26 20:10 | 6.4K | |
| py311-sphinxcontrib-..> | 2025-12-18 11:02 | 34K | |
| py311-sphinxcontrib-..> | 2025-12-30 09:28 | 15K | |
| py311-sphinxcontrib-..> | 2025-12-28 19:56 | 15K | |
| py311-sphinxcontrib-..> | 2025-12-30 16:01 | 26K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:40 | 26K | |
| py311-sphinxcontrib-..> | 2025-12-27 11:37 | 14K | |
| py311-sphinxcontrib-..> | 2025-12-16 01:40 | 26K | |
| py311-sphinxcontrib-..> | 2025-12-27 18:03 | 191K | |
| py311-sphinxcontrib-..> | 2025-12-26 22:57 | 11K | |
| py311-sphinxcontrib-..> | 2025-12-26 06:21 | 19K | |
| py311-sphinxcontrib-..> | 2025-12-29 15:39 | 58K | |
| py311-sphinxemoji-0...> | 2025-12-28 10:09 | 40K | |
| py311-sphinxext-open..> | 2025-12-27 11:47 | 864K | |
| py311-spinners-0.0.2..> | 2025-12-18 17:55 | 7.6K | |
| py311-spint-1.0.7_2.pkg | 2025-12-27 12:26 | 58K | |
| py311-spktype01-1.0...> | 2025-12-30 16:27 | 13K | |
| py311-spktype21-0.1...> | 2025-12-26 15:03 | 15K | |
| py311-splinter-0.21...> | 2025-12-27 21:10 | 75K | |
| py311-splot-1.1.7_1.pkg | 2025-12-27 09:39 | 67K | |
| py311-splunk-hec-1.8..> | 2025-12-27 00:34 | 13K | |
| py311-spopt-0.7.0.pkg | 2025-12-27 15:36 | 310K | |
| py311-spot-2.14.3.pkg | 2025-12-23 11:37 | 1.2M | |
| py311-spotipy-2.25.2..> | 2025-12-29 00:47 | 2.7M | |
| py311-spreg-1.8.4.pkg | 2025-12-26 17:57 | 562K | |
| py311-spsdk-2.2.1_2.pkg | 2025-12-27 11:36 | 1.8M | |
| py311-spyder-kernels..> | 2025-12-30 17:21 | 161K | |
| py311-spylls-0.1.7_2..> | 2025-12-23 03:56 | 1.3M | |
| py311-spyne-2.14.0_5..> | 2025-12-21 17:59 | 951K | |
| py311-sqids-0.5.2.pkg | 2025-12-23 15:13 | 16K | |
| py311-sqlalchemy-jso..> | 2025-12-20 00:43 | 12K | |
| py311-sqlalchemy-mig..> | 2025-12-21 10:50 | 206K | |
| py311-sqlalchemy-uti..> | 2025-12-29 22:28 | 158K | |
| py311-sqlalchemy10-1..> | 2025-12-19 23:22 | 3.3M | |
| py311-sqlalchemy14-1..> | 2025-12-18 20:50 | 5.7M | |
| py311-sqlalchemy20-2..> | 2025-12-26 16:31 | 6.8M | |
| py311-sqlcipher3-0.5..> | 2025-12-21 02:55 | 37K | |
| py311-sqlfluff-3.5.0..> | 2025-12-20 07:25 | 1.4M | |
| py311-sqlframe-3.43...> | 2025-12-20 22:45 | 364K | |
| py311-sqlglot-27.29...> | 2025-12-19 15:38 | 1.1M | |
| py311-sqlglotrs-0.7...> | 2025-12-27 22:19 | 247K | |
| py311-sqlite-anyio-0..> | 2025-12-18 11:42 | 7.5K | |
| py311-sqlite-fts4-1...> | 2025-12-18 11:37 | 9.5K | |
| py311-sqlite-migrate..> | 2025-12-18 20:33 | 14K | |
| py311-sqlite-utils-3..> | 2025-12-18 17:26 | 151K | |
| py311-sqlite3-3.11.1..> | 2025-12-18 00:50 | 36K | |
| py311-sqlmap-1.9.12.pkg | 2025-12-27 21:04 | 7.8M | |
| py311-sqlmodel-0.0.2..> | 2025-12-29 16:12 | 59K | |
| py311-sqlobject-3.11..> | 2025-12-18 19:53 | 1.2M | |
| py311-sqloxide-0.1.4..> | 2025-12-30 01:22 | 1.2M | |
| py311-sqlparse-0.5.4..> | 2025-12-18 03:54 | 95K | |
| py311-sqlrelay-1.9.3..> | 2025-12-22 12:37 | 26K | |
| py311-squarify-0.4.4..> | 2025-12-27 22:43 | 7.1K | |
| py311-squint-0.1.0_1..> | 2025-12-20 12:03 | 84K | |
| py311-sre-yield-1.2_..> | 2025-12-18 23:22 | 43K | |
| py311-srsly-2.5.2.pkg | 2025-12-18 12:10 | 752K | |
| py311-srt-3.5.3_1.pkg | 2025-12-20 01:50 | 27K | |
| py311-sse-starlette-..> | 2025-12-18 14:22 | 19K | |
| py311-sseclient-0.0...> | 2025-12-28 00:26 | 8.6K | |
| py311-ssh-audit-3.3...> | 2025-12-23 09:40 | 209K | |
| py311-ssh-import-id-..> | 2025-12-20 13:36 | 15K | |
| py311-sshpubkeys-3.3..> | 2025-12-29 16:08 | 20K | |
| py311-sshtunnel-0.4...> | 2025-12-27 16:11 | 49K | |
| py311-sshuttle-1.3.2..> | 2025-12-22 14:35 | 172K | |
| py311-ssm-0.0.1_3.pkg | 2025-12-28 10:06 | 268K | |
| py311-stack-data-0.6..> | 2025-12-18 01:50 | 49K | |
| py311-starlette-0.50..> | 2025-12-18 13:33 | 174K | |
| py311-starlette-cont..> | 2025-12-19 05:03 | 20K | |
| py311-statgrab-0.7.3..> | 2025-12-21 07:51 | 57K | |
| py311-statsd-4.0.1_1..> | 2025-12-18 12:00 | 34K | |
| py311-statsmodels-0...> | 2025-12-26 14:53 | 11M | |
| py311-stdlib-list-0...> | 2025-12-27 13:28 | 21K | |
| py311-stdlibs-2025.1..> | 2025-12-19 02:36 | 38K | |
| py311-stdnum-1.20_1.pkg | 2025-12-18 12:39 | 789K | |
| py311-stem-1.8.2_1.pkg | 2025-12-27 00:46 | 678K | |
| py311-stemming-1.0.1..> | 2025-12-23 00:40 | 25K | |
| py311-stestr-4.2.0_1..> | 2025-12-23 16:54 | 176K | |
| py311-stevedore-5.6...> | 2025-12-18 07:55 | 65K | |
| py311-stig-0.14.1.a0..> | 2025-12-29 13:11 | 572K | |
| py311-stix-1.2.0.11_..> | 2025-12-21 18:54 | 426K | |
| py311-stix2-2.1.0_1.pkg | 2025-12-29 05:53 | 245K | |
| py311-stix2-patterns..> | 2025-12-20 03:05 | 87K | |
| py311-stocksera-0.1...> | 2025-12-30 02:00 | 8.7K | |
| py311-stomp.py-8.0.1..> | 2025-12-23 15:27 | 73K | |
| py311-stone-3.3.9.pkg | 2025-12-18 17:07 | 359K | |
| py311-stopit-1.1.2_1..> | 2025-12-19 02:06 | 15K | |
| py311-strategies-0.2..> | 2025-12-23 00:03 | 13K | |
| py311-strawberry-gra..> | 2025-12-20 00:30 | 555K | |
| py311-strawberry-gra..> | 2025-12-22 13:24 | 230K | |
| py311-streamdeck-0.9..> | 2025-12-28 17:33 | 50K | |
| py311-streamlink-6.5..> | 2025-12-27 09:23 | 864K | |
| py311-streamlit-1.48..> | 2025-12-27 17:52 | 8.5M | |
| py311-streamparse-4...> | 2025-12-30 11:18 | 121K | |
| py311-strict-rfc3339..> | 2025-12-19 08:54 | 8.6K | |
| py311-strictyaml-1.7..> | 2025-12-21 16:28 | 274K | |
| py311-stringbrewer-0..> | 2025-12-20 00:42 | 7.5K | |
| py311-stringcase-1.2..> | 2025-12-23 11:33 | 5.7K | |
| py311-stringzilla-4...> | 2025-12-26 20:40 | 407K | |
| py311-stripe-2.76.0_..> | 2025-12-28 11:51 | 246K | |
| py311-structlog-25.4..> | 2025-12-20 00:09 | 112K | |
| py311-subliminal-2.5..> | 2025-12-29 16:23 | 215K | |
| py311-subprocess-tee..> | 2025-12-18 20:51 | 7.6K | |
| py311-subversion-1.1..> | 2025-12-19 00:42 | 804K | |
| py311-suds-1.2.0.pkg | 2025-12-19 02:01 | 231K | |
| py311-sunpy-7.0.2.pkg | 2025-12-29 16:50 | 3.6M | |
| py311-super-collecti..> | 2025-12-19 00:04 | 28K | |
| py311-superqt-0.7.6.pkg | 2025-12-18 18:32 | 202K | |
| py311-supervisor-4.2..> | 2025-12-19 13:06 | 665K | |
| py311-supysonic-0.7...> | 2025-12-28 12:04 | 302K | |
| py311-sure-1.4.11_1.pkg | 2025-12-21 12:23 | 48K | |
| py311-svg_path-4.0.2..> | 2025-12-19 01:13 | 39K | |
| py311-svgelements-1...> | 2025-12-20 05:15 | 297K | |
| py311-svglib-1.6.0.pkg | 2025-12-26 22:48 | 78K | |
| py311-svgmath-0.3.3_..> | 2025-12-22 16:13 | 126K | |
| py311-svgwrite-1.4.3..> | 2025-12-18 13:44 | 156K | |
| py311-swagger-spec-v..> | 2025-12-26 16:58 | 36K | |
| py311-swapper-1.4.0.pkg | 2025-12-19 12:55 | 8.8K | |
| py311-sym-0.3.7.pkg | 2025-12-26 21:41 | 54K | |
| py311-symengine-0.14..> | 2025-12-27 17:27 | 829K | |
| py311-symfc-1.3.1.pkg | 2025-12-26 16:40 | 122K | |
| py311-sympy-1.14.0.pkg | 2025-12-18 04:22 | 13M | |
| py311-synced-collect..> | 2025-12-20 01:39 | 71K | |
| py311-synr-0.6.0_1.pkg | 2025-12-21 11:57 | 35K | |
| py311-syrupy-4.7.2.pkg | 2025-12-19 06:57 | 99K | |
| py311-sysctl-0.3.3.2..> | 2025-12-19 12:38 | 16K | |
| py311-sysv_ipc-1.1.0..> | 2025-12-23 13:34 | 20K | |
| py311-ta-lib-0.4.32_..> | 2025-12-27 00:47 | 296K | |
| py311-tables-3.10.2_..> | 2025-12-26 18:33 | 2.5M | |
| py311-tableschema-1...> | 2025-12-27 10:01 | 75K | |
| py311-tableschema-to..> | 2025-12-30 05:46 | 19K | |
| py311-tabletext-0.1_..> | 2025-12-20 05:56 | 11K | |
| py311-tablib-3.9.0.pkg | 2025-12-27 10:28 | 99K | |
| py311-tabulate-0.9.0..> | 2025-12-18 12:48 | 61K | |
| py311-tabulate2-1.10..> | 2025-12-21 09:29 | 70K | |
| py311-tabulator-1.53..> | 2025-12-28 14:11 | 84K | |
| py311-tahoe-lafs-1.2..> | 2025-12-30 15:13 | 2.5M | |
| py311-tailer-0.4.1_1..> | 2025-12-22 18:24 | 9.9K | |
| py311-tapi-0.1.7_3.pkg | 2025-12-23 16:56 | 7.8K | |
| py311-tarantool-1.2...> | 2025-12-19 11:08 | 164K | |
| py311-tarantool-queu..> | 2025-12-23 03:33 | 18K | |
| py311-tarsnapper-0.5..> | 2025-12-20 23:45 | 30K | |
| py311-tartiflette-1...> | 2025-12-19 15:05 | 313K | |
| py311-tartiflette-ai..> | 2025-12-22 21:55 | 27K | |
| py311-tartube-2.5.16..> | 2025-12-28 23:07 | 3.6M | |
| py311-taskflow-5.12...> | 2025-12-28 08:37 | 797K | |
| py311-taskgroup-0.2...> | 2025-12-20 10:07 | 28K | |
| py311-tasklib-2.5.1_..> | 2025-12-19 11:00 | 64K | |
| py311-taskw-2.0.0_3.pkg | 2025-12-19 05:28 | 77K | |
| py311-taxii2-client-..> | 2025-12-30 03:51 | 34K | |
| py311-tblib-3.2.2.pkg | 2025-12-18 06:55 | 20K | |
| py311-tdworkflow-0.9..> | 2025-12-28 13:27 | 42K | |
| py311-technical-1.5...> | 2025-12-27 08:28 | 88K | |
| py311-telepath-0.3.1..> | 2025-12-18 20:19 | 21K | |
| py311-tempora-5.8.1.pkg | 2025-12-18 17:31 | 28K | |
| py311-tenacity-9.0.0..> | 2025-12-18 13:34 | 48K | |
| py311-tenacity8-8.5...> | 2025-12-19 12:55 | 48K | |
| py311-tendo-0.3.0_1.pkg | 2025-12-21 12:02 | 39K | |
| py311-tensorflow-2.1..> | 2025-12-27 09:37 | 304M | |
| py311-term-backgroun..> | 2025-12-19 23:07 | 10K | |
| py311-term-image-0.7..> | 2025-12-27 14:45 | 117K | |
| py311-termcolor-3.2...> | 2025-12-18 11:36 | 11K | |
| py311-termcolor-whl-..> | 2025-12-23 01:41 | 7.0K | |
| py311-terminado-0.12..> | 2025-12-18 01:28 | 29K | |
| py311-terminaltables..> | 2025-12-20 04:05 | 25K | |
| py311-terminaltables..> | 2025-12-18 23:18 | 26K | |
| py311-terminaltextef..> | 2025-12-18 19:13 | 315K | |
| py311-termstyle-0.1...> | 2025-12-19 09:04 | 6.0K | |
| py311-termtosvg-1.1...> | 2025-12-20 05:31 | 90K | |
| py311-tes-1.1.1_1.pkg | 2025-12-27 16:13 | 14K | |
| py311-test-utils-0.1..> | 2025-12-20 17:09 | 5.4K | |
| py311-testfixtures-6..> | 2025-12-21 02:07 | 226K | |
| py311-testinfra-3.2...> | 2025-12-23 09:59 | 96K | |
| py311-testoob-1.15_3..> | 2025-12-23 15:26 | 209K | |
| py311-testpath-0.6.0..> | 2025-12-21 09:10 | 84K | |
| py311-testrepository..> | 2025-12-21 01:23 | 178K | |
| py311-testresources-..> | 2025-12-18 12:11 | 61K | |
| py311-testscenarios-..> | 2025-12-19 12:45 | 23K | |
| py311-testtools-2.8...> | 2025-12-19 01:07 | 404K | |
| py311-text-unidecode..> | 2025-12-18 07:23 | 56K | |
| py311-text2digits-0...> | 2025-12-19 12:36 | 20K | |
| py311-textX-3.1.1_1.pkg | 2025-12-19 08:06 | 142K | |
| py311-textdistance-4..> | 2025-12-29 05:42 | 67K | |
| py311-textfsm-2.1.0.pkg | 2025-12-18 13:03 | 71K | |
| py311-textile-4.0.3_..> | 2025-12-27 00:58 | 65K | |
| py311-texttable-1.7...> | 2025-12-18 19:51 | 19K | |
| py311-textual-6.9.0.pkg | 2025-12-27 17:54 | 1.3M | |
| py311-textual-autoco..> | 2025-12-29 18:03 | 28K | |
| py311-textual-image-..> | 2025-12-30 02:02 | 132K | |
| py311-textual-speedu..> | 2025-12-30 16:50 | 220K | |
| py311-textual0-0.89...> | 2025-12-20 02:25 | 1.2M | |
| py311-textualeffects..> | 2025-12-19 08:01 | 8.5K | |
| py311-textwrap3-0.9...> | 2025-12-19 03:19 | 15K | |
| py311-tflearn-0.3.2...> | 2025-12-28 10:10 | 232K | |
| py311-tflite-2.10.0.pkg | 2025-12-28 23:13 | 96K | |
| py311-tflite-support..> | 2025-12-29 11:48 | 416K | |
| py311-tftpy-0.8.6.pkg | 2025-12-19 17:33 | 53K | |
| py311-theano-1.0.5_3..> | 2025-12-27 09:42 | 4.3M | |
| py311-thefuzz-0.20.0..> | 2025-12-27 16:24 | 11K | |
| py311-thepassiveinve..> | 2025-12-28 19:04 | 21K | |
| py311-thermocouples_..> | 2025-12-29 13:56 | 28K | |
| py311-thewalrus-0.21..> | 2025-12-30 02:46 | 155K | |
| py311-thinc-9.1.1_3.pkg | 2025-12-30 02:10 | 821K | |
| py311-thinc8-8.3.10.pkg | 2025-12-27 01:07 | 840K | |
| py311-threadpoolctl-..> | 2025-12-18 08:10 | 35K | |
| py311-three-merge-0...> | 2025-12-22 10:47 | 7.0K | |
| py311-threema-msgapi..> | 2025-12-21 03:44 | 67K | |
| py311-thrift-0.22.0,..> | 2025-12-19 05:59 | 148K | |
| py311-thriftpy2-0.5...> | 2025-12-19 22:02 | 407K | |
| py311-throughpy-0.1_..> | 2025-12-21 09:41 | 4.1K | |
| py311-tiamat-7.10.3_..> | 2025-12-28 10:31 | 50K | |
| py311-ticketutil-1.8..> | 2025-12-30 12:15 | 57K | |
| py311-tifffile-2025...> | 2025-12-26 19:30 | 489K | |
| py311-tika-client-0...> | 2025-12-19 11:49 | 22K | |
| py311-tiktoken-0.12...> | 2025-12-27 01:36 | 789K | |
| py311-tiledb-0.36.0.pkg | 2025-12-29 04:36 | 1.3M | |
| py311-time-machine-2..> | 2025-12-18 12:42 | 25K | |
| py311-timelib-0.3.0_..> | 2025-12-22 03:39 | 137K | |
| py311-timeout-decora..> | 2025-12-19 02:19 | 8.2K | |
| py311-timm-1.0.22.pkg | 2025-12-26 22:24 | 2.7M | |
| py311-timm-vis-2.0.0..> | 2025-12-28 13:17 | 18K | |
| py311-timple-0.1.8_2..> | 2025-12-27 06:03 | 31K | |
| py311-tiny-proxy-0.2..> | 2025-12-23 12:41 | 21K | |
| py311-tinyaes-1.1.2.pkg | 2025-12-21 09:31 | 28K | |
| py311-tinyarray-1.2...> | 2025-12-20 19:05 | 53K | |
| py311-tinycss-0.4_1.pkg | 2025-12-19 22:33 | 79K | |
| py311-tinycss2-1.5.1..> | 2025-12-18 01:17 | 57K | |
| py311-tinynetrc-1.3...> | 2025-12-18 15:51 | 6.0K | |
| py311-tinyrpc-1.1.7.pkg | 2025-12-27 18:04 | 58K | |
| py311-tipper-0.1_1.pkg | 2025-12-21 18:33 | 7.1K | |
| py311-tkcolorpicker-..> | 2025-12-20 01:40 | 35K | |
| py311-tkinter-3.11.1..> | 2025-12-26 06:40 | 21K | |
| py311-tkrzw-0.1.32.pkg | 2025-12-21 01:34 | 74K | |
| py311-tktreectrl-2.0..> | 2025-12-29 21:46 | 64K | |
| py311-tld-0.11.11_1.pkg | 2025-12-19 22:08 | 116K | |
| py311-tldextract-5.3..> | 2025-12-26 21:08 | 112K | |
| py311-tldr-3.4.1.pkg | 2025-12-21 17:56 | 27K | |
| py311-tls-parser-2.0..> | 2025-12-24 02:01 | 21K | |
| py311-tlslite-0.4.9_..> | 2025-12-23 19:59 | 187K | |
| py311-tlslite-ng-0.8..> | 2025-12-22 16:39 | 524K | |
| py311-tlsrpt-reporte..> | 2025-12-20 12:20 | 79K | |
| py311-tlv8-0.10.0.pkg | 2025-12-19 01:49 | 18K | |
| py311-tmuxp-1.62.0.pkg | 2025-12-28 17:54 | 99K | |
| py311-tobler-0.12.1.pkg | 2025-12-27 03:04 | 50K | |
| py311-tofu-0.5_2.pkg | 2025-12-28 03:12 | 40K | |
| py311-toil-7.0.0_2.pkg | 2025-12-28 23:31 | 1.5M | |
| py311-tokenize-rt-6...> | 2025-12-19 17:27 | 10K | |
| py311-tokenizer-3.5...> | 2025-12-21 09:40 | 116K | |
| py311-tokenizers-0.2..> | 2025-12-27 00:17 | 1.5M | |
| py311-toml-0.10.2_1.pkg | 2025-12-16 01:40 | 42K | |
| py311-toml-fmt-commo..> | 2025-12-19 21:51 | 11K | |
| py311-tomli-2.3.0.pkg | 2025-12-18 09:51 | 28K | |
| py311-tomli-w-1.2.0.pkg | 2025-12-18 10:25 | 12K | |
| py311-tomlkit-0.13.3..> | 2025-12-18 03:57 | 277K | |
| py311-toolz-1.0.0_1.pkg | 2025-12-18 10:57 | 130K | |
| py311-toot-0.51.0.pkg | 2025-12-29 06:35 | 72K | |
| py311-tooz-7.0.0.pkg | 2025-12-23 05:08 | 167K | |
| py311-toposort-1.5_1..> | 2025-12-19 06:40 | 6.5K | |
| py311-torch-geometri..> | 2025-12-30 18:20 | 1.7M | |
| py311-torchao-0.13.0..> | 2025-12-30 04:37 | 1.7M | |
| py311-torchaudio-2.8..> | 2025-12-26 23:36 | 889K | |
| py311-torchdata-0.11..> | 2025-12-28 10:53 | 98K | |
| py311-torchmetrics-1..> | 2025-12-27 02:44 | 950K | |
| py311-torchsummary-1..> | 2025-12-28 00:12 | 6.0K | |
| py311-torchvision-0...> | 2025-12-26 18:02 | 1.3M | |
| py311-tornado-6.5.pkg | 2025-12-18 00:52 | 856K | |
| py311-toronado-0.1.0..> | 2025-12-22 21:51 | 10K | |
| py311-torrequest-0.1..> | 2025-12-27 13:15 | 4.1K | |
| py311-towncrier-25.8..> | 2025-12-18 00:49 | 123K | |
| py311-tox-4.32.0.pkg | 2025-12-26 23:54 | 351K | |
| py311-tox-toml-fmt-1..> | 2025-12-30 02:37 | 352K | |
| py311-toxcore-c-0.2...> | 2025-12-30 18:48 | 21K | |
| py311-toyplot-0.19.0..> | 2025-12-28 21:07 | 398K | |
| py311-tqdm-4.67.1.pkg | 2025-12-18 09:16 | 127K | |
| py311-traceback2-1.4..> | 2025-12-19 13:06 | 40K | |
| py311-tradingview-ta..> | 2025-12-28 14:37 | 18K | |
| py311-trailrunner-1...> | 2025-12-18 22:31 | 25K | |
| py311-trainstation-1..> | 2025-12-27 10:28 | 48K | |
| py311-traitlets-5.14..> | 2025-12-18 00:33 | 177K | |
| py311-traits-7.0.2_1..> | 2025-12-18 04:03 | 5.1M | |
| py311-traitsui-8.0.0..> | 2025-12-26 11:53 | 1.8M | |
| py311-traittypes-0.2..> | 2025-12-18 19:26 | 16K | |
| py311-trakit-0.2.5.pkg | 2025-12-19 17:15 | 31K | |
| py311-transaction-3...> | 2025-12-19 10:13 | 97K | |
| py311-transformers-4..> | 2025-12-27 03:34 | 13M | |
| py311-transip-2.1.2_..> | 2025-12-29 03:14 | 30K | |
| py311-transitions-0...> | 2025-12-18 17:28 | 144K | |
| py311-translationstr..> | 2025-12-18 21:12 | 26K | |
| py311-transmission-r..> | 2025-12-28 04:24 | 61K | |
| py311-transpopy-0.2...> | 2025-12-28 06:32 | 8.6K | |
| py311-trash-cli-0.24..> | 2025-12-23 00:24 | 158K | |
| py311-tree-format-0...> | 2025-12-22 00:35 | 7.9K | |
| py311-tree-sitter-0...> | 2025-12-18 18:47 | 116K | |
| py311-tree-sitter-ba..> | 2025-12-23 20:59 | 151K | |
| py311-tree-sitter-cs..> | 2025-12-20 08:45 | 25K | |
| py311-tree-sitter-go..> | 2025-12-23 04:56 | 39K | |
| py311-tree-sitter-ja..> | 2025-12-21 05:20 | 52K | |
| py311-tree-sitter-la..> | 2025-12-22 15:19 | 9.7M | |
| py311-tree-sitter-la..> | 2025-12-19 01:06 | 4.8M | |
| py311-tree-sitter-py..> | 2025-12-21 09:13 | 59K | |
| py311-tree-sitter-re..> | 2025-12-20 15:04 | 12K | |
| py311-tree-sitter-ya..> | 2025-12-22 15:58 | 29K | |
| py311-tree-sitter023..> | 2025-12-19 07:11 | 119K | |
| py311-treelib-1.7.1_..> | 2025-12-23 19:24 | 38K | |
| py311-tremc-0.9.5.pkg | 2025-12-22 17:06 | 48K | |
| py311-treq-22.2.0_3.pkg | 2025-12-27 02:08 | 131K | |
| py311-trezor-0.13.10..> | 2025-12-27 16:23 | 459K | |
| py311-triangle-20230..> | 2025-12-18 23:56 | 1.1M | |
| py311-trimesh-3.5.25..> | 2025-12-27 12:02 | 760K | |
| py311-trio-0.32.0.pkg | 2025-12-18 01:18 | 1.0M | |
| py311-trio-websocket..> | 2025-12-18 15:31 | 34K | |
| py311-trove-classifi..> | 2025-12-16 01:39 | 18K | |
| py311-trueskill-0.4...> | 2025-12-20 20:12 | 39K | |
| py311-trustme-1.2.1_..> | 2025-12-30 09:02 | 25K | |
| py311-truststore-0.1..> | 2025-12-18 01:29 | 38K | |
| py311-trx-python-0.3..> | 2025-12-19 07:11 | 92K | |
| py311-ttfautohint-py..> | 2025-12-27 17:59 | 43K | |
| py311-ttictoc-0.5.6_..> | 2025-12-29 17:32 | 7.6K | |
| py311-ttkbootstrap-1..> | 2025-12-27 02:41 | 315K | |
| py311-ttp-0.10.0.pkg | 2025-12-18 17:02 | 161K | |
| py311-ttp-templates-..> | 2025-12-19 01:32 | 43K | |
| py311-ttrv-1.27.3_2.pkg | 2025-12-30 04:54 | 299K | |
| py311-ttystatus-0.36..> | 2025-12-19 20:30 | 39K | |
| py311-tuir-1.29.0_3.pkg | 2025-12-30 05:23 | 307K | |
| py311-tvdb_api-3.1.0..> | 2025-12-27 03:12 | 30K | |
| py311-tvm-0.19.0.pkg | 2025-12-23 13:26 | 19M | |
| py311-tvnamer-3.0.4_..> | 2025-12-29 07:18 | 53K | |
| py311-tweedledum-1.1..> | 2025-12-20 09:08 | 847K | |
| py311-tweepy-4.16.0.pkg | 2025-12-27 09:03 | 141K | |
| py311-twiggy-0.5.1_1..> | 2025-12-21 09:09 | 50K | |
| py311-twilio-7.17.0_..> | 2025-12-28 13:15 | 1.0M | |
| py311-twine-6.2.0.pkg | 2025-12-27 01:19 | 75K | |
| py311-twisted-25.5.0..> | 2025-12-26 06:43 | 5.8M | |
| py311-twitter-tools-..> | 2025-12-20 22:19 | 96K | |
| py311-txaio-22.2.1_1..> | 2025-12-26 17:49 | 37K | |
| py311-txamqp-0.8.2_1..> | 2025-12-28 10:56 | 107K | |
| py311-txi2p-tahoe-0...> | 2025-12-27 15:50 | 91K | |
| py311-txredisapi-1.4..> | 2025-12-29 18:03 | 59K | |
| py311-txrestapi-0.2_..> | 2025-12-23 13:59 | 12K | |
| py311-txt2tags-3.9_1..> | 2025-12-20 04:06 | 99K | |
| py311-txtorcon-24.8...> | 2025-12-27 00:34 | 318K | |
| py311-ty-0.0.5.pkg | 2025-12-28 21:34 | 6.3M | |
| py311-typechecks-0.1..> | 2025-12-20 00:44 | 4.7K | |
| py311-typecode-30.0...> | 2025-12-27 10:43 | 1.5M | |
| py311-typeguard-4.4...> | 2025-12-19 00:03 | 82K | |
| py311-typer-0.20.0.pkg | 2025-12-18 12:10 | 106K | |
| py311-typer-slim-0.2..> | 2025-12-18 14:24 | 106K | |
| py311-types-decorato..> | 2025-12-21 13:42 | 2.8K | |
| py311-types-docutils..> | 2025-12-23 16:32 | 47K | |
| py311-types-jsonsche..> | 2025-12-21 09:36 | 7.5K | |
| py311-types-mock-5.2..> | 2025-12-21 18:59 | 9.5K | |
| py311-types-protobuf..> | 2025-12-26 18:44 | 51K | |
| py311-types-psutil-7..> | 2025-12-26 15:55 | 20K | |
| py311-types-psycopg2..> | 2025-12-20 16:09 | 20K | |
| py311-types-python-d..> | 2025-12-18 21:06 | 6.3K | |
| py311-types-pyyaml-6..> | 2025-12-18 18:54 | 15K | |
| py311-types-requests..> | 2025-12-26 19:34 | 16K | |
| py311-types-retry-0...> | 2025-12-19 23:00 | 2.2K | |
| py311-types-setuptoo..> | 2025-12-18 13:07 | 34K | |
| py311-types-toml-0.1..> | 2025-12-19 09:51 | 4.0K | |
| py311-types_pygments..> | 2025-12-18 19:52 | 11K | |
| py311-typeshed-clien..> | 2025-12-18 13:58 | 375K | |
| py311-typing-extensi..> | 2025-12-16 01:38 | 92K | |
| py311-typing-inspect..> | 2025-12-18 12:02 | 20K | |
| py311-typing-inspect..> | 2025-12-18 03:48 | 22K | |
| py311-typogrify-2.1...> | 2025-12-16 01:40 | 22K | |
| py311-typst-0.14.4.pkg | 2025-12-27 05:43 | 15M | |
| py311-tzdata-2025.3.pkg | 2025-12-18 00:53 | 124K | |
| py311-tzlocal-5.2.pkg | 2025-12-18 18:38 | 35K | |
| py311-u-msgpack-pyth..> | 2025-12-18 18:00 | 21K | |
| py311-ua_parser-0.7...> | 2025-12-19 13:06 | 57K | |
| py311-ubelt-1.4.0.pkg | 2025-12-23 17:34 | 310K | |
| py311-uc-micro-py-1...> | 2025-12-18 20:57 | 6.4K | |
| py311-ucl-0.9.3.pkg | 2025-12-19 05:41 | 7.5K | |
| py311-ueberzug-18.1...> | 2025-12-27 10:28 | 84K | |
| py311-ufal.udpipe-1...> | 2025-12-21 02:04 | 626K | |
| py311-ufmt-2.9.0.pkg | 2025-12-29 20:12 | 65K | |
| py311-ufo2ft-2.30.0_..> | 2025-12-27 10:00 | 192K | |
| py311-ufoLib-2.3.2_4..> | 2025-12-30 10:48 | 208K | |
| py311-ufolib2-0.18.1..> | 2025-12-26 17:35 | 97K | |
| py311-ufolint-1.2.0_..> | 2025-12-27 19:43 | 33K | |
| py311-ufomerge-1.9.6..> | 2025-12-27 13:04 | 42K | |
| py311-ufonormalizer-..> | 2025-12-18 11:54 | 42K | |
| py311-ufoprocessor-1..> | 2025-12-26 15:09 | 50K | |
| py311-uharfbuzz-0.53..> | 2025-12-27 01:12 | 198K | |
| py311-uhashring-2.4.pkg | 2025-12-20 04:01 | 19K | |
| py311-uhi-0.5.0.pkg | 2025-12-26 20:35 | 23K | |
| py311-uhid-freebsd-1..> | 2025-12-20 13:06 | 44K | |
| py311-uiCA-g20240114..> | 2025-12-28 17:04 | 4.1M | |
| py311-ujson-5.11.0.pkg | 2025-12-18 18:21 | 53K | |
| py311-umap-learn-0.5..> | 2025-12-30 02:12 | 183K | |
| py311-uncertainties-..> | 2025-12-26 19:47 | 83K | |
| py311-undefined-0.0...> | 2025-12-23 07:46 | 5.3K | |
| py311-unearth-0.18.1..> | 2025-12-19 23:07 | 106K | |
| py311-unicode-segmen..> | 2025-12-27 10:31 | 220K | |
| py311-unicodecsv-0.1..> | 2025-12-18 17:51 | 30K | |
| py311-unicodedata2-1..> | 2025-12-18 01:29 | 395K | |
| py311-unicodeitplus-..> | 2025-12-21 02:22 | 61K | |
| py311-unicorn-2.0.1p..> | 2025-12-19 23:04 | 65K | |
| py311-unidecode-1.3...> | 2025-12-18 23:19 | 221K | |
| py311-unidep-0.69.0.pkg | 2025-12-27 22:43 | 115K | |
| py311-unidic-1.1.0_2..> | 2025-12-29 15:02 | 10K | |
| py311-unidiff-0.7.5_..> | 2025-12-19 19:23 | 20K | |
| py311-unittest-paral..> | 2025-12-22 16:08 | 17K | |
| py311-unittest2-1.1...> | 2025-12-23 14:32 | 222K | |
| py311-unittest2pytes..> | 2025-12-22 16:26 | 21K | |
| py311-unmessage-0.2...> | 2025-12-29 16:27 | 105K | |
| py311-unpaddedbase64..> | 2025-12-18 19:48 | 6.6K | |
| py311-unqlite-0.9.9_..> | 2025-12-22 15:36 | 287K | |
| py311-untangle-1.2.1..> | 2025-12-19 23:34 | 9.2K | |
| py311-untokenize-0.1..> | 2025-12-19 00:03 | 4.0K | |
| py311-unyt-3.0.3.pkg | 2025-12-27 09:59 | 310K | |
| py311-update_checker..> | 2025-12-26 18:49 | 12K | |
| py311-uproot-5.6.8.pkg | 2025-12-30 10:59 | 748K | |
| py311-uptime-3.0.1_1..> | 2025-12-21 03:04 | 13K | |
| py311-urbanaccess-0...> | 2025-12-28 10:17 | 95K | |
| py311-urbansim-3.2_3..> | 2025-12-30 17:25 | 131K | |
| py311-uri-template-1..> | 2025-12-18 01:36 | 23K | |
| py311-uritemplate-4...> | 2025-12-18 10:58 | 23K | |
| py311-uritools-5.0.0..> | 2025-12-18 17:11 | 21K | |
| py311-url-normalize-..> | 2025-12-18 18:10 | 10K | |
| py311-urlextract-1.9..> | 2025-12-28 21:28 | 39K | |
| py311-urlgrabber-4.0..> | 2025-12-22 10:38 | 109K | |
| py311-urlimport-0.42..> | 2025-12-20 11:02 | 6.6K | |
| py311-urllib3-2.6.2,..> | 2025-12-24 20:05 | 232K | |
| py311-urllib3-future..> | 2025-12-26 19:43 | 520K | |
| py311-urllib31-1.26...> | 2025-12-22 05:03 | 241K | |
| py311-urlman-1.2.0_1..> | 2025-12-20 23:16 | 7.2K | |
| py311-urlobject-2.4...> | 2025-12-19 08:54 | 31K | |
| py311-urlscan-1.0.7.pkg | 2025-12-21 13:08 | 66K | |
| py311-urlwatch-2.29_..> | 2025-12-29 19:47 | 355K | |
| py311-urwid-2.6.16.pkg | 2025-12-18 20:27 | 548K | |
| py311-urwid-readline..> | 2025-12-19 03:04 | 21K | |
| py311-urwidgets-0.2...> | 2025-12-19 13:05 | 25K | |
| py311-urwidtrees-1.0..> | 2025-12-19 22:44 | 35K | |
| py311-us-2.0.2_1.pkg | 2025-12-23 06:26 | 20K | |
| py311-usbtmc-0.8_2.pkg | 2025-12-22 14:36 | 20K | |
| py311-user_agent-0.1..> | 2025-12-18 23:14 | 25K | |
| py311-user_agents-1...> | 2025-12-21 05:55 | 16K | |
| py311-userpath-1.9.2..> | 2025-12-18 11:33 | 20K | |
| py311-usort-1.0.8.po..> | 2025-12-27 09:25 | 81K | |
| py311-ustreamer-6.42..> | 2025-12-28 08:34 | 8.0K | |
| py311-utidylib-0.10.pkg | 2025-12-22 10:44 | 21K | |
| py311-utm-0.8.1.pkg | 2025-12-20 00:39 | 14K | |
| py311-uuid-utils-0.1..> | 2025-12-26 16:06 | 242K | |
| py311-uuid7-0.1.0.pkg | 2025-12-22 09:21 | 12K | |
| py311-uv-0.9.17.pkg | 2025-12-26 16:26 | 16K | |
| py311-uv-build-0.9.1..> | 2025-12-26 09:56 | 10K | |
| py311-uv-build08-0.8..> | 2025-12-28 12:29 | 1.6M | |
| py311-uv-bump-0.4.0.pkg | 2025-12-28 00:50 | 9.4K | |
| py311-uv-dynamic-ver..> | 2025-12-26 18:05 | 23K | |
| py311-uvicorn-0.38.0..> | 2025-12-18 12:40 | 133K | |
| py311-uvloop-0.21.0_..> | 2025-12-19 23:08 | 600K | |
| py311-vaderSentiment..> | 2025-12-29 22:33 | 118K | |
| py311-valerius-0.2_1..> | 2025-12-27 09:34 | 7.9K | |
| py311-validate-pypro..> | 2025-12-23 13:34 | 84K | |
| py311-validate-pypro..> | 2025-12-19 12:36 | 71K | |
| py311-validate_email..> | 2025-12-20 04:03 | 8.2K | |
| py311-validators-0.3..> | 2025-12-19 02:29 | 65K | |
| py311-validictory-1...> | 2025-12-24 06:01 | 24K | |
| py311-valinvest-0.0...> | 2025-12-20 07:27 | 21K | |
| py311-valkey-6.1.1_1..> | 2025-12-27 19:23 | 482K | |
| py311-varstack-g.201..> | 2025-12-21 19:42 | 8.8K | |
| py311-vatnumber-1.2_..> | 2025-12-18 15:51 | 11K | |
| py311-vbuild-0.8.2_1..> | 2025-12-18 19:04 | 20K | |
| py311-vcrpy-8.1.0.pkg | 2025-12-18 12:10 | 93K | |
| py311-vcver-0.2.12_1..> | 2025-12-22 10:17 | 22K | |
| py311-vcversioner-2...> | 2025-12-19 11:33 | 11K | |
| py311-vdirsyncer-0.2..> | 2025-12-27 17:44 | 136K | |
| py311-vecrec-0.3.1_1..> | 2025-12-19 17:14 | 25K | |
| py311-vector-1.7.0.pkg | 2025-12-30 11:06 | 264K | |
| py311-vedo-2025.5.4.pkg | 2025-12-28 13:40 | 3.2M | |
| py311-vendy-0.0.3.pkg | 2025-12-29 07:43 | 18K | |
| py311-venusian-3.1.1..> | 2025-12-18 21:39 | 20K | |
| py311-verboselogs-1...> | 2025-12-20 07:50 | 10K | |
| py311-verilog_parser..> | 2025-12-21 17:47 | 17K | |
| py311-versioneer-0.2..> | 2025-12-18 00:47 | 44K | |
| py311-versioneer-518..> | 2025-12-20 11:45 | 32K | |
| py311-versioningit-3..> | 2025-12-18 21:30 | 72K | |
| py311-versiontools-1..> | 2025-12-18 23:57 | 23K | |
| py311-verspec-0.1.0_..> | 2025-12-19 22:20 | 36K | |
| py311-veusz-4.2.pkg | 2025-12-30 06:32 | 2.0M | |
| py311-vfblib-0.10.6.pkg | 2025-12-29 11:32 | 210K | |
| py311-vharfbuzz-0.3...> | 2025-12-27 18:42 | 13K | |
| py311-vici-6.0.3.pkg | 2025-12-22 05:21 | 21K | |
| py311-viewvc-devel-1..> | 2025-12-22 17:35 | 383K | |
| py311-vim-bridge-0.6..> | 2025-12-23 11:22 | 6.0K | |
| py311-vincenty-0.1.4..> | 2025-12-21 20:27 | 5.1K | |
| py311-vine-5.1.0_1.pkg | 2025-12-18 10:00 | 16K | |
| py311-virtualenv-20...> | 2025-12-26 11:57 | 4.6M | |
| py311-virtualenv-api..> | 2025-12-21 05:57 | 16K | |
| py311-virtualenv-clo..> | 2025-12-19 19:51 | 14K | |
| py311-virtualenvwrap..> | 2025-12-29 13:14 | 246K | |
| py311-virustotal-api..> | 2025-12-20 00:19 | 21K | |
| py311-visidata-2.11_..> | 2025-12-22 19:56 | 617K | |
| py311-visitor-0.1.3_..> | 2025-12-19 22:43 | 4.2K | |
| py311-vispy-0.15.2.pkg | 2025-12-26 18:06 | 1.7M | |
| py311-vistir-0.8.0.pkg | 2025-12-20 10:28 | 79K | |
| py311-vit-2.3.3.pkg | 2025-12-23 12:56 | 183K | |
| py311-vobject-0.9.6...> | 2025-12-18 18:41 | 101K | |
| py311-volatility3-2...> | 2025-12-30 16:28 | 958K | |
| py311-voluptuous-0.1..> | 2025-12-19 22:18 | 65K | |
| py311-voluptuous-ser..> | 2025-12-21 02:29 | 4.7K | |
| py311-vorta-0.11.1.pkg | 2025-12-30 04:40 | 847K | |
| py311-vosk-0.3.50_1.pkg | 2025-12-29 11:33 | 25K | |
| py311-vpn-slice-0.16..> | 2025-12-27 20:10 | 61K | |
| py311-vsts-0.1.25_1.pkg | 2025-12-27 10:43 | 1.1M | |
| py311-vsts-cd-manage..> | 2025-12-28 13:09 | 32K | |
| py311-vulndb-0.0.19_..> | 2025-12-24 07:04 | 49K | |
| py311-vulture-2.9.1_..> | 2025-12-20 02:26 | 50K | |
| py311-vunit-hdl-4.7...> | 2025-12-22 13:39 | 853K | |
| py311-w3lib-1.21.0_1..> | 2025-12-18 15:59 | 35K | |
| py311-wadllib-1.3.6_..> | 2025-12-18 15:56 | 54K | |
| py311-wagtail-2fa-1...> | 2025-12-28 04:44 | 28K | |
| py311-wagtail-7.2.1_..> | 2025-12-27 18:24 | 6.9M | |
| py311-wagtail-airtab..> | 2025-12-28 01:42 | 41K | |
| py311-wagtail-bakery..> | 2025-12-28 20:28 | 17K | |
| py311-wagtail-factor..> | 2025-12-28 07:21 | 20K | |
| py311-wagtail-locali..> | 2025-12-28 03:05 | 364K | |
| py311-wagtail-transf..> | 2025-12-30 17:23 | 277K | |
| py311-wait-for2-0.4...> | 2025-12-23 20:01 | 9.0K | |
| py311-waitress-3.0.2..> | 2025-12-18 17:11 | 104K | |
| py311-wandb-0.17.9_4..> | 2025-12-29 00:48 | 7.1M | |
| py311-wapiti-3.0.3_1..> | 2025-12-30 02:58 | 531K | |
| py311-warctools-4.10..> | 2025-12-22 14:51 | 75K | |
| py311-warlock-2.1.0.pkg | 2025-12-26 21:02 | 13K | |
| py311-warpinator-1.8..> | 2025-12-28 12:51 | 331K | |
| py311-wasabi-1.1.3.pkg | 2025-12-18 18:46 | 52K | |
| py311-wassima-2.0.2.pkg | 2025-12-18 15:25 | 145K | |
| py311-watchdog-6.0.0..> | 2025-12-18 09:04 | 317K | |
| py311-watchfiles-1.1..> | 2025-12-26 23:32 | 336K | |
| py311-watchgod-0.8.2..> | 2025-12-20 09:25 | 24K | |
| py311-watermark-2.5...> | 2025-12-30 15:55 | 15K | |
| py311-wavedrom-2.0.3..> | 2025-12-18 17:20 | 70K | |
| py311-wavio-0.0.9_1.pkg | 2025-12-29 16:28 | 13K | |
| py311-waypaper-2.7.pkg | 2025-12-28 21:20 | 88K | |
| py311-wcag-contrast-..> | 2025-12-23 13:56 | 3.3K | |
| py311-wcmatch-10.1.pkg | 2025-12-18 21:25 | 91K | |
| py311-wcwidth-0.2.8_..> | 2025-12-18 01:37 | 33K | |
| py311-weasel-0.4.3.pkg | 2025-12-26 21:40 | 97K | |
| py311-weasyprint-61...> | 2025-12-30 03:57 | 589K | |
| py311-web2ldap-1.8.1..> | 2025-12-30 14:58 | 667K | |
| py311-webargs-8.7.1.pkg | 2025-12-18 17:36 | 56K | |
| py311-webassets-2.0_..> | 2025-12-18 20:20 | 223K | |
| py311-webauthn-2.7.0..> | 2025-12-30 01:16 | 102K | |
| py311-webcolors-24.8..> | 2025-12-18 01:27 | 24K | |
| py311-webdriver_mana..> | 2025-12-26 22:40 | 37K | |
| py311-webencodings-0..> | 2025-12-16 03:15 | 20K | |
| py311-weblib-0.1.30_..> | 2025-12-19 03:06 | 75K | |
| py311-webob-1.8.7_1.pkg | 2025-12-18 12:09 | 505K | |
| py311-webpy-0.62_1.pkg | 2025-12-19 19:49 | 187K | |
| py311-webrtcvad-2.0...> | 2025-12-19 17:17 | 29K | |
| py311-websocket-clie..> | 2025-12-18 01:47 | 104K | |
| py311-websockets-15...> | 2025-12-18 10:11 | 258K | |
| py311-websockify-0.1..> | 2025-12-30 08:13 | 83K | |
| py311-webtest-3.0.0_..> | 2025-12-19 00:50 | 74K | |
| py311-webunit-1.3.10..> | 2025-12-23 05:38 | 47K | |
| py311-weechat-otr-1...> | 2025-12-22 16:48 | 17K | |
| py311-werkzeug-3.1.4..> | 2025-12-18 10:08 | 528K | |
| py311-werkzeug2-2.3...> | 2025-12-20 20:22 | 551K | |
| py311-wfuzz-3.1.0_1.pkg | 2025-12-20 04:25 | 273K | |
| py311-whatthepatch-1..> | 2025-12-18 20:37 | 23K | |
| py311-wheel-0.45.1.pkg | 2025-12-16 01:37 | 144K | |
| py311-wheel-filename..> | 2025-12-20 05:39 | 8.6K | |
| py311-wheel044-0.44...> | 2025-12-16 01:36 | 138K | |
| py311-whichcraft-0.6..> | 2025-12-21 06:29 | 5.6K | |
| py311-whisper-1.1.10..> | 2025-12-24 07:19 | 46K | |
| py311-whistle-2.1.4.pkg | 2025-12-19 22:44 | 18K | |
| py311-whitenoise-6.2..> | 2025-12-20 00:28 | 42K | |
| py311-whois-0.9.27_2..> | 2025-12-23 12:41 | 59K | |
| py311-whoosh-2.7.4_1..> | 2025-12-19 14:40 | 805K | |
| py311-widgetsnbexten..> | 2025-12-18 07:21 | 863K | |
| py311-wikipedia-1.4...> | 2025-12-30 00:42 | 22K | |
| py311-wikitools-1.1...> | 2025-12-20 18:21 | 47K | |
| py311-willow-1.12.0.pkg | 2025-12-26 22:17 | 120K | |
| py311-wimpy-0.6_1.pkg | 2025-12-20 00:32 | 7.3K | |
| py311-wirerope-1.0.0..> | 2025-12-19 09:21 | 18K | |
| py311-wlc-1.15_1.pkg | 2025-12-28 11:46 | 85K | |
| py311-wmi-query-0.1...> | 2025-12-30 08:19 | 7.4K | |
| py311-woob-3.7_3.pkg | 2025-12-27 15:16 | 842K | |
| py311-woob-qt-2.0.27..> | 2025-12-28 07:06 | 358K | |
| py311-woops-0.2.1_1.pkg | 2025-12-20 04:52 | 8.5K | |
| py311-wordcloud-1.9...> | 2025-12-27 01:45 | 166K | |
| py311-wordnet-2.0.1_..> | 2025-12-22 13:35 | 7.6M | |
| py311-wordninja-2.0...> | 2025-12-19 06:04 | 532K | |
| py311-wpgtk-6.7.0_1.pkg | 2025-12-30 18:26 | 82K | |
| py311-wrapt-1.17.3.pkg | 2025-12-18 04:16 | 54K | |
| py311-wsdd-0.9.pkg | 2025-12-20 05:25 | 25K | |
| py311-wsgi-intercept..> | 2025-12-20 07:50 | 52K | |
| py311-wsgi_xmlrpc-0...> | 2025-12-21 13:20 | 4.8K | |
| py311-wsgitools-0.3...> | 2025-12-20 23:26 | 69K | |
| py311-wsgiutils-0.7...> | 2025-12-20 08:57 | 26K | |
| py311-wsme-0.12.1.pkg | 2025-12-21 21:51 | 165K | |
| py311-wsproto-1.3.2.pkg | 2025-12-18 01:09 | 51K | |
| py311-wtf-peewee-3.0..> | 2025-12-27 17:05 | 33K | |
| py311-wtforms-3.1.2_..> | 2025-12-26 23:55 | 390K | |
| py311-wurlitzer-3.1...> | 2025-12-27 09:47 | 18K | |
| py311-wxPython42-4.2..> | 2025-12-26 17:47 | 9.6M | |
| py311-x-wr-timezone-..> | 2025-12-18 16:14 | 15K | |
| py311-xandikos-0.2.1..> | 2025-12-29 12:51 | 215K | |
| py311-xapian-1.4.30.pkg | 2025-12-19 22:23 | 800K | |
| py311-xarray-2025.12..> | 2025-12-26 18:52 | 3.0M | |
| py311-xarray-einstat..> | 2025-12-26 23:31 | 58K | |
| py311-xarray-simlab-..> | 2025-12-28 16:27 | 193K | |
| py311-xasm-1.2.2.pkg | 2025-12-21 12:56 | 42K | |
| py311-xattr-1.3.0.pkg | 2025-12-18 22:12 | 29K | |
| py311-xbout-0.3.5_4.pkg | 2025-12-29 07:30 | 244K | |
| py311-xcffib-1.11.2.pkg | 2025-12-18 10:35 | 278K | |
| py311-xdg-0.28_1.pkg | 2025-12-18 17:06 | 102K | |
| py311-xdg-base-dirs-..> | 2025-12-21 21:48 | 5.7K | |
| py311-xdis-6.1.8.pkg | 2025-12-19 03:27 | 275K | |
| py311-xdoctest-1.2.0..> | 2025-12-23 17:16 | 230K | |
| py311-xdot-1.6.pkg | 2025-12-26 20:13 | 89K | |
| py311-xenaPython-1.0..> | 2025-12-22 02:17 | 27K | |
| py311-xerox-0.4.1_1.pkg | 2025-12-19 20:51 | 8.5K | |
| py311-xformers-0.0.2..> | 2025-12-28 06:05 | 1.0M | |
| py311-xgboost-2.1.4.pkg | 2025-12-27 03:46 | 1.6M | |
| py311-xhtml2pdf-0.2...> | 2025-12-27 22:52 | 272K | |
| py311-xist-5.34_4.pkg | 2025-12-28 07:21 | 1.1M | |
| py311-xkcdpass-1.17...> | 2025-12-22 07:00 | 1.4M | |
| py311-xlmmacrodeobfu..> | 2025-12-30 07:59 | 120K | |
| py311-xlrd-2.0.2.pkg | 2025-12-18 17:52 | 199K | |
| py311-xlrd2-1.3.4_1.pkg | 2025-12-19 08:06 | 243K | |
| py311-xlutils-2.0.0_..> | 2025-12-22 13:08 | 90K | |
| py311-xlwt-1.3.0_1.pkg | 2025-12-18 16:36 | 203K | |
| py311-xml-default-di..> | 2025-12-22 08:40 | 5.8K | |
| py311-xml2rfc-3.31.0..> | 2025-12-26 20:44 | 597K | |
| py311-xmldiff-2.7.0_..> | 2025-12-22 09:22 | 91K | |
| py311-xmlschema-4.2...> | 2025-12-18 17:18 | 702K | |
| py311-xmlsec-1.3.17.pkg | 2025-12-18 12:31 | 37K | |
| py311-xmltodict-1.0...> | 2025-12-18 23:22 | 22K | |
| py311-xmod-1.8.1.pkg | 2025-12-18 12:49 | 7.4K | |
| py311-xmodem-0.4.5_1..> | 2025-12-20 03:07 | 35K | |
| py311-xonsh-0.22.0.pkg | 2025-12-29 19:04 | 1.2M | |
| py311-xopen-2.0.2.pkg | 2025-12-18 19:31 | 29K | |
| py311-xrootd-5.9.1.pkg | 2025-12-29 11:32 | 106K | |
| py311-xsdata-25.7_2.pkg | 2025-12-19 15:38 | 444K | |
| py311-xsdata-attrs-2..> | 2025-12-21 01:00 | 13K | |
| py311-xsdata-plantum..> | 2025-12-30 07:16 | 7.6K | |
| py311-xsdata-pydanti..> | 2025-12-29 10:37 | 15K | |
| py311-xstatic-1.0.3_..> | 2025-12-19 09:58 | 5.3K | |
| py311-xstatic-angula..> | 2025-12-19 09:27 | 372K | |
| py311-xstatic-angula..> | 2025-12-19 09:10 | 52K | |
| py311-xstatic-angula..> | 2025-12-19 17:44 | 143K | |
| py311-xstatic-angula..> | 2025-12-20 00:30 | 12K | |
| py311-xstatic-angula..> | 2025-12-19 22:31 | 5.7K | |
| py311-xstatic-angula..> | 2025-12-19 09:58 | 37K | |
| py311-xstatic-autosi..> | 2025-12-19 22:25 | 7.5K | |
| py311-xstatic-bootst..> | 2025-12-23 03:15 | 299K | |
| py311-xstatic-bootst..> | 2025-12-19 08:19 | 35K | |
| py311-xstatic-bootst..> | 2025-12-19 15:16 | 183K | |
| py311-xstatic-bootst..> | 2025-12-19 11:41 | 195K | |
| py311-xstatic-bootsw..> | 2025-12-19 20:59 | 659K | |
| py311-xstatic-ckedit..> | 2025-12-19 23:22 | 553K | |
| py311-xstatic-d3-3.5..> | 2025-12-19 11:22 | 68K | |
| py311-xstatic-font-a..> | 2025-12-19 08:32 | 1.7M | |
| py311-xstatic-hogan-..> | 2025-12-19 17:18 | 8.0K | |
| py311-xstatic-jasmin..> | 2025-12-19 14:36 | 35K | |
| py311-xstatic-jquery..> | 2025-12-19 02:18 | 161K | |
| py311-xstatic-jquery..> | 2025-12-20 04:06 | 39K | |
| py311-xstatic-jquery..> | 2025-12-19 08:33 | 14K | |
| py311-xstatic-jquery..> | 2025-12-19 22:37 | 497K | |
| py311-xstatic-jquery..> | 2025-12-19 15:32 | 8.0K | |
| py311-xstatic-jquery..> | 2025-12-20 02:08 | 20K | |
| py311-xstatic-jsencr..> | 2025-12-19 11:00 | 32K | |
| py311-xstatic-mdi-1...> | 2025-12-20 00:39 | 558K | |
| py311-xstatic-object..> | 2025-12-19 08:33 | 4.9K | |
| py311-xstatic-pygmen..> | 2025-12-20 00:26 | 12K | |
| py311-xstatic-ricksh..> | 2025-12-19 21:50 | 27K | |
| py311-xstatic-roboto..> | 2025-12-19 08:04 | 3.9M | |
| py311-xstatic-smart-..> | 2025-12-19 22:53 | 13K | |
| py311-xstatic-spin-1..> | 2025-12-19 15:01 | 6.2K | |
| py311-xstatic-svg-ed..> | 2025-12-19 18:20 | 624K | |
| py311-xstatic-term.j..> | 2025-12-19 21:53 | 35K | |
| py311-xstatic-tv4-1...> | 2025-12-19 10:44 | 22K | |
| py311-xxdiff-scripts..> | 2025-12-29 16:27 | 120K | |
| py311-xxhash-3.6.0.pkg | 2025-12-18 13:09 | 15K | |
| py311-xyzservices-20..> | 2025-12-18 23:26 | 45K | |
| py311-yacs-0.1.8_2.pkg | 2025-12-18 21:31 | 24K | |
| py311-yahooquery-2.3..> | 2025-12-27 16:27 | 101K | |
| py311-yamllint-1.37...> | 2025-12-19 10:59 | 84K | |
| py311-yamlordereddic..> | 2025-12-18 16:02 | 5.1K | |
| py311-yapf-0.43.0.pkg | 2025-12-19 01:00 | 403K | |
| py311-yappi-1.4.0_1.pkg | 2025-12-18 12:26 | 50K | |
| py311-yapps2-2.1.1_2..> | 2025-12-23 03:56 | 33K | |
| py311-yara-4.3.1_1.pkg | 2025-12-19 15:11 | 20K | |
| py311-yara-python-de..> | 2025-12-19 16:26 | 145K | |
| py311-yarg-0.1.10_1.pkg | 2025-12-27 11:45 | 15K | |
| py311-yarl-1.20.1.pkg | 2025-12-18 02:48 | 106K | |
| py311-yaspin-3.4.0.pkg | 2025-12-30 17:39 | 33K | |
| py311-yaswfp-0.9.3_1..> | 2025-12-19 12:42 | 42K | |
| py311-yattag-1.16.1_..> | 2025-12-19 07:05 | 33K | |
| py311-yfinance-0.2.5..> | 2025-12-26 19:33 | 246K | |
| py311-yg.lockfile-2...> | 2025-12-22 07:27 | 9.6K | |
| py311-youseedee-0.7...> | 2025-12-27 02:05 | 21K | |
| py311-youtube-transc..> | 2025-12-27 06:04 | 235K | |
| py311-ystockquote-0...> | 2025-12-21 20:34 | 9.3K | |
| py311-yt-4.3.1_2.pkg | 2025-12-28 14:12 | 7.2M | |
| py311-yt-dlp-2025.10..> | 2025-12-29 00:45 | 1.7M | |
| py311-yubikey-manage..> | 2025-12-27 02:08 | 426K | |
| py311-yunomi-0.3.0_2..> | 2025-12-23 12:58 | 39K | |
| py311-z3-solver-4.14..> | 2025-12-18 12:56 | 84K | |
| py311-zaproxy-0.4.0.pkg | 2025-12-24 03:39 | 82K | |
| py311-zapzap-6.2.4.pkg | 2025-12-28 04:59 | 181K | |
| py311-zarr-2.18.4.pkg | 2025-12-26 20:35 | 522K | |
| py311-zbar-py-1.0.4_..> | 2025-12-27 16:49 | 74K | |
| py311-zc.lockfile-3...> | 2025-12-19 00:46 | 13K | |
| py311-zeep-4.3.2.pkg | 2025-12-26 19:54 | 212K | |
| py311-zensical-0.0.1..> | 2025-12-29 19:59 | 5.7M | |
| py311-zeroconf-0.132..> | 2025-12-19 12:01 | 944K | |
| py311-zfec-1.6.0.0.pkg | 2025-12-19 17:27 | 72K | |
| py311-zfp-1.0.1.pkg | 2025-12-26 16:40 | 73K | |
| py311-zfs-autobackup..> | 2025-12-23 10:19 | 92K | |
| py311-zict-3.0.0_1.pkg | 2025-12-18 21:52 | 106K | |
| py311-zipp-3.21.0.pkg | 2025-12-18 02:54 | 19K | |
| py311-zipstream-ng-1..> | 2025-12-19 02:17 | 41K | |
| py311-zita-audiotool..> | 2025-12-27 15:09 | 19K | |
| py311-zita-jacktools..> | 2025-12-29 16:04 | 131K | |
| py311-zkg-3.0.1.pkg | 2025-12-27 09:06 | 121K | |
| py311-zlib-ng-1.0.0.pkg | 2025-12-21 05:20 | 122K | |
| py311-zodb-6.0_3.pkg | 2025-12-23 13:59 | 631K | |
| py311-zodbpickle-3.0..> | 2025-12-19 10:33 | 181K | |
| py311-zope.component..> | 2025-12-18 19:10 | 123K | |
| py311-zope.configura..> | 2025-12-18 20:19 | 126K | |
| py311-zope.deprecati..> | 2025-12-18 20:28 | 19K | |
| py311-zope.event-4.1..> | 2025-12-18 12:08 | 7.5K | |
| py311-zope.i18nmessa..> | 2025-12-18 14:32 | 21K | |
| py311-zope.interface..> | 2025-12-18 01:19 | 379K | |
| py311-zope.proxy-5.3..> | 2025-12-21 19:42 | 60K | |
| py311-zope.schema-4...> | 2025-12-18 17:39 | 134K | |
| py311-zope.testbrows..> | 2025-12-20 04:19 | 108K | |
| py311-zopfli-0.2.3.pkg | 2025-12-18 01:30 | 136K | |
| py311-zpt-2.5_1.pkg | 2025-12-23 04:29 | 113K | |
| py311-zstandard-0.23..> | 2025-12-18 12:11 | 412K | |
| py311-zstd-1.5.5.1_1..> | 2025-12-19 10:35 | 8.4K | |
| py311-zxcvbn-4.5.0_1..> | 2025-12-19 23:41 | 394K | |
| py312-build-1.3.0.pkg | 2025-12-18 17:58 | 47K | |
| py312-cython-0.29.37..> | 2025-12-22 16:48 | 2.2M | |
| py312-cython3-3.2.3.pkg | 2025-12-28 21:44 | 3.3M | |
| py312-flit-core-3.12..> | 2025-12-18 06:32 | 96K | |
| py312-gdbm-3.12.12_1..> | 2025-12-22 16:49 | 9.1K | |
| py312-installer-0.7...> | 2025-12-18 09:52 | 244K | |
| py312-packaging-25.0..> | 2025-12-18 13:54 | 125K | |
| py312-pyproject-hook..> | 2025-12-18 13:15 | 20K | |
| py312-setuptools-63...> | 2025-12-19 22:02 | 1.4M | |
| py312-sqlite3-3.12.1..> | 2025-12-22 11:25 | 37K | |
| py312-tkinter-3.12.1..> | 2025-12-29 05:55 | 22K | |
| py312-tomli-2.3.0.pkg | 2025-12-20 05:35 | 27K | |
| py312-wheel-0.45.1.pkg | 2025-12-19 12:57 | 140K | |
| py312-wheel044-0.44...> | 2025-12-18 19:52 | 134K | |
| py313-build-1.3.0.pkg | 2025-12-18 15:56 | 47K | |
| py313-cython3-3.2.3.pkg | 2025-12-29 11:56 | 3.3M | |
| py313-flit-core-3.12..> | 2025-12-18 06:58 | 97K | |
| py313-gdbm-3.13.11_1..> | 2025-12-22 16:40 | 9.2K | |
| py313-installer-0.7...> | 2025-12-18 11:20 | 245K | |
| py313-packaging-25.0..> | 2025-12-18 11:41 | 127K | |
| py313-pyproject-hook..> | 2025-12-18 12:10 | 20K | |
| py313-setuptools-63...> | 2025-12-19 12:53 | 1.4M | |
| py313-sqlite3-3.13.1..> | 2025-12-21 16:02 | 39K | |
| py313-tkinter-3.13.1..> | 2025-12-30 00:59 | 22K | |
| py313-tomli-2.3.0.pkg | 2025-12-21 02:51 | 27K | |
| py313-wheel-0.45.1.pkg | 2025-12-20 01:58 | 142K | |
| py313-wheel044-0.44...> | 2025-12-18 19:31 | 136K | |
| py313t-build-1.3.0.pkg | 2025-12-18 16:24 | 47K | |
| py313t-cython3-3.2.3..> | 2025-12-28 20:05 | 2.2M | |
| py313t-flit-core-3.1..> | 2025-12-18 07:18 | 97K | |
| py313t-gdbm-3.13.11_..> | 2025-12-21 16:51 | 9.4K | |
| py313t-installer-0.7..> | 2025-12-18 11:00 | 245K | |
| py313t-packaging-25...> | 2025-12-18 12:27 | 127K | |
| py313t-pyproject-hoo..> | 2025-12-18 13:35 | 20K | |
| py313t-setuptools-63..> | 2025-12-20 01:36 | 1.4M | |
| py313t-sqlite3-3.13...> | 2025-12-20 23:25 | 40K | |
| py313t-tkinter-3.13...> | 2025-12-29 01:27 | 22K | |
| py313t-tomli-2.3.0.pkg | 2025-12-22 08:57 | 27K | |
| py313t-wheel-0.45.1.pkg | 2025-12-19 22:43 | 143K | |
| py313t-wheel044-0.44..> | 2025-12-18 21:11 | 136K | |
| py314-build-1.3.0.pkg | 2025-12-18 15:31 | 49K | |
| py314-cython3-3.2.3.pkg | 2025-12-29 15:14 | 3.4M | |
| py314-flit-core-3.12..> | 2025-12-18 07:00 | 100K | |
| py314-gdbm-3.14.2_10..> | 2025-12-23 23:53 | 9.2K | |
| py314-installer-0.7...> | 2025-12-18 11:08 | 246K | |
| py314-packaging-25.0..> | 2025-12-18 12:08 | 132K | |
| py314-pyproject-hook..> | 2025-12-18 13:44 | 21K | |
| py314-setuptools-63...> | 2025-12-20 01:15 | 1.5M | |
| py314-sqlite3-3.14.2..> | 2025-12-21 16:13 | 39K | |
| py314-tkinter-3.14.2..> | 2025-12-27 19:44 | 23K | |
| py314-tomli-2.3.0.pkg | 2025-12-21 05:16 | 28K | |
| py314-wheel-0.45.1.pkg | 2025-12-19 21:41 | 149K | |
| py314-wheel044-0.44...> | 2025-12-19 02:27 | 143K | |
| pyWeather-0.1b.pkg | 2025-12-22 16:06 | 1.9K | |
| pybind11-3.0.1.pkg | 2025-12-18 04:16 | 191K | |
| pybind11-json-0.2.15..> | 2025-12-19 21:19 | 4.6K | |
| pybind11_abseil-2024..> | 2025-08-18 05:57 | 105K | |
| pybind11_protobuf-0...> | 2025-12-22 11:30 | 128K | |
| pybrain-0.3.3_6.pkg | 2025-12-28 13:52 | 757K | |
| pycanberra-1_3.pkg | 2025-12-19 11:43 | 9.8K | |
| pycdc-g20250704.pkg | 2025-12-22 10:08 | 108K | |
| pycharm-2025.3.pkg | 2025-12-30 07:53 | 667M | |
| pychess-1.0.4_3.pkg | 2025-12-30 06:27 | 11M | |
| pydbus-common-1.3.2.pkg | 2025-12-16 01:48 | 31K | |
| pydeps-3.0.0_1.pkg | 2025-12-28 06:32 | 95K | |
| pydio-cells-4.4.16_1..> | 2025-12-21 01:15 | 52M | |
| pyenv-2.6.17.pkg | 2025-12-29 20:22 | 316K | |
| pygobject-common-3.5..> | 2025-12-17 23:00 | 6.5K | |
| pykep-2.6.2_8.pkg | 2025-12-20 03:09 | 2.2M | |
| pylint-py311-4.0.4.pkg | 2025-12-18 13:33 | 951K | |
| pylyzer-0.0.78_8.pkg | 2025-12-30 10:28 | 4.7M | |
| pymsgauth-2.1.0_2.pkg | 2025-12-20 17:05 | 12K | |
| pyobd-0.9.3_14.pkg | 2025-12-28 02:30 | 50K | |
| pyobfuscate-0.3.2013..> | 2025-12-22 12:36 | 11K | |
| pyotherside-qt5-1.5...> | 2025-12-27 11:59 | 74K | |
| pysolfc-3.4.1_1.pkg | 2025-12-27 16:49 | 56M | |
| pysolfc-cardsets-3.1..> | 2025-12-28 13:15 | 40M | |
| pystring-1.1.4.pkg | 2025-08-13 14:38 | 43K | |
| python-3.11_3,2.pkg | 2025-12-22 14:19 | 1.1K | |
| python-doc-html-3.11..> | 2025-12-23 12:48 | 6.8M | |
| python-doc-pdf-a4-3...> | 2025-12-23 19:31 | 16M | |
| python-doc-text-3.11..> | 2025-12-22 12:39 | 2.5M | |
| python-mode.el-1.0_2..> | 2025-08-20 09:10 | 47K | |
| python2-2_3.pkg | 2025-12-28 22:08 | 1.3K | |
| python3-3_4.pkg | 2025-12-19 06:16 | 1.3K | |
| python27-2.7.18_4.pkg | 2025-12-26 15:06 | 12M | |
| python310-3.10.19.pkg | 2025-12-18 04:33 | 20M | |
| python311-3.11.14.pkg | 2025-12-16 01:35 | 27M | |
| python312-3.12.12_2.pkg | 2025-12-18 05:42 | 37M | |
| python313-3.13.11.pkg | 2025-12-18 06:29 | 38M | |
| python313t-3.13.11.pkg | 2025-12-18 06:00 | 40M | |
| python314-3.14.2.pkg | 2025-12-18 05:18 | 40M | |
| pythoncego-1.0.1_1.pkg | 2025-12-29 04:06 | 32K | |
| pytorch-2.8.0_1.pkg | 2025-12-30 16:29 | 56M | |
| pytype-py311-2024.10..> | 2025-12-29 01:20 | 3.7M | |
| pyvmomi-7.0.3_1.pkg | 2025-12-29 17:29 | 582K | |
| q-6.0_1.pkg | 2025-12-28 14:33 | 1.4M | |
| q-dns-0.19.11_1.pkg | 2025-12-21 17:18 | 3.4M | |
| q2p-0.2.20061231_18.pkg | 2025-12-30 04:00 | 8.8M | |
| q2pro-142_14.pkg | 2025-12-29 00:36 | 507K | |
| qFlipper-1.3.3.pkg | 2025-12-29 20:57 | 757K | |
| qTox-1.18.3.20250404..> | 2025-12-29 22:58 | 4.1M | |
| qadsl-1.3.3_4.pkg | 2025-08-18 21:24 | 37K | |
| qalculate-gtk-5.8.2.pkg | 2025-12-27 20:52 | 2.5M | |
| qalculate-qt-5.8.2.pkg | 2025-12-30 18:07 | 1.2M | |
| qaudiosonar-1.8.3_1.pkg | 2025-12-29 16:09 | 46K | |
| qb3-1.3.2_1.pkg | 2025-12-30 07:49 | 89K | |
| qbe-1.2.pkg | 2025-08-13 22:32 | 94K | |
| qbittorrent-5.1.4.pkg | 2025-12-28 09:52 | 5.3M | |
| qbittorrent-nox-5.1...> | 2025-12-30 02:29 | 6.4M | |
| qbox-1.78.4_1.pkg | 2025-12-29 19:24 | 520K | |
| qbrew-0.4.1_8.pkg | 2025-12-30 14:21 | 310K | |
| qbs-3.1.2.pkg | 2025-12-29 02:15 | 5.1M | |
| qca-qt5-2.3.10_2.pkg | 2025-12-18 05:44 | 628K | |
| qca-qt6-2.3.10_2.pkg | 2025-12-26 04:27 | 678K | |
| qcad-qt5-3.32.2.0_2.pkg | 2025-12-27 09:33 | 28M | |
| qcc-1.01.pkg | 2025-08-18 07:04 | 23K | |
| qccx-1.0.0.pkg | 2025-08-22 17:49 | 39K | |
| qchroot-0.1_1.pkg | 2025-08-16 18:32 | 11K | |
| qcl-0.6.7.pkg | 2025-12-30 12:23 | 208K | |
| qconf-2.5.pkg | 2025-12-27 22:09 | 66K | |
| qconfirm-0.14.3_2.pkg | 2025-08-19 10:00 | 114K | |
| qcoro-qt6-0.12.0.pkg | 2025-12-26 05:40 | 144K | |
| qcsxcad-0.6.3_1.pkg | 2025-12-27 06:48 | 563K | |
| qcustomplot-qt5-2.1...> | 2025-12-27 09:56 | 469K | |
| qcustomplot-qt6-2.1...> | 2025-12-27 16:02 | 512K | |
| qd-2.3.24.pkg | 2025-12-26 19:09 | 328K | |
| qdbm-1.8.78_5.pkg | 2025-08-14 07:22 | 322K | |
| qdbm-plus-1.8.78_5.pkg | 2025-08-19 04:56 | 143K | |
| qdecoder-12.1.0.pkg | 2025-08-22 11:30 | 44K | |
| qdirstat-1.9_1.pkg | 2025-12-29 00:18 | 635K | |
| qdrant-1.16.1_1,1.pkg | 2025-12-30 03:50 | 17M | |
| qelectrotech-0.9.0_1..> | 2025-12-30 14:02 | 8.6M | |
| qemu-10.1.3.pkg | 2025-12-27 07:54 | 103M | |
| qemu-cheri-0.d202306..> | 2025-12-30 12:14 | 6.1M | |
| qemu-devel-10.1.2025..> | 2025-12-29 02:57 | 106M | |
| qemu-guest-agent-10...> | 2025-12-21 02:55 | 4.8M | |
| qemu-nox11-10.1.3.pkg | 2025-12-28 00:33 | 102M | |
| qemu-powernv-3.0.50_..> | 2025-12-21 05:31 | 3.4M | |
| qemu-tools-10.1.3.pkg | 2025-12-24 04:44 | 6.1M | |
| qemu-user-static-3.1..> | 2025-08-16 22:20 | 7.5M | |
| qemu-user-static-dev..> | 2025-08-16 20:29 | 6.5M | |
| qflow-1.4.104_3.pkg | 2025-12-30 13:17 | 631K | |
| qgit-2.9.pkg | 2025-12-30 12:17 | 348K | |
| qgnomeplatform-0.6.1..> | 2025-12-30 06:24 | 122K | |
| qgpgme-qt5-2.0.0_1.pkg | 2025-12-18 05:30 | 281K | |
| qgpgme-qt6-2.0.0_1.pkg | 2025-12-26 05:59 | 289K | |
| qhotkey-qt5-1.5.0.7.pkg | 2025-12-30 08:17 | 24K | |
| qhotkey-qt6-1.5.0.7.pkg | 2025-12-28 06:35 | 30K | |
| qhttpengine-1.0.1.5_..> | 2025-12-19 20:44 | 64K | |
| qhull-8.0.2_3,1.pkg | 2025-08-13 05:18 | 943K | |
| qhull7-7.3.2_3,1.pkg | 2025-08-18 16:55 | 1.2M | |
| qico-0.59.1_1.pkg | 2025-12-24 07:06 | 217K | |
| qimageblitz-0.1.0.15..> | 2025-12-27 17:56 | 79K | |
| qimgv-1.03.g20250905..> | 2025-12-28 10:34 | 568K | |
| qiskit-aer-0.16.0.1_..> | 2025-12-30 12:20 | 1.1M | |
| qiv-3.0.1.pkg | 2025-12-28 23:11 | 38K | |
| qjackcapture-0.2.1_2..> | 2025-12-28 14:58 | 77K | |
| qjackctl-1.0.4.pkg | 2025-12-28 09:05 | 706K | |
| qjail-5.5_1.pkg | 2025-08-16 06:03 | 77K | |
| qjail54-5.4_1.pkg | 2025-08-17 16:09 | 74K | |
| qjson-qt5-0.9.0_7.pkg | 2025-12-19 11:38 | 51K | |
| qlas-1.93.pkg | 2025-12-22 01:33 | 13K | |
| qlcplus-5.0.1.pkg | 2025-12-28 12:51 | 8.5M | |
| qlementine-1.4.1.pkg | 2025-12-27 09:10 | 1.2M | |
| qlipper-5.1.2.pkg | 2025-12-27 16:55 | 98K | |
| qlogtools-3.1_6.pkg | 2025-08-18 16:24 | 18K | |
| qmail-activedir-0.17..> | 2025-08-18 05:17 | 20K | |
| qmail-autoresponder-..> | 2025-12-20 23:05 | 21K | |
| qmail-conf-0.60_4.pkg | 2025-08-21 12:36 | 17K | |
| qmail-contrib-0.1_5.pkg | 2025-08-17 21:10 | 859 | |
| qmail-dk-0.54_3.pkg | 2025-08-18 15:44 | 23K | |
| qmail-notify-0.93_1.pkg | 2025-08-18 18:09 | 15K | |
| qmail-qfilter-2.1_5.pkg | 2025-12-22 20:44 | 11K | |
| qmail-rblchk-2.4.1_3..> | 2025-08-16 23:27 | 31K | |
| qmail-remove-0.95_1.pkg | 2025-08-21 05:43 | 10K | |
| qmailadmin-1.2.15_8,..> | 2025-08-15 03:29 | 228K | |
| qmailanalog-0.70_5.pkg | 2025-08-18 11:22 | 23K | |
| qmailmrtg7-4.2_5.pkg | 2025-12-29 20:46 | 9.3K | |
| qman-1.5.1.pkg | 2025-12-21 07:43 | 77K | |
| qmapshack-1.19.0_1.pkg | 2025-12-29 17:55 | 48M | |
| qmasm-4.1_2.pkg | 2025-12-28 14:29 | 121K | |
| qmcpack-4.1.0.pkg | 2025-12-29 16:59 | 3.5M | |
| qmdnsengine-0.2.0.pkg | 2025-12-19 20:12 | 64K | |
| qmediamanager-0.1.2.pkg | 2025-12-30 15:14 | 13K | |
| qmhandle-1.3.2_2.pkg | 2025-12-21 03:35 | 9.6K | |
| qmidiarp-0.7.1.pkg | 2025-12-28 18:02 | 406K | |
| qmidictl-1.0.2.pkg | 2025-12-27 22:06 | 153K | |
| qmidinet-1.0.1.pkg | 2025-12-27 19:45 | 92K | |
| qmk_hid-0.1.12_13.pkg | 2025-12-29 08:15 | 297K | |
| qml-box2d-qt6-2.0.20..> | 2025-12-27 02:52 | 143K | |
| qmls-0.2.pkg | 2025-08-20 23:51 | 14K | |
| qmmp-plugin-pack-qt5..> | 2025-12-30 00:04 | 226K | |
| qmmp-plugin-pack-qt6..> | 2025-12-29 13:45 | 231K | |
| qmmp-qt5-1.7.8_1.pkg | 2025-12-27 17:12 | 2.2M | |
| qmmp-qt6-2.3.0_1.pkg | 2025-12-27 11:10 | 2.3M | |
| qnetwalk-1.9.0_3.pkg | 2025-12-29 18:51 | 97K | |
| qoauth-qt5-2.0.0_7.pkg | 2025-12-20 22:57 | 25K | |
| qof-g20250913,1.pkg | 2025-12-20 01:35 | 340K | |
| qogir-gtk-themes-202..> | 2025-12-29 16:19 | 1.6M | |
| qogir-icon-themes-20..> | 2025-08-20 06:51 | 10M | |
| qonk-0.3.1_15.pkg | 2025-12-29 17:03 | 171K | |
| qownnotes-25.9.3_2.pkg | 2025-12-27 21:01 | 4.1M | |
| qownnotes-qt5-25.9.3..> | 2025-12-28 05:19 | 4.4M | |
| qpage-3.3_9.pkg | 2025-08-16 04:23 | 48K | |
| qpdf-11.10.1,2.pkg | 2025-12-26 17:07 | 957K | |
| qpdfview-0.5.0_8.pkg | 2025-12-28 16:06 | 718K | |
| qpdfview-qt5-0.5.0_8..> | 2025-12-29 01:42 | 687K | |
| qpopper-4.1.0_7.pkg | 2025-08-20 01:37 | 81K | |
| qpress-20230507.pkg | 2025-08-14 18:18 | 28K | |
| qprint-1.1_1.pkg | 2025-08-17 21:48 | 8.0K | |
| qpwgraph-0.9.7.pkg | 2025-12-28 00:55 | 224K | |
| qqwing-1.3.4_6.pkg | 2025-08-14 02:57 | 34K | |
| qr-code-generator-1...> | 2025-08-14 02:28 | 57K | |
| qr-g20200216_2.pkg | 2025-12-29 13:43 | 5.2K | |
| qrcodegen-1.14.2_2.pkg | 2025-12-28 03:57 | 659K | |
| qrcp-0.11.6_10.pkg | 2025-12-21 07:39 | 3.7M | |
| qrouter-1.4.88.pkg | 2025-12-27 17:01 | 166K | |
| qrq-0.3.5.pkg | 2025-08-19 00:45 | 139K | |
| qrupdate-1.1.2_14.pkg | 2025-12-26 09:19 | 37K | |
| qsampler-1.0.1_1.pkg | 2025-12-28 01:11 | 271K | |
| qschematic-3.0.3.pkg | 2025-12-28 06:11 | 347K | |
| qscintilla2-designer..> | 2025-12-28 06:11 | 6.7K | |
| qscintilla2-designer..> | 2025-12-28 14:32 | 7.0K | |
| qscintilla2-qt5-2.14..> | 2025-12-27 01:40 | 1.7M | |
| qscintilla2-qt6-2.14..> | 2025-12-26 09:17 | 1.7M | |
| qsf-1.2.15_1.pkg | 2025-08-17 05:49 | 60K | |
| qspeakers-1.8.5.pkg | 2025-12-30 06:12 | 139K | |
| qsstv-9.5.8_4.pkg | 2025-12-28 01:23 | 741K | |
| qstardict-4.0.0.pkg | 2025-12-30 07:31 | 488K | |
| qstat-2.17.pkg | 2025-08-15 11:52 | 183K | |
| qsudo-201711240000_4..> | 2025-12-27 14:40 | 21K | |
| qsynth-1.0.3.pkg | 2025-12-28 22:31 | 277K | |
| qt-maybe-0.0.2015122..> | 2025-12-19 14:35 | 2.3K | |
| qt-sudo-2.3.0.pkg | 2025-12-27 03:03 | 53K | |
| qt5-3d-5.15.18p0.pkg | 2025-12-26 16:55 | 2.0M | |
| qt5-assistant-5.15.1..> | 2025-12-26 08:32 | 325K | |
| qt5-buildtools-5.15...> | 2025-12-16 01:46 | 1.0M | |
| qt5-charts-5.15.18p0..> | 2025-12-26 15:35 | 618K | |
| qt5-concurrent-5.15...> | 2025-12-18 01:44 | 31K | |
| qt5-connectivity-5.1..> | 2025-12-26 09:00 | 237K | |
| qt5-core-5.15.18p109..> | 2025-12-16 01:55 | 2.3M | |
| qt5-datavis3d-5.15.1..> | 2025-12-26 15:07 | 483K | |
| qt5-dbus-5.15.18p109..> | 2025-12-16 01:56 | 301K | |
| qt5-declarative-5.15..> | 2025-12-26 06:18 | 4.5M | |
| qt5-declarative-test..> | 2025-12-26 07:06 | 84K | |
| qt5-designer-5.15.18..> | 2025-12-26 08:59 | 3.3M | |
| qt5-doc-5.12.2.pkg | 2025-08-15 04:23 | 232M | |
| qt5-examples-5.15.18..> | 2025-12-20 00:37 | 114M | |
| qt5-fceux-2.6.6_5.pkg | 2025-12-29 01:06 | 3.8M | |
| qt5-gamepad-5.15.18p..> | 2025-12-26 15:39 | 66K | |
| qt5-graphicaleffects..> | 2025-12-26 11:23 | 69K | |
| qt5-gui-5.15.18p109.pkg | 2025-12-24 22:12 | 3.6M | |
| qt5-help-5.15.18p3.pkg | 2025-12-26 06:44 | 184K | |
| qt5-imageformats-5.1..> | 2025-12-26 08:53 | 52K | |
| qt5-l10n-5.15.18p0.pkg | 2025-12-19 17:14 | 1.9M | |
| qt5-linguist-5.15.18..> | 2025-12-26 19:00 | 434K | |
| qt5-linguisttools-5...> | 2025-12-18 01:25 | 386K | |
| qt5-location-5.15.18..> | 2025-12-26 09:16 | 1.1M | |
| qt5-multimedia-5.15...> | 2025-12-26 09:05 | 685K | |
| qt5-network-5.15.18p..> | 2025-12-16 01:59 | 597K | |
| qt5-networkauth-5.15..> | 2025-12-18 19:23 | 62K | |
| qt5-opengl-5.15.18p1..> | 2025-12-26 08:36 | 144K | |
| qt5-pixeltool-5.15.1..> | 2025-12-27 17:33 | 20K | |
| qt5-printsupport-5.1..> | 2025-12-26 06:38 | 182K | |
| qt5-qdbus-5.15.18p3.pkg | 2025-12-20 04:02 | 19K | |
| qt5-qdbusviewer-5.15..> | 2025-12-27 14:05 | 39K | |
| qt5-qdoc-5.15.18p3.pkg | 2025-12-27 16:10 | 538K | |
| qt5-qdoc-data-5.15.1..> | 2025-12-19 01:02 | 162K | |
| qt5-qev-5.15.18p3.pkg | 2025-12-27 15:11 | 5.1K | |
| qt5-qmake-5.15.18p10..> | 2025-12-16 01:43 | 5.8M | |
| qt5-qtdiag-5.15.18p3..> | 2025-12-27 13:20 | 27K | |
| qt5-qtpaths-5.15.18p..> | 2025-12-19 08:00 | 12K | |
| qt5-qtplugininfo-5.1..> | 2025-12-19 07:48 | 8.9K | |
| qt5-quick3d-5.15.18p..> | 2025-12-26 08:40 | 3.6M | |
| qt5-quickcontrols-5...> | 2025-12-26 19:46 | 903K | |
| qt5-quickcontrols2-5..> | 2025-12-26 11:08 | 1.5M | |
| qt5-quicktimeline-5...> | 2025-12-27 19:41 | 22K | |
| qt5-remoteobjects-5...> | 2025-12-26 08:49 | 342K | |
| qt5-script-5.15.19p0..> | 2025-12-18 09:54 | 549K | |
| qt5-scripttools-5.15..> | 2025-12-26 15:09 | 217K | |
| qt5-scxml-5.15.18p0.pkg | 2025-12-26 14:58 | 236K | |
| qt5-sensors-5.15.18p..> | 2025-12-26 08:50 | 149K | |
| qt5-serialbus-5.15.1..> | 2025-12-19 16:25 | 153K | |
| qt5-serialport-5.15...> | 2025-12-18 01:50 | 39K | |
| qt5-speech-5.15.18p1..> | 2025-12-26 08:54 | 32K | |
| qt5-sql-5.15.18p109.pkg | 2025-12-18 00:43 | 97K | |
| qt5-sqldrivers-mysql..> | 2025-12-18 23:29 | 24K | |
| qt5-sqldrivers-odbc-..> | 2025-12-19 15:04 | 34K | |
| qt5-sqldrivers-pgsql..> | 2025-12-20 00:38 | 28K | |
| qt5-sqldrivers-sqlit..> | 2025-12-19 21:43 | 14K | |
| qt5-sqldrivers-sqlit..> | 2025-12-18 01:13 | 24K | |
| qt5-sqldrivers-tds-5..> | 2025-12-20 00:20 | 19K | |
| qt5-style-plugins-5...> | 2025-12-27 19:43 | 403K | |
| qt5-style-qtcurve-1...> | 2025-12-27 16:27 | 219K | |
| qt5-svg-5.15.18p5.pkg | 2025-12-26 09:05 | 138K | |
| qt5-testlib-5.15.18p..> | 2025-12-18 01:19 | 162K | |
| qt5-uiplugin-5.15.18..> | 2025-12-26 06:25 | 6.1K | |
| qt5-uitools-5.15.18p..> | 2025-12-26 06:41 | 163K | |
| qt5-virtualkeyboard-..> | 2025-12-27 02:19 | 542K | |
| qt5-wayland-5.15.18p..> | 2025-12-26 06:38 | 1.1M | |
| qt5-webchannel-5.15...> | 2025-12-26 08:54 | 73K | |
| qt5-webglplugin-5.15..> | 2025-12-27 08:17 | 218K | |
| qt5-websockets-5.15...> | 2025-12-18 02:49 | 69K | |
| qt5-websockets-qml-5..> | 2025-12-27 10:45 | 15K | |
| qt5-widgets-5.15.18p..> | 2025-12-24 22:19 | 2.5M | |
| qt5-x11extras-5.15.1..> | 2025-12-26 06:33 | 12K | |
| qt5-xml-5.15.18p109.pkg | 2025-12-18 01:05 | 105K | |
| qt5-xmlpatterns-5.15..> | 2025-12-26 08:45 | 1.1M | |
| qt5-xxdiff-g20250320..> | 2025-12-27 13:14 | 1.0M | |
| qt5ct-1.9.pkg | 2025-12-28 10:47 | 200K | |
| qt5pas-1.2.16_1,1.pkg | 2025-12-26 22:40 | 520K | |
| qt6-3d-6.10.1.pkg | 2025-12-26 18:43 | 3.2M | |
| qt6-5compat-6.10.1.pkg | 2025-12-26 04:25 | 496K | |
| qt6-6.10.1.pkg | 2025-12-29 19:44 | 1.2K | |
| qt6-base-6.10.1_1.pkg | 2025-12-26 03:33 | 14M | |
| qt6-base_sqldriver-m..> | 2025-12-26 05:43 | 33K | |
| qt6-base_sqldriver-o..> | 2025-12-27 13:00 | 48K | |
| qt6-base_sqldriver-p..> | 2025-12-27 12:45 | 40K | |
| qt6-base_sqldriver-s..> | 2025-12-26 03:39 | 35K | |
| qt6-charts-6.10.1.pkg | 2025-12-26 11:28 | 755K | |
| qt6-coap-6.10.1.pkg | 2025-12-27 12:32 | 92K | |
| qt6-connectivity-6.1..> | 2025-12-26 15:00 | 210K | |
| qt6-datavis3d-6.10.1..> | 2025-12-26 18:28 | 590K | |
| qt6-declarative-6.10..> | 2025-12-26 04:15 | 16M | |
| qt6-doc-6.10.1.pkg | 2025-12-26 19:07 | 14M | |
| qt6-examples-6.10.1.pkg | 2025-12-27 16:47 | 148M | |
| qt6-fceux-2.6.6_5.pkg | 2025-12-29 23:56 | 3.8M | |
| qt6-graphs-6.10.1.pkg | 2025-12-26 19:07 | 878K | |
| qt6-grpc-6.10.1.pkg | 2025-12-27 06:22 | 663K | |
| qt6-httpserver-6.10...> | 2025-12-26 19:26 | 92K | |
| qt6-imageformats-6.1..> | 2025-12-26 16:55 | 65K | |
| qt6-languageserver-6..> | 2025-12-26 03:37 | 429K | |
| qt6-location-6.10.1.pkg | 2025-12-26 12:56 | 613K | |
| qt6-lottie-6.10.1.pkg | 2025-12-27 12:54 | 197K | |
| qt6-mqtt-6.10.1.pkg | 2025-12-27 03:26 | 95K | |
| qt6-multimedia-6.10...> | 2025-12-26 04:59 | 1.9M | |
| qt6-networkauth-6.10..> | 2025-12-26 14:07 | 110K | |
| qt6-pdf-6.10.1.pkg | 2025-12-26 15:24 | 1.8M | |
| qt6-positioning-6.10..> | 2025-12-26 06:46 | 384K | |
| qt6-quick3d-6.10.1.pkg | 2025-12-26 04:54 | 5.8M | |
| qt6-quick3dphysics-6..> | 2025-12-27 18:54 | 3.5M | |
| qt6-quickeffectmaker..> | 2025-12-27 06:59 | 3.7M | |
| qt6-quicktimeline-6...> | 2025-12-26 04:22 | 73K | |
| qt6-remoteobjects-6...> | 2025-12-26 16:03 | 433K | |
| qt6-scxml-6.10.1.pkg | 2025-12-26 16:39 | 447K | |
| qt6-sensors-6.10.1.pkg | 2025-12-26 12:27 | 167K | |
| qt6-serialbus-6.10.1..> | 2025-12-26 20:12 | 234K | |
| qt6-serialport-6.10...> | 2025-12-26 06:24 | 55K | |
| qt6-shadertools-6.10..> | 2025-12-26 03:38 | 1.4M | |
| qt6-speech-6.10.1.pkg | 2025-12-26 05:21 | 97K | |
| qt6-svg-6.10.1.pkg | 2025-12-26 03:40 | 247K | |
| qt6-tools-6.10.1.pkg | 2025-12-26 04:25 | 5.7M | |
| qt6-translations-6.1..> | 2025-12-26 15:08 | 1.9M | |
| qt6-virtualkeyboard-..> | 2025-12-27 10:21 | 2.4M | |
| qt6-wayland-6.10.1.pkg | 2025-12-26 04:20 | 731K | |
| qt6-webchannel-6.10...> | 2025-12-26 06:38 | 115K | |
| qt6-webengine-6.10.1..> | 2025-12-26 17:01 | 83M | |
| qt6-websockets-6.10...> | 2025-12-26 05:28 | 102K | |
| qt6-webview-6.10.1.pkg | 2025-12-26 19:58 | 69K | |
| qt6-xxdiff-g20250320..> | 2025-12-30 16:06 | 1.0M | |
| qt6ct-0.11_1.pkg | 2025-12-29 09:53 | 156K | |
| qt6gtk2-0.6_1.pkg | 2025-12-30 11:20 | 101K | |
| qt6pas-6.2.10_1.pkg | 2025-12-26 20:52 | 537K | |
| qtawesome-20150319_5..> | 2025-12-30 02:13 | 32K | |
| qtcreator-18.0.1.pkg | 2025-12-29 11:23 | 49M | |
| qtcurve-1.9.0.pkg | 2025-12-29 09:22 | 585 | |
| qtcurve-utils-1.9.0.pkg | 2025-12-19 02:37 | 320K | |
| qtel-19.09.2_2.pkg | 2025-12-28 22:44 | 145K | |
| qterminal-2.3.0.pkg | 2025-12-27 11:11 | 284K | |
| qtermwidget-2.3.0.pkg | 2025-12-27 01:35 | 226K | |
| qtermwidget-qt5-1.4...> | 2025-12-29 00:53 | 201K | |
| qtfeedback-5.0.0.b1...> | 2025-12-27 06:50 | 43K | |
| qtfm-6.2.1_1.pkg | 2025-12-27 22:29 | 341K | |
| qtiplot-doc-0.9.8.9_..> | 2025-08-16 20:22 | 6.6M | |
| qtkeychain-qt5-0.15...> | 2025-12-20 01:24 | 55K | |
| qtkeychain-qt6-0.15...> | 2025-12-26 05:37 | 62K | |
| qtpass-1.4.0.pkg | 2025-12-29 18:43 | 342K | |
| qtpbfimageplugin-2.1..> | 2025-12-27 18:49 | 247K | |
| qtractor-1.5.9.pkg | 2025-12-29 14:58 | 1.8M | |
| qtutilities-6.18.4.pkg | 2025-12-28 00:19 | 197K | |
| qtv-1.15.pkg | 2025-08-16 12:50 | 827K | |
| qtxdg-tools-4.3.0.pkg | 2025-12-26 18:01 | 22K | |
| qu-aspell-0.02.0_1,2..> | 2025-12-22 17:40 | 328K | |
| quackle-1.0.4.pkg | 2025-12-29 12:15 | 21M | |
| quadra-1.3.0_7.pkg | 2025-12-28 10:39 | 2.4M | |
| quadrapassel-40.2_3.pkg | 2025-12-30 13:52 | 257K | |
| quagga-1.2.4_13.pkg | 2025-12-21 01:17 | 1.4M | |
| quake-data-1.0.6_3.pkg | 2025-08-14 06:30 | 7.4M | |
| quake-dpmod-20130301..> | 2025-12-30 04:21 | 4.1M | |
| quake-framework-0.5...> | 2025-12-30 14:27 | 3.1M | |
| quake-maps-1.0.0.pkg | 2025-08-13 22:30 | 359M | |
| quake-par-0.03.01.pkg | 2025-08-21 06:02 | 14K | |
| quake-source-1.01_1.pkg | 2025-08-15 17:25 | 84K | |
| quake2-3zb2-0.97_1.pkg | 2025-08-19 01:39 | 2.1M | |
| quake2-ctf-1.52.pkg | 2025-08-16 12:51 | 8.1M | |
| quake2-data-3.20_3.pkg | 2025-08-15 05:43 | 9.6M | |
| quake2-extras-1.0.pkg | 2025-08-21 09:34 | 26M | |
| quake2-lights-1.pkg | 2025-08-17 06:19 | 853K | |
| quake2-matrix-1.pkg | 2025-08-19 10:57 | 6.6M | |
| quake2-psychomod-3.1..> | 2025-08-18 03:18 | 1.4M | |
| quake2-relay-0.4_1.pkg | 2025-08-16 05:44 | 102K | |
| quake2-rogue-3.20.pkg | 2025-08-19 10:47 | 267K | |
| quake2-source-3.21_1..> | 2025-08-18 06:11 | 162K | |
| quake2-xatrix-3.20.pkg | 2025-08-20 02:42 | 208K | |
| quake2lnx-0.16.2_16.pkg | 2025-08-16 10:26 | 394K | |
| quake2max-0.45_16.pkg | 2025-12-30 07:38 | 2.1M | |
| quake3-data-1.32.b.3..> | 2025-08-14 00:24 | 24M | |
| quake3-excessive-003..> | 2025-08-20 04:33 | 113K | |
| quake3-osp-1.03a.pkg | 2025-08-20 10:24 | 44M | |
| quake3-ut-3.7_1.pkg | 2025-08-20 08:00 | 438M | |
| quake3-wfa-3.5b.pkg | 2025-08-19 06:24 | 198M | |
| quakeforge-0.7.2_10.pkg | 2025-12-29 20:21 | 1.4M | |
| quantis-kmod-v18.03...> | 2025-08-19 06:50 | 4.0K | |
| quantlib-1.40.pkg | 2025-12-23 04:57 | 29M | |
| quantum++-6.0.pkg | 2025-12-28 10:06 | 129K | |
| quantum-espresso-7.5..> | 2025-12-27 16:35 | 177M | |
| quantum-espresso-pse..> | 2025-08-19 08:55 | 635M | |
| quantum-jet-0.2.2.2_..> | 2025-12-27 21:23 | 149K | |
| quantum-parallelizat..> | 2025-12-20 21:14 | 71K | |
| quantumminigolf-1.1...> | 2025-12-30 16:27 | 320K | |
| quaqut-0.2.0_2.pkg | 2025-08-22 01:30 | 19K | |
| quark-server-2022081..> | 2025-08-16 06:03 | 18K | |
| quarto-1.9.10.pkg | 2025-12-27 16:08 | 13M | |
| quary-0.9.0.pkg | 2025-12-23 06:24 | 4.9M | |
| quasi88-0.6.4.pkg | 2025-12-23 08:26 | 536K | |
| quassel-core-0.14.0_..> | 2025-12-20 05:15 | 738K | |
| quat-1.20.pkg | 2025-08-16 06:01 | 257K | |
| quazip-qt5-1.5.pkg | 2025-12-18 19:11 | 111K | |
| quazip-qt6-1.5.pkg | 2025-12-27 17:51 | 120K | |
| qucs-s-25.2.0.pkg | 2025-12-30 05:03 | 3.9M | |
| qucsator-0.0.20.4.pkg | 2025-08-22 23:05 | 957K | |
| qudos-0.40.1_21.pkg | 2025-12-27 22:35 | 5.6M | |
| quesa-1.8_9.pkg | 2025-08-17 10:43 | 636K | |
| quesoglc-0.7.2_10.pkg | 2025-12-27 02:56 | 95K | |
| quetoo-0.6.1_10.pkg | 2025-12-23 07:12 | 1.2M | |
| queue-repair-0.9.0_3..> | 2025-12-22 06:14 | 7.7K | |
| quftp-1.0.7_7.pkg | 2025-12-21 11:51 | 38K | |
| quich-4.0.0.pkg | 2025-08-20 01:23 | 9.3K | |
| quiche-0.24.5_3.pkg | 2025-12-27 02:41 | 28M | |
| quickcheck++-0.0.3.pkg | 2025-08-21 15:54 | 16K | |
| quickcpplib-g2023061..> | 2025-08-15 01:55 | 194K | |
| quickfix-1.15.1_6.pkg | 2025-12-23 08:49 | 600K | |
| quickjail-0.2.1.pkg | 2025-08-21 10:23 | 6.7K | |
| quickjs-2025.09.13.2..> | 2025-12-18 18:47 | 563K | |
| quickjs-ng-0.11.0.pkg | 2025-12-24 05:21 | 475K | |
| quickqanava-2.2.0.pkg | 2025-12-29 06:19 | 451K | |
| quicksynergy-0.9.0_9..> | 2025-12-30 02:31 | 14K | |
| quickwit-0.8.2_13.pkg | 2025-12-30 14:02 | 13M | |
| quilc-1.26.0_8.pkg | 2025-12-27 17:06 | 24M | |
| quill-logging-librar..> | 2025-08-21 16:58 | 207K | |
| quilt-0.67_2.pkg | 2025-12-28 11:22 | 386K | |
| quimup-2.1.1.pkg | 2025-12-28 21:05 | 286K | |
| quirc-0.9.84_6.pkg | 2025-12-30 08:31 | 240K | |
| quisk-4.2.36_6.pkg | 2025-12-27 22:35 | 3.2M | |
| quit-1.2a_3.pkg | 2025-08-18 22:33 | 5.3K | |
| quoted-1.01_4.pkg | 2025-08-20 19:57 | 16K | |
| qutebrowser-3.6.3.pkg | 2025-12-28 07:05 | 2.4M | |
| qvge-0.6.3_1.pkg | 2025-12-28 12:56 | 635K | |
| qview-6.1_1.pkg | 2025-12-28 11:15 | 483K | |
| qwalk-1.0.1.300_6.pkg | 2025-12-27 20:50 | 1.3M | |
| qwdtools-0.34.202209..> | 2025-08-20 11:07 | 39K | |
| qwfwd-1.30.pkg | 2025-08-21 13:53 | 34K | |
| qwinff-0.2.1.22_1.pkg | 2025-12-30 16:15 | 475K | |
| qwt5-qt5-5.2.3g20210..> | 2025-12-27 19:45 | 1.6M | |
| qwt6-qt5-6.3.0.pkg | 2025-12-26 18:08 | 3.0M | |
| qwt6-qt6-6.3.0.pkg | 2025-12-30 00:56 | 3.0M | |
| qwtplot3d-qt5-0.3.0...> | 2025-12-27 10:29 | 103K | |
| qxfun-01.pkg | 2025-12-29 17:00 | 61K | |
| qxgedit-1.0.1.pkg | 2025-12-27 22:20 | 309K | |
| qxlsx-1.5.0_1.pkg | 2025-12-27 03:11 | 254K | |
| qxlsx-qt6-1.5.0_1.pkg | 2025-12-27 16:40 | 287K | |
| qxmpp-qt6-1.11.2.pkg | 2025-12-27 17:53 | 1.5M | |
| r1q2-8012_6.pkg | 2025-12-30 09:50 | 418K | |
| rabbitmq-4.2.0.pkg | 2025-12-19 05:39 | 22M | |
| rabbitmq-c-0.15.0.pkg | 2025-12-19 08:54 | 97K | |
| rabbitmqadmin-0.29.0..> | 2025-12-27 22:35 | 2.7M | |
| rabs-2.34.3.pkg | 2025-12-22 15:10 | 280K | |
| racket-9.0.pkg | 2025-12-28 09:00 | 190M | |
| racket-minimal-9.0.pkg | 2025-12-23 08:41 | 31M | |
| rackmonkey-1.2.5_6.pkg | 2025-12-21 13:21 | 207K | |
| racktables-php81-0.2..> | 2025-12-30 06:41 | 799K | |
| racktables-php82-0.2..> | 2025-12-29 20:03 | 799K | |
| racktables-php83-0.2..> | 2025-12-28 10:14 | 799K | |
| racktables-php84-0.2..> | 2025-12-29 23:12 | 799K | |
| racktables-php85-0.2..> | 2025-12-29 17:25 | 799K | |
| radamsa-0.7.pkg | 2025-12-22 13:10 | 108K | |
| radare2-5.9.6.pkg | 2025-08-14 16:39 | 7.3M | |
| radarr-5.27.5.10198.pkg | 2025-12-28 04:30 | 35M | |
| radcli-1.4.0.pkg | 2025-12-19 13:16 | 123K | |
| raddump-0.3.1_1.pkg | 2025-08-18 04:42 | 30K | |
| radeontool-1.5.pkg | 2025-08-21 02:17 | 5.5K | |
| radeontop-1.4_1.pkg | 2025-12-22 17:45 | 25K | |
| radicle-1.5.0_2.pkg | 2025-12-27 21:59 | 7.6M | |
| radio_datetime_analy..> | 2025-12-30 14:04 | 184K | |
| radius-engine-1.1_6.pkg | 2025-12-27 11:47 | 85K | |
| radiusclient-0.5.6_3..> | 2025-08-13 23:10 | 59K | |
| radmind-1.16.1_1.pkg | 2025-08-19 17:51 | 143K | |
| radns-20110809.2_2.pkg | 2025-08-19 11:59 | 34K | |
| radreport-1.3.pkg | 2025-08-22 07:07 | 14K | |
| radsecproxy-1.11.1.pkg | 2025-08-21 09:42 | 99K | |
| radvd-2.20.pkg | 2025-08-22 09:32 | 75K | |
| rage-0.4.0_3.pkg | 2025-12-28 11:10 | 255K | |
| rage-encryption-0.11..> | 2025-12-30 18:19 | 1.6M | |
| ragel-6.10_1.pkg | 2025-08-13 19:15 | 492K | |
| raidtest-1.3.pkg | 2025-08-19 07:02 | 6.3K | |
| rainbarf-1.4_1.pkg | 2025-12-21 18:46 | 15K | |
| rainbow-2.0.4.pkg | 2025-08-15 08:55 | 44K | |
| rainloop-php81-1.17...> | 2025-12-30 00:17 | 4.0M | |
| rainloop-php82-1.17...> | 2025-12-28 10:28 | 4.0M | |
| rainloop-php83-1.17...> | 2025-12-29 04:38 | 4.0M | |
| rainloop-php84-1.17...> | 2025-12-29 07:35 | 4.0M | |
| rainloop-php85-1.17...> | 2025-12-29 05:54 | 4.0M | |
| raja-2025.09.1.pkg | 2025-12-19 00:05 | 268K | |
| raleway-4.101.pkg | 2025-12-28 18:20 | 805K | |
| rampler-2.0.0_1.pkg | 2025-08-19 10:14 | 16K | |
| rancid3-3.14_1.pkg | 2025-12-20 00:41 | 224K | |
| rand-1.9_2.pkg | 2025-08-19 17:44 | 6.6K | |
| randlib-1.3.pkg | 2025-08-22 22:09 | 36K | |
| random123-1.14.0.5.pkg | 2025-08-14 03:34 | 39K | |
| randomio-1.4.pkg | 2025-08-22 09:09 | 4.4K | |
| randomx-1.2.1.pkg | 2025-08-16 14:46 | 72K | |
| rang-3.2.pkg | 2025-08-13 23:57 | 5.8K | |
| range-v3-0.12.0.pkg | 2025-08-14 04:59 | 213K | |
| rankwidth-0.10.pkg | 2025-12-28 15:39 | 12K | |
| rapid-2.01_1.pkg | 2025-08-19 13:11 | 24K | |
| rapid-photo-download..> | 2025-12-30 02:02 | 8.8M | |
| rapidcheck-g20220314..> | 2025-08-16 15:20 | 163K | |
| rapidfuzz-cpp-3.3.3.pkg | 2025-12-18 10:00 | 48K | |
| rapidjson-1.1.0.763.pkg | 2025-08-13 05:14 | 1.1M | |
| rapidxml-1.13.pkg | 2025-08-21 18:04 | 32K | |
| rapidyaml-0.9.0.pkg | 2025-12-18 03:50 | 185K | |
| raptor2-2.0.16_5.pkg | 2025-12-18 10:31 | 380K | |
| rar-7.12,3.pkg | 2025-12-18 16:03 | 402K | |
| rarian-0.8.5_8.pkg | 2025-12-27 04:03 | 76K | |
| rash-2.16.1_3.pkg | 2025-12-30 12:53 | 2.4M | |
| rasqal-0.9.33_3.pkg | 2025-12-26 15:27 | 383K | |
| raster3d-3.0.7_5.pkg | 2025-12-27 15:12 | 1.5M | |
| ratatouille-lv2-0.9...> | 2025-12-29 17:14 | 952K | |
| ratbox-respond-1.0_3..> | 2025-08-17 10:01 | 9.1K | |
| rate-0.9_4.pkg | 2025-08-19 15:07 | 41K | |
| ratelimit-policyd-1...> | 2025-12-22 18:41 | 11K | |
| ratfor-1985.06_17.pkg | 2025-12-29 15:25 | 15K | |
| rathole-0.5.0_20.pkg | 2025-12-29 17:54 | 1.3M | |
| ratify-2.3.1_3.pkg | 2025-12-29 14:25 | 543K | |
| rationl-0.1.0.139_1.pkg | 2025-08-15 23:42 | 36K | |
| ratpoison-1.4.9_4.pkg | 2025-12-30 09:25 | 123K | |
| ratproxy-1.58.pkg | 2025-08-18 01:42 | 41K | |
| rats-2.4_1.pkg | 2025-12-20 08:11 | 120K | |
| raul-2.0.0.pkg | 2025-08-15 03:35 | 11K | |
| rav1e-0.8.1_5.pkg | 2025-12-27 22:15 | 5.6M | |
| rawgl-g20180321_2.pkg | 2025-12-29 13:43 | 61K | |
| rawrec-0.9.991_2.pkg | 2025-08-14 18:29 | 21K | |
| rawstudio-2.0_27.pkg | 2025-12-29 21:38 | 1.0M | |
| rawtherapee-5.12.pkg | 2025-12-27 23:09 | 27M | |
| raylib-5.5.pkg | 2025-12-28 19:49 | 724K | |
| raysfilter-1.14_3.pkg | 2025-08-21 14:32 | 32K | |
| razor-agents-2.85.pkg | 2025-12-21 00:07 | 79K | |
| rbenv-1.3.2.pkg | 2025-12-19 20:48 | 15K | |
| rbl-milter-0.30_6.pkg | 2025-08-17 18:39 | 7.8K | |
| rblcheck-1.5_2.pkg | 2025-08-16 14:46 | 5.6K | |
| rbldnsd-0.998_1.pkg | 2025-08-22 15:43 | 87K | |
| rbllookup-0.0.1.1_1.pkg | 2025-12-23 19:31 | 5.3K | |
| rbllookup-ng-1.1_3.pkg | 2025-12-23 08:48 | 6.4K | |
| rbprof-0.2.1.pkg | 2025-12-22 04:02 | 8.4K | |
| rc-1.7.4_5.pkg | 2025-08-18 21:53 | 325K | |
| rc-subr-jail-5.pkg | 2025-08-14 09:10 | 2.0K | |
| rcadm-0.1.pkg | 2025-08-19 23:14 | 1.4K | |
| rcctools-0.1.1_4.pkg | 2025-12-29 21:46 | 8.0K | |
| rclean-1.14.pkg | 2025-08-18 20:02 | 4.8K | |
| rclint-1.3.0.pkg | 2025-12-23 14:44 | 7.3K | |
| rclock-2.7.10_4.pkg | 2025-12-20 17:29 | 15K | |
| rclone-1.71.2_2.pkg | 2025-12-19 15:48 | 18M | |
| rclone-browser-1.8.0..> | 2025-12-30 02:07 | 290K | |
| rcm-1.3.6.pkg | 2025-08-16 08:22 | 20K | |
| rcpd-1.3_1.pkg | 2025-08-17 04:40 | 11K | |
| rcracki_mt-0.7.0.pkg | 2025-08-22 02:59 | 133K | |
| rcs-5.10.1_2.pkg | 2025-08-14 09:56 | 194K | |
| rcs57-5.7_3.pkg | 2025-08-14 20:05 | 166K | |
| rdap-0.9.1_17.pkg | 2025-12-22 15:03 | 2.8M | |
| rdapper-20150326.pkg | 2025-12-20 06:32 | 9.8K | |
| rdate-20150501_1.pkg | 2025-08-20 11:34 | 9.0K | |
| rdesktop-1.9.0_1.pkg | 2025-12-18 23:48 | 194K | |
| rdfind-1.7.0.pkg | 2025-08-22 19:45 | 37K | |
| rdist-6.1.5_10.pkg | 2025-08-22 17:37 | 58K | |
| rdist7-7.0.0.a10.pkg | 2025-08-22 22:00 | 67K | |
| rdkit-2025.09.2.pkg | 2025-12-27 02:00 | 33M | |
| rdp2tcp-0.1.0.202508..> | 2025-12-22 19:57 | 17K | |
| rdrview-0.1.4.pkg | 2025-12-21 23:00 | 26K | |
| rdup-1.1.15_3.pkg | 2025-12-20 23:32 | 48K | |
| re-4.4.0.pkg | 2025-12-27 13:46 | 507K | |
| re-flex-6.0.0.pkg | 2025-08-19 06:51 | 412K | |
| re2-20251105.pkg | 2025-12-16 03:19 | 278K | |
| re2c-4.3.pkg | 2025-12-18 00:48 | 1.1M | |
| re3-g20210219_2.pkg | 2025-12-29 18:51 | 3.7M | |
| re_graph-0.2_3.pkg | 2025-12-30 00:22 | 49K | |
| reactphysics3d-0.10...> | 2025-08-21 09:25 | 414K | |
| read-edid-3.0.2.pkg | 2025-08-20 22:34 | 15K | |
| readarr-0.4.16.2793.pkg | 2025-12-28 08:44 | 29M | |
| readerwriterqueue-1...> | 2025-12-23 12:59 | 18K | |
| readline-8.3.1.pkg | 2025-12-16 01:27 | 458K | |
| readosm-1.1.0.pkg | 2025-12-19 07:21 | 27K | |
| readseq-2.1.19.pkg | 2025-12-27 09:05 | 696K | |
| readstat-1.1.9.pkg | 2025-08-15 01:29 | 369K | |
| readur-2.6.3_3.pkg | 2025-12-30 08:56 | 12M | |
| realesrgan-ncnn-vulk..> | 2025-12-26 21:56 | 41M | |
| reallyslick-0.9.1_26..> | 2025-12-30 16:51 | 3.0M | |
| realmd-0.17.1_1.pkg | 2025-12-27 20:48 | 222K | |
| realsr-ncnn-vulkan-2..> | 2025-12-28 12:42 | 60M | |
| realtek-re-kmod-1101..> | 2025-12-24 07:39 | 156K | |
| realtek-re-kmod198-1..> | 2025-08-22 08:07 | 102K | |
| realtek-rge-kmod-202..> | 2025-12-23 15:15 | 47K | |
| rearx-0.1.4_44.pkg | 2025-12-29 07:25 | 1.0M | |
| reaver-1.6.6_1.pkg | 2025-08-17 01:10 | 185K | |
| rebar-2.6.4,1.pkg | 2025-12-19 19:04 | 194K | |
| rebar3-3.25.1,1.pkg | 2025-12-18 20:24 | 818K | |
| recastnavigation-1.6..> | 2025-12-27 09:00 | 219K | |
| recode-3.6_16.pkg | 2025-12-18 14:41 | 552K | |
| recoll-1.33.1_13.pkg | 2025-12-30 00:28 | 2.2M | |
| recordmydesktop-0.3...> | 2025-08-13 20:07 | 46K | |
| recoverdm-0.20_1.pkg | 2025-08-17 08:03 | 13K | |
| recoverjpeg-2.6.3_4.pkg | 2025-12-30 02:32 | 19K | |
| recutils-1.9_2.pkg | 2025-12-30 06:35 | 557K | |
| recvnet-0.0.1_1.pkg | 2025-08-17 06:19 | 4.4K | |
| recycle-7.0.0.pkg | 2025-08-18 14:01 | 4.6K | |
| reddsaver-0.4.0_27.pkg | 2025-12-29 12:07 | 1.1M | |
| redeclipse-2.0.0_3.pkg | 2025-12-29 15:50 | 2.5M | |
| redeclipse-data-2.0...> | 2025-08-15 00:58 | 871M | |
| redeclipse-data16-1...> | 2025-08-15 20:10 | 827M | |
| redeclipse16-1.6.0_3..> | 2025-12-29 10:40 | 2.2M | |
| redet-8.26_1.pkg | 2025-12-29 16:08 | 245K | |
| redir-2.2.1_3.pkg | 2025-08-19 13:14 | 14K | |
| redis-8.4.0_1.pkg | 2025-12-18 16:32 | 1.1M | |
| redis-devel-8.2.2.20..> | 2025-12-23 04:27 | 1.1M | |
| redis62-6.2.21.pkg | 2025-12-20 19:20 | 795K | |
| redis72-7.2.12.pkg | 2025-12-21 06:01 | 952K | |
| redis74-7.4.7.pkg | 2025-12-21 13:27 | 955K | |
| redis80-8.0.5.pkg | 2025-12-23 14:47 | 1.0M | |
| redis82-8.2.3.pkg | 2025-12-20 11:09 | 1.0M | |
| redis_exporter-1.80...> | 2025-12-22 10:00 | 3.1M | |
| redisearch-2.2.10.pkg | 2025-08-19 09:56 | 1.3M | |
| redisearch20-2.0.15.pkg | 2025-08-16 20:17 | 1.3M | |
| redisearch22-2.2.10.pkg | 2025-08-20 06:57 | 1.3M | |
| redisjson-2.0.8_33.pkg | 2025-12-28 06:16 | 477K | |
| redkite-1.3.1.pkg | 2025-12-28 16:02 | 97K | |
| redland-1.0.17_6.pkg | 2025-12-26 18:49 | 281K | |
| redland-bindings-1.0..> | 2025-12-29 19:42 | 58K | |
| redmine60-6.0.7_1.pkg | 2025-12-30 15:10 | 3.0M | |
| rednotebook-2.31_4.pkg | 2025-12-27 21:06 | 628K | |
| redo-1.5_1.pkg | 2025-12-21 02:12 | 39K | |
| redorblack-1.0.pkg | 2025-08-22 07:08 | 17K | |
| redpanda-connect-4.7..> | 2025-12-20 05:20 | 52M | |
| redsea-1.2.0.pkg | 2025-12-29 12:59 | 241K | |
| redshift-1.12_2.pkg | 2025-12-29 12:53 | 150K | |
| reduce-20220617_3.pkg | 2025-12-29 05:54 | 12M | |
| reduce-psl-20240812.pkg | 2025-08-22 10:26 | 8.6M | |
| ree-1.4.1_1.pkg | 2025-08-21 02:50 | 6.3K | |
| reed-5.6_1.pkg | 2025-08-19 04:45 | 20K | |
| reed-solomon-4.0_1.pkg | 2025-08-21 02:56 | 17K | |
| refdb-0.9.9_14.pkg | 2025-12-22 03:35 | 882K | |
| referenceassemblies-..> | 2025-08-16 08:18 | 825K | |
| reflect-cpp-0.22.0.pkg | 2025-12-22 07:57 | 363K | |
| reflection-cpp-0.4.0..> | 2025-08-15 00:14 | 9.9K | |
| reflex-20241231.pkg | 2025-08-15 16:22 | 108K | |
| regexx-0.98.1_6.pkg | 2025-08-19 09:19 | 19K | |
| regexxer-0.10_9.pkg | 2025-12-29 12:57 | 188K | |
| reggae-0.5.0.pkg | 2025-12-23 14:18 | 45K | |
| regoth-0.4.189_3.pkg | 2025-12-28 13:52 | 1.8M | |
| rehex-0.63.4.pkg | 2025-12-30 05:51 | 2.6M | |
| reicast-0.20201231_5..> | 2025-12-28 13:39 | 1.5M | |
| rej-0.16_1.pkg | 2025-12-21 12:21 | 12K | |
| rejik-3.2.12.pkg | 2025-12-21 01:04 | 37K | |
| rekor-client-1.4.3.pkg | 2025-12-24 04:19 | 9.0M | |
| rekor-server-1.4.3.pkg | 2025-12-20 06:04 | 25M | |
| relayd-7.4.2024.01.1..> | 2025-12-19 06:06 | 782K | |
| remake-1.6_2.pkg | 2025-12-22 14:58 | 353K | |
| remark42-1.14.0_12.pkg | 2025-12-20 05:21 | 6.8M | |
| remarkable-devd-1.0_..> | 2025-08-20 08:51 | 1.5K | |
| remarp-0.05_1.pkg | 2025-12-20 17:19 | 11K | |
| remind-06.02.01.pkg | 2025-12-28 14:12 | 385K | |
| remmina-1.4.41_1.pkg | 2025-12-30 03:49 | 1.0M | |
| remmina-lite-1.4.41_..> | 2025-12-28 02:28 | 951K | |
| remontoire-1.4.4.pkg | 2025-12-29 12:11 | 23K | |
| remotebox-3.2_2.pkg | 2025-12-30 14:21 | 902K | |
| remotedesk-0.1_12.pkg | 2025-12-27 15:43 | 17K | |
| remotery-g20190209.pkg | 2025-08-18 20:22 | 96K | |
| remserial-1.4.pkg | 2025-08-17 00:33 | 8.9K | |
| rename-1.99.2_1.pkg | 2025-08-17 12:20 | 12K | |
| renameutils-0.12.0_3..> | 2025-12-29 02:34 | 93K | |
| renattach-1.2.4_2.pkg | 2025-08-20 19:50 | 33K | |
| rendercheck-1.5_1.pkg | 2025-08-22 04:05 | 22K | |
| renewck-1.01_1.pkg | 2025-12-21 04:35 | 11K | |
| renrot-1.2.0_3.pkg | 2025-12-29 08:50 | 53K | |
| renterd-2.7.1_1.pkg | 2025-12-21 06:30 | 7.0M | |
| reoback-1.0_3.pkg | 2025-12-23 12:12 | 14K | |
| reop-2.1.1_2.pkg | 2025-08-17 08:15 | 21K | |
| rep-gtk2-0.90.8.3_1,..> | 2025-12-26 22:52 | 406K | |
| repeater-0.17.pkg | 2025-08-20 19:11 | 26K | |
| replaceit-1.0.1.pkg | 2025-08-18 23:08 | 5.8K | |
| replex-0.1.6.8_1,1.pkg | 2025-08-18 05:56 | 44K | |
| replxx-0.0.4.pkg | 2025-08-21 05:10 | 100K | |
| repng2jpeg-1.0.5_2.pkg | 2025-12-28 14:14 | 3.9K | |
| reportmagic-2.21_4.pkg | 2025-12-30 14:18 | 298K | |
| repos-style-2.0_3.pkg | 2025-12-29 12:55 | 42K | |
| reposilite-3.5.26.pkg | 2025-12-29 03:29 | 64M | |
| reprise-0.6.1_2.pkg | 2025-12-20 17:05 | 84K | |
| reproc-14.2.5.pkg | 2025-08-15 12:25 | 29K | |
| reproduce-0.7.0.pkg | 2025-12-20 20:59 | 9.9K | |
| reproxy-1.2.3_1.pkg | 2025-08-20 13:57 | 4.1M | |
| repsnapper-2.5.a5_1.pkg | 2025-12-29 19:48 | 736K | |
| reptyr-0.10.0.pkg | 2025-08-19 07:28 | 18K | |
| rescue-1.0.5.pkg | 2025-12-29 13:05 | 3.8M | |
| resolv_wrapper-1.1.8..> | 2025-08-14 16:17 | 13K | |
| resource-agents-4.13..> | 2025-12-19 15:36 | 698K | |
| respond-1.3_1.pkg | 2025-08-21 09:48 | 7.8K | |
| rest-0.8.1_3.pkg | 2025-12-19 01:26 | 100K | |
| rest-server-0.14.0_4..> | 2025-12-23 12:12 | 3.0M | |
| restbed-4.8.pkg | 2025-08-13 23:08 | 713K | |
| restic-0.18.1_4.pkg | 2025-12-19 12:47 | 10M | |
| restinio-0.7.8.pkg | 2025-12-19 00:21 | 192K | |
| resvg-0.45.1_2.pkg | 2025-12-28 19:52 | 1.1M | |
| resvg-c-api-0.45.1_2..> | 2025-12-27 16:49 | 1.5M | |
| retail-1.0.2.pkg | 2025-08-17 22:26 | 6.9K | |
| retawq-0.2.6.c_12.pkg | 2025-12-23 22:23 | 179K | |
| retcl-0.6.0.pkg | 2025-09-01 08:46 | 7.5K | |
| reticulum-1.0.0.pkg | 2025-12-26 20:23 | 729K | |
| retro12-2024.1.pkg | 2025-08-18 23:52 | 247K | |
| retroarch-assets-1.2..> | 2025-12-19 06:58 | 166M | |
| retroshare-0.6.4_18.pkg | 2025-12-29 03:38 | 11M | |
| retry-1.0.5_1.pkg | 2025-08-16 03:41 | 8.0K | |
| revive-1.12.0.pkg | 2025-12-20 15:02 | 3.2M | |
| revsocks-2.8_19.pkg | 2025-12-23 12:38 | 3.5M | |
| rex-4.1_1.pkg | 2025-08-27 23:44 | 36K | |
| rexima-1.4_1.pkg | 2025-08-18 19:33 | 10K | |
| rexx-curl-2.1.1.pkg | 2025-12-23 03:10 | 193K | |
| rexx-imc-1.76_5.pkg | 2025-08-16 18:37 | 216K | |
| rexx-regina-3.9.3_1.pkg | 2025-08-15 16:15 | 2.3M | |
| rexx-regmath-1.00_2.pkg | 2025-08-17 17:27 | 51K | |
| rexx-regutil-1.26_3.pkg | 2025-08-20 04:44 | 135K | |
| rexx-wrapper-2.4.pkg | 2025-08-22 13:35 | 250K | |
| rezerwar-0.4.2_3.pkg | 2025-12-22 20:16 | 1.7M | |
| rezound-0.13.1.b_9.pkg | 2025-12-28 00:41 | 1.4M | |
| rfbproxy-1.1.1_1.pkg | 2025-08-20 01:23 | 26K | |
| rfc-3.2.3_5.pkg | 2025-12-21 02:32 | 8.0K | |
| rfcdiff-1.33_1.pkg | 2025-12-22 17:11 | 11K | |
| rfksay-0.1.pkg | 2025-12-22 03:39 | 1.8K | |
| rgb-1.1.0_1.pkg | 2025-08-13 22:33 | 8.7K | |
| rgb-tui-1.2.0_1.pkg | 2025-12-29 00:39 | 22K | |
| rgbds-1.0.0.pkg | 2025-12-27 16:59 | 416K | |
| rgbpaint-0.8.7_11.pkg | 2025-12-29 11:46 | 61K | |
| rgxg-0.1.2_1.pkg | 2025-08-22 17:50 | 25K | |
| rhash-1.4.4_2.pkg | 2025-12-16 01:31 | 225K | |
| rhino-1.7.r4_2.pkg | 2025-12-27 06:02 | 1.0M | |
| rhtvision-2.2.1.1_11..> | 2025-12-30 02:37 | 624K | |
| rhythmbox-3.4.8_3.pkg | 2025-12-29 23:14 | 2.8M | |
| ricochet-1.1.4_37.pkg | 2025-12-28 01:47 | 498K | |
| ridl-g20190530.pkg | 2025-08-15 23:05 | 11K | |
| riece-9.0.0_28,1.pkg | 2025-12-29 21:58 | 182K | |
| riece-emacs_canna-9...> | 2025-12-29 22:34 | 182K | |
| riece-emacs_devel-9...> | 2025-12-28 16:04 | 182K | |
| riece-emacs_devel_no..> | 2025-12-20 16:35 | 182K | |
| riece-emacs_nox-9.0...> | 2025-12-24 04:32 | 182K | |
| riece-emacs_wayland-..> | 2025-12-30 17:24 | 182K | |
| riemann-0.3.11.pkg | 2025-12-29 19:03 | 94M | |
| riemann-c-client-2.2..> | 2025-12-20 07:50 | 35K | |
| riffdiff-3.6.1_1.pkg | 2025-12-27 22:14 | 728K | |
| rifiuti2-0.7.0_1.pkg | 2025-12-21 06:44 | 32K | |
| rigsofrods-caelum-0...> | 2025-12-30 14:03 | 242K | |
| rinetd-0.62,1.pkg | 2025-08-16 18:19 | 20K | |
| ringrtc-2.60.7_1.pkg | 2025-12-27 19:18 | 5.5M | |
| ringtonetools-2.26.pkg | 2025-08-17 15:44 | 47K | |
| rinse-3.2.pkg | 2025-12-20 13:34 | 24K | |
| rinutils-0.10.2.pkg | 2025-08-13 14:23 | 6.1K | |
| rio-terminal-emulato..> | 2025-12-29 16:40 | 8.2M | |
| ripe-whois-3.2.2_1.pkg | 2025-08-16 01:12 | 11K | |
| ripgrep-15.1.0_2.pkg | 2025-12-25 00:30 | 3.6M | |
| ripgrep-all-0.9.6_42..> | 2025-12-29 13:02 | 2.0M | |
| ripmime-1.4.1.0_1.pkg | 2025-08-14 21:34 | 55K | |
| ripole-0.2.2.pkg | 2025-08-14 05:59 | 16K | |
| ripperx-2.7.3_6.pkg | 2025-12-30 11:09 | 109K | |
| riscv-isa-sim-1.1.0...> | 2025-08-19 00:51 | 6.6M | |
| riscv32-unknown-elf-..> | 2025-12-19 11:03 | 2.2M | |
| riscv32-unknown-elf-..> | 2025-12-23 04:02 | 32M | |
| riscv64-binutils-2.4..> | 2025-12-20 03:56 | 2.2M | |
| riscv64-freebsd-sysr..> | 2025-12-20 00:17 | 61M | |
| riscv64-gcc12-12.3.0..> | 2025-12-21 19:14 | 28M | |
| riscv64-gcc13-13.2.0..> | 2025-12-22 02:17 | 33M | |
| riscv64-gcc14-14.1.0..> | 2025-12-23 11:27 | 52M | |
| riscv64-none-elf-bin..> | 2025-12-18 20:19 | 2.2M | |
| riscv64-none-elf-gcc..> | 2025-12-19 13:35 | 32M | |
| riscv64-rust-bootstr..> | 2025-12-29 23:41 | 82M | |
| ristretto-0.13.4.pkg | 2025-12-27 09:44 | 254K | |
| river-0.3.12.pkg | 2025-12-27 06:48 | 200K | |
| rizin-0.8.1.pkg | 2025-12-20 03:38 | 6.1M | |
| rizin-cutter-2.4.1_1..> | 2025-12-28 06:47 | 1.6M | |
| rkbin-v0.3.pkg | 2025-12-19 07:14 | 200K | |
| rkcommon-1.14.2,1.pkg | 2025-12-27 16:09 | 176K | |
| rkhunter-1.4.6_3.pkg | 2025-12-23 17:05 | 230K | |
| rkr-lv2-2.2_1.pkg | 2025-12-29 19:15 | 284K | |
| rl-0.2.7_1.pkg | 2025-08-22 19:19 | 9.1K | |
| rlaunch-1.3.14_22.pkg | 2025-12-28 13:47 | 353K | |
| rldd-0.3.0_6.pkg | 2025-12-30 17:57 | 159K | |
| rlog-1.4_3.pkg | 2025-08-14 10:08 | 249K | |
| rlottie-0.2.49.pkg | 2025-08-15 19:42 | 187K | |
| rlpr-2.06_4.pkg | 2025-08-19 21:39 | 37K | |
| rlwrap-0.45.2_2.pkg | 2025-12-18 19:32 | 112K | |
| rman-3.2_1.pkg | 2025-08-22 07:35 | 45K | |
| rmap-1.2_15.pkg | 2025-12-29 02:35 | 7.4M | |
| rmf-1.7.0_3.pkg | 2025-12-27 06:46 | 1.4M | |
| rmilter-1.10.0_1.pkg | 2025-12-20 07:53 | 217K | |
| rmlint-2.10.1.11_1.pkg | 2025-12-21 02:38 | 123K | |
| rna-STAR-2.7.11.a_1.pkg | 2025-12-27 02:48 | 586K | |
| rna-seq-0.1.4_1.pkg | 2025-12-30 17:23 | 783 | |
| rname-1.0.2_1.pkg | 2025-08-20 05:15 | 4.4K | |
| rnd_jue-3.3.0.0_7.pkg | 2025-12-27 21:55 | 37M | |
| rndpassw-0.2.2_1.pkg | 2025-08-16 17:22 | 4.7K | |
| rngstreams-1.0.1_2.pkg | 2025-08-15 21:45 | 15K | |
| rnnoise-0.2.pkg | 2025-08-14 08:25 | 1.2M | |
| rnnoise-nu-g20180916..> | 2025-08-15 19:37 | 528K | |
| rnp-0.18.0_3.pkg | 2025-12-22 10:16 | 528K | |
| rntrack-2.2.2.pkg | 2025-12-22 01:28 | 164K | |
| rnv-1.7.11_2.pkg | 2025-12-22 00:25 | 95K | |
| ro-aspell-3.3.2,1.pkg | 2025-12-22 10:09 | 9.3M | |
| ro-hunspell-3.3.10.pkg | 2025-08-17 02:43 | 507K | |
| ro-hyphen-3.3.10.pkg | 2025-08-21 23:03 | 3.6K | |
| ro-libreoffice-25.8...> | 2025-12-27 17:51 | 3.1M | |
| ro-mythes-3.3_1.pkg | 2025-08-18 08:33 | 869K | |
| robin-hood-hashing-3..> | 2025-08-15 16:34 | 21K | |
| robin-map-1.3.0_1.pkg | 2025-08-13 04:54 | 20K | |
| robocode-1.9.5.2.pkg | 2025-12-28 06:06 | 15M | |
| robocode-naval-0.9.2..> | 2025-12-28 10:26 | 5.3M | |
| roboctl-0.3.9.4.pkg | 2025-08-18 09:26 | 81K | |
| robodoc-4.99.44_1.pkg | 2025-08-21 20:46 | 100K | |
| robotfindskitten-2.8..> | 2025-08-17 13:58 | 36K | |
| roboto-fonts-ttf-2.1..> | 2025-12-27 11:03 | 3.0M | |
| rocinante-1.1.0.2512..> | 2025-12-28 11:48 | 8.7K | |
| rockdodger-1.1.4_1.pkg | 2025-12-29 12:41 | 868K | |
| rocksdb-10.7.5_1.pkg | 2025-12-19 15:33 | 109M | |
| rocksdb-jni-9.11.1_1..> | 2025-12-28 04:26 | 2.6M | |
| rocksdb9-9.11.2_1.pkg | 2025-12-19 08:28 | 106M | |
| rocksndiamonds-4.4.1..> | 2025-12-29 04:00 | 2.5M | |
| rocksndiamonds-data-..> | 2025-08-21 19:08 | 65M | |
| rocr-1.9.1.pkg | 2025-12-29 00:41 | 262K | |
| rocs-25.12.0.pkg | 2025-12-27 01:02 | 1.5M | |
| roct-1.9.1.pkg | 2025-12-27 09:00 | 60K | |
| rodent-5.3.16.3_7.pkg | 2025-12-29 01:25 | 3.3M | |
| rofi-1.7.8.pkg | 2025-12-27 03:42 | 551K | |
| rofi-calc-2.5.0.pkg | 2025-12-29 15:27 | 7.2K | |
| rofi-emoji-3.2.0.pkg | 2025-12-28 07:03 | 69K | |
| rofi-file-browser-ex..> | 2025-12-29 04:49 | 17K | |
| rofi-pass-2.0.2_2.pkg | 2025-12-30 12:11 | 10K | |
| rofi-wayland-1.7.8.pkg | 2025-12-29 12:32 | 568K | |
| rolo-011_1.pkg | 2025-08-16 18:56 | 20K | |
| root-tail-1.3_1.pkg | 2025-08-16 02:55 | 15K | |
| ros-console_bridge-1..> | 2025-08-13 14:27 | 12K | |
| ros-urdfdom-3.0.2.pkg | 2025-08-13 18:20 | 72K | |
| ros-urdfdom_headers-..> | 2025-08-13 15:55 | 13K | |
| rosegarden-22.12.1_1..> | 2025-12-29 15:47 | 7.3M | |
| rosenpass-0.2.2_14.pkg | 2025-12-28 12:04 | 894K | |
| rospo-0.15.1_3.pkg | 2025-12-22 06:33 | 3.0M | |
| roswell-24.10.115.pkg | 2025-12-20 20:42 | 109K | |
| rotate-1.2.pkg | 2025-08-16 06:15 | 34K | |
| rote-0.2.8_1.pkg | 2025-08-14 18:48 | 13K | |
| rotorouter-1.0_3.pkg | 2025-08-22 03:28 | 6.0K | |
| rottdc-1.0.2_8.pkg | 2025-12-23 16:02 | 547K | |
| roundcube-automatic_..> | 2025-12-30 12:02 | 30K | |
| roundcube-automatic_..> | 2025-12-29 10:46 | 30K | |
| roundcube-automatic_..> | 2025-12-28 10:19 | 30K | |
| roundcube-automatic_..> | 2025-12-28 01:16 | 30K | |
| roundcube-automatic_..> | 2025-12-28 20:36 | 30K | |
| roundcube-calendar-k..> | 2025-12-28 14:47 | 1.5M | |
| roundcube-calendar-k..> | 2025-12-29 12:02 | 1.5M | |
| roundcube-calendar-k..> | 2025-12-27 22:17 | 1.5M | |
| roundcube-calendar-k..> | 2025-12-29 06:53 | 1.5M | |
| roundcube-calendar-k..> | 2025-12-29 09:54 | 1.5M | |
| roundcube-carddav-ph..> | 2025-12-30 01:48 | 498K | |
| roundcube-carddav-ph..> | 2025-12-29 15:02 | 498K | |
| roundcube-carddav-ph..> | 2025-12-29 13:20 | 498K | |
| roundcube-carddav-ph..> | 2025-12-29 16:28 | 498K | |
| roundcube-carddav-ph..> | 2025-12-29 16:29 | 498K | |
| roundcube-classic-ph..> | 2025-12-27 21:26 | 224K | |
| roundcube-classic-ph..> | 2025-12-29 18:12 | 225K | |
| roundcube-classic-ph..> | 2025-12-30 05:35 | 225K | |
| roundcube-classic-ph..> | 2025-12-30 07:15 | 224K | |
| roundcube-classic-ph..> | 2025-12-29 23:47 | 224K | |
| roundcube-contextmen..> | 2025-12-29 22:33 | 49K | |
| roundcube-contextmen..> | 2025-12-28 19:07 | 49K | |
| roundcube-contextmen..> | 2025-12-27 22:33 | 49K | |
| roundcube-contextmen..> | 2025-12-29 06:30 | 49K | |
| roundcube-contextmen..> | 2025-12-29 00:45 | 49K | |
| roundcube-gravatar-p..> | 2025-12-29 14:58 | 18K | |
| roundcube-gravatar-p..> | 2025-12-30 06:34 | 18K | |
| roundcube-gravatar-p..> | 2025-12-30 00:56 | 18K | |
| roundcube-gravatar-p..> | 2025-12-29 00:59 | 18K | |
| roundcube-gravatar-p..> | 2025-12-30 05:34 | 18K | |
| roundcube-html5_noti..> | 2025-12-30 14:47 | 21K | |
| roundcube-html5_noti..> | 2025-12-29 11:46 | 21K | |
| roundcube-html5_noti..> | 2025-12-28 21:06 | 21K | |
| roundcube-html5_noti..> | 2025-12-29 00:53 | 21K | |
| roundcube-html5_noti..> | 2025-12-29 05:50 | 21K | |
| roundcube-identity_s..> | 2025-12-28 21:12 | 5.7K | |
| roundcube-identity_s..> | 2025-12-30 01:42 | 5.7K | |
| roundcube-identity_s..> | 2025-12-29 11:36 | 5.7K | |
| roundcube-identity_s..> | 2025-12-30 08:17 | 5.7K | |
| roundcube-identity_s..> | 2025-12-29 18:41 | 5.7K | |
| roundcube-larry-php8..> | 2025-12-30 15:26 | 250K | |
| roundcube-larry-php8..> | 2025-12-28 07:16 | 250K | |
| roundcube-larry-php8..> | 2025-12-30 10:28 | 250K | |
| roundcube-larry-php8..> | 2025-12-30 02:55 | 250K | |
| roundcube-larry-php8..> | 2025-12-28 23:05 | 250K | |
| roundcube-login_info..> | 2025-12-29 06:44 | 17K | |
| roundcube-login_info..> | 2025-12-30 10:35 | 17K | |
| roundcube-login_info..> | 2025-12-28 02:33 | 17K | |
| roundcube-login_info..> | 2025-12-28 23:32 | 17K | |
| roundcube-login_info..> | 2025-12-29 23:57 | 17K | |
| roundcube-php81-1.6...> | 2025-12-27 09:43 | 4.3M | |
| roundcube-php82-1.6...> | 2025-12-27 11:59 | 4.3M | |
| roundcube-php83-1.6...> | 2025-12-27 13:16 | 4.3M | |
| roundcube-php84-1.6...> | 2025-12-27 04:46 | 4.3M | |
| roundcube-php85-1.6...> | 2025-12-27 11:27 | 4.3M | |
| roundcube-sauserpref..> | 2025-12-27 23:41 | 67K | |
| roundcube-sauserpref..> | 2025-12-29 13:00 | 67K | |
| roundcube-sauserpref..> | 2025-12-30 11:52 | 67K | |
| roundcube-sauserpref..> | 2025-12-30 04:51 | 67K | |
| roundcube-sauserpref..> | 2025-12-29 03:51 | 67K | |
| roundcube-thunderbir..> | 2025-12-30 16:35 | 186K | |
| roundcube-thunderbir..> | 2025-12-28 06:48 | 186K | |
| roundcube-thunderbir..> | 2025-12-29 04:47 | 186K | |
| roundcube-thunderbir..> | 2025-12-28 19:41 | 186K | |
| roundcube-thunderbir..> | 2025-12-30 08:45 | 186K | |
| roundcube-tls_icon-p..> | 2025-12-30 12:17 | 7.2K | |
| roundcube-tls_icon-p..> | 2025-12-29 15:11 | 7.2K | |
| roundcube-tls_icon-p..> | 2025-12-30 08:15 | 7.2K | |
| roundcube-tls_icon-p..> | 2025-12-28 09:07 | 7.2K | |
| roundcube-tls_icon-p..> | 2025-12-30 06:27 | 7.2K | |
| roundcube-twofactor_..> | 2025-12-28 01:19 | 1.1M | |
| roundcube-twofactor_..> | 2025-12-28 18:28 | 1.1M | |
| roundcube-twofactor_..> | 2025-12-27 20:52 | 1.1M | |
| roundcube-twofactor_..> | 2025-12-27 23:41 | 1.1M | |
| roundcube-twofactor_..> | 2025-12-29 00:53 | 1.1M | |
| roundcube-veximaccou..> | 2025-12-29 11:34 | 23K | |
| roundcube-veximaccou..> | 2025-12-28 22:43 | 23K | |
| roundcube-veximaccou..> | 2025-12-30 05:25 | 23K | |
| roundcube-veximaccou..> | 2025-12-28 19:09 | 23K | |
| roundcube-veximaccou..> | 2025-12-29 19:28 | 23K | |
| roundcube-yubikey_au..> | 2025-12-27 23:08 | 15K | |
| roundcube-yubikey_au..> | 2025-12-29 18:39 | 15K | |
| roundcube-yubikey_au..> | 2025-12-30 04:41 | 15K | |
| roundcube-yubikey_au..> | 2025-12-28 12:03 | 15K | |
| roundcube-yubikey_au..> | 2025-12-29 19:42 | 15K | |
| routers2-2.23.pkg | 2025-12-27 12:48 | 216K | |
| routers2-extensions-..> | 2025-12-30 02:31 | 32K | |
| routers2-extras-2.23..> | 2025-12-30 02:29 | 56K | |
| routinator-0.15.1_2.pkg | 2025-12-28 19:09 | 2.3M | |
| routino-3.4.3.pkg | 2025-12-19 10:17 | 1.8M | |
| rovclock-0.6e_1.pkg | 2025-08-16 21:59 | 7.5K | |
| rox-filer-2.11_14.pkg | 2025-12-28 11:01 | 1.0M | |
| roxterm-3.17.2.pkg | 2025-12-29 13:20 | 488K | |
| rpcalc-0.8.2_11.pkg | 2025-12-30 07:58 | 82K | |
| rpclib-2.3.0.pkg | 2025-08-18 10:20 | 402K | |
| rpg-cli-1.0.1_34.pkg | 2025-12-27 22:06 | 581K | |
| rpi-firmware-1.20230..> | 2025-08-22 01:22 | 5.2M | |
| rpki-client-9.6.pkg | 2025-12-22 18:53 | 139K | |
| rpl-1.4.1_1.pkg | 2025-08-17 01:26 | 13K | |
| rpm-sequoia-1.9.0_4.pkg | 2025-12-29 16:16 | 703K | |
| rpm2cpio-1.4_2.pkg | 2025-08-14 08:05 | 967 | |
| rpm4-4.18.2_3.pkg | 2025-12-18 16:04 | 907K | |
| rpm4-noopenmp-4.18.2..> | 2025-12-23 05:32 | 908K | |
| rpsl2acl-1.01.pkg | 2025-12-22 03:13 | 8.3K | |
| rqlite-9.3.2_1.pkg | 2025-12-23 18:48 | 11M | |
| rrdbot-0.9.7.d202003..> | 2025-12-28 09:16 | 270K | |
| rrdman-1.0.1_7.pkg | 2025-12-28 10:07 | 7.6K | |
| rrdmerge-0.0.1_2.pkg | 2025-12-27 21:38 | 4.7K | |
| rrdtool-1.9.0_1.pkg | 2025-12-26 18:51 | 729K | |
| rs-aggregate-0.3.2_1..> | 2025-12-27 21:26 | 310K | |
| rsclock-0.1.12_7.pkg | 2025-12-30 00:54 | 207K | |
| rscsi-2024.03.21.pkg | 2025-12-20 03:35 | 16K | |
| rset-3.2.pkg | 2025-08-21 03:02 | 35K | |
| rsgain-3.6_1.pkg | 2025-12-30 16:40 | 107K | |
| rshim-user-space-2.0..> | 2025-12-29 08:03 | 39K | |
| rsibreak-0.13.0.pkg | 2025-12-30 14:15 | 551K | |
| rslsync-2.8.1.1390.pkg | 2025-08-22 11:17 | 12M | |
| rsnapshot-1.4.4_2.pkg | 2025-12-23 16:08 | 78K | |
| rspamd-3.14.0.pkg | 2025-12-22 03:34 | 4.0M | |
| rspamd-devel-3.11.a1..> | 2025-12-21 06:34 | 3.9M | |
| rsplib-3.5.6.pkg | 2025-12-30 04:55 | 1.7M | |
| rss-bridge-php81-202..> | 2025-12-28 08:59 | 612K | |
| rss-bridge-php82-202..> | 2025-12-30 18:14 | 611K | |
| rss-bridge-php83-202..> | 2025-12-30 15:11 | 612K | |
| rss-bridge-php84-202..> | 2025-12-28 13:39 | 612K | |
| rss-bridge-php85-202..> | 2025-12-30 07:49 | 612K | |
| rsskit-0.4_10.pkg | 2025-12-27 13:16 | 36K | |
| rssroll-0.11.0_1.pkg | 2025-12-23 17:25 | 34K | |
| rsstail-2.1.pkg | 2025-12-28 04:30 | 8.2K | |
| rsstool-1.0.0_5.pkg | 2025-12-23 11:02 | 55K | |
| rsvndump-0.6.2_2.pkg | 2025-12-22 16:21 | 35K | |
| rsyn-0.0.1_19.pkg | 2025-12-30 16:44 | 582K | |
| rsync-3.4.1_4.pkg | 2025-12-18 04:32 | 392K | |
| rsync-bpc-3.1.3.0.pkg | 2025-08-16 23:36 | 228K | |
| rsyncbackup-1.1_1.pkg | 2025-12-23 05:45 | 41K | |
| rsyncrypto-1.14_3.pkg | 2025-12-22 15:20 | 52K | |
| rsynth-2.0_7.pkg | 2025-12-23 04:08 | 30K | |
| rsyslog-8.2512.0.pkg | 2025-12-28 04:50 | 425K | |
| rt44-4.4.9.pkg | 2025-12-27 06:22 | 6.3M | |
| rt50-5.0.9.pkg | 2025-12-27 14:45 | 14M | |
| rt60-6.0.2.pkg | 2025-12-29 14:12 | 8.3M | |
| rtaudio-6.0.1_1.pkg | 2025-12-27 12:59 | 43K | |
| rtf2latex2e-2.2.3.pkg | 2025-08-21 23:30 | 163K | |
| rtfm-1.0_1.pkg | 2025-08-17 13:32 | 5.9K | |
| rtfreader-1.0_1.pkg | 2025-08-16 08:32 | 5.9K | |
| rtg-0.7.5_2.pkg | 2025-12-28 00:26 | 103K | |
| rtkit-unix-0.2025050..> | 2025-12-29 05:22 | 27K | |
| rtl-433-25.12.pkg | 2025-12-30 08:47 | 349K | |
| rtl-sdr-2.0.2,1.pkg | 2025-08-13 23:10 | 85K | |
| rtlbt-firmware-20251..> | 2025-12-29 04:01 | 490K | |
| rtmidi-6.0.0.pkg | 2025-12-26 20:44 | 29K | |
| rtorrent-0.16.5.pkg | 2025-12-22 03:21 | 484K | |
| rtpproxy-2.1.1_1.pkg | 2025-12-23 18:08 | 133K | |
| rtptools-1.22_1.pkg | 2025-08-18 19:32 | 43K | |
| rtrlib-0.8.0_1.pkg | 2025-12-19 00:01 | 58K | |
| rttr-0.9.6.16_3.pkg | 2025-08-13 22:12 | 254K | |
| rtty-4.0.pkg | 2025-08-17 03:49 | 20K | |
| ru-artwiz-ru-2004103..> | 2025-12-28 14:17 | 18K | |
| ru-aspell-0.99.f7.1_..> | 2025-12-21 12:32 | 1.5M | |
| ru-d1489-1.5.1_1.pkg | 2025-08-16 13:01 | 8.6K | |
| ru-emkatic-gtk2-0.44..> | 2025-12-30 10:30 | 2.0M | |
| ru-emkatic-qt5-0.44_..> | 2025-12-30 02:24 | 2.0M | |
| ru-emkatic-qt6-0.44_..> | 2025-12-29 14:16 | 2.0M | |
| ru-eric6-21.11.pkg | 2025-08-17 15:12 | 423K | |
| ru-freebsd-doc-20251..> | 2025-12-19 06:48 | 21M | |
| ru-hunspell-20131101..> | 2025-08-22 09:04 | 599K | |
| ru-hyphen-2004.04.15..> | 2025-08-17 21:21 | 9.1K | |
| ru-koi2koi-1998.04.1..> | 2025-08-16 04:56 | 7.4K | |
| ru-koi8rPS-1.0_2.pkg | 2025-08-18 19:08 | 625K | |
| ru-libgd-2.3.3_13,1.pkg | 2025-12-29 23:20 | 222K | |
| ru-libreoffice-25.8...> | 2025-12-27 07:30 | 3.5M | |
| ru-mueller-dic-1.2_4..> | 2025-08-21 18:33 | 5.0M | |
| ru-mythes-2007.06.13..> | 2025-08-21 09:06 | 189K | |
| ru-p5-XML-Parser-enc..> | 2025-12-22 13:15 | 1.5K | |
| ru-russian-0.6.0.pkg | 2025-12-30 02:00 | 24K | |
| ru-rux-0.82_1.pkg | 2025-08-17 09:12 | 11K | |
| ru-wordpress-ru_RU-6..> | 2025-12-29 19:25 | 25M | |
| ru-xcode-4.1.pkg | 2025-08-18 05:15 | 15K | |
| ru-xruskb-1.15.4_4.pkg | 2025-08-22 20:33 | 75K | |
| rubberband-4.0.0.pkg | 2025-12-27 10:12 | 381K | |
| rubiks-20070912.pkg | 2025-08-22 03:22 | 234K | |
| rubix-1.0.6_8.pkg | 2025-12-28 05:41 | 31K | |
| ruby-3.3.10,1.pkg | 2025-12-16 01:41 | 9.8M | |
| ruby-build-20251218.pkg | 2025-12-29 04:07 | 81K | |
| ruby-install-0.10.1.pkg | 2025-12-23 19:53 | 13K | |
| ruby-notmuch-0.39_1.pkg | 2025-12-21 14:56 | 13K | |
| ruby-subversion-1.14..> | 2025-12-20 05:40 | 594K | |
| ruby32-3.2.9,1.pkg | 2025-12-21 01:07 | 9.1M | |
| ruby33-bdb-0.6.6_9.pkg | 2025-12-18 20:55 | 422K | |
| ruby33-bio-1.5.1.pkg | 2025-12-22 12:53 | 515K | |
| ruby33-bsearch-1.5_1..> | 2025-12-19 14:18 | 2.1K | |
| ruby33-escape-0.2.pkg | 2025-12-22 01:22 | 4.7K | |
| ruby33-format-1.09.pkg | 2025-12-22 14:38 | 22K | |
| ruby33-gd-0.8.0_9.pkg | 2025-12-28 03:09 | 42K | |
| ruby33-gems-3.7.2.pkg | 2025-12-16 01:49 | 654K | |
| ruby33-htree-0.8_1.pkg | 2025-12-23 17:03 | 316K | |
| ruby33-libpafe-ruby-..> | 2025-12-19 22:26 | 10K | |
| ruby33-qdbm-1.8.78_4..> | 2025-12-21 06:07 | 31K | |
| ruby33-setup.rb-3.4...> | 2025-12-23 13:56 | 31K | |
| ruby33-smf-0.15.15_1..> | 2025-12-23 14:48 | 41K | |
| ruby33-taglib-1.1_2.pkg | 2025-12-23 15:14 | 2.8K | |
| ruby33-tokyocabinet-..> | 2025-12-23 01:34 | 60K | |
| ruby33-xapian-1.4.30..> | 2025-12-19 21:03 | 656K | |
| ruby34-3.4.7,1.pkg | 2025-12-23 12:32 | 10M | |
| ruby40-4.0.0.p2,1.pkg | 2025-12-21 16:18 | 8.9M | |
| rubygem-CFPropertyLi..> | 2025-12-18 10:08 | 15K | |
| rubygem-CFPropertyLi..> | 2025-12-19 16:47 | 15K | |
| rubygem-StreetAddres..> | 2025-12-20 09:52 | 8.9K | |
| rubygem-aarch64-2.1...> | 2025-12-19 08:04 | 106K | |
| rubygem-abbrev-0.1.2..> | 2025-12-19 15:48 | 5.1K | |
| rubygem-abstract-1.0..> | 2025-12-20 06:03 | 9.7K | |
| rubygem-ace-rails-ap..> | 2025-12-23 17:03 | 1.0M | |
| rubygem-acme-client-..> | 2025-12-28 01:20 | 20K | |
| rubygem-acme-client-..> | 2025-12-20 00:11 | 19K | |
| rubygem-action_text-..> | 2025-12-26 14:09 | 90K | |
| rubygem-actioncable-..> | 2025-12-26 19:14 | 40K | |
| rubygem-actioncable5..> | 2025-12-27 01:18 | 36K | |
| rubygem-actioncable5..> | 2025-12-27 01:06 | 37K | |
| rubygem-actioncable5..> | 2025-12-27 00:59 | 36K | |
| rubygem-actioncable6..> | 2025-12-27 00:28 | 37K | |
| rubygem-actioncable6..> | 2025-12-26 20:22 | 37K | |
| rubygem-actioncable7..> | 2025-12-27 00:54 | 38K | |
| rubygem-actioncable7..> | 2025-12-26 23:47 | 40K | |
| rubygem-actioncable7..> | 2025-12-26 18:31 | 39K | |
| rubygem-actioncable8..> | 2025-12-27 00:46 | 39K | |
| rubygem-actioncable8..> | 2025-12-26 14:09 | 39K | |
| rubygem-actionmailbo..> | 2025-12-26 19:49 | 20K | |
| rubygem-actionmailbo..> | 2025-12-26 20:36 | 19K | |
| rubygem-actionmailbo..> | 2025-12-26 21:06 | 20K | |
| rubygem-actionmailbo..> | 2025-12-26 23:31 | 20K | |
| rubygem-actionmailbo..> | 2025-12-26 20:28 | 20K | |
| rubygem-actionmailbo..> | 2025-12-26 21:09 | 20K | |
| rubygem-actionmailbo..> | 2025-12-27 09:40 | 20K | |
| rubygem-actionmailbo..> | 2025-12-26 17:36 | 20K | |
| rubygem-actionmailer..> | 2025-12-26 20:20 | 29K | |
| rubygem-actionmailer..> | 2025-12-27 00:28 | 23K | |
| rubygem-actionmailer..> | 2025-12-26 21:39 | 25K | |
| rubygem-actionmailer..> | 2025-12-26 22:57 | 24K | |
| rubygem-actionmailer..> | 2025-12-26 22:54 | 25K | |
| rubygem-actionmailer..> | 2025-12-26 21:25 | 26K | |
| rubygem-actionmailer..> | 2025-12-26 22:53 | 26K | |
| rubygem-actionmailer..> | 2025-12-27 02:07 | 26K | |
| rubygem-actionmailer..> | 2025-12-27 01:26 | 29K | |
| rubygem-actionmailer..> | 2025-12-26 20:26 | 27K | |
| rubygem-actionmailer..> | 2025-12-27 02:15 | 27K | |
| rubygem-actionmailer..> | 2025-12-26 16:05 | 28K | |
| rubygem-actionpack-a..> | 2025-12-28 23:36 | 13K | |
| rubygem-actionpack-g..> | 2025-12-26 14:20 | 200K | |
| rubygem-actionpack-p..> | 2025-12-29 17:28 | 14K | |
| rubygem-actionpack-x..> | 2025-12-28 21:04 | 3.2K | |
| rubygem-actionpack-x..> | 2025-12-29 13:42 | 3.1K | |
| rubygem-actionpack-x..> | 2025-12-28 04:55 | 3.1K | |
| rubygem-actionpack-x..> | 2025-12-27 19:03 | 3.1K | |
| rubygem-actionpack4-..> | 2025-12-26 14:27 | 154K | |
| rubygem-actionpack5-..> | 2025-12-26 14:46 | 171K | |
| rubygem-actionpack50..> | 2025-12-26 13:50 | 174K | |
| rubygem-actionpack52..> | 2025-12-26 14:40 | 177K | |
| rubygem-actionpack60..> | 2025-12-26 12:30 | 180K | |
| rubygem-actionpack61..> | 2025-12-26 13:48 | 186K | |
| rubygem-actionpack70..> | 2025-12-26 15:29 | 191K | |
| rubygem-actionpack71..> | 2025-12-26 13:05 | 200K | |
| rubygem-actionpack72..> | 2025-12-26 17:29 | 197K | |
| rubygem-actionpack80..> | 2025-12-26 18:52 | 202K | |
| rubygem-actionpack81..> | 2025-12-26 10:24 | 210K | |
| rubygem-actiontext-g..> | 2025-12-26 20:11 | 115K | |
| rubygem-actiontext60..> | 2025-12-26 20:25 | 15K | |
| rubygem-actiontext61..> | 2025-12-27 01:38 | 17K | |
| rubygem-actiontext70..> | 2025-12-26 23:11 | 81K | |
| rubygem-actiontext71..> | 2025-12-26 22:10 | 115K | |
| rubygem-actiontext72..> | 2025-12-26 21:05 | 115K | |
| rubygem-actiontext80..> | 2025-12-27 13:20 | 116K | |
| rubygem-actiontext81..> | 2025-12-26 16:34 | 34K | |
| rubygem-actionview-g..> | 2025-12-26 11:38 | 152K | |
| rubygem-actionview4-..> | 2025-12-26 10:56 | 119K | |
| rubygem-actionview5-..> | 2025-12-26 10:56 | 132K | |
| rubygem-actionview50..> | 2025-12-26 11:49 | 124K | |
| rubygem-actionview52..> | 2025-12-26 11:22 | 134K | |
| rubygem-actionview60..> | 2025-12-26 11:18 | 139K | |
| rubygem-actionview61..> | 2025-12-26 11:12 | 140K | |
| rubygem-actionview70..> | 2025-12-26 13:04 | 146K | |
| rubygem-actionview71..> | 2025-12-26 11:28 | 152K | |
| rubygem-actionview72..> | 2025-12-26 13:42 | 151K | |
| rubygem-actionview80..> | 2025-12-26 16:00 | 153K | |
| rubygem-actionview81..> | 2025-12-26 09:22 | 155K | |
| rubygem-active_hash-..> | 2025-12-26 21:25 | 22K | |
| rubygem-active_model..> | 2025-12-29 11:31 | 54K | |
| rubygem-active_recor..> | 2025-12-21 23:42 | 4.0K | |
| rubygem-active_scaff..> | 2025-12-28 23:33 | 263K | |
| rubygem-activejob-gi..> | 2025-12-26 14:10 | 32K | |
| rubygem-activejob4-4..> | 2025-12-26 18:52 | 17K | |
| rubygem-activejob5-5..> | 2025-12-26 18:42 | 22K | |
| rubygem-activejob50-..> | 2025-12-26 20:13 | 22K | |
| rubygem-activejob52-..> | 2025-12-26 18:48 | 23K | |
| rubygem-activejob60-..> | 2025-12-26 15:41 | 27K | |
| rubygem-activejob61-..> | 2025-12-26 14:55 | 29K | |
| rubygem-activejob70-..> | 2025-12-26 16:26 | 29K | |
| rubygem-activejob71-..> | 2025-12-26 17:31 | 32K | |
| rubygem-activejob72-..> | 2025-12-26 16:07 | 31K | |
| rubygem-activejob80-..> | 2025-12-26 19:47 | 31K | |
| rubygem-activejob81-..> | 2025-12-26 11:36 | 37K | |
| rubygem-activemessag..> | 2025-12-28 04:56 | 39K | |
| rubygem-activemodel-..> | 2025-12-26 11:01 | 58K | |
| rubygem-activemodel-..> | 2025-12-27 18:55 | 8.5K | |
| rubygem-activemodel4..> | 2025-12-26 16:56 | 38K | |
| rubygem-activemodel5..> | 2025-12-26 19:38 | 44K | |
| rubygem-activemodel5..> | 2025-12-26 18:39 | 46K | |
| rubygem-activemodel5..> | 2025-12-26 16:41 | 48K | |
| rubygem-activemodel6..> | 2025-12-26 13:52 | 50K | |
| rubygem-activemodel6..> | 2025-12-26 13:50 | 53K | |
| rubygem-activemodel7..> | 2025-12-26 13:51 | 52K | |
| rubygem-activemodel7..> | 2025-12-26 14:40 | 58K | |
| rubygem-activemodel7..> | 2025-12-26 13:21 | 57K | |
| rubygem-activemodel8..> | 2025-12-26 16:04 | 58K | |
| rubygem-activemodel8..> | 2025-12-26 09:55 | 59K | |
| rubygem-activerecord..> | 2025-12-22 06:51 | 7.6K | |
| rubygem-activerecord..> | 2025-12-29 05:42 | 4.9K | |
| rubygem-activerecord..> | 2025-12-26 14:40 | 426K | |
| rubygem-activerecord..> | 2025-12-28 06:20 | 63K | |
| rubygem-activerecord..> | 2025-12-27 15:43 | 283K | |
| rubygem-activerecord..> | 2025-12-29 18:24 | 2.8K | |
| rubygem-activerecord..> | 2025-12-29 23:02 | 9.4K | |
| rubygem-activerecord..> | 2025-12-29 03:51 | 8.9K | |
| rubygem-activerecord..> | 2025-12-26 20:38 | 266K | |
| rubygem-activerecord..> | 2025-12-26 22:51 | 282K | |
| rubygem-activerecord..> | 2025-12-26 22:54 | 289K | |
| rubygem-activerecord..> | 2025-12-26 19:50 | 283K | |
| rubygem-activerecord..> | 2025-12-26 17:30 | 326K | |
| rubygem-activerecord..> | 2025-12-26 15:56 | 342K | |
| rubygem-activerecord..> | 2025-12-26 15:58 | 378K | |
| rubygem-activerecord..> | 2025-12-26 17:29 | 426K | |
| rubygem-activerecord..> | 2025-12-26 14:53 | 422K | |
| rubygem-activerecord..> | 2025-12-26 17:49 | 426K | |
| rubygem-activerecord..> | 2025-12-26 11:39 | 438K | |
| rubygem-activeresour..> | 2025-12-29 15:08 | 37K | |
| rubygem-activeresour..> | 2025-12-26 21:07 | 33K | |
| rubygem-activestorag..> | 2025-12-26 14:50 | 58K | |
| rubygem-activestorag..> | 2025-12-26 22:59 | 40K | |
| rubygem-activestorag..> | 2025-12-26 19:02 | 46K | |
| rubygem-activestorag..> | 2025-12-26 20:13 | 50K | |
| rubygem-activestorag..> | 2025-12-26 18:12 | 56K | |
| rubygem-activestorag..> | 2025-12-26 18:04 | 57K | |
| rubygem-activestorag..> | 2025-12-26 18:28 | 56K | |
| rubygem-activestorag..> | 2025-12-26 22:02 | 57K | |
| rubygem-activestorag..> | 2025-12-26 13:56 | 58K | |
| rubygem-activesuppor..> | 2025-12-26 09:34 | 211K | |
| rubygem-activesuppor..> | 2025-12-26 08:35 | 240K | |
| rubygem-activesuppor..> | 2025-12-26 09:20 | 267K | |
| rubygem-activesuppor..> | 2025-12-26 09:22 | 263K | |
| rubygem-activesuppor..> | 2025-12-26 09:22 | 277K | |
| rubygem-activesuppor..> | 2025-12-26 09:11 | 180K | |
| rubygem-activesuppor..> | 2025-12-26 09:35 | 184K | |
| rubygem-activesuppor..> | 2025-12-26 09:55 | 187K | |
| rubygem-activesuppor..> | 2025-12-26 09:35 | 211K | |
| rubygem-activesuppor..> | 2025-12-26 10:08 | 204K | |
| rubygem-activesuppor..> | 2025-12-26 11:33 | 207K | |
| rubygem-activesuppor..> | 2025-12-26 06:46 | 219K | |
| rubygem-acts-as-tagg..> | 2025-12-29 10:04 | 18K | |
| rubygem-acts_as_tagg..> | 2025-12-22 10:23 | 14K | |
| rubygem-addressable-..> | 2025-12-18 04:16 | 83K | |
| rubygem-adsf-1.4.6.pkg | 2025-12-21 20:15 | 5.7K | |
| rubygem-aes_key_wrap..> | 2025-12-18 10:12 | 5.4K | |
| rubygem-afm-1.0.0.pkg | 2025-12-18 04:41 | 12K | |
| rubygem-after_commit..> | 2025-12-28 06:16 | 18K | |
| rubygem-ai4r-1.13.pkg | 2025-12-20 16:41 | 52K | |
| rubygem-airborne-0.3..> | 2025-12-29 05:21 | 23K | |
| rubygem-airbrussh-1...> | 2025-12-26 21:39 | 12K | |
| rubygem-akami-1.3.3_..> | 2025-12-19 15:37 | 8.9K | |
| rubygem-akismet-3.0...> | 2025-12-19 20:19 | 7.0K | |
| rubygem-albino-1.3.3..> | 2025-12-21 06:33 | 7.1K | |
| rubygem-algebra-0.2...> | 2025-12-21 03:21 | 143K | |
| rubygem-algebrick-0...> | 2025-12-18 17:18 | 21K | |
| rubygem-algorithms-1..> | 2025-12-20 11:00 | 303K | |
| rubygem-aliyun-sdk-0..> | 2025-12-18 13:14 | 65K | |
| rubygem-aliyun-sdk-g..> | 2025-12-18 22:54 | 65K | |
| rubygem-allison-2.0...> | 2025-12-18 09:12 | 22K | |
| rubygem-amalgalite-2..> | 2025-12-23 03:08 | 1.0M | |
| rubygem-amatch-0.5.0..> | 2025-12-27 19:31 | 40K | |
| rubygem-amazing_prin..> | 2025-12-18 15:25 | 23K | |
| rubygem-amazon-ec2-0..> | 2025-12-19 04:53 | 81K | |
| rubygem-amazon-ecs-2..> | 2025-12-21 02:55 | 26K | |
| rubygem-amq-protocol..> | 2025-12-19 02:18 | 40K | |
| rubygem-amqp-1.8.0.pkg | 2025-12-19 22:50 | 1.1M | |
| rubygem-amqp-utils-0..> | 2025-12-24 04:18 | 11K | |
| rubygem-analogger-1...> | 2025-12-20 05:51 | 20K | |
| rubygem-android_key_..> | 2025-12-18 21:05 | 11K | |
| rubygem-anemone-0.7...> | 2025-12-21 17:18 | 21K | |
| rubygem-annoy-0.5.6.pkg | 2025-12-26 21:22 | 6.9K | |
| rubygem-ansi-1.5.0.pkg | 2025-12-19 15:50 | 32K | |
| rubygem-apipie-bindi..> | 2025-12-18 18:36 | 28K | |
| rubygem-apipie-param..> | 2025-12-18 18:00 | 7.0K | |
| rubygem-apollo_uploa..> | 2025-12-27 16:20 | 8.3K | |
| rubygem-app_config-2..> | 2025-12-23 05:07 | 5.5K | |
| rubygem-app_store_co..> | 2025-12-27 18:43 | 16K | |
| rubygem-appraisal-2...> | 2025-12-20 20:57 | 23K | |
| rubygem-archive-zip-..> | 2025-12-18 16:24 | 50K | |
| rubygem-arel-9.0.0,1..> | 2025-12-18 13:53 | 29K | |
| rubygem-arel-helpers..> | 2025-12-26 19:09 | 9.5K | |
| rubygem-arel6-6.0.4.pkg | 2025-12-18 18:41 | 27K | |
| rubygem-arel7-7.1.4,..> | 2025-12-18 17:55 | 30K | |
| rubygem-arel8-8.0.0,..> | 2025-12-18 16:04 | 29K | |
| rubygem-arr-pm-0.0.1..> | 2025-12-19 16:12 | 30K | |
| rubygem-arrayfields-..> | 2025-12-19 01:24 | 14K | |
| rubygem-asana-2.0.3.pkg | 2025-12-29 09:15 | 61K | |
| rubygem-ascii85-2.0...> | 2025-12-18 04:37 | 12K | |
| rubygem-asciidoctor-..> | 2025-12-16 02:18 | 233K | |
| rubygem-asciidoctor-..> | 2025-12-18 12:02 | 11M | |
| rubygem-asciidoctor-..> | 2025-12-21 07:13 | 703K | |
| rubygem-asciidoctor-..> | 2025-12-20 02:01 | 8.2K | |
| rubygem-asciidoctor-..> | 2025-12-20 00:14 | 37K | |
| rubygem-asciidoctor-..> | 2025-12-26 15:52 | 1.6M | |
| rubygem-asciidoctor-..> | 2025-12-21 11:00 | 6.0K | |
| rubygem-asciidoctor-..> | 2025-12-19 04:53 | 4.8K | |
| rubygem-asetus-0.4.0..> | 2025-12-18 23:48 | 7.9K | |
| rubygem-aspectr-0.3...> | 2025-12-18 23:33 | 5.6K | |
| rubygem-asset_sync-2..> | 2025-12-30 04:17 | 39K | |
| rubygem-ast-2.4.3.pkg | 2025-12-18 11:17 | 8.4K | |
| rubygem-astrolabe-1...> | 2025-12-22 14:15 | 13K | |
| rubygem-async-2.35.0..> | 2025-12-26 14:46 | 52K | |
| rubygem-async-gitlab..> | 2025-12-27 17:59 | 50K | |
| rubygem-async-http-0..> | 2025-12-26 18:53 | 32K | |
| rubygem-async-io-1.4..> | 2025-12-30 10:19 | 19K | |
| rubygem-async-pool-0..> | 2025-12-26 17:32 | 7.7K | |
| rubygem-async-rest-0..> | 2025-12-27 04:26 | 11K | |
| rubygem-async-websoc..> | 2025-12-30 02:29 | 8.5K | |
| rubygem-async212-2.1..> | 2025-12-30 09:10 | 22K | |
| rubygem-async_sinatr..> | 2025-12-22 07:30 | 8.6K | |
| rubygem-atk-4.3.4.pkg | 2025-12-18 18:26 | 12K | |
| rubygem-atlassian-jw..> | 2025-12-18 22:52 | 5.6K | |
| rubygem-atomic-1.1.1..> | 2025-12-19 20:27 | 14K | |
| rubygem-attic-1.0.1.pkg | 2025-12-18 18:46 | 11K | |
| rubygem-attr_encrypt..> | 2025-12-19 19:20 | 25K | |
| rubygem-attr_encrypt..> | 2025-12-18 20:56 | 26K | |
| rubygem-attr_json-2...> | 2025-12-29 20:22 | 42K | |
| rubygem-attr_require..> | 2025-12-18 11:37 | 5.6K | |
| rubygem-authlogic-6...> | 2025-12-28 12:34 | 42K | |
| rubygem-autoprefixer..> | 2025-12-27 12:07 | 853K | |
| rubygem-av-0.9.0_1.pkg | 2025-12-21 00:44 | 72K | |
| rubygem-avro-1.12.1.pkg | 2025-12-20 00:00 | 45K | |
| rubygem-awesome_nest..> | 2025-12-30 07:26 | 18K | |
| rubygem-awesome_prin..> | 2025-12-19 00:01 | 39K | |
| rubygem-awrence-4.0...> | 2025-12-23 06:24 | 4.3K | |
| rubygem-aws-crt-0.4...> | 2025-12-29 17:14 | 26K | |
| rubygem-aws-eventstr..> | 2025-12-18 07:11 | 9.7K | |
| rubygem-aws-partitio..> | 2025-12-26 13:49 | 59K | |
| rubygem-aws-s3-0.6.3..> | 2025-12-19 06:03 | 117K | |
| rubygem-aws-sdk-3.3...> | 2025-12-29 06:36 | 5.8K | |
| rubygem-aws-sdk-acce..> | 2025-12-26 20:45 | 61K | |
| rubygem-aws-sdk-acco..> | 2025-12-26 22:12 | 26K | |
| rubygem-aws-sdk-acm-..> | 2025-12-26 23:27 | 39K | |
| rubygem-aws-sdk-acmp..> | 2025-12-27 01:38 | 53K | |
| rubygem-aws-sdk-aiop..> | 2025-12-26 22:43 | 25K | |
| rubygem-aws-sdk-ampl..> | 2025-12-26 23:01 | 44K | |
| rubygem-aws-sdk-ampl..> | 2025-12-26 20:51 | 37K | |
| rubygem-aws-sdk-ampl..> | 2025-12-26 23:17 | 54K | |
| rubygem-aws-sdk-apig..> | 2025-12-26 22:10 | 76K | |
| rubygem-aws-sdk-apig..> | 2025-12-27 01:12 | 18K | |
| rubygem-aws-sdk-apig..> | 2025-12-26 22:52 | 73K | |
| rubygem-aws-sdk-appc..> | 2025-12-26 21:35 | 48K | |
| rubygem-aws-sdk-appc..> | 2025-12-26 20:46 | 20K | |
| rubygem-aws-sdk-appf..> | 2025-12-26 21:22 | 31K | |
| rubygem-aws-sdk-appf..> | 2025-12-26 23:30 | 68K | |
| rubygem-aws-sdk-appi..> | 2025-12-27 01:02 | 31K | |
| rubygem-aws-sdk-appl..> | 2025-12-27 00:31 | 47K | |
| rubygem-aws-sdk-appl..> | 2025-12-26 23:02 | 20K | |
| rubygem-aws-sdk-appl..> | 2025-12-27 00:45 | 44K | |
| rubygem-aws-sdk-appl..> | 2025-12-27 00:12 | 38K | |
| rubygem-aws-sdk-appl..> | 2025-12-26 22:55 | 50K | |
| rubygem-aws-sdk-appm..> | 2025-12-26 23:28 | 57K | |
| rubygem-aws-sdk-appr..> | 2025-12-26 22:23 | 30K | |
| rubygem-aws-sdk-appr..> | 2025-12-26 23:33 | 46K | |
| rubygem-aws-sdk-apps..> | 2025-12-26 20:56 | 75K | |
| rubygem-aws-sdk-apps..> | 2025-12-26 21:46 | 63K | |
| rubygem-aws-sdk-appt..> | 2025-12-28 03:55 | 39K | |
| rubygem-aws-sdk-arcr..> | 2025-12-26 20:25 | 39K | |
| rubygem-aws-sdk-arcz..> | 2025-12-26 23:48 | 31K | |
| rubygem-aws-sdk-arti..> | 2025-12-26 20:29 | 23K | |
| rubygem-aws-sdk-athe..> | 2025-12-26 22:06 | 69K | |
| rubygem-aws-sdk-audi..> | 2025-12-26 22:54 | 61K | |
| rubygem-aws-sdk-augm..> | 2025-12-26 22:02 | 21K | |
| rubygem-aws-sdk-auto..> | 2025-12-26 22:53 | 118K | |
| rubygem-aws-sdk-auto..> | 2025-12-27 02:03 | 30K | |
| rubygem-aws-sdk-b2bi..> | 2025-12-26 20:31 | 52K | |
| rubygem-aws-sdk-back..> | 2025-12-27 01:07 | 100K | |
| rubygem-aws-sdk-back..> | 2025-12-26 21:36 | 30K | |
| rubygem-aws-sdk-back..> | 2025-12-27 01:33 | 29K | |
| rubygem-aws-sdk-batc..> | 2025-12-27 00:37 | 99K | |
| rubygem-aws-sdk-bcmd..> | 2025-12-26 22:56 | 28K | |
| rubygem-aws-sdk-bcmd..> | 2025-12-26 22:06 | 25K | |
| rubygem-aws-sdk-bcmp..> | 2025-12-26 21:12 | 42K | |
| rubygem-aws-sdk-bcmr..> | 2025-12-27 02:04 | 19K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 22:26 | 131K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 21:39 | 105K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 21:56 | 53K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 20:28 | 97K | |
| rubygem-aws-sdk-bedr..> | 2025-12-27 01:37 | 100K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 22:29 | 31K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 21:07 | 23K | |
| rubygem-aws-sdk-bedr..> | 2025-12-26 23:01 | 68K | |
| rubygem-aws-sdk-bill..> | 2025-12-26 22:06 | 27K | |
| rubygem-aws-sdk-bill..> | 2025-12-27 01:17 | 42K | |
| rubygem-aws-sdk-brak..> | 2025-12-26 22:54 | 35K | |
| rubygem-aws-sdk-budg..> | 2025-12-26 21:39 | 41K | |
| rubygem-aws-sdk-chat..> | 2025-12-26 22:38 | 34K | |
| rubygem-aws-sdk-chim..> | 2025-12-26 23:54 | 46K | |
| rubygem-aws-sdk-chim..> | 2025-12-26 20:51 | 31K | |
| rubygem-aws-sdk-chim..> | 2025-12-27 01:02 | 50K | |
| rubygem-aws-sdk-chim..> | 2025-12-26 22:51 | 34K | |
| rubygem-aws-sdk-chim..> | 2025-12-26 21:49 | 45K | |
| rubygem-aws-sdk-chim..> | 2025-12-26 20:51 | 59K | |
| rubygem-aws-sdk-clea..> | 2025-12-26 20:28 | 89K | |
| rubygem-aws-sdk-clea..> | 2025-12-26 22:03 | 63K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 23:43 | 27K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 23:01 | 28K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 23:58 | 62K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 20:27 | 132K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 15:03 | 125K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 21:40 | 153K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 22:56 | 20K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 02:03 | 27K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 01:12 | 30K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 00:48 | 36K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 01:44 | 26K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 01:02 | 78K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 21:29 | 18K | |
| rubygem-aws-sdk-clou..> | 2025-12-27 01:07 | 78K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 21:27 | 60K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 21:27 | 48K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 23:21 | 121K | |
| rubygem-aws-sdk-clou..> | 2025-12-26 22:57 | 37K | |
| rubygem-aws-sdk-code..> | 2025-12-26 22:55 | 50K | |
| rubygem-aws-sdk-code..> | 2025-12-26 21:20 | 84K | |
| rubygem-aws-sdk-code..> | 2025-12-26 20:40 | 39K | |
| rubygem-aws-sdk-code..> | 2025-12-26 21:31 | 80K | |
| rubygem-aws-sdk-code..> | 2025-12-26 21:59 | 33K | |
| rubygem-aws-sdk-code..> | 2025-12-26 21:49 | 70K | |
| rubygem-aws-sdk-code..> | 2025-12-26 21:41 | 38K | |
| rubygem-aws-sdk-code..> | 2025-12-26 20:37 | 36K | |
| rubygem-aws-sdk-code..> | 2025-12-27 00:18 | 29K | |
| rubygem-aws-sdk-code..> | 2025-12-26 20:22 | 71K | |
| rubygem-aws-sdk-code..> | 2025-12-26 20:54 | 33K | |
| rubygem-aws-sdk-code..> | 2025-12-26 22:17 | 25K | |
| rubygem-aws-sdk-cogn..> | 2025-12-26 20:32 | 34K | |
| rubygem-aws-sdk-cogn..> | 2025-12-26 22:05 | 132K | |
| rubygem-aws-sdk-cogn..> | 2025-12-26 21:11 | 28K | |
| rubygem-aws-sdk-comp..> | 2025-12-27 00:18 | 82K | |
| rubygem-aws-sdk-comp..> | 2025-12-26 21:38 | 34K | |
| rubygem-aws-sdk-comp..> | 2025-12-27 02:01 | 70K | |
| rubygem-aws-sdk-comp..> | 2025-12-26 20:27 | 37K | |
| rubygem-aws-sdk-conf..> | 2025-12-27 01:15 | 112K | |
| rubygem-aws-sdk-conn..> | 2025-12-26 22:23 | 277K | |
| rubygem-aws-sdk-conn..> | 2025-12-27 01:36 | 27K | |
| rubygem-aws-sdk-conn..> | 2025-12-26 22:57 | 38K | |
| rubygem-aws-sdk-conn..> | 2025-12-26 21:55 | 50K | |
| rubygem-aws-sdk-conn..> | 2025-12-26 22:13 | 20K | |
| rubygem-aws-sdk-conn..> | 2025-12-27 01:07 | 30K | |
| rubygem-aws-sdk-conn..> | 2025-12-27 00:44 | 45K | |
| rubygem-aws-sdk-cont..> | 2025-12-26 21:40 | 27K | |
| rubygem-aws-sdk-cont..> | 2025-12-26 21:02 | 35K | |
| rubygem-aws-sdk-core..> | 2025-12-26 16:33 | 320K | |
| rubygem-aws-sdk-core..> | 2025-12-26 19:13 | 311K | |
| rubygem-aws-sdk-core..> | 2025-12-18 21:30 | 1.3M | |
| rubygem-aws-sdk-cost..> | 2025-12-26 23:41 | 23K | |
| rubygem-aws-sdk-cost..> | 2025-12-26 22:56 | 86K | |
| rubygem-aws-sdk-cost..> | 2025-12-26 23:30 | 39K | |
| rubygem-aws-sdk-cust..> | 2025-12-26 22:46 | 97K | |
| rubygem-aws-sdk-data..> | 2025-12-26 21:12 | 147K | |
| rubygem-aws-sdk-data..> | 2025-12-26 22:50 | 47K | |
| rubygem-aws-sdk-data..> | 2025-12-26 21:26 | 31K | |
| rubygem-aws-sdk-data..> | 2025-12-26 21:50 | 68K | |
| rubygem-aws-sdk-data..> | 2025-12-26 22:33 | 164K | |
| rubygem-aws-sdk-dax-..> | 2025-12-26 22:52 | 34K | |
| rubygem-aws-sdk-dead..> | 2025-12-26 20:22 | 93K | |
| rubygem-aws-sdk-dete..> | 2025-12-27 01:35 | 38K | |
| rubygem-aws-sdk-devi..> | 2025-12-26 21:42 | 71K | |
| rubygem-aws-sdk-devo..> | 2025-12-27 00:37 | 54K | |
| rubygem-aws-sdk-dire..> | 2025-12-26 23:05 | 54K | |
| rubygem-aws-sdk-dire..> | 2025-12-26 20:42 | 73K | |
| rubygem-aws-sdk-dire..> | 2025-12-26 21:40 | 27K | |
| rubygem-aws-sdk-dlm-..> | 2025-12-26 20:44 | 34K | |
| rubygem-aws-sdk-docd..> | 2025-12-26 21:18 | 73K | |
| rubygem-aws-sdk-docd..> | 2025-12-27 00:48 | 29K | |
| rubygem-aws-sdk-drs-..> | 2025-12-27 01:16 | 54K | |
| rubygem-aws-sdk-dsql..> | 2025-12-27 01:00 | 28K | |
| rubygem-aws-sdk-dyna..> | 2025-12-26 22:24 | 123K | |
| rubygem-aws-sdk-dyna..> | 2025-12-26 21:03 | 29K | |
| rubygem-aws-sdk-ebs-..> | 2025-12-26 22:53 | 25K | |
| rubygem-aws-sdk-ec2-..> | 2025-12-26 22:24 | 708K | |
| rubygem-aws-sdk-ec2i..> | 2025-12-26 22:06 | 20K | |
| rubygem-aws-sdk-ecr-..> | 2025-12-27 02:02 | 70K | |
| rubygem-aws-sdk-ecrp..> | 2025-12-27 01:17 | 34K | |
| rubygem-aws-sdk-ecs-..> | 2025-12-27 01:17 | 176K | |
| rubygem-aws-sdk-efs-..> | 2025-12-27 00:01 | 49K | |
| rubygem-aws-sdk-eks-..> | 2025-12-27 01:15 | 96K | |
| rubygem-aws-sdk-eksa..> | 2025-12-26 22:43 | 19K | |
| rubygem-aws-sdk-elas..> | 2025-12-26 21:49 | 104K | |
| rubygem-aws-sdk-elas..> | 2025-12-26 22:17 | 67K | |
| rubygem-aws-sdk-elas..> | 2025-12-26 23:28 | 42K | |
| rubygem-aws-sdk-elas..> | 2025-12-26 21:55 | 73K | |
| rubygem-aws-sdk-elas..> | 2025-12-26 23:41 | 62K | |
| rubygem-aws-sdk-elas..> | 2025-12-27 02:04 | 55K | |
| rubygem-aws-sdk-emr-..> | 2025-12-27 01:24 | 90K | |
| rubygem-aws-sdk-emrc..> | 2025-12-26 22:48 | 37K | |
| rubygem-aws-sdk-emrs..> | 2025-12-26 22:29 | 36K | |
| rubygem-aws-sdk-enti..> | 2025-12-26 22:18 | 46K | |
| rubygem-aws-sdk-even..> | 2025-12-26 20:23 | 69K | |
| rubygem-aws-sdk-evs-..> | 2025-12-26 22:53 | 32K | |
| rubygem-aws-sdk-fins..> | 2025-12-26 22:56 | 56K | |
| rubygem-aws-sdk-fins..> | 2025-12-26 21:07 | 38K | |
| rubygem-aws-sdk-fire..> | 2025-12-26 20:43 | 66K | |
| rubygem-aws-sdk-fis-..> | 2025-12-26 22:17 | 36K | |
| rubygem-aws-sdk-fms-..> | 2025-12-26 22:51 | 68K | |
| rubygem-aws-sdk-fore..> | 2025-12-27 01:19 | 19K | |
| rubygem-aws-sdk-fore..> | 2025-12-26 21:18 | 71K | |
| rubygem-aws-sdk-frau..> | 2025-12-27 00:31 | 59K | |
| rubygem-aws-sdk-free..> | 2025-12-27 00:21 | 24K | |
| rubygem-aws-sdk-fsx-..> | 2025-12-26 22:37 | 119K | |
| rubygem-aws-sdk-game..> | 2025-12-27 01:12 | 148K | |
| rubygem-aws-sdk-game..> | 2025-12-26 21:12 | 44K | |
| rubygem-aws-sdk-geom..> | 2025-12-27 01:09 | 25K | |
| rubygem-aws-sdk-geop..> | 2025-12-26 23:27 | 41K | |
| rubygem-aws-sdk-geor..> | 2025-12-26 20:28 | 62K | |
| rubygem-aws-sdk-glac..> | 2025-12-27 01:11 | 58K | |
| rubygem-aws-sdk-glob..> | 2025-12-26 21:14 | 48K | |
| rubygem-aws-sdk-glue..> | 2025-12-26 22:12 | 260K | |
| rubygem-aws-sdk-glue..> | 2025-12-26 20:41 | 52K | |
| rubygem-aws-sdk-gree..> | 2025-12-27 00:59 | 52K | |
| rubygem-aws-sdk-gree..> | 2025-12-26 21:13 | 47K | |
| rubygem-aws-sdk-grou..> | 2025-12-26 21:14 | 53K | |
| rubygem-aws-sdk-guar..> | 2025-12-26 22:24 | 107K | |
| rubygem-aws-sdk-heal..> | 2025-12-26 21:55 | 33K | |
| rubygem-aws-sdk-heal..> | 2025-12-27 00:42 | 30K | |
| rubygem-aws-sdk-iam-..> | 2025-12-26 22:53 | 140K | |
| rubygem-aws-sdk-iden..> | 2025-12-26 23:02 | 32K | |
| rubygem-aws-sdk-imag..> | 2025-12-27 01:37 | 86K | |
| rubygem-aws-sdk-impo..> | 2025-12-26 22:52 | 22K | |
| rubygem-aws-sdk-insp..> | 2025-12-26 23:49 | 45K | |
| rubygem-aws-sdk-insp..> | 2025-12-26 22:02 | 96K | |
| rubygem-aws-sdk-insp..> | 2025-12-26 22:46 | 18K | |
| rubygem-aws-sdk-inte..> | 2025-12-27 00:41 | 36K | |
| rubygem-aws-sdk-invo..> | 2025-12-26 22:02 | 37K | |
| rubygem-aws-sdk-iot-..> | 2025-12-27 01:03 | 190K | |
| rubygem-aws-sdk-iota..> | 2025-12-27 00:32 | 45K | |
| rubygem-aws-sdk-iotd..> | 2025-12-26 21:08 | 24K | |
| rubygem-aws-sdk-iotd..> | 2025-12-26 21:04 | 26K | |
| rubygem-aws-sdk-iote..> | 2025-12-26 23:05 | 44K | |
| rubygem-aws-sdk-iote..> | 2025-12-26 21:57 | 27K | |
| rubygem-aws-sdk-iotf..> | 2025-12-29 16:40 | 21K | |
| rubygem-aws-sdk-iotf..> | 2025-12-27 00:32 | 64K | |
| rubygem-aws-sdk-iotj..> | 2025-12-26 20:41 | 23K | |
| rubygem-aws-sdk-iotm..> | 2025-12-27 02:04 | 63K | |
| rubygem-aws-sdk-iots..> | 2025-12-26 21:23 | 22K | |
| rubygem-aws-sdk-iots..> | 2025-12-26 21:12 | 104K | |
| rubygem-aws-sdk-iott..> | 2025-12-26 23:32 | 34K | |
| rubygem-aws-sdk-iott..> | 2025-12-27 01:09 | 50K | |
| rubygem-aws-sdk-iotw..> | 2025-12-26 20:52 | 82K | |
| rubygem-aws-sdk-ivs-..> | 2025-12-27 01:24 | 41K | |
| rubygem-aws-sdk-ivsc..> | 2025-12-26 21:06 | 28K | |
| rubygem-aws-sdk-ivsr..> | 2025-12-27 02:02 | 45K | |
| rubygem-aws-sdk-kafk..> | 2025-12-26 20:54 | 57K | |
| rubygem-aws-sdk-kafk..> | 2025-12-26 23:04 | 33K | |
| rubygem-aws-sdk-kend..> | 2025-12-26 20:23 | 114K | |
| rubygem-aws-sdk-kend..> | 2025-12-27 01:23 | 23K | |
| rubygem-aws-sdk-keys..> | 2025-12-26 23:31 | 38K | |
| rubygem-aws-sdk-keys..> | 2025-12-27 01:35 | 27K | |
| rubygem-aws-sdk-kine..> | 2025-12-27 00:19 | 57K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 21:39 | 40K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 23:32 | 61K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 20:41 | 41K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 21:04 | 33K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 21:11 | 20K | |
| rubygem-aws-sdk-kine..> | 2025-12-27 02:04 | 19K | |
| rubygem-aws-sdk-kine..> | 2025-12-26 23:01 | 18K | |
| rubygem-aws-sdk-kms-..> | 2025-12-26 18:12 | 104K | |
| rubygem-aws-sdk-kms-..> | 2025-12-26 20:26 | 103K | |
| rubygem-aws-sdk-lake..> | 2025-12-27 02:02 | 60K | |
| rubygem-aws-sdk-lamb..> | 2025-12-26 22:20 | 110K | |
| rubygem-aws-sdk-laun..> | 2025-12-27 00:31 | 24K | |
| rubygem-aws-sdk-lex-..> | 2025-12-26 21:27 | 32K | |
| rubygem-aws-sdk-lexm..> | 2025-12-26 22:56 | 59K | |
| rubygem-aws-sdk-lexm..> | 2025-12-26 22:27 | 140K | |
| rubygem-aws-sdk-lexr..> | 2025-12-27 02:07 | 38K | |
| rubygem-aws-sdk-lice..> | 2025-12-26 21:48 | 58K | |
| rubygem-aws-sdk-lice..> | 2025-12-26 22:01 | 25K | |
| rubygem-aws-sdk-lice..> | 2025-12-26 22:20 | 30K | |
| rubygem-aws-sdk-ligh..> | 2025-12-26 23:34 | 139K | |
| rubygem-aws-sdk-loca..> | 2025-12-27 01:12 | 75K | |
| rubygem-aws-sdk-look..> | 2025-12-26 22:08 | 53K | |
| rubygem-aws-sdk-look..> | 2025-12-29 00:47 | 36K | |
| rubygem-aws-sdk-look..> | 2025-12-29 06:24 | 42K | |
| rubygem-aws-sdk-mach..> | 2025-12-27 00:54 | 45K | |
| rubygem-aws-sdk-maci..> | 2025-12-27 02:03 | 77K | |
| rubygem-aws-sdk-mail..> | 2025-12-27 01:24 | 58K | |
| rubygem-aws-sdk-main..> | 2025-12-27 01:09 | 46K | |
| rubygem-aws-sdk-mana..> | 2025-12-26 21:15 | 39K | |
| rubygem-aws-sdk-mana..> | 2025-12-27 00:50 | 28K | |
| rubygem-aws-sdk-mana..> | 2025-12-26 21:04 | 39K | |
| rubygem-aws-sdk-mark..> | 2025-12-26 20:47 | 29K | |
| rubygem-aws-sdk-mark..> | 2025-12-27 01:33 | 40K | |
| rubygem-aws-sdk-mark..> | 2025-12-26 23:01 | 21K | |
| rubygem-aws-sdk-mark..> | 2025-12-26 22:53 | 20K | |
| rubygem-aws-sdk-mark..> | 2025-12-26 23:30 | 20K | |
| rubygem-aws-sdk-mark..> | 2025-12-26 21:51 | 26K | |
| rubygem-aws-sdk-mark..> | 2025-12-27 01:20 | 18K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 20:54 | 92K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 21:20 | 179K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 20:30 | 193K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 20:28 | 36K | |
| rubygem-aws-sdk-medi..> | 2025-12-27 01:31 | 55K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 20:26 | 31K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 20:22 | 27K | |
| rubygem-aws-sdk-medi..> | 2025-12-27 01:12 | 22K | |
| rubygem-aws-sdk-medi..> | 2025-12-27 00:37 | 59K | |
| rubygem-aws-sdk-medi..> | 2025-12-26 22:57 | 33K | |
| rubygem-aws-sdk-memo..> | 2025-12-26 21:53 | 52K | |
| rubygem-aws-sdk-mgn-..> | 2025-12-26 23:05 | 59K | |
| rubygem-aws-sdk-migr..> | 2025-12-27 00:46 | 30K | |
| rubygem-aws-sdk-migr..> | 2025-12-26 21:18 | 20K | |
| rubygem-aws-sdk-migr..> | 2025-12-26 23:28 | 35K | |
| rubygem-aws-sdk-migr..> | 2025-12-26 23:47 | 36K | |
| rubygem-aws-sdk-migr..> | 2025-12-26 21:04 | 42K | |
| rubygem-aws-sdk-mpa-..> | 2025-12-26 22:40 | 33K | |
| rubygem-aws-sdk-mq-1..> | 2025-12-26 21:41 | 38K | |
| rubygem-aws-sdk-mtur..> | 2025-12-26 21:50 | 47K | |
| rubygem-aws-sdk-mwaa..> | 2025-12-27 01:17 | 32K | |
| rubygem-aws-sdk-mwaa..> | 2025-12-26 21:17 | 32K | |
| rubygem-aws-sdk-nept..> | 2025-12-26 22:07 | 85K | |
| rubygem-aws-sdk-nept..> | 2025-12-27 00:27 | 52K | |
| rubygem-aws-sdk-nept..> | 2025-12-26 21:06 | 45K | |
| rubygem-aws-sdk-netw..> | 2025-12-27 01:15 | 88K | |
| rubygem-aws-sdk-netw..> | 2025-12-26 21:15 | 33K | |
| rubygem-aws-sdk-netw..> | 2025-12-27 01:14 | 70K | |
| rubygem-aws-sdk-netw..> | 2025-12-26 21:09 | 24K | |
| rubygem-aws-sdk-noti..> | 2025-12-26 21:43 | 41K | |
| rubygem-aws-sdk-noti..> | 2025-12-26 21:19 | 21K | |
| rubygem-aws-sdk-nova..> | 2025-12-26 22:56 | 28K | |
| rubygem-aws-sdk-oam-..> | 2025-12-27 00:59 | 26K | |
| rubygem-aws-sdk-obse..> | 2025-12-26 21:48 | 42K | |
| rubygem-aws-sdk-odb-..> | 2025-12-27 01:11 | 55K | |
| rubygem-aws-sdk-omic..> | 2025-12-26 21:26 | 86K | |
| rubygem-aws-sdk-open..> | 2025-12-26 23:02 | 40K | |
| rubygem-aws-sdk-open..> | 2025-12-26 23:43 | 93K | |
| rubygem-aws-sdk-orga..> | 2025-12-26 22:56 | 72K | |
| rubygem-aws-sdk-osis..> | 2025-12-26 22:14 | 30K | |
| rubygem-aws-sdk-outp..> | 2025-12-26 23:28 | 44K | |
| rubygem-aws-sdk-pano..> | 2025-12-26 22:59 | 41K | |
| rubygem-aws-sdk-part..> | 2025-12-27 01:18 | 38K | |
| rubygem-aws-sdk-part..> | 2025-12-26 20:31 | 32K | |
| rubygem-aws-sdk-part..> | 2025-12-26 22:13 | 32K | |
| rubygem-aws-sdk-part..> | 2025-12-27 00:54 | 88K | |
| rubygem-aws-sdk-paym..> | 2025-12-27 00:31 | 45K | |
| rubygem-aws-sdk-paym..> | 2025-12-26 22:14 | 44K | |
| rubygem-aws-sdk-pcac..> | 2025-12-26 23:12 | 38K | |
| rubygem-aws-sdk-pcac..> | 2025-12-26 21:02 | 25K | |
| rubygem-aws-sdk-pcs-..> | 2025-12-27 00:32 | 34K | |
| rubygem-aws-sdk-pers..> | 2025-12-26 21:50 | 65K | |
| rubygem-aws-sdk-pers..> | 2025-12-26 22:35 | 22K | |
| rubygem-aws-sdk-pers..> | 2025-12-26 20:28 | 22K | |
| rubygem-aws-sdk-pi-1..> | 2025-12-26 22:46 | 34K | |
| rubygem-aws-sdk-pinp..> | 2025-12-26 20:45 | 119K | |
| rubygem-aws-sdk-pinp..> | 2025-12-26 21:17 | 49K | |
| rubygem-aws-sdk-pinp..> | 2025-12-26 22:52 | 22K | |
| rubygem-aws-sdk-pinp..> | 2025-12-27 00:52 | 75K | |
| rubygem-aws-sdk-pipe..> | 2025-12-26 20:55 | 48K | |
| rubygem-aws-sdk-poll..> | 2025-12-27 01:20 | 32K | |
| rubygem-aws-sdk-pric..> | 2025-12-26 23:48 | 24K | |
| rubygem-aws-sdk-prom..> | 2025-12-27 00:47 | 48K | |
| rubygem-aws-sdk-prot..> | 2025-12-26 22:56 | 65K | |
| rubygem-aws-sdk-qapp..> | 2025-12-26 20:56 | 45K | |
| rubygem-aws-sdk-qbus..> | 2025-12-27 00:42 | 103K | |
| rubygem-aws-sdk-qcon..> | 2025-12-26 21:57 | 111K | |
| rubygem-aws-sdk-qldb..> | 2025-12-28 02:12 | 32K | |
| rubygem-aws-sdk-qldb..> | 2025-12-29 08:40 | 21K | |
| rubygem-aws-sdk-quic..> | 2025-12-27 01:31 | 368K | |
| rubygem-aws-sdk-ram-..> | 2025-12-26 23:06 | 44K | |
| rubygem-aws-sdk-rds-..> | 2025-12-26 21:39 | 264K | |
| rubygem-aws-sdk-rdsd..> | 2025-12-26 22:38 | 28K | |
| rubygem-aws-sdk-recy..> | 2025-12-27 00:44 | 24K | |
| rubygem-aws-sdk-reds..> | 2025-12-26 20:41 | 134K | |
| rubygem-aws-sdk-reds..> | 2025-12-26 20:46 | 30K | |
| rubygem-aws-sdk-reds..> | 2025-12-27 01:17 | 55K | |
| rubygem-aws-sdk-reko..> | 2025-12-26 21:29 | 117K | |
| rubygem-aws-sdk-repo..> | 2025-12-26 22:20 | 30K | |
| rubygem-aws-sdk-resi..> | 2025-12-26 23:47 | 63K | |
| rubygem-aws-sdk-reso..> | 2025-12-26 21:19 | 39K | |
| rubygem-aws-sdk-reso..> | 2025-12-27 02:02 | 36K | |
| rubygem-aws-sdk-reso..> | 2025-12-27 01:29 | 29K | |
| rubygem-aws-sdk-reso..> | 2025-12-27 16:12 | 21K | |
| rubygem-aws-sdk-reso..> | 2025-12-19 14:56 | 48K | |
| rubygem-aws-sdk-robo..> | 2025-12-28 23:10 | 59K | |
| rubygem-aws-sdk-role..> | 2025-12-26 21:19 | 30K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 20:36 | 99K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 23:00 | 49K | |
| rubygem-aws-sdk-rout..> | 2025-12-27 01:00 | 44K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 23:04 | 25K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 20:25 | 21K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 21:15 | 33K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 21:04 | 29K | |
| rubygem-aws-sdk-rout..> | 2025-12-26 22:52 | 61K | |
| rubygem-aws-sdk-rtbf..> | 2025-12-26 20:44 | 36K | |
| rubygem-aws-sdk-s3-1..> | 2025-12-26 22:25 | 265K | |
| rubygem-aws-sdk-s3-g..> | 2025-12-27 17:43 | 258K | |
| rubygem-aws-sdk-s3co..> | 2025-12-26 22:38 | 108K | |
| rubygem-aws-sdk-s3ou..> | 2025-12-26 20:27 | 21K | |
| rubygem-aws-sdk-s3ta..> | 2025-12-26 23:45 | 39K | |
| rubygem-aws-sdk-s3ve..> | 2025-12-26 21:28 | 30K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 22:25 | 461K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 21:43 | 20K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 22:23 | 22K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 21:19 | 39K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 22:51 | 19K | |
| rubygem-aws-sdk-sage..> | 2025-12-26 21:38 | 25K | |
| rubygem-aws-sdk-sage..> | 2025-12-27 00:54 | 19K | |
| rubygem-aws-sdk-savi..> | 2025-12-26 20:42 | 26K | |
| rubygem-aws-sdk-sche..> | 2025-12-26 23:45 | 30K | |
| rubygem-aws-sdk-sche..> | 2025-12-26 21:21 | 31K | |
| rubygem-aws-sdk-secr..> | 2025-12-26 22:55 | 48K | |
| rubygem-aws-sdk-secu..> | 2025-12-26 23:05 | 281K | |
| rubygem-aws-sdk-secu..> | 2025-12-26 21:41 | 38K | |
| rubygem-aws-sdk-secu..> | 2025-12-27 01:06 | 38K | |
| rubygem-aws-sdk-serv..> | 2025-12-26 23:02 | 30K | |
| rubygem-aws-sdk-serv..> | 2025-12-26 20:47 | 76K | |
| rubygem-aws-sdk-serv..> | 2025-12-26 22:08 | 49K | |
| rubygem-aws-sdk-serv..> | 2025-12-26 23:06 | 34K | |
| rubygem-aws-sdk-ses-..> | 2025-12-27 01:35 | 71K | |
| rubygem-aws-sdk-sesv..> | 2025-12-27 02:02 | 99K | |
| rubygem-aws-sdk-shie..> | 2025-12-27 02:01 | 40K | |
| rubygem-aws-sdk-sign..> | 2025-12-27 01:12 | 36K | |
| rubygem-aws-sdk-simp..> | 2025-12-26 23:27 | 23K | |
| rubygem-aws-sdk-sims..> | 2025-12-26 21:44 | 27K | |
| rubygem-aws-sdk-snow..> | 2025-12-26 20:27 | 47K | |
| rubygem-aws-sdk-snow..> | 2025-12-26 21:09 | 27K | |
| rubygem-aws-sdk-sns-..> | 2025-12-26 21:47 | 54K | |
| rubygem-aws-sdk-soci..> | 2025-12-27 00:09 | 33K | |
| rubygem-aws-sdk-sqs-..> | 2025-12-26 20:37 | 54K | |
| rubygem-aws-sdk-ssm-..> | 2025-12-26 22:33 | 194K | |
| rubygem-aws-sdk-ssmc..> | 2025-12-26 21:51 | 40K | |
| rubygem-aws-sdk-ssmg..> | 2025-12-26 22:17 | 18K | |
| rubygem-aws-sdk-ssmi..> | 2025-12-26 22:52 | 44K | |
| rubygem-aws-sdk-ssmq..> | 2025-12-26 21:05 | 27K | |
| rubygem-aws-sdk-ssms..> | 2025-12-27 00:09 | 35K | |
| rubygem-aws-sdk-ssoa..> | 2025-12-26 21:47 | 53K | |
| rubygem-aws-sdk-stat..> | 2025-12-26 20:52 | 62K | |
| rubygem-aws-sdk-stor..> | 2025-12-26 20:46 | 88K | |
| rubygem-aws-sdk-supp..> | 2025-12-26 23:00 | 44K | |
| rubygem-aws-sdk-supp..> | 2025-12-27 00:21 | 34K | |
| rubygem-aws-sdk-supp..> | 2025-12-26 21:26 | 22K | |
| rubygem-aws-sdk-swf-..> | 2025-12-27 01:46 | 60K | |
| rubygem-aws-sdk-synt..> | 2025-12-27 00:50 | 42K | |
| rubygem-aws-sdk-taxs..> | 2025-12-26 21:36 | 39K | |
| rubygem-aws-sdk-text..> | 2025-12-26 22:54 | 50K | |
| rubygem-aws-sdk-time..> | 2025-12-27 00:47 | 40K | |
| rubygem-aws-sdk-time..> | 2025-12-27 00:45 | 39K | |
| rubygem-aws-sdk-time..> | 2025-12-26 20:24 | 36K | |
| rubygem-aws-sdk-tnb-..> | 2025-12-26 23:45 | 35K | |
| rubygem-aws-sdk-tran..> | 2025-12-26 21:42 | 63K | |
| rubygem-aws-sdk-tran..> | 2025-12-26 20:30 | 45K | |
| rubygem-aws-sdk-tran..> | 2025-12-26 22:35 | 85K | |
| rubygem-aws-sdk-tran..> | 2025-12-26 22:45 | 38K | |
| rubygem-aws-sdk-trus..> | 2025-12-27 00:58 | 26K | |
| rubygem-aws-sdk-veri..> | 2025-12-27 00:21 | 55K | |
| rubygem-aws-sdk-voic..> | 2025-12-27 00:21 | 36K | |
| rubygem-aws-sdk-vpcl..> | 2025-12-26 22:46 | 58K | |
| rubygem-aws-sdk-waf-..> | 2025-12-27 00:48 | 70K | |
| rubygem-aws-sdk-wafr..> | 2025-12-27 01:12 | 71K | |
| rubygem-aws-sdk-wafv..> | 2025-12-27 00:55 | 101K | |
| rubygem-aws-sdk-well..> | 2025-12-26 21:55 | 58K | |
| rubygem-aws-sdk-work..> | 2025-12-26 21:50 | 46K | |
| rubygem-aws-sdk-work..> | 2025-12-26 22:17 | 63K | |
| rubygem-aws-sdk-work..> | 2025-12-26 21:25 | 19K | |
| rubygem-aws-sdk-work..> | 2025-12-27 01:07 | 82K | |
| rubygem-aws-sdk-work..> | 2025-12-26 21:18 | 32K | |
| rubygem-aws-sdk-work..> | 2025-12-26 20:26 | 27K | |
| rubygem-aws-sdk-work..> | 2025-12-27 00:19 | 54K | |
| rubygem-aws-sdk-xray..> | 2025-12-26 20:51 | 53K | |
| rubygem-aws-sdk2-2.1..> | 2025-12-23 01:30 | 1.3K | |
| rubygem-aws-ses-0.7...> | 2025-12-27 09:21 | 19K | |
| rubygem-aws-sigv2-1...> | 2025-12-18 16:30 | 7.8K | |
| rubygem-aws-sigv4-1...> | 2025-12-18 10:21 | 15K | |
| rubygem-axiom-types-..> | 2025-12-18 17:54 | 22K | |
| rubygem-azure-0.7.10..> | 2025-12-19 22:45 | 78K | |
| rubygem-azure-core-0..> | 2025-12-19 01:37 | 19K | |
| rubygem-azure-storag..> | 2025-12-19 09:59 | 59K | |
| rubygem-azure-storag..> | 2025-12-23 00:06 | 23K | |
| rubygem-azure-storag..> | 2025-12-19 03:28 | 38K | |
| rubygem-azure-storag..> | 2025-12-21 04:34 | 12K | |
| rubygem-azure-storag..> | 2025-12-22 12:41 | 9.7K | |
| rubygem-azure-storag..> | 2025-12-20 21:43 | 14K | |
| rubygem-azure_cognit..> | 2025-12-27 16:23 | 8.8K | |
| rubygem-azure_cognit..> | 2025-12-27 09:49 | 15K | |
| rubygem-azure_cognit..> | 2025-12-27 17:03 | 28K | |
| rubygem-azure_cognit..> | 2025-12-27 11:45 | 24K | |
| rubygem-azure_cognit..> | 2025-12-27 12:30 | 18K | |
| rubygem-azure_cognit..> | 2025-12-27 16:16 | 15K | |
| rubygem-azure_cognit..> | 2025-12-27 17:14 | 11K | |
| rubygem-azure_cognit..> | 2025-12-27 15:58 | 35K | |
| rubygem-azure_cognit..> | 2025-12-27 09:12 | 21K | |
| rubygem-azure_cognit..> | 2025-12-27 14:47 | 35K | |
| rubygem-azure_cognit..> | 2025-12-27 16:09 | 15K | |
| rubygem-azure_cognit..> | 2025-12-27 11:16 | 30K | |
| rubygem-azure_cognit..> | 2025-12-27 18:15 | 18K | |
| rubygem-azure_cognit..> | 2025-12-27 06:02 | 54K | |
| rubygem-azure_cognit..> | 2025-12-27 09:44 | 12K | |
| rubygem-azure_cognit..> | 2025-12-27 09:12 | 18K | |
| rubygem-azure_cognit..> | 2025-12-27 02:50 | 9.4K | |
| rubygem-azure_cognit..> | 2025-12-27 11:55 | 17K | |
| rubygem-azure_cognit..> | 2025-12-27 16:42 | 11K | |
| rubygem-azure_cognit..> | 2025-12-27 06:58 | 13K | |
| rubygem-azure_cognit..> | 2025-12-27 17:08 | 15K | |
| rubygem-azure_cognit..> | 2025-12-27 07:54 | 20K | |
| rubygem-azure_cognit..> | 2025-12-27 10:15 | 24K | |
| rubygem-azure_cognit..> | 2025-12-27 07:38 | 22K | |
| rubygem-azure_event_..> | 2025-12-27 06:27 | 23K | |
| rubygem-azure_graph_..> | 2025-12-27 12:46 | 20K | |
| rubygem-azure_key_va..> | 2025-12-27 17:48 | 91K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 11:08 | 40K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 09:49 | 20K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 12:35 | 36K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 12:02 | 21K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 10:44 | 235K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 03:30 | 21K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 11:31 | 9.4K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 14:18 | 23K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 02:52 | 15K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 15:58 | 47K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 16:05 | 16K | |
| rubygem-azure_mgmt_a..> | 2025-12-27 16:13 | 12K | |
| rubygem-azure_mgmt_b..> | 2025-12-27 07:25 | 66K | |
| rubygem-azure_mgmt_b..> | 2025-12-27 09:56 | 56K | |
| rubygem-azure_mgmt_b..> | 2025-12-27 02:07 | 14K | |
| rubygem-azure_mgmt_b..> | 2025-12-27 12:31 | 25K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 11:40 | 105K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 07:30 | 26K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 19:17 | 12K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 09:50 | 321K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 09:42 | 79K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 02:58 | 49K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 03:25 | 77K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 02:28 | 92K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 11:17 | 151K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 17:25 | 38K | |
| rubygem-azure_mgmt_c..> | 2025-12-27 10:42 | 47K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 14:32 | 196K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 13:19 | 114K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 16:22 | 24K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 10:30 | 28K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 15:58 | 24K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 09:55 | 38K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 13:06 | 24K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 02:42 | 12K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 02:29 | 74K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 17:43 | 14K | |
| rubygem-azure_mgmt_d..> | 2025-12-27 14:16 | 22K | |
| rubygem-azure_mgmt_e..> | 2025-12-27 16:53 | 34K | |
| rubygem-azure_mgmt_e..> | 2025-12-27 07:38 | 95K | |
| rubygem-azure_mgmt_e..> | 2025-12-27 17:01 | 38K | |
| rubygem-azure_mgmt_f..> | 2025-12-27 16:46 | 9.0K | |
| rubygem-azure_mgmt_h..> | 2025-12-27 10:23 | 15K | |
| rubygem-azure_mgmt_h..> | 2025-12-27 19:24 | 41K | |
| rubygem-azure_mgmt_h..> | 2025-12-27 15:33 | 21K | |
| rubygem-azure_mgmt_i..> | 2025-12-27 15:10 | 15K | |
| rubygem-azure_mgmt_i..> | 2025-12-27 16:28 | 14K | |
| rubygem-azure_mgmt_i..> | 2025-12-27 16:39 | 62K | |
| rubygem-azure_mgmt_k..> | 2025-12-27 13:18 | 35K | |
| rubygem-azure_mgmt_k..> | 2025-12-27 16:06 | 15K | |
| rubygem-azure_mgmt_k..> | 2025-12-27 05:38 | 63K | |
| rubygem-azure_mgmt_l..> | 2025-12-27 02:52 | 28K | |
| rubygem-azure_mgmt_l..> | 2025-12-27 16:27 | 9.9K | |
| rubygem-azure_mgmt_l..> | 2025-12-27 18:30 | 13K | |
| rubygem-azure_mgmt_l..> | 2025-12-27 14:27 | 73K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 16:03 | 19K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 03:47 | 31K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 12:54 | 12K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 18:46 | 19K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 11:20 | 26K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 16:12 | 9.4K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 13:47 | 118K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 19:43 | 24K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 02:26 | 21K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 07:25 | 104K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 03:42 | 9.2K | |
| rubygem-azure_mgmt_m..> | 2025-12-27 02:59 | 33K | |
| rubygem-azure_mgmt_n..> | 2025-12-27 19:19 | 68K | |
| rubygem-azure_mgmt_n..> | 2025-12-27 14:37 | 1.1M | |
| rubygem-azure_mgmt_n..> | 2025-12-27 17:08 | 18K | |
| rubygem-azure_mgmt_o..> | 2025-12-27 05:34 | 48K | |
| rubygem-azure_mgmt_o..> | 2025-12-27 09:04 | 12K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 16:45 | 20K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 17:52 | 28K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 11:40 | 35K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 15:15 | 11K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 12:43 | 24K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 12:30 | 13K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 17:49 | 12K | |
| rubygem-azure_mgmt_p..> | 2025-12-27 09:14 | 15K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 08:27 | 20K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 15:43 | 121K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 12:33 | 114K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 09:39 | 29K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 12:33 | 22K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 16:13 | 32K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 19:43 | 25K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 13:15 | 11K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 09:40 | 98K | |
| rubygem-azure_mgmt_r..> | 2025-12-27 18:43 | 22K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 11:38 | 17K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 09:19 | 14K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 19:42 | 111K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 12:27 | 7.4K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 11:26 | 40K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 10:15 | 37K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 12:31 | 27K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 17:04 | 142K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 02:12 | 20K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 13:16 | 51K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 16:09 | 136K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 10:12 | 36K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 04:25 | 42K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 16:04 | 29K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 15:38 | 27K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 16:10 | 18K | |
| rubygem-azure_mgmt_s..> | 2025-12-27 16:39 | 77K | |
| rubygem-azure_mgmt_t..> | 2025-12-27 08:51 | 31K | |
| rubygem-azure_mgmt_t..> | 2025-12-27 16:03 | 25K | |
| rubygem-azure_mgmt_v..> | 2025-12-27 18:01 | 23K | |
| rubygem-azure_mgmt_w..> | 2025-12-27 04:24 | 291K | |
| rubygem-azure_sdk-0...> | 2025-12-30 16:42 | 269K | |
| rubygem-azure_servic..> | 2025-12-27 17:58 | 316K | |
| rubygem-babel-source..> | 2025-12-18 20:08 | 351K | |
| rubygem-babel-transp..> | 2025-12-27 15:42 | 2.3K | |
| rubygem-babosa-2.0.0..> | 2025-12-19 23:07 | 19K | |
| rubygem-backports-3...> | 2025-12-27 11:59 | 125K | |
| rubygem-backup-4.4.1..> | 2025-12-30 16:26 | 72K | |
| rubygem-bacon-1.2.0.pkg | 2025-12-23 10:54 | 16K | |
| rubygem-baf-0.14.1.pkg | 2025-12-19 22:30 | 5.1K | |
| rubygem-base32-0.3.4..> | 2025-12-20 00:26 | 5.9K | |
| rubygem-base64-0.3.0..> | 2025-12-18 01:45 | 8.1K | |
| rubygem-base6402-0.2..> | 2025-12-18 14:40 | 5.3K | |
| rubygem-batch-loader..> | 2025-12-27 08:56 | 15K | |
| rubygem-bcp47_spec-0..> | 2025-12-18 17:27 | 3.7K | |
| rubygem-bcrypt-3.1.2..> | 2025-12-18 17:07 | 22K | |
| rubygem-bcrypt-ruby-..> | 2025-12-18 22:32 | 6.3K | |
| rubygem-bcrypt_pbkdf..> | 2025-12-19 01:02 | 21K | |
| rubygem-bdb1-0.2.5_4..> | 2025-12-23 01:34 | 67K | |
| rubygem-beefcake-1.2..> | 2025-12-18 18:49 | 17K | |
| rubygem-benchmark-0...> | 2025-12-18 01:54 | 10K | |
| rubygem-benchmark-ip..> | 2025-12-19 04:55 | 19K | |
| rubygem-benchmark-me..> | 2025-12-22 06:22 | 15K | |
| rubygem-benelux-0.6...> | 2025-12-19 19:49 | 15K | |
| rubygem-best_in_plac..> | 2025-12-29 07:35 | 68K | |
| rubygem-best_in_plac..> | 2025-12-30 16:41 | 68K | |
| rubygem-better_html-..> | 2025-12-26 22:53 | 27K | |
| rubygem-bigdecimal-3..> | 2025-12-18 01:45 | 53K | |
| rubygem-bigrecord-0...> | 2025-12-28 09:50 | 107K | |
| rubygem-bin_struct-0..> | 2025-12-20 03:15 | 20K | |
| rubygem-bin_utils-0...> | 2025-12-18 23:51 | 24K | |
| rubygem-bindata-2.5...> | 2025-12-18 10:15 | 70K | |
| rubygem-bindata24-2...> | 2025-12-18 20:36 | 67K | |
| rubygem-bindex-0.8.1..> | 2025-12-18 10:04 | 17K | |
| rubygem-binding_of_c..> | 2025-12-18 16:59 | 6.6K | |
| rubygem-bio-2.0.6.pkg | 2025-12-19 01:02 | 1.0M | |
| rubygem-bio-executab..> | 2025-12-23 04:26 | 12K | |
| rubygem-bio-old-biof..> | 2025-12-20 01:42 | 8.0K | |
| rubygem-bio-shell-1...> | 2025-12-22 10:26 | 42K | |
| rubygem-bit-struct-0..> | 2025-12-20 05:47 | 27K | |
| rubygem-blankslate-3..> | 2025-12-23 16:45 | 4.7K | |
| rubygem-blimpy-0.6.7..> | 2025-12-29 17:14 | 22K | |
| rubygem-blockenspiel..> | 2025-12-18 18:58 | 41K | |
| rubygem-bluecloth-2...> | 2025-12-23 04:18 | 84K | |
| rubygem-blurhash-0.1..> | 2025-12-22 11:30 | 11K | |
| rubygem-bolt-3.30.0_..> | 2025-12-27 19:49 | 204K | |
| rubygem-bones-3.9.0.pkg | 2025-12-28 06:36 | 33K | |
| rubygem-bootsnap-1.1..> | 2025-12-18 12:40 | 36K | |
| rubygem-bootsnap-git..> | 2025-12-19 17:43 | 36K | |
| rubygem-bootstrap-sa..> | 2025-12-30 01:15 | 228K | |
| rubygem-bootstrap_fo..> | 2025-12-29 17:26 | 94K | |
| rubygem-bosh-gen-0.1..> | 2025-12-30 00:24 | 31K | |
| rubygem-bourbon-7.3...> | 2025-12-22 15:11 | 82K | |
| rubygem-brakeman-7.1..> | 2025-12-22 15:52 | 964K | |
| rubygem-browser-6.2...> | 2025-12-21 15:43 | 54K | |
| rubygem-browser5-5.3..> | 2025-12-19 19:57 | 53K | |
| rubygem-brpoplpush-r..> | 2025-12-30 02:34 | 9.5K | |
| rubygem-bson-5.2.0.pkg | 2025-12-18 23:24 | 150K | |
| rubygem-buftok-0.3.0..> | 2025-12-18 22:46 | 4.7K | |
| rubygem-bugspots-0.2..> | 2025-12-21 09:16 | 5.9K | |
| rubygem-builder-3.3...> | 2025-12-18 04:16 | 26K | |
| rubygem-bullet_train..> | 2025-12-28 01:28 | 291K | |
| rubygem-bullet_train..> | 2025-12-26 21:50 | 21K | |
| rubygem-bullet_train..> | 2025-12-27 11:27 | 3.1K | |
| rubygem-bullet_train..> | 2025-12-27 04:42 | 17K | |
| rubygem-bullet_train..> | 2025-12-29 18:46 | 3.8K | |
| rubygem-bullet_train..> | 2025-12-27 11:31 | 9.1K | |
| rubygem-bullet_train..> | 2025-12-27 07:25 | 6.0K | |
| rubygem-bullet_train..> | 2025-12-27 11:17 | 11K | |
| rubygem-bundler-2.7...> | 2025-12-18 07:54 | 406K | |
| rubygem-bundler_ext-..> | 2025-12-18 16:38 | 10K | |
| rubygem-bunny-2.9.0.pkg | 2025-12-20 10:43 | 173K | |
| rubygem-byebug-12.0...> | 2025-12-18 21:02 | 79K | |
| rubygem-bzip2-ffi-1...> | 2025-12-20 16:48 | 195K | |
| rubygem-bzip2-ruby-0..> | 2025-12-24 07:22 | 20K | |
| rubygem-c21e-2.0.0.pkg | 2025-12-21 11:00 | 4.0K | |
| rubygem-cabin-0.9.1.pkg | 2025-12-18 22:22 | 19K | |
| rubygem-cable_ready-..> | 2025-12-27 02:11 | 156K | |
| rubygem-caesars-0.7...> | 2025-12-19 03:04 | 16K | |
| rubygem-cairo-1.17.1..> | 2025-12-26 09:56 | 175K | |
| rubygem-cairo-gobjec..> | 2025-12-26 11:28 | 19K | |
| rubygem-cal-heatmap-..> | 2025-12-28 03:05 | 31K | |
| rubygem-callsign-2.2..> | 2025-12-30 07:26 | 1.9K | |
| rubygem-cancancan-3...> | 2025-12-18 23:30 | 25K | |
| rubygem-capistrano-3..> | 2025-12-27 15:58 | 67K | |
| rubygem-capistrano-e..> | 2025-12-28 04:56 | 14K | |
| rubygem-capistrano-h..> | 2025-12-21 06:16 | 26K | |
| rubygem-captcha-1.2...> | 2025-12-28 06:00 | 64K | |
| rubygem-capybara-3.4..> | 2025-12-18 12:55 | 319K | |
| rubygem-capybara-scr..> | 2025-12-21 22:40 | 31K | |
| rubygem-carrierwave-..> | 2025-12-27 02:57 | 46K | |
| rubygem-carrierwave-..> | 2025-12-27 11:32 | 39K | |
| rubygem-carrierwave1..> | 2025-12-30 07:29 | 39K | |
| rubygem-case_transfo..> | 2025-12-27 17:59 | 3.1K | |
| rubygem-cbor-0.5.9.8..> | 2025-12-18 18:34 | 41K | |
| rubygem-cdo-1.5.1_1.pkg | 2025-12-28 00:34 | 13K | |
| rubygem-celluloid-0...> | 2025-12-19 06:40 | 74K | |
| rubygem-celluloid-es..> | 2025-12-22 20:22 | 15K | |
| rubygem-celluloid-ex..> | 2025-12-21 12:08 | 4.8K | |
| rubygem-celluloid-fs..> | 2025-12-24 03:55 | 6.1K | |
| rubygem-celluloid-io..> | 2025-12-20 08:05 | 52K | |
| rubygem-celluloid-po..> | 2025-12-22 09:24 | 7.0K | |
| rubygem-celluloid-su..> | 2025-12-20 10:44 | 13K | |
| rubygem-cf-uaa-lib-4..> | 2025-12-30 03:05 | 86K | |
| rubygem-cgi-0.5.1.pkg | 2025-12-26 10:50 | 36K | |
| rubygem-cgi_multipar..> | 2025-12-21 09:38 | 7.1K | |
| rubygem-character_se..> | 2025-12-18 22:23 | 41K | |
| rubygem-charlock_hol..> | 2025-12-18 10:08 | 10K | |
| rubygem-checkson-1.3..> | 2025-12-21 07:12 | 5.7K | |
| rubygem-chef-18.8.54..> | 2025-12-27 16:18 | 685K | |
| rubygem-chef-bin-18...> | 2025-12-28 09:47 | 7.8K | |
| rubygem-chef-cleanro..> | 2025-12-19 11:21 | 14K | |
| rubygem-chef-config-..> | 2025-12-26 17:31 | 43K | |
| rubygem-chef-gyoku-1..> | 2025-12-18 07:22 | 17K | |
| rubygem-chef-licensi..> | 2025-12-30 06:28 | 27K | |
| rubygem-chef-telemet..> | 2025-12-26 18:05 | 9.6K | |
| rubygem-chef-utils-1..> | 2025-12-26 11:47 | 30K | |
| rubygem-chef-vault-4..> | 2025-12-18 22:38 | 19K | |
| rubygem-chef-winrm-2..> | 2025-12-18 10:21 | 37K | |
| rubygem-chef-winrm-e..> | 2025-12-18 16:32 | 9.6K | |
| rubygem-chef-winrm-f..> | 2025-12-18 12:53 | 19K | |
| rubygem-chef-zero-15..> | 2025-12-26 23:51 | 63K | |
| rubygem-cheffish-17...> | 2025-12-28 08:22 | 49K | |
| rubygem-chewy-7.6.0.pkg | 2025-12-28 20:14 | 144K | |
| rubygem-childprocess..> | 2025-12-18 15:21 | 18K | |
| rubygem-childprocess..> | 2025-12-20 01:07 | 18K | |
| rubygem-choria-mcorp..> | 2025-12-21 23:04 | 144K | |
| rubygem-chosen-rails..> | 2025-12-28 12:01 | 19K | |
| rubygem-chromedriver..> | 2025-12-18 18:57 | 17K | |
| rubygem-chronic-0.10..> | 2025-12-18 16:22 | 37K | |
| rubygem-chronic_dura..> | 2025-12-21 02:32 | 7.8K | |
| rubygem-chunky_png-1..> | 2025-12-18 21:44 | 303K | |
| rubygem-cinch-2.3.4.pkg | 2025-12-20 04:01 | 69K | |
| rubygem-circuitbox-2..> | 2025-12-19 07:59 | 11K | |
| rubygem-citrus-3.0.2..> | 2025-12-18 17:50 | 36K | |
| rubygem-claide-1.1.0..> | 2025-12-18 13:21 | 24K | |
| rubygem-claide-plugi..> | 2025-12-18 12:41 | 17K | |
| rubygem-clamp-1.3.3.pkg | 2025-12-18 17:58 | 27K | |
| rubygem-classifier-1..> | 2025-12-21 12:18 | 18K | |
| rubygem-classifier-r..> | 2025-12-23 12:10 | 45K | |
| rubygem-cld3-3.7.0.pkg | 2025-12-23 20:07 | 417K | |
| rubygem-click_house-..> | 2025-12-27 11:15 | 19K | |
| rubygem-climate_cont..> | 2025-12-18 17:46 | 7.6K | |
| rubygem-clio-0.3.0.pkg | 2025-12-19 04:38 | 30K | |
| rubygem-cliprompt-0...> | 2025-12-19 20:57 | 6.7K | |
| rubygem-cloudfiles-1..> | 2025-12-28 23:56 | 28K | |
| rubygem-cloudflare-4..> | 2025-12-28 03:15 | 9.9K | |
| rubygem-cloudinary-2..> | 2025-12-26 18:49 | 128K | |
| rubygem-clutter-4.3...> | 2025-12-26 17:54 | 36K | |
| rubygem-clutter-gdk-..> | 2025-12-27 01:18 | 11K | |
| rubygem-clutter-gstr..> | 2025-12-27 02:11 | 67K | |
| rubygem-clutter-gtk-..> | 2025-12-27 12:41 | 26K | |
| rubygem-cmath-1.0.0.pkg | 2025-12-20 02:05 | 3.3K | |
| rubygem-cms_scanner-..> | 2025-12-28 10:31 | 33K | |
| rubygem-cocaine-0.6...> | 2025-12-19 06:05 | 10K | |
| rubygem-cocoon-1.2.1..> | 2025-12-21 18:27 | 82K | |
| rubygem-coderay-1.1...> | 2025-12-18 10:11 | 79K | |
| rubygem-coercible-1...> | 2025-12-18 17:31 | 23K | |
| rubygem-coffee-rails..> | 2025-12-26 21:45 | 4.2K | |
| rubygem-coffee-rails..> | 2025-12-26 22:58 | 4.2K | |
| rubygem-coffee-rails..> | 2025-12-26 20:24 | 4.3K | |
| rubygem-coffee-rails..> | 2025-12-27 04:50 | 4.2K | |
| rubygem-coffee-rails..> | 2025-12-27 01:07 | 3.8K | |
| rubygem-coffee-scrip..> | 2025-12-26 19:09 | 3.3K | |
| rubygem-coffee-scrip..> | 2025-12-18 12:49 | 53K | |
| rubygem-cogbot-0.1.1..> | 2025-12-28 11:21 | 17K | |
| rubygem-color-1.8.pkg | 2025-12-20 00:46 | 39K | |
| rubygem-color-tools-..> | 2025-12-21 02:55 | 27K | |
| rubygem-color_diff-0..> | 2025-12-30 07:22 | 4.7K | |
| rubygem-colorator-1...> | 2025-12-18 18:33 | 3.9K | |
| rubygem-colored-1.2.pkg | 2025-12-19 15:45 | 3.4K | |
| rubygem-colored2-3.1..> | 2025-12-18 07:59 | 7.3K | |
| rubygem-colorize-1.1..> | 2025-12-19 21:28 | 14K | |
| rubygem-colorizer-0...> | 2025-12-19 12:16 | 3.5K | |
| rubygem-columnize-0...> | 2025-12-21 05:07 | 15K | |
| rubygem-commander-5...> | 2025-12-27 19:23 | 33K | |
| rubygem-commonmarker..> | 2025-12-27 10:01 | 1.2M | |
| rubygem-commonmarker..> | 2025-12-19 03:20 | 122K | |
| rubygem-concurrent-r..> | 2025-12-26 06:20 | 233K | |
| rubygem-concurrent-r..> | 2025-12-29 11:34 | 58K | |
| rubygem-concurrent-r..> | 2025-12-18 18:06 | 57K | |
| rubygem-concurrent-r..> | 2025-12-29 16:40 | 22K | |
| rubygem-concurrent-r..> | 2025-12-18 12:28 | 240K | |
| rubygem-configatron-..> | 2025-12-23 19:50 | 16K | |
| rubygem-configstruct..> | 2025-12-19 20:33 | 4.8K | |
| rubygem-configuratio..> | 2025-12-24 07:10 | 8.8K | |
| rubygem-connection_p..> | 2025-12-18 01:40 | 9.8K | |
| rubygem-console-1.34..> | 2025-12-26 11:40 | 24K | |
| rubygem-constant_res..> | 2025-12-18 23:56 | 9.1K | |
| rubygem-contracts-0...> | 2025-12-20 04:33 | 38K | |
| rubygem-contracts016..> | 2025-12-19 17:15 | 51K | |
| rubygem-cookbook-omn..> | 2025-12-24 06:35 | 15K | |
| rubygem-cookiejar-0...> | 2025-12-18 19:51 | 17K | |
| rubygem-cool.io-1.9...> | 2025-12-26 20:22 | 53K | |
| rubygem-corefines-1...> | 2025-12-21 07:42 | 32K | |
| rubygem-corefoundati..> | 2025-12-19 01:17 | 9.9K | |
| rubygem-cork-0.3.0.pkg | 2025-12-18 10:12 | 5.8K | |
| rubygem-cose-1.2.1.pkg | 2025-12-18 20:12 | 14K | |
| rubygem-couchrest-2...> | 2025-12-21 10:43 | 52K | |
| rubygem-countries-4...> | 2025-12-19 15:58 | 1.8M | |
| rubygem-coverband-6...> | 2025-12-19 22:35 | 186K | |
| rubygem-cow_proxy-0...> | 2025-12-20 00:39 | 8.1K | |
| rubygem-crack-1.0.1.pkg | 2025-12-18 10:25 | 7.5K | |
| rubygem-crass-1.0.6.pkg | 2025-12-18 02:10 | 15K | |
| rubygem-creole-0.5.0..> | 2025-12-19 04:21 | 11K | |
| rubygem-cri-2.15.12.pkg | 2025-12-18 13:07 | 30K | |
| rubygem-css_parser-1..> | 2025-12-18 07:54 | 17K | |
| rubygem-cssbundling-..> | 2025-12-26 16:09 | 9.5K | |
| rubygem-cssbundling-..> | 2025-12-27 16:20 | 9.6K | |
| rubygem-cssbundling-..> | 2025-12-26 22:54 | 9.5K | |
| rubygem-cssbundling-..> | 2025-12-26 22:17 | 9.5K | |
| rubygem-cssbundling-..> | 2025-12-26 20:33 | 9.5K | |
| rubygem-cssbundling-..> | 2025-12-27 09:58 | 9.5K | |
| rubygem-cssmin-1.0.3..> | 2025-12-19 19:32 | 3.5K | |
| rubygem-csv-3.3.5.pkg | 2025-12-18 11:26 | 56K | |
| rubygem-cuba-4.0.1.pkg | 2025-12-21 00:00 | 23K | |
| rubygem-cucumber-10...> | 2025-12-27 09:43 | 69K | |
| rubygem-cucumber-ci-..> | 2025-12-23 21:39 | 4.1K | |
| rubygem-cucumber-ci-..> | 2025-12-19 00:45 | 5.4K | |
| rubygem-cucumber-ci-..> | 2025-12-27 01:25 | 4.1K | |
| rubygem-cucumber-cor..> | 2025-12-26 21:46 | 20K | |
| rubygem-cucumber-cuc..> | 2025-12-18 19:38 | 12K | |
| rubygem-cucumber-cuc..> | 2025-12-24 01:35 | 21K | |
| rubygem-cucumber-ghe..> | 2025-12-20 14:54 | 27K | |
| rubygem-cucumber-ghe..> | 2025-12-18 18:45 | 26K | |
| rubygem-cucumber-htm..> | 2025-12-21 09:20 | 239K | |
| rubygem-cucumber-htm..> | 2025-12-18 19:28 | 237K | |
| rubygem-cucumber-mes..> | 2025-12-20 01:52 | 19K | |
| rubygem-cucumber-mes..> | 2025-12-18 16:55 | 19K | |
| rubygem-cucumber-mes..> | 2025-12-18 12:32 | 19K | |
| rubygem-cucumber-mes..> | 2025-12-18 18:22 | 19K | |
| rubygem-cucumber-mes..> | 2025-12-19 08:41 | 19K | |
| rubygem-cucumber-rai..> | 2025-12-29 14:30 | 14K | |
| rubygem-cucumber-tag..> | 2025-12-18 18:10 | 3.7K | |
| rubygem-cucumber-wir..> | 2025-12-30 07:26 | 8.4K | |
| rubygem-curb-1.2.2.pkg | 2025-12-22 11:19 | 87K | |
| rubygem-curses-1.4.4..> | 2025-12-20 03:11 | 379K | |
| rubygem-cvss-suite-3..> | 2025-12-19 23:40 | 25K | |
| rubygem-cyoi-0.11.3_..> | 2025-12-27 09:46 | 26K | |
| rubygem-d3_rails-4.1..> | 2025-12-27 17:28 | 114K | |
| rubygem-daemon_contr..> | 2025-12-21 01:17 | 22K | |
| rubygem-daemons-1.4...> | 2025-12-19 02:01 | 25K | |
| rubygem-dalli-3.2.8.pkg | 2025-12-18 13:35 | 38K | |
| rubygem-danger-9.5.3..> | 2025-12-18 14:36 | 76K | |
| rubygem-danger-gitla..> | 2025-12-18 19:03 | 2.4K | |
| rubygem-dartsass-1.4..> | 2025-12-19 01:36 | 8.1M | |
| rubygem-data_objects..> | 2025-12-18 21:22 | 26K | |
| rubygem-datadog-2.23..> | 2025-12-27 16:11 | 463K | |
| rubygem-datadog-ci-1..> | 2025-12-30 08:46 | 107K | |
| rubygem-datadog-ruby..> | 2025-12-26 21:42 | 197K | |
| rubygem-datamapper-1..> | 2025-12-20 23:25 | 3.2K | |
| rubygem-date-3.5.1.pkg | 2025-12-26 06:44 | 85K | |
| rubygem-davclient-0...> | 2025-12-20 18:23 | 21K | |
| rubygem-dbd-pg-0.3.9..> | 2025-12-20 10:49 | 48K | |
| rubygem-dbd-sqlite3-..> | 2025-12-20 11:11 | 38K | |
| rubygem-dbf-5.1.1.pkg | 2025-12-21 19:36 | 108K | |
| rubygem-dbf4-4.3.2.pkg | 2025-12-19 20:08 | 107K | |
| rubygem-dbi-0.4.5_1.pkg | 2025-12-19 11:15 | 63K | |
| rubygem-dbm-1.1.0.pkg | 2025-12-19 11:00 | 9.1K | |
| rubygem-ddmemoize-1...> | 2025-12-21 08:05 | 8.8K | |
| rubygem-ddmetrics-1...> | 2025-12-18 10:29 | 16K | |
| rubygem-ddplugin-1.0..> | 2025-12-18 11:14 | 6.6K | |
| rubygem-dead_end-4.0..> | 2025-12-22 23:58 | 30K | |
| rubygem-deb_version-..> | 2025-12-18 19:36 | 4.9K | |
| rubygem-debase-ruby_..> | 2025-12-20 11:02 | 455K | |
| rubygem-debug-1.11.0..> | 2025-12-26 23:05 | 77K | |
| rubygem-debug_inspec..> | 2025-12-18 11:46 | 7.6K | |
| rubygem-debugger-lin..> | 2025-12-23 09:57 | 14K | |
| rubygem-debugger-rub..> | 2025-12-18 19:52 | 112K | |
| rubygem-debugger-xml..> | 2025-12-23 19:54 | 27K | |
| rubygem-deckar01-tas..> | 2025-12-27 12:42 | 57K | |
| rubygem-deckar01-tas..> | 2025-12-27 16:05 | 57K | |
| rubygem-declarative-..> | 2025-12-18 04:32 | 7.7K | |
| rubygem-declarative-..> | 2025-12-22 20:25 | 5.7K | |
| rubygem-declarative_..> | 2025-12-20 04:04 | 28K | |
| rubygem-deep_merge-1..> | 2025-12-18 18:40 | 11K | |
| rubygem-deep_test-1...> | 2025-12-20 17:34 | 38K | |
| rubygem-deface-1.9.0..> | 2025-12-28 08:30 | 44K | |
| rubygem-default_valu..> | 2025-12-30 14:39 | 12K | |
| rubygem-delayed_job-..> | 2025-12-28 12:33 | 36K | |
| rubygem-delayer-1.2...> | 2025-12-18 19:56 | 9.1K | |
| rubygem-delayer-defe..> | 2025-12-19 14:50 | 19K | |
| rubygem-delegate-0.4..> | 2025-12-23 15:42 | 8.6K | |
| rubygem-deprecated-3..> | 2025-12-21 07:29 | 3.9K | |
| rubygem-deprecated2-..> | 2025-12-18 21:33 | 4.0K | |
| rubygem-derailed_ben..> | 2025-12-23 19:18 | 106K | |
| rubygem-descendants_..> | 2025-12-18 14:19 | 8.6K | |
| rubygem-devfile-0.4...> | 2025-12-19 23:32 | 83M | |
| rubygem-device_detec..> | 2025-12-20 00:28 | 340K | |
| rubygem-devise-4.9.4..> | 2025-12-29 19:01 | 80K | |
| rubygem-devise-pwned..> | 2025-12-27 12:58 | 6.3K | |
| rubygem-devise-rails..> | 2025-12-27 00:54 | 80K | |
| rubygem-devise-rails..> | 2025-12-27 06:47 | 80K | |
| rubygem-devise-rails..> | 2025-12-28 10:18 | 80K | |
| rubygem-devise-rails..> | 2025-12-29 16:31 | 80K | |
| rubygem-devise-rails..> | 2025-12-27 20:09 | 80K | |
| rubygem-devise-rails..> | 2025-12-27 17:13 | 80K | |
| rubygem-devise-rails..> | 2025-12-27 23:43 | 80K | |
| rubygem-devise-rails..> | 2025-12-27 14:51 | 80K | |
| rubygem-devise-rails..> | 2025-12-30 05:57 | 80K | |
| rubygem-devise-rails..> | 2025-12-26 20:31 | 80K | |
| rubygem-devise-two-f..> | 2025-12-30 06:42 | 21K | |
| rubygem-devise-two-f..> | 2025-12-27 10:15 | 21K | |
| rubygem-devise-two-f..> | 2025-12-29 04:22 | 21K | |
| rubygem-devise-two-f..> | 2025-12-30 14:27 | 21K | |
| rubygem-devise_pam_a..> | 2025-12-28 08:36 | 5.4K | |
| rubygem-did_you_mean..> | 2025-12-21 18:34 | 32K | |
| rubygem-diff-lcs-1.6..> | 2025-12-18 06:48 | 53K | |
| rubygem-diff_match_p..> | 2025-12-21 05:23 | 21K | |
| rubygem-diffy-3.4.4.pkg | 2025-12-19 05:48 | 14K | |
| rubygem-dig_rb-1.0.1..> | 2025-12-21 00:53 | 5.4K | |
| rubygem-digest-3.2.1..> | 2025-12-22 19:27 | 30K | |
| rubygem-digest-crc-0..> | 2025-12-18 23:40 | 57K | |
| rubygem-directory_wa..> | 2025-12-21 20:46 | 25K | |
| rubygem-discordrb-we..> | 2025-12-24 06:00 | 7.7K | |
| rubygem-discordrb-we..> | 2025-12-21 21:29 | 5.0K | |
| rubygem-ditz-0.5_3.pkg | 2025-12-21 13:11 | 63K | |
| rubygem-diva-2.0.1.pkg | 2025-12-19 19:23 | 13K | |
| rubygem-dm-aggregate..> | 2025-12-19 23:23 | 11K | |
| rubygem-dm-chunked_q..> | 2025-12-23 09:41 | 7.8K | |
| rubygem-dm-constrain..> | 2025-12-19 12:51 | 13K | |
| rubygem-dm-core-1.2...> | 2025-12-18 19:51 | 162K | |
| rubygem-dm-do-adapte..> | 2025-12-19 03:19 | 11K | |
| rubygem-dm-migration..> | 2025-12-19 15:14 | 31K | |
| rubygem-dm-mysql-ada..> | 2025-12-23 14:50 | 4.8K | |
| rubygem-dm-observer-..> | 2025-12-24 03:54 | 5.5K | |
| rubygem-dm-pager-1.1..> | 2025-12-21 17:43 | 10K | |
| rubygem-dm-paperclip..> | 2025-12-21 06:59 | 68K | |
| rubygem-dm-postgres-..> | 2025-12-23 03:33 | 4.6K | |
| rubygem-dm-serialize..> | 2025-12-19 08:29 | 15K | |
| rubygem-dm-timestamp..> | 2025-12-19 15:31 | 6.2K | |
| rubygem-dm-transacti..> | 2025-12-19 16:38 | 10K | |
| rubygem-dm-types-1.2..> | 2025-12-19 08:38 | 26K | |
| rubygem-dm-validatio..> | 2025-12-19 11:52 | 49K | |
| rubygem-dnsruby-1.61..> | 2025-12-19 07:20 | 214K | |
| rubygem-do_mysql-0.1..> | 2025-12-19 06:05 | 29K | |
| rubygem-do_postgres-..> | 2025-12-19 23:33 | 28K | |
| rubygem-do_sqlite3-0..> | 2025-12-20 10:41 | 25K | |
| rubygem-docdiff-0.6...> | 2025-12-20 05:24 | 117K | |
| rubygem-docile-1.4.1..> | 2025-12-18 19:22 | 13K | |
| rubygem-docker-api-1..> | 2025-12-19 20:12 | 23K | |
| rubygem-docopt-0.6.1..> | 2025-12-19 17:53 | 15K | |
| rubygem-dogapi-1.45...> | 2025-12-19 14:34 | 51K | |
| rubygem-domain_name-..> | 2025-12-18 04:33 | 108K | |
| rubygem-domainatrix-..> | 2025-12-22 16:48 | 35K | |
| rubygem-doorkeeper-5..> | 2025-12-28 06:22 | 93K | |
| rubygem-doorkeeper-d..> | 2025-12-27 12:58 | 14K | |
| rubygem-doorkeeper-o..> | 2025-12-27 03:40 | 21K | |
| rubygem-doorkeeper-r..> | 2025-12-26 22:10 | 93K | |
| rubygem-doorkeeper-r..> | 2025-12-29 19:36 | 93K | |
| rubygem-doorkeeper-r..> | 2025-12-29 11:34 | 93K | |
| rubygem-doorkeeper-r..> | 2025-12-29 07:15 | 93K | |
| rubygem-doorkeeper57..> | 2025-12-27 22:28 | 91K | |
| rubygem-dotenv-3.2.0..> | 2025-12-18 18:41 | 14K | |
| rubygem-dotenv-rails..> | 2025-12-27 20:02 | 6.2K | |
| rubygem-dotenv-rails..> | 2025-12-29 00:23 | 6.7K | |
| rubygem-dotenv-rails..> | 2025-12-30 07:20 | 6.6K | |
| rubygem-dotenv-rails..> | 2025-12-29 11:34 | 6.6K | |
| rubygem-dotenv2-2.8...> | 2025-12-19 12:37 | 9.4K | |
| rubygem-dragonfly-1...> | 2025-12-22 19:45 | 409K | |
| rubygem-drb-2.2.1.pkg | 2025-12-18 01:45 | 25K | |
| rubygem-drb-gitlab-2..> | 2025-12-19 20:13 | 25K | |
| rubygem-dropbox-sdk-..> | 2025-12-27 15:40 | 53K | |
| rubygem-dropzonejs-r..> | 2025-12-30 17:14 | 20K | |
| rubygem-dry-cli-1.1...> | 2025-12-18 15:58 | 13K | |
| rubygem-dry-configur..> | 2025-12-26 22:01 | 12K | |
| rubygem-dry-containe..> | 2025-12-29 22:44 | 9.5K | |
| rubygem-dry-core-1.1..> | 2025-12-26 15:43 | 19K | |
| rubygem-dry-core-git..> | 2025-12-26 11:14 | 19K | |
| rubygem-dry-equalize..> | 2025-12-22 12:54 | 12K | |
| rubygem-dry-inflecto..> | 2025-12-18 10:16 | 8.0K | |
| rubygem-dry-logic-1...> | 2025-12-26 18:39 | 13K | |
| rubygem-dry-logic-gi..> | 2025-12-26 13:39 | 13K | |
| rubygem-dry-types-1...> | 2025-12-26 20:41 | 40K | |
| rubygem-dry-types-gi..> | 2025-12-26 15:26 | 40K | |
| rubygem-drydock-1.0...> | 2025-12-18 16:28 | 19K | |
| rubygem-duo_api-1.5...> | 2025-12-19 09:26 | 24K | |
| rubygem-dynflow-1.9...> | 2025-12-18 22:33 | 611K | |
| rubygem-e2mmap-0.1.0..> | 2025-12-19 15:05 | 4.6K | |
| rubygem-ecma-re-vali..> | 2025-12-22 08:38 | 5.9K | |
| rubygem-ed25519-1.4...> | 2025-12-18 21:56 | 135K | |
| rubygem-edavis10-obj..> | 2025-12-20 23:16 | 13K | |
| rubygem-elastic-apm-..> | 2025-12-30 05:53 | 107K | |
| rubygem-elastic-tran..> | 2025-12-26 18:10 | 54K | |
| rubygem-elasticsearc..> | 2025-12-29 18:10 | 12K | |
| rubygem-elasticsearc..> | 2025-12-19 22:30 | 168K | |
| rubygem-elasticsearc..> | 2025-12-18 18:34 | 78K | |
| rubygem-elasticsearc..> | 2025-12-19 00:30 | 78K | |
| rubygem-elasticsearc..> | 2025-12-18 17:19 | 186K | |
| rubygem-elasticsearc..> | 2025-12-19 09:08 | 61K | |
| rubygem-elasticsearc..> | 2025-12-18 19:11 | 12K | |
| rubygem-elasticsearc..> | 2025-12-27 16:46 | 58K | |
| rubygem-elasticsearc..> | 2025-12-27 17:43 | 59K | |
| rubygem-elasticsearc..> | 2025-12-29 20:46 | 25K | |
| rubygem-elasticsearc..> | 2025-12-21 15:52 | 4.1M | |
| rubygem-elasticsearc..> | 2025-12-19 09:38 | 4.1M | |
| rubygem-elasticsearc..> | 2025-12-26 21:50 | 49K | |
| rubygem-elasticsearc..> | 2025-12-18 18:56 | 50K | |
| rubygem-elasticsearc..> | 2025-12-23 14:47 | 55K | |
| rubygem-elasticsearc..> | 2025-12-27 10:41 | 12K | |
| rubygem-elasticsearc..> | 2025-12-27 01:18 | 21K | |
| rubygem-elftools-1.3..> | 2025-12-19 15:45 | 26K | |
| rubygem-elif-0.1.0.pkg | 2025-12-22 05:39 | 19K | |
| rubygem-em-http-requ..> | 2025-12-19 13:27 | 210K | |
| rubygem-em-redis-uni..> | 2025-12-23 16:54 | 15K | |
| rubygem-em-socksify-..> | 2025-12-18 23:18 | 5.5K | |
| rubygem-em-twitter-0..> | 2025-12-19 07:11 | 15K | |
| rubygem-em-websocket..> | 2025-12-18 16:21 | 29K | |
| rubygem-email_reply_..> | 2025-12-18 23:15 | 14K | |
| rubygem-email_reply_..> | 2025-12-20 08:39 | 20K | |
| rubygem-email_reply_..> | 2025-12-19 12:39 | 33K | |
| rubygem-email_valida..> | 2025-12-26 20:12 | 11K | |
| rubygem-emk-sinatra-..> | 2025-12-20 03:09 | 3.5K | |
| rubygem-emoji-1.0.7.pkg | 2025-12-28 02:49 | 1.2M | |
| rubygem-emoji_regex-..> | 2025-12-23 15:51 | 5.2K | |
| rubygem-emot-0.0.4.pkg | 2025-12-20 01:59 | 14K | |
| rubygem-encryptor-3...> | 2025-12-18 17:17 | 13K | |
| rubygem-english-0.8...> | 2025-12-22 18:48 | 5.7K | |
| rubygem-enumerable-s..> | 2025-12-19 07:04 | 346K | |
| rubygem-enumerize-2...> | 2025-12-29 20:02 | 28K | |
| rubygem-epp-client-a..> | 2025-12-23 16:36 | 11K | |
| rubygem-epp-client-b..> | 2025-12-19 05:11 | 76K | |
| rubygem-epp-client-r..> | 2025-12-20 03:04 | 14K | |
| rubygem-epp-client-s..> | 2025-12-19 12:27 | 21K | |
| rubygem-epp-client-s..> | 2025-12-20 16:32 | 5.7K | |
| rubygem-equalizer-0...> | 2025-12-19 02:24 | 10K | |
| rubygem-equatable-0...> | 2025-12-19 05:10 | 5.1K | |
| rubygem-erb-6.0.1.pkg | 2025-12-26 09:10 | 27K | |
| rubygem-errand-0.8.1..> | 2025-12-27 16:03 | 8.4K | |
| rubygem-error_highli..> | 2025-12-21 01:16 | 10K | |
| rubygem-erubi-1.13.1..> | 2025-12-18 03:54 | 10K | |
| rubygem-erubis-2.7.0..> | 2025-12-18 05:33 | 121K | |
| rubygem-escape_utils..> | 2025-12-19 14:02 | 21K | |
| rubygem-et-orbi-1.4...> | 2025-12-26 11:36 | 16K | |
| rubygem-etc-1.4.6.pkg | 2025-12-19 22:44 | 14K | |
| rubygem-ethon-0.18.0..> | 2025-12-18 12:40 | 35K | |
| rubygem-ethon-gitlab..> | 2025-12-18 17:35 | 34K | |
| rubygem-event_emitte..> | 2025-12-19 13:13 | 6.9K | |
| rubygem-event_stream..> | 2025-12-18 20:12 | 5.2K | |
| rubygem-eventmachine..> | 2025-12-18 13:44 | 213K | |
| rubygem-eventmachine..> | 2025-12-19 15:35 | 26K | |
| rubygem-exception_no..> | 2025-12-29 18:04 | 33K | |
| rubygem-excon-1.3.2.pkg | 2025-12-18 07:02 | 157K | |
| rubygem-excon-gitlab..> | 2025-12-18 13:41 | 157K | |
| rubygem-excon0-0.112..> | 2025-12-18 21:38 | 161K | |
| rubygem-excon1-gitla..> | 2025-12-18 20:14 | 159K | |
| rubygem-execjs-2.10...> | 2025-12-26 15:28 | 15K | |
| rubygem-exifr-1.3.10..> | 2025-12-22 06:47 | 245K | |
| rubygem-expression_p..> | 2025-12-19 02:06 | 3.8K | |
| rubygem-extended-mar..> | 2025-12-27 18:26 | 9.3K | |
| rubygem-extended_ema..> | 2025-12-29 17:41 | 18K | |
| rubygem-extlib-0.9.1..> | 2025-12-18 23:15 | 57K | |
| rubygem-extpp-0.1.1.pkg | 2025-12-18 17:39 | 8.6K | |
| rubygem-extras-0.3.0..> | 2025-12-18 19:22 | 4.2K | |
| rubygem-ezamar-2009...> | 2025-12-20 23:20 | 13K | |
| rubygem-ezcrypto-0.7..> | 2025-12-22 20:38 | 96K | |
| rubygem-fabrication-..> | 2025-12-22 08:36 | 13K | |
| rubygem-facets-3.1.0..> | 2025-12-19 19:18 | 291K | |
| rubygem-facter-4.10...> | 2025-12-26 20:02 | 158K | |
| rubygem-faker-3.3.1.pkg | 2025-12-27 02:16 | 1.2M | |
| rubygem-familia-0.10..> | 2025-12-19 07:02 | 20K | |
| rubygem-faraday-2.14..> | 2025-12-26 09:23 | 64K | |
| rubygem-faraday-cook..> | 2025-12-18 17:26 | 4.6K | |
| rubygem-faraday-em_h..> | 2025-12-30 06:09 | 6.1K | |
| rubygem-faraday-em_h..> | 2025-12-18 06:12 | 5.8K | |
| rubygem-faraday-em_s..> | 2025-12-18 05:28 | 5.3K | |
| rubygem-faraday-exco..> | 2025-12-30 12:53 | 4.3K | |
| rubygem-faraday-exco..> | 2025-12-18 05:26 | 4.1K | |
| rubygem-faraday-foll..> | 2025-12-26 14:55 | 5.9K | |
| rubygem-faraday-foll..> | 2025-12-18 11:25 | 5.7K | |
| rubygem-faraday-gitl..> | 2025-12-18 07:57 | 64K | |
| rubygem-faraday-http..> | 2025-12-27 16:15 | 21K | |
| rubygem-faraday-http..> | 2025-12-18 13:30 | 21K | |
| rubygem-faraday-http..> | 2025-12-20 16:33 | 4.5K | |
| rubygem-faraday-http..> | 2025-12-18 05:37 | 4.6K | |
| rubygem-faraday-mult..> | 2025-12-18 04:34 | 7.6K | |
| rubygem-faraday-net_..> | 2025-12-18 02:55 | 4.9K | |
| rubygem-faraday-net_..> | 2025-12-18 06:01 | 4.9K | |
| rubygem-faraday-net_..> | 2025-12-18 05:37 | 5.0K | |
| rubygem-faraday-net_..> | 2025-12-27 00:53 | 5.4K | |
| rubygem-faraday-net_..> | 2025-12-18 23:03 | 5.4K | |
| rubygem-faraday-net_..> | 2025-12-18 04:37 | 4.5K | |
| rubygem-faraday-patr..> | 2025-12-23 16:11 | 4.2K | |
| rubygem-faraday-patr..> | 2025-12-18 04:38 | 4.4K | |
| rubygem-faraday-rack..> | 2025-12-27 08:45 | 3.8K | |
| rubygem-faraday-rack..> | 2025-12-18 05:32 | 3.9K | |
| rubygem-faraday-retr..> | 2025-12-26 15:07 | 8.7K | |
| rubygem-faraday-retr..> | 2025-12-18 12:35 | 8.7K | |
| rubygem-faraday-retr..> | 2025-12-18 04:33 | 6.9K | |
| rubygem-faraday-typh..> | 2025-12-27 01:17 | 5.3K | |
| rubygem-faraday-typh..> | 2025-12-19 22:53 | 5.3K | |
| rubygem-faraday0-0.1..> | 2025-12-18 12:39 | 62K | |
| rubygem-faraday1-1.1..> | 2025-12-18 07:18 | 62K | |
| rubygem-faraday_midd..> | 2025-12-18 20:49 | 14K | |
| rubygem-faraday_midd..> | 2025-12-29 11:01 | 5.8K | |
| rubygem-faraday_midd..> | 2025-12-19 21:01 | 5.8K | |
| rubygem-faraday_midd..> | 2025-12-20 10:18 | 4.4K | |
| rubygem-faraday_midd..> | 2025-12-18 18:38 | 14K | |
| rubygem-fast-stemmer..> | 2025-12-19 14:59 | 8.4K | |
| rubygem-fast_blank-1..> | 2025-12-19 05:56 | 7.1K | |
| rubygem-fast_gettext..> | 2025-12-18 15:32 | 26K | |
| rubygem-fast_stack-0..> | 2025-12-23 05:46 | 5.4K | |
| rubygem-fast_xor-1.1..> | 2025-12-28 02:11 | 5.8K | |
| rubygem-fast_xs-0.8...> | 2025-12-23 19:34 | 21K | |
| rubygem-fastercsv-1...> | 2025-12-18 23:41 | 103K | |
| rubygem-fastimage-2...> | 2025-12-19 09:25 | 15K | |
| rubygem-fastri-0.3.1..> | 2025-12-22 11:25 | 43K | |
| rubygem-fattr-2.4.0.pkg | 2025-12-19 01:59 | 11K | |
| rubygem-faye-1.4.1.pkg | 2025-12-21 04:48 | 81K | |
| rubygem-faye-websock..> | 2025-12-19 22:56 | 16K | |
| rubygem-fcgi-0.9.2.2..> | 2025-12-22 12:02 | 15K | |
| rubygem-fcntl-1.3.0.pkg | 2025-12-21 20:49 | 6.0K | |
| rubygem-feed-normali..> | 2025-12-20 21:58 | 39K | |
| rubygem-feedjira-4.0..> | 2025-12-29 04:32 | 340K | |
| rubygem-ffaker-2.25...> | 2025-12-19 15:01 | 440K | |
| rubygem-ffi-1.17.2.pkg | 2025-12-18 04:36 | 107K | |
| rubygem-ffi-compiler..> | 2025-12-18 12:12 | 12K | |
| rubygem-ffi-libarchi..> | 2025-12-18 20:27 | 12K | |
| rubygem-ffi-win32-ex..> | 2025-12-19 00:01 | 9.6K | |
| rubygem-ffi-yajl-2.3..> | 2025-12-18 18:21 | 119K | |
| rubygem-fftw3-0.3.pkg | 2025-12-21 17:28 | 7.8K | |
| rubygem-fiber-annota..> | 2025-12-18 04:33 | 4.1K | |
| rubygem-fiber-local-..> | 2025-12-18 04:36 | 4.7K | |
| rubygem-fiber-storag..> | 2025-12-18 03:48 | 5.1K | |
| rubygem-fiddle-1.1.8..> | 2025-12-18 04:40 | 37K | |
| rubygem-figaro-1.3.0..> | 2025-12-19 03:25 | 17K | |
| rubygem-file-tail-1...> | 2025-12-24 07:20 | 17K | |
| rubygem-filesize-0.2..> | 2025-12-19 08:34 | 5.0K | |
| rubygem-fileutils-1...> | 2025-12-20 03:04 | 18K | |
| rubygem-find-0.2.0.pkg | 2025-12-22 12:31 | 4.8K | |
| rubygem-fission-0.5...> | 2025-12-18 12:03 | 39K | |
| rubygem-flamegraph-0..> | 2025-12-24 04:56 | 96K | |
| rubygem-flexmock-3.0..> | 2025-12-23 02:42 | 60K | |
| rubygem-flipper-1.3...> | 2025-12-20 03:05 | 793K | |
| rubygem-flipper-acti..> | 2025-12-30 17:06 | 9.4K | |
| rubygem-flipper-acti..> | 2025-12-27 11:24 | 6.9K | |
| rubygem-flipper-acti..> | 2025-12-29 22:45 | 6.9K | |
| rubygem-flipper-acti..> | 2025-12-30 19:07 | 3.7K | |
| rubygem-flipper-acti..> | 2025-12-27 17:34 | 3.3K | |
| rubygem-flipper-acti..> | 2025-12-28 13:12 | 3.3K | |
| rubygem-flipper-gitl..> | 2025-12-26 23:32 | 98K | |
| rubygem-flipper-ui-1..> | 2025-12-21 11:51 | 297K | |
| rubygem-flowdock-0.7..> | 2025-12-19 16:50 | 9.5K | |
| rubygem-fluent-logge..> | 2025-12-19 13:18 | 17K | |
| rubygem-fluent-mixin..> | 2025-12-27 13:19 | 6.6K | |
| rubygem-fluent-plugi..> | 2025-12-28 18:12 | 6.6K | |
| rubygem-fluent-plugi..> | 2025-12-29 22:44 | 6.2K | |
| rubygem-fluent-plugi..> | 2025-12-29 10:58 | 4.3K | |
| rubygem-fluentd-1.19..> | 2025-12-26 21:21 | 511K | |
| rubygem-flvtool2-1.0..> | 2025-12-20 01:36 | 25K | |
| rubygem-fog-2.3.0.pkg | 2025-12-26 23:05 | 404K | |
| rubygem-fog-aliyun-0..> | 2025-12-26 18:07 | 41K | |
| rubygem-fog-aliyun-g..> | 2025-12-27 13:16 | 41K | |
| rubygem-fog-atmos-0...> | 2025-12-26 20:05 | 15K | |
| rubygem-fog-aws-3.33..> | 2025-12-26 20:21 | 367K | |
| rubygem-fog-aws-gitl..> | 2025-12-27 11:32 | 367K | |
| rubygem-fog-azure-0...> | 2025-12-29 05:19 | 13K | |
| rubygem-fog-brightbo..> | 2025-12-26 19:50 | 76K | |
| rubygem-fog-cloudatc..> | 2025-12-26 18:57 | 9.0K | |
| rubygem-fog-cloudsta..> | 2025-12-26 19:51 | 80K | |
| rubygem-fog-core-2.6..> | 2025-12-26 14:45 | 43K | |
| rubygem-fog-core-git..> | 2025-12-26 19:30 | 43K | |
| rubygem-fog-core1-1...> | 2025-12-27 13:16 | 49K | |
| rubygem-fog-digitalo..> | 2025-12-26 20:00 | 43K | |
| rubygem-fog-dnsimple..> | 2025-12-26 18:47 | 10K | |
| rubygem-fog-dynect-0..> | 2025-12-26 20:12 | 15K | |
| rubygem-fog-ecloud-0..> | 2025-12-26 19:41 | 63K | |
| rubygem-fog-google-1..> | 2025-12-26 19:39 | 116K | |
| rubygem-fog-google-g..> | 2025-12-27 12:40 | 142K | |
| rubygem-fog-gridscal..> | 2025-12-29 12:02 | 25K | |
| rubygem-fog-internet..> | 2025-12-26 18:36 | 41K | |
| rubygem-fog-joyent-0..> | 2025-12-27 21:59 | 24K | |
| rubygem-fog-json-1.2..> | 2025-12-26 15:43 | 5.6K | |
| rubygem-fog-json-git..> | 2025-12-27 00:18 | 5.6K | |
| rubygem-fog-local-0...> | 2025-12-26 20:10 | 11K | |
| rubygem-fog-local-gi..> | 2025-12-27 18:39 | 11K | |
| rubygem-fog-openstac..> | 2025-12-26 20:05 | 212K | |
| rubygem-fog-ovirt-2...> | 2025-12-26 19:55 | 21K | |
| rubygem-fog-powerdns..> | 2025-12-26 18:08 | 8.7K | |
| rubygem-fog-profitbr..> | 2025-12-26 19:19 | 55K | |
| rubygem-fog-rackspac..> | 2025-12-26 18:04 | 199K | |
| rubygem-fog-radosgw-..> | 2025-12-26 20:16 | 11K | |
| rubygem-fog-riakcs-0..> | 2025-12-26 19:17 | 15K | |
| rubygem-fog-sakuracl..> | 2025-12-26 19:43 | 19K | |
| rubygem-fog-serverlo..> | 2025-12-26 19:50 | 14K | |
| rubygem-fog-softlaye..> | 2025-12-26 19:51 | 180K | |
| rubygem-fog-storm_on..> | 2025-12-26 18:37 | 25K | |
| rubygem-fog-terremar..> | 2025-12-26 18:35 | 23K | |
| rubygem-fog-vmfusion..> | 2025-12-26 17:56 | 8.5K | |
| rubygem-fog-voxel-0...> | 2025-12-26 18:05 | 16K | |
| rubygem-fog-vsphere-..> | 2025-12-26 20:13 | 126K | |
| rubygem-fog-xenserve..> | 2025-12-26 20:10 | 88K | |
| rubygem-fog-xml-0.1...> | 2025-12-26 17:05 | 8.7K | |
| rubygem-fog-xml-gitl..> | 2025-12-26 22:59 | 8.7K | |
| rubygem-font-awesome..> | 2025-12-29 17:57 | 496K | |
| rubygem-font-awesome..> | 2025-12-27 22:51 | 496K | |
| rubygem-font-awesome..> | 2025-12-28 00:55 | 496K | |
| rubygem-font-awesome..> | 2025-12-27 20:02 | 496K | |
| rubygem-foreigner-1...> | 2025-12-30 14:05 | 12K | |
| rubygem-foreman-0.87..> | 2025-12-22 08:17 | 66K | |
| rubygem-formatador-1..> | 2025-12-26 11:25 | 10K | |
| rubygem-fortune_gem-..> | 2025-12-19 09:37 | 39K | |
| rubygem-forwardable-..> | 2025-12-18 10:31 | 4.1K | |
| rubygem-forwardable-..> | 2025-12-18 13:55 | 3.6K | |
| rubygem-fpm-1.17.0.pkg | 2025-12-30 10:35 | 121K | |
| rubygem-fssm-0.2.10.pkg | 2025-12-23 09:41 | 18K | |
| rubygem-fugit-1.12.1..> | 2025-12-26 14:23 | 27K | |
| rubygem-fugit-gitlab..> | 2025-12-27 01:15 | 26K | |
| rubygem-fuubar-2.5.1..> | 2025-12-21 05:07 | 6.8K | |
| rubygem-fuzzy_match-..> | 2025-12-18 23:20 | 104K | |
| rubygem-fuzzyurl-0.9..> | 2025-12-18 09:17 | 5.3K | |
| rubygem-gapic-common..> | 2025-12-26 19:12 | 37K | |
| rubygem-gapic-common..> | 2025-12-18 16:53 | 32K | |
| rubygem-gd2-1.1.1_7.pkg | 2025-12-30 17:34 | 23K | |
| rubygem-gdata-1.1.2.pkg | 2025-12-23 11:09 | 18K | |
| rubygem-gdbm-2.1.1,2..> | 2025-12-18 20:39 | 10K | |
| rubygem-gdk3-4.3.4.pkg | 2025-12-26 18:45 | 31K | |
| rubygem-gdk4-4.3.4.pkg | 2025-12-26 16:11 | 26K | |
| rubygem-gdk_pixbuf2-..> | 2025-12-26 14:40 | 29K | |
| rubygem-gem-compare-..> | 2025-12-28 15:35 | 30K | |
| rubygem-gem_plugin-0..> | 2025-12-20 17:22 | 27K | |
| rubygem-gemcutter-0...> | 2025-12-20 11:00 | 8.0K | |
| rubygem-gemdiff-6.0...> | 2025-12-29 23:37 | 10K | |
| rubygem-geminabox-2...> | 2025-12-30 14:56 | 19K | |
| rubygem-gemnasium-pa..> | 2025-12-19 15:14 | 7.9K | |
| rubygem-gemoji-4.1.0..> | 2025-12-19 13:19 | 36K | |
| rubygem-gemoji3-3.0...> | 2025-12-19 15:43 | 64K | |
| rubygem-gemojione-4...> | 2025-12-27 02:02 | 17M | |
| rubygem-gemojione32-..> | 2025-12-30 10:15 | 4.5M | |
| rubygem-gems-1.3.0.pkg | 2025-12-18 18:41 | 8.4K | |
| rubygem-generator-0...> | 2025-12-23 16:58 | 4.8K | |
| rubygem-generator_sp..> | 2025-12-30 14:49 | 7.7K | |
| rubygem-generator_sp..> | 2025-12-28 03:55 | 7.7K | |
| rubygem-geokit-1.14...> | 2025-12-20 02:05 | 82K | |
| rubygem-georuby-2.5...> | 2025-12-20 08:04 | 130K | |
| rubygem-gepub-1.0.15..> | 2025-12-20 02:05 | 34K | |
| rubygem-get_process_..> | 2025-12-19 22:44 | 8.4K | |
| rubygem-get_process_..> | 2025-12-19 09:53 | 8.0K | |
| rubygem-getopt-1.6.0..> | 2025-12-23 08:37 | 17K | |
| rubygem-getoptlong-0..> | 2025-12-18 01:40 | 10K | |
| rubygem-gettext-3.5...> | 2025-12-18 16:53 | 156K | |
| rubygem-gettext-setu..> | 2025-12-18 23:48 | 15K | |
| rubygem-gettext_i18n..> | 2025-12-19 23:39 | 9.7K | |
| rubygem-gettext_i18n..> | 2025-12-28 19:19 | 19K | |
| rubygem-gettext_i18n..> | 2025-12-28 08:20 | 19K | |
| rubygem-gettext_i18n..> | 2025-12-30 11:14 | 19K | |
| rubygem-gettext_i18n..> | 2025-12-29 01:19 | 19K | |
| rubygem-gettext_i18n..> | 2025-12-29 21:39 | 22K | |
| rubygem-gettext_i18n..> | 2025-12-28 13:16 | 22K | |
| rubygem-gh-0.18.0_1.pkg | 2025-12-29 17:14 | 12K | |
| rubygem-gibbler-1.0...> | 2025-12-19 01:35 | 39K | |
| rubygem-gio2-4.3.4.pkg | 2025-12-18 07:55 | 37K | |
| rubygem-git-1.19.1.pkg | 2025-12-18 13:13 | 42K | |
| rubygem-git-version-..> | 2025-12-22 21:21 | 21K | |
| rubygem-gitaly-18.6...> | 2025-12-19 16:03 | 44K | |
| rubygem-gitaly-proto..> | 2025-12-20 15:06 | 16K | |
| rubygem-github-lingu..> | 2025-12-26 17:05 | 2.3M | |
| rubygem-github-marku..> | 2025-12-19 01:34 | 52K | |
| rubygem-github_api-0..> | 2025-12-27 07:27 | 133K | |
| rubygem-gitlab-4.20...> | 2025-12-18 16:56 | 63K | |
| rubygem-gitlab-chron..> | 2025-12-20 01:36 | 38K | |
| rubygem-gitlab-cloud..> | 2025-12-27 15:14 | 19K | |
| rubygem-gitlab-dange..> | 2025-12-19 13:16 | 133K | |
| rubygem-gitlab-derai..> | 2025-12-22 04:57 | 98K | |
| rubygem-gitlab-exper..> | 2025-12-27 10:09 | 30K | |
| rubygem-gitlab-flowd..> | 2025-12-22 14:48 | 8.1K | |
| rubygem-gitlab-fog-a..> | 2025-12-27 15:35 | 107K | |
| rubygem-gitlab-glfm-..> | 2025-12-27 03:02 | 901K | |
| rubygem-gitlab-gollu..> | 2025-12-20 22:07 | 8.2K | |
| rubygem-gitlab-grit-..> | 2025-12-19 10:33 | 40K | |
| rubygem-gitlab-kas-g..> | 2025-12-27 16:42 | 8.1K | |
| rubygem-gitlab-labki..> | 2025-12-27 17:39 | 44K | |
| rubygem-gitlab-licen..> | 2025-12-19 13:27 | 9.2K | |
| rubygem-gitlab-mail_..> | 2025-12-27 19:43 | 37K | |
| rubygem-gitlab-marku..> | 2025-12-19 11:51 | 35K | |
| rubygem-gitlab-net-d..> | 2025-12-20 00:33 | 52K | |
| rubygem-gitlab-pygme..> | 2025-12-22 09:31 | 1.1M | |
| rubygem-gitlab-sdk-0..> | 2025-12-27 05:34 | 5.0K | |
| rubygem-gitlab-secre..> | 2025-12-27 15:39 | 46K | |
| rubygem-gitlab-secur..> | 2025-12-27 03:14 | 29K | |
| rubygem-gitlab-turbo..> | 2025-12-30 02:40 | 18K | |
| rubygem-gitlab_chron..> | 2025-12-19 13:01 | 8.7K | |
| rubygem-gitlab_emoji..> | 2025-12-27 20:32 | 4.1K | |
| rubygem-gitlab_git-1..> | 2025-12-29 12:15 | 23K | |
| rubygem-gitlab_meta-..> | 2025-12-21 16:03 | 1.8K | |
| rubygem-gitlab_omnia..> | 2025-12-22 10:37 | 12K | |
| rubygem-gitlab_omnia..> | 2025-12-19 15:38 | 12K | |
| rubygem-glib2-4.3.4.pkg | 2025-12-18 03:24 | 165K | |
| rubygem-globalid-0.4..> | 2025-12-26 17:29 | 9.6K | |
| rubygem-globalid-rai..> | 2025-12-26 11:02 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 17:30 | 10K | |
| rubygem-globalid-rai..> | 2025-12-26 16:33 | 10K | |
| rubygem-globalid-rai..> | 2025-12-26 15:45 | 10K | |
| rubygem-globalid-rai..> | 2025-12-26 13:21 | 10K | |
| rubygem-globalid-rai..> | 2025-12-26 14:40 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 13:54 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 14:40 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 14:01 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 17:01 | 12K | |
| rubygem-globalid-rai..> | 2025-12-26 09:53 | 12K | |
| rubygem-gnome-4.3.4.pkg | 2025-12-28 11:29 | 778 | |
| rubygem-gobject-intr..> | 2025-12-18 04:35 | 70K | |
| rubygem-god-0.13.7.pkg | 2025-12-21 02:05 | 83K | |
| rubygem-goldfinger-2..> | 2025-12-20 08:36 | 5.1K | |
| rubygem-gollum-6.1.0..> | 2025-12-30 00:13 | 3.8M | |
| rubygem-gollum-grit_..> | 2025-12-21 16:03 | 4.4K | |
| rubygem-gollum-lib-6..> | 2025-12-27 02:52 | 46K | |
| rubygem-gollum-rugge..> | 2025-12-18 19:23 | 10K | |
| rubygem-gon-rails-gi..> | 2025-12-27 17:07 | 14K | |
| rubygem-gon-rails5-6..> | 2025-12-27 21:13 | 143K | |
| rubygem-gon-rails50-..> | 2025-12-30 01:43 | 143K | |
| rubygem-google-api-c..> | 2025-12-27 18:18 | 2.9M | |
| rubygem-google-apis-..> | 2025-12-27 11:42 | 56K | |
| rubygem-google-apis-..> | 2025-12-29 05:43 | 75K | |
| rubygem-google-apis-..> | 2025-12-20 00:38 | 72K | |
| rubygem-google-apis-..> | 2025-12-28 10:05 | 100K | |
| rubygem-google-apis-..> | 2025-12-19 10:55 | 21K | |
| rubygem-google-apis-..> | 2025-12-27 16:18 | 37K | |
| rubygem-google-apis-..> | 2025-12-27 06:27 | 30K | |
| rubygem-google-apis-..> | 2025-12-19 05:55 | 30K | |
| rubygem-google-apis-..> | 2025-12-30 01:59 | 21K | |
| rubygem-google-apis-..> | 2025-12-28 02:16 | 33K | |
| rubygem-google-apis-..> | 2025-12-26 15:37 | 288K | |
| rubygem-google-apis-..> | 2025-12-18 20:37 | 269K | |
| rubygem-google-apis-..> | 2025-12-20 04:22 | 70K | |
| rubygem-google-apis-..> | 2025-12-19 09:53 | 75K | |
| rubygem-google-apis-..> | 2025-12-26 14:07 | 31K | |
| rubygem-google-apis-..> | 2025-12-18 16:38 | 31K | |
| rubygem-google-apis-..> | 2025-12-26 18:37 | 16K | |
| rubygem-google-apis-..> | 2025-12-26 15:33 | 30K | |
| rubygem-google-apis-..> | 2025-12-18 21:02 | 30K | |
| rubygem-google-apis-..> | 2025-12-29 19:30 | 46K | |
| rubygem-google-apis-..> | 2025-12-26 22:52 | 23K | |
| rubygem-google-apis-..> | 2025-12-27 11:27 | 48K | |
| rubygem-google-apis-..> | 2025-12-19 11:37 | 47K | |
| rubygem-google-apis-..> | 2025-12-29 13:36 | 17K | |
| rubygem-google-apis-..> | 2025-12-29 22:24 | 17K | |
| rubygem-google-apis-..> | 2025-12-26 15:38 | 13K | |
| rubygem-google-apis-..> | 2025-12-18 19:34 | 13K | |
| rubygem-google-apis-..> | 2025-12-26 15:29 | 61K | |
| rubygem-google-apis-..> | 2025-12-19 02:38 | 59K | |
| rubygem-google-apis-..> | 2025-12-27 21:04 | 10K | |
| rubygem-google-apis-..> | 2025-12-26 14:55 | 34K | |
| rubygem-google-apis-..> | 2025-12-19 02:24 | 32K | |
| rubygem-google-apis-..> | 2025-12-19 13:27 | 44K | |
| rubygem-google-apis-..> | 2025-12-28 01:28 | 67K | |
| rubygem-google-apis-..> | 2025-12-26 16:27 | 57K | |
| rubygem-google-apis-..> | 2025-12-18 19:11 | 36K | |
| rubygem-google-apis-..> | 2025-12-26 17:00 | 39K | |
| rubygem-google-apis-..> | 2025-12-19 02:39 | 39K | |
| rubygem-google-cloud..> | 2025-12-19 03:28 | 68K | |
| rubygem-google-cloud..> | 2025-12-30 08:12 | 83K | |
| rubygem-google-cloud..> | 2025-12-30 02:59 | 71K | |
| rubygem-google-cloud..> | 2025-12-27 16:40 | 88K | |
| rubygem-google-cloud..> | 2025-12-27 18:50 | 62K | |
| rubygem-google-cloud..> | 2025-12-18 21:05 | 5.3K | |
| rubygem-google-cloud..> | 2025-12-20 00:31 | 442K | |
| rubygem-google-cloud..> | 2025-12-27 00:54 | 17K | |
| rubygem-google-cloud..> | 2025-12-19 00:12 | 16K | |
| rubygem-google-cloud..> | 2025-12-28 15:26 | 44K | |
| rubygem-google-cloud..> | 2025-12-27 09:11 | 52K | |
| rubygem-google-cloud..> | 2025-12-29 18:07 | 27K | |
| rubygem-google-cloud..> | 2025-12-26 10:54 | 28K | |
| rubygem-google-cloud..> | 2025-12-18 11:22 | 28K | |
| rubygem-google-cloud..> | 2025-12-18 18:04 | 11K | |
| rubygem-google-cloud..> | 2025-12-29 02:34 | 63K | |
| rubygem-google-cloud..> | 2025-12-27 14:44 | 66K | |
| rubygem-google-cloud..> | 2025-12-26 22:23 | 26K | |
| rubygem-google-cloud..> | 2025-12-19 02:03 | 25K | |
| rubygem-google-cloud..> | 2025-12-29 19:47 | 46K | |
| rubygem-google-cloud..> | 2025-12-27 16:14 | 75K | |
| rubygem-google-cloud..> | 2025-12-29 01:32 | 17K | |
| rubygem-google-cloud..> | 2025-12-27 13:18 | 54K | |
| rubygem-google-cloud..> | 2025-12-27 18:39 | 34K | |
| rubygem-google-cloud..> | 2025-12-27 18:23 | 107K | |
| rubygem-google-cloud..> | 2025-12-19 05:30 | 33K | |
| rubygem-google-cloud..> | 2025-12-28 04:58 | 68K | |
| rubygem-google-cloud..> | 2025-12-27 08:33 | 64K | |
| rubygem-google-cloud..> | 2025-12-29 12:28 | 24K | |
| rubygem-google-cloud..> | 2025-12-30 17:24 | 87K | |
| rubygem-google-cloud..> | 2025-12-27 11:16 | 73K | |
| rubygem-google-cloud..> | 2025-12-27 17:57 | 67K | |
| rubygem-google-cloud..> | 2025-12-27 03:32 | 71K | |
| rubygem-google-cloud..> | 2025-12-28 13:10 | 75K | |
| rubygem-google-cloud..> | 2025-12-19 03:03 | 75K | |
| rubygem-google-cloud..> | 2025-12-30 11:08 | 11K | |
| rubygem-google-cloud..> | 2025-12-20 04:19 | 10K | |
| rubygem-google-cloud..> | 2025-12-27 02:08 | 63K | |
| rubygem-google-cloud..> | 2025-12-18 23:23 | 60K | |
| rubygem-google-cloud..> | 2025-12-29 22:22 | 10K | |
| rubygem-google-cloud..> | 2025-12-28 05:07 | 38K | |
| rubygem-google-cloud..> | 2025-12-27 11:47 | 33K | |
| rubygem-google-cloud..> | 2025-12-27 17:05 | 37K | |
| rubygem-google-cloud..> | 2025-12-29 19:14 | 15K | |
| rubygem-google-cloud..> | 2025-12-27 09:08 | 15K | |
| rubygem-google-cloud..> | 2025-12-27 11:13 | 73K | |
| rubygem-google-iam-c..> | 2025-12-28 06:26 | 11K | |
| rubygem-google-iam-c..> | 2025-12-27 19:43 | 31K | |
| rubygem-google-iam-v..> | 2025-12-26 21:16 | 33K | |
| rubygem-google-loggi..> | 2025-12-18 06:16 | 11K | |
| rubygem-google-proto..> | 2025-12-18 06:02 | 161K | |
| rubygem-google-proto..> | 2025-12-18 23:27 | 142K | |
| rubygem-googleapis-c..> | 2025-12-18 13:49 | 3.5K | |
| rubygem-googleapis-c..> | 2025-12-18 13:38 | 3.5K | |
| rubygem-googleapis-c..> | 2025-12-18 07:54 | 82K | |
| rubygem-googleapis-c..> | 2025-12-18 19:30 | 83K | |
| rubygem-googleauth-1..> | 2025-12-26 11:53 | 58K | |
| rubygem-googleauth-g..> | 2025-12-18 13:33 | 50K | |
| rubygem-gpgme-2.0.25..> | 2025-12-19 12:55 | 64K | |
| rubygem-gpgr-0.1.0.pkg | 2025-12-21 03:29 | 8.1K | |
| rubygem-graf-0.0.5.pkg | 2025-12-20 17:34 | 4.4K | |
| rubygem-grape-3.0.1.pkg | 2025-12-27 10:18 | 131K | |
| rubygem-grape-entity..> | 2025-12-26 21:48 | 40K | |
| rubygem-grape-path-h..> | 2025-12-27 17:04 | 14K | |
| rubygem-grape-route-..> | 2025-12-28 11:01 | 11K | |
| rubygem-grape-swagge..> | 2025-12-27 22:08 | 43K | |
| rubygem-grape-swagge..> | 2025-12-27 19:28 | 10K | |
| rubygem-grape-swagge..> | 2025-12-26 21:08 | 43K | |
| rubygem-grape20-2.0...> | 2025-12-26 19:01 | 124K | |
| rubygem-grape_loggin..> | 2025-12-30 00:15 | 16K | |
| rubygem-grape_loggin..> | 2025-12-27 10:32 | 10K | |
| rubygem-graphene1-4...> | 2025-12-18 11:38 | 12K | |
| rubygem-graphiql-rai..> | 2025-12-27 21:23 | 826K | |
| rubygem-graphlient-0..> | 2025-12-30 00:44 | 138K | |
| rubygem-graphql-2.5...> | 2025-12-18 22:58 | 316K | |
| rubygem-graphql-clie..> | 2025-12-27 13:13 | 24K | |
| rubygem-graphql-docs..> | 2025-12-29 12:09 | 1.1M | |
| rubygem-grpc-1.76.0_..> | 2025-12-18 11:08 | 147K | |
| rubygem-grpc-gitlab-..> | 2025-12-18 10:22 | 147K | |
| rubygem-grpc-google-..> | 2025-12-18 16:32 | 10K | |
| rubygem-grpc-google-..> | 2025-12-18 20:42 | 10K | |
| rubygem-grpc-tools-1..> | 2025-12-19 13:12 | 9.8M | |
| rubygem-grpc_reflect..> | 2025-12-18 23:14 | 10K | |
| rubygem-gruff-0.29.0..> | 2025-12-27 15:58 | 189K | |
| rubygem-gsk4-4.3.4.pkg | 2025-12-26 20:17 | 12K | |
| rubygem-gssapi-1.3.1..> | 2025-12-18 07:59 | 15K | |
| rubygem-gstreamer-4...> | 2025-12-26 22:53 | 29K | |
| rubygem-gtk2-3.4.3_2..> | 2025-12-27 17:00 | 551K | |
| rubygem-gtk3-4.3.4.pkg | 2025-12-26 21:43 | 784K | |
| rubygem-gtk4-4.3.4.pkg | 2025-12-26 22:54 | 87K | |
| rubygem-gtksourcevie..> | 2025-12-27 13:07 | 14K | |
| rubygem-gtksourcevie..> | 2025-12-27 18:32 | 14K | |
| rubygem-guard-2.19.1..> | 2025-12-27 03:39 | 55K | |
| rubygem-guard-compat..> | 2025-12-19 21:17 | 8.5K | |
| rubygem-guard-cucumb..> | 2025-12-29 18:07 | 9.9K | |
| rubygem-guard-livere..> | 2025-12-27 19:46 | 20K | |
| rubygem-guard-minite..> | 2025-12-30 07:08 | 9.0K | |
| rubygem-guard-rspec-..> | 2025-12-30 06:22 | 26K | |
| rubygem-guess_html_e..> | 2025-12-19 12:14 | 23K | |
| rubygem-gyoku-1.4.0.pkg | 2025-12-18 11:46 | 16K | |
| rubygem-hackpad-cli-..> | 2025-12-20 20:48 | 16K | |
| rubygem-haiti-hash-3..> | 2025-12-22 19:57 | 134K | |
| rubygem-haml-7.1.0.pkg | 2025-12-27 19:42 | 65K | |
| rubygem-haml-coderay..> | 2025-12-29 13:42 | 2.8K | |
| rubygem-haml-contrib..> | 2025-12-30 03:53 | 3.6K | |
| rubygem-haml-rails-r..> | 2025-12-29 21:54 | 11K | |
| rubygem-haml5-5.2.2.pkg | 2025-12-18 18:57 | 78K | |
| rubygem-hamlit-4.0.0..> | 2025-12-20 00:19 | 62K | |
| rubygem-hamlit-gitla..> | 2025-12-20 02:39 | 62K | |
| rubygem-hamlit-rails..> | 2025-12-28 18:18 | 8.6K | |
| rubygem-hamlit-rails..> | 2025-12-29 21:22 | 8.6K | |
| rubygem-hamlit-rails..> | 2025-12-30 10:57 | 8.6K | |
| rubygem-hammer_cli-3..> | 2025-12-26 20:22 | 191K | |
| rubygem-hammer_cli_f..> | 2025-12-27 03:13 | 318K | |
| rubygem-hammer_cli_f..> | 2025-12-30 15:28 | 14K | |
| rubygem-hammer_cli_f..> | 2025-12-29 23:20 | 3.7K | |
| rubygem-hammer_cli_f..> | 2025-12-29 15:29 | 4.0K | |
| rubygem-hamster-3.0...> | 2025-12-26 14:15 | 104K | |
| rubygem-hana-1.3.7.pkg | 2025-12-18 16:28 | 10K | |
| rubygem-hangouts-cha..> | 2025-12-20 16:49 | 5.6K | |
| rubygem-hashdiff-1.2..> | 2025-12-18 11:09 | 14K | |
| rubygem-hashery-2.1...> | 2025-12-18 04:38 | 37K | |
| rubygem-hashicorp-ch..> | 2025-12-19 06:40 | 35K | |
| rubygem-hashie-5.0.0..> | 2025-12-18 07:04 | 45K | |
| rubygem-hashie-forbi..> | 2025-12-21 01:58 | 12K | |
| rubygem-haversine_di..> | 2025-12-20 05:53 | 3.5K | |
| rubygem-health_check..> | 2025-12-29 20:00 | 30K | |
| rubygem-health_check..> | 2025-12-27 02:29 | 30K | |
| rubygem-health_check..> | 2025-12-30 17:14 | 30K | |
| rubygem-heapy-0.2.0.pkg | 2025-12-19 22:28 | 9.7K | |
| rubygem-her-1.1.1_1.pkg | 2025-12-30 14:29 | 48K | |
| rubygem-heredoc_unin..> | 2025-12-19 22:38 | 6.9K | |
| rubygem-heroics-0.1...> | 2025-12-19 23:33 | 17K | |
| rubygem-heroku-api-0..> | 2025-12-23 20:32 | 36K | |
| rubygem-heroku-nav-0..> | 2025-12-21 21:29 | 9.8K | |
| rubygem-hiera-3.12.0..> | 2025-12-19 22:27 | 36K | |
| rubygem-hiera-eyaml-..> | 2025-12-19 10:36 | 37K | |
| rubygem-hiera-file-1..> | 2025-12-23 00:13 | 2.7K | |
| rubygem-hieracles-0...> | 2025-12-22 12:22 | 42K | |
| rubygem-highline-3.1..> | 2025-12-26 19:08 | 204K | |
| rubygem-highline1-1...> | 2025-12-18 21:38 | 207K | |
| rubygem-highline2-2...> | 2025-12-19 02:14 | 201K | |
| rubygem-hike-2.1.3,1..> | 2025-12-21 09:23 | 6.5K | |
| rubygem-hike1-1.2.3,..> | 2025-12-18 23:37 | 6.5K | |
| rubygem-hikidoc-0.1...> | 2025-12-18 19:27 | 23K | |
| rubygem-hipchat-1.6...> | 2025-12-19 07:39 | 23K | |
| rubygem-hiredis-0.6...> | 2025-12-19 04:54 | 155K | |
| rubygem-histogram-0...> | 2025-12-18 23:08 | 13K | |
| rubygem-hitimes-3.1...> | 2025-12-20 00:01 | 15K | |
| rubygem-hkdf-1.0.0.pkg | 2025-12-20 11:19 | 6.4K | |
| rubygem-hkdf0-0.3.0.pkg | 2025-12-19 17:01 | 5.7K | |
| rubygem-hocon-1.4.0.pkg | 2025-12-18 12:41 | 90K | |
| rubygem-hoe-4.3.0.pkg | 2025-12-19 15:36 | 174K | |
| rubygem-holidays-8.8..> | 2025-12-23 07:35 | 109K | |
| rubygem-hpricot-0.8...> | 2025-12-16 02:17 | 250K | |
| rubygem-hrr_rb_ssh-0..> | 2025-12-18 21:12 | 54K | |
| rubygem-hrr_rb_ssh-e..> | 2025-12-19 12:11 | 11K | |
| rubygem-html-pipelin..> | 2025-12-27 00:37 | 31K | |
| rubygem-html-pipelin..> | 2025-12-27 02:00 | 31K | |
| rubygem-html-proofer..> | 2025-12-29 04:15 | 21K | |
| rubygem-html2haml-2...> | 2025-12-19 16:45 | 18K | |
| rubygem-html2text-0...> | 2025-12-20 01:06 | 5.6K | |
| rubygem-htmlentities..> | 2025-12-18 18:09 | 25K | |
| rubygem-http-5.3.1.pkg | 2025-12-18 19:50 | 80K | |
| rubygem-http-accept-..> | 2025-12-18 08:12 | 9.6K | |
| rubygem-http-cookie-..> | 2025-12-18 07:03 | 22K | |
| rubygem-http-form_da..> | 2025-12-18 15:50 | 15K | |
| rubygem-http-parser-..> | 2025-12-18 17:22 | 22K | |
| rubygem-http3-3.3.0_..> | 2025-12-19 23:07 | 62K | |
| rubygem-http4-4.4.1.pkg | 2025-12-18 23:45 | 66K | |
| rubygem-http_accept_..> | 2025-12-19 11:03 | 8.1K | |
| rubygem-http_parser...> | 2025-12-18 12:33 | 31K | |
| rubygem-http_router-..> | 2025-12-18 22:32 | 147K | |
| rubygem-httparty-0.2..> | 2025-12-18 21:44 | 43K | |
| rubygem-httparty-git..> | 2025-12-18 12:50 | 43K | |
| rubygem-httparty021-..> | 2025-12-22 08:25 | 42K | |
| rubygem-httpauth-0.2..> | 2025-12-21 13:35 | 11K | |
| rubygem-httpclient-2..> | 2025-12-18 07:11 | 240K | |
| rubygem-httpi-4.0.4.pkg | 2025-12-19 23:18 | 21K | |
| rubygem-httplog-1.7...> | 2025-12-23 13:36 | 13K | |
| rubygem-hurley-0.2.pkg | 2025-12-22 05:03 | 28K | |
| rubygem-i18n-1.14.7,..> | 2025-12-26 06:39 | 40K | |
| rubygem-i18n_data-0...> | 2025-12-18 23:24 | 223K | |
| rubygem-icalendar-2...> | 2025-12-20 15:02 | 43K | |
| rubygem-icalendar-gi..> | 2025-12-19 12:38 | 40K | |
| rubygem-ice_cube-0.1..> | 2025-12-19 00:46 | 29K | |
| rubygem-ice_nine-0.1..> | 2025-12-18 11:58 | 17K | |
| rubygem-iconv-1.1.1.pkg | 2025-12-22 07:22 | 17K | |
| rubygem-idn-ruby-0.1..> | 2025-12-18 17:45 | 16K | |
| rubygem-iesd-1.2.2.pkg | 2025-12-22 17:12 | 10K | |
| rubygem-image_proces..> | 2025-12-26 15:31 | 14K | |
| rubygem-image_scienc..> | 2025-12-24 04:58 | 14K | |
| rubygem-imagen-0.2.0..> | 2025-12-19 17:24 | 7.7K | |
| rubygem-imagesize-0...> | 2025-12-20 04:42 | 74K | |
| rubygem-importmap-ra..> | 2025-12-26 15:03 | 17K | |
| rubygem-importmap-ra..> | 2025-12-26 23:54 | 17K | |
| rubygem-importmap-ra..> | 2025-12-27 01:06 | 17K | |
| rubygem-importmap-ra..> | 2025-12-27 00:18 | 17K | |
| rubygem-importmap-ra..> | 2025-12-27 14:12 | 17K | |
| rubygem-inflecto-0.0..> | 2025-12-19 11:44 | 15K | |
| rubygem-influxdb-0.8..> | 2025-12-21 12:07 | 39K | |
| rubygem-ini-0.1.1.pkg | 2025-12-23 04:55 | 7.0K | |
| rubygem-inifile-3.0...> | 2025-12-20 00:24 | 14K | |
| rubygem-iniparse-1.5..> | 2025-12-19 01:59 | 12K | |
| rubygem-innate-2015...> | 2025-12-19 03:27 | 94K | |
| rubygem-insist-1.0.0..> | 2025-12-18 19:21 | 8.3K | |
| rubygem-inspec-core-..> | 2025-12-26 21:02 | 363K | |
| rubygem-instance_sto..> | 2025-12-19 00:28 | 4.2K | |
| rubygem-interact-0.5..> | 2025-12-22 13:05 | 8.6K | |
| rubygem-interfacez-1..> | 2025-12-19 12:02 | 6.6K | |
| rubygem-invisible_ca..> | 2025-12-27 02:57 | 23K | |
| rubygem-io-console-0..> | 2025-12-26 08:40 | 13K | |
| rubygem-io-endpoint-..> | 2025-12-18 11:38 | 14K | |
| rubygem-io-event-1.1..> | 2025-12-18 08:34 | 26K | |
| rubygem-io-like-0.3...> | 2025-12-18 13:23 | 367K | |
| rubygem-io-nonblock-..> | 2025-12-23 12:10 | 5.1K | |
| rubygem-io-stream-0...> | 2025-12-18 14:16 | 12K | |
| rubygem-io-wait-0.3...> | 2025-12-21 09:38 | 5.4K | |
| rubygem-io-wait01-0...> | 2025-12-22 17:55 | 3.8K | |
| rubygem-iobuffer-1.1..> | 2025-12-18 12:10 | 7.4K | |
| rubygem-iostruct-0.5..> | 2025-12-19 01:46 | 6.4K | |
| rubygem-ipaddr-1.2.7..> | 2025-12-19 01:21 | 8.2K | |
| rubygem-ipaddress-0...> | 2025-12-18 13:14 | 31K | |
| rubygem-iproto-0.3.1..> | 2025-12-19 15:17 | 6.5K | |
| rubygem-ipynbdiff-0...> | 2025-12-29 18:50 | 7.7K | |
| rubygem-irb-1.15.3.pkg | 2025-12-26 09:53 | 88K | |
| rubygem-irb-gitlab-1..> | 2025-12-26 14:05 | 88K | |
| rubygem-iso-639-0.3...> | 2025-12-23 03:52 | 14K | |
| rubygem-iso8601-0.13..> | 2025-12-23 15:01 | 21K | |
| rubygem-itamae-1.10...> | 2025-12-21 12:29 | 38K | |
| rubygem-itextomml-1...> | 2025-12-20 22:26 | 64K | |
| rubygem-jaeger-clien..> | 2025-12-18 22:05 | 31K | |
| rubygem-jammit-0.7.0..> | 2025-12-22 17:12 | 16K | |
| rubygem-jaro_winkler..> | 2025-12-22 21:04 | 10K | |
| rubygem-jasmine-core..> | 2025-12-21 03:44 | 75K | |
| rubygem-jbuilder-2.9..> | 2025-12-27 00:19 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-27 00:23 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-27 01:12 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-26 21:51 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-27 00:34 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-27 00:56 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-26 23:42 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-26 22:48 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-27 12:00 | 24K | |
| rubygem-jbuilder-rai..> | 2025-12-26 15:07 | 24K | |
| rubygem-jdbc-mysql-5..> | 2025-12-27 19:24 | 930K | |
| rubygem-jekyll-4.4.1..> | 2025-12-27 01:16 | 110K | |
| rubygem-jekyll-archi..> | 2025-12-28 21:01 | 3.4K | |
| rubygem-jekyll-asset..> | 2025-12-30 09:50 | 31K | |
| rubygem-jekyll-coffe..> | 2025-12-29 10:54 | 1.6K | |
| rubygem-jekyll-email..> | 2025-12-30 02:43 | 3.7K | |
| rubygem-jekyll-feed-..> | 2025-12-27 09:45 | 10K | |
| rubygem-jekyll-gist-..> | 2025-12-21 10:15 | 9.1K | |
| rubygem-jekyll-menti..> | 2025-12-27 21:32 | 2.7K | |
| rubygem-jekyll-pagin..> | 2025-12-22 17:45 | 8.5K | |
| rubygem-jekyll-redir..> | 2025-12-30 04:15 | 15K | |
| rubygem-jekyll-sanit..> | 2025-12-27 14:55 | 2.7K | |
| rubygem-jekyll-sass-..> | 2025-12-18 17:23 | 4.9K | |
| rubygem-jekyll-sass-..> | 2025-12-18 17:36 | 2.5K | |
| rubygem-jekyll-seo-t..> | 2025-12-27 17:57 | 19K | |
| rubygem-jekyll-sitem..> | 2025-12-29 15:43 | 68K | |
| rubygem-jekyll-watch..> | 2025-12-18 17:15 | 3.0K | |
| rubygem-jekyll3-3.10..> | 2025-12-27 01:07 | 99K | |
| rubygem-jemoji-0.13...> | 2025-12-29 17:35 | 2.4K | |
| rubygem-jenkins_api_..> | 2025-12-30 18:26 | 3.1M | |
| rubygem-jeweler-2.3...> | 2025-12-28 12:35 | 53K | |
| rubygem-jira-ruby-3...> | 2025-12-27 20:19 | 64K | |
| rubygem-jira-ruby-gi..> | 2025-12-27 16:13 | 58K | |
| rubygem-jmespath-1.6..> | 2025-12-18 11:31 | 18K | |
| rubygem-journey-1.0...> | 2025-12-23 16:21 | 25K | |
| rubygem-jquery-atwho..> | 2025-12-22 14:33 | 17K | |
| rubygem-jquery-rails..> | 2025-12-26 21:49 | 293K | |
| rubygem-jquery-rails..> | 2025-12-27 01:12 | 293K | |
| rubygem-jquery-rails..> | 2025-12-26 21:59 | 293K | |
| rubygem-jquery-scrol..> | 2025-12-28 07:42 | 6.1K | |
| rubygem-jquery-turbo..> | 2025-12-29 13:43 | 8.0K | |
| rubygem-jquery-ui-ra..> | 2025-12-28 05:05 | 157K | |
| rubygem-jquery-ui-th..> | 2025-12-23 05:21 | 304K | |
| rubygem-jruby-jars-9..> | 2025-12-27 06:05 | 25M | |
| rubygem-jruby-rack-1..> | 2025-12-27 11:30 | 256K | |
| rubygem-js_regex-3.1..> | 2025-12-20 00:00 | 14K | |
| rubygem-jsbundling-r..> | 2025-12-26 16:40 | 8.5K | |
| rubygem-jsbundling-r..> | 2025-12-26 21:46 | 8.5K | |
| rubygem-jsbundling-r..> | 2025-12-26 21:20 | 8.5K | |
| rubygem-jsbundling-r..> | 2025-12-26 20:27 | 8.5K | |
| rubygem-jsbundling-r..> | 2025-12-27 10:15 | 8.5K | |
| rubygem-jsmin-1.0.1_..> | 2025-12-20 00:39 | 3.2K | |
| rubygem-jsobfu-0.4.2..> | 2025-12-19 01:49 | 21K | |
| rubygem-json-2.18.0.pkg | 2025-12-26 06:32 | 78K | |
| rubygem-json-canonic..> | 2025-12-18 19:59 | 7.5K | |
| rubygem-json-gitlab-..> | 2025-12-18 06:27 | 64K | |
| rubygem-json-jwt-1.1..> | 2025-12-27 16:52 | 11K | |
| rubygem-json-jwt-git..> | 2025-12-26 17:30 | 11K | |
| rubygem-json-ld-3.3...> | 2025-12-27 03:26 | 76K | |
| rubygem-json-ld-prel..> | 2025-12-28 11:07 | 106K | |
| rubygem-json-schema-..> | 2025-12-19 12:56 | 29K | |
| rubygem-json-schema-..> | 2025-12-18 20:19 | 29K | |
| rubygem-json1-1.8.6.pkg | 2025-12-18 23:18 | 112K | |
| rubygem-json_pure-2...> | 2025-12-18 02:23 | 15K | |
| rubygem-json_pure1-1..> | 2025-12-19 02:35 | 90K | |
| rubygem-json_schema-..> | 2025-12-18 11:08 | 31K | |
| rubygem-json_schemer..> | 2025-12-19 00:08 | 44K | |
| rubygem-jsonapi-rend..> | 2025-12-19 14:54 | 5.6K | |
| rubygem-jsonb_access..> | 2025-12-27 13:16 | 16K | |
| rubygem-jsonpath-1.1..> | 2025-12-19 02:37 | 20K | |
| rubygem-jwt-3.1.2.pkg | 2025-12-18 04:21 | 46K | |
| rubygem-jwt2-2.10.2.pkg | 2025-12-18 08:33 | 47K | |
| rubygem-kafo-7.6.1.pkg | 2025-12-30 04:14 | 202K | |
| rubygem-kafo_parsers..> | 2025-12-27 05:35 | 7.2K | |
| rubygem-kafo_wizards..> | 2025-12-19 10:12 | 7.7K | |
| rubygem-kamal-2.10.0..> | 2025-12-26 17:00 | 68K | |
| rubygem-kamal-rails8..> | 2025-12-30 18:52 | 67K | |
| rubygem-kaminari-1.2..> | 2025-12-30 06:31 | 20K | |
| rubygem-kaminari-act..> | 2025-12-27 17:12 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-26 21:52 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 16:22 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 17:40 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 09:19 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 18:03 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 17:50 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 17:45 | 3.1K | |
| rubygem-kaminari-act..> | 2025-12-27 14:12 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-26 22:50 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 10:59 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 16:53 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 10:43 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 16:11 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 19:22 | 5.0K | |
| rubygem-kaminari-act..> | 2025-12-27 10:00 | 5.0K | |
| rubygem-kaminari-cor..> | 2025-12-18 18:56 | 15K | |
| rubygem-kaminari-rai..> | 2025-12-27 11:39 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-29 04:04 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-30 08:12 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-30 02:47 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-29 10:46 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-28 02:28 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-28 04:58 | 20K | |
| rubygem-kaminari-rai..> | 2025-12-27 22:09 | 20K | |
| rubygem-kgio-2.11.4.pkg | 2025-12-18 19:29 | 50K | |
| rubygem-kramdown-2.5..> | 2025-12-18 13:13 | 123K | |
| rubygem-kramdown-git..> | 2025-12-18 11:09 | 123K | |
| rubygem-kramdown-par..> | 2025-12-18 16:06 | 9.9K | |
| rubygem-kramdown-par..> | 2025-12-18 12:38 | 9.9K | |
| rubygem-kubeclient-4..> | 2025-12-19 04:51 | 31K | |
| rubygem-kwalify-0.7...> | 2025-12-21 21:14 | 138K | |
| rubygem-language_ser..> | 2025-12-18 17:22 | 67K | |
| rubygem-launchy-3.1...> | 2025-12-18 23:18 | 14K | |
| rubygem-launchy2-2.5..> | 2025-12-19 15:30 | 26K | |
| rubygem-layout_yulli..> | 2025-12-23 12:56 | 46K | |
| rubygem-lazy_priorit..> | 2025-12-21 04:00 | 2.3K | |
| rubygem-leo_manager_..> | 2025-12-19 11:32 | 13K | |
| rubygem-less-1.2.21.pkg | 2025-12-22 07:43 | 47K | |
| rubygem-libarchive-0..> | 2025-12-22 15:49 | 26K | |
| rubygem-libdatadog-2..> | 2025-12-27 00:18 | 2.8K | |
| rubygem-libddwaf-1.3..> | 2025-12-26 21:27 | 2.2M | |
| rubygem-librarian-0...> | 2025-12-30 10:15 | 42K | |
| rubygem-librarian-pu..> | 2025-12-28 10:49 | 19K | |
| rubygem-librarianp-1..> | 2025-12-19 17:17 | 47K | |
| rubygem-librmpd-0.1...> | 2025-12-23 01:22 | 34K | |
| rubygem-libxml-ruby-..> | 2025-12-18 13:30 | 292K | |
| rubygem-libyajl2-1.2..> | 2025-12-18 12:06 | 32K | |
| rubygem-license-acce..> | 2025-12-18 18:05 | 12K | |
| rubygem-license_find..> | 2025-12-21 05:25 | 145K | |
| rubygem-license_find..> | 2025-12-19 20:31 | 156K | |
| rubygem-license_scou..> | 2025-12-27 15:30 | 1.6M | |
| rubygem-licensee-9.1..> | 2025-12-26 21:51 | 217K | |
| rubygem-licensee-git..> | 2025-12-19 11:15 | 217K | |
| rubygem-lighthouse-a..> | 2025-12-27 23:15 | 6.4K | |
| rubygem-linguistics-..> | 2025-12-22 07:58 | 97K | |
| rubygem-link_header-..> | 2025-12-18 17:50 | 5.6K | |
| rubygem-lint_roller-..> | 2025-12-18 15:52 | 6.8K | |
| rubygem-liquid-5.11...> | 2025-12-24 05:23 | 52K | |
| rubygem-liquid-tag-p..> | 2025-12-23 04:29 | 3.6K | |
| rubygem-liquid-tag-p..> | 2025-12-20 02:05 | 3.9K | |
| rubygem-liquid4-4.0...> | 2025-12-18 18:10 | 66K | |
| rubygem-listen-3.9.0..> | 2025-12-18 12:12 | 28K | |
| rubygem-lita-4.8.0_1..> | 2025-12-27 17:13 | 57K | |
| rubygem-lita-gems-1...> | 2025-12-30 06:29 | 4.0K | |
| rubygem-lita-irc-2.2..> | 2025-12-30 01:42 | 7.4K | |
| rubygem-little-plugg..> | 2025-12-18 05:27 | 7.0K | |
| rubygem-llhttp-0.6.1..> | 2025-12-22 08:47 | 29K | |
| rubygem-llhttp-ffi-0..> | 2025-12-18 18:37 | 28K | |
| rubygem-local_time-3..> | 2025-12-24 03:34 | 640K | |
| rubygem-local_time-r..> | 2025-12-30 06:40 | 640K | |
| rubygem-locale-2.1.4..> | 2025-12-18 11:41 | 95K | |
| rubygem-lockbox-1.4...> | 2025-12-19 08:34 | 26K | |
| rubygem-lockfile-2.1..> | 2025-12-21 09:44 | 18K | |
| rubygem-log4r-1.1.10..> | 2025-12-18 20:02 | 107K | |
| rubygem-loggability-..> | 2025-12-19 13:06 | 32K | |
| rubygem-logger-1.7.0..> | 2025-12-18 01:46 | 13K | |
| rubygem-logger-gitla..> | 2025-12-18 02:48 | 13K | |
| rubygem-logger15-1.5..> | 2025-12-19 23:40 | 9.8K | |
| rubygem-logging-2.4...> | 2025-12-18 07:31 | 76K | |
| rubygem-logging-gitl..> | 2025-12-18 13:10 | 75K | |
| rubygem-logify-0.2.0..> | 2025-12-23 15:38 | 11K | |
| rubygem-lograge-0.14..> | 2025-12-29 18:45 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-27 13:00 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-30 16:30 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-30 09:32 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-28 10:53 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-30 08:29 | 9.0K | |
| rubygem-lograge-rail..> | 2025-12-30 17:21 | 9.0K | |
| rubygem-logster-1.2...> | 2025-12-24 05:53 | 1.0M | |
| rubygem-lolcat-100.0..> | 2025-12-21 10:58 | 114K | |
| rubygem-loofah-2.25...> | 2025-12-26 06:48 | 29K | |
| rubygem-loofah-gitla..> | 2025-12-27 10:21 | 29K | |
| rubygem-loofah222-2...> | 2025-12-22 15:05 | 27K | |
| rubygem-loquacious-1..> | 2025-12-20 02:49 | 19K | |
| rubygem-lrama-0.6.11..> | 2025-12-21 07:29 | 86K | |
| rubygem-lru_redux-1...> | 2025-12-20 00:56 | 9.2K | |
| rubygem-ltsv-0.1.0.pkg | 2025-12-18 20:26 | 5.8K | |
| rubygem-lumberjack-1..> | 2025-12-18 19:14 | 27K | |
| rubygem-macaddr-1.7...> | 2025-12-18 23:37 | 8.4K | |
| rubygem-mail-2.8.1,2..> | 2025-12-26 13:39 | 280K | |
| rubygem-mail-gitlab-..> | 2025-12-27 17:44 | 280K | |
| rubygem-mail_room-0...> | 2025-12-28 00:49 | 34K | |
| rubygem-mailboxer-0...> | 2025-12-29 07:15 | 37K | |
| rubygem-mailfactory-..> | 2025-12-23 17:25 | 7.0K | |
| rubygem-main-6.4.0.pkg | 2025-12-19 17:01 | 36K | |
| rubygem-manpages-0.6..> | 2025-12-19 12:10 | 12K | |
| rubygem-map-6.6.0.pkg | 2025-12-19 00:28 | 19K | |
| rubygem-marcel-1.1.0..> | 2025-12-18 07:53 | 41K | |
| rubygem-marcel-gitla..> | 2025-12-18 11:19 | 38K | |
| rubygem-marginalia-1..> | 2025-12-27 12:28 | 11K | |
| rubygem-mario-redis-..> | 2025-12-23 21:01 | 11K | |
| rubygem-markaby-0.9...> | 2025-12-21 11:26 | 22K | |
| rubygem-maruku-0.7.3..> | 2025-12-21 16:52 | 123K | |
| rubygem-mathn-0.2.0.pkg | 2025-12-21 11:33 | 6.1K | |
| rubygem-matrix-0.4.3..> | 2025-12-18 03:18 | 22K | |
| rubygem-maxmind-db-1..> | 2025-12-21 11:57 | 152K | |
| rubygem-mdl-0.11.0_2..> | 2025-12-28 04:41 | 14K | |
| rubygem-mdless-2.1.6..> | 2025-12-20 17:26 | 40K | |
| rubygem-mechanize-2...> | 2025-12-19 03:30 | 124K | |
| rubygem-memcache-1.5..> | 2025-12-23 19:19 | 28K | |
| rubygem-memcache-cli..> | 2025-12-22 12:27 | 27K | |
| rubygem-memo_wise-1...> | 2025-12-18 11:27 | 157K | |
| rubygem-memoist-0.16..> | 2025-12-19 14:42 | 10K | |
| rubygem-memoist3-1.0..> | 2025-12-18 18:36 | 11K | |
| rubygem-memoizable-0..> | 2025-12-19 01:35 | 10K | |
| rubygem-memoize-1.3...> | 2025-12-20 17:44 | 5.2K | |
| rubygem-memory_profi..> | 2025-12-19 20:19 | 13K | |
| rubygem-merb-assets-..> | 2025-12-23 16:00 | 28K | |
| rubygem-merb-core-1...> | 2025-12-19 14:41 | 1.0M | |
| rubygem-merb-haml-1...> | 2025-12-29 23:57 | 7.7K | |
| rubygem-merb-helpers..> | 2025-12-23 20:46 | 62K | |
| rubygem-merb-param-p..> | 2025-12-23 01:22 | 6.2K | |
| rubygem-mercenary-0...> | 2025-12-18 18:43 | 15K | |
| rubygem-message_bus-..> | 2025-12-21 02:55 | 156K | |
| rubygem-metaclass-0...> | 2025-12-20 10:37 | 3.3K | |
| rubygem-metaid-1.0.pkg | 2025-12-23 08:42 | 1.3K | |
| rubygem-metasm-1.0.5..> | 2025-12-18 14:50 | 627K | |
| rubygem-metasploit-c..> | 2025-12-26 20:20 | 11K | |
| rubygem-metasploit-c..> | 2025-12-27 15:51 | 97K | |
| rubygem-metasploit-m..> | 2025-12-26 18:53 | 69K | |
| rubygem-metasploit-p..> | 2025-12-19 21:39 | 46M | |
| rubygem-metasploit_d..> | 2025-12-26 23:57 | 152K | |
| rubygem-metasploit_p..> | 2025-12-20 02:53 | 8.2M | |
| rubygem-method_sourc..> | 2025-12-18 10:12 | 10K | |
| rubygem-metrics-0.15..> | 2025-12-18 06:58 | 9.5K | |
| rubygem-micromachine..> | 2025-12-21 09:10 | 6.4K | |
| rubygem-microscope-1..> | 2025-12-30 04:10 | 12K | |
| rubygem-middleware-0..> | 2025-12-19 23:17 | 8.8K | |
| rubygem-mime-types-3..> | 2025-12-18 07:15 | 36K | |
| rubygem-mime-types-d..> | 2025-12-18 04:33 | 124K | |
| rubygem-mime-types-g..> | 2025-12-18 13:56 | 36K | |
| rubygem-mimemagic-0...> | 2025-12-18 23:14 | 8.0K | |
| rubygem-mini_histogr..> | 2025-12-19 20:49 | 15K | |
| rubygem-mini_magick-..> | 2025-12-26 20:45 | 17K | |
| rubygem-mini_magick4..> | 2025-12-26 13:46 | 21K | |
| rubygem-mini_mime-1...> | 2025-12-18 07:05 | 22K | |
| rubygem-mini_portile..> | 2025-12-18 01:37 | 32K | |
| rubygem-mini_portile..> | 2025-12-21 20:42 | 23K | |
| rubygem-minima-2.5.2..> | 2025-12-28 07:07 | 17K | |
| rubygem-minitar-1.1...> | 2025-12-18 18:01 | 44K | |
| rubygem-minitar-cli-..> | 2025-12-19 23:07 | 15K | |
| rubygem-minitar0-0.1..> | 2025-12-19 00:13 | 29K | |
| rubygem-minitest-5.2..> | 2025-12-26 06:40 | 82K | |
| rubygem-mixlib-archi..> | 2025-12-18 20:21 | 7.7K | |
| rubygem-mixlib-authe..> | 2025-12-19 02:36 | 12K | |
| rubygem-mixlib-cli-2..> | 2025-12-18 16:24 | 11K | |
| rubygem-mixlib-confi..> | 2025-12-18 11:20 | 11K | |
| rubygem-mixlib-insta..> | 2025-12-28 15:24 | 35K | |
| rubygem-mixlib-log-3..> | 2025-12-18 15:42 | 8.9K | |
| rubygem-mixlib-shell..> | 2025-12-26 13:25 | 23K | |
| rubygem-mixlib-versi..> | 2025-12-19 21:39 | 12K | |
| rubygem-mize-0.6.1.pkg | 2025-12-18 18:43 | 10K | |
| rubygem-mkrf-0.2.3.pkg | 2025-12-20 07:10 | 265K | |
| rubygem-mocha-3.0.0.pkg | 2025-12-27 13:05 | 63K | |
| rubygem-mogilefs-cli..> | 2025-12-20 06:05 | 70K | |
| rubygem-molinillo-0...> | 2025-12-19 01:36 | 25K | |
| rubygem-moneta-1.6.0..> | 2025-12-19 02:06 | 67K | |
| rubygem-money-6.14.1..> | 2025-12-28 08:38 | 42K | |
| rubygem-mongo-2.22.0..> | 2025-12-20 04:20 | 336K | |
| rubygem-mono_logger-..> | 2025-12-19 02:19 | 7.2K | |
| rubygem-mothra-0.0.3..> | 2025-12-23 04:10 | 5.9K | |
| rubygem-mousetrap-ra..> | 2025-12-24 06:34 | 30K | |
| rubygem-mqtt-0.6.0.pkg | 2025-12-19 12:25 | 32K | |
| rubygem-ms_rest-0.7...> | 2025-12-26 19:04 | 144K | |
| rubygem-ms_rest_azur..> | 2025-12-26 21:00 | 17K | |
| rubygem-msgpack-1.8...> | 2025-12-18 10:22 | 43K | |
| rubygem-mspec-1.9.1.pkg | 2025-12-23 19:42 | 102K | |
| rubygem-mtrc-0.0.4.pkg | 2025-12-18 16:22 | 3.9K | |
| rubygem-multi_json-1..> | 2025-12-18 03:53 | 18K | |
| rubygem-multi_json-g..> | 2025-12-18 07:35 | 18K | |
| rubygem-multi_test-1..> | 2025-12-18 23:33 | 6.4K | |
| rubygem-multi_xml-0...> | 2025-12-18 11:26 | 13K | |
| rubygem-multipart-po..> | 2025-12-18 03:52 | 9.7K | |
| rubygem-murder-0.1.2..> | 2025-12-22 09:01 | 92K | |
| rubygem-murmurhash3-..> | 2025-12-19 01:02 | 9.3K | |
| rubygem-mustache-1.1..> | 2025-12-16 02:02 | 38K | |
| rubygem-mustache-sin..> | 2025-12-19 17:05 | 7.1K | |
| rubygem-mustermann-3..> | 2025-12-18 08:38 | 43K | |
| rubygem-mustermann-g..> | 2025-12-19 01:39 | 8.1K | |
| rubygem-mustermann-g..> | 2025-12-18 12:50 | 7.5K | |
| rubygem-mutex_m-0.3...> | 2025-12-18 01:43 | 4.6K | |
| rubygem-mutter-0.5.3..> | 2025-12-19 12:28 | 8.6K | |
| rubygem-mysql2-0.5.7..> | 2025-12-19 14:02 | 74K | |
| rubygem-nakayoshi_fo..> | 2025-12-21 17:03 | 4.6K | |
| rubygem-nanoc-4.12.1..> | 2025-12-29 16:07 | 57K | |
| rubygem-nanoc-checki..> | 2025-12-26 21:29 | 8.2K | |
| rubygem-nanoc-cli-4...> | 2025-12-26 20:07 | 19K | |
| rubygem-nanoc-core-4..> | 2025-12-26 17:00 | 53K | |
| rubygem-nanoc-deploy..> | 2025-12-27 04:05 | 6.7K | |
| rubygem-nap-1.1.0.pkg | 2025-12-18 11:02 | 141K | |
| rubygem-narray-0.6.1..> | 2025-12-18 22:59 | 139K | |
| rubygem-narray_miss-..> | 2025-12-19 13:10 | 13K | |
| rubygem-native-packa..> | 2025-12-18 03:13 | 20K | |
| rubygem-nats-pure-0...> | 2025-12-19 22:43 | 15K | |
| rubygem-naught-1.1.0..> | 2025-12-19 02:19 | 17K | |
| rubygem-necromancer-..> | 2025-12-22 10:09 | 13K | |
| rubygem-needle-1.3.0..> | 2025-12-20 14:56 | 582K | |
| rubygem-neighbor-0.3..> | 2025-12-29 07:09 | 8.2K | |
| rubygem-nenv-0.3.0.pkg | 2025-12-18 14:35 | 7.0K | |
| rubygem-neovim-0.10...> | 2025-12-24 04:58 | 42K | |
| rubygem-nessus_rest-..> | 2025-12-20 00:33 | 8.8K | |
| rubygem-nested_form-..> | 2025-12-23 08:53 | 119K | |
| rubygem-nesty-1.0.2.pkg | 2025-12-20 00:09 | 6.2K | |
| rubygem-net-dns-0.9...> | 2025-12-23 10:46 | 48K | |
| rubygem-net-ftp-0.3...> | 2025-12-26 21:57 | 15K | |
| rubygem-net-http-0.8..> | 2025-12-18 02:10 | 44K | |
| rubygem-net-http-dig..> | 2025-12-19 01:00 | 7.3K | |
| rubygem-net-http-git..> | 2025-12-19 04:53 | 44K | |
| rubygem-net-http-per..> | 2025-12-18 18:40 | 23K | |
| rubygem-net-http-per..> | 2025-12-19 14:03 | 23K | |
| rubygem-net-http-pip..> | 2025-12-19 02:36 | 8.4K | |
| rubygem-net-http041-..> | 2025-12-18 03:46 | 43K | |
| rubygem-net-imap-0.5..> | 2025-12-26 11:12 | 142K | |
| rubygem-net-irc-0.0...> | 2025-12-21 16:19 | 51K | |
| rubygem-net-ldap-0.2..> | 2025-12-18 18:57 | 58K | |
| rubygem-net-ldap017-..> | 2025-12-19 22:56 | 57K | |
| rubygem-net-netrc-0...> | 2025-12-22 19:35 | 5.0K | |
| rubygem-net-ntp-2.1...> | 2025-12-19 12:52 | 4.9K | |
| rubygem-net-ping-2.0..> | 2025-12-22 11:28 | 24K | |
| rubygem-net-pop-0.1...> | 2025-12-26 11:09 | 10K | |
| rubygem-net-protocol..> | 2025-12-26 10:49 | 7.0K | |
| rubygem-net-protocol..> | 2025-12-30 12:13 | 6.8K | |
| rubygem-net-scp-4.1...> | 2025-12-18 13:07 | 24K | |
| rubygem-net-scp1-1.2..> | 2025-12-22 19:57 | 25K | |
| rubygem-net-sftp-4.0..> | 2025-12-18 13:32 | 43K | |
| rubygem-net-smtp-0.5..> | 2025-12-26 10:56 | 13K | |
| rubygem-net-ssh-7.3...> | 2025-12-18 09:51 | 119K | |
| rubygem-net-ssh-gate..> | 2025-12-18 19:36 | 7.6K | |
| rubygem-net-ssh-krb-..> | 2025-12-19 11:35 | 10K | |
| rubygem-net-ssh-mult..> | 2025-12-19 12:37 | 25K | |
| rubygem-net-ssh5-5.2..> | 2025-12-21 18:27 | 109K | |
| rubygem-net-ssh6-6.1..> | 2025-12-18 10:19 | 110K | |
| rubygem-net-telnet-0..> | 2025-12-19 02:38 | 13K | |
| rubygem-netaddr-2.0...> | 2025-12-20 15:14 | 18K | |
| rubygem-netrc-0.11.0..> | 2025-12-18 06:47 | 7.7K | |
| rubygem-network_inte..> | 2025-12-20 02:47 | 13K | |
| rubygem-newrelic-gra..> | 2025-12-29 05:45 | 12K | |
| rubygem-newrelic_rpm..> | 2025-12-19 16:01 | 269K | |
| rubygem-nexpose-7.3...> | 2025-12-19 13:11 | 102K | |
| rubygem-nice-ffi-0.4..> | 2025-12-20 07:49 | 20K | |
| rubygem-nice_partial..> | 2025-12-26 21:51 | 16K | |
| rubygem-nicovideo-0...> | 2025-12-29 23:23 | 14K | |
| rubygem-nio4r-2.7.5.pkg | 2025-12-18 10:16 | 39K | |
| rubygem-nkf-0.2.0.pkg | 2025-12-18 07:58 | 124K | |
| rubygem-nmap-parser-..> | 2025-12-20 13:15 | 17K | |
| rubygem-no_proxy_fix..> | 2025-12-23 01:35 | 6.2K | |
| rubygem-nokogiri-1.1..> | 2025-12-18 01:41 | 414K | |
| rubygem-nokogiri-dif..> | 2025-12-20 15:35 | 6.8K | |
| rubygem-nori-2.7.1.pkg | 2025-12-18 07:35 | 20K | |
| rubygem-notiffany-0...> | 2025-12-18 23:19 | 19K | |
| rubygem-notify-0.5.2..> | 2025-12-19 23:10 | 4.6K | |
| rubygem-nprogress-ra..> | 2025-12-23 05:39 | 8.7K | |
| rubygem-nsa-rails5-0..> | 2025-12-27 21:39 | 7.6K | |
| rubygem-ntlm-http-0...> | 2025-12-21 07:02 | 11K | |
| rubygem-numerizer-0...> | 2025-12-18 21:31 | 5.3K | |
| rubygem-numru-misc-0..> | 2025-12-23 07:41 | 14K | |
| rubygem-numru-units-..> | 2025-12-21 02:11 | 37K | |
| rubygem-oauth-1.1.3.pkg | 2025-12-18 13:43 | 50K | |
| rubygem-oauth-tty-1...> | 2025-12-18 10:25 | 30K | |
| rubygem-oauth0-0.5.1..> | 2025-12-19 02:05 | 37K | |
| rubygem-oauth2-2.0.1..> | 2025-12-26 22:49 | 66K | |
| rubygem-oauth2-gitla..> | 2025-12-18 17:35 | 66K | |
| rubygem-oauth21-1.4...> | 2025-12-26 23:09 | 24K | |
| rubygem-observer-0.1..> | 2025-12-18 17:22 | 6.2K | |
| rubygem-oci-2.22.0_1..> | 2025-12-29 22:37 | 5.0M | |
| rubygem-octicons-19...> | 2025-12-20 00:02 | 146K | |
| rubygem-octokit-10.0..> | 2025-12-26 19:19 | 74K | |
| rubygem-octokit-gitl..> | 2025-12-18 12:34 | 74K | |
| rubygem-octokit4-4.2..> | 2025-12-19 10:57 | 71K | |
| rubygem-octopress-3...> | 2025-12-28 01:05 | 25K | |
| rubygem-octopress-de..> | 2025-12-19 10:59 | 13K | |
| rubygem-octopress-es..> | 2025-12-27 18:02 | 4.7K | |
| rubygem-octopress-ho..> | 2025-12-27 06:05 | 6.4K | |
| rubygem-oembed-0.2.0..> | 2025-12-21 13:55 | 8.4K | |
| rubygem-ohai-18.2.6.pkg | 2025-12-26 21:17 | 110K | |
| rubygem-oj-3.16.13.pkg | 2025-12-18 16:25 | 181K | |
| rubygem-oj-introspec..> | 2025-12-20 00:31 | 10K | |
| rubygem-oj313-3.13.2..> | 2025-12-23 17:22 | 234K | |
| rubygem-omniauth-2.1..> | 2025-12-18 20:40 | 20K | |
| rubygem-omniauth-ali..> | 2025-12-19 05:02 | 4.7K | |
| rubygem-omniauth-atl..> | 2025-12-20 01:37 | 6.0K | |
| rubygem-omniauth-aut..> | 2025-12-30 16:23 | 30K | |
| rubygem-omniauth-aut..> | 2025-12-20 02:08 | 30K | |
| rubygem-omniauth-aut..> | 2025-12-29 16:07 | 6.6K | |
| rubygem-omniauth-azu..> | 2025-12-20 01:56 | 9.5K | |
| rubygem-omniauth-azu..> | 2025-12-28 05:47 | 7.2K | |
| rubygem-omniauth-bit..> | 2025-12-23 03:06 | 4.4K | |
| rubygem-omniauth-cas..> | 2025-12-20 17:44 | 8.9K | |
| rubygem-omniauth-din..> | 2025-12-28 21:06 | 6.2K | |
| rubygem-omniauth-fac..> | 2025-12-29 11:34 | 17K | |
| rubygem-omniauth-git..> | 2025-12-28 19:15 | 6.0K | |
| rubygem-omniauth-git..> | 2025-12-30 07:26 | 5.3K | |
| rubygem-omniauth-git..> | 2025-12-19 10:07 | 6.0K | |
| rubygem-omniauth-git..> | 2025-12-29 19:47 | 5.1K | |
| rubygem-omniauth-gl-..> | 2025-12-18 17:01 | 20K | |
| rubygem-omniauth-goo..> | 2025-12-30 02:31 | 20K | |
| rubygem-omniauth-goo..> | 2025-12-19 23:58 | 20K | |
| rubygem-omniauth-jwt..> | 2025-12-21 14:55 | 6.3K | |
| rubygem-omniauth-ker..> | 2025-12-30 15:43 | 5.0K | |
| rubygem-omniauth-mul..> | 2025-12-21 16:32 | 5.6K | |
| rubygem-omniauth-mul..> | 2025-12-19 04:56 | 8.7K | |
| rubygem-omniauth-oau..> | 2025-12-20 03:10 | 6.5K | |
| rubygem-omniauth-oau..> | 2025-12-27 11:31 | 9.3K | |
| rubygem-omniauth-oau..> | 2025-12-29 13:25 | 9.4K | |
| rubygem-omniauth-oau..> | 2025-12-20 00:25 | 9.4K | |
| rubygem-omniauth-oau..> | 2025-12-18 19:21 | 9.3K | |
| rubygem-omniauth-ope..> | 2025-12-21 23:48 | 18K | |
| rubygem-omniauth-rai..> | 2025-12-29 08:47 | 4.9K | |
| rubygem-omniauth-sal..> | 2025-12-30 13:28 | 6.7K | |
| rubygem-omniauth-sam..> | 2025-12-20 20:42 | 13K | |
| rubygem-omniauth-sam..> | 2025-12-19 17:27 | 13K | |
| rubygem-omniauth-sam..> | 2025-12-24 06:03 | 13K | |
| rubygem-omniauth-shi..> | 2025-12-22 13:39 | 8.5K | |
| rubygem-omniauth-shi..> | 2025-12-23 14:32 | 8.4K | |
| rubygem-omniauth-shi..> | 2025-12-19 22:16 | 8.4K | |
| rubygem-omniauth-twi..> | 2025-12-23 12:48 | 8.5K | |
| rubygem-omniauth-ult..> | 2025-12-27 20:46 | 5.2K | |
| rubygem-omniauth1-1...> | 2025-12-18 23:18 | 18K | |
| rubygem-omniauth_cro..> | 2025-12-28 10:46 | 11K | |
| rubygem-omniauth_ope..> | 2025-12-27 06:08 | 19K | |
| rubygem-omnibus-9.0...> | 2025-12-28 21:34 | 1.1M | |
| rubygem-open-uri-0.5..> | 2025-12-27 22:48 | 11K | |
| rubygem-open-uri-cac..> | 2025-12-21 03:07 | 3.5K | |
| rubygem-open3-0.2.1.pkg | 2025-12-20 11:02 | 10K | |
| rubygem-open3_backpo..> | 2025-12-22 06:32 | 12K | |
| rubygem-open4-1.3.4.pkg | 2025-12-18 11:05 | 15K | |
| rubygem-openbolt-5.1..> | 2025-12-28 21:33 | 190K | |
| rubygem-openfact-5.1..> | 2025-12-26 20:19 | 158K | |
| rubygem-opengl-0.10...> | 2025-12-22 07:39 | 434K | |
| rubygem-openid-redis..> | 2025-12-22 00:49 | 2.7K | |
| rubygem-openid_conne..> | 2025-12-26 23:54 | 29K | |
| rubygem-opennebula-7..> | 2025-12-29 09:46 | 88K | |
| rubygem-opensearch-r..> | 2025-12-19 14:02 | 108K | |
| rubygem-openssl-4.0...> | 2025-12-26 19:39 | 144K | |
| rubygem-openssl-ccm-..> | 2025-12-27 00:59 | 4.3K | |
| rubygem-openssl-cmac..> | 2025-12-26 23:11 | 4.5K | |
| rubygem-openssl-sign..> | 2025-12-18 17:21 | 12K | |
| rubygem-openssl3-3.3..> | 2025-12-27 13:00 | 144K | |
| rubygem-opentelemetr..> | 2025-12-18 07:15 | 25K | |
| rubygem-opentelemetr..> | 2025-12-18 10:13 | 10K | |
| rubygem-opentelemetr..> | 2025-12-20 01:21 | 18K | |
| rubygem-opentelemetr..> | 2025-12-21 11:27 | 18K | |
| rubygem-opentelemetr..> | 2025-12-23 16:12 | 19K | |
| rubygem-opentelemetr..> | 2025-12-19 00:30 | 7.7K | |
| rubygem-opentelemetr..> | 2025-12-18 23:50 | 7.4K | |
| rubygem-opentelemetr..> | 2025-12-18 23:13 | 8.9K | |
| rubygem-opentelemetr..> | 2025-12-23 14:28 | 8.7K | |
| rubygem-opentelemetr..> | 2025-12-18 21:15 | 9.0K | |
| rubygem-opentelemetr..> | 2025-12-18 21:31 | 11K | |
| rubygem-opentelemetr..> | 2025-12-18 21:15 | 8.4K | |
| rubygem-opentelemetr..> | 2025-12-19 00:08 | 13K | |
| rubygem-opentelemetr..> | 2025-12-19 17:33 | 8.1K | |
| rubygem-opentelemetr..> | 2025-12-18 21:11 | 9.2K | |
| rubygem-opentelemetr..> | 2025-12-18 19:10 | 8.6K | |
| rubygem-opentelemetr..> | 2025-12-18 15:52 | 9.2K | |
| rubygem-opentelemetr..> | 2025-12-23 13:36 | 11K | |
| rubygem-opentelemetr..> | 2025-12-20 04:20 | 7.1K | |
| rubygem-opentelemetr..> | 2025-12-19 14:04 | 10K | |
| rubygem-opentelemetr..> | 2025-12-20 03:34 | 11K | |
| rubygem-opentelemetr..> | 2025-12-18 11:42 | 12K | |
| rubygem-opentelemetr..> | 2025-12-19 12:45 | 9.2K | |
| rubygem-opentelemetr..> | 2025-12-18 19:36 | 7.8K | |
| rubygem-opentelemetr..> | 2025-12-19 04:50 | 9.3K | |
| rubygem-opentelemetr..> | 2025-12-19 03:05 | 8.6K | |
| rubygem-opentelemetr..> | 2025-12-19 11:33 | 10K | |
| rubygem-opentelemetr..> | 2025-12-19 23:26 | 11K | |
| rubygem-opentelemetr..> | 2025-12-19 05:06 | 11K | |
| rubygem-opentelemetr..> | 2025-12-19 23:26 | 9.6K | |
| rubygem-opentelemetr..> | 2025-12-19 14:56 | 10K | |
| rubygem-opentelemetr..> | 2025-12-19 04:32 | 10K | |
| rubygem-opentelemetr..> | 2025-12-20 01:56 | 8.1K | |
| rubygem-opentelemetr..> | 2025-12-19 07:57 | 9.8K | |
| rubygem-opentelemetr..> | 2025-12-19 05:54 | 9.5K | |
| rubygem-opentelemetr..> | 2025-12-20 02:42 | 9.4K | |
| rubygem-opentelemetr..> | 2025-12-19 17:39 | 7.5K | |
| rubygem-opentelemetr..> | 2025-12-19 22:20 | 7.9K | |
| rubygem-opentelemetr..> | 2025-12-19 10:54 | 9.7K | |
| rubygem-opentelemetr..> | 2025-12-19 15:38 | 9.2K | |
| rubygem-opentelemetr..> | 2025-12-20 00:19 | 10K | |
| rubygem-opentelemetr..> | 2025-12-19 11:53 | 12K | |
| rubygem-opentelemetr..> | 2025-12-19 22:00 | 10K | |
| rubygem-opentelemetr..> | 2025-12-19 16:28 | 8.5K | |
| rubygem-opentelemetr..> | 2025-12-18 18:04 | 15K | |
| rubygem-opentelemetr..> | 2025-12-19 06:09 | 9.3K | |
| rubygem-opentelemetr..> | 2025-12-19 15:52 | 7.4K | |
| rubygem-opentelemetr..> | 2025-12-20 00:00 | 8.6K | |
| rubygem-opentelemetr..> | 2025-12-19 17:12 | 10K | |
| rubygem-opentelemetr..> | 2025-12-19 16:23 | 9.2K | |
| rubygem-opentelemetr..> | 2025-12-19 14:34 | 9.5K | |
| rubygem-opentelemetr..> | 2025-12-19 23:40 | 9.4K | |
| rubygem-opentelemetr..> | 2025-12-20 02:52 | 11K | |
| rubygem-opentelemetr..> | 2025-12-19 20:57 | 9.8K | |
| rubygem-opentelemetr..> | 2025-12-19 12:01 | 9.7K | |
| rubygem-opentelemetr..> | 2025-12-18 21:15 | 8.1K | |
| rubygem-opentelemetr..> | 2025-12-19 15:10 | 15K | |
| rubygem-opentelemetr..> | 2025-12-18 22:38 | 11K | |
| rubygem-opentelemetr..> | 2025-12-19 19:17 | 25K | |
| rubygem-opentelemetr..> | 2025-12-18 10:30 | 7.7K | |
| rubygem-opentelemetr..> | 2025-12-18 20:17 | 29K | |
| rubygem-opentelemetr..> | 2025-12-18 18:08 | 97K | |
| rubygem-opentracing-..> | 2025-12-18 17:22 | 14K | |
| rubygem-openvas-omp-..> | 2025-12-20 00:01 | 8.3K | |
| rubygem-openvox-stri..> | 2025-12-27 16:18 | 53K | |
| rubygem-openvoxserve..> | 2025-12-27 16:20 | 43K | |
| rubygem-opml-1.0.0.pkg | 2025-12-23 12:55 | 7.7K | |
| rubygem-opt_parse_va..> | 2025-12-27 07:27 | 12K | |
| rubygem-optimist-3.2..> | 2025-12-18 10:35 | 36K | |
| rubygem-optparse-0.8..> | 2025-12-30 09:41 | 37K | |
| rubygem-orchestrator..> | 2025-12-27 04:03 | 7.6K | |
| rubygem-org-ruby-0.9..> | 2025-12-19 20:33 | 28K | |
| rubygem-origami-2.1...> | 2025-12-24 01:18 | 192K | |
| rubygem-orm_adapter-..> | 2025-12-18 18:43 | 12K | |
| rubygem-os-1.1.4.pkg | 2025-12-18 04:33 | 9.5K | |
| rubygem-ostatus2-2.0..> | 2025-12-21 19:44 | 4.6K | |
| rubygem-ostruct-0.6...> | 2025-12-18 13:38 | 9.0K | |
| rubygem-ovirt-engine..> | 2025-12-26 17:30 | 224K | |
| rubygem-ox-2.14.23.pkg | 2025-12-22 07:37 | 89K | |
| rubygem-oxidized-0.3..> | 2025-12-27 10:27 | 171K | |
| rubygem-oxidized-scr..> | 2025-12-29 06:37 | 14K | |
| rubygem-oxidized-web..> | 2025-12-30 18:29 | 740K | |
| rubygem-p4ruby-2023...> | 2025-12-28 14:14 | 1.2M | |
| rubygem-packetfu-2.0..> | 2025-12-19 14:43 | 577K | |
| rubygem-packetgen-4...> | 2025-12-22 18:19 | 86K | |
| rubygem-packwerk-3.2..> | 2025-12-27 11:45 | 1.1M | |
| rubygem-packwerk-ext..> | 2025-12-28 06:53 | 11K | |
| rubygem-pagerduty-4...> | 2025-12-19 06:54 | 12K | |
| rubygem-pagy-9.4.0.pkg | 2025-12-22 19:50 | 60K | |
| rubygem-pagy6-6.5.0.pkg | 2025-12-19 08:53 | 41K | |
| rubygem-paint-2.3.0.pkg | 2025-12-19 00:18 | 18K | |
| rubygem-pairing_heap..> | 2025-12-18 20:32 | 11K | |
| rubygem-pango-4.3.4.pkg | 2025-12-26 13:48 | 23K | |
| rubygem-paper_trail-..> | 2025-12-27 17:01 | 31K | |
| rubygem-parallel-1.2..> | 2025-12-18 16:07 | 7.4K | |
| rubygem-paranoia-3.1..> | 2025-12-27 21:10 | 16K | |
| rubygem-parse-cron-0..> | 2025-12-19 15:46 | 6.7K | |
| rubygem-parser-3.3.1..> | 2025-12-18 12:52 | 497K | |
| rubygem-parslet-2.0...> | 2025-12-18 16:58 | 71K | |
| rubygem-parslet1-1.8..> | 2025-12-19 21:51 | 70K | |
| rubygem-passenger-ap..> | 2025-12-28 12:54 | 23M | |
| rubygem-passenger-ng..> | 2025-12-28 04:22 | 19M | |
| rubygem-pastel-0.8.0..> | 2025-12-18 09:15 | 13K | |
| rubygem-patch_finder..> | 2025-12-20 00:14 | 12K | |
| rubygem-pathname-0.4..> | 2025-12-18 18:56 | 21K | |
| rubygem-pathspec-2.1..> | 2025-12-18 19:22 | 14K | |
| rubygem-pathutil-0.1..> | 2025-12-18 17:49 | 8.5K | |
| rubygem-patron-0.13...> | 2025-12-20 00:39 | 48K | |
| rubygem-pbkdf2-ruby-..> | 2025-12-21 18:27 | 9.5K | |
| rubygem-pcaprub-0.13..> | 2025-12-18 20:42 | 32K | |
| rubygem-pdf-core-0.1..> | 2025-12-18 06:30 | 38K | |
| rubygem-pdf-core09-0..> | 2025-12-18 07:53 | 33K | |
| rubygem-pdf-reader-2..> | 2025-12-18 07:05 | 155K | |
| rubygem-pdf-writer-1..> | 2025-12-21 06:19 | 256K | |
| rubygem-pdk-3.3.0_3.pkg | 2025-12-30 02:46 | 109K | |
| rubygem-pedump-0.6.7..> | 2025-12-19 05:42 | 342K | |
| rubygem-peek-1.1.0.pkg | 2025-12-27 16:09 | 23K | |
| rubygem-peek-gc-rail..> | 2025-12-28 19:13 | 3.8K | |
| rubygem-peek-host-1...> | 2025-12-28 12:20 | 3.3K | |
| rubygem-peek-perform..> | 2025-12-28 17:54 | 8.1K | |
| rubygem-peek-rails-g..> | 2025-12-27 10:22 | 23K | |
| rubygem-peek-rails4-..> | 2025-12-30 18:48 | 23K | |
| rubygem-peek-rails52..> | 2025-12-27 06:34 | 23K | |
| rubygem-peek-rails60..> | 2025-12-29 17:32 | 23K | |
| rubygem-peek-rails61..> | 2025-12-28 19:13 | 23K | |
| rubygem-peek-rails70..> | 2025-12-28 06:11 | 23K | |
| rubygem-peek-rblinep..> | 2025-12-28 01:45 | 7.2K | |
| rubygem-peek-redis-r..> | 2025-12-30 09:49 | 3.9K | |
| rubygem-pg-1.6.2.pkg | 2025-12-18 18:41 | 164K | |
| rubygem-pg-gitlab-1...> | 2025-12-18 20:22 | 164K | |
| rubygem-pg_array_par..> | 2025-12-20 00:07 | 6.5K | |
| rubygem-pg_query-6.1..> | 2025-12-18 21:19 | 604K | |
| rubygem-pghero-3.7.0..> | 2025-12-29 02:34 | 296K | |
| rubygem-pghero-rails..> | 2025-12-28 23:53 | 268K | |
| rubygem-pghero-rails..> | 2025-12-28 12:44 | 268K | |
| rubygem-phone-1.2.3.pkg | 2025-12-20 04:36 | 22K | |
| rubygem-phonelib-0.9..> | 2025-12-18 16:20 | 749K | |
| rubygem-pkg-config-1..> | 2025-12-18 01:37 | 20K | |
| rubygem-pl-puppetdb-..> | 2025-12-20 00:33 | 8.3K | |
| rubygem-platform-0.4..> | 2025-12-19 11:15 | 2.5K | |
| rubygem-platform-api..> | 2025-12-22 13:18 | 61K | |
| rubygem-pleaserun-0...> | 2025-12-19 16:50 | 29K | |
| rubygem-plist-3.6.0.pkg | 2025-12-18 18:42 | 5.8K | |
| rubygem-pluggaloid-1..> | 2025-12-19 15:08 | 17K | |
| rubygem-png-1.3.1.pkg | 2025-12-22 09:00 | 15K | |
| rubygem-po_to_json-2..> | 2025-12-27 16:18 | 5.9K | |
| rubygem-polyamorous-..> | 2025-12-28 11:46 | 4.2K | |
| rubygem-polyglot-0.3..> | 2025-12-18 06:58 | 4.8K | |
| rubygem-pony-1.13.pkg | 2025-12-30 18:36 | 9.7K | |
| rubygem-popen4-0.1.4..> | 2025-12-23 16:01 | 5.5K | |
| rubygem-poppler-4.3...> | 2025-12-26 22:53 | 84K | |
| rubygem-posix-spawn-..> | 2025-12-18 22:58 | 28K | |
| rubygem-possessive-1..> | 2025-12-19 10:49 | 3.6K | |
| rubygem-postgres_ext..> | 2025-12-27 20:22 | 20K | |
| rubygem-power_assert..> | 2025-12-19 01:33 | 11K | |
| rubygem-powerbar-1.0..> | 2025-12-18 19:12 | 8.9K | |
| rubygem-powerpack-0...> | 2025-12-22 05:03 | 15K | |
| rubygem-pp-0.6.3.pkg | 2025-12-18 04:42 | 8.2K | |
| rubygem-pqueue-2.1.0..> | 2025-12-23 16:17 | 7.7K | |
| rubygem-prawn-2.5.0.pkg | 2025-12-18 08:37 | 146K | |
| rubygem-prawn-core-0..> | 2025-12-20 04:10 | 3.4M | |
| rubygem-prawn-flexib..> | 2025-12-21 12:33 | 21K | |
| rubygem-prawn-format..> | 2025-12-22 09:17 | 80K | |
| rubygem-prawn-graph-..> | 2025-12-22 07:39 | 22K | |
| rubygem-prawn-icon-4..> | 2025-12-23 06:54 | 1.2M | |
| rubygem-prawn-icon3-..> | 2025-12-18 10:58 | 1.1M | |
| rubygem-prawn-js-0.7..> | 2025-12-21 12:04 | 5.0K | |
| rubygem-prawn-layout..> | 2025-12-20 04:42 | 23K | |
| rubygem-prawn-rails-..> | 2025-12-29 13:19 | 6.5K | |
| rubygem-prawn-securi..> | 2025-12-21 02:49 | 14K | |
| rubygem-prawn-svg-0...> | 2025-12-20 01:10 | 241K | |
| rubygem-prawn-svg036..> | 2025-12-18 09:05 | 236K | |
| rubygem-prawn-table-..> | 2025-12-18 10:30 | 54K | |
| rubygem-prawn-templa..> | 2025-12-18 11:00 | 22K | |
| rubygem-prawn24-2.4...> | 2025-12-18 11:02 | 249K | |
| rubygem-prawn_shapes..> | 2025-12-19 10:20 | 8.5K | |
| rubygem-premailer-1...> | 2025-12-19 02:00 | 19K | |
| rubygem-premailer-ra..> | 2025-12-29 11:48 | 22K | |
| rubygem-premailer-ra..> | 2025-12-27 08:28 | 22K | |
| rubygem-premailer-ra..> | 2025-12-30 17:29 | 22K | |
| rubygem-premailer-ra..> | 2025-12-30 14:20 | 22K | |
| rubygem-premailer-ra..> | 2025-12-29 18:12 | 22K | |
| rubygem-premailer-ra..> | 2025-12-29 08:02 | 22K | |
| rubygem-premailer-ra..> | 2025-12-30 07:10 | 22K | |
| rubygem-premailer-ra..> | 2025-12-29 04:47 | 22K | |
| rubygem-prettier_pri..> | 2025-12-19 07:35 | 20K | |
| rubygem-pretty-xml-0..> | 2025-12-21 20:41 | 2.7K | |
| rubygem-prettyprint-..> | 2025-12-18 03:48 | 8.4K | |
| rubygem-prime-0.1.4.pkg | 2025-12-18 12:00 | 9.3K | |
| rubygem-prism-1.6.0.pkg | 2025-12-18 12:26 | 629K | |
| rubygem-private_addr..> | 2025-12-20 18:00 | 6.4K | |
| rubygem-profile-0.4...> | 2025-12-24 07:20 | 4.4K | |
| rubygem-progressbar-..> | 2025-12-19 08:29 | 13K | |
| rubygem-prometheus-c..> | 2025-12-27 00:21 | 276K | |
| rubygem-propshaft-1...> | 2025-12-26 17:37 | 15K | |
| rubygem-propshaft-ra..> | 2025-12-27 01:44 | 15K | |
| rubygem-propshaft-ra..> | 2025-12-26 21:36 | 15K | |
| rubygem-propshaft-ra..> | 2025-12-26 20:29 | 15K | |
| rubygem-propshaft-ra..> | 2025-12-27 09:34 | 15K | |
| rubygem-protected_at..> | 2025-12-30 18:57 | 12K | |
| rubygem-protobuf-cuc..> | 2025-12-30 13:28 | 183K | |
| rubygem-protocol-2.0..> | 2025-12-22 13:57 | 24K | |
| rubygem-protocol-hpa..> | 2025-12-18 11:28 | 19K | |
| rubygem-protocol-htt..> | 2025-12-26 13:50 | 49K | |
| rubygem-protocol-htt..> | 2025-12-26 16:10 | 18K | |
| rubygem-protocol-htt..> | 2025-12-26 16:12 | 26K | |
| rubygem-protocol-rac..> | 2025-12-27 02:42 | 18K | |
| rubygem-protocol-url..> | 2025-12-18 14:22 | 13K | |
| rubygem-protocol-web..> | 2025-12-27 14:40 | 14K | |
| rubygem-proxifier-1...> | 2025-12-23 10:34 | 6.8K | |
| rubygem-proxifier2-1..> | 2025-12-19 01:42 | 6.9K | |
| rubygem-pry-0.15.2.pkg | 2025-12-18 11:57 | 130K | |
| rubygem-pry-byebug-3..> | 2025-12-23 11:16 | 13K | |
| rubygem-pry-rails-0...> | 2025-12-23 01:43 | 15K | |
| rubygem-pry-remote-0..> | 2025-12-20 20:15 | 5.1K | |
| rubygem-pry-remote-e..> | 2025-12-21 16:07 | 27K | |
| rubygem-pstore-0.2.0..> | 2025-12-18 11:37 | 12K | |
| rubygem-psych-5.3.0.pkg | 2025-12-26 08:40 | 36K | |
| rubygem-psych3-3.3.4..> | 2025-12-19 07:34 | 36K | |
| rubygem-ptreloaded-0..> | 2025-12-21 04:34 | 11K | |
| rubygem-public_suffi..> | 2025-12-18 02:17 | 93K | |
| rubygem-public_suffi..> | 2025-12-19 17:17 | 94K | |
| rubygem-puma-7.1.0.pkg | 2025-12-18 11:56 | 199K | |
| rubygem-puma-gitlab-..> | 2025-12-19 18:10 | 196K | |
| rubygem-puma6-6.6.1.pkg | 2025-12-19 13:02 | 196K | |
| rubygem-puma_worker_..> | 2025-12-24 07:20 | 11K | |
| rubygem-pundit-2.5.2..> | 2025-12-30 07:29 | 21K | |
| rubygem-puppet-lint-..> | 2025-12-22 01:51 | 73K | |
| rubygem-puppet-modul..> | 2025-12-19 04:56 | 15K | |
| rubygem-puppet-resou..> | 2025-12-18 18:00 | 91K | |
| rubygem-puppet-strin..> | 2025-12-27 12:40 | 55K | |
| rubygem-puppet_forge..> | 2025-12-26 22:57 | 248K | |
| rubygem-puppetdb_cli..> | 2025-12-22 12:11 | 16K | |
| rubygem-puppetfile-r..> | 2025-12-20 02:08 | 149K | |
| rubygem-puppetserver..> | 2025-12-27 09:22 | 40K | |
| rubygem-pusher-clien..> | 2025-12-27 16:18 | 124K | |
| rubygem-pwned-2.4.1.pkg | 2025-12-19 00:16 | 16K | |
| rubygem-pygments.rb-..> | 2025-12-24 03:55 | 1.9M | |
| rubygem-pyu-ruby-sas..> | 2025-12-18 19:11 | 5.8K | |
| rubygem-qiniu-6.9.1.pkg | 2025-12-19 15:37 | 26K | |
| rubygem-que-2.4.1.pkg | 2025-12-18 23:24 | 64K | |
| rubygem-que-schedule..> | 2025-12-29 22:21 | 18K | |
| rubygem-r10k-5.0.2_1..> | 2025-12-27 13:19 | 148K | |
| rubygem-r18n-core-5...> | 2025-12-18 20:22 | 46K | |
| rubygem-r18n-desktop..> | 2025-12-20 23:16 | 13K | |
| rubygem-r18n-rails-5..> | 2025-12-28 13:16 | 13K | |
| rubygem-r18n-rails-a..> | 2025-12-27 13:45 | 13K | |
| rubygem-raabro-1.4.0..> | 2025-12-18 12:08 | 9.8K | |
| rubygem-rabbirack-2...> | 2025-12-28 23:38 | 12K | |
| rubygem-rabbit-3.0.1..> | 2025-12-27 16:48 | 4.4M | |
| rubygem-rabbiter-2.0..> | 2025-12-30 00:27 | 18K | |
| rubygem-rabl-0.17.0.pkg | 2025-12-29 19:48 | 28K | |
| rubygem-rabl-rails50..> | 2025-12-29 23:44 | 28K | |
| rubygem-racc-1.8.1.pkg | 2025-12-18 01:35 | 59K | |
| rubygem-rack-3.1.19,..> | 2025-12-18 03:27 | 94K | |
| rubygem-rack-accept-..> | 2025-12-18 11:37 | 12K | |
| rubygem-rack-attack-..> | 2025-12-19 23:23 | 24K | |
| rubygem-rack-cache-1..> | 2025-12-18 12:47 | 25K | |
| rubygem-rack-contrib..> | 2025-12-23 06:16 | 24K | |
| rubygem-rack-cors-2...> | 2025-12-19 11:44 | 10K | |
| rubygem-rack-mini-pr..> | 2025-12-23 08:47 | 368K | |
| rubygem-rack-mount-0..> | 2025-12-20 04:42 | 21K | |
| rubygem-rack-oauth2-..> | 2025-12-29 05:10 | 28K | |
| rubygem-rack-oauth2-..> | 2025-12-26 18:35 | 28K | |
| rubygem-rack-openid-..> | 2025-12-19 14:47 | 5.2K | |
| rubygem-rack-protect..> | 2025-12-18 17:23 | 15K | |
| rubygem-rack-protect..> | 2025-12-18 15:42 | 15K | |
| rubygem-rack-protect..> | 2025-12-18 13:46 | 14K | |
| rubygem-rack-protect..> | 2025-12-18 14:01 | 17K | |
| rubygem-rack-proxy-0..> | 2025-12-18 17:42 | 12K | |
| rubygem-rack-raw-upl..> | 2025-12-22 15:29 | 13K | |
| rubygem-rack-session..> | 2025-12-18 04:35 | 12K | |
| rubygem-rack-session..> | 2025-12-18 07:55 | 2.9K | |
| rubygem-rack-ssl-1.4..> | 2025-12-23 13:38 | 2.9K | |
| rubygem-rack-test-2...> | 2025-12-18 04:39 | 17K | |
| rubygem-rack-timeout..> | 2025-12-19 03:26 | 23K | |
| rubygem-rack16-1.6.1..> | 2025-12-18 07:00 | 196K | |
| rubygem-rack22-2.2.2..> | 2025-12-18 04:34 | 132K | |
| rubygem-rack_csrf-2...> | 2025-12-21 13:24 | 19K | |
| rubygem-rackup-2.3.1..> | 2025-12-26 10:25 | 14K | |
| rubygem-rackup10-1.0..> | 2025-12-18 11:02 | 2.6K | |
| rubygem-railroad-0.5..> | 2025-12-23 21:17 | 16K | |
| rubygem-rails-deprec..> | 2025-12-26 09:19 | 22K | |
| rubygem-rails-deprec..> | 2025-12-29 03:24 | 22K | |
| rubygem-rails-deprec..> | 2025-12-29 00:17 | 22K | |
| rubygem-rails-dom-te..> | 2025-12-26 18:12 | 11K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:05 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:01 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:23 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 09:52 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 09:56 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:13 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 11:50 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:54 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 11:55 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 13:49 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 08:59 | 14K | |
| rubygem-rails-dom-te..> | 2025-12-26 10:09 | 14K | |
| rubygem-rails-gitlab..> | 2025-12-27 00:54 | 4.3K | |
| rubygem-rails-html-s..> | 2025-12-26 08:51 | 21K | |
| rubygem-rails-i18n-r..> | 2025-12-27 07:02 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-30 02:15 | 97K | |
| rubygem-rails-i18n-r..> | 2025-12-30 17:07 | 97K | |
| rubygem-rails-i18n-r..> | 2025-12-29 08:20 | 97K | |
| rubygem-rails-i18n-r..> | 2025-12-28 23:23 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-28 17:30 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-28 17:33 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-30 18:14 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-30 08:08 | 108K | |
| rubygem-rails-i18n-r..> | 2025-12-28 03:10 | 110K | |
| rubygem-rails-i18n-r..> | 2025-12-30 11:40 | 110K | |
| rubygem-rails-observ..> | 2025-12-26 18:26 | 11K | |
| rubygem-rails-settin..> | 2025-12-29 00:58 | 7.1K | |
| rubygem-rails-settin..> | 2025-12-30 08:57 | 7.1K | |
| rubygem-rails-settin..> | 2025-12-29 18:07 | 7.1K | |
| rubygem-rails4-4.2.1..> | 2025-12-27 18:08 | 1.3M | |
| rubygem-rails5-5.1.7..> | 2025-12-27 19:42 | 3.9K | |
| rubygem-rails50-5.0...> | 2025-12-27 16:48 | 3.8K | |
| rubygem-rails52-5.2...> | 2025-12-27 13:22 | 3.9K | |
| rubygem-rails60-6.0...> | 2025-12-27 18:35 | 4.1K | |
| rubygem-rails61-6.1...> | 2025-12-27 04:26 | 3.9K | |
| rubygem-rails70-7.0...> | 2025-12-27 09:41 | 4.8K | |
| rubygem-rails71-7.1...> | 2025-12-27 10:46 | 4.8K | |
| rubygem-rails72-7.2...> | 2025-12-27 18:30 | 4.9K | |
| rubygem-rails80-8.0...> | 2025-12-29 04:00 | 4.9K | |
| rubygem-rails81-8.1...> | 2025-12-26 18:51 | 4.9K | |
| rubygem-rails_12fact..> | 2025-12-20 04:54 | 4.9K | |
| rubygem-rails_autoli..> | 2025-12-28 09:39 | 5.4K | |
| rubygem-rails_serve_..> | 2025-12-19 19:55 | 634K | |
| rubygem-rails_stdout..> | 2025-12-19 21:41 | 68K | |
| rubygem-railsbench-0..> | 2025-12-23 16:28 | 77K | |
| rubygem-railties-git..> | 2025-12-26 15:54 | 154K | |
| rubygem-railties4-4...> | 2025-12-26 16:39 | 111K | |
| rubygem-railties5-5...> | 2025-12-26 15:55 | 207K | |
| rubygem-railties50-5..> | 2025-12-26 16:39 | 202K | |
| rubygem-railties52-5..> | 2025-12-26 16:11 | 213K | |
| rubygem-railties60-6..> | 2025-12-26 17:30 | 426K | |
| rubygem-railties61-6..> | 2025-12-26 16:27 | 426K | |
| rubygem-railties70-7..> | 2025-12-26 20:21 | 138K | |
| rubygem-railties71-7..> | 2025-12-26 17:29 | 154K | |
| rubygem-railties72-7..> | 2025-12-26 19:08 | 154K | |
| rubygem-railties80-8..> | 2025-12-26 21:13 | 168K | |
| rubygem-railties81-8..> | 2025-12-26 11:56 | 171K | |
| rubygem-rainbow-3.1...> | 2025-12-18 17:58 | 10K | |
| rubygem-raindrops-0...> | 2025-12-18 20:19 | 51K | |
| rubygem-rak-1.4_1.pkg | 2025-12-23 05:01 | 13K | |
| rubygem-rake-13.3.1.pkg | 2025-12-18 02:40 | 73K | |
| rubygem-rake-compile..> | 2025-12-27 02:45 | 31K | |
| rubygem-rake-compile..> | 2025-12-18 12:47 | 41K | |
| rubygem-rake-contrib..> | 2025-12-20 12:25 | 4.7K | |
| rubygem-ramaze-2012...> | 2025-12-23 16:04 | 433K | |
| rubygem-ransack-4.4...> | 2025-12-30 10:14 | 67K | |
| rubygem-raphael-rail..> | 2025-12-20 19:12 | 101K | |
| rubygem-rapt-0.2.2.pkg | 2025-12-22 17:52 | 16K | |
| rubygem-rash-0.4.0_1..> | 2025-12-20 15:53 | 5.1K | |
| rubygem-rash_alt-0.4..> | 2025-12-20 15:35 | 6.2K | |
| rubygem-rasn1-0.16.3..> | 2025-12-20 02:12 | 28K | |
| rubygem-rate_throttl..> | 2025-12-19 14:34 | 15K | |
| rubygem-razorback-sc..> | 2025-12-22 12:31 | 2.1K | |
| rubygem-rb-fsevent-0..> | 2025-12-18 07:20 | 34K | |
| rubygem-rb-gsl-2.1.0..> | 2025-12-20 06:46 | 645K | |
| rubygem-rb-inotify-0..> | 2025-12-18 06:40 | 13K | |
| rubygem-rb-kqueue-0...> | 2025-12-18 10:54 | 16K | |
| rubygem-rb_sys-0.9.1..> | 2025-12-18 18:15 | 24K | |
| rubygem-rbase-0.1.3.pkg | 2025-12-20 18:01 | 7.7K | |
| rubygem-rblineprof-0..> | 2025-12-19 11:16 | 9.7K | |
| rubygem-rbnacl-5.0.0..> | 2025-12-19 20:19 | 203K | |
| rubygem-rbnacl-libso..> | 2025-12-20 20:17 | 4.9M | |
| rubygem-rbovirt-0.1...> | 2025-12-23 01:23 | 22K | |
| rubygem-rbpdf-1.21.4..> | 2025-12-19 12:14 | 165K | |
| rubygem-rbpdf-font-1..> | 2025-12-19 00:03 | 8.4M | |
| rubygem-rbs-3.9.5.pkg | 2025-12-19 01:59 | 875K | |
| rubygem-rbs_json_sch..> | 2025-12-28 11:20 | 11K | |
| rubygem-rbtrace-0.5...> | 2025-12-19 23:09 | 31K | |
| rubygem-rbtree-0.4.6..> | 2025-12-19 05:05 | 45K | |
| rubygem-rbvmomi-3.0...> | 2025-12-30 15:26 | 177K | |
| rubygem-rbvmomi2-3.8..> | 2025-12-26 15:52 | 181K | |
| rubygem-rchardet-1.1..> | 2025-12-18 11:26 | 111K | |
| rubygem-rdf-3.3.4.pkg | 2025-12-27 01:00 | 127K | |
| rubygem-rdf-normaliz..> | 2025-12-30 00:44 | 12K | |
| rubygem-rdiscount-2...> | 2025-12-16 02:00 | 68K | |
| rubygem-rdoc-6.17.0.pkg | 2025-12-26 09:43 | 502K | |
| rubygem-rdoc-gitlab-..> | 2025-12-18 08:11 | 406K | |
| rubygem-rdtool-0.6.3..> | 2025-12-18 21:17 | 91K | |
| rubygem-re2-2.20.0.pkg | 2025-12-18 22:29 | 2.5M | |
| rubygem-react-rails-..> | 2025-12-29 17:00 | 419K | |
| rubygem-react-rails-..> | 2025-12-29 06:39 | 419K | |
| rubygem-readline-0.0..> | 2025-12-26 18:49 | 3.3K | |
| rubygem-readline-ext..> | 2025-12-18 12:45 | 14K | |
| rubygem-readwriteset..> | 2025-12-18 22:35 | 10K | |
| rubygem-recaptcha-5...> | 2025-12-20 01:14 | 20K | |
| rubygem-recog-3.1.13..> | 2025-12-18 17:49 | 314K | |
| rubygem-recursive-op..> | 2025-12-21 06:19 | 19K | |
| rubygem-recursive-op..> | 2025-12-19 02:36 | 19K | |
| rubygem-red-arrow-21..> | 2025-12-26 20:28 | 93K | |
| rubygem-red-arrow-da..> | 2025-12-29 19:47 | 10K | |
| rubygem-red-arrow-fl..> | 2025-12-27 09:04 | 11K | |
| rubygem-red-arrow-fl..> | 2025-12-29 22:47 | 9.6K | |
| rubygem-red-colors-0..> | 2025-12-26 09:52 | 80K | |
| rubygem-red-datasets..> | 2025-12-21 15:08 | 64K | |
| rubygem-red-gandiva-..> | 2025-12-29 05:04 | 11K | |
| rubygem-red-parquet-..> | 2025-12-28 00:08 | 11K | |
| rubygem-redcarpet-3...> | 2025-12-20 00:35 | 52K | |
| rubygem-redcloth-4.3..> | 2025-12-19 15:20 | 167K | |
| rubygem-redfish_clie..> | 2025-12-20 15:22 | 11K | |
| rubygem-redis-5.4.1.pkg | 2025-12-18 11:01 | 43K | |
| rubygem-redis-action..> | 2025-12-27 02:48 | 13K | |
| rubygem-redis-action..> | 2025-12-27 10:47 | 13K | |
| rubygem-redis-action..> | 2025-12-27 16:53 | 13K | |
| rubygem-redis-action..> | 2025-12-27 11:37 | 13K | |
| rubygem-redis-action..> | 2025-12-27 18:32 | 13K | |
| rubygem-redis-action..> | 2025-12-27 17:49 | 13K | |
| rubygem-redis-action..> | 2025-12-27 19:22 | 13K | |
| rubygem-redis-action..> | 2025-12-28 23:08 | 13K | |
| rubygem-redis-active..> | 2025-12-27 17:59 | 11K | |
| rubygem-redis-active..> | 2025-12-27 09:41 | 11K | |
| rubygem-redis-active..> | 2025-12-27 11:03 | 11K | |
| rubygem-redis-active..> | 2025-12-27 15:52 | 11K | |
| rubygem-redis-active..> | 2025-12-27 09:19 | 11K | |
| rubygem-redis-active..> | 2025-12-27 11:16 | 11K | |
| rubygem-redis-client..> | 2025-12-18 07:22 | 24K | |
| rubygem-redis-cluste..> | 2025-12-18 20:21 | 22K | |
| rubygem-redis-cluste..> | 2025-12-20 06:06 | 7.1K | |
| rubygem-redis-cluste..> | 2025-12-19 10:35 | 7.1K | |
| rubygem-redis-gitlab..> | 2025-12-18 14:02 | 43K | |
| rubygem-redis-namesp..> | 2025-12-18 13:07 | 15K | |
| rubygem-redis-namesp..> | 2025-12-18 23:23 | 15K | |
| rubygem-redis-namesp..> | 2025-12-22 15:39 | 15K | |
| rubygem-redis-rack-3..> | 2025-12-19 00:17 | 11K | |
| rubygem-redis-rack-g..> | 2025-12-19 03:02 | 11K | |
| rubygem-redis-rack2-..> | 2025-12-20 02:44 | 11K | |
| rubygem-redis-rails-..> | 2025-12-30 00:26 | 4.6K | |
| rubygem-redis-rails-..> | 2025-12-29 07:16 | 4.6K | |
| rubygem-redis-rails-..> | 2025-12-29 12:34 | 4.6K | |
| rubygem-redis-rails-..> | 2025-12-28 12:25 | 4.6K | |
| rubygem-redis-rails-..> | 2025-12-29 07:40 | 4.6K | |
| rubygem-redis-rails-..> | 2025-12-28 00:23 | 4.6K | |
| rubygem-redis-store-..> | 2025-12-18 14:37 | 24K | |
| rubygem-redis-store-..> | 2025-12-18 17:25 | 24K | |
| rubygem-redlock-2.0...> | 2025-12-21 16:23 | 16K | |
| rubygem-redlock1-1.3..> | 2025-12-19 16:43 | 15K | |
| rubygem-redmine_plug..> | 2025-12-20 21:24 | 9.9K | |
| rubygem-reentrant_fl..> | 2025-12-20 00:41 | 5.2K | |
| rubygem-ref-2.0.0.pkg | 2025-12-19 15:31 | 12K | |
| rubygem-regexp_parse..> | 2025-12-18 11:26 | 49K | |
| rubygem-regexp_prope..> | 2025-12-18 18:58 | 16K | |
| rubygem-reline-0.6.3..> | 2025-12-26 09:45 | 43K | |
| rubygem-repl_type_co..> | 2025-12-20 06:39 | 21K | |
| rubygem-representabl..> | 2025-12-18 08:09 | 66K | |
| rubygem-request_stor..> | 2025-12-18 19:29 | 6.5K | |
| rubygem-request_stor..> | 2025-12-20 02:51 | 6.3K | |
| rubygem-require_all-..> | 2025-12-22 12:36 | 11K | |
| rubygem-resolv-0.7.0..> | 2025-12-27 11:04 | 21K | |
| rubygem-resolv-repla..> | 2025-12-30 09:45 | 3.7K | |
| rubygem-responders-3..> | 2025-12-27 10:56 | 16K | |
| rubygem-responders-r..> | 2025-12-26 18:31 | 17K | |
| rubygem-responders-r..> | 2025-12-26 23:49 | 16K | |
| rubygem-responders-r..> | 2025-12-27 03:10 | 17K | |
| rubygem-responders-r..> | 2025-12-27 09:55 | 17K | |
| rubygem-responders-r..> | 2025-12-27 15:23 | 17K | |
| rubygem-responders-r..> | 2025-12-26 20:29 | 17K | |
| rubygem-responders-r..> | 2025-12-27 16:52 | 17K | |
| rubygem-responders-r..> | 2025-12-26 20:42 | 17K | |
| rubygem-responders-r..> | 2025-12-27 09:57 | 17K | |
| rubygem-responders-r..> | 2025-12-26 19:27 | 17K | |
| rubygem-resque-2.7.0..> | 2025-12-19 23:23 | 90K | |
| rubygem-resque-sched..> | 2025-12-29 19:46 | 40K | |
| rubygem-rest-client-..> | 2025-12-18 10:57 | 133K | |
| rubygem-rest-client-..> | 2025-12-18 18:38 | 133K | |
| rubygem-retriable-3...> | 2025-12-18 07:18 | 14K | |
| rubygem-retryable-3...> | 2025-12-19 13:16 | 11K | |
| rubygem-reverse_mark..> | 2025-12-18 18:05 | 21K | |
| rubygem-rex-arch-0.1..> | 2025-12-18 18:48 | 12K | |
| rubygem-rex-bin_tool..> | 2025-12-20 04:23 | 59K | |
| rubygem-rex-core-0.1..> | 2025-12-18 16:23 | 24K | |
| rubygem-rex-encoder-..> | 2025-12-18 20:21 | 32K | |
| rubygem-rex-exploita..> | 2025-12-19 08:36 | 66K | |
| rubygem-rex-java-0.1..> | 2025-12-19 20:49 | 15K | |
| rubygem-rex-mime-0.1..> | 2025-12-19 10:44 | 9.1K | |
| rubygem-rex-nop-0.1...> | 2025-12-19 06:00 | 15K | |
| rubygem-rex-ole-0.1...> | 2025-12-20 01:45 | 18K | |
| rubygem-rex-powershe..> | 2025-12-19 07:11 | 23K | |
| rubygem-rex-random_i..> | 2025-12-18 23:38 | 11K | |
| rubygem-rex-registry..> | 2025-12-19 17:00 | 8.9K | |
| rubygem-rex-rop_buil..> | 2025-12-19 15:42 | 10K | |
| rubygem-rex-socket-0..> | 2025-12-19 02:00 | 34K | |
| rubygem-rex-sslscan-..> | 2025-12-19 21:45 | 10K | |
| rubygem-rex-struct2-..> | 2025-12-18 21:38 | 10K | |
| rubygem-rex-text-0.2..> | 2025-12-18 12:34 | 38K | |
| rubygem-rex-zip-0.1...> | 2025-12-19 22:31 | 15K | |
| rubygem-rexml-3.4.4.pkg | 2025-12-18 06:22 | 88K | |
| rubygem-rfacebook-0...> | 2025-12-29 18:52 | 11K | |
| rubygem-rfeedfinder-..> | 2025-12-23 01:02 | 27K | |
| rubygem-rgen-0.10.2.pkg | 2025-12-18 23:18 | 201K | |
| rubygem-rgeo-3.0.1.pkg | 2025-12-20 02:00 | 100K | |
| rubygem-rgeo-geojson..> | 2025-12-22 14:46 | 8.9K | |
| rubygem-rgeo-proj4-4..> | 2025-12-29 22:49 | 12K | |
| rubygem-rgeo-shapefi..> | 2025-12-23 09:46 | 13K | |
| rubygem-rgl-0.5.10.pkg | 2025-12-19 07:13 | 58K | |
| rubygem-rhc-1.32.2_2..> | 2025-12-29 21:45 | 193K | |
| rubygem-ri_cal-0.8.8..> | 2025-12-20 05:36 | 352K | |
| rubygem-rice-4.3.3.pkg | 2025-12-22 00:50 | 91K | |
| rubygem-riemann-clie..> | 2025-12-18 23:17 | 20K | |
| rubygem-riemann-dash..> | 2025-12-23 16:10 | 289K | |
| rubygem-riemann-rabb..> | 2025-12-29 04:16 | 246K | |
| rubygem-riemann-tail..> | 2025-12-21 16:26 | 250K | |
| rubygem-riemann-tool..> | 2025-12-27 09:56 | 364K | |
| rubygem-right_aws-3...> | 2025-12-23 00:52 | 150K | |
| rubygem-right_flexis..> | 2025-12-23 05:41 | 16K | |
| rubygem-right_gogrid..> | 2025-12-20 16:33 | 15K | |
| rubygem-right_http_c..> | 2025-12-19 19:21 | 100K | |
| rubygem-right_sliceh..> | 2025-12-20 18:52 | 14K | |
| rubygem-rinda-0.2.0.pkg | 2025-12-19 17:39 | 12K | |
| rubygem-rinku-2.0.6.pkg | 2025-12-19 00:58 | 19K | |
| rubygem-rkelly-remix..> | 2025-12-18 16:39 | 62K | |
| rubygem-rly-0.2.3.pkg | 2025-12-21 06:52 | 21K | |
| rubygem-rmagick-6.1...> | 2025-12-26 23:05 | 222K | |
| rubygem-rmail-1.1.4.pkg | 2025-12-23 16:53 | 63K | |
| rubygem-rmmseg-cpp-0..> | 2025-12-22 23:32 | 660K | |
| rubygem-roadie-5.2.1..> | 2025-12-18 21:56 | 47K | |
| rubygem-roadie-rails..> | 2025-12-29 10:46 | 12K | |
| rubygem-roadie-rails..> | 2025-12-30 15:07 | 15K | |
| rubygem-roadie-rails..> | 2025-12-29 13:39 | 15K | |
| rubygem-roadie-rails..> | 2025-12-27 03:12 | 15K | |
| rubygem-roadie3-3.5...> | 2025-12-20 04:21 | 47K | |
| rubygem-roauth-0.0.8..> | 2025-12-21 18:36 | 4.5K | |
| rubygem-robotex-1.0...> | 2025-12-19 11:58 | 4.7K | |
| rubygem-robots-0.10...> | 2025-12-24 07:09 | 8.3K | |
| rubygem-roda-3.99.0.pkg | 2025-12-28 14:29 | 154K | |
| rubygem-rodzilla-0.3..> | 2025-12-19 09:52 | 16K | |
| rubygem-ronn-0.7.3.pkg | 2025-12-16 02:18 | 53K | |
| rubygem-rotp-6.3.0.pkg | 2025-12-18 21:44 | 19K | |
| rubygem-rouge-4.6.1.pkg | 2025-12-18 13:12 | 456K | |
| rubygem-rouge-gitlab..> | 2025-12-19 11:15 | 455K | |
| rubygem-rouge3-3.30...> | 2025-12-18 18:41 | 436K | |
| rubygem-rpam2-4.0.2.pkg | 2025-12-19 11:45 | 7.2K | |
| rubygem-rqrcode-3.1...> | 2025-12-19 15:03 | 98K | |
| rubygem-rqrcode-gitl..> | 2025-12-19 11:41 | 98K | |
| rubygem-rqrcode_core..> | 2025-12-18 21:17 | 16K | |
| rubygem-rqrcode_core..> | 2025-12-18 19:27 | 15K | |
| rubygem-rr-1.2.1.pkg | 2025-12-22 16:29 | 83K | |
| rubygem-rrd-ffi-0.2...> | 2025-12-26 21:25 | 19K | |
| rubygem-rscm-0.5.1.pkg | 2025-12-22 00:34 | 145K | |
| rubygem-rsec-0.4.3.pkg | 2025-12-18 17:20 | 21K | |
| rubygem-rspec-3.13.2..> | 2025-12-18 12:38 | 4.8K | |
| rubygem-rspec-core-3..> | 2025-12-18 10:13 | 135K | |
| rubygem-rspec-expect..> | 2025-12-18 09:14 | 73K | |
| rubygem-rspec-its-1...> | 2025-12-18 18:07 | 11K | |
| rubygem-rspec-logspl..> | 2025-12-23 08:42 | 5.0K | |
| rubygem-rspec-mocks-..> | 2025-12-18 09:12 | 66K | |
| rubygem-rspec-rails-..> | 2025-12-30 17:54 | 63K | |
| rubygem-rspec-suppor..> | 2025-12-18 07:50 | 33K | |
| rubygem-rspec_junit_..> | 2025-12-21 21:20 | 8.0K | |
| rubygem-rss-0.3.1.pkg | 2025-12-19 12:56 | 44K | |
| rubygem-rsvg2-4.3.4.pkg | 2025-12-27 01:07 | 15K | |
| rubygem-rsync-1.0.9_..> | 2025-12-19 16:29 | 6.8K | |
| rubygem-rtlit-0.0.5.pkg | 2025-12-22 04:49 | 6.4K | |
| rubygem-rttool-1.0.3..> | 2025-12-19 00:02 | 31K | |
| rubygem-rubocop-1.81..> | 2025-12-27 01:02 | 555K | |
| rubygem-rubocop-ast-..> | 2025-12-18 15:53 | 54K | |
| rubygem-rubocop-capy..> | 2025-12-28 18:55 | 18K | |
| rubygem-rubocop-fact..> | 2025-12-30 01:42 | 16K | |
| rubygem-rubocop-mini..> | 2025-12-28 10:46 | 26K | |
| rubygem-rubocop-perf..> | 2025-12-27 06:41 | 38K | |
| rubygem-rubocop-rail..> | 2025-12-27 15:52 | 98K | |
| rubygem-rubocop-rake..> | 2025-12-28 04:23 | 9.3K | |
| rubygem-rubocop-rspe..> | 2025-12-27 04:05 | 77K | |
| rubygem-rubocop-rspe..> | 2025-12-30 07:56 | 14K | |
| rubygem-ruby-atmos-p..> | 2025-12-21 18:27 | 30K | |
| rubygem-ruby-augeas-..> | 2025-12-18 12:44 | 29K | |
| rubygem-ruby-bsdconv..> | 2025-12-23 19:50 | 11K | |
| rubygem-ruby-bugzill..> | 2025-12-28 06:23 | 18K | |
| rubygem-ruby-enum-1...> | 2025-12-21 09:36 | 116K | |
| rubygem-ruby-filemag..> | 2025-12-22 13:17 | 20K | |
| rubygem-ruby-fogbugz..> | 2025-12-24 02:03 | 6.5K | |
| rubygem-ruby-gdsii-1..> | 2025-12-21 16:46 | 46K | |
| rubygem-ruby-graphvi..> | 2025-12-27 20:52 | 107K | |
| rubygem-ruby-growl-4..> | 2025-12-22 19:58 | 192K | |
| rubygem-ruby-hmac-0...> | 2025-12-19 15:09 | 5.0K | |
| rubygem-ruby-libvirt..> | 2025-12-20 07:49 | 101K | |
| rubygem-ruby-lsp-0.2..> | 2025-12-19 21:01 | 140K | |
| rubygem-ruby-lsp-rai..> | 2025-12-24 07:40 | 20K | |
| rubygem-ruby-lsp-rsp..> | 2025-12-23 13:36 | 11K | |
| rubygem-ruby-macho-4..> | 2025-12-19 21:15 | 30K | |
| rubygem-ruby-magic-0..> | 2025-12-19 23:18 | 31K | |
| rubygem-ruby-mp3info..> | 2025-12-21 07:27 | 84K | |
| rubygem-ruby-mysql-4..> | 2025-12-19 19:52 | 35K | |
| rubygem-ruby-netcdf-..> | 2025-12-30 01:50 | 81K | |
| rubygem-ruby-oembed-..> | 2025-12-24 05:53 | 38K | |
| rubygem-ruby-ogginfo..> | 2025-12-23 06:27 | 71K | |
| rubygem-ruby-ole-1.2..> | 2025-12-19 17:05 | 44K | |
| rubygem-ruby-openai-..> | 2025-12-30 09:17 | 38K | |
| rubygem-ruby-openai3..> | 2025-12-20 01:56 | 15K | |
| rubygem-ruby-openid-..> | 2025-12-19 00:57 | 279K | |
| rubygem-ruby-prof-1...> | 2025-12-22 18:27 | 89K | |
| rubygem-ruby-progres..> | 2025-12-18 18:42 | 13K | |
| rubygem-ruby-qmail-0..> | 2025-12-21 18:39 | 9.4K | |
| rubygem-ruby-rc4-0.1..> | 2025-12-18 06:30 | 4.7K | |
| rubygem-ruby-readabi..> | 2025-12-22 20:17 | 546K | |
| rubygem-ruby-saml-1...> | 2025-12-19 12:24 | 63K | |
| rubygem-ruby-saml-gi..> | 2025-12-18 21:03 | 63K | |
| rubygem-ruby-shout-2..> | 2025-12-21 12:19 | 12K | |
| rubygem-ruby-statist..> | 2025-12-19 20:31 | 23K | |
| rubygem-ruby-termios..> | 2025-12-18 08:05 | 25K | |
| rubygem-ruby-vips-2...> | 2025-12-26 13:51 | 63K | |
| rubygem-ruby-xslt-0...> | 2025-12-21 06:58 | 34K | |
| rubygem-ruby-xz-1.0...> | 2025-12-22 02:17 | 21K | |
| rubygem-ruby-yadis-0..> | 2025-12-20 23:30 | 15K | |
| rubygem-ruby2_keywor..> | 2025-12-18 04:41 | 7.1K | |
| rubygem-ruby2ruby-2...> | 2025-12-21 10:47 | 22K | |
| rubygem-ruby_expect-..> | 2025-12-19 11:40 | 12K | |
| rubygem-ruby_languag..> | 2025-12-28 19:22 | 25K | |
| rubygem-ruby_memchec..> | 2025-12-23 14:47 | 14K | |
| rubygem-ruby_parser-..> | 2025-12-18 19:36 | 332K | |
| rubygem-ruby_smb-3.3..> | 2025-12-27 13:06 | 319K | |
| rubygem-rubygems-mir..> | 2025-12-20 22:55 | 8.7K | |
| rubygem-rubygems-tas..> | 2025-12-30 14:35 | 20K | |
| rubygem-rubygems-tes..> | 2025-12-20 18:01 | 15K | |
| rubygem-rubyinline-3..> | 2025-12-19 02:23 | 24K | |
| rubygem-rubyinlineac..> | 2025-12-20 00:28 | 11K | |
| rubygem-rubyipmi-0.1..> | 2025-12-21 05:25 | 31K | |
| rubygem-rubyntlm-0.6..> | 2025-12-18 07:20 | 31K | |
| rubygem-rubypants-0...> | 2025-12-19 01:37 | 11K | |
| rubygem-rubytree-2.1..> | 2025-12-30 18:33 | 44K | |
| rubygem-rubytter-1.5..> | 2025-12-27 11:16 | 13K | |
| rubygem-rubyzip-2.4...> | 2025-12-18 11:31 | 36K | |
| rubygem-rubyzip-gitl..> | 2025-12-18 16:25 | 36K | |
| rubygem-rubyzip2-2.0..> | 2025-12-21 18:27 | 49K | |
| rubygem-rubyzip13-1...> | 2025-12-19 21:52 | 129K | |
| rubygem-rudy-0.9.8.0..> | 2025-12-29 05:55 | 90K | |
| rubygem-rufo-0.18.1.pkg | 2025-12-20 18:00 | 39K | |
| rubygem-rufus-schedu..> | 2025-12-27 17:01 | 35K | |
| rubygem-rugged-1.7.2..> | 2025-12-18 10:03 | 2.4M | |
| rubygem-rugments-1.0..> | 2025-12-20 07:34 | 135K | |
| rubygem-runt-0.9.0.pkg | 2025-12-22 12:51 | 81K | |
| rubygem-ruport-1.8.0..> | 2025-12-21 00:43 | 234K | |
| rubygem-rye-0.9.13_1..> | 2025-12-27 03:32 | 1.3M | |
| rubygem-safe_yaml-1...> | 2025-12-18 18:21 | 27K | |
| rubygem-safety_net_a..> | 2025-12-18 22:02 | 15K | |
| rubygem-sanitize-7.0..> | 2025-12-19 05:59 | 40K | |
| rubygem-sanitize60-6..> | 2025-12-19 12:39 | 39K | |
| rubygem-sass-3.7.4.pkg | 2025-12-18 12:18 | 171K | |
| rubygem-sass-listen-..> | 2025-12-18 11:20 | 24K | |
| rubygem-sass-rails-r..> | 2025-12-26 21:50 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-26 22:58 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-26 22:08 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-26 22:02 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-26 22:13 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-27 00:19 | 4.1K | |
| rubygem-sass-rails-r..> | 2025-12-30 09:03 | 4.1K | |
| rubygem-sassc-2.4.0.pkg | 2025-12-18 12:03 | 752K | |
| rubygem-sassc-rails-..> | 2025-12-26 19:05 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-26 19:13 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-26 19:30 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-26 19:27 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-26 19:43 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-26 18:07 | 29K | |
| rubygem-sassc-rails-..> | 2025-12-27 13:22 | 29K | |
| rubygem-savon-2.15.1..> | 2025-12-28 12:37 | 29K | |
| rubygem-sawyer-0.9.3..> | 2025-12-18 11:06 | 9.7K | |
| rubygem-sax-machine-..> | 2025-12-19 12:01 | 22K | |
| rubygem-scanf-1.0.0.pkg | 2025-12-18 18:19 | 8.6K | |
| rubygem-schash-0.1.2..> | 2025-12-19 12:45 | 5.8K | |
| rubygem-scientist-1...> | 2025-12-20 20:17 | 22K | |
| rubygem-scruffy-0.2...> | 2025-12-21 00:53 | 165K | |
| rubygem-scrypt-3.1.0..> | 2025-12-20 07:52 | 28K | |
| rubygem-scss_lint-0...> | 2025-12-22 11:27 | 96K | |
| rubygem-sd_notify-0...> | 2025-12-18 14:28 | 4.0K | |
| rubygem-sdbm-1.0.0.pkg | 2025-12-19 01:18 | 13K | |
| rubygem-sdoc-2.6.5.pkg | 2025-12-26 23:33 | 178K | |
| rubygem-securecompar..> | 2025-12-21 15:23 | 4.3K | |
| rubygem-securerandom..> | 2025-12-18 01:41 | 4.4K | |
| rubygem-seed-fu-2.3...> | 2025-12-28 16:12 | 11K | |
| rubygem-seed-fu-gitl..> | 2025-12-27 15:03 | 11K | |
| rubygem-select2-rail..> | 2025-12-23 06:23 | 55K | |
| rubygem-selenium-web..> | 2025-12-26 16:56 | 5.8M | |
| rubygem-semantic-ui-..> | 2025-12-21 06:52 | 673K | |
| rubygem-semantic_log..> | 2025-12-26 20:44 | 58K | |
| rubygem-semantic_pup..> | 2025-12-18 17:01 | 28K | |
| rubygem-semantic_ran..> | 2025-12-18 15:54 | 8.2K | |
| rubygem-semi_semanti..> | 2025-12-22 13:48 | 3.4K | |
| rubygem-semver2-3.4...> | 2025-12-19 22:53 | 6.3K | |
| rubygem-semver_diale..> | 2025-12-19 11:19 | 18K | |
| rubygem-semverse-3.0..> | 2025-12-18 18:23 | 8.1K | |
| rubygem-sentry-rails..> | 2025-12-27 17:15 | 19K | |
| rubygem-sentry-raven..> | 2025-12-23 18:46 | 46K | |
| rubygem-sentry-ruby-..> | 2025-12-26 21:56 | 65K | |
| rubygem-sentry-ruby-..> | 2025-12-30 04:54 | 65K | |
| rubygem-sentry-sidek..> | 2025-12-27 11:16 | 11K | |
| rubygem-sequel-5.99...> | 2025-12-18 16:35 | 487K | |
| rubygem-serialport-1..> | 2025-12-24 00:28 | 19K | |
| rubygem-server_sent_..> | 2025-12-19 09:26 | 9.9K | |
| rubygem-serverengine..> | 2025-12-18 17:15 | 38K | |
| rubygem-serverspec-2..> | 2025-12-23 14:33 | 39K | |
| rubygem-set-1.1.2.pkg | 2025-12-20 00:07 | 12K | |
| rubygem-settingslogi..> | 2025-12-23 11:02 | 8.8K | |
| rubygem-sexp_process..> | 2025-12-18 15:56 | 46K | |
| rubygem-shell-0.8.1.pkg | 2025-12-22 18:02 | 15K | |
| rubygem-shell2html-0..> | 2025-12-19 16:23 | 7.2K | |
| rubygem-shellany-0.0..> | 2025-12-18 15:54 | 6.1K | |
| rubygem-shellplay-0...> | 2025-12-21 22:31 | 44K | |
| rubygem-shellwords-0..> | 2025-12-21 20:04 | 6.9K | |
| rubygem-shoulda-4.0...> | 2025-12-30 08:46 | 18K | |
| rubygem-shoulda-cont..> | 2025-12-19 14:44 | 30K | |
| rubygem-shoulda-matc..> | 2025-12-27 12:26 | 69K | |
| rubygem-showcase-rai..> | 2025-12-27 19:43 | 19K | |
| rubygem-sidekiq-8.0...> | 2025-12-27 14:56 | 251K | |
| rubygem-sidekiq-bulk..> | 2025-12-29 15:27 | 7.8K | |
| rubygem-sidekiq-cron..> | 2025-12-29 00:53 | 19K | |
| rubygem-sidekiq-cron..> | 2025-12-27 02:45 | 19K | |
| rubygem-sidekiq-cron..> | 2025-12-28 05:41 | 19K | |
| rubygem-sidekiq-gitl..> | 2025-12-18 21:52 | 265K | |
| rubygem-sidekiq-sche..> | 2025-12-30 14:03 | 25K | |
| rubygem-sidekiq-uniq..> | 2025-12-28 20:07 | 84K | |
| rubygem-sidetiq-0.7...> | 2025-12-29 22:22 | 20K | |
| rubygem-sigdump-0.2...> | 2025-12-18 14:20 | 8.8K | |
| rubygem-signet-0.21...> | 2025-12-26 10:19 | 28K | |
| rubygem-signet-gitla..> | 2025-12-18 10:23 | 28K | |
| rubygem-simple-navig..> | 2025-12-28 12:18 | 39K | |
| rubygem-simple-navig..> | 2025-12-28 06:09 | 39K | |
| rubygem-simple-rss-1..> | 2025-12-19 05:07 | 30K | |
| rubygem-simple_form-..> | 2025-12-29 15:26 | 69K | |
| rubygem-simple_form-..> | 2025-12-29 11:13 | 71K | |
| rubygem-simple_form-..> | 2025-12-29 01:12 | 71K | |
| rubygem-simple_oauth..> | 2025-12-18 23:21 | 5.8K | |
| rubygem-simple_po_pa..> | 2025-12-18 18:50 | 40K | |
| rubygem-simplecov-0...> | 2025-12-19 21:04 | 41K | |
| rubygem-simplecov-ht..> | 2025-12-19 01:37 | 119K | |
| rubygem-simplecov_js..> | 2025-12-18 22:52 | 3.3K | |
| rubygem-simpleidn-0...> | 2025-12-18 19:48 | 99K | |
| rubygem-simpleidn02-..> | 2025-12-18 15:22 | 107K | |
| rubygem-sinatra-4.2...> | 2025-12-18 20:01 | 119K | |
| rubygem-sinatra-cont..> | 2025-12-19 04:39 | 29K | |
| rubygem-sinatra-cont..> | 2025-12-19 08:13 | 46K | |
| rubygem-sinatra-cont..> | 2025-12-19 03:28 | 29K | |
| rubygem-sinatra-r18n..> | 2025-12-21 16:50 | 11K | |
| rubygem-sinatra-resp..> | 2025-12-20 07:34 | 12K | |
| rubygem-sinatra1-1.4..> | 2025-12-18 20:38 | 282K | |
| rubygem-sinatra2-2.2..> | 2025-12-18 15:21 | 272K | |
| rubygem-sinatra3-3.2..> | 2025-12-19 08:36 | 118K | |
| rubygem-singleton-0...> | 2025-12-18 10:54 | 6.9K | |
| rubygem-sitemap_gene..> | 2025-12-21 10:06 | 44K | |
| rubygem-six-0.2.2.pkg | 2025-12-22 06:21 | 3.0K | |
| rubygem-sixarm_ruby_..> | 2025-12-18 20:20 | 50K | |
| rubygem-skiptrace-0...> | 2025-12-24 05:45 | 16K | |
| rubygem-slack-messen..> | 2025-12-19 12:45 | 12K | |
| rubygem-slack-notifi..> | 2025-12-22 17:31 | 11K | |
| rubygem-slim-5.2.1.pkg | 2025-12-21 03:44 | 83K | |
| rubygem-slop-4.10.1.pkg | 2025-12-18 19:00 | 18K | |
| rubygem-slop3-3.6.0.pkg | 2025-12-19 04:18 | 19K | |
| rubygem-slow_enumera..> | 2025-12-18 10:18 | 9.8K | |
| rubygem-smart_proper..> | 2025-12-18 15:32 | 20K | |
| rubygem-smart_proxy_..> | 2025-12-27 14:18 | 30K | |
| rubygem-smart_proxy_..> | 2025-12-30 01:03 | 35K | |
| rubygem-smart_proxy_..> | 2025-12-28 15:10 | 26K | |
| rubygem-smashing-1.3..> | 2025-12-28 00:52 | 1.2M | |
| rubygem-snaky_hash-2..> | 2025-12-18 10:20 | 23K | |
| rubygem-snappy-0.0.1..> | 2025-12-22 13:11 | 331K | |
| rubygem-snmp-1.2.0.pkg | 2025-12-20 08:39 | 173K | |
| rubygem-snowplow-tra..> | 2025-12-18 22:38 | 23K | |
| rubygem-soap4r-1.5.8..> | 2025-12-19 05:56 | 235K | |
| rubygem-socksify-1.8..> | 2025-12-18 17:22 | 20K | |
| rubygem-solid_cable-..> | 2025-12-26 15:50 | 9.9K | |
| rubygem-solid_cable-..> | 2025-12-26 21:24 | 9.9K | |
| rubygem-solid_cable-..> | 2025-12-27 12:40 | 9.9K | |
| rubygem-solid_cache-..> | 2025-12-26 16:27 | 20K | |
| rubygem-solid_cache-..> | 2025-12-26 21:14 | 20K | |
| rubygem-solid_cache-..> | 2025-12-27 08:16 | 20K | |
| rubygem-solid_queue-..> | 2025-12-26 15:30 | 40K | |
| rubygem-solid_queue-..> | 2025-12-27 00:02 | 40K | |
| rubygem-solid_queue-..> | 2025-12-27 03:03 | 40K | |
| rubygem-solve-4.0.4.pkg | 2025-12-21 20:23 | 14K | |
| rubygem-sorbet-runti..> | 2025-12-26 21:04 | 73K | |
| rubygem-sorted_set-1..> | 2025-12-21 16:38 | 4.8K | |
| rubygem-spamcheck-1...> | 2025-12-19 20:27 | 3.3K | |
| rubygem-specinfra-2...> | 2025-12-19 16:39 | 85K | |
| rubygem-spreadsheet-..> | 2025-12-21 04:44 | 218K | |
| rubygem-spring-4.4.0..> | 2025-12-19 00:03 | 28K | |
| rubygem-spring-watch..> | 2025-12-22 20:25 | 5.6K | |
| rubygem-sprockets-4...> | 2025-12-26 13:25 | 70K | |
| rubygem-sprockets-es..> | 2025-12-27 20:43 | 3.4K | |
| rubygem-sprockets-gi..> | 2025-12-27 01:35 | 61K | |
| rubygem-sprockets-he..> | 2025-12-27 16:37 | 14K | |
| rubygem-sprockets-ra..> | 2025-12-27 11:45 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 15:11 | 12K | |
| rubygem-sprockets-ra..> | 2025-12-26 16:57 | 12K | |
| rubygem-sprockets-ra..> | 2025-12-26 16:12 | 12K | |
| rubygem-sprockets-ra..> | 2025-12-26 15:40 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 17:04 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 15:25 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 21:19 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 21:16 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-27 00:32 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-27 18:00 | 13K | |
| rubygem-sprockets-ra..> | 2025-12-26 15:29 | 13K | |
| rubygem-sprockets-sa..> | 2025-12-22 15:05 | 13K | |
| rubygem-sprockets2-2..> | 2025-12-20 00:34 | 36K | |
| rubygem-sprockets3-3..> | 2025-12-26 13:43 | 61K | |
| rubygem-spruz-0.2.13..> | 2025-12-23 13:19 | 22K | |
| rubygem-sqlite3-2.8...> | 2025-12-18 12:19 | 53K | |
| rubygem-sqlite3-ruby..> | 2025-12-19 15:16 | 5.8K | |
| rubygem-sqlite31-1.7..> | 2025-12-18 22:41 | 60K | |
| rubygem-ssh_data-2.0..> | 2025-12-20 02:47 | 15K | |
| rubygem-sshkey-3.0.0..> | 2025-12-19 14:03 | 26K | |
| rubygem-sshkit-1.25...> | 2025-12-26 13:40 | 136K | |
| rubygem-sslshake-1.3..> | 2025-12-18 17:19 | 9.4K | |
| rubygem-ssrf_filter-..> | 2025-12-18 23:36 | 3.9K | |
| rubygem-ssrf_filter1..> | 2025-12-19 01:13 | 5.7K | |
| rubygem-stackdriver-..> | 2025-12-27 10:18 | 13K | |
| rubygem-stackprof-0...> | 2025-12-19 02:20 | 67K | |
| rubygem-stamp-0.6.0.pkg | 2025-12-20 17:51 | 10K | |
| rubygem-state_machin..> | 2025-12-21 16:48 | 480K | |
| rubygem-state_machin..> | 2025-12-18 17:37 | 61K | |
| rubygem-state_machin..> | 2025-12-27 13:18 | 13K | |
| rubygem-state_machin..> | 2025-12-26 20:44 | 15K | |
| rubygem-state_machin..> | 2025-12-28 05:22 | 19K | |
| rubygem-state_machin..> | 2025-12-27 04:05 | 21K | |
| rubygem-state_machin..> | 2025-12-28 04:58 | 21K | |
| rubygem-statsd-0.5.4..> | 2025-12-20 07:48 | 8.3K | |
| rubygem-statsd-instr..> | 2025-12-22 20:25 | 52K | |
| rubygem-statsd-ruby-..> | 2025-12-19 21:37 | 13K | |
| rubygem-stella-2.1.2..> | 2025-12-22 06:24 | 1.0M | |
| rubygem-stemmer-1.0...> | 2025-12-23 05:35 | 2.6K | |
| rubygem-stimulus-rai..> | 2025-12-26 16:07 | 60K | |
| rubygem-stimulus-rai..> | 2025-12-26 22:23 | 60K | |
| rubygem-stimulus-rai..> | 2025-12-26 23:47 | 60K | |
| rubygem-stimulus-rai..> | 2025-12-26 21:18 | 60K | |
| rubygem-stimulus-rai..> | 2025-12-27 18:55 | 60K | |
| rubygem-stomp-1.4.10..> | 2025-12-23 09:58 | 80K | |
| rubygem-stompserver-..> | 2025-12-22 15:08 | 28K | |
| rubygem-stoplight-4...> | 2025-12-22 07:39 | 24K | |
| rubygem-storable-0.1..> | 2025-12-18 16:31 | 9.4K | |
| rubygem-stream-0.5.5..> | 2025-12-19 00:02 | 11K | |
| rubygem-streamio-ffm..> | 2025-12-28 21:40 | 14K | |
| rubygem-stringex-2.8..> | 2025-12-19 01:44 | 107K | |
| rubygem-stringio-3.1..> | 2025-12-18 02:34 | 19K | |
| rubygem-strings-0.2...> | 2025-12-18 11:09 | 11K | |
| rubygem-strings-ansi..> | 2025-12-18 07:15 | 6.9K | |
| rubygem-strong_migra..> | 2025-12-28 07:21 | 25K | |
| rubygem-strptime-0.2..> | 2025-12-18 15:54 | 17K | |
| rubygem-strscan-3.1...> | 2025-12-19 12:57 | 20K | |
| rubygem-structured_w..> | 2025-12-23 14:01 | 8.7K | |
| rubygem-stud-0.0.23.pkg | 2025-12-18 21:11 | 13K | |
| rubygem-subexec-0.2...> | 2025-12-23 05:13 | 2.7K | |
| rubygem-sucker_punch..> | 2025-12-26 20:44 | 16K | |
| rubygem-sugar-high-0..> | 2025-12-23 12:49 | 21K | |
| rubygem-sumbur-0.1.2..> | 2025-12-19 20:45 | 5.9K | |
| rubygem-sundawg_coun..> | 2025-12-21 05:12 | 14K | |
| rubygem-sus-0.34.0.pkg | 2025-12-21 05:59 | 31K | |
| rubygem-svg_optimize..> | 2025-12-18 23:57 | 6.8K | |
| rubygem-svg_sprite-1..> | 2025-12-19 17:40 | 16K | |
| rubygem-svn2git-2.4...> | 2025-12-20 22:59 | 15K | |
| rubygem-swagger-bloc..> | 2025-12-20 01:30 | 20K | |
| rubygem-swd-2.0.3_2.pkg | 2025-12-26 18:01 | 8.5K | |
| rubygem-sync-0.5.0.pkg | 2025-12-18 18:41 | 5.3K | |
| rubygem-syntax-1.2.2..> | 2025-12-23 19:49 | 17K | |
| rubygem-syntax_sugge..> | 2025-12-22 10:59 | 35K | |
| rubygem-syntax_tree-..> | 2025-12-21 05:51 | 173K | |
| rubygem-sys-admin-1...> | 2025-12-22 19:19 | 27K | |
| rubygem-sys-cpu-1.1...> | 2025-12-21 11:40 | 26K | |
| rubygem-sys-filesyst..> | 2025-12-26 15:07 | 28K | |
| rubygem-sys-filesyst..> | 2025-12-20 00:46 | 25K | |
| rubygem-sys-host-0.6..> | 2025-12-23 01:48 | 10K | |
| rubygem-sys-proctabl..> | 2025-12-19 16:17 | 43K | |
| rubygem-sys-uname-1...> | 2025-12-19 00:17 | 21K | |
| rubygem-sys-uptime-0..> | 2025-12-23 05:32 | 15K | |
| rubygem-sysinfo-0.10..> | 2025-12-18 19:37 | 7.0K | |
| rubygem-syslog-0.3.0..> | 2025-12-18 17:04 | 13K | |
| rubygem-syslog-logge..> | 2025-12-18 23:16 | 6.6K | |
| rubygem-syslog_proto..> | 2025-12-18 23:49 | 7.6K | |
| rubygem-systemu-2.6...> | 2025-12-18 17:01 | 12K | |
| rubygem-t-4.2.0.pkg | 2025-12-20 22:32 | 25K | |
| rubygem-table_print-..> | 2025-12-22 19:30 | 23K | |
| rubygem-tailwindcss-..> | 2025-12-26 16:00 | 700K | |
| rubygem-tailwindcss-..> | 2025-12-27 00:19 | 700K | |
| rubygem-tailwindcss-..> | 2025-12-26 21:15 | 700K | |
| rubygem-tailwindcss-..> | 2025-12-26 20:47 | 700K | |
| rubygem-tailwindcss-..> | 2025-12-27 12:30 | 700K | |
| rubygem-tanuki_emoji..> | 2025-12-27 06:48 | 12M | |
| rubygem-tarantool-0...> | 2025-12-21 23:42 | 42K | |
| rubygem-task_list-1...> | 2025-12-29 02:59 | 14K | |
| rubygem-taskjuggler-..> | 2025-12-29 15:43 | 574K | |
| rubygem-tdiff-0.4.0.pkg | 2025-12-19 21:00 | 7.5K | |
| rubygem-teamocil-1.4..> | 2025-12-20 23:29 | 13K | |
| rubygem-telesign-2.4..> | 2025-12-18 23:17 | 5.5K | |
| rubygem-telesignente..> | 2025-12-19 04:50 | 4.8K | |
| rubygem-tempfile-0.3..> | 2025-12-23 11:28 | 9.6K | |
| rubygem-templater-1...> | 2025-12-29 13:11 | 28K | |
| rubygem-temple-0.10...> | 2025-12-18 18:50 | 29K | |
| rubygem-term-ansicol..> | 2025-12-20 01:49 | 43K | |
| rubygem-termcolor-1...> | 2025-12-27 16:59 | 4.9K | |
| rubygem-terminal-tab..> | 2025-12-18 11:43 | 18K | |
| rubygem-terminal-tab..> | 2025-12-18 17:19 | 18K | |
| rubygem-termtter-2.2..> | 2025-12-30 06:49 | 1.4M | |
| rubygem-terrapin-1.1..> | 2025-12-18 23:41 | 16K | |
| rubygem-terser-1.0.2..> | 2025-12-27 13:15 | 116K | |
| rubygem-test-unit-3...> | 2025-12-19 04:49 | 83K | |
| rubygem-text-1.3.1.pkg | 2025-12-18 13:19 | 102K | |
| rubygem-thin-2.0.1.pkg | 2025-12-19 07:02 | 54K | |
| rubygem-thor-1.4.0.pkg | 2025-12-18 08:10 | 48K | |
| rubygem-thor0-0.20.3..> | 2025-12-19 02:55 | 47K | |
| rubygem-thor12-1.2.2..> | 2025-12-19 23:33 | 45K | |
| rubygem-thread-local..> | 2025-12-18 20:56 | 2.9K | |
| rubygem-thread_safe-..> | 2025-12-18 01:30 | 36K | |
| rubygem-thrift-0.22...> | 2025-12-18 17:54 | 74K | |
| rubygem-thruster-0.1..> | 2025-12-19 13:10 | 5.0K | |
| rubygem-thwait-0.2.0..> | 2025-12-23 22:21 | 4.6K | |
| rubygem-tidy_ffi-1.0..> | 2025-12-22 05:03 | 9.2K | |
| rubygem-tilt-2.6.1.pkg | 2025-12-18 12:03 | 24K | |
| rubygem-tilt1-1.4.1.pkg | 2025-12-18 20:22 | 37K | |
| rubygem-time-0.4.1.pkg | 2025-12-26 19:41 | 10K | |
| rubygem-timecop-0.9...> | 2025-12-22 07:26 | 9.3K | |
| rubygem-timeliness-0..> | 2025-12-18 13:51 | 25K | |
| rubygem-timeout-0.5...> | 2025-12-26 09:24 | 6.0K | |
| rubygem-timers-4.4.0..> | 2025-12-19 00:02 | 9.6K | |
| rubygem-timfel-krb5-..> | 2025-12-27 16:46 | 9.2K | |
| rubygem-tinder-1.10...> | 2025-12-21 19:41 | 16K | |
| rubygem-tins-1.48.0.pkg | 2025-12-18 19:31 | 124K | |
| rubygem-tinyatom-0.3..> | 2025-12-20 08:59 | 4.6K | |
| rubygem-tinymce-rail..> | 2025-12-29 09:59 | 514K | |
| rubygem-titlecase-0...> | 2025-12-19 17:05 | 3.2K | |
| rubygem-tk-0.4.0.pkg | 2025-12-28 13:59 | 1.3M | |
| rubygem-tmpdir-0.3.1..> | 2025-12-23 09:34 | 5.9K | |
| rubygem-tmuxinator-3..> | 2025-12-30 16:38 | 31K | |
| rubygem-to_regexp-0...> | 2025-12-22 06:54 | 6.2K | |
| rubygem-toml-0.3.0.pkg | 2025-12-23 19:10 | 7.2K | |
| rubygem-toml-rb-2.2...> | 2025-12-18 20:20 | 8.6K | |
| rubygem-tomlrb-2.0.3..> | 2025-12-18 07:31 | 9.8K | |
| rubygem-tomlrb1-1.3...> | 2025-12-18 11:26 | 6.9K | |
| rubygem-tool-0.2.3.pkg | 2025-12-22 15:36 | 7.2K | |
| rubygem-totoridipjp-..> | 2025-12-19 16:18 | 3.9K | |
| rubygem-tpm-key_atte..> | 2025-12-26 20:55 | 32K | |
| rubygem-tracer-0.2.3..> | 2025-12-23 16:49 | 11K | |
| rubygem-traces-0.18...> | 2025-12-18 07:42 | 14K | |
| rubygem-trailblazer-..> | 2025-12-18 04:32 | 6.6K | |
| rubygem-train-3.13.4..> | 2025-12-28 14:38 | 14K | |
| rubygem-train-core-3..> | 2025-12-26 18:28 | 43K | |
| rubygem-train-rest-0..> | 2025-12-27 00:46 | 11K | |
| rubygem-train-winrm-..> | 2025-12-18 21:56 | 12K | |
| rubygem-transaction-..> | 2025-12-19 07:22 | 14K | |
| rubygem-travis-1.14...> | 2025-12-28 03:47 | 171K | |
| rubygem-travis-gh-0...> | 2025-12-27 17:09 | 12K | |
| rubygem-treetop-1.6...> | 2025-12-18 10:19 | 78K | |
| rubygem-trilogy-2.9...> | 2025-12-19 11:16 | 42K | |
| rubygem-trollop-2.9...> | 2025-12-19 09:03 | 25K | |
| rubygem-trollop1-1.1..> | 2025-12-19 17:24 | 18K | |
| rubygem-truncato-0.7..> | 2025-12-19 21:52 | 5.4K | |
| rubygem-tsort-0.2.0.pkg | 2025-12-18 03:57 | 6.7K | |
| rubygem-ttfunk-1.8.0..> | 2025-12-18 06:30 | 69K | |
| rubygem-ttfunk17-1.7..> | 2025-12-18 10:30 | 57K | |
| rubygem-tty-0.10.0_1..> | 2025-12-21 17:15 | 45K | |
| rubygem-tty-box-0.7...> | 2025-12-18 14:21 | 9.8K | |
| rubygem-tty-color-0...> | 2025-12-18 07:20 | 6.5K | |
| rubygem-tty-command-..> | 2025-12-19 00:28 | 19K | |
| rubygem-tty-config-0..> | 2025-12-19 16:20 | 18K | |
| rubygem-tty-cursor-0..> | 2025-12-18 07:54 | 6.3K | |
| rubygem-tty-editor-0..> | 2025-12-19 06:00 | 8.6K | |
| rubygem-tty-file-0.1..> | 2025-12-19 09:57 | 16K | |
| rubygem-tty-font-0.5..> | 2025-12-19 12:20 | 15K | |
| rubygem-tty-logger-0..> | 2025-12-19 10:46 | 17K | |
| rubygem-tty-markdown..> | 2025-12-19 08:57 | 13K | |
| rubygem-tty-pager-0...> | 2025-12-20 03:45 | 11K | |
| rubygem-tty-pie-0.4...> | 2025-12-19 14:36 | 8.2K | |
| rubygem-tty-platform..> | 2025-12-18 11:08 | 4.6K | |
| rubygem-tty-progress..> | 2025-12-20 04:01 | 25K | |
| rubygem-tty-prompt-0..> | 2025-12-18 12:33 | 42K | |
| rubygem-tty-reader-0..> | 2025-12-18 09:02 | 15K | |
| rubygem-tty-screen-0..> | 2025-12-18 07:20 | 7.7K | |
| rubygem-tty-spinner-..> | 2025-12-19 15:46 | 14K | |
| rubygem-tty-table-0...> | 2025-12-18 14:41 | 25K | |
| rubygem-tty-tree-0.4..> | 2025-12-19 17:18 | 7.5K | |
| rubygem-tty-which-0...> | 2025-12-19 03:16 | 5.1K | |
| rubygem-tumblr_clien..> | 2025-12-29 19:47 | 15K | |
| rubygem-turbo-rails-..> | 2025-12-26 16:14 | 157K | |
| rubygem-turbo-rails-..> | 2025-12-26 20:28 | 156K | |
| rubygem-turbo-rails-..> | 2025-12-26 23:09 | 157K | |
| rubygem-turbo-rails-..> | 2025-12-27 01:40 | 157K | |
| rubygem-turbo-rails-..> | 2025-12-27 10:50 | 157K | |
| rubygem-turbolinks-5..> | 2025-12-18 21:42 | 3.6K | |
| rubygem-turbolinks-s..> | 2025-12-18 18:48 | 10K | |
| rubygem-turn-0.9.7_1..> | 2025-12-28 10:53 | 29K | |
| rubygem-tweetstream-..> | 2025-12-23 13:37 | 31K | |
| rubygem-twitter-8.2...> | 2025-12-19 08:29 | 65K | |
| rubygem-twitter-stre..> | 2025-12-19 06:03 | 11K | |
| rubygem-twitter-text..> | 2025-12-18 20:32 | 49K | |
| rubygem-twitter-text..> | 2025-12-19 02:03 | 39K | |
| rubygem-twitter4r-0...> | 2025-12-29 12:21 | 35K | |
| rubygem-twitter_oaut..> | 2025-12-27 14:38 | 9.8K | |
| rubygem-typed-array-..> | 2025-12-20 02:05 | 7.5K | |
| rubygem-typeprof-0.2..> | 2025-12-21 07:12 | 62K | |
| rubygem-typhoeus-1.5..> | 2025-12-18 18:09 | 33K | |
| rubygem-typhoeus-git..> | 2025-12-18 21:43 | 51K | |
| rubygem-typhoeus14-1..> | 2025-12-19 13:02 | 51K | |
| rubygem-tzinfo-2.0.6..> | 2025-12-26 06:37 | 62K | |
| rubygem-tzinfo-data-..> | 2025-12-26 20:01 | 147K | |
| rubygem-tzinfo1-1.2...> | 2025-12-18 01:50 | 129K | |
| rubygem-u2f-1.0.0.pkg | 2025-12-21 07:29 | 12K | |
| rubygem-uber-0.1.0.pkg | 2025-12-18 06:22 | 12K | |
| rubygem-uglifier-4.2..> | 2025-12-26 22:03 | 119K | |
| rubygem-uh-2.1.1.pkg | 2025-12-19 15:05 | 20K | |
| rubygem-uh-layout-0...> | 2025-12-19 21:19 | 6.3K | |
| rubygem-uh-wm-0.2.1.pkg | 2025-12-21 04:39 | 13K | |
| rubygem-un-0.3.0.pkg | 2025-12-21 02:04 | 6.7K | |
| rubygem-undercover-0..> | 2025-12-21 17:00 | 2.7M | |
| rubygem-underscore-r..> | 2025-12-22 14:38 | 16K | |
| rubygem-unf-0.2.0.pkg | 2025-12-18 04:04 | 4.7K | |
| rubygem-unf_ext-0.0...> | 2025-12-18 16:24 | 262K | |
| rubygem-unicode-0.4...> | 2025-12-23 06:42 | 107K | |
| rubygem-unicode-disp..> | 2025-12-18 08:41 | 15K | |
| rubygem-unicode-disp..> | 2025-12-18 06:32 | 10K | |
| rubygem-unicode-emoj..> | 2025-12-18 07:37 | 72K | |
| rubygem-unicode-vers..> | 2025-12-20 05:29 | 5.6K | |
| rubygem-unicode_plot..> | 2025-12-20 11:07 | 27K | |
| rubygem-unicode_util..> | 2025-12-18 07:50 | 247K | |
| rubygem-unicorn-6.1...> | 2025-12-19 11:21 | 181K | |
| rubygem-unicorn-work..> | 2025-12-22 14:51 | 5.9K | |
| rubygem-unix-crypt-1..> | 2025-12-19 12:03 | 9.6K | |
| rubygem-unleash-3.2...> | 2025-12-19 22:58 | 21K | |
| rubygem-uri-1.1.1.pkg | 2025-12-18 01:35 | 31K | |
| rubygem-uri-gitlab-0..> | 2025-12-18 23:17 | 31K | |
| rubygem-uri-redis-1...> | 2025-12-18 22:36 | 5.5K | |
| rubygem-uri_template..> | 2025-12-21 20:52 | 18K | |
| rubygem-url_escape-2..> | 2025-12-20 13:16 | 16K | |
| rubygem-url_mount-0...> | 2025-12-18 17:19 | 13K | |
| rubygem-url_safe_bas..> | 2025-12-23 10:34 | 3.7K | |
| rubygem-useragent-0...> | 2025-12-18 11:14 | 11K | |
| rubygem-uuid-2.3.9.pkg | 2025-12-19 21:10 | 11K | |
| rubygem-uuidtools-3...> | 2025-12-18 18:45 | 23K | |
| rubygem-vagrant-bhyv..> | 2025-12-22 20:57 | 19K | |
| rubygem-vagrant-muta..> | 2025-12-20 21:40 | 22K | |
| rubygem-vagrant_clou..> | 2025-12-27 16:39 | 19K | |
| rubygem-vagrant_clou..> | 2025-12-19 17:17 | 19K | |
| rubygem-valid-1.2.0.pkg | 2025-12-22 21:11 | 5.9K | |
| rubygem-valid_email-..> | 2025-12-27 08:02 | 14K | |
| rubygem-valid_email0..> | 2025-12-30 02:40 | 14K | |
| rubygem-validatable-..> | 2025-12-21 14:11 | 14K | |
| rubygem-validate_ema..> | 2025-12-30 07:26 | 2.6K | |
| rubygem-validate_url..> | 2025-12-26 20:12 | 6.1K | |
| rubygem-validates_ho..> | 2025-12-28 06:11 | 11K | |
| rubygem-validates_ho..> | 2025-12-27 19:09 | 11K | |
| rubygem-validates_ti..> | 2025-12-30 10:29 | 25K | |
| rubygem-validates_ti..> | 2025-12-28 13:37 | 25K | |
| rubygem-vault-0.19.0..> | 2025-12-18 23:41 | 34K | |
| rubygem-vcr-6.3.1.pkg | 2025-12-22 12:24 | 36K | |
| rubygem-vegas-0.1.11..> | 2025-12-20 12:37 | 9.9K | |
| rubygem-version_gem-..> | 2025-12-18 07:53 | 28K | |
| rubygem-version_sort..> | 2025-12-19 20:12 | 5.7K | |
| rubygem-versionomy-0..> | 2025-12-19 21:00 | 43K | |
| rubygem-view_compone..> | 2025-12-27 14:02 | 61K | |
| rubygem-vimgolf-0.5...> | 2025-12-30 14:04 | 11K | |
| rubygem-virtus-2.0.0..> | 2025-12-18 20:23 | 45K | |
| rubygem-visage-app-2..> | 2025-12-27 21:55 | 276K | |
| rubygem-vite_rails-g..> | 2025-12-27 06:08 | 11K | |
| rubygem-vite_ruby-3...> | 2025-12-22 19:47 | 27K | |
| rubygem-vite_ruby-gi..> | 2025-12-19 02:18 | 27K | |
| rubygem-vmail-2.9.8_..> | 2025-12-28 03:29 | 67K | |
| rubygem-vmstat-2.3.1..> | 2025-12-19 10:44 | 25K | |
| rubygem-vpim-13.11.1..> | 2025-12-22 07:22 | 84K | |
| rubygem-vte3-4.3.4.pkg | 2025-12-27 16:37 | 16K | |
| rubygem-vte4-4.3.4.pkg | 2025-12-27 14:15 | 16K | |
| rubygem-warbler-2.0...> | 2025-12-30 00:23 | 55K | |
| rubygem-warden-1.2.9..> | 2025-12-18 16:30 | 16K | |
| rubygem-warning-1.5...> | 2025-12-19 07:11 | 7.2K | |
| rubygem-wasabi-5.1.0..> | 2025-12-27 16:24 | 9.9K | |
| rubygem-wdm-0.2.0.pkg | 2025-12-19 22:37 | 5.1K | |
| rubygem-weakref-0.1...> | 2025-12-22 21:30 | 5.9K | |
| rubygem-web-console-..> | 2025-12-26 21:26 | 26K | |
| rubygem-web-console-..> | 2025-12-26 22:14 | 26K | |
| rubygem-web-console-..> | 2025-12-27 01:40 | 26K | |
| rubygem-web-console-..> | 2025-12-26 22:33 | 26K | |
| rubygem-web-console-..> | 2025-12-27 09:49 | 26K | |
| rubygem-web-console-..> | 2025-12-26 14:46 | 26K | |
| rubygem-web-console2..> | 2025-12-27 00:19 | 22K | |
| rubygem-web-console3..> | 2025-12-27 00:21 | 25K | |
| rubygem-web-console3..> | 2025-12-26 22:57 | 25K | |
| rubygem-web-console3..> | 2025-12-26 22:56 | 25K | |
| rubygem-webauthn-3.4..> | 2025-12-27 06:04 | 38K | |
| rubygem-webdrivers-5..> | 2025-12-29 09:53 | 24K | |
| rubygem-webfinger-2...> | 2025-12-26 18:28 | 8.5K | |
| rubygem-webmock-3.26..> | 2025-12-18 13:44 | 60K | |
| rubygem-webpacker-ra..> | 2025-12-29 06:36 | 208K | |
| rubygem-webpacker-ra..> | 2025-12-26 21:21 | 208K | |
| rubygem-webpacker4-r..> | 2025-12-26 20:42 | 200K | |
| rubygem-webpush-1.1...> | 2025-12-23 13:00 | 14K | |
| rubygem-webrick-1.9...> | 2025-12-18 07:44 | 59K | |
| rubygem-webrobots-0...> | 2025-12-19 00:48 | 19K | |
| rubygem-websocket-1...> | 2025-12-18 10:00 | 25K | |
| rubygem-websocket-cl..> | 2025-12-23 13:37 | 7.7K | |
| rubygem-websocket-dr..> | 2025-12-18 09:15 | 20K | |
| rubygem-websocket-ex..> | 2025-12-18 07:44 | 7.3K | |
| rubygem-whatlanguage..> | 2025-12-23 04:51 | 2.7M | |
| rubygem-whois-6.0.3.pkg | 2025-12-19 05:31 | 79K | |
| rubygem-wikicloth-0...> | 2025-12-21 11:11 | 110K | |
| rubygem-wikicloth081..> | 2025-12-19 22:37 | 110K | |
| rubygem-will_paginat..> | 2025-12-23 02:30 | 16K | |
| rubygem-win32-file-0..> | 2025-12-23 21:15 | 17K | |
| rubygem-win32-file-s..> | 2025-12-23 16:33 | 15K | |
| rubygem-win32-file-s..> | 2025-12-19 10:41 | 19K | |
| rubygem-windows_erro..> | 2025-12-19 02:16 | 257K | |
| rubygem-winrm-2.3.9.pkg | 2025-12-18 17:29 | 37K | |
| rubygem-winrm-elevat..> | 2025-12-20 01:10 | 9.5K | |
| rubygem-winrm-elevat..> | 2025-12-19 08:13 | 9.5K | |
| rubygem-winrm-fs-1.3..> | 2025-12-18 23:19 | 18K | |
| rubygem-winrm-fs-git..> | 2025-12-19 03:02 | 18K | |
| rubygem-winrm-gitlab..> | 2025-12-18 18:48 | 37K | |
| rubygem-wisper-3.0.0..> | 2025-12-21 10:36 | 19K | |
| rubygem-wisper2-2.0...> | 2025-12-18 06:46 | 19K | |
| rubygem-with_advisor..> | 2025-12-27 19:19 | 16K | |
| rubygem-with_env-1.1..> | 2025-12-18 23:44 | 3.9K | |
| rubygem-wmi-lite-1.0..> | 2025-12-18 17:35 | 6.7K | |
| rubygem-x-0.17.0.pkg | 2025-12-20 16:43 | 16K | |
| rubygem-xdg7-7.1.3_1..> | 2025-12-22 13:55 | 11K | |
| rubygem-xdg8-8.10.0.pkg | 2025-12-20 15:16 | 11K | |
| rubygem-xdr-3.0.3_2.pkg | 2025-12-27 10:38 | 14K | |
| rubygem-xml-simple-1..> | 2025-12-18 13:32 | 8.7K | |
| rubygem-xml-simple-g..> | 2025-12-18 19:09 | 8.8K | |
| rubygem-xmlrpc-0.3.3..> | 2025-12-18 12:09 | 25K | |
| rubygem-xorcist-1.1...> | 2025-12-20 06:55 | 5.4K | |
| rubygem-xpath-3.2.0.pkg | 2025-12-18 10:38 | 11K | |
| rubygem-xxhash-0.7.0..> | 2025-12-19 08:29 | 26K | |
| rubygem-ya2yaml-0.31..> | 2025-12-21 05:57 | 9.6K | |
| rubygem-yajl-ruby-1...> | 2025-12-18 18:30 | 404K | |
| rubygem-yapra-0.2.2.pkg | 2025-12-21 21:19 | 40K | |
| rubygem-yard-0.9.38.pkg | 2025-12-19 01:46 | 560K | |
| rubygem-yard-chef-2...> | 2025-12-23 18:58 | 121K | |
| rubygem-yard-sorbet-..> | 2025-12-30 13:48 | 13K | |
| rubygem-yell-2.2.2.pkg | 2025-12-19 15:12 | 21K | |
| rubygem-yui-compress..> | 2025-12-20 11:10 | 730K | |
| rubygem-zeitwerk-2.6..> | 2025-12-18 03:23 | 34K | |
| rubygem-zentest-4.12..> | 2025-12-18 17:44 | 40K | |
| rubygem-zhexdump-0.3..> | 2025-12-18 20:19 | 6.4K | |
| rubygem-zlib-3.2.2.pkg | 2025-12-21 18:46 | 29K | |
| rubygem-zonefile-1.0..> | 2025-12-19 15:29 | 8.9K | |
| rubygem-zstd-ruby-1...> | 2025-12-18 18:55 | 264K | |
| rubymine-2023.1.1_2.pkg | 2025-12-29 00:53 | 238M | |
| rude-0.70_5.pkg | 2025-12-29 18:25 | 36K | |
| rudeconfig-5.0.5_4.pkg | 2025-08-17 18:37 | 59K | |
| rudiments-1.4.2.pkg | 2025-12-18 19:08 | 1.3M | |
| ruff-0.14.7_1.pkg | 2025-12-27 06:52 | 16M | |
| rump-20170822_4.pkg | 2025-12-23 03:48 | 3.9M | |
| rumur-2025.08.31.pkg | 2025-12-22 23:11 | 496K | |
| runas-0.2.0_1.pkg | 2025-08-16 22:35 | 4.7K | |
| runawk-1.6.1_1.pkg | 2025-08-15 02:39 | 62K | |
| rundeck-5.18.0.pkg | 2025-12-27 21:42 | 176M | |
| runelite-2.2.0.pkg | 2025-12-30 07:00 | 2.2M | |
| runiq-2.1.0_1.pkg | 2025-12-29 06:50 | 748K | |
| runit-2.1.2_5.pkg | 2025-08-15 16:15 | 351K | |
| runit-faster-2.1.3.7..> | 2025-08-17 15:49 | 379K | |
| runj-0.1.0_18.pkg | 2025-12-22 19:21 | 7.0M | |
| runner-1.1.pkg | 2025-12-29 14:56 | 201K | |
| runwhen-2021.04.30_4..> | 2025-12-23 19:49 | 11K | |
| ruqola-2.5.3.pkg | 2025-12-30 07:12 | 2.6M | |
| rush-2.4.pkg | 2025-12-21 04:06 | 256K | |
| rush-parallelization..> | 2025-12-22 11:08 | 2.8M | |
| rust-1.92.0.pkg | 2025-12-25 00:00 | 182M | |
| rust-analyzer-2025.0..> | 2025-12-25 00:38 | 11M | |
| rust-bindgen-cli-0.7..> | 2025-12-25 00:27 | 1.5M | |
| rust-cbindgen-0.29.2..> | 2025-12-25 06:18 | 1.1M | |
| rust-coreutils-0.5.0..> | 2025-12-25 17:33 | 3.6M | |
| rust-findutils-0.7.0..> | 2025-12-25 00:33 | 843K | |
| rust-mode-1.0.5.58_1..> | 2025-08-23 01:50 | 22K | |
| rust-nightly-1.94.0...> | 2025-12-25 05:26 | 325M | |
| rust-script-0.36.0_2..> | 2025-12-25 16:59 | 959K | |
| rust188-1.88.0.pkg | 2025-12-17 17:26 | 175M | |
| rustc-demangle-0.1.2..> | 2025-12-25 16:55 | 347K | |
| rustdesk-server-1.1...> | 2025-12-25 17:22 | 3.3M | |
| rustlings-6.5.0_2.pkg | 2025-12-25 14:19 | 642K | |
| rustls-ffi-0.15.0_7.pkg | 2025-12-25 17:06 | 5.0M | |
| rustpython-0.4.0_9.pkg | 2025-12-25 05:52 | 4.4M | |
| rustscan-2.4.1_7.pkg | 2025-12-25 06:08 | 1.7M | |
| rustup-init-1.28.1_8..> | 2025-12-26 03:17 | 2.9M | |
| rustypaste-0.16.1_6.pkg | 2025-12-25 00:50 | 2.3M | |
| rustypaste-cli-0.9.4..> | 2025-12-25 00:40 | 1.1M | |
| ruut-0.8.0_18.pkg | 2025-12-29 12:32 | 335K | |
| rvi-1.0.0.pkg | 2025-08-17 20:59 | 5.6K | |
| rvm-1.20_2.pkg | 2025-08-21 15:32 | 163K | |
| rvman-1.11_7.pkg | 2025-12-23 16:59 | 519K | |
| rw-1.0_1.pkg | 2025-08-18 21:07 | 12K | |
| rw-aspell-0.50.0_1,1..> | 2025-12-23 16:13 | 41K | |
| rw-libreoffice-25.8...> | 2025-12-27 10:00 | 266K | |
| rw-tui-1.0.0.1_1.pkg | 2025-12-21 22:16 | 53K | |
| rwpspread-0.4.0_9.pkg | 2025-12-30 00:33 | 1.6M | |
| rx-editor-0.5.2_41.pkg | 2025-12-28 18:27 | 728K | |
| rxcpp-4.1.1.23.pkg | 2025-08-21 10:27 | 89K | |
| rxp-1.5.2.pkg | 2025-08-18 19:32 | 141K | |
| rxtx-openjdk8-2.2p2_..> | 2025-12-26 23:16 | 85K | |
| rxvt-unicode-9.31_2.pkg | 2025-12-27 15:59 | 894K | |
| rye-0.44.0_6.pkg | 2025-12-27 22:49 | 4.0M | |
| rzip-2.1_2.pkg | 2025-08-14 16:52 | 15K | |
| s-0.7.4_1.pkg | 2025-12-22 02:43 | 2.9M | |
| s-nail-14.9.25.pkg | 2025-12-20 04:44 | 556K | |
| s-news-0.1.11_6.pkg | 2025-12-21 06:30 | 47K | |
| s-tui-1.1.6_1.pkg | 2025-12-20 17:19 | 84K | |
| s2-0.12.0_1.pkg | 2025-08-15 08:57 | 970K | |
| s2n-tls-1.6.3,1.pkg | 2025-12-18 01:24 | 1.2M | |
| s2tc-1.0+20151228_5.pkg | 2025-08-17 07:54 | 91K | |
| s3m-0.13.1_5.pkg | 2025-12-30 03:11 | 1.8M | |
| s3mod-1.09_2.pkg | 2025-08-22 04:20 | 13K | |
| s5-1.1_3.pkg | 2025-08-20 03:56 | 392K | |
| s5cmd-2.3.0_11.pkg | 2025-12-21 09:19 | 4.1M | |
| s6-2.13.2.0.pkg | 2025-12-19 06:44 | 348K | |
| s6-rc-0.5.6.0.pkg | 2025-12-23 18:02 | 141K | |
| s6-rc-run-0.5.6.0.pkg | 2025-12-20 16:56 | 141K | |
| s7-11.5.20250902.pkg | 2025-12-19 21:02 | 2.1M | |
| s7-nrepl-11.5.202509..> | 2025-12-28 09:30 | 53K | |
| s10sh-0.2.2_3.pkg | 2025-12-21 02:59 | 30K | |
| s390x-binutils-2.44,..> | 2025-12-23 19:37 | 2.0M | |
| sa-stats-1.0_3.pkg | 2025-12-23 23:20 | 3.8K | |
| sa-utils-0.04.pkg | 2025-12-20 10:12 | 2.4K | |
| sa_IN-libreoffice-25..> | 2025-12-27 09:01 | 321K | |
| sablotron-1.0.3_5.pkg | 2025-12-21 05:30 | 543K | |
| sabnzbd-4.5.5.pkg | 2025-12-30 00:25 | 1.0M | |
| sabre-20100501_1.pkg | 2025-12-27 18:43 | 129K | |
| sabredav-4.6.0.pkg | 2025-12-29 16:20 | 209K | |
| sacc-1.07.pkg | 2025-08-19 10:27 | 14K | |
| sad-0.4.32_6.pkg | 2025-12-29 18:05 | 771K | |
| safe-iop-0.3.2.pkg | 2025-08-17 12:29 | 10K | |
| safe-rm-0.12.pkg | 2025-12-21 00:43 | 4.8K | |
| safecat-1.13_1.pkg | 2025-08-21 14:16 | 15K | |
| safecopy-1.7_1.pkg | 2025-08-18 10:15 | 29K | |
| safesh-1.5_1.pkg | 2025-08-17 01:41 | 8.4K | |
| saga-9.11.0.pkg | 2025-12-29 08:25 | 8.4M | |
| sagittarius-scheme-0..> | 2025-12-20 12:35 | 2.6M | |
| sake-0.15.1_19.pkg | 2025-12-23 11:02 | 2.8M | |
| sakisafe-2.5.2.pkg | 2025-12-21 15:42 | 7.7K | |
| sakura-3.8.9.pkg | 2025-12-30 17:08 | 59K | |
| salmon-1.10.3_1.pkg | 2025-12-30 03:57 | 2.3M | |
| salome-configuration..> | 2025-12-19 22:41 | 90K | |
| salome-kernel-9.11.0..> | 2025-12-28 15:19 | 4.8M | |
| sam-g20230103_1.pkg | 2025-12-29 21:13 | 109K | |
| sam2p-0.49.4_4,1.pkg | 2025-12-28 05:05 | 221K | |
| sam2pairwise-1.0.0.pkg | 2025-08-14 20:10 | 14K | |
| samba-nsupdate-9.16...> | 2025-12-21 09:19 | 1.0M | |
| samba416-4.16.11_10.pkg | 2025-12-26 11:22 | 15M | |
| samba419-4.19.9_11.pkg | 2025-12-30 00:28 | 15M | |
| samba420-4.20.8.pkg | 2025-12-28 15:08 | 16M | |
| samba422-4.22.6_6.pkg | 2025-12-29 06:41 | 17M | |
| samba423-4.23.4.pkg | 2025-12-28 14:09 | 16M | |
| samdruckerserver-0.2..> | 2025-12-28 06:24 | 5.7K | |
| sameboy-1.0.2.pkg | 2025-12-28 02:32 | 2.1M | |
| samefile-2.15_2.pkg | 2025-08-19 11:23 | 13K | |
| samesame-1.10_3.pkg | 2025-08-22 10:51 | 81K | |
| samhain-4.4.3_1.pkg | 2025-08-16 05:38 | 625K | |
| samhain-client-4.4.3..> | 2025-08-17 12:55 | 650K | |
| samhain-server-4.4.3..> | 2025-08-19 11:15 | 623K | |
| sampleicc-1.6.8_2.pkg | 2025-12-27 06:04 | 423K | |
| samplicator-1.3.8.r1..> | 2025-08-16 10:56 | 12K | |
| samplv1-lv2-1.3.2.pkg | 2025-12-30 06:50 | 386K | |
| sampsvr-0.3c_1.pkg | 2025-12-20 10:28 | 1.3M | |
| samtools-1.22.pkg | 2025-12-18 18:41 | 514K | |
| samurai-1.2.2024.09...> | 2025-08-18 00:53 | 31K | |
| sandbar-0.1.pkg | 2025-12-29 08:50 | 14K | |
| sane-airscan-0.99.36..> | 2025-12-28 12:31 | 165K | |
| sane-backends-1.4.0_..> | 2025-12-26 14:44 | 3.9M | |
| sanoid-2.3.0.pkg | 2025-12-23 10:36 | 35K | |
| sanoid-devel-1.0.0.2..> | 2025-12-21 02:05 | 30K | |
| sansi-1.0.2_1.pkg | 2025-12-19 16:38 | 3.3K | |
| sarep-1.1.pkg | 2025-12-20 08:58 | 3.7K | |
| sarg-2.4.0_4.pkg | 2025-12-30 17:16 | 554K | |
| sarien-0.7.0_3.pkg | 2025-08-17 03:25 | 75K | |
| sas2ircu-20.00.00.00..> | 2025-08-22 13:47 | 265K | |
| sash-3.8_1.pkg | 2025-08-18 12:41 | 511K | |
| sasp-0.1_5.pkg | 2025-08-20 06:52 | 5.7K | |
| sasquatch-4.3.pkg | 2025-12-20 05:10 | 114K | |
| sassc-3.6.2.pkg | 2025-08-13 05:15 | 6.1K | |
| sat-libreoffice-25.8..> | 2025-12-27 18:38 | 363K | |
| sather-specification..> | 2025-08-22 21:10 | 57K | |
| sather-tutorial-0003..> | 2025-08-17 03:05 | 232K | |
| satty-0.20.0_2.pkg | 2025-12-28 09:04 | 1.1M | |
| sauerbraten-20201221..> | 2025-12-30 12:25 | 917M | |
| savage-0.2.0_35.pkg | 2025-12-29 13:01 | 686K | |
| savelogs-1.98_1.pkg | 2025-12-23 04:46 | 64K | |
| savvycan-220,2.pkg | 2025-12-29 02:18 | 1.4M | |
| sawfish-1.13.0_3.pkg | 2025-12-27 11:39 | 2.6M | |
| sawfish-pager-0.90.3..> | 2025-12-29 06:53 | 25K | |
| sawfish-themes-0.13.pkg | 2025-12-29 21:24 | 576K | |
| saxon-he-12.8_1.pkg | 2025-12-26 16:11 | 6.6M | |
| sayonara-1.11.0.pkg | 2025-12-28 02:56 | 2.1M | |
| sbagen-1.4.5.pkg | 2025-08-17 16:09 | 84K | |
| sbcl-2.5.7,1.pkg | 2025-12-18 17:32 | 10M | |
| sbd-1.37.pkg | 2025-08-19 19:41 | 22K | |
| sblim-wbemcli-1.6.3_..> | 2025-12-20 08:17 | 119K | |
| sbm-0.8_1.pkg | 2025-08-19 09:38 | 7.3K | |
| sbt-1.11.7.pkg | 2025-12-26 22:56 | 3.3M | |
| sbxkb-0.7.6_3.pkg | 2025-12-29 04:46 | 58K | |
| sc-7.16_4.pkg | 2025-08-18 00:21 | 146K | |
| sc-aspell-1.0_1,2.pkg | 2025-12-21 07:44 | 5.1M | |
| sc-im-0.8.5_2.pkg | 2025-12-22 21:13 | 192K | |
| sc3-plugins-3.13.0.pkg | 2025-12-27 21:23 | 3.2M | |
| scala-3.3.5.pkg | 2025-12-27 09:38 | 34M | |
| scalapack-2.2.2_1.pkg | 2025-12-26 20:09 | 5.0M | |
| scalapackfx-1.2_5.pkg | 2025-12-26 20:48 | 211K | |
| scalatest-1.6.1.pkg | 2025-12-28 04:06 | 6.8M | |
| scale2x-3.1_2.pkg | 2025-12-28 06:09 | 75K | |
| scalpel-2.0_1.pkg | 2025-12-23 16:44 | 31K | |
| scam-backscatter-1.5..> | 2025-08-16 07:12 | 17K | |
| scamper-20251113.pkg | 2025-12-19 22:49 | 911K | |
| scan_ffs-1.2_1.pkg | 2025-08-18 02:33 | 6.4K | |
| scanbd-1.5.1_4.pkg | 2025-12-28 23:59 | 33K | |
| scanbuttond-0.2.3_2.pkg | 2025-08-21 18:20 | 24K | |
| scanlogd-2.2.8_3.pkg | 2025-08-16 16:58 | 8.9K | |
| scanmem-0.17_1.pkg | 2025-12-20 11:11 | 85K | |
| scantailor-1.0.19_1.pkg | 2025-12-29 17:06 | 1.1M | |
| scare-1.3.10.pkg | 2025-08-21 02:37 | 134K | |
| scavenge-2.0_1.pkg | 2025-12-21 19:35 | 3.8K | |
| scc-3.6.0_2.pkg | 2025-12-18 13:37 | 1.5M | |
| sccache-0.10.0_4,1.pkg | 2025-12-28 20:53 | 6.2M | |
| sccache-overlay-0.2...> | 2025-12-27 22:52 | 2.2M | |
| sccs-2024.03.21.pkg | 2025-12-19 22:48 | 470K | |
| scct-0.1.pkg | 2025-12-22 14:04 | 2.4K | |
| scdoc-1.11.4.pkg | 2025-12-18 11:26 | 12K | |
| scenefx04-0.4.1.pkg | 2025-12-27 13:13 | 66K | |
| scew-1.2.0.pkg | 2025-12-23 04:52 | 43K | |
| sch-rnd-1.0.10.pkg | 2025-12-30 12:44 | 1.0M | |
| schedutils-0.7.2_1.pkg | 2025-08-22 16:24 | 7.4K | |
| scheme48-1.9.2_1.pkg | 2025-08-18 11:47 | 2.2M | |
| schemesh-0.9.2.pkg | 2025-12-22 14:00 | 1.1M | |
| schilybase-2024.03.2..> | 2025-12-18 10:25 | 574K | |
| schilytools-3_1.pkg | 2025-12-28 03:10 | 1.0K | |
| schilyutils-2024.03...> | 2025-12-19 03:05 | 477K | |
| schismtracker-202510..> | 2025-12-30 18:41 | 484K | |
| scid-4.7.0.pkg | 2025-12-28 23:52 | 9.6M | |
| scidavis-2.9.2_2.pkg | 2025-12-29 10:54 | 1.7M | |
| scilab-6.1.1_24.pkg | 2025-12-27 12:52 | 66M | |
| scilab-toolbox-swt-0..> | 2025-12-30 09:34 | 715K | |
| scim-1.4.9_7.pkg | 2025-12-26 19:44 | 1.0M | |
| scim-input-pad-0.1.3..> | 2025-12-30 04:09 | 87K | |
| scim-kmfl-imengine-0..> | 2025-12-30 11:21 | 77K | |
| scim-m17n-0.2.3_10.pkg | 2025-12-29 13:36 | 31K | |
| scim-openvanilla-0.7..> | 2025-12-30 09:12 | 38K | |
| scim-table-imengine-..> | 2025-12-26 21:25 | 226K | |
| scimark2-java-2.0_2.pkg | 2025-12-30 00:20 | 32K | |
| scimark2c-2.1.pkg | 2025-08-21 10:50 | 8.2K | |
| scimark4c-4.pkg | 2025-08-17 07:20 | 9.6K | |
| scintilla-5.5.0.pkg | 2025-12-26 23:30 | 450K | |
| sciplot-plotting-lib..> | 2025-12-29 05:27 | 50K | |
| scipoptsuite-10.0.0.pkg | 2025-12-30 01:34 | 25M | |
| scite-5.5.0.pkg | 2025-12-27 22:44 | 1.5M | |
| scli-0.7.1.pkg | 2025-12-30 01:22 | 124K | |
| scloader-0.32_1.pkg | 2025-12-27 21:27 | 70K | |
| scm-5f3_2.pkg | 2025-12-19 11:10 | 401K | |
| scmxx-0.9.0_4.pkg | 2025-12-24 03:29 | 168K | |
| scons-py311-4.10.1.pkg | 2025-12-18 06:28 | 2.3M | |
| scorec-core-3.0.2.pkg | 2025-12-29 23:17 | 1.2M | |
| scotch-6.0.4.a7_6.pkg | 2025-12-26 12:30 | 2.6M | |
| scourge-0.21.1_15.pkg | 2025-12-30 03:16 | 789K | |
| scourge-data-0.21.1.pkg | 2025-08-15 22:16 | 126M | |
| scponly-4.8.20110526..> | 2025-08-20 19:20 | 23K | |
| scr2png-1.2_9.pkg | 2025-12-29 23:42 | 6.7K | |
| scr2txt-1.2_1.pkg | 2025-08-16 20:25 | 4.8K | |
| scr_ipfm-0.64.pkg | 2025-12-29 08:21 | 21K | |
| scramble-0.9.5_13.pkg | 2025-12-28 06:50 | 416K | |
| scratch-1.4.0.7_1.pkg | 2025-12-29 04:07 | 34M | |
| scrcpy-3.3.4_1.pkg | 2025-12-29 18:03 | 187K | |
| screcord-lv2-g201712..> | 2025-12-29 16:11 | 10K | |
| screen-5.0.1_5.pkg | 2025-12-19 10:53 | 498K | |
| screen-devel-5.0.1.2..> | 2025-08-20 22:48 | 561K | |
| screen-message-0.29.pkg | 2025-12-30 18:33 | 11K | |
| screenFetch-3.9.9.pkg | 2025-12-21 01:53 | 61K | |
| screenFetch-nox11-3...> | 2025-12-23 10:21 | 61K | |
| screengrab-3.1.0_1.pkg | 2025-12-27 02:43 | 192K | |
| screenie-20120406.pkg | 2025-12-23 15:25 | 3.8K | |
| screenkey-1.5_4.pkg | 2025-12-28 19:49 | 119K | |
| scribus-1.6.5.pkg | 2025-12-30 13:09 | 72M | |
| scribus-devel-1.7.1.pkg | 2025-12-28 12:30 | 72M | |
| script4rss-0.4b.pkg | 2025-12-22 14:57 | 7.7K | |
| scripts-1.0.1_2.pkg | 2025-08-16 05:38 | 6.8K | |
| scrm-1.7.4_1.pkg | 2025-08-17 00:44 | 71K | |
| scrot-1.12.1.pkg | 2025-12-29 12:16 | 75K | |
| scryer-prolog-0.10.0..> | 2025-12-30 11:22 | 13M | |
| scrypt-1.3.3.pkg | 2025-08-17 10:43 | 44K | |
| scs-3.2.9.pkg | 2025-12-30 18:53 | 196K | |
| scss-0.4.2_3.pkg | 2025-12-20 07:37 | 30K | |
| sct-1.0.0_1.pkg | 2025-08-20 04:58 | 4.7K | |
| sctd-0.2.0_46.pkg | 2025-12-30 06:25 | 299K | |
| scte35dump-0.1.8_15.pkg | 2025-12-28 03:27 | 813K | |
| scterc-0.0.1.pkg | 2025-12-23 04:56 | 3.7K | |
| sctplib-1.0.33.pkg | 2025-12-19 07:10 | 124K | |
| scummvm-2.9.1.pkg | 2025-12-27 15:58 | 93M | |
| scummvm-tools-2.9.0_..> | 2025-12-29 22:18 | 1.2M | |
| scwm-icons-0.99.2_2.pkg | 2025-08-20 08:01 | 1.3M | |
| scws-1.2.3.pkg | 2025-08-15 22:28 | 38K | |
| sd-1.0.0_20.pkg | 2025-12-28 16:34 | 697K | |
| sd-agent-1.13.4_1.pkg | 2025-12-23 11:59 | 31K | |
| sd-libreoffice-25.8...> | 2025-12-27 18:54 | 315K | |
| sd-mux-ctrl-g2020021..> | 2025-12-23 04:25 | 11K | |
| sdb-1.0.2_17.pkg | 2025-12-30 17:41 | 9.4M | |
| sdbus-cpp-2.2.1.pkg | 2025-12-20 02:47 | 192K | |
| sdcc-4.4.0.pkg | 2025-12-20 14:43 | 7.1M | |
| sdcv-0.5.5_1.pkg | 2025-12-22 05:03 | 59K | |
| sddm-0.21.0.36_2.pkg | 2025-12-30 14:56 | 3.4M | |
| sddm-freebsd-black-t..> | 2025-12-29 17:16 | 82K | |
| sdformat-8.0.0_7.pkg | 2025-12-21 19:32 | 312K | |
| sdig-0.45_3.pkg | 2025-12-30 07:09 | 52K | |
| sdl-1.2.15_17,2.pkg | 2025-12-18 08:42 | 710K | |
| sdl-ball-1.04_1.pkg | 2025-12-29 06:29 | 3.0M | |
| sdl-sopwith-2.8.0.pkg | 2025-12-28 16:15 | 77K | |
| sdl2-2.32.10.pkg | 2025-12-26 13:51 | 1.4M | |
| sdl2_gfx-1.0.4.pkg | 2025-12-26 21:02 | 48K | |
| sdl2_gpu-0.12.0.pkg | 2025-12-27 09:54 | 497K | |
| sdl2_image-2.8.8_1.pkg | 2025-12-26 15:48 | 72K | |
| sdl2_mixer-2.8.1.pkg | 2025-12-26 18:59 | 74K | |
| sdl2_net-2.2.0.pkg | 2025-12-27 03:37 | 19K | |
| sdl2_pango-2.1.5.pkg | 2025-12-26 20:53 | 11K | |
| sdl2_sound-2.0.4.pkg | 2025-12-27 12:37 | 335K | |
| sdl2_ttf-2.24.0.pkg | 2025-12-26 16:00 | 48K | |
| sdl2pp-0.18.1_2.pkg | 2025-12-27 13:01 | 74K | |
| sdl3-3.2.28.pkg | 2025-12-26 13:24 | 1.3M | |
| sdl3_image-3.2.4_1.pkg | 2025-12-26 15:54 | 75K | |
| sdl3_ttf-3.2.2_3.pkg | 2025-12-26 15:27 | 71K | |
| sdl12-compat-1.2.72.pkg | 2025-12-30 01:44 | 86K | |
| sdl_audiolib-git2022..> | 2025-12-27 04:15 | 141K | |
| sdl_console-2.1_8.pkg | 2025-12-28 09:59 | 22K | |
| sdl_gfx-2.0.27.pkg | 2025-12-18 17:21 | 63K | |
| sdl_image-1.2.12_14.pkg | 2025-12-26 18:31 | 46K | |
| sdl_jewels-1.1.1_6.pkg | 2025-12-28 01:14 | 180K | |
| sdl_lopan-10_5.pkg | 2025-12-29 23:23 | 365K | |
| sdl_mixer-1.2.12_15.pkg | 2025-12-18 17:21 | 131K | |
| sdl_net-1.2.8_3.pkg | 2025-12-20 00:01 | 16K | |
| sdl_pango-0.1.2_11.pkg | 2025-12-26 19:30 | 13K | |
| sdl_scavenger-145.20..> | 2025-12-28 06:17 | 200K | |
| sdl_sound-1.0.3_17.pkg | 2025-12-19 02:37 | 99K | |
| sdl_ttf-2.0.11_8.pkg | 2025-12-26 19:46 | 29K | |
| sdlmm-0.1.8_10.pkg | 2025-12-23 17:12 | 75K | |
| sdlpop-1.23_2.pkg | 2025-12-29 23:57 | 488K | |
| sdlroids-1.3.4_20.pkg | 2025-12-24 07:02 | 91K | |
| sdlsand-20061017_6.pkg | 2025-12-23 19:47 | 16K | |
| sdlskk-0.5_4.pkg | 2025-12-28 00:28 | 34K | |
| sdocbook-xml-1.1_2,2..> | 2025-08-10 21:08 | 16K | |
| sdom-0.5.1_2.pkg | 2025-12-22 06:19 | 39K | |
| sdorfehs-1.6_1.pkg | 2025-12-30 06:42 | 85K | |
| sdpa-7.3.17_3.pkg | 2025-12-30 12:44 | 1.2M | |
| sdparm-1.12_1.pkg | 2025-08-17 21:32 | 146K | |
| sdr++-20250105_1.pkg | 2025-12-29 22:50 | 1.6M | |
| sdsl-lite-2.3.1.v.20..> | 2025-12-19 02:02 | 410K | |
| sdump-2015.01.16_2.pkg | 2025-12-29 11:44 | 28K | |
| sdwmbar-1.5.pkg | 2025-12-28 15:25 | 3.7K | |
| se-3.0.1_1.pkg | 2025-08-19 14:04 | 74K | |
| sea-defender-0.9_5.pkg | 2025-12-28 22:39 | 111K | |
| seabattle-1.1_1.pkg | 2025-12-29 11:52 | 42K | |
| seabios-1.16.1_1.pkg | 2025-08-14 21:17 | 100K | |
| seacas-2025.10.14.pkg | 2025-12-29 20:46 | 8.3M | |
| seafile-client-9.0.6..> | 2025-12-27 05:44 | 205K | |
| seafile-gui-9.0.6_1.pkg | 2025-12-29 11:18 | 1.4M | |
| seafile-server-11.0...> | 2025-12-27 10:14 | 391K | |
| seahorse-47.0.1.pkg | 2025-12-29 23:43 | 1.2M | |
| seahub-11.0.12_1.pkg | 2025-12-29 00:35 | 14M | |
| seal-4.1.2.pkg | 2025-08-21 04:10 | 280K | |
| seatd-0.9.1_1.pkg | 2025-12-18 13:14 | 37K | |
| seatidepool-0.9.9.pkg | 2025-08-17 22:40 | 204K | |
| seaview-5.1,1.pkg | 2025-12-29 21:20 | 372K | |
| seaweedfs-3.91_7.pkg | 2025-12-24 07:35 | 29M | |
| sec-2.9.3.pkg | 2025-12-20 16:54 | 129K | |
| seccure-0.5_10.pkg | 2025-12-29 19:17 | 27K | |
| seclists-2024.1.pkg | 2025-08-18 02:49 | 462M | |
| secp256k1-0.6.0.pkg | 2025-08-14 04:23 | 1.2M | |
| secpanel-0.6.1_5,1.pkg | 2025-12-29 21:59 | 40K | |
| sectar-1.02.pkg | 2025-08-18 17:03 | 19K | |
| secure_delete-3.1_2.pkg | 2025-08-21 05:04 | 53K | |
| seda-3.0_3.pkg | 2025-12-27 20:08 | 271K | |
| sedsed-2.0.0.pkg | 2025-12-22 11:00 | 12K | |
| sedutil-1.12.pkg | 2025-08-19 12:59 | 116K | |
| see-3.1.1424_4.pkg | 2025-12-21 21:57 | 325K | |
| seed7-05.20250930.pkg | 2025-12-23 12:26 | 3.0M | |
| seejpeg-1.10_7.pkg | 2025-12-27 20:22 | 20K | |
| seer-gdb-2.4.pkg | 2025-12-29 16:15 | 901K | |
| seexpr-3.4.4.0_2.pkg | 2025-12-29 02:39 | 453K | |
| segyio-1.9.13.pkg | 2025-08-15 05:37 | 43K | |
| sekrit-twc-zimg-3.0...> | 2025-08-25 10:19 | 346K | |
| selectwm-0.4.1_12.pkg | 2025-12-30 00:56 | 14K | |
| selene-0.29.0_1.pkg | 2025-12-28 07:04 | 2.0M | |
| selenium-4.35.0.pkg | 2025-12-28 16:01 | 37M | |
| self-service-passwor..> | 2025-12-28 21:33 | 4.5M | |
| self-service-passwor..> | 2025-12-30 14:30 | 4.5M | |
| self-service-passwor..> | 2025-12-28 18:17 | 4.5M | |
| self-service-passwor..> | 2025-12-30 07:22 | 4.5M | |
| self-service-passwor..> | 2025-12-29 05:46 | 4.5M | |
| semaphore-2.9.2_20.pkg | 2025-12-29 00:00 | 4.9M | |
| semi-1.14.7.20240606..> | 2025-12-27 00:32 | 119K | |
| semi-emacs_canna-1.1..> | 2025-12-26 22:49 | 119K | |
| semi-emacs_devel-1.1..> | 2025-12-26 22:43 | 119K | |
| semi-emacs_devel_nox..> | 2025-12-18 20:27 | 119K | |
| semi-emacs_nox-1.14...> | 2025-12-18 20:47 | 119K | |
| semi-emacs_wayland-1..> | 2025-12-26 21:46 | 119K | |
| semver-1.0.0.r.pkg | 2025-12-19 22:42 | 8.7K | |
| sendEmail-1.56_2.pkg | 2025-12-21 00:00 | 26K | |
| sendSNPP-v1.03_1.pkg | 2025-12-20 10:11 | 8.3K | |
| sendip-2.5_5.pkg | 2025-12-21 03:29 | 35K | |
| sendmail-8.18.1_2.pkg | 2025-08-20 01:45 | 1.3M | |
| sendmail-devel-8.18...> | 2025-12-21 09:15 | 1.2M | |
| sendme-0.28.0_2.pkg | 2025-12-29 05:59 | 3.2M | |
| sendok-0.9.2.pkg | 2025-08-18 05:20 | 9.9K | |
| sendsms-0.2.4.pkg | 2025-12-20 07:37 | 14K | |
| sendxmpp-1.24_1.pkg | 2025-12-22 20:33 | 11K | |
| senna-1.1.5_10,1.pkg | 2025-12-26 22:05 | 616K | |
| sensors-0.6.pkg | 2025-08-19 06:45 | 3.6K | |
| sensu-go-6.9.2_21.pkg | 2025-12-21 13:14 | 6.1M | |
| sent-1_1.pkg | 2025-12-29 09:52 | 16K | |
| sentencepiece-0.2.1.pkg | 2025-12-18 18:19 | 1.1M | |
| sentinel-1.7b_5.pkg | 2025-08-22 11:34 | 39K | |
| sentry-cli-2.31.0_18..> | 2025-12-29 04:21 | 2.4M | |
| seom-2010011201_4.pkg | 2025-08-14 15:14 | 23K | |
| separate-0.5.8_7,1.pkg | 2025-12-30 16:48 | 86K | |
| seq2-0.2_2.pkg | 2025-08-21 06:34 | 6.4K | |
| seq2gif-0.10.4.pkg | 2025-08-18 12:46 | 120K | |
| seqan-2.4.0.pkg | 2025-08-18 22:29 | 4.8M | |
| seqan1-1.3.1_4.pkg | 2025-08-16 20:00 | 1.3M | |
| seqan3-3.4.0.pkg | 2025-12-28 10:28 | 626K | |
| seqkit-2.11.0_1.pkg | 2025-12-19 14:59 | 6.3M | |
| seqtk-1.5.pkg | 2025-08-15 15:00 | 33K | |
| sequeler-0.8.2_5.pkg | 2025-12-29 05:21 | 168K | |
| sequoia-2.0.0_1.pkg | 2025-12-29 01:31 | 646 | |
| sequoia-chameleon-gn..> | 2025-12-27 08:16 | 27M | |
| sequoia-sq-1.3.1_7.pkg | 2025-12-27 16:17 | 30M | |
| seqwish-0.7.11_2.pkg | 2025-12-24 01:45 | 245K | |
| ser2net-4.6.5.pkg | 2025-08-15 23:46 | 82K | |
| serd-0.32.4.pkg | 2025-08-13 12:47 | 51K | |
| serdisplib-1.97.9.pkg | 2025-08-22 18:47 | 147K | |
| serendipity-2.5.0_1.pkg | 2025-12-30 00:11 | 10M | |
| serf-1.3.10_1.pkg | 2025-12-18 07:01 | 86K | |
| serialmail-0.75_5.pkg | 2025-08-19 10:13 | 36K | |
| serialoverip-1.0.pkg | 2025-08-16 16:22 | 4.8K | |
| serveez-0.3.1_1.pkg | 2025-12-21 22:18 | 264K | |
| serviio-2.4.pkg | 2025-12-30 06:49 | 27M | |
| servlet-api-2.5_3.pkg | 2025-12-28 09:59 | 96K | |
| sessreg-1.1.2_1.pkg | 2025-08-14 08:00 | 6.0K | |
| setaudit-1.0.3_1.pkg | 2025-08-20 03:34 | 4.7K | |
| setcdboot-1.0.pkg | 2025-08-22 21:17 | 4.0K | |
| setlayout-20080210.pkg | 2025-08-17 16:36 | 2.8K | |
| sets-1.0.0_3.pkg | 2025-12-29 00:55 | 11K | |
| setsid-2.37.pkg | 2025-08-14 07:58 | 5.0K | |
| setxkbmap-1.3.4.pkg | 2025-08-13 10:16 | 11K | |
| sex-1.0_2.pkg | 2025-08-21 18:20 | 7.5K | |
| sexp-0.17.0.pkg | 2025-08-19 03:54 | 3.9M | |
| sextractor-2.5.0_3.pkg | 2025-08-21 13:35 | 193K | |
| sfcgal-2.2.0_1.pkg | 2025-12-18 01:46 | 2.7M | |
| sfeed-2.2.pkg | 2025-08-22 11:24 | 91K | |
| sff-1.2.pkg | 2025-12-22 15:35 | 35K | |
| sfft-0.1.0_14.pkg | 2025-12-29 23:26 | 165K | |
| sfizz-1.2.3_1.pkg | 2025-12-27 02:13 | 909K | |
| sflowtool-6.09.pkg | 2025-12-21 05:11 | 52K | |
| sfm-0.4.pkg | 2025-08-21 09:12 | 29K | |
| sfront-0.99.pkg | 2025-08-19 08:49 | 489K | |
| sfsexp-1.4.1.pkg | 2025-08-13 18:07 | 36K | |
| sftpgo-2.6.6_3.pkg | 2025-08-17 21:21 | 16M | |
| sfwbar-1.0.b16.1.pkg | 2025-12-29 13:44 | 285K | |
| sfwbar-nopulse-1.0.b..> | 2025-12-27 20:43 | 279K | |
| sg3_utils-1.48_2.pkg | 2025-08-14 01:05 | 954K | |
| sgb-20090810_1.pkg | 2025-08-19 21:35 | 284K | |
| sgf2tex-3.3_7.pkg | 2025-12-30 09:31 | 66K | |
| sgifonts-1.0.1_5.pkg | 2025-12-28 03:27 | 146K | |
| sgmlformat-1.7_8.pkg | 2025-12-19 20:51 | 92K | |
| sgmls-1.1.91_3.pkg | 2025-08-13 14:00 | 115K | |
| sgrep2-1.94a_1.pkg | 2025-08-15 23:22 | 75K | |
| sgt-puzzles-20251211..> | 2025-12-28 06:00 | 2.7M | |
| sgwi-1.1.8_1.pkg | 2025-12-29 18:07 | 11K | |
| sha1collisiondetecti..> | 2025-08-19 15:09 | 18K | |
| sha2wordlist-1.0.201..> | 2025-08-21 17:13 | 10K | |
| shaderbg-s20230316.pkg | 2025-12-21 03:28 | 9.9K | |
| shaderc-2025.5_1.pkg | 2025-12-24 21:52 | 3.3M | |
| shadered-1.5.6.pkg | 2025-12-30 16:14 | 5.7M | |
| shadowsocks-rust-1.2..> | 2025-12-29 22:20 | 12M | |
| shairplay-0.9.0.2015..> | 2025-12-24 05:31 | 91K | |
| shairport-sync-4.3.7..> | 2025-12-28 07:50 | 148K | |
| shapelib-1.6.2.pkg | 2025-12-19 05:27 | 101K | |
| shards-0.19.1_1.pkg | 2025-12-19 13:26 | 416K | |
| shared-color-profile..> | 2025-08-20 00:06 | 5.8M | |
| shared-mime-info-2.4..> | 2025-12-16 01:47 | 625K | |
| sharedance-0.6_7.pkg | 2025-08-17 10:13 | 10K | |
| sharefonts-0.10_8.pkg | 2025-12-30 04:17 | 693K | |
| sharpconstruct-0.11_..> | 2025-12-29 00:15 | 284K | |
| sharutils-4.15.2_4.pkg | 2025-12-19 15:16 | 232K | |
| shc-4.0.3_1.pkg | 2025-08-13 11:57 | 19K | |
| shed-1.17.pkg | 2025-12-22 06:55 | 20K | |
| shed-skin-0.9.11.pkg | 2025-12-20 17:17 | 540K | |
| sheldon-0.8.5_4.pkg | 2025-12-28 21:55 | 1.4M | |
| shell-hist-g20190515..> | 2025-12-27 20:49 | 508K | |
| shell-toolbox-201905..> | 2025-08-21 13:35 | 11K | |
| shellbench-20200806.pkg | 2025-08-19 05:24 | 5.7K | |
| shelldap-1.5.1_1.pkg | 2025-12-23 11:39 | 26K | |
| shellharden-4.3.1_15..> | 2025-12-29 19:04 | 159K | |
| shellinabox-2.20_6.pkg | 2025-08-17 21:27 | 117K | |
| shelxle-1.0.1703.pkg | 2025-12-30 14:20 | 3.8M | |
| sherlock-lv2-0.28.0_..> | 2025-12-27 20:57 | 263K | |
| shflags-1.3.0.pkg | 2025-08-16 03:39 | 10K | |
| shfmt-3.12.0_7.pkg | 2025-12-19 07:10 | 1.0M | |
| shibboleth-idp-5.1.6..> | 2025-12-30 10:44 | 42M | |
| shibboleth-sp-3.5.2.pkg | 2025-12-30 05:06 | 1.1M | |
| shikane-1.0.1_14.pkg | 2025-12-28 14:18 | 1.2M | |
| shimmy-1.8.2_1.pkg | 2025-12-30 01:41 | 5.8M | |
| shiori-1.8.0.pkg | 2025-12-21 02:47 | 9.6M | |
| shlock-2.7.3.pkg | 2025-08-22 20:51 | 10K | |
| shmap-0.3.2_2.pkg | 2025-08-20 08:48 | 26K | |
| shmcat-1.8_1.pkg | 2025-12-23 13:48 | 16K | |
| shmux-1.0.3_1.pkg | 2025-08-18 15:28 | 37K | |
| shntool-3.0.10_4.pkg | 2025-08-19 23:42 | 65K | |
| shockolate-0.8.2.43_..> | 2025-12-29 04:15 | 666K | |
| shootingstar-1.2.0_1..> | 2025-12-30 08:56 | 7.3M | |
| shortwave-5.0.0_6.pkg | 2025-12-28 11:09 | 3.1M | |
| shotcut-22.06.23_2.pkg | 2025-12-30 16:25 | 2.2M | |
| shotcut-qt6-25.08.16..> | 2025-12-30 10:48 | 8.6M | |
| shotman-0.4.10_4.pkg | 2025-12-27 21:39 | 655K | |
| shotwell-0.32.14.pkg | 2025-12-28 02:41 | 3.1M | |
| showfont-1.0.5_1.pkg | 2025-08-18 13:10 | 7.1K | |
| showkey-1.9.pkg | 2025-08-16 23:09 | 5.3K | |
| showkeys-g20191004.pkg | 2025-08-17 23:18 | 4.8K | |
| showmethekey-1.18.4.pkg | 2025-12-29 15:24 | 53K | |
| showtime-48.1.pkg | 2025-12-30 10:32 | 82K | |
| shrinkpdf-1.2,1.pkg | 2025-12-30 01:45 | 4.8K | |
| shroud-wrapper-gener..> | 2025-12-24 05:15 | 379K | |
| shtk-1.7.pkg | 2025-08-19 12:41 | 117K | |
| shtool-2.0.8_1.pkg | 2025-12-21 15:56 | 95K | |
| shuf-3.0.pkg | 2025-08-14 19:37 | 7.3K | |
| shuffle-20010603_1.pkg | 2025-08-22 10:20 | 5.7K | |
| shuffle-db-1.0.r1_1.pkg | 2025-12-22 01:19 | 7.1K | |
| shunit2-2.1.8.93.pkg | 2025-12-22 04:14 | 8.3K | |
| shuriken-0.5.2.5_2.pkg | 2025-12-29 15:20 | 893K | |
| si-libreoffice-25.8...> | 2025-12-27 13:21 | 2.9M | |
| siconos-4.5.0_3.pkg | 2025-12-29 15:50 | 2.3M | |
| sid-libreoffice-25.8..> | 2025-12-27 04:02 | 2.9M | |
| sid-milter-1.0.0_9.pkg | 2025-08-19 10:15 | 87K | |
| sidplayer-4.4_9.pkg | 2025-12-22 17:31 | 105K | |
| sidplayfp-2.15.2.pkg | 2025-12-27 22:33 | 82K | |
| sie-nmsg-1.3.1_4.pkg | 2025-12-19 12:46 | 18K | |
| siege-4.1.7.pkg | 2025-12-21 20:59 | 92K | |
| siegfried-1.11.2_11.pkg | 2025-12-23 07:32 | 2.7M | |
| sierra-gtk-themes-20..> | 2025-12-30 02:36 | 670K | |
| siesta-4.1.5_3.pkg | 2025-12-30 16:23 | 2.9M | |
| sieve-connect-0.90_1..> | 2025-12-21 07:13 | 51K | |
| sift-0.9.1_2.pkg | 2025-12-21 13:07 | 1.2M | |
| sig2dot-0.35.pkg | 2025-12-21 07:24 | 5.0K | |
| sigar-1.7.3_2.pkg | 2025-08-14 03:08 | 88K | |
| sigdigger-0.3.0.1_2.pkg | 2025-12-30 16:50 | 6.2M | |
| sigi-3.7.1_14.pkg | 2025-12-28 10:53 | 479K | |
| sigil-2.7.0.pkg | 2025-12-29 12:15 | 6.3M | |
| signal-cli-0.13.20,1..> | 2025-12-27 12:19 | 57M | |
| signal-desktop-7.82...> | 2025-12-30 09:28 | 115M | |
| signal-sqlcipher-ext..> | 2025-12-26 20:23 | 391K | |
| signify-0.14,1.pkg | 2025-08-13 17:59 | 61K | |
| signing-party-2.10_1..> | 2025-12-28 23:24 | 116K | |
| signon-kwallet-exten..> | 2025-12-30 02:40 | 11K | |
| signon-plugin-oauth2..> | 2025-12-28 13:09 | 63K | |
| signon-plugin-oauth2..> | 2025-12-26 20:12 | 68K | |
| signon-qt5-8.61.pkg | 2025-12-26 23:54 | 370K | |
| signon-qt6-8.61.pkg | 2025-12-26 05:38 | 441K | |
| sigrok-cli-0.7.2_2.pkg | 2025-12-22 07:13 | 41K | |
| sigrok-firmware-2015..> | 2025-12-21 07:47 | 307K | |
| sigrok-firmware-fx2l..> | 2025-08-15 01:07 | 10K | |
| sigrok-firmware-util..> | 2025-12-19 08:16 | 10K | |
| sigrot-1.0_1.pkg | 2025-08-18 23:19 | 5.6K | |
| sigslot-1.0.0.pkg | 2025-08-17 23:21 | 5.4K | |
| sigutils-0.3.0_1.pkg | 2025-12-26 22:52 | 80K | |
| sigviewer-0.6.4.13_2..> | 2025-12-28 12:49 | 299K | |
| silentbob-3.2.pkg | 2025-08-16 00:49 | 41K | |
| silgraphite-2.3.1_4.pkg | 2025-12-27 18:46 | 294K | |
| silice-g20221229_1.pkg | 2025-12-29 19:52 | 1.2M | |
| silicon-0.1.124.pkg | 2025-08-18 02:04 | 42K | |
| silicon-code-visuali..> | 2025-12-29 16:23 | 3.6M | |
| silktools-3.22.2.pkg | 2025-12-19 20:59 | 1.7M | |
| silo-4.12.0.pkg | 2025-12-26 19:29 | 597K | |
| silq-20250624_1.pkg | 2025-08-16 15:55 | 1.1M | |
| simage-1.7.0_12.pkg | 2025-12-26 16:55 | 87K | |
| simavr-1.7_3.pkg | 2025-08-22 10:49 | 777K | |
| simbody-3.7_8.pkg | 2025-12-27 11:35 | 20M | |
| simd-viterbi-2.0.3_2..> | 2025-08-17 22:30 | 10K | |
| simde-0.8.2.pkg | 2025-08-14 07:14 | 450K | |
| simdjson-4.2.4.pkg | 2025-12-24 21:55 | 266K | |
| simdutf-7.7.1.pkg | 2025-12-30 03:58 | 199K | |
| simgear-2024.1.1_1.pkg | 2025-12-27 11:44 | 2.4M | |
| simh-3.9.0_6.pkg | 2025-08-18 05:14 | 3.7M | |
| simh-hp2100-3.11.0.3..> | 2025-08-21 02:26 | 826K | |
| simh-hp3000-3.11.0.1..> | 2025-08-16 14:31 | 490K | |
| simh-hpdoc-3.11.0_1.pkg | 2025-08-14 23:27 | 443K | |
| simian-2.5.10.pkg | 2025-12-29 20:02 | 145K | |
| simint-0.8.pkg | 2025-08-19 00:20 | 5.3M | |
| simlib-3.06.pkg | 2025-08-18 04:56 | 883K | |
| simple-dftd3-1.1.1_2..> | 2025-12-27 01:33 | 555K | |
| simple-fb2-reader-1...> | 2025-12-30 18:28 | 36K | |
| simple-scan-46.0.pkg | 2025-12-30 07:23 | 1.0M | |
| simple-web-server-3...> | 2025-08-18 19:33 | 19K | |
| simpleagenda-0.46_2.pkg | 2025-12-27 17:49 | 169K | |
| simpleini-4.24.pkg | 2025-12-19 21:42 | 27K | |
| simpleirc-1.3_1.pkg | 2025-08-20 08:15 | 6.9K | |
| simpleitk-2.3.1.pkg | 2025-12-28 20:45 | 42M | |
| simplemod-1.1_1.pkg | 2025-08-14 17:25 | 3.4K | |
| simpleproxy-3.4_2.pkg | 2025-08-18 18:01 | 12K | |
| simplescreenrecorder..> | 2025-12-28 02:30 | 1.3M | |
| simplesnap-2.1.3.pkg | 2025-12-30 03:52 | 16K | |
| simplestroke-1.3.1.pkg | 2025-08-16 14:37 | 10K | |
| simplevaders-0.8.1_1..> | 2025-12-30 11:04 | 341K | |
| simpleviewer-3.1.9_5..> | 2025-12-29 06:29 | 676K | |
| simplomon-g20250224.pkg | 2025-12-21 15:39 | 2.6M | |
| simscan-1.4.6.2.pkg | 2025-08-17 00:45 | 25K | |
| simsmith-9.9_1.pkg | 2025-12-30 08:28 | 3.4M | |
| simsu-1.4.6.pkg | 2025-12-30 05:40 | 279K | |
| simutrans-124.3.1_1.pkg | 2025-12-29 05:25 | 3.1M | |
| simutrans-pak64-124...> | 2025-08-16 10:51 | 3.7M | |
| simutrans-pak128-2.1..> | 2025-08-15 13:33 | 38M | |
| simutrans-pak128.ger..> | 2025-08-21 07:59 | 192M | |
| since-1.1_1.pkg | 2025-08-17 23:58 | 14K | |
| sing-box-1.12.13.pkg | 2025-12-20 07:55 | 5.5M | |
| singular-4.4.1.pkg | 2025-12-27 23:49 | 12M | |
| siod-3.6.2_2.pkg | 2025-08-18 14:26 | 230K | |
| sioyek-2.0.0.2025051..> | 2025-12-27 21:51 | 1.4M | |
| sipcalc-1.1.6_1.pkg | 2025-08-17 21:13 | 30K | |
| sipp-3.5.1_7.pkg | 2025-08-16 17:55 | 188K | |
| siproxd-0.8.3.pkg | 2025-12-21 18:38 | 126K | |
| sipsak-0.9.8.1_1.pkg | 2025-12-22 07:27 | 47K | |
| siren-0.11_1.pkg | 2025-12-29 05:27 | 68K | |
| siril-1.2.6_1.pkg | 2025-12-30 07:16 | 2.3M | |
| sirius-quantum-chemi..> | 2025-12-30 00:34 | 2.5M | |
| sirula-1.1.0_8.pkg | 2025-12-29 00:56 | 600K | |
| sisc-1.16.6_3.pkg | 2025-12-30 00:26 | 743K | |
| sisl-4.6.0.44.pkg | 2025-08-16 02:59 | 516K | |
| sispmctl-4.12.pkg | 2025-08-15 23:51 | 19K | |
| sjasmplus-1.20.3.pkg | 2025-08-20 17:06 | 351K | |
| sjeng-11.2_3.pkg | 2025-12-21 02:19 | 74K | |
| sjitter-0.18.1b.pkg | 2025-08-16 17:04 | 7.5K | |
| sk-aspell-2.01.2,1.pkg | 2025-12-23 15:50 | 1.3M | |
| sk-hunspell-20110228..> | 2025-08-18 14:02 | 717K | |
| sk-hyphen-2004.04.15..> | 2025-08-20 01:41 | 6.0K | |
| sk-libreoffice-25.8...> | 2025-12-27 02:39 | 3.5M | |
| sk-mythes-2024.02.19..> | 2025-08-17 02:36 | 155K | |
| skalibs-2.14.4.0.pkg | 2025-12-18 17:54 | 239K | |
| skanlite-25.12.0.pkg | 2025-12-27 00:04 | 2.4M | |
| skanpage-25.12.0.pkg | 2025-12-29 00:16 | 214K | |
| skem-1.0.2_4.pkg | 2025-08-21 06:30 | 16K | |
| sketchy-20070218_2.pkg | 2025-08-18 03:08 | 297K | |
| skeuos-gtk-themes-20..> | 2025-08-16 21:04 | 1.2M | |
| ski-6.13_1.pkg | 2025-12-20 04:27 | 18K | |
| skia-140_1.pkg | 2025-12-29 05:39 | 2.7M | |
| skim-fuzzy-finder-0...> | 2025-12-28 08:07 | 1.0M | |
| skinlf-6.7.pkg | 2025-12-26 21:36 | 310K | |
| skippy-xd-0.5.0_3.pkg | 2025-12-30 04:41 | 48K | |
| skladnik-25.12.0.pkg | 2025-12-26 20:44 | 456K | |
| skopeo-1.21.0.pkg | 2025-12-20 00:46 | 16M | |
| skypat-3.2.0.pkg | 2025-12-21 21:37 | 458K | |
| sl-5.02_1.pkg | 2025-08-19 08:33 | 8.2K | |
| sl-aspell-0.50.0_1,1..> | 2025-12-22 12:21 | 5.6M | |
| sl-hunspell-2020.12...> | 2025-08-16 18:42 | 947K | |
| sl-hyphen-2007.01.27..> | 2025-08-18 12:47 | 3.5K | |
| sl-libreoffice-25.8...> | 2025-12-27 09:04 | 3.5M | |
| sl-mythes-2016.06.30..> | 2025-08-19 05:20 | 277K | |
| sl2tps-0.4.2_3.pkg | 2025-12-23 02:30 | 13K | |
| slack-0.15.2_4.pkg | 2025-12-22 04:28 | 38K | |
| slack-term-0.5.0_34.pkg | 2025-12-24 06:58 | 2.7M | |
| slackcat-1.7.3_32.pkg | 2025-12-22 11:24 | 2.9M | |
| slade-3.1.13_5.pkg | 2025-12-28 12:02 | 5.6M | |
| slashem-tty-0.0.7E.7..> | 2025-08-15 23:47 | 1.2M | |
| slatec-4.1_13.pkg | 2025-12-29 19:08 | 1.6M | |
| slclust-2010.02.02.pkg | 2025-08-17 09:40 | 14K | |
| sleef-3.9.0_1.pkg | 2025-12-18 03:55 | 769K | |
| slepc-3.22.2_2.pkg | 2025-12-26 22:20 | 8.0M | |
| sleuth-1.4.4.pkg | 2025-12-22 00:20 | 8.8K | |
| sleuthkit-4.12.1.pkg | 2025-12-21 11:33 | 1.7M | |
| slf4j-1.7.36.pkg | 2025-12-26 17:05 | 170K | |
| slgrace-0.2.2_11.pkg | 2025-12-29 23:23 | 21K | |
| slib-3c1.pkg | 2025-08-13 23:15 | 541K | |
| slib-guile18-3b7.pkg | 2025-12-23 18:02 | 819 | |
| slib-guile22-3b7.pkg | 2025-12-21 01:47 | 818 | |
| slib-guile30-3b7.pkg | 2025-12-23 04:58 | 820 | |
| slibtool-0.7.4.pkg | 2025-12-22 15:43 | 93K | |
| slick-greeter-2.2.5.pkg | 2025-12-30 15:56 | 305K | |
| sliderule-1.0_12.pkg | 2025-08-18 10:03 | 23K | |
| slides-3.4.0_1.pkg | 2025-08-19 01:19 | 168K | |
| slides-presentation-..> | 2025-12-21 06:32 | 4.9M | |
| slim-1.3.6_26.pkg | 2025-12-27 11:37 | 253K | |
| slim-freebsd-black-t..> | 2025-12-30 16:45 | 71K | |
| slim-freebsd-dark-th..> | 2025-12-28 12:22 | 70K | |
| slim-freebsd-themes-..> | 2025-12-30 18:05 | 189K | |
| slim-themes-1.0.1_2.pkg | 2025-12-29 04:01 | 4.9M | |
| slime-2.26.1.9_15.pkg | 2025-12-28 20:10 | 745K | |
| slime-emacs_canna-2...> | 2025-12-30 06:42 | 745K | |
| slime-emacs_devel-2...> | 2025-12-29 07:09 | 743K | |
| slime-emacs_devel_no..> | 2025-12-20 19:01 | 743K | |
| slime-emacs_nox-2.26..> | 2025-12-22 05:09 | 745K | |
| slime-emacs_wayland-..> | 2025-12-30 10:37 | 745K | |
| slimta-0.9.1_2.pkg | 2025-12-28 14:06 | 47K | |
| slisp-1.2_2.pkg | 2025-08-22 22:29 | 16K | |
| sloccount-2.26_2.pkg | 2025-12-23 19:18 | 95K | |
| slock-1.5_1.pkg | 2025-08-17 20:47 | 6.2K | |
| slony1v2-2.2.11.pkg | 2025-12-23 18:09 | 419K | |
| slop-7.7.pkg | 2025-08-15 00:10 | 98K | |
| slowcat-2.2.pkg | 2025-12-19 03:03 | 1.8K | |
| slowcgi-7.1.20220916..> | 2025-08-16 04:21 | 12K | |
| slowhttptest-1.9.0_1..> | 2025-08-16 00:55 | 28K | |
| slowloris-0.7_2.pkg | 2025-12-20 16:33 | 6.7K | |
| slrn-1.0.3a_2.pkg | 2025-12-29 20:10 | 542K | |
| slrnface-2.1.1_7.pkg | 2025-12-21 03:26 | 15K | |
| sls-1.00_1.pkg | 2025-08-16 04:29 | 17K | |
| sltdl-0.5.2.pkg | 2025-08-18 14:34 | 14K | |
| slump-0.003.02.pkg | 2025-08-16 05:59 | 102K | |
| slurm-0.4.4_2.pkg | 2025-08-21 09:16 | 29K | |
| slurm-wlm-25.11.0_1.pkg | 2025-12-26 08:40 | 7.8M | |
| slurp-1.5.0_1.pkg | 2025-12-27 03:51 | 16K | |
| sly-1.0.43.20240809_..> | 2025-12-27 03:42 | 1.5M | |
| sly-asdf-0.2.0.20221..> | 2025-12-30 18:57 | 16K | |
| sly-asdf-emacs_canna..> | 2025-12-30 14:48 | 16K | |
| sly-asdf-emacs_devel..> | 2025-12-28 13:12 | 16K | |
| sly-asdf-emacs_devel..> | 2025-12-21 07:53 | 16K | |
| sly-asdf-emacs_nox-0..> | 2025-12-20 08:15 | 16K | |
| sly-asdf-emacs_wayla..> | 2025-12-29 00:14 | 16K | |
| sly-emacs_canna-1.0...> | 2025-12-27 19:44 | 1.5M | |
| sly-emacs_devel-1.0...> | 2025-12-27 16:01 | 1.5M | |
| sly-emacs_devel_nox-..> | 2025-12-19 20:56 | 1.5M | |
| sly-emacs_nox-1.0.43..> | 2025-12-19 12:28 | 1.5M | |
| sly-emacs_wayland-1...> | 2025-12-27 09:50 | 1.5M | |
| sly-named-readtables..> | 2025-12-30 03:54 | 29K | |
| sly-named-readtables..> | 2025-12-27 20:27 | 29K | |
| sly-named-readtables..> | 2025-12-27 20:42 | 29K | |
| sly-named-readtables..> | 2025-12-21 13:18 | 29K | |
| sly-named-readtables..> | 2025-12-22 02:53 | 29K | |
| sly-named-readtables..> | 2025-12-29 04:49 | 29K | |
| sly-quicklisp-202112..> | 2025-12-29 06:28 | 47K | |
| sly-quicklisp-emacs_..> | 2025-12-30 00:36 | 47K | |
| sly-quicklisp-emacs_..> | 2025-12-29 03:21 | 47K | |
| sly-quicklisp-emacs_..> | 2025-12-23 19:10 | 47K | |
| sly-quicklisp-emacs_..> | 2025-12-23 16:11 | 47K | |
| sly-quicklisp-emacs_..> | 2025-12-28 18:11 | 47K | |
| sma-1.4_1.pkg | 2025-08-20 23:55 | 39K | |
| smake-2024.03.21.pkg | 2025-12-18 13:34 | 58K | |
| smalltalk-3.2.5_19.pkg | 2025-12-28 07:48 | 2.5M | |
| smart-0.4.1_2.pkg | 2025-08-14 19:07 | 18K | |
| smartctl_exporter-0...> | 2025-12-22 13:24 | 3.8M | |
| smartirc4net-1.1_3.pkg | 2025-12-22 10:55 | 90K | |
| smartmontools-7.5_1.pkg | 2025-12-18 17:20 | 591K | |
| smarty-php81-5.7.0.pkg | 2025-12-28 14:49 | 132K | |
| smarty-php82-5.7.0.pkg | 2025-12-29 16:37 | 132K | |
| smarty-php83-5.7.0.pkg | 2025-12-27 19:55 | 132K | |
| smarty-php84-5.7.0.pkg | 2025-12-29 03:52 | 132K | |
| smarty-php85-5.7.0.pkg | 2025-12-28 16:51 | 132K | |
| smarty3-php81-3.1.48..> | 2025-12-27 09:47 | 145K | |
| smarty3-php82-3.1.48..> | 2025-12-27 03:48 | 145K | |
| smarty3-php83-3.1.48..> | 2025-12-27 17:03 | 145K | |
| smarty3-php84-3.1.48..> | 2025-12-27 07:28 | 145K | |
| smarty3-php85-3.1.48..> | 2025-12-27 14:55 | 146K | |
| smarty4-php81-4.5.6.pkg | 2025-12-29 13:21 | 144K | |
| smarty4-php82-4.5.6.pkg | 2025-12-30 01:02 | 144K | |
| smarty4-php83-4.5.6.pkg | 2025-12-28 09:34 | 144K | |
| smarty4-php84-4.5.6.pkg | 2025-12-28 14:38 | 144K | |
| smarty4-php85-4.5.6.pkg | 2025-12-30 12:26 | 144K | |
| smb4k-4.0.5.pkg | 2025-12-29 10:46 | 5.0M | |
| smb_auth-0.05_10.pkg | 2025-12-29 07:18 | 8.0K | |
| smbftpd-2.4_2.pkg | 2025-12-21 09:25 | 59K | |
| smbldap-tools-0.9.11..> | 2025-12-21 17:29 | 266K | |
| smc-4.3.0_2.pkg | 2025-12-29 13:07 | 807K | |
| smcroute-2.5.7.pkg | 2025-08-18 12:25 | 63K | |
| smenu-1.3.0_1.pkg | 2025-08-18 15:34 | 109K | |
| smfsav-1.4.0_4.pkg | 2025-08-18 04:36 | 18K | |
| smfsav-devel-2.1_2.pkg | 2025-08-17 03:30 | 19K | |
| smhasher-1.0_1.pkg | 2025-08-22 14:48 | 94K | |
| smi-1.4_3.pkg | 2025-08-17 04:05 | 11K | |
| smithwaterman-g20160..> | 2025-08-14 05:58 | 64K | |
| smlnj-110.99.6.1.pkg | 2025-08-20 22:56 | 8.0M | |
| smm++-6.1.1_1.pkg | 2025-12-28 09:00 | 181K | |
| smokeping-2.9.0.pkg | 2025-12-30 07:26 | 425K | |
| smoldyn-2.75.pkg | 2025-12-29 18:07 | 957K | |
| smooth-0.9.10_4.pkg | 2025-12-27 01:20 | 466K | |
| smp_utils-0.99_1.pkg | 2025-08-22 01:19 | 176K | |
| smpeg-0.4.4_18.pkg | 2025-12-18 11:57 | 145K | |
| smpeg2-2.0.0_5.pkg | 2025-12-26 22:10 | 149K | |
| smplayer-25.6.0.pkg | 2025-12-28 09:33 | 3.4M | |
| smplayer-skins-20.11..> | 2025-08-14 16:10 | 474K | |
| smplayer-themes-20.1..> | 2025-08-14 15:34 | 2.5M | |
| smpq-1.6.pkg | 2025-12-21 21:48 | 16K | |
| smproxy-1.0.6_1.pkg | 2025-08-13 23:27 | 10K | |
| smstools-3.1.21_1.pkg | 2025-08-16 20:19 | 273K | |
| smtp-cli-3.6.pkg | 2025-12-21 00:57 | 11K | |
| smtpfeed-1.23_1.pkg | 2025-08-22 21:37 | 75K | |
| smtpmail-0.4.5.pkg | 2025-08-18 00:46 | 10K | |
| smtprc-2.0.3_1.pkg | 2025-08-18 03:34 | 31K | |
| smtprelay-1.13.0_1.pkg | 2025-12-21 19:35 | 2.2M | |
| smtptrapd-1.6_1.pkg | 2025-08-18 00:38 | 7.8K | |
| smu-1.5_1.pkg | 2025-08-19 21:34 | 8.4K | |
| smug-0.3.11_2.pkg | 2025-12-21 02:55 | 1.0M | |
| smurflog-2.1_1.pkg | 2025-08-17 22:00 | 6.4K | |
| smuxi-1.2.1_2.pkg | 2025-12-28 18:23 | 2.4M | |
| smv-2.5.4.3_11.pkg | 2025-12-28 07:15 | 205K | |
| snac-2.84.pkg | 2025-12-23 00:47 | 207K | |
| snack-2.2.10_7.pkg | 2025-12-27 15:38 | 287K | |
| snakemake-6.15.5_4.pkg | 2025-12-29 16:59 | 637K | |
| snap-1.01_1,1.pkg | 2025-12-22 05:03 | 6.2K | |
| snap7-1.4.2.pkg | 2025-08-20 03:47 | 84K | |
| snapcast-0.34.0.pkg | 2025-12-29 07:15 | 1.0M | |
| snappy-1.2.2.pkg | 2025-08-13 03:57 | 28K | |
| snappyjava-1.1.10.8.pkg | 2025-08-15 20:41 | 2.3M | |
| snappymail-php81-2.3..> | 2025-12-29 04:06 | 5.6M | |
| snappymail-php82-2.3..> | 2025-12-29 22:21 | 5.6M | |
| snappymail-php83-2.3..> | 2025-12-29 12:43 | 5.6M | |
| snappymail-php84-2.3..> | 2025-12-29 19:49 | 5.6M | |
| snappymail-php85-2.3..> | 2025-12-28 12:37 | 5.6M | |
| snapraid-13.0.pkg | 2025-12-20 14:49 | 288K | |
| snarf-7.0.pkg | 2025-08-20 00:06 | 15K | |
| snazy-0.58.1_1.pkg | 2025-12-30 17:23 | 882K | |
| snd-25.7.pkg | 2025-12-28 01:19 | 7.9M | |
| sndio-1.10.0_1.pkg | 2025-12-16 01:29 | 122K | |
| sndy-0.0.6.pkg | 2025-12-28 01:28 | 2.9K | |
| snes9x-gtk-1.63_1.pkg | 2025-12-28 01:03 | 3.3M | |
| sngrep-1.7.0_1.pkg | 2025-08-18 09:06 | 78K | |
| sniffglue-0.16.1_10.pkg | 2025-12-30 17:30 | 901K | |
| sniffit-0.7.pkg | 2025-12-22 15:34 | 46K | |
| sniffnet-1.4.2_2.pkg | 2025-12-29 16:44 | 16M | |
| sniproxy-0.6.1_2.pkg | 2025-12-23 23:53 | 32K | |
| snitch-testing-1.3.2..> | 2025-08-21 10:18 | 96K | |
| snitch-testing-heade..> | 2025-08-22 22:05 | 40K | |
| snmp_exporter-0.29.0..> | 2025-12-29 16:18 | 5.4M | |
| snmp_exporter20-0.20..> | 2025-12-27 22:09 | 5.0M | |
| snmptt-1.5_1.pkg | 2025-12-28 23:56 | 103K | |
| snns-4.3_1.pkg | 2025-12-21 01:48 | 1.5M | |
| snobol4-2.3.1_3.pkg | 2025-12-21 16:06 | 344K | |
| snoopy-2.5.2.pkg | 2025-08-16 00:48 | 47K | |
| snooze-0.5_1.pkg | 2025-08-14 18:29 | 11K | |
| snort-2.9.20_3.pkg | 2025-12-19 23:03 | 3.1M | |
| snort-rep-1.10_1.pkg | 2025-12-24 04:42 | 15K | |
| snort2pfcd-3.2_1.pkg | 2025-12-23 21:49 | 19K | |
| snort3-3.10.0.0,1.pkg | 2025-12-30 07:00 | 2.4M | |
| snortsam-2.70_1.pkg | 2025-08-18 22:12 | 99K | |
| snortsnarf-1.0_1,1.pkg | 2025-12-20 10:44 | 144K | |
| snowballstemmer-3.0...> | 2025-08-13 03:54 | 161K | |
| sntop-1.4.3_2.pkg | 2025-08-16 16:02 | 22K | |
| snzip-1.0.5.pkg | 2025-08-16 04:23 | 38K | |
| so-0.4.6_33.pkg | 2025-12-30 11:56 | 1.5M | |
| so-hunspell-1.0.2_1.pkg | 2025-08-21 14:43 | 75K | |
| so-synth-lv2-1.5.pkg | 2025-08-18 10:23 | 10K | |
| soapui-5.5.0.pkg | 2025-12-29 15:41 | 46M | |
| sobjectizer-5.8.3.pkg | 2025-08-13 17:28 | 814K | |
| socat-1.8.1.0.pkg | 2025-12-19 00:15 | 216K | |
| soci-4.0.3_13.pkg | 2025-12-18 16:38 | 435K | |
| sock-0.4.2.pkg | 2025-08-22 15:41 | 16K | |
| sockaddr-1.0.7_11.pkg | 2025-12-23 11:13 | 2.2M | |
| socket_wrapper-1.5.2..> | 2025-12-27 15:01 | 44K | |
| socketapi-2.2.26.pkg | 2025-12-21 02:31 | 173K | |
| socketbind-1_1.pkg | 2025-08-20 22:51 | 2.9K | |
| socketpipe-1.10_1.pkg | 2025-08-22 07:13 | 9.0K | |
| socketw-3.10.27.pkg | 2025-08-17 04:31 | 35K | |
| socklog-2.1.0_2.pkg | 2025-08-17 11:48 | 50K | |
| sofa-20231011.pkg | 2025-08-14 10:26 | 133K | |
| sofia-sip-1.13.17.pkg | 2025-12-18 21:09 | 1.1M | |
| soft-serve-0.7.6_12.pkg | 2025-12-20 06:30 | 7.8M | |
| softether-4.44.9807.pkg | 2025-12-22 16:54 | 3.0M | |
| softether5-5.02.5185..> | 2025-12-23 19:13 | 3.5M | |
| softflowd-1.0.0_1.pkg | 2025-08-19 06:46 | 35K | |
| softhsm2-2.6.1_4.pkg | 2025-12-23 13:22 | 593K | |
| sogo-mysql-5.12.4.pkg | 2025-12-28 12:25 | 20M | |
| sogo-mysqlactivesync..> | 2025-12-29 18:00 | 20M | |
| sogo-pgsql-5.12.4.pkg | 2025-12-28 06:10 | 20M | |
| sogo-pgsqlactivesync..> | 2025-12-28 13:14 | 20M | |
| soju-0.9.0_2.pkg | 2025-12-21 01:25 | 10M | |
| sokoban-1.0_3.pkg | 2025-08-20 13:11 | 22K | |
| sol-1.0.8_1.pkg | 2025-12-21 06:35 | 31K | |
| sol2-4.0.0.a_2.pkg | 2025-12-19 09:59 | 133K | |
| solaar-1.0.1_2.pkg | 2025-12-23 17:47 | 214K | |
| solanum-5.0.0_19.pkg | 2025-12-27 22:32 | 247K | |
| solarconquest-0.2_13..> | 2025-12-28 06:22 | 76K | |
| solarized-1.0.0.pkg | 2025-08-18 16:12 | 145K | |
| solarus-2.0.1_1.pkg | 2025-12-27 16:27 | 1.5M | |
| solarus-quest-editor..> | 2025-12-28 13:37 | 56M | |
| solfege-nosound-3.23..> | 2025-12-29 09:56 | 3.6M | |
| solidity-0.8.33.pkg | 2025-12-28 11:57 | 4.0M | |
| solitaire-19980817_1..> | 2025-12-23 11:34 | 3.8K | |
| solver-0.1_2.pkg | 2025-12-28 10:07 | 483K | |
| solvespace-3.1_2.pkg | 2025-12-29 07:23 | 3.1M | |
| somafm-cli-0.3.1_1.pkg | 2025-12-30 14:02 | 4.3K | |
| somebar-1.0.3_1.pkg | 2025-12-29 04:06 | 41K | |
| sonar-scanner-cli-6...> | 2025-12-27 16:11 | 10M | |
| sonarqube-ant-task-2..> | 2025-12-27 22:27 | 551K | |
| sonarqube-community-..> | 2025-12-29 20:10 | 638M | |
| sonarr-4.0.15.2941.pkg | 2025-12-29 16:35 | 35M | |
| songrec-0.4.3_13.pkg | 2025-12-30 18:47 | 1.5M | |
| sonic-1.4.9_14.pkg | 2025-12-29 15:36 | 4.5M | |
| sonic-visualiser-4.0..> | 2025-12-27 21:22 | 3.5M | |
| sonicradio-0.8.12.pkg | 2025-12-29 21:22 | 3.6M | |
| sonivox-3.6.16.pkg | 2025-12-18 21:43 | 316K | |
| sonivox-eas-1.5.1_1.pkg | 2025-12-30 08:01 | 162K | |
| sope-mysql-5.12.4.pkg | 2025-12-19 05:45 | 3.8M | |
| sope-pgsql-5.12.4.pkg | 2025-12-20 02:56 | 3.8M | |
| sope2-2.4.3_3.pkg | 2025-12-29 22:20 | 1.7M | |
| sops-3.11.0_4.pkg | 2025-12-23 06:08 | 10M | |
| sord-0.16.20.pkg | 2025-12-18 13:36 | 31K | |
| sortmail-1.20_1.pkg | 2025-08-21 19:05 | 22K | |
| sound-juicer-3.40.0.pkg | 2025-12-30 07:50 | 1.6M | |
| sound-of-sorting-0.6..> | 2025-12-29 16:05 | 106K | |
| soundgrab-1.0.1_4.pkg | 2025-12-30 07:20 | 47K | |
| soundtouch-2.3.3.pkg | 2025-08-13 22:33 | 60K | |
| soundtracker-1.0.5.1..> | 2025-12-30 02:44 | 469K | |
| source-code-pro-ttf-..> | 2025-12-26 10:56 | 650K | |
| source-highlight-3.1..> | 2025-12-18 16:21 | 1.1M | |
| source-sans-ttf-3.05..> | 2025-12-30 17:55 | 1.2M | |
| source-serif-ttf-4.0..> | 2025-12-27 23:08 | 3.5M | |
| sowing-1.1.18_3.pkg | 2025-12-30 04:13 | 160K | |
| sowon-g20201203_1.pkg | 2025-12-30 04:45 | 74K | |
| sox-14.4.2.20210509_..> | 2025-12-26 13:51 | 375K | |
| sox-noise-g20241022_..> | 2025-12-30 09:06 | 23K | |
| sp2sp-20090213_1.pkg | 2025-12-28 12:19 | 17K | |
| spacefm-1.0.6_4.pkg | 2025-12-27 22:43 | 1.1M | |
| spacenavd-devel-r202..> | 2025-08-18 22:38 | 33K | |
| spamass-iXhash-1.5.5..> | 2025-12-23 17:11 | 11K | |
| spamass-milter-0.4.0..> | 2025-12-22 11:20 | 44K | |
| spamass-rules-201901..> | 2025-12-20 22:55 | 35K | |
| spamassassin-4.0.2_1..> | 2025-12-18 21:38 | 1.1M | |
| spamassassin-devel-2..> | 2025-12-22 12:12 | 1.1M | |
| spamassassin-dqs-1.5..> | 2025-12-22 02:43 | 9.3K | |
| spambnc-30.f,1.pkg | 2025-12-28 13:21 | 236K | |
| spamcup-1.09_5.pkg | 2025-12-20 21:14 | 6.4K | |
| spamd-4.9.1_7.pkg | 2025-08-17 11:48 | 58K | |
| spamguard-1.8_1.pkg | 2025-08-19 09:37 | 24K | |
| spamilter-0.60_5.pkg | 2025-08-16 17:50 | 49K | |
| spampd-2.62.pkg | 2025-12-22 16:26 | 35K | |
| spamprobe-1.4d_21.pkg | 2025-12-30 17:30 | 191K | |
| spamstats-0.6c_2.pkg | 2025-12-20 10:18 | 13K | |
| spandsp-3.0.0.g20211..> | 2025-12-26 20:36 | 645K | |
| spar-0.5.10_7.pkg | 2025-12-21 15:42 | 78K | |
| sparsehash-2.0.4.pkg | 2025-08-14 07:35 | 78K | |
| sparta-dsmc-2024.09...> | 2025-12-29 10:39 | 563K | |
| spass-3.2.5_12.pkg | 2025-12-20 15:12 | 67K | |
| spass-qt5-3.2.5_12.pkg | 2025-12-29 15:26 | 61K | |
| spatialindex-2.1.0.pkg | 2025-08-13 15:29 | 294K | |
| spatialite-5.1.0_5.pkg | 2025-12-26 06:41 | 5.6M | |
| spatialite-tools-5.0..> | 2025-12-29 13:44 | 217K | |
| spatialite_gui-2.1.0..> | 2025-12-30 17:55 | 1.8M | |
| spawn-fcgi-1.6.4_3.pkg | 2025-08-15 16:05 | 9.9K | |
| spblas-1.03_1.pkg | 2025-08-18 01:10 | 1.3M | |
| spc2it-0.4.0_1.pkg | 2025-08-18 18:18 | 24K | |
| spcm-0.5.8.pkg | 2025-12-29 22:32 | 79K | |
| spdlog-1.16.0_1.pkg | 2025-12-18 00:53 | 164K | |
| speak-1.2.pkg | 2025-08-16 04:24 | 14K | |
| species-1.2d_1.pkg | 2025-08-17 09:35 | 119K | |
| spectacle-lv2-2.0.1_..> | 2025-12-29 00:24 | 896K | |
| spectmorph-0.6.1_1.pkg | 2025-12-28 20:22 | 51M | |
| spectools-201108.r1_..> | 2025-12-30 00:51 | 70K | |
| spectra-1.2.0.pkg | 2025-12-26 19:21 | 61K | |
| spectral-817_6.pkg | 2025-12-30 00:35 | 746K | |
| spectre-meltdown-che..> | 2025-08-18 02:48 | 50K | |
| spectrogram-20190725..> | 2025-12-23 12:50 | 9.8K | |
| spectrwm-3.7.0.pkg | 2025-12-30 01:58 | 138K | |
| speech-denoiser-lv2-..> | 2025-08-16 07:55 | 3.9K | |
| speech-dispatcher-0...> | 2025-12-24 23:54 | 4.1M | |
| speedcrunch-0.12.0_3..> | 2025-12-30 03:53 | 771K | |
| speedtables-1.13.18_..> | 2025-12-21 13:34 | 183K | |
| speedtest-go-1.7.10_..> | 2025-12-22 01:16 | 2.8M | |
| speex-1.2.1_1,1.pkg | 2025-08-11 00:27 | 117K | |
| speexdsp-1.2.1.pkg | 2025-08-10 21:51 | 81K | |
| spegla-1.1p5_1.pkg | 2025-08-18 10:49 | 61K | |
| spek-0.8.5_7.pkg | 2025-12-29 20:31 | 94K | |
| spellcast-1.2_3.pkg | 2025-08-16 22:04 | 64K | |
| spellutils-0.7_5.pkg | 2025-12-23 23:23 | 20K | |
| spfft-1.1.1.pkg | 2025-12-27 18:15 | 93K | |
| spfmilter-2.2.pkg | 2025-08-22 07:37 | 17K | |
| spfval-0.0.1.pkg | 2025-08-17 09:51 | 7.8K | |
| spglib-2.6.0.pkg | 2025-12-26 11:57 | 234K | |
| spheral-2025.06.1_4.pkg | 2025-12-30 18:36 | 6.5M | |
| sphinxsearch-2.2.11_..> | 2025-12-23 11:00 | 2.4M | |
| spice-3f5.2_15.pkg | 2025-12-20 08:47 | 844K | |
| spice-gtk-0.37_7.pkg | 2025-12-26 21:29 | 471K | |
| spice-protocol-0.14...> | 2025-12-18 16:19 | 19K | |
| spicetrade-1.2_4.pkg | 2025-12-29 16:53 | 170M | |
| spidermonkey78-78.15..> | 2025-12-30 00:47 | 7.7M | |
| spidermonkey102-102...> | 2025-12-28 22:08 | 5.1M | |
| spidermonkey115-115...> | 2025-12-27 13:05 | 5.4M | |
| spidermonkey128-128...> | 2025-12-26 14:48 | 7.6M | |
| spidermonkey140-140...> | 2025-12-28 12:32 | 7.1M | |
| spim-8.0_1.pkg | 2025-12-20 08:52 | 245K | |
| spin-6.5.2_1.pkg | 2025-12-29 13:35 | 458K | |
| spindown-0.4_1.pkg | 2025-08-19 23:11 | 9.2K | |
| spine-1.2.30.pkg | 2025-12-30 02:33 | 54K | |
| spinner-1.2.4.pkg | 2025-08-21 04:28 | 14K | |
| spiped-1.6.4.pkg | 2025-08-16 12:07 | 68K | |
| spiralloops-2.0.0_9.pkg | 2025-12-28 20:12 | 44K | |
| spiralsynthmodular-0..> | 2025-12-29 15:02 | 728K | |
| spiritvnc-0.6.5.pkg | 2025-12-28 05:54 | 53K | |
| spirv-cross-1.4.328...> | 2025-12-18 21:04 | 2.1M | |
| spirv-llvm-translato..> | 2025-12-18 23:26 | 673K | |
| spirv-llvm-translato..> | 2025-12-19 00:06 | 653K | |
| spirv-llvm-translato..> | 2025-12-19 01:23 | 733K | |
| spirv-llvm-translato..> | 2025-12-18 21:55 | 850K | |
| spirv-llvm-translato..> | 2025-12-19 11:18 | 878K | |
| spirv-llvm-translato..> | 2025-12-19 15:29 | 920K | |
| spirv-llvm-translato..> | 2025-12-20 02:07 | 921K | |
| spirv-llvm-translato..> | 2025-12-20 04:03 | 937K | |
| spirv-llvm-translato..> | 2025-12-16 04:13 | 960K | |
| spirv-llvm-translato..> | 2025-12-20 11:09 | 1.0M | |
| spirv-llvm-translato..> | 2025-12-27 05:58 | 1.0M | |
| spirv-tools-2025.5.pkg | 2025-12-24 20:22 | 4.4M | |
| spla-1.6.1_1.pkg | 2025-12-27 09:11 | 96K | |
| splat-1.4.2_2.pkg | 2025-08-20 22:51 | 123K | |
| spleen-font-2.1.0.pkg | 2025-12-30 16:19 | 171K | |
| splint-3.1.2_1.pkg | 2025-08-14 09:06 | 685K | |
| splitpatch-2025.0226..> | 2025-12-22 15:03 | 5.8K | |
| splix-2.0.0_9.pkg | 2025-12-20 09:40 | 45K | |
| spm-0.20200208_1.pkg | 2025-12-23 18:25 | 4.0K | |
| spmfilter-0.6.7_9.pkg | 2025-08-14 12:08 | 75K | |
| spmfilter-clamav-0.2..> | 2025-08-22 07:54 | 10K | |
| spnavcfg-devel-r2025..> | 2025-12-30 19:07 | 359K | |
| spoa-4.1.5.pkg | 2025-12-22 14:17 | 89K | |
| spoofdpi-1.2.1.pkg | 2025-12-29 00:46 | 3.5M | |
| spoofer-1.4.11_9.pkg | 2025-12-29 22:09 | 309K | |
| spooles-2.2_16.pkg | 2025-08-13 22:51 | 4.5M | |
| spooles-mpich-2.2_16..> | 2025-12-29 00:03 | 3.8M | |
| spot-2.14.3.pkg | 2025-12-19 10:06 | 3.0M | |
| spotify-player-0.21...> | 2025-12-29 14:11 | 15M | |
| spotify-qt-4.0.1_1.pkg | 2025-12-27 21:59 | 582K | |
| spotifyd-0.4.2_1.pkg | 2025-12-30 12:11 | 2.7M | |
| spp-0.4.2.pkg | 2025-08-22 13:47 | 22K | |
| spr-1.3.7_4.pkg | 2025-12-30 10:56 | 1.6M | |
| spread-3.17.4_8.pkg | 2025-12-19 11:44 | 186K | |
| spread-j-3.17.3_1.pkg | 2025-12-29 14:16 | 60K | |
| spread-sheet-widget-..> | 2025-12-28 03:16 | 82K | |
| spreadlogd-1.4.2.pkg | 2025-12-20 16:22 | 21K | |
| springframework-3.2...> | 2025-12-29 04:27 | 35M | |
| springframework31-3...> | 2025-12-30 08:07 | 17M | |
| springgraph-0.88_3.pkg | 2025-12-27 21:28 | 8.6K | |
| sprop-0.1.pkg | 2025-08-22 20:00 | 3.5K | |
| sq-0.48.5_7.pkg | 2025-12-21 16:33 | 8.5M | |
| sq-hunspell-1.6.2_1.pkg | 2025-08-18 20:32 | 539K | |
| sq-libreoffice-25.8...> | 2025-12-27 11:00 | 2.8M | |
| sql-ledger-3.2.12.pkg | 2025-12-21 12:39 | 1.2M | |
| sql-workbench-141,1.pkg | 2025-12-30 02:24 | 6.7M | |
| sqlcached-r6_5.pkg | 2025-12-21 12:26 | 13K | |
| sqlcipher-4.6.1_1.pkg | 2025-12-19 23:33 | 1.4M | |
| sqlclient-1.9.0_1.pkg | 2025-12-18 20:04 | 179K | |
| sqlgrey-1.8.0_6.pkg | 2025-12-30 14:14 | 43K | |
| sqlite-2.8.17_5.pkg | 2025-12-18 19:21 | 407K | |
| sqlite-ext-miscfuncs..> | 2025-12-23 19:37 | 13K | |
| sqlite-ext-pcre-2010..> | 2025-12-24 04:40 | 3.5K | |
| sqlite-ext-regexp-3...> | 2025-12-23 12:59 | 8.4K | |
| sqlite-ext-spellfix-..> | 2025-12-20 17:02 | 16K | |
| sqlite3-3.50.4_2,1.pkg | 2025-12-16 01:32 | 1.3M | |
| sqlite3-icu-3.50.4_2..> | 2025-12-22 17:48 | 1.3M | |
| sqlite3-tcl-3.50.4_2..> | 2025-12-20 18:02 | 1.4M | |
| sqlitebrowser-3.13.1..> | 2025-12-28 07:20 | 2.8M | |
| sqliteconvert-0.1.2_..> | 2025-12-30 18:04 | 21K | |
| sqlitecpp-3.3.3.pkg | 2025-12-20 09:51 | 38K | |
| sqlitejdbc-056_2.pkg | 2025-12-30 12:42 | 40K | |
| sqlitemanager-1.2.4.pkg | 2025-12-28 23:59 | 616K | |
| sqliteodbc-0.99991_1..> | 2025-12-18 23:42 | 170K | |
| sqlitestudio-3.4.17.pkg | 2025-12-29 07:13 | 5.4M | |
| sqlninja-0.2.6.pkg | 2025-12-20 23:17 | 202K | |
| sqlpage-0.40.0_1.pkg | 2025-12-29 05:03 | 7.3M | |
| sqlrelay-1.9.3_1.pkg | 2025-12-20 03:37 | 2.2M | |
| sqlx-cli-0.8.6_2.pkg | 2025-12-29 06:59 | 2.0M | |
| sqsh-2.5.16.1_3.pkg | 2025-12-29 07:19 | 155K | |
| sqstat-1.20_1.pkg | 2025-12-29 10:59 | 11K | |
| sqtop-2015.02.08_1.pkg | 2025-08-19 09:30 | 75K | |
| squash-1.0_22.pkg | 2025-12-28 14:12 | 46K | |
| squashfs-tools-4.6.1..> | 2025-12-23 06:44 | 236K | |
| squashfs-tools-ng-1...> | 2025-12-18 22:29 | 284K | |
| squeak-4.10.2_15.pkg | 2025-12-27 11:57 | 12M | |
| squeekboard-1.43.1_1..> | 2025-12-29 17:41 | 1.4M | |
| squeezelite-2.0.0.15..> | 2025-12-28 17:02 | 66K | |
| squid-6.14_1.pkg | 2025-12-19 21:37 | 2.5M | |
| squid-langpack-7.0.0..> | 2025-08-22 06:41 | 210K | |
| squidGuard-1.4_15.pkg | 2025-12-23 19:38 | 540K | |
| squid_radius_auth-1...> | 2025-08-18 21:03 | 11K | |
| squidanalyzer-6.5_1.pkg | 2025-12-21 13:16 | 149K | |
| squidclamav-7.3_2.pkg | 2025-12-22 07:56 | 73K | |
| squidpurge-1.17_4.pkg | 2025-08-16 05:24 | 15K | |
| squidview-0.86_1.pkg | 2025-08-17 04:05 | 75K | |
| squirrel-3.2.pkg | 2025-08-15 07:10 | 143K | |
| squirrel-sql-4.8.0.pkg | 2025-12-28 06:21 | 50M | |
| squirrelmail-abook_i..> | 2025-12-28 12:16 | 22K | |
| squirrelmail-abook_i..> | 2025-12-30 17:54 | 22K | |
| squirrelmail-abook_i..> | 2025-12-27 22:28 | 22K | |
| squirrelmail-abook_i..> | 2025-12-29 00:48 | 22K | |
| squirrelmail-abook_i..> | 2025-12-28 04:01 | 22K | |
| squirrelmail-askuser..> | 2025-12-29 09:52 | 2.6K | |
| squirrelmail-askuser..> | 2025-12-29 17:02 | 2.6K | |
| squirrelmail-askuser..> | 2025-12-28 07:24 | 2.6K | |
| squirrelmail-askuser..> | 2025-12-29 04:15 | 2.6K | |
| squirrelmail-askuser..> | 2025-12-28 13:40 | 2.5K | |
| squirrelmail-avelsie..> | 2025-12-28 20:10 | 298K | |
| squirrelmail-avelsie..> | 2025-12-28 21:06 | 298K | |
| squirrelmail-avelsie..> | 2025-12-28 06:23 | 298K | |
| squirrelmail-avelsie..> | 2025-12-29 17:32 | 298K | |
| squirrelmail-avelsie..> | 2025-12-28 15:23 | 298K | |
| squirrelmail-calenda..> | 2025-12-27 03:40 | 16K | |
| squirrelmail-calenda..> | 2025-12-27 11:38 | 16K | |
| squirrelmail-calenda..> | 2025-12-27 12:32 | 16K | |
| squirrelmail-calenda..> | 2025-12-27 05:35 | 16K | |
| squirrelmail-calenda..> | 2025-12-27 16:22 | 16K | |
| squirrelmail-change-..> | 2025-12-27 21:32 | 28K | |
| squirrelmail-change-..> | 2025-12-29 08:18 | 28K | |
| squirrelmail-change_..> | 2025-12-28 03:17 | 50K | |
| squirrelmail-change_..> | 2025-12-29 17:21 | 50K | |
| squirrelmail-change_..> | 2025-12-28 00:29 | 50K | |
| squirrelmail-change_..> | 2025-12-29 01:14 | 50K | |
| squirrelmail-change_..> | 2025-12-30 10:42 | 50K | |
| squirrelmail-check-q..> | 2025-12-29 13:43 | 37K | |
| squirrelmail-check-q..> | 2025-12-28 01:32 | 37K | |
| squirrelmail-check-q..> | 2025-12-30 14:05 | 37K | |
| squirrelmail-check-q..> | 2025-12-28 10:30 | 37K | |
| squirrelmail-check-q..> | 2025-12-29 05:21 | 37K | |
| squirrelmail-compati..> | 2025-12-27 17:13 | 37K | |
| squirrelmail-compati..> | 2025-12-27 16:54 | 37K | |
| squirrelmail-compati..> | 2025-12-27 15:39 | 37K | |
| squirrelmail-compati..> | 2025-12-27 13:17 | 37K | |
| squirrelmail-compati..> | 2025-12-27 10:28 | 37K | |
| squirrelmail-decode-..> | 2025-12-29 23:43 | 211K | |
| squirrelmail-email_f..> | 2025-12-30 04:51 | 17K | |
| squirrelmail-email_f..> | 2025-12-29 06:48 | 17K | |
| squirrelmail-email_f..> | 2025-12-29 23:26 | 17K | |
| squirrelmail-email_f..> | 2025-12-28 23:33 | 17K | |
| squirrelmail-email_f..> | 2025-12-29 16:07 | 17K | |
| squirrelmail-login_a..> | 2025-12-28 10:10 | 27K | |
| squirrelmail-login_a..> | 2025-12-28 12:26 | 27K | |
| squirrelmail-login_a..> | 2025-12-29 16:31 | 27K | |
| squirrelmail-login_a..> | 2025-12-29 13:47 | 27K | |
| squirrelmail-login_a..> | 2025-12-29 21:24 | 27K | |
| squirrelmail-login_n..> | 2025-12-29 04:07 | 13K | |
| squirrelmail-login_n..> | 2025-12-30 06:34 | 13K | |
| squirrelmail-login_n..> | 2025-12-28 11:35 | 13K | |
| squirrelmail-login_n..> | 2025-12-29 16:27 | 13K | |
| squirrelmail-login_n..> | 2025-12-29 12:53 | 13K | |
| squirrelmail-mark_re..> | 2025-12-28 16:41 | 16K | |
| squirrelmail-mark_re..> | 2025-12-30 09:00 | 16K | |
| squirrelmail-mark_re..> | 2025-12-29 03:18 | 16K | |
| squirrelmail-mark_re..> | 2025-12-29 13:14 | 16K | |
| squirrelmail-mark_re..> | 2025-12-28 06:13 | 16K | |
| squirrelmail-multilo..> | 2025-12-28 03:19 | 20K | |
| squirrelmail-multilo..> | 2025-12-30 17:14 | 20K | |
| squirrelmail-multilo..> | 2025-12-30 00:25 | 20K | |
| squirrelmail-multilo..> | 2025-12-29 14:59 | 20K | |
| squirrelmail-multilo..> | 2025-12-28 13:24 | 20K | |
| squirrelmail-notes-p..> | 2025-12-30 07:00 | 14K | |
| squirrelmail-notes-p..> | 2025-12-28 09:43 | 14K | |
| squirrelmail-notes-p..> | 2025-12-30 15:57 | 14K | |
| squirrelmail-notes-p..> | 2025-12-30 01:02 | 14K | |
| squirrelmail-notes-p..> | 2025-12-29 02:51 | 14K | |
| squirrelmail-notify-..> | 2025-12-29 03:42 | 17K | |
| squirrelmail-notify-..> | 2025-12-30 16:42 | 17K | |
| squirrelmail-notify-..> | 2025-12-29 03:47 | 17K | |
| squirrelmail-notify-..> | 2025-12-29 13:21 | 17K | |
| squirrelmail-notify-..> | 2025-12-30 02:36 | 17K | |
| squirrelmail-passwor..> | 2025-12-29 04:32 | 14K | |
| squirrelmail-passwor..> | 2025-12-30 16:29 | 14K | |
| squirrelmail-passwor..> | 2025-12-30 00:26 | 14K | |
| squirrelmail-passwor..> | 2025-12-28 05:37 | 14K | |
| squirrelmail-passwor..> | 2025-12-29 21:22 | 14K | |
| squirrelmail-php81-2..> | 2025-12-27 01:18 | 537K | |
| squirrelmail-php82-2..> | 2025-12-26 22:45 | 537K | |
| squirrelmail-php83-2..> | 2025-12-27 00:59 | 536K | |
| squirrelmail-php84-2..> | 2025-12-26 20:40 | 536K | |
| squirrelmail-php85-2..> | 2025-12-26 23:35 | 537K | |
| squirrelmail-plugins..> | 2025-12-29 19:28 | 909 | |
| squirrelmail-plugins..> | 2025-12-30 12:55 | 912 | |
| squirrelmail-plugins..> | 2025-12-29 00:44 | 911 | |
| squirrelmail-plugins..> | 2025-12-29 23:57 | 910 | |
| squirrelmail-plugins..> | 2025-12-30 17:20 | 912 | |
| squirrelmail-pupdate..> | 2025-12-30 08:08 | 13K | |
| squirrelmail-pupdate..> | 2025-12-30 12:15 | 13K | |
| squirrelmail-pupdate..> | 2025-12-28 10:45 | 13K | |
| squirrelmail-pupdate..> | 2025-12-28 16:25 | 13K | |
| squirrelmail-pupdate..> | 2025-12-30 07:00 | 13K | |
| squirrelmail-qmailad..> | 2025-12-30 02:15 | 12K | |
| squirrelmail-qmailad..> | 2025-12-27 19:44 | 12K | |
| squirrelmail-qmailad..> | 2025-12-29 07:58 | 12K | |
| squirrelmail-qmailad..> | 2025-12-30 07:55 | 12K | |
| squirrelmail-qmailad..> | 2025-12-30 02:58 | 12K | |
| squirrelmail-quota_u..> | 2025-12-30 04:07 | 37K | |
| squirrelmail-quota_u..> | 2025-12-30 16:48 | 37K | |
| squirrelmail-quota_u..> | 2025-12-29 13:11 | 37K | |
| squirrelmail-quota_u..> | 2025-12-30 16:52 | 37K | |
| squirrelmail-quota_u..> | 2025-12-30 16:01 | 37K | |
| squirrelmail-sasql-p..> | 2025-12-29 07:38 | 36K | |
| squirrelmail-sasql-p..> | 2025-12-27 23:39 | 36K | |
| squirrelmail-secure_..> | 2025-12-30 09:50 | 17K | |
| squirrelmail-secure_..> | 2025-12-27 22:51 | 17K | |
| squirrelmail-secure_..> | 2025-12-30 04:54 | 17K | |
| squirrelmail-secure_..> | 2025-12-30 05:46 | 17K | |
| squirrelmail-secure_..> | 2025-12-29 22:14 | 17K | |
| squirrelmail-shared_..> | 2025-12-30 14:05 | 219K | |
| squirrelmail-shared_..> | 2025-12-30 01:43 | 219K | |
| squirrelmail-shared_..> | 2025-12-30 02:31 | 219K | |
| squirrelmail-shared_..> | 2025-12-30 09:46 | 219K | |
| squirrelmail-shared_..> | 2025-12-30 12:16 | 219K | |
| squirrelmail-spam-bu..> | 2025-12-29 04:40 | 60K | |
| squirrelmail-spam-bu..> | 2025-12-28 01:23 | 60K | |
| squirrelmail-spam-bu..> | 2025-12-28 23:09 | 60K | |
| squirrelmail-spam-bu..> | 2025-12-30 12:17 | 60K | |
| squirrelmail-spam-bu..> | 2025-12-28 08:22 | 60K | |
| squirrelmail-squirre..> | 2025-12-29 09:22 | 27K | |
| squirrelmail-squirre..> | 2025-12-29 19:15 | 27K | |
| squirrelmail-squirre..> | 2025-12-29 00:58 | 27K | |
| squirrelmail-squirre..> | 2025-12-29 07:13 | 27K | |
| squirrelmail-squirre..> | 2025-12-29 22:23 | 27K | |
| squirrelmail-timeout..> | 2025-12-30 12:50 | 5.2K | |
| squirrelmail-timeout..> | 2025-12-28 20:38 | 5.2K | |
| squirrelmail-timeout..> | 2025-12-29 13:11 | 5.2K | |
| squirrelmail-timeout..> | 2025-12-30 02:23 | 5.2K | |
| squirrelmail-timeout..> | 2025-12-28 17:57 | 5.2K | |
| squirrelmail-transla..> | 2025-12-30 12:43 | 3.3M | |
| squirrelmail-transla..> | 2025-12-28 10:30 | 3.3M | |
| squirrelmail-transla..> | 2025-12-30 18:53 | 3.3M | |
| squirrelmail-transla..> | 2025-12-28 22:39 | 3.3M | |
| squirrelmail-transla..> | 2025-12-30 12:53 | 3.3M | |
| squirrelmail-unsafe_..> | 2025-12-29 00:50 | 13K | |
| squirrelmail-unsafe_..> | 2025-12-29 16:32 | 13K | |
| squirrelmail-unsafe_..> | 2025-12-29 10:52 | 13K | |
| squirrelmail-unsafe_..> | 2025-12-29 08:50 | 13K | |
| squirrelmail-unsafe_..> | 2025-12-29 13:20 | 13K | |
| squirrelmail-user_sp..> | 2025-12-29 16:33 | 3.9K | |
| squirrelmail-user_sp..> | 2025-12-30 16:27 | 3.9K | |
| squirrelmail-user_sp..> | 2025-12-30 07:49 | 3.9K | |
| squirrelmail-user_sp..> | 2025-12-29 16:08 | 3.9K | |
| squirrelmail-user_sp..> | 2025-12-29 06:18 | 3.9K | |
| squirrelmail-vlogin-..> | 2025-12-29 13:06 | 53K | |
| squirrelmail-vlogin-..> | 2025-12-27 22:19 | 53K | |
| squirrelmail-vlogin-..> | 2025-12-29 00:18 | 53K | |
| squirrelmail-vlogin-..> | 2025-12-28 01:16 | 53K | |
| squirrelmail-vlogin-..> | 2025-12-30 15:40 | 53K | |
| squirrelmail-web_sea..> | 2025-12-27 22:58 | 4.3K | |
| squirrelmail-web_sea..> | 2025-12-28 22:02 | 4.3K | |
| squirrelmail-web_sea..> | 2025-12-29 16:04 | 4.3K | |
| squirrelmail-web_sea..> | 2025-12-30 10:00 | 4.3K | |
| squirrelmail-web_sea..> | 2025-12-29 17:28 | 4.3K | |
| squirrelmail-wettero..> | 2025-12-29 02:35 | 2.5K | |
| squirrelmail-wettero..> | 2025-12-28 12:08 | 2.5K | |
| squirrelmail-wettero..> | 2025-12-30 10:57 | 2.5K | |
| squirrelmail-wettero..> | 2025-12-29 22:03 | 2.5K | |
| squirrelmail-wettero..> | 2025-12-28 06:48 | 2.5K | |
| squish-1.15_1.pkg | 2025-08-13 21:17 | 23K | |
| squsq-3.3.pkg | 2025-08-20 08:29 | 10K | |
| sqwebmail-6.3.0.pkg | 2025-12-22 09:18 | 568K | |
| sr-aspell-0.02_1,2.pkg | 2025-12-21 21:00 | 3.9M | |
| sr-hunspell-0.18_1.pkg | 2025-08-22 18:01 | 955K | |
| sr-libreoffice-25.8...> | 2025-12-27 16:20 | 637K | |
| sr_Latn-libreoffice-..> | 2025-12-27 17:05 | 202K | |
| sra-tools-3.3.0.pkg | 2025-12-27 11:53 | 13M | |
| srain-1.7.0.pkg | 2025-12-28 06:06 | 2.5M | |
| srandrd-0.6.0.15.pkg | 2025-08-20 04:26 | 22K | |
| sratom-0.6.20.pkg | 2025-12-26 19:20 | 16K | |
| srecord-1.64_20.pkg | 2025-12-28 23:05 | 1.2M | |
| sredird-2.2.2_1.pkg | 2025-08-19 04:48 | 17K | |
| srelay-0.4.8p3_1.pkg | 2025-08-17 03:57 | 29K | |
| srell-4.070.pkg | 2025-12-20 18:08 | 114K | |
| srg-1.3.6_1.pkg | 2025-08-22 00:12 | 45K | |
| srm-1.2.15_1.pkg | 2025-08-18 09:52 | 16K | |
| srt-1.5.4.pkg | 2025-12-19 02:12 | 446K | |
| srvx-1.3.1.pkg | 2025-08-16 16:40 | 224K | |
| ss-hunspell-20110323..> | 2025-08-22 03:21 | 86K | |
| ss-libreoffice-25.8...> | 2025-12-27 15:53 | 222K | |
| ss5-3.8.9.8_4.pkg | 2025-08-21 02:29 | 204K | |
| ssb-0.1.1_33.pkg | 2025-12-20 19:27 | 1.4M | |
| sscalc-1.0.pkg | 2025-08-18 10:13 | 51K | |
| ssd_report-0.4.pkg | 2025-08-18 12:52 | 5.1K | |
| ssd_report-smartmont..> | 2025-12-21 19:36 | 5.1K | |
| ssdeep-2.14.1_1.pkg | 2025-08-17 17:41 | 33K | |
| sse2neon-1.8.0.pkg | 2025-08-19 18:41 | 48K | |
| sselp-0.2.pkg | 2025-08-17 01:26 | 3.6K | |
| ssgless-1.3.pkg | 2025-08-17 17:45 | 1.2K | |
| ssh-chat-1.10.1_34.pkg | 2025-12-23 06:56 | 2.5M | |
| ssh-multiadd-1.3.2_1..> | 2025-12-20 05:56 | 6.6K | |
| ssh-tools-1.7_1.pkg | 2025-12-23 00:11 | 11K | |
| ssh-vault-1.0.10_17.pkg | 2025-12-28 18:12 | 1.5M | |
| sshbuddy-1.05_2.pkg | 2025-12-29 13:49 | 9.5K | |
| sshesame-0.0.39.pkg | 2025-08-16 12:35 | 2.8M | |
| sshguard-2.5.1,1.pkg | 2025-08-20 18:22 | 340K | |
| sshout-1.3.0.pkg | 2025-12-28 05:14 | 37K | |
| sshpass-1.10_1.pkg | 2025-08-14 02:27 | 9.1K | |
| sshping-0.1.4_1.pkg | 2025-12-23 00:43 | 20K | |
| sshsudo-1.0_1.pkg | 2025-12-20 20:57 | 2.8K | |
| ssht-1.5.2.pkg | 2025-08-17 08:20 | 99K | |
| ssl-admin-1.3.0_2.pkg | 2025-12-21 12:22 | 11K | |
| ssl-checker-0.1.7_6.pkg | 2025-12-24 04:59 | 4.9M | |
| ssldump-0.9b3_6.pkg | 2025-08-19 03:39 | 28K | |
| sslh-2.3.0.pkg | 2025-12-20 11:09 | 88K | |
| ssllabs-scan-1.5.0_3..> | 2025-12-20 16:17 | 2.1M | |
| sslproxy-0.9.10,1.pkg | 2025-12-21 22:22 | 155K | |
| sslscan-2.1.3_1.pkg | 2025-08-21 05:55 | 1.8M | |
| sslsplit-0.5.5_3.pkg | 2025-08-19 00:36 | 88K | |
| ssmtp-2.64_7.pkg | 2025-08-18 15:55 | 21K | |
| ssocr-2.25.1.pkg | 2025-12-29 05:17 | 33K | |
| ssr-lv2-g20210922_2.pkg | 2025-12-30 18:37 | 289K | |
| sssd2-2.9.6_6.pkg | 2025-12-27 11:44 | 1.7M | |
| sssnips-0.05_1.pkg | 2025-08-17 11:52 | 35K | |
| ssspl-0.1.pkg | 2025-12-22 00:35 | 5.5K | |
| ssss-0.5.7.pkg | 2025-08-21 22:57 | 13K | |
| sst-1.26_2.pkg | 2025-08-21 16:45 | 15K | |
| sswf-1.8.4_7.pkg | 2025-12-28 09:12 | 2.5M | |
| ssync-2.3_3.pkg | 2025-08-18 10:04 | 22K | |
| st-1.9_2.pkg | 2025-08-18 06:03 | 75K | |
| st-libreoffice-25.8...> | 2025-12-27 09:08 | 216K | |
| stackit-0.50.0.pkg | 2025-12-28 12:36 | 10M | |
| stacks-2.68.pkg | 2025-12-20 01:08 | 1.4M | |
| staf-3.4.26_1.pkg | 2025-08-19 15:07 | 1.8M | |
| stagit-1.2_5.pkg | 2025-12-21 22:41 | 24K | |
| stalepid-1.0.2_1.pkg | 2025-12-23 19:39 | 4.8K | |
| stalonetray-1.0.1.pkg | 2025-12-19 04:51 | 44K | |
| stamp-2.0.8_14.pkg | 2025-12-28 00:37 | 58K | |
| stan-2.34.1.pkg | 2025-12-29 22:48 | 125K | |
| stanmath-4.8.1.pkg | 2025-12-27 17:06 | 604K | |
| star-2024.03.21.pkg | 2025-12-19 10:11 | 320K | |
| star-history-1.0.31_..> | 2025-12-29 18:21 | 867K | |
| star_traders-7.20.pkg | 2025-12-23 18:02 | 262K | |
| stardates-1.6.1.pkg | 2025-08-18 13:29 | 16K | |
| stardict-3.0.6_8.pkg | 2025-12-29 07:59 | 1.1M | |
| stardict-dict-fa_IR-..> | 2025-08-21 21:29 | 8.7M | |
| stardict-rptts-2.1.0..> | 2025-08-20 22:04 | 90M | |
| starfetch-0.0.4.pkg | 2025-08-17 23:50 | 72K | |
| starfighter-2.4_3.pkg | 2025-12-27 20:06 | 47M | |
| starlanes-1.2.2_1.pkg | 2025-08-17 03:36 | 22K | |
| starlark-rust-0.13.0..> | 2025-12-27 19:54 | 2.1M | |
| starplot-0.95.5_11.pkg | 2025-12-28 10:42 | 555K | |
| stars-1.0_1.pkg | 2025-08-16 17:22 | 7.2K | |
| starship-1.24.1_1.pkg | 2025-12-29 01:20 | 3.1M | |
| starttls-0.10_36.pkg | 2025-12-29 13:07 | 6.5K | |
| starttls-emacs_canna..> | 2025-12-29 19:15 | 6.5K | |
| starttls-emacs_devel..> | 2025-12-29 23:26 | 6.6K | |
| starttls-emacs_devel..> | 2025-12-20 06:49 | 6.6K | |
| starttls-emacs_nox-0..> | 2025-12-22 15:32 | 6.5K | |
| starttls-emacs_wayla..> | 2025-12-29 06:32 | 6.5K | |
| startup-notification..> | 2025-08-13 08:32 | 25K | |
| statcvs-0.7.0_1.pkg | 2025-08-19 00:54 | 2.1M | |
| statik-0.1.2_34,1.pkg | 2025-12-20 17:11 | 712K | |
| statsite-0.8.0_2.pkg | 2025-08-17 05:53 | 75K | |
| statsvn-0.7.0_6.pkg | 2025-12-24 04:10 | 2.4M | |
| stb-2.37.20241109.pkg | 2025-08-14 23:02 | 352K | |
| stc-1.5.4_10.pkg | 2025-12-23 12:10 | 2.3M | |
| stc-library-5.0.pkg | 2025-12-22 20:26 | 879K | |
| stdgenerator-0.1.pkg | 2025-12-20 02:06 | 7.5K | |
| stdman-2022.07.30.pkg | 2025-08-16 19:28 | 3.7M | |
| stdx-allocator-3.0.2..> | 2025-08-14 05:08 | 109K | |
| sted-0.2.2_1.pkg | 2025-08-20 01:57 | 12K | |
| steghide-0.5.1_9.pkg | 2025-12-30 09:45 | 148K | |
| stegify-1.2.2_33.pkg | 2025-12-23 22:16 | 763K | |
| stella-7.0.pkg | 2025-12-30 07:07 | 2.9M | |
| stellarsolver-2.5_1.pkg | 2025-12-27 05:58 | 1.6M | |
| stendhal-1.35_2.pkg | 2025-12-30 07:24 | 56M | |
| step-25.12.0.pkg | 2025-12-27 00:46 | 1.4M | |
| step-certificates-0...> | 2025-12-28 12:33 | 11M | |
| step-cli-0.29.0.pkg | 2025-12-27 17:43 | 10M | |
| stepcode-0.8.2_1.pkg | 2025-08-18 07:34 | 3.1M | |
| steps-mono-0.3.29.pkg | 2025-12-30 06:49 | 18K | |
| stepsync-1.0_4.pkg | 2025-12-30 16:51 | 24K | |
| sterm-0.9.3.pkg | 2025-12-26 20:23 | 49K | |
| stfl-0.24_1.pkg | 2025-12-19 12:40 | 115K | |
| stgit-2.5.5_1.pkg | 2025-12-29 04:06 | 1.9M | |
| stirling-pdf-2.1.5.pkg | 2025-12-29 03:44 | 183M | |
| stixfonts-2.13.b171,..> | 2025-12-27 16:19 | 2.6M | |
| stjerm-0.18_2.pkg | 2025-12-30 06:49 | 20K | |
| stk-5.0.1.pkg | 2025-12-26 18:27 | 526K | |
| stlfilt-20080203.pkg | 2025-12-22 17:31 | 21K | |
| stlink-1.8.0.pkg | 2025-08-16 04:57 | 144K | |
| stm32flash-0.7.pkg | 2025-08-22 16:50 | 25K | |
| stockfish-17.1.pkg | 2025-08-19 15:37 | 61M | |
| stoken-0.93_4.pkg | 2025-12-23 13:57 | 60K | |
| stone-2.4_1.pkg | 2025-08-18 11:35 | 76K | |
| stone-phaser-lv2-0.1..> | 2025-12-28 08:30 | 1.0M | |
| stonesoup-0.33.1_1.pkg | 2025-12-23 01:27 | 7.8M | |
| stonesoup-sdl-0.33.1..> | 2025-12-28 12:54 | 24M | |
| stonx-0.6.7e.6_4.pkg | 2025-12-29 12:19 | 348K | |
| storj-1.117.8_11.pkg | 2025-12-22 06:19 | 103M | |
| stork-1.6.0_25.pkg | 2025-12-30 14:38 | 1.5M | |
| stormbaancoureur-2.1..> | 2025-12-29 19:43 | 3.1M | |
| stormlib-9.30.pkg | 2025-08-14 14:14 | 144K | |
| stormy-0.3.3_6.pkg | 2025-12-23 08:25 | 2.1M | |
| stow-2.4.1.pkg | 2025-12-20 04:19 | 384K | |
| stowES-0.5.7_1.pkg | 2025-12-24 01:18 | 48K | |
| stp-2.3.4_5,1.pkg | 2025-12-27 05:39 | 1.0M | |
| str-0.9.12_2.pkg | 2025-08-20 05:09 | 77K | |
| stratagus-3.3.2_2.pkg | 2025-12-27 11:42 | 886K | |
| strawberry-1.2.16.pkg | 2025-12-28 17:32 | 6.1M | |
| stream-5.10.pkg | 2025-08-22 04:34 | 11K | |
| streamripper-1.64.6_..> | 2025-12-20 23:20 | 63K | |
| streamtranscoder-1.2..> | 2025-12-21 04:35 | 36K | |
| streamvbyte-2.0.0.pkg | 2025-08-13 17:47 | 12K | |
| stress-1.0.4_2.pkg | 2025-08-18 16:50 | 13K | |
| stress-ng-0.19.02.pkg | 2025-12-30 15:57 | 754K | |
| stressdisk-1.0.13_21..> | 2025-12-22 01:28 | 959K | |
| string-machine-lv2-0..> | 2025-12-29 06:05 | 150K | |
| string_theory-3.8.pkg | 2025-08-15 03:23 | 27K | |
| stringencoders-3.10...> | 2025-12-22 15:05 | 26K | |
| stringtie-2.1.1.pkg | 2025-08-14 07:44 | 295K | |
| stringzilla-4.5.1.pkg | 2025-12-29 22:14 | 821K | |
| strongswan-6.0.3_1.pkg | 2025-12-22 05:38 | 863K | |
| sttr-0.2.28.pkg | 2025-12-20 10:09 | 2.4M | |
| stuffbin-1.3.0_18.pkg | 2025-12-24 04:20 | 1.4M | |
| stuffit-5.2.0.611_2.pkg | 2025-12-21 10:46 | 1.1M | |
| stumpwm-24.11.20.pkg | 2025-12-22 14:01 | 12M | |
| stund-0.96.pkg | 2025-08-18 09:30 | 30K | |
| stunnel-5.76,1.pkg | 2025-12-18 19:26 | 202K | |
| stxxl-1.4.1.pkg | 2025-08-17 09:26 | 665K | |
| stylua-2.3.1_2.pkg | 2025-12-29 15:23 | 1.2M | |
| stymulator-0.21a_5.pkg | 2025-08-21 11:16 | 43K | |
| styx-2.0.1.pkg | 2025-08-18 12:23 | 691K | |
| su-exec-0.3.pkg | 2025-12-22 01:24 | 3.0K | |
| su-exec-static-0.3.pkg | 2025-12-21 03:00 | 423K | |
| subcalc-1.3_1.pkg | 2025-08-22 22:23 | 19K | |
| subfinder-2.10.1_1.pkg | 2025-12-22 14:52 | 8.3M | |
| submodules2tuple-1.0..> | 2025-12-22 17:14 | 2.0K | |
| subnetcalc-2.6.5.pkg | 2025-12-24 03:32 | 22K | |
| subprocess-0.6.0.pkg | 2025-12-19 14:20 | 47K | |
| subprocess.h-g202407..> | 2025-12-21 02:28 | 7.5K | |
| subread-2.1.0.pkg | 2025-08-14 18:29 | 724K | |
| subsurface-5.0.10_8.pkg | 2025-12-29 03:56 | 8.3M | |
| subtitlecomposer-0.8..> | 2025-12-29 05:31 | 926K | |
| subtitleoffsetmodifi..> | 2025-12-22 06:27 | 2.2K | |
| subtle-0.11.3224_1.pkg | 2025-12-29 10:57 | 153K | |
| subtools-20081026.pkg | 2025-12-22 20:36 | 13K | |
| subversion-1.14.5_1.pkg | 2025-12-18 11:28 | 3.4M | |
| subversion-book-4515..> | 2025-08-18 16:53 | 468K | |
| subversion-gnome-key..> | 2025-12-22 19:20 | 4.2K | |
| subversion-lts-1.14...> | 2025-12-23 15:27 | 3.4M | |
| subversive-2.0.0_2.pkg | 2025-12-29 07:38 | 31M | |
| suck-4.3.5.pkg | 2025-08-19 08:37 | 89K | |
| suck-cnews-4.3.5.pkg | 2025-08-19 07:30 | 96K | |
| suckblow-1.1_1.pkg | 2025-08-17 14:06 | 6.0K | |
| sudo-1.9.17p2_2.pkg | 2025-12-18 17:33 | 1.8M | |
| sudo-font-1.4.pkg | 2025-12-28 23:59 | 2.1M | |
| sudo-rs-0.2.11.pkg | 2025-12-28 10:44 | 419K | |
| sudo-rs-coexist-0.2...> | 2025-12-30 17:28 | 417K | |
| sudo-sssd-1.9.17p2_2..> | 2025-12-28 14:09 | 1.8M | |
| sudoscript-2.1.2_1.pkg | 2025-12-23 07:45 | 130K | |
| sudsol-0.1.pkg | 2025-08-17 14:53 | 8.9K | |
| suil-0.10.12_3.pkg | 2025-12-27 01:00 | 26K | |
| suitecrm-8.7.pkg | 2025-12-29 07:06 | 49M | |
| suitesparse-7.12.1.pkg | 2025-12-26 20:19 | 1.1K | |
| suitesparse-amd-3.3...> | 2025-12-26 05:41 | 280K | |
| suitesparse-btf-2.3...> | 2025-12-26 08:30 | 18K | |
| suitesparse-camd-3.3..> | 2025-12-26 05:41 | 270K | |
| suitesparse-ccolamd-..> | 2025-12-26 05:42 | 38K | |
| suitesparse-cholmod-..> | 2025-12-26 05:43 | 1.6M | |
| suitesparse-colamd-3..> | 2025-12-26 05:41 | 28K | |
| suitesparse-config-7..> | 2025-12-26 05:41 | 42K | |
| suitesparse-csparse-..> | 2025-12-29 17:15 | 907 | |
| suitesparse-cxsparse..> | 2025-12-26 09:26 | 122K | |
| suitesparse-example-..> | 2025-12-28 11:18 | 26K | |
| suitesparse-graphbla..> | 2025-12-26 14:19 | 4.6M | |
| suitesparse-klu-2.3...> | 2025-12-26 09:04 | 398K | |
| suitesparse-lagraph-..> | 2025-12-26 17:35 | 396K | |
| suitesparse-ldl-3.3...> | 2025-12-26 14:51 | 238K | |
| suitesparse-mongoose..> | 2025-12-26 14:54 | 261K | |
| suitesparse-paru-1.1..> | 2025-12-26 16:28 | 387K | |
| suitesparse-rbio-4.3..> | 2025-12-26 15:11 | 50K | |
| suitesparse-spex-3.2..> | 2025-12-26 17:30 | 491K | |
| suitesparse-spqr-4.3..> | 2025-12-26 09:11 | 391K | |
| suitesparse-umfpack-..> | 2025-12-26 05:59 | 1.1M | |
| sulis-1.0.0_11.pkg | 2025-12-30 09:26 | 73M | |
| sumo-1.2.0_22.pkg | 2025-12-30 00:12 | 14M | |
| sunclock-3.57_4.pkg | 2025-12-28 02:50 | 1.4M | |
| sundials-7.5.0.pkg | 2025-12-26 09:20 | 703K | |
| sunlight-0.6.0.pkg | 2025-12-30 01:19 | 7.6M | |
| sunpromake-2024.03.2..> | 2025-12-19 11:54 | 128K | |
| sunwait-0.9.1,1.pkg | 2025-08-22 03:13 | 14K | |
| sunxi-tools-1.4.2.pkg | 2025-08-18 05:17 | 36K | |
| sup-2.0.20200824_1.pkg | 2025-08-17 13:36 | 64K | |
| super-3.30.3_2.pkg | 2025-08-20 06:33 | 95K | |
| supercollider-3.14.1..> | 2025-12-27 09:00 | 5.7M | |
| superfile-1.4.0_3,1.pkg | 2025-12-23 00:24 | 5.0M | |
| superiotool-4.18_1,1..> | 2025-12-29 13:56 | 33K | |
| superlu-7.0.1.pkg | 2025-12-26 11:49 | 1.1M | |
| superlu-dist-9.1.0_1..> | 2025-12-26 18:04 | 1.5M | |
| supersonic-0.19.0_1.pkg | 2025-12-28 15:12 | 11M | |
| supertux-0.1.3_14.pkg | 2025-12-28 14:50 | 5.7M | |
| supertux2-0.6.3_13.pkg | 2025-12-28 09:46 | 160M | |
| supertuxkart-1.5.pkg | 2025-12-29 08:18 | 670M | |
| suphp-php81-0.7.2_2.pkg | 2025-12-28 03:51 | 75K | |
| suphp-php82-0.7.2_2.pkg | 2025-12-29 14:26 | 75K | |
| suphp-php83-0.7.2_2.pkg | 2025-12-30 13:55 | 75K | |
| suphp-php84-0.7.2_2.pkg | 2025-12-29 15:57 | 75K | |
| suphp-php85-0.7.2_2.pkg | 2025-12-28 13:14 | 75K | |
| surblhost-0.8.0_1.pkg | 2025-08-17 06:23 | 18K | |
| surelog-1.84.pkg | 2025-12-23 19:35 | 2.8M | |
| surf-browser-2.1_6.pkg | 2025-12-30 06:25 | 26K | |
| surfer-0.4.0_2.pkg | 2025-12-28 04:41 | 8.3M | |
| surge-synthesizer-xt..> | 2025-12-30 15:09 | 225M | |
| suricata-8.0.2_1.pkg | 2025-12-30 00:52 | 12M | |
| surrealdb-2.4.0_1.pkg | 2025-12-29 03:54 | 12M | |
| suscan-0.3.0_2.pkg | 2025-12-27 15:43 | 449K | |
| sushi-46.0.pkg | 2025-12-27 06:06 | 83K | |
| suwidgets-0.3.0_1.pkg | 2025-12-27 17:39 | 292K | |
| suxus-1.5_4.pkg | 2025-12-29 05:21 | 5.3K | |
| sv-1.2.pkg | 2025-08-15 19:35 | 19K | |
| sv-aspell-0.51.0_1,1..> | 2025-12-21 06:17 | 1.0M | |
| sv-hunspell-2.40.pkg | 2025-08-21 08:11 | 606K | |
| sv-libreoffice-25.8...> | 2025-12-27 17:57 | 3.4M | |
| sv-mythes-2008.06.10..> | 2025-08-18 13:07 | 230K | |
| svgalib-1.4.3_8.pkg | 2025-08-15 18:45 | 577K | |
| svgbob-0.7.1_24.pkg | 2025-12-28 16:30 | 497K | |
| svgpp-1.3.1.pkg | 2025-08-15 20:18 | 101K | |
| svk-2.2.3_7.pkg | 2025-12-20 02:51 | 339K | |
| svlint-0.9.5_2.pkg | 2025-12-29 04:16 | 3.9M | |
| svls-0.2.14_2.pkg | 2025-12-30 08:13 | 3.8M | |
| svn2cl-0.14_2.pkg | 2025-12-21 21:31 | 21K | |
| svn2git-1.0.20_1.pkg | 2025-12-28 09:30 | 122K | |
| svn_load_dirs-1.8.4_..> | 2025-12-21 06:29 | 23K | |
| svntrac-2.0.1_5.pkg | 2025-12-20 15:01 | 156K | |
| svnup-1.08_1.pkg | 2025-08-16 15:30 | 28K | |
| svt-av1-3.1.2.pkg | 2025-12-16 02:01 | 2.0M | |
| svt-av1-hdr-3.1.3.pkg | 2025-12-21 15:37 | 2.0M | |
| svt-hevc-1.5.1_1.pkg | 2025-08-14 12:50 | 597K | |
| svt-vp9-0.3.1.pkg | 2025-12-19 16:49 | 386K | |
| svxlink-19.09.2_2.pkg | 2025-12-27 14:47 | 1.0M | |
| sw-aspell-0.50.0_1,1..> | 2025-12-21 11:57 | 320K | |
| sw_TZ-libreoffice-25..> | 2025-12-27 03:18 | 241K | |
| swaks-20240103.0.pkg | 2025-12-21 18:25 | 58K | |
| swank-clojure-1.2.1.pkg | 2025-12-29 00:55 | 37K | |
| swapd-1.0.5_3.pkg | 2025-12-20 22:14 | 10K | |
| swapexd-0.4.pkg | 2025-08-17 11:04 | 5.8K | |
| swapmon-1.5_1.pkg | 2025-08-22 21:19 | 5.9K | |
| swappy-1.8.0.pkg | 2025-12-29 00:23 | 31K | |
| swapusage-1.0.0.pkg | 2025-08-18 01:09 | 3.0K | |
| swarp-0.1_1.pkg | 2025-08-17 11:28 | 3.5K | |
| swatchdog-3.2.4.pkg | 2025-12-20 17:04 | 27K | |
| sway-1.11_1.pkg | 2025-12-29 18:24 | 5.0M | |
| sway-audio-idle-inhi..> | 2025-12-29 16:31 | 9.5K | |
| swaybg-1.2.1.pkg | 2025-12-27 13:44 | 12K | |
| swayfloatingswitcher..> | 2025-12-30 10:09 | 23K | |
| swayfx-0.5.3_1.pkg | 2025-12-30 14:04 | 5.0M | |
| swayidle-1.9.0.pkg | 2025-12-24 04:36 | 11K | |
| swayimg-4.6.pkg | 2025-12-29 06:34 | 268K | |
| swaylock-1.8.4.pkg | 2025-12-30 00:55 | 28K | |
| swaylock-effects-1.7..> | 2025-12-28 21:02 | 44K | |
| swaylock-plugin-1.8...> | 2025-12-30 03:56 | 45K | |
| swaync-0.12.3.pkg | 2025-12-30 07:09 | 224K | |
| swayr-0.28.1_7.pkg | 2025-12-29 21:25 | 1.1M | |
| swayrbar-0.4.2_13.pkg | 2025-12-30 12:45 | 968K | |
| swaysettings-0.5.0_1..> | 2025-12-29 19:23 | 144K | |
| swe-2.10.03,1.pkg | 2025-08-17 23:10 | 389K | |
| sweeper-25.12.0.pkg | 2025-12-30 16:52 | 400K | |
| sweethome3d-7.1_1.pkg | 2025-12-30 18:03 | 24M | |
| swell-foop-48.1.pkg | 2025-12-27 17:50 | 686K | |
| swfmill-0.3.6_6.pkg | 2025-12-29 16:56 | 288K | |
| swftools-0.9.2_13.pkg | 2025-12-27 20:51 | 1.9M | |
| swh-lv2-1.0.16.4.pkg | 2025-08-17 19:09 | 186K | |
| swhplugins-0.4.17.pkg | 2025-12-18 15:32 | 362K | |
| swi-pl-9.2.9_1.pkg | 2025-12-29 18:20 | 6.7M | |
| swift510-5.10.1_2.pkg | 2025-12-21 09:37 | 421M | |
| swig-4.3.1.pkg | 2025-12-16 01:45 | 6.0M | |
| swig40-4.0.2.pkg | 2025-08-11 00:14 | 1.0M | |
| swiggle-0.4_10.pkg | 2025-12-29 23:14 | 15K | |
| swissfileknife-2.0.0..> | 2025-08-16 16:36 | 792K | |
| switchBashZsh-1.3_1.pkg | 2025-08-17 14:28 | 5.8K | |
| sword-1.9.0.pkg | 2025-12-20 00:00 | 1.2M | |
| sws-1.0_1.pkg | 2025-08-17 22:00 | 4.8K | |
| swt-4.21_3.pkg | 2025-12-26 18:40 | 1.3M | |
| swtpm-0.10.1.pkg | 2025-12-19 11:17 | 333K | |
| swww-0.11.2_3.pkg | 2025-12-28 06:27 | 2.0M | |
| sxhkd-0.6.2_1.pkg | 2025-08-14 21:57 | 32K | |
| sxmo-wayout-0.1.4_1.pkg | 2025-12-29 16:19 | 17K | |
| sxpc-1.4_3.pkg | 2025-08-22 10:57 | 10K | |
| sxsame-3.02_1.pkg | 2025-12-21 11:27 | 46K | |
| sylpheed-3.7.0_9.pkg | 2025-12-27 22:14 | 1.6M | |
| symbiyosys-0.60.pkg | 2025-12-30 12:22 | 39K | |
| symengine-0.14.0_2.pkg | 2025-12-26 21:13 | 1.4M | |
| symfpu-g20190517.pkg | 2025-08-13 22:32 | 35K | |
| symlinks-1.4_1.pkg | 2025-08-20 21:36 | 6.5K | |
| symmetrica-3.0.1.pkg | 2025-08-20 00:03 | 2.5M | |
| symon-2.88_2.pkg | 2025-12-30 16:49 | 51K | |
| sympa-6.2.76_1.pkg | 2025-12-21 04:08 | 3.5M | |
| symphytum-2.6.pkg | 2025-12-30 07:49 | 3.7M | |
| sympol-0.1.9_16.pkg | 2025-12-22 09:51 | 286K | |
| sympow-2.023.7_1.pkg | 2025-12-21 19:44 | 2.7M | |
| synaesthesia-2.4_7.pkg | 2025-12-23 12:19 | 65K | |
| synapse-0.2.99.4_6.pkg | 2025-12-28 02:39 | 450K | |
| syncterm-1.7.pkg | 2025-12-23 11:32 | 2.2M | |
| syncthing-2.0.12_2.pkg | 2025-12-20 05:17 | 21M | |
| syncthing1-1.30.0_9.pkg | 2025-12-21 10:02 | 20M | |
| syncthingtray-2.0.4.pkg | 2025-12-28 12:43 | 1.0M | |
| synergy-1.15.1,3.pkg | 2025-12-27 17:32 | 487K | |
| synfig-1.4.5_11.pkg | 2025-12-27 11:31 | 2.7M | |
| synfigstudio-1.4.5_6..> | 2025-12-27 23:21 | 4.2M | |
| syngesture-1.0.1_21.pkg | 2025-12-28 17:35 | 519K | |
| synth-3.12.pkg | 2025-08-16 22:45 | 820K | |
| synthpod-lv2-g202305..> | 2025-12-30 08:24 | 611K | |
| synthv1-lv2-1.3.2.pkg | 2025-12-29 00:55 | 349K | |
| sysbench-1.0.20_2.pkg | 2025-12-22 00:03 | 96K | |
| sysconftool-0.21_1.pkg | 2025-12-18 21:34 | 13K | |
| sysctlbyname-improve..> | 2025-08-14 07:43 | 5.3K | |
| sysctlinfo-kmod-2022..> | 2025-08-14 00:37 | 14K | |
| sysctltui-0.0.3.pkg | 2025-12-21 00:58 | 11K | |
| sysctlview-2.1_4.pkg | 2025-12-29 05:23 | 63K | |
| sysfsutils-2.1.0_4.pkg | 2025-08-17 07:26 | 42K | |
| sysgather-1.0.p10_2.pkg | 2025-12-20 15:40 | 18K | |
| sysinfo-1.0.4_1.pkg | 2025-08-14 16:41 | 16K | |
| syslinux-6.03_1.pkg | 2025-12-19 17:40 | 2.7M | |
| syslog-ng-4.10.1_2.pkg | 2025-12-22 14:06 | 1.1M | |
| syslogger-1.0.pkg | 2025-08-20 15:19 | 4.9K | |
| sysmon-0.93_2.pkg | 2025-08-16 22:14 | 250K | |
| system-config-printe..> | 2025-12-30 17:04 | 825K | |
| systemc-3.0.1.pkg | 2025-12-18 19:30 | 1.7M | |
| systempreferences-1...> | 2025-12-26 23:00 | 293K | |
| systeroid-0.4.6_1.pkg | 2025-12-30 17:23 | 1.2M | |
| sysvbanner-1.0.15_1.pkg | 2025-08-16 03:01 | 3.8K | |
| sz3-3.3.2.pkg | 2025-12-19 11:07 | 815K | |
| szap_s2-20100129s_1.pkg | 2025-08-16 21:32 | 11K | |
| szip-1.12b_2.pkg | 2025-08-21 04:37 | 25K | |
| szl-libreoffice-25.8..> | 2025-12-27 03:25 | 539K | |
| szyszka-3.0.0_23.pkg | 2025-12-29 07:39 | 952K | |
| t-prot-3.4_1.pkg | 2025-12-23 15:27 | 45K | |
| t1lib-5.1.2_5,1.pkg | 2025-12-17 23:40 | 779K | |
| t1utils-1.32_1.pkg | 2025-08-13 21:09 | 56K | |
| t3d-1.1_3.pkg | 2025-08-22 01:45 | 14K | |
| tDOM-0.9.6.pkg | 2025-12-19 04:56 | 372K | |
| tRNAscan-SE-2.0.11.pkg | 2025-12-21 05:19 | 2.6M | |
| ta-aspell-20040424.1..> | 2025-12-20 15:16 | 108K | |
| ta-lib-0.4.0_2.pkg | 2025-08-13 22:11 | 306K | |
| ta-libreoffice-25.8...> | 2025-12-27 11:31 | 3.2M | |
| ta2as-0.8.2.pkg | 2025-08-18 03:34 | 11K | |
| tabbed-0.8.pkg | 2025-12-29 00:46 | 16K | |
| tabby-ai-coding-assi..> | 2025-12-29 12:52 | 14M | |
| tabixpp-1.1.2.pkg | 2025-12-18 20:34 | 16K | |
| table.el-1.5.54_1.pkg | 2025-08-16 23:34 | 50K | |
| tableutil-0.6_2.pkg | 2025-08-17 05:38 | 22K | |
| tablist-1.0.13_11.pkg | 2025-12-27 15:49 | 33K | |
| tablist-emacs_canna-..> | 2025-12-27 10:05 | 33K | |
| tablist-emacs_devel-..> | 2025-12-27 15:19 | 33K | |
| tablist-emacs_devel_..> | 2025-12-22 14:59 | 33K | |
| tablist-emacs_nox-1...> | 2025-12-23 21:06 | 33K | |
| tablist-emacs_waylan..> | 2025-12-27 11:17 | 33K | |
| tabulate-1.5.pkg | 2025-08-18 12:49 | 41K | |
| tac_plus-F4.0.4.28_2..> | 2025-08-22 16:18 | 124K | |
| tacacs-202302261244.pkg | 2025-12-20 08:33 | 2.6M | |
| tachyon-0.98.9_2.pkg | 2025-08-20 05:34 | 99K | |
| tads-2.5.9.pkg | 2025-08-18 00:09 | 320K | |
| taglib-2.1.1.pkg | 2025-08-13 07:15 | 405K | |
| tagref-1.10.0_16.pkg | 2025-12-30 02:30 | 715K | |
| tagsoup-1.2.1_2.pkg | 2025-12-29 19:05 | 87K | |
| tagutil-3.1_3.pkg | 2025-08-22 06:03 | 25K | |
| tai64nfrac-1.4_1.pkg | 2025-08-16 04:41 | 5.5K | |
| tailor-0.9.37_2.pkg | 2025-12-22 18:19 | 309K | |
| tailscale-1.92.3.pkg | 2025-12-30 00:45 | 11M | |
| tailspin-5.5.0_4.pkg | 2025-12-30 12:23 | 1.1M | |
| tailwindcss3-3.4.17_..> | 2025-12-30 02:23 | 2.5M | |
| tailwindcss4-4.1.11.pkg | 2025-12-29 00:14 | 4.8M | |
| taipan-0.9_2.pkg | 2025-08-19 03:18 | 21K | |
| taisei-1.3.2_2.pkg | 2025-12-29 23:44 | 61M | |
| tali-40.9.pkg | 2025-12-30 03:58 | 1.5M | |
| talkfilters-2.4.pkg | 2025-08-15 07:43 | 505K | |
| talloc-2.4.1_1.pkg | 2025-12-18 03:49 | 45K | |
| talloc242-2.4.2_3.pkg | 2025-12-18 18:39 | 45K | |
| talloc243-2.4.3.pkg | 2025-12-18 23:31 | 45K | |
| tamago-4.0.6.0.20041..> | 2025-12-29 22:21 | 431K | |
| tamago-emacs_canna-4..> | 2025-12-30 15:56 | 431K | |
| tamago-emacs_devel-4..> | 2025-12-30 12:24 | 431K | |
| tamago-emacs_devel_n..> | 2025-12-21 10:49 | 431K | |
| tamago-emacs_nox-4.0..> | 2025-12-24 04:55 | 431K | |
| tamago-emacs_wayland..> | 2025-12-27 21:04 | 431K | |
| tamgamp-lv2-g2020061..> | 2025-08-19 05:29 | 925K | |
| tamsyn-font-1.11_1.pkg | 2025-12-27 23:21 | 60K | |
| tamzen-font-1.11.5.pkg | 2025-12-29 00:16 | 28K | |
| tang-15.pkg | 2025-08-17 00:05 | 21K | |
| tanglet-1.6.8.pkg | 2025-12-30 10:08 | 22M | |
| tap-plugins-0.7.2.pkg | 2025-08-17 09:49 | 56K | |
| tap-plugins-lv2-g201..> | 2025-08-19 02:14 | 8.9M | |
| tapidbus-0.2.1_7.pkg | 2025-12-20 21:23 | 8.8K | |
| tar-stream-chunker-1..> | 2025-08-16 13:44 | 4.3K | |
| tarantool-3.1.1_1.pkg | 2025-12-20 18:24 | 1.8M | |
| tarantool-c-1.0.1_5.pkg | 2025-08-21 18:18 | 220K | |
| tarbsd-builder-php82..> | 2025-12-29 10:58 | 454K | |
| tarbsd-builder-php83..> | 2025-12-29 18:10 | 454K | |
| tarbsd-builder-php84..> | 2025-12-28 20:07 | 454K | |
| tarbsd-builder-php85..> | 2025-12-30 16:35 | 454K | |
| tardy-1.28_16.pkg | 2025-12-23 15:47 | 131K | |
| tarsnap-1.0.41.pkg | 2025-08-15 08:38 | 280K | |
| tarsnap-gui-1.0.2_4.pkg | 2025-12-30 05:40 | 452K | |
| tarsnap-periodic-1.0..> | 2025-08-19 08:56 | 2.3K | |
| tartarus-0.9.8_8.pkg | 2025-12-27 22:50 | 34K | |
| tartest-2024.03.21.pkg | 2025-12-19 07:26 | 160K | |
| task-3.46.3.pkg | 2025-12-30 09:16 | 7.8M | |
| taskctl-1.4.2_34.pkg | 2025-12-22 04:44 | 3.3M | |
| taskd-1.1.0_9.pkg | 2025-12-21 02:56 | 169K | |
| taskflow-3.11.0.pkg | 2025-12-18 11:06 | 136K | |
| tasksh-1.2.0_5.pkg | 2025-12-22 17:40 | 96K | |
| taskwarrior-2.6.2_1.pkg | 2025-12-18 20:44 | 863K | |
| taskwarrior-tui-0.26..> | 2025-12-30 09:49 | 3.7M | |
| tass64-1.60.3243.pkg | 2025-08-19 11:24 | 370K | |
| tatuin-0.25.2.pkg | 2025-12-28 05:04 | 3.0M | |
| taucs-2.2_26.pkg | 2025-12-30 06:38 | 1.2M | |
| tauthon-2.8.5.202407..> | 2025-12-20 23:27 | 12M | |
| tautulli-2.16.0_1.pkg | 2025-12-28 04:23 | 16M | |
| taxonkit-0.19.0_10.pkg | 2025-12-21 12:08 | 3.5M | |
| tayga-0.9.5.pkg | 2025-08-21 23:00 | 31K | |
| tbb-2020.3_4.pkg | 2025-08-14 12:46 | 12M | |
| tbclock-1.10_1.pkg | 2025-08-18 10:56 | 12K | |
| tblis-1.3.0.pkg | 2025-12-23 04:04 | 2.1M | |
| tbox-1.7.9.pkg | 2025-12-19 22:58 | 375K | |
| tcbasic-2.3.0.pkg | 2025-08-21 06:31 | 19K | |
| tcc-0.9.26_7.pkg | 2025-08-19 13:44 | 153K | |
| tcd-2.2.0_9.pkg | 2025-12-20 11:07 | 12K | |
| tcexam-php81-16.5.0.pkg | 2025-12-30 14:56 | 13M | |
| tcexam-php82-16.5.0.pkg | 2025-12-28 07:16 | 13M | |
| tcexam-php83-16.5.0.pkg | 2025-12-29 02:51 | 13M | |
| tcexam-php84-16.5.0.pkg | 2025-12-28 00:28 | 13M | |
| tcexam-php85-16.5.0.pkg | 2025-12-28 08:20 | 13M | |
| tcl-Trf-2.1.4_6.pkg | 2025-08-26 12:36 | 108K | |
| tcl-lmdb-0.5.0.pkg | 2025-08-28 11:53 | 12K | |
| tcl-manual-20131001.pkg | 2025-08-20 04:58 | 1.0M | |
| tcl-memchan-2.3_2.pkg | 2025-08-28 03:16 | 41K | |
| tcl-mmap-1.1_1.pkg | 2025-08-28 18:58 | 7.4K | |
| tcl-signal-1.4.5.pkg | 2025-08-30 06:32 | 8.3K | |
| tcl-sqlite3-3.50.4.pkg | 2025-12-19 17:40 | 791K | |
| tcl-wrapper-1.1_3.pkg | 2025-08-25 09:54 | 8.4K | |
| tcl8-thread-2.8.12.pkg | 2025-12-21 22:30 | 112K | |
| tcl9-thread-3.0.2.pkg | 2025-12-20 05:22 | 112K | |
| tcl86-8.6.17.pkg | 2025-08-23 01:49 | 2.5M | |
| tcl86-sql-20000114_8..> | 2025-12-20 06:05 | 10K | |
| tcl90-9.0.3.pkg | 2025-12-19 13:01 | 2.5M | |
| tclX-8.4.1_2.pkg | 2025-08-26 10:07 | 150K | |
| tclap-1.4.0.r1.pkg | 2025-08-15 01:35 | 26K | |
| tclap12-1.2.5.pkg | 2025-08-21 00:58 | 3.2M | |
| tclbsd-1.9.2_1.pkg | 2025-09-01 06:36 | 122K | |
| tclcheck-1.1.14_1.pkg | 2025-08-20 02:18 | 10K | |
| tclhttpd-3.5.1_6.pkg | 2025-08-29 21:39 | 337K | |
| tcllauncher-1.10_1.pkg | 2025-08-29 12:16 | 14K | |
| tcllib-2.0.pkg | 2025-08-25 22:31 | 2.4M | |
| tcllibc-2.0.pkg | 2025-09-01 15:38 | 125K | |
| tclock-1.0.1_5.pkg | 2025-08-21 07:12 | 9.3K | |
| tclreadline-2.4.0.pkg | 2025-12-21 08:33 | 48K | |
| tclsasl-1.0_3.pkg | 2025-09-01 15:36 | 29K | |
| tclsoap-1.6.7.pkg | 2025-12-22 04:55 | 41K | |
| tclsyslog-2.1_2.pkg | 2025-08-30 11:17 | 9.4K | |
| tcltls-1.7.22_1.pkg | 2025-08-26 06:21 | 25K | |
| tcludp-1.0.11_1.pkg | 2025-08-30 11:41 | 14K | |
| tclvfs-20080503_1.pkg | 2025-08-28 09:36 | 72K | |
| tclwebtest-1.0_3.pkg | 2025-08-30 23:50 | 78K | |
| tclxml-3.3_11.pkg | 2025-12-19 23:16 | 144K | |
| tcpblast-1.1_1.pkg | 2025-08-17 13:20 | 3.6K | |
| tcpcat-1.2.0.pkg | 2025-08-21 09:07 | 11K | |
| tcpcrypt-0.5_2.pkg | 2025-08-18 11:48 | 50K | |
| tcpdump-4.99.5.pkg | 2025-08-16 22:56 | 426K | |
| tcpflow-1.6.1_1.pkg | 2025-12-27 21:25 | 262K | |
| tcpick-0.2.1_2.pkg | 2025-08-22 13:49 | 24K | |
| tcpillust-2.01_3,1.pkg | 2025-12-27 23:43 | 37K | |
| tcping-2.1.0.pkg | 2025-08-18 09:28 | 5.5K | |
| tcpkali-1.1.1.201801..> | 2025-08-20 05:44 | 137K | |
| tcplist-2.2_3.pkg | 2025-12-21 15:49 | 9.6K | |
| tcplog_dumper-0.1.2.pkg | 2025-08-17 11:39 | 16K | |
| tcpmssd-1.1_2.pkg | 2025-08-20 00:04 | 7.0K | |
| tcpproxy-1.2_1.pkg | 2025-08-18 06:26 | 23K | |
| tcpreen-1.4.4_4.pkg | 2025-12-21 09:22 | 30K | |
| tcpreplay-4.5.2.pkg | 2025-12-20 22:42 | 190K | |
| tcprtt-g20191022_1.pkg | 2025-08-17 05:22 | 4.9K | |
| tcpser-g20210425,1.pkg | 2025-08-18 05:58 | 28K | |
| tcpsg-0.0.2.pkg | 2025-08-22 20:52 | 6.4K | |
| tcpshow-1.74_3.pkg | 2025-08-18 19:34 | 20K | |
| tcpslice-1.8,1.pkg | 2025-08-16 18:44 | 16K | |
| tcpsplit-0.3.pkg | 2025-08-19 19:41 | 6.3K | |
| tcpstat-1.5_1.pkg | 2025-08-22 01:21 | 30K | |
| tcptestsuite-g202512..> | 2025-12-20 05:39 | 129K | |
| tcptrace-6.6.8_2.pkg | 2025-08-22 07:42 | 150K | |
| tcptraceroute-1.5bet..> | 2025-08-17 02:13 | 34K | |
| tcptrack-1.4.2_4.pkg | 2025-08-22 08:26 | 26K | |
| tcpview-1.0_8.pkg | 2025-12-29 21:54 | 109K | |
| tcpwatch-1.3_5.pkg | 2025-12-28 16:09 | 33K | |
| tcpxd-1.4_2.pkg | 2025-08-20 18:23 | 8.7K | |
| tcpxtract-1.0.1_1.pkg | 2025-08-16 17:04 | 14K | |
| tcshrc-1.6.2.pkg | 2025-08-15 23:32 | 27K | |
| td-system-tools-2.2...> | 2025-12-29 15:14 | 75K | |
| tdb-1.4.9_1,1.pkg | 2025-12-18 06:31 | 73K | |
| tdb1-1.4.14,1.pkg | 2025-12-19 22:54 | 74K | |
| tdb1410-1.4.10_3,1.pkg | 2025-12-19 00:22 | 73K | |
| tdb1413-1.4.13_1,1.pkg | 2025-12-20 00:28 | 74K | |
| tdbc-1.1.12.pkg | 2025-12-22 09:00 | 97K | |
| tde2e-1.8.59.pkg | 2025-12-27 16:40 | 595K | |
| tdetect-0.2.pkg | 2025-08-18 08:04 | 4.2K | |
| tdfiglet-0.5.pkg | 2025-08-22 09:16 | 2.4M | |
| tdiary-5.4.0.pkg | 2025-12-29 20:52 | 3.6M | |
| tdir-1.73_1.pkg | 2025-12-23 06:30 | 5.6K | |
| tdl-1.5.2_3.pkg | 2025-12-23 07:20 | 34K | |
| tdlib-1.8.48_4.pkg | 2025-12-22 06:46 | 10M | |
| tdrop-0.5.0_1.pkg | 2025-12-29 20:14 | 18K | |
| te-aspell-0.01.2_1,2..> | 2025-12-22 23:30 | 959K | |
| te-hunspell-0.01.2_3..> | 2025-08-22 09:15 | 435K | |
| te-libreoffice-25.8...> | 2025-12-27 08:49 | 377K | |
| tea-63.3.1_1.pkg | 2025-12-29 15:27 | 697K | |
| tealdeer-1.8.1_1.pkg | 2025-12-29 16:25 | 1.2M | |
| team-3.1_4.pkg | 2025-08-17 05:22 | 9.5K | |
| teamspeak3-server-3...> | 2025-12-23 19:53 | 7.2M | |
| teapot-2.3.0_1.pkg | 2025-08-16 08:51 | 311K | |
| teckit-2.5.11_1.pkg | 2025-12-17 23:38 | 1.2M | |
| tecla-47.0.pkg | 2025-12-26 15:43 | 28K | |
| tecnoballz-0.93.1_3.pkg | 2025-12-29 04:40 | 1.7M | |
| teco-0398_2.pkg | 2025-08-20 06:58 | 209K | |
| teddycloud-0.6.4_2.pkg | 2025-12-28 01:25 | 11M | |
| teem-1.11.0.pkg | 2025-12-29 05:19 | 1.1M | |
| teeworlds-0.7.5_2.pkg | 2025-12-29 23:42 | 8.1M | |
| tela-icon-theme-2025..> | 2025-12-27 08:27 | 2.4M | |
| telak-0.7_6.pkg | 2025-12-30 17:32 | 9.9K | |
| telegraf-1.37.0.pkg | 2025-12-22 09:33 | 54M | |
| telegram-cli-2020010..> | 2025-12-23 21:54 | 1.0M | |
| telegram-desktop-6.3..> | 2025-12-30 19:44 | 49M | |
| telegramqml-0.9.2_4.pkg | 2025-12-27 08:17 | 433K | |
| teleirc-2.3.0_21.pkg | 2025-12-21 02:03 | 2.3M | |
| telepathy-accounts-s..> | 2025-12-30 01:43 | 9.3K | |
| telepathy-farstream-..> | 2025-12-28 21:02 | 110K | |
| telepathy-gabble-0.1..> | 2025-12-30 15:12 | 734K | |
| telepathy-glib-0.24...> | 2025-12-19 00:35 | 2.1M | |
| telepathy-idle-0.2.2..> | 2025-12-19 03:28 | 56K | |
| telepathy-logger-0.8..> | 2025-12-22 09:59 | 157K | |
| telepathy-mission-co..> | 2025-12-19 16:21 | 195K | |
| telepathy-sofiasip-0..> | 2025-12-21 06:14 | 52K | |
| teleport-5.2.5_22.pkg | 2025-12-23 08:25 | 37M | |
| television-0.14.1.pkg | 2025-12-30 18:12 | 2.7M | |
| tellico-4.1.3_1.pkg | 2025-12-30 11:34 | 6.1M | |
| tempcontrol-1.2_3.pkg | 2025-12-23 15:01 | 23K | |
| temperature.app-1.5.pkg | 2025-12-23 05:07 | 14K | |
| tempest_for_eliza-1...> | 2025-12-23 13:36 | 13K | |
| template-glib-3.36.3..> | 2025-12-19 15:21 | 76K | |
| templatelite-2.10.pkg | 2025-12-29 07:19 | 178K | |
| tenacity-1.4.a1_1.pkg | 2025-12-29 22:56 | 7.5M | |
| tenebrae-1.04_13.pkg | 2025-12-30 18:20 | 3.2M | |
| tenere-0.11.3_2.pkg | 2025-12-29 18:18 | 3.2M | |
| tenshi-0.17_1.pkg | 2025-12-23 20:01 | 25K | |
| teo-1.8.4_2.pkg | 2025-12-28 12:08 | 161K | |
| tepl6-6.13.0.pkg | 2025-12-26 23:02 | 207K | |
| tere-1.6.0_11.pkg | 2025-12-28 21:28 | 863K | |
| termatrix-0.2.pkg | 2025-08-16 03:21 | 4.7K | |
| termbox-1.1.4.pkg | 2025-08-22 00:57 | 46K | |
| termbox2-2.5.0.pkg | 2025-08-16 22:22 | 118K | |
| termcolor-2.1.0.pkg | 2025-08-14 23:44 | 5.4K | |
| terminal-image-viewe..> | 2025-12-30 12:42 | 102K | |
| terminal.app-0.9.9_6..> | 2025-12-27 16:37 | 90K | |
| terminality-2.1.pkg | 2025-08-16 22:34 | 152K | |
| terminator-2.1.5.pkg | 2025-12-27 21:16 | 610K | |
| terminfo-db-20250719..> | 2025-12-18 23:58 | 314K | |
| terminology-1.14.0.pkg | 2025-12-28 03:27 | 2.6M | |
| terminus-font-4.49.1..> | 2025-12-30 16:20 | 1.6M | |
| terminus-ttf-4.49.3.pkg | 2025-12-30 06:24 | 377K | |
| termit-3.1_3.pkg | 2025-12-29 22:59 | 43K | |
| termplay-2.0.6_49.pkg | 2025-12-29 17:50 | 556K | |
| termscp-0.10.0_28.pkg | 2025-12-30 09:49 | 3.1M | |
| termshark-2.4.0_31.pkg | 2025-12-22 16:31 | 5.3M | |
| termshot-0.6.0_1.pkg | 2025-12-23 05:27 | 1.6M | |
| terraform-1.13.4_2.pkg | 2025-12-19 20:04 | 21M | |
| terraform-docs-0.20...> | 2025-12-20 13:07 | 5.2M | |
| terraform-ls-0.38.3.pkg | 2025-12-22 03:42 | 5.1M | |
| terraform-provider-g..> | 2025-12-23 20:59 | 5.5M | |
| terraform-provider-v..> | 2025-12-20 17:30 | 5.4M | |
| terraform-switcher-1..> | 2025-12-23 07:30 | 4.3M | |
| terragrunt-0.48.7.pkg | 2025-12-23 02:41 | 9.1M | |
| terragrunt-0.93.9_1.pkg | 2025-12-19 14:25 | 17M | |
| teseq-1.1.1_2.pkg | 2025-12-23 02:30 | 52K | |
| tessen-2.2.3.pkg | 2025-12-27 22:49 | 13K | |
| tesseract-5.5.1.pkg | 2025-12-26 22:34 | 2.5M | |
| tesseract-data-4.1.0..> | 2025-08-13 20:35 | 424M | |
| tesseract-game-2014...> | 2025-12-28 03:19 | 969K | |
| tesseract-game-data-..> | 2025-08-14 10:22 | 234M | |
| test-drive-0.5.0.pkg | 2025-12-29 22:02 | 24K | |
| testdisk-7.2.pkg | 2025-12-28 04:41 | 406K | |
| testssl.sh-3.2.2.pkg | 2025-12-23 05:33 | 852K | |
| tet-aspell-0.1.1_1,2..> | 2025-12-21 22:28 | 71K | |
| tetgen-1.5.1.pkg | 2025-08-18 14:14 | 332K | |
| tetradraw-2.0.2_1.pkg | 2025-08-17 04:55 | 63K | |
| tetraproc-0.10.0.pkg | 2025-12-30 08:36 | 54K | |
| tetrigo-0.2.0_5.pkg | 2025-08-21 13:02 | 2.9M | |
| tetrinet-0.11_1.pkg | 2025-08-21 22:39 | 46K | |
| tetrinet-x-1.13.16_2..> | 2025-08-19 10:52 | 34K | |
| tetzle-3.0.3.pkg | 2025-12-27 22:04 | 432K | |
| tevent-0.15.0_1.pkg | 2025-12-18 05:36 | 52K | |
| tevent016-0.16.1_3.pkg | 2025-12-18 22:29 | 52K | |
| tevent017-0.17.1.pkg | 2025-12-19 12:38 | 53K | |
| tex-basic-engines-20..> | 2025-12-26 04:11 | 1.1M | |
| tex-dvipdfmx-2025030..> | 2025-12-26 18:57 | 3.2M | |
| tex-dvipsk-20250308.pkg | 2025-12-26 05:02 | 3.3M | |
| tex-formats-20250308..> | 2025-12-26 05:04 | 14M | |
| tex-jadetex-20250308..> | 2025-12-26 18:51 | 8.1M | |
| tex-kpathsea-6.4.1.pkg | 2025-08-13 00:05 | 182K | |
| tex-libtexlua-5.3.6_..> | 2025-08-13 15:08 | 186K | |
| tex-libtexluajit-2.1..> | 2025-08-13 14:29 | 422K | |
| tex-luatex-20250308_..> | 2025-12-26 15:04 | 88M | |
| tex-ptexenc-1.5.1.pkg | 2025-08-13 00:17 | 40K | |
| tex-synctex-2.0.0_5.pkg | 2025-08-14 06:55 | 81K | |
| tex-web2c-20250308.pkg | 2025-12-26 03:48 | 1.1M | |
| tex-xdvik-22.87.06_4..> | 2025-12-27 17:07 | 375K | |
| tex-xetex-20250308_1..> | 2025-12-27 00:28 | 45M | |
| tex-xmltex-20250308.pkg | 2025-12-26 17:31 | 6.2M | |
| texi2db-0.5_1.pkg | 2025-12-23 17:05 | 18K | |
| texi2html-5.0_5,1.pkg | 2025-12-16 01:54 | 511K | |
| texi2mdoc-0.1.2_1.pkg | 2025-08-19 12:33 | 23K | |
| texinfo-7.2_3,1.pkg | 2025-12-16 01:31 | 1.8M | |
| texlab-4.2.0_31.pkg | 2025-12-28 16:09 | 9.2M | |
| texlive-base-2025030..> | 2025-12-26 04:08 | 4.6M | |
| texlive-docs-2025030..> | 2025-12-20 02:35 | 2.8G | |
| texlive-full-2025030..> | 2025-12-30 09:24 | 971 | |
| texlive-texmf-202503..> | 2025-12-18 00:24 | 1.3G | |
| texlive-texmf-source..> | 2025-08-16 16:01 | 75M | |
| texlive-tlmgr-202503..> | 2025-12-17 23:47 | 1.7M | |
| texmaker-5.0.3_5,3.pkg | 2025-12-28 10:43 | 10M | |
| texstudio-4.9.0_1.pkg | 2025-12-30 13:16 | 52M | |
| textadept-11.4_2.pkg | 2025-12-29 04:14 | 2.9M | |
| textmail-20070803_45..> | 2025-12-29 04:02 | 20K | |
| textmaze-1.2.pkg | 2025-12-23 20:57 | 7.5K | |
| textnote-1.3.0_33.pkg | 2025-12-20 04:36 | 1.7M | |
| textogif-1.1_4.pkg | 2025-12-29 02:29 | 4.0K | |
| textql-g20210706_27.pkg | 2025-12-22 17:00 | 1.5M | |
| texvc-20050202_10.pkg | 2025-12-30 09:33 | 356K | |
| texworks-0.6.7_9.pkg | 2025-12-30 02:23 | 2.5M | |
| teyjus-2.1.7_1.pkg | 2025-08-19 00:42 | 1.3M | |
| tf-5.0b8_5.pkg | 2025-08-22 11:53 | 342K | |
| tfel-mfront-edf-3.2...> | 2025-12-30 11:04 | 2.9M | |
| tfhe-1.0.1.30.pkg | 2025-08-22 00:31 | 130K | |
| tflint-0.60.0.pkg | 2025-12-23 21:44 | 12M | |
| tftp-hpa-5.2_3.pkg | 2025-08-15 13:49 | 41K | |
| tftpgrab-0.2.pkg | 2025-08-19 09:25 | 13K | |
| tg-libreoffice-25.8...> | 2025-12-27 15:34 | 2.8M | |
| tg_owt-0.0.20251212_..> | 2025-12-27 09:25 | 6.0M | |
| tgif-4.2.5_4.pkg | 2025-12-27 17:28 | 1.2M | |
| tgif2tex-2.13_4.pkg | 2025-12-21 03:44 | 52K | |
| tgpt-2.11.0_5.pkg | 2025-12-22 05:01 | 3.2M | |
| th-libreoffice-25.8...> | 2025-12-27 13:20 | 836K | |
| thanos-0.40.1_2.pkg | 2025-12-23 04:33 | 22M | |
| the-3.3.r4_3.pkg | 2025-08-19 02:37 | 428K | |
| the-algorithms-c++-g..> | 2025-08-17 11:42 | 603K | |
| the-way-0.20.3_17.pkg | 2025-12-29 23:48 | 2.7M | |
| the_silver_searcher-..> | 2025-08-16 19:02 | 37K | |
| thebridge-1.09_2.pkg | 2025-12-21 05:30 | 97K | |
| thefish-0.6.8.pkg | 2025-12-29 14:16 | 38K | |
| thefuck-3.32_1.pkg | 2025-12-23 19:02 | 175K | |
| thegrind-0.1.2_6.pkg | 2025-12-29 00:39 | 117K | |
| theonionbox-4.3.1_5.pkg | 2025-12-30 13:10 | 11M | |
| thermofun-0.5.1.pkg | 2025-12-21 01:31 | 1.1M | |
| theseus-ship-6.2.0_3..> | 2025-12-29 16:04 | 1.6M | |
| thewidgetfactory-0.2..> | 2025-12-28 12:39 | 11K | |
| thingylaunch-4.0.0.pkg | 2025-08-22 03:19 | 24K | |
| thinkingrock-2.2.1_3..> | 2025-12-30 16:27 | 31M | |
| thirtybees-1.6.0.pkg | 2025-12-29 13:25 | 25M | |
| thokr-0.4.1_27.pkg | 2025-12-30 07:11 | 629K | |
| thonny-py311-4.1.7.pkg | 2025-12-30 17:14 | 2.0M | |
| three.js-182.pkg | 2025-12-23 16:27 | 278M | |
| threema-web-2.6.2.pkg | 2025-08-20 17:55 | 22M | |
| thrift-0.22.0,1.pkg | 2025-12-18 06:31 | 1.2M | |
| thrift-c_glib-0.22.0..> | 2025-12-23 20:51 | 67K | |
| thrift-cpp-0.22.0_1,..> | 2025-12-18 07:33 | 321K | |
| thrill-g20200406_2.pkg | 2025-12-29 23:38 | 2.8M | |
| throttled-0.5.2.pkg | 2025-08-16 08:07 | 12K | |
| thrulay-0.9_2.pkg | 2025-08-15 23:05 | 67K | |
| thrust-1.9.5_1.pkg | 2025-08-15 04:33 | 493K | |
| thttpd-2.29_1.pkg | 2025-08-16 09:47 | 67K | |
| thumbnail_index-1998..> | 2025-12-30 02:00 | 6.3K | |
| thunar-4.20.6.pkg | 2025-12-26 20:36 | 1.5M | |
| thunar-archive-plugi..> | 2025-12-27 16:58 | 37K | |
| thunar-media-tags-pl..> | 2025-12-27 02:28 | 64K | |
| thunar-vcs-plugin-0...> | 2025-12-27 02:29 | 192K | |
| thunderbird-146.0.1_..> | 2025-12-27 13:13 | 84M | |
| thunderbird-dictiona..> | 2025-12-30 10:42 | 14M | |
| thunderbird-esr-140...> | 2025-12-29 21:49 | 81M | |
| ti-hunspell-20090911..> | 2025-08-19 04:34 | 370K | |
| tiatracker-1.3_2.pkg | 2025-12-30 08:14 | 3.9M | |
| ticcutils-0.36_2.pkg | 2025-12-18 19:31 | 270K | |
| ticker-5.1.0_1.pkg | 2025-12-21 04:08 | 4.3M | |
| tickrs-0.14.11_2.pkg | 2025-12-29 11:33 | 1.4M | |
| tidy-html5-5.8.0_3.pkg | 2025-12-18 21:03 | 411K | |
| tidy4-20000804_4.pkg | 2025-08-17 23:18 | 107K | |
| tiempo-1.11.5_2.pkg | 2025-12-27 19:51 | 1.8M | |
| tiemu3-3.03_15.pkg | 2025-12-30 15:43 | 1.6M | |
| tif22pnm-0.14_2.pkg | 2025-12-27 17:13 | 37K | |
| tiff-4.7.1.pkg | 2025-12-24 20:23 | 1.2M | |
| tifmerge-1.0_2.pkg | 2025-08-22 11:44 | 5.5K | |
| tig-2.6.0.pkg | 2025-12-23 11:45 | 218K | |
| tigcc-0.96.b8_11.pkg | 2025-12-29 11:27 | 3.1M | |
| tigervnc-server-1.15..> | 2025-12-30 09:12 | 1.2M | |
| tigervnc-viewer-1.15..> | 2025-12-27 18:48 | 368K | |
| tigervnc-viewer-java..> | 2025-12-29 19:42 | 578K | |
| tightvnc-1.3.10_9.pkg | 2025-12-29 16:27 | 739K | |
| tijmp-0.8.pkg | 2025-08-18 17:43 | 112K | |
| tikiwiki-29.0.pkg | 2025-12-30 12:28 | 111M | |
| tikzit-2.1.6_31.pkg | 2025-12-28 07:17 | 308K | |
| tilda-2.0.0.pkg | 2025-12-28 23:31 | 127K | |
| tile38-1.12.0_33.pkg | 2025-12-21 10:34 | 5.4M | |
| tiled-1.8.6.pkg | 2025-12-28 10:47 | 2.8M | |
| tiledb-2.30.0.pkg | 2025-12-27 06:47 | 3.2M | |
| tilem-2.0_5.pkg | 2025-12-30 06:44 | 2.2M | |
| tileworld-1.3.0_7.pkg | 2025-12-20 10:40 | 750K | |
| tilix-1.9.6_2.pkg | 2025-12-30 08:59 | 1.4M | |
| tilp2-1.18_3.pkg | 2025-12-28 06:33 | 319K | |
| timbl-6.10_2.pkg | 2025-12-20 20:03 | 323K | |
| timbre-mill-0.5.6_1.pkg | 2025-12-29 12:32 | 198K | |
| timed-8.1_2.pkg | 2025-08-16 09:14 | 35K | |
| timeless-1.0_7.pkg | 2025-12-21 21:18 | 317K | |
| timelimit-1.9.2_1.pkg | 2025-08-17 10:56 | 7.5K | |
| timely-lv2-g20190412..> | 2025-08-20 13:19 | 6.1K | |
| timemachine-0.3.3_9.pkg | 2025-12-29 21:13 | 76K | |
| timemon-4.2_7.pkg | 2025-12-27 08:48 | 31K | |
| timescaledb-2.24.0.pkg | 2025-12-23 08:54 | 627K | |
| timescaledb-backup-0..> | 2025-12-22 22:01 | 2.7M | |
| timescaledb-tune-0.1..> | 2025-12-23 10:18 | 850K | |
| timestamp-authority-..> | 2025-12-22 16:39 | 22M | |
| timetrace-0.14.3_34.pkg | 2025-12-22 03:18 | 2.5M | |
| timewarrior-1.9.1.pkg | 2025-12-22 12:57 | 346K | |
| timezonemap-0.4.5.3.pkg | 2025-12-27 04:51 | 2.4M | |
| timg-1.6.3_1.pkg | 2025-12-30 11:35 | 142K | |
| timidity++-2.15.0_1.pkg | 2025-12-27 15:59 | 514K | |
| timidity++-emacs-2.1..> | 2025-12-28 05:05 | 10K | |
| timidity++-gtk-2.15...> | 2025-12-29 01:03 | 20K | |
| timidity++-motif-2.1..> | 2025-12-29 12:42 | 13K | |
| timidity++-slang-2.1..> | 2025-12-29 18:09 | 9.0K | |
| timidity++-xaw-2.15...> | 2025-12-30 10:29 | 67K | |
| timidity++-xskin-2.1..> | 2025-12-30 09:03 | 23K | |
| timidity-0.2i_1.pkg | 2025-08-13 15:34 | 9.5M | |
| timr-tui-1.6.1_2.pkg | 2025-12-30 00:24 | 1.2M | |
| tin-2.6.5.pkg | 2025-12-30 09:37 | 732K | |
| tinc-1.0.36_3.pkg | 2025-08-16 13:07 | 105K | |
| tinc-devel-1.1pre18_..> | 2025-12-23 01:33 | 234K | |
| tinker-25.6.3.pkg | 2025-12-30 05:34 | 36M | |
| tint2-16.7_7.pkg | 2025-12-28 00:09 | 360K | |
| tintfu-0.0.4_3.pkg | 2025-12-30 07:14 | 69K | |
| tintin++-2.02.51.pkg | 2025-08-16 16:38 | 1.5M | |
| tiny-bignum-c-g20210..> | 2025-08-21 20:37 | 14K | |
| tiny-network-utiliti..> | 2025-12-19 17:16 | 9.5K | |
| tinyauth-4.0.1_2.pkg | 2025-12-20 19:12 | 10M | |
| tinyca-0.7.6_4.pkg | 2025-12-30 12:05 | 50K | |
| tinycbor-0.6.1_1.pkg | 2025-12-22 16:13 | 46K | |
| tinycdb-0.81.pkg | 2025-08-14 09:12 | 30K | |
| tinycols-0.8.5.pkg | 2025-12-22 15:36 | 10K | |
| tinyexpr-g20221120.pkg | 2025-08-14 11:24 | 7.8K | |
| tinyfugue-devel-5.2...> | 2025-12-23 15:42 | 368K | |
| tinygo-0.19.0_33.pkg | 2025-12-20 08:16 | 27M | |
| tinylaf-1.4.0.pkg | 2025-12-29 19:36 | 885K | |
| tinyldap-0.0.2017031..> | 2025-08-19 03:31 | 85K | |
| tinymce-8.3.0.pkg | 2025-12-29 20:18 | 596K | |
| tinymembench-0.4.pkg | 2025-12-28 00:57 | 7.2K | |
| tinymt-1.1.2.pkg | 2025-08-20 04:22 | 7.3K | |
| tinyobjloader-2.0.0...> | 2025-08-16 22:50 | 72K | |
| tinyopt-1.0.8.pkg | 2025-12-18 19:22 | 9.6K | |
| tinyows-1.2.2_1.pkg | 2025-12-30 00:40 | 165K | |
| tinyproxy-1.11.2_3,1..> | 2025-12-21 04:16 | 52K | |
| tinysparql-3.10.1.pkg | 2025-12-26 15:41 | 1.2M | |
| tinywm-1.3_3.pkg | 2025-08-16 19:15 | 3.9K | |
| tinyxml-2.6.2_4.pkg | 2025-08-13 14:51 | 141K | |
| tinyxml2-11.0.0_1,1.pkg | 2025-08-13 12:56 | 88K | |
| tio-3.9.pkg | 2025-12-21 11:33 | 70K | |
| tiramisu-2.0.2024061..> | 2025-12-23 20:28 | 11K | |
| titlefix-0.5.3_1.pkg | 2025-12-21 09:15 | 6.1K | |
| tits-1.3.0_1.pkg | 2025-08-21 17:45 | 27K | |
| tivodecode-0.2.p4.pkg | 2025-08-17 15:27 | 34K | |
| tivoka-3.5.2.pkg | 2025-12-29 23:14 | 12K | |
| tix-8.4.3_3.pkg | 2025-12-30 15:45 | 343K | |
| tk-aspell-0.01.0_1.pkg | 2025-12-21 03:14 | 74K | |
| tk-hunspell-0.1.6.pkg | 2025-08-21 15:14 | 195K | |
| tk-wrapper-1.1_3.pkg | 2025-12-26 19:58 | 8.4K | |
| tk86-8.6.17.pkg | 2025-12-26 05:39 | 1.9M | |
| tk90-9.0.3_1.pkg | 2025-12-30 07:28 | 839K | |
| tkRunIt-0.94.1_2.pkg | 2025-12-30 06:43 | 6.9K | |
| tkabber-1.1.2_2.pkg | 2025-12-27 18:48 | 966K | |
| tkabber-plugins-1.1...> | 2025-12-29 11:33 | 678K | |
| tkcon-2.5.pkg | 2025-12-28 05:19 | 116K | |
| tkcron-2.12_3.pkg | 2025-12-27 19:46 | 5.0K | |
| tkcvs-9.3.3.pkg | 2025-12-29 11:25 | 214K | |
| tkdiff-6.0.pkg | 2025-12-27 15:40 | 236K | |
| tkdnd-2.8_1.pkg | 2025-12-28 08:11 | 40K | |
| tkdvd-4.0.9_4.pkg | 2025-12-29 19:02 | 43K | |
| tkeca-4.4.3.pkg | 2025-12-28 10:09 | 40K | |
| tkfont-1.1_3.pkg | 2025-12-29 03:38 | 14K | |
| tkinfo-2.11_1.pkg | 2025-12-27 21:42 | 44K | |
| tkmoo-0.3.32_3.pkg | 2025-12-29 12:57 | 77K | |
| tkp4-1.12_3.pkg | 2025-12-28 03:19 | 97K | |
| tkpng-0.9_1.pkg | 2025-12-27 13:05 | 16K | |
| tkregexp-3.1.pkg | 2025-12-29 16:22 | 25K | |
| tkrzw-1.0.32.pkg | 2025-12-19 20:11 | 894K | |
| tkscanfax-1.1.8_2,1.pkg | 2025-12-27 21:55 | 171K | |
| tkshape-0.4_4.pkg | 2025-12-29 00:55 | 25K | |
| tktable-2.10_1.pkg | 2025-12-27 16:28 | 60K | |
| tktray-1.3.9_1.pkg | 2025-12-27 17:52 | 15K | |
| tktreectrl-2.4.1.pkg | 2025-12-27 12:27 | 329K | |
| tkxmlive-0.1.5_2.pkg | 2025-12-29 06:39 | 70K | |
| tl-aspell-0.02.1_1,2..> | 2025-12-21 18:43 | 105K | |
| tl-expected-1.3.1.pkg | 2025-12-18 21:31 | 13K | |
| tlb-0.11a_1.pkg | 2025-12-22 07:43 | 27K | |
| tlci-0.1.0.2_1.pkg | 2025-08-16 04:31 | 14K | |
| tldr-1.12.0_3.pkg | 2025-12-29 19:53 | 1.2M | |
| tldx-1.3.0_6.pkg | 2025-12-21 09:18 | 3.1M | |
| tlf-1.4.1_4.pkg | 2025-12-29 03:17 | 297K | |
| tlfloat-1.15.0_1.pkg | 2025-12-18 02:49 | 448K | |
| tllist-1.1.0.pkg | 2025-08-13 22:02 | 3.2K | |
| tlm-1.2_1.pkg | 2025-12-22 20:59 | 3.5M | |
| tls-check-1.0.2_7.pkg | 2025-12-20 17:22 | 111K | |
| tlsc-2.0.pkg | 2025-12-21 17:04 | 9.1K | |
| tlsdate-0.0.13_5.pkg | 2025-08-17 05:39 | 162K | |
| tlsh-4.7.2.pkg | 2025-08-20 17:10 | 885K | |
| tlwg-ttf-0.6.1.pkg | 2025-08-20 22:43 | 2.0M | |
| tlx-0.6.1.pkg | 2025-08-19 17:42 | 1.1M | |
| tm-0.4.1_1.pkg | 2025-08-16 16:54 | 16K | |
| tmate-2.4.0_4.pkg | 2025-12-20 11:12 | 223K | |
| tmate-ssh-server-g20..> | 2025-12-23 16:21 | 183K | |
| tmatrix-1.4.pkg | 2025-08-16 05:58 | 44K | |
| tme-0.8_7.pkg | 2025-12-30 10:12 | 446K | |
| tmpmail-1.2.3.pkg | 2025-12-21 22:31 | 4.7K | |
| tmpreaper-1.6.18.pkg | 2025-08-16 17:38 | 13K | |
| tmpwatch-2.11_1.pkg | 2025-08-16 09:06 | 14K | |
| tmu-1.901.b_2.pkg | 2025-12-30 00:23 | 917K | |
| tmux-3.6_1.pkg | 2025-12-18 21:39 | 477K | |
| tmux-mem-cpu-load-3...> | 2025-08-20 15:48 | 13K | |
| tmux-xpanes-4.2.0.pkg | 2025-12-23 19:50 | 30K | |
| tmux23-2.3_2.pkg | 2025-08-15 23:10 | 253K | |
| tmv-0.76_1.pkg | 2025-12-28 15:31 | 4.3M | |
| tn-aspell-1.0.1.0_1,..> | 2025-12-22 05:40 | 46K | |
| tn-hunspell-20110323..> | 2025-08-16 11:09 | 68K | |
| tn-libreoffice-25.8...> | 2025-12-27 10:56 | 205K | |
| tn5250-0.17.6_1.pkg | 2025-08-20 09:24 | 170K | |
| tnef-1.4.18.pkg | 2025-08-14 20:11 | 31K | |
| tnef2txt-1.4.pkg | 2025-08-16 16:56 | 8.9K | |
| tnftp-20230507_1.pkg | 2025-12-23 15:25 | 86K | |
| tnftpd-20231001_1.pkg | 2025-08-18 10:10 | 86K | |
| tnt-1.2.6.pkg | 2025-08-14 20:21 | 43K | |
| tntnet-2.2.1_6.pkg | 2025-08-22 00:18 | 630K | |
| tnylpo-1.1.4_1.pkg | 2025-08-17 04:15 | 83K | |
| tocaia-0.9.0.pkg | 2025-12-22 17:35 | 11K | |
| toccata-lv2-g2020081..> | 2025-12-30 05:30 | 3.3M | |
| todo-2.13.0_1.pkg | 2025-12-23 00:06 | 16K | |
| todour-2.22.pkg | 2025-12-30 09:45 | 219K | |
| tofi-0.9.1_1.pkg | 2025-12-29 03:54 | 49K | |
| togl-2.0_3.pkg | 2025-12-26 22:44 | 128K | |
| toilet-0.3_3.pkg | 2025-12-28 06:12 | 706K | |
| tokay-0.6.13_2.pkg | 2025-12-29 08:17 | 1.0M | |
| tokei-13.0.0_1.pkg | 2025-12-29 19:45 | 1.4M | |
| tokio-console-0.1.14..> | 2025-12-29 12:16 | 1.8M | |
| tokodon-25.12.0.pkg | 2025-12-29 04:38 | 1.8M | |
| tokyocabinet-1.4.48_..> | 2025-08-13 18:01 | 1.0M | |
| tokyodystopia-0.9.15..> | 2025-08-20 02:12 | 135K | |
| tokyopromenade-0.9.2..> | 2025-12-24 07:03 | 97K | |
| tokyotyrant-1.1.41_3..> | 2025-12-18 19:09 | 199K | |
| tolua++-1.0.93_3.pkg | 2025-12-18 20:49 | 47K | |
| tolua-5.2.4.pkg | 2025-12-22 10:56 | 52K | |
| tomatoes-1.55_2.pkg | 2025-12-30 02:58 | 8.6M | |
| tomcat-devel-11.0.15..> | 2025-12-30 06:26 | 12M | |
| tomcat-native-1.3.0_..> | 2025-12-29 00:15 | 97K | |
| tomcat-native2-2.0.7..> | 2025-12-29 19:15 | 29K | |
| tomcat9-9.0.113.pkg | 2025-12-26 18:12 | 11M | |
| tomcat101-10.1.50.pkg | 2025-12-27 16:46 | 12M | |
| tomcat110-11.0.15.pkg | 2025-12-30 00:17 | 12M | |
| tome4-1.7.6_1.pkg | 2025-12-28 01:14 | 454M | |
| tome4-beta-1.6.0.b7_..> | 2025-12-28 17:44 | 397M | |
| tomee-8.0.16_1.pkg | 2025-12-29 19:21 | 46M | |
| tomenet-4.6.0.pkg | 2025-08-17 15:02 | 2.0M | |
| toml-f-0.4.2.pkg | 2025-12-26 18:35 | 428K | |
| toml11-3.7.1.pkg | 2025-08-15 07:53 | 57K | |
| tomlplusplus-3.4.0.pkg | 2025-08-14 02:56 | 166K | |
| tomlq-0.2.2_7.pkg | 2025-12-30 00:04 | 348K | |
| tomsfastmath-0.13.1_..> | 2025-08-17 15:41 | 101K | |
| tong-1.3_2.pkg | 2025-12-27 22:17 | 44M | |
| toolboxkit-0.8_12.pkg | 2025-12-27 06:48 | 6.3K | |
| toonel-0.0.50.50_1.pkg | 2025-12-30 03:12 | 109K | |
| topaz-3.41_2.pkg | 2025-12-20 16:02 | 323K | |
| topcom-1.1.2_1.pkg | 2025-12-19 10:55 | 1.7M | |
| topgrade-16.0.2_8.pkg | 2025-12-28 06:29 | 2.1M | |
| topless-1.52_1.pkg | 2025-08-17 11:12 | 6.1K | |
| toppler-1.3_4.pkg | 2025-12-28 10:11 | 1.6M | |
| tor-0.4.8.21.pkg | 2025-12-19 02:37 | 3.8M | |
| torcs-1.3.7_5.pkg | 2025-12-28 03:42 | 331M | |
| tornado-1.4_5.pkg | 2025-12-20 12:25 | 38K | |
| torrent-0.8.2_13.pkg | 2025-12-29 07:01 | 430K | |
| torrent-file-editor-..> | 2025-12-29 00:42 | 293K | |
| torrentcheck-1.00_1.pkg | 2025-08-19 10:40 | 17K | |
| torrentsniff-0.3.0_1..> | 2025-12-23 21:47 | 4.9K | |
| torrentzip-0.2_3.pkg | 2025-08-22 01:36 | 22K | |
| torrus-2.09_4.pkg | 2025-12-30 13:17 | 408K | |
| torsocks-2.5.0.pkg | 2025-12-23 12:12 | 72K | |
| tortoisehg-7.0.1.pkg | 2025-12-28 14:50 | 2.0M | |
| tosha-0.6_2.pkg | 2025-08-19 13:12 | 30K | |
| totd-1.5.1_3.pkg | 2025-08-21 01:27 | 41K | |
| totem-43.2.pkg | 2025-12-27 12:49 | 1.3M | |
| totem-pl-parser-3.26..> | 2025-12-18 12:18 | 102K | |
| totp-cli-1.9.2_10.pkg | 2025-12-21 09:25 | 1.7M | |
| touchegg-2.0.18.pkg | 2025-12-27 22:46 | 94K | |
| tox_extension_messag..> | 2025-12-27 09:58 | 7.0K | |
| toxbot-g20180325_4.pkg | 2025-12-30 00:11 | 13K | |
| toxcore-0.2.21,1.pkg | 2025-12-26 19:50 | 442K | |
| toxext-0.0.3_7.pkg | 2025-12-26 21:43 | 9.0K | |
| toxic-0.16.1_1.pkg | 2025-12-29 03:17 | 1.0M | |
| toxins-g20180217_4.pkg | 2025-12-29 15:56 | 25K | |
| toxiproxy-cli-2.12.0..> | 2025-12-23 05:39 | 3.3M | |
| toxiproxy-server-2.1..> | 2025-12-21 17:46 | 2.9M | |
| toybox-0.8.11.pkg | 2025-08-22 02:34 | 163K | |
| toycars-0.3.10_9.pkg | 2025-12-29 07:32 | 5.6M | |
| tpasm-1.11.pkg | 2025-08-19 17:45 | 112K | |
| tpb-0.6.4_14.pkg | 2025-12-21 07:03 | 31K | |
| tpm-emulator-0.7.4_3..> | 2025-08-13 18:47 | 121K | |
| tpm-quote-tools-1.0...> | 2025-08-20 22:15 | 25K | |
| tpm-tools-1.3.9.1_2.pkg | 2025-12-21 22:19 | 159K | |
| tpm2-abrmd-3.0.0_4.pkg | 2025-12-19 06:57 | 133K | |
| tpm2-openssl-1.3.0.pkg | 2025-12-22 14:39 | 29K | |
| tpm2-pkcs11-1.9.1.pkg | 2025-12-21 06:19 | 99K | |
| tpm2-tools-5.6_2.pkg | 2025-12-23 01:47 | 686K | |
| tpm2-tss-4.0.1_3.pkg | 2025-12-18 20:41 | 1.1M | |
| tpop3d-1.5.5_6.pkg | 2025-08-19 07:09 | 85K | |
| tr-aspell-0.50.0_1,1..> | 2025-12-22 04:56 | 524K | |
| tr-freebsd-doc-20251..> | 2025-12-20 00:17 | 72K | |
| tr-libreoffice-25.8...> | 2025-12-27 11:55 | 3.4M | |
| trac-1.6_6.pkg | 2025-12-27 16:16 | 2.5M | |
| trac-accountmanager-..> | 2025-12-30 17:42 | 236K | |
| trac-markdownmacro-0..> | 2025-12-28 13:16 | 16K | |
| trac-spamfilter-1.5...> | 2025-12-29 22:17 | 350K | |
| trac-tocmacro-12.0.0..> | 2025-12-30 02:30 | 11K | |
| traccar-6.11.1.pkg | 2025-12-27 21:24 | 138M | |
| trackballs-1.3.5.pkg | 2025-12-30 02:59 | 30M | |
| tractorgen-0.31.7_3.pkg | 2025-08-16 13:26 | 6.1K | |
| tracy-0.13.0.pkg | 2025-12-23 15:49 | 232K | |
| tradcpp-0.5.3.pkg | 2025-08-11 00:10 | 30K | |
| traefik-3.6.5.pkg | 2025-12-27 10:47 | 32M | |
| traff-0.7_3.pkg | 2025-12-23 19:29 | 14K | |
| trafficserver-10.1.0..> | 2025-12-30 12:16 | 4.1M | |
| trafshow-5.2.3_4,1.pkg | 2025-08-18 14:09 | 54K | |
| trafshow3-3.1_9,1.pkg | 2025-08-18 17:29 | 20K | |
| traingame-0.3_35.pkg | 2025-12-27 22:35 | 1.0M | |
| trang-20241231.pkg | 2025-12-30 18:44 | 749K | |
| trans-1.20_1.pkg | 2025-08-19 14:40 | 111K | |
| transcrypt-2.3.1.pkg | 2025-12-23 19:30 | 18K | |
| transfig-3.2.5e_6.pkg | 2025-12-27 03:03 | 234K | |
| transient-0.11.0.pkg | 2025-12-26 20:47 | 158K | |
| transient-emacs_cann..> | 2025-12-26 21:07 | 158K | |
| transient-emacs_deve..> | 2025-12-26 23:43 | 158K | |
| transient-emacs_deve..> | 2025-12-18 23:43 | 158K | |
| transient-emacs_nox-..> | 2025-12-18 20:38 | 158K | |
| transient-emacs_wayl..> | 2025-12-26 21:48 | 158K | |
| translate-1.20_1.pkg | 2025-12-22 17:57 | 4.7K | |
| translate-shell-0.9...> | 2025-12-27 11:33 | 48K | |
| translate-toolkit-3...> | 2025-12-28 23:35 | 1.1M | |
| transmission-4.0.6_1..> | 2025-12-28 14:27 | 804 | |
| transmission-cli-4.0..> | 2025-12-20 00:21 | 550K | |
| transmission-daemon-..> | 2025-12-20 04:25 | 563K | |
| transmission-docs-4...> | 2025-12-19 12:01 | 25K | |
| transmission-gtk-4.0..> | 2025-12-27 03:29 | 1.2M | |
| transmission-qt-4.0...> | 2025-12-27 10:42 | 1.0M | |
| transmission-remote-..> | 2025-12-28 04:41 | 2.3M | |
| transmission-remote-..> | 2025-12-29 07:25 | 2.3M | |
| transmission-remote-..> | 2025-12-30 04:15 | 2.3M | |
| transmission-utils-4..> | 2025-12-19 03:15 | 965K | |
| transmission-web-4.0..> | 2025-12-19 22:32 | 68K | |
| transproxy-1.6_1.pkg | 2025-08-17 19:27 | 16K | |
| transset-1.0.2_3,1.pkg | 2025-08-22 13:12 | 8.3K | |
| transwarp-2.2.3.pkg | 2025-08-18 15:34 | 18K | |
| trantor-1.5.24.pkg | 2025-08-14 16:45 | 178K | |
| trayer-1.1.8_2.pkg | 2025-12-30 09:49 | 24K | |
| trdsql-0.20.0_14.pkg | 2025-12-22 14:00 | 3.5M | |
| trealla-prolog-2.68...> | 2025-12-22 14:34 | 517K | |
| tree-2.2.1.pkg | 2025-08-14 00:37 | 52K | |
| tree-sitter-0.25.10.pkg | 2025-12-18 07:32 | 123K | |
| tree-sitter-cli-0.25..> | 2025-12-27 00:27 | 1.8M | |
| tree-sitter-grammars..> | 2025-12-27 11:24 | 9.9M | |
| tree-sitter-graph-0...> | 2025-12-28 00:23 | 1.1M | |
| treefmt-2.1.1_3.pkg | 2025-08-20 21:37 | 2.6M | |
| treeform-1.0.3.pkg | 2025-12-30 05:23 | 1.6M | |
| treekin-0.5.1_7.pkg | 2025-12-29 23:30 | 60K | |
| treeline-3.2.1.pkg | 2025-12-29 08:19 | 1.0M | |
| treepuzzle-5.2.pkg | 2025-08-20 09:06 | 186K | |
| treepy.el-0.1.2_15.pkg | 2025-12-26 21:03 | 11K | |
| treepy.el-emacs_cann..> | 2025-12-26 22:55 | 11K | |
| treepy.el-emacs_deve..> | 2025-12-26 23:56 | 11K | |
| treepy.el-emacs_deve..> | 2025-12-18 21:44 | 11K | |
| treepy.el-emacs_nox-..> | 2025-12-18 19:10 | 11K | |
| treepy.el-emacs_wayl..> | 2025-12-26 21:44 | 11K | |
| treesheets-2830.pkg | 2025-12-30 14:33 | 2.9M | |
| treetop-0.0.0.202202..> | 2025-12-23 01:32 | 627K | |
| trellis-g2025011100_..> | 2025-12-19 23:21 | 2.0M | |
| tremotesf-qt6-2.9.0_..> | 2025-12-30 16:07 | 668K | |
| tremulous-1.1.0_14.pkg | 2025-08-19 02:49 | 92M | |
| trenchbroom-2.0.0.b_..> | 2025-12-28 05:17 | 1.8M | |
| trezord-2.0.33.9.pkg | 2025-12-21 06:02 | 2.9M | |
| triangle-1.6_5.pkg | 2025-08-13 16:38 | 143K | |
| triceratops-lv2-0.5...> | 2025-12-30 01:42 | 275K | |
| trickle-1.07_8.pkg | 2025-08-20 00:11 | 36K | |
| trigger-rally-0.6.6...> | 2025-12-29 13:47 | 114M | |
| trilinos-16.2.0.pkg | 2025-12-27 06:03 | 52M | |
| trillian-1.7.2_9.pkg | 2025-12-22 02:53 | 39M | |
| trilogy-2.9.0.pkg | 2025-08-20 20:52 | 56K | |
| trimadap-0.1.4.pkg | 2025-08-14 22:55 | 12K | |
| trimines-1.3.0_7.pkg | 2025-12-22 13:57 | 48K | |
| trimmomatic-0.39.pkg | 2025-12-27 06:03 | 117K | |
| trio-1.16_1.pkg | 2025-08-15 20:37 | 85K | |
| triplane-1.08.r20130..> | 2025-12-24 01:09 | 1.1M | |
| trippy-0.13.0_6.pkg | 2025-12-30 11:03 | 2.1M | |
| tripwire-2.4.3.8_2.pkg | 2025-12-21 03:50 | 1.1M | |
| triton-0.9.597_1.pkg | 2025-12-21 11:29 | 1.3M | |
| triton-guesttools-0...> | 2025-12-22 18:29 | 4.9K | |
| trivy-0.68.2.pkg | 2025-12-30 12:01 | 39M | |
| trlan-201009_12.pkg | 2025-12-29 22:48 | 280K | |
| trlib-0.4_3.pkg | 2025-12-30 15:10 | 58K | |
| trn-3.6_1.pkg | 2025-08-18 11:10 | 190K | |
| trn4-4.0.b77_1.pkg | 2025-08-21 04:10 | 335K | |
| trojka-1.0_2.pkg | 2025-08-19 06:11 | 12K | |
| trompeloeil-49.pkg | 2025-08-21 04:20 | 229K | |
| trousers-0.3.14_5.pkg | 2025-08-14 05:47 | 511K | |
| trove4j-3.1a1.pkg | 2025-12-29 22:10 | 2.6M | |
| truc-0.12.0_3.pkg | 2025-12-29 23:01 | 1.1M | |
| trueos-libqt5-201710..> | 2025-12-27 11:10 | 412K | |
| trueprint-5.4_3.pkg | 2025-12-21 15:42 | 58K | |
| trufflehog-3.91.1_1.pkg | 2025-12-22 09:57 | 25M | |
| trunk-0.21.14_6.pkg | 2025-12-30 07:39 | 5.8M | |
| trurl-0.16.pkg | 2025-12-24 05:37 | 24K | |
| trustedqsl-2.8.1_1.pkg | 2025-12-29 20:19 | 1.6M | |
| ts-1.0.2_1.pkg | 2025-08-17 08:38 | 31K | |
| ts-hunspell-20110323..> | 2025-08-18 12:30 | 102K | |
| ts-libreoffice-25.8...> | 2025-12-27 07:41 | 214K | |
| ts-warp-1.5.8.pkg | 2025-08-16 16:07 | 35K | |
| tscli-0.0.15_6.pkg | 2025-12-23 16:49 | 3.3M | |
| tsclient-0.150_14.pkg | 2025-12-30 14:02 | 323K | |
| tsctp-0.8.4.pkg | 2025-12-20 22:06 | 10K | |
| tse3-0.3.1_3.pkg | 2025-08-20 14:48 | 443K | |
| tsito-0.8.4_2.pkg | 2025-08-18 06:55 | 101K | |
| tslib-1.23.pkg | 2025-08-19 20:26 | 98K | |
| tsocks-1.8.b5_10.pkg | 2025-08-18 11:23 | 29K | |
| tsung-1.8.0_1.pkg | 2025-12-23 20:28 | 579K | |
| tt-15.1.pkg | 2025-08-22 07:04 | 17K | |
| tt-libreoffice-25.8...> | 2025-12-27 16:39 | 139K | |
| tt-rss-php81-g202512..> | 2025-12-29 17:29 | 2.5M | |
| tt-rss-php82-g202512..> | 2025-12-27 19:44 | 2.5M | |
| tt-rss-php83-g202512..> | 2025-12-29 07:18 | 2.5M | |
| tt-rss-php84-g202512..> | 2025-12-28 14:10 | 2.5M | |
| tt-rss-php85-g202512..> | 2025-12-30 02:38 | 2.5M | |
| tt2020-0.2.1.pkg | 2025-12-29 00:22 | 77M | |
| tta-3.4.1.pkg | 2025-08-21 13:05 | 17K | |
| ttcp-1.13.pkg | 2025-08-22 04:36 | 12K | |
| ttf2pt1-3.4.4_8.pkg | 2025-12-27 09:35 | 197K | |
| ttfautohint-1.8.4.pkg | 2025-12-26 20:45 | 199K | |
| tth-4.16.pkg | 2025-12-28 16:32 | 290K | |
| tthsum-1.3.2_2.pkg | 2025-08-18 08:48 | 22K | |
| ttmath-0.9.3.2019101..> | 2025-08-17 09:05 | 84K | |
| ttt-2011.04_5.pkg | 2025-12-21 02:50 | 119K | |
| tttcmds-1.0.20190920..> | 2025-08-17 07:46 | 265K | |
| tty-clock-2.3.pkg | 2025-08-17 23:53 | 9.2K | |
| tty-solitaire-1.4.1.pkg | 2025-08-21 10:58 | 12K | |
| ttyd-1.7.7_2.pkg | 2025-12-19 16:40 | 207K | |
| ttygif-1.4.0_3.pkg | 2025-12-29 03:07 | 6.2K | |
| ttyload-0.5.3_2.pkg | 2025-08-22 04:47 | 11K | |
| ttynt-0.0.1_13.pkg | 2025-12-29 01:40 | 630K | |
| ttyplot-1.7.0.pkg | 2025-08-20 23:02 | 12K | |
| ttyrec-1.0.8_4.pkg | 2025-08-21 16:43 | 12K | |
| tuareg-mode-2.0.8_22..> | 2025-12-28 00:32 | 82K | |
| tuareg-mode-emacs_ca..> | 2025-12-29 04:34 | 82K | |
| tuareg-mode-emacs_de..> | 2025-12-29 15:33 | 83K | |
| tuareg-mode-emacs_de..> | 2025-12-21 08:45 | 83K | |
| tuareg-mode-emacs_no..> | 2025-12-20 07:18 | 83K | |
| tuareg-mode-emacs_wa..> | 2025-12-29 06:35 | 83K | |
| tuckr-0.12.0_2.pkg | 2025-12-30 18:32 | 494K | |
| tudu-0.10.3_1.pkg | 2025-08-18 15:32 | 94K | |
| tui-journal-0.16.1_3..> | 2025-12-28 06:56 | 2.1M | |
| tuifeed-0.4.2_7.pkg | 2025-12-29 12:56 | 1.8M | |
| tumble-0.38_3.pkg | 2025-12-29 17:09 | 39K | |
| tumgreyspf-1.38_3.pkg | 2025-12-30 09:49 | 17K | |
| tuner-1.5.4.pkg | 2025-12-30 13:52 | 128K | |
| tuning-primer-1.6.r1..> | 2025-12-23 05:07 | 13K | |
| tunneller-0.6_33.pkg | 2025-12-23 03:38 | 2.3M | |
| tup-0.7.11.pkg | 2025-08-22 00:15 | 680K | |
| tuptime-5.2.3_1.pkg | 2025-12-23 23:59 | 15K | |
| turbo-g20250826.pkg | 2025-12-23 21:10 | 944K | |
| turbostat-4.17_5.pkg | 2025-08-16 00:55 | 41K | |
| turnserver-4.6.3.pkg | 2025-12-22 06:24 | 563K | |
| tusc-0.4.7_33.pkg | 2025-12-20 05:03 | 3.1M | |
| tusd-2.0.0_19.pkg | 2025-12-21 02:22 | 6.9M | |
| tux_aqfh-1.0.14_12.pkg | 2025-08-20 02:34 | 3.3M | |
| tuxkart-0.4.0_7.pkg | 2025-08-19 15:07 | 4.3M | |
| tuxpaint-0.9.34_2.pkg | 2025-12-27 07:57 | 15M | |
| tuxpaint-config-0.0...> | 2025-12-28 14:23 | 283K | |
| tuxpaint-fonts-2004...> | 2025-12-30 14:28 | 5.1M | |
| tuxpaint-stamps-2024..> | 2025-12-28 09:15 | 76M | |
| tuxracer-0.61_15.pkg | 2025-12-30 08:32 | 6.2M | |
| tuxtype-1.8.3_4.pkg | 2025-12-29 06:10 | 11M | |
| tv-fonts-1.1_6.pkg | 2025-12-27 17:12 | 234K | |
| tvbrowser-4.2.7.pkg | 2025-12-30 08:13 | 5.3M | |
| tvheadend-4.2.8_7.pkg | 2025-12-29 06:18 | 5.4M | |
| tvision-g20250515.pkg | 2025-12-19 21:19 | 369K | |
| tvm-0.19.0.pkg | 2025-12-20 00:32 | 14M | |
| tvmet-1.7.2_2.pkg | 2025-08-16 10:21 | 178K | |
| tvterm-g20250621.pkg | 2025-12-20 10:34 | 44K | |
| tw_cli-9.5.5_2.pkg | 2025-08-20 04:13 | 660K | |
| twa-kmod-20230821.14..> | 2025-08-21 06:23 | 24K | |
| tweak-3.02_1.pkg | 2025-08-17 14:39 | 35K | |
| tweedledum-1.1.1.pkg | 2025-08-18 03:39 | 465K | |
| tweeny-3.6.pkg | 2025-08-18 15:35 | 15K | |
| twemoji-color-font-t..> | 2025-12-26 18:35 | 3.7M | |
| twemproxy-0.5.0_1.pkg | 2025-08-19 06:38 | 93K | |
| twiggy-0.6.0_27.pkg | 2025-12-30 14:31 | 3.6M | |
| twiki-6.1.0,2.pkg | 2025-12-20 04:26 | 14M | |
| twiki-BehaviourContr..> | 2025-08-13 21:33 | 16K | |
| twiki-BlogAddOn-0.0...> | 2025-08-19 01:39 | 231K | |
| twiki-BugzillaLinkPl..> | 2025-08-16 12:34 | 6.8K | |
| twiki-ClassicSkin-0...> | 2025-08-20 20:38 | 43K | |
| twiki-CommentPlugin-..> | 2025-08-16 19:50 | 21K | |
| twiki-EditTablePlugi..> | 2025-08-17 20:53 | 75K | |
| twiki-EmptyPlugin-0...> | 2025-08-19 18:40 | 12K | |
| twiki-GluePlugin-0.0..> | 2025-08-17 09:49 | 8.1K | |
| twiki-InterwikiPlugi..> | 2025-08-18 16:01 | 7.5K | |
| twiki-JSCalendarCont..> | 2025-08-18 22:51 | 333K | |
| twiki-LDAPPasswordCh..> | 2025-12-22 02:54 | 5.9K | |
| twiki-LdapContrib-0...> | 2025-12-19 09:05 | 28K | |
| twiki-LdapNgPlugin-0..> | 2025-12-21 22:29 | 7.3K | |
| twiki-MailerContrib-..> | 2025-12-19 04:56 | 39K | |
| twiki-MathModePlugin..> | 2025-12-29 16:07 | 13K | |
| twiki-NewUserPlugin-..> | 2025-08-20 22:50 | 9.0K | |
| twiki-PatternSkin-0...> | 2025-08-18 08:57 | 498K | |
| twiki-PreferencesPlu..> | 2025-08-22 01:30 | 9.5K | |
| twiki-RenderListPlug..> | 2025-08-20 11:19 | 17K | |
| twiki-SlideShowPlugi..> | 2025-08-21 20:08 | 14K | |
| twiki-SmiliesPlugin-..> | 2025-08-16 17:12 | 13K | |
| twiki-SpreadSheetPlu..> | 2025-08-15 10:02 | 24K | |
| twiki-SubscribePlugi..> | 2025-12-23 11:37 | 29K | |
| twiki-TWikiUserMappi..> | 2025-08-15 21:47 | 31K | |
| twiki-TablePlugin-0...> | 2025-08-15 01:59 | 20K | |
| twiki-TagMePlugin-0...> | 2025-08-21 11:45 | 96K | |
| twiki-TinyMCEPlugin-..> | 2025-12-22 14:24 | 459K | |
| twiki-TipsContrib-0...> | 2025-08-21 16:56 | 12K | |
| twiki-TopicVarsPlugi..> | 2025-08-18 23:26 | 4.6K | |
| twiki-TwistyContrib-..> | 2025-08-14 01:25 | 8.6K | |
| twiki-TwistyPlugin-0..> | 2025-08-14 22:20 | 16K | |
| twiki-WysiwygPlugin-..> | 2025-12-20 01:58 | 55K | |
| twind-1.1.0_5.pkg | 2025-12-29 12:11 | 2.7M | |
| twirssi-2.8.0.pkg | 2025-12-22 05:01 | 30K | |
| twitch-tui-2.6.19_6.pkg | 2025-12-29 09:10 | 3.9M | |
| twm-1.0.12_1.pkg | 2025-08-14 01:29 | 93K | |
| twms-0.06y_3.pkg | 2025-12-30 11:28 | 70K | |
| twoftpd-1.43_2.pkg | 2025-12-22 17:40 | 44K | |
| twolame-0.4.0_5.pkg | 2025-12-26 20:21 | 113K | |
| twpsk-4.3_5.pkg | 2025-12-30 08:05 | 66K | |
| txt2html-2.51_2.pkg | 2025-12-23 09:45 | 61K | |
| txt2man-1.7.1.pkg | 2025-12-19 01:38 | 14K | |
| txtbdf2ps-0.7.1_1.pkg | 2025-12-21 12:46 | 15K | |
| tycho-0.1.pkg | 2025-08-16 03:08 | 19K | |
| typescript-go-7.0.0...> | 2025-12-16 05:45 | 6.4M | |
| typeshare-1.13.3_2.pkg | 2025-12-29 18:10 | 1.5M | |
| typespeed-0.6.5_4.pkg | 2025-12-20 23:00 | 64K | |
| typetools-2.110_1.pkg | 2025-08-15 19:48 | 719K | |
| typo3-11-php81-11.5...> | 2025-12-30 10:10 | 23M | |
| typo3-11-php82-11.5...> | 2025-12-29 13:34 | 23M | |
| typo3-11-php83-11.5...> | 2025-12-29 12:21 | 23M | |
| typo3-11-php84-11.5...> | 2025-12-30 08:00 | 23M | |
| typo3-11-php85-11.5...> | 2025-12-28 21:01 | 23M | |
| typo3-12-php81-12.4...> | 2025-12-29 20:13 | 21M | |
| typo3-12-php82-12.4...> | 2025-12-30 07:22 | 21M | |
| typo3-12-php83-12.4...> | 2025-12-29 04:47 | 21M | |
| typo3-12-php84-12.4...> | 2025-12-29 16:34 | 21M | |
| typo3-12-php85-12.4...> | 2025-12-29 04:32 | 21M | |
| typo3-13-php82-13.4...> | 2025-12-29 16:17 | 20M | |
| typo3-13-php83-13.4...> | 2025-12-30 00:44 | 20M | |
| typo3-13-php84-13.4...> | 2025-12-30 09:50 | 20M | |
| typo3-13-php85-13.4...> | 2025-12-30 16:47 | 20M | |
| typometer-1.0.1.pkg | 2025-12-29 15:16 | 457K | |
| typos-1.40.0_1.pkg | 2025-12-30 04:08 | 3.0M | |
| typst-0.14.0_2.pkg | 2025-12-26 22:22 | 13M | |
| typstfmt-0.2.10_13.pkg | 2025-12-24 07:37 | 745K | |
| typstyle-0.14.0_2.pkg | 2025-12-30 08:06 | 544K | |
| typtea-0.1.6_5.pkg | 2025-12-21 10:57 | 1.2M | |
| tyrian-data-21.pkg | 2025-08-17 12:29 | 3.8M | |
| tzdialog-1.2_1.pkg | 2025-08-18 14:12 | 16K | |
| tzdiff-1.2.1.pkg | 2025-08-20 06:44 | 5.1K | |
| u-boot-a13-olinuxino..> | 2025-12-21 11:35 | 323K | |
| u-boot-a64-olinuxino..> | 2025-12-20 21:15 | 337K | |
| u-boot-bananapi-2025..> | 2025-12-21 12:43 | 305K | |
| u-boot-bananapi-r2-p..> | 2025-12-22 09:23 | 495K | |
| u-boot-bananapim2-20..> | 2025-12-21 02:57 | 293K | |
| u-boot-beaglebone-20..> | 2025-12-22 15:38 | 370K | |
| u-boot-bhyve-arm64-2..> | 2025-08-16 05:30 | 204K | |
| u-boot-bhyve-riscv-2..> | 2025-08-16 14:03 | 369K | |
| u-boot-chip-2025.10.pkg | 2025-12-22 10:10 | 303K | |
| u-boot-clearfog-2025..> | 2025-12-23 05:35 | 312K | |
| u-boot-cubieboard-20..> | 2025-12-21 01:18 | 302K | |
| u-boot-cubieboard2-2..> | 2025-12-21 13:35 | 303K | |
| u-boot-cubox-humming..> | 2025-12-23 08:36 | 303K | |
| u-boot-firefly-rk339..> | 2025-12-22 04:57 | 431K | |
| u-boot-imx-serial-lo..> | 2025-08-16 15:19 | 65K | |
| u-boot-nanopi-neo2-2..> | 2025-12-21 17:48 | 335K | |
| u-boot-nanopi-r2s-20..> | 2025-12-23 04:26 | 405K | |
| u-boot-nanopi-r4s-20..> | 2025-12-22 16:21 | 455K | |
| u-boot-nanopi-r5s-20..> | 2025-12-20 10:16 | 526K | |
| u-boot-nanopi-r6s-20..> | 2025-12-21 12:10 | 524K | |
| u-boot-nanopi_a64-20..> | 2025-12-21 21:19 | 337K | |
| u-boot-nanopi_m1plus..> | 2025-12-21 07:46 | 290K | |
| u-boot-nanopi_neo-20..> | 2025-12-22 06:29 | 270K | |
| u-boot-nanopi_neo_ai..> | 2025-12-23 17:34 | 265K | |
| u-boot-olimex-a20-so..> | 2025-12-21 12:35 | 304K | |
| u-boot-olinuxino-lim..> | 2025-12-24 04:53 | 301K | |
| u-boot-olinuxino-lim..> | 2025-12-20 18:08 | 339K | |
| u-boot-olinuxino-lim..> | 2025-12-23 12:57 | 341K | |
| u-boot-orangepi-one-..> | 2025-12-22 17:54 | 290K | |
| u-boot-orangepi-pc-2..> | 2025-12-21 11:11 | 296K | |
| u-boot-orangepi-pc-p..> | 2025-12-23 19:38 | 296K | |
| u-boot-orangepi-pc2-..> | 2025-12-22 05:00 | 379K | |
| u-boot-orangepi-plus..> | 2025-12-22 16:56 | 297K | |
| u-boot-orangepi-zero..> | 2025-12-20 15:33 | 281K | |
| u-boot-orangepi-zero..> | 2025-12-22 05:02 | 335K | |
| u-boot-orangepi_r1-2..> | 2025-12-20 04:31 | 280K | |
| u-boot-pcduino3-2025..> | 2025-12-23 11:14 | 303K | |
| u-boot-pine-h64-2025..> | 2025-12-23 01:28 | 336K | |
| u-boot-pine64-2025.1..> | 2025-12-23 14:31 | 338K | |
| u-boot-pine64-lts-20..> | 2025-12-23 19:11 | 349K | |
| u-boot-pinebook-2025..> | 2025-12-23 07:19 | 339K | |
| u-boot-pinebookpro-2..> | 2025-12-23 14:11 | 477K | |
| u-boot-qemu-arm-2025..> | 2025-12-22 07:40 | 483K | |
| u-boot-qemu-arm64-20..> | 2025-12-22 12:12 | 501K | |
| u-boot-qemu-riscv64-..> | 2025-12-21 10:44 | 462K | |
| u-boot-quartz64-a-20..> | 2025-12-20 15:32 | 515K | |
| u-boot-quartz64-b-20..> | 2025-12-21 07:44 | 513K | |
| u-boot-radxa-zero3-2..> | 2025-12-23 04:27 | 506K | |
| u-boot-riotboard-202..> | 2025-12-20 08:35 | 273K | |
| u-boot-rock-pi-4-202..> | 2025-12-22 14:30 | 525K | |
| u-boot-rock64-2025.1..> | 2025-12-20 08:37 | 379K | |
| u-boot-rockpro64-202..> | 2025-12-23 13:24 | 485K | |
| u-boot-rpi-0-w-2025...> | 2025-12-23 13:20 | 251K | |
| u-boot-rpi-2025.10.pkg | 2025-12-23 23:51 | 251K | |
| u-boot-rpi-arm64-202..> | 2025-12-23 22:31 | 306K | |
| u-boot-rpi2-2025.10.pkg | 2025-12-23 23:53 | 248K | |
| u-boot-rpi3-32-2025...> | 2025-12-22 15:32 | 252K | |
| u-boot-rpi3-2025.10.pkg | 2025-12-21 07:25 | 285K | |
| u-boot-rpi4-2025.10.pkg | 2025-12-22 07:37 | 311K | |
| u-boot-sifive-fu540-..> | 2025-12-22 06:58 | 388K | |
| u-boot-sifive-fu740-..> | 2025-12-23 15:57 | 443K | |
| u-boot-sinovoip-bpi-..> | 2025-12-22 09:00 | 281K | |
| u-boot-sopine-2025.1..> | 2025-12-21 12:45 | 349K | |
| u-boot-sopine-spi-20..> | 2025-12-22 08:43 | 350K | |
| u-boot-starfive-visi..> | 2025-12-21 16:36 | 519K | |
| u-boot-tools-2020.07..> | 2025-08-15 03:30 | 157K | |
| u-boot-wandboard-202..> | 2025-12-22 15:10 | 312K | |
| u2f-devd-1.1.10_9.pkg | 2025-08-14 02:11 | 2.0K | |
| u6rd-1.6_4.pkg | 2025-08-19 11:18 | 15K | |
| uTox-0.18.1.pkg | 2025-12-28 11:46 | 426K | |
| ua-1.0.1_1.pkg | 2025-08-16 19:41 | 28K | |
| ua_parser-core-0.5.0..> | 2025-08-14 01:33 | 31K | |
| uacme-1.7.6_1.pkg | 2025-12-19 15:08 | 87K | |
| uade-3.05.pkg | 2025-12-20 11:08 | 1.5M | |
| uae-0.8.29_5.pkg | 2025-12-29 11:13 | 576K | |
| uarduno-1.02.1403000..> | 2025-08-19 15:09 | 5.1K | |
| ubench-0.32_1.pkg | 2025-08-18 01:18 | 7.7K | |
| ubh-2.5_3.pkg | 2025-12-21 21:27 | 26K | |
| ubuntu-font-0.83_2.pkg | 2025-12-27 11:32 | 1.5M | |
| ubuntu-keyring-2021...> | 2025-08-14 10:08 | 25K | |
| ucarp-1.5.2.20171201..> | 2025-08-18 05:36 | 17K | |
| ucc-1.6.2.pkg | 2025-08-21 17:05 | 57K | |
| uchardet-0.0.8_1.pkg | 2025-08-13 00:34 | 105K | |
| uchiwa-0.18.2_34.pkg | 2025-12-20 21:09 | 7.1M | |
| ucl-1.03_5.pkg | 2025-08-13 13:59 | 42K | |
| uclcmd-0.2.20211204.pkg | 2025-12-19 11:41 | 17K | |
| ucommon-7.0.0_6.pkg | 2025-08-18 23:18 | 454K | |
| ucon64-2.2.2.pkg | 2025-08-19 20:25 | 303K | |
| uconvert-1.01_2.pkg | 2025-12-29 15:11 | 27K | |
| ucored-v0.1.pkg | 2025-12-22 01:22 | 570K | |
| ucpp-1.3.2_1,1.pkg | 2025-08-18 17:31 | 37K | |
| ucsc-userapps-474.pkg | 2025-12-27 17:36 | 6.9M | |
| ucspi-ipc-0.67.pkg | 2025-12-22 01:42 | 53K | |
| ucspi-proxy-1.1_1.pkg | 2025-12-21 19:10 | 20K | |
| ucspi-ssl-0.99b_1.pkg | 2025-12-24 04:54 | 78K | |
| ucspi-tcp-0.88_3.pkg | 2025-08-13 16:37 | 71K | |
| ucspi-unix-1.0_1.pkg | 2025-08-21 23:33 | 11K | |
| ucto-0.35_2.pkg | 2025-12-20 17:41 | 176K | |
| uctodata-0.11.pkg | 2025-08-15 01:26 | 14K | |
| udfclient-0.8.11.pkg | 2025-08-17 01:26 | 162K | |
| udis86-1.7.2_4.pkg | 2025-08-15 14:00 | 73K | |
| udns-0.6.pkg | 2025-08-15 13:46 | 80K | |
| udp-over-tcp-0.4.0_1..> | 2025-12-29 22:24 | 896K | |
| udpbroadcastrelay-1...> | 2025-08-20 04:29 | 18K | |
| udpt-g20200202.pkg | 2025-12-22 07:04 | 45K | |
| udptunnel-1.1_1.pkg | 2025-08-19 05:30 | 6.1K | |
| udpxy-1.0.25.1_1.pkg | 2025-08-16 11:36 | 39K | |
| udt-4.11_3.pkg | 2025-08-21 13:19 | 191K | |
| udunits-2.2.28.pkg | 2025-12-18 13:07 | 142K | |
| uemacs-4.0_1.pkg | 2025-08-21 22:37 | 128K | |
| ufdbGuard-1.35.8.pkg | 2025-12-22 14:44 | 473K | |
| ufetch-0.3.pkg | 2025-08-19 04:10 | 1.5K | |
| ufoai-2.5_12.pkg | 2025-12-29 00:13 | 2.8M | |
| ufoai-data-2.5_1.pkg | 2025-08-15 19:39 | 1.0G | |
| ufraw-0.22.20210424_..> | 2025-12-27 16:19 | 706K | |
| ufs_copy-20060921_2.pkg | 2025-08-22 16:52 | 283K | |
| uftp-5.0.3_1,1.pkg | 2025-08-17 21:37 | 150K | |
| ug-libreoffice-25.8...> | 2025-12-27 19:04 | 2.9M | |
| ugene-40.1_1.pkg | 2025-12-28 06:10 | 29M | |
| uget-2.2.3_2.pkg | 2025-12-29 01:01 | 390K | |
| ugrep-7.5.0.pkg | 2025-12-20 17:04 | 473K | |
| uhd-4.9.0.1.pkg | 2025-12-19 14:54 | 9.8M | |
| uhdm-1.84.pkg | 2025-08-15 06:20 | 1.0M | |
| uhex-1.0.4.pkg | 2025-08-18 07:59 | 9.3K | |
| uhexen-0.601_12.pkg | 2025-12-21 22:28 | 227K | |
| uhexen2-1.5.9_4.pkg | 2025-12-19 07:41 | 6.0M | |
| uhexen2-extras-1.5.6..> | 2025-12-21 07:52 | 43M | |
| uhidd-0.2.1_5.pkg | 2025-08-16 05:38 | 67K | |
| uhttpmock-0.11.0.pkg | 2025-12-21 01:16 | 58K | |
| uhttpmock0-0.5.3.pkg | 2025-12-18 23:44 | 63K | |
| uhub-0.5.1.pkg | 2025-12-22 17:45 | 122K | |
| uhubctl-2.6.0.pkg | 2025-12-24 00:25 | 10K | |
| uid_wrapper-1.3.2.pkg | 2025-08-26 21:51 | 16K | |
| uif2iso-0.1.7c_1.pkg | 2025-08-18 22:47 | 40K | |
| uim-1.9.6.pkg | 2025-12-27 11:14 | 2.2M | |
| uim-el-1.9.6_1.pkg | 2025-12-29 11:11 | 35K | |
| uim-el-emacs_canna-1..> | 2025-12-28 10:02 | 35K | |
| uim-el-emacs_devel-1..> | 2025-12-29 19:32 | 35K | |
| uim-el-emacs_devel_n..> | 2025-12-28 12:03 | 35K | |
| uim-el-emacs_nox-1.9..> | 2025-12-28 00:26 | 35K | |
| uim-el-emacs_wayland..> | 2025-12-28 12:22 | 35K | |
| uim-gtk2-1.9.6.pkg | 2025-12-29 23:23 | 101K | |
| uim-gtk3-1.9.6.pkg | 2025-12-29 02:45 | 85K | |
| uim-m17nlib-1.9.6.pkg | 2025-12-29 10:57 | 20K | |
| uim-qt5-1.9.6.pkg | 2025-12-30 10:46 | 165K | |
| uim-qt6-1.9.6.pkg | 2025-12-30 01:41 | 171K | |
| uird-1.1.pkg | 2025-12-21 15:25 | 11K | |
| ujprog-g20191117_1.pkg | 2025-12-23 13:38 | 25K | |
| uk-aspell-1.4.0.0_1,..> | 2025-12-20 06:01 | 761K | |
| uk-hunspell-1.8.0_1.pkg | 2025-08-17 00:42 | 446K | |
| uk-hyphen-2005.03.08..> | 2025-08-19 18:53 | 5.3K | |
| uk-libgd-2.3.3_13,1.pkg | 2025-12-27 18:33 | 222K | |
| uk-libreoffice-25.8...> | 2025-12-27 09:23 | 3.5M | |
| uk-mythes-1.8.0.pkg | 2025-08-16 00:40 | 244K | |
| uk-webalizer-2.23.8_..> | 2025-12-27 20:07 | 137K | |
| ukncbtl-g20240813.pkg | 2025-12-28 13:18 | 186K | |
| ukrmol+-3.2_6.pkg | 2025-12-29 19:43 | 2.4M | |
| ulauncher-5.15.6_6.pkg | 2025-12-28 13:40 | 1.5M | |
| ulfius-2.7.15.pkg | 2025-12-19 12:15 | 104K | |
| ultimatestunts-0.7.7..> | 2025-12-29 15:08 | 21M | |
| ultragetopt-0.6.0_1.pkg | 2025-08-15 13:48 | 8.9K | |
| ultralist-1.7.0_34.pkg | 2025-12-20 22:55 | 3.1M | |
| ulxmlrpcpp-1.7.5_3.pkg | 2025-12-20 10:28 | 495K | |
| umark-2.0.0.b3_9.pkg | 2025-12-30 04:13 | 146K | |
| umbrello-25.12.0_1.pkg | 2025-12-27 16:59 | 5.0M | |
| umix-1.0.2_4.pkg | 2025-08-18 08:29 | 20K | |
| uml2svg-0.18.pkg | 2025-08-18 21:53 | 249K | |
| umlgraph-5.7.2.pkg | 2025-12-29 12:35 | 62K | |
| umodplayer-0.b5.1_4.pkg | 2025-12-23 18:12 | 28K | |
| umodunpack-0.4.pkg | 2025-12-20 11:08 | 7.4K | |
| ump-math-0.8.6_14.pkg | 2025-12-29 16:28 | 260K | |
| umpire-2025.09.0_1.pkg | 2025-12-19 03:02 | 451K | |
| umurmur-0.3.1_3.pkg | 2025-08-20 06:04 | 42K | |
| unace-1.2b_3.pkg | 2025-08-15 19:14 | 14K | |
| unadf-0.10.5.pkg | 2025-12-21 06:21 | 206K | |
| unalz-0.66.pkg | 2025-08-17 13:58 | 30K | |
| unar-1.10.1_27.pkg | 2025-12-19 15:32 | 1.0M | |
| unarj-2.65_2.pkg | 2025-08-14 23:41 | 20K | |
| unarr-1.1.1.pkg | 2025-08-14 13:24 | 79K | |
| unbound-1.24.2.pkg | 2025-12-18 13:39 | 2.5M | |
| unbound_exporter-0.4..> | 2025-12-23 09:31 | 3.1M | |
| uncle-0.2_1.pkg | 2025-12-22 18:28 | 4.1K | |
| unclutter-8_4.pkg | 2025-08-16 08:56 | 8.0K | |
| unclutter-xfixes-1.6..> | 2025-08-22 08:59 | 9.0K | |
| uncrustify-0.82.0.pkg | 2025-12-20 17:32 | 563K | |
| undead-1.1.8_2.pkg | 2025-08-15 05:41 | 285K | |
| undernet-ircu-2.10.1..> | 2025-12-30 16:36 | 536K | |
| undms-1.3.pkg | 2025-08-22 00:31 | 9.1K | |
| unetbootin-702_2.pkg | 2025-12-28 04:44 | 462K | |
| unflac-1.3_11.pkg | 2025-12-29 12:21 | 1.5M | |
| unfoo-1.0.8.pkg | 2025-12-22 08:17 | 3.2K | |
| unfs3-0.9.23_2.pkg | 2025-12-30 09:12 | 48K | |
| unftp-0.15.1_9.pkg | 2025-12-29 15:57 | 4.2M | |
| ungoogled-chromium-1..> | 2025-12-26 01:23 | 127M | |
| unhide-20210124_1.pkg | 2025-08-22 11:14 | 298K | |
| uni-2.9.0.pkg | 2025-12-28 00:27 | 1.6M | |
| uni-algo-1.2.0.pkg | 2025-08-15 08:47 | 298K | |
| uni2ascii-4.20.pkg | 2025-08-22 06:18 | 36K | |
| unibilium-2.1.2.pkg | 2025-08-13 07:57 | 98K | |
| unicode-emoji-15.1.pkg | 2025-08-13 11:25 | 85K | |
| unicorn-2.0.1p1.pkg | 2025-08-14 01:59 | 5.8M | |
| unifi9-9.5.21_1.pkg | 2025-12-28 14:17 | 131M | |
| unifi9-externaldb-9...> | 2025-12-29 19:58 | 131M | |
| unifi10-10.0.160.pkg | 2025-12-30 02:35 | 114M | |
| unifi10-externaldb-1..> | 2025-12-29 09:58 | 114M | |
| unikmer-0.20.0_14.pkg | 2025-12-22 17:32 | 3.2M | |
| unique-1.1.6_9.pkg | 2025-12-26 20:45 | 56K | |
| unison-2.53.8.pkg | 2025-12-28 01:19 | 4.7M | |
| unison-nox11-2.53.8.pkg | 2025-12-21 22:13 | 2.2M | |
| unison240-2.40.128_8..> | 2025-12-29 06:35 | 1.9M | |
| unison240-nox11-2.40..> | 2025-12-22 15:27 | 900K | |
| unison248-2.48.15_5.pkg | 2025-12-29 17:31 | 2.2M | |
| unison248-nox11-2.48..> | 2025-08-20 15:39 | 1.1M | |
| unison251-2.51.5_3.pkg | 2025-12-29 09:17 | 2.2M | |
| unison251-nox11-2.51..> | 2025-08-18 03:22 | 1.2M | |
| unit-1.35.0_1.pkg | 2025-12-19 14:39 | 934K | |
| unit-java8-1.35.0_1.pkg | 2025-12-29 20:19 | 6.6M | |
| unit-otel-1.35.0_3.pkg | 2025-12-28 19:22 | 1.9M | |
| unit-perl5.42-1.35.0..> | 2025-12-24 07:12 | 37K | |
| unit-php81-1.35.0_1.pkg | 2025-12-30 15:14 | 34K | |
| unit-php82-1.35.0_1.pkg | 2025-12-28 04:24 | 34K | |
| unit-php83-1.35.0_1.pkg | 2025-12-29 22:20 | 34K | |
| unit-php84-1.35.0_1.pkg | 2025-12-29 12:03 | 34K | |
| unit-php85-1.35.0_1.pkg | 2025-12-30 16:18 | 34K | |
| unit-python311-1.35...> | 2025-12-21 18:50 | 53K | |
| unit-wasm-1.35.0_1.pkg | 2025-12-29 08:22 | 32K | |
| unitc-1.35.0.pkg | 2025-12-22 18:24 | 4.6K | |
| units-2.16_3.pkg | 2025-12-22 20:29 | 206K | |
| units-library-0.13.1..> | 2025-12-18 20:40 | 380K | |
| uniutils-2.28_1.pkg | 2025-12-22 07:35 | 189K | |
| universal-ctags-p6.2..> | 2025-12-19 14:41 | 968K | |
| universal-fp-library..> | 2025-08-20 13:36 | 519K | |
| unix-selfauth-helper..> | 2025-08-13 06:54 | 4.5K | |
| unix2dos-1.3_2.pkg | 2025-08-15 18:02 | 5.6K | |
| unix2tcp-0.8.3.pkg | 2025-08-21 14:24 | 8.2K | |
| unixODBC-2.3.12_2.pkg | 2025-12-18 12:48 | 536K | |
| unixbench-5.1.3.51_2..> | 2025-12-30 05:08 | 102K | |
| unixcw-3.5.1_3.pkg | 2025-12-19 10:11 | 157K | |
| unknown-horizons-201..> | 2025-12-30 06:28 | 242M | |
| unlzx-1.1.pkg | 2025-08-17 22:42 | 11K | |
| unmakeself-1.1_1.pkg | 2025-12-19 10:56 | 4.6K | |
| unmass-0.92.pkg | 2025-08-18 20:51 | 28K | |
| unnethack-5.1.0.2013..> | 2025-08-16 20:37 | 1.3M | |
| unordered-dense-4.8...> | 2025-12-20 23:06 | 18K | |
| unpackerr-0.14.5_4.pkg | 2025-12-23 21:18 | 4.6M | |
| unpaper-7.0.0_4.pkg | 2025-12-26 22:18 | 35K | |
| unquote-1.0.b4_1.pkg | 2025-08-16 04:04 | 7.8K | |
| unrar-7.13,6.pkg | 2025-12-18 17:51 | 177K | |
| unrar-iconv-6.24,6.pkg | 2025-08-22 19:06 | 141K | |
| unreal-6.1.9.1.pkg | 2025-12-22 11:30 | 1.2M | |
| unroff-1.0.2_5.pkg | 2025-12-28 13:16 | 87K | |
| unrpa-2.3.0_1.pkg | 2025-12-21 06:56 | 31K | |
| unrtf-0.21.10_1.pkg | 2025-08-15 17:25 | 42K | |
| unshield-1.6.2.pkg | 2025-08-15 15:18 | 26K | |
| unstow-0.1.1_1.pkg | 2025-08-16 01:26 | 3.2K | |
| untahris-3.1_6.pkg | 2025-12-28 10:06 | 659K | |
| unuran-1.11.0.pkg | 2025-08-16 13:01 | 1.5M | |
| unzip-6.0_8.pkg | 2025-08-13 05:49 | 138K | |
| unzoo-4.4_2.pkg | 2025-08-13 21:07 | 18K | |
| up-0.4_33.pkg | 2025-12-21 17:00 | 1.0M | |
| up-imapproxy-1.2.8.p..> | 2025-08-17 23:13 | 46K | |
| upclient-5.0.b8_8.pkg | 2025-12-20 16:55 | 46K | |
| uperf-1.0.7,1.pkg | 2025-08-16 20:46 | 66K | |
| upnp-1.14.25,1.pkg | 2025-12-18 17:42 | 540K | |
| upower-1.91.0.pkg | 2025-12-18 10:58 | 108K | |
| upscaler-1.1.2_2.pkg | 2025-12-27 15:16 | 24K | |
| upsdaemon-1.0_1.pkg | 2025-08-19 21:25 | 6.7K | |
| uptimed-0.4.7.pkg | 2025-08-18 13:35 | 25K | |
| upx-5.0.2.pkg | 2025-08-14 09:02 | 674K | |
| uqm-0.8.0_1.pkg | 2025-12-29 03:25 | 9.0M | |
| urbackup-client-2.5...> | 2025-12-22 08:59 | 1.4M | |
| urbackup-server-2.5...> | 2025-12-22 12:30 | 3.3M | |
| urbanterror-data-4.2..> | 2025-08-20 18:08 | 1.7G | |
| urelay-1.0_1.pkg | 2025-08-16 10:39 | 7.1K | |
| urh-2.9.8_1.pkg | 2025-12-29 18:13 | 3.7M | |
| urho3d-1.7.1_1.pkg | 2025-08-19 07:54 | 96M | |
| uriparser-1.0.0_1.pkg | 2025-12-26 06:18 | 444K | |
| urjtag-2021.03_2.pkg | 2025-12-24 04:58 | 919K | |
| urlendec-1.0_1.pkg | 2025-08-18 00:46 | 21K | |
| urlfinder-0.0.3_2.pkg | 2025-12-22 23:09 | 5.3M | |
| urlview-0.9.20131021..> | 2025-08-14 03:34 | 12K | |
| urw-base35-fonts-202..> | 2025-12-26 03:20 | 8.4M | |
| urweb-20200209_3.pkg | 2025-12-22 08:05 | 3.7M | |
| urwfonts-1.0_8.pkg | 2025-12-29 01:14 | 1.3M | |
| urwfonts-ttf-1.0.7b1..> | 2025-12-27 18:46 | 1.3M | |
| urxvt-font-size-1.3_..> | 2025-12-28 00:51 | 6.3K | |
| urxvt-perls-2.0_1.pkg | 2025-12-30 07:18 | 7.0K | |
| usacloud-1.19.3.pkg | 2025-12-21 00:19 | 21K | |
| usacloud-core-1.19.3..> | 2025-12-19 23:30 | 5.6M | |
| usb_modeswitch-2.6.0..> | 2025-08-17 11:45 | 57K | |
| usbhid-dump-1.4.pkg | 2025-08-13 17:34 | 17K | |
| usbids-20251213.pkg | 2025-12-24 20:09 | 215K | |
| usbmuxd-1.1.1.69.pkg | 2025-12-19 09:11 | 38K | |
| usbredir-0.8.0_1.pkg | 2025-08-19 00:23 | 50K | |
| usbrh-libusb-0.05_1.pkg | 2025-08-18 08:29 | 4.9K | |
| usbtop-1.0_7.pkg | 2025-08-19 11:16 | 13K | |
| usbutils-0.91.pkg | 2025-12-26 23:57 | 48K | |
| uschedule-0.7.1_2.pkg | 2025-08-18 03:36 | 85K | |
| usd-21.11_12.pkg | 2025-12-20 23:59 | 5.2M | |
| usendmail-0.1.6_2.pkg | 2025-08-18 12:19 | 21K | |
| userinfo-2.5_1.pkg | 2025-08-18 21:56 | 18K | |
| userlist-0.1.pkg | 2025-08-16 17:11 | 1.0K | |
| usermatic-0.6.1_1.pkg | 2025-12-23 13:56 | 24K | |
| usermin-2.510.pkg | 2025-12-20 12:04 | 10M | |
| userneu-1.38_2.pkg | 2025-12-19 22:02 | 17K | |
| userneu-devel-1.43_3..> | 2025-12-22 09:38 | 22K | |
| usockets-0.8.8_2.pkg | 2025-08-15 05:02 | 28K | |
| usql-0.19.26_1.pkg | 2025-12-27 21:02 | 9.5M | |
| usrinfo-.10_1.pkg | 2025-08-19 15:02 | 6.6K | |
| ustreamer-6.42.pkg | 2025-12-28 11:00 | 201K | |
| ut-2.3.1.pkg | 2025-08-19 17:59 | 20K | |
| utcount-0.1_1.pkg | 2025-08-15 23:07 | 5.6K | |
| utdns-1.2.pkg | 2025-08-15 23:10 | 8.3K | |
| utf8cpp-4.0.8.pkg | 2025-12-18 03:34 | 8.8K | |
| utf8proc-2.11.2.pkg | 2025-12-18 07:47 | 83K | |
| utftools-1.6_2.pkg | 2025-08-16 04:15 | 18K | |
| utftpd-0.2.4_3.pkg | 2025-08-20 13:49 | 49K | |
| uthash-2.3.0.pkg | 2025-08-13 09:20 | 51K | |
| util-linux-2.41.2.pkg | 2025-12-26 21:22 | 777K | |
| utopia-1.1_1.pkg | 2025-08-17 07:10 | 187K | |
| utouch-kmod-0.0.5.14..> | 2025-08-18 21:10 | 9.1K | |
| uudeview-0.5.20_1.pkg | 2025-08-14 20:10 | 41K | |
| uulib-0.5.20_3.pkg | 2025-08-14 07:41 | 147K | |
| uv-0.9.17_1.pkg | 2025-12-26 09:51 | 11M | |
| uvg266-0.8.1.pkg | 2025-08-16 15:04 | 484K | |
| uvwasi-0.0.23.pkg | 2025-12-24 04:10 | 42K | |
| uw-ttyp0-1.3_2.pkg | 2025-12-29 05:46 | 1.7M | |
| uwebsockets-20.74.0.pkg | 2025-12-22 15:14 | 63K | |
| uwsgi-py311-2.0.30.pkg | 2025-12-18 11:42 | 411K | |
| uwsgitop-0.10_2.pkg | 2025-12-21 17:40 | 5.3K | |
| uxplay-1.72.2.pkg | 2025-12-28 14:17 | 283K | |
| uz-aspell-0.6.0_1,2.pkg | 2025-12-22 23:14 | 582K | |
| uz-libreoffice-25.8...> | 2025-12-27 11:37 | 237K | |
| uzap-1.0_1.pkg | 2025-08-22 09:39 | 15K | |
| v-0.4.12.pkg | 2025-12-20 21:58 | 8.8M | |
| v2ray-5.41.0_2.pkg | 2025-12-22 10:51 | 9.7M | |
| v4l-utils-1.23.0_5.pkg | 2025-12-29 16:22 | 633K | |
| v4l_compat-1.23.0_7.pkg | 2025-08-10 21:32 | 86K | |
| v7sh-1.0_2.pkg | 2025-08-20 06:38 | 32K | |
| v8-10.4.132.20_4.pkg | 2025-12-18 22:50 | 12M | |
| v1541commander-1.1.pkg | 2025-12-29 15:31 | 194K | |
| v_sim-3.9.0.pkg | 2025-12-29 19:38 | 3.1M | |
| vacation-3.3.3_2.pkg | 2025-08-19 11:21 | 12K | |
| vacuum-lint-tool-0.1..> | 2025-08-18 17:20 | 11M | |
| vagrant-2.4.1_3.pkg | 2025-12-28 10:08 | 1.5M | |
| vagrant-gitlab-2.4.9..> | 2025-12-30 14:50 | 1.3M | |
| vala-0.56.18,1.pkg | 2025-12-16 01:49 | 1.8M | |
| vale-3.13.0_2.pkg | 2025-12-18 13:38 | 7.5M | |
| valentina-0.7.53.pkg | 2025-12-29 12:08 | 9.7M | |
| valgrind-3.26.0,1.pkg | 2025-12-18 20:28 | 66M | |
| valgrind-devel-3.26...> | 2025-12-22 14:42 | 66M | |
| validator-1.3_6.pkg | 2025-12-22 13:22 | 2.4M | |
| valkey-9.0.1.pkg | 2025-12-20 18:03 | 1.0M | |
| valkey8-8.1.5.pkg | 2025-12-21 13:02 | 1.0M | |
| vamos-0.8.2.pkg | 2025-12-30 02:05 | 1.8M | |
| vamp-plugin-sdk-2.9...> | 2025-12-27 01:15 | 241K | |
| vampire-4.9.c2024_1.pkg | 2025-12-20 22:36 | 1.9M | |
| vamps-0.99.2_10.pkg | 2025-12-20 11:16 | 29K | |
| vanguards-tor-0.3.1_..> | 2025-12-28 06:02 | 48K | |
| vanilla-conquer-g202..> | 2025-12-29 09:45 | 1.3M | |
| vapoursynth-fmtconv-..> | 2025-08-20 08:09 | 2.3M | |
| vapoursynth-r66.pkg | 2025-12-18 18:39 | 3.4M | |
| vapoursynth-vmaf-r7_..> | 2025-08-21 09:36 | 9.2K | |
| vapoursynth-waifu2x-..> | 2025-12-28 21:33 | 1.0M | |
| vapoursynth-waifu2x-..> | 2025-12-30 06:46 | 21M | |
| variety-0.8.13_3.pkg | 2025-12-28 16:24 | 824K | |
| varnish-ip2location-..> | 2025-12-29 23:59 | 6.5K | |
| varnish-ip2proxy-1.2..> | 2025-12-29 19:43 | 6.8K | |
| varnish-libvmod-dige..> | 2025-12-20 04:28 | 14K | |
| varnish-libvmod-dyna..> | 2025-12-22 10:47 | 45K | |
| varnish-libvmod-file..> | 2025-12-27 21:08 | 177K | |
| varnish-libvmod-geoi..> | 2025-12-20 10:13 | 8.6K | |
| varnish-libvmod-maxm..> | 2025-12-22 08:57 | 5.3K | |
| varnish-libvmod-quer..> | 2025-12-20 10:18 | 14K | |
| varnish-libvmod-redi..> | 2025-12-21 09:19 | 61K | |
| varnish-modules-0.26..> | 2025-12-22 04:29 | 64K | |
| varnish7-7.7.3.pkg | 2025-12-20 01:53 | 1.1M | |
| varnish_exporter-1.6..> | 2025-12-23 09:56 | 2.4M | |
| vasm-1.8c.pkg | 2025-08-14 22:15 | 1.2M | |
| vault-1.21.1_1.pkg | 2025-12-20 05:56 | 60M | |
| vault-medusa-0.7.2_1..> | 2025-12-21 16:49 | 3.6M | |
| vaultwarden-1.34.3_4..> | 2025-12-29 05:17 | 8.2M | |
| vaultwarden_web-vaul..> | 2025-08-14 12:20 | 13M | |
| vavoom-1.33_17.pkg | 2025-12-27 07:27 | 1.9M | |
| vavoom-extras-1.30_4..> | 2025-12-30 16:30 | 16M | |
| vazirmatn-33.003.pkg | 2025-12-29 16:17 | 676K | |
| vba-1.7.2_13.pkg | 2025-12-29 16:53 | 284K | |
| vban-tools-g20201011..> | 2025-12-29 05:40 | 20K | |
| vbetool-1.1_3.pkg | 2025-12-28 15:25 | 29K | |
| vbindiff-3.0.b5_1.pkg | 2025-08-16 12:54 | 26K | |
| vboxtool-0.5_4.pkg | 2025-12-29 07:07 | 9.3K | |
| vbsfilter-1.15_4.pkg | 2025-08-20 11:07 | 6.1K | |
| vbz-compression-1.0...> | 2025-12-26 23:48 | 18K | |
| vc-1.4.5.pkg | 2025-08-13 12:22 | 236K | |
| vc-intrinsics-llvm11..> | 2025-08-15 00:10 | 109K | |
| vc-intrinsics-llvm12..> | 2025-08-14 17:37 | 109K | |
| vc-intrinsics-llvm13..> | 2025-08-15 12:25 | 109K | |
| vc-intrinsics-llvm14..> | 2025-08-15 18:45 | 110K | |
| vc-intrinsics-llvm15..> | 2025-08-22 15:51 | 110K | |
| vcdgear-1.6d.pkg | 2025-08-20 07:32 | 62K | |
| vcdimager-2.0.1_8.pkg | 2025-12-26 20:50 | 304K | |
| vcf-split-0.1.5.10_1..> | 2025-12-27 13:22 | 9.8K | |
| vcf2hap-0.1.6.7_1.pkg | 2025-12-27 10:29 | 5.0K | |
| vcflib-1.0.13.pkg | 2025-12-19 00:09 | 2.1M | |
| vcftools-0.1.17.pkg | 2025-12-19 23:07 | 396K | |
| vcg-1.30_4.pkg | 2025-08-14 08:27 | 320K | |
| vcglib-2020.09.pkg | 2025-08-15 20:54 | 4.9M | |
| vchanger-1.0.3_1.pkg | 2025-08-21 22:25 | 96K | |
| vcmi-1.6.8_4.pkg | 2025-12-29 10:33 | 11M | |
| vcp-2.2_1.pkg | 2025-08-20 07:16 | 18K | |
| vde-1.5.7_1.pkg | 2025-08-22 21:39 | 53K | |
| vde2-2.3.3_1.pkg | 2025-08-13 23:57 | 167K | |
| vdesk-1.2_4.pkg | 2025-08-19 16:27 | 6.2K | |
| vdmfec-1.0_1.pkg | 2025-08-22 19:17 | 17K | |
| vdpauinfo-1.5.pkg | 2025-08-20 19:47 | 8.0K | |
| vdradmin-am-3.6.10_1..> | 2025-12-23 12:02 | 433K | |
| vdt-0.4.6.pkg | 2025-08-14 23:39 | 27K | |
| ve-hunspell-20110323..> | 2025-08-19 14:53 | 56K | |
| ve-libreoffice-25.8...> | 2025-12-27 16:23 | 220K | |
| vec-libreoffice-25.8..> | 2025-12-27 17:04 | 551K | |
| vectoroids-1.1.2_1.pkg | 2025-12-29 19:53 | 281K | |
| ved-2024.03.21.pkg | 2025-12-20 00:27 | 100K | |
| veditor-1.2.2_6.pkg | 2025-12-29 11:29 | 664K | |
| vegeta-12.11.0_20.pkg | 2025-12-22 00:29 | 3.8M | |
| veles-2018.05.0_5.pkg | 2025-12-30 00:57 | 706K | |
| veloren-weekly-s2025..> | 2025-12-29 06:25 | 354M | |
| velvet-1.2.10_2.pkg | 2025-12-22 23:43 | 625K | |
| venice-0.752.b.pkg | 2025-12-29 23:26 | 4.0M | |
| venom-1.2.0_17.pkg | 2025-12-24 03:52 | 14M | |
| vera-1.23.pkg | 2025-08-22 00:03 | 185K | |
| veracrypt-1.26.24_1.pkg | 2025-12-30 00:30 | 6.2M | |
| verdict-1.4.4.pkg | 2025-12-18 22:09 | 733K | |
| verilator-5.042.pkg | 2025-12-20 03:24 | 3.1M | |
| verilog-mode.el-801_..> | 2025-12-27 07:27 | 97K | |
| verilog-mode.el-emac..> | 2025-12-27 18:32 | 97K | |
| verilog-mode.el-emac..> | 2025-12-27 02:55 | 97K | |
| verilog-mode.el-emac..> | 2025-12-19 11:05 | 97K | |
| verilog-mode.el-emac..> | 2025-12-19 11:00 | 97K | |
| verilog-mode.el-emac..> | 2025-12-27 16:21 | 97K | |
| veroroute-2.39,1.pkg | 2025-12-28 13:59 | 522K | |
| vertico.el-2.5_1.pkg | 2025-12-28 13:09 | 52K | |
| vertico.el-emacs_can..> | 2025-12-30 11:28 | 52K | |
| vertico.el-emacs_dev..> | 2025-12-28 17:33 | 52K | |
| vertico.el-emacs_dev..> | 2025-12-22 06:46 | 52K | |
| vertico.el-emacs_nox..> | 2025-12-24 04:54 | 52K | |
| vertico.el-emacs_way..> | 2025-12-28 10:02 | 52K | |
| vertx-2.1.1.pkg | 2025-12-28 17:54 | 5.9M | |
| veryl-0.17.1_1.pkg | 2025-12-29 02:04 | 6.1M | |
| vether-kmod-g2021121..> | 2025-08-19 13:36 | 4.6K | |
| vexcl-1.4.3_2.pkg | 2025-12-23 15:21 | 146K | |
| vexim-php81-2.3_4.pkg | 2025-12-27 21:31 | 94K | |
| vexim-php82-2.3_4.pkg | 2025-12-28 02:49 | 95K | |
| vexim-php83-2.3_4.pkg | 2025-12-30 07:09 | 95K | |
| vexim-php84-2.3_4.pkg | 2025-12-28 06:22 | 95K | |
| vexim-php85-2.3_4.pkg | 2025-12-28 15:21 | 94K | |
| vfc-2.1.6.pkg | 2025-12-30 05:01 | 81K | |
| vfront-0.96.c_2.pkg | 2025-12-28 09:17 | 2.9M | |
| vger-2.0.1_1.pkg | 2025-08-20 08:51 | 13K | |
| vgmplay-0.51.1_2.pkg | 2025-12-22 09:52 | 53K | |
| vgmtools-g20220718.pkg | 2025-08-18 01:28 | 175K | |
| vgrep-2.8.0_14.pkg | 2025-12-20 05:29 | 1.2M | |
| vhostcname-2.00.pkg | 2025-12-22 19:35 | 14K | |
| vhs-0.10.0_7.pkg | 2025-12-30 02:00 | 5.7M | |
| vi-aspell-0.01.1.1_1..> | 2025-12-23 00:58 | 50K | |
| vi-hunspell-20141110..> | 2025-08-19 10:50 | 12K | |
| vi-libreoffice-25.8...> | 2025-12-27 09:02 | 3.1M | |
| vi-libviet-20010210_..> | 2025-08-15 01:21 | 13K | |
| vi-unicode-uhoai-2.1..> | 2025-12-28 06:11 | 27K | |
| vi-urwvn-3.04_5.pkg | 2025-12-29 06:59 | 1.1M | |
| vi-vietunicode-hanno..> | 2025-12-30 00:55 | 17M | |
| vi-vietunicode-trich..> | 2025-12-29 14:26 | 1.0M | |
| vi-vietunicode-web1-..> | 2025-12-30 04:06 | 946K | |
| vi-vis2u-1.0.pkg | 2025-08-16 18:44 | 3.5K | |
| vi-vn7to8-1.1.1_1.pkg | 2025-08-17 01:26 | 14K | |
| vi-vnconvert-1.0_2.pkg | 2025-08-18 23:48 | 10K | |
| vi-vnless-1.0_2.pkg | 2025-08-19 11:14 | 36K | |
| vi-vnpstext-1.1_2.pkg | 2025-08-16 22:00 | 10K | |
| vi-vnroff-2.1_1.pkg | 2025-08-18 01:32 | 6.3K | |
| vi-x-unikey-1.0.4.pkg | 2025-08-16 16:55 | 81K | |
| viamillipede-0.89_1.pkg | 2025-08-21 08:23 | 21K | |
| vice-3.9_1.pkg | 2025-12-28 15:32 | 12M | |
| victor-mono-ttf-1.5...> | 2025-12-30 02:27 | 800K | |
| victoria-logs-1.40.0..> | 2025-12-20 15:18 | 8.2M | |
| victoria-metrics-1.1..> | 2025-12-21 10:48 | 15M | |
| vid.stab-1.1.1.pkg | 2025-08-13 11:00 | 51K | |
| viddy-0.3.4_33.pkg | 2025-12-21 09:17 | 3.2M | |
| video-trimmer-25.03_..> | 2025-12-28 09:54 | 398K | |
| videogen-0.33_2.pkg | 2025-08-16 10:38 | 19K | |
| viennacl-1.7.1_6.pkg | 2025-12-19 10:14 | 365K | |
| viennarna-2.7.0_2.pkg | 2025-12-27 17:12 | 16M | |
| viewfax-2.6_2.pkg | 2025-08-21 07:57 | 47K | |
| viewglob-2.0.4_10.pkg | 2025-12-27 23:43 | 112K | |
| viewklass-0.7.2_1.pkg | 2025-12-30 16:41 | 143K | |
| viewnior-1.8_3.pkg | 2025-12-30 01:43 | 132K | |
| viewres-1.0.8.pkg | 2025-12-23 12:59 | 15K | |
| vifm-0.14.3.pkg | 2025-12-21 21:41 | 970K | |
| vifm-colors-0.13.pkg | 2025-08-16 08:22 | 9.8K | |
| vigenere-1.0_1.pkg | 2025-08-19 22:48 | 7.3K | |
| vigil-1.28.6_1.pkg | 2025-12-29 18:51 | 3.7M | |
| vigor-0.016_4.pkg | 2025-12-30 10:02 | 204K | |
| vigra-1.12.2.pkg | 2025-12-26 18:28 | 964K | |
| vii-4.2_6.pkg | 2025-12-20 23:30 | 14K | |
| viking-1.10_3.pkg | 2025-12-30 08:45 | 2.9M | |
| vile-9.8z_1.pkg | 2025-08-17 09:34 | 1.1M | |
| vils-20020228_1.pkg | 2025-08-16 20:19 | 1.7K | |
| vim-9.1.1948.pkg | 2025-12-18 11:49 | 9.3M | |
| vim-colorschemes-leg..> | 2025-08-20 00:07 | 9.1K | |
| vim-gtk2-9.1.1948.pkg | 2025-12-27 05:00 | 9.5M | |
| vim-gtk3-9.1.1948.pkg | 2025-12-27 04:23 | 9.4M | |
| vim-lsp-0.1.4.198.pkg | 2025-08-17 01:36 | 101K | |
| vim-motif-9.1.1948.pkg | 2025-12-27 02:55 | 9.5M | |
| vim-tiny-9.1.1948.pkg | 2025-12-19 12:45 | 1.6M | |
| vim-x11-9.1.1948.pkg | 2025-12-19 22:07 | 9.4M | |
| vimb-3.7.0_5.pkg | 2025-12-28 06:58 | 81K | |
| vimpager-2.06.202504..> | 2025-12-20 08:35 | 74K | |
| vimpager-gtk2-2.06.2..> | 2025-12-30 12:50 | 74K | |
| vimpager-gtk3-2.06.2..> | 2025-12-30 07:16 | 74K | |
| vimpager-motif-2.06...> | 2025-12-30 02:15 | 74K | |
| vimpager-neovim-2.06..> | 2025-12-23 13:48 | 74K | |
| vimpager-tiny-2.06.2..> | 2025-12-23 13:56 | 74K | |
| vimpager-x11-2.06.20..> | 2025-12-22 13:35 | 74K | |
| vimpc-0.09.2_2.pkg | 2025-12-21 22:12 | 283K | |
| vinagre-3.22.0_12.pkg | 2025-12-30 02:23 | 1.4M | |
| vinci-1.0.5.pkg | 2025-08-19 18:18 | 30K | |
| vino-3.22.0_4.pkg | 2025-12-28 14:26 | 393K | |
| violet-2.1.0.pkg | 2025-12-29 00:44 | 3.2M | |
| violetland-0.5_26.pkg | 2025-12-29 04:01 | 8.2M | |
| vipack-0.9.1.pkg | 2025-12-23 01:47 | 272K | |
| vips-8.18.0.pkg | 2025-12-26 11:47 | 3.8M | |
| vipster-1.19.1.b.109..> | 2025-12-29 07:56 | 695K | |
| virglrenderer-1.0.1.pkg | 2025-12-23 04:37 | 230K | |
| virt-firmware-25.12.pkg | 2025-12-27 21:59 | 185K | |
| virt-manager-5.1.0.pkg | 2025-12-29 03:06 | 1.1M | |
| virt-viewer-11.0_7.pkg | 2025-12-27 17:50 | 248K | |
| virt-what-1.25_1.pkg | 2025-12-20 06:00 | 13K | |
| virtboard-0.0.6_1.pkg | 2025-12-29 22:44 | 64K | |
| virtual_oss-1.3.2_2.pkg | 2025-12-27 07:25 | 63K | |
| virtual_oss_ctl-1.3...> | 2025-12-29 04:06 | 43K | |
| virtualbox-ose-6.1.5..> | 2025-12-27 19:37 | 40M | |
| virtualbox-ose-70-7...> | 2025-12-30 09:45 | 47M | |
| virtualbox-ose-71-7...> | 2025-12-29 03:25 | 53M | |
| virtualbox-ose-72-7...> | 2025-12-28 09:29 | 59M | |
| virtualbox-ose-addit..> | 2025-12-20 19:18 | 1.2M | |
| virtualbox-ose-addit..> | 2025-12-22 17:14 | 598K | |
| virtualbox-ose-addit..> | 2025-12-20 09:29 | 615K | |
| virtualbox-ose-addit..> | 2025-12-23 11:18 | 618K | |
| virtualbox-ose-addit..> | 2025-12-23 08:56 | 752K | |
| virtualbox-ose-addit..> | 2025-12-20 17:18 | 1.0M | |
| virtualbox-ose-addit..> | 2025-12-21 20:54 | 493K | |
| virtualbox-ose-addit..> | 2025-12-23 14:21 | 506K | |
| virtualbox-ose-addit..> | 2025-12-21 17:06 | 509K | |
| virtualbox-ose-addit..> | 2025-12-22 04:43 | 520K | |
| virtualbox-ose-kmod-..> | 2025-08-14 09:00 | 141K | |
| virtualbox-ose-kmod-..> | 2025-08-15 20:37 | 146K | |
| virtualbox-ose-kmod-..> | 2025-12-19 20:54 | 146K | |
| virtualbox-ose-kmod-..> | 2025-12-19 20:14 | 147K | |
| virtualbox-ose-kmod-..> | 2025-08-14 10:45 | 134K | |
| virtualbox-ose-legac..> | 2025-12-28 12:22 | 24M | |
| virtualbox-ose-nox11..> | 2025-12-29 06:04 | 15M | |
| virtualbox-ose-nox11..> | 2025-12-27 20:22 | 19M | |
| virtualbox-ose-nox11..> | 2025-12-30 09:05 | 19M | |
| virtualbox-ose-nox11..> | 2025-12-30 11:45 | 26M | |
| virtualbox-ose-nox11..> | 2025-12-30 10:28 | 12M | |
| virtualgl-3.1.4.pkg | 2025-12-29 12:22 | 759K | |
| virtualmin-7.2,1.pkg | 2025-12-22 02:53 | 4.5M | |
| virtualpg-2.0.1.pkg | 2025-12-19 14:42 | 26K | |
| viruskiller-1.03_7.pkg | 2025-12-30 04:41 | 4.1M | |
| vis-0.9.pkg | 2025-12-21 21:23 | 331K | |
| visitors-0.7.0_1.pkg | 2025-08-22 07:57 | 67K | |
| visp-3.6.0_13.pkg | 2025-12-28 14:11 | 3.0M | |
| visp-go-g20210723_34..> | 2025-12-23 09:19 | 7.3M | |
| visprint-2.1_4.pkg | 2025-12-28 08:57 | 9.7K | |
| visualboyadvance-m-2..> | 2025-12-27 21:23 | 579K | |
| visualpolylib-0.9_1.pkg | 2025-12-28 09:40 | 35K | |
| visualvm-2.1.9.pkg | 2025-12-28 00:29 | 16M | |
| vit-1.2_2.pkg | 2025-12-20 06:27 | 15K | |
| vitables-3.1.0.pkg | 2025-12-30 14:05 | 485K | |
| vitetris-0.59.1.pkg | 2025-08-22 09:10 | 66K | |
| vitunes-2.3_7.pkg | 2025-12-28 16:09 | 58K | |
| viu-1.5.1_9.pkg | 2025-12-29 05:30 | 940K | |
| vivid-0.10.1_4.pkg | 2025-12-30 12:54 | 362K | |
| viz-1.1.1_3.pkg | 2025-08-19 05:52 | 34K | |
| vizone-0.1.pkg | 2025-12-21 03:36 | 2.1K | |
| vkoverhead-1.3.pkg | 2025-12-29 11:02 | 161K | |
| vkpeak-20251010.pkg | 2025-12-28 23:06 | 759K | |
| vkquake-1.32.3.1_2.pkg | 2025-12-27 21:25 | 871K | |
| vlc-3.0.21_21,4.pkg | 2025-12-27 01:33 | 11M | |
| vlock-2.2.3_5.pkg | 2025-08-18 17:16 | 27K | |
| vm-bhyve-1.7.0_1.pkg | 2025-12-22 17:06 | 66K | |
| vm-bhyve-devel-1.7.0..> | 2025-12-21 06:21 | 66K | |
| vm-bhyve-zcomp-20250..> | 2025-08-15 23:48 | 2.3K | |
| vm-lv2-0.14.0_2.pkg | 2025-12-28 06:09 | 271K | |
| vm-to-tor-1.0.pkg | 2025-12-20 05:11 | 11K | |
| vmaf-3.0.0.pkg | 2025-08-10 21:31 | 326K | |
| vmdktool-1.4.pkg | 2025-08-21 17:42 | 14K | |
| vmips-1.5.1_3.pkg | 2025-08-21 02:38 | 142K | |
| vmpk-0.9.0.pkg | 2025-12-28 19:37 | 489K | |
| vms-empire-1.18.pkg | 2025-08-16 00:12 | 81K | |
| vmsbackup-4.1.1_1.pkg | 2025-08-22 13:40 | 11K | |
| vmstated-0.10.pkg | 2025-08-21 08:17 | 46K | |
| vmtouch-1.3.1_1.pkg | 2025-08-20 11:47 | 15K | |
| vmutils-1.131.0_1.pkg | 2025-12-20 19:05 | 34M | |
| vmw-060510_2.pkg | 2025-08-16 07:47 | 56K | |
| vncreflector-1.2.4_8..> | 2025-12-29 12:52 | 53K | |
| vnote-3.20.0.pkg | 2025-12-28 22:55 | 6.7M | |
| vnstat-2.13.pkg | 2025-12-28 12:51 | 147K | |
| vo-amrwbenc-0.1.3_1.pkg | 2025-08-19 12:30 | 107K | |
| voadi-0.3_1.pkg | 2025-12-29 17:00 | 4.5M | |
| vobcopy-1.2.1.pkg | 2025-12-22 15:14 | 49K | |
| voc-2.1.2.pkg | 2025-08-14 09:59 | 1.7M | |
| void-zones-tools-1.0..> | 2025-12-22 10:44 | 12K | |
| voipong-2.0.pkg | 2025-08-18 11:25 | 92K | |
| volk-3.1.1.pkg | 2025-12-18 18:35 | 685K | |
| volleyball-0.8.6_13.pkg | 2025-12-29 00:16 | 775K | |
| vollkorn-ttf-4.105_1..> | 2025-12-29 03:52 | 1.3M | |
| volman-0.7_2.pkg | 2025-08-18 23:47 | 5.4K | |
| volpack-1.0b3_2.pkg | 2025-08-16 11:43 | 172K | |
| volta-0.3.0_1.pkg | 2025-12-21 08:07 | 25K | |
| volumeicon-0.5.1_3.pkg | 2025-12-29 15:56 | 36K | |
| vor-0.5.8.pkg | 2025-12-29 20:03 | 191K | |
| vorbis-tools-1.4.3,3..> | 2025-12-26 15:10 | 292K | |
| vorbisgain-0.37_6.pkg | 2025-08-20 06:42 | 23K | |
| voro++-0.4.6_2.pkg | 2025-08-13 11:12 | 168K | |
| vortex-2.9.0.59_2.pkg | 2025-12-24 04:50 | 32K | |
| vosk-api-0.3.50_1.pkg | 2025-12-27 05:36 | 445K | |
| votca-2025.1_1.pkg | 2025-12-29 11:10 | 30M | |
| vote-1.2.pkg | 2025-08-16 12:34 | 4.3K | |
| vouch-proxy-0.45.1_6..> | 2025-12-21 16:09 | 3.7M | |
| vowpal_wabbit-7.10_2..> | 2025-12-21 12:12 | 820K | |
| vp-1.8_3.pkg | 2025-12-29 16:26 | 8.6K | |
| vpaint-1.7_3.pkg | 2025-12-28 11:07 | 777K | |
| vpnc-0.5.3_15.pkg | 2025-12-20 10:36 | 61K | |
| vpnc-scripts-2022051..> | 2025-08-14 00:57 | 14K | |
| vpopmail-5.4.33_4.pkg | 2025-08-14 02:35 | 406K | |
| vpp-24.06_1.pkg | 2025-12-21 05:48 | 12M | |
| vqadmin-2.3.6_1.pkg | 2025-08-17 21:54 | 68K | |
| vqcc-gtk-0.5_11.pkg | 2025-12-28 12:38 | 94K | |
| vrflash-0.24.pkg | 2025-08-22 13:31 | 20K | |
| vrfy-1.0_3.pkg | 2025-08-21 15:26 | 20K | |
| vscode-1.107.1_1.pkg | 2025-12-26 03:14 | 106M | |
| vsearch-2.30.2.pkg | 2025-12-28 07:01 | 255K | |
| vsftpd-ext-3.0.3.1_3..> | 2025-08-18 19:09 | 133K | |
| vsftpd-ssl-3.0.5_2.pkg | 2025-08-22 20:05 | 120K | |
| vshnu-1.0500.pkg | 2025-12-22 08:47 | 41K | |
| vsound-0.6_7.pkg | 2025-12-27 23:43 | 8.0K | |
| vst3sdk-3.7.12.b.20.pkg | 2025-12-29 15:24 | 13M | |
| vstr-1.0.15_2.pkg | 2025-08-22 22:25 | 306K | |
| vt-0.57721_3.pkg | 2025-12-19 05:12 | 725K | |
| vt100-0.2_1.pkg | 2025-12-29 22:24 | 34K | |
| vt100-art-and-animat..> | 2025-12-20 05:31 | 198K | |
| vte-0.28.2_4.pkg | 2025-12-26 23:45 | 360K | |
| vte3-0.80.4.pkg | 2025-12-26 15:45 | 577K | |
| vtk9-9.5.2.pkg | 2025-12-26 12:15 | 40M | |
| vtm-2025.09.12.pkg | 2025-12-22 17:47 | 1.6M | |
| vttest-2023.12.30_1.pkg | 2025-08-22 06:06 | 105K | |
| vtwm-5.5.0_1.pkg | 2025-12-29 18:56 | 178K | |
| vulkan-caps-viewer-4..> | 2025-12-30 12:50 | 339K | |
| vulkan-extension-lay..> | 2025-12-28 04:28 | 479K | |
| vulkan-headers-1.4.3..> | 2025-12-24 20:27 | 1.6M | |
| vulkan-loader-1.4.33..> | 2025-12-24 21:49 | 145K | |
| vulkan-tools-1.4.336..> | 2025-12-26 19:41 | 427K | |
| vulkan-utility-libra..> | 2025-12-27 09:59 | 588K | |
| vulkan-validation-la..> | 2025-12-28 20:04 | 5.1M | |
| vuls-0.37.0.pkg | 2025-12-19 23:28 | 42M | |
| vulsrepo-0.7.1_17.pkg | 2025-12-23 23:54 | 14M | |
| vultr-cli-3.6.0_5.pkg | 2025-12-23 11:02 | 2.9M | |
| vultures-eye-2.3.67_..> | 2025-12-30 09:31 | 25M | |
| vuxml-1.1_6.pkg | 2025-12-21 09:15 | 9.0K | |
| vv-1.4.0.406.pkg | 2025-12-30 01:13 | 3.9M | |
| vvdec-3.1.0.pkg | 2025-12-20 07:52 | 696K | |
| vvenc-1.13.1.pkg | 2025-08-17 18:58 | 1.4M | |
| vxl-3.3.2_3.pkg | 2025-12-26 13:33 | 5.3M | |
| vxlog-1.0.3_1.pkg | 2025-08-19 11:30 | 8.8K | |
| vxquery-0.2.1.pkg | 2025-08-22 12:20 | 34K | |
| vym-2.9.22_1.pkg | 2025-12-29 03:59 | 5.3M | |
| w3m-0.5.5.pkg | 2025-12-16 01:35 | 1.0M | |
| w3m-img-0.5.5.pkg | 2025-12-27 12:04 | 1.0M | |
| w3mir-1.0.10_3.pkg | 2025-12-21 16:40 | 81K | |
| w_scan2-1.0.17.pkg | 2025-12-20 11:09 | 153K | |
| wa-aspell-0.50.0_1,1..> | 2025-12-23 17:13 | 702K | |
| wa-hunspell-0.4.15_1..> | 2025-08-18 20:32 | 47K | |
| wabt-1.0.37.pkg | 2025-12-22 14:55 | 1.1M | |
| wackamole-2.1.5_2.pkg | 2025-12-20 10:27 | 44K | |
| waffle-1.6.1.15_4.pkg | 2025-12-19 14:43 | 102K | |
| waifu2x-converter-cp..> | 2025-12-27 03:12 | 11M | |
| waifu2x-ncnn-vulkan-..> | 2025-12-27 16:32 | 33M | |
| waiho-0.2_13.pkg | 2025-12-27 17:32 | 59K | |
| wait_on-1.1.2_1.pkg | 2025-08-19 10:56 | 7.0K | |
| waitforssh-0.0.1.pkg | 2025-12-21 17:29 | 5.0K | |
| wakeonlan-0.42.pkg | 2025-12-21 19:14 | 5.4K | |
| walk-1.13.0_9.pkg | 2025-12-20 10:58 | 2.5M | |
| walker-3.8_2.pkg | 2025-12-21 21:14 | 11K | |
| walker-launcher-2.12..> | 2025-12-30 11:27 | 832K | |
| walld-1.4.4_2.pkg | 2025-12-29 17:25 | 16K | |
| walletd-2.11.0_1.pkg | 2025-12-20 22:21 | 8.2M | |
| wallhaven-cli-2.0.6.pkg | 2025-12-28 06:48 | 2.8M | |
| wallpapers-freebsd-k..> | 2025-08-22 15:38 | 4.1M | |
| wallust-3.4.0_3.pkg | 2025-12-28 04:55 | 1.5M | |
| wallutils-5.14.3_1.pkg | 2025-12-28 07:01 | 9.8M | |
| wand-libconfig-1.0.5..> | 2025-08-22 17:01 | 19K | |
| wanderer-3.2_2.pkg | 2025-08-22 04:55 | 51K | |
| wanderlust-2.15.9.b...> | 2025-12-27 21:01 | 902K | |
| wanderlust-emacs_can..> | 2025-12-30 04:05 | 902K | |
| wanderlust-emacs_dev..> | 2025-12-30 01:48 | 901K | |
| wanderlust-emacs_dev..> | 2025-12-30 00:25 | 901K | |
| wanderlust-emacs_nox..> | 2025-12-28 10:43 | 903K | |
| wanderlust-emacs_way..> | 2025-12-27 21:27 | 902K | |
| wandio-1.0.5.pkg | 2025-12-20 20:44 | 27K | |
| wangle-2025.12.15.00..> | 2025-12-26 23:43 | 327K | |
| wannier90-3.1.0_5.pkg | 2025-12-27 00:56 | 951K | |
| wanted-ports-0.3.pkg | 2025-08-15 22:52 | 8.0K | |
| waon-0.10_6.pkg | 2025-12-30 09:04 | 68K | |
| wapanel-1.1.0_7.pkg | 2025-12-29 15:36 | 239K | |
| wargus-3.3.2_2.pkg | 2025-12-30 10:57 | 3.6M | |
| warmux-11.04.1_12.pkg | 2025-12-29 20:24 | 98M | |
| warzone2100-4.6.2.pkg | 2025-12-30 11:25 | 322M | |
| wasabi-1.0.4.pkg | 2025-12-21 11:10 | 7.2M | |
| wasi-compiler-rt17-1..> | 2025-08-15 15:21 | 21K | |
| wasi-compiler-rt18-1..> | 2025-08-15 01:35 | 21K | |
| wasi-compiler-rt19-1..> | 2025-08-13 18:35 | 21K | |
| wasi-compiler-rt20-2..> | 2025-08-14 22:55 | 21K | |
| wasi-compiler-rt21-2..> | 2025-12-27 09:40 | 21K | |
| wasi-libc17-28.pkg | 2025-12-18 19:49 | 442K | |
| wasi-libc18-28.pkg | 2025-12-18 19:33 | 445K | |
| wasi-libc19-28.pkg | 2025-12-18 12:23 | 446K | |
| wasi-libc20-28.pkg | 2025-12-18 22:21 | 446K | |
| wasi-libc21-28.pkg | 2025-12-18 20:33 | 446K | |
| wasi-libcxx17-17.0.6..> | 2025-08-19 00:12 | 1.0M | |
| wasi-libcxx18-18.1.8..> | 2025-08-16 09:16 | 1.0M | |
| wasi-libcxx19-19.1.7..> | 2025-08-14 01:23 | 1.0M | |
| wasi-libcxx20-20.1.8..> | 2025-08-20 19:49 | 1.2M | |
| wasi-libcxx21-21.1.8..> | 2025-12-27 21:49 | 1.2M | |
| wasm-bindgen-cli-0.2..> | 2025-12-27 02:33 | 2.7M | |
| wasm-pack-0.13.1_11.pkg | 2025-12-27 11:45 | 1.5M | |
| wasm-server-runner-1..> | 2025-12-30 00:49 | 2.8M | |
| wasm3-0.5.0_2.pkg | 2025-08-18 11:33 | 63K | |
| wasmer-6.1.0_2.pkg | 2025-12-30 02:09 | 26M | |
| watchfolder-0.3.3_1.pkg | 2025-08-18 16:02 | 46K | |
| watchman-4.5.0,1.pkg | 2025-08-15 09:31 | 84K | |
| watchmen-0.09_1.pkg | 2025-12-22 15:36 | 19K | |
| watershot-0.2.2_20.pkg | 2025-12-28 19:48 | 2.3M | |
| wavbreaker-0.16_3.pkg | 2025-12-30 09:37 | 83K | |
| wavedrom-0.1.0_6.pkg | 2025-12-30 12:01 | 657K | |
| wavegain-1.3.1.pkg | 2025-08-18 18:40 | 29K | |
| wavelib-g20200528.pkg | 2025-08-20 23:46 | 118K | |
| wavetral-g20210517_1..> | 2025-12-29 23:21 | 48K | |
| wavpack-5.8.1.pkg | 2025-08-13 19:18 | 197K | |
| wavplay-2.0_1.pkg | 2025-08-15 21:10 | 16K | |
| way-displays-1.15.0.pkg | 2025-12-22 02:38 | 360K | |
| waybar-0.14.0_2.pkg | 2025-12-29 21:43 | 677K | |
| waybar-nopulse-0.14...> | 2025-12-27 20:35 | 663K | |
| waycheck-1.7.0.pkg | 2025-12-30 15:40 | 49K | |
| waycorner-0.2.3_4.pkg | 2025-12-30 16:03 | 816K | |
| wayfire-0.10.0.pkg | 2025-12-26 23:39 | 1.9M | |
| wayfire-plugins-extr..> | 2025-12-28 10:31 | 642K | |
| wayidle-1.0.1_7.pkg | 2025-12-29 04:13 | 203K | |
| wayland-1.24.0_2.pkg | 2025-12-16 01:47 | 142K | |
| wayland-logout-1.4_1..> | 2025-08-14 02:57 | 3.7K | |
| wayland-protocols-1...> | 2025-12-16 01:51 | 125K | |
| wayland-utils-1.3.0.pkg | 2025-12-18 15:32 | 18K | |
| waylandpp-1.0.1.pkg | 2025-12-18 13:43 | 601K | |
| waylock-1.5.0.pkg | 2025-12-30 03:48 | 33K | |
| waynergy-0.0.17.pkg | 2025-12-27 22:51 | 48K | |
| wayout-1.1.3_24.pkg | 2025-12-28 22:16 | 284K | |
| waypipe-0.10.6_2.pkg | 2025-12-30 07:17 | 736K | |
| wayst-g20250601.pkg | 2025-12-29 14:58 | 219K | |
| wayvnc-0.9.1_1.pkg | 2025-12-29 17:00 | 63K | |
| wazuh-agent-4.14.1.pkg | 2025-12-29 17:25 | 5.3M | |
| wazuh-dashboard-4.14..> | 2025-12-30 00:03 | 16M | |
| wazuh-indexer-4.14.1..> | 2025-12-28 12:44 | 2.7K | |
| wazuh-manager-4.14.1..> | 2025-12-27 05:57 | 93M | |
| wazuh-server-4.14.1.pkg | 2025-12-28 02:29 | 12K | |
| wbar-2.3.4_11.pkg | 2025-12-29 19:56 | 73K | |
| wcalc-2.5_4.pkg | 2025-12-21 16:49 | 108K | |
| wcd-6.0.5_1.pkg | 2025-12-22 02:45 | 517K | |
| wcm-0.10.0.pkg | 2025-12-30 02:02 | 284K | |
| wcslib-8.4.pkg | 2025-12-27 01:19 | 2.6M | |
| wdiag-0.10.2.pkg | 2025-08-18 01:32 | 11K | |
| wdiff-1.2.2_3.pkg | 2025-12-19 13:11 | 100K | |
| wdisplays-1.1.3.pkg | 2025-12-27 14:12 | 36K | |
| wdm-1.28_17.pkg | 2025-12-29 18:28 | 383K | |
| wdns-0.12.0.pkg | 2025-08-13 22:08 | 61K | |
| weather-2.5.0.pkg | 2025-12-23 14:01 | 2.4M | |
| weaviate-1.34.3_1.pkg | 2025-12-23 03:25 | 56M | |
| web-mode-15.1_22.pkg | 2025-12-28 08:46 | 83K | |
| web-mode-emacs_canna..> | 2025-12-29 20:14 | 83K | |
| web-mode-emacs_devel..> | 2025-12-30 08:29 | 83K | |
| web-mode-emacs_devel..> | 2025-12-21 02:09 | 83K | |
| web-mode-emacs_nox-1..> | 2025-12-21 01:16 | 83K | |
| web-mode-emacs_wayla..> | 2025-12-28 06:37 | 83K | |
| webalizer-2.23.8_18.pkg | 2025-12-27 17:37 | 135K | |
| webalizer-geodb-2021..> | 2025-08-16 13:11 | 1.1M | |
| webalizer-geoip-2.23..> | 2025-12-27 20:17 | 271K | |
| webbench-1.5_1.pkg | 2025-08-20 23:29 | 8.9K | |
| webbrowser-0.4.0.pkg | 2025-08-15 09:03 | 2.3K | |
| webcamd-5.17.1.2_2.pkg | 2025-08-13 15:22 | 1.8M | |
| webcpp-0.8.4.pkg | 2025-08-16 05:58 | 112K | |
| webcrawl-1.10_2.pkg | 2025-08-19 03:38 | 16K | |
| webdis-0.1.20_1.pkg | 2025-08-20 15:38 | 78K | |
| weberp-4.15.2.pkg | 2025-12-29 03:52 | 20M | |
| webfonts-0.30_14.pkg | 2025-12-27 09:41 | 4.6M | |
| webfs-1.21_1.pkg | 2025-08-20 00:37 | 24K | |
| webfwlog-1.1.3.pkg | 2025-12-30 17:29 | 239K | |
| webgrind-1.9.2.pkg | 2025-12-29 23:25 | 101K | |
| webhook-2.8.2_7.pkg | 2025-12-24 06:58 | 3.1M | |
| webinject-1.41_1.pkg | 2025-12-23 14:21 | 22K | |
| webkit2-gtk_40-2.46...> | 2025-12-26 09:01 | 35M | |
| webkit2-gtk_41-2.46...> | 2025-12-26 13:49 | 35M | |
| webkit2-gtk_60-2.46...> | 2025-12-26 16:25 | 34M | |
| weblint++-1.15_3.pkg | 2025-12-20 02:05 | 15K | |
| webmin-2.610.pkg | 2025-12-20 02:47 | 28M | |
| webp-1.6.0.pkg | 2025-12-24 21:58 | 480K | |
| webp-pixbuf-loader-0..> | 2025-12-27 09:43 | 8.6K | |
| webresolve-0.2.0_2.pkg | 2025-08-21 10:29 | 6.2K | |
| webrtc-audio-process..> | 2025-08-10 22:14 | 552K | |
| webrtc-audio-process..> | 2025-08-14 17:41 | 532K | |
| webrtc-audio-process..> | 2025-08-18 03:56 | 450K | |
| websh-3.6.0.b5_9,1.pkg | 2025-12-22 03:27 | 92K | |
| websieve-0.63.a_4.pkg | 2025-12-23 06:41 | 25K | |
| website-2.6.0.pkg | 2025-08-18 01:59 | 147K | |
| websocat-1.14.0_10.pkg | 2025-12-27 18:29 | 885K | |
| websocketd-0.4.1_35.pkg | 2025-12-21 01:54 | 2.3M | |
| websocketpp-0.8.2_3.pkg | 2025-12-19 00:06 | 115K | |
| webstone-2.5_2.pkg | 2025-12-22 21:19 | 58K | |
| websvn-php81-2.8.5.pkg | 2025-12-29 16:11 | 211K | |
| websvn-php82-2.8.5.pkg | 2025-12-30 01:58 | 211K | |
| websvn-php83-2.8.5.pkg | 2025-12-28 06:12 | 211K | |
| websvn-php84-2.8.5.pkg | 2025-12-28 11:16 | 211K | |
| websvn-php85-2.8.5.pkg | 2025-12-30 14:50 | 211K | |
| webtrees21-php81-2.1..> | 2025-12-30 17:56 | 20M | |
| webtrees21-php82-2.1..> | 2025-12-29 05:40 | 20M | |
| webtrees22-php83-2.2..> | 2025-12-30 08:46 | 19M | |
| webtrees22-php84-2.2..> | 2025-12-30 17:22 | 19M | |
| webtrees22-php85-2.2..> | 2025-12-27 19:57 | 19M | |
| webtunnel-tor-0.0.1_..> | 2025-12-23 20:03 | 2.1M | |
| weechat-4.8.1.pkg | 2025-12-19 16:22 | 2.8M | |
| weedit-2.0.3.pkg | 2025-08-22 03:29 | 12K | |
| weex-2.8.4.4.pkg | 2025-12-22 14:38 | 52K | |
| wego-2.3_11.pkg | 2025-12-20 06:31 | 2.2M | |
| weka-3.8.6.pkg | 2025-12-30 07:32 | 12M | |
| welle.io-2.7.pkg | 2025-12-27 20:07 | 382K | |
| wemux-3.2.0_2.pkg | 2025-12-20 05:40 | 12K | |
| wesnoth-1.18.5_3,1.pkg | 2025-12-28 21:05 | 396M | |
| wev-1.1.0.pkg | 2025-12-28 01:26 | 43K | |
| wezterm-20250730.110..> | 2025-12-27 20:57 | 76M | |
| wf-config-0.10.0.pkg | 2025-12-18 16:37 | 125K | |
| wf-recorder-0.6.0_1.pkg | 2025-12-29 03:21 | 47K | |
| wf-shell-0.10.0.pkg | 2025-12-27 02:59 | 6.0M | |
| wf-shell-nopulse-0.1..> | 2025-12-28 10:36 | 6.0M | |
| wfa2-lib-2.3.5.pkg | 2025-08-13 17:19 | 136K | |
| wfb2sql-0.6_1.pkg | 2025-12-24 06:58 | 12K | |
| wgcf-2.2.27_7.pkg | 2025-12-22 03:48 | 3.3M | |
| wget-1.25.0.pkg | 2025-12-18 22:59 | 767K | |
| wget2-2.2.0_1.pkg | 2025-12-21 15:43 | 566K | |
| wgetpaste-2.34.pkg | 2025-12-22 06:45 | 14K | |
| whatmask-1.2_3.pkg | 2025-08-17 09:22 | 7.7K | |
| whatpix-1.2_2.pkg | 2025-12-20 08:11 | 4.8K | |
| whatweb-0.5.5.1.b351..> | 2025-12-29 05:19 | 2.6M | |
| when-1.1.45.pkg | 2025-12-20 06:48 | 48K | |
| whichman-2.4_1.pkg | 2025-08-18 14:45 | 14K | |
| whichwayisup-0.7.9_1..> | 2025-12-28 04:24 | 970K | |
| whisper.cpp-1.7.6_1.pkg | 2025-12-29 22:43 | 624K | |
| whois-5.5.7_1.pkg | 2025-12-23 16:27 | 63K | |
| whoseip-1.00.pkg | 2025-12-21 11:33 | 29K | |
| whoson-2.05_2.pkg | 2025-08-21 12:36 | 41K | |
| whowatch-1.4_2.pkg | 2025-08-20 03:43 | 16K | |
| whysynth-20120903_7.pkg | 2025-12-29 11:01 | 1.6M | |
| widelands-1.2.1.pkg | 2025-12-30 08:05 | 423M | |
| widentd-1.05.pkg | 2025-08-22 21:55 | 8.7K | |
| wideriver-1.3.1.pkg | 2025-12-27 21:12 | 27K | |
| wifi-firmware-ath10k..> | 2025-12-23 12:13 | 6.4M | |
| wifi-firmware-ath10k..> | 2025-12-19 21:42 | 356K | |
| wifi-firmware-ath10k..> | 2025-12-20 00:39 | 278K | |
| wifi-firmware-ath10k..> | 2025-12-20 00:28 | 459K | |
| wifi-firmware-ath10k..> | 2025-12-19 10:30 | 307K | |
| wifi-firmware-ath10k..> | 2025-12-20 01:52 | 926K | |
| wifi-firmware-ath10k..> | 2025-12-20 01:26 | 1.0M | |
| wifi-firmware-ath10k..> | 2025-12-19 13:18 | 201K | |
| wifi-firmware-ath10k..> | 2025-12-19 11:00 | 503K | |
| wifi-firmware-ath10k..> | 2025-12-19 16:44 | 496K | |
| wifi-firmware-ath10k..> | 2025-12-19 17:26 | 3.3M | |
| wifi-firmware-ath11k..> | 2025-12-22 19:21 | 21M | |
| wifi-firmware-ath11k..> | 2025-12-19 17:27 | 1.9M | |
| wifi-firmware-ath11k..> | 2025-12-20 02:01 | 2.0M | |
| wifi-firmware-ath11k..> | 2025-12-19 23:18 | 2.4M | |
| wifi-firmware-ath11k..> | 2025-12-19 16:03 | 2.2M | |
| wifi-firmware-ath11k..> | 2025-12-20 01:41 | 1.5M | |
| wifi-firmware-ath11k..> | 2025-12-19 22:46 | 2.1M | |
| wifi-firmware-ath11k..> | 2025-12-20 04:06 | 2.0M | |
| wifi-firmware-ath11k..> | 2025-12-19 07:34 | 5.3M | |
| wifi-firmware-ath11k..> | 2025-12-20 01:58 | 3.9M | |
| wifi-firmware-ath12k..> | 2025-12-22 04:35 | 7.7M | |
| wifi-firmware-ath12k..> | 2025-12-20 00:39 | 3.7M | |
| wifi-firmware-ath12k..> | 2025-12-19 12:11 | 5.7M | |
| wifi-firmware-iwlwif..> | 2025-12-19 15:39 | 828K | |
| wifi-firmware-iwlwif..> | 2025-12-19 09:40 | 518K | |
| wifi-firmware-iwlwif..> | 2025-12-19 13:02 | 548K | |
| wifi-firmware-iwlwif..> | 2025-12-19 08:33 | 776K | |
| wifi-firmware-iwlwif..> | 2025-12-23 03:00 | 7.4M | |
| wifi-firmware-iwlwif..> | 2025-12-20 01:42 | 3.2M | |
| wifi-firmware-iwlwif..> | 2025-12-20 03:13 | 1.6M | |
| wifi-firmware-iwlwif..> | 2025-12-19 05:54 | 662K | |
| wifi-firmware-kmod-2..> | 2025-12-22 17:40 | 840 | |
| wifi-firmware-kmod-r..> | 2025-12-21 03:29 | 675 | |
| wifi-firmware-mt76-k..> | 2025-12-23 14:48 | 16M | |
| wifi-firmware-mt76-k..> | 2025-08-14 16:34 | 2.7M | |
| wifi-firmware-mt76-k..> | 2025-12-19 08:34 | 537K | |
| wifi-firmware-mt76-k..> | 2025-12-20 02:51 | 1.5M | |
| wifi-firmware-mt76-k..> | 2025-12-19 17:29 | 1.4M | |
| wifi-firmware-mt76-k..> | 2025-12-19 15:41 | 1.3M | |
| wifi-firmware-mt76-k..> | 2025-12-19 12:56 | 11M | |
| wifi-firmware-mt76-k..> | 2025-12-20 00:30 | 48K | |
| wifi-firmware-mt7601..> | 2025-12-19 12:12 | 26K | |
| wifi-firmware-rtw88-..> | 2025-12-22 17:14 | 318K | |
| wifi-firmware-rtw88-..> | 2025-12-19 22:20 | 25K | |
| wifi-firmware-rtw88-..> | 2025-12-19 09:29 | 19K | |
| wifi-firmware-rtw88-..> | 2025-12-19 10:57 | 17K | |
| wifi-firmware-rtw88-..> | 2025-12-19 04:57 | 36K | |
| wifi-firmware-rtw88-..> | 2025-12-19 11:40 | 20K | |
| wifi-firmware-rtw88-..> | 2025-12-19 12:46 | 54K | |
| wifi-firmware-rtw88-..> | 2025-12-19 14:04 | 81K | |
| wifi-firmware-rtw88-..> | 2025-12-19 22:37 | 123K | |
| wifi-firmware-rtw89-..> | 2025-12-24 00:52 | 2.1M | |
| wifi-firmware-rtw89-..> | 2025-12-19 16:56 | 220K | |
| wifi-firmware-rtw89-..> | 2025-12-19 21:41 | 230K | |
| wifi-firmware-rtw89-..> | 2025-12-19 23:07 | 456K | |
| wifi-firmware-rtw89-..> | 2025-12-19 11:59 | 295K | |
| wifi-firmware-rtw89-..> | 2025-12-19 15:49 | 540K | |
| wifi-firmware-rtw89-..> | 2025-12-19 14:34 | 773K | |
| wifibox-1.7.0.pkg | 2025-12-23 18:03 | 813 | |
| wifibox-alpine-20250..> | 2025-12-19 20:26 | 178M | |
| wifibox-alpine-ath10..> | 2025-12-20 02:42 | 20M | |
| wifibox-alpine-ath11..> | 2025-12-20 00:40 | 35M | |
| wifibox-alpine-ath12..> | 2025-12-19 10:54 | 23M | |
| wifibox-alpine-brcm-..> | 2025-12-19 12:27 | 21M | |
| wifibox-alpine-iwlwi..> | 2025-12-19 12:49 | 91M | |
| wifibox-alpine-marve..> | 2025-12-19 06:33 | 12M | |
| wifibox-alpine-media..> | 2025-12-20 03:53 | 34M | |
| wifibox-alpine-rt61-..> | 2025-12-19 14:20 | 21M | |
| wifibox-alpine-rtlwi..> | 2025-12-19 14:31 | 12M | |
| wifibox-alpine-rtw88..> | 2025-12-19 03:19 | 13M | |
| wifibox-alpine-rtw89..> | 2025-12-19 19:45 | 20M | |
| wifibox-ath10k-1.7.0..> | 2025-12-20 19:06 | 815 | |
| wifibox-ath11k-1.7.0..> | 2025-12-21 07:51 | 815 | |
| wifibox-ath12k-1.7.0..> | 2025-12-23 04:05 | 817 | |
| wifibox-brcm-1.7.0.pkg | 2025-12-20 21:24 | 818 | |
| wifibox-core-0.15.1.pkg | 2025-12-20 01:34 | 14K | |
| wifibox-iwlwifi-1.7...> | 2025-12-22 04:20 | 819 | |
| wifibox-marvell-1.7...> | 2025-12-20 19:05 | 817 | |
| wifibox-mediatek-1.7..> | 2025-12-22 13:57 | 822 | |
| wifibox-rt61-1.7.0.pkg | 2025-12-21 00:01 | 817 | |
| wifibox-rtlwifi-1.7...> | 2025-12-23 14:43 | 818 | |
| wifibox-rtw88-1.7.0.pkg | 2025-12-20 14:51 | 816 | |
| wifibox-rtw89-1.7.0.pkg | 2025-12-23 09:36 | 818 | |
| wifimgr-1.26.pkg | 2025-12-28 16:10 | 77K | |
| wiggle-1.3_1.pkg | 2025-08-20 18:38 | 60K | |
| wiimms-2.23.a_10.pkg | 2025-12-27 20:27 | 786K | |
| wiki-tui-0.9.2_1.pkg | 2025-12-30 10:51 | 2.0M | |
| wikicalc-1.0.pkg | 2025-12-23 18:22 | 165K | |
| wikiman-2.14.1.pkg | 2025-12-30 09:50 | 16K | |
| wildfly-38.0.1.pkg | 2025-12-29 13:14 | 237M | |
| wildmidi-0.4.2_1.pkg | 2025-08-14 06:39 | 93K | |
| wimlib-1.14.4.pkg | 2025-08-16 12:31 | 300K | |
| win98se-icon-theme-0..> | 2025-08-17 01:54 | 10M | |
| window-1.0_2.pkg | 2025-08-18 17:17 | 76K | |
| windowmaker-0.96.0_3..> | 2025-12-27 09:41 | 1.9M | |
| windowtolayer-0.3.0_..> | 2025-12-30 09:32 | 249K | |
| wine-10.0_3,1.pkg | 2025-12-27 08:01 | 82M | |
| wine-devel-11.0.r3_1..> | 2025-12-28 03:46 | 86M | |
| wine-gecko-2.47.4_1.pkg | 2025-12-19 23:34 | 51M | |
| wine-gecko-devel-2.4..> | 2025-12-22 10:09 | 51M | |
| wine-mono-9.4.0.pkg | 2025-08-15 14:18 | 79M | |
| wine-mono-devel-10.4..> | 2025-12-20 18:01 | 80M | |
| wine-proton-9.0.3.pkg | 2025-12-28 08:04 | 30M | |
| winetricks-20250212.pkg | 2025-12-27 12:04 | 140K | |
| wings-2.4.1.pkg | 2025-12-30 05:14 | 12M | |
| wininfo-0.7_13.pkg | 2025-12-28 14:29 | 14K | |
| wipe-2.3.1_2.pkg | 2025-08-21 02:29 | 23K | |
| wipeclean-1.1.2_4,1.pkg | 2025-12-30 18:47 | 39K | |
| wiper-disk-cleanup-t..> | 2025-12-29 14:15 | 420K | |
| wireguard-go-0.0.202..> | 2025-12-23 20:48 | 1.1M | |
| wireguard-tools-1.0...> | 2025-12-20 02:11 | 54K | |
| wireguard-tools-lite..> | 2025-12-20 10:08 | 45K | |
| wireplumber-0.5.8_2.pkg | 2025-12-27 04:43 | 370K | |
| wireproxy-1.0.9_15.pkg | 2025-12-21 05:58 | 3.0M | |
| wireshark-4.6.2.pkg | 2025-12-30 09:19 | 30M | |
| wireshark-nox11-4.6...> | 2025-12-19 12:35 | 26M | |
| wise-2.4.1_1.pkg | 2025-12-23 15:27 | 1.3M | |
| with-editor-3.4.7.pkg | 2025-12-26 20:51 | 27K | |
| with-editor-emacs_ca..> | 2025-12-27 00:54 | 27K | |
| with-editor-emacs_de..> | 2025-12-26 20:51 | 27K | |
| with-editor-emacs_de..> | 2025-12-18 22:52 | 27K | |
| with-editor-emacs_no..> | 2025-12-18 23:34 | 27K | |
| with-editor-emacs_wa..> | 2025-12-26 20:44 | 27K | |
| with-g20180520.pkg | 2025-12-20 22:57 | 4.5K | |
| wizardkit-0.1_12.pkg | 2025-12-27 16:12 | 9.4K | |
| wizer-10.0.0_4.pkg | 2025-12-30 07:26 | 3.4M | |
| wizznic-1.1_1,1.pkg | 2025-12-30 18:30 | 23M | |
| wl-clipboard-2.2.1_1..> | 2025-12-18 23:45 | 28K | |
| wl-gammarelay-rs-1.0..> | 2025-12-30 00:55 | 363K | |
| wl-kbptr-0.4.1.pkg | 2025-12-29 11:11 | 26K | |
| wl-kbptr-opencv-0.4...> | 2025-12-30 17:57 | 33K | |
| wl-mirror-0.18.3.pkg | 2025-12-29 12:10 | 39K | |
| wl-screenrec-0.1.5_1..> | 2025-12-30 15:35 | 573K | |
| wlan2eth-1.3_1.pkg | 2025-08-19 17:08 | 4.6K | |
| wlclock-1.0.1_2.pkg | 2025-12-27 21:32 | 16K | |
| wleave-0.6.2_2.pkg | 2025-12-27 21:15 | 1.8M | |
| wlmaker-0.6.2.pkg | 2025-12-30 17:20 | 232K | |
| wlogout-1.2.2.pkg | 2025-12-30 06:13 | 89K | |
| wlopm-1.0.0.pkg | 2025-12-20 07:15 | 6.6K | |
| wlr-randr-0.5.0.pkg | 2025-12-22 04:57 | 11K | |
| wlr-which-key-1.3.0_..> | 2025-12-27 22:13 | 449K | |
| wlrctl-0.2.2_1.pkg | 2025-12-30 08:07 | 15K | |
| wlrobs-1.2.pkg | 2025-12-28 02:13 | 8.4K | |
| wlroots015-0.15.1_7.pkg | 2025-12-27 09:40 | 341K | |
| wlroots017-0.17.4_6.pkg | 2025-12-27 04:37 | 435K | |
| wlroots018-0.18.3.pkg | 2025-12-26 22:40 | 451K | |
| wlroots019-0.19.2.pkg | 2025-12-26 20:00 | 487K | |
| wlsunset-0.4.0.pkg | 2025-12-20 07:51 | 13K | |
| wlvncc-s20250727_1.pkg | 2025-12-30 09:15 | 74K | |
| wm2-4.0_2.pkg | 2025-08-16 05:59 | 35K | |
| wmCalClock-1.26_3.pkg | 2025-12-22 09:33 | 49K | |
| wmScoreBoard-0.30_4.pkg | 2025-12-22 00:29 | 13K | |
| wmakerconf-2.12_13.pkg | 2025-12-28 01:10 | 285K | |
| wmanager-0.3.1.pkg | 2025-12-30 08:42 | 12K | |
| wmanager-addons-0.02..> | 2025-12-20 02:01 | 8.0K | |
| wmapp-0.0.4.3_2.pkg | 2025-12-23 15:21 | 71K | |
| wmappl-0.71_6.pkg | 2025-12-22 12:37 | 35K | |
| wmbday-0.3.1_3.pkg | 2025-12-21 07:16 | 13K | |
| wmbiff-0.4.37.pkg | 2025-12-20 17:59 | 51K | |
| wmbinclock-0.51.pkg | 2025-12-21 06:52 | 11K | |
| wmblob-1.0.4_3.pkg | 2025-12-29 16:17 | 18K | |
| wmblueclock-0.0_4.pkg | 2025-12-21 04:59 | 8.3K | |
| wmbluecpu-0.4_5.pkg | 2025-12-22 13:54 | 8.1K | |
| wmbsdbatt-0.1_5.pkg | 2025-12-20 18:00 | 10K | |
| wmbutton-0.6.1_2.pkg | 2025-12-24 03:37 | 31K | |
| wmcalendar-0.5.2_20.pkg | 2025-12-30 12:16 | 38K | |
| wmcliphist-1.0_3.pkg | 2025-12-29 01:24 | 62K | |
| wmclock-1.0.16_1.pkg | 2025-12-21 19:42 | 22K | |
| wmclockmon-0.8.1_10.pkg | 2025-12-29 15:36 | 48K | |
| wmconfig-1.5.2_1.pkg | 2025-12-23 08:47 | 63K | |
| wmcpuload-1.1.1_1.pkg | 2025-12-23 06:36 | 17K | |
| wmctrl-fork-1.09.02.pkg | 2025-12-18 20:28 | 18K | |
| wmcube-0.98_4.pkg | 2025-12-21 14:57 | 27K | |
| wmdiskmon-0.0.2_5.pkg | 2025-12-22 04:13 | 13K | |
| wmdrawer-0.10.5_14.pkg | 2025-12-27 20:27 | 40K | |
| wmenu-0.2.0.pkg | 2025-12-27 16:16 | 21K | |
| wmeyes-1.2_1.pkg | 2025-12-20 13:15 | 12K | |
| wmfishtime-1.24_9.pkg | 2025-12-27 22:44 | 13K | |
| wmflame-0.60_3.pkg | 2025-12-22 02:38 | 21K | |
| wmfocus-1.5.0_18.pkg | 2025-12-27 20:19 | 883K | |
| wmforecast-1.9.0_2.pkg | 2025-12-29 13:07 | 43K | |
| wmget-0.6.0_9.pkg | 2025-12-22 18:07 | 25K | |
| wmglobe-1.3_12.pkg | 2025-12-30 16:01 | 65K | |
| wmi-client-1.3.16_4.pkg | 2025-08-14 16:52 | 1.6M | |
| wmicons-1.0_2.pkg | 2025-08-14 01:44 | 1.3M | |
| wmii-3.6_8.pkg | 2025-12-27 20:39 | 92K | |
| wmii-devel-3.9.2_4.pkg | 2025-12-30 15:10 | 303K | |
| wmitime-0.5_1.pkg | 2025-12-30 12:36 | 11K | |
| wmix-3.1_3.pkg | 2025-12-23 04:11 | 21K | |
| wmjulia-0.40_5.pkg | 2025-12-24 00:11 | 14K | |
| wmjupiter-1.21_1.pkg | 2025-12-22 06:31 | 11K | |
| wmmaiload-2.3.0_2.pkg | 2025-12-29 06:56 | 34K | |
| wmmemfree-0.7_5.pkg | 2025-12-23 07:43 | 8.7K | |
| wmmemload-0.1.8_2.pkg | 2025-12-23 23:19 | 12K | |
| wmmoonclock-1.30_1.pkg | 2025-12-22 18:12 | 137K | |
| wmmp-0.12.6_1.pkg | 2025-12-24 03:29 | 24K | |
| wmname-0.1_3.pkg | 2025-08-17 05:28 | 3.1K | |
| wmnd-0.4.18_1.pkg | 2025-12-22 23:19 | 28K | |
| wmnet-1.2_4.pkg | 2025-12-22 18:49 | 12K | |
| wmnetload-1.3_5.pkg | 2025-12-30 18:52 | 16K | |
| wmpal-0.6.1.pkg | 2025-12-22 10:43 | 134K | |
| wmpinboard-1.0_6.pkg | 2025-12-20 17:46 | 53K | |
| wmping-0.2.1_3.pkg | 2025-12-23 18:20 | 15K | |
| wmpuzzle-0.5.3.pkg | 2025-12-20 11:21 | 18K | |
| wmqstat-0.0.4_3.pkg | 2025-12-20 18:00 | 14K | |
| wmscript-1.0.pkg | 2025-12-20 08:50 | 15K | |
| wmsmixer-0.5.1_1.pkg | 2025-12-22 04:49 | 16K | |
| wmsolar-1.1.pkg | 2025-12-22 20:19 | 48K | |
| wmspaceweather-1.04_..> | 2025-12-20 18:10 | 11K | |
| wmsun-1.06,1.pkg | 2025-12-28 00:20 | 13K | |
| wmsystemtray-1.4_1.pkg | 2025-12-21 07:51 | 16K | |
| wmtictactoe-1.1.1.pkg | 2025-12-20 19:05 | 15K | |
| wmtime-1.0b2_2.pkg | 2025-12-21 20:41 | 11K | |
| wmtimer-2.92_12.pkg | 2025-12-29 22:57 | 14K | |
| wmtop-0.84_4.pkg | 2025-12-23 12:38 | 19K | |
| wmtunlo-0.1.3_4.pkg | 2025-12-22 00:48 | 14K | |
| wmupmon-0.1.3_6.pkg | 2025-12-24 06:58 | 11K | |
| wmutils-core-1.7_1.pkg | 2025-08-21 10:34 | 25K | |
| wmutils-opt-1.0_1.pkg | 2025-08-16 15:37 | 12K | |
| wmwave-0.4_8.pkg | 2025-12-20 05:44 | 11K | |
| wmweather+-2.18_2.pkg | 2025-12-28 12:43 | 70K | |
| wmwifi-0.4_5.pkg | 2025-12-21 16:08 | 12K | |
| wmwork-0.2.5_4.pkg | 2025-12-21 04:09 | 17K | |
| wmx-8.pkg | 2025-12-30 18:22 | 74K | |
| wob-0.16.pkg | 2025-12-20 16:54 | 19K | |
| woff2-1.0.2_5.pkg | 2025-12-18 01:30 | 59K | |
| wofi-1.5.1.pkg | 2025-12-30 09:31 | 63K | |
| wol-0.7.1_5.pkg | 2025-12-22 01:23 | 26K | |
| wolf-shaper-1.0.2_3.pkg | 2025-12-28 14:40 | 710K | |
| wolfpack-4.4.1_1.pkg | 2025-08-22 14:50 | 693K | |
| wolfssh-1.4.21.pkg | 2025-12-20 12:22 | 216K | |
| wolfssl-5.8.4.pkg | 2025-12-19 14:09 | 1.5M | |
| wop-0.4.3_15.pkg | 2025-12-30 10:00 | 4.3M | |
| wordplay-7.22_1.pkg | 2025-08-22 02:20 | 88K | |
| wordpress-6.9,1.pkg | 2025-12-28 06:24 | 21M | |
| wordsearch-2.1.pkg | 2025-12-20 23:05 | 16K | |
| wordwarvi-1.0.4_1.pkg | 2025-12-30 16:21 | 8.3M | |
| work-tuimer-0.3.4_1.pkg | 2025-12-28 21:10 | 948K | |
| worker-5.1.0_1.pkg | 2025-12-30 14:54 | 1.5M | |
| workrave-1.10.53.pkg | 2025-12-27 23:41 | 8.9M | |
| workrave-xfce-1.10.5..> | 2025-12-28 10:09 | 8.9M | |
| worldofpadman-1.2.20..> | 2025-12-20 05:35 | 583M | |
| worldtools-1.3.1_2.pkg | 2025-12-22 23:08 | 9.3K | |
| wp-cli-php81-2.12.0.pkg | 2025-12-28 02:12 | 1.1M | |
| wp-cli-php82-2.12.0.pkg | 2025-12-28 06:01 | 1.1M | |
| wp-cli-php83-2.12.0.pkg | 2025-12-28 06:32 | 1.1M | |
| wp-cli-php84-2.12.0.pkg | 2025-12-28 20:33 | 1.1M | |
| wp-cli-php85-2.12.0.pkg | 2025-12-29 18:27 | 1.1M | |
| wpa_supplicant-2.11_..> | 2025-12-20 15:36 | 680K | |
| wpa_supplicant-devel..> | 2025-12-20 10:32 | 690K | |
| wpa_supplicant29-2.9..> | 2025-12-21 01:27 | 569K | |
| wpa_supplicant210-2...> | 2025-12-22 18:09 | 621K | |
| wpa_supplicant_gui-2..> | 2025-12-30 02:30 | 261K | |
| wpebackend-fdo-1.12...> | 2025-12-28 20:10 | 34K | |
| wping-0.1a_5.pkg | 2025-12-29 03:11 | 3.2K | |
| wput-0.6.2_8.pkg | 2025-12-21 05:26 | 111K | |
| wqy-fonts-20100803_1..> | 2025-12-27 16:22 | 14M | |
| wrapland-0.602.0_1.pkg | 2025-12-26 22:16 | 744K | |
| wrapsrv-1.0.0_2.pkg | 2025-08-21 22:43 | 5.6K | |
| write-good-1.0.8_4.pkg | 2025-12-29 15:24 | 6.2M | |
| writeas-cli-2.0.0.w_..> | 2025-12-22 01:36 | 3.7M | |
| writefreely-0.16.0_5..> | 2025-12-22 13:57 | 9.0M | |
| wrk-luajit-4.2.0_2.pkg | 2025-12-23 02:05 | 30K | |
| wrk-luajit-openresty..> | 2025-12-23 23:54 | 30K | |
| wscreensaver-s202312..> | 2025-12-29 07:34 | 7.7M | |
| wsdlpull-1.24_4.pkg | 2025-12-21 07:25 | 280K | |
| wshowkeys-1.0.pkg | 2025-12-29 14:30 | 12K | |
| wsjtx-2.5.4_15.pkg | 2025-12-28 05:57 | 13M | |
| wsjtz-2.7.0.r7.1.48.pkg | 2025-12-28 23:01 | 22M | |
| wslay-1.1.1.22_1.pkg | 2025-12-19 15:37 | 19K | |
| wsmake-0.7.901_2.pkg | 2025-08-20 04:30 | 464K | |
| wstunnel-10.5.1_1.pkg | 2025-12-29 19:31 | 3.4M | |
| wt-4.12.1.pkg | 2025-12-27 10:05 | 6.6M | |
| wtf-20230906_1.pkg | 2025-08-16 05:30 | 30K | |
| wthrr-1.2.1_11.pkg | 2025-12-28 11:04 | 1.4M | |
| wtype-0.4_1.pkg | 2025-12-26 21:29 | 7.8K | |
| wush-0.4.1_5.pkg | 2025-08-17 02:21 | 11M | |
| wutil-0.4.2.pkg | 2025-12-23 03:05 | 33K | |
| wuzz-0.5.0_34.pkg | 2025-12-21 01:45 | 2.9M | |
| wuzzah-0.53_1.pkg | 2025-08-20 02:27 | 12K | |
| wv-1.2.9_10.pkg | 2025-12-26 20:34 | 298K | |
| wv2-0.4.2_10.pkg | 2025-12-28 01:17 | 252K | |
| wvkbd-0.18.pkg | 2025-12-30 06:46 | 39K | |
| wwl-1.3_1.pkg | 2025-08-21 08:22 | 5.0K | |
| wwplot-1.0.1.pkg | 2025-12-30 00:16 | 13K | |
| wwwoffle-2.9j_1.pkg | 2025-12-19 14:44 | 670K | |
| wx30-gtk2-3.0.5.1_7.pkg | 2025-12-27 11:53 | 5.7M | |
| wx30-gtk3-3.0.5.1_7.pkg | 2025-12-26 09:10 | 5.7M | |
| wx32-gtk2-3.2.8.1_1.pkg | 2025-12-30 01:03 | 6.8M | |
| wx32-gtk3-3.2.8.1_1.pkg | 2025-12-26 14:05 | 6.8M | |
| wxformbuilder-3.5.0...> | 2025-12-30 06:30 | 1.3M | |
| wxguitar-1.01_13.pkg | 2025-12-30 07:23 | 347K | |
| wxhexeditor-0.24_7.pkg | 2025-12-30 10:26 | 416K | |
| wxlauncher-0.10.1.pkg | 2025-12-27 17:06 | 797K | |
| wxmacmolplt-7.7.43_5..> | 2025-12-30 12:16 | 1.6M | |
| wxmaxima-25.04.0,1.pkg | 2025-12-29 03:24 | 3.8M | |
| wxsvg-1.5.25_1.pkg | 2025-12-29 05:12 | 734K | |
| wy60-2.0.9_1.pkg | 2025-08-17 21:00 | 42K | |
| wzdftpd-0.8.3_12.pkg | 2025-12-24 01:56 | 298K | |
| x-face-e21-20070306_..> | 2025-12-27 18:25 | 35K | |
| x-face-e21-emacs_can..> | 2025-12-27 10:22 | 35K | |
| x-face-e21-emacs_dev..> | 2025-12-27 12:37 | 35K | |
| x-face-e21-emacs_dev..> | 2025-12-19 17:17 | 35K | |
| x-face-e21-emacs_nox..> | 2025-12-19 17:12 | 35K | |
| x-face-e21-emacs_way..> | 2025-12-27 17:14 | 35K | |
| x-on-resize-0.2_1.pkg | 2025-08-22 18:42 | 9.2K | |
| x026-1.2_1.pkg | 2025-12-23 14:31 | 365K | |
| x2goclient-4.1.2.2_4..> | 2025-12-29 05:45 | 1.2M | |
| x2goclient-cli-3.0.1..> | 2025-12-27 03:04 | 4.8K | |
| x2vnc-1.7.2_1,1.pkg | 2025-08-17 08:48 | 27K | |
| x2x-1.30.20180709_1.pkg | 2025-08-22 13:56 | 27K | |
| x11perf-1.6.1_1.pkg | 2025-12-26 21:41 | 59K | |
| x11vnc-0.9.17.pkg | 2025-12-28 00:51 | 692K | |
| x16-emulator-r48.pkg | 2025-12-28 06:13 | 99K | |
| x16-rom-r48.pkg | 2025-08-14 20:57 | 87K | |
| x42-plugins-lv2-2025..> | 2025-12-29 03:58 | 1.4M | |
| x48-0.6.4_1.pkg | 2025-12-27 20:56 | 455K | |
| x49gp-20100425_9.pkg | 2025-12-30 08:02 | 2.7M | |
| x264-0.164.3095_3.pkg | 2025-12-27 17:51 | 63K | |
| x265-4.1.pkg | 2025-12-16 02:09 | 2.1M | |
| x3270-4.3_1.pkg | 2025-12-29 01:14 | 1.8M | |
| xNetHack-9.0.pkg | 2025-12-23 03:28 | 2.1M | |
| xNetHack-nox11-9.0.pkg | 2025-12-23 11:00 | 2.1M | |
| xNetHack-qt-9.0.pkg | 2025-12-29 02:23 | 2.3M | |
| xa65-2.4.1.pkg | 2025-12-19 17:53 | 96K | |
| xalan-j-2.7.2.pkg | 2025-12-27 18:16 | 8.8M | |
| xalarm-3.06_1.pkg | 2025-12-23 12:10 | 34K | |
| xan-0.54.1_1.pkg | 2025-12-28 09:07 | 4.0M | |
| xanalyser-1.32_4.pkg | 2025-12-28 18:19 | 27K | |
| xanim-2.92.0_12.pkg | 2025-12-27 18:30 | 319K | |
| xannotate-g20220604.pkg | 2025-08-20 13:45 | 5.1K | |
| xantfarm-1.16_3.pkg | 2025-08-21 22:28 | 14K | |
| xaos-4.2.1_1.pkg | 2025-12-30 15:40 | 463K | |
| xapian-bindings-1.4...> | 2025-12-28 00:54 | 736 | |
| xapian-core-1.4.30,1..> | 2025-12-18 01:11 | 2.0M | |
| xapian-omega-1.4.30.pkg | 2025-12-20 00:24 | 362K | |
| xapp-3.2.0.pkg | 2025-12-26 19:41 | 238K | |
| xapsd-g20241228_9.pkg | 2025-12-19 16:26 | 3.0M | |
| xarcan-0.6.3.pkg | 2025-12-29 22:38 | 854K | |
| xarchive-0.2.8.6_11.pkg | 2025-12-29 21:26 | 37K | |
| xarchiver-0.5.4.26.pkg | 2025-12-29 15:56 | 515K | |
| xascii-1.0_1.pkg | 2025-12-21 13:35 | 7.8K | |
| xasteroids-5.0_3.pkg | 2025-08-21 12:02 | 13K | |
| xastir-2.2.0_9.pkg | 2025-12-28 09:04 | 1.2M | |
| xauth-1.1.4.pkg | 2025-08-14 02:28 | 22K | |
| xautolock-2.2_2.pkg | 2025-12-30 00:36 | 17K | |
| xautomation-1.09_2.pkg | 2025-12-28 03:27 | 37K | |
| xawtv-3.107_2.pkg | 2025-12-29 01:03 | 347K | |
| xbacklight-1.2.3_1.pkg | 2025-08-14 07:03 | 6.5K | |
| xballoon-1.0_4.pkg | 2025-12-24 07:40 | 7.4K | |
| xbanish-1.8_1.pkg | 2025-08-20 02:29 | 7.7K | |
| xbat-1.11_11.pkg | 2025-12-29 16:20 | 111K | |
| xbatt-1.2.1_4.pkg | 2025-12-22 11:20 | 7.4K | |
| xbattbar-1.4.2_9.pkg | 2025-08-16 06:03 | 7.5K | |
| xbiff-1.0.5.pkg | 2025-12-21 02:51 | 10K | |
| xbill-2.1_12.pkg | 2025-12-22 06:59 | 40K | |
| xbindkeys-1.8.7_1.pkg | 2025-08-22 17:03 | 16K | |
| xbitmaps-1.1.3.pkg | 2025-08-13 09:56 | 21K | |
| xbl-1.1.6_1.pkg | 2025-08-18 08:00 | 106K | |
| xblackjack-2.2_5.pkg | 2025-12-30 07:29 | 52K | |
| xblas-1.0.248.pkg | 2025-08-17 16:47 | 1.3M | |
| xblast-2.10.4_20.pkg | 2025-12-30 12:26 | 8.4M | |
| xblood-2.0_3.pkg | 2025-08-19 13:46 | 6.0K | |
| xbmbrowser-5.1_4.pkg | 2025-12-20 07:14 | 33K | |
| xboard-4.9.1_4.pkg | 2025-12-30 02:58 | 1.3M | |
| xboard-devel-4.8.0.2..> | 2025-12-28 08:59 | 1.2M | |
| xboing-2.4_7.pkg | 2025-12-20 15:55 | 484K | |
| xbomb-2.2b_1.pkg | 2025-12-21 19:43 | 19K | |
| xbraitenberg-0.9_2.pkg | 2025-08-21 08:43 | 70K | |
| xbrightness-0.3_1.pkg | 2025-12-19 02:47 | 5.2K | |
| xbt-g20221002_1.pkg | 2025-12-23 21:47 | 97K | |
| xbubble-0.5.8_8.pkg | 2025-12-29 00:55 | 5.0M | |
| xbuffy-3.3.3_5.pkg | 2025-12-20 19:15 | 19K | |
| xbyak-7.30.pkg | 2025-12-21 02:31 | 60K | |
| xc3sprog-g20221005,1..> | 2025-12-21 16:28 | 121K | |
| xca-2.9.0.pkg | 2025-12-29 17:23 | 1.2M | |
| xca-qt6-2.9.0.pkg | 2025-12-30 00:03 | 1.2M | |
| xcaddy-0.4.5_6.pkg | 2025-12-19 11:10 | 1.5M | |
| xcalc-1.1.2_1.pkg | 2025-12-26 22:56 | 23K | |
| xcalendar-4.0.2008_3..> | 2025-12-23 10:30 | 36K | |
| xcalib-0.10.pkg | 2025-08-14 07:40 | 25K | |
| xcape-1.2.9_1.pkg | 2025-08-18 12:51 | 8.1K | |
| xcb-2.4_4.pkg | 2025-12-22 14:33 | 16K | |
| xcb-imdkit-1.0.9.pkg | 2025-12-26 13:23 | 327K | |
| xcb-proto-1.17.0.pkg | 2025-12-16 01:39 | 128K | |
| xcb-util-0.4.1,1.pkg | 2025-08-10 21:33 | 14K | |
| xcb-util-cursor-0.1...> | 2025-08-12 22:24 | 14K | |
| xcb-util-errors-1.0...> | 2025-08-13 14:26 | 15K | |
| xcb-util-image-0.4.1..> | 2025-08-10 21:49 | 19K | |
| xcb-util-keysyms-0.4..> | 2025-08-10 22:17 | 8.1K | |
| xcb-util-renderutil-..> | 2025-08-10 21:46 | 9.1K | |
| xcb-util-wm-0.4.2.pkg | 2025-08-10 22:16 | 44K | |
| xcb-util-xrm-1.3.pkg | 2025-08-14 00:14 | 19K | |
| xcbautolock-0.2.2_1.pkg | 2025-08-17 21:10 | 5.6K | |
| xcd-1.7_4.pkg | 2025-12-28 21:20 | 11K | |
| xcdplayer-2.2_6.pkg | 2025-12-23 04:11 | 25K | |
| xcdroast-0.98.a.16_1..> | 2025-12-27 23:49 | 395K | |
| xcftools-1.0.8.20130..> | 2025-12-28 22:14 | 45K | |
| xcfun-2.1.1.1.pkg | 2025-08-14 09:38 | 2.5M | |
| xchadance-1.0_2.pkg | 2025-08-19 04:33 | 10K | |
| xcheckers-2.2.3_4.pkg | 2025-12-22 15:53 | 33K | |
| xchm-1.37_2.pkg | 2025-12-30 09:35 | 190K | |
| xchomp-pl1_2.pkg | 2025-08-16 03:27 | 18K | |
| xcircuit-3.10.30_2,1..> | 2025-12-29 05:43 | 502K | |
| xcite-1.60_29.pkg | 2025-12-29 17:57 | 20K | |
| xcite-emacs_canna-1...> | 2025-12-30 00:16 | 20K | |
| xcite-emacs_devel-1...> | 2025-12-28 22:15 | 20K | |
| xcite-emacs_devel_no..> | 2025-12-22 04:57 | 20K | |
| xcite-emacs_nox-1.60..> | 2025-12-22 06:22 | 20K | |
| xcite-emacs_wayland-..> | 2025-12-29 19:53 | 20K | |
| xclicker-1.5.1.pkg | 2025-12-29 00:42 | 18K | |
| xclickroot-1.4.0.pkg | 2025-08-17 03:29 | 3.8K | |
| xclip-0.13.99.pkg | 2025-08-13 06:52 | 20K | |
| xclipboard-1.1.5,1.pkg | 2025-12-22 01:22 | 15K | |
| xclock-1.0.9_1.pkg | 2025-12-26 20:39 | 26K | |
| xcm-0.5.4_2.pkg | 2025-12-30 06:12 | 22K | |
| xcmd-1.8_3.pkg | 2025-08-20 08:54 | 14K | |
| xcmsdb-1.0.5_1.pkg | 2025-08-13 23:19 | 17K | |
| xcoloredit-1.2_3.pkg | 2025-12-21 18:39 | 14K | |
| xcolors-1.3_6.pkg | 2025-12-22 05:41 | 8.1K | |
| xcompmgr-1.1.8_1.pkg | 2025-08-20 08:40 | 17K | |
| xconq-7.5.0.0.p.0.20..> | 2025-12-28 07:14 | 4.5M | |
| xconsole-1.0.8_1.pkg | 2025-12-18 21:12 | 9.4K | |
| xcoral-3.47_5.pkg | 2025-08-17 16:28 | 2.0M | |
| xcowsay-1.6_4.pkg | 2025-12-29 11:01 | 63K | |
| xcp-0.24.2_4.pkg | 2025-12-29 16:19 | 834K | |
| xcpc-20070122_15.pkg | 2025-12-28 16:25 | 99K | |
| xcpustate-2.9_4.pkg | 2025-12-20 12:04 | 17K | |
| xcruiser-0.30_4.pkg | 2025-12-21 17:20 | 26K | |
| xcrysden-1.6.2_4.pkg | 2025-12-27 10:39 | 2.1M | |
| xcscope.el-1.5_10.pkg | 2025-08-31 23:47 | 25K | |
| xcubes-5.5.2_3.pkg | 2025-08-16 15:19 | 18K | |
| xcur2png-0.7.1.pkg | 2025-12-26 20:42 | 11K | |
| xcursor-themes-1.0.6..> | 2025-08-14 09:51 | 363K | |
| xcursorgen-1.0.9.pkg | 2025-12-26 21:15 | 7.4K | |
| xcut-0.2_4.pkg | 2025-08-20 21:53 | 4.4K | |
| xcwcp-3.5.1_3.pkg | 2025-12-28 01:50 | 59K | |
| xd-0.0.4_46.pkg | 2025-12-29 18:45 | 362K | |
| xd3d-8.3.1_21.pkg | 2025-12-29 04:39 | 1.8M | |
| xdaliclock-2.49.pkg | 2025-12-30 07:55 | 89K | |
| xdaliclock-classic-2..> | 2025-08-16 01:45 | 44K | |
| xdeblock-1.0_3.pkg | 2025-12-23 18:09 | 100K | |
| xdelta-1.1.4_6.pkg | 2025-12-18 23:28 | 108K | |
| xdelta3-3.1.0_4,1.pkg | 2025-08-17 01:39 | 75K | |
| xdemineur-2.1.1_2.pkg | 2025-12-23 06:45 | 16K | |
| xdemorse-3.6.7_2.pkg | 2025-12-29 03:42 | 35K | |
| xdesktopwaves-1.4_1.pkg | 2025-08-17 01:23 | 28K | |
| xdeview-0.5.20_4.pkg | 2025-12-30 08:18 | 46K | |
| xdg-dbus-proxy-0.1.6..> | 2025-12-23 05:00 | 22K | |
| xdg-desktop-portal-1..> | 2025-12-26 15:28 | 416K | |
| xdg-desktop-portal-g..> | 2025-12-27 11:59 | 219K | |
| xdg-desktop-portal-g..> | 2025-12-26 19:27 | 127K | |
| xdg-desktop-portal-h..> | 2025-12-27 22:38 | 224K | |
| xdg-desktop-portal-l..> | 2025-12-29 20:10 | 3.8M | |
| xdg-desktop-portal-l..> | 2025-12-27 16:19 | 53K | |
| xdg-desktop-portal-w..> | 2025-12-30 07:10 | 39K | |
| xdg-terminal-exec-0...> | 2025-12-29 15:25 | 12K | |
| xdg-user-dirs-0.19_1..> | 2025-12-18 18:56 | 40K | |
| xdg-user-dirs-gtk-0...> | 2025-12-27 17:16 | 46K | |
| xdg-utils-1.2.1.pkg | 2025-08-10 21:41 | 58K | |
| xdgagrab-0.3_2.pkg | 2025-08-21 12:44 | 4.5K | |
| xdgmenumaker-2.4.pkg | 2025-12-29 19:46 | 35K | |
| xdgpaths-0.2.5_6.pkg | 2025-08-15 20:49 | 33K | |
| xdialog-2.3.1_11.pkg | 2025-12-28 21:08 | 306K | |
| xdigger-1.0.10_5.pkg | 2025-08-19 01:31 | 35K | |
| xdino-5.5.2_3.pkg | 2025-08-16 17:27 | 27K | |
| xdiskusage-1.60.pkg | 2025-12-29 09:52 | 21K | |
| xditview-1.0.7.pkg | 2025-12-28 12:34 | 25K | |
| xdm-1.1.14_5.pkg | 2025-12-30 08:29 | 102K | |
| xdms-1.3.2.pkg | 2025-08-17 05:46 | 22K | |
| xdo-0.5.7.pkg | 2025-08-18 07:12 | 11K | |
| xdotool-3.20211022.1..> | 2025-12-26 19:22 | 64K | |
| xdpyinfo-1.3.4.pkg | 2025-08-13 18:05 | 14K | |
| xdrawchem-1.11.1.2.pkg | 2025-12-29 23:48 | 729K | |
| xdriinfo-1.0.7.pkg | 2025-08-14 05:05 | 4.4K | |
| xdu-3.0_6.pkg | 2025-12-23 12:56 | 12K | |
| xdx-2.91_3.pkg | 2025-12-29 19:55 | 101K | |
| xe-1.0.pkg | 2025-08-15 16:18 | 12K | |
| xe-guest-utilities-6..> | 2025-12-23 14:42 | 4.2K | |
| xearth-1.2_3.pkg | 2025-08-22 10:50 | 121K | |
| xed-3.8.5.pkg | 2025-12-29 18:11 | 2.2M | |
| xedit-1.2.4.pkg | 2025-12-22 15:42 | 313K | |
| xelfviewer-0.05.pkg | 2025-12-27 21:59 | 3.4M | |
| xemeraldia-0.4.3_2.pkg | 2025-12-29 20:54 | 23K | |
| xen-guest-tools-4.20..> | 2025-08-15 21:44 | 22K | |
| xen-kernel-4.19.1.20..> | 2025-08-22 16:34 | 13M | |
| xen-tools-4.19.1.202..> | 2025-12-22 15:35 | 40M | |
| xenv-4.0_1.pkg | 2025-08-19 17:03 | 58K | |
| xephem-4.2.0.pkg | 2025-12-29 20:04 | 11M | |
| xephyr-21.1.20,1.pkg | 2025-12-29 06:20 | 832K | |
| xerces-c3-3.3.0.pkg | 2025-08-13 06:20 | 2.2M | |
| xerces-j-2.12.2.pkg | 2025-12-26 21:20 | 3.2M | |
| xeus-5.0.0_1.pkg | 2025-08-15 06:23 | 298K | |
| xeus-zmq-2.0.0_3.pkg | 2025-08-16 03:22 | 334K | |
| xev-1.2.6.pkg | 2025-08-14 07:48 | 12K | |
| xeyes+-2.02_2.pkg | 2025-12-23 04:59 | 20K | |
| xeyes-1.3.0_1.pkg | 2025-08-21 18:57 | 11K | |
| xf86-input-egalax-0...> | 2025-12-30 18:54 | 5.9K | |
| xf86-input-elographi..> | 2025-12-29 18:52 | 8.6K | |
| xf86-input-evdev-2.1..> | 2025-12-27 22:11 | 30K | |
| xf86-input-joystick-..> | 2025-12-28 23:02 | 23K | |
| xf86-input-keyboard-..> | 2025-12-26 20:42 | 8.7K | |
| xf86-input-libinput-..> | 2025-12-26 19:57 | 42K | |
| xf86-input-mouse-1.9..> | 2025-12-26 21:19 | 31K | |
| xf86-input-synaptics..> | 2025-12-29 20:52 | 53K | |
| xf86-input-vmmouse-1..> | 2025-12-27 22:19 | 10K | |
| xf86-input-void-1.4...> | 2025-12-28 14:38 | 3.8K | |
| xf86-input-wacom-0.3..> | 2025-12-27 21:34 | 84K | |
| xf86-video-amdgpu-22..> | 2025-12-29 16:30 | 61K | |
| xf86-video-ast-1.1.5..> | 2025-12-30 01:03 | 41K | |
| xf86-video-ati-19.1...> | 2025-12-29 06:35 | 141K | |
| xf86-video-dummy-0.3..> | 2025-12-30 16:39 | 6.7K | |
| xf86-video-intel-2.9..> | 2025-12-30 07:21 | 655K | |
| xf86-video-mga-2.0.0..> | 2025-12-28 19:42 | 62K | |
| xf86-video-nv-2.1.22..> | 2025-12-28 12:01 | 68K | |
| xf86-video-qxl-0.1.6..> | 2025-12-30 01:42 | 109K | |
| xf86-video-scfb-0.0...> | 2025-12-27 02:07 | 10K | |
| xf86-video-vesa-2.5...> | 2025-12-26 22:59 | 12K | |
| xf86-video-vmware-13..> | 2025-12-28 08:05 | 67K | |
| xf86dga-1.0.3_2.pkg | 2025-12-18 20:52 | 5.0K | |
| xfaces-3.3_6.pkg | 2025-12-21 09:16 | 56K | |
| xfburn-0.8.0.pkg | 2025-12-27 03:11 | 438K | |
| xfce-4.20.pkg | 2025-12-28 21:12 | 852 | |
| xfce-icons-elementar..> | 2025-12-27 02:48 | 16M | |
| xfce4-appfinder-4.20..> | 2025-12-27 19:38 | 167K | |
| xfce4-appmenu-plugin..> | 2025-12-28 19:01 | 66K | |
| xfce4-battery-plugin..> | 2025-12-27 11:39 | 96K | |
| xfce4-bsdcpufreq-plu..> | 2025-12-27 10:32 | 7.6K | |
| xfce4-calculator-plu..> | 2025-12-27 17:12 | 76K | |
| xfce4-clipman-plugin..> | 2025-12-27 14:51 | 178K | |
| xfce4-conf-4.20.0.pkg | 2025-12-18 08:05 | 167K | |
| xfce4-cpugraph-plugi..> | 2025-12-27 19:37 | 107K | |
| xfce4-dashboard-1.1...> | 2025-12-27 02:26 | 2.5M | |
| xfce4-datetime-plugi..> | 2025-12-27 17:28 | 32K | |
| xfce4-desktop-4.20.1..> | 2025-12-27 18:44 | 1.3M | |
| xfce4-dev-tools-4.20..> | 2025-12-18 03:51 | 25K | |
| xfce4-dict-plugin-0...> | 2025-12-27 08:45 | 174K | |
| xfce4-diskperf-plugi..> | 2025-12-27 17:54 | 53K | |
| xfce4-docklike-plugi..> | 2025-12-30 05:53 | 108K | |
| xfce4-eyes-plugin-4...> | 2025-12-30 04:09 | 45K | |
| xfce4-fsguard-plugin..> | 2025-12-27 09:37 | 64K | |
| xfce4-generic-slider..> | 2025-12-30 12:25 | 37K | |
| xfce4-genmon-plugin-..> | 2025-12-27 04:24 | 62K | |
| xfce4-goodies-4.20.pkg | 2025-12-28 03:31 | 1.8K | |
| xfce4-mailwatch-plug..> | 2025-12-27 17:13 | 164K | |
| xfce4-mixer-4.20.0.pkg | 2025-12-30 08:28 | 110K | |
| xfce4-mixer-full-4.2..> | 2025-12-30 00:35 | 123K | |
| xfce4-mount-plugin-1..> | 2025-12-27 16:09 | 88K | |
| xfce4-mpc-plugin-0.6..> | 2025-12-27 21:15 | 41K | |
| xfce4-netload-plugin..> | 2025-12-27 13:26 | 53K | |
| xfce4-notes-plugin-1..> | 2025-12-27 14:43 | 152K | |
| xfce4-notifyd-0.9.7.pkg | 2025-12-27 15:44 | 226K | |
| xfce4-panel-4.20.5.pkg | 2025-12-26 17:48 | 915K | |
| xfce4-panel-profiles..> | 2025-12-28 06:50 | 101K | |
| xfce4-places-plugin-..> | 2025-12-29 19:13 | 67K | |
| xfce4-power-manager-..> | 2025-12-27 08:27 | 533K | |
| xfce4-pulseaudio-plu..> | 2025-12-30 16:20 | 105K | |
| xfce4-screensaver-4...> | 2025-12-27 04:44 | 250K | |
| xfce4-screenshooter-..> | 2025-12-27 17:37 | 156K | |
| xfce4-session-4.20.3..> | 2025-12-27 16:47 | 369K | |
| xfce4-settings-4.20...> | 2025-12-27 06:09 | 973K | |
| xfce4-smartbookmark-..> | 2025-12-27 17:53 | 22K | |
| xfce4-stopwatch-plug..> | 2025-12-27 19:43 | 22K | |
| xfce4-systemload-plu..> | 2025-12-27 19:42 | 52K | |
| xfce4-taskmanager-1...> | 2025-12-27 11:12 | 118K | |
| xfce4-terminal-1.1.5..> | 2025-12-27 16:54 | 421K | |
| xfce4-time-out-plugi..> | 2025-12-27 16:21 | 58K | |
| xfce4-timer-plugin-1..> | 2025-12-27 06:27 | 58K | |
| xfce4-tumbler-4.20.1..> | 2025-12-26 18:06 | 146K | |
| xfce4-verve-plugin-2..> | 2025-12-27 11:17 | 44K | |
| xfce4-volumed-pulse-..> | 2025-12-29 10:04 | 19K | |
| xfce4-wavelan-plugin..> | 2025-12-27 07:41 | 38K | |
| xfce4-weather-plugin..> | 2025-12-27 10:11 | 2.3M | |
| xfce4-whiskermenu-pl..> | 2025-12-27 11:20 | 231K | |
| xfce4-windowck-plugi..> | 2025-12-30 08:12 | 80K | |
| xfce4-wm-4.20.0.pkg | 2025-12-27 09:45 | 475K | |
| xfce4-wm-themes-4.10..> | 2025-08-15 20:28 | 517K | |
| xfce4-xkb-plugin-0.9..> | 2025-12-27 02:16 | 297K | |
| xfd-1.1.4_1.pkg | 2025-12-29 18:09 | 15K | |
| xfe-2.1.1_1.pkg | 2025-12-27 21:31 | 3.3M | |
| xfig-3.2.8b_3.pkg | 2025-12-27 12:08 | 5.1M | |
| xfile-1.0.pkg | 2025-12-29 09:46 | 122K | |
| xfireworks-1.4_3.pkg | 2025-08-20 00:18 | 24K | |
| xfishtank-2.5_2.pkg | 2025-12-30 11:28 | 64K | |
| xfmpc-0.4.0.pkg | 2025-12-29 01:20 | 97K | |
| xfontsel-1.1.1.pkg | 2025-12-19 15:09 | 23K | |
| xforms-1.2.4_8,1.pkg | 2025-12-27 17:10 | 915K | |
| xforward-1.0_2.pkg | 2025-12-30 03:53 | 11K | |
| xfractint-20.04p16_1..> | 2025-12-28 20:38 | 649K | |
| xfrisk-1.2_6.pkg | 2025-12-23 03:15 | 126K | |
| xfs-1.2.0_2,1.pkg | 2025-12-29 03:35 | 56K | |
| xfsinfo-1.0.6_1.pkg | 2025-08-18 23:32 | 5.2K | |
| xfsm-1.99_2.pkg | 2025-08-17 08:14 | 25K | |
| xfsprogs-3.2.4_4.pkg | 2025-12-21 15:57 | 775K | |
| xfstt-1.11_1.pkg | 2025-08-20 00:12 | 55K | |
| xgalaga++-0.9_1.pkg | 2025-12-22 07:27 | 49K | |
| xgalaga-2.1.1.0_1.pkg | 2025-12-21 07:39 | 210K | |
| xgalaga-sdl-2.1.1.0_..> | 2025-12-28 11:21 | 337K | |
| xgamma-1.0.7_1.pkg | 2025-08-13 22:47 | 6.0K | |
| xgap-4.32.pkg | 2025-12-21 12:14 | 46K | |
| xgboost-2.1.4.pkg | 2025-08-18 07:10 | 1.3M | |
| xgc-1.0.6.pkg | 2025-12-19 00:02 | 31K | |
| xglk-411_7.pkg | 2025-12-30 00:30 | 89K | |
| xglurbules-3.3_3.pkg | 2025-12-22 12:44 | 20K | |
| xgraph-11.3.2.200009..> | 2025-08-16 14:08 | 57K | |
| xgrasp-1.7d_3.pkg | 2025-08-22 22:01 | 37K | |
| xh-0.25.0_2.pkg | 2025-12-30 16:01 | 1.9M | |
| xh-hunspell-20110323..> | 2025-08-19 20:42 | 160K | |
| xh-libreoffice-25.8...> | 2025-12-27 11:40 | 226K | |
| xhash-3.6.3_9.pkg | 2025-12-21 04:22 | 1.3M | |
| xhexagons-5.5.2_3.pkg | 2025-08-19 22:19 | 19K | |
| xhime-1.51_3.pkg | 2025-08-17 11:48 | 31K | |
| xhomer-9.16.06_2,1.pkg | 2025-08-17 00:10 | 90K | |
| xhost-1.0.8_1.pkg | 2025-08-13 14:44 | 9.5K | |
| xhtml-1.0.20020801_5..> | 2025-08-22 10:05 | 18K | |
| xhtml-11-1.1.2010112..> | 2025-08-18 12:24 | 33K | |
| xhtml-basic-1.0.2000..> | 2025-08-15 05:46 | 19K | |
| xhtml-modularization..> | 2025-08-13 22:39 | 418K | |
| xhtml1-xsd-200208.pkg | 2025-08-16 18:23 | 10K | |
| xiccd-0.4.1.pkg | 2025-12-29 18:05 | 15K | |
| xidle-26052015_2.pkg | 2025-08-19 17:03 | 7.7K | |
| ximaging-1.9.pkg | 2025-12-28 14:12 | 95K | |
| xin-1.0.0_2.pkg | 2025-08-15 23:11 | 6.7K | |
| xine-0.99.14_5.pkg | 2025-12-29 07:08 | 1.6M | |
| xinetd-2.3.15_3.pkg | 2025-12-23 19:59 | 87K | |
| xinfocom-1.8m_1.pkg | 2025-08-22 04:00 | 29K | |
| xinit-1.4.4,1.pkg | 2025-08-14 00:54 | 16K | |
| xinput-1.6.4.pkg | 2025-08-14 04:46 | 24K | |
| xinvaders-2.1.1_12.pkg | 2025-12-21 12:56 | 25K | |
| xinvaders3d-1.3.6_3.pkg | 2025-12-30 01:15 | 20K | |
| xiphos-4.3.2.pkg | 2025-12-30 17:41 | 6.0M | |
| xisola-1.0_2.pkg | 2025-12-20 14:54 | 7.2K | |
| xisp-2.7p4_10.pkg | 2025-12-27 22:42 | 150K | |
| xjig-2.4_6.pkg | 2025-08-18 16:51 | 46K | |
| xjobs-20200726_1.pkg | 2025-08-21 08:16 | 34K | |
| xjump-2.7.5_3.pkg | 2025-12-22 17:23 | 12K | |
| xjumpx-1.4_4.pkg | 2025-12-24 03:32 | 26K | |
| xkb-switch-1.8.5_1.pkg | 2025-08-17 07:40 | 21K | |
| xkbcomp-1.5.0.pkg | 2025-12-24 20:08 | 83K | |
| xkbctrl-1.0_2.pkg | 2025-08-19 01:38 | 9.1K | |
| xkbevd-1.1.4_1.pkg | 2025-08-14 02:42 | 16K | |
| xkbind-2010.05.20.pkg | 2025-08-17 16:40 | 16K | |
| xkblayout-state-g202..> | 2025-08-20 14:32 | 18K | |
| xkbprint-1.0.5_1.pkg | 2025-08-22 09:34 | 39K | |
| xkbset-0.8_1.pkg | 2025-08-21 03:20 | 15K | |
| xkbutils-1.0.6.pkg | 2025-12-18 23:42 | 16K | |
| xkeyboard-config-2.4..> | 2025-12-16 01:49 | 872K | |
| xkeycaps-2.47_1.pkg | 2025-12-21 16:25 | 109K | |
| xkeywrap-1.1_4.pkg | 2025-08-16 01:41 | 36K | |
| xkill-1.0.6.pkg | 2025-08-14 08:17 | 7.2K | |
| xkoules-1.4_5.pkg | 2025-08-17 08:22 | 201K | |
| xlaby-2.0.1_4.pkg | 2025-08-17 14:59 | 18K | |
| xldlas-0.85_10.pkg | 2025-12-30 02:21 | 123K | |
| xlennart-1.1.1_2.pkg | 2025-12-30 18:19 | 52K | |
| xless-1.7_3.pkg | 2025-12-23 21:09 | 24K | |
| xlhtml-0.5_6,1.pkg | 2025-08-14 05:21 | 50K | |
| xli-1.17.0_19.pkg | 2025-12-27 19:43 | 131K | |
| xlibre-0.1.pkg | 2025-12-27 20:51 | 719 | |
| xlibre-drivers-0.1.pkg | 2025-12-27 10:50 | 749 | |
| xlibre-ephyr-25.0.0...> | 2025-12-30 00:58 | 924K | |
| xlibre-nest-25.0.0.1..> | 2025-12-30 10:07 | 646K | |
| xlibre-nvidia-driver..> | 2025-12-29 21:28 | 10M | |
| xlibre-nvidia-driver..> | 2025-12-29 01:04 | 19M | |
| xlibre-nvidia-driver..> | 2025-12-29 03:02 | 17M | |
| xlibre-nvidia-driver..> | 2025-12-29 19:15 | 46M | |
| xlibre-nvidia-driver..> | 2025-12-29 20:49 | 79M | |
| xlibre-nvidia-driver..> | 2025-12-28 12:20 | 79M | |
| xlibre-server-25.0.0..> | 2025-12-26 19:51 | 1.5M | |
| xlibre-vfb-25.0.0.16..> | 2025-12-30 15:41 | 777K | |
| xlibre-xf86-input-eg..> | 2025-12-29 06:14 | 5.9K | |
| xlibre-xf86-input-el..> | 2025-12-28 05:32 | 8.7K | |
| xlibre-xf86-input-ev..> | 2025-12-30 04:15 | 30K | |
| xlibre-xf86-input-jo..> | 2025-12-28 07:43 | 23K | |
| xlibre-xf86-input-ke..> | 2025-12-26 20:27 | 8.6K | |
| xlibre-xf86-input-li..> | 2025-12-26 23:26 | 43K | |
| xlibre-xf86-input-mo..> | 2025-12-27 01:40 | 31K | |
| xlibre-xf86-input-sy..> | 2025-12-27 19:48 | 53K | |
| xlibre-xf86-input-vm..> | 2025-12-29 05:44 | 10K | |
| xlibre-xf86-input-vo..> | 2025-12-29 17:09 | 3.8K | |
| xlibre-xf86-input-wa..> | 2025-12-30 00:42 | 85K | |
| xlibre-xf86-video-am..> | 2025-12-28 13:51 | 60K | |
| xlibre-xf86-video-as..> | 2025-12-30 17:52 | 41K | |
| xlibre-xf86-video-at..> | 2025-12-28 10:32 | 141K | |
| xlibre-xf86-video-du..> | 2025-12-28 23:30 | 7.8K | |
| xlibre-xf86-video-in..> | 2025-12-29 20:03 | 802K | |
| xlibre-xf86-video-mg..> | 2025-12-30 13:54 | 62K | |
| xlibre-xf86-video-nv..> | 2025-12-30 10:59 | 68K | |
| xlibre-xf86-video-qx..> | 2025-12-28 20:54 | 109K | |
| xlibre-xf86-video-ve..> | 2025-12-26 21:54 | 12K | |
| xlibre-xf86-video-vm..> | 2025-12-28 11:35 | 68K | |
| xlife++-3.0.pkg | 2025-12-28 17:00 | 30M | |
| xlife-6.7.6_1.pkg | 2025-12-23 00:11 | 170K | |
| xlnt-1.5.0.92.pkg | 2025-08-16 18:41 | 756K | |
| xload-1.2.0.pkg | 2025-12-20 05:23 | 8.0K | |
| xloadimage-4.1.24_3.pkg | 2025-12-29 19:35 | 103K | |
| xlockmore-5.83.pkg | 2025-12-27 17:01 | 737K | |
| xlog-2.0.25_2.pkg | 2025-12-30 18:27 | 9.7M | |
| xlogical-1.0.8.pkg | 2025-12-30 12:15 | 1.5M | |
| xlogo-1.0.7.pkg | 2025-12-30 01:39 | 10K | |
| xlreader-0.9.0.pkg | 2025-08-22 15:18 | 10K | |
| xls2txt-1.0.1_46.pkg | 2025-12-29 16:58 | 551K | |
| xlsatoms-1.1.4_1.pkg | 2025-08-14 06:48 | 5.8K | |
| xlsclients-1.1.5_1.pkg | 2025-08-14 00:54 | 8.0K | |
| xlsfonts-1.0.8.pkg | 2025-08-15 21:56 | 9.8K | |
| xlsxio-0.2.35_1.pkg | 2025-12-19 19:54 | 43K | |
| xlupe-1.1_3.pkg | 2025-12-21 08:51 | 12K | |
| xmag-1.0.8.pkg | 2025-12-23 12:59 | 18K | |
| xmahjongg-3.7_4.pkg | 2025-08-20 05:50 | 420K | |
| xmail-1.6_3.pkg | 2025-12-22 21:16 | 72K | |
| xmailbox-2.5_3.pkg | 2025-12-20 11:56 | 33K | |
| xmailwatcher-1.6_3.pkg | 2025-12-22 06:12 | 11K | |
| xmake-1.06_2.pkg | 2025-08-15 15:01 | 14K | |
| xman-1.2.0.pkg | 2025-12-23 05:34 | 34K | |
| xmangekyou-2.0.1_4.pkg | 2025-12-22 08:43 | 26K | |
| xmascot-2.6a.2020083..> | 2025-12-22 16:13 | 138K | |
| xmastermind-0.1_8.pkg | 2025-12-28 06:22 | 16K | |
| xmball-5.5.2_3.pkg | 2025-08-22 20:02 | 24K | |
| xmbibtex-1.7_4.pkg | 2025-12-30 14:56 | 41K | |
| xmbmon-205_16.pkg | 2025-08-19 21:47 | 52K | |
| xmcd-3.3.2_23.pkg | 2025-12-29 20:11 | 635K | |
| xmdiary-3.0.3_8.pkg | 2025-12-28 10:05 | 846K | |
| xmedcon-0.23.0_1.pkg | 2025-12-26 22:30 | 662K | |
| xmemory-3.7_4.pkg | 2025-08-22 07:51 | 211K | |
| xmenu-4.6.1_4.pkg | 2025-12-30 10:51 | 28K | |
| xmessage-1.0.7.pkg | 2025-12-18 09:03 | 11K | |
| xmh-1.0.5.pkg | 2025-12-21 22:09 | 75K | |
| xmill-0.8.pkg | 2025-08-16 20:29 | 715K | |
| xmille-2.0_5.pkg | 2025-08-16 14:25 | 29K | |
| xmine-1.0.3_3.pkg | 2025-12-23 15:42 | 18K | |
| xminehunter-0.4_5.pkg | 2025-12-28 10:27 | 15K | |
| xmines-1.0_3.pkg | 2025-08-22 04:35 | 15K | |
| xmix-2.1_4.pkg | 2025-12-22 02:54 | 8.5K | |
| xmixer-0.9.4_8.pkg | 2025-12-22 16:43 | 35K | |
| xml-commons-1.4.01_1..> | 2025-12-26 21:32 | 207K | |
| xml-format-0.2.0.3_1..> | 2025-12-30 03:04 | 8.9K | |
| xml-lite.el-1.1_28,1..> | 2025-12-29 18:22 | 9.3K | |
| xml-lite.el-emacs_ca..> | 2025-12-29 06:53 | 9.3K | |
| xml-lite.el-emacs_de..> | 2025-12-28 18:16 | 9.3K | |
| xml-lite.el-emacs_de..> | 2025-12-20 13:07 | 9.3K | |
| xml-lite.el-emacs_no..> | 2025-12-23 19:38 | 9.3K | |
| xml-lite.el-emacs_wa..> | 2025-12-29 19:22 | 9.3K | |
| xml2c-20151019_3.pkg | 2025-12-22 10:10 | 7.8K | |
| xmlada-25.0.0_1.pkg | 2025-12-19 11:38 | 4.9M | |
| xmlcatmgr-2.2_4.pkg | 2025-08-10 21:07 | 22K | |
| xmlcharent-0.3_2.pkg | 2025-08-10 21:07 | 13K | |
| xmlcopyeditor-1.3.1...> | 2025-12-30 01:01 | 1.2M | |
| xmlf90-1.6.3_1.pkg | 2025-12-26 20:39 | 250K | |
| xmlformat-1.04_1.pkg | 2025-12-23 05:01 | 93K | |
| xmlgen-1.4.pkg | 2025-09-01 20:52 | 18K | |
| xmlgraphics-commons-..> | 2025-12-26 20:11 | 1.0M | |
| xmlindent-0.2.18.pkg | 2025-08-20 17:32 | 13K | |
| xmlink-5.5.2_3.pkg | 2025-08-19 04:30 | 20K | |
| xmlppm-0.98.3_2.pkg | 2025-12-22 04:20 | 33K | |
| xmlroff-0.6.3_4.pkg | 2025-12-27 19:49 | 372K | |
| xmlrpc-c-1.60.05.pkg | 2025-12-19 20:55 | 1.7M | |
| xmlrpc-epi-0.54.2_4.pkg | 2025-12-23 15:18 | 76K | |
| xmlsec-3.0.5.pkg | 2025-12-26 18:43 | 3.7M | |
| xmlsec1-1.3.6_1.pkg | 2025-12-18 11:22 | 696K | |
| xmlstarlet-1.6.1_5.pkg | 2025-12-19 02:31 | 221K | |
| xmlto-0.0.28_3.pkg | 2025-12-24 20:09 | 41K | |
| xmltooling-3.3.0.pkg | 2025-12-18 14:50 | 757K | |
| xmlwrapp-0.7.0_33.pkg | 2025-12-20 05:07 | 872K | |
| xmmix-1.2.2_6.pkg | 2025-12-30 18:30 | 21K | |
| xmodmap-1.0.11.pkg | 2025-08-13 14:55 | 22K | |
| xmoji-0.8.pkg | 2025-12-29 06:23 | 246K | |
| xmoontool-3.0.3_9.pkg | 2025-12-28 12:37 | 18K | |
| xmore-1.0.4.pkg | 2025-12-20 21:25 | 4.6K | |
| xmorse-20041125_10.pkg | 2025-12-29 12:09 | 16K | |
| xmotd-1.17.3.b_3.pkg | 2025-12-21 12:42 | 17K | |
| xmoto-0.6.2_4.pkg | 2025-12-28 02:28 | 33M | |
| xmountains-2.15.pkg | 2025-12-22 06:34 | 22K | |
| xmp-4.2.0_3,1.pkg | 2025-12-23 17:37 | 25K | |
| xmpp-client-20170324..> | 2025-12-20 07:28 | 1.9M | |
| xmrig-6.24.0.pkg | 2025-12-29 12:18 | 1.0M | |
| xmris-4.04_6.pkg | 2025-12-23 05:08 | 154K | |
| xmsg-1.1_3.pkg | 2025-12-24 04:47 | 8.7K | |
| xmulti-2.00b4_5.pkg | 2025-12-21 04:14 | 206K | |
| xmx-1.1_3.pkg | 2025-08-19 08:56 | 26K | |
| xnec2c-4.4.17.pkg | 2025-12-29 11:45 | 1.3M | |
| xnecview-1.37.pkg | 2025-12-30 07:49 | 69K | |
| xnee-3.19_3.pkg | 2025-08-19 00:45 | 110K | |
| xneko-1.0_2,1.pkg | 2025-08-22 20:54 | 10K | |
| xneur-0.20.0_4.pkg | 2025-12-27 09:43 | 444K | |
| xnotify-0.9.3_3.pkg | 2025-12-30 02:12 | 16K | |
| xnvme-0.7.5.pkg | 2025-08-20 04:09 | 250K | |
| xob-0.3_1.pkg | 2025-08-17 16:10 | 20K | |
| xoct-5.5.2_2.pkg | 2025-08-17 19:56 | 26K | |
| xoids-1.5_2.pkg | 2025-12-21 22:02 | 36K | |
| xoj-1.0_2.pkg | 2025-12-22 12:30 | 7.3K | |
| xom-1.2.11,1.pkg | 2025-12-30 06:47 | 508K | |
| xonotic-0.8.6_2.pkg | 2025-12-29 19:41 | 1.1G | |
| xoops-2.5.10.pkg | 2025-12-28 09:15 | 6.9M | |
| xopcodecalc-0.05.pkg | 2025-12-30 00:44 | 188K | |
| xorg-7.7_3.pkg | 2025-12-29 20:00 | 659 | |
| xorg-apps-7.7_4.pkg | 2025-12-27 15:10 | 1.2K | |
| xorg-cf-files-1.0.8_..> | 2025-08-13 05:35 | 167K | |
| xorg-docs-1.7.3,1.pkg | 2025-08-15 14:04 | 96K | |
| xorg-drivers-7.7_7.pkg | 2025-12-27 13:18 | 757 | |
| xorg-fonts-7.7_1.pkg | 2025-12-27 09:34 | 602 | |
| xorg-fonts-75dpi-7.7..> | 2025-12-27 01:37 | 595 | |
| xorg-fonts-100dpi-7...> | 2025-12-26 22:24 | 594 | |
| xorg-fonts-cyrillic-..> | 2025-12-26 21:07 | 576 | |
| xorg-fonts-miscbitma..> | 2025-12-26 21:51 | 694 | |
| xorg-fonts-truetype-..> | 2025-12-24 21:55 | 581 | |
| xorg-fonts-type1-7.7..> | 2025-12-26 20:41 | 580 | |
| xorg-libraries-7.7_6..> | 2025-12-27 09:51 | 903 | |
| xorg-macros-1.19.3.pkg | 2025-08-10 21:08 | 21K | |
| xorg-minimal-7.5.2_3..> | 2025-12-27 09:54 | 624 | |
| xorg-nestserver-21.1..> | 2025-12-28 12:33 | 631K | |
| xorg-server-21.1.20,..> | 2025-12-26 15:51 | 1.6M | |
| xorg-sgml-doctools-1..> | 2025-08-22 14:38 | 8.8K | |
| xorg-vfbserver-21.1...> | 2025-12-27 18:36 | 764K | |
| xorgproto-2024.1.pkg | 2025-08-10 21:08 | 234K | |
| xorgramana-0.0.8_11.pkg | 2025-12-28 19:13 | 388K | |
| xorgxrdp-0.10.4_3.pkg | 2025-12-27 19:38 | 106K | |
| xorgxrdp-devel-0.10...> | 2025-12-27 12:35 | 106K | |
| xoris-0.1e_1.pkg | 2025-08-20 00:06 | 5.8K | |
| xorriso-1.5.6_2.pkg | 2025-12-21 19:29 | 950K | |
| xorsearch-1.11.1.pkg | 2025-08-19 06:12 | 19K | |
| xoscope-2.0_4.pkg | 2025-12-29 01:21 | 73K | |
| xosd-2.2.14_4.pkg | 2025-08-14 16:34 | 50K | |
| xosmulti-1.00_3.pkg | 2025-08-18 19:45 | 19K | |
| xosview-1.23_3.pkg | 2025-12-30 14:33 | 59K | |
| xournal-0.4.8.2016_5..> | 2025-12-28 10:02 | 232K | |
| xournalpp-1.2.8_1.pkg | 2025-12-30 08:17 | 1.4M | |
| xpad-5.8.0_3.pkg | 2025-12-28 23:32 | 108K | |
| xpad3-3.1_11.pkg | 2025-12-29 13:18 | 62K | |
| xpaint-3.1.4_3.pkg | 2025-12-30 09:33 | 836K | |
| xpanex-5.5.2_3.pkg | 2025-08-18 15:29 | 23K | |
| xparam-1.22_3.pkg | 2025-08-18 17:12 | 1.1M | |
| xpat2-1.07_5.pkg | 2025-12-24 07:20 | 249K | |
| xpbiff-1.27_5.pkg | 2025-12-20 08:51 | 15K | |
| xpdf-4.06,1.pkg | 2025-12-27 11:26 | 1.7M | |
| xpdf-qt6-4.06,1.pkg | 2025-12-28 02:13 | 1.7M | |
| xpdf3-3.04_14.pkg | 2025-12-30 07:25 | 1.3M | |
| xpdf4-4.06,1.pkg | 2025-12-29 09:52 | 1.7M | |
| xpdf4-qt6-4.06,1.pkg | 2025-12-30 15:32 | 1.7M | |
| xpdfopen-20250308.pkg | 2025-08-13 00:40 | 11K | |
| xpeviewer-0.04.pkg | 2025-12-30 00:22 | 3.5M | |
| xphoon-20000613_2.pkg | 2025-08-19 18:52 | 57K | |
| xpilot-4.5.5_1.pkg | 2025-08-18 12:20 | 676K | |
| xpilot-ng-server-4.7..> | 2025-12-21 05:55 | 839K | |
| xpipe-g20200503.pkg | 2025-08-19 17:52 | 8.1K | |
| xpipeman-1.5_2.pkg | 2025-12-22 19:19 | 17K | |
| xpired-1.22_24.pkg | 2025-12-30 13:09 | 444K | |
| xplanet-1.3.1_3.pkg | 2025-12-27 03:41 | 936K | |
| xplot-0.90.7.1_4.pkg | 2025-12-20 06:54 | 39K | |
| xplr-1.0.0_2.pkg | 2025-12-29 17:20 | 1.8M | |
| xporthdmv-1.01.pkg | 2025-08-18 14:10 | 19K | |
| xpostit-3.3.1_4.pkg | 2025-12-20 18:03 | 17K | |
| xpr-1.2.0.pkg | 2025-08-14 01:02 | 31K | |
| xpra-6.4_1.pkg | 2025-12-27 21:53 | 11M | |
| xpra-html5-19.pkg | 2025-12-20 05:07 | 2.6M | |
| xprintidle-2.1.pkg | 2025-08-21 11:38 | 2.9K | |
| xprobe2-0.3_1.pkg | 2025-08-15 18:02 | 104K | |
| xprompt-1.4_3.pkg | 2025-12-23 04:18 | 12K | |
| xprop-1.2.8.pkg | 2025-08-10 21:39 | 24K | |
| xpuzzletama-1.5b_1.pkg | 2025-12-21 12:15 | 51K | |
| xpx-1.41_2.pkg | 2025-08-21 19:20 | 80K | |
| xpyraminx-5.5.2_3.pkg | 2025-08-16 01:46 | 29K | |
| xrally-1.1.1_6.pkg | 2025-12-22 07:44 | 455K | |
| xrandr-1.5.3.pkg | 2025-08-14 07:02 | 34K | |
| xray-16-2921.j.2025...> | 2025-12-29 15:02 | 48M | |
| xray-core-25.12.8_1.pkg | 2025-12-30 07:37 | 11M | |
| xray_re-tools-g20180..> | 2025-08-22 15:48 | 393K | |
| xrdb-1.2.2.pkg | 2025-08-13 10:19 | 18K | |
| xrdesktop2-2.00_3.pkg | 2025-12-29 15:25 | 39K | |
| xrdp-0.10.4.1_3,1.pkg | 2025-12-28 19:06 | 643K | |
| xrdp-devel-0.10.80.b..> | 2025-12-29 07:18 | 647K | |
| xreader-4.6.0_1.pkg | 2025-12-29 12:16 | 1.0M | |
| xrefresh-1.1.0.pkg | 2025-08-14 08:41 | 6.4K | |
| xrestop-0.6.pkg | 2025-08-20 19:53 | 7.7K | |
| xrick-021212_12.pkg | 2025-12-30 12:16 | 1.5M | |
| xrisk-2.15_3.pkg | 2025-08-18 14:16 | 73K | |
| xroach-4.4_3.pkg | 2025-08-15 23:28 | 11K | |
| xrobots-1.0_6.pkg | 2025-12-23 19:24 | 16K | |
| xrootconsole-0.6_2.pkg | 2025-08-21 15:27 | 8.4K | |
| xrootd-5.6.9_2.pkg | 2025-12-27 03:07 | 2.8M | |
| xrot-1.3.2_2.pkg | 2025-12-21 21:40 | 144K | |
| xrsh-5.92_4.pkg | 2025-08-16 01:37 | 12K | |
| xrsi-0.9_2.pkg | 2025-08-16 22:00 | 5.8K | |
| xrubik-5.5.2_2.pkg | 2025-08-18 17:20 | 35K | |
| xsane-0.999_11.pkg | 2025-12-28 21:35 | 1.6M | |
| xsc-1.6_2.pkg | 2025-08-16 02:56 | 45K | |
| xscavenger-1.4.5_2.pkg | 2025-08-16 12:30 | 141K | |
| xschem-3.4.7.pkg | 2025-12-29 06:17 | 11M | |
| xscope-1.4.5.pkg | 2025-08-22 00:12 | 103K | |
| xscrabble-2.12_1.pkg | 2025-12-23 23:21 | 443K | |
| xscreensaver-6.12.pkg | 2025-12-27 01:59 | 16M | |
| xsd-4.2.0_1.pkg | 2025-08-13 09:33 | 1.3M | |
| xsel-conrad-1.2.0_2.pkg | 2025-08-14 05:40 | 17K | |
| xset-1.2.5_1.pkg | 2025-08-10 21:39 | 18K | |
| xseticon-0.1.pkg | 2025-12-27 21:47 | 6.0K | |
| xsetroot-1.1.3.pkg | 2025-08-13 14:47 | 9.2K | |
| xsettingsd-1.0.0.2_2..> | 2025-08-13 16:40 | 26K | |
| xshisen-1.51_5.pkg | 2025-12-29 13:12 | 50K | |
| xshogi-1.4.2_2.pkg | 2025-12-30 02:54 | 60K | |
| xsimd-14.0.0.pkg | 2025-12-19 02:58 | 144K | |
| xskat-4.0_3.pkg | 2025-08-16 01:23 | 185K | |
| xskewb-5.5.2_3.pkg | 2025-08-19 10:49 | 28K | |
| xskyroot-920428_2.pkg | 2025-08-21 04:31 | 10K | |
| xslide.el-0.2.2_2.pkg | 2025-08-21 01:17 | 22K | |
| xsm-1.0.6.pkg | 2025-12-20 01:58 | 40K | |
| xsnow-3.8.4.pkg | 2025-12-28 16:11 | 1.9M | |
| xsokoban-3.3c_2.pkg | 2025-12-21 05:19 | 52K | |
| xsoldier-1.8_2.pkg | 2025-12-23 04:06 | 55K | |
| xsp-4.7.1_1.pkg | 2025-12-19 06:53 | 297K | |
| xspacewarp-1.2_2.pkg | 2025-12-24 07:31 | 36K | |
| xspread-3.1.1c_6.pkg | 2025-08-22 17:26 | 228K | |
| xspringies-1.12_1.pkg | 2025-08-19 04:33 | 128K | |
| xss-lock-0.3.0.g2014..> | 2025-12-24 04:55 | 14K | |
| xssstate-1.1.pkg | 2025-08-16 04:31 | 5.6K | |
| xstarroll-1.1b_4,1.pkg | 2025-12-23 18:01 | 17K | |
| xstdcmap-1.0.5_1.pkg | 2025-08-22 04:35 | 6.8K | |
| xstow-1.0.2_1.pkg | 2025-08-16 07:22 | 205K | |
| xstream-1.4.21.pkg | 2025-12-27 13:15 | 546K | |
| xstroke-0.5.12_9.pkg | 2025-12-29 17:07 | 49K | |
| xsv-rs-0.13.0_72.pkg | 2025-12-28 08:59 | 2.8M | |
| xsynth-0.3.3.pkg | 2025-08-16 06:14 | 1.2M | |
| xsynth-dssi-0.9.4_7.pkg | 2025-12-28 04:24 | 122K | |
| xsysstats-1.51_6.pkg | 2025-08-17 14:13 | 21K | |
| xsystem35-1.7.3.p5_7..> | 2025-12-30 10:19 | 356K | |
| xtacy-1.14_3.pkg | 2025-08-20 03:20 | 65K | |
| xtail-2.1_1.pkg | 2025-08-20 03:50 | 8.2K | |
| xtar-1.4_6.pkg | 2025-12-29 15:15 | 43K | |
| xtb-6.5.1_4.pkg | 2025-12-30 08:31 | 3.7M | |
| xteddy-2.2_5.pkg | 2025-12-29 13:14 | 714K | |
| xtensa-esp-elf-13.2...> | 2025-12-30 05:44 | 115M | |
| xtensor-0.27.1.pkg | 2025-12-18 21:11 | 195K | |
| xtensor-blas-0.21.0.pkg | 2025-12-23 06:20 | 234K | |
| xtensor-io-0.13.0.pkg | 2025-12-21 09:28 | 31K | |
| xtensor-python-0.29...> | 2025-12-27 12:48 | 15K | |
| xterm-406.pkg | 2025-12-26 16:32 | 427K | |
| xtermcontrol-3.6_1.pkg | 2025-08-18 05:18 | 20K | |
| xtermset-0.5.2_3.pkg | 2025-08-18 00:16 | 8.3K | |
| xtestpicture-1.2_3.pkg | 2025-08-21 07:01 | 7.1K | |
| xtet42-2.21_6.pkg | 2025-08-21 02:52 | 18K | |
| xtexcad-2.4.1_3.pkg | 2025-12-21 04:08 | 48K | |
| xtexsh-1.4.2_7.pkg | 2025-12-30 18:28 | 15K | |
| xtgyoretsu-git201408..> | 2025-08-22 20:54 | 6.8K | |
| xtic-1.12_3.pkg | 2025-12-21 02:59 | 12K | |
| xtide-2.15.6.pkg | 2025-12-28 17:56 | 1.4M | |
| xtitle-0.4.4.pkg | 2025-08-19 02:06 | 7.6K | |
| xtl-1.4.2.pkg | 2025-08-18 08:33 | 12K | |
| xtl-quant-stack-0.8...> | 2025-12-18 14:28 | 71K | |
| xtoolwait-1.3_3.pkg | 2025-08-17 04:32 | 7.1K | |
| xtrabackup80-8.0.35_..> | 2025-12-22 09:07 | 14M | |
| xtrabackup84-8.4.0.4..> | 2025-12-22 11:57 | 14M | |
| xtrans-1.6.0_1.pkg | 2025-08-10 21:08 | 33K | |
| xtriangles-5.5.2_3.pkg | 2025-08-18 22:18 | 17K | |
| xtrlock-2.17.pkg | 2025-12-22 07:39 | 6.0K | |
| xtrojka-1.2.3_5.pkg | 2025-12-23 14:33 | 30K | |
| xtron-1.1a_3.pkg | 2025-12-22 20:21 | 16K | |
| xtruco-1.0_2.pkg | 2025-08-18 00:25 | 27K | |
| xtset-1.1_1.pkg | 2025-08-19 10:40 | 5.4K | |
| xtux-20030306.pkg | 2025-12-22 03:29 | 1.2M | |
| xtxf-0.11.5.pkg | 2025-12-28 08:12 | 194K | |
| xuidesigner-0.9_1.pkg | 2025-12-28 16:41 | 722K | |
| xurls-2.6.0_2.pkg | 2025-08-18 05:44 | 1.9M | |
| xv-6.1.0.pkg | 2025-12-27 09:03 | 2.6M | |
| xv-m17n-6.1.0.pkg | 2025-12-29 13:44 | 2.6M | |
| xvattr-1.3_12.pkg | 2025-12-28 04:53 | 11K | |
| xvid-1.3.7,1.pkg | 2025-08-13 08:53 | 360K | |
| xvidtune-1.0.4.pkg | 2025-12-23 11:30 | 18K | |
| xvier-1.0_4.pkg | 2025-08-17 06:08 | 27K | |
| xviewer-3.4.8_2.pkg | 2025-12-30 07:19 | 1.2M | |
| xvile-9.8z_1.pkg | 2025-12-22 09:18 | 1.1M | |
| xvinfo-1.1.5_1.pkg | 2025-08-14 01:34 | 6.1K | |
| xvkbd-4.1_1.pkg | 2025-12-21 11:34 | 270K | |
| xvmcinfo-0.1.pkg | 2025-08-20 05:54 | 3.8K | |
| xvt-3.0.6_1.pkg | 2025-12-21 03:14 | 146K | |
| xwallpaper-0.7.4_3.pkg | 2025-12-29 01:25 | 15K | |
| xwatchwin-1.1.1_4.pkg | 2025-08-22 10:28 | 10K | |
| xwave-2.2_3.pkg | 2025-12-21 07:18 | 105K | |
| xwax-1.9.pkg | 2025-12-28 04:29 | 42K | |
| xwayland-24.1.9,1.pkg | 2025-12-26 11:29 | 905K | |
| xwayland-run-0.0.2_1..> | 2025-12-29 06:31 | 9.0K | |
| xwayland-satellite-0..> | 2025-12-30 12:49 | 1.3M | |
| xwaylandvideobridge-..> | 2025-12-29 22:35 | 49K | |
| xwd-1.0.9.pkg | 2025-08-14 09:33 | 16K | |
| xwindiff-1.1.6.pkg | 2025-12-22 02:38 | 53K | |
| xwininfo-1.1.6.pkg | 2025-08-13 21:00 | 20K | |
| xwinwrap-0.3_4.pkg | 2025-08-21 16:38 | 8.3K | |
| xwit-3.4_4.pkg | 2025-08-22 02:22 | 15K | |
| xworld-2.0_2.pkg | 2025-08-22 02:52 | 101K | |
| xworm-1.02_2.pkg | 2025-08-20 03:18 | 27K | |
| xwpe-1.5.30a_1.pkg | 2025-08-18 05:47 | 227K | |
| xwpick-2.20_3.pkg | 2025-08-20 17:26 | 73K | |
| xwrits-2.26_3.pkg | 2025-08-21 11:19 | 95K | |
| xwud-1.0.7.pkg | 2025-08-14 09:27 | 15K | |
| xxd-9.1.1948.pkg | 2025-12-16 01:30 | 14K | |
| xxgdb-1.12_5.pkg | 2025-12-23 18:58 | 45K | |
| xxhash-0.8.3.pkg | 2025-08-10 21:32 | 101K | |
| xxkb-1.11.1_3.pkg | 2025-12-22 07:04 | 33K | |
| xxl-1.0.1_3.pkg | 2025-08-17 09:34 | 175K | |
| xyce-7.10.0_1.pkg | 2025-12-30 08:58 | 9.6M | |
| xye-0.12.2_4.pkg | 2025-12-28 04:31 | 2.5M | |
| xymon-client-4.3.30_..> | 2025-12-21 04:56 | 471K | |
| xymon-server-4.3.30_..> | 2025-12-30 14:12 | 4.8M | |
| xzgv-0.9.2_3.pkg | 2025-12-29 03:26 | 74K | |
| xzip-1.8.2_3.pkg | 2025-08-17 19:00 | 55K | |
| xzoom-0.4_1.pkg | 2025-08-16 06:46 | 11K | |
| xzx-4.6_6.pkg | 2025-12-30 05:30 | 288K | |
| y2l-1.2_1.pkg | 2025-08-17 19:39 | 9.8K | |
| yabasic-2.91.4,1.pkg | 2025-12-20 07:15 | 183K | |
| yabb-2.6.11_1.pkg | 2025-12-21 05:03 | 1.0M | |
| yacas-1.9.1_1.pkg | 2025-08-19 02:59 | 563K | |
| yacreader-9.16.2.pkg | 2025-12-30 04:28 | 1.5M | |
| yad-14.2.pkg | 2025-12-27 15:22 | 182K | |
| yadex-1.7.0_3.pkg | 2025-08-17 16:10 | 313K | |
| yadf-1.0.0_33.pkg | 2025-12-30 06:48 | 841K | |
| yadifa-3.0.2.pkg | 2025-08-21 08:22 | 1.2M | |
| yadm-3.3.0.pkg | 2025-12-23 14:25 | 26K | |
| yaegi-0.16.1_21.pkg | 2025-12-23 19:50 | 6.0M | |
| yaf-2.13.0_1.pkg | 2025-12-20 05:44 | 369K | |
| yafaray-3.5.1_32.pkg | 2025-12-29 19:11 | 1.4M | |
| yafc-1.3.7_2.pkg | 2025-12-20 10:34 | 129K | |
| yafic-1.2.2_4.pkg | 2025-08-20 22:55 | 1.9M | |
| yaggo-1.5.11_1.pkg | 2025-12-19 01:23 | 22K | |
| yagiuda-1.19_2.pkg | 2025-08-18 05:13 | 122K | |
| yahtzee-1.0_2.pkg | 2025-08-19 09:38 | 15K | |
| yajl-2.1.0.pkg | 2025-08-13 09:33 | 66K | |
| yajl-tcl-1.8.1_1.pkg | 2025-08-29 16:35 | 11K | |
| yakuake-25.12.0.pkg | 2025-12-29 07:20 | 457K | |
| yali-1.1_1.pkg | 2025-12-22 15:20 | 8.5K | |
| yalias-0.7_12.pkg | 2025-12-30 04:32 | 11K | |
| yamdi-1.9.pkg | 2025-08-17 04:51 | 16K | |
| yami4-2.0.0.pkg | 2025-12-22 19:12 | 351K | |
| yaml-cpp-0.8.0.pkg | 2025-08-13 14:46 | 117K | |
| yaml-mode.el-0.0.16_..> | 2025-12-29 16:46 | 12K | |
| yaml-mode.el-emacs_c..> | 2025-12-28 08:30 | 12K | |
| yaml-mode.el-emacs_d..> | 2025-12-30 01:42 | 12K | |
| yaml-mode.el-emacs_d..> | 2025-12-21 20:49 | 12K | |
| yaml-mode.el-emacs_n..> | 2025-12-23 19:24 | 12K | |
| yaml-mode.el-emacs_w..> | 2025-12-29 23:01 | 12K | |
| yaml.el-1.2.1.pkg | 2025-12-27 17:59 | 32K | |
| yaml.el-emacs_canna-..> | 2025-12-27 12:59 | 32K | |
| yaml.el-emacs_devel-..> | 2025-12-27 10:01 | 32K | |
| yaml.el-emacs_devel_..> | 2025-12-19 08:16 | 32K | |
| yaml.el-emacs_nox-1...> | 2025-12-19 21:28 | 32K | |
| yaml.el-emacs_waylan..> | 2025-12-27 06:20 | 32K | |
| yaml2argdata-0.4_1.pkg | 2025-08-18 21:56 | 4.1K | |
| yamlfmt-0.20.0_1.pkg | 2025-12-21 09:29 | 1.4M | |
| yandex-ddns-g2020061..> | 2025-12-21 16:50 | 2.2M | |
| yank-1.3.0_1.pkg | 2025-08-16 13:32 | 7.4K | |
| yapet-2.3_2.pkg | 2025-12-21 14:51 | 291K | |
| yaph-0.91.pkg | 2025-08-17 08:54 | 14K | |
| yara-4.5.0.pkg | 2025-08-14 01:46 | 399K | |
| yarn-1.22.18_4.pkg | 2025-12-27 10:43 | 665 | |
| yarn-node12-1.22.18_..> | 2025-12-29 00:22 | 820 | |
| yarn-node20-1.22.19_..> | 2025-12-29 16:40 | 940K | |
| yarn-node22-1.22.19_..> | 2025-12-24 23:55 | 940K | |
| yarn-node24-1.22.19_..> | 2025-12-26 19:39 | 940K | |
| yarn-node25-1.22.19_..> | 2025-12-29 16:32 | 940K | |
| yarr-2.6_1.pkg | 2025-12-22 09:10 | 4.1M | |
| yaru-gtk-themes-25.1..> | 2025-12-20 10:43 | 890K | |
| yaru-icon-theme-25.1..> | 2025-12-22 05:05 | 25M | |
| yash-2.60.pkg | 2025-12-21 05:38 | 471K | |
| yasm-1.3.0_1.pkg | 2025-12-16 03:16 | 590K | |
| yasr-0.6.9_6.pkg | 2025-12-22 16:28 | 54K | |
| yate-6.4.1_1.pkg | 2025-12-29 00:55 | 3.5M | |
| yatex-1.83_2.pkg | 2025-08-31 17:17 | 279K | |
| yaws-2.2.0.pkg | 2025-12-24 01:08 | 1.4M | |
| yaz++-1.9.0_1.pkg | 2025-12-20 02:44 | 109K | |
| yaz-5.35.0_1.pkg | 2025-12-18 19:57 | 1.1M | |
| yaze-ag-2.51.3_1.pkg | 2025-12-20 16:09 | 2.7M | |
| yazi-25.5.31_7.pkg | 2025-12-29 11:30 | 5.2M | |
| yazproxy-1.3.13_1.pkg | 2025-12-21 18:51 | 161K | |
| yconalyzer-1.0.4_2.pkg | 2025-08-16 22:20 | 23K | |
| yder-1.4.20.pkg | 2025-08-13 22:00 | 12K | |
| ydiff-1.2_1,1.pkg | 2025-12-19 01:20 | 31K | |
| ydotool-1.0.4.pkg | 2025-08-19 14:31 | 14K | |
| yeahconsole-0.3.4.pkg | 2025-08-18 23:54 | 8.3K | |
| yeahwm-0.3.5_1.pkg | 2025-08-20 03:50 | 23K | |
| yell-1.1.pkg | 2025-08-17 06:03 | 2.4K | |
| yelp-42.3_2.pkg | 2025-12-26 19:55 | 799K | |
| yelp-tools-42.1_2.pkg | 2025-12-18 17:57 | 22K | |
| yelp-xsl-42.4.pkg | 2025-12-18 11:43 | 189K | |
| yencode-0.46_8.pkg | 2025-12-23 15:25 | 53K | |
| yersinia-gtk-0.8.2_4..> | 2025-12-29 08:52 | 130K | |
| yfklog-0.7.0.pkg | 2025-12-23 08:54 | 156K | |
| yggdrasil-0.5.12_4.pkg | 2025-12-20 10:41 | 4.8M | |
| yi-aspell-0.01.1.1_1..> | 2025-12-23 14:22 | 429K | |
| yi-hunspell-0.0.3.pkg | 2025-08-16 18:54 | 243K | |
| yices-2.7.0_2.pkg | 2025-12-18 16:33 | 1.7M | |
| yj-5.1.0_32.pkg | 2025-12-21 08:36 | 1.1M | |
| yj-bruceadams-1.2.0_..> | 2025-12-27 21:35 | 451K | |
| ykclient-2.15_1.pkg | 2025-12-19 20:31 | 25K | |
| ykpers-1.19.0_2.pkg | 2025-08-14 02:38 | 59K | |
| ylva-1.7.pkg | 2025-12-22 04:43 | 16K | |
| ympd-1.3.0.pkg | 2025-08-18 17:11 | 291K | |
| yoda-2.0.2.pkg | 2025-12-23 23:17 | 2.5M | |
| yodl-4.01.00.pkg | 2025-12-27 22:07 | 1.6M | |
| yorick-2.2.04_4.pkg | 2025-08-21 02:35 | 2.0M | |
| yoshimi-2.3.5.2.pkg | 2025-12-28 14:13 | 7.8M | |
| yosys-0.60.pkg | 2025-12-27 01:57 | 6.7M | |
| you-get-0.4.1743.pkg | 2025-12-30 15:43 | 381K | |
| yourls-1.10.2.pkg | 2025-12-29 23:46 | 4.8M | |
| youtube-downloader-2..> | 2025-08-15 22:55 | 4.8M | |
| youtui-0.0.30_1.pkg | 2025-12-30 15:42 | 5.8M | |
| ypsilon-0.9.6.3_13.pkg | 2025-08-22 09:13 | 567K | |
| yptransitd-0.5_8.pkg | 2025-08-17 15:04 | 23K | |
| yq-3.4.3.pkg | 2025-12-23 14:18 | 34K | |
| yquake2-8.10.pkg | 2025-12-30 00:39 | 781K | |
| yt-dlp-2025.11.12.pkg | 2025-12-26 17:00 | 2.9M | |
| ytfzf-2.6.2_1.pkg | 2025-12-29 17:34 | 51K | |
| ytnef-2.1.2,1.pkg | 2025-12-19 01:09 | 50K | |
| ytree-2.10.pkg | 2025-12-24 03:36 | 74K | |
| ytt-0.52.0_6.pkg | 2025-12-23 14:40 | 3.7M | |
| yubico-piv-tool-2.7...> | 2025-12-23 04:08 | 191K | |
| yubikey-agent-0.1.6_..> | 2025-12-21 09:14 | 1.6M | |
| yubikey-manager-qt-1..> | 2025-12-30 01:03 | 4.2M | |
| yubikey-personalizat..> | 2025-12-29 04:39 | 551K | |
| yubioath-desktop-5.0..> | 2025-12-29 21:21 | 4.5M | |
| yuck-cmdline-parser-..> | 2025-08-19 05:19 | 31K | |
| yudit-3.1.0_1.pkg | 2025-08-22 11:56 | 2.8M | |
| yuicompressor-2.4.8_..> | 2025-12-27 04:46 | 723K | |
| yukon-2010011201_4.pkg | 2025-08-16 16:09 | 9.9K | |
| yume-0.2.0_46.pkg | 2025-12-30 11:16 | 416K | |
| yuzu-s20240301_12.pkg | 2025-12-28 07:02 | 13M | |
| yydecode-0.2.10_1.pkg | 2025-08-18 23:31 | 16K | |
| yyjson-0.12.0.pkg | 2025-12-18 18:36 | 134K | |
| z-1.12_1.pkg | 2025-08-22 12:07 | 6.2K | |
| z3-4.15.3.0.pkg | 2025-12-18 11:35 | 14M | |
| z80-asm-2.4.1.pkg | 2025-08-21 01:54 | 86K | |
| z80asm-1.8_1.pkg | 2025-08-19 12:17 | 34K | |
| z80ex-1.1.21.pkg | 2025-08-19 18:51 | 50K | |
| z80pack-1.38.pkg | 2025-12-30 03:56 | 15M | |
| z88-15_2.pkg | 2025-12-28 12:37 | 41M | |
| z88dk-2.2_1.pkg | 2025-12-22 16:10 | 3.5M | |
| zabbix6-agent-6.0.43..> | 2025-12-29 00:38 | 315K | |
| zabbix6-frontend-php..> | 2025-12-28 11:37 | 8.2M | |
| zabbix6-frontend-php..> | 2025-12-30 04:49 | 8.2M | |
| zabbix6-frontend-php..> | 2025-12-30 10:02 | 8.2M | |
| zabbix6-frontend-php..> | 2025-12-27 21:45 | 8.2M | |
| zabbix6-frontend-php..> | 2025-12-28 20:27 | 8.2M | |
| zabbix6-java-6.0.43.pkg | 2025-12-29 06:21 | 899K | |
| zabbix6-proxy-6.0.43..> | 2025-12-30 08:18 | 9.1M | |
| zabbix6-server-6.0.4..> | 2025-12-28 02:16 | 9.4M | |
| zabbix7-agent-7.0.22..> | 2025-12-30 04:40 | 358K | |
| zabbix7-frontend-php..> | 2025-12-29 08:20 | 9.2M | |
| zabbix7-frontend-php..> | 2025-12-30 09:36 | 9.2M | |
| zabbix7-frontend-php..> | 2025-12-30 10:12 | 9.2M | |
| zabbix7-frontend-php..> | 2025-12-27 20:02 | 9.2M | |
| zabbix7-frontend-php..> | 2025-12-30 18:15 | 9.2M | |
| zabbix7-java-7.0.22.pkg | 2025-12-30 01:17 | 899K | |
| zabbix7-proxy-7.0.22..> | 2025-12-27 22:19 | 10M | |
| zabbix7-server-7.0.2..> | 2025-12-29 13:11 | 10M | |
| zabbix72-agent-7.2.1..> | 2025-12-28 23:55 | 363K | |
| zabbix72-frontend-ph..> | 2025-12-30 17:36 | 9.2M | |
| zabbix72-frontend-ph..> | 2025-12-27 21:49 | 9.2M | |
| zabbix72-frontend-ph..> | 2025-12-29 18:09 | 9.2M | |
| zabbix72-frontend-ph..> | 2025-12-28 01:20 | 9.2M | |
| zabbix72-frontend-ph..> | 2025-12-27 22:40 | 9.2M | |
| zabbix72-java-7.2.15..> | 2025-12-30 04:53 | 899K | |
| zabbix72-proxy-7.2.1..> | 2025-12-29 23:31 | 6.9M | |
| zabbix72-server-7.2...> | 2025-12-30 10:20 | 7.3M | |
| zabbix74-agent-7.4.6..> | 2025-12-30 14:17 | 368K | |
| zabbix74-frontend-ph..> | 2025-12-30 05:53 | 9.5M | |
| zabbix74-frontend-ph..> | 2025-12-29 23:52 | 9.5M | |
| zabbix74-frontend-ph..> | 2025-12-28 07:03 | 9.5M | |
| zabbix74-frontend-ph..> | 2025-12-29 12:53 | 9.5M | |
| zabbix74-frontend-ph..> | 2025-12-30 14:46 | 9.5M | |
| zabbix74-java-7.4.6.pkg | 2025-12-30 02:29 | 899K | |
| zabbix74-proxy-7.4.6..> | 2025-12-29 02:58 | 7.1M | |
| zabbix74-server-7.4...> | 2025-12-30 18:30 | 7.6M | |
| zam-plugins-lv2-4.4.pkg | 2025-12-27 09:27 | 33M | |
| zanata-cli-4.6.2.pkg | 2025-12-28 19:32 | 16M | |
| zangband-2.7.5.p1.pkg | 2025-08-21 12:51 | 1.5M | |
| zanshin-25.12.0.pkg | 2025-12-29 21:58 | 686K | |
| zap-0.8.3_1.pkg | 2025-08-20 05:29 | 12K | |
| zapcc-g20180622_4.pkg | 2025-12-21 02:49 | 26M | |
| zapret-72.3.pkg | 2025-12-22 17:11 | 122K | |
| zaproxy-2.17.0.pkg | 2025-12-29 23:42 | 252M | |
| zarray-0.1.0.pkg | 2025-12-21 05:29 | 16K | |
| zart-g20191124_6.pkg | 2025-12-30 01:46 | 1.8M | |
| zatacka-0.1.8_11.pkg | 2025-12-28 00:50 | 181K | |
| zathura-0.5.14.pkg | 2025-12-27 17:08 | 204K | |
| zathura-cb-0.1.12_1.pkg | 2025-12-30 04:54 | 6.8K | |
| zathura-djvu-0.2.11.pkg | 2025-12-29 04:38 | 10K | |
| zathura-pdf-mupdf-0...> | 2025-12-30 02:30 | 10K | |
| zathura-pdf-poppler-..> | 2025-12-29 02:35 | 8.5K | |
| zathura-ps-0.2.9.pkg | 2025-12-28 10:50 | 5.1K | |
| zaz-1.0.1_1.pkg | 2025-12-28 10:15 | 19M | |
| zbackup-1.4.4_30.pkg | 2025-08-20 23:29 | 82K | |
| zbar-0.23.90_6.pkg | 2025-12-27 00:50 | 224K | |
| zchunk-1.5.3.pkg | 2025-12-18 18:40 | 66K | |
| zdns-2.0.5_1.pkg | 2025-12-20 10:43 | 3.9M | |
| zdoom-2.8.1_11.pkg | 2025-12-27 22:47 | 2.2M | |
| zeal-0.7.2_1.pkg | 2025-12-28 22:42 | 574K | |
| zebra-server-2.0.55_..> | 2025-12-23 08:15 | 771K | |
| zed-1.18.0_2.pkg | 2025-08-17 21:10 | 9.9M | |
| zeek-8.0.4_1.pkg | 2025-12-30 15:39 | 22M | |
| zeitgeist-1.0.4_2.pkg | 2025-12-27 14:43 | 345K | |
| zellij-0.43.1_4.pkg | 2025-12-27 06:18 | 8.8M | |
| zelta-1.0.1_1.pkg | 2025-12-20 19:24 | 30K | |
| zenity-3.44.5.pkg | 2025-12-26 13:55 | 2.9M | |
| zenity4-4.2.0.pkg | 2025-12-27 18:43 | 2.6M | |
| zeno-2024.10.1_3.pkg | 2025-12-30 16:40 | 55M | |
| zenphoto-php81-1.6.8..> | 2025-12-28 12:37 | 7.0M | |
| zenphoto-php82-1.6.8..> | 2025-12-27 21:05 | 7.0M | |
| zenphoto-php83-1.6.8..> | 2025-12-29 11:45 | 7.0M | |
| zenphoto-php84-1.6.8..> | 2025-12-28 08:39 | 7.0M | |
| zenphoto-php85-1.6.8..> | 2025-12-29 03:10 | 7.0M | |
| zenxml-2.5.pkg | 2025-08-19 06:51 | 65K | |
| zeroer-0.1_2.pkg | 2025-12-21 06:52 | 5.4K | |
| zerofs-0.16.2_2.pkg | 2025-12-30 09:11 | 3.4M | |
| zeronet-0.7.1_2.pkg | 2025-12-28 10:02 | 1.7M | |
| zerotier-1.16.0.pkg | 2025-12-21 22:18 | 576K | |
| zerowait-httpd-0.8d_..> | 2025-08-22 21:45 | 86K | |
| zetaback-1.0.7.pkg | 2025-12-20 09:40 | 27K | |
| zetaback-devel-2020...> | 2025-12-23 05:49 | 27K | |
| zfp-1.0.1.pkg | 2025-08-13 11:13 | 126K | |
| zfs-periodic-1.0.201..> | 2025-08-19 03:04 | 2.4K | |
| zfs-replicate-2.0.2.pkg | 2025-08-17 09:58 | 9.2K | |
| zfs-snap-diff-1.1.3_..> | 2025-12-22 17:25 | 5.3M | |
| zfs-snapshot-clean-0..> | 2025-08-21 05:47 | 3.5K | |
| zfs-snapshot-mgmt-20..> | 2025-12-23 13:27 | 5.9K | |
| zfs-stats-1.3.2.pkg | 2025-12-22 11:18 | 10K | |
| zfs-stats-lite-1.4.pkg | 2025-08-17 00:39 | 8.3K | |
| zfsnap-1.11.1_1.pkg | 2025-08-22 15:04 | 6.5K | |
| zfsnap2-2.0.0.b3_4.pkg | 2025-08-19 02:32 | 19K | |
| zfstools-0.3.6_2.pkg | 2025-12-20 18:57 | 7.9K | |
| zgrab2-0.1.8_11.pkg | 2025-12-21 03:15 | 4.7M | |
| zgv-5.9_12.pkg | 2025-12-29 12:22 | 165K | |
| zh-CJKUnifonts-0.2.2..> | 2025-12-28 09:26 | 15M | |
| zh-CNS11643-font-98...> | 2025-12-29 06:00 | 25M | |
| zh-FreeWnn-lib-1.1.1..> | 2025-08-14 14:50 | 175K | |
| zh-FreeWnn-server-1...> | 2025-08-17 17:03 | 1.1M | |
| zh-arphicttf-2.11_6.pkg | 2025-12-27 09:34 | 13M | |
| zh-aterm-1.0.1_1.pkg | 2025-12-20 23:47 | 80K | |
| zh-auto-cn-l10n-1.1_..> | 2025-12-28 08:57 | 7.7K | |
| zh-auto-tw-l10n-1.16..> | 2025-08-16 15:32 | 9.5K | |
| zh-autoconvert-0.3.1..> | 2025-08-17 07:53 | 171K | |
| zh-bitchx-1.2.1_4,1.pkg | 2025-08-17 18:55 | 1.0M | |
| zh-bug5-1.18.pkg | 2025-08-20 11:11 | 6.0K | |
| zh-c2t-1.0_1.pkg | 2025-08-19 05:20 | 23K | |
| zh-cconv-0.6.3.pkg | 2025-08-16 09:56 | 369K | |
| zh-chiconv-11.3.pkg | 2025-08-21 10:25 | 5.8K | |
| zh-chinese-calendar-..> | 2025-12-29 13:05 | 448K | |
| zh-cless-290_1.pkg | 2025-08-16 03:18 | 66K | |
| zh-cnprint-3.30b_1.pkg | 2025-08-22 00:33 | 4.6M | |
| zh-dictd-database-1...> | 2025-08-21 01:41 | 5.8M | |
| zh-elffont-1.0.pkg | 2025-12-30 18:19 | 37K | |
| zh-enscript-a4-1.6.6..> | 2025-12-28 10:58 | 346K | |
| zh-fandol-0.3_1.pkg | 2025-12-28 12:46 | 22M | |
| zh-fcitx-4.2.9.9_2.pkg | 2025-12-26 20:51 | 7.9M | |
| zh-fcitx-chewing-0.2..> | 2025-12-30 02:05 | 16K | |
| zh-fcitx-cloudpinyin..> | 2025-12-29 12:56 | 17K | |
| zh-fcitx-configtool-..> | 2025-12-27 21:39 | 29K | |
| zh-fcitx-table-extra..> | 2025-12-29 00:37 | 4.6M | |
| zh-fcitx-ui-light-0...> | 2025-12-29 18:27 | 28K | |
| zh-fcitx5-chewing-5...> | 2025-12-30 12:43 | 41K | |
| zh-fcitx5-chinese-ad..> | 2025-12-27 19:39 | 1.4M | |
| zh-fcitx5-mcbopomofo..> | 2025-12-28 11:40 | 2.1M | |
| zh-fcitx5-rime-5.1.1..> | 2025-12-29 22:22 | 98K | |
| zh-fcitx5-table-extr..> | 2025-12-29 13:48 | 42M | |
| zh-fcitx5-table-othe..> | 2025-12-29 07:26 | 1.3M | |
| zh-fireflyttf-LGJ-1...> | 2025-12-28 12:49 | 5.2M | |
| zh-font-std-0.0.2009..> | 2025-12-28 19:52 | 1.2K | |
| zh-fortunetw-1.4.pkg | 2025-08-20 04:34 | 106K | |
| zh-gb2jis-1.5_1.pkg | 2025-08-16 14:59 | 29K | |
| zh-gb2ps-2.02.pkg | 2025-08-20 14:15 | 1.4M | |
| zh-gcin-2.9.0_4.pkg | 2025-12-27 10:30 | 4.7M | |
| zh-gcin-gtk3-2.9.0_2..> | 2025-12-29 07:29 | 6.2K | |
| zh-gcin-qt5-2.9.0.pkg | 2025-12-30 13:28 | 17K | |
| zh-gydict-1.0_1.pkg | 2025-12-22 15:46 | 1.6K | |
| zh-hc-3.0_1.pkg | 2025-08-16 23:09 | 33K | |
| zh-ibus-array-0.2.2...> | 2025-12-28 04:43 | 2.0M | |
| zh-ibus-cangjie-2.4_..> | 2025-12-30 08:54 | 30K | |
| zh-ibus-libpinyin-1...> | 2025-12-28 01:26 | 752K | |
| zh-ibus-pinyin-1.5.0..> | 2025-12-30 08:07 | 461K | |
| zh-ibus-rime-1.5.0_1..> | 2025-12-28 03:18 | 20K | |
| zh-ibus-table-chines..> | 2025-12-30 00:54 | 14M | |
| zh-jis2gb-1.5_1.pkg | 2025-08-16 13:53 | 27K | |
| zh-libcangjie-1.3_2.pkg | 2025-12-26 21:21 | 2.3M | |
| zh-libchewing-0.8.5.pkg | 2025-12-19 13:01 | 1.8M | |
| zh-libime-1.1.12.pkg | 2025-12-27 00:57 | 37M | |
| zh-libime-jyutping-1..> | 2025-12-29 03:16 | 15M | |
| zh-libpinyin-2.8.1_2..> | 2025-12-19 04:48 | 10M | |
| zh-librime-1.15.0_1.pkg | 2025-12-18 17:13 | 730K | |
| zh-libtabe-0.2.6_8.pkg | 2025-08-13 19:18 | 3.0M | |
| zh-lunar-2.1_2.pkg | 2025-08-22 22:28 | 13K | |
| zh-moettf-2.0_7.pkg | 2025-12-29 23:24 | 19M | |
| zh-opencc-1.1.6.pkg | 2025-08-13 16:04 | 690K | |
| zh-opendesktop-fonts..> | 2025-12-28 06:21 | 16M | |
| zh-oto-0.5_1.pkg | 2025-08-18 10:47 | 84K | |
| zh-pcmanx-1.3_4.pkg | 2025-12-29 16:46 | 327K | |
| zh-phpbb3-tw-3.0.12.pkg | 2025-08-20 08:09 | 1.5M | |
| zh-pycangjie-1.3.pkg | 2025-12-27 06:22 | 47K | |
| zh-pyzy-0.1.0_9.pkg | 2025-12-19 23:38 | 1.3M | |
| zh-qe-0.1.1_3.pkg | 2025-08-21 17:39 | 48K | |
| zh-rime-array-g20240..> | 2025-12-19 16:43 | 8.2M | |
| zh-rime-bopomofo-g20..> | 2025-12-19 10:58 | 104K | |
| zh-rime-cangjie-g202..> | 2025-12-19 13:10 | 11M | |
| zh-rime-cantonese-g2..> | 2025-12-19 05:04 | 17M | |
| zh-rime-combo-pinyin..> | 2025-12-19 22:31 | 15K | |
| zh-rime-data-full-g2..> | 2025-12-22 04:02 | 843 | |
| zh-rime-double-pinyi..> | 2025-12-19 20:13 | 24K | |
| zh-rime-emoji-g20250..> | 2025-12-20 02:35 | 42K | |
| zh-rime-essay-g20251..> | 2025-12-18 16:19 | 2.1M | |
| zh-rime-ipa-g2020041..> | 2025-12-19 10:44 | 24K | |
| zh-rime-jyutping-g20..> | 2025-12-19 16:13 | 17M | |
| zh-rime-luna-pinyin-..> | 2025-12-18 22:33 | 9.1M | |
| zh-rime-middle-chine..> | 2025-12-19 23:01 | 12M | |
| zh-rime-pinyin-simp-..> | 2025-12-19 15:22 | 1.1M | |
| zh-rime-prelude-g202..> | 2025-12-18 18:24 | 12K | |
| zh-rime-quick-g20190..> | 2025-12-19 10:15 | 6.7M | |
| zh-rime-scj-g2019012..> | 2025-12-19 20:54 | 1.1M | |
| zh-rime-soutzoe-g201..> | 2025-12-19 19:18 | 5.6M | |
| zh-rime-stenotype-g2..> | 2025-12-19 12:38 | 9.8K | |
| zh-rime-stroke-g2019..> | 2025-12-19 22:23 | 3.5M | |
| zh-rime-terra-pinyin..> | 2025-12-19 02:53 | 7.2M | |
| zh-rime-wubi-g202310..> | 2025-12-19 14:18 | 3.2M | |
| zh-rime-wugniu-g2019..> | 2025-12-19 15:49 | 6.4M | |
| zh-scim-fcitx-3.1.1_..> | 2025-12-29 17:57 | 1.2M | |
| zh-scim-pinyin-0.5.9..> | 2025-12-27 09:03 | 2.0M | |
| zh-scim-tables-0.5.1..> | 2025-12-27 15:50 | 4.6M | |
| zh-sourcehansans-sc-..> | 2025-12-28 12:34 | 85M | |
| zh-sourcehansans-tc-..> | 2025-12-28 03:07 | 85M | |
| zh-sourcehanserif-sc..> | 2025-12-30 08:04 | 107M | |
| zh-sourcehanserif-tc..> | 2025-12-30 07:36 | 107M | |
| zh-taipeisanstc-b.pkg | 2025-12-30 15:55 | 25M | |
| zh-tintin++-2.02.51.pkg | 2025-08-18 13:59 | 1.5M | |
| zh-ttf2pt1-3.4.0.pkg | 2025-12-29 22:43 | 113K | |
| zh-ttfm-0.9.5_8.pkg | 2025-12-27 16:20 | 28K | |
| zh-ve-1.1.pkg | 2025-08-22 19:52 | 32K | |
| zh-wenju-1.6_4.pkg | 2025-12-29 13:42 | 1.0M | |
| zh-wordpress-zh_CN-6..> | 2025-12-28 01:27 | 25M | |
| zh-wordpress-zh_TW-6..> | 2025-12-29 03:44 | 25M | |
| zh_CN-libreoffice-25..> | 2025-12-27 16:02 | 3.5M | |
| zh_TW-libreoffice-25..> | 2025-12-27 09:39 | 3.6M | |
| zh_cn-freebsd-doc-20..> | 2025-12-19 12:24 | 27M | |
| zh_tw-freebsd-doc-20..> | 2025-12-19 05:16 | 22M | |
| zhlt-3.4.pkg | 2025-08-17 16:20 | 156K | |
| zidrav-1.2.0_4.pkg | 2025-08-22 21:25 | 15K | |
| zig-0.15.2.pkg | 2025-12-26 22:53 | 25M | |
| zig014-0.14.0.pkg | 2025-12-27 08:56 | 21M | |
| zig2tuple-g20251222.pkg | 2025-12-28 07:18 | 21K | |
| zigbee2mqtt-2.0.0.pkg | 2025-12-28 12:05 | 14M | |
| zile-2.6.4.pkg | 2025-12-23 21:34 | 139K | |
| zim-0.76.3.pkg | 2025-12-28 10:03 | 2.2M | |
| zim-tools-3.5.0_2.pkg | 2025-12-20 11:10 | 231K | |
| zimg-5.0.0_10.pkg | 2025-12-28 11:07 | 53K | |
| zimpl-3.7.0.pkg | 2025-12-21 09:19 | 147K | |
| zine-0.16.0_22.pkg | 2025-12-29 00:29 | 2.8M | |
| zint-2.15.0.pkg | 2025-12-27 14:28 | 836K | |
| zip-3.0_4.pkg | 2025-08-11 00:06 | 228K | |
| zipmix-20070221.pkg | 2025-08-15 23:22 | 7.3K | |
| zipper-1.5_10.pkg | 2025-12-27 12:10 | 57K | |
| zisofs-tools-1.0.8_2..> | 2025-08-21 16:43 | 21K | |
| zita-alsa-pcmi-0.6.1..> | 2025-08-14 14:58 | 20K | |
| zita-at1-0.8.2.pkg | 2025-12-28 21:06 | 36K | |
| zita-bls1-0.4.0.pkg | 2025-12-30 15:11 | 32K | |
| zita-convolver-4.0.3..> | 2025-08-15 14:53 | 15K | |
| zita-dpl1-0.3.3_2.pkg | 2025-12-30 11:42 | 25K | |
| zita-jclient-0.5.2.pkg | 2025-12-27 19:43 | 7.2K | |
| zita-mu1-0.3.3_2.pkg | 2025-12-30 03:29 | 48K | |
| zita-njbridge-0.4.8_..> | 2025-12-29 23:23 | 27K | |
| zita-resampler-1.11...> | 2025-08-14 03:20 | 11K | |
| zita-rev1-0.2.2_2.pkg | 2025-12-30 09:50 | 40K | |
| zix-0.8.0.pkg | 2025-12-18 11:24 | 39K | |
| zkgroup-0.7.4_39,1.pkg | 2025-12-29 06:28 | 239K | |
| zkt-1.1.6_1.pkg | 2025-12-27 20:09 | 91K | |
| zli-2.1.11_1.pkg | 2025-12-22 07:26 | 3.4M | |
| zlib-ng-2.3.2.pkg | 2025-12-18 01:35 | 147K | |
| zlint-3.6.8_1.pkg | 2025-12-20 05:12 | 2.2M | |
| zls-0.14.0_1.pkg | 2025-12-29 05:49 | 3.9M | |
| zmap-4.3.4.pkg | 2025-12-23 19:53 | 117K | |
| zmate-0.3.1_7.pkg | 2025-12-27 22:54 | 2.2M | |
| zmusic-1.1.12_2.pkg | 2025-12-27 19:29 | 885K | |
| zn_poly-0.9.2.pkg | 2025-08-22 13:17 | 59K | |
| znapzend-0.23.2.pkg | 2025-12-22 14:34 | 75K | |
| znc-1.10.1_1.pkg | 2025-12-27 07:34 | 3.7M | |
| znc-clientbuffer-1.0..> | 2025-12-29 06:23 | 18K | |
| znc-push-1.1.0.1_1.pkg | 2025-12-30 18:33 | 90K | |
| znotes-0.4.7.pkg | 2025-12-27 23:42 | 228K | |
| zns-0.4.0_4.pkg | 2025-12-20 20:21 | 2.0M | |
| zogftw-2025.02.23.pkg | 2025-12-21 09:29 | 22K | |
| zola-0.21.0_4.pkg | 2025-12-29 15:55 | 43M | |
| zoneinfo-2025.c.pkg | 2025-12-30 10:12 | 71K | |
| zonenotify-0.1_1.pkg | 2025-08-19 20:43 | 4.0K | |
| zoo-2.10.1_5.pkg | 2025-08-14 04:55 | 62K | |
| zookeeper-3.8.3.pkg | 2025-12-29 18:51 | 13M | |
| zoom-1.1.5_3.pkg | 2025-12-27 22:51 | 362K | |
| zoom-video-conferenc..> | 2025-12-30 14:19 | 56M | |
| zopfli-1.0.3_1.pkg | 2025-08-13 14:25 | 228K | |
| zorin-gtk-themes-4.2..> | 2025-12-23 18:12 | 427K | |
| zorin-icon-themes-4...> | 2025-12-21 04:16 | 46M | |
| zorro-1.1.8_3.pkg | 2025-12-28 19:10 | 12K | |
| zot-2.1.11_1.pkg | 2025-12-23 19:27 | 58M | |
| zotero-7.0.15_1.pkg | 2025-12-29 22:34 | 97M | |
| zoxide-0.9.8_4.pkg | 2025-12-27 18:31 | 391K | |
| zpaqfranz-55.12_1.pkg | 2025-08-17 15:02 | 655K | |
| zplugins-lv2-0.2.7.pkg | 2025-12-29 18:12 | 86K | |
| zpool-iostat-viz-3_2..> | 2025-12-21 01:48 | 6.9K | |
| zq-1.18.0_2.pkg | 2025-08-16 07:14 | 9.1M | |
| zrep-2.0.2.pkg | 2025-12-21 09:15 | 24K | |
| zrepl-0.6.1_21.pkg | 2025-12-23 00:42 | 5.5M | |
| zrepl-dsh2dsh-1.1.0_..> | 2025-12-21 11:52 | 5.1M | |
| zrythm-1.0.0.a.26.0...> | 2025-12-30 05:53 | 1.4M | |
| zsd-2025.02.23.pkg | 2025-12-23 01:48 | 8.7K | |
| zsh-5.9_5.pkg | 2025-08-14 23:00 | 4.9M | |
| zsh-antigen-2.2.3.pkg | 2025-12-23 08:41 | 17K | |
| zsh-autosuggestions-..> | 2025-08-16 16:24 | 8.3K | |
| zsh-completions-0.35..> | 2025-08-19 12:06 | 250K | |
| zsh-fast-syntax-high..> | 2025-12-24 07:28 | 550K | |
| zsh-navigation-tools..> | 2025-08-20 08:17 | 130K | |
| zsh-syntax-highlight..> | 2025-08-19 13:10 | 39K | |
| zsh-you-should-use-1..> | 2025-08-22 02:07 | 3.4K | |
| zsm-0.4.0_2.pkg | 2025-12-21 22:31 | 16K | |
| zstd-1.5.7_1.pkg | 2025-12-16 01:28 | 503K | |
| zstr-1.1.0.pkg | 2025-12-23 14:48 | 7.2K | |
| zsync-0.6.3.pkg | 2025-08-16 23:03 | 77K | |
| zthread-2.3.2_2.pkg | 2025-08-18 22:46 | 109K | |
| ztoolkit-0.1.2_2.pkg | 2025-12-27 19:25 | 41K | |
| ztop-0.3.0_8.pkg | 2025-12-30 10:13 | 580K | |
| ztrack-1.0_1.pkg | 2025-08-19 18:33 | 14K | |
| zu-aspell-0.50.0_1,1..> | 2025-12-20 16:41 | 512K | |
| zu-hunspell-20110323..> | 2025-08-18 00:20 | 324K | |
| zu-libreoffice-25.8...> | 2025-12-27 13:16 | 240K | |
| zug-0.1.1.pkg | 2025-08-13 22:16 | 35K | |
| zuki-themes-4.0.pkg | 2025-12-30 08:15 | 231K | |
| zutils-1.15.pkg | 2025-08-17 16:34 | 93K | |
| zutty-0.16.pkg | 2025-12-30 10:49 | 100K | |
| zx-g20221101.pkg | 2025-08-17 10:32 | 48K | |
| zxfer-1.1.7_2.pkg | 2025-08-21 11:19 | 35K | |
| zxing-cpp-2.3.0.pkg | 2025-08-13 03:16 | 569K | |
| zycore-c-1.5.2.pkg | 2025-08-15 08:34 | 48K | |
| zydis-4.1.1.pkg | 2025-08-17 23:58 | 209K | |
| zynaddsubfx-3.0.6_3,..> | 2025-12-29 11:16 | 6.9M | |
| zyre-2.0.1_1.pkg | 2025-08-16 14:19 | 50K | |
| zziplib-0.13.80_1.pkg | 2025-08-24 19:36 | 90K | |
| zzuf-0.13_2.pkg | 2025-08-18 07:38 | 129K | |
To use these repoistories over TLS you should download and install the Pacy World Root CA:
fetch -qo /tmp/ca.crt http://cdn.pacyworld.com/pacyworld.com/ca/alt_ca-morante_root.crt && [ "$(sha256 -q /tmp/ca.crt)" = "22d07a03345496ea9dc3ee767c991117e355405cab8d13e98d192474ef0296ce" ] && mv /tmp/ca.crt /usr/share/certs/trusted/alt_ca-morante_root.pem && certctl rehash || echo "HASH MISMATCH: Trust not established."
Package Build Stats and Status