![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0ad-0.0.26_15.pkg | 2023-10-09 00:41 | 1.3G | |
| 0d1n-3.8_1.pkg | 2023-10-08 14:29 | 219K | |
| 0verkill-0.16_2.pkg | 2023-10-11 00:08 | 221K | |
| 1password-client-1.1..> | 2023-10-09 03:13 | 2.8M | |
| 1password-client2-2...> | 2023-10-09 00:09 | 5.2M | |
| 1password-client2-be..> | 2023-10-14 07:01 | 5.3M | |
| 2bsd-diff-2.11.1_1.pkg | 2023-10-09 01:36 | 21K | |
| 2bsd-vi-050325_2.pkg | 2023-10-08 21:55 | 141K | |
| 2d-rewriter-1.6.pkg | 2023-10-10 21:25 | 17K | |
| 2fa-1.2.0_15.pkg | 2023-10-09 19:16 | 592K | |
| 2ping-4.5.1.pkg | 2023-10-14 06:27 | 43K | |
| 3d-ascii-viewer-1.3...> | 2023-10-14 13:52 | 569K | |
| 3dc-0.8.1_4.pkg | 2023-10-09 18:54 | 30K | |
| 3ddesktop-0.2.9_15.pkg | 2023-10-09 09:09 | 52K | |
| 3dm-2.11.00.021_4,1.pkg | 2023-10-09 05:19 | 4.8M | |
| 3dpong-0.5_6.pkg | 2023-10-10 14:35 | 26K | |
| 3mux-1.1.0_15.pkg | 2023-10-10 05:42 | 1.1M | |
| 3omns-0.2_1.pkg | 2023-10-14 07:24 | 75K | |
| 3proxy-0.9.4.pkg | 2023-10-14 07:22 | 199K | |
| 4pane-8.0.pkg | 2023-10-10 07:07 | 1.3M | |
| 4ti2-1.6.10.pkg | 2023-10-07 20:05 | 1.0M | |
| 4va-1.21_2.pkg | 2023-10-08 15:13 | 20K | |
| 6tunnel-0.13.pkg | 2023-10-09 12:13 | 10K | |
| 7-zip-23.01.pkg | 2023-10-06 22:53 | 940K | |
| 7kaa-2.15.5.pkg | 2023-10-09 17:52 | 30M | |
| 9base-20170701.pkg | 2023-10-14 11:21 | 726K | |
| 9box-0.2.1_3.pkg | 2023-10-10 23:48 | 9.1K | |
| 9e-1.0.pkg | 2023-10-08 18:43 | 4.2K | |
| 9menu-1.10.pkg | 2023-10-09 16:39 | 11K | |
| 44bsd-csh-20001106_5..> | 2023-10-08 17:34 | 91K | |
| 44bsd-more-20000521_..> | 2023-10-08 20:10 | 34K | |
| 44bsd-rdist-20001111..> | 2023-10-09 23:59 | 28K | |
| 90secondportraits-1...> | 2023-10-10 06:50 | 4.4M | |
| 915resolution-0.5.3_..> | 2023-10-14 10:33 | 10K | |
| 2048-0.9.1.pkg | 2023-10-09 15:49 | 9.0K | |
| 2048-qt-0.1.6_3.pkg | 2023-10-11 09:21 | 1.3M | |
| 3270font-2.3.1.pkg | 2023-10-08 23:46 | 1.3M | |
| 54321-1.0.2001.11.16..> | 2023-10-10 18:39 | 549K | |
| ADMsmb-0.3.pkg | 2023-10-14 13:20 | 76K | |
| ADMsnmp-0.1.pkg | 2023-10-11 00:43 | 9.2K | |
| ALPSCore-2.2.0_18.pkg | 2023-10-14 06:17 | 1.2M | |
| APKiD-2.1.5.pkg | 2023-10-10 10:05 | 87K | |
| Aluminum-1.4.1.pkg | 2023-10-09 09:21 | 78K | |
| Andika-6.101.pkg | 2023-10-07 23:04 | 1.2M | |
| AppStream-0.16.1_1.pkg | 2023-10-06 15:25 | 670K | |
| AppStreamCompose-0.1..> | 2023-10-09 16:27 | 106K | |
| AppStreamQt-0.16.1.pkg | 2023-10-06 19:18 | 73K | |
| Atlas-0.5.2_2.pkg | 2023-10-09 20:33 | 111K | |
| Atlas-devel-0.6.4_2.pkg | 2023-10-08 07:27 | 181K | |
| BRiAl-1.2.11_1.pkg | 2023-10-07 03:04 | 1.1M | |
| Bento4-1.6.0_2.pkg | 2023-10-10 21:09 | 1.4M | |
| BerkeleyGW-3.0.1_1.pkg | 2023-10-09 09:49 | 58M | |
| BlackjackClient-0.1_..> | 2023-10-14 15:09 | 21K | |
| Box2D-2.4.1.pkg | 2023-10-06 21:40 | 113K | |
| CAMotics-1.3.0_2.pkg | 2023-10-09 00:28 | 7.5M | |
| CLDR-43.0.pkg | 2023-10-07 21:13 | 17M | |
| CTK-widgets-2023.07...> | 2023-10-10 13:25 | 832K | |
| CalculiX-ccx-2.21.pkg | 2023-10-07 18:40 | 15M | |
| CaribbeanStud-1.0_3.pkg | 2023-10-10 13:36 | 37K | |
| Carla-2.5.6_1.pkg | 2023-10-07 22:13 | 5.1M | |
| ChaiScript-6.1.0_3.pkg | 2023-10-06 16:40 | 1.0M | |
| CharisSIL-6.200.pkg | 2023-10-07 14:33 | 1.0M | |
| CharisSILCompact-4.1..> | 2023-10-08 15:31 | 1.1M | |
| CheMPS2-1.8.12_3.pkg | 2023-10-07 23:10 | 504K | |
| CheckM-1.2.0_1.pkg | 2023-10-14 03:09 | 181K | |
| ChipmunkPhysics-7.0...> | 2023-10-08 14:02 | 479K | |
| Coin-4.0.0_4.pkg | 2023-10-06 20:22 | 2.3M | |
| CoinMP-1.8.4_9.pkg | 2023-10-08 05:53 | 33K | |
| CombBLAS-2.0.0_1.pkg | 2023-10-11 17:26 | 478K | |
| CsoundQt-0.9.8.1_2.pkg | 2023-10-11 14:28 | 48M | |
| Cura-4.13.1_4,2.pkg | 2023-10-14 16:34 | 28M | |
| CuraEngine-4.13.1_1,..> | 2023-10-08 03:59 | 629K | |
| CycloneDDS-0.10.2.pkg | 2023-10-10 11:00 | 929K | |
| DDNet-17.2.1_1.pkg | 2023-10-08 22:55 | 34M | |
| DFileServer-1.1.3_1.pkg | 2023-10-09 07:39 | 39K | |
| DRAWxtl-5.5_1.pkg | 2023-10-11 01:06 | 242K | |
| Doom64EX-g20180824_1..> | 2023-10-08 13:21 | 365K | |
| DoulosSIL-4.112_2.pkg | 2023-10-07 21:11 | 407K | |
| DoulosSILCompact-4.1..> | 2023-10-08 19:40 | 396K | |
| Drawpile-2.1.20_4.pkg | 2023-10-14 11:31 | 1.5M | |
| FAudio-21.01.pkg | 2023-10-07 22:20 | 109K | |
| FFaudioConverter-0.3..> | 2023-10-10 22:10 | 70K | |
| FastTree-2.1.10_5.pkg | 2023-10-10 09:10 | 110K | |
| FlexGet-3.9.10.pkg | 2023-10-09 01:18 | 1.2M | |
| FlintQS-1.0.pkg | 2023-10-08 01:43 | 23K | |
| FluidPlug-lv2-g20230..> | 2023-10-09 14:27 | 331M | |
| FreeCAD-0.21.1.pkg | 2023-10-09 21:48 | 57M | |
| FrontISTR-5.2_1.pkg | 2023-10-10 11:35 | 19M | |
| GLee-5.4.0_1.pkg | 2023-10-07 20:55 | 100K | |
| GNUDoku-0.93_12.pkg | 2023-10-10 00:33 | 27K | |
| Gdtclft-2.2.5_18.pkg | 2023-10-14 17:18 | 13K | |
| GentiumBasic-1102_1.pkg | 2023-10-06 21:16 | 371K | |
| GentiumPlus-6.200.pkg | 2023-10-09 09:27 | 2.2M | |
| GiNaC-1.8.7.pkg | 2023-10-09 20:16 | 1.7M | |
| GraphicsMagick-1.3.4..> | 2023-10-06 12:07 | 2.9M | |
| GroopM-0.3.4_4.pkg | 2023-10-10 17:39 | 183K | |
| GxSwitchlessWah-lv2-..> | 2023-10-09 18:21 | 5.3K | |
| HPCombi-0.0.6_1.pkg | 2023-10-06 23:44 | 33K | |
| HVSC-Update-2.8.7.pkg | 2023-10-14 06:05 | 45K | |
| Hasklig-1.1_1.pkg | 2023-10-09 07:55 | 764K | |
| Hermes-1.3.3_5.pkg | 2023-10-07 05:31 | 106K | |
| Hyperlatex-2.9.a_20.pkg | 2023-10-10 13:31 | 58K | |
| Hyperlatex-emacs_can..> | 2023-10-09 16:06 | 58K | |
| Hyperlatex-emacs_dev..> | 2023-10-14 16:02 | 58K | |
| Hyperlatex-emacs_dev..> | 2023-10-11 17:03 | 58K | |
| Hyperlatex-emacs_nox..> | 2023-10-09 16:24 | 58K | |
| IMB-2021.3_1.pkg | 2023-10-10 16:03 | 387K | |
| Ice-3.6.5_1.pkg | 2023-10-08 00:47 | 5.0M | |
| Ice37-3.7.6.pkg | 2023-10-07 20:52 | 6.4M | |
| ImageMagick6-6.9.12...> | 2023-10-06 15:42 | 7.6M | |
| ImageMagick6-nox11-6..> | 2023-10-07 09:09 | 7.3M | |
| ImageMagick7-7.1.0.6..> | 2023-10-06 13:23 | 8.6M | |
| ImageMagick7-nox11-7..> | 2023-10-07 02:15 | 8.3M | |
| Imath-3.1.9.pkg | 2023-10-05 17:44 | 103K | |
| Inconsolata-LGC-2013..> | 2023-10-10 07:40 | 83K | |
| InsightToolkit-5.3.0..> | 2023-10-07 11:27 | 16M | |
| InsightToolkit501-5...> | 2023-10-07 13:38 | 7.7M | |
| Ipopt-3.14.12.pkg | 2023-10-06 13:54 | 729K | |
| Jellyfish-2.3.0_3.pkg | 2023-10-08 05:02 | 260K | |
| Jmol-16.1.25.pkg | 2023-10-07 11:46 | 54M | |
| Judy-1.0.5_3.pkg | 2023-10-08 10:08 | 205K | |
| KVIrc-5.0.0.102_3.pkg | 2023-10-08 13:32 | 4.6M | |
| Kvantum-qt5-1.0.10.pkg | 2023-10-14 16:30 | 932K | |
| LAStools-2.0.0_1.pkg | 2023-10-10 02:03 | 552K | |
| LLnextgen-0.5.5.pkg | 2023-10-08 14:00 | 284K | |
| LPRng-3.8.C_5,1.pkg | 2023-10-10 06:03 | 476K | |
| LPRngTool-1.3.2_10.pkg | 2023-10-11 08:25 | 123K | |
| LibreMines-1.9.1.pkg | 2023-10-10 11:11 | 889K | |
| Lohit-20140220_3.pkg | 2023-10-14 13:35 | 291K | |
| M4RI-20200125.pkg | 2023-10-06 19:21 | 131K | |
| M4RIE-20200115.pkg | 2023-10-07 20:08 | 181K | |
| MMseqs2-13.45111_2.pkg | 2023-10-09 19:06 | 1.1M | |
| MST-Bench-0.2.2.pkg | 2023-10-08 22:57 | 8.2K | |
| Maaate-0.3.1_5.pkg | 2023-10-10 18:27 | 253K | |
| MailScanner-5.3.4.3_..> | 2023-10-10 07:13 | 456K | |
| MathJax-2.7.9.pkg | 2023-10-08 04:22 | 17M | |
| MathJax3-3.2.2.pkg | 2023-10-07 14:38 | 1.8M | |
| MathMod-11.1_1.pkg | 2023-10-10 08:21 | 892K | |
| MetaPhysicL-1.3.3_1.pkg | 2023-10-07 13:28 | 66K | |
| Mojo-Base-XS-0.07.pkg | 2023-10-09 20:34 | 14K | |
| MolScript-2.1.2_4.pkg | 2023-10-09 16:36 | 2.1M | |
| Mowitz-0.2.1_5.pkg | 2023-10-09 16:42 | 708K | |
| NBlood-r13800.pkg | 2023-10-09 11:38 | 2.4M | |
| NTPoly-3.0.0.pkg | 2023-10-08 16:54 | 717K | |
| NetRexx-2.05_3.pkg | 2023-10-10 18:21 | 692K | |
| NunniMCAX-1.4.1.pkg | 2023-10-08 23:58 | 23K | |
| NymphCast-v0.1_4.pkg | 2023-10-09 20:42 | 2.8M | |
| NymphCastLib-v0.1_1.pkg | 2023-10-08 07:45 | 477K | |
| NymphRPC-v0.1_1.pkg | 2023-10-07 00:32 | 1.1M | |
| O2-tools-2.01.pkg | 2023-10-09 03:33 | 93K | |
| OSCAR-1.4.0.pkg | 2023-10-10 12:48 | 5.7M | |
| OSKAR-2.8.3_5.pkg | 2023-10-14 12:27 | 732K | |
| Open3D-0.2_11.pkg | 2023-10-11 00:33 | 539K | |
| OpenClaw-0.3.98_4.pkg | 2023-10-08 12:40 | 3.4M | |
| OpenCorsairLink-g201..> | 2023-10-09 09:26 | 17K | |
| OpenDiablo2-0.1.g202..> | 2023-10-12 04:00 | 3.3M | |
| OpenFodder-1.8.0.pkg | 2023-10-14 18:46 | 3.0M | |
| OpenHMD-0.3.0_1.pkg | 2023-10-10 05:49 | 67K | |
| OpenJUMP-2.0.pkg | 2023-10-09 05:24 | 53M | |
| OpenLara-g20230628.pkg | 2023-10-09 01:23 | 428K | |
| OpenSP-1.5.2_4.pkg | 2023-10-05 17:13 | 1.2M | |
| OpenSPH-0.4.0_12.pkg | 2023-10-14 08:38 | 3.0M | |
| OpenSSH-askpass-1.2...> | 2023-10-08 09:13 | 25K | |
| OpenSim-core-4.1_5.pkg | 2023-10-14 13:15 | 16M | |
| OpenTomb-2018.02.03...> | 2023-10-08 14:52 | 1.5M | |
| PDL-2.084.pkg | 2023-10-08 05:23 | 3.5M | |
| PETSc-3.19.5.pkg | 2023-10-06 19:29 | 20M | |
| PHPUnit_MockObject-4..> | 2023-10-08 21:32 | 1.1K | |
| PackageKit-1.2.6_2.pkg | 2023-10-07 10:51 | 563K | |
| PackageKit-Qt5-1.1.1..> | 2023-10-14 05:16 | 79K | |
| PackageKit-Qt6-1.1.1..> | 2023-10-09 22:06 | 93K | |
| ParMetis-4.0.3_8.pkg | 2023-10-10 09:54 | 615K | |
| PrusaSlicer-2.6.0_3.pkg | 2023-10-14 01:38 | 35M | |
| QComicBook-0.9.1_47.pkg | 2023-10-09 09:47 | 691K | |
| QtBitcoinTrader-1.42..> | 2023-10-10 16:50 | 1.2M | |
| Quaternion-0.0.95.1_..> | 2023-10-11 07:25 | 699K | |
| R-4.3.1_1.pkg | 2023-10-06 08:48 | 43M | |
| R-cran-ADGofTest-0.3..> | 2023-10-14 09:30 | 14K | |
| R-cran-AER-1.2.10_1.pkg | 2023-10-08 11:54 | 2.4M | |
| R-cran-Amelia-1.8.1_..> | 2023-10-07 10:40 | 1.4M | |
| R-cran-BH-1.81.0.1.pkg | 2023-10-06 11:32 | 8.3M | |
| R-cran-BsMD-2023.707..> | 2023-10-07 22:42 | 374K | |
| R-cran-CVST-0.2.3_1.pkg | 2023-10-06 23:19 | 83K | |
| R-cran-ChangeAnomaly..> | 2023-10-14 10:54 | 16K | |
| R-cran-DBI-1.1.3_1.pkg | 2023-10-06 21:50 | 682K | |
| R-cran-DCluster-0.2...> | 2023-10-11 15:10 | 179K | |
| R-cran-DEoptimR-1.1...> | 2023-10-07 04:24 | 72K | |
| R-cran-DRR-0.0.4_2.pkg | 2023-10-07 23:19 | 151K | |
| R-cran-DT-0.29.pkg | 2023-10-09 17:59 | 1.2M | |
| R-cran-Defaults-1.1...> | 2023-10-11 17:41 | 135K | |
| R-cran-DiagrammeR-1...> | 2023-10-11 00:01 | 2.0M | |
| R-cran-DoE.base-1.2...> | 2023-10-07 14:52 | 1.6M | |
| R-cran-Epi-2.47.1.pkg | 2023-10-08 16:27 | 3.5M | |
| R-cran-FAdist-2.4_1.pkg | 2023-10-14 12:12 | 66K | |
| R-cran-FNN-1.1.3.2_1..> | 2023-10-06 19:28 | 120K | |
| R-cran-Formula-1.2.5..> | 2023-10-07 02:44 | 155K | |
| R-cran-FrF2-2.3.2.pkg | 2023-10-09 22:19 | 906K | |
| R-cran-GDD-0.1.13.1_..> | 2023-10-14 12:33 | 45K | |
| R-cran-Hmisc-4.7.0_2..> | 2023-10-08 19:28 | 3.1M | |
| R-cran-KFAS-1.5.1.pkg | 2023-10-08 06:57 | 720K | |
| R-cran-LearnBayes-2...> | 2023-10-08 17:31 | 938K | |
| R-cran-MCMCpack-1.6...> | 2023-10-07 17:21 | 1.8M | |
| R-cran-MSwM-1.5_1.pkg | 2023-10-14 06:21 | 696K | |
| R-cran-MatchIt-4.5.4..> | 2023-10-07 17:21 | 1.6M | |
| R-cran-Matching-4.10..> | 2023-10-07 06:11 | 471K | |
| R-cran-MatrixModels-..> | 2023-10-06 16:40 | 368K | |
| R-cran-ModelMetrics-..> | 2023-10-08 04:38 | 125K | |
| R-cran-PerformanceAn..> | 2023-10-09 11:13 | 2.7M | |
| R-cran-R2HTML-2.3.3_..> | 2023-10-07 12:52 | 568K | |
| R-cran-R6-2.5.1_1.pkg | 2023-10-06 10:00 | 91K | |
| R-cran-RColorBrewer-..> | 2023-10-06 18:00 | 52K | |
| R-cran-RCurl-1.98.1...> | 2023-10-08 04:58 | 777K | |
| R-cran-RFinanceYJ-0...> | 2023-10-09 13:13 | 26K | |
| R-cran-RJSONIO-1.3.1..> | 2023-10-10 14:28 | 928K | |
| R-cran-RMySQL-0.10.2..> | 2023-10-14 18:25 | 278K | |
| R-cran-ROAuth-0.9.6_..> | 2023-10-08 21:18 | 139K | |
| R-cran-RPostgreSQL-0..> | 2023-10-09 17:02 | 355K | |
| R-cran-RSQLite-2.2.1..> | 2023-10-07 22:05 | 1.1M | |
| R-cran-RSvgDevice-0...> | 2023-10-10 09:22 | 16K | |
| R-cran-RUnit-0.4.28_..> | 2023-10-08 16:03 | 270K | |
| R-cran-Rcpp-1.0.11.pkg | 2023-10-06 10:26 | 1.9M | |
| R-cran-RcppArmadillo..> | 2023-10-07 07:22 | 842K | |
| R-cran-RcppEigen-0.3..> | 2023-10-06 15:36 | 1.1M | |
| R-cran-RcppProgress-..> | 2023-10-07 03:22 | 20K | |
| R-cran-RcppRoll-0.3...> | 2023-10-09 05:56 | 91K | |
| R-cran-Rdpack-2.5.pkg | 2023-10-06 22:14 | 723K | |
| R-cran-RgoogleMaps-1..> | 2023-10-08 17:07 | 470K | |
| R-cran-Rmpfr-0.9.3.pkg | 2023-10-10 13:30 | 1.1M | |
| R-cran-Rook-1.2.pkg | 2023-10-09 11:51 | 356K | |
| R-cran-Rsolnp-1.16_5..> | 2023-10-08 08:30 | 243K | |
| R-cran-SQUAREM-2021...> | 2023-10-06 14:08 | 172K | |
| R-cran-SparseM-1.81_..> | 2023-10-06 17:20 | 879K | |
| R-cran-TTR-0.24.3_1.pkg | 2023-10-06 17:35 | 496K | |
| R-cran-VGAM-1.1.8_1.pkg | 2023-10-07 13:11 | 7.0M | |
| R-cran-XLConnect-1.0..> | 2023-10-07 19:50 | 1.4M | |
| R-cran-XML-3.99.0.14..> | 2023-10-08 09:17 | 1.6M | |
| R-cran-Zelig-5.1.7_1..> | 2023-10-08 13:14 | 1.8M | |
| R-cran-abind-1.4.5_4..> | 2023-10-06 22:30 | 66K | |
| R-cran-acepack-1.4.1..> | 2023-10-09 15:11 | 55K | |
| R-cran-admisc-0.33.pkg | 2023-10-06 20:31 | 339K | |
| R-cran-alabama-2015...> | 2023-10-14 05:47 | 69K | |
| R-cran-arabic2kansuj..> | 2023-10-07 11:21 | 20K | |
| R-cran-ash-1.0.15_1.pkg | 2023-10-07 06:01 | 24K | |
| R-cran-askpass-1.2.0..> | 2023-10-06 13:21 | 22K | |
| R-cran-assertthat-0...> | 2023-10-06 09:46 | 54K | |
| R-cran-backports-1.4..> | 2023-10-06 14:55 | 97K | |
| R-cran-base64enc-0.1..> | 2023-10-06 11:50 | 25K | |
| R-cran-bayesm-3.1.5_..> | 2023-10-11 12:31 | 2.4M | |
| R-cran-bdsmatrix-1.3..> | 2023-10-07 17:03 | 305K | |
| R-cran-bibtex-0.5.1.pkg | 2023-10-08 17:46 | 91K | |
| R-cran-bindr-0.1.1_4..> | 2023-10-07 13:48 | 17K | |
| R-cran-bindrcpp-0.2...> | 2023-10-09 07:48 | 68K | |
| R-cran-bit-4.0.5.pkg | 2023-10-06 10:56 | 1.0M | |
| R-cran-bit64-4.0.5_1..> | 2023-10-06 11:19 | 471K | |
| R-cran-bitops-1.0.7_..> | 2023-10-07 08:24 | 26K | |
| R-cran-blob-1.2.4.pkg | 2023-10-07 08:03 | 47K | |
| R-cran-brew-1.0.8.pkg | 2023-10-06 22:07 | 63K | |
| R-cran-brio-1.1.3_1.pkg | 2023-10-06 11:03 | 32K | |
| R-cran-broom-1.0.5.pkg | 2023-10-06 16:14 | 1.7M | |
| R-cran-bslib-0.5.1.pkg | 2023-10-06 16:08 | 4.8M | |
| R-cran-caTools-1.18...> | 2023-10-09 07:09 | 198K | |
| R-cran-cachem-1.0.8.pkg | 2023-10-06 13:18 | 68K | |
| R-cran-callr-3.7.3_1..> | 2023-10-06 11:27 | 411K | |
| R-cran-car-3.1.2.pkg | 2023-10-07 07:47 | 1.6M | |
| R-cran-carData-3.0.5..> | 2023-10-06 20:31 | 1.7M | |
| R-cran-caret-6.0.94.pkg | 2023-10-08 12:57 | 3.4M | |
| R-cran-cellranger-1...> | 2023-10-06 15:08 | 102K | |
| R-cran-checkmate-2.1..> | 2023-10-07 09:57 | 601K | |
| R-cran-chk-0.9.0.pkg | 2023-10-07 07:10 | 343K | |
| R-cran-chron-2.3.57_..> | 2023-10-07 15:49 | 183K | |
| R-cran-classInt-0.4...> | 2023-10-06 19:27 | 460K | |
| R-cran-cli-3.6.1.pkg | 2023-10-06 08:51 | 1.2M | |
| R-cran-cliapp-0.1.1_..> | 2023-10-09 00:34 | 234K | |
| R-cran-clipr-0.8.0_1..> | 2023-10-06 13:36 | 50K | |
| R-cran-clisymbols-1...> | 2023-10-06 19:03 | 18K | |
| R-cran-clock-0.7.0.pkg | 2023-10-07 08:47 | 1.6M | |
| R-cran-cmprsk-2.2.11..> | 2023-10-07 18:25 | 94K | |
| R-cran-coda-0.19.4_1..> | 2023-10-07 03:11 | 312K | |
| R-cran-collapse-1.9...> | 2023-10-08 02:33 | 2.8M | |
| R-cran-colorspace-2...> | 2023-10-06 14:20 | 2.4M | |
| R-cran-combinat-0.0...> | 2023-10-07 00:48 | 40K | |
| R-cran-commonmark-1...> | 2023-10-06 19:26 | 103K | |
| R-cran-conf.design-2..> | 2023-10-07 01:54 | 43K | |
| R-cran-conquer-1.3.3..> | 2023-10-10 00:31 | 481K | |
| R-cran-covr-3.6.2_1.pkg | 2023-10-09 13:28 | 329K | |
| R-cran-cpp11-0.4.6.pkg | 2023-10-06 10:07 | 211K | |
| R-cran-crayon-1.5.2_..> | 2023-10-06 09:54 | 158K | |
| R-cran-credentials-1..> | 2023-10-06 17:50 | 163K | |
| R-cran-crosstalk-1.2..> | 2023-10-08 03:24 | 348K | |
| R-cran-curl-5.0.2.pkg | 2023-10-06 14:02 | 416K | |
| R-cran-cvar-0.5_1.pkg | 2023-10-08 10:10 | 270K | |
| R-cran-cyclocomp-1.1..> | 2023-10-07 15:27 | 32K | |
| R-cran-data.table-1...> | 2023-10-06 17:14 | 1.7M | |
| R-cran-date-1.2.42_1..> | 2023-10-14 17:42 | 46K | |
| R-cran-ddalpha-1.3.1..> | 2023-10-14 07:01 | 1.1M | |
| R-cran-decor-1.0.2.pkg | 2023-10-14 11:38 | 33K | |
| R-cran-deldir-1.0.9.pkg | 2023-10-07 02:33 | 278K | |
| R-cran-desc-1.4.2_1.pkg | 2023-10-06 10:30 | 338K | |
| R-cran-devtools-2.4...> | 2023-10-08 02:44 | 659K | |
| R-cran-diagram-1.6.5..> | 2023-10-09 09:34 | 640K | |
| R-cran-dichromat-2.0..> | 2023-10-10 04:39 | 143K | |
| R-cran-diffobj-0.3.5..> | 2023-10-06 10:52 | 1.0M | |
| R-cran-digest-0.6.33..> | 2023-10-06 11:48 | 176K | |
| R-cran-dimRed-0.2.6_..> | 2023-10-14 03:02 | 1.5M | |
| R-cran-dlmodeler-1.4..> | 2023-10-10 10:17 | 163K | |
| R-cran-doParallel-1...> | 2023-10-08 08:23 | 182K | |
| R-cran-downloader-0...> | 2023-10-07 15:11 | 22K | |
| R-cran-dplyr-1.1.2.pkg | 2023-10-06 12:20 | 1.4M | |
| R-cran-dygraphs-1.1...> | 2023-10-09 14:26 | 366K | |
| R-cran-e1071-1.7.13.pkg | 2023-10-06 16:25 | 561K | |
| R-cran-eRm-1.0.2_1.pkg | 2023-10-10 02:19 | 1.4M | |
| R-cran-eco-4.0.3.pkg | 2023-10-11 05:53 | 386K | |
| R-cran-ellipsis-0.3...> | 2023-10-06 10:21 | 34K | |
| R-cran-energy-1.7.11..> | 2023-10-09 06:12 | 269K | |
| R-cran-epicalc-2.15...> | 2023-10-09 12:46 | 744K | |
| R-cran-etm-1.1.1_1.pkg | 2023-10-08 00:14 | 456K | |
| R-cran-evaluate-0.21..> | 2023-10-06 09:17 | 92K | |
| R-cran-exactRankTest..> | 2023-10-08 08:04 | 153K | |
| R-cran-expm-0.999.7.pkg | 2023-10-06 20:04 | 207K | |
| R-cran-fBasics-4022...> | 2023-10-07 21:30 | 2.5M | |
| R-cran-fGarch-4022.8..> | 2023-10-09 13:20 | 640K | |
| R-cran-fansi-1.0.4.pkg | 2023-10-06 09:10 | 586K | |
| R-cran-farver-2.1.1_..> | 2023-10-06 16:18 | 1.3M | |
| R-cran-fastICA-1.2.3..> | 2023-10-07 20:50 | 46K | |
| R-cran-fastmap-1.1.1..> | 2023-10-06 11:34 | 67K | |
| R-cran-filelock-1.0...> | 2023-10-07 01:53 | 22K | |
| R-cran-fontawesome-0..> | 2023-10-06 17:51 | 1.2M | |
| R-cran-forcats-1.0.0..> | 2023-10-06 14:37 | 411K | |
| R-cran-foreach-1.5.2..> | 2023-10-07 07:19 | 120K | |
| R-cran-forecast-8.21..> | 2023-10-08 02:10 | 1.5M | |
| R-cran-formatR-1.14.pkg | 2023-10-11 00:09 | 145K | |
| R-cran-fracdiff-1.5...> | 2023-10-07 01:00 | 104K | |
| R-cran-fs-1.6.3.pkg | 2023-10-06 10:47 | 267K | |
| R-cran-future-1.33.0..> | 2023-10-06 12:29 | 625K | |
| R-cran-future.apply-..> | 2023-10-06 15:39 | 161K | |
| R-cran-gbRd-0.4.11_3..> | 2023-10-08 12:58 | 42K | |
| R-cran-gbm-2.0.8_12.pkg | 2023-10-14 16:17 | 432K | |
| R-cran-gbutils-0.5_1..> | 2023-10-07 09:41 | 255K | |
| R-cran-gdata-2.19.0.pkg | 2023-10-07 23:08 | 1.3M | |
| R-cran-geepack-1.3.9..> | 2023-10-08 09:38 | 553K | |
| R-cran-generics-0.1...> | 2023-10-06 12:09 | 78K | |
| R-cran-geometry-0.4...> | 2023-10-07 16:55 | 815K | |
| R-cran-gert-1.3.0_3.pkg | 2023-10-06 19:09 | 176K | |
| R-cran-getopt-1.20.3..> | 2023-10-07 06:31 | 35K | |
| R-cran-ggplot2-3.4.3..> | 2023-10-07 00:40 | 3.4M | |
| R-cran-ggrepel-0.9.3..> | 2023-10-10 01:55 | 247K | |
| R-cran-gh-1.3.1_1.pkg | 2023-10-06 21:04 | 96K | |
| R-cran-git2r-0.27.1_..> | 2023-10-11 00:39 | 419K | |
| R-cran-gitcreds-0.1...> | 2023-10-06 17:00 | 88K | |
| R-cran-glmnet-1.8.5_..> | 2023-10-08 20:05 | 302K | |
| R-cran-globals-0.16...> | 2023-10-06 11:03 | 112K | |
| R-cran-glue-1.6.2_1.pkg | 2023-10-06 08:51 | 145K | |
| R-cran-gmm-1.8.pkg | 2023-10-10 05:57 | 1.4M | |
| R-cran-gmodels-2.18...> | 2023-10-14 18:58 | 111K | |
| R-cran-gmp-0.7.2.pkg | 2023-10-06 22:20 | 297K | |
| R-cran-gower-1.0.1.pkg | 2023-10-07 08:45 | 200K | |
| R-cran-gpclib-1.5.6_..> | 2023-10-10 05:33 | 192K | |
| R-cran-gridBase-0.4...> | 2023-10-07 12:01 | 157K | |
| R-cran-gridExtra-2.3..> | 2023-10-07 08:25 | 1.0M | |
| R-cran-gsl-2.1.8_1.pkg | 2023-10-08 06:02 | 475K | |
| R-cran-gss-2.2.7.pkg | 2023-10-06 23:31 | 1.6M | |
| R-cran-gsubfn-0.7_1.pkg | 2023-10-08 04:40 | 339K | |
| R-cran-gtable-0.3.3.pkg | 2023-10-06 19:59 | 215K | |
| R-cran-gtools-3.9.4.pkg | 2023-10-07 02:56 | 341K | |
| R-cran-hardhat-1.3.0..> | 2023-10-07 05:06 | 812K | |
| R-cran-haven-2.5.3.pkg | 2023-10-06 17:49 | 353K | |
| R-cran-hdrcde-3.4_1.pkg | 2023-10-07 10:10 | 211K | |
| R-cran-hexbin-1.28.3..> | 2023-10-10 06:53 | 1.5M | |
| R-cran-highr-0.10.pkg | 2023-10-06 09:11 | 39K | |
| R-cran-hms-1.1.3.pkg | 2023-10-06 10:56 | 100K | |
| R-cran-htmlTable-2.4..> | 2023-10-08 01:44 | 553K | |
| R-cran-htmltools-0.5..> | 2023-10-06 13:25 | 357K | |
| R-cran-htmlwidgets-1..> | 2023-10-07 04:35 | 397K | |
| R-cran-httpuv-1.6.11..> | 2023-10-07 08:50 | 486K | |
| R-cran-httr-1.4.7.pkg | 2023-10-06 15:57 | 453K | |
| R-cran-hunspell-3.0...> | 2023-10-08 03:02 | 2.4M | |
| R-cran-igraph-1.5.1.pkg | 2023-10-07 11:04 | 4.1M | |
| R-cran-influenceR-0...> | 2023-10-09 12:26 | 47K | |
| R-cran-ini-0.3.1_1.pkg | 2023-10-06 16:41 | 14K | |
| R-cran-inline-0.3.19..> | 2023-10-14 15:12 | 123K | |
| R-cran-intervals-0.1..> | 2023-10-09 14:57 | 735K | |
| R-cran-ipred-0.9.14.pkg | 2023-10-06 23:44 | 373K | |
| R-cran-irlba-2.3.5.1..> | 2023-10-08 23:59 | 287K | |
| R-cran-isoband-0.2.7..> | 2023-10-06 22:44 | 1.5M | |
| R-cran-iterators-1.0..> | 2023-10-06 19:22 | 328K | |
| R-cran-itertools-0.1..> | 2023-10-09 03:45 | 107K | |
| R-cran-jpeg-0.1.10_1..> | 2023-10-07 08:07 | 29K | |
| R-cran-jquerylib-0.1..> | 2023-10-06 14:53 | 277K | |
| R-cran-jsonlite-1.8...> | 2023-10-06 11:42 | 610K | |
| R-cran-kernlab-0.9.3..> | 2023-10-06 22:56 | 2.0M | |
| R-cran-knitr-1.43.pkg | 2023-10-06 09:48 | 1.2M | |
| R-cran-ks-1.14.1.pkg | 2023-10-07 07:27 | 1.8M | |
| R-cran-labeling-0.4...> | 2023-10-06 16:16 | 59K | |
| R-cran-later-1.3.1.pkg | 2023-10-06 17:14 | 110K | |
| R-cran-latticeExtra-..> | 2023-10-07 17:29 | 2.1M | |
| R-cran-lava-1.7.2.1.pkg | 2023-10-06 17:56 | 2.3M | |
| R-cran-lazyeval-0.2...> | 2023-10-07 08:16 | 138K | |
| R-cran-lifecycle-1.0..> | 2023-10-06 08:55 | 115K | |
| R-cran-linprog-0.9.4..> | 2023-10-06 23:43 | 69K | |
| R-cran-lintr-3.1.0.pkg | 2023-10-09 23:03 | 1.2M | |
| R-cran-listenv-0.9.0..> | 2023-10-06 11:17 | 109K | |
| R-cran-lme4-1.1.34.pkg | 2023-10-06 16:40 | 4.0M | |
| R-cran-lmtest-0.9.40..> | 2023-10-06 21:46 | 397K | |
| R-cran-locfit-1.5.9...> | 2023-10-07 05:40 | 523K | |
| R-cran-lpSolve-5.6.1..> | 2023-10-06 20:08 | 324K | |
| R-cran-ltm-1.2.0_1.pkg | 2023-10-08 09:08 | 690K | |
| R-cran-lubridate-1.9..> | 2023-10-07 02:28 | 1.0M | |
| R-cran-magic-1.6.1.pkg | 2023-10-07 01:00 | 391K | |
| R-cran-magick-2.7.5.pkg | 2023-10-14 11:26 | 4.5M | |
| R-cran-magrittr-2.0...> | 2023-10-06 09:14 | 194K | |
| R-cran-maps-3.4.1_1.pkg | 2023-10-10 16:36 | 1.9M | |
| R-cran-maptools-1.1...> | 2023-10-06 19:32 | 1.6M | |
| R-cran-markdown-1.8.pkg | 2023-10-14 09:00 | 168K | |
| R-cran-mathjaxr-1.6...> | 2023-10-06 19:07 | 589K | |
| R-cran-matrixStats-1..> | 2023-10-08 00:58 | 461K | |
| R-cran-maxLik-1.5.2_..> | 2023-10-08 03:30 | 1.5M | |
| R-cran-mclust-6.0.0_..> | 2023-10-06 23:08 | 3.7M | |
| R-cran-mcmc-0.9.7_2.pkg | 2023-10-07 04:33 | 1.3M | |
| R-cran-memisc-0.99.3..> | 2023-10-14 10:14 | 1.8M | |
| R-cran-memoise-2.0.1..> | 2023-10-06 14:13 | 50K | |
| R-cran-microbenchmar..> | 2023-10-14 06:18 | 48K | |
| R-cran-mime-0.12_1.pkg | 2023-10-06 15:15 | 33K | |
| R-cran-minqa-1.2.6.pkg | 2023-10-06 14:55 | 102K | |
| R-cran-misc3d-0.9.1_..> | 2023-10-06 16:54 | 232K | |
| R-cran-miscTools-0.6..> | 2023-10-07 01:45 | 93K | |
| R-cran-mitools-2.4_3..> | 2023-10-07 08:55 | 258K | |
| R-cran-mockery-0.4.3..> | 2023-10-08 23:31 | 42K | |
| R-cran-moments-0.14...> | 2023-10-08 09:38 | 53K | |
| R-cran-msm-1.7_1.pkg | 2023-10-07 00:37 | 1.4M | |
| R-cran-multicool-0.1..> | 2023-10-06 20:14 | 97K | |
| R-cran-munsell-0.5.0..> | 2023-10-06 18:32 | 227K | |
| R-cran-mvtnorm-1.2.3..> | 2023-10-06 19:39 | 728K | |
| R-cran-ncdf4-1.21.pkg | 2023-10-10 12:37 | 270K | |
| R-cran-nloptr-2.0.3_..> | 2023-10-06 15:15 | 378K | |
| R-cran-nnls-1.4_13.pkg | 2023-10-14 16:36 | 32K | |
| R-cran-nortest-1.0.4..> | 2023-10-07 12:10 | 36K | |
| R-cran-numDeriv-2016..> | 2023-10-06 13:48 | 115K | |
| R-cran-numbers-0.8.5..> | 2023-10-07 06:54 | 229K | |
| R-cran-openssl-2.1.0..> | 2023-10-06 15:40 | 639K | |
| R-cran-openxlsx-4.2...> | 2023-10-06 18:33 | 1.9M | |
| R-cran-optparse-1.6...> | 2023-10-08 08:34 | 67K | |
| R-cran-outliers-0.15..> | 2023-10-07 19:28 | 81K | |
| R-cran-pROC-1.18.4.pkg | 2023-10-08 01:06 | 913K | |
| R-cran-pak-0.5.1.pkg | 2023-10-09 19:09 | 452K | |
| R-cran-parallelly-1...> | 2023-10-06 11:49 | 349K | |
| R-cran-parsedate-1.3..> | 2023-10-07 15:47 | 43K | |
| R-cran-partitions-1...> | 2023-10-07 01:31 | 515K | |
| R-cran-pbkrtest-0.5...> | 2023-10-06 23:10 | 177K | |
| R-cran-pillar-1.9.0.pkg | 2023-10-06 09:28 | 615K | |
| R-cran-pingr-2.0.2_1..> | 2023-10-10 08:41 | 38K | |
| R-cran-pixmap-0.4.12..> | 2023-10-07 16:07 | 200K | |
| R-cran-pkgbuild-1.4...> | 2023-10-06 22:23 | 192K | |
| R-cran-pkgcache-2.2...> | 2023-10-07 21:36 | 866K | |
| R-cran-pkgconfig-2.0..> | 2023-10-06 09:20 | 19K | |
| R-cran-pkgdepends-0...> | 2023-10-12 05:08 | 1.4M | |
| R-cran-pkgload-1.3.2..> | 2023-10-06 11:56 | 198K | |
| R-cran-pkgmaker-0.32..> | 2023-10-08 03:01 | 664K | |
| R-cran-pkgsearch-3.1..> | 2023-10-08 16:08 | 171K | |
| R-cran-plm-2.6.3.pkg | 2023-10-14 07:22 | 2.0M | |
| R-cran-plogr-0.2.0_4..> | 2023-10-06 12:05 | 13K | |
| R-cran-plot3D-1.4_1.pkg | 2023-10-06 20:14 | 2.7M | |
| R-cran-pls-2.8.2.pkg | 2023-10-09 21:02 | 4.4M | |
| R-cran-plyr-1.8.8.pkg | 2023-10-07 01:35 | 808K | |
| R-cran-png-0.1.8.pkg | 2023-10-07 08:28 | 38K | |
| R-cran-polycor-0.8.1..> | 2023-10-07 01:20 | 71K | |
| R-cran-polynom-1.4.1..> | 2023-10-06 22:05 | 360K | |
| R-cran-pracma-2.4.2_..> | 2023-10-06 21:08 | 1.6M | |
| R-cran-praise-1.0.0_..> | 2023-10-06 11:45 | 18K | |
| R-cran-prettycode-1...> | 2023-10-08 10:27 | 240K | |
| R-cran-prettyunits-1..> | 2023-10-06 10:41 | 37K | |
| R-cran-processx-3.8...> | 2023-10-06 10:10 | 322K | |
| R-cran-prodlim-1.6.1..> | 2023-10-06 19:49 | 383K | |
| R-cran-progress-1.2...> | 2023-10-06 11:09 | 87K | |
| R-cran-progressr-0.1..> | 2023-10-06 13:51 | 327K | |
| R-cran-promises-1.2...> | 2023-10-06 19:14 | 1.5M | |
| R-cran-proto-1.0.0_5..> | 2023-10-07 05:56 | 455K | |
| R-cran-proxy-0.4.27_..> | 2023-10-06 14:01 | 173K | |
| R-cran-ps-1.7.5.pkg | 2023-10-06 09:58 | 290K | |
| R-cran-psych-1.2.1_1..> | 2023-10-07 19:51 | 2.9M | |
| R-cran-purrr-1.0.2.pkg | 2023-10-06 10:37 | 492K | |
| R-cran-pwr-1.3.0_1.pkg | 2023-10-08 03:09 | 143K | |
| R-cran-pystr-2.0.0_6..> | 2023-10-09 22:33 | 135K | |
| R-cran-qcc-2.7_5.pkg | 2023-10-08 00:58 | 3.2M | |
| R-cran-quadprog-1.5...> | 2023-10-06 19:25 | 31K | |
| R-cran-qualityTools-..> | 2023-10-14 04:19 | 1.8M | |
| R-cran-quantmod-0.4...> | 2023-10-06 18:33 | 1.0M | |
| R-cran-quantreg-5.97..> | 2023-10-06 21:40 | 1.5M | |
| R-cran-rJava-1.0.6_3..> | 2023-10-07 04:12 | 907K | |
| R-cran-randomForest-..> | 2023-10-14 09:06 | 208K | |
| R-cran-rappdirs-0.3...> | 2023-10-06 13:24 | 45K | |
| R-cran-raster-3.6.23..> | 2023-10-10 08:40 | 3.0M | |
| R-cran-rbibutils-2.2..> | 2023-10-06 18:29 | 652K | |
| R-cran-rcmdcheck-1.3..> | 2023-10-07 07:58 | 149K | |
| R-cran-readr-2.1.4.pkg | 2023-10-06 13:58 | 739K | |
| R-cran-readxl-1.4.3.pkg | 2023-10-06 16:33 | 1.3M | |
| R-cran-recipes-1.0.8..> | 2023-10-07 16:06 | 1.8M | |
| R-cran-registry-0.5...> | 2023-10-07 08:30 | 190K | |
| R-cran-rematch-2.0.0..> | 2023-10-06 13:10 | 17K | |
| R-cran-rematch2-2.1...> | 2023-10-06 10:45 | 47K | |
| R-cran-remotes-2.4.2..> | 2023-10-07 07:36 | 400K | |
| R-cran-repr-1.1.6.pkg | 2023-10-14 03:32 | 126K | |
| R-cran-reshape-0.8.9..> | 2023-10-10 10:28 | 163K | |
| R-cran-reshape2-1.4...> | 2023-10-08 08:16 | 110K | |
| R-cran-rex-1.2.1_1.pkg | 2023-10-07 19:21 | 118K | |
| R-cran-rgdal-1.6.7_1..> | 2023-10-10 18:32 | 4.1M | |
| R-cran-rgenoud-5.9.0..> | 2023-10-07 02:26 | 654K | |
| R-cran-rgexf-0.16.2_..> | 2023-10-10 21:01 | 1.4M | |
| R-cran-rio-0.5.29_1.pkg | 2023-10-06 19:56 | 473K | |
| R-cran-rjson-0.2.21_..> | 2023-10-07 10:52 | 136K | |
| R-cran-rlang-1.1.1.pkg | 2023-10-06 08:52 | 1.6M | |
| R-cran-rmarkdown-2.2..> | 2023-10-06 20:11 | 1.9M | |
| R-cran-rngtools-1.5...> | 2023-10-08 07:08 | 79K | |
| R-cran-robustbase-0...> | 2023-10-08 09:35 | 3.0M | |
| R-cran-roxygen2-7.1...> | 2023-10-07 07:23 | 631K | |
| R-cran-rprojroot-2.0..> | 2023-10-06 09:32 | 115K | |
| R-cran-rstudioapi-0...> | 2023-10-06 16:15 | 276K | |
| R-cran-rtiff-1.4.8_1..> | 2023-10-09 19:14 | 90K | |
| R-cran-rversions-2.1..> | 2023-10-07 01:03 | 64K | |
| R-cran-rvest-1.0.3_1..> | 2023-10-08 14:55 | 206K | |
| R-cran-s2-1.1.4.pkg | 2023-10-06 20:36 | 1.8M | |
| R-cran-sandwich-3.0...> | 2023-10-06 13:45 | 1.4M | |
| R-cran-sass-0.4.7.pkg | 2023-10-06 14:25 | 2.0M | |
| R-cran-scales-1.2.1_..> | 2023-10-06 22:39 | 589K | |
| R-cran-scatterplot3d..> | 2023-10-08 02:13 | 341K | |
| R-cran-scrapeR-0.1.6..> | 2023-10-10 10:02 | 29K | |
| R-cran-selectr-0.4.2..> | 2023-10-08 05:52 | 407K | |
| R-cran-servr-0.27.pkg | 2023-10-08 00:18 | 85K | |
| R-cran-sessioninfo-1..> | 2023-10-06 21:20 | 258K | |
| R-cran-sets-1.0.24_1..> | 2023-10-06 19:59 | 613K | |
| R-cran-sf-1.0.14.pkg | 2023-10-07 06:30 | 3.5M | |
| R-cran-sfsmisc-1.1.1..> | 2023-10-08 01:18 | 637K | |
| R-cran-shape-1.4.6_1..> | 2023-10-07 12:01 | 748K | |
| R-cran-shiny-1.7.5.pkg | 2023-10-07 20:15 | 3.2M | |
| R-cran-shinyjs-2.1.0..> | 2023-10-10 12:26 | 973K | |
| R-cran-sm-2.2.5.7.1_..> | 2023-10-10 06:35 | 776K | |
| R-cran-snow-0.4.4_1.pkg | 2023-10-07 12:06 | 95K | |
| R-cran-sodium-1.2.1.pkg | 2023-10-10 17:35 | 244K | |
| R-cran-som-0.3.5.1_5..> | 2023-10-09 04:31 | 231K | |
| R-cran-sourcetools-0..> | 2023-10-07 03:36 | 42K | |
| R-cran-sp-2.0.0.pkg | 2023-10-06 16:06 | 1.6M | |
| R-cran-spData-2.3.0.pkg | 2023-10-07 09:40 | 3.4M | |
| R-cran-spdep-1.2.8.pkg | 2023-10-08 09:30 | 3.3M | |
| R-cran-spelling-2.2...> | 2023-10-09 23:11 | 53K | |
| R-cran-sqldf-0.4.11_..> | 2023-10-09 10:29 | 74K | |
| R-cran-sspir-0.2.10_..> | 2023-10-14 13:47 | 166K | |
| R-cran-stabledist-0...> | 2023-10-07 05:02 | 80K | |
| R-cran-statmod-1.4.3..> | 2023-10-08 23:51 | 251K | |
| R-cran-stringi-1.7.1..> | 2023-10-06 11:59 | 822K | |
| R-cran-stringr-1.5.0..> | 2023-10-06 13:36 | 289K | |
| R-cran-strucchange-1..> | 2023-10-06 16:44 | 919K | |
| R-cran-survey-4.2.1.pkg | 2023-10-08 05:08 | 3.0M | |
| R-cran-sys-3.4.2.pkg | 2023-10-06 11:14 | 41K | |
| R-cran-tensor-1.5_1.pkg | 2023-10-08 19:37 | 14K | |
| R-cran-terra-1.7.46.pkg | 2023-10-07 16:26 | 3.4M | |
| R-cran-testit-0.13.pkg | 2023-10-10 22:04 | 32K | |
| R-cran-testthat-3.1...> | 2023-10-06 12:22 | 1.6M | |
| R-cran-tibble-3.2.1_..> | 2023-10-06 09:32 | 616K | |
| R-cran-tidyr-1.3.0.pkg | 2023-10-06 14:45 | 1.1M | |
| R-cran-tidyselect-1...> | 2023-10-06 11:16 | 218K | |
| R-cran-timeDate-4022..> | 2023-10-06 19:36 | 1.1M | |
| R-cran-timeSeries-40..> | 2023-10-07 03:46 | 1.9M | |
| R-cran-timechange-0...> | 2023-10-06 18:45 | 160K | |
| R-cran-tinytest-1.4...> | 2023-10-09 19:43 | 661K | |
| R-cran-tinytex-0.46.pkg | 2023-10-06 16:31 | 134K | |
| R-cran-truncnorm-1.0..> | 2023-10-07 02:36 | 22K | |
| R-cran-tseries-0.10...> | 2023-10-07 01:05 | 361K | |
| R-cran-twitteR-1.1.9..> | 2023-10-11 00:58 | 593K | |
| R-cran-tzdb-0.4.0.pkg | 2023-10-06 11:58 | 491K | |
| R-cran-udunits2-0.13..> | 2023-10-14 05:31 | 48K | |
| R-cran-units-0.8.4.pkg | 2023-10-06 20:31 | 333K | |
| R-cran-urca-1.3.3_1.pkg | 2023-10-07 06:50 | 1.0M | |
| R-cran-uroot-2.1.2_1..> | 2023-10-09 21:45 | 1.8M | |
| R-cran-usethis-2.0.1..> | 2023-10-07 03:24 | 694K | |
| R-cran-utf8-1.2.3.pkg | 2023-10-06 08:54 | 130K | |
| R-cran-uuid-1.1.0_1.pkg | 2023-10-09 12:48 | 40K | |
| R-cran-vars-1.5.9.pkg | 2023-10-14 04:42 | 411K | |
| R-cran-vcd-1.4.11.pkg | 2023-10-07 04:20 | 1.2M | |
| R-cran-vctrs-0.6.3.pkg | 2023-10-06 09:03 | 1.3M | |
| R-cran-viridis-0.6.4..> | 2023-10-07 10:23 | 2.9M | |
| R-cran-viridisLite-0..> | 2023-10-06 16:15 | 1.2M | |
| R-cran-visNetwork-2...> | 2023-10-07 19:13 | 3.5M | |
| R-cran-vroom-1.6.3.pkg | 2023-10-06 13:44 | 780K | |
| R-cran-waldo-0.5.1.pkg | 2023-10-06 11:28 | 112K | |
| R-cran-webshot-0.5.5..> | 2023-10-10 07:14 | 185K | |
| R-cran-whisker-0.4.1..> | 2023-10-06 19:22 | 60K | |
| R-cran-whoami-1.3.0.pkg | 2023-10-10 17:16 | 30K | |
| R-cran-withr-2.5.0_1..> | 2023-10-06 10:57 | 227K | |
| R-cran-wk-0.8.0.pkg | 2023-10-06 18:09 | 1.7M | |
| R-cran-xfun-0.40.pkg | 2023-10-06 08:52 | 412K | |
| R-cran-xml2-1.3.5.pkg | 2023-10-06 19:03 | 267K | |
| R-cran-xmlparsedata-..> | 2023-10-07 12:03 | 20K | |
| R-cran-xopen-1.0.0_1..> | 2023-10-06 21:31 | 23K | |
| R-cran-xtable-1.8.4_..> | 2023-10-07 02:02 | 671K | |
| R-cran-xts-0.13.1.pkg | 2023-10-06 15:01 | 759K | |
| R-cran-yaml-2.3.7.pkg | 2023-10-06 09:25 | 94K | |
| R-cran-zeallot-0.1.0..> | 2023-10-10 14:41 | 57K | |
| R-cran-zip-2.3.0_1.pkg | 2023-10-06 14:55 | 134K | |
| R-cran-zoo-1.8.12.pkg | 2023-10-06 13:33 | 1.0M | |
| REminiscence-0.5.1.pkg | 2023-10-10 05:24 | 187K | |
| RetroArch-1.10.3_3.pkg | 2023-10-10 05:31 | 3.2M | |
| Ri-li-2.0.1_7.pkg | 2023-10-10 09:36 | 13M | |
| SASM-3.12.2.pkg | 2023-10-09 03:49 | 963K | |
| SCIP-8.0.4.pkg | 2023-10-08 07:13 | 6.0M | |
| SLICOT-5.8_2.pkg | 2023-10-10 20:50 | 3.0M | |
| SNMP4Nagios-0.4_4.pkg | 2023-10-10 03:49 | 135K | |
| SPRNG-5.0_1.pkg | 2023-10-09 02:34 | 567K | |
| SRB2-2.2.9_1.pkg | 2023-10-09 18:09 | 60M | |
| SamDruckerClientShel..> | 2023-10-10 12:00 | 2.3K | |
| SciPlot-1.36_6.pkg | 2023-10-08 12:11 | 64K | |
| ScrollZ-2.3.1.pkg | 2023-10-11 15:05 | 490K | |
| SearchAndRescue-1.4...> | 2023-10-08 21:16 | 288K | |
| SearchAndRescue-data..> | 2023-10-07 22:47 | 44M | |
| SimGrid-3.32.2023022..> | 2023-10-08 18:50 | 1.4M | |
| SoPlex-6.0.4.pkg | 2023-10-07 08:05 | 2.5M | |
| SoQt-1.6.0_2,1.pkg | 2023-10-07 10:01 | 238K | |
| SoXt-1.3.0_9.pkg | 2023-10-10 21:02 | 223K | |
| SoapyAirspy-0.2.0.pkg | 2023-10-08 15:40 | 20K | |
| SoapyBladeRF-0.4.1_2..> | 2023-10-10 05:19 | 40K | |
| SoapyHackRF-0.3.3_2.pkg | 2023-10-14 07:20 | 26K | |
| SoapyPlutoSDR-0.2.1_..> | 2023-10-10 16:01 | 25K | |
| SoapyRTLSDR-0.3.2_1.pkg | 2023-10-09 19:18 | 25K | |
| SoapyRedPitaya-0.1.1..> | 2023-10-09 23:38 | 15K | |
| SoapyRemote-0.5.2_1.pkg | 2023-10-10 05:28 | 118K | |
| SoapySDR-0.8.1.pkg | 2023-10-06 17:44 | 134K | |
| SoapyUHD-0.4.1_3.pkg | 2023-10-09 22:39 | 146K | |
| Sockets-2.3.9.9_3.pkg | 2023-10-07 15:26 | 306K | |
| Sorcer-lv2-1.1.3_9.pkg | 2023-10-14 15:04 | 47K | |
| SpaceCadetPinball-2...> | 2023-10-09 14:11 | 409K | |
| SpaceCadetPinball-de..> | 2023-10-10 13:30 | 585K | |
| SparseBitSet-1.3.pkg | 2023-10-06 22:35 | 23K | |
| SpecTcl-1.2.2a.pkg | 2023-10-10 14:36 | 1.4M | |
| Stikked-0.14.0.pkg | 2023-10-10 00:12 | 5.6M | |
| TIC-80-1.1.2736.pkg | 2023-10-12 05:57 | 1.6M | |
| TestU01-1.2.3_3.pkg | 2023-10-08 06:08 | 2.1M | |
| TkTopNetFlows-0.4_8.pkg | 2023-10-08 18:31 | 80K | |
| UCD-15.1.0,1.pkg | 2023-10-05 16:40 | 17M | |
| UEFITool-qt5-67.pkg | 2023-10-08 15:07 | 597K | |
| UEFITool-qt6-67.pkg | 2023-10-08 15:31 | 604K | |
| UniversalFeedCreator..> | 2023-10-14 16:35 | 24K | |
| Uranium-4.13.1_3,1.pkg | 2023-10-07 21:04 | 381K | |
| VVVVVV-2.3.6_3.pkg | 2023-10-08 17:03 | 342K | |
| VVVVVV-makeandplay-2..> | 2023-10-10 04:29 | 59M | |
| WWWdb-0.8.3_2.pkg | 2023-10-09 21:03 | 55K | |
| WebCalendar-php80-1...> | 2023-10-09 03:44 | 1.5M | |
| WebCalendar-php81-1...> | 2023-10-09 19:09 | 1.5M | |
| WebCalendar-php82-1...> | 2023-10-09 14:36 | 1.5M | |
| WebCalendar-php83-1...> | 2023-10-09 06:00 | 1.5M | |
| WinFF-gtk2-1.5.5_30.pkg | 2023-10-14 10:38 | 2.2M | |
| WordNet-3.0_4.pkg | 2023-10-07 09:45 | 7.5M | |
| XPostitPlus-2.3_3.pkg | 2023-10-10 20:26 | 33K | |
| XScreenSaver.App-2.3..> | 2023-10-14 18:56 | 18K | |
| Xaw3d-1.5E_8.pkg | 2023-10-07 08:45 | 297K | |
| Xbae-4.60.4_4.pkg | 2023-10-06 21:13 | 1.1M | |
| XmHTML-1.1.10_1.pkg | 2023-10-06 20:29 | 563K | |
| Xmt-4.0.0_1.pkg | 2023-10-10 06:45 | 451K | |
| ZeGrapher-3.1.1.2020..> | 2023-10-10 19:09 | 539K | |
| ZendFramework-php80-..> | 2023-10-10 12:29 | 1.2M | |
| ZendFramework-php81-..> | 2023-10-11 15:20 | 1.2M | |
| ZendFramework-php82-..> | 2023-10-09 23:09 | 1.2M | |
| ZendFramework-php83-..> | 2023-10-09 13:32 | 1.2M | |
| a2jmidid-9_3.pkg | 2023-10-08 21:57 | 26K | |
| a2pdf-1.13_2.pkg | 2023-10-10 07:34 | 9.4K | |
| a2png-0.1.5_11.pkg | 2023-10-08 12:53 | 12K | |
| a2ps-4.15.5_1.pkg | 2023-10-08 09:16 | 591K | |
| aalib-1.4.r5_13.pkg | 2023-10-06 13:21 | 129K | |
| aamath-0.3_4.pkg | 2023-10-14 14:08 | 29K | |
| aaphoto-0.43.1_15.pkg | 2023-10-08 15:53 | 38K | |
| aarch64-binutils-2.4..> | 2023-10-08 06:34 | 2.1M | |
| aarch64-freebsd-sysr..> | 2023-10-08 03:28 | 34M | |
| aarch64-gcc9-9.5.0_1..> | 2023-10-09 22:37 | 19M | |
| aarch64-none-elf-bin..> | 2023-10-06 19:05 | 2.2M | |
| aarch64-none-elf-gcc..> | 2023-10-07 10:19 | 34M | |
| aarch64-rust-bootstr..> | 2023-10-14 08:34 | 84M | |
| ab-av1-0.7.8_1.pkg | 2023-10-14 07:47 | 769K | |
| ab25-0.2.5.pkg | 2023-10-09 21:48 | 38K | |
| abGate-lv2-1.2.0_5.pkg | 2023-10-10 01:26 | 608K | |
| abbayedesmorts-2.0.1..> | 2023-10-14 10:17 | 1.4M | |
| abc-g20220920.pkg | 2023-10-06 20:08 | 4.8M | |
| abcde-2.9.3_1.pkg | 2023-10-09 19:01 | 66K | |
| abcl-1.9.2.pkg | 2023-10-10 20:53 | 10M | |
| abclock-1.0d_4.pkg | 2023-10-09 19:03 | 15K | |
| abcm2ps-8.14.14.pkg | 2023-10-14 03:32 | 215K | |
| abcselect-1.5.pkg | 2023-10-14 13:16 | 3.8K | |
| abduco-0.6.pkg | 2023-10-10 07:23 | 11K | |
| abe-1.1_9.pkg | 2023-10-09 19:35 | 2.8M | |
| abella-2.0.7.pkg | 2023-10-14 07:42 | 501K | |
| abgx360-1.0.6_1.pkg | 2023-10-08 21:39 | 157K | |
| abi-compliance-check..> | 2023-10-07 20:38 | 193K | |
| abinit-9.10.3.pkg | 2023-10-07 21:13 | 50M | |
| abiword-3.0.5_7.pkg | 2023-10-08 05:41 | 4.6M | |
| abiword-docs-3.0.1_1..> | 2023-10-10 18:05 | 1.0M | |
| abook-0.6.1_2.pkg | 2023-10-08 18:21 | 80K | |
| abs-0908_4.pkg | 2023-10-14 05:42 | 166K | |
| abseil-20230125.3.pkg | 2023-10-05 17:43 | 1.0M | |
| abuse_sdl-0.8_8.pkg | 2023-10-14 06:31 | 3.9M | |
| abx-0.1_2.pkg | 2023-10-09 02:25 | 16K | |
| abyss-2.3.7.pkg | 2023-10-14 07:50 | 1.4M | |
| acalc-0.3.pkg | 2023-10-10 01:30 | 85K | |
| accerciser-3.38.0_1.pkg | 2023-10-07 20:50 | 1.6M | |
| accounts-qml-module-..> | 2023-10-06 09:16 | 109K | |
| accountsservice-23.1..> | 2023-10-06 13:03 | 120K | |
| accrete-1.0_1.pkg | 2023-10-09 20:59 | 11K | |
| ace-of-penguins-1.4.pkg | 2023-10-14 14:33 | 204K | |
| acerhdf-kmod-0.1.4.pkg | 2023-10-10 22:51 | 7.9K | |
| acfax-0.981011_4.pkg | 2023-10-10 06:54 | 32K | |
| acfgfs-0.6.2.1_1.pkg | 2023-10-10 08:53 | 6.6K | |
| acidwarp-sdl-g202211..> | 2023-10-14 05:13 | 40K | |
| aclgen-2.02.pkg | 2023-10-10 01:26 | 10K | |
| aclip-0.6.2.1_1.pkg | 2023-10-08 23:17 | 6.5K | |
| aclock-0.4.0_10.pkg | 2023-10-07 12:40 | 155K | |
| acltool-1.16.2.pkg | 2023-10-14 04:33 | 45K | |
| acme-0.97.r324,1.pkg | 2023-10-07 20:58 | 147K | |
| acme-dns-1.0_11,1.pkg | 2023-10-09 19:56 | 3.3M | |
| acme-tiny-4.1.0.pkg | 2023-10-14 13:22 | 7.5K | |
| acme.sh-3.0.6_1.pkg | 2023-10-14 09:34 | 202K | |
| acmed-0.21.0_4.pkg | 2023-10-08 22:52 | 1.1M | |
| acmetool-0.2.2_4.pkg | 2023-10-08 23:32 | 2.9M | |
| acpi_call-1.0.1_1.pkg | 2023-10-08 14:31 | 5.7K | |
| acpica-tools-2022102..> | 2023-10-08 18:06 | 552K | |
| acsccid-1.1.10.pkg | 2023-10-10 13:34 | 59K | |
| actiona-3.10.1_6.pkg | 2023-10-09 12:24 | 1.6M | |
| activemq-5.18.1.pkg | 2023-10-10 10:53 | 36M | |
| activitymail-1.26.pkg | 2023-10-14 18:00 | 23K | |
| actor-framework-0.19..> | 2023-10-10 03:23 | 1.2M | |
| acts-1.4.2.pkg | 2023-10-09 14:31 | 6.1K | |
| ad2vcf-0.1.6.pkg | 2023-10-08 19:30 | 9.9K | |
| adacurses-20211021_1..> | 2023-10-08 06:50 | 377K | |
| adamem-1.0_4.pkg | 2023-10-10 03:01 | 465K | |
| adapta-backgrounds-0..> | 2023-10-10 04:41 | 5.0M | |
| adapta-gtk-theme-3.9..> | 2023-10-08 14:50 | 656K | |
| adcli-0.9.1.pkg | 2023-10-09 11:49 | 77K | |
| adcomplain-3.52.pkg | 2023-10-08 18:27 | 50K | |
| add-20230205.pkg | 2023-10-09 13:31 | 21K | |
| add-css-links-1.0_1.pkg | 2023-10-08 11:07 | 1.7K | |
| addresses-0.4.8_9.pkg | 2023-10-07 05:11 | 176K | |
| addresses-goodies-0...> | 2023-10-08 09:05 | 27K | |
| addrwatch-1.0.2.pkg | 2023-10-10 01:36 | 17K | |
| addts-1.0.pkg | 2023-10-09 22:34 | 9.8K | |
| adept-2.1.1_1.pkg | 2023-10-09 15:38 | 197K | |
| adguard-exporter-1.1..> | 2023-10-10 15:02 | 2.0M | |
| adguardhome-0.107.36..> | 2023-10-14 10:27 | 5.6M | |
| adios2-2.9.1.pkg | 2023-10-14 02:50 | 3.1M | |
| adjuster-3.23.23.pkg | 2023-10-10 13:17 | 227K | |
| admesh-0.98.5.pkg | 2023-10-10 02:15 | 37K | |
| adminer-4.8.1.pkg | 2023-10-08 13:17 | 274K | |
| admintools-g20201224..> | 2023-10-11 15:50 | 2.7K | |
| admiral-1.0.0.7_52.pkg | 2023-10-10 01:11 | 317K | |
| adms-2.3.7.pkg | 2023-10-08 02:45 | 162K | |
| adns-1.6.0.pkg | 2023-10-07 05:57 | 127K | |
| adobe-cmaps-20051217..> | 2023-10-06 09:54 | 1.6M | |
| adoc-mode.el-0.7.0_1..> | 2023-10-10 15:59 | 49K | |
| adoc-mode.el-emacs_c..> | 2023-10-14 05:19 | 49K | |
| adoc-mode.el-emacs_d..> | 2023-10-09 21:20 | 49K | |
| adoc-mode.el-emacs_d..> | 2023-10-14 14:46 | 49K | |
| adoc-mode.el-emacs_n..> | 2023-10-14 18:56 | 49K | |
| adodb5-php80-5.22.6.pkg | 2023-10-11 00:02 | 301K | |
| adodb5-php81-5.22.6.pkg | 2023-10-08 06:35 | 301K | |
| adodb5-php82-5.22.6.pkg | 2023-10-10 13:19 | 301K | |
| adodb5-php83-5.22.6.pkg | 2023-10-09 19:38 | 301K | |
| adol-c-2.7.2_6.pkg | 2023-10-10 04:10 | 330K | |
| adom-3.0.6.pkg | 2023-10-14 11:24 | 1.2M | |
| adonthell-0.3.8_2.pkg | 2023-10-08 03:07 | 246K | |
| adonthell-wastesedge..> | 2023-10-09 18:53 | 13M | |
| adplay-1.8.1_2.pkg | 2023-10-14 06:36 | 17K | |
| adsuck-2.3_9.pkg | 2023-10-10 14:39 | 1.6M | |
| adtool-1.3.3_3.pkg | 2023-10-09 08:29 | 12K | |
| advancecomp-2.5.pkg | 2023-10-08 15:52 | 148K | |
| adwaita-icon-theme-4..> | 2023-10-05 17:57 | 8.8M | |
| adwaita-qt5-1.4.2.pkg | 2023-10-09 10:28 | 186K | |
| adwaita-qt6-1.4.2.pkg | 2023-10-09 20:12 | 195K | |
| adzap-20110915_2.pkg | 2023-10-09 03:51 | 73K | |
| aee-2.2.22.pkg | 2023-10-09 21:28 | 88K | |
| aegis-4.25_14.pkg | 2023-10-10 20:16 | 10M | |
| aeolus-0.10.4_2.pkg | 2023-10-09 22:08 | 84K | |
| aerc-0.10.0_11.pkg | 2023-10-10 12:48 | 3.5M | |
| aescrypt-0.7_1.pkg | 2023-10-10 16:12 | 26K | |
| aeskulap-0.2.2.20190..> | 2023-10-08 20:40 | 242K | |
| aespipe-2.4e.pkg | 2023-10-09 11:12 | 27K | |
| aestats-5.39.pkg | 2023-10-10 22:54 | 320K | |
| aewan-1.0.01_1.pkg | 2023-10-11 05:20 | 53K | |
| af-aspell-0.50.0_1,1..> | 2023-10-08 20:57 | 848K | |
| af-libreoffice-7.5.5..> | 2023-10-08 03:25 | 748K | |
| afdko-3.9.7.pkg | 2023-10-06 17:35 | 658K | |
| affenspiel-1.0_2.pkg | 2023-10-10 10:36 | 9.2K | |
| affiche-0.6.0_12.pkg | 2023-10-07 10:19 | 35K | |
| afflib-3.7.16_1.pkg | 2023-10-07 22:33 | 364K | |
| afio-2.5.2.pkg | 2023-10-14 07:47 | 72K | |
| afl++-gcc-4.08.c.pkg | 2023-10-10 18:34 | 1.0M | |
| afl++-llvm-4.08.c.pkg | 2023-10-09 14:56 | 5.2M | |
| afm-1.0_1.pkg | 2023-10-10 21:52 | 58K | |
| afni-23.2.10.pkg | 2023-10-08 16:07 | 382M | |
| afpfs-ng-0.8.1_6.pkg | 2023-10-09 18:26 | 89K | |
| afsp-8.2.pkg | 2023-10-08 19:04 | 317K | |
| aft-5.098_1,1.pkg | 2023-10-10 12:50 | 61K | |
| aften-0.0.8.pkg | 2023-10-08 14:33 | 63K | |
| afterglow-1.6.2_2.pkg | 2023-10-09 13:21 | 56K | |
| afternoonstalker-1.1..> | 2023-10-10 15:29 | 93K | |
| afterstep-2.2.12_9.pkg | 2023-10-14 11:58 | 5.2M | |
| afterstep1-1.0_5.pkg | 2023-10-08 21:25 | 445K | |
| agame-1577_13.pkg | 2023-10-10 18:58 | 1.1M | |
| agar-1.7.0_1.pkg | 2023-10-10 08:06 | 4.4M | |
| agave-37.pkg | 2023-10-08 12:36 | 98K | |
| age-1.1.1_7.pkg | 2023-10-10 12:23 | 1.3M | |
| agedu-20211129.8cd63..> | 2023-10-08 21:50 | 47K | |
| aget-0.4.1_1.pkg | 2023-10-10 09:25 | 10K | |
| agg-2.5_11.pkg | 2023-10-07 00:30 | 285K | |
| aggregate-1.6_1.pkg | 2023-10-09 18:29 | 10K | |
| agrep-2.04_2.pkg | 2023-10-07 16:45 | 152K | |
| ags-3.6.0.52.pkg | 2023-10-09 21:41 | 1.2M | |
| ah-tty-0.3.12_3.pkg | 2023-10-08 16:09 | 360K | |
| aha-0.5.1.pkg | 2023-10-14 05:08 | 13K | |
| aichat-0.8.0_4.pkg | 2023-10-14 10:34 | 2.7M | |
| aide-0.17.4.pkg | 2023-10-14 08:55 | 540K | |
| aifad-2.0.8_1.pkg | 2023-10-09 21:11 | 482K | |
| aiksaurus-1.2.1_3.pkg | 2023-10-08 23:46 | 293K | |
| aimage-3.2.5_2.pkg | 2023-10-08 13:56 | 28K | |
| aircrack-ng-1.5.2_4.pkg | 2023-10-14 05:56 | 436K | |
| aircraft-datcom-0.0...> | 2023-10-11 05:39 | 37M | |
| aird-1.0.pkg | 2023-10-10 20:10 | 6.8K | |
| airsaned-0.3.4.0_1.pkg | 2023-10-09 04:03 | 179K | |
| airspy-1.0.10.pkg | 2023-10-07 16:11 | 35K | |
| airspyhf-1.6.8.7.pkg | 2023-10-08 08:11 | 28K | |
| aish-1.13.pkg | 2023-10-08 12:37 | 31K | |
| aisleriot-3.22.25_2.pkg | 2023-10-06 23:41 | 5.7M | |
| aixlog-1.5.0_1.pkg | 2023-10-08 20:05 | 7.9K | |
| akira-0.0.16_2.pkg | 2023-10-10 20:21 | 299K | |
| aklabeth-1.0.pkg | 2023-10-11 06:11 | 28K | |
| akmos-0.7.2_3.pkg | 2023-10-10 10:06 | 128K | |
| akonadi-23.08.1.pkg | 2023-10-06 14:29 | 2.2M | |
| akonadi-calendar-23...> | 2023-10-06 15:29 | 559K | |
| akonadi-calendar-too..> | 2023-10-14 04:03 | 369K | |
| akonadi-contacts-23...> | 2023-10-06 14:44 | 456K | |
| akonadi-import-wizar..> | 2023-10-06 22:39 | 660K | |
| akonadi-mime-23.08.1..> | 2023-10-06 14:36 | 184K | |
| akonadi-notes-23.08...> | 2023-10-06 14:35 | 28K | |
| akonadi-search-23.08..> | 2023-10-06 14:42 | 221K | |
| akonadiconsole-23.08..> | 2023-10-07 05:05 | 395K | |
| akpop3d-0.7.7.pkg | 2023-10-08 20:45 | 17K | |
| akregator-23.08.1.pkg | 2023-10-07 03:53 | 2.4M | |
| alac-0.0.7,1.pkg | 2023-10-11 15:20 | 38K | |
| alacenc-0.3.0.pkg | 2023-10-08 21:45 | 111K | |
| alacritty-0.12.2_2.pkg | 2023-10-10 18:24 | 1.5M | |
| alarm-clock-applet-0..> | 2023-10-09 18:28 | 143K | |
| albert-0.20.5_2.pkg | 2023-10-10 19:52 | 1.9M | |
| alberta-fem-3.0.3_1.pkg | 2023-10-06 23:22 | 7.5M | |
| alchemist.el-1.8.2_1..> | 2023-10-11 03:56 | 1.5M | |
| alchemist.el-emacs_c..> | 2023-10-10 13:57 | 1.5M | |
| alchemist.el-emacs_d..> | 2023-10-09 08:44 | 1.5M | |
| alchemist.el-emacs_d..> | 2023-10-10 22:10 | 1.5M | |
| alchemist.el-emacs_n..> | 2023-10-10 05:21 | 1.5M | |
| aldo-0.7.7_3.pkg | 2023-10-08 22:06 | 52K | |
| alef-1.0_4.pkg | 2023-10-07 11:15 | 71K | |
| alef-webfont-1.0_2.pkg | 2023-10-09 02:34 | 356K | |
| alegreya-2.008_1.pkg | 2023-10-09 16:13 | 1.3M | |
| alegreya-sans-2.008_..> | 2023-10-08 03:39 | 1.6M | |
| alembic-1.8.5_3.pkg | 2023-10-07 02:46 | 730K | |
| alephone-20230119_3.pkg | 2023-10-08 10:19 | 2.7M | |
| alephone-data-1.0_11..> | 2023-10-08 14:50 | 77M | |
| alephone-scenarios-1..> | 2023-10-10 20:16 | 40M | |
| alertmanager-0.23.0_..> | 2023-10-09 07:17 | 11M | |
| alex4-1.1_1.pkg | 2023-10-10 21:56 | 669K | |
| alfio-0.3.pkg | 2023-10-09 21:28 | 3.5K | |
| alfont-2.0.9_1,1.pkg | 2023-10-07 23:11 | 26K | |
| algae-4.3.6_19.pkg | 2023-10-08 16:47 | 766K | |
| alglib-4.00.0.pkg | 2023-10-14 16:40 | 1.5M | |
| algol68g-3.3.23.pkg | 2023-10-09 01:12 | 585K | |
| ali-0.7.5_15.pkg | 2023-10-09 03:49 | 2.1M | |
| alienarena-2013.766_..> | 2023-10-08 21:27 | 591K | |
| alienarena-data-2013..> | 2023-10-07 13:35 | 474M | |
| alienblaster-1.1.0_7..> | 2023-10-09 13:35 | 5.4M | |
| alienwah-1.13_1.pkg | 2023-10-08 12:50 | 5.0K | |
| alienwave-0.4.0.pkg | 2023-10-14 14:57 | 17K | |
| align-1.7.5.pkg | 2023-10-09 06:23 | 3.8K | |
| alignmargins-1.0_1.pkg | 2023-10-14 14:30 | 5.3K | |
| alizams-1.9.3.pkg | 2023-10-14 16:07 | 2.4M | |
| alkimia-8.1.2_1.pkg | 2023-10-07 13:18 | 240K | |
| allacrost-1.0.2_33.pkg | 2023-10-08 15:50 | 59M | |
| allegro-4.4.3.1_3.pkg | 2023-10-07 06:37 | 2.5M | |
| allegro5-5.2.7.0_7.pkg | 2023-10-09 00:15 | 7.0M | |
| alliance-5.1.1_5.pkg | 2023-10-08 16:33 | 4.1M | |
| alligator-23.08.1.pkg | 2023-10-14 18:05 | 92K | |
| alltraxclock-2.0.2_1..> | 2023-10-09 03:16 | 5.5K | |
| almostti-1.3.pkg | 2023-10-09 10:29 | 1.4M | |
| alo-lv2-0.9.pkg | 2023-10-09 15:13 | 394K | |
| aloadimage-0.6.2.1_1..> | 2023-10-08 18:24 | 111K | |
| alpine-2.26.pkg | 2023-10-07 11:01 | 1.9M | |
| alpng-1.3_4.pkg | 2023-10-07 15:43 | 18K | |
| alsa-lib-1.2.2_1.pkg | 2023-10-05 17:29 | 444K | |
| alsa-plugins-1.2.2_1..> | 2023-10-05 17:59 | 38K | |
| alsa-seq-server-1.1...> | 2023-10-08 08:58 | 19K | |
| alsa-sndio-0.2_1.pkg | 2023-10-14 10:26 | 4.7K | |
| alsa-utils-1.2.2_3.pkg | 2023-10-06 22:25 | 1.0M | |
| alt-ergo-0.95.2_4.pkg | 2023-10-14 03:10 | 3.2M | |
| alttab-1.7.0.pkg | 2023-10-09 17:44 | 41K | |
| alure-1.2_13.pkg | 2023-10-08 00:12 | 56K | |
| am-aspell-0.03.1_1,2..> | 2023-10-14 17:41 | 103K | |
| am-libreoffice-7.5.5..> | 2023-10-07 14:20 | 3.0M | |
| am-utils-6.2_11,1.pkg | 2023-10-11 07:04 | 314K | |
| amanda-client-3.5.1,..> | 2023-10-08 06:29 | 1.4M | |
| amanda-perl-wrapper-..> | 2023-10-07 00:20 | 2.5K | |
| amanda-server-3.5.1,..> | 2023-10-14 15:37 | 823K | |
| amass-4.2.0.pkg | 2023-10-08 21:07 | 15M | |
| amavis-logwatch-1.51..> | 2023-10-10 10:53 | 67K | |
| amavisd-milter-1.7.0..> | 2023-10-10 21:24 | 27K | |
| amavisd-new-2.12.2_1..> | 2023-10-08 11:49 | 721K | |
| amazon-qldb-shell-2...> | 2023-10-14 15:15 | 2.0M | |
| amazon-ssm-agent-2.3..> | 2023-10-10 02:52 | 13M | |
| amazon-ssm-plugin-1...> | 2023-10-09 12:59 | 5.9M | |
| amb-plugins-0.8.1_2.pkg | 2023-10-09 11:43 | 22K | |
| amber-code-search-re..> | 2023-10-14 05:35 | 743K | |
| amberfish-1.6.4_1.pkg | 2023-10-10 13:51 | 59K | |
| amberol-0.10.3_3.pkg | 2023-10-10 13:47 | 1.2M | |
| ambit-tensor-0.7.1.pkg | 2023-10-08 02:18 | 202K | |
| amd64-binutils-2.40_..> | 2023-10-08 10:02 | 2.2M | |
| amd64-freebsd-sysroo..> | 2023-10-07 12:25 | 42M | |
| amd64-gcc9-9.5.0_11.pkg | 2023-10-10 01:16 | 22M | |
| amd64-rust-bootstrap..> | 2023-10-10 13:03 | 78M | |
| amdmsrtweaker-1.1.pkg | 2023-10-09 21:36 | 13K | |
| amfora-1.9.2_16.pkg | 2023-10-14 02:04 | 2.8M | |
| amgcl-1.4.3_2.pkg | 2023-10-09 17:02 | 131K | |
| amigadepacker-0.04.pkg | 2023-10-09 16:10 | 13K | |
| amigafonts-1.02.pkg | 2023-10-09 17:22 | 27K | |
| aminal-0.9.0_16.pkg | 2023-10-14 06:34 | 3.7M | |
| amiwm-0.21.pl2_1.pkg | 2023-10-08 15:09 | 89K | |
| aml-0.3.0.pkg | 2023-10-07 00:52 | 10K | |
| ammonite-2.5.6.pkg | 2023-10-10 17:36 | 56M | |
| amnesia-tdd-0.3.2.pkg | 2023-10-08 17:02 | 1.7M | |
| amoebax-0.2.1_8.pkg | 2023-10-08 14:13 | 8.7M | |
| amp-0.6.2.27_5.pkg | 2023-10-09 06:32 | 1.2M | |
| ampache-php80-5.6.0.pkg | 2023-10-10 03:40 | 38M | |
| ampache-php81-5.6.0.pkg | 2023-10-14 12:01 | 38M | |
| ampache-php82-5.6.0.pkg | 2023-10-14 07:01 | 38M | |
| ampache-php83-5.6.0.pkg | 2023-10-14 07:15 | 38M | |
| ampasACES-container-..> | 2023-10-08 11:16 | 42K | |
| ampasCTL-1.5.2_20.pkg | 2023-10-14 05:44 | 1.0M | |
| amphetadesk-0.93.1_7..> | 2023-10-09 18:05 | 596K | |
| ample-0.5.7.pkg | 2023-10-09 07:41 | 27K | |
| amqp-cpp-4.1.4_1.pkg | 2023-10-09 12:31 | 151K | |
| amrstat-20070216_1.pkg | 2023-10-08 13:33 | 184K | |
| amsynth-1.11.0_4.pkg | 2023-10-10 05:45 | 955K | |
| amtc-0.8.5.pkg | 2023-10-14 10:27 | 62K | |
| amtk-5.6.0_1.pkg | 2023-10-06 16:34 | 79K | |
| amtterm-1.6.pkg | 2023-10-14 11:26 | 17K | |
| amule-2.3.3_9.pkg | 2023-10-08 15:29 | 3.6M | |
| an-1.2_16.pkg | 2023-10-08 19:34 | 8.0K | |
| anacron-2.3_7.pkg | 2023-10-14 08:40 | 14K | |
| analitza-23.08.1.pkg | 2023-10-06 19:38 | 477K | |
| analog-6.0_13,1.pkg | 2023-10-08 06:08 | 501K | |
| ancient-2.1.1.pkg | 2023-10-08 09:15 | 254K | |
| and-1.2.2_1.pkg | 2023-10-09 08:17 | 17K | |
| android-file-transfe..> | 2023-10-14 10:03 | 315K | |
| android-file-transfe..> | 2023-10-08 12:08 | 206K | |
| android-tools-31.0.3..> | 2023-10-07 13:51 | 1.7M | |
| anese-0.9.1.pkg | 2023-10-09 16:55 | 189K | |
| angband-4.2.2.pkg | 2023-10-08 20:15 | 22M | |
| angelscript-2.34.0.pkg | 2023-10-07 18:36 | 609K | |
| angie-1.2.0_1.pkg | 2023-10-07 21:10 | 2.0M | |
| angie-module-auth-jw..> | 2023-10-14 04:57 | 84K | |
| angie-module-auth-sp..> | 2023-10-10 20:37 | 47K | |
| angie-module-brotli-..> | 2023-10-14 13:49 | 50K | |
| angie-module-cache-p..> | 2023-10-14 18:50 | 43K | |
| angie-module-echo-1...> | 2023-10-14 07:12 | 144K | |
| angie-module-enhance..> | 2023-10-09 14:34 | 51K | |
| angie-module-eval-1...> | 2023-10-09 16:12 | 37K | |
| angie-module-geoip2-..> | 2023-10-09 20:21 | 48K | |
| angie-module-headers..> | 2023-10-08 17:19 | 64K | |
| angie-module-image-f..> | 2023-10-09 02:38 | 43K | |
| angie-module-jwt-1.2..> | 2023-10-09 23:39 | 36K | |
| angie-module-keyval-..> | 2023-10-10 22:22 | 33K | |
| angie-module-ndk-1.2..> | 2023-10-10 00:47 | 39K | |
| angie-module-njs-1.2..> | 2023-10-09 09:50 | 1.3M | |
| angie-module-perl-1...> | 2023-10-09 18:40 | 63K | |
| angie-module-postgre..> | 2023-10-11 01:17 | 131K | |
| angie-module-redis2-..> | 2023-10-10 00:00 | 66K | |
| angie-module-rtmp-1...> | 2023-10-09 14:18 | 403K | |
| angie-module-set-mis..> | 2023-10-08 14:08 | 131K | |
| angie-module-subs-1...> | 2023-10-08 20:58 | 41K | |
| angie-module-upload-..> | 2023-10-08 19:24 | 72K | |
| angie-module-vod-1.2..> | 2023-10-11 07:38 | 959K | |
| angie-module-xslt-1...> | 2023-10-09 08:47 | 47K | |
| angle-grinder-0.19.2..> | 2023-10-14 11:29 | 1.0M | |
| angrysearch-1.0.3_3.pkg | 2023-10-08 18:18 | 281K | |
| animorph-0.3_8.pkg | 2023-10-09 14:36 | 274K | |
| anjuta-3.34.0_4.pkg | 2023-10-11 16:47 | 5.0M | |
| anki-2.1.66_1.pkg | 2023-10-09 05:38 | 7.2M | |
| ann-1.1.2_1.pkg | 2023-10-09 09:44 | 363K | |
| annoy-1.17.3.pkg | 2023-10-08 16:24 | 15K | |
| anomaly-mono-g202103..> | 2023-10-10 18:44 | 324K | |
| anomy-sanitizer-1.76..> | 2023-10-10 05:57 | 88K | |
| anongitssh-0.2.pkg | 2023-10-09 21:57 | 6.8K | |
| anonymous-pro-1.002_..> | 2023-10-07 21:28 | 135K | |
| anope-2.0.14.pkg | 2023-10-09 19:14 | 3.1M | |
| ansible-sshjail-1.1...> | 2023-10-08 13:23 | 4.9K | |
| ansifilter-2.20.pkg | 2023-10-14 10:37 | 69K | |
| ansilove-4.2.0.pkg | 2023-10-09 06:57 | 25K | |
| ansiprint-1.0.pkg | 2023-10-09 08:31 | 5.2K | |
| ansiweather-1.18.0.pkg | 2023-10-09 02:26 | 7.6K | |
| ant-dracula-theme-4...> | 2023-10-14 13:45 | 1.4M | |
| antibody-6.1.1_15.pkg | 2023-10-08 19:51 | 1.2M | |
| antic-0.2.5_1,1.pkg | 2023-10-06 23:42 | 38K | |
| antimicro-2.23_3.pkg | 2023-10-09 00:28 | 673K | |
| antimicrox-3.3.4.pkg | 2023-10-10 18:40 | 1.1M | |
| antimony-cad-0.9.3.b..> | 2023-10-09 17:54 | 357K | |
| antimony-language-0...> | 2023-10-08 22:46 | 532K | |
| antioch-0.4.0.156_14..> | 2023-10-12 04:38 | 456K | |
| antipolix-2.1_2.pkg | 2023-10-14 18:20 | 41K | |
| antivirus-3.30_10.pkg | 2023-10-10 11:14 | 12K | |
| antiwm-0.0.5.pkg | 2023-10-08 14:21 | 8.9K | |
| antiword-0.37_4.pkg | 2023-10-07 12:34 | 139K | |
| antlr-2.7.7_2.pkg | 2023-10-06 23:54 | 647K | |
| antlr3-3.5.2_1.pkg | 2023-10-14 04:24 | 2.2M | |
| antlr4-4.12.0.pkg | 2023-10-14 13:37 | 2.7M | |
| anttweakbar-1.16_1.pkg | 2023-10-08 02:42 | 237K | |
| anubis-4.2_17.pkg | 2023-10-09 00:44 | 260K | |
| anvil-0.0.20.pkg | 2023-10-09 18:01 | 5.0K | |
| anydesk-6.1.1_2.pkg | 2023-10-08 16:14 | 3.6M | |
| anyremote-6.7.3.pkg | 2023-10-08 10:30 | 2.0M | |
| anyremote2html-1.4.pkg | 2023-10-11 07:46 | 591K | |
| aoe-1.2.0_4.pkg | 2023-10-08 19:18 | 14K | |
| aoi-3.0_5.pkg | 2023-10-08 12:36 | 24M | |
| aom-3.7.0.pkg | 2023-10-06 07:05 | 3.6M | |
| aop-0.6_2.pkg | 2023-10-08 21:19 | 10K | |
| ap-utils-1.4.1_5.pkg | 2023-10-09 18:12 | 162K | |
| ap24-mod_amazon_prox..> | 2023-10-09 22:38 | 4.8K | |
| ap24-mod_auth_cas-1...> | 2023-10-11 02:18 | 32K | |
| ap24-mod_auth_cookie..> | 2023-10-11 01:15 | 5.1K | |
| ap24-mod_auth_gssapi..> | 2023-10-09 03:55 | 58K | |
| ap24-mod_auth_kerb2-..> | 2023-10-09 02:55 | 12K | |
| ap24-mod_auth_mellon..> | 2023-10-14 04:30 | 46K | |
| ap24-mod_auth_mysql2..> | 2023-10-10 18:13 | 9.2K | |
| ap24-mod_auth_mysql_..> | 2023-10-09 12:11 | 14K | |
| ap24-mod_auth_openid..> | 2023-10-08 18:51 | 47K | |
| ap24-mod_auth_openid..> | 2023-10-14 12:37 | 156K | |
| ap24-mod_auth_pam2-1..> | 2023-10-14 17:52 | 6.4K | |
| ap24-mod_auth_pgsql2..> | 2023-10-12 09:05 | 14K | |
| ap24-mod_auth_pubtkt..> | 2023-10-14 09:42 | 10K | |
| ap24-mod_auth_tkt-2...> | 2023-10-12 12:19 | 37K | |
| ap24-mod_auth_xradiu..> | 2023-10-10 00:54 | 16K | |
| ap24-mod_authn_dovec..> | 2023-10-09 10:59 | 5.9K | |
| ap24-mod_authnz_exte..> | 2023-10-11 06:19 | 29K | |
| ap24-mod_authz_unixg..> | 2023-10-08 14:21 | 7.2K | |
| ap24-mod_cfg_ldap-1...> | 2023-10-08 21:51 | 7.2K | |
| ap24-mod_cloudflare-..> | 2023-10-09 12:30 | 5.0K | |
| ap24-mod_defensible-..> | 2023-10-10 17:30 | 4.0K | |
| ap24-mod_dnssd-0.6_1..> | 2023-10-07 14:24 | 10K | |
| ap24-mod_evasive-1.1..> | 2023-10-09 15:29 | 11K | |
| ap24-mod_fastcgi-2.4..> | 2023-10-07 08:42 | 42K | |
| ap24-mod_fcgid-2.3.9..> | 2023-10-11 07:22 | 44K | |
| ap24-mod_fileiri-1.1..> | 2023-10-08 20:10 | 5.0K | |
| ap24-mod_gnutls-0.12..> | 2023-10-10 03:13 | 41K | |
| ap24-mod_h264_stream..> | 2023-10-08 19:45 | 29K | |
| ap24-mod_http2-2.0.2..> | 2023-10-11 14:24 | 102K | |
| ap24-mod_jk-1.2.49,1..> | 2023-10-14 11:21 | 143K | |
| ap24-mod_limitipconn..> | 2023-10-14 06:39 | 6.9K | |
| ap24-mod_log_sql-1.1..> | 2023-10-09 08:36 | 52K | |
| ap24-mod_maxminddb-1..> | 2023-10-09 02:17 | 6.4K | |
| ap24-mod_memcache-0...> | 2023-10-10 23:31 | 3.5K | |
| ap24-mod_memcache_bl..> | 2023-10-09 09:24 | 6.5K | |
| ap24-mod_mono-3.13_2..> | 2023-10-09 23:13 | 29K | |
| ap24-mod_mpm_itk-2.4..> | 2023-10-08 23:57 | 6.7K | |
| ap24-mod_perl2-2.0.1..> | 2023-10-06 21:14 | 850K | |
| ap24-mod_proctitle-0..> | 2023-10-14 06:18 | 2.4K | |
| ap24-mod_qos-11.74.pkg | 2023-10-08 12:43 | 84K | |
| ap24-mod_realdoc-201..> | 2023-10-10 08:40 | 3.3K | |
| ap24-mod_reproxy-0.0..> | 2023-10-09 19:04 | 7.6K | |
| ap24-mod_rpaf2-0.8.4..> | 2023-10-09 22:30 | 6.6K | |
| ap24-mod_scgi-2.0.pkg | 2023-10-10 18:58 | 7.3K | |
| ap24-mod_security-2...> | 2023-10-10 07:51 | 268K | |
| ap24-mod_setenvifplu..> | 2023-10-10 20:02 | 15K | |
| ap24-mod_tidy-0.5.5_..> | 2023-10-09 07:29 | 7.2K | |
| ap24-mod_umask-0.1.0..> | 2023-10-09 07:15 | 2.3K | |
| ap24-mod_webkit-1.2...> | 2023-10-14 18:42 | 6.5K | |
| ap24-mod_xsendfile-0..> | 2023-10-14 14:52 | 5.0K | |
| ap24-py39-mod_wsgi-4..> | 2023-10-08 13:26 | 78K | |
| apache-ant-1.10.13.pkg | 2023-10-06 17:11 | 4.6M | |
| apache-bcel-6.4.1.pkg | 2023-10-14 10:19 | 1.4M | |
| apache-commons-beanu..> | 2023-10-07 01:27 | 414K | |
| apache-commons-cli-1..> | 2023-10-06 23:02 | 103K | |
| apache-commons-codec..> | 2023-10-06 17:03 | 592K | |
| apache-commons-colle..> | 2023-10-06 19:43 | 945K | |
| apache-commons-colle..> | 2023-10-06 22:00 | 1.6M | |
| apache-commons-compr..> | 2023-10-07 00:32 | 2.1M | |
| apache-commons-confi..> | 2023-10-11 02:06 | 620K | |
| apache-commons-csv-1..> | 2023-10-08 21:39 | 135K | |
| apache-commons-daemo..> | 2023-10-06 16:43 | 130K | |
| apache-commons-dbcp-..> | 2023-10-09 15:25 | 492K | |
| apache-commons-dbuti..> | 2023-10-11 22:13 | 157K | |
| apache-commons-diges..> | 2023-10-10 14:44 | 454K | |
| apache-commons-httpc..> | 2023-10-06 20:56 | 431K | |
| apache-commons-io-2...> | 2023-10-06 19:13 | 825K | |
| apache-commons-jelly..> | 2023-10-08 20:27 | 2.8M | |
| apache-commons-jxpat..> | 2023-10-09 04:02 | 675K | |
| apache-commons-lang-..> | 2023-10-07 14:31 | 510K | |
| apache-commons-lang3..> | 2023-10-06 19:43 | 1.7M | |
| apache-commons-loggi..> | 2023-10-06 17:38 | 116K | |
| apache-commons-math-..> | 2023-10-06 19:10 | 16K | |
| apache-commons-net-3..> | 2023-10-08 11:56 | 837K | |
| apache-commons-pool-..> | 2023-10-08 00:24 | 321K | |
| apache-jmeter-2.11_3..> | 2023-10-08 12:16 | 16M | |
| apache-log4j2-2.20.0..> | 2023-10-10 04:51 | 2.8M | |
| apache-mode.el-2.0_1..> | 2023-10-14 17:06 | 6.3K | |
| apache-openoffice-4...> | 2023-10-14 18:04 | 91M | |
| apache-openoffice-de..> | 2023-10-10 21:20 | 88M | |
| apache-poi-5.2.3.pkg | 2023-10-06 23:17 | 35M | |
| apache-rat-0.13.pkg | 2023-10-14 12:52 | 1.4M | |
| apache-solr-9.3.0,1.pkg | 2023-10-08 14:39 | 257M | |
| apache-solr8-8.11.2,..> | 2023-10-09 06:08 | 203M | |
| apache-spark-3.3.0.pkg | 2023-10-14 11:06 | 245M | |
| apache-xml-security-..> | 2023-10-06 19:36 | 450K | |
| apache-xmlbeans-5.1...> | 2023-10-07 02:34 | 2.1M | |
| apache24-2.4.57_1.pkg | 2023-10-06 17:30 | 5.1M | |
| apachetop-0.19.7.pkg | 2023-10-14 17:45 | 19K | |
| aparapi-1.0.0_1.pkg | 2023-10-14 11:40 | 490K | |
| apbs-1.5.102.pkg | 2023-10-10 00:33 | 19M | |
| apc-1.0_8.pkg | 2023-10-10 07:06 | 16K | |
| apcctrl-0.8.21_1.pkg | 2023-10-08 12:55 | 96K | |
| apcpwr-1.3_1.pkg | 2023-10-14 18:54 | 6.6K | |
| apcupsd-3.14.14_4.pkg | 2023-10-12 11:03 | 145K | |
| apel-10.8.20220720_5..> | 2023-10-06 15:45 | 45K | |
| apel-emacs_canna-10...> | 2023-10-06 18:23 | 45K | |
| apel-emacs_devel-10...> | 2023-10-06 18:23 | 45K | |
| apel-emacs_devel_nox..> | 2023-10-06 16:05 | 45K | |
| apel-emacs_nox-10.8...> | 2023-10-06 17:55 | 45K | |
| apertium-3.8.3_1.pkg | 2023-10-08 08:31 | 1.1M | |
| apertium-eng-0.1.0.2..> | 2023-10-08 14:26 | 2.9M | |
| apg-0.4.1_12,1.pkg | 2023-10-08 15:11 | 1.6M | |
| aphelia-g20190913.pkg | 2023-10-08 16:20 | 4.2K | |
| api-sanity-checker-1..> | 2023-10-08 23:31 | 95K | |
| apib-1.2.1_4.pkg | 2023-10-14 14:46 | 85K | |
| apinger-0.6.1_3.pkg | 2023-10-09 17:46 | 30K | |
| apitrace-9.0_2.pkg | 2023-10-11 06:02 | 2.1M | |
| apl385-20191020.pkg | 2023-10-09 15:56 | 82K | |
| apngasm-2.91.pkg | 2023-10-14 15:42 | 55K | |
| apngdis-2.9.pkg | 2023-10-10 02:12 | 8.8K | |
| apoolGL-0.99.22_9.pkg | 2023-10-10 09:48 | 1.5M | |
| app-builder-4.2.0.pkg | 2023-10-07 10:41 | 3.8M | |
| apparix-20110303.pkg | 2023-10-10 03:29 | 87K | |
| appcsxcad-0.2.2.9_6.pkg | 2023-10-10 06:13 | 11K | |
| appjail-2.7.1.pkg | 2023-10-07 10:30 | 157K | |
| appjail-devel-g20230..> | 2023-10-14 08:15 | 157K | |
| appmenu-gtk-module-0..> | 2023-10-07 19:20 | 48K | |
| appmenu-registrar-0...> | 2023-10-08 09:33 | 15K | |
| appres-1.0.5.pkg | 2023-10-07 08:39 | 5.6K | |
| appstream-glib-0.8.2..> | 2023-10-06 10:26 | 457K | |
| appwrapper-0.1_12.pkg | 2023-10-08 06:09 | 14K | |
| apr-1.7.3.1.6.3_1.pkg | 2023-10-06 11:57 | 467K | |
| apricots-0.2.8.pkg | 2023-10-14 11:13 | 215K | |
| apron-0.9.13.pkg | 2023-10-07 11:01 | 5.3M | |
| aprsc-2.1.10.pkg | 2023-10-14 11:25 | 394K | |
| aprsd-2.2.515_3.pkg | 2023-10-08 19:42 | 120K | |
| apt-cacher-ng-3.2.1.pkg | 2023-10-10 06:01 | 439K | |
| apt-mirror-devel-0.5..> | 2023-10-14 04:12 | 12K | |
| aptly-1.5.0_13.pkg | 2023-10-10 23:10 | 5.3M | |
| apwal-0.4.5_15.pkg | 2023-10-09 23:12 | 40K | |
| aqbanking-6.5.4.pkg | 2023-10-08 01:17 | 1.0M | |
| aqemu-0.9.2_3.pkg | 2023-10-14 06:16 | 1.4M | |
| aqualung-1.0_25.pkg | 2023-10-10 06:12 | 1.0M | |
| aquantia-atlantic-km..> | 2023-10-08 20:16 | 21K | |
| aquaria-1.002.22_9.pkg | 2023-10-09 13:55 | 1.4M | |
| aquatone-1.7.0_15.pkg | 2023-10-10 23:03 | 2.5M | |
| ar-ae_fonts1_ttf-1.1..> | 2023-10-07 18:31 | 732K | |
| ar-ae_fonts_mono-1.0..> | 2023-10-07 16:14 | 48K | |
| ar-arabtex-3.11_7.pkg | 2023-10-14 16:52 | 485K | |
| ar-aspell-1.2.0_1,1.pkg | 2023-10-14 04:23 | 4.2M | |
| ar-kacst_fonts-2.01_..> | 2023-10-07 11:46 | 243K | |
| ar-khotot-1.0_3.pkg | 2023-10-14 14:39 | 1.0K | |
| ar-libitl-0.8.0.pkg | 2023-10-14 12:31 | 1.2M | |
| ar-libreoffice-7.5.5..> | 2023-10-07 16:03 | 2.8M | |
| arachne-pnr-g2018102..> | 2023-10-07 02:12 | 6.4M | |
| arandr-0.1.10_2.pkg | 2023-10-08 20:14 | 87K | |
| aranym-1.1.0_3.pkg | 2023-10-14 17:43 | 568K | |
| arataga-0.5.4_1.pkg | 2023-10-09 00:06 | 547K | |
| aravis-0.8.20_1.pkg | 2023-10-14 13:05 | 56K | |
| arb-2.23.0_1.pkg | 2023-10-06 12:02 | 1.2M | |
| arbor-0.9.0.pkg | 2023-10-08 02:54 | 1.1M | |
| arborx-1.4.1_1.pkg | 2023-10-14 14:44 | 61K | |
| arc-5.21q.pkg | 2023-10-06 19:22 | 43K | |
| arc-gruvbox-theme-g2..> | 2023-10-09 15:11 | 154K | |
| arc_summary-20230609..> | 2023-10-10 16:52 | 9.7K | |
| arcan-0.6.2.1_2.pkg | 2023-10-08 07:37 | 1.7M | |
| arcan-trayicon-0.6.2..> | 2023-10-14 04:47 | 37K | |
| arcanist-lib-php80-2..> | 2023-10-08 04:56 | 1.5M | |
| arcanist-lib-php81-2..> | 2023-10-07 00:45 | 1.5M | |
| arcanist-lib-php82-2..> | 2023-10-08 07:30 | 1.5M | |
| arcanist-lib-php83-2..> | 2023-10-07 10:34 | 1.5M | |
| arcanist-php80-20220..> | 2023-10-10 13:56 | 840 | |
| arcanist-php81-20220..> | 2023-10-08 04:35 | 840 | |
| arcanist-php82-20220..> | 2023-10-08 20:39 | 840 | |
| arcanist-php83-20220..> | 2023-10-09 12:29 | 840 | |
| arcconf-4.01.24763_1..> | 2023-10-08 13:47 | 1.3M | |
| archey4-4.14.1.0.pkg | 2023-10-10 08:20 | 92K | |
| archimedes-2.0.1.pkg | 2023-10-08 23:18 | 50K | |
| archiva-2.2.3.pkg | 2023-10-09 20:06 | 64M | |
| archivemount-0.9.1.pkg | 2023-10-09 14:58 | 20K | |
| archiveopteryx-3.2.0..> | 2023-10-09 05:51 | 8.7M | |
| archiveopteryx-devel..> | 2023-10-10 05:39 | 8.7M | |
| archivesmtp-1.2_3.pkg | 2023-10-09 19:40 | 20K | |
| archlinux-keyring-20..> | 2023-10-10 08:38 | 1.1M | |
| archlinux-pacman-6.0..> | 2023-10-07 19:33 | 272K | |
| archmbox-4.10.0_1.pkg | 2023-10-08 15:28 | 29K | |
| ardour-7.5.0.pkg | 2023-10-10 23:20 | 13M | |
| arduino-1.0.6_4,1.pkg | 2023-10-07 12:25 | 6.5M | |
| arduino-avrdude-6.3_..> | 2023-10-06 19:10 | 200K | |
| arduino-bsd-mk-2.4.pkg | 2023-10-14 15:10 | 11K | |
| arduino-builder-1.3...> | 2023-10-08 05:30 | 864K | |
| arduino-core-1.6.18_..> | 2023-10-05 16:40 | 11M | |
| arduino-ctags-5.8_1.pkg | 2023-10-06 18:30 | 95K | |
| arduino-irremote-4.2..> | 2023-10-08 17:53 | 138K | |
| arduino-mk-0.10_5.pkg | 2023-10-14 18:43 | 15K | |
| arduino-openglcd-1.0..> | 2023-10-08 13:10 | 1.1M | |
| arduino-sevseg-3.7.0..> | 2023-10-10 08:38 | 8.0K | |
| arduino-tools-1.8.2_..> | 2023-10-07 10:01 | 1.3K | |
| arduino18-1.8.5_2.pkg | 2023-10-09 12:47 | 25M | |
| arduinoOTA-1.2.0_14.pkg | 2023-10-06 22:55 | 1.6M | |
| argc-1.10.0.pkg | 2023-10-09 23:30 | 315K | |
| argdata-0.7_4.pkg | 2023-10-06 20:33 | 17K | |
| argobots-1.1.186.pkg | 2023-10-10 16:19 | 126K | |
| argouml-0.34_2.pkg | 2023-10-12 09:48 | 17M | |
| argp-standalone-1.5...> | 2023-10-05 17:32 | 29K | |
| argparse-2.9_1.pkg | 2023-10-07 23:18 | 13K | |
| args-6.4.6.pkg | 2023-10-08 03:14 | 21K | |
| argtable-2.13_2.pkg | 2023-10-07 08:39 | 1.9M | |
| argus-clients-sasl-3..> | 2023-10-10 19:51 | 2.8M | |
| argus-sasl-3.0.8.2_1..> | 2023-10-14 09:15 | 168K | |
| argyllcms-1.9.2_6.pkg | 2023-10-10 12:21 | 5.4M | |
| aria2-1.36.0_2.pkg | 2023-10-07 05:06 | 2.3M | |
| arianna-1.0.1.pkg | 2023-10-10 15:44 | 256K | |
| aribas-1.64.pkg | 2023-10-09 19:10 | 185K | |
| aribb24-1.0.4.pkg | 2023-10-07 22:12 | 36K | |
| ario-1.6_3.pkg | 2023-10-09 11:40 | 382K | |
| arj-3.10.22_9.pkg | 2023-10-06 22:02 | 197K | |
| ark-23.08.1.pkg | 2023-10-07 03:20 | 1.4M | |
| arm-elf-binutils-2.3..> | 2023-10-10 02:20 | 2.1M | |
| arm-gnueabi-binutils..> | 2023-10-08 06:33 | 2.0M | |
| arm-none-eabi-binuti..> | 2023-10-06 22:06 | 2.0M | |
| arm-none-eabi-gcc-11..> | 2023-10-07 06:25 | 31M | |
| arm-none-eabi-newlib..> | 2023-10-14 11:15 | 1.1M | |
| armadillo-12.6.4.pkg | 2023-10-07 02:52 | 415K | |
| armagetronad-0.2.8.3..> | 2023-10-14 18:48 | 1.2M | |
| armv6-gcc9-9.5.0_11.pkg | 2023-10-14 03:38 | 20M | |
| armv7-freebsd-sysroo..> | 2023-10-07 11:05 | 31M | |
| armv7-gcc9-9.5.0_11.pkg | 2023-10-10 01:20 | 20M | |
| armv7-rust-bootstrap..> | 2023-10-10 12:22 | 84M | |
| arp-scan-1.10.0.pkg | 2023-10-08 14:49 | 451K | |
| arp-sk-0.0.16_5.pkg | 2023-10-09 17:34 | 15K | |
| arpCounterattack-1.2..> | 2023-10-14 07:01 | 509K | |
| arpack++-2.3.0_5.pkg | 2023-10-06 20:12 | 1.7M | |
| arpack-ng-3.9.0_1.pkg | 2023-10-06 11:42 | 221K | |
| arpc-0.7_2.pkg | 2023-10-07 00:04 | 31K | |
| arpdig-0.5.7.pkg | 2023-10-14 05:26 | 7.5K | |
| arping-2.21_1.pkg | 2023-10-09 22:34 | 18K | |
| arpoison-0.7_1.pkg | 2023-10-10 18:17 | 3.7K | |
| arprelease-1.2_5.pkg | 2023-10-10 01:51 | 3.3K | |
| arpscan-0.5_1.pkg | 2023-10-14 09:35 | 4.8K | |
| arpwatch-3.4.pkg | 2023-10-10 01:13 | 32K | |
| arqiver-0.9.0.pkg | 2023-10-10 16:14 | 117K | |
| arrow-13.0.0_1.pkg | 2023-10-06 22:35 | 16M | |
| arrow-datafusion-16...> | 2023-10-08 14:03 | 5.9M | |
| arrow-glib-13.0.0.pkg | 2023-10-07 02:51 | 852K | |
| arss-0.2.3_2.pkg | 2023-10-14 15:46 | 18K | |
| art-0.9.02.pkg | 2023-10-08 12:49 | 71K | |
| art-raw-image-editor..> | 2023-10-12 08:40 | 16M | |
| artemis-17.0.1.11.pkg | 2023-10-11 00:42 | 99M | |
| arti-1.1.8_1.pkg | 2023-10-10 02:18 | 2.0M | |
| artikulate-23.08.1.pkg | 2023-10-07 08:29 | 1.1M | |
| arts++-1.1.a13_2,1.pkg | 2023-10-08 12:41 | 456K | |
| arttime-2.1.2.pkg | 2023-10-14 16:18 | 291K | |
| artwiz-aleczapka-de-..> | 2023-10-09 16:07 | 21K | |
| artwiz-aleczapka-en-..> | 2023-10-10 11:49 | 23K | |
| artwiz-aleczapka-se-..> | 2023-10-11 01:02 | 20K | |
| artwiz-fonts-1.0_5.pkg | 2023-10-09 13:43 | 36K | |
| artyfx-lv2-1.3.1_1,1..> | 2023-10-10 01:51 | 96K | |
| arx-libertatis-1.2.1..> | 2023-10-09 01:16 | 1.7M | |
| as-libreoffice-7.5.5..> | 2023-10-07 13:56 | 346K | |
| asbutton-0.3_3.pkg | 2023-10-09 20:46 | 69K | |
| ascent-simulation-en..> | 2023-10-09 02:17 | 23K | |
| ascent-visualizer-0...> | 2023-10-10 00:56 | 2.9M | |
| ascii-invaders-1.0.1..> | 2023-10-14 18:18 | 8.3K | |
| ascii2binary-2.14_1.pkg | 2023-10-07 14:41 | 16K | |
| asciidoc-10.2.0_2.pkg | 2023-10-05 17:32 | 252K | |
| asciinema-agg-1.4.2_..> | 2023-10-14 05:19 | 2.1M | |
| asciiquarium-1.1_1.pkg | 2023-10-14 07:30 | 8.4K | |
| asclock-1.0_4.pkg | 2023-10-08 05:49 | 11K | |
| asclock-xlib-2.0.11_..> | 2023-10-08 13:31 | 77K | |
| ascpu-1.11_7.pkg | 2023-10-14 09:24 | 13K | |
| asedit-1.3.2_5.pkg | 2023-10-10 15:55 | 83K | |
| aseprite-1.2.9_10.pkg | 2023-10-14 15:51 | 1.4M | |
| asfsm-1.0.p15_3.pkg | 2023-10-14 03:03 | 64K | |
| asignify-1.0.pkg | 2023-10-09 20:06 | 71K | |
| asio-1.28.0.pkg | 2023-10-07 05:24 | 441K | |
| ask-2.5.3.pkg | 2023-10-09 15:23 | 76K | |
| asl-1.42.183.pkg | 2023-10-10 11:11 | 1.1M | |
| aslookup-0.13d.pkg | 2023-10-11 10:33 | 13K | |
| asm-xml-1.4.pkg | 2023-10-09 06:54 | 8.0K | |
| asm2html-1.7.pkg | 2023-10-14 17:27 | 9.9K | |
| asmail-2.1_4.pkg | 2023-10-14 13:13 | 121K | |
| asmctl-1.9.pkg | 2023-10-09 09:36 | 6.5K | |
| asmem-1.12_1.pkg | 2023-10-09 15:49 | 13K | |
| asmix-1.5_3.pkg | 2023-10-09 05:26 | 12K | |
| asmixer-0.5_3.pkg | 2023-10-10 22:31 | 8.6K | |
| asmjit-g20221210.pkg | 2023-10-07 11:17 | 372K | |
| asmx-1.8.2_2.pkg | 2023-10-10 13:21 | 128K | |
| asn1c-0.9.27.pkg | 2023-10-08 12:40 | 569K | |
| aspell-0.60.8_1,1.pkg | 2023-10-05 17:09 | 721K | |
| aspell-ispell-0.60.8..> | 2023-10-08 11:41 | 1.1K | |
| aspostit-1.3_7.pkg | 2023-10-10 22:47 | 33K | |
| asprint-1.0_3.pkg | 2023-10-11 05:44 | 5.0K | |
| asql-1.7.pkg | 2023-10-14 11:09 | 9.6K | |
| asr-manpages-2000040..> | 2023-10-14 18:04 | 21K | |
| asr10-1.0.pkg | 2023-10-10 04:08 | 18K | |
| assaultcube-1.3.0.2.pkg | 2023-10-09 09:01 | 40M | |
| assh-2.15.0_9.pkg | 2023-10-14 14:47 | 2.4M | |
| assimp-5.2.5.pkg | 2023-10-06 09:20 | 2.3M | |
| assp-1.9.9.14158,1.pkg | 2023-10-14 06:51 | 503K | |
| ast-aspell-0.01.pkg | 2023-10-09 09:50 | 303K | |
| ast-ksh-20141224_1.pkg | 2023-10-10 01:44 | 852K | |
| ast-libreoffice-7.5...> | 2023-10-08 01:18 | 2.7M | |
| astc-encoder-4.5.0.pkg | 2023-10-08 15:32 | 254K | |
| asterisk16-16.30.1.pkg | 2023-10-07 19:23 | 21M | |
| asterisk16-chan_sccp..> | 2023-10-14 11:49 | 435K | |
| asterisk16-espeak-5...> | 2023-10-09 09:42 | 7.5K | |
| asterisk16-flite-3.0..> | 2023-10-09 23:13 | 6.3K | |
| asterisk16-g72x-1.4...> | 2023-10-11 01:03 | 4.8K | |
| asterisk18-18.19.0.pkg | 2023-10-07 22:57 | 21M | |
| asterisk18-chan_sccp..> | 2023-10-09 20:00 | 434K | |
| asterisk18-espeak-5...> | 2023-10-10 14:32 | 7.5K | |
| asterisk18-flite-3.0..> | 2023-10-09 12:32 | 6.3K | |
| asterisk18-g72x-1.4...> | 2023-10-14 15:14 | 4.8K | |
| asteroids3d-0.5.1_9.pkg | 2023-10-10 21:38 | 459K | |
| astime-2.8_2.pkg | 2023-10-09 21:41 | 19K | |
| astroid-0.16_5.pkg | 2023-10-10 15:38 | 1.0M | |
| astromenace-1.4.2.pkg | 2023-10-14 05:56 | 49M | |
| astrometry-0.93_2.pkg | 2023-10-14 07:02 | 8.2M | |
| astron-0.0.20200521_..> | 2023-10-10 06:37 | 271K | |
| astyle-3.4.6.pkg | 2023-10-08 11:48 | 239K | |
| astzclock-1.0_2.pkg | 2023-10-09 16:49 | 16K | |
| asunder-2.9.6_3.pkg | 2023-10-10 11:37 | 130K | |
| asusoled-0.10_10.pkg | 2023-10-10 19:53 | 11K | |
| asylum-0.3.2_2.pkg | 2023-10-09 20:28 | 314K | |
| asymptote-2.81_3.pkg | 2023-10-10 04:53 | 3.9M | |
| async-0.1.1_7.pkg | 2023-10-14 15:09 | 507K | |
| asyncplusplus-1.1.pkg | 2023-10-09 02:23 | 32K | |
| at-spi2-core-2.48.0.pkg | 2023-10-05 17:51 | 508K | |
| atac-seq-0.1.3.pkg | 2023-10-09 20:02 | 708 | |
| atanks-6.5_3.pkg | 2023-10-08 16:26 | 4.4M | |
| atari800-3.1.0_2.pkg | 2023-10-09 17:01 | 443K | |
| ateam_mysql57_ldap_a..> | 2023-10-10 23:59 | 11K | |
| aterm-1.0.1_7.pkg | 2023-10-08 11:59 | 72K | |
| atf-0.21_1.pkg | 2023-10-07 10:01 | 421K | |
| atf-rk3328-v2.9.0_1.pkg | 2023-10-08 04:17 | 23K | |
| atf-rk3399-v2.9.0_1.pkg | 2023-10-08 11:55 | 43K | |
| atf-sun50i_a64-v2.9...> | 2023-10-08 07:19 | 16K | |
| atf-sun50i_h6-v2.9.0..> | 2023-10-07 20:06 | 15K | |
| atheme-services-7.2...> | 2023-10-09 02:37 | 1.0M | |
| athens-0.12.1_2.pkg | 2023-10-09 11:41 | 8.2M | |
| atkinson-hyperlegibl..> | 2023-10-09 15:29 | 130K | |
| atkmm-2.28.0_1.pkg | 2023-10-06 17:44 | 95K | |
| atlantis-0.23.5_3.pkg | 2023-10-11 08:43 | 6.6M | |
| atlast-1.2.pkg | 2023-10-09 04:30 | 344K | |
| atlc-4.6.1_1.pkg | 2023-10-14 11:43 | 1.5M | |
| atom-1.0.pkg | 2023-10-08 20:41 | 20K | |
| atomicparsley-202212..> | 2023-10-08 01:47 | 103K | |
| atomix-3.34.0_1.pkg | 2023-10-07 03:47 | 437K | |
| atompaw-4.2.0.3.pkg | 2023-10-07 06:18 | 4.0M | |
| atool-0.39.0.pkg | 2023-10-08 00:28 | 23K | |
| atop-2.0.2.b3_3.pkg | 2023-10-09 19:57 | 94K | |
| atp-1.50_2.pkg | 2023-10-10 02:03 | 83K | |
| atr3d-0.6_19.pkg | 2023-10-09 13:10 | 194K | |
| atril-1.26.0_20.pkg | 2023-10-07 22:33 | 1.3M | |
| atril-lite-1.26.0_20..> | 2023-10-14 07:52 | 1.2M | |
| atris-1.0.7_7.pkg | 2023-10-07 21:13 | 293K | |
| atris-sounds-1.0.1_2..> | 2023-10-14 10:42 | 507K | |
| atslog-2.1.1_8.pkg | 2023-10-11 11:01 | 427K | |
| atuin-16.0.0_1.pkg | 2023-10-14 11:05 | 3.5M | |
| atunes-3.1.2_5.pkg | 2023-10-09 03:34 | 15M | |
| aub-2.2_1.pkg | 2023-10-12 12:34 | 39K | |
| aubio-0.4.9_4.pkg | 2023-10-08 03:26 | 485K | |
| audacious-4.3.1_1.pkg | 2023-10-07 23:28 | 518K | |
| audacious-gtk2-4.3.1..> | 2023-10-08 03:43 | 477K | |
| audacious-gtk3-4.3.1..> | 2023-10-07 19:08 | 475K | |
| audacious-plugins-4...> | 2023-10-12 03:55 | 1.2M | |
| audacious-plugins-gt..> | 2023-10-14 18:02 | 1.1M | |
| audacious-plugins-gt..> | 2023-10-09 13:44 | 1.1M | |
| audacious-plugins-qt..> | 2023-10-10 23:06 | 1.2M | |
| audacious-qt6-4.3.1_..> | 2023-10-08 07:25 | 530K | |
| audacious-skins-1.0...> | 2023-10-14 05:45 | 8.0M | |
| audacity-3.3.3_1.pkg | 2023-10-09 21:35 | 7.2M | |
| audi-1.9.2.1_1.pkg | 2023-10-07 12:33 | 25K | |
| audiere-1.9.4_7.pkg | 2023-10-10 17:11 | 231K | |
| audiocd-kio-23.08.1.pkg | 2023-10-07 03:27 | 642K | |
| audiowmark-0.6.1_1.pkg | 2023-10-14 06:24 | 160K | |
| augeas-1.14.0_1.pkg | 2023-10-06 14:12 | 696K | |
| augustus-3.2.0_1.pkg | 2023-10-08 16:55 | 11M | |
| augustus-gene-predic..> | 2023-10-09 15:08 | 22M | |
| aumix-2.9.1_1.pkg | 2023-10-10 19:22 | 40K | |
| auralquiz-1.0.0_5.pkg | 2023-10-14 12:23 | 366K | |
| ausweisapp2-1.24.2.pkg | 2023-10-14 07:08 | 6.2M | |
| authelia-4.37.5_7.pkg | 2023-10-11 05:43 | 9.4M | |
| authenticator-4.3.1_..> | 2023-10-14 04:09 | 2.7M | |
| authoscope-0.8.1_7.pkg | 2023-10-08 16:23 | 1.9M | |
| auto-admin-0.7.18.7.pkg | 2023-10-08 11:20 | 99K | |
| autobackupmysql-1.4.pkg | 2023-10-09 18:39 | 7.3K | |
| autobench-2.1.2_9.pkg | 2023-10-14 15:41 | 24K | |
| autobook-1.5.pkg | 2023-10-14 16:21 | 265K | |
| autocd-3.02.12b_3.pkg | 2023-10-11 01:17 | 26K | |
| autoconf-2.71.pkg | 2023-10-05 17:18 | 550K | |
| autoconf-archive-202..> | 2023-10-06 12:45 | 398K | |
| autoconf-switch-2022..> | 2023-10-05 16:39 | 896 | |
| autoconf2.13-2.13.pkg | 2023-10-06 10:47 | 113K | |
| autoconf2.69-2.69.pkg | 2023-10-06 10:44 | 505K | |
| autocutsel-0.10.1.pkg | 2023-10-09 08:42 | 11K | |
| autodia-2.14_1.pkg | 2023-10-08 22:01 | 94K | |
| autogen-5.18.16_4.pkg | 2023-10-07 18:55 | 618K | |
| autojump-22.5.3_1.pkg | 2023-10-08 15:42 | 25K | |
| automake-1.16.5.pkg | 2023-10-05 17:19 | 545K | |
| automount-1.7.9.pkg | 2023-10-09 22:39 | 7.8K | |
| automounter-1.5.1.pkg | 2023-10-09 18:53 | 25K | |
| automuteus-7.2.7_12.pkg | 2023-10-10 04:45 | 4.0M | |
| automx-0.10.2_3.pkg | 2023-10-10 09:00 | 42K | |
| automysqlbackup-3.0...> | 2023-10-14 04:22 | 24K | |
| autopano-sift-C-2.5...> | 2023-10-11 17:10 | 88K | |
| autorandr-1.12.1.pkg | 2023-10-10 09:42 | 44K | |
| autorespond-2.0.5.pkg | 2023-10-07 01:54 | 7.4K | |
| autoscan-1.4.0.pkg | 2023-10-09 09:43 | 3.9M | |
| autossh-1.4g.pkg | 2023-10-12 11:58 | 23K | |
| autotalent-0.2_1.pkg | 2023-10-09 16:40 | 12K | |
| autotools-20220528.pkg | 2023-10-14 11:48 | 516 | |
| autotrace-0.31.1_34.pkg | 2023-10-09 13:14 | 127K | |
| autozen-2.1_8.pkg | 2023-10-09 22:04 | 86K | |
| av1an-0.4.1_7.pkg | 2023-10-11 12:02 | 1.0M | |
| avahi-0.8.pkg | 2023-10-10 09:58 | 740 | |
| avahi-app-0.8_1.pkg | 2023-10-05 17:53 | 335K | |
| avahi-autoipd-0.8_1.pkg | 2023-10-07 12:10 | 17K | |
| avahi-gtk-0.8_1.pkg | 2023-10-09 23:32 | 15K | |
| avahi-gtk3-0.8_1.pkg | 2023-10-07 05:07 | 24K | |
| avahi-header-0.8_1.pkg | 2023-10-06 22:20 | 2.7K | |
| avahi-libdns-0.8_1.pkg | 2023-10-06 14:28 | 29K | |
| avahi-qt5-0.8_1.pkg | 2023-10-10 12:54 | 5.8K | |
| avahi-sharp-0.8_1.pkg | 2023-10-14 05:04 | 18K | |
| avalon-framework-4.2..> | 2023-10-07 08:43 | 274K | |
| avanor-0.5.8.pkg | 2023-10-12 05:09 | 204K | |
| avarice-2.14.pkg | 2023-10-10 23:54 | 64K | |
| avce00-2.0.0.pkg | 2023-10-09 09:48 | 151K | |
| avenger-0.8.5.pkg | 2023-10-11 14:42 | 425K | |
| averiagwf-1.00_1.pkg | 2023-10-08 02:26 | 569K | |
| avfs-1.1.4.pkg | 2023-10-07 16:15 | 217K | |
| avida-2.12.4.pkg | 2023-10-14 14:28 | 2.3M | |
| avidemux-2.8.1_2.pkg | 2023-10-07 04:24 | 3.5M | |
| avidemux-cli-2.8.1_2..> | 2023-10-08 17:09 | 1.1M | |
| avidemux-plugins-2.8..> | 2023-10-09 02:29 | 1.3M | |
| avidemux-qt5-2.8.1_2..> | 2023-10-08 08:46 | 2.5M | |
| aview-1.3.0.r1_7.pkg | 2023-10-10 15:03 | 19K | |
| avir-3.0.pkg | 2023-10-07 12:34 | 41K | |
| avis-1.2.0_1.pkg | 2023-10-11 00:12 | 518K | |
| avldrums-lv2-0.7.2.pkg | 2023-10-10 08:22 | 74M | |
| avogadro2-1.97.0_1.pkg | 2023-10-14 12:51 | 1.2M | |
| avogadrolibs-1.97.0_..> | 2023-10-08 11:48 | 2.5M | |
| avoision-1.1_9.pkg | 2023-10-14 05:53 | 2.9M | |
| avp-20170505_1.pkg | 2023-10-10 13:57 | 656K | |
| avr-binutils-2.40_4,..> | 2023-10-06 15:14 | 1.7M | |
| avr-gcc-11.2.0_1.pkg | 2023-10-06 19:48 | 30M | |
| avr-gdb-7.3.1_6.pkg | 2023-10-14 14:25 | 1.2M | |
| avr-libc-2.0.0_5,1.pkg | 2023-10-06 21:07 | 667K | |
| avra-1.4.2.pkg | 2023-10-10 12:50 | 115K | |
| avrdude-7.2.pkg | 2023-10-07 00:01 | 588K | |
| avro-1.11.2.pkg | 2023-10-14 06:19 | 776 | |
| avro-c-1.11.2.pkg | 2023-10-07 16:31 | 207K | |
| avro-cpp-1.11.2.pkg | 2023-10-07 20:39 | 756K | |
| awale-1.6.pkg | 2023-10-10 16:40 | 364K | |
| awele-1.0_4.pkg | 2023-10-10 12:22 | 11K | |
| awesome-4.3_4,1.pkg | 2023-10-08 07:08 | 879K | |
| awesome-vicious-2.6...> | 2023-10-09 17:43 | 60K | |
| awffull-3.10.2_18.pkg | 2023-10-08 15:36 | 369K | |
| awgg-gtk2-0.6.0.6034..> | 2023-10-08 23:04 | 2.5M | |
| awgg-qt5-0.6.0.6034...> | 2023-10-10 01:12 | 2.5M | |
| awka-0.7.5_1.pkg | 2023-10-09 20:21 | 221K | |
| awless-0.1.11_17.pkg | 2023-10-14 08:26 | 6.1M | |
| aws-c-auth-0.7.3.pkg | 2023-10-06 12:04 | 77K | |
| aws-c-cal-0.6.2.pkg | 2023-10-06 09:21 | 25K | |
| aws-c-common-0.9.3,1..> | 2023-10-06 09:03 | 187K | |
| aws-c-compression-0...> | 2023-10-06 09:30 | 7.9K | |
| aws-c-event-stream-0..> | 2023-10-06 13:34 | 35K | |
| aws-c-http-0.7.12.pkg | 2023-10-06 10:09 | 140K | |
| aws-c-io-0.13.32.pkg | 2023-10-06 09:34 | 123K | |
| aws-c-mqtt-0.9.5.pkg | 2023-10-06 13:01 | 106K | |
| aws-c-s3-0.3.17.pkg | 2023-10-06 12:35 | 63K | |
| aws-c-sdkutils-0.1.1..> | 2023-10-06 10:46 | 35K | |
| aws-checksums-0.1.17..> | 2023-10-06 12:01 | 39K | |
| aws-crt-cpp-0.23.1.pkg | 2023-10-06 13:58 | 196K | |
| aws-ec2-imdsv2-get-1..> | 2023-10-07 19:53 | 172K | |
| aws-iam-authenticato..> | 2023-10-09 16:49 | 9.0M | |
| aws-sdk-cpp-1.11.160..> | 2023-10-06 19:15 | 63M | |
| aws-sdk-php80-3.273...> | 2023-10-09 15:09 | 2.5M | |
| aws-sdk-php81-3.273...> | 2023-10-08 12:23 | 2.5M | |
| aws-sdk-php82-3.273...> | 2023-10-09 14:35 | 2.5M | |
| aws-sdk-php83-3.273...> | 2023-10-10 21:50 | 2.5M | |
| aws-vault-6.6.2_6.pkg | 2023-10-09 09:23 | 2.8M | |
| awstats-7.9,1.pkg | 2023-10-14 05:57 | 2.1M | |
| axa-3.0.1_1.pkg | 2023-10-08 19:24 | 332K | |
| axc-0.3.7.pkg | 2023-10-08 09:23 | 24K | |
| axel-2.17.11.21.pkg | 2023-10-09 17:18 | 27K | |
| axfr2acl-1.01.pkg | 2023-10-09 14:39 | 8.9K | |
| axis2-1.8.0.pkg | 2023-10-08 23:29 | 31M | |
| axmldec-1.2.0_8.pkg | 2023-10-14 15:30 | 57K | |
| axom-0.7.0_1.pkg | 2023-10-08 06:42 | 1.6M | |
| ayatana-ido-0.9.3_2.pkg | 2023-10-06 23:06 | 78K | |
| aylet-0.5_7.pkg | 2023-10-08 13:29 | 40K | |
| az-aspell-0.02.0_1,2..> | 2023-10-09 22:28 | 122K | |
| azpainter-2.1.7_1.pkg | 2023-10-09 06:22 | 581K | |
| azpainterb-1.1.3_1.pkg | 2023-10-08 22:17 | 463K | |
| azure-agent-2.8.0.11..> | 2023-10-14 11:05 | 488K | |
| b2-1.3.8_1.pkg | 2023-10-09 19:18 | 141K | |
| b2sum-20190724_1.pkg | 2023-10-10 12:51 | 14K | |
| b3sum-1.3.1_13.pkg | 2023-10-08 14:59 | 322K | |
| b43-fwcutter-019.pkg | 2023-10-08 09:37 | 14K | |
| b612-1.008.pkg | 2023-10-07 20:07 | 209K | |
| babel-1.6_4.pkg | 2023-10-10 00:48 | 123K | |
| babeld-1.10_1.pkg | 2023-10-14 05:58 | 60K | |
| babelflow-1.1.0_1.pkg | 2023-10-09 06:27 | 179K | |
| babeltrace-1.5.7.pkg | 2023-10-14 18:41 | 264K | |
| babl-0.1.106.pkg | 2023-10-06 16:50 | 363K | |
| backdown-1.1.1_2.pkg | 2023-10-09 20:47 | 514K | |
| backuppc-3.3.2_5.pkg | 2023-10-14 13:15 | 398K | |
| backuppc-devel-4.3.3..> | 2023-10-09 18:10 | 460K | |
| backuppc4-4.4.0.pkg | 2023-10-10 23:59 | 465K | |
| backupuser-1.1.1.pkg | 2023-10-08 17:51 | 7.4K | |
| bacon-2.13.0.pkg | 2023-10-08 17:07 | 1.3M | |
| bacula-web-php80-8.7..> | 2023-10-08 18:57 | 3.2M | |
| bacula-web-php81-8.7..> | 2023-10-09 13:49 | 3.2M | |
| bacula-web-php82-8.7..> | 2023-10-10 21:32 | 3.2M | |
| bacula-web-php83-8.7..> | 2023-10-10 03:15 | 3.2M | |
| bacula9-client-9.6.7..> | 2023-10-08 09:56 | 362K | |
| bacula9-client-stati..> | 2023-10-10 22:20 | 2.0M | |
| bacula9-docs-9.6.7_1..> | 2023-10-08 18:13 | 10M | |
| bacula9-server-9.6.7..> | 2023-10-09 13:45 | 650K | |
| bacula11-client-11.0..> | 2023-10-07 15:41 | 411K | |
| bacula11-client-stat..> | 2023-10-10 20:43 | 2.0M | |
| bacula11-docs-11.0.6..> | 2023-10-14 06:52 | 14M | |
| bacula11-libs3-20200..> | 2023-10-14 13:24 | 93K | |
| bacula11-server-11.0..> | 2023-10-14 05:30 | 679K | |
| bacula13-client-13.0..> | 2023-10-08 02:45 | 419K | |
| bacula13-client-stat..> | 2023-10-09 09:44 | 2.1M | |
| bacula13-docs-13.0.1..> | 2023-10-09 09:00 | 14M | |
| bacula13-server-13.0..> | 2023-10-09 07:06 | 701K | |
| baculum-api-11.0.6.pkg | 2023-10-09 03:47 | 106K | |
| baculum-common-11.0...> | 2023-10-08 03:16 | 4.9M | |
| baculum-web-11.0.6_1..> | 2023-10-08 14:05 | 339K | |
| badwolf-1.2.2_2.pkg | 2023-10-12 12:45 | 62K | |
| bagel-1.2.2.132_5.pkg | 2023-10-14 07:07 | 32M | |
| baikal-0.9.3.pkg | 2023-10-10 21:22 | 1.0M | |
| baka-mplayer-2.0.4_1..> | 2023-10-09 12:19 | 368K | |
| balance-3.57.pkg | 2023-10-11 13:06 | 19K | |
| ballerburg-1.2.1.pkg | 2023-10-10 05:12 | 59K | |
| baloo-widgets-23.08...> | 2023-10-06 20:55 | 100K | |
| balsa-2.6.4.pkg | 2023-10-08 18:30 | 2.6M | |
| bam-0.4.0.pkg | 2023-10-09 13:20 | 100K | |
| bambootracker-0.6.3.pkg | 2023-10-09 19:31 | 1.1M | |
| bamf-0.5.6_1.pkg | 2023-10-07 08:19 | 133K | |
| bamp-lv2-g20210212.pkg | 2023-10-11 17:05 | 81K | |
| bamtools-2.5.2_1.pkg | 2023-10-07 18:30 | 317K | |
| bamutil-1.0.15.pkg | 2023-10-08 05:07 | 303K | |
| bandwhich-0.20.0_28.pkg | 2023-10-14 03:53 | 878K | |
| bandwidthd-2.0.1_12.pkg | 2023-10-11 08:21 | 36K | |
| bangr-lv2-1.6.2.pkg | 2023-10-08 12:27 | 230K | |
| banihstypos-0.2.pkg | 2023-10-09 07:25 | 6.3K | |
| baobab-43.0_1.pkg | 2023-10-07 05:46 | 279K | |
| bar-1.4.pkg | 2023-10-10 05:12 | 5.6K | |
| barcode-0.98_1.pkg | 2023-10-14 03:11 | 58K | |
| bareos-client-22.0.3..> | 2023-10-07 18:48 | 667K | |
| bareos-server-22.0.3..> | 2023-10-08 23:12 | 1.2M | |
| bareos-traymonitor-2..> | 2023-10-10 21:37 | 156K | |
| bareos-webui-22.0.3.pkg | 2023-10-10 23:24 | 3.9M | |
| bareos19-client-19.2..> | 2023-10-07 19:44 | 417K | |
| bareos19-server-19.2..> | 2023-10-09 20:49 | 798K | |
| bareos19-traymonitor..> | 2023-10-10 20:45 | 54K | |
| bareos19-webui-19.2...> | 2023-10-09 01:35 | 1.7M | |
| bareos20-client-20.0..> | 2023-10-07 17:29 | 467K | |
| bareos20-server-20.0..> | 2023-10-14 04:58 | 816K | |
| bareos20-traymonitor..> | 2023-10-10 14:14 | 53K | |
| bareos20-webui-20.0...> | 2023-10-08 21:10 | 1.8M | |
| bareos21-client-21.1..> | 2023-10-07 13:42 | 470K | |
| bareos21-server-21.1..> | 2023-10-09 03:22 | 713K | |
| bareos21-traymonitor..> | 2023-10-09 02:59 | 53K | |
| bareos21-webui-21.1...> | 2023-10-10 12:25 | 2.2M | |
| baresip-3.5.1.pkg | 2023-10-14 03:11 | 765K | |
| barnyard2-1.13_6.pkg | 2023-10-07 03:28 | 140K | |
| barnyard2-sguil-1.13..> | 2023-10-08 20:03 | 141K | |
| barony-3.3.7_2.pkg | 2023-10-10 19:40 | 1.1M | |
| barrage-1.0.7.pkg | 2023-10-08 20:01 | 252K | |
| barrier-2.4.0.pkg | 2023-10-11 18:14 | 640K | |
| barrnap-0.9.pkg | 2023-10-14 10:51 | 486K | |
| barvinok-0.41.7.pkg | 2023-10-09 09:27 | 294K | |
| bas2tap-2.6.pkg | 2023-10-14 12:24 | 23K | |
| base64-1.5_1.pkg | 2023-10-07 01:13 | 6.5K | |
| base91-0.6.0.pkg | 2023-10-09 11:45 | 6.8K | |
| bash-5.2.15.pkg | 2023-10-05 17:29 | 1.6M | |
| bash-completion-2.11..> | 2023-10-05 17:30 | 222K | |
| bash-static-5.2.15.pkg | 2023-10-09 21:56 | 2.0M | |
| bashc-5.1.8.pkg | 2023-10-11 02:29 | 1.6M | |
| bashdb-5.0.1.1.2.pkg | 2023-10-14 11:48 | 137K | |
| bashtop-0.9.25_1.pkg | 2023-10-14 14:08 | 45K | |
| basic-stats-0.1.2.pkg | 2023-10-09 02:00 | 53K | |
| basic256-2.0.0.11_2.pkg | 2023-10-08 22:38 | 551K | |
| basket-2.49.a.46_11.pkg | 2023-10-09 08:26 | 2.8M | |
| bass-1.2_5.pkg | 2023-10-14 10:42 | 63M | |
| bastet-0.43.2_5.pkg | 2023-10-09 01:19 | 72K | |
| bastille-0.9.2022071..> | 2023-10-08 21:18 | 37K | |
| bastillion-3.14.00.pkg | 2023-10-08 20:10 | 23M | |
| basu-0.2.1.pkg | 2023-10-06 10:02 | 189K | |
| bat-0.23.0_5.pkg | 2023-10-11 23:23 | 1.9M | |
| batik-1.16.pkg | 2023-10-07 06:00 | 7.9M | |
| batmon-0.8_6.pkg | 2023-10-07 16:15 | 32K | |
| bats-core-1.10.0.pkg | 2023-10-14 11:03 | 39K | |
| battalion-1.4b_3.pkg | 2023-10-11 19:20 | 1.2M | |
| batterycat-1.6_1.pkg | 2023-10-09 10:10 | 52K | |
| battmond-0.4_1.pkg | 2023-10-10 22:50 | 5.4K | |
| battray-2.3_1.pkg | 2023-10-10 06:07 | 42K | |
| batv-milter-0.5.0_2.pkg | 2023-10-12 05:09 | 37K | |
| bayespam-0.9.2_1.pkg | 2023-10-10 20:21 | 14K | |
| bazarr-1.3.0.pkg | 2023-10-14 13:16 | 20M | |
| bazel-6.2.0.pkg | 2023-10-14 10:13 | 28M | |
| bazel-buildtools-3.2..> | 2023-10-10 09:39 | 2.1M | |
| bazel029-0.29.0_2.pkg | 2023-10-08 10:29 | 25M | |
| bazel5-5.4.1.pkg | 2023-10-06 21:58 | 27M | |
| bb-1.3.r1_2.pkg | 2023-10-09 02:54 | 965K | |
| bbappconf-0.0.2_2.pkg | 2023-10-10 13:52 | 31K | |
| bbdate-0.2.4_3.pkg | 2023-10-09 22:26 | 22K | |
| bbdb-3.2.2.a_6.pkg | 2023-10-09 07:25 | 345K | |
| bbdb-emacs_canna-3.2..> | 2023-10-10 14:35 | 345K | |
| bbdb-emacs_devel-3.2..> | 2023-10-14 09:22 | 345K | |
| bbdb-emacs_devel_nox..> | 2023-10-11 04:53 | 345K | |
| bbdb-emacs_nox-3.2.2..> | 2023-10-09 13:59 | 345K | |
| bbdock-0.2.9_2.pkg | 2023-10-09 19:17 | 27K | |
| bbe-0.2.2_2.pkg | 2023-10-09 18:31 | 27K | |
| bbftp-client-3.2.1.pkg | 2023-10-09 11:50 | 55K | |
| bbftp-server-3.2.1.pkg | 2023-10-11 00:08 | 41K | |
| bbjd-1.01_1.pkg | 2023-10-09 01:22 | 29K | |
| bbkeys-0.9.1_1.pkg | 2023-10-11 11:43 | 129K | |
| bbmail-0.9.3.pkg | 2023-10-10 04:51 | 102K | |
| bbmap-38.92.pkg | 2023-10-07 18:49 | 4.2M | |
| bbpager-0.4.7_3.pkg | 2023-10-08 22:05 | 104K | |
| bbrun-1.6_14.pkg | 2023-10-08 13:13 | 12K | |
| bcal-2.4.pkg | 2023-10-14 05:37 | 24K | |
| bcc-1995.03.12_2.pkg | 2023-10-08 15:10 | 92K | |
| bcf-score-1.16_1.pkg | 2023-10-14 15:49 | 74K | |
| bcftools-1.17.pkg | 2023-10-07 21:10 | 719K | |
| bcg729-1.1.1.pkg | 2023-10-06 22:41 | 48K | |
| bchoppr-lv2-1.12.6.1..> | 2023-10-09 16:36 | 337K | |
| bchunk-1.2.2.pkg | 2023-10-08 20:22 | 8.1K | |
| bclock-1.0_2.pkg | 2023-10-10 07:55 | 9.8K | |
| bcmatroska2-5.2.1_1.pkg | 2023-10-06 18:56 | 131K | |
| bcpp-20230130.pkg | 2023-10-09 16:36 | 31K | |
| bcrypt-1.1.pkg | 2023-10-14 06:22 | 15K | |
| bctoolbox-5.2.94.pkg | 2023-10-06 14:50 | 200K | |
| bcunit-5.2.62.pkg | 2023-10-06 13:28 | 56K | |
| bcwipe-1.9.13.pkg | 2023-10-09 11:15 | 27K | |
| bddsolve-1.04_13.pkg | 2023-10-08 11:59 | 96K | |
| bdelta-0.3.1.pkg | 2023-10-07 01:47 | 20K | |
| bdes-1993.pkg | 2023-10-11 17:31 | 15K | |
| bdf2sfd-1.1.8.pkg | 2023-10-09 17:15 | 6.5K | |
| bdfresize-1.5_2.pkg | 2023-10-10 00:34 | 12K | |
| bdftopcf-1.1_2.pkg | 2023-10-05 16:42 | 22K | |
| be-aspell-0.01_1,2.pkg | 2023-10-11 10:33 | 8.9M | |
| be-libreoffice-7.5.5..> | 2023-10-07 20:14 | 442K | |
| beacon-1.4_4.pkg | 2023-10-14 07:52 | 84K | |
| beadm-1.3.5.pkg | 2023-10-10 13:44 | 9.8K | |
| beadm-devel-1.2.99.2..> | 2023-10-14 09:01 | 8.9K | |
| beancount-2.3.5.pkg | 2023-10-07 16:01 | 892K | |
| beanie-0.8.2_1.pkg | 2023-10-11 17:11 | 196K | |
| beansdb-0.7.1.4.pkg | 2023-10-09 14:13 | 84K | |
| beanstalkd-1.12.pkg | 2023-10-07 10:36 | 35K | |
| bear-3.1.3_1.pkg | 2023-10-10 15:12 | 375K | |
| bearssl-0.6.pkg | 2023-10-10 12:37 | 290K | |
| beats7-7.17.11_2.pkg | 2023-10-08 11:42 | 32M | |
| beats8-8.8.2_2.pkg | 2023-10-14 17:48 | 33M | |
| beav-1.40.18_3.pkg | 2023-10-10 01:18 | 59K | |
| bedtools-2.31.0.pkg | 2023-10-07 04:30 | 528K | |
| bee-host-1.3.6.pkg | 2023-10-09 08:48 | 7.8K | |
| beebeep-5.8.4.pkg | 2023-10-08 12:23 | 22M | |
| beecrypt-4.2.1_2.pkg | 2023-10-14 08:52 | 131K | |
| beehive-0.4.0_16.pkg | 2023-10-08 12:04 | 7.4M | |
| beep-1.0_1.pkg | 2023-10-14 10:25 | 5.3K | |
| beets-1.6.0_3.pkg | 2023-10-10 12:07 | 626K | |
| beforelight-1.0.5_1.pkg | 2023-10-10 04:21 | 5.6K | |
| beid-5.0.28_3.pkg | 2023-10-09 10:58 | 455K | |
| belcard-5.2.94.pkg | 2023-10-07 05:01 | 220K | |
| belle-sip-5.2.94.pkg | 2023-10-06 22:53 | 626K | |
| belooted-0.1.4.1_8.pkg | 2023-10-14 12:05 | 80K | |
| belr-5.2.94.pkg | 2023-10-06 16:29 | 148K | |
| bemenu-0.6.15.pkg | 2023-10-07 13:19 | 66K | |
| benchmark-1.8.3.pkg | 2023-10-06 11:15 | 124K | |
| bencodetools-g202211..> | 2023-10-08 04:59 | 25K | |
| beret-1.2.1.pkg | 2023-10-09 14:26 | 41M | |
| berry-0.1.9.pkg | 2023-10-08 12:36 | 22K | |
| bestfit-0.2.0.pkg | 2023-10-10 06:49 | 13K | |
| bfbtester-2.0.1_1.pkg | 2023-10-09 13:15 | 14K | |
| bfc-g20150417.pkg | 2023-10-08 00:27 | 26K | |
| bfe2-20030723_11.pkg | 2023-10-10 08:24 | 21K | |
| bfg-1.14.0.pkg | 2023-10-12 10:39 | 12M | |
| bfhist-0.4.pkg | 2023-10-11 05:03 | 5.6K | |
| bforce-kst-0.22.8.7_..> | 2023-10-14 11:09 | 176K | |
| bfs-3.0.2.pkg | 2023-10-08 16:20 | 90K | |
| bftpd-6.1.pkg | 2023-10-09 23:56 | 75K | |
| bg-aspell-4.1.0_1,2.pkg | 2023-10-09 05:53 | 718K | |
| bg-hyphen-4.3_1.pkg | 2023-10-10 16:09 | 3.5K | |
| bg-libreoffice-7.5.5..> | 2023-10-08 00:20 | 3.2M | |
| bg-mythes-4.3_1.pkg | 2023-10-14 02:54 | 694K | |
| bgfx-1.121.8558.454.pkg | 2023-10-10 14:06 | 4.8M | |
| bglibs-2.04_1,1.pkg | 2023-10-07 00:00 | 519K | |
| bgpq3-0.1.36.pkg | 2023-10-14 08:20 | 32K | |
| bgpq4-1.11.pkg | 2023-10-08 11:49 | 36K | |
| bgpuma-20151209_1.pkg | 2023-10-14 09:33 | 28K | |
| bgrot-1.31.pkg | 2023-10-10 08:14 | 3.8K | |
| bgs-0.8.pkg | 2023-10-08 15:37 | 5.8K | |
| bharvestr-lv2-g20201..> | 2023-10-08 13:32 | 671K | |
| bhyve+-0.1.0.pkg | 2023-10-07 03:00 | 352K | |
| bhyve-firmware-1.0_1..> | 2023-10-07 03:11 | 504 | |
| bhyve-rc-4.pkg | 2023-10-10 21:14 | 2.4K | |
| biabam-0.9.7_2.pkg | 2023-10-11 15:50 | 2.6K | |
| bib2html-6.7.pkg | 2023-10-10 00:15 | 94K | |
| bibclean-3.06.pkg | 2023-10-08 23:23 | 114K | |
| bibcursed-2.0.1.pkg | 2023-10-10 08:47 | 14K | |
| bible-kjv-4.38.pkg | 2023-10-10 15:53 | 2.4M | |
| biblesync-2.1.0.pkg | 2023-10-07 20:56 | 34K | |
| bibletime-2.11.2_5.pkg | 2023-10-08 18:52 | 1.5M | |
| biblical-curse-0.02.pkg | 2023-10-14 08:50 | 2.1K | |
| biboumi-9.0_2.pkg | 2023-10-09 13:41 | 2.9M | |
| bibtex2html-1.99_1.pkg | 2023-10-14 05:43 | 480K | |
| bibtexconv-1.2.0.pkg | 2023-10-11 16:17 | 137K | |
| bibutils-7.2.pkg | 2023-10-09 17:03 | 1.1M | |
| bibview-2.2_2.pkg | 2023-10-14 13:54 | 72K | |
| bicom-1.01.pkg | 2023-10-09 21:57 | 28K | |
| bicon-0.5.pkg | 2023-10-08 13:15 | 35K | |
| biew-6.1.0_4.pkg | 2023-10-09 18:55 | 437K | |
| bifrost-1.2.1_1.pkg | 2023-10-10 23:27 | 830K | |
| bigyear-20010226,1.pkg | 2023-10-08 18:46 | 5.6K | |
| bijiben-40.1_5.pkg | 2023-10-10 07:34 | 271K | |
| billardgl-1.75_2.pkg | 2023-10-14 03:54 | 475K | |
| biloba-0.9.3_5.pkg | 2023-10-10 19:39 | 2.5M | |
| binary-cvsup-static-..> | 2023-10-08 20:27 | 782K | |
| binaryen-116.pkg | 2023-10-07 15:11 | 3.3M | |
| binbloom-2.0.12.pkg | 2023-10-09 22:20 | 18K | |
| bincimap-1.2.13_3.pkg | 2023-10-08 12:19 | 262K | |
| binclock-1.5.pkg | 2023-10-08 12:40 | 6.3K | |
| bind-tools-9.18.16.pkg | 2023-10-07 01:53 | 1.4M | |
| bind9-devel-9.19.3.2..> | 2023-10-08 17:01 | 6.5M | |
| bind916-9.16.42.pkg | 2023-10-09 22:55 | 8.1M | |
| bind918-9.18.16.pkg | 2023-10-07 18:31 | 6.6M | |
| bind_exporter-0.7.0_..> | 2023-10-14 05:38 | 3.2M | |
| bindgraph-0.3_1.pkg | 2023-10-10 05:40 | 8.9K | |
| bindtest-1.56_1.pkg | 2023-10-11 03:04 | 13K | |
| bined-0.2.2.pkg | 2023-10-09 00:01 | 3.9M | |
| bingrep-0.11.0_6.pkg | 2023-10-10 00:16 | 1.2M | |
| bingrok-0.0.1.pkg | 2023-10-09 22:27 | 40K | |
| biniax2-1.30_9.pkg | 2023-10-10 08:48 | 2.3M | |
| binkd-1.1.a.115.pkg | 2023-10-09 07:15 | 121K | |
| bino-1.6.5_8.pkg | 2023-10-14 15:07 | 544K | |
| binocle-0.3.1_4.pkg | 2023-10-14 06:44 | 2.1M | |
| binutils-2.40_4,1.pkg | 2023-10-05 17:46 | 11M | |
| binwalk-2.3.3.pkg | 2023-10-09 12:25 | 147K | |
| bio-mocha-1.16.pkg | 2023-10-14 08:35 | 88K | |
| bioawk-1.0.7.pkg | 2023-10-07 16:13 | 58K | |
| biococoa-2.2.2_8.pkg | 2023-10-07 21:47 | 134K | |
| biodiff-1.1.0_2.pkg | 2023-10-09 15:21 | 853K | |
| biolibc-0.2.5.pkg | 2023-10-06 23:55 | 310K | |
| biolibc-tools-0.1.4...> | 2023-10-08 02:23 | 28K | |
| bioparser-3.1.0.pkg | 2023-10-08 07:41 | 6.3K | |
| biorythm-1.1.4.pkg | 2023-10-10 02:50 | 7.9K | |
| biosfont-1.3.pkg | 2023-10-08 07:13 | 4.5K | |
| biosfont-demos-1.3.pkg | 2023-10-10 04:36 | 5.4K | |
| biosig-2.5.2.pkg | 2023-10-07 05:50 | 1.6M | |
| biosoup-0.11.0_1.pkg | 2023-10-07 07:08 | 5.9K | |
| bip-0.9.0.r4.pkg | 2023-10-08 23:18 | 113K | |
| bird-1.6.8.pkg | 2023-10-14 11:18 | 218K | |
| bird2-2.13.1.pkg | 2023-10-14 06:52 | 354K | |
| bird6-1.6.8.pkg | 2023-10-10 06:47 | 241K | |
| birda-1.3.pkg | 2023-10-08 20:59 | 60K | |
| birdfont-2.32.3_2.pkg | 2023-10-11 06:05 | 2.8M | |
| birdtray-1.11.4.pkg | 2023-10-10 02:48 | 331K | |
| birthday-1.6.2.pkg | 2023-10-09 10:06 | 12K | |
| bison-3.8.2,1.pkg | 2023-10-05 17:22 | 687K | |
| bit-1.1.2_15.pkg | 2023-10-09 08:51 | 2.8M | |
| bitchx-1.2.1_3,1.pkg | 2023-10-11 11:50 | 1.0M | |
| bitcoin-25.0.pkg | 2023-10-10 07:59 | 6.6M | |
| bitcoin-daemon-25.0.pkg | 2023-10-10 01:55 | 3.6M | |
| bitcoin-utils-25.0.pkg | 2023-10-08 07:17 | 9.2M | |
| bitedit-0.9.4.pkg | 2023-10-10 06:11 | 8.4K | |
| bitefusion-1.0.2_3.pkg | 2023-10-08 20:09 | 56K | |
| bitflu-1.52.pkg | 2023-10-09 15:26 | 131K | |
| bitkeeper-7.3.3_6.pkg | 2023-10-09 20:23 | 5.9M | |
| bitlbee-3.6_1.pkg | 2023-10-08 02:30 | 239K | |
| bitlbee-discord-0.4...> | 2023-10-09 09:53 | 22K | |
| bitlbee-facebook-1.2..> | 2023-10-08 18:11 | 52K | |
| bitlbee-mastodon-1.4..> | 2023-10-09 15:26 | 43K | |
| bitlbee-steam-1.4.2.pkg | 2023-10-14 07:32 | 26K | |
| bitmap-1.0.9.pkg | 2023-10-07 04:01 | 49K | |
| bitmap-graphics-libr..> | 2023-10-08 17:40 | 24K | |
| bitmap2pp-4.35.0_1.pkg | 2023-10-09 07:23 | 137K | |
| bitmark-0.15.4_4.pkg | 2023-10-09 17:04 | 9.0M | |
| bitmark-cli-0.15.4_4..> | 2023-10-14 09:15 | 9.0M | |
| bitmark-daemon-0.15...> | 2023-10-14 02:28 | 4.5M | |
| bitmark-recorder-0.1..> | 2023-10-14 15:38 | 2.1M | |
| bitstream-1.5.pkg | 2023-10-07 17:08 | 88K | |
| bitstream-vera-1.10_..> | 2023-10-08 05:43 | 215K | |
| bitter-2.110,1.pkg | 2023-10-10 14:13 | 185K | |
| bittwist-3.8.pkg | 2023-10-09 17:18 | 36K | |
| bitwarden-cli-2023.8..> | 2023-10-14 03:42 | 17M | |
| bitwise-0.50.pkg | 2023-10-10 03:59 | 17K | |
| bjumblr-lv2-1.6.8_1.pkg | 2023-10-08 13:33 | 404K | |
| bkmrkconv-1.12.pkg | 2023-10-09 11:09 | 9.0K | |
| bkpupsd-1.0a.pkg | 2023-10-10 12:24 | 5.8K | |
| bksh-1.7.pkg | 2023-10-14 15:52 | 4.8K | |
| bkt-0.7.1_1.pkg | 2023-10-09 17:33 | 332K | |
| black-box-1.4.8_3.pkg | 2023-10-14 18:54 | 226K | |
| black-hole-solver-1...> | 2023-10-06 21:44 | 15K | |
| blackbox-0.70.1_7.pkg | 2023-10-08 03:36 | 264K | |
| blackbox_exporter-0...> | 2023-10-10 14:17 | 4.1M | |
| blackout-g20140730.pkg | 2023-10-09 23:04 | 107K | |
| blackshadeselite-0.0..> | 2023-10-09 12:37 | 822K | |
| blacs-1.7_39.pkg | 2023-10-14 04:57 | 437K | |
| bladeRF-2023.02.pkg | 2023-10-08 01:52 | 276K | |
| blahtexml-1.0.pkg | 2023-10-09 09:22 | 270K | |
| blame-1.3.1.20221108..> | 2023-10-10 19:03 | 52K | |
| blas-3.11.0_1.pkg | 2023-10-06 08:26 | 137K | |
| blasfeo-0.1.3.59_1.pkg | 2023-10-08 07:15 | 547K | |
| blaspp-2022.05.00_1.pkg | 2023-10-07 06:15 | 112K | |
| blaze-3.8_2.pkg | 2023-10-07 17:54 | 1.1M | |
| blazeiterative-g2018..> | 2023-10-09 12:24 | 5.7K | |
| blender-3.6.1_4.pkg | 2023-10-09 11:22 | 53M | |
| blender-doc-3.5.pkg | 2023-10-09 12:20 | 476M | |
| bless-0.6.3_3,1.pkg | 2023-10-10 00:22 | 470K | |
| blind-1.1.pkg | 2023-10-09 02:20 | 97K | |
| blinken-23.08.1.pkg | 2023-10-07 02:31 | 2.3M | |
| blinkensisters-with-..> | 2023-10-10 07:21 | 75M | |
| blis-0.9.0_2.pkg | 2023-10-08 00:18 | 3.2M | |
| blisp-g20230703.pkg | 2023-10-08 19:24 | 66K | |
| bliss-graph-tool-0.7..> | 2023-10-07 21:28 | 78K | |
| bliss-music-analyzer..> | 2023-10-10 16:07 | 14K | |
| blitz-1.0.2_4.pkg | 2023-10-10 18:25 | 220K | |
| bloaty-1.1_11.pkg | 2023-10-10 20:10 | 151K | |
| blobby-1.1.1,1.pkg | 2023-10-10 13:46 | 1.4M | |
| blobwars-2.00_1.pkg | 2023-10-14 17:36 | 64M | |
| block-0.6.pkg | 2023-10-14 12:25 | 18K | |
| blockattack-2.8.0_2.pkg | 2023-10-14 02:56 | 6.2M | |
| blockout-2.5_5.pkg | 2023-10-09 10:06 | 4.1M | |
| blockrage-0.2.3_6.pkg | 2023-10-14 11:27 | 67K | |
| blocksolve95-3.0_27.pkg | 2023-10-09 21:28 | 251K | |
| blocky-0.22_1.pkg | 2023-10-14 12:21 | 5.2M | |
| blogbench-1.1_1.pkg | 2023-10-08 19:58 | 8.0K | |
| blokish-0.9.4_13.pkg | 2023-10-10 00:40 | 64K | |
| bloodfrontier-b2_12.pkg | 2023-10-14 08:39 | 380M | |
| bloomberg-bde-3.117...> | 2023-10-10 10:18 | 5.8M | |
| blop-0.2.8_2.pkg | 2023-10-08 20:20 | 543K | |
| blt-2.5.3_6.pkg | 2023-10-07 09:19 | 1.7M | |
| bluefish-2.2.14_1.pkg | 2023-10-09 15:49 | 2.8M | |
| bluegps-linux-2.0.pkg | 2023-10-14 02:33 | 10K | |
| bluej-4.2.2_1.pkg | 2023-10-10 08:15 | 16M | |
| bluemoon-2.12.pkg | 2023-10-14 11:00 | 13K | |
| blueprint-compiler-0..> | 2023-10-07 21:20 | 44K | |
| blues-g20220312.pkg | 2023-10-11 00:21 | 113K | |
| bluez-firmware-1.2.pkg | 2023-10-09 23:38 | 61K | |
| bmake-20230723.pkg | 2023-10-06 16:26 | 192K | |
| bmd-2.0.pkg | 2023-10-08 09:54 | 59K | |
| bmd-plugin-avahi-2.0..> | 2023-10-09 10:17 | 3.9K | |
| bmd-plugin-hookcmd-2..> | 2023-10-10 11:57 | 3.4K | |
| bmf-0.9.4,1.pkg | 2023-10-10 01:09 | 23K | |
| bmfdec-g20211007.pkg | 2023-10-09 11:04 | 18K | |
| bmkdep-20140112.pkg | 2023-10-06 16:32 | 8.6K | |
| bmon-4.0.pkg | 2023-10-09 15:18 | 36K | |
| bmp2html-0.1_6.pkg | 2023-10-10 06:14 | 5.7K | |
| bmpanel2-2.1.p1_2.pkg | 2023-10-09 02:51 | 227K | |
| bn-aspell-0.01.1.1_1..> | 2023-10-14 13:42 | 568K | |
| bn-libreoffice-7.5.5..> | 2023-10-07 14:02 | 2.7M | |
| bn_IN-libreoffice-7...> | 2023-10-07 14:08 | 3.0M | |
| bnc-2.9.4.pkg | 2023-10-10 11:18 | 40K | |
| bnf-1.6.10_1.pkg | 2023-10-09 01:53 | 28K | |
| bo-libreoffice-7.5.5..> | 2023-10-07 21:19 | 2.6M | |
| boca-1.0.7.pkg | 2023-10-08 03:08 | 1.2M | |
| bochs-2.7_1,2.pkg | 2023-10-08 04:28 | 953K | |
| bodr-10.pkg | 2023-10-07 11:48 | 86K | |
| boehm-gc-8.2.4.pkg | 2023-10-05 16:48 | 258K | |
| boehm-gc-threaded-8...> | 2023-10-05 16:59 | 151K | |
| bogofilter-1.2.5_3.pkg | 2023-10-07 03:31 | 312K | |
| bogofilter-bdb-1.2.5..> | 2023-10-10 06:27 | 325K | |
| bogofilter-kc-1.2.5_..> | 2023-10-11 13:00 | 310K | |
| bogofilter-sqlite-1...> | 2023-10-14 18:50 | 313K | |
| bogosort-0.4.2_2.pkg | 2023-10-14 18:48 | 16K | |
| boiling-egg-0.02_1.pkg | 2023-10-10 09:38 | 1.8K | |
| boinc-client-7.20.2_..> | 2023-10-07 11:31 | 3.5M | |
| boinc_curses-0.2.3_1..> | 2023-10-11 21:03 | 100K | |
| bolt-2.2.24.pkg | 2023-10-10 13:42 | 7.6M | |
| bolt-lmm-2.3.6_5.pkg | 2023-10-10 06:18 | 312M | |
| bomb-her-man-0.3_7.pkg | 2023-10-10 17:11 | 1.1M | |
| bombardier-1.2.6_2.pkg | 2023-10-08 16:24 | 2.8M | |
| bomber-23.08.1.pkg | 2023-10-07 05:07 | 856K | |
| bomberclone-0.11.9_3..> | 2023-10-10 14:24 | 7.2M | |
| bomns-0.99.3_3.pkg | 2023-10-10 06:42 | 747K | |
| bonnie++-1.98.pkg | 2023-10-09 09:42 | 52K | |
| bonnie-2.0.6_1.pkg | 2023-10-10 07:11 | 8.3K | |
| bonzomatic-2022.08.2..> | 2023-10-09 22:47 | 423K | |
| bookworm-1.1.2_18.pkg | 2023-10-09 08:01 | 1.5M | |
| boolector-3.2.2_2.pkg | 2023-10-09 22:08 | 801K | |
| boops-lv2-1.8.2_1.pkg | 2023-10-08 16:41 | 930K | |
| boost-all-1.82.0.pkg | 2023-10-10 04:04 | 932 | |
| boost-build-4.9.4.pkg | 2023-10-06 18:41 | 402K | |
| boost-docs-1.82.0.pkg | 2023-10-07 13:32 | 53M | |
| boost-jam-1.82.0.pkg | 2023-10-05 16:45 | 109K | |
| boost-libs-1.82.0_1.pkg | 2023-10-05 17:42 | 14M | |
| boot-extract-g201906..> | 2023-10-14 09:52 | 3.7K | |
| bootstrap-openjdk8-r..> | 2023-10-05 16:40 | 29M | |
| bootstrap-openjdk11-..> | 2023-10-05 16:41 | 98M | |
| bootstrap-openjdk17-..> | 2023-10-05 16:42 | 105M | |
| bopm-3.1.3_3.pkg | 2023-10-10 04:16 | 50K | |
| boringssl-0.0.0.0.20..> | 2023-10-11 07:06 | 1.1M | |
| bosh-2023.04.19.pkg | 2023-10-08 00:25 | 227K | |
| bosh-bootloader-7.6...> | 2023-10-08 12:28 | 7.4M | |
| bosh-cli-5.5.0_15.pkg | 2023-10-09 08:37 | 4.7M | |
| bossa-1.9.1.pkg | 2023-10-06 21:08 | 47K | |
| bosun-0.9.0_15.pkg | 2023-10-09 08:59 | 8.5M | |
| botan2-2.19.3_4.pkg | 2023-10-07 06:12 | 5.2M | |
| bottlerocket-0.04c_2..> | 2023-10-11 18:21 | 8.5K | |
| bottom-0.9.6_1.pkg | 2023-10-10 05:01 | 2.0M | |
| bounce-1.0_8.pkg | 2023-10-14 10:37 | 5.3K | |
| bouncycastle-1.45_2.pkg | 2023-10-09 18:23 | 4.9M | |
| bouncycastle15-1.71.pkg | 2023-10-07 09:37 | 123M | |
| bout++-4.4.2_3.pkg | 2023-10-08 08:05 | 1.0M | |
| bout++-merging-filam..> | 2023-10-14 13:52 | 28K | |
| bovo-23.08.1.pkg | 2023-10-07 03:25 | 284K | |
| bowtie-1.3.1.pkg | 2023-10-09 08:19 | 6.8M | |
| bowtie2-2.5.1.pkg | 2023-10-07 20:24 | 8.6M | |
| box-0.4.0_2.pkg | 2023-10-08 21:27 | 430K | |
| boxes-2.2.0_1.pkg | 2023-10-09 23:39 | 59K | |
| boxfort-0.1.4.pkg | 2023-10-07 22:34 | 16K | |
| bozohttpd-20210227.pkg | 2023-10-10 12:09 | 42K | |
| bpatch-1.0_1.pkg | 2023-10-10 11:28 | 16K | |
| bpft-4.20040506_1.pkg | 2023-10-09 08:45 | 45K | |
| bpl+-1.0_1.pkg | 2023-10-09 07:26 | 21K | |
| bpython-py39-0.24.pkg | 2023-10-09 03:11 | 297K | |
| bpytop-1.0.68_1.pkg | 2023-10-08 18:45 | 51K | |
| br-aspell-0.50.2,1.pkg | 2023-10-10 02:34 | 301K | |
| br-libreoffice-7.5.5..> | 2023-10-08 11:13 | 430K | |
| braa-0.82.pkg | 2023-10-14 03:26 | 18K | |
| braincurses-1.1.0_5.pkg | 2023-10-10 06:31 | 19K | |
| brainparty-0.61_3.pkg | 2023-10-14 10:21 | 38M | |
| brainworkshop-5.0.2_..> | 2023-10-14 13:16 | 6.4M | |
| brasero-3.12.3_4.pkg | 2023-10-07 16:14 | 2.0M | |
| bredbandskollen-0.20..> | 2023-10-09 05:42 | 152K | |
| brename-2.13.0_2.pkg | 2023-10-10 23:14 | 2.3M | |
| brickout-2002.06.09.pkg | 2023-10-09 09:55 | 90K | |
| brickshooter-0.04_8.pkg | 2023-10-10 08:14 | 2.1M | |
| brikx-0.4.5_9.pkg | 2023-10-14 12:57 | 4.3M | |
| briquolo-0.5.7_16.pkg | 2023-10-08 20:59 | 1.3M | |
| brisk-menu-0.6.2_1.pkg | 2023-10-10 00:06 | 54K | |
| bristol-0.60.10_8.pkg | 2023-10-10 09:04 | 3.0M | |
| brlaser-6.2.pkg | 2023-10-09 14:13 | 20K | |
| brlcad-7.32.6.pkg | 2023-10-10 03:08 | 118M | |
| brogue-1.12.pkg | 2023-10-10 01:28 | 690K | |
| brogue-nox11-1.12.pkg | 2023-10-09 02:26 | 680K | |
| broot-1.25.0_2.pkg | 2023-10-09 17:37 | 3.2M | |
| brotli-1.1.0,1.pkg | 2023-10-05 17:35 | 328K | |
| browsh-1.8.0_1.pkg | 2023-10-09 21:05 | 2.5M | |
| brumbrumrally-0.7.pkg | 2023-10-09 13:21 | 325K | |
| brunsli-0.1_3.pkg | 2023-10-09 18:36 | 115K | |
| brut-1.55_1.pkg | 2023-10-14 14:53 | 96K | |
| brutalchess-0.5.2_16..> | 2023-10-09 10:12 | 4.0M | |
| bruteblock-0.0.5_10.pkg | 2023-10-09 16:32 | 18K | |
| brx-libreoffice-7.5...> | 2023-10-08 02:21 | 227K | |
| brynet-1.12.2.pkg | 2023-10-10 14:20 | 53K | |
| bs-2.11.pkg | 2023-10-09 16:37 | 16K | |
| bs-libreoffice-7.5.5..> | 2023-10-07 18:57 | 2.7M | |
| bschaffl-lv2-1.4.10_..> | 2023-10-09 02:33 | 284K | |
| bsd-diff-20120705_2.pkg | 2023-10-10 19:03 | 24K | |
| bsd-grep-2.6.0,1.pkg | 2023-10-09 23:56 | 21K | |
| bsd-plotutils-1.4.2_..> | 2023-10-14 14:26 | 73K | |
| bsd-splash-changer-0..> | 2023-10-08 11:57 | 1.5K | |
| bsdadminscripts2-0.4..> | 2023-10-14 08:15 | 85K | |
| bsdbuild-3.1.pkg | 2023-10-10 21:06 | 271K | |
| bsdcflow-0.0.6_1.pkg | 2023-10-14 06:05 | 27K | |
| bsdconfig-0.9.0_1.pkg | 2023-10-11 05:45 | 149K | |
| bsdconv-11.6.pkg | 2023-10-07 06:09 | 1.0M | |
| bsdconv-opencc-11.5.pkg | 2023-10-09 09:56 | 3.4K | |
| bsdcrashtar-0.1.3_1.pkg | 2023-10-09 08:47 | 6.5K | |
| bsddialog-0.4.1.pkg | 2023-10-07 12:17 | 77K | |
| bsdebfetch-1.1.b.pkg | 2023-10-09 06:26 | 2.3K | |
| bsdec2-image-upload-..> | 2023-10-09 00:18 | 24K | |
| bsdfan-g20180112.pkg | 2023-10-10 03:21 | 6.1K | |
| bsdftpd-ssl-1.1.0_4.pkg | 2023-10-11 06:20 | 198K | |
| bsdgames-0.75_1,2.pkg | 2023-10-14 05:35 | 1.1M | |
| bsdhwmon-20151206.pkg | 2023-10-09 04:08 | 11K | |
| bsdinfo-0.22_2.pkg | 2023-10-14 11:32 | 5.1K | |
| bsdisks-0.30.pkg | 2023-10-06 06:49 | 107K | |
| bsdnt-1.0_1.pkg | 2023-10-14 13:00 | 131K | |
| bsdowl-2.2.1_4.pkg | 2023-10-08 15:52 | 41K | |
| bsdrcmds-20171003.01..> | 2023-10-08 07:57 | 36K | |
| bsdsfv-1.18.pkg | 2023-10-14 08:54 | 13K | |
| bsdstats-7.0_3.pkg | 2023-10-10 14:42 | 6.4K | |
| bsdtris-1.1_2.pkg | 2023-10-10 09:37 | 14K | |
| bsequencer-lv2-1.8.1..> | 2023-10-14 10:39 | 590K | |
| bsfilter-1.0.19_3.pkg | 2023-10-08 00:20 | 25K | |
| bsh-2.1.1.pkg | 2023-10-07 21:43 | 411K | |
| bshapr-lv2-0.13.pkg | 2023-10-09 20:12 | 393K | |
| bslizr-lv2-1.2.16.pkg | 2023-10-09 12:58 | 448K | |
| bsmtp-1.02_5.pkg | 2023-10-14 17:40 | 12K | |
| bsmtrace-1.4_1.pkg | 2023-10-14 12:38 | 25K | |
| bsmtrace3-3.1.pkg | 2023-10-14 18:05 | 25K | |
| bsnmp-regex-0.6_2.pkg | 2023-10-14 15:38 | 20K | |
| bsnmp-ucd-0.4.5.pkg | 2023-10-10 20:55 | 17K | |
| bsod-0.1.pkg | 2023-10-08 14:21 | 7.5K | |
| bsp-5.2.pkg | 2023-10-10 20:53 | 19K | |
| bspwm-0.9.10.pkg | 2023-10-10 08:19 | 88K | |
| bspwm-devel-0.9.10.2..> | 2023-10-09 05:46 | 91K | |
| bstack-0.1_1.pkg | 2023-10-09 14:04 | 1.4K | |
| bstone-1.1.9_3.pkg | 2023-10-08 22:37 | 261K | |
| bsvc-2.4.6.pkg | 2023-10-10 16:03 | 196K | |
| btanks-0.9.8083_10.pkg | 2023-10-08 12:34 | 27M | |
| btcheck-2.1_1.pkg | 2023-10-10 06:30 | 13K | |
| btllib-1.6.2.pkg | 2023-10-08 08:58 | 600K | |
| btoa-5.2_1,1.pkg | 2023-10-10 17:52 | 9.9K | |
| btop-1.2.13_1.pkg | 2023-10-14 14:44 | 397K | |
| btor2tools-g20190418..> | 2023-10-07 20:47 | 37K | |
| btparse-0.35_1.pkg | 2023-10-07 11:39 | 115K | |
| btpd-0.16_3.pkg | 2023-10-08 12:34 | 73K | |
| btsixad-0.1.1.pkg | 2023-10-10 13:40 | 14K | |
| bubble-chains-0.2.0_..> | 2023-10-08 17:07 | 2.8M | |
| bucklespring-1.5.1.pkg | 2023-10-10 07:59 | 2.9M | |
| buddy-2.4_2.pkg | 2023-10-07 11:04 | 323K | |
| budgie-10.8.pkg | 2023-10-10 12:31 | 1.9K | |
| budgie-backgrounds-2..> | 2023-10-08 04:27 | 26M | |
| budgie-control-cente..> | 2023-10-07 14:47 | 3.0M | |
| budgie-desktop-10.8_..> | 2023-10-07 04:22 | 2.0M | |
| budgie-desktop-view-..> | 2023-10-08 10:17 | 38K | |
| budgie-screensaver-5..> | 2023-10-06 21:57 | 199K | |
| budgie-trash-applet-..> | 2023-10-10 09:09 | 21K | |
| buffer-1.19.pkg | 2023-10-09 17:04 | 11K | |
| bugsquish-0.0.6_13.pkg | 2023-10-14 15:01 | 6.1M | |
| bugsx-1.08_2.pkg | 2023-10-14 04:48 | 18K | |
| bugzilla2atom-0.0.0...> | 2023-10-14 02:27 | 669K | |
| bugzilla44-4.4.13_2.pkg | 2023-10-07 10:44 | 1.9M | |
| bugzilla50-5.0.4_3.pkg | 2023-10-07 10:59 | 1.1M | |
| buici-clock-0.4.9.4_..> | 2023-10-09 17:22 | 23K | |
| build-0.3.10.pkg | 2023-10-06 12:09 | 51K | |
| build2-0.16.0.pkg | 2023-10-08 03:45 | 5.4M | |
| buildkite-agent-3.47..> | 2023-10-14 17:57 | 5.9M | |
| buku-4.8.pkg | 2023-10-10 18:37 | 94K | |
| bulk_extractor-2.0.3..> | 2023-10-08 12:50 | 1.2M | |
| bulk_mailer-1.13_1.pkg | 2023-10-09 01:43 | 24K | |
| bullet-3.25.pkg | 2023-10-08 03:33 | 12M | |
| bullet-double-3.25.pkg | 2023-10-08 04:28 | 12M | |
| bumprace-1.5.8_1.pkg | 2023-10-12 06:29 | 4.0M | |
| bunyan-0.1.9_7.pkg | 2023-10-14 17:27 | 325K | |
| bupstash-0.12.0_8.pkg | 2023-10-09 05:50 | 2.0M | |
| burgerspace-1.9.5.pkg | 2023-10-08 16:26 | 149K | |
| burp-2.4.0.pkg | 2023-10-09 07:19 | 235K | |
| burp-devel-3.1.4.pkg | 2023-10-08 18:31 | 202K | |
| burrtools-0.6.3_23.pkg | 2023-10-14 05:29 | 727K | |
| busybee-0.7.0.pkg | 2023-10-08 17:09 | 53K | |
| busybox-1.36.1_1.pkg | 2023-10-11 11:04 | 700K | |
| butt-0.1.27_3.pkg | 2023-10-10 19:04 | 85K | |
| butterfly-2.0.1_1.pkg | 2023-10-14 18:21 | 872K | |
| buzhug-1.8_1.pkg | 2023-10-08 14:57 | 44K | |
| bvi-1.4.2.pkg | 2023-10-09 09:06 | 51K | |
| bvm-1.3.3.pkg | 2023-10-10 00:28 | 93K | |
| bwa-0.7.17_1.pkg | 2023-10-08 03:09 | 169K | |
| bwbasic-3.20.pkg | 2023-10-08 16:42 | 129K | |
| bwi-firmware-kmod-3...> | 2023-10-10 03:04 | 22K | |
| bwidget-1.9.16.pkg | 2023-10-07 00:45 | 174K | |
| bwm-ng-0.6.3.pkg | 2023-10-14 08:35 | 24K | |
| bwn-firmware-kmod-0...> | 2023-10-09 08:30 | 76K | |
| bwping-2.5.pkg | 2023-10-10 03:31 | 9.3K | |
| byacc-20230521.pkg | 2023-10-10 11:13 | 69K | |
| byaccj-1.15.pkg | 2023-10-08 21:11 | 51K | |
| byobu-5.133_2.pkg | 2023-10-14 14:06 | 90K | |
| bzflag-2.4.26_1.pkg | 2023-10-14 17:31 | 10M | |
| bzflag-server-2.4.26..> | 2023-10-08 23:59 | 9.4M | |
| bzip-0.21_1.pkg | 2023-10-10 18:20 | 26K | |
| bzip2-1.0.8.pkg | 2023-10-07 20:31 | 447K | |
| bzip3-1.3.2.pkg | 2023-10-09 01:45 | 46K | |
| bzrtp-5.2.94.pkg | 2023-10-06 19:25 | 48K | |
| c-0.14.pkg | 2023-10-11 00:18 | 2.9K | |
| c-a-i-r-2.19.pkg | 2023-10-14 15:25 | 32K | |
| c-ares-1.19.1.pkg | 2023-10-05 17:42 | 139K | |
| c-blosc-1.21.0.pkg | 2023-10-06 17:17 | 40K | |
| c-blosc2-2.10.2.pkg | 2023-10-07 11:11 | 291K | |
| c-icap-0.5.10_1,2.pkg | 2023-10-07 14:27 | 195K | |
| c-icap-modules-0.5.5..> | 2023-10-09 14:23 | 93K | |
| c-lightning-23.08.pkg | 2023-10-09 10:59 | 4.5M | |
| c-nocem-3.7_4.pkg | 2023-10-09 14:53 | 17K | |
| c-sig-3.8.0.1_13.pkg | 2023-10-14 05:26 | 24K | |
| c-sig-emacs_canna-3...> | 2023-10-09 15:05 | 24K | |
| c-sig-emacs_devel-3...> | 2023-10-08 12:30 | 24K | |
| c-sig-emacs_devel_no..> | 2023-10-09 19:02 | 24K | |
| c-sig-emacs_nox-3.8...> | 2023-10-08 22:17 | 24K | |
| c2html-0.9.6.pkg | 2023-10-10 16:11 | 30K | |
| c2man-2.0.42.pkg | 2023-10-14 05:21 | 56K | |
| c2mdoc-20040302_1.pkg | 2023-10-09 00:45 | 1.2K | |
| c2ps-4.0_4.pkg | 2023-10-11 12:15 | 28K | |
| c3p0-0.9.5.3.pkg | 2023-10-07 01:37 | 655K | |
| c4core-0.1.8.pkg | 2023-10-06 19:32 | 94K | |
| c64bdf-1.0_4.pkg | 2023-10-10 07:39 | 2.9K | |
| c3270-4.2_1.pkg | 2023-10-08 15:00 | 1.3M | |
| ca-aspell-2.1.5.1,1.pkg | 2023-10-10 01:35 | 1.1M | |
| ca-libreoffice-7.5.5..> | 2023-10-08 09:12 | 3.1M | |
| ca_root_nss-3.93_1.pkg | 2023-10-05 16:47 | 269K | |
| ca_valencia-libreoff..> | 2023-10-08 05:36 | 3.0M | |
| cabextract-1.11.pkg | 2023-10-06 16:17 | 60K | |
| cacti-1.2.23_1.pkg | 2023-10-10 01:21 | 32M | |
| cacti88-spine-0.8.8h..> | 2023-10-10 05:58 | 35K | |
| cadabra2-2.4.4.1.pkg | 2023-10-10 23:56 | 2.1M | |
| cadaver-0.23.3_4.pkg | 2023-10-08 23:47 | 44K | |
| caddy-2.7.4_1.pkg | 2023-10-10 19:17 | 10M | |
| cadence-0.9.2_4.pkg | 2023-10-10 18:35 | 1.6M | |
| cadical-1.6.0.pkg | 2023-10-08 07:04 | 453K | |
| cado-nfs-2.3.0.20220..> | 2023-10-10 05:20 | 4.6M | |
| cadubi-1.3.4.pkg | 2023-10-10 00:40 | 12K | |
| caesarcipher-1.1.pkg | 2023-10-08 18:33 | 7.4K | |
| caffe-1.0.136_3.pkg | 2023-10-08 23:14 | 1.5M | |
| cage-0.1.5.pkg | 2023-10-09 16:08 | 17K | |
| cagebreak-2.2.1.pkg | 2023-10-14 03:38 | 58K | |
| cairo-1.17.4_2,3.pkg | 2023-10-05 17:44 | 1.1M | |
| cairo-clock-0.3.4_4.pkg | 2023-10-14 07:57 | 198K | |
| cairo-dock-3.4.1_10.pkg | 2023-10-07 15:04 | 1.2M | |
| cairo-dock-plugins-3..> | 2023-10-09 00:26 | 2.8M | |
| cairo-language-2.2.0..> | 2023-10-08 21:27 | 14M | |
| cairomm-1.12.2_6.pkg | 2023-10-06 15:24 | 511K | |
| caja-1.26.1_3.pkg | 2023-10-07 04:38 | 3.0M | |
| caja-extensions-1.26..> | 2023-10-07 10:38 | 203K | |
| cake-2005.12.26_14.pkg | 2023-10-09 04:55 | 137K | |
| cal-4.1.pkg | 2023-10-10 07:01 | 26K | |
| cal3d-0.11.1.pkg | 2023-10-07 20:07 | 171K | |
| calamares-3.2.61_3.pkg | 2023-10-09 23:47 | 3.6M | |
| calamaris-2.59_2.pkg | 2023-10-14 10:55 | 34K | |
| calamaris-devel-2.99..> | 2023-10-14 06:20 | 68K | |
| calc-2.14.3.5.pkg | 2023-10-08 10:07 | 811K | |
| calcium-0.4.1_1.pkg | 2023-10-08 17:28 | 406K | |
| calcmysky-0.3.1.pkg | 2023-10-08 10:32 | 327K | |
| calcoo-1.3.18_8.pkg | 2023-10-09 08:02 | 30K | |
| calculix-2.21.pkg | 2023-10-08 13:18 | 4.8M | |
| calcurse-4.8.1.pkg | 2023-10-10 02:39 | 215K | |
| caldavzap-0.13.1_1.pkg | 2023-10-14 10:41 | 2.7M | |
| caldera-4.2.0_2.pkg | 2023-10-08 19:17 | 21M | |
| calendar-0.9.3.pkg | 2023-10-08 20:48 | 28K | |
| calendar-data-2022.1..> | 2023-10-08 11:56 | 71K | |
| calendarsupport-23.0..> | 2023-10-06 15:37 | 521K | |
| calf-lv2-0.90.3.2021..> | 2023-10-09 18:07 | 13M | |
| calibrator-0.9.pkg | 2023-10-09 02:29 | 13K | |
| calibre-6.26.0.pkg | 2023-10-10 11:38 | 24M | |
| calife-3.0.6_1.pkg | 2023-10-14 11:42 | 11K | |
| calindori-1.4_3.pkg | 2023-10-09 09:37 | 177K | |
| caliper-2.10.0.pkg | 2023-10-14 09:04 | 499K | |
| calligra-3.2.1_59.pkg | 2023-10-09 20:42 | 38M | |
| calligraplan-3.3.0_4..> | 2023-10-10 05:04 | 5.0M | |
| cam-1.02.pkg | 2023-10-09 09:52 | 11K | |
| camerakit-0.0.1_15.pkg | 2023-10-08 07:31 | 4.1K | |
| camserv-0.5.1_21,1.pkg | 2023-10-09 13:06 | 64K | |
| candycrisis-3.0.1.pkg | 2023-10-10 05:07 | 4.7M | |
| caneda-0.3.1.pkg | 2023-10-11 15:23 | 746K | |
| cannonball-0.34_2.pkg | 2023-10-14 10:09 | 179K | |
| canta-gtk-themes-202..> | 2023-10-09 12:39 | 1.1M | |
| canta-icon-theme-202..> | 2023-10-09 18:20 | 1.1M | |
| cantarell-fonts-0.30..> | 2023-10-06 11:20 | 319K | |
| cantata-2.5.0_3.pkg | 2023-10-09 18:34 | 2.0M | |
| cantor-23.08.1.pkg | 2023-10-07 05:56 | 2.0M | |
| canu-2.2_3.pkg | 2023-10-09 17:46 | 2.0M | |
| caph-1.1_6.pkg | 2023-10-14 07:08 | 579K | |
| capnproto-0.10.3.pkg | 2023-10-06 17:08 | 1.6M | |
| capnproto080-0.8.0.pkg | 2023-10-07 07:34 | 2.3M | |
| caps-lv2-g20200529.pkg | 2023-10-09 19:47 | 12M | |
| caps-plugins-0.4.5_1..> | 2023-10-08 09:02 | 591K | |
| capslock-0.1.1.pkg | 2023-10-09 23:39 | 2.2M | |
| capstone-5.0.1_1.pkg | 2023-10-06 21:25 | 1.9M | |
| capstone3-3.0.5_1.pkg | 2023-10-09 06:55 | 595K | |
| capstone4-4.0.2.pkg | 2023-10-07 18:48 | 1.2M | |
| carbon-relay-ng-0.10..> | 2023-10-14 12:05 | 3.7M | |
| carbonapi-0.14.1_15.pkg | 2023-10-10 12:18 | 8.3M | |
| carbonzipper-0.74_14..> | 2023-10-09 16:57 | 2.3M | |
| cardinal-22.05_2.pkg | 2023-10-09 11:11 | 109M | |
| cardioid-g20211026_1..> | 2023-10-14 06:08 | 328K | |
| cardpeek-0.8.4_1.pkg | 2023-10-09 10:00 | 783K | |
| cardpics-0.4.pkg | 2023-10-08 10:46 | 101K | |
| cargo-audit-0.17.6_3..> | 2023-10-09 16:58 | 1.5M | |
| cargo-bloat-0.11.1_6..> | 2023-10-08 19:56 | 336K | |
| cargo-c-0.9.24_2.pkg | 2023-10-06 09:57 | 15M | |
| cargo-depgraph-1.5.0..> | 2023-10-09 03:43 | 358K | |
| cargo-generate-0.18...> | 2023-10-14 18:03 | 1.6M | |
| caribou-0.4.21_6.pkg | 2023-10-08 01:48 | 189K | |
| caronade-0.6.1_7.pkg | 2023-10-10 00:10 | 2.8M | |
| cartotheque-0.1_12.pkg | 2023-10-07 19:21 | 28K | |
| casadi-3.6.0_2.pkg | 2023-10-10 01:12 | 2.8M | |
| cascade-1.4.pkg | 2023-10-10 17:21 | 18K | |
| cascade-compiler-g20..> | 2023-10-09 01:33 | 1.5M | |
| cascadia-code-2111.0..> | 2023-10-09 06:31 | 967K | |
| cask-0.8.3_12.pkg | 2023-10-07 18:43 | 32K | |
| cask-emacs_canna-0.8..> | 2023-10-07 21:23 | 32K | |
| cask-emacs_devel-0.8..> | 2023-10-07 23:12 | 32K | |
| cask-emacs_devel_nox..> | 2023-10-11 00:04 | 32K | |
| cask-emacs_nox-0.8.3..> | 2023-10-09 15:47 | 32K | |
| cassandra-cpp-driver..> | 2023-10-08 11:50 | 1.2M | |
| cassandra3-3.11.14.pkg | 2023-10-14 19:01 | 30M | |
| cassandra4-4.0.8.pkg | 2023-10-10 04:49 | 37M | |
| casstcl-2.16.1.pkg | 2023-10-09 09:14 | 37K | |
| cast2gif-0.1.0.5_1.pkg | 2023-10-10 09:07 | 3.1M | |
| castget-2.0.1.202202..> | 2023-10-10 13:55 | 21K | |
| castor-0.8.16_28.pkg | 2023-10-08 14:40 | 623K | |
| castxml-0.6.1.pkg | 2023-10-07 01:48 | 732K | |
| cataclysm-dda-0.g_1,..> | 2023-10-08 22:34 | 45M | |
| cataclysm-dda-tiles-..> | 2023-10-10 03:25 | 76M | |
| catapult-18.0_2.pkg | 2023-10-09 16:06 | 344K | |
| catatonit-0.1.7_2.pkg | 2023-10-09 20:09 | 190K | |
| catch-2.13.10.pkg | 2023-10-06 19:48 | 178K | |
| catch2-3.4.0.pkg | 2023-10-07 08:10 | 415K | |
| catclock-g20200328.pkg | 2023-10-14 10:51 | 23K | |
| catdoc-0.95.pkg | 2023-10-08 11:37 | 76K | |
| catdvi-0.14_7.pkg | 2023-10-07 11:58 | 36K | |
| catesc-0.6_1.pkg | 2023-10-11 11:01 | 3.0M | |
| catfish-4.18.0.pkg | 2023-10-09 11:04 | 309K | |
| catgirl-2.1_3.pkg | 2023-10-08 20:27 | 59K | |
| catimg-2.7.0.pkg | 2023-10-14 12:57 | 41K | |
| catseye-fm-4.2.0.0_3..> | 2023-10-10 01:59 | 125K | |
| catsit-1.4.pkg | 2023-10-09 17:53 | 18K | |
| cava-0.7.4_2.pkg | 2023-10-10 21:01 | 30K | |
| cave9-0.4.1.git20150..> | 2023-10-10 16:51 | 838K | |
| cavezofphear-0.6.1.pkg | 2023-10-08 17:02 | 19K | |
| cawbird-1.5_1.pkg | 2023-10-08 21:04 | 568K | |
| cayley-0.7.7_5.pkg | 2023-10-10 05:40 | 7.3M | |
| cbang-1.8.0_2.pkg | 2023-10-07 23:40 | 2.8M | |
| cbfmt-0.2.0_7.pkg | 2023-10-14 16:59 | 816K | |
| cblas-3.11.0_1.pkg | 2023-10-06 12:52 | 41K | |
| cbmbasic-20180708.pkg | 2023-10-14 06:26 | 44K | |
| cbrowser-0.8_4.pkg | 2023-10-10 00:27 | 51K | |
| cbsd-13.2.6.pkg | 2023-10-09 16:47 | 3.6M | |
| cbsd-mq-api-0.3_14.pkg | 2023-10-09 18:41 | 1.8M | |
| cbsd-mq-router-0.2_1..> | 2023-10-08 21:01 | 856K | |
| cbviewer-0.8_3.pkg | 2023-10-08 18:05 | 291K | |
| cc65-2.19.pkg | 2023-10-07 03:11 | 2.2M | |
| ccache-3.7.12_4.pkg | 2023-10-05 16:39 | 118K | |
| ccache-static-3.7.12..> | 2023-10-10 02:38 | 540K | |
| ccache4-4.8.pkg | 2023-10-10 10:05 | 567K | |
| ccaudio2-2.2.0_5.pkg | 2023-10-09 20:39 | 77K | |
| cccc-3.2.0.pkg | 2023-10-09 23:21 | 159K | |
| ccd2iso-0.9_1.pkg | 2023-10-09 10:02 | 3.1K | |
| ccdoc-0.8r41.pkg | 2023-10-08 14:55 | 1.4M | |
| ccid-1.5.1.pkg | 2023-10-07 04:26 | 58K | |
| cciss_vol_status-1.1..> | 2023-10-14 05:29 | 21K | |
| ccl-1.12_2.pkg | 2023-10-14 12:41 | 8.9M | |
| cclient-2007f_5,1.pkg | 2023-10-07 15:30 | 1.1M | |
| ccls-0.20230115.pkg | 2023-10-08 21:18 | 426K | |
| ccmath-2.2.1_3.pkg | 2023-10-08 04:58 | 201K | |
| ccmix-g20170612_2.pkg | 2023-10-09 18:10 | 177K | |
| ccrtp-2.1.2.pkg | 2023-10-14 03:50 | 194K | |
| ccrypt-1.11.pkg | 2023-10-10 19:25 | 91K | |
| ccsrch-1.0.3_1.pkg | 2023-10-08 13:32 | 11K | |
| cctz-2.2_3.pkg | 2023-10-14 15:33 | 336K | |
| ccxstream-1.0.15_4.pkg | 2023-10-14 11:16 | 37K | |
| ccze-0.2.1_5.pkg | 2023-10-14 18:21 | 43K | |
| cd-discid-0.9.pkg | 2023-10-07 23:52 | 4.2K | |
| cd-hit-4.8.1_3.pkg | 2023-10-07 16:07 | 104K | |
| cdargs-1.35.pkg | 2023-10-09 00:45 | 34K | |
| cdash-2.2.3_2.pkg | 2023-10-14 16:43 | 1.0M | |
| cdb-0.75.pkg | 2023-10-07 13:04 | 19K | |
| cdbfasta-2023.07.10.pkg | 2023-10-09 17:59 | 49K | |
| cdbkup-1.0_3.pkg | 2023-10-14 03:10 | 22K | |
| cddb-bundle-0.2_12.pkg | 2023-10-07 00:04 | 11K | |
| cddlib-0.94m.pkg | 2023-10-06 20:39 | 835K | |
| cde-2.5.1_5.pkg | 2023-10-09 18:35 | 19M | |
| cde-25-2.5.1_5.pkg | 2023-10-09 11:02 | 19M | |
| cde-devel-2023.08.16..> | 2023-10-08 17:39 | 19M | |
| cdecl-13.1.pkg | 2023-10-10 05:09 | 147K | |
| cdeploy-0.2.1.pkg | 2023-10-09 23:54 | 7.1K | |
| cdf3-3.8.0_1.pkg | 2023-10-06 14:43 | 1.2M | |
| cdialog-1.3.20230209..> | 2023-10-07 22:01 | 279K | |
| cdif-2.14.20170401.pkg | 2023-10-08 18:48 | 10K | |
| cdircmp-0.3.pkg | 2023-10-09 11:10 | 13K | |
| cdk-5.0.20161210,1.pkg | 2023-10-08 04:51 | 376K | |
| cdk-chemistry-2.7.1.pkg | 2023-10-09 05:50 | 24M | |
| cdlabelgen-4.3.0.pkg | 2023-10-14 10:15 | 115K | |
| cdo-2.2.2.pkg | 2023-10-08 00:32 | 3.1M | |
| cdogs-sdl-1.5.0.pkg | 2023-10-09 07:38 | 28M | |
| cdparanoia-3.9.8_10.pkg | 2023-10-06 20:26 | 69K | |
| cdpd-1.0.4.1_1.pkg | 2023-10-10 11:32 | 9.8K | |
| cdpr-2.4.pkg | 2023-10-14 08:16 | 15K | |
| cdpsnarf-0.1.6_1.pkg | 2023-10-08 19:38 | 8.9K | |
| cdrdao-1.2.5.pkg | 2023-10-07 09:16 | 286K | |
| cdrkit-1.1.11_2.pkg | 2023-10-09 09:06 | 395K | |
| cdrkit-genisoimage-1..> | 2023-10-08 05:01 | 198K | |
| cdroot-1.2.6.pkg | 2023-10-09 07:19 | 15K | |
| cdrtools-2023.04.19_..> | 2023-10-06 22:46 | 511K | |
| cego-2.48.29.pkg | 2023-10-08 00:10 | 2.3M | |
| cegobridge-1.6.4.pkg | 2023-10-14 06:07 | 106K | |
| cegui-0.8.7_19.pkg | 2023-10-10 20:01 | 15M | |
| celestia-glut-1.6.1_..> | 2023-10-09 12:10 | 32M | |
| celestia-gtk-1.6.1_1..> | 2023-10-09 19:20 | 32M | |
| celluloid-0.26.pkg | 2023-10-14 09:20 | 297K | |
| cemu-1.3_1.pkg | 2023-10-09 07:49 | 818K | |
| cenon-4.0.2_6,1.pkg | 2023-10-08 05:55 | 3.1M | |
| centerim-4.22.10_6.pkg | 2023-10-09 15:26 | 1.2M | |
| centreon-clib-21.04...> | 2023-10-10 03:16 | 76K | |
| cereal-1.3.2_1.pkg | 2023-10-07 04:20 | 184K | |
| ceres-solver-2.1.0_4..> | 2023-10-06 22:00 | 2.6M | |
| certmgr-3.0.3_15.pkg | 2023-10-12 09:27 | 3.1M | |
| cervisia-23.08.1.pkg | 2023-10-09 02:03 | 2.3M | |
| ceylon-1.3.3.pkg | 2023-10-10 10:04 | 19M | |
| cf-6.49.0_15.pkg | 2023-10-10 03:19 | 4.5M | |
| cfdg-3.4.1_3.pkg | 2023-10-12 11:20 | 338K | |
| cfengine-3.22.0.pkg | 2023-10-07 13:34 | 795K | |
| cfengine-devel-3.202..> | 2023-10-07 11:36 | 792K | |
| cfengine-masterfiles..> | 2023-10-09 04:33 | 133K | |
| cfengine-masterfiles..> | 2023-10-08 16:07 | 134K | |
| cfengine-masterfiles..> | 2023-10-08 11:59 | 131K | |
| cfengine-masterfiles..> | 2023-10-10 06:00 | 133K | |
| cfengine-masterfiles..> | 2023-10-09 15:07 | 133K | |
| cfengine320-3.20.0.pkg | 2023-10-08 00:34 | 784K | |
| cfengine321-3.21.2.pkg | 2023-10-07 10:26 | 793K | |
| cfengine322-3.22.0.pkg | 2023-10-08 05:44 | 794K | |
| cfiles-1.8.6_28.pkg | 2023-10-14 01:27 | 16K | |
| cfitsio-4.3.0.pkg | 2023-10-06 13:39 | 845K | |
| cflow-2.0_1.pkg | 2023-10-10 04:05 | 14K | |
| cflow2vcg-0.5_1.pkg | 2023-10-14 18:02 | 68K | |
| cfortran-4.3.pkg | 2023-10-08 06:48 | 71K | |
| cfr-0.152.pkg | 2023-10-09 07:33 | 1.8M | |
| cfs-1.5.0.pkg | 2023-10-14 06:33 | 81K | |
| cfssl-1.6.4_2.pkg | 2023-10-09 06:20 | 37M | |
| cg-0.4.pkg | 2023-10-14 07:12 | 31K | |
| cg3-1.3.6_6.pkg | 2023-10-08 04:15 | 390K | |
| cgal-5.5.1_1.pkg | 2023-10-06 09:51 | 4.8M | |
| cgdb-0.8.0.pkg | 2023-10-09 14:23 | 151K | |
| cgi-lib-1.4_1.pkg | 2023-10-10 02:50 | 15K | |
| cgi-lib_pl-2.18_1.pkg | 2023-10-09 17:45 | 6.1K | |
| cgicc-3.2.19_2.pkg | 2023-10-11 11:24 | 117K | |
| cgichk-2.60_1.pkg | 2023-10-08 13:45 | 9.9K | |
| cgif-0.3.2.pkg | 2023-10-06 13:31 | 11K | |
| cgiirc-0.5.12.pkg | 2023-10-09 21:41 | 88K | |
| cgilib-0.7_1.pkg | 2023-10-14 08:46 | 31K | |
| cgit-1.2.3.pkg | 2023-10-09 06:52 | 761K | |
| cgiwrap-4.1.pkg | 2023-10-10 08:50 | 37K | |
| cglm-0.9.1.pkg | 2023-10-08 04:07 | 112K | |
| cgnslib-4.4.0,1.pkg | 2023-10-06 14:25 | 930K | |
| cgoban-1.9.14_4.pkg | 2023-10-09 20:57 | 187K | |
| cgprof-1.2_4.pkg | 2023-10-10 00:23 | 4.2K | |
| cgribex-1.9.4_3.pkg | 2023-10-07 07:54 | 121K | |
| ch-7.0.0_1.pkg | 2023-10-10 07:18 | 16M | |
| chaco-2.2.pkg | 2023-10-09 16:01 | 804K | |
| chafa-1.12.5_3.pkg | 2023-10-07 10:17 | 250K | |
| chamfer-s20230310.pkg | 2023-10-11 02:34 | 289K | |
| chaoskube-0.28.0_3.pkg | 2023-10-14 14:52 | 7.1M | |
| chaosreader-0.96.pkg | 2023-10-10 04:54 | 45K | |
| chapping-0.43_14.pkg | 2023-10-08 19:36 | 4.2M | |
| charls-2.4.2.pkg | 2023-10-09 11:52 | 85K | |
| charm-uiuc-6.8.2_5.pkg | 2023-10-08 03:00 | 3.3M | |
| charmtimetracker-1.1..> | 2023-10-10 00:42 | 407K | |
| chart-3.0.0_15.pkg | 2023-10-14 10:32 | 1.0M | |
| charva-1.1.4_6.pkg | 2023-10-08 21:53 | 570K | |
| chatgpt-shell-cli-g2..> | 2023-10-11 00:18 | 5.4K | |
| chatgpt-shell-cli-no..> | 2023-10-09 17:37 | 5.4K | |
| chatterino2-2.4.1.pkg | 2023-10-14 07:39 | 2.9M | |
| cheat-4.4.0_8.pkg | 2023-10-14 08:21 | 3.5M | |
| check-0.15.2.pkg | 2023-10-05 17:34 | 96K | |
| check_ipmi_sensor-3...> | 2023-10-10 20:15 | 8.6K | |
| check_logfiles-4.1.1..> | 2023-10-14 02:08 | 42K | |
| check_mk_agent-2.1.0..> | 2023-10-14 03:14 | 11K | |
| check_multi-0.26_1.pkg | 2023-10-14 07:08 | 44K | |
| check_mysql_health-2..> | 2023-10-14 02:07 | 20K | |
| check_nwc_health-11...> | 2023-10-10 09:42 | 436K | |
| check_ssl_cert-2.74...> | 2023-10-09 01:50 | 49K | |
| check_ups_health-3.0..> | 2023-10-14 16:09 | 133K | |
| checkbashisms-2.22.2..> | 2023-10-09 23:09 | 11K | |
| checkbot-1.80_2.pkg | 2023-10-08 12:35 | 24K | |
| checkheaders-1.0.1_1..> | 2023-10-09 16:39 | 40K | |
| checkmate-0.21.pkg | 2023-10-08 11:58 | 13K | |
| checkmol-0.5_14.pkg | 2023-10-09 12:09 | 208K | |
| checkpassword-0.90.pkg | 2023-10-14 15:28 | 6.7K | |
| checkpassword-pam-0...> | 2023-10-07 13:36 | 12K | |
| checkrestart-0.5.0_1..> | 2023-10-10 19:34 | 7.2K | |
| cheese-41.1_3.pkg | 2023-10-06 22:33 | 790K | |
| cheesecutter-2.9.b.3..> | 2023-10-10 20:48 | 576K | |
| chef-19930426.pkg | 2023-10-09 21:01 | 7.5K | |
| chemical-mime-data-0..> | 2023-10-08 00:44 | 42K | |
| chemicalfun-0.1.8_1.pkg | 2023-10-07 12:16 | 346K | |
| chems-0.x04_1.pkg | 2023-10-08 15:43 | 301K | |
| chemtool-1.6.14_4.pkg | 2023-10-11 00:58 | 204K | |
| chemtool-devel-1.7.2..> | 2023-10-09 18:18 | 190K | |
| cherrytree-1.0.1.pkg | 2023-10-08 18:33 | 2.6M | |
| chessx-1.6.0.pkg | 2023-10-12 11:07 | 3.7M | |
| chexedit-0.9.7_2.pkg | 2023-10-08 15:34 | 34K | |
| chez-scheme-9.6.2.pkg | 2023-10-14 12:48 | 2.4M | |
| chezmoi-2.37.0_1.pkg | 2023-10-14 06:34 | 8.6M | |
| chgrep-1.2.4.pkg | 2023-10-14 05:40 | 10K | |
| chiapos-1.0.3.pkg | 2023-10-09 09:40 | 397K | |
| chibi-scheme-0.10.0.pkg | 2023-10-09 07:33 | 763K | |
| chicago95-2.0.1.119_..> | 2023-10-09 18:31 | 3.9M | |
| chicken-5.3.0,1.pkg | 2023-10-08 18:57 | 2.7M | |
| chilitags-2.0.0.169_..> | 2023-10-10 20:05 | 59K | |
| chillispot-1.0_13.pkg | 2023-10-09 15:06 | 74K | |
| chimes-calculator-1...> | 2023-10-07 01:42 | 127K | |
| chip-seq-0.1.2.pkg | 2023-10-10 08:15 | 696 | |
| chipvault-200607.pkg | 2023-10-09 09:14 | 84K | |
| chirp-py39-20230731.pkg | 2023-10-09 23:43 | 1.5M | |
| chisel-1.9.1_1.pkg | 2023-10-14 01:26 | 2.6M | |
| chkascii-2.4.pkg | 2023-10-10 06:39 | 8.8K | |
| chkrootkit-0.58b.pkg | 2023-10-14 07:02 | 31K | |
| chmlib-0.40_1.pkg | 2023-10-06 18:58 | 23K | |
| chmview-2.0b4_2.pkg | 2023-10-08 22:03 | 5.3K | |
| chntpw-140201.pkg | 2023-10-11 00:28 | 57K | |
| chocolate-doom-3.0.1..> | 2023-10-08 21:28 | 886K | |
| chomsky-2.3.pkg | 2023-10-10 13:09 | 63K | |
| choose-1.3.4_5.pkg | 2023-10-08 15:54 | 473K | |
| choparp-20150613.pkg | 2023-10-14 16:30 | 7.2K | |
| choqok-1.7.0_7.pkg | 2023-10-09 09:22 | 1.6M | |
| chordpack-0.8.1_2.pkg | 2023-10-10 14:25 | 20K | |
| choria-0.27.0_3.pkg | 2023-10-07 20:29 | 11M | |
| chpasswd-2.2.4_1.pkg | 2023-10-11 02:43 | 15K | |
| chpp-0.3.5_7.pkg | 2023-10-11 12:58 | 143K | |
| chroma-1.20.pkg | 2023-10-09 07:59 | 2.4M | |
| chroma-syntax-highli..> | 2023-10-09 09:53 | 2.1M | |
| chromaprint-1.5.1.20..> | 2023-10-06 12:03 | 45K | |
| chrome-gnome-shell-1..> | 2023-10-14 18:56 | 11K | |
| chromium-bsu-0.9.16...> | 2023-10-08 19:45 | 1.2M | |
| chromono-1.1.1.pkg | 2023-10-09 21:35 | 595K | |
| chrono-physics-simul..> | 2023-10-14 02:12 | 235M | |
| chrono-time-tracking..> | 2023-10-08 13:39 | 2.6M | |
| chrony-4.4.pkg | 2023-10-09 18:09 | 251K | |
| chrony-lite-4.4.pkg | 2023-10-09 13:17 | 238K | |
| chroot_safe-1.4_1.pkg | 2023-10-14 13:27 | 4.8K | |
| chrootuid-1.3.pkg | 2023-10-09 23:08 | 6.7K | |
| chrpath-0.16.pkg | 2023-10-14 04:10 | 13K | |
| chruby-0.3.9.pkg | 2023-10-10 10:06 | 2.3K | |
| chryzodus-0.32_4.pkg | 2023-10-10 08:21 | 13K | |
| chu-0.1.29.pkg | 2023-10-09 21:22 | 20K | |
| chuffed-0.12.1.pkg | 2023-10-07 22:29 | 369K | |
| chyves-0.2.0.pkg | 2023-10-11 06:13 | 72K | |
| cidr-2.3.2_1.pkg | 2023-10-11 05:20 | 6.0K | |
| cif-tools-1.0.9.pkg | 2023-10-08 14:59 | 195K | |
| cil-1.7.3_3.pkg | 2023-10-14 13:49 | 1.4M | |
| cim-3.37_2.pkg | 2023-10-09 16:48 | 170K | |
| cimg-3.3.0,3.pkg | 2023-10-09 17:13 | 5.9M | |
| cimod-1.5.1.pkg | 2023-10-07 05:50 | 19K | |
| cineencoder-3.5.5_1.pkg | 2023-10-09 19:49 | 769K | |
| cingb-0.32_1.pkg | 2023-10-10 16:10 | 44K | |
| cinnamon-control-cen..> | 2023-10-07 16:07 | 278K | |
| cinnamon-desktop-5.4..> | 2023-10-06 22:08 | 234K | |
| cinnamon-menus-5.4.0..> | 2023-10-07 09:18 | 55K | |
| cinnamon-screensaver..> | 2023-10-07 20:12 | 146K | |
| cinnamon-session-5.4..> | 2023-10-06 22:04 | 107K | |
| cinnamon-settings-da..> | 2023-10-07 02:52 | 359K | |
| cinnamon-translation..> | 2023-10-07 18:56 | 3.1M | |
| cinny-2.2.6.pkg | 2023-10-08 15:34 | 3.4M | |
| circuslinux-1.0.3_14..> | 2023-10-10 13:31 | 1.0M | |
| cirrus-cli-0.103.1.pkg | 2023-10-09 21:23 | 6.6M | |
| ciscoconf-1.1.pkg | 2023-10-09 00:21 | 9.5K | |
| ciso-1.0.0_2.pkg | 2023-10-08 17:03 | 7.7K | |
| ciso-maker-1.02.pkg | 2023-10-14 17:22 | 7.6K | |
| citra-qt5-s20220902_..> | 2023-10-10 00:10 | 4.9M | |
| citra-s20220902_3.pkg | 2023-10-09 15:01 | 4.2M | |
| cityhash-1.1.1_1.pkg | 2023-10-14 10:09 | 12K | |
| civetweb-1.15.pkg | 2023-10-07 01:11 | 92K | |
| cjdns-21.1_1.pkg | 2023-10-08 13:05 | 317K | |
| cjose-0.6.1_2.pkg | 2023-10-08 10:14 | 53K | |
| cjs-5.4.1_1.pkg | 2023-10-07 22:12 | 307K | |
| ck4up-1.4_1.pkg | 2023-10-10 08:01 | 6.3K | |
| ckb-libreoffice-7.5...> | 2023-10-08 06:02 | 242K | |
| ckeditor-4.21.0.pkg | 2023-10-14 05:36 | 940K | |
| ckpass-0.2.pkg | 2023-10-09 07:42 | 10K | |
| cksfv-1.3.15.pkg | 2023-10-10 15:12 | 11K | |
| cl-alexandria-1.2,1.pkg | 2023-10-07 08:43 | 192K | |
| cl-alexandria-sbcl-1..> | 2023-10-07 15:15 | 91K | |
| cl-asdf-3.3.4.7,2.pkg | 2023-10-06 16:57 | 145K | |
| cl-babel-2010.01.16_..> | 2023-10-07 21:07 | 88K | |
| cl-babel-sbcl-2010.0..> | 2023-10-10 03:42 | 124K | |
| cl-cffi-0.16.1.pkg | 2023-10-08 20:58 | 843K | |
| cl-clx-0.7.5.65.pkg | 2023-10-07 06:49 | 393K | |
| cl-clx-sbcl-0.7.5.65..> | 2023-10-08 08:17 | 774K | |
| cl-infix-19960628_3.pkg | 2023-10-08 06:17 | 12K | |
| cl-infix-sbcl-199606..> | 2023-10-11 02:22 | 23K | |
| cl-lml-2.5.7_2.pkg | 2023-10-08 06:28 | 11K | |
| cl-lml-sbcl-2.5.7_77..> | 2023-10-10 12:32 | 29K | |
| cl-md5-1.8.5_1.pkg | 2023-10-08 06:07 | 8.5K | |
| cl-md5-sbcl-1.8.5_79..> | 2023-10-10 18:20 | 16K | |
| cl-meta-0.1_3,1.pkg | 2023-10-07 16:21 | 34K | |
| cl-meta-sbcl-0.1_80,..> | 2023-10-11 02:16 | 12K | |
| cl-port-2002.10.02.1..> | 2023-10-07 10:56 | 19K | |
| cl-port-sbcl-2002.10..> | 2023-10-11 00:28 | 41K | |
| cl-ppcre-2.1.1.pkg | 2023-10-07 06:34 | 114K | |
| cl-ppcre-sbcl-2.1.1_..> | 2023-10-07 18:27 | 199K | |
| cl-split-sequence-20..> | 2023-10-08 11:23 | 2.7K | |
| cl-split-sequence-sb..> | 2023-10-11 11:31 | 6.1K | |
| cl-trivial-features-..> | 2023-10-07 03:27 | 6.7K | |
| cl-trivial-features-..> | 2023-10-07 16:53 | 2.0K | |
| cl-trivial-gray-stre..> | 2023-10-07 09:41 | 3.3K | |
| cl-trivial-gray-stre..> | 2023-10-08 06:51 | 5.1K | |
| clad-1.2.pkg | 2023-10-09 12:14 | 266K | |
| clamassassin-1.2.4_7..> | 2023-10-14 11:50 | 3.2K | |
| clamav-1.2.0_1,1.pkg | 2023-10-07 09:06 | 6.4M | |
| clamav-lts-1.0.3_1,1..> | 2023-10-09 01:41 | 5.0M | |
| clamav-unofficial-si..> | 2023-10-08 13:00 | 48K | |
| clamd-stream-client-..> | 2023-10-10 17:41 | 7.4K | |
| clamfs-1.2.0_3.pkg | 2023-10-11 22:15 | 48K | |
| clamsmtp-1.10_5.pkg | 2023-10-09 00:08 | 28K | |
| clamtk-6.14_1.pkg | 2023-10-10 03:50 | 56K | |
| clapper-0.5.2_3.pkg | 2023-10-10 17:27 | 173K | |
| clash-1.17.0_2.pkg | 2023-10-09 02:33 | 2.8M | |
| clasp-3.3.9.pkg | 2023-10-10 21:54 | 423K | |
| classiclooks-2.2.0_1..> | 2023-10-08 21:41 | 168K | |
| claws-mail-3.19.1.pkg | 2023-10-08 08:00 | 2.6M | |
| claws-mail-acpi_noti..> | 2023-10-09 09:04 | 7.7K | |
| claws-mail-address_k..> | 2023-10-10 23:00 | 6.8K | |
| claws-mail-archive-3..> | 2023-10-09 08:29 | 18K | |
| claws-mail-att_remov..> | 2023-10-09 01:01 | 7.3K | |
| claws-mail-attachwar..> | 2023-10-09 06:23 | 6.7K | |
| claws-mail-bogofilte..> | 2023-10-14 14:49 | 12K | |
| claws-mail-bsfilter-..> | 2023-10-09 18:24 | 9.4K | |
| claws-mail-clamd-3.1..> | 2023-10-14 07:47 | 14K | |
| claws-mail-dillo-3.1..> | 2023-10-09 19:57 | 6.1K | |
| claws-mail-fetchinfo..> | 2023-10-10 08:45 | 5.4K | |
| claws-mail-gdata-3.1..> | 2023-10-14 16:44 | 11K | |
| claws-mail-keyword_w..> | 2023-10-10 16:37 | 6.4K | |
| claws-mail-libravata..> | 2023-10-10 01:08 | 13K | |
| claws-mail-litehtml_..> | 2023-10-09 05:36 | 180K | |
| claws-mail-mailmbox-..> | 2023-10-10 23:33 | 45K | |
| claws-mail-managesie..> | 2023-10-09 02:19 | 23K | |
| claws-mail-newmail-3..> | 2023-10-09 14:57 | 3.4K | |
| claws-mail-notificat..> | 2023-10-09 02:29 | 45K | |
| claws-mail-pdf_viewe..> | 2023-10-08 15:18 | 15K | |
| claws-mail-perl-3.19..> | 2023-10-11 02:15 | 23K | |
| claws-mail-pgp-3.19...> | 2023-10-14 09:38 | 43K | |
| claws-mail-plugins-3..> | 2023-10-14 02:57 | 632 | |
| claws-mail-rssyl-3.1..> | 2023-10-10 17:52 | 46K | |
| claws-mail-spam_repo..> | 2023-10-14 17:15 | 8.0K | |
| claws-mail-spamassas..> | 2023-10-10 08:58 | 21K | |
| claws-mail-themes-20..> | 2023-10-07 03:23 | 2.3M | |
| claws-mail-tnef_pars..> | 2023-10-14 16:23 | 10K | |
| claws-mail-vcalendar..> | 2023-10-09 06:10 | 68K | |
| clazy-1.11_2.pkg | 2023-10-14 12:16 | 416K | |
| clblas-2.10_15.pkg | 2023-10-07 10:27 | 1.0M | |
| clblast-1.1.0_4.pkg | 2023-10-10 16:59 | 461K | |
| cld2-20150505.pkg | 2023-10-07 11:32 | 5.0M | |
| cldr-emoji-annotatio..> | 2023-10-06 14:08 | 4.6M | |
| clean-3.4.pkg | 2023-10-11 08:08 | 9.1K | |
| cleanfeed-20200402.pkg | 2023-10-14 16:37 | 28K | |
| cleanfeed-current-20..> | 2023-10-10 04:24 | 28K | |
| cleanup-maildir-0.3...> | 2023-10-14 18:57 | 6.3K | |
| clearlooks-0.6.2_14.pkg | 2023-10-08 10:44 | 46K | |
| clearlooks-metacity-..> | 2023-10-07 08:34 | 4.1K | |
| clearlooks-phenix-th..> | 2023-10-14 15:51 | 79K | |
| clearlooks-themes-0...> | 2023-10-10 04:29 | 16K | |
| clearlooks-themes-ex..> | 2023-10-10 13:16 | 143K | |
| clearsans-1.00_2.pkg | 2023-10-09 22:33 | 364K | |
| clearsilver-0.10.5_1..> | 2023-10-07 05:32 | 240K | |
| clewn-1.14_3.pkg | 2023-10-09 21:50 | 56K | |
| clex-4.7.pkg | 2023-10-10 09:28 | 113K | |
| clfft-2.12.2_1.pkg | 2023-10-10 02:26 | 281K | |
| clhep-2.4.6.4.pkg | 2023-10-07 20:24 | 1.4M | |
| cli-2.1.0.pkg | 2023-10-08 19:33 | 25K | |
| cli-visualizer-1.8.2..> | 2023-10-10 10:39 | 60K | |
| cli11-2.3.2.pkg | 2023-10-07 07:52 | 65K | |
| cli53-0.8.22_4.pkg | 2023-10-09 04:42 | 3.1M | |
| clickhouse-22.1.3.7.pkg | 2023-10-11 10:58 | 65M | |
| clifm-1.14.5.pkg | 2023-10-10 19:07 | 439K | |
| clig-1.9.11.1_3.pkg | 2023-10-08 15:28 | 58K | |
| cligen-6.2.0.pkg | 2023-10-07 17:16 | 80K | |
| climm-0.7.1_12.pkg | 2023-10-08 20:11 | 422K | |
| clinfo-3.0.23.01.25.pkg | 2023-10-06 17:18 | 49K | |
| cling-0.5.2018.08.13..> | 2023-10-08 09:25 | 24M | |
| clingcon-5.2.0.pkg | 2023-10-14 04:36 | 140K | |
| clingo-5.6.2.pkg | 2023-10-07 19:47 | 1.2M | |
| clipcat-0.5.0_7.pkg | 2023-10-08 23:12 | 3.0M | |
| cliphist-0.4.0_3.pkg | 2023-10-14 02:03 | 591K | |
| clipit-1.4.5_1.pkg | 2023-10-10 15:47 | 49K | |
| clipman-1.6.2_2.pkg | 2023-10-09 06:24 | 1.2M | |
| clipmenu-6.2.0.pkg | 2023-10-09 09:06 | 5.6K | |
| clipnotify-1.0.2.6.pkg | 2023-10-07 15:14 | 3.4K | |
| clipp-1.2.3.pkg | 2023-10-07 03:05 | 30K | |
| clipper-2.1.20180802..> | 2023-10-08 20:37 | 1.2M | |
| clips-6.30.pkg | 2023-10-09 20:32 | 309K | |
| cliquer-1.22.pkg | 2023-10-07 07:09 | 62K | |
| clisp-2.49.93+_5.pkg | 2023-10-11 00:00 | 2.5M | |
| clisp-hyperspec-7.0.pkg | 2023-10-14 08:40 | 1.3M | |
| clixon-6.2.0.pkg | 2023-10-12 04:37 | 439K | |
| cln-1.3.6.pkg | 2023-10-06 13:19 | 915K | |
| cloak-0.3.0_15.pkg | 2023-10-14 09:07 | 361K | |
| cloc-1.96.pkg | 2023-10-08 14:23 | 111K | |
| clockspeed-0.62_5.pkg | 2023-10-08 19:33 | 23K | |
| clog-1.6.pkg | 2023-10-09 02:28 | 5.2K | |
| clojure-1.11.1.1200.pkg | 2023-10-09 03:00 | 17M | |
| clojure-cider-1.7.0_..> | 2023-10-14 12:38 | 90K | |
| clojure-cider-emacs_..> | 2023-10-09 23:34 | 90K | |
| clojure-cider-emacs_..> | 2023-10-09 06:43 | 90K | |
| clojure-cider-emacs_..> | 2023-10-10 04:42 | 90K | |
| clojure-cider-emacs_..> | 2023-10-10 14:44 | 90K | |
| clojure-mode.el-5.11..> | 2023-10-08 11:15 | 29K | |
| clojure-mode.el-emac..> | 2023-10-08 02:53 | 29K | |
| clojure-mode.el-emac..> | 2023-10-07 15:25 | 29K | |
| clojure-mode.el-emac..> | 2023-10-07 16:06 | 29K | |
| clojure-mode.el-emac..> | 2023-10-08 07:28 | 29K | |
| clone-1.0.8.pkg | 2023-10-14 10:02 | 21K | |
| clonehdd-2.0.3_1.pkg | 2023-10-09 23:30 | 8.2K | |
| cloog-0.21.1.pkg | 2023-10-14 15:19 | 105K | |
| closql-1.2.1_6.pkg | 2023-10-07 20:35 | 11K | |
| closql-devel-1.2.1.2..> | 2023-10-07 23:33 | 13K | |
| closql-devel-emacs_c..> | 2023-10-07 12:23 | 13K | |
| closql-devel-emacs_d..> | 2023-10-07 11:40 | 13K | |
| closql-devel-emacs_d..> | 2023-10-08 07:19 | 13K | |
| closql-devel-emacs_n..> | 2023-10-08 11:22 | 13K | |
| closql-emacs_canna-1..> | 2023-10-08 10:21 | 11K | |
| closql-emacs_devel-1..> | 2023-10-07 15:22 | 11K | |
| closql-emacs_devel_n..> | 2023-10-08 02:26 | 11K | |
| closql-emacs_nox-1.2..> | 2023-10-07 20:13 | 11K | |
| closure-compiler-202..> | 2023-10-08 14:08 | 12M | |
| cloudabi-0.19.pkg | 2023-10-07 20:35 | 8.7K | |
| cloudabi-toolchain-1..> | 2023-10-10 13:29 | 3.1K | |
| cloudabi-utils-0.38_..> | 2023-10-10 01:06 | 78K | |
| cloudcompare-2.12.4_..> | 2023-10-09 10:48 | 3.7M | |
| cloudflared-2023.8.2..> | 2023-10-14 12:01 | 6.3M | |
| cloudquery-0.32.0_2.pkg | 2023-10-14 07:02 | 8.2M | |
| clover-22.3.7.pkg | 2023-10-08 03:25 | 2.3M | |
| clpbar-1.11.1.pkg | 2023-10-09 22:20 | 31K | |
| clpeak-1.1.2.pkg | 2023-10-09 23:42 | 46K | |
| clrng-1.0.0.b_3.pkg | 2023-10-11 22:54 | 59K | |
| clsync-0.4.r2_2.pkg | 2023-10-14 10:34 | 55K | |
| clthreads-2.4.2_1.pkg | 2023-10-07 02:20 | 11K | |
| cltune-2.7.0_2.pkg | 2023-10-10 05:25 | 86K | |
| clucene-2.3.3.4_21.pkg | 2023-10-06 21:13 | 781K | |
| clunk-1.3.261_1.pkg | 2023-10-14 15:57 | 2.6M | |
| clustal-omega-1.2.4.pkg | 2023-10-07 19:22 | 422K | |
| clustalw-2.1_3.pkg | 2023-10-07 05:12 | 241K | |
| cluster-glue-1.0.12_..> | 2023-10-09 01:33 | 476K | |
| clusterit-2.5.pkg | 2023-10-09 17:41 | 80K | |
| clusterssh-4.16.pkg | 2023-10-14 13:52 | 120K | |
| clutter-1.26.4_1.pkg | 2023-10-06 13:30 | 1.8M | |
| clutter-gst-2.0.18_2..> | 2023-10-09 17:39 | 67K | |
| clutter-gst3-3.0.27_..> | 2023-10-06 15:25 | 75K | |
| clutter-gtk3-1.8.4_2..> | 2023-10-06 15:18 | 26K | |
| cluttermm-1.17.3_5.pkg | 2023-10-09 15:55 | 308K | |
| clxclient-3.9.2.pkg | 2023-10-08 08:35 | 40K | |
| cm-0.4.2.pkg | 2023-10-08 21:44 | 245K | |
| cmake-3.26.1.pkg | 2023-10-08 04:12 | 772 | |
| cmake-core-3.26.1_2.pkg | 2023-10-05 17:35 | 8.0M | |
| cmake-doc-3.26.1.pkg | 2023-10-07 02:54 | 5.2M | |
| cmake-fedora-2.9.2.pkg | 2023-10-08 11:15 | 49K | |
| cmake-gui-qt5-3.26.1..> | 2023-10-10 15:02 | 2.0M | |
| cmake-gui-qt6-3.26.1..> | 2023-10-11 14:37 | 2.0M | |
| cmake-man-3.26.1.pkg | 2023-10-06 23:40 | 707K | |
| cmake-modules-webos-..> | 2023-10-08 10:41 | 25K | |
| cmark-0.30.2.pkg | 2023-10-06 23:32 | 139K | |
| cmatrix-2.0.pkg | 2023-10-10 23:25 | 8.8K | |
| cmdftp-0.9.8.pkg | 2023-10-11 05:28 | 27K | |
| cmdpack-1.06.pkg | 2023-10-08 14:14 | 66K | |
| cmdwatch-0.2.0_2.pkg | 2023-10-14 15:10 | 8.2K | |
| cmh-1.1.1_3.pkg | 2023-10-07 23:50 | 85K | |
| cminpack-1.3.6_5.pkg | 2023-10-06 21:30 | 88K | |
| cmios9-2.1.pkg | 2023-10-10 14:08 | 48K | |
| cmlib-3.0_9.pkg | 2023-10-09 04:23 | 1.3M | |
| cmocka-1.1.5.pkg | 2023-10-06 12:49 | 29K | |
| cmockery2-1.3.8.pkg | 2023-10-09 11:02 | 36K | |
| cmogstored-1.8.1.pkg | 2023-10-14 05:58 | 100K | |
| cmospwd-5.1.pkg | 2023-10-10 08:06 | 22K | |
| cmph-2.0_1.pkg | 2023-10-09 15:32 | 74K | |
| cmrt-1.0.6_2.pkg | 2023-10-07 10:04 | 170K | |
| cmrtlib-20.1.1.pkg | 2023-10-07 00:14 | 85K | |
| cmt-1.16_1.pkg | 2023-10-07 23:14 | 44K | |
| cmunge-1.0_2.pkg | 2023-10-09 03:35 | 21K | |
| cmus-2.10.0_6.pkg | 2023-10-09 16:01 | 197K | |
| cnagios-nagios3-0.33..> | 2023-10-09 14:32 | 22K | |
| cnagios-nagios4-0.33..> | 2023-10-10 02:04 | 22K | |
| cncli-5.3.2_4.pkg | 2023-10-14 13:15 | 3.6M | |
| cnd-0.7_1.pkg | 2023-10-14 14:01 | 7.1K | |
| cnews-cr.g_20.pkg | 2023-10-07 16:32 | 275K | |
| cntlm-0.92.3.pkg | 2023-10-10 07:30 | 53K | |
| cobalt-site-generato..> | 2023-10-10 22:04 | 2.7M | |
| coccigrep-1.20.pkg | 2023-10-10 01:46 | 23K | |
| coccinella-0.96.20_2..> | 2023-10-14 04:18 | 2.2M | |
| coccinelle-1.1.1.pkg | 2023-10-07 13:38 | 4.0M | |
| cockroach-19.1.11_15..> | 2023-10-14 07:40 | 16M | |
| cocoalib-0.99800.pkg | 2023-10-09 02:52 | 3.9M | |
| cocogitto-5.5.0_1.pkg | 2023-10-09 18:14 | 1.6M | |
| cocor-1.7_3.pkg | 2023-10-08 19:25 | 159K | |
| cocot-20120313_1.pkg | 2023-10-08 12:17 | 13K | |
| code-minimap-0.6.4_5..> | 2023-10-09 07:40 | 332K | |
| code2html-0.9.1_1.pkg | 2023-10-08 19:02 | 28K | |
| code2000-1.171_3.pkg | 2023-10-10 13:46 | 2.4M | |
| codeblocks-20.03_6.pkg | 2023-10-14 10:02 | 12M | |
| codec2-1.0.3_1.pkg | 2023-10-06 19:55 | 6.9M | |
| codeigniter-3.1.13.pkg | 2023-10-10 00:25 | 300K | |
| codequery-0.26.0.pkg | 2023-10-08 21:08 | 881K | |
| codesearch-1.1.0_14.pkg | 2023-10-09 04:11 | 898K | |
| codespell-2.2.5.pkg | 2023-10-08 14:18 | 218K | |
| codeville-0.1.18.pkg | 2023-10-10 05:34 | 160K | |
| codeworker-4.5.3.pkg | 2023-10-08 21:40 | 565K | |
| coeurl-0.3.0_1.pkg | 2023-10-07 07:29 | 64K | |
| coffeebreak-0.1.1.pkg | 2023-10-09 23:49 | 4.4K | |
| coffeescript-2.7.0_1..> | 2023-10-10 16:58 | 145K | |
| cogl-1.22.8_1.pkg | 2023-10-06 12:09 | 758K | |
| coin-or-Clp-1.17.8.pkg | 2023-10-06 12:52 | 970K | |
| coin-or-CoinUtils-2...> | 2023-10-06 10:39 | 569K | |
| coin-or-Data-Netlib-..> | 2023-10-05 16:53 | 3.4M | |
| coin-or-Data-Sample-..> | 2023-10-05 16:52 | 139K | |
| coin-or-Data-Stochas..> | 2023-10-10 00:32 | 59K | |
| coin-or-Osi-0.108.8.pkg | 2023-10-06 11:17 | 305K | |
| coin-or-alps-2.0.2.pkg | 2023-10-07 01:24 | 86K | |
| coin-or-asl-2.0.0.pkg | 2023-10-05 16:57 | 254K | |
| coin-or-bcps-0.99.2_..> | 2023-10-08 07:20 | 34K | |
| coin-or-bonmin-1.8.9..> | 2023-10-06 22:12 | 378K | |
| coin-or-cbc-2.10.10_..> | 2023-10-06 16:07 | 871K | |
| coin-or-cgl-0.60.7.pkg | 2023-10-06 15:28 | 455K | |
| coin-or-cgl-conic-1...> | 2023-10-08 02:53 | 66K | |
| coin-or-couenne-0.5...> | 2023-10-07 20:55 | 527K | |
| coin-or-cppad-202300..> | 2023-10-09 13:06 | 400K | |
| coin-or-creme-g20210..> | 2023-10-14 12:16 | 23K | |
| coin-or-csdp-6.2.0_1..> | 2023-10-14 17:27 | 55K | |
| coin-or-disco-1.0.0...> | 2023-10-12 05:11 | 123K | |
| coin-or-flopc++-1.2...> | 2023-10-09 14:05 | 61K | |
| coin-or-gravity-1.1...> | 2023-10-10 03:11 | 884K | |
| coin-or-highs-1.5.3_..> | 2023-10-09 07:50 | 1.3M | |
| coin-or-hsl-2.2.1_1.pkg | 2023-10-10 05:33 | 2.9K | |
| coin-or-lemon-1.3.1_..> | 2023-10-07 09:55 | 470K | |
| coin-or-metis-1.3.10..> | 2023-10-06 10:57 | 135K | |
| coin-or-mumps-3.0.3_..> | 2023-10-06 12:11 | 771K | |
| coin-or-osi-conic-1...> | 2023-10-06 18:38 | 24K | |
| coin-or-osiipopt-0.1..> | 2023-10-06 23:41 | 33K | |
| coin-or-qpOASES-3.2...> | 2023-10-10 06:52 | 181K | |
| coin-or-rehearse-g20..> | 2023-10-14 07:25 | 17K | |
| coin-or-symphony-5.7..> | 2023-10-10 05:39 | 294K | |
| cointop-1.6.10_14.pkg | 2023-10-10 08:07 | 3.1M | |
| collada-dom-2.5.0_8.pkg | 2023-10-14 12:39 | 1.3M | |
| collectd5-5.12.0_9.pkg | 2023-10-09 10:36 | 514K | |
| colly-2.1.0_14.pkg | 2023-10-14 04:16 | 30M | |
| colm-0.14.7.43.pkg | 2023-10-10 21:59 | 850K | |
| colmap-3.8_2.pkg | 2023-10-11 07:20 | 9.4M | |
| colobot-0.2.0_6.pkg | 2023-10-10 23:36 | 90M | |
| color-g20210207.pkg | 2023-10-09 08:28 | 250K | |
| color-widgets-qt5-2...> | 2023-10-10 06:00 | 139K | |
| colorcode-0.8.5_2.pkg | 2023-10-08 23:17 | 213K | |
| colord-1.4.6.pkg | 2023-10-05 18:00 | 726K | |
| colord-gtk-0.3.0_1.pkg | 2023-10-06 17:19 | 24K | |
| colordiff-1.0.21.pkg | 2023-10-10 21:02 | 9.3K | |
| colorgcc-1.4.5.pkg | 2023-10-14 15:00 | 5.4K | |
| colorize-0.3.4_3.pkg | 2023-10-07 20:28 | 9.7K | |
| colormake-0.9_1.pkg | 2023-10-08 15:34 | 3.1K | |
| colortail-0.3.3_1.pkg | 2023-10-09 04:22 | 20K | |
| coloursum-0.3.0_1.pkg | 2023-10-10 17:06 | 330K | |
| colpack-1.0.10.249_1..> | 2023-10-14 09:33 | 536K | |
| colt-1.2.0_1.pkg | 2023-10-09 10:48 | 1.0M | |
| columns-1.2b_9.pkg | 2023-10-08 12:14 | 489K | |
| colwide-0.01.pkg | 2023-10-08 15:19 | 1.7K | |
| comfortaa-ttf-3.001_..> | 2023-10-07 10:40 | 119K | |
| comic-neue-2.51.pkg | 2023-10-07 22:27 | 198K | |
| commit-mono-1.135.pkg | 2023-10-10 11:59 | 112K | |
| commit-patch-2.6.pkg | 2023-10-10 17:45 | 22K | |
| commoncpp-1.8.1_3,2.pkg | 2023-10-07 17:43 | 424K | |
| compat.el-29.1.4.2_1..> | 2023-10-06 19:49 | 73K | |
| compat.el-emacs_cann..> | 2023-10-06 23:01 | 73K | |
| compat.el-emacs_deve..> | 2023-10-06 19:22 | 73K | |
| compat.el-emacs_deve..> | 2023-10-06 19:12 | 73K | |
| compat.el-emacs_nox-..> | 2023-10-06 21:32 | 74K | |
| compat4x-i386-5.3_11..> | 2023-10-08 00:22 | 816K | |
| compat5x-amd64-5.4.0..> | 2023-10-07 20:29 | 3.9M | |
| compat6x-amd64-6.4.6..> | 2023-10-10 18:28 | 4.6M | |
| compat7x-amd64-7.4.7..> | 2023-10-08 15:48 | 4.9M | |
| compat8x-amd64-8.4.8..> | 2023-10-07 14:47 | 418K | |
| compat9x-amd64-9.3.9..> | 2023-10-07 01:43 | 2.8M | |
| compat10x-amd64-10.4..> | 2023-10-05 16:39 | 2.3M | |
| compat11x-amd64-11.2..> | 2023-10-09 14:57 | 2.3M | |
| compat12x-amd64-12.2..> | 2023-10-10 23:16 | 1.0M | |
| compiler-rt-0.r13163..> | 2023-10-11 03:18 | 6.8K | |
| compiz-0.8.8_15.pkg | 2023-10-07 02:23 | 801K | |
| compiz-bcop-0.8.8_2.pkg | 2023-10-07 03:50 | 6.7K | |
| compiz-plugins-extra..> | 2023-10-10 09:28 | 2.4M | |
| compiz-plugins-main-..> | 2023-10-08 11:49 | 1.1M | |
| compiz-plugins-unsup..> | 2023-10-11 22:19 | 857K | |
| compton-20160907_6.pkg | 2023-10-07 02:03 | 94K | |
| compton-conf-0.16.0_..> | 2023-10-09 14:30 | 43K | |
| comrak-0.18.0_2.pkg | 2023-10-14 17:29 | 1.0M | |
| comserv-1.4.4.pkg | 2023-10-10 09:07 | 28K | |
| conan-2.0.10.pkg | 2023-10-08 05:41 | 621K | |
| conauto-2.03.pkg | 2023-10-09 10:47 | 24K | |
| concentration-1.2_12..> | 2023-10-08 16:44 | 881K | |
| concordance-1.5.pkg | 2023-10-08 13:11 | 13K | |
| concorde-20031219.pkg | 2023-10-14 07:29 | 1.0M | |
| concourse-6.7.2_14.pkg | 2023-10-14 10:02 | 17M | |
| concourse-fly-6.7.1_..> | 2023-10-10 23:20 | 9.7M | |
| concurrencpp-0.1.7.pkg | 2023-10-09 19:55 | 73K | |
| concurrencykit-0.6.0..> | 2023-10-07 07:28 | 291K | |
| concurrentqueue-1.0...> | 2023-10-09 15:22 | 36K | |
| conduit-0.8.8.pkg | 2023-10-06 23:56 | 1.8M | |
| cone-1.12.pkg | 2023-10-10 05:12 | 1.4M | |
| confctl-1.2.pkg | 2023-10-10 05:14 | 15K | |
| confetti-0.0.2012080..> | 2023-10-10 21:19 | 62K | |
| confget-5.1.0.pkg | 2023-10-08 14:42 | 12K | |
| configkit-0.4.200809..> | 2023-10-09 04:18 | 39K | |
| confregdecode-1.2.1_..> | 2023-10-09 00:07 | 20K | |
| conky-1.19.4.pkg | 2023-10-07 14:34 | 263K | |
| conky-awesome-1.19.4..> | 2023-10-09 13:44 | 189K | |
| conkyforecast-2.24.pkg | 2023-10-11 16:39 | 2.4M | |
| conman-0.3.0.pkg | 2023-10-10 10:10 | 81K | |
| conmon-2.1.7_5.pkg | 2023-10-07 04:52 | 31K | |
| connectagram-1.3.4_1..> | 2023-10-08 15:00 | 20M | |
| connectfive-1.0.2_9.pkg | 2023-10-08 16:21 | 131K | |
| cons-2.2.0_3.pkg | 2023-10-07 12:57 | 106K | |
| cons-test-2.2.0_4.pkg | 2023-10-10 11:55 | 70K | |
| conserver-com-8.2.7.pkg | 2023-10-10 20:01 | 135K | |
| consolamono-ttf-2013..> | 2023-10-09 06:59 | 190K | |
| consolehm-1.31_1.pkg | 2023-10-09 07:57 | 7.2K | |
| consolekit2-1.2.6_2.pkg | 2023-10-05 17:53 | 147K | |
| construo-0.2.3_2.pkg | 2023-10-09 05:46 | 288K | |
| consul-1.16.1_1.pkg | 2023-10-08 02:44 | 19M | |
| consul-alerts-0.6.0_..> | 2023-10-08 22:27 | 2.9M | |
| consul-replicate-0.4..> | 2023-10-10 23:33 | 2.0M | |
| consul-template-0.33..> | 2023-10-14 02:17 | 3.5M | |
| consul_exporter-0.3...> | 2023-10-09 15:20 | 2.6M | |
| container-diff-0.17...> | 2023-10-09 03:36 | 2.8M | |
| containerd-1.7.5_1.pkg | 2023-10-09 00:27 | 24M | |
| containernetworking-..> | 2023-10-07 02:09 | 1.8M | |
| containers-0.9.0_3.pkg | 2023-10-07 01:14 | 33K | |
| containers-common-0...> | 2023-10-07 04:50 | 66K | |
| contractor-0.3.5.pkg | 2023-10-07 03:39 | 22K | |
| controllermap-2.28.2..> | 2023-10-10 09:49 | 53K | |
| convco-0.4.2_1.pkg | 2023-10-09 07:10 | 1.3M | |
| converseen-0.11.0.0.pkg | 2023-10-09 09:00 | 427K | |
| convertall-0.8.0_7.pkg | 2023-10-14 10:46 | 221K | |
| convey-0.3_3.pkg | 2023-10-09 14:02 | 908K | |
| convmv-2.05.pkg | 2023-10-14 11:14 | 20K | |
| cool-retro-term-1.1...> | 2023-10-09 01:35 | 1.5M | |
| cooledit-4.1.2.pkg | 2023-10-10 16:42 | 729K | |
| coolmail-1.3_3.pkg | 2023-10-10 10:36 | 12K | |
| coolreader-3.2.59.pkg | 2023-10-14 14:22 | 2.1M | |
| coordgenlibs-3.0.2.pkg | 2023-10-06 20:11 | 250K | |
| coovachilli-1.0.12_1..> | 2023-10-10 12:48 | 231K | |
| coppermine-1.6.25_1.pkg | 2023-10-14 17:11 | 2.6M | |
| copperspice-1.7.4_3.pkg | 2023-10-08 03:46 | 23M | |
| copperspice-examples..> | 2023-10-14 13:56 | 843K | |
| cops-1.04_1.pkg | 2023-10-09 20:34 | 256K | |
| copyq-qt5-7.1.0.pkg | 2023-10-11 00:35 | 1.6M | |
| copyq-qt6-7.1.0.pkg | 2023-10-10 11:32 | 1.7M | |
| copytape-1.0.pkg | 2023-10-11 00:54 | 6.7K | |
| coq-8.6_19,3.pkg | 2023-10-08 18:44 | 26M | |
| coq-emacs_canna-8.6_..> | 2023-10-09 19:59 | 26M | |
| coq-emacs_devel-8.6_..> | 2023-10-09 11:08 | 26M | |
| coq-emacs_devel_nox-..> | 2023-10-10 10:31 | 26M | |
| coq-emacs_nox-8.6_19..> | 2023-10-10 23:38 | 26M | |
| coredns-1.11.1_1.pkg | 2023-10-09 07:25 | 11M | |
| coregarage-4.3.0_2.pkg | 2023-10-08 02:35 | 52K | |
| coreos-ct-0.9.0_14.pkg | 2023-10-09 23:27 | 1.5M | |
| coreos-etcd-2.3.8_20..> | 2023-10-09 09:27 | 6.4M | |
| coreos-etcd31-3.1.20..> | 2023-10-08 12:08 | 6.6M | |
| coreos-etcd32-3.2.32..> | 2023-10-08 12:31 | 7.8M | |
| coreos-etcd33-3.3.23..> | 2023-10-08 12:22 | 8.6M | |
| coreos-etcd34-3.4.18..> | 2023-10-09 15:28 | 9.1M | |
| coreterminal-4.3.0_3..> | 2023-10-10 14:29 | 46K | |
| coreutils-9.1.pkg | 2023-10-05 17:18 | 2.7M | |
| corkscrew-2.0_1.pkg | 2023-10-09 15:17 | 6.1K | |
| coronapoker-4.33.pkg | 2023-10-11 14:35 | 89M | |
| corosync2-2.4.6.pkg | 2023-10-07 22:27 | 438K | |
| corosync3-3.1.7.pkg | 2023-10-09 02:41 | 441K | |
| corrade-2020.06.1214..> | 2023-10-07 00:50 | 525K | |
| corrupter-1.0_14.pkg | 2023-10-10 17:19 | 609K | |
| corsixth-0.67.pkg | 2023-10-11 12:42 | 1.8M | |
| cos-2002.11.05_3,1.pkg | 2023-10-09 04:14 | 159K | |
| cosma-2.6.2_1.pkg | 2023-10-09 22:39 | 329K | |
| cosmoplayer-2.1.1_2.pkg | 2023-10-10 10:11 | 33K | |
| cosmosmash-1.4.8.pkg | 2023-10-10 10:50 | 434K | |
| costa-2.2_2.pkg | 2023-10-08 06:34 | 98K | |
| couchdb3-3.3.2.pkg | 2023-10-12 06:32 | 11M | |
| countdown-20150606.pkg | 2023-10-08 14:52 | 5.3K | |
| countrycodes-1.0.6.pkg | 2023-10-10 08:57 | 12K | |
| courier-1.1.11.pkg | 2023-10-08 17:24 | 1.8M | |
| courier-analog-0.21.pkg | 2023-10-09 09:51 | 14K | |
| courier-authlib-0.72..> | 2023-10-09 16:52 | 700 | |
| courier-authlib-base..> | 2023-10-08 10:16 | 130K | |
| courier-authlib-ldap..> | 2023-10-14 08:43 | 34K | |
| courier-authlib-mysq..> | 2023-10-14 18:35 | 29K | |
| courier-authlib-pgsq..> | 2023-10-09 14:07 | 20K | |
| courier-authlib-sqli..> | 2023-10-10 16:22 | 20K | |
| courier-authlib-user..> | 2023-10-10 03:08 | 31K | |
| courier-authlib-user..> | 2023-10-14 19:01 | 31K | |
| courier-authlib-vchk..> | 2023-10-09 03:26 | 42K | |
| courier-imap-5.2.5,2..> | 2023-10-10 09:08 | 353K | |
| courier-prime-g20180..> | 2023-10-08 05:48 | 102K | |
| courier-sox-0.17.pkg | 2023-10-08 13:41 | 54K | |
| courier-unicode-2.2...> | 2023-10-07 03:21 | 179K | |
| couriergraph-2006020..> | 2023-10-11 08:31 | 8.2K | |
| courierpassd-1.1.2.pkg | 2023-10-10 18:39 | 20K | |
| courierpasswd-1.1.3.pkg | 2023-10-14 06:39 | 15K | |
| courieruserinfo-1.1...> | 2023-10-08 18:45 | 11K | |
| coursier-1.1.0.m12.pkg | 2023-10-12 12:45 | 16K | |
| covtool-2.1_11.pkg | 2023-10-09 19:05 | 151K | |
| cowpatty-4.8.pkg | 2023-10-14 12:13 | 36K | |
| cowrie-2.5.0.pkg | 2023-10-09 17:18 | 351K | |
| cowsay-3.04_2.pkg | 2023-10-08 07:55 | 17K | |
| coxeter-3.1.20210124..> | 2023-10-08 16:31 | 354K | |
| coyim-0.3.11_19.pkg | 2023-10-09 15:09 | 3.1M | |
| cozette-1.22.2.pkg | 2023-10-14 06:27 | 26K | |
| cp2k-2022.2_1.pkg | 2023-10-09 20:24 | 29M | |
| cp2k-data-2022.2.pkg | 2023-10-07 10:25 | 17M | |
| cpan-upload-2.2_2.pkg | 2023-10-08 23:16 | 10K | |
| cpan-upload-http-2.4..> | 2023-10-09 21:51 | 8.9K | |
| cparser-0.9.14.pkg | 2023-10-09 22:37 | 167K | |
| cpdup-1.22.pkg | 2023-10-11 01:16 | 28K | |
| cpeditor-6.10.3.pkg | 2023-10-09 21:17 | 784K | |
| cpipe-3.0.2.pkg | 2023-10-08 23:38 | 10K | |
| cplanet-0.9_2.pkg | 2023-10-09 15:45 | 74K | |
| cpmtools-1.1_2.pkg | 2023-10-14 13:45 | 15K | |
| cpmtools2-2.24.pkg | 2023-10-10 22:52 | 76K | |
| cpp-hocon-0.3.0_4.pkg | 2023-10-08 01:46 | 386K | |
| cpp-httplib-0.14.0.pkg | 2023-10-10 21:59 | 51K | |
| cpp-netlib-0.13.0_5.pkg | 2023-10-09 09:31 | 224K | |
| cpp-pcp-client-1.7.7..> | 2023-10-08 02:15 | 499K | |
| cpp-peglib-1.8.4.pkg | 2023-10-10 16:47 | 23K | |
| cpp-utilities-5.24.1..> | 2023-10-08 02:52 | 152K | |
| cpp2py-2.0.0_1.pkg | 2023-10-09 11:29 | 74K | |
| cppcheck-2.10.3.pkg | 2023-10-09 19:02 | 2.3M | |
| cppdb-0.3.1_2.pkg | 2023-10-10 05:05 | 108K | |
| cppi-1.18_1.pkg | 2023-10-08 20:31 | 47K | |
| cpplint-1.6.1.pkg | 2023-10-12 12:19 | 107K | |
| cpprestsdk-2.10.18.pkg | 2023-10-14 17:40 | 922K | |
| cpptest-2.0.0_1.pkg | 2023-10-07 15:32 | 48K | |
| cpptoml-0.1.1.pkg | 2023-10-07 00:03 | 18K | |
| cppunit-1.15.1.pkg | 2023-10-06 17:56 | 201K | |
| cppurses-0.3.5.pkg | 2023-10-10 05:28 | 208K | |
| cpputest-4.0.pkg | 2023-10-09 04:25 | 178K | |
| cppzmq-4.9.0.pkg | 2023-10-06 19:45 | 22K | |
| cpr-1.10.4.pkg | 2023-10-09 22:37 | 94K | |
| cproto-4.7k.pkg | 2023-10-08 09:41 | 31K | |
| cptutils-1.76.pkg | 2023-10-08 14:36 | 199K | |
| cpu-microcode-1.0.pkg | 2023-10-10 00:10 | 552 | |
| cpu-microcode-amd-20..> | 2023-10-07 11:08 | 56K | |
| cpu-microcode-intel-..> | 2023-10-08 00:40 | 8.1M | |
| cpu-microcode-rc-1.0..> | 2023-10-07 03:53 | 2.0K | |
| cpu-x-4.5.3.pkg | 2023-10-14 09:50 | 1.6M | |
| cpu-x-tuionly-4.5.3.pkg | 2023-10-14 04:25 | 213K | |
| cpu_features-0.7.0.pkg | 2023-10-06 16:35 | 25K | |
| cpu_rec_rs-1.0.0_2.pkg | 2023-10-09 03:30 | 8.2M | |
| cpuburn-1.4_3.pkg | 2023-10-10 14:09 | 6.4K | |
| cpufetch-1.04.pkg | 2023-10-10 00:51 | 30K | |
| cpuid-3.3_7.pkg | 2023-10-10 14:34 | 11K | |
| cpuid-etallen-202301..> | 2023-10-10 21:43 | 86K | |
| cpuid2cpuflags-12.pkg | 2023-10-14 03:54 | 5.1K | |
| cpulimit-2.2.pkg | 2023-10-09 14:49 | 9.6K | |
| cpuminer-2.5.1_1.pkg | 2023-10-10 22:58 | 54K | |
| cpupdate-g20180513_5..> | 2023-10-10 08:32 | 14K | |
| cqrlog-gtk2-2.5.2_4.pkg | 2023-10-14 12:10 | 14M | |
| cqrlog-qt5-2.5.2_4.pkg | 2023-10-09 13:54 | 14M | |
| cquery-20180718_7.pkg | 2023-10-10 17:47 | 647K | |
| crack-attack-1.1.14_..> | 2023-10-10 13:38 | 402K | |
| cracklib-2.9.7_1.pkg | 2023-10-06 15:14 | 3.4M | |
| crackpkcs12-0.2.11.pkg | 2023-10-14 16:36 | 6.3K | |
| craft-1.0_10.pkg | 2023-10-08 18:13 | 695K | |
| crafty-25.2_1.pkg | 2023-10-08 15:53 | 960K | |
| cramfs-1.1_1.pkg | 2023-10-14 09:34 | 12K | |
| crashme-2.4_1.pkg | 2023-10-09 10:59 | 19K | |
| crashtest-1.1_4.pkg | 2023-10-09 03:21 | 236K | |
| crate-0.1.3_2.pkg | 2023-10-10 18:06 | 116K | |
| crawl-0.4_14.pkg | 2023-10-09 04:03 | 27K | |
| crc32c-1.1.2.pkg | 2023-10-06 13:01 | 14K | |
| cream-0.43.pkg | 2023-10-09 04:04 | 626K | |
| create-cert-2.10.pkg | 2023-10-14 16:54 | 8.3K | |
| create-rb-port-0.0.3..> | 2023-10-10 01:03 | 2.1K | |
| createtorrent-1.1.4.pkg | 2023-10-09 20:03 | 6.0K | |
| credis-0.2.3.pkg | 2023-10-14 06:40 | 20K | |
| creduce-2.11.0.l13.g..> | 2023-10-09 01:50 | 1.3M | |
| cretan-hubris-0.2_7.pkg | 2023-10-09 09:25 | 265K | |
| crex-0.2.5_2.pkg | 2023-10-10 04:41 | 65K | |
| crf++-0.59_2.pkg | 2023-10-14 04:29 | 282K | |
| cricket-1.0.5_12.pkg | 2023-10-14 10:48 | 350K | |
| crimson-fields-0.5.3..> | 2023-10-10 06:23 | 517K | |
| crispy-doom-6.0_1.pkg | 2023-10-11 06:45 | 1.0M | |
| critcl-3.2.pkg | 2023-10-07 17:43 | 437K | |
| criterion-2.4.2_1.pkg | 2023-10-09 17:08 | 114K | |
| criticalmass-1.5.0_3..> | 2023-10-10 01:59 | 2.8M | |
| crlfuzz-1.4.1_15.pkg | 2023-10-10 12:52 | 1.6M | |
| crlibm-1.0.b4_2.pkg | 2023-10-10 03:08 | 1.5M | |
| crm114-20100106_6.pkg | 2023-10-10 03:28 | 382K | |
| crmsh-4.3.1.pkg | 2023-10-09 14:31 | 846K | |
| croc-9.6.5_2.pkg | 2023-10-09 19:50 | 2.4M | |
| cronic-3.pkg | 2023-10-14 05:46 | 1.2K | |
| cronolog-1.6.2_6.pkg | 2023-10-10 23:15 | 21K | |
| cronolog-devel-1.7.1..> | 2023-10-10 00:08 | 22K | |
| croscorefonts-1.31.0..> | 2023-10-08 03:11 | 2.0M | |
| crosextrafonts-calad..> | 2023-10-06 20:13 | 78K | |
| crosextrafonts-carli..> | 2023-10-06 22:45 | 724K | |
| crossfire-client-1.7..> | 2023-10-08 12:40 | 590K | |
| crossip-1.2_5.pkg | 2023-10-09 05:12 | 39K | |
| crosti-1.14.0_2.pkg | 2023-10-09 11:56 | 490K | |
| crow-translate-2.10...> | 2023-10-11 10:38 | 963K | |
| crowdsec-1.5.1_2.pkg | 2023-10-14 08:48 | 35M | |
| crowdsec-blocklist-m..> | 2023-10-08 12:39 | 3.5M | |
| crowdsec-firewall-bo..> | 2023-10-10 03:01 | 3.3M | |
| crrcsim-0.9.13_3.pkg | 2023-10-08 20:35 | 6.5M | |
| crunch-3.6.pkg | 2023-10-09 14:34 | 30K | |
| crw-1.03_3.pkg | 2023-10-09 04:08 | 18K | |
| cryptcat-1.2.1,1.pkg | 2023-10-09 16:27 | 431K | |
| cryptlib-3.4.6.pkg | 2023-10-08 06:36 | 1.0M | |
| cryptoballot-g201810..> | 2023-10-11 11:44 | 3.9M | |
| cryptominisat-5.11.1..> | 2023-10-07 00:07 | 573K | |
| cryptopp-8.8.0.pkg | 2023-10-07 21:52 | 9.5M | |
| cryptoslam-1.2.pkg | 2023-10-14 04:35 | 9.5K | |
| crystal-1.7.3.pkg | 2023-10-07 03:28 | 6.1M | |
| cs-0.9.6_2.pkg | 2023-10-10 20:56 | 2.9K | |
| cs-aspell-20040614.1..> | 2023-10-09 10:22 | 2.0M | |
| cs-hunspell-2.0.pkg | 2023-10-09 18:32 | 482K | |
| cs-hyphen-2.0.pkg | 2023-10-09 16:33 | 9.2K | |
| cs-libreoffice-7.5.5..> | 2023-10-07 14:00 | 3.1M | |
| cs-mythes-2007.09.26..> | 2023-10-10 14:03 | 190K | |
| csb-aspell-0.02.0_1,..> | 2023-10-09 04:16 | 40K | |
| cscope-15.9.pkg | 2023-10-08 01:22 | 128K | |
| cscout-3.01.pkg | 2023-10-10 10:59 | 415K | |
| csharp-mode.el-0.9.2..> | 2023-10-08 17:14 | 29K | |
| csharp-mode.el-emacs..> | 2023-10-08 22:41 | 29K | |
| csharp-mode.el-emacs..> | 2023-10-10 20:16 | 29K | |
| csharp-mode.el-emacs..> | 2023-10-10 03:27 | 29K | |
| csharp-mode.el-emacs..> | 2023-10-14 08:26 | 29K | |
| csmash-0.6.6_23.pkg | 2023-10-14 12:07 | 1.3M | |
| csmith-2.3.0.pkg | 2023-10-11 15:06 | 317K | |
| csoap-1.1.0_5.pkg | 2023-10-08 17:48 | 78K | |
| csocks-1.7_1.pkg | 2023-10-10 07:39 | 12K | |
| csound-6.15.0_10.pkg | 2023-10-07 04:05 | 6.4M | |
| css-mode-elisp-0.11_..> | 2023-10-10 20:54 | 6.9K | |
| cssc-1.4.1.pkg | 2023-10-14 06:15 | 234K | |
| cssed-0.4.0_15.pkg | 2023-10-09 08:11 | 544K | |
| csso-1.3.9_3.pkg | 2023-10-08 21:51 | 20K | |
| csstidy-1.4.pkg | 2023-10-09 22:08 | 88K | |
| cstream-3.2.1.pkg | 2023-10-09 14:02 | 18K | |
| csvdiff-1.7_1.pkg | 2023-10-10 08:51 | 18K | |
| csvq-1.18.1_2.pkg | 2023-10-14 09:49 | 3.1M | |
| csvtk-0.24.0_15.pkg | 2023-10-07 21:17 | 6.6M | |
| csxcad-0.6.2.109_8.pkg | 2023-10-06 23:39 | 211K | |
| csync2-2.0_3.pkg | 2023-10-08 20:39 | 56K | |
| ct-submit-1.1.2_15.pkg | 2023-10-14 17:09 | 1.6M | |
| ctags-5.8.pkg | 2023-10-06 16:52 | 126K | |
| ctcs-1.4.1_1.pkg | 2023-10-08 16:34 | 24K | |
| ctemplate-0.5.pkg | 2023-10-08 13:11 | 14K | |
| ctl-sat-g20200210.pkg | 2023-10-14 09:40 | 48K | |
| ctm-2.0_3.pkg | 2023-10-14 12:02 | 38K | |
| ctop-0.7.7_13.pkg | 2023-10-14 08:43 | 2.6M | |
| ctorrent-3.3.2_4.pkg | 2023-10-10 23:34 | 93K | |
| ctpl-0.3.4.pkg | 2023-10-07 00:13 | 89K | |
| ctpp2-2.8.3_8.pkg | 2023-10-06 23:58 | 365K | |
| ctrace-0.9_1.pkg | 2023-10-14 09:26 | 13K | |
| ctre-3.8.pkg | 2023-10-14 10:15 | 85K | |
| ctris-0.42.1.pkg | 2023-10-14 06:11 | 11K | |
| ctrlproxy-3.0.8_9.pkg | 2023-10-08 21:57 | 161K | |
| ctronome-0.5.6.pkg | 2023-10-09 15:14 | 10K | |
| ctwm-4.1.0_1,1.pkg | 2023-10-09 13:21 | 414K | |
| ctypes.sh-1.2_2.pkg | 2023-10-08 19:45 | 12K | |
| cube-2005.08.29_19.pkg | 2023-10-10 01:09 | 27M | |
| cubicsdr-0.2.5_12.pkg | 2023-10-14 11:35 | 949K | |
| cudatext-gtk2-1.198...> | 2023-10-10 03:48 | 6.6M | |
| cudatext-qt5-1.198.0..> | 2023-10-10 07:21 | 6.5M | |
| cudd-3.0.0.pkg | 2023-10-07 01:48 | 290K | |
| cuetools-1.4.1.pkg | 2023-10-10 02:05 | 46K | |
| cufflinks-2.2.1.89_6..> | 2023-10-09 15:57 | 1.3M | |
| cunit-2.1.3_3.pkg | 2023-10-08 10:07 | 148K | |
| cups-2.4.6.pkg | 2023-10-05 17:57 | 1.5M | |
| cups-bjnp-2.0.3.pkg | 2023-10-09 17:57 | 17K | |
| cups-filters-1.28.16..> | 2023-10-06 20:38 | 863K | |
| cups-fxlinuxprint-1...> | 2023-10-08 21:16 | 13K | |
| cups-pdf-3.0.1_2.pkg | 2023-10-14 18:48 | 21K | |
| cups-pk-helper-0.2.7..> | 2023-10-07 10:08 | 58K | |
| cups-smb-backend-1.0..> | 2023-10-08 19:18 | 1.2K | |
| curator-2.1_8.pkg | 2023-10-08 21:13 | 23K | |
| curl-8.2.1.pkg | 2023-10-05 17:24 | 1.4M | |
| curlie-1.6.7_15.pkg | 2023-10-11 10:48 | 738K | |
| curlpp-0.8.1_4.pkg | 2023-10-14 11:32 | 150K | |
| currtime-0.2.5.pkg | 2023-10-09 10:56 | 4.4K | |
| cursive-0.11,1.pkg | 2023-10-14 04:38 | 5.9K | |
| cursor-ardoise-theme..> | 2023-10-11 07:25 | 195K | |
| cursor-chameleon-ant..> | 2023-10-14 06:02 | 1.3M | |
| cursor-chameleon-dar..> | 2023-10-10 12:33 | 1.4M | |
| cursor-chameleon-pea..> | 2023-10-09 09:15 | 1.3M | |
| cursor-chameleon-sky..> | 2023-10-10 10:45 | 1.4M | |
| cursor-chameleon-whi..> | 2023-10-11 05:27 | 1.2M | |
| cursor-crystal-theme..> | 2023-10-10 14:13 | 119K | |
| cursor-dmz-aa-theme-..> | 2023-10-09 15:03 | 99K | |
| cursor-dmz-theme-0.4..> | 2023-10-10 23:03 | 93K | |
| cursor-jimmac-theme-..> | 2023-10-09 09:44 | 9.4K | |
| cursor-neutral-white..> | 2023-10-08 19:08 | 11K | |
| curtail-1.7.0_2.pkg | 2023-10-11 08:01 | 56K | |
| curv-0.5_17.pkg | 2023-10-14 04:22 | 970K | |
| curvedns-0.88.b_13.pkg | 2023-10-09 02:14 | 21K | |
| cut-2.7_1.pkg | 2023-10-10 18:37 | 9.4K | |
| cutecom-0.51.0_1.pkg | 2023-10-10 18:10 | 254K | |
| cutegram-2.7.1_6.pkg | 2023-10-09 22:52 | 12M | |
| cutelyst-3.7.0.pkg | 2023-10-08 23:56 | 623K | |
| cutelyst-asql-0.80.0..> | 2023-10-09 13:44 | 99K | |
| cutemaze-1.3.2_1.pkg | 2023-10-14 10:46 | 296K | |
| cutils-1.6_1.pkg | 2023-10-09 16:17 | 65K | |
| cutmp3-3.0.1_2.pkg | 2023-10-14 04:17 | 47K | |
| cutter-1.2.6_4.pkg | 2023-10-10 02:27 | 463K | |
| cuttlefish-1.3_5.pkg | 2023-10-10 18:23 | 431K | |
| cuttlefish-texture-c..> | 2023-10-08 21:18 | 453K | |
| cuyo-2.1.0,1.pkg | 2023-10-09 19:52 | 3.4M | |
| cvc-1.1.5.pkg | 2023-10-14 06:13 | 640K | |
| cvc5-1.0.8.pkg | 2023-10-10 17:35 | 5.4M | |
| cvechecker-3.9_1.pkg | 2023-10-08 14:29 | 51K | |
| cvise-2.8.0.pkg | 2023-10-14 15:00 | 1.5M | |
| cvm-0.97.pkg | 2023-10-08 04:51 | 85K | |
| cvs+ipv6-1.20120905_..> | 2023-10-09 08:34 | 492K | |
| cvs-1.20120905_7.pkg | 2023-10-07 01:04 | 492K | |
| cvs-devel-1.12.13_13..> | 2023-10-14 07:49 | 592K | |
| cvs-syncmail-2.1.pkg | 2023-10-09 22:36 | 5.5K | |
| cvs2cl-2.73.pkg | 2023-10-08 21:44 | 33K | |
| cvs2darcs-0.8_9.pkg | 2023-10-10 00:29 | 7.5K | |
| cvs2html-1.98_1.pkg | 2023-10-09 02:28 | 16K | |
| cvsadmin-1.0.3_2.pkg | 2023-10-08 17:16 | 12K | |
| cvsbook-1.21_3.pkg | 2023-10-08 19:23 | 1.5M | |
| cvschangelogbuilder-..> | 2023-10-09 14:03 | 58K | |
| cvschk-1.12.pkg | 2023-10-10 09:21 | 7.2K | |
| cvsd-1.0.24.pkg | 2023-10-10 01:26 | 42K | |
| cvsdadm-0.3.2_1.pkg | 2023-10-09 17:32 | 12K | |
| cvsdelta-1.7.0.pkg | 2023-10-08 17:43 | 18K | |
| cvsdiff2patch-1.0.1.pkg | 2023-10-10 10:27 | 3.3K | |
| cvsgraph-1.7.2_1.pkg | 2023-10-07 11:46 | 71K | |
| cvslines-1.6.9.pkg | 2023-10-09 10:50 | 37K | |
| cvsmail-2.2.pkg | 2023-10-09 10:41 | 14K | |
| cvsmonitor-0.6.3_8.pkg | 2023-10-09 04:00 | 97K | |
| cvsplot-1.7.4_5.pkg | 2023-10-10 13:17 | 9.8K | |
| cvsps-2.1_2.pkg | 2023-10-07 23:00 | 37K | |
| cvsps-devel-2.2.b1.pkg | 2023-10-09 01:15 | 37K | |
| cvsspam-0.2.12_1.pkg | 2023-10-08 11:58 | 54K | |
| cvstrac-2.0.1_1.pkg | 2023-10-09 20:19 | 145K | |
| cvsutils-0.2.6,1.pkg | 2023-10-08 20:27 | 17K | |
| cvsweb-2.0.6_2.pkg | 2023-10-10 19:02 | 46K | |
| cvsweb3-3.0.6_5.pkg | 2023-10-09 15:18 | 63K | |
| cvswrap-0.2.pkg | 2023-10-08 20:21 | 8.5K | |
| cvsync-0.25.0.pkg | 2023-10-09 09:41 | 132K | |
| cw-1.0.16_1.pkg | 2023-10-14 03:47 | 50K | |
| cwdaemon-0.10.2.pkg | 2023-10-08 21:09 | 112K | |
| cweb-3.64a.a.pkg | 2023-10-07 17:07 | 87K | |
| cwm-7.1.pkg | 2023-10-09 08:06 | 42K | |
| cwrap-1.1.0.pkg | 2023-10-08 20:42 | 492 | |
| cwstudio-0.9.6_5.pkg | 2023-10-09 08:59 | 254K | |
| cwtext-0.96.pkg | 2023-10-09 16:30 | 9.6K | |
| cx88-1.5.4.pkg | 2023-10-10 04:38 | 213K | |
| cxmon-3.2.pkg | 2023-10-09 07:51 | 79K | |
| cxref-1.6e.pkg | 2023-10-08 15:11 | 116K | |
| cxxmatrix-g20220324.pkg | 2023-10-09 17:23 | 41K | |
| cxxopts-3.1.1.pkg | 2023-10-07 16:14 | 15K | |
| cxxplot-0.4.2_1.pkg | 2023-10-10 04:53 | 503K | |
| cxxtest-4.4_2.pkg | 2023-10-10 19:49 | 366K | |
| cxxtools-2.2.1_3.pkg | 2023-10-08 06:28 | 1.2M | |
| cy-aspell-0.50.3_1,1..> | 2023-10-09 14:34 | 1.7M | |
| cy-hunspell-v2022072..> | 2023-10-09 06:32 | 160K | |
| cy-libreoffice-7.5.5..> | 2023-10-07 14:08 | 734K | |
| cyanrip-0.9.0_2.pkg | 2023-10-08 21:20 | 37K | |
| cyberbit-ttfonts-2.0..> | 2023-10-08 19:58 | 4.6M | |
| cyberchef-10.5.2.pkg | 2023-10-09 09:55 | 15M | |
| cyr-rfx-koi8-o-1.1_5..> | 2023-10-08 19:11 | 751K | |
| cyrus-imapd23-2.3.20..> | 2023-10-14 18:07 | 1.7M | |
| cyrus-imapd24-2.4.22..> | 2023-10-08 06:24 | 2.0M | |
| cyrus-imapd25-2.5.17..> | 2023-10-14 19:05 | 1.2M | |
| cyrus-imapd30-3.0.18..> | 2023-10-14 11:17 | 2.8M | |
| cyrus-imapd32-3.2.11..> | 2023-10-14 03:29 | 3.0M | |
| cyrus-imapd34-3.4.5_..> | 2023-10-14 17:17 | 3.1M | |
| cyrus-imapd34-http-3..> | 2023-10-14 06:09 | 3.3M | |
| cyrus-imapd36-3.6.3.pkg | 2023-10-10 12:00 | 3.2M | |
| cyrus-imapd36-http-3..> | 2023-10-14 11:48 | 3.4M | |
| cyrus-imapd38-3.8.1.pkg | 2023-10-10 05:23 | 3.2M | |
| cyrus-imapd38-http-3..> | 2023-10-11 00:47 | 3.5M | |
| cyrus-sasl-2.1.28.pkg | 2023-10-05 16:50 | 967K | |
| cyrus-sasl-gssapi-2...> | 2023-10-07 16:13 | 16K | |
| cyrus-sasl-ldapdb-2...> | 2023-10-10 12:17 | 12K | |
| cyrus-sasl-saslauthd..> | 2023-10-08 09:37 | 42K | |
| cyrus-sasl-sql-2.1.2..> | 2023-10-08 19:23 | 14K | |
| cyrus-sasl-srp-2.1.2..> | 2023-10-14 13:09 | 26K | |
| cyrus2courier-1.4_1.pkg | 2023-10-09 00:12 | 12K | |
| cyrus2dovecot-1.3.pkg | 2023-10-09 09:10 | 23K | |
| cytoscape-3.6.1.pkg | 2023-10-08 17:30 | 1.2G | |
| czkawka-6.0.0_2.pkg | 2023-10-14 06:20 | 5.5M | |
| czmq-4.1.1.pkg | 2023-10-07 10:49 | 326K | |
| czmq4-4.2.1.pkg | 2023-10-10 11:16 | 547K | |
| d-feet-0.3.16_1.pkg | 2023-10-10 18:13 | 51K | |
| d-spy-1.8.0.pkg | 2023-10-09 03:09 | 68K | |
| d0_blind_id-1.0_2.pkg | 2023-10-08 06:30 | 48K | |
| d2x-0.2.5_15.pkg | 2023-10-10 02:05 | 367K | |
| d11amp-0.61_1.pkg | 2023-10-10 03:06 | 57K | |
| dDocent-2.7.8_2.pkg | 2023-10-14 12:25 | 25K | |
| dMagnetic-0.37.pkg | 2023-10-09 07:03 | 74K | |
| da-aspell-1.6.36.11...> | 2023-10-09 10:30 | 2.6M | |
| da-libreoffice-7.5.5..> | 2023-10-07 19:45 | 3.1M | |
| daa2iso-0.1.7e_1.pkg | 2023-10-10 16:59 | 27K | |
| dact-0.8.42_2.pkg | 2023-10-14 18:12 | 56K | |
| dadadodo-1.04.pkg | 2023-10-10 07:51 | 17K | |
| dae-0.9.pkg | 2023-10-09 01:12 | 2.3K | |
| daemonize-1.7.8.pkg | 2023-10-08 20:21 | 8.6K | |
| daemonlogger-1.2.2.pkg | 2023-10-14 18:10 | 12K | |
| daemontools-0.76_18.pkg | 2023-10-07 21:24 | 56K | |
| daemontools-encore-1..> | 2023-10-10 11:11 | 68K | |
| daggy-2.1.3_1.pkg | 2023-10-09 14:52 | 134K | |
| dahdi-2.4.0rc5_7.pkg | 2023-10-06 21:21 | 126K | |
| dahdi-kmod26-2.6.1.r..> | 2023-10-14 18:16 | 3.0M | |
| dailystrips-1.0.28_1..> | 2023-10-10 07:55 | 33K | |
| dakota-6.17.0_4.pkg | 2023-10-14 09:31 | 14M | |
| dalmp-3.1.0.pkg | 2023-10-12 06:28 | 159K | |
| dalton-2020.0_1.pkg | 2023-10-09 15:29 | 15M | |
| damager-0.1.pkg | 2023-10-08 21:17 | 3.4K | |
| dancer-4.16_1.pkg | 2023-10-14 11:22 | 207K | |
| dangen-0.5_5.pkg | 2023-10-10 15:18 | 214K | |
| dante-1.4.3.pkg | 2023-10-08 02:10 | 563K | |
| daq-2.2.2_3.pkg | 2023-10-07 04:43 | 175K | |
| dar-2.7.12.pkg | 2023-10-09 00:54 | 2.3M | |
| darcnes-9b0401_8.pkg | 2023-10-11 05:06 | 68K | |
| darkbot-6f6.r6_3,1.pkg | 2023-10-09 05:25 | 39K | |
| darkhttpd-1.14.pkg | 2023-10-09 13:41 | 19K | |
| darkice-1.4_3.pkg | 2023-10-10 14:32 | 105K | |
| darkman-1.5.4_6.pkg | 2023-10-10 13:14 | 1.5M | |
| darknet-4.p_3,1.pkg | 2023-10-14 08:16 | 556K | |
| darkplaces-20180412...> | 2023-10-07 13:46 | 1.7M | |
| darkstat-3.0.721.pkg | 2023-10-08 17:27 | 56K | |
| darktable-4.4.2_3.pkg | 2023-10-14 15:40 | 5.7M | |
| darling-dmg-g2022101..> | 2023-10-08 15:12 | 68K | |
| darts-0.32_1.pkg | 2023-10-07 00:43 | 27K | |
| dartsim-6.13.0_3.pkg | 2023-10-08 20:07 | 12M | |
| dasel-2.3.6.pkg | 2023-10-09 06:38 | 2.5M | |
| dash-0.5.12.pkg | 2023-10-07 17:26 | 80K | |
| dash.el-2.19.1_8.pkg | 2023-10-07 02:43 | 43K | |
| dash.el-emacs_canna-..> | 2023-10-07 06:34 | 43K | |
| dash.el-emacs_devel-..> | 2023-10-07 04:01 | 43K | |
| dash.el-emacs_devel_..> | 2023-10-07 03:44 | 43K | |
| dash.el-emacs_nox-2...> | 2023-10-07 02:56 | 43K | |
| dasherr-1.05.01.pkg | 2023-10-10 02:29 | 210K | |
| dasm-2.20.14.1.pkg | 2023-10-09 20:03 | 521K | |
| datadog-agent-7.24.1..> | 2023-10-08 03:11 | 12M | |
| datadog-integrations..> | 2023-10-14 16:45 | 193K | |
| datadraw-3.1.1_1.pkg | 2023-10-09 04:06 | 486K | |
| datalegreya-0.2017.0..> | 2023-10-08 13:26 | 262K | |
| datamash-1.8.pkg | 2023-10-07 18:41 | 337K | |
| datapipe-1.0_1.pkg | 2023-10-09 02:32 | 4.6K | |
| dataplot-20210713_2.pkg | 2023-10-09 05:03 | 16M | |
| datasette-0.63.3.pkg | 2023-10-09 11:16 | 256K | |
| date-3.0.1_1.pkg | 2023-10-07 00:25 | 105K | |
| dateutils-0.4.1_1.pkg | 2023-10-09 08:21 | 261K | |
| datovka-4.22.1.pkg | 2023-10-09 03:04 | 17M | |
| dav1d-1.2.1_1.pkg | 2023-10-05 17:31 | 563K | |
| davical-php80-1.1.12..> | 2023-10-14 18:59 | 1.0M | |
| davical-php81-1.1.12..> | 2023-10-09 09:33 | 1.0M | |
| davical-php82-1.1.12..> | 2023-10-08 23:42 | 1.0M | |
| davical-php83-1.1.12..> | 2023-10-14 10:26 | 1.0M | |
| davix-0.8.4.pkg | 2023-10-10 12:42 | 512K | |
| davmail-6.1.0.pkg | 2023-10-09 07:01 | 21M | |
| db-1.27,2.pkg | 2023-10-14 05:25 | 9.8K | |
| db2latex-0.8p1_2.pkg | 2023-10-09 21:19 | 503K | |
| db5-5.3.28_9.pkg | 2023-10-05 17:14 | 12M | |
| db18-18.1.40.pkg | 2023-10-05 17:02 | 17M | |
| dbacl-1.14.1.pkg | 2023-10-10 11:54 | 504K | |
| dbcsr-2.6.0.pkg | 2023-10-09 04:33 | 1.3M | |
| dbeacon-0.3.9.1.pkg | 2023-10-10 04:53 | 30K | |
| dbench-4.0_2.pkg | 2023-10-08 13:03 | 708K | |
| dbf-0.9.0_3.pkg | 2023-10-09 07:13 | 22K | |
| dbh-5.0.22_1.pkg | 2023-10-07 03:54 | 1.0M | |
| dbixx-0.0.4_4.pkg | 2023-10-08 14:20 | 35K | |
| dblatex-0.3.12.pkg | 2023-10-07 08:35 | 1.4M | |
| dbmail-3.4.0.pkg | 2023-10-09 21:38 | 333K | |
| dbow-0.7_1.pkg | 2023-10-07 23:41 | 44K | |
| dbow2-1.1.f.23_4.pkg | 2023-10-14 09:55 | 39K | |
| dbtool-1.9.1_1.pkg | 2023-10-09 12:27 | 34K | |
| dbus-1.14.10,1.pkg | 2023-10-05 17:29 | 378K | |
| dbus-c++-0.9.1_5.pkg | 2023-10-11 06:49 | 119K | |
| dbus-glib-0.112.pkg | 2023-10-05 17:31 | 163K | |
| dbus-java-2.7.pkg | 2023-10-09 15:22 | 191K | |
| dbus-sharp-0.8.1_3,1..> | 2023-10-07 09:25 | 70K | |
| dbus-sharp-glib-0.6.pkg | 2023-10-08 03:46 | 5.6K | |
| dbus-tcl-3.1.pkg | 2023-10-14 17:53 | 41K | |
| dbview-1.0.4.pkg | 2023-10-14 13:23 | 9.9K | |
| dbvis-13.0.4.pkg | 2023-10-10 13:20 | 133M | |
| dc3dd-7.3.0.pkg | 2023-10-08 14:24 | 99K | |
| dc20pack-1.0.pkg | 2023-10-14 10:41 | 17K | |
| dcc-dccd-2.3.168.pkg | 2023-10-11 06:10 | 831K | |
| dcd-0.99.2_2.pkg | 2023-10-08 16:21 | 12K | |
| dcf77pi-3.7.1.1_1.pkg | 2023-10-08 17:03 | 38K | |
| dcfldd-1.9.1.pkg | 2023-10-09 12:48 | 32K | |
| dclib-0.3.23_8.pkg | 2023-10-10 20:57 | 318K | |
| dclock-2.2.2_1.pkg | 2023-10-14 04:33 | 47K | |
| dcmtk-3.6.7_3.pkg | 2023-10-06 21:44 | 7.3M | |
| dconf-0.40.0_3.pkg | 2023-10-05 17:32 | 71K | |
| dconf-editor-3.38.3_..> | 2023-10-08 02:17 | 538K | |
| dcp2icc-0.1_9.pkg | 2023-10-10 13:48 | 292K | |
| dcraw-9.28_4.pkg | 2023-10-08 10:07 | 163K | |
| dcraw-m-9.22_9.pkg | 2023-10-14 03:45 | 150K | |
| dcw-gmt-2.1.1.pkg | 2023-10-07 19:46 | 21M | |
| dd_package-2.2.0.pkg | 2023-10-08 13:18 | 40K | |
| dd_rescue-1.99.12.pkg | 2023-10-09 10:47 | 145K | |
| ddate-0.2.2.6,3.pkg | 2023-10-09 17:40 | 8.3K | |
| ddclient-3.9.1.pkg | 2023-10-09 19:54 | 44K | |
| ddgr-2.1.pkg | 2023-10-09 13:12 | 28K | |
| ddh-64_7.pkg | 2023-10-09 09:07 | 315K | |
| ddns-1.0.pkg | 2023-10-09 16:38 | 26K | |
| ddosify-1.0.5_2.pkg | 2023-10-14 04:49 | 2.5M | |
| ddpt-0.97.pkg | 2023-10-10 10:39 | 243K | |
| ddrescue-1.25.pkg | 2023-10-14 13:26 | 97K | |
| de-BBBike-3.18_4.pkg | 2023-10-09 07:46 | 2.8M | |
| de-alt-aspell-2.1.1_..> | 2023-10-08 15:49 | 2.4M | |
| de-aspell-20161207_3..> | 2023-10-10 22:23 | 1.1M | |
| de-bugzilla44-4.4.10..> | 2023-10-14 03:55 | 204K | |
| de-dict-1.2.pkg | 2023-10-14 09:09 | 741K | |
| de-ding-1.9.pkg | 2023-10-09 00:22 | 11M | |
| de-dtaus-0.9.pkg | 2023-10-09 21:24 | 29K | |
| de-eric6-21.11.pkg | 2023-10-10 13:48 | 382K | |
| de-geonext-1.74.pkg | 2023-10-11 06:43 | 1.4K | |
| de-hunspell-20161207..> | 2023-10-09 03:56 | 281K | |
| de-hyphen-2007.02.17..> | 2023-10-09 16:58 | 22K | |
| de-jdictionary-eng-g..> | 2023-10-10 00:27 | 1.4M | |
| de-jdictionary-ger-h..> | 2023-10-11 09:41 | 551K | |
| de-libreoffice-7.5.5..> | 2023-10-07 21:49 | 3.2M | |
| de-mythes-2023.09.03..> | 2023-10-10 04:51 | 4.4M | |
| de-phone-1.20170802.pkg | 2023-10-08 22:02 | 36K | |
| de-schwobifyer-20050..> | 2023-10-14 18:17 | 9.4K | |
| de-tipp10-3.3.0.pkg | 2023-10-14 08:55 | 1.6M | |
| de-webalizer-2.23.8_..> | 2023-10-10 10:30 | 130K | |
| de-wordpress-de_DE-6..> | 2023-10-08 12:00 | 15M | |
| deadbeef-0.7.2_26.pkg | 2023-10-07 16:51 | 2.8M | |
| deadbeef-jack-plugin..> | 2023-10-14 13:27 | 4.2K | |
| deadbeef-mpris2-plug..> | 2023-10-11 05:01 | 10K | |
| deadbeef-musical-spe..> | 2023-10-09 10:30 | 19K | |
| deadbeef-playback-st..> | 2023-10-10 04:33 | 6.0K | |
| deadbeef-quick-searc..> | 2023-10-08 13:11 | 7.7K | |
| deadbeef-spectrogram..> | 2023-10-14 17:54 | 9.2K | |
| deadbeef-vu-meter-pl..> | 2023-10-10 09:07 | 27K | |
| deadbeef-waveform-se..> | 2023-10-10 13:56 | 18K | |
| deal.II-9.5.0_1.pkg | 2023-10-07 17:05 | 22M | |
| deb2targz-20100710.pkg | 2023-10-14 15:10 | 860 | |
| debhelper-13.11.6.pkg | 2023-10-09 21:46 | 140K | |
| debootstrap-1.0.128n..> | 2023-10-11 17:31 | 33K | |
| debugedit-20170411.1..> | 2023-10-09 18:51 | 14K | |
| deco-extractor-1.6.4..> | 2023-10-10 23:54 | 12K | |
| deco-misc-3.9_5.pkg | 2023-10-09 17:14 | 82K | |
| dee-1.2.7_24.pkg | 2023-10-06 14:51 | 145K | |
| defendguin-0.0.13.pkg | 2023-10-09 20:21 | 8.8M | |
| deforaos-browser-0.5..> | 2023-10-10 10:47 | 151K | |
| deforaos-editor-0.4...> | 2023-10-10 17:20 | 23K | |
| deforaos-keyboard-0...> | 2023-10-08 14:11 | 21K | |
| deforaos-libdesktop-..> | 2023-10-07 00:35 | 66K | |
| deforaos-libsystem-0..> | 2023-10-06 22:17 | 94K | |
| deforaos-mailer-0.1...> | 2023-10-07 18:27 | 196K | |
| deforaos-pdfviewer-0..> | 2023-10-08 18:59 | 11K | |
| deforaos-player-0.1...> | 2023-10-09 13:35 | 52K | |
| deforaos-todo-0.2.1_..> | 2023-10-11 13:53 | 29K | |
| deheader-1.6.pkg | 2023-10-10 09:56 | 17K | |
| dehydrated-0.7.1.5.pkg | 2023-10-10 20:51 | 36K | |
| dejagnu-1.6.3.pkg | 2023-10-10 02:57 | 159K | |
| dejavu-2.37_2.pkg | 2023-10-05 17:40 | 2.4M | |
| delaboratory-0.8_13.pkg | 2023-10-14 03:16 | 198K | |
| delatt-1.1.3_1.pkg | 2023-10-10 18:53 | 3.2K | |
| delay-1.6.pkg | 2023-10-10 14:25 | 18K | |
| delegate-9.9.13_1.pkg | 2023-10-09 08:06 | 1.8M | |
| delta-2020.06.22.pkg | 2023-10-07 10:44 | 22K | |
| deltarpm-3.6_1.pkg | 2023-10-09 10:47 | 152K | |
| deltup-0.4.4_1.pkg | 2023-10-07 11:07 | 96K | |
| deluge-2.1.1,2.pkg | 2023-10-08 15:44 | 892 | |
| deluge-cli-2.1.1.pkg | 2023-10-08 06:04 | 2.2M | |
| delve-1.21.0_2.pkg | 2023-10-07 15:32 | 3.4M | |
| denature-0.6.5_2.pkg | 2023-10-09 00:07 | 16K | |
| dendrite-0.13.2_1.pkg | 2023-10-09 02:17 | 45M | |
| denemo-2.0.6_18.pkg | 2023-10-11 02:15 | 12M | |
| deno-1.36.2_1.pkg | 2023-10-09 07:14 | 21M | |
| denominator-4.7.1.pkg | 2023-10-10 19:41 | 5.6M | |
| denyhosts-py39-3.1.2..> | 2023-10-14 03:25 | 54K | |
| derelict-ft-1.1.3_7.pkg | 2023-10-10 05:31 | 30K | |
| derelict-gl3-1.0.24_..> | 2023-10-09 13:53 | 184K | |
| derelict-sdl2-2.1.4_..> | 2023-10-11 03:03 | 65K | |
| derelict-util-2.1.0_..> | 2023-10-07 14:34 | 66K | |
| desed-1.2.1_10.pkg | 2023-10-09 07:23 | 373K | |
| deskmenu-1.4.5_1.pkg | 2023-10-09 14:45 | 16K | |
| desktop-file-utils-0..> | 2023-10-05 17:30 | 39K | |
| desktop-installer-0...> | 2023-10-10 16:01 | 101K | |
| destroy-20130926.pkg | 2023-10-09 04:37 | 5.3K | |
| detex-2.8_1.pkg | 2023-10-11 07:31 | 20K | |
| detox-1.4.5.pkg | 2023-10-14 07:07 | 29K | |
| deutex-5.2.2.pkg | 2023-10-09 17:53 | 87K | |
| dev86-0.16.20.pkg | 2023-10-09 14:47 | 171K | |
| devcpu-data-20230617..> | 2023-10-11 05:53 | 672 | |
| devctl-jail-kmod-g20..> | 2023-10-14 04:26 | 2.6K | |
| devd-0.9_18.pkg | 2023-10-14 14:36 | 2.7M | |
| devd-mount-0.1.0.7.pkg | 2023-10-07 21:07 | 5.3K | |
| devel-replay-1.0.4.pkg | 2023-10-09 09:04 | 3.9K | |
| devhelp-41.2_1.pkg | 2023-10-07 20:55 | 249K | |
| devil-1.8.0_4,1.pkg | 2023-10-07 09:20 | 1.5M | |
| devilspie-0.23_1.pkg | 2023-10-14 13:34 | 41K | |
| devilspie2-0.43_2.pkg | 2023-10-14 06:51 | 32K | |
| devilutionX-1.4.1_2.pkg | 2023-10-10 18:21 | 5.1M | |
| devisor-2.1_3.pkg | 2023-10-10 10:31 | 1.1M | |
| devmon-0.3.1.b1_4.pkg | 2023-10-07 13:02 | 82K | |
| devmon-templates-200..> | 2023-10-14 12:01 | 46K | |
| devstat-0.3.3_1.pkg | 2023-10-14 10:52 | 5.2K | |
| devtodo-0.1.20_3.pkg | 2023-10-10 03:01 | 100K | |
| dexed-synth-0.9.6.16..> | 2023-10-08 20:38 | 1.9M | |
| dfc-3.1.1.pkg | 2023-10-14 14:58 | 37K | |
| dfshow-0.10.1.b.pkg | 2023-10-10 09:49 | 81K | |
| dftbplus-23.1_1.pkg | 2023-10-08 05:47 | 12M | |
| dftd3-3.2.0.3_1.pkg | 2023-10-10 12:03 | 257K | |
| dftd4-3.5.0.pkg | 2023-10-07 22:24 | 269K | |
| dfu-programmer-0.7.2..> | 2023-10-07 19:02 | 31K | |
| dfu-util-0.11.pkg | 2023-10-07 23:35 | 31K | |
| dfuife-curses-1.5.1...> | 2023-10-10 15:44 | 16K | |
| dgd-1.4.23.pkg | 2023-10-07 20:58 | 288K | |
| dgd-kernel-1.3.4_2.pkg | 2023-10-08 19:12 | 43K | |
| dgd-lpmud-2.4.5_6.pkg | 2023-10-08 21:51 | 179K | |
| dgedit-0.10.0_1.pkg | 2023-10-14 14:15 | 168K | |
| dgen-sdl-1.33_5.pkg | 2023-10-14 03:47 | 642K | |
| dgl-1.1.1.pkg | 2023-10-07 17:41 | 2.5M | |
| dgo-libreoffice-7.5...> | 2023-10-08 06:40 | 287K | |
| dhcdrop-0.5_3.pkg | 2023-10-14 15:18 | 34K | |
| dhcp6-20080615.2_3.pkg | 2023-10-08 05:47 | 110K | |
| dhcp_probe-1.3.1_1.pkg | 2023-10-14 06:02 | 35K | |
| dhcpcd-10.0.2.pkg | 2023-10-14 09:38 | 166K | |
| dhcpcd-ui-0.7.9.pkg | 2023-10-10 03:04 | 182K | |
| dhcpd-6.6.20200413.pkg | 2023-10-09 11:05 | 74K | |
| dhcpd-pools-3.1.pkg | 2023-10-11 15:48 | 39K | |
| dhcpdump-1.8.pkg | 2023-10-10 02:56 | 11K | |
| dhcping-1.2.pkg | 2023-10-10 00:15 | 10K | |
| dhcprelya-6.1_1.pkg | 2023-10-09 21:31 | 31K | |
| dhewm3-1.5.2.pkg | 2023-10-09 07:34 | 2.6M | |
| dhex-0.69.pkg | 2023-10-12 06:28 | 45K | |
| dhisd-5.5.pkg | 2023-10-08 15:37 | 23K | |
| dhrystone-2.1_2.pkg | 2023-10-08 15:28 | 15K | |
| dht-0.27.pkg | 2023-10-07 20:01 | 35K | |
| dhttpd-1.02a_1.pkg | 2023-10-10 10:37 | 8.8K | |
| di-4.51.pkg | 2023-10-09 10:10 | 29K | |
| dia-0.97.3_5,1.pkg | 2023-10-10 17:53 | 3.1M | |
| dia2code+-1.0.0_9.pkg | 2023-10-09 10:15 | 57K | |
| dia2code-0.8.8_2.pkg | 2023-10-10 14:20 | 43K | |
| diablo-5.1_2.pkg | 2023-10-09 23:11 | 1.2M | |
| diakonos-0.9.7_1.pkg | 2023-10-14 10:45 | 96K | |
| dialog4ports-0.1.6_1..> | 2023-10-07 09:30 | 11K | |
| dialog4ports-static-..> | 2023-10-10 16:52 | 9.6K | |
| diamond-2.1.8.pkg | 2023-10-11 01:24 | 1.5M | |
| diamond-cs-1.3.8_2.pkg | 2023-10-09 23:03 | 673K | |
| diaspora-1.1.1_3.pkg | 2023-10-10 21:49 | 1.5G | |
| dico-2.11_1.pkg | 2023-10-08 15:03 | 549K | |
| dict-1.13.1.pkg | 2023-10-08 11:35 | 36K | |
| dictd-1.13.1.pkg | 2023-10-08 03:26 | 86K | |
| dictem-1.0.4_18.pkg | 2023-10-10 07:24 | 29K | |
| dictem-emacs_canna-1..> | 2023-10-10 03:50 | 29K | |
| dictem-emacs_devel-1..> | 2023-10-08 18:55 | 29K | |
| dictem-emacs_devel_n..> | 2023-10-09 11:40 | 29K | |
| dictem-emacs_nox-1.0..> | 2023-10-09 23:33 | 29K | |
| dictfmt-1.13.1.pkg | 2023-10-10 20:08 | 24K | |
| diction-1.11_2.pkg | 2023-10-10 05:18 | 44K | |
| dictionary-1.8.7_34.pkg | 2023-10-09 07:33 | 27K | |
| dictionary-emacs_can..> | 2023-10-11 09:42 | 27K | |
| dictionary-emacs_dev..> | 2023-10-08 12:58 | 27K | |
| dictionary-emacs_dev..> | 2023-10-10 15:10 | 27K | |
| dictionary-emacs_nox..> | 2023-10-10 05:40 | 27K | |
| dieharder-3.31.1_9.pkg | 2023-10-10 07:55 | 268K | |
| diesel-cli-2.1.1_1.pkg | 2023-10-11 09:32 | 1.2M | |
| diff-pdf-0.5.1_1.pkg | 2023-10-14 07:01 | 37K | |
| diff-so-fancy-1.4.4.pkg | 2023-10-08 13:20 | 15K | |
| diffcode-1.2.pkg | 2023-10-14 12:07 | 9.5K | |
| diffmark-0.10_4.pkg | 2023-10-07 20:03 | 68K | |
| diffpdf-2.1.3_51.pkg | 2023-10-09 23:00 | 110K | |
| diffsplit-1.0.pkg | 2023-10-11 16:16 | 2.3K | |
| diffstat-1.65.pkg | 2023-10-07 11:04 | 26K | |
| difftastic-0.51.1_1.pkg | 2023-10-14 13:39 | 4.2M | |
| diffutils-3.8.pkg | 2023-10-07 06:59 | 341K | |
| dify-0.6.0_6.pkg | 2023-10-14 11:58 | 671K | |
| digdag-0.10.5.pkg | 2023-10-08 22:06 | 78M | |
| digestpp-g20200907.pkg | 2023-10-14 16:45 | 66K | |
| digger-20020314_3.pkg | 2023-10-10 07:13 | 69K | |
| digiham-0.3.0.pkg | 2023-10-08 23:47 | 33K | |
| digikam-8.1.0_3.pkg | 2023-10-10 09:21 | 18M | |
| digital-0.29.pkg | 2023-10-09 12:43 | 3.3M | |
| digitemp-3.7.2.pkg | 2023-10-09 18:41 | 76K | |
| dihydrogen-0.2.1.36_..> | 2023-10-08 11:33 | 41K | |
| dijo-0.2.7_7.pkg | 2023-10-10 07:53 | 594K | |
| dikt-2s4_1,1.pkg | 2023-10-09 14:45 | 119K | |
| dilay-1.9.0_6.pkg | 2023-10-14 17:21 | 301K | |
| dillo-3.0.5_4.pkg | 2023-10-08 06:47 | 416K | |
| dim-1.1.pkg | 2023-10-14 05:58 | 4.7K | |
| dimod-0.12.11.pkg | 2023-10-07 12:30 | 18K | |
| din-57.pkg | 2023-10-08 14:35 | 2.6M | |
| dina-2.92_2.pkg | 2023-10-14 14:28 | 56K | |
| ding-libs-0.6.1.pkg | 2023-10-08 00:23 | 118K | |
| dino-0.4.3.pkg | 2023-10-09 04:30 | 1.5M | |
| dinotrace-9.4f_5.pkg | 2023-10-10 20:27 | 136K | |
| dinotrace-emacs_cann..> | 2023-10-08 19:28 | 136K | |
| dinotrace-emacs_deve..> | 2023-10-10 10:05 | 136K | |
| dinotrace-emacs_deve..> | 2023-10-09 15:12 | 136K | |
| dinotrace-emacs_nox-..> | 2023-10-14 05:52 | 136K | |
| dionysus-topology-li..> | 2023-10-11 02:37 | 26K | |
| diplib-3.4.0.pkg | 2023-10-14 18:35 | 3.2M | |
| dirac-1.0.2_5.pkg | 2023-10-08 15:52 | 530K | |
| dirac-quantum-chemis..> | 2023-10-08 01:38 | 25M | |
| dirbuster-1.0r1.pkg | 2023-10-08 18:57 | 3.9M | |
| dircproxy-1.2.0.r1_2..> | 2023-10-14 08:53 | 74K | |
| dirdiff-2.1_4.pkg | 2023-10-10 07:46 | 31K | |
| directfb-1.4.17_4.pkg | 2023-10-10 12:19 | 1.2M | |
| direnv-2.32.3_2.pkg | 2023-10-10 22:11 | 2.2M | |
| direvent-5.3.pkg | 2023-10-11 17:32 | 140K | |
| direwolf-1.6_2.pkg | 2023-10-09 17:10 | 20M | |
| dirmngr-1.1.0_15.pkg | 2023-10-09 06:58 | 168K | |
| dirvish-1.2.1_3.pkg | 2023-10-10 23:50 | 27K | |
| discid-1.3_1.pkg | 2023-10-10 22:37 | 3.4K | |
| disco-1.2_2.pkg | 2023-10-10 22:52 | 21K | |
| discordo-g20220909_9..> | 2023-10-08 12:39 | 2.8M | |
| discount-2.2.7d.pkg | 2023-10-06 22:06 | 71K | |
| discus-0.5.0.pkg | 2023-10-10 13:35 | 9.0K | |
| diskcheckd-20150220.pkg | 2023-10-10 06:51 | 12K | |
| diskimage-tools-0.2.pkg | 2023-10-08 10:44 | 3.2K | |
| diskonaut-0.11.0_28.pkg | 2023-10-09 15:44 | 413K | |
| diskscrub-2.6.1.pkg | 2023-10-11 16:37 | 21K | |
| diskus-0.7.0_14.pkg | 2023-10-14 15:45 | 301K | |
| disman-0.527.0.pkg | 2023-10-07 10:55 | 248K | |
| distcache-1.5.1.pkg | 2023-10-14 15:00 | 185K | |
| distcc-3.4.pkg | 2023-10-14 12:40 | 168K | |
| distel-4.1.1_14.pkg | 2023-10-09 18:56 | 250K | |
| distel-emacs_canna-4..> | 2023-10-09 17:27 | 250K | |
| distel-emacs_devel-4..> | 2023-10-09 16:07 | 250K | |
| distel-emacs_devel_n..> | 2023-10-08 12:34 | 250K | |
| distel-emacs_nox-4.1..> | 2023-10-10 18:24 | 250K | |
| distilator-1.4.pkg | 2023-10-12 12:19 | 2.6K | |
| distorm-20121220.r23..> | 2023-10-10 09:48 | 44K | |
| diswall-0.4.2_2.pkg | 2023-10-09 03:22 | 1.2M | |
| ditaa-0.11.0.pkg | 2023-10-08 19:59 | 11M | |
| dive-0.11.0_2.pkg | 2023-10-08 20:31 | 2.9M | |
| divide-and-succeed-0..> | 2023-10-08 15:08 | 79K | |
| djbfft-0.76_2.pkg | 2023-10-14 13:51 | 45K | |
| djgpp-binutils-2.17_..> | 2023-10-10 06:01 | 1.2M | |
| djview-4.12_2.pkg | 2023-10-08 20:09 | 545K | |
| djvulibre-3.5.28_2.pkg | 2023-10-06 18:56 | 2.9M | |
| dk-milter-1.0.2_6.pkg | 2023-10-09 09:00 | 77K | |
| dkfilter-0.11_1.pkg | 2023-10-14 18:19 | 19K | |
| dkftpbench-0.45_2.pkg | 2023-10-09 01:24 | 19K | |
| dkh-1.2_6.pkg | 2023-10-09 11:26 | 42K | |
| dkimproxy-1.4.1_1.pkg | 2023-10-11 07:23 | 26K | |
| dkns-1.100.pkg | 2023-10-09 18:15 | 29K | |
| dlang-tools-2.101.0_..> | 2023-10-07 13:18 | 1.3M | |
| dlib-1.1.0_3.pkg | 2023-10-10 04:28 | 593K | |
| dlib-cpp-19.24_1.pkg | 2023-10-06 19:09 | 2.3M | |
| dlib-models-20210513..> | 2023-10-07 10:02 | 317M | |
| dlint-1.4.1.pkg | 2023-10-14 11:24 | 13K | |
| dlmalloc-2.8.6.pkg | 2023-10-14 13:44 | 23K | |
| dma-0.13.20220128_1,..> | 2023-10-09 18:12 | 34K | |
| dmachine-0.25.pkg | 2023-10-10 08:49 | 58K | |
| dmake-4.13.1,1.pkg | 2023-10-06 19:07 | 95K | |
| dmalloc-5.6.5.pkg | 2023-10-08 15:42 | 152K | |
| dmarcts-report-parse..> | 2023-10-10 05:56 | 13K | |
| dmenu-5.1.pkg | 2023-10-06 23:57 | 16K | |
| dmenu-wayland-0.1.pkg | 2023-10-10 23:55 | 16K | |
| dmenu2-0.2.pkg | 2023-10-14 18:40 | 17K | |
| dmg2img-1.6.7.pkg | 2023-10-09 08:27 | 15K | |
| dmidecode-3.5.pkg | 2023-10-06 17:05 | 65K | |
| dmidiplayer-1.7.2_1.pkg | 2023-10-09 04:43 | 473K | |
| dmjava-1.05_2.pkg | 2023-10-14 05:50 | 11M | |
| dmlc-core-0.3.123.pkg | 2023-10-06 20:18 | 261K | |
| dmtx-utils-0.7.6_2.pkg | 2023-10-11 14:56 | 20K | |
| dmucs-0.6.1_1.pkg | 2023-10-14 04:50 | 60K | |
| dnetc-2.9112.521,1.pkg | 2023-10-09 00:57 | 838K | |
| dnf-4.17.0.pkg | 2023-10-09 18:52 | 516K | |
| dnrd-2.20.3_1.pkg | 2023-10-11 06:18 | 41K | |
| dns-ui-v0.2.7_1.pkg | 2023-10-08 19:08 | 467K | |
| dns2blackhole-0.1.pkg | 2023-10-09 20:25 | 11K | |
| dns2tcp-0.5.2.pkg | 2023-10-09 00:18 | 36K | |
| dns_balance-2.1.pkg | 2023-10-11 11:01 | 15K | |
| dnsblast-0.0.2016060..> | 2023-10-10 03:55 | 5.2K | |
| dnscap-2.2.0,1.pkg | 2023-10-14 07:13 | 117K | |
| dnscheckengine-1.1_4..> | 2023-10-08 22:19 | 430K | |
| dnscontrol-4.2.0_1.pkg | 2023-10-14 01:30 | 8.3M | |
| dnscrypt-proxy2-2.1...> | 2023-10-10 19:39 | 3.1M | |
| dnscrypt-wrapper-0.4..> | 2023-10-09 18:07 | 28K | |
| dnsdbck-1.01.pkg | 2023-10-10 01:10 | 11K | |
| dnsdbflex-1.0.6.pkg | 2023-10-09 20:12 | 19K | |
| dnsdbq-2.6.4.pkg | 2023-10-14 15:00 | 40K | |
| dnsdist-1.8.1.pkg | 2023-10-09 04:10 | 1.9M | |
| dnsenum-1.2.4.2.pkg | 2023-10-09 17:04 | 18K | |
| dnsflood-1.20.pkg | 2023-10-09 04:44 | 10K | |
| dnsforwarder-6.1.15,..> | 2023-10-10 15:17 | 46K | |
| dnshistory-1.3_2.pkg | 2023-10-11 03:44 | 27K | |
| dnsjava-2.1.9.pkg | 2023-10-10 01:58 | 457K | |
| dnsjit-1.2.3_1.pkg | 2023-10-07 18:17 | 150K | |
| dnsmap-0.30.pkg | 2023-10-10 16:58 | 18K | |
| dnsmasq-2.89_1,1.pkg | 2023-10-06 22:00 | 365K | |
| dnsmax-perl-1.0.1.pkg | 2023-10-09 13:20 | 12K | |
| dnsperf-2.11.0.pkg | 2023-10-10 10:53 | 65K | |
| dnsproxy-1.17_3.pkg | 2023-10-08 18:41 | 9.3K | |
| dnsrecon-0.10.1_1.pkg | 2023-10-11 05:37 | 453K | |
| dnsreflector-1.02.pkg | 2023-10-14 09:24 | 7.0K | |
| dnstable-0.13.1_1.pkg | 2023-10-08 04:08 | 73K | |
| dnstable-convert-0.1..> | 2023-10-14 08:39 | 15K | |
| dnstop-20140915.pkg | 2023-10-08 15:23 | 23K | |
| dnstracer-1.10.pkg | 2023-10-10 03:58 | 16K | |
| dnsutl-1.12_2.pkg | 2023-10-08 21:34 | 146K | |
| dnsviz-0.9.4.pkg | 2023-10-08 13:19 | 418K | |
| dnswalk-2.0.2_3.pkg | 2023-10-08 22:12 | 12K | |
| dnswall-0.1.4_1.pkg | 2023-10-10 10:39 | 5.2K | |
| dnsx-1.1.4_3.pkg | 2023-10-14 07:44 | 5.4M | |
| doas-6.3p9.pkg | 2023-10-08 00:39 | 22K | |
| dobutsu-5.pkg | 2023-10-09 16:24 | 26M | |
| doc-2.2.3.pkg | 2023-10-09 14:26 | 19K | |
| doc-mode.el-1.1_27.pkg | 2023-10-14 10:07 | 3.1K | |
| doc-mode.el-emacs_ca..> | 2023-10-11 15:06 | 3.1K | |
| doc-mode.el-emacs_de..> | 2023-10-14 10:48 | 3.1K | |
| doc-mode.el-emacs_de..> | 2023-10-10 22:28 | 3.1K | |
| doc-mode.el-emacs_no..> | 2023-10-09 13:50 | 3.1K | |
| docbook-1.5.pkg | 2023-10-05 16:41 | 544 | |
| docbook-sgml-4.5_1.pkg | 2023-10-05 16:41 | 136K | |
| docbook-to-man-1.0_2..> | 2023-10-07 04:49 | 50K | |
| docbook-utils-0.6.14..> | 2023-10-07 07:29 | 52K | |
| docbook-xml-5.0_3.pkg | 2023-10-05 16:41 | 540K | |
| docbook-xsd-1.0.b1.pkg | 2023-10-14 13:35 | 17K | |
| docbook-xsl-1.79.1_1..> | 2023-10-05 16:42 | 19M | |
| docbook-xsl-ns-1.79...> | 2023-10-05 16:43 | 20M | |
| docbook2X-0.8.8_7.pkg | 2023-10-09 02:01 | 221K | |
| docbook2mdoc-1.1.0_1..> | 2023-10-05 16:41 | 56K | |
| docbook2odf-0.244_2.pkg | 2023-10-09 11:42 | 476K | |
| docbookrx-1.0.0.d.pkg | 2023-10-10 04:36 | 290K | |
| docear-1.2.0.pkg | 2023-10-12 04:20 | 57M | |
| docker-18.09.5_14.pkg | 2023-10-09 20:20 | 10M | |
| docker-compose-1.24...> | 2023-10-08 18:35 | 172K | |
| docker-credential-pa..> | 2023-10-09 08:27 | 666K | |
| docker-machine-0.16...> | 2023-10-14 12:05 | 4.6M | |
| docker-registry-2.7...> | 2023-10-11 07:12 | 4.2M | |
| docker-tray-1.5_8.pkg | 2023-10-14 10:57 | 7.6K | |
| docopt.cpp-0.6.3.5.pkg | 2023-10-08 02:25 | 94K | |
| docproj-fonts-cjk-20..> | 2023-10-07 01:02 | 12M | |
| docproj-legacy-3.1.pkg | 2023-10-09 17:50 | 1.1K | |
| docsis-0.9.8.pkg | 2023-10-08 16:46 | 256K | |
| doctest-2.4.8.pkg | 2023-10-10 18:04 | 53K | |
| doctl-1.98.0_1.pkg | 2023-10-08 12:26 | 5.6M | |
| doctorj-5.1.2_2.pkg | 2023-10-14 17:02 | 295K | |
| dodgindiamond2-0.2.2..> | 2023-10-10 18:37 | 161K | |
| dog-0.1.0_27.pkg | 2023-10-10 06:05 | 253K | |
| doggo-0.5.6_2,1.pkg | 2023-10-14 02:32 | 2.8M | |
| doh-proxy-0.9.8_5.pkg | 2023-10-09 19:49 | 972K | |
| doinkd-0.02.pkg | 2023-10-08 13:12 | 24K | |
| dojo-1.12.2.pkg | 2023-10-11 15:30 | 8.3M | |
| dokuwiki-php80-20230..> | 2023-10-11 02:06 | 2.8M | |
| dokuwiki-php81-20230..> | 2023-10-10 12:14 | 2.8M | |
| dokuwiki-php82-20230..> | 2023-10-10 22:37 | 2.8M | |
| dokuwiki-php83-20230..> | 2023-10-10 21:40 | 2.8M | |
| dolibarr-17.0.1.pkg | 2023-10-09 13:26 | 41M | |
| dolibarr16-16.0.5.pkg | 2023-10-10 12:31 | 35M | |
| dolly-0.58.c.pkg | 2023-10-08 20:29 | 23K | |
| dolphin-23.08.1.pkg | 2023-10-07 00:19 | 4.2M | |
| dolphin-emu-5.0.1679..> | 2023-10-09 04:16 | 9.9M | |
| dolphin-plugins-23.0..> | 2023-10-08 14:27 | 341K | |
| dom4j-1.6.1_2.pkg | 2023-10-09 01:31 | 1.4M | |
| domc-0.8.0_4.pkg | 2023-10-09 12:29 | 39K | |
| domination-1.2.5.pkg | 2023-10-10 12:38 | 16M | |
| domino-chain-1.1_6.pkg | 2023-10-14 15:00 | 34M | |
| domoticz-2023.1.pkg | 2023-10-14 16:18 | 10M | |
| dontspace-1.2_4.pkg | 2023-10-10 21:00 | 32K | |
| dooble-2023.08.30.pkg | 2023-10-10 02:23 | 776K | |
| dooble-qt5-2023.08.3..> | 2023-10-14 12:38 | 743K | |
| doom-data-1.0_1.pkg | 2023-10-07 05:38 | 1.3M | |
| doom-freedoom-0.12.1..> | 2023-10-09 07:02 | 14M | |
| doom-hacx-1.0.pkg | 2023-10-09 18:16 | 6.7M | |
| doom-hr-1.0_1.pkg | 2023-10-09 19:51 | 2.4M | |
| doom-hr2-1.0.pkg | 2023-10-09 16:45 | 1.7M | |
| doom-wolfendoom-1.0.pkg | 2023-10-14 06:55 | 24M | |
| doomlegacy-1.48.12,1..> | 2023-10-10 08:30 | 1.4M | |
| doomsday-2.3.1_6.pkg | 2023-10-09 12:07 | 33M | |
| dos2unix-7.5.1.pkg | 2023-10-14 11:27 | 423K | |
| dosage-3.0_1.pkg | 2023-10-09 00:05 | 256K | |
| dosbox-0.74.3_1.pkg | 2023-10-14 06:28 | 795K | |
| dosbox-staging-0.80...> | 2023-10-09 06:52 | 1.5M | |
| dosbox-x-2022.12.26.pkg | 2023-10-14 11:24 | 14M | |
| dose-response-1.0.0_..> | 2023-10-09 07:02 | 1.0M | |
| dosunix-1.0.14.pkg | 2023-10-09 17:15 | 5.9K | |
| dot-forward-0.71.pkg | 2023-10-09 21:43 | 20K | |
| dot-http-0.2.0_7.pkg | 2023-10-08 12:23 | 1.1M | |
| dotconf-1.3_1.pkg | 2023-10-05 16:44 | 35K | |
| dotdotpwn-3.0.2_2.pkg | 2023-10-09 03:29 | 32K | |
| dotenv-linter-3.3.0_..> | 2023-10-08 16:14 | 837K | |
| double-conversion-3...> | 2023-10-05 17:37 | 48K | |
| doublecmd-gtk2-1.0.1..> | 2023-10-09 13:47 | 15M | |
| doublecmd-qt5-1.0.11..> | 2023-10-09 17:43 | 15M | |
| dovecot-2.3.20_1.pkg | 2023-10-07 16:23 | 4.3M | |
| dovecot-coi-2.3.9_2.pkg | 2023-10-14 06:49 | 63K | |
| dovecot-fts-elastic-..> | 2023-10-09 14:34 | 19K | |
| dovecot-fts-flatcurv..> | 2023-10-09 05:05 | 48K | |
| dovecot-fts-xapian-1..> | 2023-10-14 03:50 | 42K | |
| dovecot-pigeonhole-0..> | 2023-10-08 17:38 | 624K | |
| dovecot-xaps-g202106..> | 2023-10-10 07:49 | 8.1K | |
| downtimed-1.0.pkg | 2023-10-10 23:25 | 14K | |
| downzemall-3.0.6_1.pkg | 2023-10-14 18:36 | 742K | |
| doxygen-1.9.6,2.pkg | 2023-10-06 09:10 | 6.3M | |
| dparser-1.33.pkg | 2023-10-09 15:28 | 152K | |
| dpdk-19.11.12.pkg | 2023-10-09 10:21 | 5.6M | |
| dpdk20.11-20.11.8.pkg | 2023-10-09 02:03 | 6.8M | |
| dpf-plugins-lv2-1.7_..> | 2023-10-09 00:54 | 8.0M | |
| dpinger-3.3.pkg | 2023-10-09 10:13 | 9.6K | |
| dpkg-1.19.8.pkg | 2023-10-08 11:42 | 2.3M | |
| dps8m-3.0.1_1.pkg | 2023-10-09 12:10 | 340K | |
| dq-20230101.pkg | 2023-10-10 02:34 | 107K | |
| draco-3d-compression..> | 2023-10-06 13:35 | 758K | |
| dragon-1.5.5.pkg | 2023-10-10 05:59 | 84K | |
| dragon-player-23.08...> | 2023-10-07 01:38 | 1.7M | |
| dragonfly-reverb-3.2..> | 2023-10-08 12:51 | 1.0M | |
| drawing-1.0.2_1.pkg | 2023-10-08 15:09 | 3.2M | |
| drawterm-20140106_1.pkg | 2023-10-08 12:52 | 164K | |
| dreamchess-0.3.0_3.pkg | 2023-10-14 19:00 | 78M | |
| drg2sbg-2.2.pkg | 2023-10-14 06:08 | 11K | |
| drgeo-1.1.0_26.pkg | 2023-10-10 06:11 | 471K | |
| driftnet-1.5.0_1.pkg | 2023-10-14 03:18 | 35K | |
| drill-0.8.3_2.pkg | 2023-10-10 18:47 | 1.3M | |
| drive-0.4.0_23.pkg | 2023-10-10 11:57 | 3.4M | |
| drjava-20140826.r576..> | 2023-10-08 13:50 | 11M | |
| drm-fbsd12.0-kmod-4...> | 2023-10-08 03:46 | 2.0M | |
| drm-kmod-20220907_1.pkg | 2023-10-14 18:53 | 832 | |
| drm_info-2.5.0.pkg | 2023-10-08 18:54 | 19K | |
| droid-fonts-ttf-2013..> | 2023-10-06 19:51 | 3.5M | |
| drool-2.0.0.pkg | 2023-10-11 15:30 | 13K | |
| dropbear-2022.83.pkg | 2023-10-10 19:09 | 175K | |
| dropbox-api-command-..> | 2023-10-09 17:46 | 16K | |
| dropbox-uploader-1.0..> | 2023-10-09 20:16 | 11K | |
| drumgizmo-0.9.19_2.pkg | 2023-10-08 13:06 | 474K | |
| drumkv1-lv2-0.9.32.pkg | 2023-10-08 20:32 | 385K | |
| drumpiler-0.9.0_7.pkg | 2023-10-09 02:59 | 8.3K | |
| drumstick-2.8.1.pkg | 2023-10-07 22:55 | 507K | |
| drupal7-7.98.pkg | 2023-10-07 12:05 | 2.5M | |
| drupal7-wysiwyg-7.x...> | 2023-10-08 23:57 | 94K | |
| drupal8-8.9.20.pkg | 2023-10-09 03:46 | 15M | |
| drupal9-9.5.9.pkg | 2023-10-14 10:06 | 17M | |
| drupal10-10.0.9.pkg | 2023-10-10 13:43 | 13M | |
| drush-php80-8.4.11.pkg | 2023-10-10 07:37 | 1.2M | |
| drush-php81-8.4.11.pkg | 2023-10-09 03:25 | 1.2M | |
| drush-php82-8.4.11.pkg | 2023-10-09 08:47 | 1.2M | |
| drush-php83-8.4.11.pkg | 2023-10-09 02:06 | 1.2M | |
| ds2-20151028.pkg | 2023-10-08 16:33 | 135K | |
| dsb-libreoffice-7.5...> | 2023-10-08 04:25 | 745K | |
| dsbautostart-1.2_1.pkg | 2023-10-14 07:22 | 28K | |
| dsbbatmon-1.0.6_1.pkg | 2023-10-11 16:05 | 27K | |
| dsbdriverd-1.1.pkg | 2023-10-10 18:20 | 28K | |
| dsblogoutmgr-1.3.2_1..> | 2023-10-14 10:24 | 28K | |
| dsbmc-1.2_1.pkg | 2023-10-14 07:17 | 54K | |
| dsbmc-cli-0.4.pkg | 2023-10-09 16:16 | 16K | |
| dsbmd-1.11.4.pkg | 2023-10-07 19:24 | 41K | |
| dsbmixer-1.7_1.pkg | 2023-10-09 01:27 | 63K | |
| dsbsu-0.2_1.pkg | 2023-10-10 02:53 | 19K | |
| dsbwrtsysctl-0.1.5.pkg | 2023-10-08 08:55 | 4.2K | |
| dsbxinput-0.1.1_3.pkg | 2023-10-10 22:04 | 7.5K | |
| dsc-2.13.0.pkg | 2023-10-14 11:58 | 97K | |
| dsd-1.6.0_1.pkg | 2023-10-09 17:28 | 32K | |
| dsdp-5.8_5.pkg | 2023-10-07 03:33 | 227K | |
| dseg-0.46.pkg | 2023-10-09 22:48 | 77K | |
| dsniff-2.4.b1_8.pkg | 2023-10-09 18:53 | 1.0M | |
| dsp-2.0.1.pkg | 2023-10-14 18:35 | 21K | |
| dspam-3.10.2_9.pkg | 2023-10-10 04:36 | 389K | |
| dspdfviewer-1.15.1_6..> | 2023-10-14 09:42 | 78K | |
| dsr-pdb-1.0.3_10.pkg | 2023-10-10 18:02 | 205K | |
| dssi-1.1.1_12.pkg | 2023-10-06 20:21 | 56K | |
| dssim-3.2.4_9.pkg | 2023-10-10 19:07 | 807K | |
| dssp-4.4.2.pkg | 2023-10-14 17:04 | 574K | |
| dsssl-docbook-modula..> | 2023-10-06 19:03 | 328K | |
| dstask-0.26_8.pkg | 2023-10-14 15:06 | 2.6M | |
| dsvpn-0.1.4.pkg | 2023-10-14 16:17 | 11K | |
| dsymbol-0.14.1_3.pkg | 2023-10-07 13:17 | 311K | |
| dtach-0.9.pkg | 2023-10-09 04:31 | 14K | |
| dtc-1.6.0.pkg | 2023-10-06 16:15 | 126K | |
| dtcp-20130602_4.pkg | 2023-10-11 00:43 | 21K | |
| dtcpclient-20151002_..> | 2023-10-09 16:07 | 14K | |
| dtd-catalogs-1.2.pkg | 2023-10-14 07:09 | 800 | |
| dtd2relax-1.1.1_2.pkg | 2023-10-14 13:26 | 238K | |
| dtdparse-2.00_1.pkg | 2023-10-10 15:27 | 54K | |
| dte-1.9.1.pkg | 2023-10-09 18:39 | 134K | |
| dtmfdial-0.2.pkg | 2023-10-11 07:07 | 6.6K | |
| dtool-0.12.0_14.pkg | 2023-10-09 16:38 | 1.0M | |
| dtpstree-1.0.3.pkg | 2023-10-14 04:06 | 19K | |
| dtrace-toolkit-1.0_7..> | 2023-10-08 18:35 | 326K | |
| dtse-1.3_2.pkg | 2023-10-10 09:11 | 86K | |
| dtv-scan-tables-2022..> | 2023-10-07 15:10 | 451K | |
| du2ps-3.1.pkg | 2023-10-10 01:18 | 20K | |
| dua-cli-2.20.1_3.pkg | 2023-10-09 03:51 | 472K | |
| dual-dhclient-1.0_1.pkg | 2023-10-14 10:36 | 848 | |
| dual-dhclient-daemon..> | 2023-10-08 21:51 | 3.4K | |
| dub-1.29.0_3.pkg | 2023-10-06 14:29 | 955K | |
| duckdb-0.8.1.pkg | 2023-10-09 00:57 | 28M | |
| duel-0.98_11.pkg | 2023-10-09 23:29 | 1.6M | |
| duf-0.8.1_15.pkg | 2023-10-09 07:12 | 750K | |
| duff-0.5.2_2.pkg | 2023-10-14 09:10 | 20K | |
| dufs-0.36.0_1.pkg | 2023-10-08 16:40 | 1.2M | |
| duhdraw-2.8.13.pkg | 2023-10-09 11:22 | 25K | |
| duktape-2.7.0.pkg | 2023-10-07 23:27 | 211K | |
| duktape-lib-2.7.0.pkg | 2023-10-05 16:46 | 248K | |
| dumb-0.9.3_5.pkg | 2023-10-07 15:43 | 108K | |
| dumb-allegro-0.9.3_5..> | 2023-10-07 18:49 | 120K | |
| dump1090-20200718.pkg | 2023-10-09 08:11 | 25K | |
| dumpasn1-20210212.pkg | 2023-10-14 11:08 | 48K | |
| dumpmpeg-0.6_10.pkg | 2023-10-08 17:04 | 6.2K | |
| duncan-0.4_1.pkg | 2023-10-07 23:39 | 1.2M | |
| dune-alugrid-2.8.0_6..> | 2023-10-07 19:18 | 3.2M | |
| dune-common-2.8.0_9.pkg | 2023-10-06 18:40 | 358K | |
| dune-curvedgeometry-..> | 2023-10-14 04:42 | 13K | |
| dune-fem-2.8.0.5_9.pkg | 2023-10-11 00:50 | 39M | |
| dune-foamgrid-2.8.0_..> | 2023-10-08 03:47 | 517K | |
| dune-functions-2.8.0..> | 2023-10-07 18:48 | 1.7M | |
| dune-geometry-2.8.0_..> | 2023-10-06 21:50 | 1.2M | |
| dune-grid-2.8.0_8.pkg | 2023-10-07 04:39 | 8.0M | |
| dune-grid-glue-2.8.0..> | 2023-10-10 17:02 | 909K | |
| dune-istl-2.8.0_4.pkg | 2023-10-07 04:49 | 3.4M | |
| dune-localfunctions-..> | 2023-10-07 09:05 | 4.3M | |
| dune-metagrid-g20210..> | 2023-10-09 02:33 | 75K | |
| dune-multidomaingrid..> | 2023-10-14 03:05 | 1.2M | |
| dune-pdelab-2.7.0.20..> | 2023-10-10 19:34 | 22M | |
| dune-polygongrid-2.8..> | 2023-10-08 11:08 | 29K | |
| dune-spgrid-2.8.0_1.pkg | 2023-10-07 23:56 | 1.3M | |
| dune-typetree-2.8.0_..> | 2023-10-07 09:26 | 860K | |
| dune-uggrid-2.8.0_8.pkg | 2023-10-06 22:12 | 496K | |
| dune-vtk-2.8.0_9.pkg | 2023-10-14 11:44 | 1.3M | |
| dunelegacy-0.96.4_5.pkg | 2023-10-10 00:19 | 1.5M | |
| dungeon-3.2_1.pkg | 2023-10-08 15:54 | 584K | |
| dungeoncrawl-4.0.0.b..> | 2023-10-09 20:15 | 525K | |
| dunst-1.9.1.pkg | 2023-10-08 09:33 | 93K | |
| duo-2.0.1.pkg | 2023-10-08 14:14 | 79K | |
| duo_openvpn-2.5.pkg | 2023-10-08 23:30 | 9.0K | |
| dupd-1.7.pkg | 2023-10-11 17:20 | 73K | |
| dupl-1.0.0.11_15.pkg | 2023-10-14 06:18 | 717K | |
| duplicity-0.8.23.pkg | 2023-10-08 03:06 | 523K | |
| duplo-0.2.0.pkg | 2023-10-08 14:22 | 28K | |
| duply-2.2.2.pkg | 2023-10-10 11:03 | 30K | |
| dupmerge-1.73_1.pkg | 2023-10-09 16:31 | 10K | |
| dura-0.2.0_8.pkg | 2023-10-08 23:21 | 640K | |
| durden-0.6.1_1.pkg | 2023-10-09 22:45 | 3.0M | |
| dust-0.8.6_3.pkg | 2023-10-10 19:05 | 622K | |
| dust3d-1.0.0.r.6_1.pkg | 2023-10-14 17:36 | 11M | |
| dustrac-2.1.1_1.pkg | 2023-10-08 17:28 | 4.3M | |
| dutree-0.2.15_3.pkg | 2023-10-08 22:43 | 409K | |
| dv2sub-0.3_5.pkg | 2023-10-14 05:29 | 9.1K | |
| dvb-apps-1.1.2.1505_..> | 2023-10-08 20:39 | 248K | |
| dvbcut-0.7.4_5.pkg | 2023-10-14 02:46 | 173K | |
| dvbsnoop-1.4.50.pkg | 2023-10-09 09:58 | 103K | |
| dvc-0.30.1_4.pkg | 2023-10-10 09:52 | 177K | |
| dvd+rw-tools-7.1_3.pkg | 2023-10-07 09:54 | 80K | |
| dvd-slideshow-0.8.4_..> | 2023-10-10 04:00 | 101K | |
| dvdauthor-0.7.2.2021..> | 2023-10-06 19:22 | 164K | |
| dvdbackup-0.4.2_7.pkg | 2023-10-10 23:20 | 38K | |
| dvdid-0.2.0a_2.pkg | 2023-10-08 17:25 | 33K | |
| dvdimagecmp-0.3.pkg | 2023-10-14 08:30 | 4.6K | |
| dvdisaster-0.79.10.pkg | 2023-10-09 23:31 | 3.3M | |
| dvdisaster-nox11-0.7..> | 2023-10-09 01:08 | 394K | |
| dvdread-g20160701_2.pkg | 2023-10-10 07:18 | 6.4K | |
| dvdstyler-3.3.b3_4,2..> | 2023-10-10 21:49 | 8.7M | |
| dvdvideo-py39-201301..> | 2023-10-14 08:18 | 18K | |
| dvi2tty-5.3.4.pkg | 2023-10-08 17:58 | 24K | |
| dvips2ascii-1.3.pkg | 2023-10-09 01:42 | 3.2K | |
| dvisvg-0.7.1.d_9.pkg | 2023-10-10 12:47 | 17K | |
| dvorak7min-1.6.1_1.pkg | 2023-10-08 12:58 | 17K | |
| dvtm-0.15.pkg | 2023-10-09 22:02 | 29K | |
| dwarf2json-g20220807..> | 2023-10-09 00:24 | 731K | |
| dwarfdump-20161124.pkg | 2023-10-07 20:45 | 171K | |
| dwarves-1.19_1.pkg | 2023-10-10 02:51 | 169K | |
| dwatch-0.1.1_1.pkg | 2023-10-10 11:51 | 5.0K | |
| dwatch-gource-0.9.pkg | 2023-10-08 22:38 | 8.9K | |
| dwatch-json-1.2.pkg | 2023-10-09 17:17 | 29K | |
| dwatch-pwsnoop-0.1.1..> | 2023-10-10 23:46 | 1.8K | |
| dwave-preprocessing-..> | 2023-10-09 19:31 | 23K | |
| dwdiff-2.1.4_5.pkg | 2023-10-09 01:31 | 71K | |
| dwl-0.4.pkg | 2023-10-09 08:46 | 25K | |
| dwm-6.4.pkg | 2023-10-08 09:03 | 22K | |
| dwmblocks-g20201227.pkg | 2023-10-08 15:36 | 3.8K | |
| dwz-0.14.pkg | 2023-10-10 20:49 | 100K | |
| dxa65-0.1.5.pkg | 2023-10-14 11:58 | 21K | |
| dxirc-1.40.1.pkg | 2023-10-08 15:31 | 1.0M | |
| dxpc-3.9.2.pkg | 2023-10-14 14:11 | 63K | |
| dxx-rebirth-20220929..> | 2023-10-11 06:27 | 949K | |
| dymo-cups-drivers-1...> | 2023-10-10 23:29 | 46K | |
| dynamechs-4.0.p1_9,1..> | 2023-10-10 08:34 | 150K | |
| dynamips-community-0..> | 2023-10-09 19:40 | 263K | |
| dynare-5.4_2.pkg | 2023-10-10 14:56 | 4.2M | |
| dyncall-1.4.pkg | 2023-10-08 15:06 | 32K | |
| dynip-0.0.pkg | 2023-10-10 00:39 | 6.1K | |
| dynomite-0.6.22.pkg | 2023-10-09 03:53 | 182K | |
| dz-libreoffice-7.5.5..> | 2023-10-07 17:03 | 2.7M | |
| dzen2-0.9.5.pkg | 2023-10-10 03:58 | 25K | |
| dzip-2.9.pkg | 2023-10-08 20:04 | 40K | |
| e-antic-1.2.1_3.pkg | 2023-10-07 10:53 | 138K | |
| e00compr-1.0.1.pkg | 2023-10-09 01:17 | 19K | |
| e2fsprogs-1.47.0.pkg | 2023-10-12 09:48 | 331K | |
| e2fsprogs-core-1.47...> | 2023-10-06 23:19 | 1.2M | |
| e2fsprogs-libblkid-1..> | 2023-10-06 17:24 | 34K | |
| e2fsprogs-libuuid-1...> | 2023-10-06 09:52 | 34K | |
| e2guardian-5.3.4_2.pkg | 2023-10-09 19:45 | 490K | |
| e2tools-0.1.0_2.pkg | 2023-10-14 11:09 | 27K | |
| e16-themes-1.0.2.pkg | 2023-10-09 21:27 | 6.7M | |
| e93-1.4.3.pkg | 2023-10-14 12:21 | 189K | |
| e107-2.3.2.pkg | 2023-10-09 16:38 | 9.0M | |
| eaglemode-0.96.1_1.pkg | 2023-10-09 14:48 | 11M | |
| eastl-3.21.12.9.pkg | 2023-10-14 03:24 | 483K | |
| easy-profiler-2.1.0...> | 2023-10-09 23:18 | 407K | |
| easy-rsa-3.1.6.pkg | 2023-10-07 00:28 | 62K | |
| easydiff-0.4.0_10.pkg | 2023-10-08 06:03 | 31K | |
| easyexif-1.0.pkg | 2023-10-07 00:17 | 18K | |
| easygit-0.98.pkg | 2023-10-09 02:24 | 55K | |
| easylatex-0.080.pkg | 2023-10-08 19:42 | 21K | |
| easyloggingpp-9.97.1..> | 2023-10-09 23:07 | 127K | |
| easyrpg-player-0.8.pkg | 2023-10-08 19:23 | 1.2M | |
| easysoap-0.8.0_7.pkg | 2023-10-14 07:13 | 164K | |
| easystroke-0.6.0.9_3..> | 2023-10-08 17:16 | 264K | |
| easytag-2.4.3_8.pkg | 2023-10-09 11:39 | 618K | |
| eawpats-12_4.pkg | 2023-10-07 03:18 | 26M | |
| eawplus-12.1_3.pkg | 2023-10-10 08:03 | 3.2M | |
| ebnf2yacc-0.1.1.pkg | 2023-10-08 20:47 | 31K | |
| eboard-1.1.3_1.pkg | 2023-10-09 09:05 | 1.3M | |
| ebook-tools-0.2.2_8.pkg | 2023-10-06 10:56 | 22K | |
| ebook2cw-0.8.2_2.pkg | 2023-10-10 09:23 | 19K | |
| ebsnvme-id-1.0.2.pkg | 2023-10-08 03:41 | 6.3K | |
| ebsynth-0.0.0.201905..> | 2023-10-08 15:11 | 472K | |
| ebumeter-0.4.2_2.pkg | 2023-10-14 07:56 | 45K | |
| ebur128-0.1.8_3.pkg | 2023-10-06 14:58 | 321K | |
| ebusd-23.2.pkg | 2023-10-09 10:01 | 302K | |
| ec2-scripts-1.12.pkg | 2023-10-14 11:58 | 5.6K | |
| ecal-5.12.0.pkg | 2023-10-09 12:04 | 3.6M | |
| ecartis-1.0.0.s20060..> | 2023-10-10 20:11 | 226K | |
| ecasound-2.9.3_1.pkg | 2023-10-08 09:52 | 1.0M | |
| ecce-2.9.d.pkg | 2023-10-08 22:35 | 63K | |
| eccodes-2.30.0_2.pkg | 2023-10-07 01:13 | 2.6M | |
| ecflow-5.11.3.pkg | 2023-10-08 13:58 | 8.2M | |
| ecgi-0.6.3.pkg | 2023-10-10 00:21 | 38K | |
| echat-0.04.b1.pkg | 2023-10-09 15:08 | 58K | |
| echinus-0.4.9_2.pkg | 2023-10-08 15:49 | 36K | |
| echolinux-0.17a_8.pkg | 2023-10-08 21:20 | 27K | |
| echoping-6.0.2_9.pkg | 2023-10-09 11:18 | 39K | |
| ecl-21.2.1_1.pkg | 2023-10-07 00:54 | 2.4M | |
| eclat-2.1.pkg | 2023-10-08 19:55 | 258K | |
| eclib-20230424.pkg | 2023-10-07 10:16 | 2.1M | |
| eclipse-4.24_1.pkg | 2023-10-08 12:13 | 227M | |
| eclipse-EPIC-0.6.35_..> | 2023-10-08 13:12 | 2.8M | |
| eclipse-ShellEd-1.0...> | 2023-10-08 16:30 | 2.4M | |
| eclipse-cdt-9.0.1.pkg | 2023-10-10 10:31 | 78M | |
| eclipse-drjava-0.9.8..> | 2023-10-10 16:30 | 2.6M | |
| eclipse-ecj-4.4.2_1.pkg | 2023-10-07 07:52 | 1.4M | |
| eclipse-findbugs-3.0..> | 2023-10-08 14:19 | 5.6M | |
| eclipse-glassfish-5...> | 2023-10-08 18:56 | 104M | |
| eclipse-pydev-10.2.1..> | 2023-10-14 15:45 | 24M | |
| ecos-2.0.10.pkg | 2023-10-09 23:54 | 55K | |
| ecpprog-g20200725_1.pkg | 2023-10-09 09:51 | 14K | |
| ecrire-0.3.4_1.pkg | 2023-10-10 02:30 | 39K | |
| ecwolf-1.4.1_3.pkg | 2023-10-09 06:34 | 671K | |
| ed2k-hash-0.4.0.pkg | 2023-10-09 23:15 | 10K | |
| ed2k-hash-openssl-1...> | 2023-10-11 01:29 | 3.8K | |
| edbrowse-3.8.5.pkg | 2023-10-10 12:10 | 885K | |
| eden-0.7.4_17.pkg | 2023-10-14 06:07 | 1.9M | |
| edenmath-1.1.1_12.pkg | 2023-10-07 13:33 | 23K | |
| edfbrowser-1.95.pkg | 2023-10-09 01:13 | 691K | |
| edflib-1.24.pkg | 2023-10-09 03:53 | 58K | |
| edge-1.35_11.pkg | 2023-10-09 03:45 | 821K | |
| edi-0.8.0_1.pkg | 2023-10-09 17:44 | 780K | |
| edid-decode-0.1.2023..> | 2023-10-09 12:28 | 106K | |
| edith-1.58_2.pkg | 2023-10-08 12:16 | 261K | |
| editline-1.17.1.pkg | 2023-10-07 12:38 | 44K | |
| editorconfig-core-c-..> | 2023-10-06 11:53 | 29K | |
| editres-1.0.7.pkg | 2023-10-10 21:38 | 33K | |
| editss-2.2_3.pkg | 2023-10-09 02:29 | 28K | |
| edje_viewer-20130520..> | 2023-10-09 03:59 | 50K | |
| edk2-bhyve-g202308_3..> | 2023-10-06 23:20 | 1.4M | |
| edk2-fvp-g202308_3.pkg | 2023-10-07 11:17 | 578K | |
| edk2-macchiatobin-g2..> | 2023-10-09 16:49 | 1.1M | |
| edk2-qemu-i386-g2023..> | 2023-10-14 16:53 | 1.0M | |
| edk2-qemu-x64-g20230..> | 2023-10-09 21:21 | 1.0M | |
| edk2-rpi3-g202308_3.pkg | 2023-10-08 19:08 | 1.1M | |
| edk2-rpi4-g202308_3.pkg | 2023-10-10 13:46 | 1.1M | |
| edk2-xen-x64-g202308..> | 2023-10-08 07:42 | 1.0M | |
| edlib-1.2.7.pkg | 2023-10-09 23:57 | 19K | |
| eduke32-20230809.pkg | 2023-10-09 18:41 | 2.0M | |
| edumips64-1.2.10.pkg | 2023-10-10 17:32 | 1.9M | |
| efl-1.26.3_12.pkg | 2023-10-08 01:39 | 29M | |
| eflite-0.4.1.pkg | 2023-10-08 20:22 | 20K | |
| eggdrop-1.9.3.pkg | 2023-10-09 07:00 | 635K | |
| egl-0.3.1_10.pkg | 2023-10-14 14:30 | 12M | |
| egl-wayland-1.1.12.pkg | 2023-10-07 07:53 | 29K | |
| eglexternalplatform-..> | 2023-10-05 16:39 | 5.0K | |
| egoboo-2.8.1_1,1.pkg | 2023-10-14 16:27 | 115M | |
| egypt-1.11.pkg | 2023-10-10 19:31 | 13K | |
| ehnt-0.3_8.pkg | 2023-10-08 21:22 | 21K | |
| eif-1.3.4_4.pkg | 2023-10-09 09:40 | 34K | |
| eiffelstudio-5.7_8.pkg | 2023-10-08 15:22 | 32M | |
| eigen-3.4.0_2.pkg | 2023-10-06 09:19 | 1.0M | |
| eights-1.0.pkg | 2023-10-09 18:17 | 7.1K | |
| einstein-2.0_10.pkg | 2023-10-09 10:16 | 735K | |
| eiskaltdcpp-cli-2.2...> | 2023-10-09 16:04 | 9.5K | |
| eiskaltdcpp-daemon-2..> | 2023-10-10 12:47 | 128K | |
| eiskaltdcpp-data-2.2..> | 2023-10-07 14:46 | 539K | |
| eiskaltdcpp-gtk-2.2...> | 2023-10-10 01:09 | 774K | |
| eiskaltdcpp-lib-2.2...> | 2023-10-07 16:21 | 688K | |
| eisl-3.50.pkg | 2023-10-10 04:10 | 260K | |
| eispack-1.0_15.pkg | 2023-10-10 18:06 | 83K | |
| ejabberd-23.04_1.pkg | 2023-10-08 16:01 | 9.9M | |
| ejdb-2.73.pkg | 2023-10-14 18:53 | 119K | |
| eject-1.5_4.pkg | 2023-10-07 15:14 | 7.6K | |
| ekhtml-0.3.2_2.pkg | 2023-10-09 07:06 | 18K | |
| eksctl-0.157.0.pkg | 2023-10-14 01:56 | 32M | |
| el-1.9.5.9.1_2,1.pkg | 2023-10-09 08:43 | 1.0M | |
| el-aspell-0.50.3_1,1..> | 2023-10-14 16:59 | 3.1M | |
| el-data-1.9.5.9.1,1.pkg | 2023-10-08 11:48 | 153M | |
| el-hyphen-2005.10.17..> | 2023-10-08 12:08 | 1.5K | |
| el-libreoffice-7.5.5..> | 2023-10-07 17:24 | 3.3M | |
| elasticsearch-plugin..> | 2023-10-08 17:01 | 356K | |
| elasticsearch7-7.17...> | 2023-10-10 02:21 | 136M | |
| elasticsearch8-8.8.2..> | 2023-10-09 03:43 | 220M | |
| elastix-5.1.0_1.pkg | 2023-10-10 15:58 | 23M | |
| electric-7.0.0_5.pkg | 2023-10-09 04:04 | 1.8M | |
| electricfence-2.2.2_..> | 2023-10-10 12:56 | 22K | |
| electron23-23.3.13_2..> | 2023-10-09 12:50 | 94M | |
| electron24-24.8.3.pkg | 2023-10-08 09:27 | 94M | |
| electron25-25.8.1.pkg | 2023-10-09 03:44 | 92M | |
| element-web-1.11.43.pkg | 2023-10-11 06:57 | 17M | |
| elemental-1.5.2.pkg | 2023-10-09 19:33 | 2.6M | |
| elementary-calendar-..> | 2023-10-14 08:28 | 279K | |
| elementary-code-7.1...> | 2023-10-10 02:02 | 542K | |
| elementary-photos-2...> | 2023-10-09 03:07 | 1.7M | |
| elementary-terminal-..> | 2023-10-08 17:12 | 111K | |
| elementary-videos-3...> | 2023-10-09 19:16 | 136K | |
| elf-0.5.4p1_5.pkg | 2023-10-14 07:16 | 11K | |
| elf-dissector-0.0.1_..> | 2023-10-09 18:38 | 291K | |
| elfcat-0.1.8_18.pkg | 2023-10-08 20:53 | 178K | |
| elfio-3.11.pkg | 2023-10-07 13:44 | 548K | |
| elfkickers-3.2.pkg | 2023-10-11 00:14 | 82K | |
| elfsh-0.51b3_5.pkg | 2023-10-14 05:31 | 175K | |
| elfutils-0.187.pkg | 2023-10-06 14:36 | 865K | |
| elgg-5.0.5.pkg | 2023-10-14 17:22 | 24M | |
| elinks-0.16.1.1_1.pkg | 2023-10-10 09:33 | 763K | |
| elisa-23.08.1.pkg | 2023-10-08 12:05 | 1.8M | |
| elixir-1.14.5.pkg | 2023-10-07 05:34 | 6.2M | |
| elixir-devel-1.15.4.pkg | 2023-10-09 15:06 | 6.7M | |
| elixir-hex-2.0.6.pkg | 2023-10-10 07:12 | 772K | |
| elixir-make-0.4.2.pkg | 2023-10-10 19:08 | 12K | |
| elixir-mode.el-2.3.1..> | 2023-10-07 18:15 | 17K | |
| elixir-mode.el-emacs..> | 2023-10-08 09:01 | 17K | |
| elixir-mode.el-emacs..> | 2023-10-07 23:08 | 18K | |
| elixir-mode.el-emacs..> | 2023-10-08 01:39 | 17K | |
| elixir-mode.el-emacs..> | 2023-10-07 18:29 | 17K | |
| elk-3.99.8_2.pkg | 2023-10-08 02:10 | 400K | |
| elk-chemistry-8.8.26..> | 2023-10-09 19:21 | 3.4M | |
| elki-0.7.1.1166_1.pkg | 2023-10-10 18:00 | 21M | |
| elliott-803-0.1.11.pkg | 2023-10-14 08:02 | 31M | |
| elm-2.5.8_5.pkg | 2023-10-10 19:01 | 217K | |
| elmerfem-9.0_9.pkg | 2023-10-14 17:56 | 20M | |
| elpa-2021.11.001_1.pkg | 2023-10-07 08:18 | 396K | |
| elscreen-1.4.6.20180..> | 2023-10-09 21:44 | 26K | |
| elscreen-emacs_canna..> | 2023-10-08 17:04 | 26K | |
| elscreen-emacs_devel..> | 2023-10-10 14:30 | 26K | |
| elscreen-emacs_devel..> | 2023-10-09 19:32 | 26K | |
| elscreen-emacs_nox-1..> | 2023-10-08 22:26 | 26K | |
| elvish-0.17.0_15.pkg | 2023-10-09 14:53 | 2.2M | |
| emacs-29.1,3.pkg | 2023-10-06 14:11 | 46M | |
| emacs-canna-29.1,3.pkg | 2023-10-06 15:39 | 46M | |
| emacs-devel-30.0.50...> | 2023-10-06 15:05 | 69M | |
| emacs-devel-nox-30.0..> | 2023-10-06 14:57 | 68M | |
| emacs-koi8u-1.0_1.pkg | 2023-10-09 21:21 | 2.0K | |
| emacs-lisp-intro-2.0..> | 2023-10-12 12:34 | 780 | |
| emacs-nox-29.1,3.pkg | 2023-10-06 14:50 | 45M | |
| emacs-sqlite3-api-0...> | 2023-10-06 19:04 | 20K | |
| emacs-sqlite3-api-em..> | 2023-10-06 19:27 | 20K | |
| emacs-sqlite3-api-em..> | 2023-10-06 19:48 | 20K | |
| emacs-sqlite3-api-em..> | 2023-10-06 19:36 | 20K | |
| emacs-sqlite3-api-em..> | 2023-10-06 22:23 | 20K | |
| emacs-w3m-1.4.632.b...> | 2023-10-07 15:17 | 745K | |
| emacs-w3m-emacs_cann..> | 2023-10-08 04:28 | 745K | |
| emacs-w3m-emacs_deve..> | 2023-10-08 04:54 | 745K | |
| emacs-w3m-emacs_deve..> | 2023-10-07 10:35 | 745K | |
| emacs-w3m-emacs_nox-..> | 2023-10-08 10:57 | 745K | |
| emacsql-3.1.1_5.pkg | 2023-10-07 02:35 | 36K | |
| emacsql-devel-3.1.1...> | 2023-10-07 06:53 | 43K | |
| emacsql-devel-emacs_..> | 2023-10-07 02:05 | 43K | |
| emacsql-devel-emacs_..> | 2023-10-07 06:41 | 43K | |
| emacsql-devel-emacs_..> | 2023-10-07 01:16 | 43K | |
| emacsql-devel-emacs_..> | 2023-10-07 00:49 | 43K | |
| emacsql-emacs_canna-..> | 2023-10-06 23:54 | 36K | |
| emacsql-emacs_devel-..> | 2023-10-07 03:56 | 36K | |
| emacsql-emacs_devel_..> | 2023-10-07 07:00 | 36K | |
| emacsql-emacs_nox-3...> | 2023-10-07 07:30 | 36K | |
| emailrelay-1.9_6.pkg | 2023-10-10 03:41 | 561K | |
| embb-1.0.0_5.pkg | 2023-10-10 20:12 | 351K | |
| embree-3.13.5_5.pkg | 2023-10-06 23:32 | 19M | |
| emby-server-4.7.14.0..> | 2023-10-11 20:20 | 50M | |
| emby-server-devel-4...> | 2023-10-10 08:47 | 50M | |
| emc2-2.17.pkg | 2023-10-09 08:24 | 1.5M | |
| emerald-0.8.8_7.pkg | 2023-10-10 20:18 | 280K | |
| emerald-themes-0.6.0..> | 2023-10-08 21:15 | 1.1M | |
| emiclock-2.0.2_5.pkg | 2023-10-10 18:06 | 106K | |
| emil-2.1b9_1.pkg | 2023-10-09 21:45 | 110K | |
| emms-5.0_13.pkg | 2023-10-09 19:27 | 199K | |
| emms-emacs_canna-5.0..> | 2023-10-08 22:16 | 199K | |
| emms-emacs_devel-5.0..> | 2023-10-14 15:34 | 199K | |
| emms-emacs_devel_nox..> | 2023-10-10 03:20 | 199K | |
| emms-emacs_nox-5.0_1..> | 2023-10-10 21:38 | 199K | |
| emovix-0.9.0_2.pkg | 2023-10-07 22:19 | 9.7M | |
| emprint-20130520_5.pkg | 2023-10-09 00:31 | 8.4K | |
| empty-0.6.23c.pkg | 2023-10-14 11:13 | 18K | |
| emptyepsilon-2021.06..> | 2023-10-10 08:17 | 254M | |
| ems-flasher-0.03_11.pkg | 2023-10-14 09:48 | 6.8K | |
| emscripten-3.1.43.pkg | 2023-10-09 12:00 | 4.8M | |
| emu64-5.1.0.pkg | 2023-10-10 06:51 | 1.3M | |
| emulationstation-2.9..> | 2023-10-08 16:40 | 934K | |
| emwm-1.1.pkg | 2023-10-08 01:52 | 158K | |
| emwm-utils-1.1.pkg | 2023-10-14 18:37 | 27K | |
| en-aspell-2020.12.07..> | 2023-10-10 20:58 | 1.1M | |
| en-gimp-help-html-2...> | 2023-10-10 11:16 | 43M | |
| en-hunspell-2020.12...> | 2023-10-08 14:30 | 176K | |
| en-mythes-2006.12.08..> | 2023-10-09 17:53 | 2.9M | |
| en_GB-libreoffice-7...> | 2023-10-08 07:16 | 2.9M | |
| en_ZA-libreoffice-7...> | 2023-10-08 05:38 | 2.5M | |
| enblend-4.2_23.pkg | 2023-10-07 13:04 | 902K | |
| enca-1.19.pkg | 2023-10-07 07:54 | 118K | |
| enchant-1.6.0_9.pkg | 2023-10-06 22:17 | 46K | |
| enchant2-2.2.15_3.pkg | 2023-10-06 09:26 | 48K | |
| enchive-3.5.pkg | 2023-10-09 01:16 | 22K | |
| encode-explorer-6.3.pkg | 2023-10-09 13:46 | 35K | |
| encodings-1.0.5,1.pkg | 2023-10-05 17:40 | 557K | |
| encrypted-dns-server..> | 2023-10-10 18:18 | 744K | |
| encryptpad-0.5.0.2_1..> | 2023-10-08 13:30 | 1.0M | |
| endgame-singularity-..> | 2023-10-08 20:13 | 1.6M | |
| endgame-singularity-..> | 2023-10-07 12:56 | 49M | |
| endian-1.1.pkg | 2023-10-07 23:59 | 7.5K | |
| endless-sky-0.9.16.1..> | 2023-10-08 08:48 | 169M | |
| endless-sky-high-dpi..> | 2023-10-14 08:47 | 440M | |
| endlessh-1.1_1.pkg | 2023-10-08 22:58 | 10K | |
| enet-1.3.17,1.pkg | 2023-10-07 22:20 | 185K | |
| engauge-digitizer-12..> | 2023-10-08 19:58 | 4.3M | |
| engrampa-1.26.0_2.pkg | 2023-10-07 12:45 | 1.1M | |
| enigma-1.30_2.pkg | 2023-10-12 11:14 | 39M | |
| enlightenment-0.25.4..> | 2023-10-10 16:16 | 385M | |
| enma-1.2.0_6.pkg | 2023-10-08 23:35 | 282K | |
| enscribe-0.1.0_12.pkg | 2023-10-08 12:13 | 15K | |
| enscript-a4-1.6.6_3.pkg | 2023-10-06 17:44 | 321K | |
| enscript-letter-1.6...> | 2023-10-07 20:39 | 321K | |
| enscript-letterdj-1...> | 2023-10-14 17:11 | 321K | |
| ensemblist-040126_12..> | 2023-10-11 13:07 | 943K | |
| ensmallen-2.19.1_1.pkg | 2023-10-07 20:04 | 152K | |
| ent-0.20080128_1.pkg | 2023-10-14 10:20 | 22K | |
| entangle-1.0_2.pkg | 2023-10-10 16:51 | 394K | |
| enteruser-1.0.pkg | 2023-10-11 05:02 | 5.2K | |
| entombed-2007.07.04_..> | 2023-10-10 07:32 | 262K | |
| entr-5.4.pkg | 2023-10-07 11:08 | 9.9K | |
| entt-3.12.2.pkg | 2023-10-09 09:41 | 95K | |
| envconsul-0.13.2_2.pkg | 2023-10-08 16:51 | 3.3M | |
| envsubst-0.1.pkg | 2023-10-10 00:55 | 4.2K | |
| envy-0.1.0_15.pkg | 2023-10-08 17:08 | 729K | |
| enygma-1.04.pkg | 2023-10-14 04:46 | 22K | |
| eo-aspell-2.1.200002..> | 2023-10-08 11:58 | 150K | |
| eo-libreoffice-7.5.5..> | 2023-10-07 14:06 | 3.0M | |
| eog-43.1_2.pkg | 2023-10-07 02:54 | 1.1M | |
| eog-plugins-3.26.8_3..> | 2023-10-08 10:35 | 130K | |
| eolie-0.9.101_2.pkg | 2023-10-08 14:08 | 274K | |
| eom-1.26.0_4.pkg | 2023-10-08 08:49 | 1.8M | |
| eos-movrec-0.3.2.b_6..> | 2023-10-14 10:53 | 313K | |
| epazote-2.1.2_14.pkg | 2023-10-08 12:02 | 1.9M | |
| epdfview-0.1.8_63.pkg | 2023-10-10 18:10 | 94K | |
| ephemera-6.34.pkg | 2023-10-14 18:46 | 258K | |
| ephoto-1.6.0_1.pkg | 2023-10-09 20:28 | 139K | |
| epic4-2.10.10.pkg | 2023-10-08 12:02 | 1.2M | |
| epic5-2.1.12.pkg | 2023-10-11 16:21 | 623K | |
| epiphany-42.4_4.pkg | 2023-10-08 00:27 | 5.3M | |
| epiphany-game-0.7.0.pkg | 2023-10-10 04:24 | 1.8M | |
| epix-1.2.22_1.pkg | 2023-10-10 18:41 | 1.6M | |
| epkowa-2.11.0_6.pkg | 2023-10-10 10:28 | 59K | |
| epl.el-0.8_14.pkg | 2023-10-08 04:22 | 6.9K | |
| epl.el-emacs_canna-0..> | 2023-10-07 10:41 | 6.9K | |
| epl.el-emacs_devel-0..> | 2023-10-07 23:20 | 6.9K | |
| epl.el-emacs_devel_n..> | 2023-10-07 21:32 | 6.9K | |
| epl.el-emacs_nox-0.8..> | 2023-10-08 04:56 | 6.9K | |
| epm-4.5.1.pkg | 2023-10-08 09:54 | 1.4M | |
| epos-2.5.37_1.pkg | 2023-10-10 01:13 | 316K | |
| eprover-2.6_1.pkg | 2023-10-08 19:03 | 836K | |
| eps-1.7_2.pkg | 2023-10-07 20:05 | 19K | |
| eps2png-2.905.pkg | 2023-10-14 12:16 | 12K | |
| epson-inkjet-printer..> | 2023-10-10 04:46 | 1.5M | |
| epson-inkjet-printer..> | 2023-10-09 12:05 | 3.4M | |
| epson-inkjet-printer..> | 2023-10-10 07:10 | 2.5M | |
| epsonepl-0.2.2_6.pkg | 2023-10-09 14:39 | 11K | |
| epsonscan2-6.6.40.0_..> | 2023-10-08 03:22 | 1.9M | |
| epsonscan2-non-free-..> | 2023-10-14 11:48 | 1.8M | |
| epstool-3.09.pkg | 2023-10-07 10:23 | 107K | |
| epstools-1.8.pkg | 2023-10-08 12:31 | 23K | |
| epte-2.0.8_1.pkg | 2023-10-14 15:10 | 112K | |
| eq10q-lv2-2.2_6.pkg | 2023-10-14 07:59 | 406K | |
| eql5-g20220228.pkg | 2023-10-10 07:57 | 2.2M | |
| equinix-metal-cli-0...> | 2023-10-08 20:54 | 2.9M | |
| erd-3.0.6_6.pkg | 2023-10-10 01:00 | 363K | |
| erdtree-3.1.2_2.pkg | 2023-10-09 10:05 | 814K | |
| erfa-2.0.0.pkg | 2023-10-08 07:00 | 159K | |
| ergo-3.8.2.pkg | 2023-10-14 08:09 | 1.3M | |
| ergo-irc-server-2.11..> | 2023-10-10 18:02 | 2.9M | |
| eric6-qt5-py39-21.11..> | 2023-10-10 05:11 | 9.0M | |
| eris-1.3.23_10.pkg | 2023-10-10 20:25 | 218K | |
| erkale-g20220405_7.pkg | 2023-10-09 21:16 | 1.6M | |
| erkale-pseudopotenti..> | 2023-10-08 04:31 | 1.5M | |
| erkale-serial-g20220..> | 2023-10-14 14:02 | 1.5M | |
| erlang-25.3.2.6,4.pkg | 2023-10-06 20:04 | 36M | |
| erlang-cl-1.2.4.pkg | 2023-10-07 16:22 | 126K | |
| erlang-doc-25.3.pkg | 2023-10-10 01:02 | 19M | |
| erlang-java-25.3.2.6..> | 2023-10-11 14:24 | 162K | |
| erlang-man-25.3.pkg | 2023-10-05 16:39 | 1.2M | |
| erlang-native-compil..> | 2023-10-08 03:53 | 26K | |
| erlang-rebar3_hex-2...> | 2023-10-09 00:01 | 83K | |
| erlang-recon-2.5.3.pkg | 2023-10-10 01:46 | 127K | |
| erlang-runtime21-21...> | 2023-10-07 02:34 | 33M | |
| erlang-runtime22-22...> | 2023-10-14 12:30 | 32M | |
| erlang-runtime23-23...> | 2023-10-09 07:17 | 33M | |
| erlang-runtime24-24...> | 2023-10-08 21:39 | 35M | |
| erlang-runtime25-25...> | 2023-10-07 10:14 | 36M | |
| erlang-runtime26-26...> | 2023-10-08 23:16 | 36M | |
| erlang-wx-25.3.2.6,1..> | 2023-10-07 13:41 | 6.0M | |
| erminej-3.2.pkg | 2023-10-08 09:53 | 13M | |
| es-0.9.b1_6.pkg | 2023-10-08 18:47 | 96K | |
| es-aspell-1.11.2,1.pkg | 2023-10-08 20:42 | 441K | |
| es-eric6-21.11.pkg | 2023-10-08 17:26 | 387K | |
| es-hunspell-2.2.pkg | 2023-10-08 12:51 | 197K | |
| es-hyphen-2013.09.01..> | 2023-10-08 12:31 | 3.3K | |
| es-libreoffice-7.5.5..> | 2023-10-07 14:12 | 3.2M | |
| es-mythes-20140516.pkg | 2023-10-14 16:18 | 544K | |
| esbuild-0.19.2_1.pkg | 2023-10-09 23:22 | 3.0M | |
| eschalot-1.2.0.20191..> | 2023-10-11 00:20 | 11K | |
| espeak-ng-1.51.1_4.pkg | 2023-10-05 17:47 | 4.4M | |
| espressivo-lv2-0.1.6..> | 2023-10-14 03:53 | 75K | |
| ess-18.10.2_16.pkg | 2023-10-10 03:14 | 1.2M | |
| ess-emacs_canna-18.1..> | 2023-10-09 09:40 | 1.2M | |
| ess-emacs_devel-18.1..> | 2023-10-10 12:46 | 1.2M | |
| ess-emacs_devel_nox-..> | 2023-10-09 13:38 | 1.2M | |
| ess-emacs_nox-18.10...> | 2023-10-14 15:23 | 1.2M | |
| essentia-2.1.b5.859_..> | 2023-10-08 11:00 | 1.6M | |
| estd-0.6.5.pkg | 2023-10-14 05:28 | 27K | |
| estic-1.61_10.pkg | 2023-10-09 07:03 | 236K | |
| estraier-1.2.30_4.pkg | 2023-10-10 18:51 | 172K | |
| et-aspell-0.1.21.1_1..> | 2023-10-14 13:06 | 857K | |
| et-libreoffice-7.5.5..> | 2023-10-07 14:02 | 3.0M | |
| etc_os-release-0.1_3..> | 2023-10-10 08:51 | 728 | |
| etcd-1.0.1_3.pkg | 2023-10-09 16:28 | 10K | |
| etcmerge-0.4.pkg | 2023-10-14 06:10 | 8.4K | |
| eterm-0.9.6_5.pkg | 2023-10-09 20:23 | 477K | |
| eterm-bg-0.9.6.pkg | 2023-10-09 19:32 | 1.8M | |
| eternalterminal-6.2...> | 2023-10-08 15:51 | 613K | |
| eteroj-lv2-0.10.0_1.pkg | 2023-10-10 19:04 | 52K | |
| ethash-1.0.1_1.pkg | 2023-10-08 08:45 | 18K | |
| etherape-0.9.20_1.pkg | 2023-10-14 05:58 | 767K | |
| ethname-2.0.1.pkg | 2023-10-10 07:36 | 3.8K | |
| etktab-3.2_3.pkg | 2023-10-08 23:21 | 42K | |
| etl-1.4.4.pkg | 2023-10-07 07:22 | 36K | |
| etracer-0.8.2.pkg | 2023-10-14 14:41 | 39M | |
| etsh-5.4.0.pkg | 2023-10-09 22:34 | 80K | |
| ettercap-0.8.3.1_2,1..> | 2023-10-09 13:31 | 744K | |
| eu-libreoffice-7.5.5..> | 2023-10-07 18:11 | 3.0M | |
| euchre-0.8_4.pkg | 2023-10-10 23:16 | 130K | |
| euclid-wm-0.4.3_1.pkg | 2023-10-09 23:58 | 22K | |
| eukleides-1.5.4_6.pkg | 2023-10-09 14:23 | 206K | |
| eureka-1.27.b_2.pkg | 2023-10-08 13:11 | 626K | |
| eval-113_2.pkg | 2023-10-08 21:54 | 32K | |
| evangeline-1.1.4.pkg | 2023-10-14 07:17 | 150K | |
| evans-0.10.11_3.pkg | 2023-10-14 04:31 | 4.5M | |
| evcxr-jupyter-0.15.1..> | 2023-10-09 18:27 | 5.7M | |
| evdev-proto-5.8.pkg | 2023-10-05 16:39 | 16K | |
| evemu-2.7.0.pkg | 2023-10-14 15:20 | 25K | |
| eventviews-23.08.1.pkg | 2023-10-06 16:33 | 543K | |
| eventxx-1.0.1_5.pkg | 2023-10-14 16:47 | 9.8K | |
| evhz-g20210920_1.pkg | 2023-10-09 08:41 | 3.7K | |
| evilfinder-1.00_5.pkg | 2023-10-10 06:07 | 14K | |
| evilvte-0.5.2.p1_4.pkg | 2023-10-10 17:53 | 29K | |
| evilwm-1.4.2.pkg | 2023-10-08 13:26 | 44K | |
| evince-43.1_6.pkg | 2023-10-07 04:21 | 1.5M | |
| evince-lite-43.1_6.pkg | 2023-10-10 22:40 | 1.4M | |
| evisum-0.6.0_1.pkg | 2023-10-14 14:37 | 1.9M | |
| evolution-3.44.4_3.pkg | 2023-10-08 01:23 | 10M | |
| evolution-data-serve..> | 2023-10-06 17:34 | 3.6M | |
| evolution-ews-3.44.4..> | 2023-10-08 16:44 | 642K | |
| evolvotron-0.8.1_1.pkg | 2023-10-10 07:47 | 402K | |
| evq3-1.3.20080810_11..> | 2023-10-14 15:27 | 854K | |
| evtViewer-0.6.pkg | 2023-10-09 03:45 | 7.9K | |
| evtest-1.35.pkg | 2023-10-07 14:32 | 13K | |
| evtx-0.8.1_3.pkg | 2023-10-07 04:48 | 766K | |
| eww-wayland-0.4.0_11..> | 2023-10-10 22:33 | 1.4M | |
| eww-x11-0.4.0_11.pkg | 2023-10-09 02:05 | 1.4M | |
| exa-0.10.1_25.pkg | 2023-10-09 17:25 | 286K | |
| exaile-4.1.1_1.pkg | 2023-10-10 23:50 | 1.3M | |
| excido-0.1.5c_17.pkg | 2023-10-11 14:39 | 2.4M | |
| execline-2.9.3.0.pkg | 2023-10-07 01:04 | 140K | |
| exempi-2.6.3.pkg | 2023-10-06 19:28 | 903K | |
| exercisix-1.2.pkg | 2023-10-09 10:31 | 9.0K | |
| exercism-3.2.0_2.pkg | 2023-10-10 01:16 | 2.8M | |
| exfat-utils-1.4.0.pkg | 2023-10-08 02:04 | 47K | |
| exhale-1.2.0.1.pkg | 2023-10-14 03:39 | 110K | |
| exhaust-1.9.2.pkg | 2023-10-09 07:35 | 12K | |
| exhaust-doc-1.9.2.pkg | 2023-10-10 16:19 | 21K | |
| exhaust-ma-1.9.pkg | 2023-10-10 01:53 | 12K | |
| exif-0.6.22.pkg | 2023-10-07 22:43 | 51K | |
| exifprobe-2.0.1.pkg | 2023-10-14 05:47 | 152K | |
| exiftags-1.01.pkg | 2023-10-10 19:24 | 57K | |
| exiftran-2.14_1.pkg | 2023-10-07 22:16 | 24K | |
| exilog-0.5_9.pkg | 2023-10-14 05:06 | 89K | |
| exim-4.96_1.pkg | 2023-10-08 01:40 | 1.3M | |
| exim-doc-html-4.96.pkg | 2023-10-09 17:16 | 563K | |
| exim-doc-pdf-4.96.pkg | 2023-10-14 06:23 | 2.0M | |
| exim-doc-postscript-..> | 2023-10-14 06:08 | 1.1M | |
| exim-ldap2-4.96_1.pkg | 2023-10-14 15:12 | 1.3M | |
| exim-monitor-4.96_1.pkg | 2023-10-10 09:12 | 57K | |
| exim-mysql-4.96_1.pkg | 2023-10-09 16:23 | 1.3M | |
| exim-postgresql-4.96..> | 2023-10-11 00:28 | 1.3M | |
| exim-sa-exim-4.96+4...> | 2023-10-09 17:44 | 1.3M | |
| exim-sqlite-4.96_1.pkg | 2023-10-08 20:46 | 1.3M | |
| exipick-20100323.0.pkg | 2023-10-10 08:40 | 16K | |
| exiv2-0.28.0_1,1.pkg | 2023-10-06 10:25 | 1.7M | |
| exmh-2.9.0_5.pkg | 2023-10-14 18:44 | 493K | |
| exo-2_2.pkg | 2023-10-07 23:33 | 893K | |
| exomizer-3.1.1.pkg | 2023-10-09 23:01 | 369K | |
| exonerate-2.4.0.pkg | 2023-10-14 05:13 | 1.0M | |
| expat-2.5.0.pkg | 2023-10-05 16:41 | 107K | |
| expect-5.45.4_4,1.pkg | 2023-10-06 19:44 | 173K | |
| expense-0.1_12.pkg | 2023-10-08 02:23 | 36K | |
| expiretable-0.6_2.pkg | 2023-10-14 12:34 | 7.7K | |
| explosions-0.2005.07..> | 2023-10-09 21:54 | 31K | |
| exprtk-0.0.2.pkg | 2023-10-07 01:15 | 106K | |
| exrtools-0.4_34.pkg | 2023-10-08 19:38 | 40K | |
| extipl-5.04.pkg | 2023-10-14 06:43 | 50K | |
| extract_url-1.6.2.pkg | 2023-10-09 12:11 | 18K | |
| exult-1.8_3,1.pkg | 2023-10-14 08:53 | 12M | |
| exult-devel-1.9.0.20..> | 2023-10-10 07:30 | 12M | |
| eyeclock-2.0_4.pkg | 2023-10-09 00:19 | 138K | |
| ez-pine-gpg-0.4.h_2.pkg | 2023-10-09 04:32 | 7.5K | |
| ezbounce-1.99.15_24.pkg | 2023-10-09 07:52 | 280K | |
| ezc3d-1.5.4.pkg | 2023-10-09 14:10 | 121K | |
| ezjail-3.4.2_1.pkg | 2023-10-14 14:04 | 43K | |
| ezmlm-0.53_1.pkg | 2023-10-07 02:59 | 57K | |
| ezmlm-idx-7.2.2_1.pkg | 2023-10-08 07:46 | 693K | |
| ezquake-3.2.3_3,2.pkg | 2023-10-10 10:25 | 17M | |
| ezstream-0.5.6_8.pkg | 2023-10-14 05:58 | 40K | |
| ezxml-0.8.6.pkg | 2023-10-08 10:48 | 16K | |
| f-prot-6.5.1.5927_1.pkg | 2023-10-08 13:49 | 24M | |
| f1spirit-remake-1.0_..> | 2023-10-09 11:16 | 16M | |
| f2-1.9.1_1.pkg | 2023-10-09 23:18 | 2.5M | |
| f2c-20200916.pkg | 2023-10-05 17:04 | 309K | |
| f3-8.0.pkg | 2023-10-10 13:06 | 13K | |
| f3d-2.1.0.pkg | 2023-10-08 02:44 | 551K | |
| f77flow-0.12_1.pkg | 2023-10-09 13:44 | 8.9K | |
| fa-aspell-0.11.0_1,2..> | 2023-10-14 16:28 | 1.6M | |
| fa-libreoffice-7.5.5..> | 2023-10-07 22:27 | 271K | |
| faac-1.30.pkg | 2023-10-06 22:11 | 61K | |
| faad2-2.10.1,1.pkg | 2023-10-06 20:24 | 224K | |
| fabio-1.6.0_14.pkg | 2023-10-09 11:48 | 4.7M | |
| fabla2-lv2-g20180331..> | 2023-10-09 07:26 | 151K | |
| facedetect-0.1_8.pkg | 2023-10-08 07:49 | 3.7K | |
| faces-1.7.7_12.pkg | 2023-10-07 04:24 | 25K | |
| facile-1.1.3_2.pkg | 2023-10-08 00:35 | 534K | |
| facter-3.14.24_3.pkg | 2023-10-10 19:31 | 502K | |
| fairymax-5.0b.201603..> | 2023-10-07 15:02 | 70K | |
| faiss-1.7.4_1.pkg | 2023-10-08 09:45 | 1.0M | |
| fakebo-0.4.2.1_1.pkg | 2023-10-10 21:35 | 31K | |
| fakeident-2.7.pkg | 2023-10-09 12:10 | 6.1K | |
| fakeroot-1.23.pkg | 2023-10-06 18:18 | 71K | |
| fakertc-3.pkg | 2023-10-10 10:58 | 1.4K | |
| fakesteak-0.2.4.pkg | 2023-10-14 03:15 | 5.8K | |
| faketty-1.0.13_1.pkg | 2023-10-14 08:48 | 255K | |
| falconseye-1.9.3_11.pkg | 2023-10-11 13:15 | 4.8M | |
| falkon-23.08.1.pkg | 2023-10-14 16:16 | 2.3M | |
| falkon-qtonly-23.08...> | 2023-10-08 18:38 | 2.3M | |
| fam-2.6.10_9.pkg | 2023-10-10 00:06 | 69K | |
| fancybox-3.5.7.pkg | 2023-10-10 10:53 | 54K | |
| fand-0.2.3.pkg | 2023-10-14 18:35 | 7.4K | |
| fann-2.2.0.20230126.pkg | 2023-10-14 06:35 | 135K | |
| fanout-0.6.1.pkg | 2023-10-08 12:26 | 4.5K | |
| fantasque-sans-mono-..> | 2023-10-09 18:19 | 213K | |
| fanwood-g20110526_1.pkg | 2023-10-09 03:47 | 152K | |
| fapg-0.43.pkg | 2023-10-08 18:40 | 18K | |
| far2l-2.5.2.pkg | 2023-10-14 08:49 | 3.3M | |
| farbfeld-4_1.pkg | 2023-10-08 01:16 | 17K | |
| fargoal-20040629_3.pkg | 2023-10-09 03:33 | 371K | |
| farmhash-g20190513.pkg | 2023-10-10 00:30 | 37K | |
| farsifonts-0.4_4.pkg | 2023-10-09 15:08 | 231K | |
| farstream-0.2.9.pkg | 2023-10-06 11:47 | 236K | |
| fasd-1.0.1.pkg | 2023-10-09 17:21 | 11K | |
| fasda-0.1.4.pkg | 2023-10-07 16:51 | 30K | |
| fasm-1.73.31.pkg | 2023-10-08 04:14 | 121K | |
| fasm-fpga-g20190920.pkg | 2023-10-10 02:55 | 14K | |
| fast_float-5.2.0.pkg | 2023-10-07 02:26 | 35K | |
| fasta-21.1.1.pkg | 2023-10-14 12:14 | 108K | |
| fasta3-36.3.8.pkg | 2023-10-09 18:40 | 697K | |
| fastahack-1.0.0.pkg | 2023-10-09 04:11 | 46K | |
| fastcap-2.0.w.011109..> | 2023-10-09 06:35 | 1.2M | |
| fastdb-3.75_8.pkg | 2023-10-11 03:45 | 372K | |
| fastdfs-6.0.6.pkg | 2023-10-14 10:12 | 284K | |
| fastdnaml-1.2.2_2.pkg | 2023-10-14 04:08 | 52K | |
| fastfetch-2.0.5_1.pkg | 2023-10-08 13:05 | 282K | |
| fastfetch-lite-2.0.5..> | 2023-10-08 18:33 | 251K | |
| fastforward-0.51.pkg | 2023-10-09 22:12 | 55K | |
| fasthenry-3.0.w.0211..> | 2023-10-14 10:18 | 1.0M | |
| fastjar-0.93.2006080..> | 2023-10-08 09:11 | 41K | |
| fastjet-3.4.2.pkg | 2023-10-10 09:29 | 7.4M | |
| fastnetmon-1.2.5_1.pkg | 2023-10-09 11:44 | 1.5M | |
| fastool-0.1.4.pkg | 2023-10-08 13:12 | 5.5K | |
| fastops-1.0.0.pkg | 2023-10-10 21:32 | 121K | |
| fastp-0.23.4.pkg | 2023-10-08 04:34 | 164K | |
| fastq-trim-0.1.2.pkg | 2023-10-07 18:48 | 50K | |
| fastqc-0.12.1.pkg | 2023-10-07 23:15 | 11M | |
| fastresolve-2.10_6.pkg | 2023-10-09 05:49 | 49K | |
| fastscapelib-0.1.3.5..> | 2023-10-10 01:33 | 32K | |
| fasttracker2-1.69_1.pkg | 2023-10-08 21:12 | 375K | |
| fastx_toolkit-0.0.14..> | 2023-10-10 05:23 | 69K | |
| fatal-2023.09.18.00.pkg | 2023-10-11 22:53 | 243K | |
| fatback-1.3_2.pkg | 2023-10-14 12:17 | 97K | |
| fatfrog-lv2-1.0.pkg | 2023-10-10 19:51 | 104K | |
| faup-1.5.48_1.pkg | 2023-10-14 13:06 | 413K | |
| faust-2.68.0.pkg | 2023-10-06 22:18 | 25M | |
| faust-lv2-1.4.201801..> | 2023-10-09 19:58 | 323K | |
| faustlive-2.5.15.202..> | 2023-10-10 13:07 | 3.3M | |
| fava-1.26.pkg | 2023-10-08 20:30 | 1.6M | |
| fb303-2023.09.18.00.pkg | 2023-10-10 22:36 | 554K | |
| fbcmd-0.5.1_4.pkg | 2023-10-10 03:27 | 15K | |
| fbdesk-1.4.1_6.pkg | 2023-10-10 08:39 | 100K | |
| fbg2-0.4_7.pkg | 2023-10-10 15:49 | 3.8M | |
| fbpanel-6.1_7.pkg | 2023-10-10 05:30 | 195K | |
| fbreader-0.99.6_6.pkg | 2023-10-09 17:54 | 1.6M | |
| fbthrift-2023.09.18...> | 2023-10-07 15:59 | 3.7M | |
| fbzmq-2022.05.30.00_..> | 2023-10-09 00:14 | 183K | |
| fc++-1.5.pkg | 2023-10-10 12:25 | 48K | |
| fccf-0.6.0_2.pkg | 2023-10-14 08:50 | 95K | |
| fceux-2.6.6.pkg | 2023-10-14 08:42 | 3.7M | |
| fcft-3.1.6.pkg | 2023-10-07 04:39 | 78K | |
| fcgi-devkit-2.4.0_5.pkg | 2023-10-07 04:25 | 168K | |
| fcgiwrap-1.1.0_11.pkg | 2023-10-10 01:32 | 11K | |
| fcheck-2.07.59_1.pkg | 2023-10-08 21:06 | 24K | |
| fcitx-m17n-0.2.3_1.pkg | 2023-10-09 09:43 | 17K | |
| fcitx-qt5-1.2.7.pkg | 2023-10-08 10:35 | 135K | |
| fcitx-table-other-0...> | 2023-10-10 09:54 | 205K | |
| fcitx5-5.0.23.pkg | 2023-10-06 18:27 | 7.8M | |
| fcitx5-configtool-5...> | 2023-10-11 15:36 | 329K | |
| fcitx5-gtk-common-5...> | 2023-10-07 21:31 | 19K | |
| fcitx5-gtk2-5.0.23.pkg | 2023-10-10 00:15 | 19K | |
| fcitx5-gtk3-5.0.23.pkg | 2023-10-09 16:49 | 39K | |
| fcitx5-gtk4-5.0.23.pkg | 2023-10-14 13:10 | 38K | |
| fcitx5-lua-5.0.10.pkg | 2023-10-07 05:20 | 38K | |
| fcitx5-m17n-5.0.11.pkg | 2023-10-10 00:19 | 65K | |
| fcitx5-qt-common-5.0..> | 2023-10-06 20:31 | 9.1K | |
| fcitx5-qt5-5.0.17_1.pkg | 2023-10-07 04:28 | 167K | |
| fcitx5-qt6-5.0.17_1.pkg | 2023-10-08 17:29 | 141K | |
| fcl-0.7.0_1.pkg | 2023-10-08 06:19 | 1.0M | |
| fcl05-0.5.0_3.pkg | 2023-10-06 20:11 | 1.0M | |
| fcode-utils-1.0.3.pkg | 2023-10-08 20:21 | 88K | |
| fconfig-20080329.pkg | 2023-10-09 08:59 | 8.1K | |
| fconv-1.1_2.pkg | 2023-10-10 02:26 | 3.7K | |
| fcplay-0.0.1_2.pkg | 2023-10-09 14:40 | 20K | |
| fcppt-4.4.0_1.pkg | 2023-10-10 15:57 | 367K | |
| fcrackzip-1.0_2.pkg | 2023-10-09 21:13 | 18K | |
| fcron-3.2.1_1.pkg | 2023-10-14 06:42 | 156K | |
| fd-3.01j.pkg | 2023-10-10 05:22 | 558K | |
| fd-find-8.7.0_5.pkg | 2023-10-07 05:56 | 759K | |
| fdk-aac-2.0.2.pkg | 2023-10-06 22:10 | 709K | |
| fdm-2.2.pkg | 2023-10-08 22:12 | 143K | |
| fdm_materials-4.7.1,..> | 2023-10-07 11:37 | 21K | |
| fdmf-0.0.9.s_12.pkg | 2023-10-09 13:16 | 15K | |
| fdupes-2.2.1,1.pkg | 2023-10-08 13:12 | 35K | |
| feappv-4.1i_5.pkg | 2023-10-10 10:17 | 1.3M | |
| feathernotes-1.1.1.pkg | 2023-10-09 19:16 | 359K | |
| featherpad-1.4.1.pkg | 2023-10-07 19:56 | 714K | |
| feedbackd-0.1.0.pkg | 2023-10-08 01:31 | 1.1M | |
| feff10-10.0.0.16_1.pkg | 2023-10-14 11:08 | 1.9M | |
| feh-3.10.pkg | 2023-10-08 07:18 | 168K | |
| felis-1.0_1.pkg | 2023-10-08 12:09 | 4.1K | |
| fence-agents-4.12.1.pkg | 2023-10-14 11:58 | 271K | |
| fenics-basix-0.5.1_1..> | 2023-10-07 14:37 | 317K | |
| fennel-1.3.0.pkg | 2023-10-10 12:30 | 129K | |
| ferite-1.0.2_9.pkg | 2023-10-14 11:12 | 1.1M | |
| ferrite-core-2.02.pkg | 2023-10-08 17:35 | 37K | |
| festalon-0.5.5_15.pkg | 2023-10-14 14:26 | 81K | |
| festival-2.4_2.pkg | 2023-10-07 00:40 | 1.1M | |
| festival-freebsoft-u..> | 2023-10-09 12:40 | 40K | |
| festlex-cmu-1.95.pkg | 2023-10-08 03:04 | 1.3M | |
| festlex-czech-0.2.1.pkg | 2023-10-09 16:37 | 20K | |
| festlex-oald-1.4.1_1..> | 2023-10-08 04:52 | 1.1M | |
| festlex-poslex-1.4.1..> | 2023-10-08 10:50 | 180K | |
| festvox-cmu_us_awb_a..> | 2023-10-09 09:17 | 122M | |
| festvox-cmu_us_bdl_a..> | 2023-10-09 12:46 | 90M | |
| festvox-cmu_us_clb_a..> | 2023-10-09 20:03 | 124M | |
| festvox-cmu_us_jmk_a..> | 2023-10-14 09:29 | 88M | |
| festvox-cmu_us_ksp_a..> | 2023-10-09 07:18 | 113M | |
| festvox-cmu_us_rms_a..> | 2023-10-11 01:52 | 111M | |
| festvox-cmu_us_slt_a..> | 2023-10-10 21:22 | 113M | |
| festvox-don-1.4.0_2.pkg | 2023-10-08 19:42 | 591K | |
| festvox-el11-1.4.0_2..> | 2023-10-09 07:30 | 1.2M | |
| festvox-kal8-1.4.0_1..> | 2023-10-14 18:55 | 2.0M | |
| festvox-kal16-1.4.0.pkg | 2023-10-10 13:07 | 3.4M | |
| festvox-ked8-1.4.0_1..> | 2023-10-10 20:35 | 2.0M | |
| festvox-ked16-1.4.0_..> | 2023-10-10 11:54 | 3.6M | |
| festvox-rab8-1.4.1_2..> | 2023-10-09 09:49 | 2.6M | |
| festvox-rab16-1.4.1_..> | 2023-10-08 18:44 | 4.5M | |
| festvox-russian-0.5.pkg | 2023-10-10 09:11 | 170M | |
| fet-qt5-6.9.5.pkg | 2023-10-10 23:13 | 11M | |
| fet-qt6-6.9.5.pkg | 2023-10-10 11:38 | 10M | |
| fetchconfig-0.26.pkg | 2023-10-14 04:41 | 19K | |
| fetchlog-1.4.pkg | 2023-10-14 17:03 | 19K | |
| fetchmail-6.4.37.pkg | 2023-10-07 20:34 | 476K | |
| fetchmailconf-6.4.37..> | 2023-10-14 15:10 | 40K | |
| fex-2.0.0_1.pkg | 2023-10-10 13:22 | 9.7K | |
| ffdec-17.0.2.pkg | 2023-10-09 19:28 | 10M | |
| ffe-0.3.9_1.pkg | 2023-10-14 07:13 | 65K | |
| fff-2.2.pkg | 2023-10-10 05:39 | 12K | |
| fflas-ffpack-2.5.0.pkg | 2023-10-07 02:41 | 223K | |
| ffmpeg-6.0_2,1.pkg | 2023-10-06 07:28 | 9.9M | |
| ffmpeg4-4.4.4_3.pkg | 2023-10-06 13:51 | 9.4M | |
| ffmpegthumbnailer-2...> | 2023-10-06 19:30 | 71K | |
| ffms2-2.40_3.pkg | 2023-10-07 06:25 | 133K | |
| ffnvcodec-headers-12..> | 2023-10-05 16:48 | 62K | |
| ffproxy-1.6.pkg | 2023-10-14 14:51 | 29K | |
| ffs2recov-1.0_1.pkg | 2023-10-09 14:37 | 17K | |
| ffsend-0.2.74_19.pkg | 2023-10-09 19:34 | 1.9M | |
| fftw-2.1.5_23.pkg | 2023-10-06 20:09 | 379K | |
| fftw-float-2.1.5_23.pkg | 2023-10-08 06:58 | 186K | |
| fftw3-3.3.10_3.pkg | 2023-10-05 17:34 | 756K | |
| fftw3-float-3.3.10_3..> | 2023-10-05 17:34 | 679K | |
| fftw3-long-3.3.10_3.pkg | 2023-10-10 19:48 | 414K | |
| fftw3-quad-3.3.10_3.pkg | 2023-10-10 13:18 | 810K | |
| ffuf-2.0.0_6.pkg | 2023-10-14 14:01 | 2.4M | |
| fgallery-1.9.1_2.pkg | 2023-10-08 12:58 | 118K | |
| fheroes2-1.0.8.pkg | 2023-10-08 17:35 | 1.2M | |
| fhist-1.21_6.pkg | 2023-10-08 18:18 | 82K | |
| fhourstones-3.1_2.pkg | 2023-10-09 09:17 | 6.6K | |
| fi-aspell-0.7.0_1,2.pkg | 2023-10-08 22:44 | 592K | |
| fi-libreoffice-7.5.5..> | 2023-10-08 11:38 | 2.9M | |
| fiche-0.9.1_3.pkg | 2023-10-08 12:33 | 7.4K | |
| ficl-4.1.0_4.pkg | 2023-10-09 21:41 | 400K | |
| fidocadj-0.24.8.pkg | 2023-10-10 10:51 | 2.6M | |
| fidogate-5.12.pkg | 2023-10-09 23:22 | 685K | |
| fidogate4-4.4.10_1.pkg | 2023-10-09 02:51 | 1.2M | |
| fifechan-0.1.5_1.pkg | 2023-10-07 09:45 | 204K | |
| fifteen-20150410_1.pkg | 2023-10-14 15:43 | 18K | |
| fig2dev-3.2.8a.pkg | 2023-10-07 05:40 | 257K | |
| fig2sxd-0.23.pkg | 2023-10-11 11:27 | 49K | |
| fightorperish-0.5_2.pkg | 2023-10-08 15:32 | 78K | |
| figlet-2.2.5.pkg | 2023-10-08 02:54 | 117K | |
| figlet-fonts-2012120..> | 2023-10-14 03:56 | 2.8M | |
| figtree-1.4.4.14.pkg | 2023-10-10 00:32 | 3.1M | |
| fiked-0.0.5_8.pkg | 2023-10-09 11:43 | 23K | |
| filament-1.43.0.pkg | 2023-10-14 08:40 | 12M | |
| file-5.39.pkg | 2023-10-07 06:23 | 313K | |
| file-roller-3.42.0_2..> | 2023-10-07 18:46 | 645K | |
| file2pcap-1.29.pkg | 2023-10-11 15:51 | 23K | |
| filebench-1.5.a3.27.pkg | 2023-10-10 09:01 | 102K | |
| filebot-4.9.6_1.pkg | 2023-10-10 13:21 | 21M | |
| filedupe-1.1_4.pkg | 2023-10-08 15:30 | 6.3K | |
| filelight-23.08.1.pkg | 2023-10-07 05:41 | 723K | |
| filemon-0.0.1.pkg | 2023-10-14 03:27 | 4.2K | |
| fileobj-0.8.0.pkg | 2023-10-10 10:37 | 339K | |
| filepp-1.8.0.pkg | 2023-10-14 14:02 | 44K | |
| fileprune-1.12.pkg | 2023-10-14 09:50 | 12K | |
| filerunner-19.07.08...> | 2023-10-09 04:06 | 1.2M | |
| fileschanged-0.6.5_2..> | 2023-10-14 12:25 | 24K | |
| filetype-0.1.3.pkg | 2023-10-10 14:33 | 18K | |
| filevercmp-g20151117..> | 2023-10-14 16:12 | 5.3K | |
| filewatcherd-1.0,1.pkg | 2023-10-10 16:58 | 13K | |
| filezilla-3.55.1_1.pkg | 2023-10-10 20:21 | 3.7M | |
| fillets-ng-1.0.1_9.pkg | 2023-10-14 03:26 | 136M | |
| filmulator-0.11.1_3.pkg | 2023-10-08 17:08 | 497K | |
| filtermail-0.8.6.pkg | 2023-10-14 14:21 | 70K | |
| filters-2.55.pkg | 2023-10-09 12:43 | 115K | |
| filtron-g20180218_15..> | 2023-10-10 21:02 | 1.7M | |
| finch-2.14.12.pkg | 2023-10-14 17:21 | 99K | |
| find-cursor-1.8.pkg | 2023-10-14 18:05 | 72K | |
| findmaildirs-0.4.pkg | 2023-10-08 22:11 | 4.1K | |
| findmtu-0.9.pkg | 2023-10-09 02:10 | 6.4K | |
| findutils-4.9.0.pkg | 2023-10-06 18:32 | 446K | |
| fineftp-server-1.3.1..> | 2023-10-07 22:18 | 116K | |
| finfo-0.1.pkg | 2023-10-09 02:20 | 5.4K | |
| fio-3.35_1.pkg | 2023-10-08 07:24 | 5.9M | |
| fira-4.301_1.pkg | 2023-10-08 02:14 | 14M | |
| firacode-6.2.pkg | 2023-10-08 03:34 | 376K | |
| firago-1.001_1.pkg | 2023-10-14 06:21 | 9.7M | |
| fire-hpp-0.2.pkg | 2023-10-09 16:52 | 9.8K | |
| firebird30-client-3...> | 2023-10-06 18:00 | 5.0M | |
| firebird30-server-3...> | 2023-10-11 07:39 | 22M | |
| firebird40-client-4...> | 2023-10-07 21:10 | 6.9M | |
| firebird40-server-4...> | 2023-10-14 11:54 | 33M | |
| firedm-2022.2.5_1.pkg | 2023-10-09 02:48 | 260K | |
| firedns-0.9.12.pkg | 2023-10-14 02:41 | 77K | |
| fireflies-2.07_8.pkg | 2023-10-11 00:08 | 25K | |
| firefox-118.0_1,2.pkg | 2023-10-08 10:04 | 56M | |
| firefox-esr-115.3.0_..> | 2023-10-14 18:41 | 55M | |
| firestring-0.9.12.pkg | 2023-10-08 05:03 | 55K | |
| firmware-utils-20111..> | 2023-10-08 17:33 | 105K | |
| firstboot-cloudsetup..> | 2023-10-14 12:10 | 4.9K | |
| firstboot-freebsd-up..> | 2023-10-10 17:55 | 1.3K | |
| firstboot-pkgs-1.6.pkg | 2023-10-11 08:38 | 1.3K | |
| fish-3.6.1_1.pkg | 2023-10-08 16:40 | 2.8M | |
| fishsupper-0.1.6_21.pkg | 2023-10-14 03:18 | 949K | |
| fist-4.1.pkg | 2023-10-09 07:10 | 7.5K | |
| fistgen-0.2.1.pkg | 2023-10-10 18:18 | 284K | |
| five-or-more-3.32.3_..> | 2023-10-07 02:42 | 1.2M | |
| fix-mime-charset-0.5..> | 2023-10-09 14:06 | 38K | |
| fixc-1.2_14.pkg | 2023-10-09 22:40 | 1.2M | |
| fixrtf-0.1.20060303_..> | 2023-10-08 21:45 | 14K | |
| fizz-2023.09.18.00.pkg | 2023-10-06 19:08 | 510K | |
| fkiss-0.33a_6.pkg | 2023-10-10 13:35 | 102K | |
| fl0p-0.0.2.b.pkg | 2023-10-09 03:08 | 18K | |
| fl_moxgen-1.00_2.pkg | 2023-10-09 10:33 | 25K | |
| flac-1.4.3,1.pkg | 2023-10-05 16:44 | 617K | |
| flac123-2.1.1.pkg | 2023-10-09 19:54 | 9.6K | |
| flacon-11.1.0.pkg | 2023-10-10 07:00 | 1.4M | |
| flag-1.0.6.pkg | 2023-10-10 22:58 | 2.7K | |
| flam3-3.1.1.5_3.pkg | 2023-10-07 12:58 | 665K | |
| flamegraph-1.1.pkg | 2023-10-08 18:38 | 35K | |
| flameshot-12.1.0_1.pkg | 2023-10-08 22:05 | 590K | |
| flamethrower-0.11.0.pkg | 2023-10-09 06:36 | 165K | |
| flamp-2.2.09.pkg | 2023-10-08 15:34 | 301K | |
| flann-1.9.2_3.pkg | 2023-10-07 05:00 | 1.2M | |
| flare-engine-1.14_1.pkg | 2023-10-07 13:10 | 2.9M | |
| flare-game-1.14_1.pkg | 2023-10-14 03:18 | 117M | |
| flash-1.2.11.pkg | 2023-10-07 10:41 | 29K | |
| flasher-1.3.pkg | 2023-10-08 22:09 | 6.9K | |
| flashlight-machine-l..> | 2023-10-10 14:29 | 1.0M | |
| flashrom-1.3.0_1.pkg | 2023-10-08 15:03 | 399K | |
| flasm-1.62_1.pkg | 2023-10-08 17:18 | 49K | |
| flat-frog-2.2.13.pkg | 2023-10-08 14:56 | 43K | |
| flat-remix-gtk-theme..> | 2023-10-08 17:38 | 1.5M | |
| flat-remix-icon-them..> | 2023-10-09 11:48 | 46M | |
| flatbuffers-23.5.26,..> | 2023-10-06 17:31 | 1.0M | |
| flatbuffers205-2.0.5..> | 2023-10-08 06:07 | 900K | |
| flatcc-0.6.1.pkg | 2023-10-08 15:37 | 222K | |
| flatery-icon-themes-..> | 2023-10-14 19:01 | 22M | |
| flatzebra-0.1.7.pkg | 2023-10-07 21:16 | 29K | |
| flawfinder-2.0.19.pkg | 2023-10-14 11:11 | 186K | |
| flcluster-1.0.4_3.pkg | 2023-10-10 17:48 | 510K | |
| fldiff-1.1_11.pkg | 2023-10-10 09:58 | 65K | |
| fldigi-4.1.23_4.pkg | 2023-10-08 11:38 | 2.8M | |
| fleur-6.2.pkg | 2023-10-08 21:43 | 3.6M | |
| flex-2.6.4_2.pkg | 2023-10-06 12:46 | 282K | |
| flex-sdk-4.6.0.23201..> | 2023-10-08 19:05 | 51M | |
| flex-sdk3-3.5.0.1268..> | 2023-10-08 12:39 | 20M | |
| flexbackup-1.2.1_7.pkg | 2023-10-08 14:29 | 63K | |
| flexdock-1.2.4.pkg | 2023-10-07 03:51 | 1.2M | |
| flexfloat-g20220606_..> | 2023-10-09 14:33 | 11K | |
| flexjson-2.1.pkg | 2023-10-11 00:40 | 123K | |
| flickcurl-1.26_3.pkg | 2023-10-08 04:51 | 767K | |
| flif-0.4.pkg | 2023-10-14 06:27 | 683K | |
| flightgear-2020.3.18..> | 2023-10-14 07:31 | 5.0M | |
| flightgear-aircraft-..> | 2023-10-10 04:47 | 425M | |
| flightgear-data-2020..> | 2023-10-08 06:20 | 1.7G | |
| flightgear-mb339-pan..> | 2023-10-14 17:18 | 1.9M | |
| flim-1.14.9.20230205..> | 2023-10-06 19:48 | 134K | |
| flim-emacs_canna-1.1..> | 2023-10-06 22:44 | 135K | |
| flim-emacs_devel-1.1..> | 2023-10-06 19:13 | 134K | |
| flim-emacs_devel_nox..> | 2023-10-06 18:56 | 134K | |
| flim-emacs_nox-1.14...> | 2023-10-06 20:13 | 135K | |
| flint2-2.9.0_1.pkg | 2023-10-06 10:39 | 3.2M | |
| flip-1.19.pkg | 2023-10-09 13:39 | 8.5K | |
| flite-2.1.pkg | 2023-10-05 17:10 | 14M | |
| fllog-1.2.6.pkg | 2023-10-09 17:45 | 196K | |
| flmsg-4.0.23.pkg | 2023-10-14 12:11 | 624K | |
| flobopuyo-0.20_16.pkg | 2023-10-10 19:54 | 1.7M | |
| flock-2.37.2.pkg | 2023-10-05 16:46 | 15K | |
| flog-1.8.pkg | 2023-10-09 23:08 | 5.9K | |
| flops-2.2.pkg | 2023-10-11 00:38 | 8.6K | |
| florence-0.6.3_5.pkg | 2023-10-14 09:38 | 180K | |
| flow-tools-0.68.6_4.pkg | 2023-10-07 07:54 | 550K | |
| flowd-0.9.1_4.pkg | 2023-10-10 05:38 | 92K | |
| flower-0.10_5.pkg | 2023-10-07 16:23 | 107K | |
| flowgger-0.3.1_2.pkg | 2023-10-08 19:05 | 744K | |
| flowgrind-0.8.2_2.pkg | 2023-10-09 01:38 | 57K | |
| flowviewer-4.5_4.pkg | 2023-10-08 13:02 | 145K | |
| flphoto-1.3.1_15.pkg | 2023-10-10 05:08 | 500K | |
| flpsed-0.7.3.pkg | 2023-10-09 02:12 | 38K | |
| flrig-1.3.54_2.pkg | 2023-10-10 10:18 | 774K | |
| flruler-1.05.pkg | 2023-10-10 17:24 | 150K | |
| fltk-1.3.8_1.pkg | 2023-10-06 11:06 | 1.2M | |
| fluctuate-1.40.pkg | 2023-10-09 11:13 | 65K | |
| fluent-bit-2.1.9.pkg | 2023-10-14 12:12 | 2.9M | |
| fluid-soundfont-3.1.pkg | 2023-10-07 06:28 | 116M | |
| fluida-lv2-0.8_1.pkg | 2023-10-09 17:11 | 290K | |
| fluidsynth-2.3.3_1.pkg | 2023-10-06 16:18 | 206K | |
| fluidsynth-dssi-1.0...> | 2023-10-08 13:37 | 27K | |
| fluxbox-1.3.7_5.pkg | 2023-10-06 21:48 | 721K | |
| fluxbox-tenr-styles-..> | 2023-10-07 03:12 | 5.2M | |
| fluxengine-572_1.pkg | 2023-10-14 15:03 | 258K | |
| fluxter-0.2.0_3.pkg | 2023-10-10 23:34 | 37K | |
| flvmeta-1.2.2.202108..> | 2023-10-10 07:57 | 37K | |
| flvstreamer-2.1.c.1_..> | 2023-10-10 00:31 | 46K | |
| flvtool++-1.2.1_16.pkg | 2023-10-11 00:43 | 24K | |
| flwm-1.16_1.pkg | 2023-10-09 16:15 | 31K | |
| flwrap-1.3.6.pkg | 2023-10-10 22:57 | 48K | |
| fly-2.0.1_7.pkg | 2023-10-14 18:06 | 44K | |
| flyhard-0.42_21.pkg | 2023-10-14 05:27 | 324K | |
| flying-6.20_3.pkg | 2023-10-14 05:57 | 72K | |
| flyspray-0.9.9.7_5.pkg | 2023-10-08 12:45 | 959K | |
| fmake-r250982.pkg | 2023-10-09 06:58 | 295K | |
| fmars-0.0.207_4.pkg | 2023-10-10 18:59 | 77K | |
| fmirror-0.8.4_4.pkg | 2023-10-10 12:24 | 39K | |
| fmit-1.2.14_3.pkg | 2023-10-09 23:43 | 199K | |
| fmsx-6.0_1.pkg | 2023-10-09 21:46 | 357K | |
| fmtlatex-g20130930.pkg | 2023-10-09 21:04 | 6.5K | |
| fnc-0.15.pkg | 2023-10-14 13:50 | 1.0M | |
| fnm-1.35.1_1.pkg | 2023-10-09 14:35 | 1.6M | |
| fnord-1.11.pkg | 2023-10-10 15:21 | 14K | |
| fnott-1.4.1.pkg | 2023-10-10 07:10 | 83K | |
| fnt-1.4.1_1.pkg | 2023-10-10 20:39 | 3.8K | |
| fntsample-5.4_1.pkg | 2023-10-10 02:04 | 17K | |
| fo-aspell-0.2.16.1_1..> | 2023-10-10 22:34 | 1.0M | |
| focuswriter-1.8.5_1.pkg | 2023-10-08 18:44 | 6.0M | |
| fogpad-lv2-1.0.0.3_2..> | 2023-10-14 16:49 | 118K | |
| foiltex-2.1.4b_7.pkg | 2023-10-14 14:48 | 113K | |
| foliate-2.6.4_1.pkg | 2023-10-10 09:11 | 892K | |
| folks-0.15.5_1.pkg | 2023-10-06 21:40 | 536K | |
| folly-2023.09.18.00.pkg | 2023-10-06 17:58 | 2.4M | |
| fomp-lv2-1.2.4.pkg | 2023-10-12 09:23 | 31K | |
| fondu-051010.pkg | 2023-10-14 18:40 | 67K | |
| font-adobe-75dpi-1.0..> | 2023-10-06 21:42 | 5.2M | |
| font-adobe-100dpi-1...> | 2023-10-06 21:19 | 5.9M | |
| font-adobe-utopia-75..> | 2023-10-06 22:53 | 1.2M | |
| font-adobe-utopia-10..> | 2023-10-06 19:39 | 1.4M | |
| font-adobe-utopia-ty..> | 2023-10-06 22:45 | 167K | |
| font-alias-1.0.4.pkg | 2023-10-06 16:00 | 2.5K | |
| font-amsfonts-3.02_4..> | 2023-10-09 06:44 | 4.9M | |
| font-arabic-misc-1.0..> | 2023-10-06 14:38 | 14K | |
| font-awesome-6.2.1.pkg | 2023-10-08 04:47 | 495K | |
| font-bh-75dpi-1.0.3_..> | 2023-10-06 22:44 | 3.1M | |
| font-bh-100dpi-1.0.3..> | 2023-10-06 21:46 | 3.6M | |
| font-bh-lucidatypewr..> | 2023-10-06 22:32 | 733K | |
| font-bh-lucidatypewr..> | 2023-10-06 20:04 | 836K | |
| font-bh-ttf-1.0.3_5.pkg | 2023-10-05 17:40 | 268K | |
| font-bh-type1-1.0.3_..> | 2023-10-06 22:51 | 523K | |
| font-bitstream-75dpi..> | 2023-10-06 18:35 | 139K | |
| font-bitstream-100dp..> | 2023-10-06 19:10 | 158K | |
| font-bitstream-type1..> | 2023-10-06 23:09 | 294K | |
| font-cronyx-cyrillic..> | 2023-10-06 18:52 | 298K | |
| font-cursor-misc-1.0..> | 2023-10-06 13:44 | 5.9K | |
| font-daewoo-misc-1.0..> | 2023-10-06 15:13 | 645K | |
| font-dec-misc-1.0.3_..> | 2023-10-06 14:21 | 4.1K | |
| font-gost-0.2_4.pkg | 2023-10-08 23:59 | 162K | |
| font-ibm-type1-1.0.3..> | 2023-10-06 20:34 | 274K | |
| font-isas-misc-1.0.3..> | 2023-10-06 14:13 | 781K | |
| font-jis-misc-1.0.3_..> | 2023-10-06 13:56 | 527K | |
| font-manager-0.8.8_4..> | 2023-10-09 18:23 | 1.9M | |
| font-micro-misc-1.0...> | 2023-10-06 15:14 | 2.4K | |
| font-misc-cyrillic-1..> | 2023-10-06 22:23 | 65K | |
| font-misc-ethiopic-1..> | 2023-10-05 17:40 | 126K | |
| font-misc-meltho-1.0..> | 2023-10-05 17:40 | 718K | |
| font-misc-misc-1.1.2..> | 2023-10-06 14:14 | 3.3M | |
| font-mutt-misc-1.0.3..> | 2023-10-06 13:41 | 204K | |
| font-schumacher-misc..> | 2023-10-06 15:17 | 152K | |
| font-screen-cyrillic..> | 2023-10-06 20:39 | 9.8K | |
| font-sony-misc-1.0.3..> | 2023-10-06 15:01 | 20K | |
| font-sun-misc-1.0.3_..> | 2023-10-06 13:40 | 26K | |
| font-tex-gyre-bonum-..> | 2023-10-09 22:29 | 257K | |
| font-tex-gyre-pagell..> | 2023-10-09 02:28 | 274K | |
| font-tex-gyre-schola..> | 2023-10-09 13:06 | 295K | |
| font-tex-gyre-termes..> | 2023-10-11 05:44 | 260K | |
| font-util-1.3.2.pkg | 2023-10-05 16:42 | 28K | |
| font-winitzki-cyrill..> | 2023-10-06 22:11 | 5.5K | |
| font-xfree86-type1-1..> | 2023-10-06 20:33 | 28K | |
| font2svg-1.0_6.pkg | 2023-10-09 06:16 | 4.7K | |
| fontconfig-2.14.2,1.pkg | 2023-10-05 17:39 | 470K | |
| fonteditfs-1.2.pkg | 2023-10-14 07:16 | 9.0K | |
| fontforge-20220308_3..> | 2023-10-06 20:23 | 8.9M | |
| fontmatrix-0.9.100_1..> | 2023-10-09 19:22 | 1.5M | |
| fontobene-0.2.0.pkg | 2023-10-09 10:29 | 4.4K | |
| fontpreview-1.0.6_3.pkg | 2023-10-14 02:07 | 5.9M | |
| fonts-indic-2.1.5_4.pkg | 2023-10-10 00:18 | 274K | |
| fonttosfnt-1.2.2.pkg | 2023-10-10 00:28 | 21K | |
| foo-yc20-1.3.0_4.pkg | 2023-10-10 05:34 | 303K | |
| foo2zjs-20161203_1.pkg | 2023-10-09 12:26 | 1.1M | |
| foobillard-3.0a_12.pkg | 2023-10-14 05:10 | 1.0M | |
| foomatic-db-20230902..> | 2023-10-07 21:08 | 60M | |
| foomatic-db-engine-4..> | 2023-10-10 19:21 | 146K | |
| foomatic-db-hpijs-1...> | 2023-10-10 01:27 | 41K | |
| foomatic-filters-4.0..> | 2023-10-10 05:31 | 54K | |
| foot-1.15.3_1.pkg | 2023-10-07 20:10 | 250K | |
| fop-2.8.pkg | 2023-10-07 06:43 | 25M | |
| foreman-proxy-3.4.0.pkg | 2023-10-07 08:21 | 118K | |
| foremost-1.5.7.pkg | 2023-10-11 17:51 | 33K | |
| forge-0.3.2_1.pkg | 2023-10-09 12:39 | 106K | |
| forge-devel-0.3.2.12..> | 2023-10-09 14:05 | 112K | |
| forge-devel-emacs_ca..> | 2023-10-09 12:19 | 112K | |
| forge-devel-emacs_de..> | 2023-10-14 13:39 | 112K | |
| forge-devel-emacs_de..> | 2023-10-08 12:04 | 112K | |
| forge-devel-emacs_no..> | 2023-10-10 17:10 | 112K | |
| forge-emacs_canna-0...> | 2023-10-12 01:13 | 106K | |
| forge-emacs_devel-0...> | 2023-10-14 06:45 | 106K | |
| forge-emacs_devel_no..> | 2023-10-08 17:18 | 106K | |
| forge-emacs_nox-0.3...> | 2023-10-09 22:51 | 106K | |
| forkbomb-1.4_1.pkg | 2023-10-08 23:29 | 6.3K | |
| form-4.3.1.pkg | 2023-10-09 00:36 | 1.2M | |
| formication-1.0.b1_3..> | 2023-10-10 09:15 | 12K | |
| formido-1.0.1_2.pkg | 2023-10-11 15:51 | 8.4M | |
| fort-1.5.4.pkg | 2023-10-09 21:26 | 187K | |
| fortran-utils-1.1.pkg | 2023-10-10 01:39 | 12K | |
| fortunate-3.1_11.pkg | 2023-10-07 10:22 | 16K | |
| fortune-mod-bible-1...> | 2023-10-09 02:18 | 1.0M | |
| fortune-mod-bofh-2.0..> | 2023-10-14 17:58 | 11K | |
| fortune-mod-epictetu..> | 2023-10-08 21:32 | 13K | |
| fortune-mod-freebsd-..> | 2023-10-09 14:35 | 1.0M | |
| fortune-mod-futurama..> | 2023-10-10 22:55 | 18K | |
| fortune-mod-psalms-1..> | 2023-10-09 14:06 | 87K | |
| fortuneit-1.99.pkg | 2023-10-08 19:02 | 592K | |
| fortunelock-0.1.2.pkg | 2023-10-08 15:10 | 4.8K | |
| fortytwo-0.2.0_13.pkg | 2023-10-08 09:10 | 101K | |
| fortytwo-bdb-0.2.1_1..> | 2023-10-07 02:57 | 38K | |
| fortytwo-encore-0.3...> | 2023-10-06 20:13 | 106K | |
| fossil-2.22,2.pkg | 2023-10-08 10:15 | 1.8M | |
| fossmixer-0.0.3_4.pkg | 2023-10-14 10:10 | 20M | |
| fossology-nomos-stan..> | 2023-10-10 14:38 | 136K | |
| foswiki-2.1.8.pkg | 2023-10-09 00:02 | 11M | |
| fotaq-1.1_2.pkg | 2023-10-09 14:18 | 30M | |
| fotoxx-23.60.pkg | 2023-10-09 17:34 | 8.3M | |
| founts-13_2.pkg | 2023-10-11 02:03 | 37K | |
| four-in-a-row-3.38.1..> | 2023-10-07 04:57 | 508K | |
| fowsr-2.0_1.pkg | 2023-10-09 22:37 | 10K | |
| fox-xml-4.1.2.91_5.pkg | 2023-10-07 03:09 | 862K | |
| fox16-1.6.57_2.pkg | 2023-10-08 09:40 | 3.4M | |
| fox17-1.7.84.pkg | 2023-10-07 13:28 | 4.8M | |
| foxtrotgps-1.2.2_5.pkg | 2023-10-10 09:31 | 927K | |
| fp16-g20200514.pkg | 2023-10-10 14:24 | 5.4K | |
| fparser-4.5.2.pkg | 2023-10-06 21:18 | 126K | |
| fpart-1.5.1_1.pkg | 2023-10-10 23:27 | 43K | |
| fpc-3.2.2_4.pkg | 2023-10-06 09:02 | 3.7M | |
| fpc-a52-3.2.2_4.pkg | 2023-10-08 07:16 | 5.7K | |
| fpc-aspell-3.2.2_4.pkg | 2023-10-07 19:08 | 35K | |
| fpc-base-3.2.2.pkg | 2023-10-10 14:43 | 660 | |
| fpc-bfd-3.2.2_4.pkg | 2023-10-07 10:39 | 38K | |
| fpc-bzip2-3.2.2_4.pkg | 2023-10-08 01:43 | 20K | |
| fpc-cairo-3.2.2_4.pkg | 2023-10-06 21:27 | 52K | |
| fpc-chm-3.2.2_4.pkg | 2023-10-06 21:26 | 1.0M | |
| fpc-dblib-3.2.2_4.pkg | 2023-10-06 12:39 | 13K | |
| fpc-dbus-3.2.2_4.pkg | 2023-10-08 03:40 | 79K | |
| fpc-docs-3.2.2.pkg | 2023-10-07 11:02 | 9.3M | |
| fpc-dts-3.2.2_4.pkg | 2023-10-08 06:16 | 6.6K | |
| fpc-fastcgi-3.2.2_4.pkg | 2023-10-06 15:06 | 4.1K | |
| fpc-fcl-async-3.2.2_..> | 2023-10-06 12:11 | 23K | |
| fpc-fcl-base-3.2.2_4..> | 2023-10-06 09:39 | 507K | |
| fpc-fcl-db-3.2.2_4.pkg | 2023-10-06 14:48 | 1.6M | |
| fpc-fcl-extra-3.2.2_..> | 2023-10-07 10:30 | 58K | |
| fpc-fcl-fpcunit-3.2...> | 2023-10-06 14:06 | 130K | |
| fpc-fcl-image-3.2.2_..> | 2023-10-06 15:42 | 427K | |
| fpc-fcl-js-3.2.2_4.pkg | 2023-10-06 17:34 | 160K | |
| fpc-fcl-json-3.2.2_4..> | 2023-10-06 12:17 | 173K | |
| fpc-fcl-net-3.2.2_4.pkg | 2023-10-06 13:00 | 93K | |
| fpc-fcl-passrc-3.2.2..> | 2023-10-06 11:00 | 735K | |
| fpc-fcl-pdf-3.2.2_4.pkg | 2023-10-07 07:33 | 190K | |
| fpc-fcl-registry-3.2..> | 2023-10-07 05:09 | 46K | |
| fpc-fcl-report-3.2.2..> | 2023-10-07 12:41 | 469K | |
| fpc-fcl-res-3.2.2_4.pkg | 2023-10-06 10:37 | 249K | |
| fpc-fcl-sdo-3.2.2_4.pkg | 2023-10-07 17:17 | 693K | |
| fpc-fcl-sound-3.2.2_..> | 2023-10-08 09:21 | 12K | |
| fpc-fcl-stl-3.2.2_4.pkg | 2023-10-07 23:22 | 61K | |
| fpc-fcl-web-3.2.2_4.pkg | 2023-10-06 18:14 | 934K | |
| fpc-fcl-xml-3.2.2_4.pkg | 2023-10-06 12:08 | 514K | |
| fpc-fftw-3.2.2_4.pkg | 2023-10-08 04:57 | 4.7K | |
| fpc-fpindexer-3.2.2_..> | 2023-10-07 14:30 | 124K | |
| fpc-fppkg-3.2.2_4.pkg | 2023-10-06 22:19 | 252K | |
| fpc-fv-3.2.2_4.pkg | 2023-10-07 21:03 | 314K | |
| fpc-gdbint-3.2.2_4.pkg | 2023-10-08 11:54 | 38K | |
| fpc-gdbm-3.2.2_4.pkg | 2023-10-07 17:46 | 6.3K | |
| fpc-gmp-3.2.2_4.pkg | 2023-10-08 09:11 | 76K | |
| fpc-gnutls-3.2.2_4.pkg | 2023-10-07 10:29 | 93K | |
| fpc-googleapi-3.2.2_..> | 2023-10-08 08:56 | 7.0M | |
| fpc-graph-3.2.2_4.pkg | 2023-10-08 11:05 | 60K | |
| fpc-gtk2-3.2.2_4.pkg | 2023-10-07 10:01 | 920K | |
| fpc-hermes-3.2.2_4.pkg | 2023-10-08 03:50 | 27K | |
| fpc-httpd22-3.2.2_4.pkg | 2023-10-06 15:21 | 129K | |
| fpc-httpd24-3.2.2_4.pkg | 2023-10-06 14:04 | 107K | |
| fpc-ibase-3.2.2_4.pkg | 2023-10-06 12:50 | 93K | |
| fpc-iconvenc-3.2.2_4..> | 2023-10-06 10:25 | 6.5K | |
| fpc-ide-3.2.2_4.pkg | 2023-10-09 10:41 | 1.6M | |
| fpc-imagemagick-3.2...> | 2023-10-08 02:28 | 61K | |
| fpc-ldap-3.2.2_4.pkg | 2023-10-08 06:00 | 35K | |
| fpc-libcups-3.2.2_4.pkg | 2023-10-07 10:31 | 41K | |
| fpc-libcurl-3.2.2_4.pkg | 2023-10-06 21:02 | 41K | |
| fpc-libenet-3.2.2_4.pkg | 2023-10-08 08:03 | 31K | |
| fpc-libfontconfig-3...> | 2023-10-08 04:10 | 30K | |
| fpc-libgd-3.2.2_4.pkg | 2023-10-08 08:22 | 23K | |
| fpc-libmagic-3.2.2_4..> | 2023-10-08 09:28 | 4.8K | |
| fpc-libmicrohttpd-3...> | 2023-10-06 14:32 | 15K | |
| fpc-libpng-3.2.2_4.pkg | 2023-10-08 07:17 | 26K | |
| fpc-libvlc-3.2.2_4.pkg | 2023-10-07 17:13 | 72K | |
| fpc-libxml2-3.2.2_4.pkg | 2023-10-07 17:56 | 232K | |
| fpc-lua-3.2.2_4.pkg | 2023-10-08 09:17 | 21K | |
| fpc-mad-3.2.2_4.pkg | 2023-10-07 15:58 | 13K | |
| fpc-modplug-3.2.2_4.pkg | 2023-10-08 10:09 | 3.4K | |
| fpc-mysql-3.2.2_4.pkg | 2023-10-06 13:09 | 288K | |
| fpc-ncurses-3.2.2_4.pkg | 2023-10-07 22:42 | 153K | |
| fpc-newt-3.2.2_4.pkg | 2023-10-07 21:31 | 16K | |
| fpc-numlib-3.2.2_4.pkg | 2023-10-07 07:10 | 155K | |
| fpc-odata-3.2.2_4.pkg | 2023-10-07 14:56 | 1.8M | |
| fpc-odbc-3.2.2_4.pkg | 2023-10-06 12:18 | 35K | |
| fpc-oggvorbis-3.2.2_..> | 2023-10-07 15:27 | 17K | |
| fpc-openal-3.2.2_4.pkg | 2023-10-08 06:23 | 11K | |
| fpc-opengl-3.2.2_4.pkg | 2023-10-07 07:13 | 201K | |
| fpc-openssl-3.2.2_4.pkg | 2023-10-06 14:24 | 105K | |
| fpc-oracle-3.2.2_4.pkg | 2023-10-06 13:22 | 206K | |
| fpc-pasjpeg-3.2.2_4.pkg | 2023-10-06 14:22 | 148K | |
| fpc-pastojs-3.2.2_4.pkg | 2023-10-06 22:38 | 618K | |
| fpc-pcap-3.2.2_4.pkg | 2023-10-07 20:13 | 8.5K | |
| fpc-postgres-3.2.2_4..> | 2023-10-06 13:32 | 46K | |
| fpc-proj4-3.2.2_7.pkg | 2023-10-08 09:42 | 4.6K | |
| fpc-pthreads-3.2.2_4..> | 2023-10-06 18:43 | 9.7K | |
| fpc-pxlib-3.2.2_4.pkg | 2023-10-06 13:04 | 18K | |
| fpc-regexpr-3.2.2_4.pkg | 2023-10-07 08:17 | 75K | |
| fpc-rexx-3.2.2_4.pkg | 2023-10-08 07:14 | 9.7K | |
| fpc-rsvg-3.2.2_3.pkg | 2023-10-08 10:29 | 4.3K | |
| fpc-rtl-console-3.2...> | 2023-10-07 09:42 | 49K | |
| fpc-rtl-extra-3.2.2_..> | 2023-10-06 11:26 | 128K | |
| fpc-rtl-generics-3.2..> | 2023-10-06 17:30 | 4.0M | |
| fpc-rtl-objpas-3.2.2..> | 2023-10-06 09:28 | 327K | |
| fpc-rtl-unicode-3.2...> | 2023-10-08 01:37 | 496K | |
| fpc-sdl-3.2.2_4.pkg | 2023-10-07 04:50 | 89K | |
| fpc-source-3.2.2_2.pkg | 2023-10-07 05:15 | 30M | |
| fpc-sqlite-3.2.2_4.pkg | 2023-10-06 12:54 | 98K | |
| fpc-svgalib-3.2.2_4.pkg | 2023-10-07 16:30 | 15K | |
| fpc-symbolic-3.2.2_4..> | 2023-10-07 19:54 | 46K | |
| fpc-syslog-3.2.2_4.pkg | 2023-10-08 05:55 | 3.8K | |
| fpc-tplylib-3.2.2_4.pkg | 2023-10-06 09:47 | 6.8K | |
| fpc-units-3.2.2.pkg | 2023-10-10 16:54 | 1.8K | |
| fpc-unzip-3.2.2_4.pkg | 2023-10-07 22:21 | 24K | |
| fpc-users-3.2.2_4.pkg | 2023-10-08 00:46 | 13K | |
| fpc-utils-3.2.2_4.pkg | 2023-10-06 23:49 | 4.3M | |
| fpc-utmp-3.2.2_4.pkg | 2023-10-07 12:49 | 7.1K | |
| fpc-uuid-3.2.2_4.pkg | 2023-10-08 00:04 | 6.5K | |
| fpc-vcl-compat-3.2.2..> | 2023-10-07 12:18 | 14K | |
| fpc-webidl-3.2.2_4.pkg | 2023-10-06 22:23 | 99K | |
| fpc-x11-3.2.2_4.pkg | 2023-10-06 16:17 | 277K | |
| fpc-xforms-3.2.2_4.pkg | 2023-10-08 07:45 | 214K | |
| fpc-zlib-3.2.2_4.pkg | 2023-10-07 00:35 | 10K | |
| fpdf-1.81,1.pkg | 2023-10-09 10:28 | 111K | |
| fpdns-20190131.pkg | 2023-10-10 13:17 | 13K | |
| fping-5.0_2.pkg | 2023-10-07 15:28 | 25K | |
| fplll-5.4.4_1.pkg | 2023-10-07 06:46 | 4.9M | |
| fpp-1.1_1.pkg | 2023-10-10 21:08 | 51K | |
| fprint_demo-20080303..> | 2023-10-11 05:10 | 58K | |
| fprintd-0.8.1.pkg | 2023-10-09 13:29 | 57K | |
| fprobe-1.1_1.pkg | 2023-10-09 16:17 | 20K | |
| fq-0.7.0_2.pkg | 2023-10-08 13:01 | 2.8M | |
| fr-aspell-0.50.3_1,1..> | 2023-10-14 16:50 | 4.2M | |
| fr-fortune-mod-zarat..> | 2023-10-08 12:42 | 9.0K | |
| fr-geonext-1.74.pkg | 2023-10-10 23:16 | 1.4K | |
| fr-hunspell-6.4.1.pkg | 2023-10-09 05:58 | 335K | |
| fr-hyphen-3.0.pkg | 2023-10-09 21:19 | 8.1K | |
| fr-jdictionary-fre-h..> | 2023-10-08 20:50 | 297K | |
| fr-libreoffice-7.5.5..> | 2023-10-08 11:57 | 3.1M | |
| fr-med-4.0.0_3.pkg | 2023-10-06 15:26 | 13M | |
| fr-mythes-2.3.pkg | 2023-10-09 02:52 | 950K | |
| fr-verbiste-0.1.48.pkg | 2023-10-09 21:34 | 125K | |
| fr-wordpress-fr_FR-6..> | 2023-10-10 21:01 | 15M | |
| fracplanet-0.5.1_16.pkg | 2023-10-08 12:41 | 160K | |
| fractal-4.4.2_3.pkg | 2023-10-10 15:49 | 2.0M | |
| fractgen-2.1.11.pkg | 2023-10-10 09:14 | 217K | |
| fragroute-1.2_16.pkg | 2023-10-09 04:36 | 26K | |
| fragrouter-1.6_1.pkg | 2023-10-14 11:16 | 20K | |
| frand-0.1_6.pkg | 2023-10-10 19:05 | 8.9K | |
| fraqtive-0.4.8.1.pkg | 2023-10-10 05:53 | 211K | |
| frawk-0.4.7.pkg | 2023-10-14 12:59 | 9.1M | |
| freac-1.1.7.pkg | 2023-10-11 14:13 | 3.1M | |
| frece-1.0.6_7.pkg | 2023-10-10 12:14 | 344K | |
| free-sa-devel-2.0.0b..> | 2023-10-14 18:25 | 101K | |
| free42-3.0.21.pkg | 2023-10-08 13:47 | 2.0M | |
| freealut-1.1.0_4.pkg | 2023-10-06 23:18 | 22K | |
| freebayes-1.3.6_2.pkg | 2023-10-07 13:11 | 959K | |
| freebee-2.0.pkg | 2023-10-09 09:29 | 11K | |
| freeblocks-0.5.pkg | 2023-10-12 12:10 | 6.3M | |
| freebsd-8k-wallpaper..> | 2023-10-11 00:41 | 29M | |
| freebsd-8k-wallpaper..> | 2023-10-10 05:14 | 32M | |
| freebsd-13-mixer-13...> | 2023-10-14 03:25 | 7.3K | |
| freebsd-bugzilla-cli..> | 2023-10-09 23:02 | 15K | |
| freebsd-ftpd-2022100..> | 2023-10-10 04:40 | 49K | |
| freebsd-git-devtools..> | 2023-10-14 07:27 | 10K | |
| freebsd-release-mani..> | 2023-10-06 22:33 | 8.6K | |
| freebsd-snapshot-200..> | 2023-10-08 22:40 | 11K | |
| freebsd-telnetd-14.0..> | 2023-10-08 15:31 | 45K | |
| freebsd-update-notif..> | 2023-10-10 09:30 | 3.9K | |
| freebsd-uucp-1.07.4_..> | 2023-10-07 07:46 | 363K | |
| freecell-solver-6.2...> | 2023-10-06 23:11 | 212K | |
| freeciv-3.0.8.pkg | 2023-10-10 20:08 | 20M | |
| freeciv-nox11-3.0.8.pkg | 2023-10-10 01:58 | 7.4M | |
| freecol-0.11.6.pkg | 2023-10-09 18:08 | 34M | |
| freecolor-0.9.3.pkg | 2023-10-10 13:16 | 5.6K | |
| freedesktop-sound-th..> | 2023-10-06 20:42 | 365K | |
| freediameter-1.5.0.pkg | 2023-10-14 16:03 | 364K | |
| freedink-108.4.pkg | 2023-10-10 04:28 | 1.0K | |
| freedink-data-1.08.2..> | 2023-10-07 11:52 | 27M | |
| freedink-dfarc-3.14_..> | 2023-10-07 15:52 | 135K | |
| freedink-engine-108...> | 2023-10-08 06:46 | 358K | |
| freedoko-0.7.19_4.pkg | 2023-10-10 22:24 | 21M | |
| freedroid-1.0.2_20.pkg | 2023-10-09 08:34 | 4.1M | |
| freedroidrpg-1.0_1.pkg | 2023-10-09 16:29 | 218M | |
| freedt-23.pkg | 2023-10-12 00:03 | 30K | |
| freedv-1.7.0_1.pkg | 2023-10-10 03:04 | 7.6M | |
| freefem++-4.13_1.pkg | 2023-10-09 09:55 | 9.0M | |
| freefont-ttf-2012050..> | 2023-10-07 05:10 | 4.0M | |
| freefonts-0.10_10.pkg | 2023-10-10 04:23 | 2.2M | |
| freeglut-3.2.1.pkg | 2023-10-06 12:20 | 237K | |
| freeguide-0.11.1.pkg | 2023-10-09 00:05 | 1.7M | |
| freehdl-0.0.7_10.pkg | 2023-10-08 10:27 | 1.4M | |
| freeimage-3.18.0_5.pkg | 2023-10-05 17:07 | 6.0M | |
| freeipmi-1.6.11.pkg | 2023-10-07 11:30 | 2.5M | |
| freemind-1.0.1_1,1.pkg | 2023-10-10 15:27 | 26M | |
| freeminer-0.4.10.4_1..> | 2023-10-08 05:13 | 3.9M | |
| freeminer-default-0...> | 2023-10-09 12:32 | 617K | |
| freeorion-0.5_1.pkg | 2023-10-10 04:36 | 149M | |
| freepats-20060219.pkg | 2023-10-07 02:08 | 24M | |
| freeplane-1.11.6.pkg | 2023-10-10 01:11 | 49M | |
| freeradius-client-1...> | 2023-10-09 03:27 | 58K | |
| freeradius3-3.2.3.pkg | 2023-10-14 14:58 | 2.0M | |
| freeradius3-ldap-3.2..> | 2023-10-11 03:35 | 2.0M | |
| freeradius3-mysql-3...> | 2023-10-14 13:25 | 2.0M | |
| freeradius3-pgsql-3...> | 2023-10-11 05:02 | 2.0M | |
| freeradius3-sqlite3-..> | 2023-10-09 13:17 | 2.0M | |
| freerdp-2.11.1.pkg | 2023-10-06 22:15 | 1.3M | |
| freesbie-2.0.2007071..> | 2023-10-14 18:20 | 32K | |
| freesweep-1.0.2.pkg | 2023-10-08 21:52 | 32K | |
| freeswitch-1.10.9_3.pkg | 2023-10-08 04:15 | 83M | |
| freesynd-0.7.5.pkg | 2023-10-09 13:48 | 2.3M | |
| freetalk-4.2_1.pkg | 2023-10-09 12:10 | 58K | |
| freetds-1.3.20,1.pkg | 2023-10-07 04:36 | 1.2M | |
| freetds-devel-1.3.16..> | 2023-10-10 09:41 | 1.2M | |
| freetype-gl-g2021020..> | 2023-10-10 03:07 | 34K | |
| freetype2-2.13.1.pkg | 2023-10-05 17:38 | 1.0M | |
| freevrrpd-1.2.pkg | 2023-10-09 14:29 | 240K | |
| freexl-2.0.0.pkg | 2023-10-06 09:45 | 41K | |
| frei0r-2.3.1.pkg | 2023-10-05 17:47 | 408K | |
| frei0r-plugins-2.3.1..> | 2023-10-06 22:49 | 888 | |
| frei0r-plugins-cairo..> | 2023-10-06 17:18 | 9.8K | |
| frei0r-plugins-gavl-..> | 2023-10-06 17:39 | 38K | |
| frei0r-plugins-openc..> | 2023-10-06 18:07 | 18K | |
| fretsonfire-1.3.110_..> | 2023-10-11 18:53 | 117K | |
| fretsonfire-data-1.3..> | 2023-10-08 04:43 | 28M | |
| fribidi-1.0.13.pkg | 2023-10-05 17:26 | 71K | |
| fricas-1.3.9_1.pkg | 2023-10-08 05:18 | 22M | |
| frikqcc-2.6.pkg | 2023-10-10 00:31 | 44K | |
| frink-2.2.2p4_3.pkg | 2023-10-14 12:31 | 43K | |
| fritzing-0.9.2_20.pkg | 2023-10-09 01:00 | 17M | |
| frobby-0.9.5_2.pkg | 2023-10-09 09:11 | 1.1M | |
| frodo-4.1b_11.pkg | 2023-10-14 18:48 | 130K | |
| frogatto-1.3.1_28.pkg | 2023-10-10 09:45 | 430M | |
| frogr-1.6_3.pkg | 2023-10-14 10:27 | 781K | |
| frontaccounting-2.3...> | 2023-10-09 04:03 | 870K | |
| frontaccounting24-2...> | 2023-10-08 20:33 | 1.3M | |
| frontbase-jdbc-2.5.6..> | 2023-10-14 16:43 | 127K | |
| frost-1.2.0.20090314..> | 2023-10-11 11:42 | 5.4M | |
| frotz-2.51.pkg | 2023-10-08 00:16 | 74K | |
| froxlor-2.0.10.pkg | 2023-10-10 08:56 | 2.2M | |
| frozen-bubble-2.213...> | 2023-10-09 23:30 | 21M | |
| frp-0.51.3_1.pkg | 2023-10-10 12:45 | 8.6M | |
| frr7-7.5.1_4.pkg | 2023-10-08 11:24 | 2.5M | |
| frr7-pythontools-7.5..> | 2023-10-08 18:26 | 14K | |
| frr8-8.5.3.pkg | 2023-10-08 06:53 | 3.4M | |
| frr8-pythontools-8.5..> | 2023-10-09 02:56 | 19K | |
| frugally-deep-0.15.2..> | 2023-10-09 08:37 | 43K | |
| fs-uae-3.1.66.pkg | 2023-10-09 09:58 | 4.2M | |
| fs-uae-launcher-3.0...> | 2023-10-10 00:06 | 8.9M | |
| fs2open-23.0.0_3.pkg | 2023-10-14 14:10 | 4.2M | |
| fsbackup-1.2.1_3.pkg | 2023-10-09 19:16 | 31K | |
| fsc-1.2.pkg | 2023-10-10 05:01 | 16K | |
| fsearch-0.2.3.pkg | 2023-10-11 12:16 | 222K | |
| fselect-0.8.4_2.pkg | 2023-10-14 04:54 | 1.0M | |
| fsharp-10.2.1_2.pkg | 2023-10-10 01:09 | 6.1M | |
| fslsfonts-1.0.5.pkg | 2023-10-14 03:18 | 7.6K | |
| fsmtrie-2.0.0.pkg | 2023-10-11 20:32 | 14K | |
| fsom-g20151117_2.pkg | 2023-10-10 15:28 | 25K | |
| fspclient-0.93.1.pkg | 2023-10-10 04:33 | 119K | |
| fspd-2.8.1.29.pkg | 2023-10-08 13:30 | 84K | |
| fsplib-0.14.pkg | 2023-10-09 07:46 | 19K | |
| fstobdf-1.0.6.pkg | 2023-10-14 13:38 | 6.8K | |
| fstrcmp-0.7.D001.pkg | 2023-10-06 18:20 | 28K | |
| fstrm-0.6.1.pkg | 2023-10-07 04:15 | 64K | |
| fstyp-0.1.pkg | 2023-10-10 15:54 | 5.6K | |
| fsv2-1.1.0_5.pkg | 2023-10-14 13:32 | 337K | |
| fswatch-0.02.b5_1.pkg | 2023-10-09 00:40 | 31K | |
| fswatch-mon-1.13.0_2..> | 2023-10-10 10:35 | 235K | |
| fswiki-3.6.2_2.pkg | 2023-10-09 17:09 | 501K | |
| fswm-g20230808.pkg | 2023-10-10 04:16 | 4.2K | |
| fsx-0.1.0_6.pkg | 2023-10-09 22:35 | 436K | |
| ft2demos-2.11.1.pkg | 2023-10-14 17:50 | 684K | |
| ft2play-g20220407.pkg | 2023-10-09 05:01 | 35K | |
| ftdi-eeprom-1.1_1.pkg | 2023-10-09 01:53 | 5.8K | |
| fte-20110708.pkg | 2023-10-08 20:44 | 316K | |
| ftgl-2.4.0_1,1.pkg | 2023-10-06 11:38 | 101K | |
| fth-1.4.2.pkg | 2023-10-10 01:38 | 565K | |
| ftimes-3.11.0_2.pkg | 2023-10-08 21:58 | 332K | |
| ftjam-2.5.2.pkg | 2023-10-09 13:17 | 89K | |
| ftnchek-3.3.1.pkg | 2023-10-14 18:21 | 189K | |
| ftpcopy-0.6.7.pkg | 2023-10-08 21:53 | 86K | |
| ftpfind-0.996.pkg | 2023-10-09 20:57 | 7.6K | |
| ftplib-4.0.1.pkg | 2023-10-10 02:15 | 19K | |
| ftpproxy-1.2.3_1.pkg | 2023-10-10 18:40 | 25K | |
| ftpsesame-0.95.pkg | 2023-10-10 11:04 | 13K | |
| ftpsync-1.3.06,1.pkg | 2023-10-09 14:55 | 17K | |
| ftwin-0.8.10.pkg | 2023-10-10 11:25 | 23K | |
| ftxui-4.1.1.pkg | 2023-10-08 04:44 | 239K | |
| fuel-1.0.1_4.pkg | 2023-10-09 03:37 | 3.8M | |
| functionalplus-0.2.2..> | 2023-10-08 08:46 | 74K | |
| fungw-1.2.1_2.pkg | 2023-10-07 00:36 | 245K | |
| funktrackergold-1.5...> | 2023-10-10 01:35 | 51K | |
| funnyboat-1.6_2.pkg | 2023-10-09 02:56 | 3.6M | |
| fur-libreoffice-7.5...> | 2023-10-08 05:28 | 146K | |
| furnace-0.6pre16.pkg | 2023-10-10 19:49 | 28M | |
| fuse-1.6.0_4.pkg | 2023-10-09 07:39 | 670K | |
| fuse-roms-0.2,1.pkg | 2023-10-08 19:53 | 100K | |
| fuse-utils-1.4.3_2.pkg | 2023-10-12 08:40 | 126K | |
| fuse-zip-0.4.4_1.pkg | 2023-10-09 13:10 | 34K | |
| fusefs-afuse-0.4.1_1..> | 2023-10-09 04:19 | 16K | |
| fusefs-bindfs-1.16.1..> | 2023-10-09 11:51 | 26K | |
| fusefs-chironfs-1.1...> | 2023-10-10 07:06 | 169K | |
| fusefs-cryptofs-0.6...> | 2023-10-09 16:03 | 13K | |
| fusefs-curlftpfs-0.9..> | 2023-10-14 15:54 | 26K | |
| fusefs-encfs-1.9.5_6..> | 2023-10-11 01:29 | 372K | |
| fusefs-exfat-1.4.0.pkg | 2023-10-08 11:18 | 24K | |
| fusefs-ext2-0.0.10_5..> | 2023-10-07 01:19 | 14K | |
| fusefs-funionfs-0.4...> | 2023-10-14 08:57 | 15K | |
| fusefs-fusepak-0.5.pkg | 2023-10-10 04:13 | 8.1K | |
| fusefs-gitfs-0.5.2_2..> | 2023-10-11 00:44 | 55K | |
| fusefs-gphotofs-0.5_..> | 2023-10-07 03:14 | 7.1K | |
| fusefs-hfsfuse-0.132..> | 2023-10-07 22:48 | 36K | |
| fusefs-httpdirfs-1.2..> | 2023-10-10 04:11 | 27K | |
| fusefs-httpfs-2.0.1...> | 2023-10-11 06:02 | 26K | |
| fusefs-ifuse-1.1.4.pkg | 2023-10-09 18:47 | 11K | |
| fusefs-jmtpfs-g20190..> | 2023-10-07 02:53 | 38K | |
| fusefs-libs-2.9.9_2.pkg | 2023-10-06 17:09 | 134K | |
| fusefs-libs3-3.16.1.pkg | 2023-10-06 17:57 | 99K | |
| fusefs-lkl-4.16.g201..> | 2023-10-08 08:23 | 12M | |
| fusefs-mhddfs-0.1.37..> | 2023-10-08 23:55 | 16K | |
| fusefs-mp3fs-0.91_2,..> | 2023-10-10 12:35 | 22K | |
| fusefs-nbt-20230720.pkg | 2023-10-14 11:04 | 42K | |
| fusefs-ntfs-2022.10...> | 2023-10-07 08:46 | 538K | |
| fusefs-ntfs-compress..> | 2023-10-09 12:03 | 13K | |
| fusefs-pod-0.5.2_14.pkg | 2023-10-10 19:46 | 41K | |
| fusefs-rar2fs-1.29.5..> | 2023-10-10 14:37 | 45K | |
| fusefs-s3backer-1.5...> | 2023-10-08 21:32 | 71K | |
| fusefs-s3fs-1.92.pkg | 2023-10-08 14:11 | 213K | |
| fusefs-sandboxfs-0.2..> | 2023-10-08 19:34 | 537K | |
| fusefs-simple-mtpfs-..> | 2023-10-09 12:23 | 45K | |
| fusefs-smbnetfs-0.6...> | 2023-10-14 05:50 | 50K | |
| fusefs-sqlfs-1.1_1,1..> | 2023-10-09 03:24 | 26K | |
| fusefs-squashfuse-0...> | 2023-10-09 14:46 | 39K | |
| fusefs-sshfs-3.7.3_1..> | 2023-10-08 11:14 | 33K | |
| fusefs-unionfs-2.2.pkg | 2023-10-09 03:47 | 35K | |
| fusefs-unreliablefs-..> | 2023-10-09 17:58 | 12K | |
| fusefs-webdavfs-g202..> | 2023-10-14 16:59 | 1.8M | |
| fusefs-xfuse-0.1.0.a..> | 2023-10-14 05:45 | 294K | |
| fusionpbx-4.4.1_1.pkg | 2023-10-09 12:42 | 5.2M | |
| futuresql-0.1.1_1.pkg | 2023-10-07 18:24 | 20K | |
| fuzz-0.6_1.pkg | 2023-10-09 22:56 | 17K | |
| fuzzel-1.9.2.pkg | 2023-10-09 21:19 | 67K | |
| fuzzylite-6.0_1.pkg | 2023-10-08 04:14 | 372K | |
| fuzzysearchdatabase-..> | 2023-10-08 11:15 | 4.5K | |
| fv-1.03_7.pkg | 2023-10-10 03:23 | 19K | |
| fvwm-2.6.9_2.pkg | 2023-10-08 11:46 | 2.5M | |
| fvwm-themes-0.7.0_6.pkg | 2023-10-10 08:58 | 1.7M | |
| fvwm3-1.0.8_1.pkg | 2023-10-08 16:13 | 3.2M | |
| fwanalog-0.6.9_6.pkg | 2023-10-10 09:40 | 42K | |
| fwbuilder-5.3.7_2.pkg | 2023-10-14 06:34 | 60M | |
| fwknop-2.6.10_2.pkg | 2023-10-12 05:10 | 178K | |
| fwlogwatch-1.5.pkg | 2023-10-09 06:29 | 118K | |
| fwup-1.10.0.pkg | 2023-10-10 22:00 | 129K | |
| fx-24.1.0_3.pkg | 2023-10-09 20:51 | 2.6M | |
| fxdiv-g20181121.pkg | 2023-10-06 13:52 | 3.1K | |
| fxite-0.92_4.pkg | 2023-10-09 11:04 | 715K | |
| fxload-20140224.pkg | 2023-10-08 09:38 | 16K | |
| fxscintilla-2.28.0_8..> | 2023-10-09 02:18 | 639K | |
| fxt-2023.06.27.pkg | 2023-10-09 12:10 | 885K | |
| fxtv-1.03_14.pkg | 2023-10-09 00:53 | 98K | |
| fy-aspell-0.12.0_1.pkg | 2023-10-09 04:00 | 206K | |
| fy-libreoffice-7.5.5..> | 2023-10-07 22:00 | 633K | |
| fyre-1.0.1_27.pkg | 2023-10-10 18:24 | 103K | |
| fzf-0.38.0_4.pkg | 2023-10-14 01:26 | 1.0M | |
| fzy-1.0.pkg | 2023-10-11 08:22 | 13K | |
| g-cows-1.12.pkg | 2023-10-09 22:37 | 173K | |
| g-gcl-1.10.pkg | 2023-10-10 06:25 | 22K | |
| g-golf-guile22-0.8.0..> | 2023-10-10 03:03 | 1.1M | |
| g-golf-guile30-0.8.0..> | 2023-10-11 07:54 | 1.2M | |
| g-wrap-1.9.15_3.pkg | 2023-10-08 01:24 | 89K | |
| g2-0.72.pkg | 2023-10-14 03:26 | 43K | |
| g2o-20230806.pkg | 2023-10-09 13:51 | 1.2M | |
| g15daemon-3.0.4.pkg | 2023-10-08 21:47 | 39K | |
| g810-led-0.4.2_1.pkg | 2023-10-09 14:16 | 48K | |
| ga-5.8.2.pkg | 2023-10-06 22:12 | 448K | |
| ga-aspell-4.5.0,2.pkg | 2023-10-14 07:22 | 2.4M | |
| ga-libreoffice-7.5.5..> | 2023-10-07 21:29 | 490K | |
| gaa-1.6.6.pkg | 2023-10-08 18:35 | 106K | |
| gabedit-2.5.1.300720..> | 2023-10-08 13:07 | 1.9M | |
| gaffitter-0.6.0_1.pkg | 2023-10-09 11:05 | 55K | |
| gajim-1.3.3.pkg | 2023-10-12 07:54 | 6.2M | |
| galaxis-1.10.pkg | 2023-10-14 05:04 | 11K | |
| galaxyhack-1.74_39.pkg | 2023-10-11 07:34 | 9.5M | |
| galculator-2.1.4_2.pkg | 2023-10-10 03:07 | 138K | |
| galene-0.7.2_2.pkg | 2023-10-10 09:16 | 3.7M | |
| galera-25.3.37_3.pkg | 2023-10-09 23:06 | 788K | |
| galera26-26.4.16.pkg | 2023-10-08 09:12 | 822K | |
| gallery-dl-1.25.8.pkg | 2023-10-09 13:54 | 771K | |
| gallery2-2.3.2_12.pkg | 2023-10-09 22:06 | 7.2M | |
| gambit-16.0.2_1.pkg | 2023-10-08 17:09 | 1.5M | |
| gambit-c-4.9.4_1,1.pkg | 2023-10-10 22:29 | 11M | |
| gamenetworkingsocket..> | 2023-10-14 12:05 | 469K | |
| gamescope-3.12.5.pkg | 2023-10-10 13:29 | 347K | |
| gamin-0.1.10_10.pkg | 2023-10-06 13:31 | 52K | |
| gammaray-2.11.3_3.pkg | 2023-10-09 03:24 | 2.8M | |
| gammu-1.42.0.pkg | 2023-10-08 16:03 | 1.1M | |
| gammy-0.9.64_1.pkg | 2023-10-10 02:05 | 142K | |
| ganglia-monitor-core..> | 2023-10-14 08:56 | 168K | |
| ganttproject-3.1.310..> | 2023-10-08 17:45 | 36M | |
| ganv-1.8.2_1.pkg | 2023-10-07 17:42 | 106K | |
| gap-4.12.2.pkg | 2023-10-08 04:08 | 410M | |
| gapcmon-0.8.9_9.pkg | 2023-10-09 04:34 | 52K | |
| garage-0.8.2_2.pkg | 2023-10-09 13:28 | 36M | |
| garcon-4.18.1.pkg | 2023-10-06 17:05 | 121K | |
| garden-of-coloured-l..> | 2023-10-10 07:21 | 1.8M | |
| garlic-1.6_1.pkg | 2023-10-09 16:30 | 1.3M | |
| gartoon-redux-1.11_2..> | 2023-10-07 16:22 | 6.4M | |
| gastex-3.0.pkg | 2023-10-10 04:59 | 22K | |
| gather-0.4.1.pkg | 2023-10-10 03:24 | 18K | |
| gatk-4.4.0.0.pkg | 2023-10-10 07:36 | 301M | |
| gatling-0.16.pkg | 2023-10-11 08:22 | 149K | |
| gau2grid-2.0.7_1.pkg | 2023-10-08 09:05 | 246K | |
| gauche-0.9.12.pkg | 2023-10-08 07:13 | 11M | |
| gauche-gl-0.6_5.pkg | 2023-10-08 13:07 | 709K | |
| gauche-makiki-0.4.pkg | 2023-10-10 09:45 | 22K | |
| gauche-readline-0.1_..> | 2023-10-14 04:55 | 7.7K | |
| gaul-0.1849.0_5.pkg | 2023-10-10 00:51 | 188K | |
| gaupol-1.4.3_2.pkg | 2023-10-10 00:01 | 449K | |
| gavl-1.4.0_4.pkg | 2023-10-06 14:23 | 2.7M | |
| gawk-5.2.2.pkg | 2023-10-06 17:10 | 1.0M | |
| gbase-0.5_9.pkg | 2023-10-10 00:54 | 6.5K | |
| gbdfed-1.6_2.pkg | 2023-10-10 23:41 | 185K | |
| gbe-0.0.22_3.pkg | 2023-10-14 06:30 | 27K | |
| gbi-5.6.pkg | 2023-10-10 05:06 | 30M | |
| gbrainy-2.4.6_2,2.pkg | 2023-10-14 05:40 | 939K | |
| gbsdconv-11.3_2.pkg | 2023-10-10 02:18 | 22K | |
| gbsplay-0.0.94,1.pkg | 2023-10-09 02:33 | 56K | |
| gbtolib-3.0.3_2.pkg | 2023-10-07 15:11 | 1.1M | |
| gbump-1.0.9_2.pkg | 2023-10-10 01:44 | 508K | |
| gcab-1.5.pkg | 2023-10-06 10:02 | 65K | |
| gcal-4.1_1.pkg | 2023-10-10 19:32 | 799K | |
| gcc-12_5.pkg | 2023-10-06 08:01 | 816 | |
| gcc-arm-embedded-10...> | 2023-10-06 17:32 | 71M | |
| gcc-msp430-ti-toolch..> | 2023-10-05 23:46 | 70M | |
| gcc6-aux-20180516_3,..> | 2023-10-05 18:41 | 53M | |
| gcc8-8.5.0_2.pkg | 2023-10-05 23:22 | 43M | |
| gcc9-9.5.0_1.pkg | 2023-10-05 22:59 | 44M | |
| gcc10-10.4.0_1.pkg | 2023-10-05 23:07 | 54M | |
| gcc11-11.3.0_8.pkg | 2023-10-06 06:33 | 90M | |
| gcc11-devel-11.4.1.s..> | 2023-10-06 00:03 | 85M | |
| gcc12-12.2.0_6.pkg | 2023-10-06 08:00 | 81M | |
| gcc12-devel-12.3.1.s..> | 2023-10-06 00:01 | 77M | |
| gcc13-13.1.0_1.pkg | 2023-10-06 09:26 | 84M | |
| gcc13-devel-13.2.1.s..> | 2023-10-06 00:19 | 79M | |
| gcc14-devel-14.0.0.s..> | 2023-10-06 01:45 | 98M | |
| gcc48-4.8.5_15.pkg | 2023-10-05 19:29 | 16M | |
| gccmakedep-1.0.3.pkg | 2023-10-05 16:44 | 2.9K | |
| gcem-1.17.0.pkg | 2023-10-14 10:23 | 24K | |
| gchemutils-0.14.17_2..> | 2023-10-09 03:06 | 1.3M | |
| gcli-1.1.0.pkg | 2023-10-10 06:05 | 94K | |
| gcolor2-0.4_11.pkg | 2023-10-09 21:41 | 14K | |
| gcolor3-2.4.0_2.pkg | 2023-10-12 03:19 | 73K | |
| gcompris-qt-3.3.pkg | 2023-10-08 16:14 | 41M | |
| gconf-editor-3.0.1_6..> | 2023-10-10 13:33 | 175K | |
| gconf2-3.2.6_9.pkg | 2023-10-07 08:29 | 918K | |
| gconfmm-2.28.3_3.pkg | 2023-10-07 21:53 | 41K | |
| gcp-2.3.1.pkg | 2023-10-14 09:11 | 129K | |
| gcp-ops-agent-2.22.0..> | 2023-10-09 23:17 | 1.6M | |
| gcpio-2.14.pkg | 2023-10-14 04:49 | 201K | |
| gcr-3.40.0_1.pkg | 2023-10-06 10:17 | 833K | |
| gcta-1.26.0_4.pkg | 2023-10-10 06:22 | 514K | |
| gd-aspell-0.1.1.1_1,..> | 2023-10-10 17:08 | 127K | |
| gd-libreoffice-7.5.5..> | 2023-10-08 04:45 | 499K | |
| gdal-3.7.1_1.pkg | 2023-10-06 11:58 | 7.6M | |
| gdal-grass-1.0.2_2,1..> | 2023-10-11 06:58 | 25K | |
| gdb-13.2.pkg | 2023-10-07 01:24 | 12M | |
| gdbm-1.23.pkg | 2023-10-05 17:09 | 209K | |
| gdchart-0.11.5_11.pkg | 2023-10-09 15:10 | 60K | |
| gdcm-3.0.21_1.pkg | 2023-10-06 12:44 | 1.8M | |
| gdialog-2.5_1.pkg | 2023-10-10 14:58 | 190K | |
| gdisk-1.0.9_3.pkg | 2023-10-09 19:47 | 139K | |
| gdk-pixbuf-xlib-2.40..> | 2023-10-07 08:12 | 39K | |
| gdk-pixbuf2-2.42.10_..> | 2023-10-05 17:49 | 465K | |
| gdl-3.40.0_1.pkg | 2023-10-07 18:51 | 245K | |
| gdm-42.0_6.pkg | 2023-10-06 21:50 | 717K | |
| gdma-2.2.6_6.pkg | 2023-10-08 17:05 | 131K | |
| gdmap-0.8.1_2.pkg | 2023-10-14 08:48 | 39K | |
| gdmd-0.1.0.20210818.pkg | 2023-10-05 17:00 | 6.6K | |
| gdnsd2-2.4.3.pkg | 2023-10-09 17:06 | 370K | |
| gdnsd3-3.8.0.pkg | 2023-10-14 15:07 | 298K | |
| gdome2-0.8.1_14.pkg | 2023-10-07 02:30 | 168K | |
| gdrive-2.1.1_14.pkg | 2023-10-11 05:20 | 1.9M | |
| gds3d-g20220203.pkg | 2023-10-14 07:29 | 319K | |
| gdscpp-g20200611.pkg | 2023-10-10 16:12 | 85K | |
| gdsreader-0.3.2_1.pkg | 2023-10-14 10:57 | 55K | |
| gdstk-0.9.42.pkg | 2023-10-09 15:34 | 379K | |
| gdt-4.0.4.pkg | 2023-10-10 04:01 | 460K | |
| gdu-5.25.0_2.pkg | 2023-10-14 08:03 | 2.9M | |
| geant4-11.1.2_1.pkg | 2023-10-09 06:46 | 2.3G | |
| geany-1.38_1.pkg | 2023-10-06 20:15 | 3.3M | |
| geany-plugin-addons-..> | 2023-10-07 10:30 | 35K | |
| geany-plugin-autoclo..> | 2023-10-08 10:06 | 18K | |
| geany-plugin-automar..> | 2023-10-07 12:52 | 10K | |
| geany-plugin-codenav..> | 2023-10-07 19:11 | 16K | |
| geany-plugin-command..> | 2023-10-07 23:13 | 19K | |
| geany-plugin-ctags-1..> | 2023-10-07 21:42 | 20K | |
| geany-plugin-debugge..> | 2023-10-07 21:49 | 64K | |
| geany-plugin-definef..> | 2023-10-08 08:10 | 11K | |
| geany-plugin-doc-1.3..> | 2023-10-08 06:10 | 19K | |
| geany-plugin-extrase..> | 2023-10-07 16:11 | 15K | |
| geany-plugin-gendoc-..> | 2023-10-08 05:17 | 50K | |
| geany-plugin-geniusp..> | 2023-10-07 12:40 | 21K | |
| geany-plugin-git-cha..> | 2023-10-08 04:13 | 24K | |
| geany-plugin-insertn..> | 2023-10-07 12:39 | 14K | |
| geany-plugin-latex-1..> | 2023-10-08 03:31 | 599K | |
| geany-plugin-lineope..> | 2023-10-08 03:38 | 16K | |
| geany-plugin-lipsum-..> | 2023-10-07 10:23 | 12K | |
| geany-plugin-lua-1.3..> | 2023-10-08 11:19 | 93K | |
| geany-plugin-macro-1..> | 2023-10-07 19:30 | 22K | |
| geany-plugin-markdow..> | 2023-10-07 22:17 | 556K | |
| geany-plugin-miniscr..> | 2023-10-07 18:41 | 16K | |
| geany-plugin-numbere..> | 2023-10-08 03:35 | 19K | |
| geany-plugin-overvie..> | 2023-10-07 15:34 | 22K | |
| geany-plugin-pairtag..> | 2023-10-08 09:27 | 7.0K | |
| geany-plugin-pg-1.38..> | 2023-10-08 07:42 | 19K | |
| geany-plugin-pohelpe..> | 2023-10-07 13:15 | 27K | |
| geany-plugin-pretty-..> | 2023-10-07 12:08 | 15K | |
| geany-plugin-prj-1.3..> | 2023-10-08 06:42 | 27K | |
| geany-plugin-project..> | 2023-10-07 10:29 | 32K | |
| geany-plugin-scope-1..> | 2023-10-07 19:22 | 147K | |
| geany-plugin-sendmai..> | 2023-10-07 10:36 | 16K | |
| geany-plugin-shiftco..> | 2023-10-07 23:52 | 12K | |
| geany-plugin-spellch..> | 2023-10-08 00:17 | 27K | |
| geany-plugin-tableco..> | 2023-10-08 11:42 | 14K | |
| geany-plugin-treebro..> | 2023-10-07 18:00 | 21K | |
| geany-plugin-updatec..> | 2023-10-07 21:58 | 12K | |
| geany-plugin-utilsli..> | 2023-10-07 09:12 | 11K | |
| geany-plugin-vc-1.38..> | 2023-10-07 14:56 | 33K | |
| geany-plugin-vimode-..> | 2023-10-08 01:41 | 27K | |
| geany-plugin-workben..> | 2023-10-07 13:15 | 41K | |
| geany-plugin-xmlsnip..> | 2023-10-07 16:50 | 13K | |
| geany-plugins-1.38.pkg | 2023-10-10 11:33 | 1.2K | |
| geany-plugins-l10n-1..> | 2023-10-07 15:18 | 279K | |
| geany-themes-1.24_1.pkg | 2023-10-14 16:03 | 12K | |
| gearmand-1.0.6_24.pkg | 2023-10-07 17:04 | 657K | |
| geary-40.0_7.pkg | 2023-10-14 11:12 | 2.4M | |
| geckodriver-0.26.0_3..> | 2023-10-14 15:53 | 1.1M | |
| gecode-6.3.0_7.pkg | 2023-10-07 06:05 | 4.1M | |
| geda-1.8.2_8,1.pkg | 2023-10-09 15:57 | 6.5M | |
| gedit-44.2_1.pkg | 2023-10-07 02:53 | 1.7M | |
| gedit-plugins-43.1_2..> | 2023-10-08 01:28 | 446K | |
| gedkeeper-2.25.2_2.pkg | 2023-10-09 03:42 | 12M | |
| geekcode-1.7.3.pkg | 2023-10-14 14:41 | 42K | |
| geeqie-2.0.1_13.pkg | 2023-10-14 07:45 | 908K | |
| gef-2022.01_1.pkg | 2023-10-10 02:00 | 82K | |
| gegl-0.4.46_2.pkg | 2023-10-06 19:28 | 2.6M | |
| gemdropx-0.9_12.pkg | 2023-10-08 12:05 | 725K | |
| gemma-0.98.3_3.pkg | 2023-10-14 10:28 | 28M | |
| gemmi-0.6.3.pkg | 2023-10-07 16:24 | 1.5M | |
| gemmlowp-g20190812.pkg | 2023-10-09 01:44 | 127K | |
| gemrb-0.9.1.pkg | 2023-10-09 15:22 | 13M | |
| gemserv-0.6.6_6.pkg | 2023-10-09 04:00 | 1.3M | |
| gen6dns-1.3.pkg | 2023-10-09 08:47 | 28K | |
| genact-0.11.0_23.pkg | 2023-10-14 03:09 | 704K | |
| generand-0.1.2.pkg | 2023-10-09 15:27 | 6.0K | |
| generate-2.8_1.pkg | 2023-10-14 03:03 | 21K | |
| geneweb-6.08_2.pkg | 2023-10-09 18:50 | 7.2M | |
| gengetopt-2.23.pkg | 2023-10-06 19:36 | 208K | |
| genht-1.1.3.pkg | 2023-10-06 19:55 | 26K | |
| genie-g2020082801.pkg | 2023-10-14 11:48 | 144K | |
| genimage-16.10.pkg | 2023-10-09 12:27 | 30K | |
| genius-1.0.27_4.pkg | 2023-10-14 08:15 | 2.4M | |
| genpatch-1.40_1.pkg | 2023-10-10 05:07 | 6.1K | |
| genplist-1.2.pkg | 2023-10-10 20:51 | 6.2K | |
| genromfs-0.5.7.pkg | 2023-10-08 23:34 | 11K | |
| genryu-1.501.pkg | 2023-10-09 17:05 | 48M | |
| genseki-1.501.pkg | 2023-10-08 22:18 | 31M | |
| gensen-1.501.pkg | 2023-10-11 12:16 | 41M | |
| gensig-2.3_1.pkg | 2023-10-08 14:16 | 16K | |
| gentoo-0.20.7_1.pkg | 2023-10-08 19:17 | 519K | |
| genwan-1.501.pkg | 2023-10-14 06:33 | 72M | |
| genyo-1.501.pkg | 2023-10-09 16:11 | 44M | |
| genyog-1.501.pkg | 2023-10-11 01:54 | 34M | |
| geoapi-3.0.0.pkg | 2023-10-10 08:29 | 811K | |
| geoclue-2.5.7.pkg | 2023-10-06 09:27 | 157K | |
| geocode-glib-3.26.4.pkg | 2023-10-06 10:50 | 89K | |
| geocode-glib2-3.26.4..> | 2023-10-06 11:50 | 82K | |
| geogebra-5.0.752.0.pkg | 2023-10-10 00:44 | 23M | |
| geogram-1.7.9.pkg | 2023-10-09 13:11 | 4.4M | |
| geographiclib-2.2.pkg | 2023-10-07 01:56 | 13M | |
| geoipupdate-6.0.0_2.pkg | 2023-10-08 22:56 | 1.7M | |
| geomorph-0.63_1.pkg | 2023-10-09 18:31 | 345K | |
| geomview-1.9.5_4.pkg | 2023-10-09 01:14 | 3.0M | |
| geonext-1.74.pkg | 2023-10-08 08:00 | 6.6M | |
| geonkick-lv2-2.10.0.pkg | 2023-10-10 00:37 | 1.3M | |
| geos-3.12.0.pkg | 2023-10-06 09:28 | 1.3M | |
| geoserver-2.23.2.pkg | 2023-10-07 19:40 | 110M | |
| geoserver-mysql-plug..> | 2023-10-14 17:34 | 2.2M | |
| gerbera-1.12.1_3.pkg | 2023-10-14 13:08 | 1.7M | |
| gerbv-2.7.0_2.pkg | 2023-10-08 19:31 | 1.6M | |
| get_flash_videos-1.2..> | 2023-10-09 23:26 | 58K | |
| get_iplayer-3.31_1.pkg | 2023-10-10 14:22 | 110K | |
| getdelta-0.7.8_5.pkg | 2023-10-14 16:10 | 11K | |
| getdns-1.5.2_4.pkg | 2023-10-08 08:44 | 447K | |
| getdp-3.5.0_1.pkg | 2023-10-06 13:58 | 903K | |
| geteltorito-0.6,1.pkg | 2023-10-09 03:52 | 3.3K | |
| getline-3.9.pkg | 2023-10-08 02:46 | 15K | |
| getopt-1.1.6.pkg | 2023-10-05 17:08 | 26K | |
| getoptions-3.3.0.pkg | 2023-10-10 22:03 | 20K | |
| getssl-2.46.pkg | 2023-10-14 04:30 | 35K | |
| gettext-0.22.pkg | 2023-10-08 07:20 | 500 | |
| gettext-lint-0.4_4.pkg | 2023-10-14 09:34 | 20K | |
| gettext-msghack-0.21..> | 2023-10-08 08:56 | 4.0K | |
| gettext-po-mode-0.22..> | 2023-10-08 15:22 | 45K | |
| gettext-runtime-0.22..> | 2023-10-05 16:44 | 203K | |
| gettext-tiny-0.3.2.pkg | 2023-10-10 07:09 | 12K | |
| gettext-tools-0.22.pkg | 2023-10-05 17:06 | 2.5M | |
| gexiv2-0.14.2.pkg | 2023-10-06 18:21 | 117K | |
| gexpr-2.0.2_1.pkg | 2023-10-11 17:30 | 11K | |
| gf2x-1.3.0.pkg | 2023-10-06 08:56 | 69K | |
| gfan-0.6.2_2.pkg | 2023-10-07 05:46 | 1.0M | |
| gfanlib-0.6.2_1.pkg | 2023-10-09 08:26 | 205K | |
| gfbgraph-0.2.5.pkg | 2023-10-06 19:15 | 74K | |
| gff2ps-0.98l.pkg | 2023-10-08 21:32 | 145K | |
| gffread-0.12.7.pkg | 2023-10-07 21:31 | 107K | |
| gflags-2.2.2_2.pkg | 2023-10-06 11:20 | 103K | |
| gfold-4.0.0_13.pkg | 2023-10-11 03:04 | 567K | |
| gforth-0.7.3_15.pkg | 2023-10-09 14:52 | 651K | |
| gftp-2.7.0b_1.pkg | 2023-10-10 05:00 | 624K | |
| ggobi-2.1.11_6.pkg | 2023-10-08 20:13 | 1.0M | |
| ggwave-0.4.1.pkg | 2023-10-09 07:58 | 38K | |
| gh-2.34.0.pkg | 2023-10-14 18:35 | 7.3M | |
| gh-bc-6.6.0.pkg | 2023-10-10 15:01 | 123K | |
| gh-grep-1.2.0_2.pkg | 2023-10-14 01:27 | 2.9M | |
| gh-md-toc-0.8.0.pkg | 2023-10-09 15:13 | 7.1K | |
| ghc-9.4.6.pkg | 2023-10-06 16:17 | 168M | |
| ghc92-9.2.8.pkg | 2023-10-07 07:19 | 105M | |
| ghc810-8.10.7_4.pkg | 2023-10-07 09:42 | 124M | |
| ghdl-3.0.0_1.pkg | 2023-10-08 09:53 | 3.1M | |
| ghemical-3.0.0_25.pkg | 2023-10-09 17:02 | 1.7M | |
| ghex-3.41.1_1.pkg | 2023-10-08 16:27 | 1.3M | |
| ghidra-9.1.pkg | 2023-10-09 13:59 | 195M | |
| ghmm-0.9.r3_2.pkg | 2023-10-09 20:27 | 243K | |
| ghostbsd-bug-report-..> | 2023-10-10 18:47 | 674K | |
| ghostbsd-common-sett..> | 2023-10-10 05:10 | 550K | |
| ghostbsd-icons-1.7.pkg | 2023-10-14 09:31 | 8.0M | |
| ghostbsd-mate-themes..> | 2023-10-09 16:58 | 196K | |
| ghostbsd-slim-theme-..> | 2023-10-09 11:23 | 1.9M | |
| ghostbsd-wallpapers-..> | 2023-10-10 00:53 | 29M | |
| ghostie-0.2.1_7.pkg | 2023-10-10 03:41 | 1.1M | |
| ghostscript9-agpl-ba..> | 2023-10-05 19:51 | 17M | |
| ghostscript9-agpl-x1..> | 2023-10-06 11:36 | 27K | |
| ghostscript10-10.02...> | 2023-10-10 10:26 | 8.6M | |
| ghostunnel-1.7.1_2.pkg | 2023-10-08 19:40 | 6.1M | |
| ghostwriter-2.2.0_3.pkg | 2023-10-14 15:23 | 2.2M | |
| ghostwriter-qt6-2.2...> | 2023-10-14 15:06 | 3.6M | |
| ghq-1.4.2_2.pkg | 2023-10-10 08:35 | 2.5M | |
| ghub-3.6.0_1.pkg | 2023-10-07 10:55 | 51K | |
| ghub-devel-3.6.0_1.pkg | 2023-10-08 06:56 | 51K | |
| ghub-devel-emacs_can..> | 2023-10-08 05:11 | 51K | |
| ghub-devel-emacs_dev..> | 2023-10-07 12:32 | 51K | |
| ghub-devel-emacs_dev..> | 2023-10-07 23:07 | 51K | |
| ghub-devel-emacs_nox..> | 2023-10-08 06:42 | 51K | |
| ghub-emacs_canna-3.6..> | 2023-10-07 11:01 | 51K | |
| ghub-emacs_devel-3.6..> | 2023-10-08 05:44 | 51K | |
| ghub-emacs_devel_nox..> | 2023-10-08 04:06 | 51K | |
| ghub-emacs_nox-3.6.0..> | 2023-10-07 16:17 | 51K | |
| giacxcas-1.9.0.55.pkg | 2023-10-08 11:50 | 64M | |
| giada-0.17.1_5.pkg | 2023-10-09 13:09 | 232K | |
| giflib-5.2.1.pkg | 2023-10-05 16:46 | 231K | |
| gifmerge-1.33.pkg | 2023-10-11 02:34 | 6.7K | |
| gifsicle-1.94.pkg | 2023-10-07 22:06 | 152K | |
| gifsicle-nox11-1.94.pkg | 2023-10-09 19:45 | 134K | |
| gifski-1.10.3_4.pkg | 2023-10-09 15:41 | 498K | |
| giftool-1.0.pkg | 2023-10-10 15:13 | 21K | |
| gigabase-3.91_9.pkg | 2023-10-08 23:41 | 497K | |
| gigalomania-0.28_1.pkg | 2023-10-09 12:17 | 9.1M | |
| gigolo-0.5.2_1.pkg | 2023-10-08 00:31 | 173K | |
| gillo-1.0.b1_12.pkg | 2023-10-12 09:48 | 4.1M | |
| gimageview-0.2.27_29..> | 2023-10-08 14:20 | 591K | |
| gimmage-0.2.3_19.pkg | 2023-10-09 01:54 | 49K | |
| gimp-2.10.32,2.pkg | 2023-10-10 19:30 | 1.0K | |
| gimp-app-2.10.34_8,1..> | 2023-10-07 09:17 | 18M | |
| gimp-beautify-plugin..> | 2023-10-10 07:48 | 19M | |
| gimp-data-extras-2.0..> | 2023-10-08 20:27 | 3.7M | |
| gimp-gutenprint-5.3...> | 2023-10-07 14:17 | 71K | |
| gimp-jxl-plugin-0.8...> | 2023-10-14 10:12 | 21K | |
| gimp-lensfun-plugin-..> | 2023-10-10 00:11 | 20K | |
| gimp-lqr-plugin-0.7...> | 2023-10-09 01:06 | 584K | |
| gimp-refocus-plugin-..> | 2023-10-08 14:28 | 201K | |
| gimp-resynthesizer-2..> | 2023-10-09 16:58 | 40K | |
| gindent-2.2.12_1.pkg | 2023-10-09 22:13 | 113K | |
| gio-sharp-2.22.3_2.pkg | 2023-10-07 19:58 | 93K | |
| gir-to-d-0.23.1_1.pkg | 2023-10-07 11:48 | 330K | |
| girara-0.4.0.pkg | 2023-10-07 00:56 | 61K | |
| gismo-21.12.0.882.pkg | 2023-10-14 15:20 | 29M | |
| gist-6.0.0.pkg | 2023-10-11 00:43 | 20K | |
| git-2.42.0.pkg | 2023-10-06 15:02 | 5.8M | |
| git-absorb-0.6.10_5.pkg | 2023-10-14 06:26 | 620K | |
| git-branchless-0.7.1..> | 2023-10-14 14:17 | 3.1M | |
| git-bug-0.8.0_3.pkg | 2023-10-09 12:53 | 6.3M | |
| git-chglog-0.15.4_3.pkg | 2023-10-08 17:50 | 2.6M | |
| git-cinnabar-0.6.2_2..> | 2023-10-14 18:35 | 1.5M | |
| git-cliff-1.3.0_1.pkg | 2023-10-09 01:50 | 2.3M | |
| git-codereview-1.6.0..> | 2023-10-09 12:13 | 1.8M | |
| git-cola-4.1.0_2.pkg | 2023-10-14 05:33 | 721K | |
| git-credential-azure..> | 2023-10-09 10:42 | 2.2M | |
| git-credential-gopas..> | 2023-10-10 20:02 | 3.7M | |
| git-credential-oauth..> | 2023-10-14 16:26 | 1.8M | |
| git-crypt-0.7.0.pkg | 2023-10-14 03:50 | 67K | |
| git-cvs-2.42.0.pkg | 2023-10-09 23:06 | 66K | |
| git-delta-0.16.5_2.pkg | 2023-10-09 16:47 | 1.8M | |
| git-extras-7.0.0.pkg | 2023-10-09 05:23 | 95K | |
| git-filter-repo-2.38..> | 2023-10-09 10:34 | 59K | |
| git-gui-2.42.0.pkg | 2023-10-14 13:05 | 335K | |
| git-lab-0.1.pkg | 2023-10-08 21:53 | 30K | |
| git-lfs-3.0.2_14.pkg | 2023-10-07 00:07 | 3.2M | |
| git-lite-2.42.0.pkg | 2023-10-06 16:33 | 5.5M | |
| git-merge-changelog-..> | 2023-10-10 17:11 | 33K | |
| git-modes-1.4.1_1,1.pkg | 2023-10-09 01:55 | 9.1K | |
| git-modes-emacs_cann..> | 2023-10-09 08:28 | 9.1K | |
| git-modes-emacs_deve..> | 2023-10-14 15:23 | 9.1K | |
| git-modes-emacs_deve..> | 2023-10-10 04:49 | 9.1K | |
| git-modes-emacs_nox-..> | 2023-10-09 06:20 | 9.1K | |
| git-p4-2.42.0.pkg | 2023-10-09 08:23 | 49K | |
| git-prev-next-g20220..> | 2023-10-14 17:46 | 2.3K | |
| git-prompt.zsh-2.3.0..> | 2023-10-10 06:55 | 8.0K | |
| git-remote-gcrypt-1...> | 2023-10-09 22:16 | 13K | |
| git-review-2.3.0.pkg | 2023-10-10 23:59 | 71K | |
| git-secret-0.2.5.pkg | 2023-10-09 23:52 | 22K | |
| git-subrepo-0.4.3.pkg | 2023-10-11 14:33 | 28K | |
| git-svn-2.42.0.pkg | 2023-10-08 18:52 | 35K | |
| git-tiny-2.42.0.pkg | 2023-10-10 11:02 | 3.9M | |
| git-town-9.0.1_2.pkg | 2023-10-14 01:42 | 3.0M | |
| git-workspace-1.2.1_..> | 2023-10-09 23:03 | 1.6M | |
| gitaly-16.3.4.pkg | 2023-10-07 19:49 | 188M | |
| gitea-1.20.4.pkg | 2023-10-10 09:22 | 26M | |
| gitflow-1.12.3.pkg | 2023-10-10 00:10 | 33K | |
| gitg-41_1.pkg | 2023-10-09 23:52 | 741K | |
| github-backup-utils-..> | 2023-10-14 09:35 | 50K | |
| gitinspector-py39-0...> | 2023-10-11 17:20 | 233K | |
| gitjacker-0.1.0_15.pkg | 2023-10-10 07:18 | 2.2M | |
| gitlab-agent-16.4.0.pkg | 2023-10-08 01:11 | 7.0M | |
| gitlab-ce-16.3.4.pkg | 2023-10-14 03:02 | 69M | |
| gitlab-elasticsearch..> | 2023-10-07 17:40 | 5.5M | |
| gitlab-metrics-expor..> | 2023-10-07 17:46 | 2.7M | |
| gitlab-pages-16.3.4.pkg | 2023-10-07 17:25 | 7.1M | |
| gitlab-runner-16.3.0..> | 2023-10-09 19:25 | 30M | |
| gitlab-shell-14.26.0..> | 2023-10-07 06:58 | 44M | |
| gitlab-workhorse-16...> | 2023-10-07 23:46 | 25M | |
| gitleaks-8.18.0_1.pkg | 2023-10-09 13:25 | 2.2M | |
| gitlist-1.1.1.pkg | 2023-10-09 08:16 | 1.4M | |
| gitolite-3.6.12,1.pkg | 2023-10-10 05:08 | 118K | |
| gitolite2-2.3.1_1.pkg | 2023-10-14 16:41 | 41K | |
| gitoxide-0.32.0_6.pkg | 2023-10-09 12:45 | 2.4M | |
| gitqlient-1.6.2.pkg | 2023-10-10 20:19 | 1.4M | |
| gitterdone-201710031..> | 2023-10-08 13:19 | 40K | |
| gittrac-2.0.1_1.pkg | 2023-10-10 14:11 | 145K | |
| gitui-0.24.3.pkg | 2023-10-14 05:33 | 2.5M | |
| gitup-0.98.8.pkg | 2023-10-09 15:05 | 31K | |
| gitwatch-0.1.a.20200..> | 2023-10-14 06:06 | 5.8K | |
| givaro-4.2.0.pkg | 2023-10-06 20:55 | 525K | |
| gjs-1.74.1_1.pkg | 2023-10-06 13:28 | 334K | |
| gkermit-1.0.pkg | 2023-10-09 12:42 | 40K | |
| gkleds2-0.8.2_10.pkg | 2023-10-09 22:54 | 12K | |
| gkmap-0.2_7.pkg | 2023-10-09 21:49 | 23K | |
| gkrellflynn-0.8_9.pkg | 2023-10-08 17:12 | 16K | |
| gkrellkam2-2.0.0_12.pkg | 2023-10-10 12:41 | 17K | |
| gkrellm-gamma-2.03_1..> | 2023-10-08 23:57 | 4.4K | |
| gkrellm-gkfreq-2.2.pkg | 2023-10-10 10:23 | 4.9K | |
| gkrellm-trayicons-1...> | 2023-10-11 00:50 | 13K | |
| gkrellm-xkb-1.05_11.pkg | 2023-10-14 15:42 | 11K | |
| gkrellm2-2.3.11_1.pkg | 2023-10-07 12:36 | 546K | |
| gkrellmbgchg2-0.1.11..> | 2023-10-14 07:37 | 12K | |
| gkrellmlaunch2-0.5_9..> | 2023-10-09 13:48 | 6.5K | |
| gkrellmoon2-0.6_11.pkg | 2023-10-10 03:15 | 55K | |
| gkrellshoot2-0.4.4_1..> | 2023-10-10 06:56 | 20K | |
| gkrelltop-2.2.13_1.pkg | 2023-10-09 11:58 | 16K | |
| gkx86info2-0.0.2_9.pkg | 2023-10-14 14:55 | 3.8K | |
| gl-117-1.3.2_12.pkg | 2023-10-09 08:29 | 1.8M | |
| gl-aspell-0.2_1,2.pkg | 2023-10-09 16:27 | 275K | |
| gl-libreoffice-7.5.5..> | 2023-10-08 07:03 | 3.1M | |
| gl2ps-1.4.2_1.pkg | 2023-10-06 12:08 | 289K | |
| glFlow-0.1.4,1.pkg | 2023-10-14 07:59 | 12K | |
| glab-1.32.0.pkg | 2023-10-10 05:49 | 5.6M | |
| glabels-3.4.1_3.pkg | 2023-10-14 18:53 | 2.9M | |
| glad-0.1.36.pkg | 2023-10-10 08:41 | 83K | |
| glade-3.40.0_1.pkg | 2023-10-06 14:21 | 1.8M | |
| glademm-2.6.0_3.pkg | 2023-10-14 18:13 | 270K | |
| gladtex-1.3_4.pkg | 2023-10-11 16:58 | 17K | |
| glassfish-4.1.pkg | 2023-10-10 16:57 | 97M | |
| glaxium-0.5_18.pkg | 2023-10-09 21:40 | 1.4M | |
| glaxnimate-qt5-0.5.3..> | 2023-10-10 22:34 | 5.6M | |
| glaxnimate-qt6-0.5.3..> | 2023-10-09 08:27 | 5.6M | |
| glbinding-3.3.0.pkg | 2023-10-09 03:51 | 1.5M | |
| glbsp-2.24.pkg | 2023-10-07 20:13 | 73K | |
| glcapsviewer-g201905..> | 2023-10-10 02:46 | 103K | |
| glclock-6.0.b6.0_7.pkg | 2023-10-14 08:44 | 619K | |
| gle-3.1.0_9.pkg | 2023-10-06 19:48 | 430K | |
| gleam-0.30.1_1.pkg | 2023-10-09 21:24 | 4.2M | |
| glest-3.2.2_16.pkg | 2023-10-11 17:14 | 300K | |
| glest-data-3.2.1.pkg | 2023-10-07 22:44 | 52M | |
| glew-2.2.0_3.pkg | 2023-10-06 13:44 | 403K | |
| glew-wayland-2.2.0_3..> | 2023-10-07 05:14 | 249K | |
| glewlwyd-2.7.4_1.pkg | 2023-10-14 17:01 | 1.4M | |
| glexcess-1.0_8.pkg | 2023-10-09 06:55 | 7.3M | |
| glfw-3.3.8.pkg | 2023-10-06 17:08 | 637K | |
| glfw2-2.7.9_3.pkg | 2023-10-08 00:27 | 827K | |
| glib-2.76.5,2.pkg | 2023-10-05 17:26 | 3.4M | |
| glib-networking-2.76..> | 2023-10-06 08:15 | 123K | |
| glibd-2.4.2_1.pkg | 2023-10-10 15:03 | 1.1M | |
| glibmm-2.66.5,1.pkg | 2023-10-06 11:55 | 967K | |
| glibmm26-2.76.0.pkg | 2023-10-08 02:15 | 1.0M | |
| glightoff-1.0.0_5.pkg | 2023-10-09 08:33 | 14K | |
| glitter-git-tool-1.6..> | 2023-10-14 09:42 | 593K | |
| gliv-1.9.7_8.pkg | 2023-10-09 00:03 | 165K | |
| gllvm-1.3.1_9.pkg | 2023-10-09 10:02 | 1.0M | |
| glm-0.9.9.8,1.pkg | 2023-10-06 18:16 | 3.3M | |
| glmark2-2023.01_1.pkg | 2023-10-14 11:53 | 7.0M | |
| glmaze-1.1.a_13.pkg | 2023-10-10 14:58 | 415K | |
| global-6.6.10_1.pkg | 2023-10-09 10:55 | 466K | |
| global-tz-2022.a.pkg | 2023-10-14 05:18 | 120K | |
| globalprotect-openco..> | 2023-10-14 12:44 | 168K | |
| glog-0.6.0.pkg | 2023-10-06 13:16 | 80K | |
| glogg-1.1.4_13.pkg | 2023-10-09 04:43 | 222K | |
| gloox-1.0.24.pkg | 2023-10-08 08:40 | 756K | |
| glosm-0.0.2_7.pkg | 2023-10-14 04:33 | 72K | |
| glow-1.5.1_2.pkg | 2023-10-09 17:54 | 4.6M | |
| glpi-10.0.7,1.pkg | 2023-10-07 13:47 | 30M | |
| glpk-5.0.pkg | 2023-10-06 11:33 | 2.5M | |
| glpng-1.46_2.pkg | 2023-10-09 17:19 | 18K | |
| glrparser-1.4_1.pkg | 2023-10-10 10:50 | 22K | |
| glsfcave-1.0_6.pkg | 2023-10-10 04:07 | 6.4K | |
| glslang-13.0.0.pkg | 2023-10-05 17:43 | 1.4M | |
| gltron-0.70_19.pkg | 2023-10-09 04:07 | 1.8M | |
| glucose-4.1_3.pkg | 2023-10-08 21:46 | 74K | |
| glui-2.36_6.pkg | 2023-10-08 22:15 | 350K | |
| glusterfs-8.4_2.pkg | 2023-10-14 06:19 | 2.9M | |
| glvis-mesh-visualize..> | 2023-10-09 12:36 | 1.0M | |
| glx-utils-9.0.0.pkg | 2023-10-07 15:55 | 59K | |
| gmake-4.3_2.pkg | 2023-10-05 16:46 | 407K | |
| gmanedit-0.4.2_9.pkg | 2023-10-09 05:11 | 36K | |
| gmap-2020.09.12.pkg | 2023-10-09 22:34 | 4.8M | |
| gmastermind-0.6_9.pkg | 2023-10-08 02:04 | 17K | |
| gmdb2-0.9.1_3.pkg | 2023-10-11 00:55 | 122K | |
| gmerlin-1.2.0_26.pkg | 2023-10-09 07:55 | 845K | |
| gmetadom-0.2.6_7.pkg | 2023-10-14 14:33 | 54K | |
| gmic-3.1.6_7.pkg | 2023-10-07 14:28 | 7.2M | |
| gmic-qt-3.2.6_1,1.pkg | 2023-10-14 05:51 | 3.6M | |
| gmic-qt-gimp-3.2.6_1..> | 2023-10-09 12:51 | 3.7M | |
| gmid-1.8.6.pkg | 2023-10-09 05:09 | 55K | |
| gmime26-2.6.23_2.pkg | 2023-10-06 12:20 | 269K | |
| gmime26-sharp-2.6.23..> | 2023-10-14 09:23 | 38K | |
| gmime30-3.2.7_1.pkg | 2023-10-06 10:20 | 391K | |
| gmines-0.2_9.pkg | 2023-10-08 04:14 | 11K | |
| gmm++-5.4.2.pkg | 2023-10-05 16:40 | 112K | |
| gmmlib-22.3.9.pkg | 2023-10-08 03:28 | 219K | |
| gmp-6.3.0.pkg | 2023-10-05 17:20 | 475K | |
| gmp-api-114.2.pkg | 2023-10-05 16:39 | 10K | |
| gmp-ecm-7.0.4_1.pkg | 2023-10-06 12:02 | 197K | |
| gmrun-0.9.2_15.pkg | 2023-10-10 23:02 | 38K | |
| gmsh-4.11.1_2.pkg | 2023-10-06 17:57 | 6.6M | |
| gmsynth-lv2-0.5.3.pkg | 2023-10-14 08:36 | 26M | |
| gmt-6.3.0_5.pkg | 2023-10-10 18:04 | 5.5M | |
| gmtk-1.0.9_3.pkg | 2023-10-07 18:40 | 76K | |
| gmtp-1.3.11_5.pkg | 2023-10-11 01:03 | 108K | |
| gn-2072.pkg | 2023-10-06 21:29 | 582K | |
| gnarwl-3.6_7.pkg | 2023-10-11 18:21 | 43K | |
| gnash-0.8.10_60.pkg | 2023-10-08 18:28 | 1.7M | |
| gnat12-12.2.0_5.pkg | 2023-10-06 23:31 | 164M | |
| gnatcross-binutils-a..> | 2023-10-14 11:58 | 1.5M | |
| gnatcross-sysroot-aa..> | 2023-10-08 11:40 | 19M | |
| gnatdroid-binutils-2..> | 2023-10-08 14:57 | 1.5M | |
| gnatdroid-binutils-x..> | 2023-10-09 13:39 | 1.7M | |
| gnatdroid-sysroot-23..> | 2023-10-07 20:57 | 3.0M | |
| gnatdroid-sysroot-x8..> | 2023-10-07 16:39 | 3.5M | |
| gnats4-4.1.0_19.pkg | 2023-10-08 22:49 | 352K | |
| gnatsweb-4.00_7.pkg | 2023-10-10 00:02 | 66K | |
| gnaural-1.0.20110606..> | 2023-10-09 22:20 | 84K | |
| gnet2-2.0.8_3.pkg | 2023-10-07 19:39 | 139K | |
| gnetcat-0.7.1_5.pkg | 2023-10-10 10:58 | 25K | |
| gngb-20060309_10.pkg | 2023-10-14 12:20 | 64K | |
| gnocky-0.0.7_6.pkg | 2023-10-09 07:34 | 267K | |
| gnokii-0.6.31_14,1.pkg | 2023-10-07 12:42 | 733K | |
| gnome-42_5.pkg | 2023-10-10 05:02 | 1.4K | |
| gnome-2048-3.38.2_2.pkg | 2023-10-07 09:14 | 93K | |
| gnome-autoar-0.4.3_1..> | 2023-10-06 18:01 | 60K | |
| gnome-backgrounds-43..> | 2023-10-07 20:29 | 31M | |
| gnome-builder-42.1_5..> | 2023-10-10 17:50 | 2.6M | |
| gnome-calculator-43...> | 2023-10-08 02:45 | 954K | |
| gnome-calendar-42.2_..> | 2023-10-07 05:38 | 335K | |
| gnome-characters-43...> | 2023-10-07 11:04 | 426K | |
| gnome-chess-43.0_1.pkg | 2023-10-07 06:25 | 401K | |
| gnome-clipboard-daem..> | 2023-10-14 16:07 | 4.9K | |
| gnome-clocks-40.0_1,..> | 2023-10-07 06:21 | 251K | |
| gnome-color-manager-..> | 2023-10-09 14:31 | 1.0M | |
| gnome-common-3.18.0.pkg | 2023-10-07 08:00 | 6.8K | |
| gnome-connections-42..> | 2023-10-07 15:35 | 144K | |
| gnome-contacts-41.0_..> | 2023-10-07 09:26 | 301K | |
| gnome-control-center..> | 2023-10-06 19:55 | 4.1M | |
| gnome-desktop-42.4_1..> | 2023-10-06 13:35 | 550K | |
| gnome-devel-docs-40...> | 2023-10-09 13:18 | 9.3M | |
| gnome-dictionary-40...> | 2023-10-07 02:51 | 358K | |
| gnome-font-viewer-43..> | 2023-10-07 05:23 | 152K | |
| gnome-games-3.24.0_1..> | 2023-10-08 00:19 | 704 | |
| gnome-getting-starte..> | 2023-10-08 07:32 | 78M | |
| gnome-icon-theme-3.1..> | 2023-10-07 00:37 | 9.4M | |
| gnome-icon-theme-ext..> | 2023-10-07 16:20 | 823K | |
| gnome-icon-theme-sym..> | 2023-10-06 15:21 | 135K | |
| gnome-icons-20060914..> | 2023-10-10 05:36 | 912 | |
| gnome-icons-aqua-fus..> | 2023-10-08 08:11 | 1.7M | |
| gnome-icons-crystal-..> | 2023-10-07 14:44 | 3.4M | |
| gnome-icons-elementa..> | 2023-10-09 07:49 | 2.5M | |
| gnome-icons-faenza-1..> | 2023-10-14 11:57 | 17M | |
| gnome-icons-gentoo-t..> | 2023-10-07 14:10 | 1.2M | |
| gnome-icons-iris-200..> | 2023-10-08 08:54 | 150K | |
| gnome-icons-lila-0.6..> | 2023-10-08 03:50 | 1.1M | |
| gnome-icons-luv-0.4...> | 2023-10-10 21:56 | 1.0M | |
| gnome-icons-noia-ful..> | 2023-10-08 05:19 | 11M | |
| gnome-icons-noia-war..> | 2023-10-07 12:45 | 5.0M | |
| gnome-icons-refined-..> | 2023-10-08 10:30 | 1.2M | |
| gnome-icons-slick-20..> | 2023-10-07 10:16 | 414K | |
| gnome-icons-snow-app..> | 2023-10-08 02:06 | 467K | |
| gnome-icons-stylish-..> | 2023-10-08 00:14 | 81K | |
| gnome-icons-ximian-s..> | 2023-10-08 10:40 | 677K | |
| gnome-initial-setup-..> | 2023-10-10 04:56 | 433K | |
| gnome-keyring-42.1_1..> | 2023-10-06 18:18 | 731K | |
| gnome-keyring-sharp-..> | 2023-10-08 12:19 | 23K | |
| gnome-klotski-3.38.2..> | 2023-10-07 01:19 | 257K | |
| gnome-latex-3.44.0_1..> | 2023-10-14 08:28 | 518K | |
| gnome-lite-42_5.pkg | 2023-10-09 11:34 | 1.3K | |
| gnome-mahjongg-3.38...> | 2023-10-07 00:27 | 2.5M | |
| gnome-maps-43.5.pkg | 2023-10-07 08:21 | 656K | |
| gnome-menus-3.36.0.pkg | 2023-10-06 21:38 | 155K | |
| gnome-metronome-1.3...> | 2023-10-10 21:39 | 474K | |
| gnome-mime-data-2.18..> | 2023-10-07 07:46 | 329K | |
| gnome-mines-40.1_1.pkg | 2023-10-07 09:11 | 203K | |
| gnome-mplayer-1.0.9_..> | 2023-10-10 03:30 | 303K | |
| gnome-music-42.1_2.pkg | 2023-10-09 07:11 | 261K | |
| gnome-nettool-42.0_1..> | 2023-10-14 18:59 | 316K | |
| gnome-nibbles-3.38.2..> | 2023-10-07 05:15 | 279K | |
| gnome-online-account..> | 2023-10-06 12:04 | 506K | |
| gnome-online-miners-..> | 2023-10-08 19:15 | 88K | |
| gnome-photos-43.0_3.pkg | 2023-10-07 05:51 | 589K | |
| gnome-pie-0.7.3_2.pkg | 2023-10-11 00:36 | 233K | |
| gnome-planner-0.14.6..> | 2023-10-10 17:16 | 658K | |
| gnome-podcasts-0.6.1..> | 2023-10-09 12:13 | 12M | |
| gnome-pomodoro-0.22...> | 2023-10-08 18:38 | 5.9M | |
| gnome-power-manager-..> | 2023-10-08 01:08 | 156K | |
| gnome-pty-helper-0.4..> | 2023-10-06 20:35 | 5.7K | |
| gnome-robots-40.0_1.pkg | 2023-10-07 03:36 | 388K | |
| gnome-screenshot-41...> | 2023-10-07 04:25 | 150K | |
| gnome-session-42.0_2..> | 2023-10-06 15:48 | 274K | |
| gnome-settings-daemo..> | 2023-10-06 13:43 | 779K | |
| gnome-shell-42.4_7.pkg | 2023-10-07 05:40 | 1.4M | |
| gnome-shell-extensio..> | 2023-10-08 10:02 | 4.8K | |
| gnome-shell-extensio..> | 2023-10-08 05:18 | 21K | |
| gnome-shell-extensio..> | 2023-10-08 07:20 | 263K | |
| gnome-shell-extensio..> | 2023-10-10 20:33 | 193K | |
| gnome-shell-extensio..> | 2023-10-07 14:54 | 15K | |
| gnome-shell-extensio..> | 2023-10-07 21:38 | 17K | |
| gnome-shell-extensio..> | 2023-10-07 21:29 | 16K | |
| gnome-shell-extensio..> | 2023-10-07 10:29 | 37K | |
| gnome-shell-extensio..> | 2023-10-07 13:27 | 124K | |
| gnome-shell-extensio..> | 2023-10-07 19:26 | 14K | |
| gnome-shell-extensio..> | 2023-10-07 23:53 | 14K | |
| gnome-shell-extensio..> | 2023-10-07 10:10 | 16K | |
| gnome-shell-extensio..> | 2023-10-07 17:18 | 31K | |
| gnome-shell-extensio..> | 2023-10-07 19:50 | 9.1K | |
| gnome-shell-extensio..> | 2023-10-07 23:47 | 142K | |
| gnome-shell-extra-ex..> | 2023-10-10 02:15 | 684 | |
| gnome-sound-recorder..> | 2023-10-10 23:19 | 95K | |
| gnome-ssh-askpass-6...> | 2023-10-14 08:50 | 4.3K | |
| gnome-sudoku-42.0_1.pkg | 2023-10-07 03:47 | 319K | |
| gnome-system-monitor..> | 2023-10-07 03:05 | 655K | |
| gnome-terminal-3.44...> | 2023-10-08 02:47 | 1.1M | |
| gnome-tetravex-3.38...> | 2023-10-07 05:09 | 954K | |
| gnome-text-editor-42..> | 2023-10-14 08:47 | 328K | |
| gnome-themes-2.32.1_..> | 2023-10-10 18:31 | 2.0M | |
| gnome-themes-extra-3..> | 2023-10-07 09:15 | 2.4M | |
| gnome-todo-41.0_3.pkg | 2023-10-08 21:43 | 348K | |
| gnome-tweaks-40.10_2..> | 2023-10-07 12:29 | 232K | |
| gnome-user-docs-42.0..> | 2023-10-08 04:51 | 7.2M | |
| gnome-user-share-3.1..> | 2023-10-10 22:02 | 78K | |
| gnome-utils-42,1.pkg | 2023-10-07 23:36 | 744 | |
| gnome-video-effects-..> | 2023-10-06 16:36 | 53K | |
| gnome-weather-42.0_1..> | 2023-10-07 02:11 | 123K | |
| gnome_subr-1.0.pkg | 2023-10-05 16:39 | 696 | |
| gnote-42.1_1.pkg | 2023-10-07 01:01 | 3.5M | |
| gns3-converter-1.2.4..> | 2023-10-09 02:31 | 33K | |
| gnu-apl-1.8_2.pkg | 2023-10-14 10:49 | 1.5M | |
| gnu-efi-3.0.15.pkg | 2023-10-07 13:36 | 171K | |
| gnu-ipcalc-1.0.3.pkg | 2023-10-09 16:36 | 19K | |
| gnu-radius-1.6.1_16.pkg | 2023-10-09 01:16 | 544K | |
| gnu-unifont-15.0.06,..> | 2023-10-07 05:17 | 911K | |
| gnu-unifont-ttf-15.0..> | 2023-10-07 11:16 | 3.2M | |
| gnu-watch-3.3.17.pkg | 2023-10-11 14:37 | 12K | |
| gnuastro-0.20_1.pkg | 2023-10-10 09:01 | 3.9M | |
| gnubc-1.07.1_2.pkg | 2023-10-07 08:00 | 90K | |
| gnubg-1.07.001_1.pkg | 2023-10-14 07:31 | 13M | |
| gnubiff-2.2.13_13.pkg | 2023-10-09 20:27 | 359K | |
| gnubik-2.4.3_7.pkg | 2023-10-14 06:07 | 89K | |
| gnucap-2013.04.23.pkg | 2023-10-14 12:01 | 558K | |
| gnucash-5.3_1.pkg | 2023-10-10 06:24 | 9.6M | |
| gnucash-docs-5.2.pkg | 2023-10-09 22:32 | 46M | |
| gnucflow-1.7.pkg | 2023-10-09 22:19 | 116K | |
| gnuchess-6.2.9.pkg | 2023-10-06 18:55 | 318K | |
| gnucobol-3.2.pkg | 2023-10-10 05:30 | 1.0M | |
| gnudatalanguage-1.0...> | 2023-10-14 07:55 | 24M | |
| gnugo-3.8_1.pkg | 2023-10-07 05:38 | 887K | |
| gnugrep-3.11.pkg | 2023-10-06 21:17 | 253K | |
| gnuitar-0.3.2_10.pkg | 2023-10-14 10:02 | 55K | |
| gnujump-1.0.8_2.pkg | 2023-10-14 08:22 | 1.5M | |
| gnulib-20140202_1.pkg | 2023-10-06 12:58 | 3.6M | |
| gnulibiberty-2.37.pkg | 2023-10-07 16:52 | 148K | |
| gnuls-9.1.pkg | 2023-10-10 06:29 | 103K | |
| gnumail-1.4.0_1.pkg | 2023-10-07 19:33 | 938K | |
| gnumeric-1.12.52_1.pkg | 2023-10-14 07:09 | 12M | |
| gnupg-2.4.3_4.pkg | 2023-10-05 17:50 | 2.3M | |
| gnupg-pkcs11-scd-0.1..> | 2023-10-10 13:19 | 25K | |
| gnupg1-1.4.23_3.pkg | 2023-10-06 22:37 | 1.1M | |
| gnuplot-5.4.1_3.pkg | 2023-10-06 12:20 | 2.0M | |
| gnuplot-lite-5.4.1_3..> | 2023-10-14 05:20 | 1.8M | |
| gnuplot-tex-extras-5..> | 2023-10-12 12:34 | 5.3K | |
| gnupod-0.99.8_3.pkg | 2023-10-09 17:34 | 109K | |
| gnuradio-3.8.4.0_11.pkg | 2023-10-07 07:50 | 11M | |
| gnurobbo-0.68.pkg | 2023-10-11 00:55 | 1.7M | |
| gnurobots-1.2.0_17.pkg | 2023-10-09 03:25 | 35K | |
| gnushogi-1.4.2_1.pkg | 2023-10-07 21:46 | 172K | |
| gnuspeechsa-0.1.5_6.pkg | 2023-10-09 19:35 | 753K | |
| gnustep-1.28.0_8.pkg | 2023-10-09 23:57 | 1.1K | |
| gnustep-back-0.28.0_..> | 2023-10-06 17:06 | 538K | |
| gnustep-base-1.29.0.pkg | 2023-10-06 12:38 | 1.9M | |
| gnustep-cdplayer-0.5..> | 2023-10-08 08:04 | 140K | |
| gnustep-ftp-0.6_2.pkg | 2023-10-07 19:05 | 69K | |
| gnustep-gui-0.28.0_7..> | 2023-10-06 15:09 | 2.8M | |
| gnustep-ladder-1.0_1..> | 2023-10-08 00:53 | 187K | |
| gnustep-make-2.8.0_1..> | 2023-10-06 11:46 | 164K | |
| gnustep-preview-0.8...> | 2023-10-07 16:00 | 46K | |
| gnustep-sudoku-0.7_9..> | 2023-10-07 22:41 | 26K | |
| gnustep-wrapper-0.1...> | 2023-10-08 01:03 | 52K | |
| gnutls-3.7.9.pkg | 2023-10-05 17:40 | 2.5M | |
| go-1.20,2.pkg | 2023-10-14 04:01 | 732 | |
| go-bapu-0.3.0_15.pkg | 2023-10-09 06:56 | 2.2M | |
| go-bindata-3.1.3_14.pkg | 2023-10-07 07:00 | 642K | |
| go-bindata-assetfs-1..> | 2023-10-10 00:41 | 555K | |
| go-carbon-0.12.0_15.pkg | 2023-10-14 12:35 | 3.7M | |
| go-cs-0.9_15.pkg | 2023-10-09 22:49 | 571K | |
| go-cve-dictionary-0...> | 2023-10-07 15:00 | 3.8M | |
| go-devel-g20230808.pkg | 2023-10-10 13:03 | 39M | |
| go-ethereum-1.12.2_1..> | 2023-10-14 16:00 | 11M | |
| go-for-it-1.9.6_1.pkg | 2023-10-09 17:32 | 488K | |
| go-git-5.9.0.pkg | 2023-10-14 16:23 | 1.2M | |
| go-md2man-2.0.2_8.pkg | 2023-10-06 18:56 | 673K | |
| go-pgweb-0.11.7_15.pkg | 2023-10-08 22:06 | 3.2M | |
| go-protobuf-1.3.2_14..> | 2023-10-08 22:03 | 3.5M | |
| go-tcping-2.4.0.pkg | 2023-10-10 20:54 | 2.5M | |
| go-tools-0.12.0_1,1.pkg | 2023-10-10 10:47 | 19M | |
| go-transifex-client-..> | 2023-10-10 02:16 | 3.3M | |
| go-wire-0.5.0_12.pkg | 2023-10-08 02:39 | 1.5M | |
| go-wtf-0.43.0_4.pkg | 2023-10-11 00:54 | 13M | |
| go-www-2.0.0_14.pkg | 2023-10-11 14:40 | 1.9M | |
| go-yq-4.34.1_2.pkg | 2023-10-08 23:18 | 2.7M | |
| go119-1.19.12.pkg | 2023-10-07 05:15 | 55M | |
| go120-1.20.8.pkg | 2023-10-06 15:42 | 38M | |
| go121-1.21.1.pkg | 2023-10-08 11:24 | 39M | |
| goaccess-1.7.2.pkg | 2023-10-10 10:35 | 310K | |
| goattracker-2.76.pkg | 2023-10-09 12:15 | 203K | |
| goawk-1.24.0_2.pkg | 2023-10-14 09:10 | 878K | |
| gob2-2.0.18.pkg | 2023-10-07 18:11 | 84K | |
| gobang-0.1.0.a.5_7.pkg | 2023-10-11 16:01 | 2.0M | |
| gobby-0.4.13_10.pkg | 2023-10-08 21:18 | 392K | |
| gobgp-3.12.0_3.pkg | 2023-10-10 00:24 | 8.5M | |
| gobi_loader-g2019122..> | 2023-10-10 10:21 | 5.8K | |
| gobject-introspectio..> | 2023-10-05 17:47 | 1.4M | |
| gobuffalo-0.16.27_14..> | 2023-10-09 01:58 | 5.3M | |
| gobuster-3.6.0_1.pkg | 2023-10-08 23:51 | 2.4M | |
| gocheese-4.1.0_2.pkg | 2023-10-10 04:10 | 2.3M | |
| gocr-0.52.pkg | 2023-10-07 10:29 | 221K | |
| gocritic-0.9.0.pkg | 2023-10-09 18:34 | 3.1M | |
| godot-4.0.2_1.pkg | 2023-10-08 19:31 | 15M | |
| godot-tools-4.0.2_1.pkg | 2023-10-10 21:56 | 200M | |
| godot2-2.1.6_6.pkg | 2023-10-08 06:00 | 4.5M | |
| godot35-3.5.1_1.pkg | 2023-10-14 13:12 | 9.0M | |
| godot35-tools-3.5.1_..> | 2023-10-09 15:06 | 175M | |
| goesimage-0.1.3_1.pkg | 2023-10-08 20:35 | 2.4K | |
| goffice-0.10.53_1.pkg | 2023-10-07 03:00 | 2.0M | |
| gofish-1.1.pkg | 2023-10-14 06:28 | 29K | |
| gofont-ttf-g20180511..> | 2023-10-10 08:34 | 359K | |
| gogglesmm-1.2.4_3.pkg | 2023-10-10 02:28 | 593K | |
| gogrepo-0.3a_3.pkg | 2023-10-10 10:36 | 14K | |
| gogs-0.12.11_4.pkg | 2023-10-09 15:14 | 23M | |
| gogui-1.4.10.pkg | 2023-10-14 06:48 | 2.5M | |
| gohufont-2.1_1.pkg | 2023-10-14 14:53 | 85K | |
| gojq-0.12.12_3.pkg | 2023-10-10 00:47 | 1.2M | |
| gokart-0.5.1_9.pkg | 2023-10-14 17:23 | 3.9M | |
| gokey-0.1.2_8.pkg | 2023-10-09 19:54 | 892K | |
| golangci-lint-1.54.2..> | 2023-10-10 03:14 | 9.2M | |
| golddig-3.1_2.pkg | 2023-10-10 13:02 | 35K | |
| golded+-1.1.5.a20170..> | 2023-10-10 02:40 | 1.0M | |
| goldendict-1.5.0.pkg | 2023-10-10 20:53 | 3.2M | |
| golint-g20190409_15.pkg | 2023-10-08 21:43 | 1.3M | |
| golly-4.2.pkg | 2023-10-09 03:38 | 12M | |
| gom-0.4.pkg | 2023-10-06 12:40 | 57K | |
| gomacro-2.7.601_7.pkg | 2023-10-11 07:58 | 7.7M | |
| gomate-g20170711_15.pkg | 2023-10-11 06:15 | 681K | |
| gomi-1.1.6_3.pkg | 2023-10-14 04:25 | 1.6M | |
| gomoku-1.2.9_9.pkg | 2023-10-10 06:42 | 82K | |
| gomplate-3.11.5_2.pkg | 2023-10-09 02:12 | 9.1M | |
| gomuks-0.3.0_8.pkg | 2023-10-14 02:27 | 5.6M | |
| gone-1.3.6.pkg | 2023-10-10 04:24 | 8.1K | |
| gonepass-g20181221_4..> | 2023-10-09 18:05 | 112K | |
| gonic-0.15.2_2.pkg | 2023-10-09 14:57 | 4.7M | |
| goobox-3.6.0_2.pkg | 2023-10-09 10:15 | 249K | |
| goocanvas2-2.0.4_1.pkg | 2023-10-07 07:15 | 314K | |
| goocanvas3-3.0.0_1.pkg | 2023-10-07 23:07 | 263K | |
| goocanvasmm2-1.90.9_..> | 2023-10-11 18:12 | 114K | |
| google-cloud-cpp-2.1..> | 2023-10-09 22:28 | 7.6M | |
| google-cloud-sdk-446..> | 2023-10-08 21:16 | 30M | |
| google-compute-engin..> | 2023-10-07 17:54 | 420K | |
| google-ctemplate-2.4..> | 2023-10-08 03:13 | 299K | |
| google-fonts-0.0.0.2..> | 2023-10-14 13:27 | 294M | |
| google-perftools-2.1..> | 2023-10-06 21:17 | 703K | |
| google-styleguide-20..> | 2023-10-09 16:37 | 382K | |
| googlebook_dl-202211..> | 2023-10-09 07:30 | 3.2K | |
| googler-4.3.2.pkg | 2023-10-10 22:37 | 37K | |
| googletest-1.14.0.pkg | 2023-10-06 15:22 | 346K | |
| goom-2k4.0_7.pkg | 2023-10-09 10:15 | 110K | |
| goonies-1.4.1528_2.pkg | 2023-10-14 07:59 | 11M | |
| goose-0.5_3.pkg | 2023-10-10 05:39 | 8.8K | |
| gopass-1.15.8.pkg | 2023-10-09 05:56 | 7.0M | |
| gopher-3.0.6_1.pkg | 2023-10-08 14:17 | 72K | |
| gophernicus-3.0.1.pkg | 2023-10-09 15:56 | 26K | |
| gopherus-1.2.2.pkg | 2023-10-09 11:02 | 21K | |
| gopls-0.13.2.pkg | 2023-10-08 23:47 | 5.7M | |
| goprotobuf-1.5.3_4,1..> | 2023-10-11 03:33 | 1.8M | |
| goredo-1.30.0_6.pkg | 2023-10-09 23:09 | 776K | |
| goreleaser-1.20.0_1.pkg | 2023-10-14 01:48 | 12M | |
| gorilla-1.5.3.6.pkg | 2023-10-09 09:06 | 280K | |
| gorm-1.2.23_5.pkg | 2023-10-07 19:03 | 588K | |
| gorss-0.3_15.pkg | 2023-10-10 13:16 | 3.0M | |
| gost-2.11.5_2.pkg | 2023-10-08 14:37 | 3.4M | |
| gost-engine-g2022052..> | 2023-10-14 18:50 | 496K | |
| gostsum-20221213_1.pkg | 2023-10-10 07:52 | 35K | |
| goswagger-0.30.4_6.pkg | 2023-10-08 20:46 | 6.3M | |
| got-0.93.pkg | 2023-10-08 12:26 | 521K | |
| gotktrix-0.1.4_11.pkg | 2023-10-08 19:18 | 9.5M | |
| gotmail-0.9.0_3.pkg | 2023-10-10 16:54 | 28K | |
| gotop-4.1.4_11.pkg | 2023-10-10 21:42 | 2.1M | |
| gotosocial-0.10.0_2.pkg | 2023-10-10 04:50 | 13M | |
| gottet-1.2.2_1.pkg | 2023-10-10 12:29 | 228K | |
| gotthard-1.3.pkg | 2023-10-09 21:36 | 9.4K | |
| gotty-1.5.0_8.pkg | 2023-10-08 17:41 | 2.8M | |
| gource-0.51_6.pkg | 2023-10-09 18:34 | 612K | |
| govmomi-0.30.7_1.pkg | 2023-10-14 01:32 | 8.8M | |
| goxel-0.12.0.pkg | 2023-10-09 11:20 | 1.4M | |
| gp2c-0.0.12_1.pkg | 2023-10-08 02:56 | 533K | |
| gpa-0.10.0_1.pkg | 2023-10-10 03:24 | 267K | |
| gpac-libgpac-1.0.0_2..> | 2023-10-08 06:10 | 5.2M | |
| gpac-mp4box-1.0.0.pkg | 2023-10-11 16:36 | 133K | |
| gpaint-0.3.4.pkg | 2023-10-10 12:29 | 92K | |
| gpart-0.1h_2.pkg | 2023-10-14 07:54 | 26K | |
| gpaw-setups-0.9.2000..> | 2023-10-08 01:48 | 50M | |
| gpds-1.6.0.pkg | 2023-10-07 22:59 | 127K | |
| gperf-3.1.pkg | 2023-10-05 16:41 | 78K | |
| gperiodic-3.0.3_1.pkg | 2023-10-10 04:25 | 142K | |
| gpg-gui-0.2.2_1.pkg | 2023-10-14 17:37 | 35K | |
| gpg-tui-0.10.0.pkg | 2023-10-08 15:27 | 1.0M | |
| gpgdir-1.9.5_1.pkg | 2023-10-14 06:02 | 15K | |
| gpgme-1.22.0.pkg | 2023-10-06 06:08 | 313K | |
| gpgme-cpp-1.22.0.pkg | 2023-10-06 06:33 | 121K | |
| gpgme-qt-headers-1.2..> | 2023-10-06 06:37 | 26K | |
| gpgme-qt5-1.22.0.pkg | 2023-10-06 06:46 | 207K | |
| gpgme-qt6-1.22.0.pkg | 2023-10-09 18:05 | 226K | |
| gphoto2-2.5.26_1.pkg | 2023-10-14 18:46 | 168K | |
| gpicker-2.3_1.pkg | 2023-10-10 10:18 | 23K | |
| gpicview-0.2.5_2.pkg | 2023-10-08 06:34 | 104K | |
| gping-1.14.0_1.pkg | 2023-10-11 20:45 | 751K | |
| gplcver-2.12.a.pkg | 2023-10-10 01:10 | 729K | |
| gplink-1.5_1.pkg | 2023-10-09 16:44 | 13K | |
| gpm-1.4.0_14.pkg | 2023-10-10 03:12 | 2.2K | |
| gpodder-3.11.1.pkg | 2023-10-10 17:32 | 660K | |
| gpp-2.24.pkg | 2023-10-10 09:17 | 42K | |
| gprbuild-23.0.0_1,1.pkg | 2023-10-07 03:24 | 10M | |
| gpredict-2.2.1_3.pkg | 2023-10-11 04:53 | 3.8M | |
| gprolog-1.5.0.pkg | 2023-10-09 21:26 | 3.0M | |
| gpsbabel-1.7.0.pkg | 2023-10-07 15:05 | 789K | |
| gpsbabel14-1.4.4_1.pkg | 2023-10-09 17:44 | 495K | |
| gpscorrelate-1.6.1_1..> | 2023-10-14 10:43 | 112K | |
| gpsd-3.23.1_1.pkg | 2023-10-06 21:25 | 838K | |
| gpsim-0.31.0_1.pkg | 2023-10-07 22:57 | 2.7M | |
| gpsman-6.4.4.2.pkg | 2023-10-07 16:32 | 1.1M | |
| gpsmanshp-1.2.3_1.pkg | 2023-10-10 02:17 | 126K | |
| gpsprune-23.1.pkg | 2023-10-10 05:11 | 1.1M | |
| gpstk-8.0.0.pkg | 2023-10-09 05:16 | 16M | |
| gpu-firmware-amd-kmo..> | 2023-10-07 08:49 | 531K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 05:52 | 530K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 03:37 | 23K | |
| gpu-firmware-amd-kmo..> | 2023-10-06 23:20 | 882K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:30 | 264K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 07:11 | 283K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:14 | 321K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 04:50 | 45K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 03:47 | 264K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 04:16 | 217K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 05:07 | 219K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 02:21 | 217K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 08:29 | 546K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 09:51 | 571K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 05:19 | 555K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 00:28 | 173K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:04 | 334K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:02 | 173K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 03:44 | 428K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 02:46 | 427K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 03:51 | 408K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 01:49 | 342K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:39 | 327K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:35 | 425K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 03:31 | 12K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 00:32 | 270K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 05:20 | 173K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 08:42 | 374K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 08:38 | 80K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 09:24 | 640K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 09:55 | 640K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 08:48 | 585K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 09:48 | 381K | |
| gpu-firmware-amd-kmo..> | 2023-10-07 06:21 | 176K | |
| gpu-firmware-amd-kmo..> | 2023-10-06 23:20 | 661K | |
| gpu-firmware-intel-k..> | 2023-10-07 01:12 | 139K | |
| gpu-firmware-intel-k..> | 2023-10-07 05:01 | 269K | |
| gpu-firmware-intel-k..> | 2023-10-07 09:46 | 5.0K | |
| gpu-firmware-intel-k..> | 2023-10-07 04:12 | 281K | |
| gpu-firmware-intel-k..> | 2023-10-07 02:18 | 292K | |
| gpu-firmware-intel-k..> | 2023-10-07 03:37 | 216K | |
| gpu-firmware-intel-k..> | 2023-10-07 07:22 | 321K | |
| gpu-firmware-intel-k..> | 2023-10-07 02:01 | 358K | |
| gpu-firmware-intel-k..> | 2023-10-06 23:34 | 7.3K | |
| gpu-firmware-intel-k..> | 2023-10-07 01:54 | 266K | |
| gpu-firmware-intel-k..> | 2023-10-07 02:33 | 392K | |
| gpu-firmware-kmod-20..> | 2023-10-08 02:18 | 960 | |
| gpu-firmware-radeon-..> | 2023-10-06 23:38 | 9.7K | |
| gpu-firmware-radeon-..> | 2023-10-07 07:07 | 24K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:41 | 335K | |
| gpu-firmware-radeon-..> | 2023-10-07 06:28 | 2.4K | |
| gpu-firmware-radeon-..> | 2023-10-07 05:35 | 24K | |
| gpu-firmware-radeon-..> | 2023-10-07 07:21 | 29K | |
| gpu-firmware-radeon-..> | 2023-10-07 06:09 | 17K | |
| gpu-firmware-radeon-..> | 2023-10-07 02:52 | 88K | |
| gpu-firmware-radeon-..> | 2023-10-07 04:33 | 66K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:10 | 303K | |
| gpu-firmware-radeon-..> | 2023-10-07 06:58 | 17K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:01 | 237K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:35 | 241K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:18 | 237K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:08 | 67K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:36 | 6.5K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:46 | 67K | |
| gpu-firmware-radeon-..> | 2023-10-07 04:19 | 2.3K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:29 | 2.4K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:56 | 2.4K | |
| gpu-firmware-radeon-..> | 2023-10-07 01:41 | 2.3K | |
| gpu-firmware-radeon-..> | 2023-10-07 01:25 | 2.3K | |
| gpu-firmware-radeon-..> | 2023-10-07 08:18 | 57K | |
| gpu-firmware-radeon-..> | 2023-10-06 23:48 | 3.6K | |
| gpu-firmware-radeon-..> | 2023-10-07 00:08 | 17K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:18 | 2.4K | |
| gpu-firmware-radeon-..> | 2023-10-07 00:31 | 2.4K | |
| gpu-firmware-radeon-..> | 2023-10-06 23:46 | 66K | |
| gpu-firmware-radeon-..> | 2023-10-07 05:45 | 7.0K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:36 | 7.0K | |
| gpu-firmware-radeon-..> | 2023-10-07 08:24 | 7.0K | |
| gpu-firmware-radeon-..> | 2023-10-07 06:31 | 7.0K | |
| gpu-firmware-radeon-..> | 2023-10-07 07:30 | 7.0K | |
| gpu-firmware-radeon-..> | 2023-10-06 23:58 | 82K | |
| gpu-firmware-radeon-..> | 2023-10-07 03:35 | 12K | |
| gpu-firmware-radeon-..> | 2023-10-07 08:13 | 7.8K | |
| gpu-firmware-radeon-..> | 2023-10-06 23:40 | 71K | |
| gpu-firmware-radeon-..> | 2023-10-07 01:21 | 125K | |
| gpu-firmware-radeon-..> | 2023-10-07 09:35 | 6.5K | |
| gpu-firmware-radeon-..> | 2023-10-07 02:50 | 230K | |
| gpu-firmware-radeon-..> | 2023-10-07 07:16 | 24K | |
| gpu-firmware-radeon-..> | 2023-10-07 08:20 | 73K | |
| gputils-1.5.2.pkg | 2023-10-07 08:05 | 1.0M | |
| gpx2map-0.2_2.pkg | 2023-10-14 04:14 | 17K | |
| gpxloggerd-0.2.5.pkg | 2023-10-09 12:14 | 9.2K | |
| gpxsee-7.32_1.pkg | 2023-10-08 12:16 | 643K | |
| gq-1.3.4_19,1.pkg | 2023-10-14 14:08 | 186K | |
| gqlplus-1.16_2.pkg | 2023-10-14 15:05 | 19K | |
| gqradio-1.9.2_14.pkg | 2023-10-08 18:02 | 269K | |
| gqrx-2.16_2,1.pkg | 2023-10-10 00:07 | 484K | |
| gr-osmosdr-0.2.3_6,1..> | 2023-10-07 19:31 | 322K | |
| grabc-1.1_4.pkg | 2023-10-09 08:30 | 4.1K | |
| grace-5.1.25_10.pkg | 2023-10-07 08:24 | 1.6M | |
| gracer-0.1.5_25.pkg | 2023-10-10 03:28 | 333K | |
| gracula-3.0_1.pkg | 2023-10-07 11:00 | 85K | |
| gradle-8.2.1.pkg | 2023-10-08 01:15 | 121M | |
| gradle-completion-1...> | 2023-10-09 08:29 | 7.7K | |
| gradle5-5.0.pkg | 2023-10-07 22:46 | 79M | |
| gradle6-6.9.4.pkg | 2023-10-07 06:24 | 101M | |
| gradle62-6.2.2_1.pkg | 2023-10-06 21:00 | 91M | |
| gradle761-7.6.1.pkg | 2023-10-07 19:58 | 115M | |
| grads-1.9b4_18.pkg | 2023-10-08 18:53 | 3.2M | |
| grafana-loki-2.8.1_2..> | 2023-10-14 08:24 | 47M | |
| grafana8-8.5.27_2.pkg | 2023-10-14 15:05 | 53M | |
| grafana9-9.5.7_2.pkg | 2023-10-08 17:56 | 52M | |
| graffer-1.1_2.pkg | 2023-10-09 23:24 | 48K | |
| grafx2-2.8_1.pkg | 2023-10-09 14:39 | 716K | |
| grails-1.3.6.pkg | 2023-10-10 17:33 | 41M | |
| gramofile-1.6P_15.pkg | 2023-10-09 01:15 | 56K | |
| gramps-5.1.6.pkg | 2023-10-09 16:28 | 8.1M | |
| granatier-23.08.1.pkg | 2023-10-06 23:54 | 2.1M | |
| granite-6.2.0_1.pkg | 2023-10-07 17:16 | 283K | |
| grantlee-editor-23.0..> | 2023-10-07 06:31 | 223K | |
| grantlee5-5.3.0.pkg | 2023-10-06 08:01 | 257K | |
| grantleetheme-23.08...> | 2023-10-06 09:46 | 50K | |
| granulate-0.2.pkg | 2023-10-08 19:30 | 4.8K | |
| grap-1.46.pkg | 2023-10-14 06:44 | 133K | |
| graphene-1.10.8.pkg | 2023-10-06 09:00 | 194K | |
| graphite2-1.3.14.pkg | 2023-10-05 17:37 | 84K | |
| graphlan-1.1.3_1.pkg | 2023-10-09 01:16 | 50K | |
| graphos-0.7_3.pkg | 2023-10-10 02:00 | 92K | |
| graphpath-1.2.pkg | 2023-10-08 19:10 | 5.7K | |
| graphviz-8.1.0_1.pkg | 2023-10-05 21:05 | 2.8M | |
| grass7-7.8.7_10.pkg | 2023-10-08 01:40 | 44M | |
| grass8-8.2.1_5.pkg | 2023-10-08 08:50 | 43M | |
| graveman-0.3.12.5_16..> | 2023-10-10 06:22 | 513K | |
| gravity-lang-0.8.5.pkg | 2023-10-10 21:53 | 120K | |
| graylog-5.1.4.pkg | 2023-10-09 11:27 | 246M | |
| graywolf-0.1.6.4_4.pkg | 2023-10-08 11:22 | 376K | |
| grc-1.13.pkg | 2023-10-08 19:29 | 30K | |
| grc-aspell-0.02.0.pkg | 2023-10-10 02:45 | 6.2M | |
| grcov-0.8.19_1.pkg | 2023-10-09 22:30 | 1.6M | |
| greed-game-4.2.pkg | 2023-10-09 02:03 | 10K | |
| gregarius-0.6.1_1.pkg | 2023-10-09 18:19 | 414K | |
| grepcidr-2.0.pkg | 2023-10-09 14:52 | 13K | |
| grepip-1.0_3.pkg | 2023-10-14 13:18 | 13K | |
| greple-8.3304.pkg | 2023-10-10 17:46 | 55K | |
| grepmail-5.3033_1.pkg | 2023-10-09 13:42 | 26K | |
| gretl-2023b.pkg | 2023-10-14 16:08 | 13M | |
| grex-1.4.2_1.pkg | 2023-10-09 18:19 | 656K | |
| greybird-theme-3.23...> | 2023-10-08 04:49 | 202K | |
| greyfix-0.4.0_1.pkg | 2023-10-10 16:26 | 14K | |
| greylite-2.3_5.pkg | 2023-10-14 16:19 | 19K | |
| gri-2.12.23_13.pkg | 2023-10-09 17:55 | 1.4M | |
| grib_api-1.28.0_7.pkg | 2023-10-14 06:04 | 1.4M | |
| griels-quest-git2015..> | 2023-10-08 15:02 | 6.0M | |
| griffith-0.15.pkg | 2023-10-10 01:04 | 471K | |
| grig-0.9.0_2.pkg | 2023-10-14 11:23 | 116K | |
| grilo-0.3.15.pkg | 2023-10-06 13:14 | 211K | |
| grilo-plugins-0.3.15..> | 2023-10-06 14:31 | 292K | |
| grim-1.4.1_1.pkg | 2023-10-08 04:53 | 13K | |
| grimshot-1.8.1.pkg | 2023-10-11 11:42 | 3.8K | |
| grip-4.2.4_2.pkg | 2023-10-09 16:54 | 443K | |
| grisbi-2.0.5_3.pkg | 2023-10-14 11:23 | 5.5M | |
| grive2-0.5.2.d_4.pkg | 2023-10-10 21:31 | 196K | |
| groff-1.23.0_1.pkg | 2023-10-05 17:55 | 2.9M | |
| grok_exporter-1.0.0...> | 2023-10-09 02:46 | 2.6M | |
| gromacs-2023.2_1.pkg | 2023-10-07 17:31 | 4.5M | |
| gromit-20041213_9.pkg | 2023-10-10 07:04 | 16K | |
| gromit-mpx-1.4.3_1.pkg | 2023-10-14 10:26 | 33K | |
| gron-0.6.1_13.pkg | 2023-10-09 17:43 | 1.7M | |
| gron.awk-0.2.0.pkg | 2023-10-08 17:08 | 4.3K | |
| groonga-13.0.1.pkg | 2023-10-07 22:44 | 4.2M | |
| groovy-2.4.21.pkg | 2023-10-11 02:28 | 23M | |
| groupoffice-6.6.58.pkg | 2023-10-09 00:58 | 42M | |
| growl-for-linux-0.8...> | 2023-10-09 13:38 | 384K | |
| grpc-1.54.2_1,2.pkg | 2023-10-06 13:19 | 3.2M | |
| grpc142-1.42.0_5.pkg | 2023-10-07 11:49 | 2.1M | |
| grpcox-1.0.0_14.pkg | 2023-10-14 16:40 | 2.9M | |
| grpcui-1.3.1_11.pkg | 2023-10-11 00:56 | 5.8M | |
| grpcurl-1.8.7_10.pkg | 2023-10-09 12:02 | 4.6M | |
| grpn-1.5.2_1.pkg | 2023-10-10 02:11 | 44K | |
| grr-1.0_10.pkg | 2023-10-09 04:13 | 109K | |
| grsync-1.3.1.pkg | 2023-10-11 11:43 | 140K | |
| grub2-bhyve-0.40_10.pkg | 2023-10-07 06:23 | 461K | |
| grub2-efi-2.02_21.pkg | 2023-10-14 09:38 | 772K | |
| grub2-pcbsd-2.02q_18..> | 2023-10-08 03:42 | 4.8M | |
| grubik-0.1_11.pkg | 2023-10-07 23:19 | 12K | |
| gruftistats-0.2.4_1.pkg | 2023-10-10 03:25 | 36K | |
| grv-0.3.2_21.pkg | 2023-10-10 05:26 | 6.4M | |
| grx-2.4.9_4.pkg | 2023-10-09 14:40 | 641K | |
| grzip-0.3.0_3.pkg | 2023-10-09 22:09 | 43K | |
| gsa-22.4.1_1.pkg | 2023-10-07 17:34 | 4.6M | |
| gsad-22.4.1_1.pkg | 2023-10-07 09:26 | 92K | |
| gsasl-2.2.0.pkg | 2023-10-10 11:47 | 140K | |
| gscheme-0.6_10.pkg | 2023-10-08 10:18 | 68K | |
| gscloud-0.13.0_1.pkg | 2023-10-14 16:36 | 3.7M | |
| gsed-4.9.pkg | 2023-10-05 17:35 | 315K | |
| gsequencer-5.4.3_1.pkg | 2023-10-10 01:27 | 4.4M | |
| gsettings-desktop-sc..> | 2023-10-05 17:53 | 598K | |
| gsfonts-8.11_8.pkg | 2023-10-05 16:39 | 4.0M | |
| gsh-1.1.0.pkg | 2023-10-08 13:27 | 13K | |
| gshhg-gmt-2.3.7.pkg | 2023-10-08 08:54 | 54M | |
| gshisen-1.3.0_9.pkg | 2023-10-08 09:19 | 36K | |
| gsimplecal-2.5.pkg | 2023-10-09 11:02 | 25K | |
| gsk-1.0.63_2.pkg | 2023-10-14 18:44 | 662K | |
| gskrab-0.0.1_12.pkg | 2023-10-08 11:29 | 18K | |
| gsl-2.7.1.pkg | 2023-10-05 17:17 | 1.9M | |
| gsm-1.0.19.pkg | 2023-10-05 17:02 | 41K | |
| gsmartcontrol-1.1.4_..> | 2023-10-11 17:45 | 489K | |
| gsmc-1.1_6.pkg | 2023-10-10 16:55 | 33K | |
| gsnmp-0.2.0_3.pkg | 2023-10-14 03:54 | 54K | |
| gsoap-2.8.130.pkg | 2023-10-07 04:09 | 1.3M | |
| gsocket-1.4.28_1.pkg | 2023-10-08 12:06 | 82K | |
| gsound-1.0.3.pkg | 2023-10-06 16:48 | 21K | |
| gspdf-0.5_11.pkg | 2023-10-08 07:56 | 42K | |
| gspell-1.10.0_3.pkg | 2023-10-06 23:09 | 109K | |
| gspiceui-1.1.00_6.pkg | 2023-10-10 01:05 | 683K | |
| gspoof-3.2_18.pkg | 2023-10-10 10:36 | 14K | |
| gssdp-1.6.2_1.pkg | 2023-10-07 04:22 | 51K | |
| gssdp14-1.4.1_1.pkg | 2023-10-07 02:22 | 49K | |
| gst123-0.3.3_4.pkg | 2023-10-14 06:27 | 42K | |
| gstat-rs-0.1.3_3.pkg | 2023-10-09 02:51 | 585K | |
| gstopd-1.1.pkg | 2023-10-14 16:19 | 5.4K | |
| gstreamer1-1.22.5.pkg | 2023-10-05 17:53 | 1.6M | |
| gstreamer1-editing-s..> | 2023-10-07 17:14 | 456K | |
| gstreamer1-libav-1.2..> | 2023-10-06 09:00 | 80K | |
| gstreamer1-plugins-1..> | 2023-10-05 17:56 | 1.7M | |
| gstreamer1-plugins-a..> | 2023-10-06 09:02 | 8.7K | |
| gstreamer1-plugins-a..> | 2023-10-08 07:53 | 11K | |
| gstreamer1-plugins-a..> | 2023-10-14 04:39 | 1.3K | |
| gstreamer1-plugins-a..> | 2023-10-07 19:48 | 6.9K | |
| gstreamer1-plugins-a..> | 2023-10-07 17:42 | 4.8K | |
| gstreamer1-plugins-a..> | 2023-10-07 16:23 | 15K | |
| gstreamer1-plugins-a..> | 2023-10-08 03:02 | 16K | |
| gstreamer1-plugins-b..> | 2023-10-06 07:54 | 1.9M | |
| gstreamer1-plugins-b..> | 2023-10-07 16:31 | 5.8K | |
| gstreamer1-plugins-c..> | 2023-10-07 11:18 | 5.8K | |
| gstreamer1-plugins-c..> | 2023-10-07 21:21 | 7.3K | |
| gstreamer1-plugins-c..> | 2023-10-07 17:03 | 7.2K | |
| gstreamer1-plugins-c..> | 2023-10-06 13:19 | 5.2K | |
| gstreamer1-plugins-c..> | 2023-10-06 09:23 | 756 | |
| gstreamer1-plugins-c..> | 2023-10-06 14:44 | 39K | |
| gstreamer1-plugins-d..> | 2023-10-07 23:17 | 73K | |
| gstreamer1-plugins-d..> | 2023-10-08 03:50 | 32K | |
| gstreamer1-plugins-d..> | 2023-10-06 08:59 | 7.9K | |
| gstreamer1-plugins-d..> | 2023-10-07 23:40 | 19K | |
| gstreamer1-plugins-d..> | 2023-10-06 08:44 | 17K | |
| gstreamer1-plugins-f..> | 2023-10-07 01:31 | 8.9K | |
| gstreamer1-plugins-f..> | 2023-10-07 05:30 | 9.1K | |
| gstreamer1-plugins-f..> | 2023-10-07 07:00 | 23K | |
| gstreamer1-plugins-f..> | 2023-10-07 19:51 | 5.9K | |
| gstreamer1-plugins-g..> | 2023-10-08 08:10 | 15K | |
| gstreamer1-plugins-g..> | 2023-10-06 09:17 | 335K | |
| gstreamer1-plugins-g..> | 2023-10-07 18:38 | 7.2K | |
| gstreamer1-plugins-g..> | 2023-10-07 19:53 | 44K | |
| gstreamer1-plugins-g..> | 2023-10-06 08:34 | 1.6M | |
| gstreamer1-plugins-g..> | 2023-10-07 18:13 | 6.0K | |
| gstreamer1-plugins-g..> | 2023-10-08 04:33 | 18K | |
| gstreamer1-plugins-h..> | 2023-10-07 10:55 | 37K | |
| gstreamer1-plugins-j..> | 2023-10-07 10:15 | 18K | |
| gstreamer1-plugins-j..> | 2023-10-06 16:39 | 19K | |
| gstreamer1-plugins-k..> | 2023-10-07 10:06 | 25K | |
| gstreamer1-plugins-l..> | 2023-10-08 03:34 | 18K | |
| gstreamer1-plugins-l..> | 2023-10-07 00:46 | 10K | |
| gstreamer1-plugins-l..> | 2023-10-07 15:06 | 7.8K | |
| gstreamer1-plugins-l..> | 2023-10-08 04:38 | 11K | |
| gstreamer1-plugins-l..> | 2023-10-07 22:17 | 6.3K | |
| gstreamer1-plugins-l..> | 2023-10-08 08:26 | 20K | |
| gstreamer1-plugins-m..> | 2023-10-07 17:37 | 10K | |
| gstreamer1-plugins-m..> | 2023-10-07 15:17 | 12K | |
| gstreamer1-plugins-m..> | 2023-10-08 00:05 | 18K | |
| gstreamer1-plugins-m..> | 2023-10-06 09:03 | 9.6K | |
| gstreamer1-plugins-m..> | 2023-10-07 12:53 | 14K | |
| gstreamer1-plugins-m..> | 2023-10-09 09:03 | 108K | |
| gstreamer1-plugins-m..> | 2023-10-07 22:31 | 9.6K | |
| gstreamer1-plugins-n..> | 2023-10-07 16:36 | 11K | |
| gstreamer1-plugins-o..> | 2023-10-06 08:40 | 83K | |
| gstreamer1-plugins-o..> | 2023-10-08 08:17 | 72K | |
| gstreamer1-plugins-o..> | 2023-10-08 08:56 | 8.5K | |
| gstreamer1-plugins-o..> | 2023-10-06 15:12 | 13K | |
| gstreamer1-plugins-o..> | 2023-10-07 11:32 | 26K | |
| gstreamer1-plugins-o..> | 2023-10-08 06:22 | 9.1K | |
| gstreamer1-plugins-o..> | 2023-10-07 20:57 | 22K | |
| gstreamer1-plugins-p..> | 2023-10-06 09:06 | 29K | |
| gstreamer1-plugins-p..> | 2023-10-06 08:54 | 11K | |
| gstreamer1-plugins-p..> | 2023-10-07 13:07 | 39K | |
| gstreamer1-plugins-q..> | 2023-10-07 23:42 | 49K | |
| gstreamer1-plugins-r..> | 2023-10-06 08:47 | 59K | |
| gstreamer1-plugins-r..> | 2023-10-07 14:21 | 9.0K | |
| gstreamer1-plugins-r..> | 2023-10-07 03:54 | 11K | |
| gstreamer1-plugins-r..> | 2023-10-07 16:27 | 17M | |
| gstreamer1-plugins-s..> | 2023-10-07 11:36 | 11K | |
| gstreamer1-plugins-s..> | 2023-10-08 00:53 | 8.7K | |
| gstreamer1-plugins-s..> | 2023-10-07 22:45 | 17K | |
| gstreamer1-plugins-s..> | 2023-10-07 14:38 | 11K | |
| gstreamer1-plugins-s..> | 2023-10-07 20:58 | 8.6K | |
| gstreamer1-plugins-s..> | 2023-10-08 00:22 | 11K | |
| gstreamer1-plugins-s..> | 2023-10-06 15:11 | 29K | |
| gstreamer1-plugins-s..> | 2023-10-08 05:48 | 9.0K | |
| gstreamer1-plugins-s..> | 2023-10-07 15:40 | 13K | |
| gstreamer1-plugins-s..> | 2023-10-09 00:10 | 22K | |
| gstreamer1-plugins-s..> | 2023-10-08 11:10 | 20K | |
| gstreamer1-plugins-s..> | 2023-10-09 23:10 | 9.3K | |
| gstreamer1-plugins-s..> | 2023-10-14 10:00 | 14K | |
| gstreamer1-plugins-s..> | 2023-10-10 19:38 | 8.9K | |
| gstreamer1-plugins-t..> | 2023-10-07 21:23 | 15K | |
| gstreamer1-plugins-t..> | 2023-10-06 09:08 | 21K | |
| gstreamer1-plugins-t..> | 2023-10-08 01:06 | 38K | |
| gstreamer1-plugins-t..> | 2023-10-07 22:29 | 10K | |
| gstreamer1-plugins-u..> | 2023-10-06 08:28 | 124K | |
| gstreamer1-plugins-v..> | 2023-10-06 15:56 | 113K | |
| gstreamer1-plugins-v..> | 2023-10-06 08:43 | 20K | |
| gstreamer1-plugins-v..> | 2023-10-06 14:52 | 29K | |
| gstreamer1-plugins-v..> | 2023-10-08 06:34 | 198K | |
| gstreamer1-plugins-w..> | 2023-10-07 02:57 | 15K | |
| gstreamer1-plugins-w..> | 2023-10-08 07:11 | 8.5K | |
| gstreamer1-plugins-w..> | 2023-10-07 10:23 | 14K | |
| gstreamer1-plugins-x..> | 2023-10-07 02:42 | 41K | |
| gstreamer1-plugins-x..> | 2023-10-08 02:03 | 23K | |
| gstreamer1-plugins-x..> | 2023-10-08 09:15 | 16K | |
| gstreamer1-plugins-x..> | 2023-10-07 11:01 | 16K | |
| gstreamer1-plugins-z..> | 2023-10-07 12:51 | 5.6K | |
| gstreamer1-plugins-z..> | 2023-10-07 17:10 | 6.7K | |
| gstreamer1-qt5-1.2.0..> | 2023-10-07 11:03 | 236K | |
| gstreamer1-rtsp-serv..> | 2023-10-07 00:41 | 242K | |
| gstreamer1-vaapi-1.2..> | 2023-10-10 02:33 | 276K | |
| gstreamer1-validate-..> | 2023-10-08 11:43 | 349K | |
| gstreamermm-1.10.0_3..> | 2023-10-08 09:51 | 611K | |
| gtamsanalyzer-0.42_1..> | 2023-10-07 17:19 | 349K | |
| gtar-1.35.pkg | 2023-10-06 15:45 | 707K | |
| gtgt-3.2.0_1.pkg | 2023-10-14 04:06 | 287K | |
| gthumb-3.12.2_6.pkg | 2023-10-10 01:35 | 2.6M | |
| gti-1.8.0.pkg | 2023-10-09 12:23 | 6.3K | |
| gtick-0.5.5_4.pkg | 2023-10-14 08:10 | 114K | |
| gtimelapse-0.1_17.pkg | 2023-10-09 18:22 | 45K | |
| gtimer-2.0.0_5.pkg | 2023-10-10 17:02 | 68K | |
| gtk-E17-theme-3.22.2..> | 2023-10-08 17:09 | 100K | |
| gtk-aluminumalloy-cr..> | 2023-10-14 15:07 | 156K | |
| gtk-aluminumalloy-sm..> | 2023-10-09 14:53 | 157K | |
| gtk-aluminumalloy-to..> | 2023-10-10 09:30 | 154K | |
| gtk-aluminumalloy-vo..> | 2023-10-10 09:42 | 154K | |
| gtk-aquaextremesunke..> | 2023-10-10 16:44 | 173K | |
| gtk-arc-themes-20220..> | 2023-10-11 07:52 | 271K | |
| gtk-digital-cream-th..> | 2023-10-08 13:14 | 142K | |
| gtk-digital-harmony-..> | 2023-10-14 04:53 | 107K | |
| gtk-doc-1.33.2_2.pkg | 2023-10-05 17:21 | 343K | |
| gtk-engines2-2.20.2_..> | 2023-10-06 22:24 | 209K | |
| gtk-equinox-engine-1..> | 2023-10-11 08:29 | 472K | |
| gtk-gnutella-1.2.2_3..> | 2023-10-08 20:00 | 17M | |
| gtk-gray-theme-1.7_8..> | 2023-10-10 12:54 | 34K | |
| gtk-layer-shell-0.8...> | 2023-10-06 15:45 | 69K | |
| gtk-lila-theme-0.5.5..> | 2023-10-08 13:53 | 9.8K | |
| gtk-lila-theme-extra..> | 2023-10-14 16:55 | 8.3K | |
| gtk-longhorninspirat..> | 2023-10-08 23:57 | 109K | |
| gtk-milk-theme-2.1_9..> | 2023-10-14 10:08 | 58K | |
| gtk-mixer-1.0.3_1.pkg | 2023-10-08 19:28 | 19K | |
| gtk-murrina-aqua-0.1..> | 2023-10-14 05:16 | 2.0K | |
| gtk-murrine-engine-0..> | 2023-10-06 19:55 | 75K | |
| gtk-nodoka-engine-0...> | 2023-10-09 17:57 | 36K | |
| gtk-oxygen-engine-1...> | 2023-10-09 23:23 | 348K | |
| gtk-pipe-viewer-0.4...> | 2023-10-10 09:42 | 261K | |
| gtk-sharp-beans-2.14..> | 2023-10-10 20:00 | 14K | |
| gtk-sharp20-2.12.45_..> | 2023-10-07 09:50 | 3.0M | |
| gtk-sharp30-2.99.3_6..> | 2023-10-08 05:17 | 3.0M | |
| gtk-theme-switch-2.0..> | 2023-10-10 14:30 | 11K | |
| gtk-update-icon-cach..> | 2023-10-05 17:51 | 67K | |
| gtk-vnc-1.3.1_3.pkg | 2023-10-07 03:35 | 129K | |
| gtk-xfce-engine-3.2...> | 2023-10-08 13:36 | 25K | |
| gtk2-2.24.33_1.pkg | 2023-10-06 14:42 | 5.3M | |
| gtk2-qtcurve-theme-1..> | 2023-10-08 04:58 | 150K | |
| gtk3-3.24.34_1.pkg | 2023-10-05 22:35 | 11M | |
| gtk3-oxygen-engine-1..> | 2023-10-08 20:23 | 329K | |
| gtk3-unico-engine-1...> | 2023-10-10 03:53 | 6.4K | |
| gtk4-4.12.1.pkg | 2023-10-06 11:33 | 9.6M | |
| gtk4-layer-shell-1.0..> | 2023-10-10 11:59 | 36K | |
| gtkam-1.0_7.pkg | 2023-10-14 04:21 | 139K | |
| gtkatlantic-0.6.3_3.pkg | 2023-10-14 18:53 | 236K | |
| gtkballs-3.1.5_14.pkg | 2023-10-09 05:53 | 572K | |
| gtkchtheme-0.3.1_12.pkg | 2023-10-09 16:45 | 12K | |
| gtkcord4-0.0.12_1.pkg | 2023-10-14 11:00 | 8.7M | |
| gtkd-3.10.0_3.pkg | 2023-10-07 21:43 | 5.9M | |
| gtkdatabox-1.0.0.pkg | 2023-10-07 21:42 | 109K | |
| gtkevemon-1.10.2016...> | 2023-10-08 16:37 | 347K | |
| gtkextra-3.3.4_1.pkg | 2023-10-08 06:15 | 653K | |
| gtkglarea-2.0.1_12.pkg | 2023-10-07 04:59 | 13K | |
| gtkglext-1.2.0_21.pkg | 2023-10-07 02:18 | 244K | |
| gtkglextmm-1.2.0_16.pkg | 2023-10-07 12:48 | 271K | |
| gtkguitune-0.8_13.pkg | 2023-10-11 22:12 | 40K | |
| gtkhtml4-4.10.0_3.pkg | 2023-10-07 11:15 | 640K | |
| gtkimageview-1.6.4_6..> | 2023-10-07 04:11 | 338K | |
| gtklp-1.3.4_1.pkg | 2023-10-09 16:37 | 135K | |
| gtkmm24-2.24.5_4.pkg | 2023-10-07 08:13 | 1.1M | |
| gtkmm30-3.24.2_3.pkg | 2023-10-06 22:36 | 1.4M | |
| gtkmmorse-0.9.27_6.pkg | 2023-10-14 03:39 | 50K | |
| gtkpasman-0.12.1_2.pkg | 2023-10-10 18:00 | 14K | |
| gtkperf-0.40_11.pkg | 2023-10-09 13:40 | 31K | |
| gtkpod-1.0.0_13.pkg | 2023-10-11 00:14 | 1.1M | |
| gtkradiant-1.5.0_19.pkg | 2023-10-10 00:51 | 2.4M | |
| gtksourceview2-2.10...> | 2023-10-07 03:49 | 618K | |
| gtksourceview3-3.24...> | 2023-10-06 20:23 | 667K | |
| gtksourceview4-4.8.3..> | 2023-10-06 17:27 | 810K | |
| gtksourceview5-5.4.2..> | 2023-10-06 17:28 | 920K | |
| gtksourceviewmm3-3.1..> | 2023-10-08 01:25 | 113K | |
| gtkspell-2.0.16_7.pkg | 2023-10-06 23:54 | 23K | |
| gtkspell3-3.0.10_1.pkg | 2023-10-06 20:05 | 36K | |
| gtkterm2-0.2.3_13.pkg | 2023-10-12 06:29 | 19K | |
| gtkwave-3.3.117.pkg | 2023-10-07 17:41 | 2.3M | |
| gtmixer-1.0.2_3.pkg | 2023-10-09 11:55 | 103K | |
| gtorrentviewer-0.2b_..> | 2023-10-14 09:26 | 77K | |
| gtranslator-40.0_3.pkg | 2023-10-09 23:39 | 628K | |
| gts-0.7.6_5.pkg | 2023-10-07 09:14 | 267K | |
| gtultra-1.5.5.pkg | 2023-10-10 15:15 | 636K | |
| gtypist-2.9.5_2.pkg | 2023-10-09 22:39 | 600K | |
| gu-aspell-0.03.0_1,2..> | 2023-10-11 01:24 | 487K | |
| gu-libreoffice-7.5.5..> | 2023-10-07 21:04 | 2.7M | |
| guacamole-client-1.5..> | 2023-10-09 18:48 | 61M | |
| guacamole-server-1.5..> | 2023-10-07 16:52 | 346K | |
| guake-3.4.0_4.pkg | 2023-10-10 05:54 | 887K | |
| gubby-0.5.5.pkg | 2023-10-09 18:02 | 33K | |
| gucharmap-15.1.0.pkg | 2023-10-07 06:57 | 1.7M | |
| guetzli-1.0.1_5.pkg | 2023-10-10 06:32 | 105K | |
| gug-libreoffice-7.5...> | 2023-10-07 14:13 | 350K | |
| guichan-0.8.2_15.pkg | 2023-10-08 02:04 | 234K | |
| guidoar-g20210127.pkg | 2023-10-07 22:40 | 274K | |
| guidolib-1.7.1,1.pkg | 2023-10-07 19:59 | 2.7M | |
| guifi-snpservices-0...> | 2023-10-14 04:01 | 31K | |
| guile-aclocal-3.0.9_..> | 2023-10-05 16:39 | 4.9K | |
| guile-cairo-guile22-..> | 2023-10-07 14:31 | 90K | |
| guile-cairo-guile30-..> | 2023-10-14 16:00 | 93K | |
| guile-gnome-platform..> | 2023-10-08 17:14 | 835K | |
| guile-gnome-platform..> | 2023-10-09 21:47 | 835K | |
| guile-lib-guile22-0...> | 2023-10-07 18:32 | 289K | |
| guile-lib-guile30-0...> | 2023-10-07 19:25 | 356K | |
| guile-meta-4.pkg | 2023-10-14 09:13 | 832 | |
| guile-www-1.1.1_5.pkg | 2023-10-09 11:07 | 11K | |
| guile1-1.8.8_1.pkg | 2023-10-07 05:43 | 1.3M | |
| guile2-2.2.7_5.pkg | 2023-10-06 13:26 | 5.7M | |
| guile3-3.0.9_1.pkg | 2023-10-06 22:52 | 7.4M | |
| guilib-1.2.1_5.pkg | 2023-10-09 13:11 | 43K | |
| guitarix-0.44.1_7.pkg | 2023-10-09 10:21 | 30M | |
| gula-plugins-lv2-g20..> | 2023-10-11 02:31 | 2.9M | |
| gum-0.11.0_3.pkg | 2023-10-08 17:48 | 2.8M | |
| gumbo-0.10.1.pkg | 2023-10-06 17:38 | 153K | |
| gummi-0.8.1_23.pkg | 2023-10-10 17:43 | 286K | |
| gunfudeadlands-1.01_..> | 2023-10-10 15:15 | 4.9M | |
| gup-0.4.pkg | 2023-10-10 02:37 | 19K | |
| gupnp-1.6.5.pkg | 2023-10-07 19:40 | 150K | |
| gupnp-av-0.14.1_1.pkg | 2023-10-08 10:53 | 132K | |
| gupnp-dlna-0.10.3_5.pkg | 2023-10-08 21:08 | 127K | |
| gupnp-igd-1.6.0.pkg | 2023-10-09 21:24 | 21K | |
| gupnp-igd12-1.2.0.pkg | 2023-10-10 09:53 | 21K | |
| gupnp-tools-0.12.1.pkg | 2023-10-08 17:59 | 167K | |
| gupnp-ui-0.1.1_10.pkg | 2023-10-09 06:59 | 15K | |
| gupnp14-1.4.4_1.pkg | 2023-10-07 13:37 | 149K | |
| gurl-0.2.3_14.pkg | 2023-10-09 08:39 | 1.7M | |
| guspat-20000706_2.pkg | 2023-10-07 13:19 | 20M | |
| gutenfetch-1.5_1.pkg | 2023-10-14 09:37 | 11K | |
| gutenprint-5.3.4.pkg | 2023-10-07 06:13 | 17M | |
| gv-3.7.4_5.pkg | 2023-10-08 13:17 | 163K | |
| gv-aspell-0.50.0_1,1..> | 2023-10-09 15:25 | 213K | |
| gvfs-1.50.2_1.pkg | 2023-10-06 16:40 | 947K | |
| gvm-22.7.0.pkg | 2023-10-14 04:54 | 2.9K | |
| gvm-libs-22.6.0.pkg | 2023-10-06 22:46 | 106K | |
| gvmd-22.4.2_1.pkg | 2023-10-08 00:10 | 602K | |
| gvolwheel-1.0.3_1.pkg | 2023-10-08 17:13 | 14K | |
| gvp-0.3.0_14.pkg | 2023-10-14 05:12 | 2.2K | |
| gwenhywfar-5.10.2.pkg | 2023-10-07 01:45 | 712K | |
| gwenhywfar-fox16-5.1..> | 2023-10-14 12:10 | 45K | |
| gwenhywfar-gtk2-5.10..> | 2023-10-08 13:10 | 24K | |
| gwenhywfar-gtk3-5.10..> | 2023-10-07 17:38 | 23K | |
| gwenhywfar-qt5-5.10...> | 2023-10-08 06:48 | 26K | |
| gwenview-23.08.1.pkg | 2023-10-07 09:47 | 6.6M | |
| gwhich-2.21_1.pkg | 2023-10-08 19:41 | 14K | |
| gwhois-20120626.pkg | 2023-10-09 21:42 | 19K | |
| gworkspace-1.0.0_1.pkg | 2023-10-07 06:37 | 906K | |
| gworkspace-gwmetadat..> | 2023-10-08 01:57 | 253K | |
| gwsocket-0.3.pkg | 2023-10-09 17:32 | 28K | |
| gxemul-0.7.0.pkg | 2023-10-09 19:58 | 5.0M | |
| gxkb-0.9.3_1.pkg | 2023-10-14 15:16 | 45K | |
| gxmessage-3.4.3_2.pkg | 2023-10-09 14:15 | 31K | |
| gxneur-0.20.0_4.pkg | 2023-10-10 12:00 | 341K | |
| gxplugins-lv2-1.0.pkg | 2023-10-09 00:53 | 4.4M | |
| gzdoom-4.7.1_6.pkg | 2023-10-09 06:07 | 14M | |
| gzip-1.12.pkg | 2023-10-07 07:22 | 167K | |
| gzip-hpp-0.1.0.1.pkg | 2023-10-09 21:12 | 3.0K | |
| gzrecover-0.8.pkg | 2023-10-09 18:00 | 6.6K | |
| gzstream-1.5_3.pkg | 2023-10-07 00:45 | 6.7K | |
| h2c-1.0.pkg | 2023-10-11 12:56 | 3.9K | |
| h2o-2.2.6_1.pkg | 2023-10-08 09:09 | 1.9M | |
| h2o-devel-2.3.0.d.20..> | 2023-10-08 13:28 | 2.2M | |
| h3-3.7.2_1.pkg | 2023-10-07 01:50 | 65K | |
| h5utils-1.13.2_2.pkg | 2023-10-09 04:31 | 69K | |
| h5z-zfp-1.1.1.pkg | 2023-10-14 17:57 | 14K | |
| h323plus-1.27.2.pkg | 2023-10-10 14:37 | 2.2M | |
| ha-0.999b_2.pkg | 2023-10-09 04:54 | 30K | |
| habak-0.2.5.pkg | 2023-10-08 21:29 | 8.9K | |
| habari-0.8.pkg | 2023-10-10 04:57 | 2.5M | |
| hack-font-3.003_1.pkg | 2023-10-06 11:36 | 353K | |
| hackrf-2021.03.1_1.pkg | 2023-10-07 21:20 | 44K | |
| hackrf-devel-g2021.0..> | 2023-10-09 14:31 | 44K | |
| half-2.2.0.pkg | 2023-10-07 20:08 | 29K | |
| halibut-1.2.pkg | 2023-10-07 12:27 | 759K | |
| halide-14.0.0,1.pkg | 2023-10-08 15:06 | 7.0M | |
| hamclock-2.80.pkg | 2023-10-10 20:10 | 264K | |
| hamcrest-1.3.pkg | 2023-10-06 15:47 | 341K | |
| hamlib-4.5.5.pkg | 2023-10-07 03:53 | 3.0M | |
| hanazono-fonts-ttf-2..> | 2023-10-10 03:24 | 21M | |
| handbrake-1.6.1_3.pkg | 2023-10-09 14:03 | 25M | |
| handlr-0.7.1_15.pkg | 2023-10-09 00:53 | 785K | |
| hangman-0.9.2_12.pkg | 2023-10-14 13:18 | 890K | |
| hans-1.0.pkg | 2023-10-10 23:51 | 24K | |
| haplohseq-0.1.2_9.pkg | 2023-10-11 00:32 | 7.9M | |
| haproxy-2.8.3.pkg | 2023-10-08 08:03 | 1.8M | |
| haproxy-devel-2.9.d4..> | 2023-10-10 04:40 | 1.8M | |
| haproxy-lua-2.8.3.pkg | 2023-10-09 05:21 | 1.9M | |
| haproxy20-2.0.33.pkg | 2023-10-07 20:00 | 1.3M | |
| haproxy22-2.2.31.pkg | 2023-10-10 02:58 | 1.4M | |
| haproxy24-2.4.24.pkg | 2023-10-10 19:13 | 1.8M | |
| haproxy24-lua-2.4.24..> | 2023-10-14 14:33 | 1.8M | |
| haproxy25-2.5.14_1.pkg | 2023-10-10 03:53 | 1.7M | |
| haproxy25-lua-2.5.14..> | 2023-10-14 12:16 | 1.8M | |
| haproxy26-2.6.15.pkg | 2023-10-09 22:47 | 1.7M | |
| haproxy26-lua-2.6.15..> | 2023-10-10 11:30 | 1.8M | |
| haproxy27-2.7.10.pkg | 2023-10-14 17:08 | 1.7M | |
| haproxy27-lua-2.7.10..> | 2023-10-09 16:26 | 1.8M | |
| haproxydevel-lua-2.9..> | 2023-10-10 07:45 | 1.9M | |
| hapy-0.0.8_1.pkg | 2023-10-14 06:20 | 60K | |
| hardening-check-2.6.pkg | 2023-10-10 05:23 | 5.3K | |
| hardlink-0.3.0.pkg | 2023-10-11 12:56 | 9.6K | |
| hare-1.0.pkg | 2023-10-14 09:36 | 9.2K | |
| harec-g20230719.pkg | 2023-10-08 11:55 | 91K | |
| hared-1.0.45_15.pkg | 2023-10-08 12:42 | 1.6M | |
| harfbuzz-8.2.1.pkg | 2023-10-05 17:51 | 1.0M | |
| harfbuzz-cairo-8.2.1..> | 2023-10-10 13:39 | 52K | |
| harfbuzz-icu-8.2.1.pkg | 2023-10-05 17:54 | 4.7K | |
| harminv-1.3.1_21.pkg | 2023-10-07 11:41 | 26K | |
| haruna-0.12.1.pkg | 2023-10-10 16:11 | 336K | |
| harvid-0.9.1_3.pkg | 2023-10-10 11:40 | 69K | |
| hash-g20200929.pkg | 2023-10-14 14:36 | 82K | |
| hashcash-1.22.pkg | 2023-10-10 15:26 | 83K | |
| hashcat-6.2.6,1.pkg | 2023-10-09 21:11 | 13M | |
| hashdb-3.1.0.8_1.pkg | 2023-10-10 19:35 | 331K | |
| hashicorp-serf-0.10...> | 2023-10-10 01:08 | 2.6M | |
| hashtypes-0.1.4.pkg | 2023-10-14 06:28 | 12K | |
| hastmon-0.3.4.pkg | 2023-10-14 11:46 | 71K | |
| hatari-2.3.1_1.pkg | 2023-10-10 01:52 | 1.7M | |
| hatop-0.8.1.pkg | 2023-10-14 17:06 | 20K | |
| havoc-0.3.1.pkg | 2023-10-14 07:01 | 51K | |
| hbiff-1.2_2.pkg | 2023-10-14 07:52 | 14K | |
| hblock-3.4.2.pkg | 2023-10-09 10:37 | 14K | |
| hcidump-1.5.1.pkg | 2023-10-09 03:46 | 17K | |
| hcloud-1.36.0_2.pkg | 2023-10-14 10:48 | 3.2M | |
| hcs12mem-1.4.1.pkg | 2023-10-09 23:07 | 55K | |
| hdf-4.2.15_3,1.pkg | 2023-10-07 10:51 | 811K | |
| hdf5-1.12.2_2,1.pkg | 2023-10-06 09:41 | 9.8M | |
| hdf5-18-1.8.23.pkg | 2023-10-12 05:00 | 5.6M | |
| hdf5-110-1.10.10.pkg | 2023-10-06 13:23 | 3.9M | |
| hdr_tools-0.0.2010.1..> | 2023-10-09 22:42 | 84K | |
| hdrecover-0.5.pkg | 2023-10-09 10:14 | 5.3K | |
| he-libreoffice-7.5.5..> | 2023-10-07 14:23 | 2.6M | |
| heaan-2.1.40_1.pkg | 2023-10-14 06:50 | 82K | |
| headscale-0.16.4_10.pkg | 2023-10-09 07:15 | 6.8M | |
| headsetcontrol-2.6.1..> | 2023-10-08 17:15 | 15K | |
| healpix-3.50_5.pkg | 2023-10-09 02:52 | 585K | |
| healpix-c-3.50_5.pkg | 2023-10-09 08:25 | 13K | |
| health-0.95.0_1.pkg | 2023-10-14 10:10 | 9.2M | |
| health-nut-20.1_3.pkg | 2023-10-09 00:01 | 1.0M | |
| healthd-0.7.9_2.pkg | 2023-10-11 15:18 | 25K | |
| heaptrack-1.4.0_4.pkg | 2023-10-10 03:57 | 515K | |
| hebcal-4.13.pkg | 2023-10-09 16:07 | 124K | |
| hedgewars-1.0.2_2.pkg | 2023-10-14 05:27 | 148M | |
| heimdal-7.8.0_6.pkg | 2023-10-08 07:31 | 2.6M | |
| heimdal-devel-2023.0..> | 2023-10-14 10:12 | 2.9M | |
| heimdall-1.4.2_5.pkg | 2023-10-14 18:20 | 93K | |
| heimer-4.2.0.pkg | 2023-10-10 02:34 | 269K | |
| heirloom-070715_4.pkg | 2023-10-08 18:33 | 1.1M | |
| heirloom-devtools-07..> | 2023-10-08 16:20 | 342K | |
| heirloom-doctools-19..> | 2023-10-10 02:33 | 846K | |
| heirloom-mailx-12.4_..> | 2023-10-09 11:21 | 236K | |
| heirloom-sh-050706_2..> | 2023-10-10 00:30 | 67K | |
| helfem-g20210912_9.pkg | 2023-10-11 04:24 | 1.2M | |
| helib-2.3.0.pkg | 2023-10-11 10:01 | 792K | |
| helix-23.05_4.pkg | 2023-10-10 15:05 | 9.3M | |
| hello-2.12.1.pkg | 2023-10-08 22:24 | 51K | |
| helm-3.12.3.pkg | 2023-10-07 15:01 | 14M | |
| helmfile-0.154.0_2.pkg | 2023-10-08 17:01 | 19M | |
| help2man-1.49.3.pkg | 2023-10-05 17:08 | 157K | |
| help_hannahs_horse-1..> | 2023-10-08 22:13 | 3.4M | |
| helpviewer-0.3_12.pkg | 2023-10-07 17:14 | 88K | |
| helvum-0.4.0_7.pkg | 2023-10-10 14:02 | 267K | |
| heme-0.4.2.pkg | 2023-10-10 01:46 | 19K | |
| hepmc3-3.2.6.pkg | 2023-10-08 08:54 | 311K | |
| herbe-1.0.0.pkg | 2023-10-10 14:40 | 6.6K | |
| herbstluftwm-0.9.5.pkg | 2023-10-14 08:00 | 505K | |
| hercules-3.13.pkg | 2023-10-09 15:52 | 1.3M | |
| heretic-1.2_9.pkg | 2023-10-08 20:16 | 1.9M | |
| hermes-javascript-en..> | 2023-10-10 01:54 | 1.7M | |
| hermit-font-2.0_1.pkg | 2023-10-10 20:43 | 84K | |
| heroes-0.21_19.pkg | 2023-10-09 22:27 | 1.7M | |
| hesiod-3.2.1_3.pkg | 2023-10-09 16:58 | 25K | |
| hetzner_ddns-0.2.4.pkg | 2023-10-11 00:43 | 4.1K | |
| hevea-2.36.pkg | 2023-10-07 07:34 | 2.4M | |
| hex-a-hop-1.1.0_6.pkg | 2023-10-14 10:27 | 8.3M | |
| hexalate-1.2.2_1.pkg | 2023-10-09 11:48 | 219K | |
| hexcalc-1.11_3.pkg | 2023-10-14 10:26 | 7.7K | |
| hexchat-2.16.1_3.pkg | 2023-10-08 08:14 | 1.0M | |
| hexchat-fishlim-0.0...> | 2023-10-08 19:40 | 7.9K | |
| hexcode-1.0.pkg | 2023-10-10 00:06 | 10K | |
| hexcompare-1.0.4.pkg | 2023-10-09 02:54 | 6.9K | |
| hexcurse-1.60.0.pkg | 2023-10-14 12:41 | 20K | |
| hexd-1.0.0_3.pkg | 2023-10-10 10:54 | 7.5K | |
| hexedit-1.6.pkg | 2023-10-10 12:47 | 20K | |
| hexer-1.0.3_1.pkg | 2023-10-14 16:11 | 92K | |
| hexinject-1.6.pkg | 2023-10-09 03:54 | 10K | |
| hexl-1.2.5.pkg | 2023-10-09 17:18 | 52K | |
| hexpeek-1.0.20200804..> | 2023-10-14 19:03 | 56K | |
| hexpert-2.4.1.pkg | 2023-10-08 21:52 | 8.0K | |
| hexter-1.0.3_3.pkg | 2023-10-11 19:47 | 111K | |
| hextools-1.2.pkg | 2023-10-14 17:55 | 12K | |
| hexxagon-1.0.2_4.pkg | 2023-10-08 19:23 | 823K | |
| hexyl-0.13.1_1.pkg | 2023-10-08 22:24 | 292K | |
| hey-0.1.4_15.pkg | 2023-10-09 04:23 | 2.1M | |
| heyoka-1.0.0_1.pkg | 2023-10-08 03:04 | 49M | |
| heyu2-2.10.3.pkg | 2023-10-10 01:47 | 384K | |
| hfsexplorer-2021.10...> | 2023-10-14 12:15 | 1.4M | |
| hfsutils-3.2.6_3.pkg | 2023-10-08 21:20 | 93K | |
| hhm-0.1.1.pkg | 2023-10-08 22:33 | 9.0K | |
| hhpc-0.3.1.pkg | 2023-10-14 15:06 | 6.3K | |
| hhsuite-3.3.0_2.pkg | 2023-10-10 10:33 | 7.3M | |
| hi-aspell-0.02.0_1,2..> | 2023-10-09 05:47 | 766K | |
| hi-libreoffice-7.5.5..> | 2023-10-08 09:49 | 2.6M | |
| hiawatha-11.2_1.pkg | 2023-10-09 20:42 | 129K | |
| hiawatha-monitor-php..> | 2023-10-14 10:58 | 536K | |
| hiawatha-monitor-php..> | 2023-10-09 21:42 | 536K | |
| hiawatha-monitor-php..> | 2023-10-14 14:54 | 536K | |
| hiawatha-monitor-php..> | 2023-10-10 00:51 | 536K | |
| hicolor-icon-theme-0..> | 2023-10-05 16:43 | 6.8K | |
| hid-tools-0.3.1.pkg | 2023-10-14 11:21 | 109K | |
| hidapi-0.14.0.pkg | 2023-10-05 17:35 | 34K | |
| higan-106_12.pkg | 2023-10-10 18:40 | 1.6M | |
| highfive-2.7.1_1.pkg | 2023-10-08 10:23 | 46K | |
| highlight-4.8,3.pkg | 2023-10-07 07:17 | 742K | |
| highlighterkit-0.1_1..> | 2023-10-07 10:46 | 20K | |
| highlnk-0.2.pkg | 2023-10-10 21:32 | 8.9K | |
| highmoon-1.2.4_12.pkg | 2023-10-09 01:48 | 376K | |
| highway-1.0.7.pkg | 2023-10-05 17:45 | 693K | |
| highwayhash-g2020102..> | 2023-10-08 07:25 | 84K | |
| hikari-2.3.3_4.pkg | 2023-10-12 11:03 | 946K | |
| hil-aspell-0.11.0_1,..> | 2023-10-09 02:39 | 111K | |
| hilite-1.5.pkg | 2023-10-10 12:58 | 3.3K | |
| himenobench-2015.07...> | 2023-10-09 00:46 | 22K | |
| hinversi-0.8.2_2.pkg | 2023-10-14 14:20 | 23K | |
| hiredis-1.0.2.pkg | 2023-10-06 16:22 | 126K | |
| hisat2-2.2.1_2.pkg | 2023-10-08 02:35 | 1.0M | |
| histring-1.1.1.1.pkg | 2023-10-14 11:54 | 5.4K | |
| hitch-1.7.3.pkg | 2023-10-14 10:59 | 80K | |
| hitori-3.38.4_1.pkg | 2023-10-07 08:05 | 148K | |
| hlextract-2.4.6.pkg | 2023-10-10 21:06 | 9.8K | |
| hllib-2.4.6.pkg | 2023-10-07 11:44 | 88K | |
| hlmaster-0.9.3.pkg | 2023-10-08 13:21 | 34K | |
| hmat-oss-1.8.1_1.pkg | 2023-10-10 16:25 | 304K | |
| hmmer-3.3.2.pkg | 2023-10-08 05:20 | 1.9M | |
| hnb-1.9.18.pkg | 2023-10-14 07:24 | 59K | |
| hobbes-icons-xpm3-1...> | 2023-10-10 21:08 | 504K | |
| hockeypuck-g20180725..> | 2023-10-09 12:54 | 5.7M | |
| hoel-1.4.27.pkg | 2023-10-07 10:06 | 25K | |
| holotz-castle-1.3.14..> | 2023-10-09 21:15 | 115M | |
| homebank-5.7.pkg | 2023-10-14 12:06 | 2.1M | |
| honeyd-1.5c_12.pkg | 2023-10-14 06:46 | 376K | |
| honeytrap-g20210510_..> | 2023-10-14 05:14 | 4.4M | |
| honggfuzz-0.7.pkg | 2023-10-11 08:22 | 27K | |
| horcrux-0.3_14.pkg | 2023-10-10 13:41 | 674K | |
| horizon-eda-2.5.0_1.pkg | 2023-10-08 16:47 | 6.4M | |
| host-setup-4.0.2.pkg | 2023-10-09 03:35 | 26K | |
| hostapd-2.10_8.pkg | 2023-10-08 19:19 | 233K | |
| hostapd-devel-2023.0..> | 2023-10-10 03:32 | 241K | |
| hostapd29-2.9_4.pkg | 2023-10-10 19:49 | 218K | |
| hostctl-1.1.4_2.pkg | 2023-10-14 05:35 | 2.6M | |
| hostdb-1.004_1.pkg | 2023-10-10 09:30 | 122K | |
| hot-babe-0.2.2_10.pkg | 2023-10-14 03:07 | 383K | |
| hotcrp-2.102_16.pkg | 2023-10-14 10:52 | 1.3M | |
| hotkeys-0.5.7.1_20.pkg | 2023-10-10 12:31 | 124K | |
| hotspot-1.4.1_2.pkg | 2023-10-10 17:15 | 658K | |
| hourglass-1.0.1.pkg | 2023-10-10 21:59 | 17K | |
| hoverboard-0.8.0_1.pkg | 2023-10-09 23:32 | 3.6M | |
| howdy-3.0.0.b.202303..> | 2023-10-07 23:02 | 34K | |
| howm-1.4.8_6.pkg | 2023-10-09 21:00 | 360K | |
| howm-emacs_canna-1.4..> | 2023-10-10 00:30 | 360K | |
| howm-emacs_nox-1.4.8..> | 2023-10-09 14:05 | 360K | |
| hp2xx-3.4.4_8.pkg | 2023-10-08 23:24 | 103K | |
| hp48cc-1.3_2.pkg | 2023-10-10 00:21 | 18K | |
| hpacucli-7.50_4.pkg | 2023-10-10 12:01 | 691K | |
| hpenc-3.0_2.pkg | 2023-10-10 05:20 | 33K | |
| hping3-20051105.pkg | 2023-10-08 20:17 | 95K | |
| hpipm-0.1.3.119_1.pkg | 2023-10-09 20:33 | 319K | |
| hpl-2.3_3.pkg | 2023-10-09 03:32 | 178K | |
| hplip-3.23.5_1.pkg | 2023-10-07 19:51 | 21M | |
| hplip-plugin-3.23.5.pkg | 2023-10-09 12:56 | 764K | |
| hploscripts-3.0_2.pkg | 2023-10-09 23:35 | 33K | |
| hppsmtools-1.1,1.pkg | 2023-10-09 16:20 | 25K | |
| hpsjam-1.2.7_1.pkg | 2023-10-14 08:52 | 179K | |
| hptcli-3.6_1.pkg | 2023-10-10 11:37 | 1.0M | |
| hptt-1.0.5.18_1.pkg | 2023-10-14 10:42 | 666K | |
| hpx-1.9.1.pkg | 2023-10-07 18:41 | 8.3M | |
| hq-1.0.1_5.pkg | 2023-10-10 05:16 | 479K | |
| hr-aspell-0.51.0_1,1..> | 2023-10-09 17:32 | 1.9M | |
| hr-libreoffice-7.5.5..> | 2023-10-08 00:02 | 2.8M | |
| hs-Agda-2.6.3_1.pkg | 2023-10-11 17:49 | 11M | |
| hs-DAV-1.3.4_5.pkg | 2023-10-09 16:37 | 5.3M | |
| hs-ShellCheck-0.9.0.pkg | 2023-10-12 02:01 | 4.6M | |
| hs-aeson-pretty-0.8...> | 2023-10-10 18:55 | 3.5M | |
| hs-alex-3.2.7.1.pkg | 2023-10-08 22:46 | 1.5M | |
| hs-arbtt-0.12.0.1.pkg | 2023-10-14 13:20 | 18M | |
| hs-brainfuck-0.1.0.3..> | 2023-10-09 11:24 | 901K | |
| hs-cabal-install-3.1..> | 2023-10-06 17:04 | 6.4M | |
| hs-cabal2tuple-2.0.0..> | 2023-10-08 17:58 | 3.9M | |
| hs-cardano-db-sync-1..> | 2023-10-09 08:37 | 9.1M | |
| hs-cardano-node-8.1...> | 2023-10-08 07:59 | 14M | |
| hs-cgrep-6.6.32_4.pkg | 2023-10-14 14:30 | 4.3M | |
| hs-conlecterm-1.4.3...> | 2023-10-09 11:19 | 4.3M | |
| hs-cpphs-1.20.9.1_3.pkg | 2023-10-10 15:27 | 1.1M | |
| hs-cputype-0.2.2_1.pkg | 2023-10-09 21:42 | 2.2M | |
| hs-cryptol-3.0.0.pkg | 2023-10-09 10:27 | 9.8M | |
| hs-darcs-2.16.5_3.pkg | 2023-10-08 00:32 | 6.4M | |
| hs-dhall-1.41.2.pkg | 2023-10-14 04:55 | 6.9M | |
| hs-dhall-bash-1.0.40..> | 2023-10-10 17:46 | 6.5M | |
| hs-dhall-json-1.7.12..> | 2023-10-09 18:58 | 8.9M | |
| hs-dhall-yaml-1.2.12..> | 2023-10-10 09:32 | 13M | |
| hs-elm-0.19.1_5.pkg | 2023-10-09 00:18 | 4.3M | |
| hs-elm-format-0.8.7.pkg | 2023-10-10 00:29 | 4.0M | |
| hs-futhark-0.25.4.pkg | 2023-10-11 06:58 | 14M | |
| hs-ghc-events-0.19.0..> | 2023-10-10 13:07 | 2.5M | |
| hs-ghcprofview-0.1.0..> | 2023-10-09 06:13 | 12M | |
| hs-git-annex-10.2023..> | 2023-10-09 14:12 | 12M | |
| hs-git-brunch-1.6.0...> | 2023-10-10 00:37 | 3.3M | |
| hs-happy-1.20.0_2.pkg | 2023-10-12 05:50 | 1.5M | |
| hs-hascard-0.5.0.3.1..> | 2023-10-14 11:07 | 3.2M | |
| hs-haskell-language-..> | 2023-10-10 18:12 | 45M | |
| hs-haskell-language-..> | 2023-10-08 21:55 | 25M | |
| hs-haskell-language-..> | 2023-10-08 17:02 | 22M | |
| hs-hasktags-0.72.0_3..> | 2023-10-10 07:55 | 1.7M | |
| hs-hedgewars-server-..> | 2023-10-08 20:06 | 1.4M | |
| hs-hledger-1.29.2.pkg | 2023-10-08 23:20 | 6.8M | |
| hs-hledger-ui-1.29.2..> | 2023-10-08 20:23 | 7.1M | |
| hs-hledger-web-1.29...> | 2023-10-10 02:54 | 10M | |
| hs-hlint-3.5.pkg | 2023-10-14 08:12 | 9.0M | |
| hs-hoogle-5.0.18.3_2..> | 2023-10-08 12:38 | 7.5M | |
| hs-hpack-0.35.2.pkg | 2023-10-11 09:21 | 5.9M | |
| hs-hscolour-1.24.4_9..> | 2023-10-14 06:46 | 1.3M | |
| hs-hspec-discover-2...> | 2023-10-14 14:13 | 1.0M | |
| hs-lhs2tex-1.24_2.pkg | 2023-10-10 22:53 | 2.2M | |
| hs-matterhorn-50200...> | 2023-10-08 16:20 | 8.5M | |
| hs-mueval-0.9.3_13.pkg | 2023-10-09 00:28 | 11M | |
| hs-ogmios-5.6.0_1.pkg | 2023-10-14 09:29 | 11M | |
| hs-pandoc-3.1.8_1.pkg | 2023-10-06 19:16 | 26M | |
| hs-pandoc-crossref-0..> | 2023-10-08 19:15 | 9.3M | |
| hs-panopticum-2.0.0...> | 2023-10-09 15:35 | 2.4M | |
| hs-postgrest-11.0.1.pkg | 2023-10-09 00:54 | 7.2M | |
| hs-profiteur-0.4.6.1..> | 2023-10-11 20:12 | 3.4M | |
| hs-purescript-0.15.9..> | 2023-10-10 22:22 | 7.3M | |
| hs-scroll-1.20180421..> | 2023-10-08 17:25 | 2.9M | |
| hs-shake-0.19.7.pkg | 2023-10-14 06:05 | 2.9M | |
| hs-spago-0.20.9.pkg | 2023-10-14 08:04 | 7.0M | |
| hs-stack-2.11.1.pkg | 2023-10-09 11:30 | 11M | |
| hs-syfco-1.1.34.pkg | 2023-10-10 09:18 | 2.3M | |
| hs-threadscope-0.2.1..> | 2023-10-09 10:53 | 3.1M | |
| hs-unlambda-0.1.4.2_..> | 2023-10-08 23:56 | 849K | |
| hs-verismith-1.0.0.2..> | 2023-10-08 21:19 | 3.6M | |
| hs-wai-app-static-3...> | 2023-10-09 23:27 | 3.7M | |
| hs-xmobar-0.46.pkg | 2023-10-10 05:19 | 5.9M | |
| hs-xmonad-0.17.1.pkg | 2023-10-08 15:46 | 1.7M | |
| hs-yaml-0.11.8.0_1.pkg | 2023-10-09 17:36 | 7.9M | |
| hs-yesod-bin-1.6.2.2..> | 2023-10-09 08:17 | 7.3M | |
| hsb-aspell-0.02.0,2.pkg | 2023-10-09 11:46 | 307K | |
| hsb-libreoffice-7.5...> | 2023-10-08 03:54 | 744K | |
| hsetroot-1.0.5.pkg | 2023-10-09 12:15 | 10K | |
| hsflowd-1.24.1.pkg | 2023-10-08 14:32 | 36K | |
| hsftp-1.15_3.pkg | 2023-10-08 14:22 | 12K | |
| hsqldb-2.3.4.pkg | 2023-10-09 09:55 | 3.6M | |
| hstr-2.3.pkg | 2023-10-08 23:07 | 23K | |
| htable-1.2.pkg | 2023-10-09 06:39 | 8.8K | |
| htdig-3.2.0.b6_7.pkg | 2023-10-09 20:25 | 1.3M | |
| htdigest-2.4.56_4.pkg | 2023-10-14 10:51 | 5.7K | |
| htdump-0.9y.pkg | 2023-10-09 17:03 | 11K | |
| hte-2.1.1.g20161206_..> | 2023-10-09 10:13 | 503K | |
| html-4.01_2.pkg | 2023-10-08 03:04 | 28K | |
| html-pretty-1.01_1.pkg | 2023-10-09 11:13 | 153K | |
| html-xml-utils-8.0.pkg | 2023-10-14 07:14 | 257K | |
| html2fo-0.4.2.pkg | 2023-10-14 16:28 | 24K | |
| html2hdml-1.0.5.pkg | 2023-10-09 18:04 | 28K | |
| html2latex-0.9c.pkg | 2023-10-14 07:16 | 10K | |
| html2ps-1.0.b7_7,1.pkg | 2023-10-09 22:01 | 87K | |
| html2text-1.3.2a_1,1..> | 2023-10-05 16:41 | 82K | |
| html2wml-0.4.11.pkg | 2023-10-14 04:21 | 63K | |
| html2xhtml-1.3.pkg | 2023-10-09 02:50 | 52K | |
| htmlc-2.21.0_1.pkg | 2023-10-14 10:38 | 523K | |
| htmlcompressor-1.5.3..> | 2023-10-09 12:40 | 62K | |
| htmlcxx-0.87.pkg | 2023-10-08 21:46 | 79K | |
| htmldoc-1.9.16_1.pkg | 2023-10-06 23:36 | 2.1M | |
| htmlise-0.2.pkg | 2023-10-10 17:33 | 8.1K | |
| htmlq-0.4.0_16.pkg | 2023-10-10 15:46 | 558K | |
| htmltest-0.17.0_9.pkg | 2023-10-09 03:36 | 1.9M | |
| htmltolatex-1_25.pkg | 2023-10-10 00:57 | 116K | |
| htop-3.2.2_1.pkg | 2023-10-11 00:58 | 90K | |
| htpdate-1.3.7.pkg | 2023-10-09 14:04 | 16K | |
| htslib-1.17.pkg | 2023-10-06 21:22 | 955K | |
| httest-2.4.24.pkg | 2023-10-09 14:44 | 128K | |
| httm-0.26.4_3.pkg | 2023-10-08 12:23 | 6.7M | |
| http-parser-2.9.4.pkg | 2023-10-05 16:50 | 18K | |
| http_get-1.0.2014081..> | 2023-10-08 22:35 | 6.6K | |
| http_load-20160309.pkg | 2023-10-10 06:15 | 14K | |
| http_ping-20050629_1..> | 2023-10-10 14:42 | 7.9K | |
| http_post-1.0.201408..> | 2023-10-14 13:59 | 8.4K | |
| httpasyncclient-4.1...> | 2023-10-08 20:40 | 255K | |
| httpclient-4.5.12.pkg | 2023-10-08 11:19 | 906K | |
| httpcore-4.4.13.pkg | 2023-10-07 03:06 | 641K | |
| httperf-0.9.1.pkg | 2023-10-07 20:26 | 60K | |
| httping-2.9.pkg | 2023-10-10 16:29 | 59K | |
| httplog-2.1_1.pkg | 2023-10-14 09:34 | 11K | |
| httpry-0.1.8.pkg | 2023-10-08 17:52 | 19K | |
| httptunnel-3.3_3.pkg | 2023-10-14 03:14 | 32K | |
| httrack-3.49.4.pkg | 2023-10-08 21:30 | 1.1M | |
| hu-aspell-0.99.4.2.0..> | 2023-10-09 10:58 | 1.5M | |
| hu-hunspell-1.6.1.pkg | 2023-10-14 08:00 | 531K | |
| hu-hyphen-2007.05.17..> | 2023-10-10 20:20 | 215K | |
| hu-jdictionary-eng-h..> | 2023-10-09 14:56 | 1.7M | |
| hu-jdictionary-eng-h..> | 2023-10-10 07:23 | 835K | |
| hu-libreoffice-7.5.5..> | 2023-10-07 13:54 | 3.2M | |
| hu-mythes-2003.09.29..> | 2023-10-08 17:46 | 286K | |
| hub-2.14.2_15.pkg | 2023-10-09 12:51 | 2.0M | |
| huc-3.21.pkg | 2023-10-08 20:15 | 217K | |
| hugin-2022.0.0_9.pkg | 2023-10-10 06:17 | 12M | |
| hugo-2.12_17.pkg | 2023-10-14 06:43 | 131K | |
| hulgalugha-1.0.pkg | 2023-10-09 13:45 | 3.1K | |
| humanzip-0.5.pkg | 2023-10-09 01:06 | 48K | |
| hunspell-1.7.2.pkg | 2023-10-05 17:09 | 353K | |
| hurl-4.0.0_1.pkg | 2023-10-10 16:57 | 1.7M | |
| husky-areafix-1.9.20..> | 2023-10-07 00:40 | 43K | |
| husky-fidoconf-1.9.2..> | 2023-10-06 18:56 | 183K | |
| husky-huskylib-1.9.2..> | 2023-10-06 14:04 | 75K | |
| husky-smapi-1.9.2019..> | 2023-10-06 16:09 | 52K | |
| husky-sqpack-1.9.201..> | 2023-10-10 02:15 | 9.6K | |
| hv_kvp_cmd-1.4.pkg | 2023-10-09 13:02 | 6.5K | |
| hw-probe-1.6.5.pkg | 2023-10-10 03:59 | 106K | |
| hwdata-0.374,1.pkg | 2023-10-05 17:28 | 1.5M | |
| hwloc-1.11.13_2.pkg | 2023-10-14 11:30 | 2.1M | |
| hwloc2-2.8.0.pkg | 2023-10-06 09:28 | 2.9M | |
| hwstat-0.5.1.pkg | 2023-10-07 17:43 | 6.1K | |
| hxtools-20230411.pkg | 2023-10-10 02:22 | 120K | |
| hy-aspell-0.10.0.0_1..> | 2023-10-14 07:47 | 776K | |
| hybrid-bar-0.4.9_4.pkg | 2023-10-10 11:56 | 628K | |
| hydra-9.2_1.pkg | 2023-10-10 07:33 | 142K | |
| hydrogen-1.2.1.pkg | 2023-10-10 18:27 | 8.0M | |
| hydrogen-linear-alge..> | 2023-10-08 03:45 | 2.6M | |
| hyperdeal-g20230706.pkg | 2023-10-09 15:06 | 106K | |
| hyperestraier-1.4.13..> | 2023-10-07 11:02 | 627K | |
| hyperfine-1.17.0_2.pkg | 2023-10-10 19:50 | 425K | |
| hyperhotp-0.1.pkg | 2023-10-10 01:06 | 8.2K | |
| hypermail-2.4.0_5.pkg | 2023-10-10 13:44 | 192K | |
| hyperrogue-12.1q.pkg | 2023-10-14 05:25 | 61M | |
| hyperscan-5.4.0.pkg | 2023-10-08 11:05 | 2.7M | |
| hyphen-2.8.8.pkg | 2023-10-05 16:52 | 53K | |
| hyphy-2.5.53.pkg | 2023-10-10 09:08 | 1.6M | |
| hypnotix-2.9_3.pkg | 2023-10-10 00:49 | 126K | |
| hypre-2.29.0_1.pkg | 2023-10-06 20:01 | 1.9M | |
| hyprland-0.29.1.pkg | 2023-10-09 19:17 | 7.0M | |
| hyprland-share-picke..> | 2023-10-07 18:42 | 16K | |
| hyprland-share-picke..> | 2023-10-07 13:04 | 16K | |
| hyprpaper-0.4.0.pkg | 2023-10-09 12:08 | 44K | |
| hyprpicker-0.1.1_1.pkg | 2023-10-10 12:03 | 18K | |
| i2c-tools-4.1.pkg | 2023-10-11 05:11 | 28K | |
| i2p-0.9.48.pkg | 2023-10-10 12:22 | 38M | |
| i2pd-2.49.0.pkg | 2023-10-10 23:31 | 3.0M | |
| i3-4.22.pkg | 2023-10-08 05:20 | 264K | |
| i3blocks-1.4.93.pkg | 2023-10-14 15:19 | 22K | |
| i3lock-2.13_1.pkg | 2023-10-11 05:51 | 24K | |
| i3lock-color-2.13.c...> | 2023-10-08 20:48 | 50K | |
| i3status-2.14_2.pkg | 2023-10-10 00:16 | 38K | |
| i7z-0.27.4.pkg | 2023-10-14 16:18 | 18K | |
| i18n-man-1.1_1.pkg | 2023-10-10 17:30 | 16K | |
| i18ntools-1.0_1.pkg | 2023-10-10 18:08 | 54K | |
| i386-binutils-2.40_4..> | 2023-10-07 20:57 | 2.2M | |
| i386-freebsd-sysroot..> | 2023-10-08 04:10 | 34M | |
| i386-gcc9-9.5.0_11.pkg | 2023-10-09 07:32 | 22M | |
| i386-rust-bootstrap-..> | 2023-10-09 03:08 | 93M | |
| ia-aspell-0.50.1_1,1..> | 2023-10-08 16:02 | 537K | |
| iaikPkcs11Wrapper-1...> | 2023-10-09 05:14 | 668K | |
| iansui-1.000.pkg | 2023-10-09 11:22 | 3.1M | |
| iat-0.1.7.pkg | 2023-10-10 06:35 | 18K | |
| iaxmodem-1.2.0_10.pkg | 2023-10-11 01:26 | 136K | |
| iboview-20150427_25.pkg | 2023-10-14 03:15 | 1.3M | |
| ibp-0.21_2.pkg | 2023-10-09 04:12 | 20K | |
| ibsh-0.3e_1.pkg | 2023-10-08 16:21 | 17K | |
| ibus-1.5.27_2.pkg | 2023-10-06 18:59 | 7.9M | |
| ibus-kmfl-1.0.3_7.pkg | 2023-10-14 07:54 | 11K | |
| ibus-m17n-1.4.22.pkg | 2023-10-14 03:45 | 155K | |
| ibus-table-1.17.2.pkg | 2023-10-07 14:25 | 966K | |
| ibus-typing-booster-..> | 2023-10-08 16:13 | 8.4M | |
| ibus-uniemoji-0.6.0...> | 2023-10-09 22:25 | 248K | |
| ical-3.0.4.pkg | 2023-10-14 09:14 | 173K | |
| ical2html-2.1.pkg | 2023-10-14 17:05 | 12K | |
| icapeg-1.0.0_2.pkg | 2023-10-14 04:33 | 3.1M | |
| icat-0.5_1.pkg | 2023-10-11 12:57 | 6.1K | |
| icbirc-2.1.pkg | 2023-10-14 04:30 | 14K | |
| icbm3d-0.4_4.pkg | 2023-10-08 14:10 | 29K | |
| icc-profiles-adobe-c..> | 2023-10-09 13:46 | 4.9M | |
| icc-profiles-basicco..> | 2023-10-07 02:20 | 14M | |
| icc-profiles-openicc..> | 2023-10-07 09:40 | 239K | |
| iccxml-0.9.8_2.pkg | 2023-10-10 09:59 | 154K | |
| icdiff-2.0.7.pkg | 2023-10-09 14:59 | 20K | |
| iceauth-1.0.8_2.pkg | 2023-10-05 17:02 | 14K | |
| icebreaker-1.9.8_2.pkg | 2023-10-14 09:28 | 118K | |
| icecast-2.4.4_2,1.pkg | 2023-10-11 22:15 | 1.4M | |
| icecast-kh-2.4.0.k15..> | 2023-10-09 04:00 | 217K | |
| icedtea-web-1.8.8_9.pkg | 2023-10-09 09:12 | 2.1M | |
| icegenerator-0.5.5.p..> | 2023-10-09 19:52 | 20K | |
| iceicepenguin-1.5.1_..> | 2023-10-14 13:29 | 17M | |
| iceoryx-2.0.3.pkg | 2023-10-07 17:27 | 640K | |
| ices-2.0.3_2,1.pkg | 2023-10-10 10:03 | 47K | |
| icestorm-g20220915.pkg | 2023-10-06 20:14 | 8.2M | |
| icewm-3.4.2.pkg | 2023-10-14 10:31 | 1.6M | |
| icewm-extra-themes-1..> | 2023-10-09 14:37 | 2.6M | |
| icinga-ipl-i18n-php8..> | 2023-10-09 02:41 | 9.4K | |
| icinga-ipl-i18n-php8..> | 2023-10-08 13:46 | 9.4K | |
| icinga-ipl-i18n-php8..> | 2023-10-09 02:25 | 9.4K | |
| icinga-ipl-i18n-php8..> | 2023-10-14 06:52 | 9.4K | |
| icinga-php-library-p..> | 2023-10-06 17:25 | 1.4M | |
| icinga-php-library-p..> | 2023-10-06 16:09 | 1.4M | |
| icinga-php-library-p..> | 2023-10-06 18:00 | 1.4M | |
| icinga-php-library-p..> | 2023-10-06 17:06 | 1.4M | |
| icinga-php-thirdpart..> | 2023-10-06 18:05 | 526K | |
| icinga-php-thirdpart..> | 2023-10-06 17:29 | 525K | |
| icinga-php-thirdpart..> | 2023-10-06 17:18 | 525K | |
| icinga-php-thirdpart..> | 2023-10-06 18:17 | 524K | |
| icinga2-2.14.0_1.pkg | 2023-10-10 21:34 | 11M | |
| icingaweb2-module-bu..> | 2023-10-10 14:01 | 2.2M | |
| icingaweb2-module-bu..> | 2023-10-08 13:36 | 2.2M | |
| icingaweb2-module-bu..> | 2023-10-14 06:01 | 2.2M | |
| icingaweb2-module-bu..> | 2023-10-14 11:15 | 2.2M | |
| icingaweb2-module-cu..> | 2023-10-09 22:26 | 569K | |
| icingaweb2-module-cu..> | 2023-10-14 12:50 | 569K | |
| icingaweb2-module-cu..> | 2023-10-10 19:45 | 569K | |
| icingaweb2-module-cu..> | 2023-10-14 14:02 | 569K | |
| icingaweb2-module-di..> | 2023-10-07 15:02 | 2.6M | |
| icingaweb2-module-di..> | 2023-10-08 05:38 | 2.6M | |
| icingaweb2-module-di..> | 2023-10-08 07:58 | 2.6M | |
| icingaweb2-module-di..> | 2023-10-08 08:58 | 2.6M | |
| icingaweb2-module-el..> | 2023-10-14 04:23 | 295K | |
| icingaweb2-module-el..> | 2023-10-08 22:08 | 295K | |
| icingaweb2-module-el..> | 2023-10-09 16:42 | 295K | |
| icingaweb2-module-el..> | 2023-10-09 22:35 | 295K | |
| icingaweb2-module-fi..> | 2023-10-09 02:03 | 243K | |
| icingaweb2-module-fi..> | 2023-10-09 12:36 | 243K | |
| icingaweb2-module-fi..> | 2023-10-09 17:23 | 243K | |
| icingaweb2-module-fi..> | 2023-10-10 02:52 | 243K | |
| icingaweb2-module-ge..> | 2023-10-11 22:53 | 12K | |
| icingaweb2-module-ge..> | 2023-10-11 06:00 | 12K | |
| icingaweb2-module-ge..> | 2023-10-09 13:56 | 12K | |
| icingaweb2-module-ge..> | 2023-10-09 05:41 | 12K | |
| icingaweb2-module-gr..> | 2023-10-14 17:57 | 1.6M | |
| icingaweb2-module-gr..> | 2023-10-10 03:51 | 1.6M | |
| icingaweb2-module-gr..> | 2023-10-10 09:15 | 1.6M | |
| icingaweb2-module-gr..> | 2023-10-10 03:05 | 1.6M | |
| icingaweb2-module-gr..> | 2023-10-14 08:26 | 309K | |
| icingaweb2-module-gr..> | 2023-10-09 07:34 | 309K | |
| icingaweb2-module-gr..> | 2023-10-09 14:11 | 309K | |
| icingaweb2-module-gr..> | 2023-10-14 08:07 | 309K | |
| icingaweb2-module-in..> | 2023-10-06 16:23 | 163K | |
| icingaweb2-module-in..> | 2023-10-06 17:58 | 163K | |
| icingaweb2-module-in..> | 2023-10-06 15:52 | 163K | |
| icingaweb2-module-in..> | 2023-10-06 18:10 | 163K | |
| icingaweb2-module-ji..> | 2023-10-09 06:55 | 631K | |
| icingaweb2-module-ji..> | 2023-10-08 15:53 | 631K | |
| icingaweb2-module-ji..> | 2023-10-10 20:34 | 631K | |
| icingaweb2-module-ji..> | 2023-10-09 01:41 | 631K | |
| icingaweb2-module-ma..> | 2023-10-09 21:08 | 7.7M | |
| icingaweb2-module-ma..> | 2023-10-09 07:04 | 7.7M | |
| icingaweb2-module-ma..> | 2023-10-09 21:44 | 7.7M | |
| icingaweb2-module-ma..> | 2023-10-09 18:22 | 7.7M | |
| icingaweb2-module-re..> | 2023-10-07 09:14 | 382K | |
| icingaweb2-module-re..> | 2023-10-07 09:59 | 382K | |
| icingaweb2-module-re..> | 2023-10-07 03:08 | 383K | |
| icingaweb2-module-re..> | 2023-10-07 06:45 | 383K | |
| icingaweb2-module-vs..> | 2023-10-08 23:27 | 320K | |
| icingaweb2-module-vs..> | 2023-10-14 09:59 | 320K | |
| icingaweb2-module-vs..> | 2023-10-09 21:40 | 320K | |
| icingaweb2-module-vs..> | 2023-10-14 10:19 | 320K | |
| icingaweb2-module-vs..> | 2023-10-09 13:14 | 3.4M | |
| icingaweb2-module-vs..> | 2023-10-14 11:03 | 3.4M | |
| icingaweb2-module-vs..> | 2023-10-10 00:43 | 3.4M | |
| icingaweb2-module-vs..> | 2023-10-08 15:40 | 3.4M | |
| icingaweb2-module-x5..> | 2023-10-09 10:26 | 594K | |
| icingaweb2-module-x5..> | 2023-10-14 12:15 | 594K | |
| icingaweb2-module-x5..> | 2023-10-10 17:59 | 594K | |
| icingaweb2-module-x5..> | 2023-10-10 09:28 | 594K | |
| icingaweb2-php80-2.1..> | 2023-10-06 22:20 | 8.3M | |
| icingaweb2-php81-2.1..> | 2023-10-06 20:34 | 8.3M | |
| icingaweb2-php82-2.1..> | 2023-10-06 22:50 | 8.3M | |
| icingaweb2-php83-2.1..> | 2023-10-06 21:58 | 8.3M | |
| icmake-9.03.01.pkg | 2023-10-08 06:52 | 200K | |
| icmpchat-0.6_1.pkg | 2023-10-09 22:03 | 19K | |
| icmpinfo-1.11_1.pkg | 2023-10-09 08:48 | 8.7K | |
| icmpmonitor-1.2.pkg | 2023-10-14 12:29 | 9.3K | |
| icmpquery-1.0.3.pkg | 2023-10-08 22:37 | 5.4K | |
| ico-1.0.5.pkg | 2023-10-09 18:33 | 12K | |
| icon-naming-utils-0...> | 2023-10-05 17:03 | 7.1K | |
| icon-slicer-0.3_11.pkg | 2023-10-10 18:23 | 16K | |
| icons-human-azul-0.1..> | 2023-10-10 07:34 | 275K | |
| icons-tango-0.8.90_3..> | 2023-10-07 21:34 | 1.2M | |
| icons-tango-extras-0..> | 2023-10-14 07:26 | 46K | |
| icontact-1.5_3.pkg | 2023-10-09 22:17 | 23K | |
| icontheme-1.2.3_3.pkg | 2023-10-10 03:53 | 98K | |
| iconv-2.0_6.pkg | 2023-10-07 02:37 | 41K | |
| iconv-extra-2.0_1.pkg | 2023-10-07 18:53 | 7.1K | |
| iconv-rfc1345-2.0_1.pkg | 2023-10-14 10:11 | 4.7K | |
| icoutils-0.32.3.pkg | 2023-10-07 01:46 | 44K | |
| icpld-1.1.5_2.pkg | 2023-10-14 06:36 | 64K | |
| icqlib-1.0.0_3.pkg | 2023-10-09 03:22 | 58K | |
| icu-73.2,1.pkg | 2023-10-05 17:28 | 11M | |
| icu-le-hb-1.2.3_2.pkg | 2023-10-07 09:54 | 33K | |
| icu-lx-73.2.pkg | 2023-10-08 05:11 | 35K | |
| id-aspell-1.2.0_1,2.pkg | 2023-10-10 09:00 | 207K | |
| id-hyphen-2004.08.12..> | 2023-10-09 14:38 | 22K | |
| id-libreoffice-7.5.5..> | 2023-10-07 14:10 | 3.0M | |
| id3el-0.05_1.pkg | 2023-10-08 19:04 | 6.5K | |
| id3lib-3.8.3_10.pkg | 2023-10-06 23:37 | 169K | |
| id3mtag-0.81.pkg | 2023-10-10 10:31 | 73K | |
| id3tool-1.2a.pkg | 2023-10-08 08:13 | 7.3K | |
| id3v2-0.1.12.pkg | 2023-10-07 11:36 | 18K | |
| ida-2.14_2.pkg | 2023-10-08 20:59 | 120K | |
| iddawc-1.1.8.pkg | 2023-10-07 22:03 | 889K | |
| idea-1.2_1.pkg | 2023-10-11 11:27 | 24K | |
| ideep-2.0.0.119.pkg | 2023-10-14 04:19 | 49K | |
| identify-0.7.pkg | 2023-10-14 18:14 | 4.9K | |
| idesk-0.7.5_11.pkg | 2023-10-09 23:36 | 70K | |
| idnits-2.17.1.pkg | 2023-10-10 03:17 | 33K | |
| idnkit-1.0_7.pkg | 2023-10-10 11:04 | 205K | |
| idnkit2-2.3_2.pkg | 2023-10-14 10:30 | 237K | |
| idutils-4.6_5.pkg | 2023-10-09 01:25 | 212K | |
| ie-hunspell-1.0.pkg | 2023-10-09 09:36 | 78K | |
| iec16022-0.3.1.pkg | 2023-10-14 10:56 | 26K | |
| ifdepd-20110412_1.pkg | 2023-10-08 20:09 | 7.9K | |
| iffinder-1.38.pkg | 2023-10-09 02:58 | 16K | |
| ifile-1.3.8.pkg | 2023-10-14 16:59 | 40K | |
| ifmail-2.15_10.pkg | 2023-10-09 01:56 | 297K | |
| ifstat-1.1_5.pkg | 2023-10-10 19:55 | 13K | |
| ifstated-5.1_3,3.pkg | 2023-10-14 06:05 | 20K | |
| iftop-1.0.p4.pkg | 2023-10-09 08:41 | 31K | |
| igal2-2.2_4.pkg | 2023-10-09 13:29 | 26K | |
| igmpproxy-0.4,1.pkg | 2023-10-14 09:37 | 22K | |
| ignition-cmake-2.0.0..> | 2023-10-06 22:57 | 162K | |
| ignition-common-3.0...> | 2023-10-07 13:12 | 323K | |
| ignition-fuel-tools-..> | 2023-10-08 15:06 | 122K | |
| ignition-math-6.0.0_..> | 2023-10-07 08:35 | 136K | |
| ignition-msgs-3.0.0_..> | 2023-10-10 17:19 | 542K | |
| ignition-plugin-1.0...> | 2023-10-08 20:08 | 64K | |
| ignition-tools-0.1.0..> | 2023-10-07 20:25 | 3.8K | |
| igor-1.595.pkg | 2023-10-06 18:25 | 30K | |
| igraph-0.10.6.pkg | 2023-10-07 00:46 | 916K | |
| igv-2.16.0_1.pkg | 2023-10-07 17:49 | 30M | |
| ii-2.0.pkg | 2023-10-10 16:15 | 11K | |
| iichid-0.0.6.pkg | 2023-10-08 03:28 | 54K | |
| iipsrv-1.1_1.pkg | 2023-10-08 14:56 | 127K | |
| iir1-1.9.4.pkg | 2023-10-07 11:07 | 41K | |
| iiview-0.31.pkg | 2023-10-08 18:56 | 18K | |
| ikiwiki-3.20200202.3..> | 2023-10-08 16:45 | 850K | |
| ikos-3.1_5.pkg | 2023-10-09 02:57 | 9.2M | |
| iksemel-1.5.pkg | 2023-10-07 09:39 | 61K | |
| ilbc-r3951_1.pkg | 2023-10-08 05:43 | 55K | |
| im-153.pkg | 2023-10-09 11:05 | 139K | |
| imageindex-2.0_5.pkg | 2023-10-10 05:05 | 38K | |
| imageviewer-0.6.3_12..> | 2023-10-08 00:48 | 48K | |
| imageworsener-1.3.5_..> | 2023-10-09 06:44 | 95K | |
| imake-1.0.8,1.pkg | 2023-10-05 16:59 | 26K | |
| imap-uw-2007f_1,1.pkg | 2023-10-10 01:11 | 447K | |
| imapdedup-0.0.201503..> | 2023-10-11 02:19 | 7.1K | |
| imapfilter-2.8.1.pkg | 2023-10-10 20:18 | 53K | |
| imapproxy-1.0_1.pkg | 2023-10-14 07:29 | 22K | |
| imapsync-2.229.pkg | 2023-10-10 02:17 | 140K | |
| imaptools-1.135_1.pkg | 2023-10-09 02:26 | 50K | |
| imaputils-1.0.5.pkg | 2023-10-10 10:39 | 48K | |
| imc-4.3_8.pkg | 2023-10-08 13:26 | 61K | |
| imds-filterd-0.1.pkg | 2023-10-08 13:22 | 33K | |
| imerge-0.2.4.pkg | 2023-10-11 15:30 | 3.8K | |
| img2xterm-1.0.0_4.pkg | 2023-10-09 23:51 | 7.7K | |
| imgui-1.89.8.pkg | 2023-10-09 03:19 | 551K | |
| imgurbash2-3.3.pkg | 2023-10-09 02:46 | 9.0K | |
| imhex-1.30.1.pkg | 2023-10-10 00:44 | 8.7M | |
| iml-1.0.5_2.pkg | 2023-10-07 00:57 | 84K | |
| imlib2-1.7.0_1,2.pkg | 2023-10-06 19:30 | 519K | |
| imlib2-jxl-0.1.1_2.pkg | 2023-10-10 05:04 | 6.5K | |
| imlib2-webp-20160601..> | 2023-10-09 11:57 | 3.0K | |
| imlib2_loaders-1.7.0..> | 2023-10-14 07:11 | 15K | |
| immortal-0.24.4_9.pkg | 2023-10-09 19:02 | 2.7M | |
| immudb15-1.5.0_2.pkg | 2023-10-11 03:20 | 19M | |
| impact-0.7.06.038_4,..> | 2023-10-14 07:08 | 9.3M | |
| imposm3-0.11.1_2.pkg | 2023-10-09 20:13 | 2.6M | |
| impossible_mission_p..> | 2023-10-10 07:13 | 119K | |
| impress-1.1b9_3.pkg | 2023-10-08 15:32 | 589K | |
| impressive-0.13.1_13..> | 2023-10-14 13:47 | 183K | |
| imtui-1.0.5.30.pkg | 2023-10-09 17:46 | 468K | |
| imv-4.3.1_4.pkg | 2023-10-08 14:23 | 61K | |
| imwheel-1.0.0.p12_2.pkg | 2023-10-10 08:58 | 49K | |
| inadyn-2.11.0_1.pkg | 2023-10-14 11:45 | 75K | |
| inastemp-0.2.4.pkg | 2023-10-10 16:42 | 25K | |
| incidenceeditor-23.0..> | 2023-10-06 18:54 | 484K | |
| include-what-you-use..> | 2023-10-10 00:38 | 535K | |
| inconsolata-ttf-2.00..> | 2023-10-07 04:48 | 75K | |
| incron-2017.11.13_2.pkg | 2023-10-10 17:30 | 81K | |
| indexinfo-0.3.1.pkg | 2023-10-05 16:40 | 4.7K | |
| indi-1.9.6_2.pkg | 2023-10-07 22:36 | 2.8M | |
| indicators-2.3.pkg | 2023-10-14 04:28 | 19K | |
| indiwebmanagerapp-1...> | 2023-10-09 18:45 | 66K | |
| infamous-plugins-lv2..> | 2023-10-14 18:22 | 562K | |
| infernal-1.1.4.pkg | 2023-10-08 01:11 | 3.5M | |
| inferno-0.11.17.pkg | 2023-10-09 08:08 | 929K | |
| influxdb-1.8.10_16.pkg | 2023-10-08 16:14 | 19M | |
| influxdb2-cli-2.7.3_..> | 2023-10-09 11:03 | 4.4M | |
| influxpkg-config-0.2..> | 2023-10-14 10:59 | 1.2M | |
| info2html-2.0.pkg | 2023-10-10 09:39 | 10K | |
| info2man-20040717_1.pkg | 2023-10-10 07:07 | 21K | |
| info_to_html-0.9.6_1..> | 2023-10-11 01:55 | 5.7K | |
| infobot-0.45.3_3.pkg | 2023-10-11 15:06 | 99K | |
| inform7-6L38.pkg | 2023-10-14 14:59 | 2.8M | |
| ini_file_manager-03_..> | 2023-10-08 05:44 | 21K | |
| inifiled-2.0.0_3.pkg | 2023-10-08 02:26 | 6.5K | |
| inih-57.pkg | 2023-10-06 09:57 | 12K | |
| inilib-1.0.7b3.pkg | 2023-10-08 16:18 | 35K | |
| inilike-1.2.1_3.pkg | 2023-10-07 15:21 | 86K | |
| iniparser-4.1.pkg | 2023-10-08 04:13 | 14K | |
| initool-0.12.0.pkg | 2023-10-09 13:14 | 65K | |
| initutil-2.1.b.pkg | 2023-10-14 03:25 | 5.6K | |
| injeqt-1.2.0_5.pkg | 2023-10-11 15:14 | 72K | |
| inkscape-1.3.pkg | 2023-10-07 12:47 | 22M | |
| inkscape-open-symbol..> | 2023-10-10 01:21 | 1.8M | |
| inn-2.7.1_1.pkg | 2023-10-07 23:19 | 1.5M | |
| inn-current-20230806..> | 2023-10-07 19:27 | 1.5M | |
| innerspace-0.2.0_11.pkg | 2023-10-08 02:06 | 32K | |
| innoextract-1.9_2.pkg | 2023-10-10 23:34 | 232K | |
| innotop-1.13.0.pkg | 2023-10-10 21:40 | 127K | |
| inotify-tools-4.23.8..> | 2023-10-07 18:34 | 48K | |
| inplace-1.2.3_1.pkg | 2023-10-08 19:40 | 8.0K | |
| inputplug-0.4.0_19.pkg | 2023-10-09 22:23 | 327K | |
| inscore-1.31_2.pkg | 2023-10-08 20:29 | 111M | |
| inscript2-20210820.pkg | 2023-10-10 19:06 | 23K | |
| inspectrum-0.2.3.pkg | 2023-10-09 23:53 | 63K | |
| inspircd-3.16.1_2.pkg | 2023-10-09 17:54 | 1.3M | |
| installwatch-0.6.3_3..> | 2023-10-08 21:34 | 8.5K | |
| instant-meshes-0.0.4..> | 2023-10-10 17:46 | 1.1M | |
| instead-3.5.1.pkg | 2023-10-07 17:35 | 3.6M | |
| insub-16.0_1.pkg | 2023-10-08 22:52 | 52K | |
| intel-backlight-2020..> | 2023-10-14 09:31 | 8.9K | |
| intel-em-kmod-7.7.8.pkg | 2023-10-11 18:08 | 87K | |
| intel-epct-1.39.56.9..> | 2023-10-10 03:45 | 1.2M | |
| intel-graphics-compi..> | 2023-10-08 06:53 | 10M | |
| intel-graphics-compi..> | 2023-10-08 10:52 | 10M | |
| intel-graphics-compi..> | 2023-10-08 04:18 | 10M | |
| intel-graphics-compi..> | 2023-10-08 09:20 | 10M | |
| intel-iavf-kmod-3.0...> | 2023-10-09 10:02 | 34K | |
| intel-ice-kmod-1.38...> | 2023-10-08 02:11 | 151K | |
| intel-igb-kmod-2.5.2..> | 2023-10-10 11:48 | 58K | |
| intel-ipsec-mb-1.3.pkg | 2023-10-08 02:31 | 1.1M | |
| intel-ix-kmod-3.3.35..> | 2023-10-09 09:27 | 81K | |
| intel-ixl-kmod-1.13...> | 2023-10-09 15:15 | 98K | |
| intel-ixv-kmod-1.5.3..> | 2023-10-14 04:49 | 3.4K | |
| intel-media-sdk-22.4..> | 2023-10-08 04:09 | 4.2M | |
| intel-nvmupdate-10g-..> | 2023-10-09 18:36 | 2.1M | |
| intel-nvmupdate-40g-..> | 2023-10-14 04:50 | 31M | |
| intel-nvmupdate-100g..> | 2023-10-09 10:00 | 30M | |
| intel-one-mono-1.3.0..> | 2023-10-11 14:54 | 350K | |
| intel-pcm-202302_1.pkg | 2023-10-08 09:25 | 1.3M | |
| intel-snap-0.0.1_15.pkg | 2023-10-08 22:50 | 5.3M | |
| intel-undervolt-1.7.pkg | 2023-10-14 12:04 | 18K | |
| intellij-2020.2.3.pkg | 2023-10-09 17:30 | 449M | |
| intellij-fsnotifier-..> | 2023-10-08 01:41 | 240K | |
| intellij-pty4j-0.11...> | 2023-10-07 17:28 | 4.4K | |
| intellij-ultimate-20..> | 2023-10-08 21:26 | 546M | |
| interGif-6.15.pkg | 2023-10-14 13:29 | 35K | |
| interactive_rebase_t..> | 2023-10-08 20:28 | 637K | |
| interbench-0.31_1.pkg | 2023-10-09 21:22 | 23K | |
| intercal-0.31.pkg | 2023-10-10 11:40 | 241K | |
| interchange-5.6.3.pkg | 2023-10-14 18:17 | 1.6M | |
| interlogic-0.30_11.pkg | 2023-10-10 18:40 | 1.4M | |
| intersect-lv2-1.3.pkg | 2023-10-08 15:18 | 4.7K | |
| intlfonts-1.4.2.pkg | 2023-10-14 10:41 | 9.0M | |
| intltool-0.51.0_1.pkg | 2023-10-05 16:47 | 37K | |
| intx-0.10.1.pkg | 2023-10-07 16:56 | 14K | |
| invada-studio-plugin..> | 2023-10-10 22:39 | 216K | |
| inxi-3.3.11.1.pkg | 2023-10-08 12:27 | 393K | |
| io-2017.09.06_8.pkg | 2023-10-09 15:21 | 3.3M | |
| io-devel-20180807_2.pkg | 2023-10-14 04:13 | 407K | |
| io_lib-1.14.10.pkg | 2023-10-07 08:47 | 540K | |
| iocell-2.1.2_2.pkg | 2023-10-14 12:18 | 65K | |
| iodine-0.8.0.pkg | 2023-10-14 18:17 | 60K | |
| iograph-0.9.1.pkg | 2023-10-10 09:38 | 10K | |
| iohyve-0.7.9.pkg | 2023-10-08 20:05 | 19K | |
| ion-shell-1.0.5.1355..> | 2023-10-08 20:43 | 937K | |
| ioncube-php81-12.0.5..> | 2023-10-10 17:34 | 606K | |
| ioping-1.3.pkg | 2023-10-09 23:09 | 15K | |
| ioquake3-1.36_17.pkg | 2023-10-10 09:06 | 1.3M | |
| ioquake3-server-1.36..> | 2023-10-08 03:04 | 870K | |
| ior-3.3.0.20230112_1..> | 2023-10-09 18:08 | 107K | |
| iorate-3.05.pkg | 2023-10-14 02:04 | 60K | |
| iortcw-1.51c_3,1.pkg | 2023-10-10 10:52 | 2.2M | |
| iosevka-16.7.0.pkg | 2023-10-14 08:42 | 320M | |
| iowow-1.4.16.pkg | 2023-10-06 23:29 | 234K | |
| iozone-3.506.pkg | 2023-10-14 17:21 | 111K | |
| iozone21-2.01.pkg | 2023-10-11 05:26 | 12K | |
| ip2location-8.4.1.pkg | 2023-10-07 12:48 | 748K | |
| ip2proxy-20211122.pkg | 2023-10-07 21:34 | 14K | |
| ip4r-2.4.1_1.pkg | 2023-10-09 14:18 | 62K | |
| ip6_int-1.0.pkg | 2023-10-14 09:01 | 1.9K | |
| ipa-2.1.2_1.pkg | 2023-10-08 02:25 | 230K | |
| ipa_conv-1.1_2.pkg | 2023-10-09 17:49 | 18K | |
| ipa_sdb-1.1.1_3.pkg | 2023-10-14 16:07 | 51K | |
| ipacctd-1.47_1.pkg | 2023-10-10 14:24 | 16K | |
| ipad_charge-2.0.1.pkg | 2023-10-09 22:00 | 1.6K | |
| ipaudit-1.1.pkg | 2023-10-10 16:06 | 56K | |
| ipbt-r8765.pkg | 2023-10-14 17:23 | 79K | |
| ipcad-3.7.3_3.pkg | 2023-10-09 23:05 | 49K | |
| ipcalc-0.51.pkg | 2023-10-09 22:00 | 9.4K | |
| ipcheck-0.240_1,1.pkg | 2023-10-10 11:49 | 29K | |
| ipdbtools-1.1.2_3.pkg | 2023-10-08 13:46 | 21K | |
| ipdecap-0.7.2_1.pkg | 2023-10-10 00:39 | 11K | |
| ipe-7.2.23_3.pkg | 2023-10-08 21:04 | 625K | |
| iperf-2.1.9.pkg | 2023-10-14 15:50 | 110K | |
| iperf3-3.15.pkg | 2023-10-07 20:59 | 98K | |
| ipfmeta-1.3_1.pkg | 2023-10-09 21:16 | 7.5K | |
| ipfs-go-0.19.1_3.pkg | 2023-10-07 15:57 | 14M | |
| ipfs-go-fs-repo-migr..> | 2023-10-08 19:17 | 13M | |
| ipget-0.9.2_2.pkg | 2023-10-08 18:26 | 13M | |
| ipgrab-0.9.10_1.pkg | 2023-10-10 20:52 | 83K | |
| ipguard-1.04_4.pkg | 2023-10-10 17:48 | 27K | |
| ipinfo-3.0.1_1.pkg | 2023-10-14 11:04 | 2.5M | |
| iplike-2.2.0.pkg | 2023-10-11 01:11 | 6.7K | |
| ipmi_exporter-1.6.1_..> | 2023-10-10 13:05 | 3.0M | |
| ipmitool-1.8.18_3.pkg | 2023-10-07 14:44 | 393K | |
| ipp-usb-0.9.23_2.pkg | 2023-10-10 22:19 | 1.8M | |
| iprange-1.0.4.pkg | 2023-10-14 16:17 | 23K | |
| ipsc-0.4.3.pkg | 2023-10-10 21:30 | 8.2K | |
| ipsec-tools-0.8.2_12..> | 2023-10-08 18:56 | 333K | |
| ipsumdump-1.86.pkg | 2023-10-08 08:12 | 640K | |
| ipsvd-1.0.0_1.pkg | 2023-10-14 14:53 | 67K | |
| ipv6calc-4.1.0.pkg | 2023-10-09 15:05 | 1.4M | |
| ipv6gen-1.0.pkg | 2023-10-10 08:38 | 6.0K | |
| ipv6mon-1.0_5.pkg | 2023-10-11 15:07 | 181K | |
| ipv6toolkit-2.0.pkg | 2023-10-14 07:12 | 393K | |
| ipxe-g20230822,1.pkg | 2023-10-09 07:44 | 2.7M | |
| iqpuzzle-1.2.9.pkg | 2023-10-14 13:58 | 583K | |
| iqtree-2.2.2.7.pkg | 2023-10-14 18:12 | 3.1M | |
| ir-lv2-1.3.4_4.pkg | 2023-10-09 02:25 | 31K | |
| irc-2.11.2p3.pkg | 2023-10-09 03:21 | 169K | |
| irc-ninja-1.5.8.1.pkg | 2023-10-14 11:16 | 231K | |
| irc2dc-0.1.pkg | 2023-10-10 10:52 | 34K | |
| ircd-hybrid-8.2.43.pkg | 2023-10-08 02:28 | 229K | |
| ircd-ratbox-3.0.10_7..> | 2023-10-10 07:47 | 422K | |
| ircd-ratbox-devel-3...> | 2023-10-09 19:11 | 439K | |
| ircii-20210314.pkg | 2023-10-09 15:05 | 356K | |
| ircproxy-1.3.6_3.pkg | 2023-10-09 18:00 | 82K | |
| irdma-1.2.17.pkg | 2023-10-14 13:43 | 119K | |
| ireport-3.7.6_1.pkg | 2023-10-14 17:13 | 69M | |
| iridium-browser-2023..> | 2023-10-11 14:47 | 82M | |
| iroffer-dinoex-3.33.pkg | 2023-10-09 14:04 | 433K | |
| ironscanner-1.1.0.20..> | 2023-10-08 12:28 | 433K | |
| irrlamb-1.0.3_2.pkg | 2023-10-14 13:38 | 13M | |
| irrlicht-1.8.5_1.pkg | 2023-10-07 09:26 | 7.4M | |
| irrtoolset-5.1.3_1.pkg | 2023-10-09 13:47 | 382K | |
| irsim-9.7.116.pkg | 2023-10-14 02:39 | 159K | |
| irssi-1.4.4,2.pkg | 2023-10-07 14:26 | 663K | |
| irssi-fish-1.6.20200..> | 2023-10-10 04:34 | 20K | |
| irssi-icb-0.17_3.pkg | 2023-10-08 15:53 | 13K | |
| irssi-scripts-202207..> | 2023-10-09 02:53 | 643K | |
| irssi-themes-2016082..> | 2023-10-08 20:09 | 96K | |
| irssi-xmpp-0.54_1.pkg | 2023-10-09 10:58 | 57K | |
| irssistats-0.75.pkg | 2023-10-10 01:16 | 49K | |
| irstlm-5.80.03_4.pkg | 2023-10-10 05:28 | 382K | |
| is-aspell-0.51.1.0_1..> | 2023-10-14 18:53 | 1.4M | |
| is-hyphen-2004.04.15..> | 2023-10-09 02:16 | 12K | |
| is-libreoffice-7.5.5..> | 2023-10-07 16:54 | 2.8M | |
| isa-l-2.30.0.pkg | 2023-10-07 01:01 | 146K | |
| isaac-4.2_17.pkg | 2023-10-08 13:26 | 3.6M | |
| isabella-ttf-1.202_3..> | 2023-10-14 13:44 | 50K | |
| isbg-2.2.1.pkg | 2023-10-09 20:00 | 42K | |
| isboot-kmod-0.2.15.pkg | 2023-10-14 05:15 | 23K | |
| isc-cron-4.1_2.pkg | 2023-10-10 19:31 | 32K | |
| isc-dhcp44-client-4...> | 2023-10-08 04:36 | 1.0M | |
| isc-dhcp44-relay-4.4..> | 2023-10-10 02:13 | 956K | |
| isc-dhcp44-server-4...> | 2023-10-08 19:33 | 1.5M | |
| ised-2.7.1_8.pkg | 2023-10-14 07:22 | 69K | |
| iselect-1.4.0_2.pkg | 2023-10-09 06:15 | 27K | |
| isfreedesktop-0.1.1_..> | 2023-10-07 03:02 | 1.4K | |
| ish-2.01a5.pkg | 2023-10-10 07:29 | 21K | |
| ishido-1.1_2.pkg | 2023-10-10 23:40 | 12K | |
| isic-0.07_5.pkg | 2023-10-11 22:11 | 27K | |
| isl-0.26.pkg | 2023-10-05 17:34 | 1.3M | |
| ismtp-g20190921.pkg | 2023-10-14 18:44 | 5.7K | |
| isnprober-1.02.pkg | 2023-10-08 12:52 | 9.9K | |
| iso-codes-4.15.0.pkg | 2023-10-05 17:28 | 2.7M | |
| iso-schematron-xslt-..> | 2023-10-07 17:30 | 44K | |
| iso2mkv-2011.05.02_4..> | 2023-10-10 10:11 | 8.8K | |
| iso8879-1986_3.pkg | 2023-10-05 16:41 | 13K | |
| iso12083-1993_2.pkg | 2023-10-07 15:11 | 12K | |
| isomaster-1.3.16_1.pkg | 2023-10-09 08:45 | 141K | |
| isoqlog-2.2.1_1.pkg | 2023-10-11 04:54 | 42K | |
| ispc-1.21.0_1.pkg | 2023-10-06 15:56 | 2.0M | |
| istatserver-3.02_2.pkg | 2023-10-09 04:06 | 134K | |
| istgt-20150713.pkg | 2023-10-10 13:25 | 148K | |
| istio-1.7.4_15.pkg | 2023-10-09 20:06 | 14M | |
| isync-1.4.4.pkg | 2023-10-14 08:50 | 92K | |
| it-aspell-2.4.200709..> | 2023-10-10 09:06 | 664K | |
| it-hunspell-2016.02...> | 2023-10-10 09:03 | 291K | |
| it-hyphen-2016.02.10..> | 2023-10-09 04:45 | 1.4K | |
| it-libreoffice-7.5.5..> | 2023-10-07 14:01 | 3.1M | |
| it-mythes-02.09.l_1.pkg | 2023-10-09 18:48 | 653K | |
| itcl-3.4.4,1.pkg | 2023-10-06 22:17 | 109K | |
| itcl4-4.2.3.pkg | 2023-10-14 05:38 | 195K | |
| itinerary-23.08.1.pkg | 2023-10-09 09:50 | 769K | |
| itk-3.4.2.pkg | 2023-10-07 08:34 | 47K | |
| itop-2.6.1.pkg | 2023-10-09 10:08 | 7.8M | |
| itstool-2.0.7.pkg | 2023-10-05 17:15 | 18K | |
| ittywm-g20180507.pkg | 2023-10-09 01:59 | 4.1K | |
| ivan-0.59_1.pkg | 2023-10-11 00:42 | 23M | |
| iverilog-12.0.pkg | 2023-10-08 00:43 | 1.8M | |
| ivykis-0.42.4.pkg | 2023-10-08 08:52 | 63K | |
| iw-aspell-1.0.0_1,2.pkg | 2023-10-14 07:13 | 1.9M | |
| iw-culmus-0.133.pkg | 2023-10-09 09:17 | 807K | |
| iw-elmar-fonts-3.3_6..> | 2023-10-08 10:19 | 414K | |
| iw-he2-0.61_3.pkg | 2023-10-10 00:17 | 227K | |
| iw-hspell-1.4.pkg | 2023-10-09 09:28 | 202K | |
| iw-hunspell-1.4.pkg | 2023-10-10 10:43 | 648K | |
| iwidgets-4.0.1_1.pkg | 2023-10-07 13:39 | 564K | |
| iwmbt-firmware-20221..> | 2023-10-14 09:11 | 1.9M | |
| iwnet-g20220907.pkg | 2023-10-07 11:43 | 714K | |
| j4-dmenu-desktop-2.1..> | 2023-10-14 10:02 | 38K | |
| ja-ASCIIdates98-fpw-..> | 2023-10-08 12:41 | 23K | |
| ja-CGdic-fpw-1.0_1.pkg | 2023-10-08 19:01 | 39K | |
| ja-FreeWnn-lib-1.1.1..> | 2023-10-07 00:56 | 342K | |
| ja-FreeWnn-server-1...> | 2023-10-09 09:59 | 807K | |
| ja-R-cran-zipangu-0...> | 2023-10-08 19:05 | 247K | |
| ja-Wnn6-lib-2000.9.1..> | 2023-10-08 07:02 | 208K | |
| ja-Wnn7-lib-2001.10...> | 2023-10-07 21:44 | 215K | |
| ja-a2ps-1.45_5.pkg | 2023-10-08 20:18 | 10K | |
| ja-ack-1.39_1.pkg | 2023-10-10 21:06 | 9.5K | |
| ja-ajaxzip2-core-200..> | 2023-10-08 00:23 | 5.9K | |
| ja-ajaxzip2-data-202..> | 2023-10-09 15:08 | 1.0M | |
| ja-alias-fonts-1.0_1..> | 2023-10-08 12:32 | 2.0K | |
| ja-another-htmllint-..> | 2023-10-09 09:26 | 255K | |
| ja-anthy-0.4_4,1.pkg | 2023-10-07 02:50 | 5.5M | |
| ja-awffull-3.10.2_18..> | 2023-10-10 20:02 | 370K | |
| ja-bible_names-fpw-1..> | 2023-10-10 21:42 | 76K | |
| ja-boiled-mozc-0.7_1..> | 2023-10-09 21:53 | 5.7K | |
| ja-boiled-mozc-emacs..> | 2023-10-09 07:19 | 5.7K | |
| ja-boiled-mozc-emacs..> | 2023-10-10 22:18 | 5.7K | |
| ja-boiled-mozc-emacs..> | 2023-10-10 23:28 | 5.7K | |
| ja-boiled-mozc-emacs..> | 2023-10-09 00:04 | 5.7K | |
| ja-bookview-3.2.1_1.pkg | 2023-10-09 10:50 | 215K | |
| ja-bugzilla44-4.4.9.pkg | 2023-10-09 09:48 | 259K | |
| ja-bugzilla50-5.0.2.pkg | 2023-10-14 08:45 | 212K | |
| ja-canna-lib-3.7p3_9..> | 2023-10-05 17:15 | 454K | |
| ja-canna-server-3.7p..> | 2023-10-07 15:27 | 880K | |
| ja-cannadic-0.95c_4.pkg | 2023-10-10 15:04 | 1.3M | |
| ja-cdrom2-1996.06.16..> | 2023-10-11 15:10 | 38K | |
| ja-celrw-0.16.pkg | 2023-10-09 13:43 | 26K | |
| ja-chasen-base-2.4.5..> | 2023-10-08 07:36 | 497K | |
| ja-cmigemo-20141220.pkg | 2023-10-07 17:16 | 31K | |
| ja-cmigemo-dict-2014..> | 2023-10-07 00:32 | 3.5M | |
| ja-cp5022x-el-0.0.20..> | 2023-10-10 08:24 | 4.0K | |
| ja-cp5022x-el-emacs_..> | 2023-10-12 00:33 | 4.0K | |
| ja-cp5022x-el-emacs_..> | 2023-10-10 01:25 | 4.0K | |
| ja-cp5022x-el-emacs_..> | 2023-10-09 20:09 | 4.0K | |
| ja-cp5022x-el-emacs_..> | 2023-10-09 06:13 | 4.0K | |
| ja-csrd-1.0_1.pkg | 2023-10-10 02:46 | 43K | |
| ja-ctags-5.8j2.pkg | 2023-10-08 17:21 | 122K | |
| ja-dams-4.3.4.pkg | 2023-10-10 13:30 | 85M | |
| ja-dbskkd-cdb-3.00.pkg | 2023-10-10 05:44 | 11K | |
| ja-ddskk-16.2_15.pkg | 2023-10-10 00:44 | 529K | |
| ja-ddskk-emacs_canna..> | 2023-10-09 21:23 | 529K | |
| ja-ddskk-emacs_nox-1..> | 2023-10-08 23:21 | 529K | |
| ja-devil-fpw-1.0.3.pkg | 2023-10-14 10:48 | 161K | |
| ja-dvi2tty-ascii-5.0..> | 2023-10-09 14:22 | 16K | |
| ja-e2ps-4.34.pkg | 2023-10-14 10:42 | 26K | |
| ja-eb-4.4.3_5.pkg | 2023-10-08 09:21 | 277K | |
| ja-ebd-fpw-1.0_1.pkg | 2023-10-10 18:11 | 826K | |
| ja-eblook-1.6.1_10.pkg | 2023-10-14 18:52 | 49K | |
| ja-ebnetd-1.0_12.pkg | 2023-10-09 15:59 | 97K | |
| ja-ebview-gtk2-0.3.6..> | 2023-10-09 00:56 | 155K | |
| ja-edict-19990714_5.pkg | 2023-10-07 15:50 | 25M | |
| ja-edict-fpw-1.2.2.pkg | 2023-10-09 00:30 | 7.4M | |
| ja-edyvalue-2007.01...> | 2023-10-10 13:10 | 3.5K | |
| ja-epwutil-1.1_1.pkg | 2023-10-08 16:54 | 47K | |
| ja-esecanna-1.0.1_6.pkg | 2023-10-08 09:19 | 22K | |
| ja-esecanna-module-v..> | 2023-10-09 02:47 | 21K | |
| ja-esecanna-module-v..> | 2023-10-14 07:18 | 19K | |
| ja-esecanna-module-w..> | 2023-10-10 11:48 | 8.8K | |
| ja-eterm-0.9.6_5.pkg | 2023-10-14 09:56 | 477K | |
| ja-fcitx-anthy-0.2.3..> | 2023-10-09 13:37 | 118K | |
| ja-fcitx-mozc-2.23.2..> | 2023-10-10 07:34 | 238K | |
| ja-fcitx-skk-0.1.4_3..> | 2023-10-14 16:19 | 41K | |
| ja-fcitx5-anthy-5.0...> | 2023-10-08 19:49 | 159K | |
| ja-flower-fpw-1.0_1.pkg | 2023-10-10 15:31 | 53K | |
| ja-foldoc-fpw-1.0.2.pkg | 2023-10-09 03:14 | 1.7M | |
| ja-font-aozoramincho..> | 2023-10-09 06:10 | 26M | |
| ja-font-ayu18-1.3.1...> | 2023-10-10 21:14 | 967K | |
| ja-font-ayu20-1.7.a_..> | 2023-10-08 19:46 | 553K | |
| ja-font-cica-5.0.3.pkg | 2023-10-09 14:15 | 19M | |
| ja-font-elisa8-1.0_4..> | 2023-10-07 19:23 | 94K | |
| ja-font-elisa10-1.0_..> | 2023-10-14 13:22 | 84K | |
| ja-font-firge-0.2.0_..> | 2023-10-14 07:35 | 18M | |
| ja-font-firge-nerd-0..> | 2023-10-14 13:17 | 20M | |
| ja-font-genjyuugothi..> | 2023-10-10 03:29 | 79M | |
| ja-font-genshingothi..> | 2023-10-14 08:00 | 45M | |
| ja-font-hackgen-2.9...> | 2023-10-10 19:27 | 31M | |
| ja-font-hackgen-nf-2..> | 2023-10-08 15:34 | 19M | |
| ja-font-ipa-00303_7.pkg | 2023-10-07 00:49 | 7.7M | |
| ja-font-ipa-uigothic..> | 2023-10-07 10:25 | 2.2M | |
| ja-font-ipaex-00401.pkg | 2023-10-09 05:53 | 7.4M | |
| ja-font-ipamjm-00601..> | 2023-10-14 11:43 | 24M | |
| ja-font-jisx0213-200..> | 2023-10-07 11:17 | 7.1M | |
| ja-font-kaname12-1.1..> | 2023-10-09 20:25 | 578K | |
| ja-font-kanji18-1.0_..> | 2023-10-08 06:05 | 1.4M | |
| ja-font-kanji26-1.0_..> | 2023-10-07 14:58 | 2.6M | |
| ja-font-kappa20-0.39..> | 2023-10-08 04:18 | 3.0M | |
| ja-font-kochi-200308..> | 2023-10-09 07:09 | 6.6M | |
| ja-font-koruri-20210..> | 2023-10-14 14:19 | 4.1M | |
| ja-font-marumoji-1.0..> | 2023-10-09 07:05 | 2.2M | |
| ja-font-mgenplus-201..> | 2023-10-09 23:58 | 161M | |
| ja-font-migmix-1.0.2..> | 2023-10-11 04:55 | 4.9M | |
| ja-font-migu-1.0.201..> | 2023-10-06 23:50 | 4.8M | |
| ja-font-mikachan-9.1..> | 2023-10-14 09:06 | 1.8M | |
| ja-font-mona-2.90_3.pkg | 2023-10-08 02:18 | 4.3M | |
| ja-font-mona-ipa-1.0..> | 2023-10-10 16:05 | 6.0M | |
| ja-font-mona-ttf-2.9..> | 2023-10-07 20:36 | 1.4M | |
| ja-font-motoya-al-0...> | 2023-10-10 10:29 | 2.6M | |
| ja-font-mplus-bitmap..> | 2023-10-10 18:57 | 363K | |
| ja-font-mplus-ipa-1...> | 2023-10-07 01:16 | 3.3M | |
| ja-font-mplus-outlin..> | 2023-10-14 05:53 | 25M | |
| ja-font-myrica-2.012..> | 2023-10-14 18:15 | 4.5M | |
| ja-font-myricam-2.01..> | 2023-10-10 21:19 | 4.2M | |
| ja-font-naga10-1.1_4..> | 2023-10-08 06:32 | 804K | |
| ja-font-nasu-2020022..> | 2023-10-09 06:59 | 9.4M | |
| ja-font-plemoljp-1.6..> | 2023-10-14 12:39 | 61M | |
| ja-font-plemoljp-hs-..> | 2023-10-14 07:37 | 61M | |
| ja-font-plemoljp-nf-..> | 2023-10-08 21:16 | 33M | |
| ja-font-ricty-4.1.1_..> | 2023-10-14 03:55 | 6.5M | |
| ja-font-ricty-discor..> | 2023-10-07 17:26 | 6.5M | |
| ja-font-rounded-mgen..> | 2023-10-08 20:28 | 260M | |
| ja-font-sazanami-200..> | 2023-10-12 12:37 | 5.7M | |
| ja-font-shinonome-0...> | 2023-10-07 13:01 | 4.7M | |
| ja-font-std-0.0.2019..> | 2023-10-08 00:52 | 884 | |
| ja-font-takao-003.02..> | 2023-10-10 03:09 | 11M | |
| ja-font-udev-gothic-..> | 2023-10-10 21:20 | 42M | |
| ja-font-udev-gothic-..> | 2023-10-08 16:42 | 30M | |
| ja-font-ume-0.0.670.pkg | 2023-10-11 15:31 | 21M | |
| ja-font-vlgothic-202..> | 2023-10-09 16:50 | 2.1M | |
| ja-freepwing-1.4.4_2..> | 2023-10-08 05:02 | 53K | |
| ja-fumeikai-fpw-1.0_..> | 2023-10-10 18:18 | 541K | |
| ja-gawk-3.0.6_1.pkg | 2023-10-08 21:32 | 138K | |
| ja-gedy-0.9.0_3.pkg | 2023-10-08 17:05 | 9.7K | |
| ja-groff-1.18.1_18.pkg | 2023-10-07 03:46 | 1.6M | |
| ja-gskk-20041208.pkg | 2023-10-14 11:17 | 1.0M | |
| ja-gsuica-0.9.1_4.pkg | 2023-10-14 17:32 | 13K | |
| ja-hns-2.19.9_1.pkg | 2023-10-08 14:22 | 626K | |
| ja-ibus-anthy-1.5.11..> | 2023-10-09 02:58 | 791K | |
| ja-ibus-mozc-2.23.28..> | 2023-10-09 17:38 | 257K | |
| ja-ibus-skk-1.4.3_1.pkg | 2023-10-08 15:36 | 38K | |
| ja-icanna-0.9.0.pkg | 2023-10-09 17:58 | 3.0K | |
| ja-ipadic-2.7.0_2.pkg | 2023-10-14 10:43 | 5.1M | |
| ja-jacode.pl-2.13.4...> | 2023-10-09 16:06 | 41K | |
| ja-japana-2.0.6_1.pkg | 2023-10-08 20:14 | 11K | |
| ja-japaneseAFM-1.0.pkg | 2023-10-07 13:07 | 155K | |
| ja-jargon-fpw-2.0.pkg | 2023-10-08 20:12 | 3.1M | |
| ja-jcode.pl-2.13_2.pkg | 2023-10-14 13:41 | 7.2K | |
| ja-jed-0.99.8.j067_6..> | 2023-10-10 17:13 | 441K | |
| ja-jishyo-0.1_13.pkg | 2023-10-08 09:39 | 2.6M | |
| ja-kakasi-2.3.5_3.pkg | 2023-10-06 16:35 | 743K | |
| ja-kasumi-2.5_9.pkg | 2023-10-08 04:11 | 57K | |
| ja-kbanner-2.1_5.pkg | 2023-10-14 12:01 | 121K | |
| ja-kcc-1.1.pkg | 2023-10-08 01:42 | 13K | |
| ja-kcode-1.0.pkg | 2023-10-10 02:29 | 5.5K | |
| ja-kdrill-6.5.pkg | 2023-10-14 11:28 | 57K | |
| ja-kinput2-3.1_13.pkg | 2023-10-14 14:19 | 176K | |
| ja-kiten-23.08.1.pkg | 2023-10-07 07:55 | 11M | |
| ja-kon2-14dot-0.3_7.pkg | 2023-10-11 04:53 | 457K | |
| ja-kon2-16dot-0.3_7.pkg | 2023-10-14 14:35 | 457K | |
| ja-leafrogue-0.72_3.pkg | 2023-10-09 17:56 | 21K | |
| ja-less-382.262.03.0..> | 2023-10-07 04:08 | 187K | |
| ja-libgd-2.3.3_7,1.pkg | 2023-10-09 17:12 | 217K | |
| ja-libreoffice-7.5.5..> | 2023-10-08 11:19 | 3.3M | |
| ja-libskk-1.0.5.pkg | 2023-10-07 15:11 | 194K | |
| ja-libslang-1.4.5.j2..> | 2023-10-07 16:58 | 516K | |
| ja-libtomoe-gtk-0.6...> | 2023-10-07 12:38 | 72K | |
| ja-lipsf-2.00_1.pkg | 2023-10-10 04:14 | 71K | |
| ja-lookup-1.99.96.20..> | 2023-10-14 11:51 | 317K | |
| ja-lookup-emacs_cann..> | 2023-10-14 06:41 | 317K | |
| ja-lookup-emacs_deve..> | 2023-10-08 16:53 | 316K | |
| ja-lookup-emacs_deve..> | 2023-10-09 08:41 | 316K | |
| ja-lookup-emacs_nox-..> | 2023-10-11 17:51 | 317K | |
| ja-ls-0.5.pkg | 2023-10-09 07:53 | 19K | |
| ja-lsd-fpw-3.0.1.pkg | 2023-10-14 10:18 | 2.7M | |
| ja-lynx-2.8.9.r1.pkg | 2023-10-14 11:27 | 1.0M | |
| ja-lynx-current-2.9...> | 2023-10-09 10:57 | 1.0M | |
| ja-man-1.1j_9.pkg | 2023-10-08 09:41 | 49K | |
| ja-man-doc-5.4.20050..> | 2023-10-10 23:27 | 5.2M | |
| ja-mecab-0.996_3.pkg | 2023-10-06 18:53 | 401K | |
| ja-mecab-ipadic-2.7...> | 2023-10-10 12:08 | 768 | |
| ja-mecab-ipadic-eucj..> | 2023-10-10 15:12 | 7.8M | |
| ja-mecab-ipadic-sjis..> | 2023-10-10 01:21 | 8.7M | |
| ja-mecab-ipadic-utf8..> | 2023-10-08 00:44 | 8.7M | |
| ja-mh-6.8.4.j3.05_5.pkg | 2023-10-08 13:42 | 895K | |
| ja-migemo-0.40_9,1.pkg | 2023-10-10 22:31 | 1.4M | |
| ja-migemo.el-1.9.2_1..> | 2023-10-08 21:07 | 7.3K | |
| ja-migemo.el-emacs_c..> | 2023-10-08 20:29 | 7.3K | |
| ja-migemo.el-emacs_d..> | 2023-10-14 04:59 | 7.3K | |
| ja-migemo.el-emacs_d..> | 2023-10-09 12:58 | 7.3K | |
| ja-migemo.el-emacs_n..> | 2023-10-14 03:03 | 7.3K | |
| ja-mozc-el-2.23.2815..> | 2023-10-08 08:48 | 37K | |
| ja-mozc-el-emacs_can..> | 2023-10-07 13:42 | 37K | |
| ja-mozc-el-emacs_dev..> | 2023-10-07 23:29 | 37K | |
| ja-mozc-el-emacs_dev..> | 2023-10-08 06:59 | 37K | |
| ja-mozc-el-emacs_nox..> | 2023-10-07 18:56 | 37K | |
| ja-mozc-server-2.23...> | 2023-10-07 07:18 | 12M | |
| ja-mozc-tool-2.23.28..> | 2023-10-08 10:13 | 748K | |
| ja-mypaedia-fpw-pack..> | 2023-10-09 03:44 | 6.7K | |
| ja-namazu-1.3.0.11_1..> | 2023-10-09 11:15 | 274K | |
| ja-namazu2-2.0.21_1.pkg | 2023-10-09 14:36 | 780 | |
| ja-navi2ch-2.0.0.d_2..> | 2023-10-10 00:20 | 293K | |
| ja-navi2ch-emacs_can..> | 2023-10-10 12:41 | 293K | |
| ja-navi2ch-emacs_dev..> | 2023-10-10 03:24 | 293K | |
| ja-navi2ch-emacs_dev..> | 2023-10-10 02:00 | 293K | |
| ja-navi2ch-emacs_nox..> | 2023-10-11 11:28 | 293K | |
| ja-ne-3.05.pkg | 2023-10-09 10:49 | 90K | |
| ja-nethack-3.4.3_7.pkg | 2023-10-10 02:45 | 1.2M | |
| ja-newosaka-1.0.pkg | 2023-10-10 15:44 | 6.9K | |
| ja-ng-1.4.4_2.pkg | 2023-10-09 03:04 | 135K | |
| ja-ng-canna-1.4.4_2.pkg | 2023-10-11 00:15 | 138K | |
| ja-ng-devel-1.5.b1.pkg | 2023-10-09 13:17 | 137K | |
| ja-ngraph-fonts-1.0_..> | 2023-10-10 03:13 | 852 | |
| ja-nkf-2.1.4,1.pkg | 2023-10-06 22:16 | 117K | |
| ja-p5-2chproxy-1.0.1..> | 2023-10-07 15:22 | 17K | |
| ja-p5-Date-Japanese-..> | 2023-10-10 17:17 | 10K | |
| ja-p5-Date-Japanese-..> | 2023-10-08 12:45 | 4.0K | |
| ja-p5-DateTime-Calen..> | 2023-10-07 03:57 | 11K | |
| ja-p5-DateTime-Forma..> | 2023-10-10 10:13 | 17K | |
| ja-p5-Encode-EUCJPAS..> | 2023-10-08 08:06 | 79K | |
| ja-p5-Encode-EUCJPMS..> | 2023-10-10 14:37 | 116K | |
| ja-p5-Encode-ISO2022..> | 2023-10-09 22:25 | 90K | |
| ja-p5-Encode-JP-Emoj..> | 2023-10-10 17:34 | 40K | |
| ja-p5-Encode-JP-Mobi..> | 2023-10-08 04:54 | 276K | |
| ja-p5-HTML-MobileJp-..> | 2023-10-11 04:56 | 8.3K | |
| ja-p5-Jcode-2.07_1.pkg | 2023-10-06 21:39 | 24K | |
| ja-p5-Lingua-JA-Kana..> | 2023-10-10 22:40 | 6.5K | |
| ja-p5-Lingua-JA-Moji..> | 2023-10-10 15:49 | 62K | |
| ja-p5-Lingua-JA-Numb..> | 2023-10-07 11:05 | 12K | |
| ja-p5-Lingua-JA-Regu..> | 2023-10-08 03:58 | 6.1K | |
| ja-p5-Lingua-JA-Summ..> | 2023-10-10 05:44 | 13K | |
| ja-p5-MeCab-0.996_2.pkg | 2023-10-07 20:36 | 34K | |
| ja-p5-Number-Phone-J..> | 2023-10-08 12:32 | 23K | |
| ja-p5-PDFJ-0.90_3.pkg | 2023-10-14 14:23 | 1.3M | |
| ja-p5-Text-ChaSen-1...> | 2023-10-09 02:48 | 11K | |
| ja-p5-Text-Kakasi-2...> | 2023-10-06 19:32 | 16K | |
| ja-p5-Text-MeCab-0.2..> | 2023-10-10 03:21 | 24K | |
| ja-p5-Unicode-Japane..> | 2023-10-07 22:18 | 119K | |
| ja-p5-WWW-MobileCarr..> | 2023-10-06 22:54 | 54K | |
| ja-p5-mime_pls-2.02_..> | 2023-10-10 12:04 | 7.5K | |
| ja-p5-nkf-2.1.4,1.pkg | 2023-10-08 07:21 | 109K | |
| ja-pejv-fpw-1.0.4.pkg | 2023-10-09 17:45 | 632K | |
| ja-plain2-2.54.1_2.pkg | 2023-10-10 11:37 | 51K | |
| ja-plan-1.12_2.pkg | 2023-10-09 10:38 | 266K | |
| ja-prn-1.0_1.pkg | 2023-10-10 13:08 | 43K | |
| ja-qkc-1.0.pkg | 2023-10-10 14:09 | 17K | |
| ja-qolibri-2.1.4_1.pkg | 2023-10-09 10:34 | 228K | |
| ja-quit-1.2a_1.pkg | 2023-10-08 23:48 | 5.0K | |
| ja-roget-fpw-1.0.2.pkg | 2023-10-08 20:59 | 937K | |
| ja-rogue_s-1.3a_2.pkg | 2023-10-08 01:54 | 96K | |
| ja-ruby31-romkan-0.4..> | 2023-10-08 03:57 | 4.6K | |
| ja-ruby31-uconv-0.5...> | 2023-10-08 15:30 | 130K | |
| ja-rubygem-jpmobile-..> | 2023-10-08 04:30 | 3.9K | |
| ja-rubygem-jpmobile-..> | 2023-10-08 07:53 | 5.4K | |
| ja-rubygem-jpmobile4..> | 2023-10-09 09:43 | 225K | |
| ja-rubygem-mail-iso-..> | 2023-10-14 09:50 | 6.8K | |
| ja-rubygem-myrurema-..> | 2023-10-09 21:51 | 8.0K | |
| ja-ryaku-fpw-1.0.1_1..> | 2023-10-14 05:06 | 330K | |
| ja-scim-anthy-1.2.7_..> | 2023-10-10 23:53 | 333K | |
| ja-scim-canna-1.0.0_..> | 2023-10-09 15:06 | 45K | |
| ja-scim-honoka-0.9.1..> | 2023-10-06 23:22 | 177K | |
| ja-scim-honoka-plugi..> | 2023-10-08 05:31 | 39K | |
| ja-scim-honoka-plugi..> | 2023-10-10 07:05 | 31K | |
| ja-scim-skk-0.5.2_12..> | 2023-10-09 04:39 | 140K | |
| ja-scim-tables-0.5.1..> | 2023-10-10 17:36 | 86K | |
| ja-scim-tomoe-0.6.0_..> | 2023-10-10 01:11 | 26K | |
| ja-scim-uim-0.2.0_15..> | 2023-10-14 12:25 | 29K | |
| ja-seaside-080908.s3..> | 2023-10-08 17:20 | 11M | |
| ja-sj3-lib-2.0.1.20_..> | 2023-10-08 00:48 | 36K | |
| ja-sj3-server-2.0.1...> | 2023-10-10 18:54 | 449K | |
| ja-skk-9.6_3.pkg | 2023-10-11 00:54 | 1.0K | |
| ja-skk-jisyo-201409.pkg | 2023-10-07 05:09 | 1.4M | |
| ja-skk-jisyo-cdb-201..> | 2023-10-07 18:39 | 2.7M | |
| ja-skk-tools-1.3.3_2..> | 2023-10-07 19:22 | 17K | |
| ja-skkinput-2.06.4_2..> | 2023-10-08 22:48 | 180K | |
| ja-skkinput3-3.0.6_1..> | 2023-10-10 10:17 | 331K | |
| ja-skkserv-9.6_6.pkg | 2023-10-08 02:51 | 8.2K | |
| ja-slimeforest-158.pkg | 2023-10-14 13:23 | 2.5M | |
| ja-slrn-0.9.6.2.pkg | 2023-10-08 17:03 | 282K | |
| ja-sourcehansans-otf..> | 2023-10-14 07:42 | 76M | |
| ja-sourcehanserif-ot..> | 2023-10-09 23:48 | 98M | |
| ja-spoqahansans-ttf-..> | 2023-10-14 04:27 | 37M | |
| ja-srd-fpw-package-1..> | 2023-10-14 15:45 | 6.0K | |
| ja-suicavalue-2007.0..> | 2023-10-14 07:44 | 3.3K | |
| ja-tdiary-5.2.4.pkg | 2023-10-10 00:19 | 3.6M | |
| ja-tegaki-zinnia-jap..> | 2023-10-07 05:42 | 12M | |
| ja-tex-ptex-3.6_4.pkg | 2023-10-08 06:25 | 22M | |
| ja-tgif-resource-4.2..> | 2023-10-10 18:23 | 1.4K | |
| ja-tiarra-20100212_7..> | 2023-10-14 13:41 | 350K | |
| ja-timidity++-slang-..> | 2023-10-09 03:32 | 8.1K | |
| ja-today-2.12_2.pkg | 2023-10-08 12:08 | 187K | |
| ja-tomoe-0.6.0_7.pkg | 2023-10-07 09:34 | 1.3M | |
| ja-uim-anthy-1.9.0.b..> | 2023-10-09 13:38 | 25K | |
| ja-uim-mozc-2.23.281..> | 2023-10-10 16:48 | 203K | |
| ja-uim-tomoe-gtk-0.6..> | 2023-10-09 02:46 | 4.1K | |
| ja-vera-fpw-1.8.1.0...> | 2023-10-09 10:33 | 220K | |
| ja-vftool-1.2_1.pkg | 2023-10-08 17:40 | 84K | |
| ja-w3m-0.5.3.2023012..> | 2023-10-09 10:37 | 889K | |
| ja-w3m-img-0.5.3.202..> | 2023-10-14 10:19 | 907K | |
| ja-wdic-fpw-1.4.pkg | 2023-10-10 08:36 | 34M | |
| ja-web1913-fpw-1.1.2..> | 2023-10-10 05:39 | 10M | |
| ja-webalizer-2.23.8_..> | 2023-10-14 18:23 | 129K | |
| ja-wnn7egg-1.02_1.pkg | 2023-10-10 19:28 | 81K | |
| ja-wordnet-fpw-1.6.1..> | 2023-10-09 14:35 | 6.4M | |
| ja-wordpress-ja-6.2...> | 2023-10-10 01:31 | 15M | |
| ja-wwasw-fpw-1.0.2.pkg | 2023-10-11 00:57 | 71K | |
| ja-xpdf-jafont-4.02.pkg | 2023-10-14 03:57 | 72K | |
| ja-xshodou-1.11_4.pkg | 2023-10-10 15:51 | 28K | |
| ja-xtr-1.50e.0.2_9.pkg | 2023-10-14 03:47 | 210K | |
| ja-xv-3.10a_22.pkg | 2023-10-09 04:21 | 451K | |
| ja-yc.el-5.2.1_23,1.pkg | 2023-10-10 16:27 | 48K | |
| ja-yc.el-emacs_canna..> | 2023-10-09 01:46 | 48K | |
| ja-yc.el-emacs_nox-5..> | 2023-10-08 22:42 | 48K | |
| ja-zinnia-0.06_2.pkg | 2023-10-06 19:29 | 104K | |
| ja-zinnia-tomoe-0.6...> | 2023-10-08 23:36 | 24M | |
| ja-zipcodes-20221228..> | 2023-10-14 02:53 | 1.8M | |
| ja2-0.20.0_5.pkg | 2023-10-11 01:13 | 12M | |
| jabberd-2.7.0_5.pkg | 2023-10-08 17:31 | 292K | |
| jacal-1c8.pkg | 2023-10-14 04:16 | 113K | |
| jack-capture-0.9.73...> | 2023-10-07 21:18 | 26K | |
| jack-example-tools-4..> | 2023-10-10 08:29 | 90K | |
| jack-keyboard-2.7.2_..> | 2023-10-10 04:26 | 23K | |
| jack-smf-utils-1.0_1..> | 2023-10-10 16:57 | 34K | |
| jack_ghero-1.0.4_2.pkg | 2023-10-14 14:40 | 6.9K | |
| jack_umidi-1.1.1_2.pkg | 2023-10-09 01:50 | 7.4K | |
| jackett-0.21.826.pkg | 2023-10-09 07:40 | 7.2M | |
| jackit-1.9.22_1.pkg | 2023-10-06 15:08 | 406K | |
| jacktrip-2.0.2.pkg | 2023-10-14 11:57 | 861K | |
| jacop-4.8.0.pkg | 2023-10-07 11:03 | 1.9M | |
| jad-1.5.8c.pkg | 2023-10-14 16:40 | 244K | |
| jade-1.2.1_11.pkg | 2023-10-05 17:25 | 2.1M | |
| jai-1.1.3_2.pkg | 2023-10-08 13:00 | 1.9M | |
| jail-primer-0.2.pkg | 2023-10-12 10:27 | 24K | |
| jail_exporter-0.15.1..> | 2023-10-09 01:07 | 941K | |
| jailadmin-1.9.pkg | 2023-10-14 12:01 | 12K | |
| jailaudit-1.6.1.pkg | 2023-10-14 18:16 | 3.8K | |
| jaildaemon-0.5.pkg | 2023-10-08 17:11 | 9.3K | |
| jailkit-2.23.pkg | 2023-10-08 17:43 | 80K | |
| jailme-0.2.0.pkg | 2023-10-10 01:55 | 3.2K | |
| jailrc-1.0.pkg | 2023-10-10 08:48 | 6.8K | |
| jailutils-1.7.pkg | 2023-10-09 11:50 | 25K | |
| jakarta-oro-2.0.8_2.pkg | 2023-10-08 03:17 | 124K | |
| jalbum-10.10.7.pkg | 2023-10-10 12:13 | 9.8M | |
| jalingo-0.6.0_3.pkg | 2023-10-11 12:57 | 923K | |
| jalv-1.6.8_2.pkg | 2023-10-08 03:09 | 79K | |
| jalv-select-1.3_5.pkg | 2023-10-10 15:36 | 56K | |
| jalview-2.11.2.5.pkg | 2023-10-08 19:22 | 41M | |
| jam-2.6.1.pkg | 2023-10-07 04:50 | 66K | |
| jama-1.2.5.pkg | 2023-10-09 06:11 | 33K | |
| james-2.3.2.1_1.pkg | 2023-10-09 07:09 | 6.0M | |
| jamlib-1.4.7_2.pkg | 2023-10-10 04:30 | 42K | |
| jamulus-3.10.0.pkg | 2023-10-09 15:05 | 1.3M | |
| jamulus-server-3.10...> | 2023-10-09 00:48 | 1.1M | |
| janet-1.30.0.pkg | 2023-10-07 20:55 | 523K | |
| jansson-2.14.pkg | 2023-10-05 17:06 | 46K | |
| janus-1.2.0.pkg | 2023-10-11 20:20 | 5.5M | |
| jaq-0.10.0_5.pkg | 2023-10-09 22:28 | 856K | |
| jargon-4.4.7.pkg | 2023-10-11 01:36 | 8.3M | |
| jarl-0.5001_5.pkg | 2023-10-10 11:53 | 128K | |
| jarnal-1079.pkg | 2023-10-14 19:03 | 12M | |
| jarowinkler-cpp-1.0...> | 2023-10-06 17:00 | 8.2K | |
| jasmin-2.4_1,1.pkg | 2023-10-14 18:45 | 148K | |
| jasper-4.0.0_1.pkg | 2023-10-06 09:09 | 416K | |
| jattach-2.1.pkg | 2023-10-09 03:51 | 7.1K | |
| java-beepcore-0.9.08..> | 2023-10-10 06:28 | 195K | |
| java-cup-11b.2016061..> | 2023-10-14 17:22 | 116K | |
| java-findbugs-1.3.9_..> | 2023-10-09 19:32 | 6.7M | |
| java-games-suite-1.0..> | 2023-10-09 15:49 | 39K | |
| java-getopt-1.0.14.pkg | 2023-10-07 11:33 | 46K | |
| java-sigar-1.7.3_11.pkg | 2023-10-07 20:46 | 338K | |
| java-simple-serial-c..> | 2023-10-08 00:49 | 20K | |
| java-subversion-1.14..> | 2023-10-09 21:54 | 524K | |
| java-zoneinfo-2021.e..> | 2023-10-05 16:39 | 71K | |
| java2html-0.9.2_1.pkg | 2023-10-10 09:51 | 72K | |
| java3d-1.5.2_7.pkg | 2023-10-08 08:32 | 2.0M | |
| javahelp-2.0.05.2017..> | 2023-10-07 03:10 | 901K | |
| javamail-1.6.2.pkg | 2023-10-06 22:04 | 955K | |
| javaservicewrapper-3..> | 2023-10-07 15:13 | 587K | |
| javatar-2.5_2.pkg | 2023-10-08 17:23 | 57K | |
| javatari-4.1_1.pkg | 2023-10-14 09:32 | 882K | |
| javavmwrapper-2.7.9.pkg | 2023-10-05 16:39 | 16K | |
| jave6-0.1_5.pkg | 2023-10-10 03:16 | 2.1M | |
| jaxen-1.0_4.pkg | 2023-10-07 02:59 | 316K | |
| jaxup-1.01_4.pkg | 2023-10-09 14:37 | 119K | |
| jbidwatcher-2.5.6_1.pkg | 2023-10-10 09:58 | 4.4M | |
| jbig2dec-0.19.pkg | 2023-10-05 17:43 | 77K | |
| jbigkit-2.1_1.pkg | 2023-10-05 16:42 | 69K | |
| jbxvt-0.8_1.pkg | 2023-10-11 01:29 | 32K | |
| jcalendar-1.3.3.pkg | 2023-10-14 12:02 | 416K | |
| jcckit-1.1_2.pkg | 2023-10-10 17:26 | 529K | |
| jchessboard-1.5_4.pkg | 2023-10-10 04:31 | 126K | |
| jcifs-1.3.19,1.pkg | 2023-10-10 03:56 | 560K | |
| jclassinfo-0.19.1_1.pkg | 2023-10-10 20:48 | 47K | |
| jcmdline-2.0.0.pkg | 2023-10-10 16:21 | 115K | |
| jcommon-1.0.23.pkg | 2023-10-07 12:27 | 1.0M | |
| jconvolver-1.1.0_2.pkg | 2023-10-08 17:45 | 20K | |
| jd-gui-1.6.6.pkg | 2023-10-14 06:56 | 2.8M | |
| jday-2.4_1.pkg | 2023-10-08 21:08 | 12K | |
| jdb-1.14_3.pkg | 2023-10-10 17:22 | 59K | |
| jdftx-1.7.0_3.pkg | 2023-10-08 13:21 | 45M | |
| jdictionary-1.8_4.pkg | 2023-10-08 00:16 | 294K | |
| jdictionary-int-eng-..> | 2023-10-10 20:11 | 828K | |
| jdiskreport-1.4.1.pkg | 2023-10-10 22:41 | 616K | |
| jdom-1.1.1,1.pkg | 2023-10-07 18:46 | 309K | |
| jdraw-1.1.5_4.pkg | 2023-10-08 17:50 | 643K | |
| jdupes-1.27.3.pkg | 2023-10-08 16:19 | 30K | |
| je-7.5.11.pkg | 2023-10-09 03:43 | 6.7M | |
| jed-0.99.19_4.pkg | 2023-10-10 08:41 | 493K | |
| jedit-5.6.0,1.pkg | 2023-10-08 21:30 | 3.2M | |
| jellyfin-10.8.10_2.pkg | 2023-10-09 02:22 | 59M | |
| jenkins-2.422.pkg | 2023-10-14 17:37 | 85M | |
| jenkins-lts-2.414.1.pkg | 2023-10-11 01:18 | 85M | |
| jericho-html-3.2.pkg | 2023-10-14 11:03 | 394K | |
| jesred-1.2.1_1.pkg | 2023-10-09 23:05 | 11K | |
| jest-3.0.16_16.pkg | 2023-10-14 10:21 | 1.9M | |
| jetbrains-clion-2023..> | 2023-10-09 23:29 | 253M | |
| jetbrains-datagrip-2..> | 2023-10-10 16:51 | 265M | |
| jetbrains-goland-202..> | 2023-10-08 17:03 | 243M | |
| jetbrains-mono-2.304..> | 2023-10-07 22:15 | 717K | |
| jetbrains-phpstorm-2..> | 2023-10-14 03:43 | 246M | |
| jetbrains-pty4j-0.12..> | 2023-10-08 11:44 | 4.2K | |
| jetbrains-sqlite-232..> | 2023-10-08 01:32 | 618K | |
| jetbrains-webstorm-2..> | 2023-10-09 20:21 | 213M | |
| jetty8-8.1.15_1.pkg | 2023-10-07 14:20 | 7.4M | |
| jetty9-openjdk8-9.4...> | 2023-10-10 22:24 | 15M | |
| jetty9-openjdk11-9.4..> | 2023-10-09 06:12 | 15M | |
| jetty10-10.0.16.pkg | 2023-10-07 16:48 | 9.9M | |
| jeuclid-3.1.9.pkg | 2023-10-07 07:37 | 6.7M | |
| jewel-0.12.41_4.pkg | 2023-10-08 19:29 | 92K | |
| jf-openhuninn-2.0.pkg | 2023-10-11 18:20 | 2.2M | |
| jfk-0.1.1_12.pkg | 2023-10-10 00:37 | 1.9M | |
| jflex-1.8.1.pkg | 2023-10-08 22:49 | 2.1M | |
| jfreechart-1.0.17.pkg | 2023-10-08 17:24 | 4.7M | |
| jfsw-20211225_2.pkg | 2023-10-12 08:40 | 787K | |
| jftp-1.60.pkg | 2023-10-09 09:33 | 3.6M | |
| jggtrans-2.2.6_3.pkg | 2023-10-14 06:39 | 67K | |
| jgmenu-4.4.1.pkg | 2023-10-08 21:03 | 130K | |
| jgnash-2.21.0.pkg | 2023-10-08 16:08 | 40M | |
| jgoodies-looks-2.7.0..> | 2023-10-07 08:18 | 969K | |
| jgraph-8.3_1.pkg | 2023-10-08 09:23 | 74K | |
| jgraph-java-5.13.0.4..> | 2023-10-14 18:19 | 635K | |
| jgraphx-4.2.2.pkg | 2023-10-07 07:24 | 2.2M | |
| jgroups-2.12.0.pkg | 2023-10-09 12:54 | 3.6M | |
| jhead-3.08.pkg | 2023-10-07 08:04 | 37K | |
| jicmp-1.4.4.pkg | 2023-10-09 16:53 | 28K | |
| jicmp6-1.2.3.pkg | 2023-10-09 04:58 | 12K | |
| jid-0.7.6_14.pkg | 2023-10-14 02:56 | 762K | |
| jid3lib-0.5.4_2.pkg | 2023-10-09 10:35 | 156K | |
| jigdo-0.7.3_8.pkg | 2023-10-14 04:32 | 127K | |
| jigsaw-0.8_9.pkg | 2023-10-08 11:19 | 30K | |
| jigzo-0.6.1_13.pkg | 2023-10-14 13:37 | 3.8M | |
| jiic-20120110.pkg | 2023-10-14 14:40 | 106K | |
| jikes-1.22_2.pkg | 2023-10-07 00:31 | 401K | |
| jimtcl-0.82.pkg | 2023-10-08 19:16 | 247K | |
| jin-2.14.1_4.pkg | 2023-10-10 06:07 | 16M | |
| jing-20220510.pkg | 2023-10-09 09:03 | 802K | |
| jinput-2.0.10,1.pkg | 2023-10-07 05:30 | 181K | |
| jira-cli-1.4.0_2.pkg | 2023-10-10 16:28 | 4.9M | |
| jiri-g2020.08.28_14.pkg | 2023-10-10 12:11 | 2.5M | |
| jitsi-meet-1.0.6991.pkg | 2023-10-08 02:22 | 15M | |
| jitsi-prosody-plugin..> | 2023-10-08 08:19 | 63K | |
| jjclient-1.0.2_2.pkg | 2023-10-11 06:09 | 6.3K | |
| jkill-1.0.pkg | 2023-10-09 12:22 | 2.0K | |
| jlatexmath-1.0.7.pkg | 2023-10-07 02:40 | 630K | |
| jless-0.7.2_15.pkg | 2023-10-09 03:44 | 582K | |
| jlex-1.2.6_3.pkg | 2023-10-09 17:41 | 52K | |
| jline-0.9.94.pkg | 2023-10-07 09:52 | 304K | |
| jlint-3.1.2_5.pkg | 2023-10-09 01:48 | 196K | |
| jlj-2.12.pkg | 2023-10-14 18:46 | 29K | |
| jlog-1.2.2.s20150122..> | 2023-10-10 02:15 | 61K | |
| jmatconvol-0.5.2_1.pkg | 2023-10-14 08:52 | 19K | |
| jmba-0.5.5.pkg | 2023-10-14 08:01 | 30K | |
| jmk-x11-fonts-3.0_6.pkg | 2023-10-09 03:24 | 445K | |
| jmref-19.0_1.pkg | 2023-10-08 21:56 | 711K | |
| jna-5.7.0_1.pkg | 2023-10-07 09:39 | 8.7M | |
| jnettop-0.13.0_1.pkg | 2023-10-09 19:18 | 27K | |
| jo-1.6.pkg | 2023-10-07 17:14 | 19K | |
| jode-1.1.1.1_4.pkg | 2023-10-14 12:51 | 422K | |
| joe-4.6,1.pkg | 2023-10-14 04:11 | 470K | |
| joequake-0.15b1329_1..> | 2023-10-09 16:29 | 4.1M | |
| jogamp-jogl-2.3.2_1.pkg | 2023-10-07 07:58 | 3.9M | |
| jogl-1.1.1_9.pkg | 2023-10-08 04:42 | 1.6M | |
| john-1.9.0.j.1_1.pkg | 2023-10-09 11:50 | 28M | |
| jojodiff-0.8.5.pkg | 2023-10-10 23:10 | 29K | |
| joomla4-4.3.2.pkg | 2023-10-14 04:36 | 18M | |
| jose-11.pkg | 2023-10-07 11:13 | 102K | |
| josm-18822.pkg | 2023-10-07 16:55 | 15M | |
| jot-0.1.2_4.pkg | 2023-10-08 16:09 | 376K | |
| jotta-cli-0.15.84961..> | 2023-10-08 15:32 | 9.9M | |
| jove-4.16_2.pkg | 2023-10-14 03:03 | 133K | |
| joytran-0.9.5.2_1.pkg | 2023-10-10 00:36 | 43K | |
| jp-1.1.12_17.pkg | 2023-10-09 01:24 | 1.1M | |
| jp2a-1.1.1_1.pkg | 2023-10-09 10:45 | 21K | |
| jpatch-0.4.p1_3.pkg | 2023-10-10 11:41 | 1.9M | |
| jpeg-turbo-3.0.0.pkg | 2023-10-05 17:39 | 442K | |
| jpeginfo-1.7.0_1.pkg | 2023-10-14 09:13 | 33K | |
| jpegoptim-1.5.5_1.pkg | 2023-10-07 14:15 | 19K | |
| jpgtn-2.06_5.pkg | 2023-10-14 02:40 | 9.3K | |
| jpm-1.1.0.pkg | 2023-10-08 17:09 | 29K | |
| jps-1.0.pkg | 2023-10-10 05:55 | 2.5K | |
| jq-1.7_1.pkg | 2023-10-06 23:43 | 330K | |
| jql-7.0.3_1.pkg | 2023-10-14 18:43 | 346K | |
| jrdesktop-0.3.1.0.pkg | 2023-10-10 12:35 | 341K | |
| jrefentry-1.1_2.pkg | 2023-10-12 11:46 | 4.4K | |
| jrobin-1.5.14.pkg | 2023-10-08 12:01 | 749K | |
| jrosetta-1.0.4_1.pkg | 2023-10-07 02:52 | 52K | |
| jrrd-1.1.4.pkg | 2023-10-14 05:48 | 6.8K | |
| jrtplib-3.11.2.pkg | 2023-10-08 17:18 | 190K | |
| jruby-9.2.17.0.pkg | 2023-10-07 05:48 | 21M | |
| jruls-0.2.pkg | 2023-10-14 12:54 | 5.2K | |
| jsMath-fonts-1.3.pkg | 2023-10-09 03:39 | 3.7M | |
| jsap-2.1_2.pkg | 2023-10-10 17:22 | 150K | |
| jsch-0.1.55.pkg | 2023-10-11 15:06 | 256K | |
| jshon-20180209.pkg | 2023-10-14 14:51 | 14K | |
| jsl-0.3.0_2.pkg | 2023-10-10 09:38 | 264K | |
| jslice-1.0.0_4.pkg | 2023-10-14 18:43 | 6.7K | |
| jsmin-20191031.pkg | 2023-10-08 22:08 | 6.4K | |
| json-c-0.17.pkg | 2023-10-06 09:15 | 67K | |
| json-dto-0.3.1.pkg | 2023-10-09 12:09 | 15K | |
| json-fortran-8.3.0.8..> | 2023-10-10 19:53 | 180K | |
| json-glib-1.6.6.pkg | 2023-10-06 08:47 | 1.2M | |
| json-tui-1.3.0.13_2.pkg | 2023-10-10 08:37 | 80K | |
| json-yaml-1.2.1.pkg | 2023-10-10 12:09 | 9.9K | |
| json2yaml-1.2.0.pkg | 2023-10-08 12:21 | 2.8K | |
| jsoncpp-1.9.5.pkg | 2023-10-05 17:17 | 125K | |
| jsonnet-0.18.0.pkg | 2023-10-07 20:17 | 2.4M | |
| jsonrpc-glib-3.42.0.pkg | 2023-10-08 01:50 | 37K | |
| jstest-gtk-20180710_..> | 2023-10-08 21:21 | 118K | |
| jstrack-3.4.0.pkg | 2023-10-09 01:00 | 145M | |
| jsxc-4.4.0.pkg | 2023-10-10 16:04 | 1.2M | |
| jtans-1.0_4.pkg | 2023-10-12 04:19 | 133K | |
| jtc-1.76.pkg | 2023-10-10 04:23 | 299K | |
| jtiger-2.1.0376.pkg | 2023-10-09 21:32 | 584K | |
| jtop-1.0.pkg | 2023-10-09 16:38 | 3.0K | |
| jtopen-6.2.pkg | 2023-10-08 14:30 | 7.4M | |
| jtransforms-2.4.pkg | 2023-10-08 19:22 | 404K | |
| jts-1.18.1.pkg | 2023-10-09 20:08 | 4.3M | |
| juce-7.0.7.pkg | 2023-10-08 07:47 | 13M | |
| jucipp-1.7.2_2.pkg | 2023-10-10 08:35 | 906K | |
| juk-23.08.1.pkg | 2023-10-09 22:15 | 2.3M | |
| juke-0.7.pkg | 2023-10-09 14:45 | 15K | |
| julia-1.9.3_1.pkg | 2023-10-09 12:34 | 42M | |
| juliamono-0.050.pkg | 2023-10-09 06:52 | 6.0M | |
| julius-4.1.2_2.pkg | 2023-10-09 10:00 | 558K | |
| julius-caesariii-1.7..> | 2023-10-08 12:27 | 384K | |
| jump-0.5_2.pkg | 2023-10-09 21:00 | 69K | |
| jumpgate-0.7_1.pkg | 2023-10-14 17:09 | 8.1K | |
| jumpnbump-1.61_2.pkg | 2023-10-08 18:23 | 181K | |
| jumpy-0.7.0_3.pkg | 2023-10-10 07:14 | 27M | |
| junction-20140329_1.pkg | 2023-10-08 12:06 | 46K | |
| junicode-1.002_1.pkg | 2023-10-09 01:49 | 1.1M | |
| junit-4.12.pkg | 2023-10-06 21:51 | 432K | |
| junkfilter-20030115_..> | 2023-10-09 09:50 | 49K | |
| jupp-3.1.41.pkg | 2023-10-14 17:00 | 185K | |
| just-1.14.0_4.pkg | 2023-10-14 06:59 | 790K | |
| jutils-1.0.1_1,1.pkg | 2023-10-06 21:03 | 6.5K | |
| jvgs-0.5.1_5.pkg | 2023-10-10 20:36 | 23M | |
| jvmtop-0.8.0.27_1.pkg | 2023-10-10 15:02 | 106K | |
| jwasm-2.17_1,1.pkg | 2023-10-09 08:25 | 206K | |
| jwhois-4.0_8.pkg | 2023-10-10 12:12 | 71K | |
| jwm-2.4.3_1.pkg | 2023-10-14 08:42 | 131K | |
| jwsmtp-1.32.15.pkg | 2023-10-10 05:13 | 139K | |
| jwt-cli-6.0.0_2.pkg | 2023-10-10 03:24 | 894K | |
| jxgrabkey-0.3.2.pkg | 2023-10-10 19:00 | 23K | |
| jxrlib-1.1.pkg | 2023-10-10 00:07 | 259K | |
| jython-2.7.0.pkg | 2023-10-07 17:43 | 57M | |
| jzintv-1.0.20200712,..> | 2023-10-10 03:40 | 1.8M | |
| jzip-2.0.1g.pkg | 2023-10-09 16:20 | 36K | |
| jzlib-1.1.1.pkg | 2023-10-08 22:24 | 67K | |
| k3b-23.08.1_1.pkg | 2023-10-09 17:33 | 11M | |
| k4dirstat-3.4.3.pkg | 2023-10-11 04:52 | 238K | |
| k8temp-0.4.1.pkg | 2023-10-08 17:23 | 7.2K | |
| k9s-0.27.4_2.pkg | 2023-10-11 17:42 | 16M | |
| k40-whisperer-0.59.pkg | 2023-10-10 05:53 | 130K | |
| kBuild-0.1.9998_15.pkg | 2023-10-06 18:48 | 610K | |
| kColorPicker-0.2.0_1..> | 2023-10-06 16:26 | 20K | |
| kImageAnnotator-0.6...> | 2023-10-06 21:11 | 316K | |
| ka-libreoffice-7.5.5..> | 2023-10-07 13:57 | 2.6M | |
| kab-libreoffice-7.5...> | 2023-10-08 11:04 | 433K | |
| kaccounts-integratio..> | 2023-10-06 14:14 | 107K | |
| kaccounts-providers-..> | 2023-10-07 05:50 | 59K | |
| kaddressbook-23.08.1..> | 2023-10-06 19:42 | 3.2M | |
| kadnode-2.3.0_1.pkg | 2023-10-08 13:22 | 51K | |
| kaffeine-2.0.18_5.pkg | 2023-10-09 22:33 | 5.8M | |
| kafka-3.5.1.pkg | 2023-10-10 02:24 | 101M | |
| kahip-3.15.pkg | 2023-10-08 00:18 | 1.1M | |
| kaidan-0.9.1_1.pkg | 2023-10-10 21:07 | 746K | |
| kak-lsp-14.2.0_5.pkg | 2023-10-08 13:49 | 1.6M | |
| kakoune-2023.08.05.pkg | 2023-10-08 05:25 | 872K | |
| kalarm-23.08.1.pkg | 2023-10-06 23:23 | 2.6M | |
| kalc-calculator-0.8...> | 2023-10-10 10:01 | 667K | |
| kalgebra-23.08.1.pkg | 2023-10-07 02:43 | 1.1M | |
| kalk-23.08.1.pkg | 2023-10-09 13:37 | 103K | |
| kalker-2.0.4_1.pkg | 2023-10-11 11:10 | 641K | |
| kallisto-0.50.0_2,1.pkg | 2023-10-08 02:22 | 1.1M | |
| kalzium-23.08.1.pkg | 2023-10-14 06:27 | 24M | |
| kamailio-5.6.2_1.pkg | 2023-10-10 22:57 | 7.3M | |
| kamera-23.08.1.pkg | 2023-10-07 00:28 | 155K | |
| kamerka-0.20_5.pkg | 2023-10-09 19:44 | 129K | |
| kamis-2.0.19.pkg | 2023-10-12 06:35 | 441K | |
| kamoso-23.08.1.pkg | 2023-10-08 23:45 | 259K | |
| kanagram-23.08.1.pkg | 2023-10-07 00:34 | 6.9M | |
| kanatest-0.4.10.g202..> | 2023-10-14 09:00 | 140K | |
| kanshi-1.4.0.pkg | 2023-10-10 15:17 | 14K | |
| kapacitor-1.5.1_14.pkg | 2023-10-09 17:21 | 9.8M | |
| kapman-23.08.1.pkg | 2023-10-07 04:46 | 2.4M | |
| kapp-0.56.0_2.pkg | 2023-10-14 01:40 | 7.7M | |
| kapptemplate-23.08.1..> | 2023-10-09 14:30 | 414K | |
| kaputa-1.000_3.pkg | 2023-10-14 04:10 | 54K | |
| kartofel-1.2_17.pkg | 2023-10-10 18:52 | 10M | |
| kasts-23.08.1.pkg | 2023-10-09 10:53 | 471K | |
| katarakt-0.2_27.pkg | 2023-10-09 14:20 | 81K | |
| kate-23.08.1_1.pkg | 2023-10-07 06:20 | 9.0M | |
| katomic-23.08.1.pkg | 2023-10-07 07:47 | 1.4M | |
| kawa-3.1.1.pkg | 2023-10-14 03:09 | 3.3M | |
| kb2mb2-1.0_3.pkg | 2023-10-08 16:53 | 3.9K | |
| kbackup-23.08.1.pkg | 2023-10-14 11:06 | 479K | |
| kbdscan-20110507.pkg | 2023-10-10 02:34 | 3.4K | |
| kbfsd-1.5.3.pkg | 2023-10-09 18:42 | 5.0K | |
| kbibtex-0.10.0_4.pkg | 2023-10-08 00:01 | 4.1M | |
| kblackbox-23.08.1.pkg | 2023-10-07 07:37 | 593K | |
| kblocks-23.08.1.pkg | 2023-10-07 02:06 | 2.2M | |
| kbounce-23.08.1.pkg | 2023-10-07 00:19 | 2.9M | |
| kbreakout-23.08.1.pkg | 2023-10-07 06:43 | 2.9M | |
| kbruch-23.08.1.pkg | 2023-10-07 06:53 | 4.9M | |
| kc-2.5.1.pkg | 2023-10-11 06:30 | 63K | |
| kcachegrind-23.08.1.pkg | 2023-10-09 06:31 | 1.0M | |
| kcalc-23.08.1.pkg | 2023-10-07 09:03 | 585K | |
| kcalutils-23.08.1.pkg | 2023-10-06 11:39 | 255K | |
| kcat-1.7.0.pkg | 2023-10-09 22:40 | 504K | |
| kcd-7.15.0_1,1.pkg | 2023-10-09 08:59 | 126K | |
| kcgi-0.13.0.pkg | 2023-10-08 05:30 | 321K | |
| kcharselect-23.08.1.pkg | 2023-10-07 04:30 | 405K | |
| kchmviewer-8.0.9.pkg | 2023-10-09 07:06 | 211K | |
| kcolorchooser-23.08...> | 2023-10-07 00:14 | 30K | |
| kconfig-frontends-4...> | 2023-10-08 17:35 | 110K | |
| kcov-37_1.pkg | 2023-10-14 17:01 | 321K | |
| kcron-23.08.1.pkg | 2023-10-07 09:49 | 969K | |
| kdb-3.2.0_14.pkg | 2023-10-07 10:51 | 728K | |
| kdbg-3.0.1_2.pkg | 2023-10-10 08:14 | 343K | |
| kdbxviewer-0.1.12.pkg | 2023-10-10 08:38 | 20K | |
| kddockwidgets-1.7.0.pkg | 2023-10-07 23:23 | 372K | |
| kde-baseapps-23.08.1..> | 2023-10-08 10:50 | 580 | |
| kde-dev-scripts-23.0..> | 2023-10-09 12:35 | 310K | |
| kde-dev-utils-23.08...> | 2023-10-09 17:17 | 83K | |
| kde-icons-black-and-..> | 2023-10-14 02:58 | 5.1M | |
| kde-icons-gartoon-bl..> | 2023-10-10 08:58 | 753K | |
| kde-icons-gartoon-sv..> | 2023-10-09 07:50 | 752K | |
| kde-icons-graphite-r..> | 2023-10-14 13:21 | 5.6M | |
| kde-icons-lime-rade8..> | 2023-10-10 00:51 | 5.9M | |
| kde-icons-lush-0.1.0..> | 2023-10-14 17:33 | 1.7M | |
| kde-icons-noia-1.00.pkg | 2023-10-08 22:24 | 10M | |
| kde-icons-nuoveXT2-2..> | 2023-10-09 03:43 | 2.2M | |
| kde-icons-nuvola-1.0..> | 2023-10-08 13:53 | 11M | |
| kde-telepathy-23.04...> | 2023-10-09 13:48 | 940 | |
| kde-thumbnailer-chm-..> | 2023-10-08 20:57 | 9.5K | |
| kde-thumbnailer-epub..> | 2023-10-08 13:31 | 10K | |
| kde-thumbnailer-fb2-..> | 2023-10-10 12:42 | 7.2K | |
| kde5-5.27.8.23.08.1_..> | 2023-10-09 04:23 | 924 | |
| kde_poster-1.0_1.pkg | 2023-10-10 13:08 | 17K | |
| kdeaccessibility-23...> | 2023-10-08 20:36 | 520 | |
| kdeadmin-23.08.1_1.pkg | 2023-10-07 21:48 | 484 | |
| kdebugsettings-23.08..> | 2023-10-07 08:14 | 129K | |
| kdeconnect-kde-23.08..> | 2023-10-08 20:46 | 871K | |
| kdeedu-23.08.1_1.pkg | 2023-10-07 16:26 | 836 | |
| kdeedu-data-23.08.1.pkg | 2023-10-08 21:00 | 327K | |
| kdegames-23.08.1_1.pkg | 2023-10-07 12:34 | 1.1K | |
| kdegraphics-23.08.1_..> | 2023-10-07 23:55 | 692 | |
| kdegraphics-mobipock..> | 2023-10-06 16:06 | 15K | |
| kdegraphics-svgpart-..> | 2023-10-07 06:52 | 26K | |
| kdegraphics-thumbnai..> | 2023-10-06 19:02 | 41K | |
| kdemultimedia-23.08...> | 2023-10-07 10:13 | 548 | |
| kdemultimedia-ffmpeg..> | 2023-10-06 22:47 | 24K | |
| kdenetwork-23.08.1_1..> | 2023-10-08 08:32 | 504 | |
| kdenetwork-fileshari..> | 2023-10-07 00:29 | 156K | |
| kdenlive-23.08.1_1.pkg | 2023-10-07 04:04 | 13M | |
| kdepim-23.08.1_2.pkg | 2023-10-07 21:25 | 1.2K | |
| kdepim-addons-23.08...> | 2023-10-07 03:34 | 1.4M | |
| kdepim-runtime-23.08..> | 2023-10-06 18:02 | 2.5M | |
| kdesdk-23.08.1.pkg | 2023-10-09 23:15 | 500 | |
| kdesdk-kio-23.08.1.pkg | 2023-10-08 20:54 | 38K | |
| kdesdk-thumbnailers-..> | 2023-10-09 21:56 | 15K | |
| kdesvn-2.1.0_5.pkg | 2023-10-09 18:56 | 2.4M | |
| kdeutils-23.08.1_1.pkg | 2023-10-07 13:31 | 744 | |
| kdev-php-23.08.1_1.pkg | 2023-10-09 10:58 | 1.2M | |
| kdev-python-23.08.1.pkg | 2023-10-09 04:38 | 1.2M | |
| kdevelop-23.08.1_1.pkg | 2023-10-07 18:28 | 9.4M | |
| kdevelop-pg-qt-2.2.2..> | 2023-10-06 23:27 | 489K | |
| kdf-23.08.1.pkg | 2023-10-07 01:53 | 606K | |
| kdiagram-2.8.0_1.pkg | 2023-10-06 15:33 | 509K | |
| kdialog-23.08.1.pkg | 2023-10-07 04:55 | 130K | |
| kdiamond-23.08.1.pkg | 2023-10-07 02:42 | 4.6M | |
| kdiff3-1.10.5.pkg | 2023-10-10 17:32 | 1.6M | |
| kdiskmark-3.1.2.pkg | 2023-10-09 22:35 | 162K | |
| kdisplay-5.27.0_1.pkg | 2023-10-10 08:31 | 90K | |
| kdsoap-qt5-2.1.1_1.pkg | 2023-10-06 18:12 | 374K | |
| kdsoap-qt6-2.1.1_1.pkg | 2023-10-10 04:21 | 414K | |
| kea-2.4.0.pkg | 2023-10-14 17:16 | 7.5M | |
| keama-4.4.3P1.pkg | 2023-10-10 13:38 | 85K | |
| keditbookmarks-23.08..> | 2023-10-06 21:57 | 315K | |
| keep-presence-1.0.6.pkg | 2023-10-09 23:44 | 2.8K | |
| keepass-2.54_2.pkg | 2023-10-08 09:07 | 1.3M | |
| keepass-plugin-keepa..> | 2023-10-09 20:10 | 202K | |
| keepassxc-2.7.6.pkg | 2023-10-10 00:49 | 7.0M | |
| keeperrl-0.0.23_5.pkg | 2023-10-08 19:07 | 4.0M | |
| keitairc-2.0.pkg | 2023-10-10 20:27 | 680K | |
| kenny-1.7_1.pkg | 2023-10-11 11:18 | 6.4K | |
| kepubify-4.0.4_14.pkg | 2023-10-10 14:10 | 3.2M | |
| kerl-3.1.0.pkg | 2023-10-09 13:22 | 28K | |
| kermit-10.0.beta10.pkg | 2023-10-08 20:13 | 872K | |
| kevedit-0.5.1_5.pkg | 2023-10-08 22:52 | 165K | |
| kexi-3.2.0_8.pkg | 2023-10-14 11:09 | 3.1M | |
| keybase-6.2.2_1.pkg | 2023-10-08 00:09 | 38M | |
| keybinder-0.3.1_6.pkg | 2023-10-07 06:59 | 18K | |
| keybinder-gtk3-0.3.2..> | 2023-10-08 07:54 | 19K | |
| keyboard-daemon-0.7_..> | 2023-10-14 10:58 | 5.7K | |
| keyboardcast-0.1.1_6..> | 2023-10-11 01:19 | 13K | |
| keychain-2.8.5.pkg | 2023-10-08 12:08 | 29K | |
| keycloak-22.0.3.pkg | 2023-10-10 02:09 | 147M | |
| keyd-2.4.3.pkg | 2023-10-09 19:04 | 109K | |
| keynav-0.20180821.0,..> | 2023-10-08 20:25 | 23K | |
| keyprint-1.0_2.pkg | 2023-10-10 21:44 | 8.4K | |
| keysmith-23.08.1.pkg | 2023-10-10 09:31 | 158K | |
| kf5-attica-5.110.0.pkg | 2023-10-06 08:02 | 151K | |
| kf5-baloo-5.110.0.pkg | 2023-10-06 12:55 | 390K | |
| kf5-breeze-icons-5.1..> | 2023-10-06 06:21 | 8.2M | |
| kf5-extra-cmake-modu..> | 2023-10-06 05:12 | 536K | |
| kf5-frameworkintegra..> | 2023-10-06 10:56 | 1.5M | |
| kf5-frameworks-5.110..> | 2023-10-14 06:13 | 1.6K | |
| kf5-kactivities-5.11..> | 2023-10-06 07:46 | 105K | |
| kf5-kactivities-stat..> | 2023-10-06 13:36 | 75K | |
| kf5-kapidox-5.110.0.pkg | 2023-10-08 03:09 | 52K | |
| kf5-karchive-5.110.0..> | 2023-10-06 05:24 | 128K | |
| kf5-kauth-5.110.0.pkg | 2023-10-06 05:28 | 87K | |
| kf5-kbookmarks-5.110..> | 2023-10-06 06:54 | 133K | |
| kf5-kcalendarcore-5...> | 2023-10-06 09:45 | 295K | |
| kf5-kcmutils-5.110.0..> | 2023-10-06 09:44 | 209K | |
| kf5-kcodecs-5.110.0.pkg | 2023-10-06 05:33 | 138K | |
| kf5-kcompletion-5.11..> | 2023-10-06 06:52 | 107K | |
| kf5-kconfig-5.110.0.pkg | 2023-10-06 05:47 | 334K | |
| kf5-kconfigwidgets-5..> | 2023-10-06 06:12 | 374K | |
| kf5-kcontacts-5.110...> | 2023-10-06 08:20 | 247K | |
| kf5-kcoreaddons-5.11..> | 2023-10-06 05:17 | 437K | |
| kf5-kcrash-5.110.0_1..> | 2023-10-06 06:01 | 16K | |
| kf5-kdav-5.110.0_1,1..> | 2023-10-06 13:44 | 83K | |
| kf5-kdbusaddons-5.11..> | 2023-10-06 05:31 | 56K | |
| kf5-kdeclarative-5.1..> | 2023-10-06 09:39 | 235K | |
| kf5-kded-5.110.0.pkg | 2023-10-06 07:02 | 56K | |
| kf5-kdelibs4support-..> | 2023-10-06 09:46 | 3.2M | |
| kf5-kdesignerplugin-..> | 2023-10-06 07:24 | 69K | |
| kf5-kdesu-5.110.0_1.pkg | 2023-10-06 13:27 | 63K | |
| kf5-kdewebkit-5.110...> | 2023-10-07 04:44 | 55K | |
| kf5-kdnssd-5.110.0.pkg | 2023-10-06 18:06 | 66K | |
| kf5-kdoctools-5.110...> | 2023-10-06 05:58 | 455K | |
| kf5-kemoticons-5.110..> | 2023-10-06 07:44 | 1.6M | |
| kf5-kfilemetadata-5...> | 2023-10-06 12:09 | 173K | |
| kf5-kglobalaccel-5.1..> | 2023-10-06 06:36 | 115K | |
| kf5-kguiaddons-5.110..> | 2023-10-06 05:37 | 88K | |
| kf5-kholidays-5.110...> | 2023-10-06 12:56 | 244K | |
| kf5-khtml-5.110.0.pkg | 2023-10-06 14:39 | 2.1M | |
| kf5-ki18n-5.110.0_1.pkg | 2023-10-06 05:22 | 1.4M | |
| kf5-kiconthemes-5.11..> | 2023-10-06 06:40 | 131K | |
| kf5-kidletime-5.110...> | 2023-10-06 10:36 | 37K | |
| kf5-kimageformats-5...> | 2023-10-06 20:17 | 159K | |
| kf5-kinit-5.110.0.pkg | 2023-10-06 09:38 | 110K | |
| kf5-kio-5.110.0_1.pkg | 2023-10-06 09:33 | 4.1M | |
| kf5-kirigami2-5.110...> | 2023-10-06 07:52 | 390K | |
| kf5-kitemmodels-5.11..> | 2023-10-06 07:35 | 118K | |
| kf5-kitemviews-5.110..> | 2023-10-06 06:27 | 92K | |
| kf5-kjobwidgets-5.11..> | 2023-10-06 06:59 | 85K | |
| kf5-kjs-5.110.0.pkg | 2023-10-06 11:04 | 328K | |
| kf5-kjsembed-5.110.0..> | 2023-10-06 13:28 | 341K | |
| kf5-kmediaplayer-5.1..> | 2023-10-08 02:20 | 18K | |
| kf5-knewstuff-5.110...> | 2023-10-06 09:41 | 779K | |
| kf5-knotifications-5..> | 2023-10-06 09:16 | 128K | |
| kf5-knotifyconfig-5...> | 2023-10-06 12:19 | 70K | |
| kf5-kpackage-5.110.0..> | 2023-10-06 07:12 | 159K | |
| kf5-kparts-5.110.0_1..> | 2023-10-06 09:38 | 229K | |
| kf5-kpeople-5.110.0_..> | 2023-10-06 13:26 | 107K | |
| kf5-kplotting-5.110...> | 2023-10-06 23:00 | 36K | |
| kf5-kpty-5.110.0.pkg | 2023-10-06 11:09 | 41K | |
| kf5-kquickcharts-5.1..> | 2023-10-06 13:06 | 104K | |
| kf5-kross-5.110.0.pkg | 2023-10-06 15:03 | 332K | |
| kf5-krunner-5.110.0_..> | 2023-10-06 09:51 | 137K | |
| kf5-kservice-5.110.0..> | 2023-10-06 06:25 | 307K | |
| kf5-ktexteditor-5.11..> | 2023-10-06 12:19 | 2.3M | |
| kf5-ktextwidgets-5.1..> | 2023-10-06 06:56 | 262K | |
| kf5-kunitconversion-..> | 2023-10-06 07:32 | 806K | |
| kf5-kwallet-5.110.0.pkg | 2023-10-06 09:22 | 399K | |
| kf5-kwayland-5.110.0..> | 2023-10-06 08:00 | 490K | |
| kf5-kwidgetsaddons-5..> | 2023-10-06 05:43 | 1.4M | |
| kf5-kwindowsystem-5...> | 2023-10-06 06:16 | 168K | |
| kf5-kxmlgui-5.110.0_..> | 2023-10-06 06:45 | 645K | |
| kf5-kxmlrpcclient-5...> | 2023-10-06 13:40 | 33K | |
| kf5-oxygen-icons5-5...> | 2023-10-06 13:13 | 30M | |
| kf5-plasma-framework..> | 2023-10-06 09:45 | 3.2M | |
| kf5-prison-5.110.0_1..> | 2023-10-06 08:39 | 51K | |
| kf5-purpose-5.110.0_..> | 2023-10-06 14:21 | 279K | |
| kf5-qqc2-desktop-sty..> | 2023-10-06 11:55 | 69K | |
| kf5-solid-5.110.0_1.pkg | 2023-10-06 07:02 | 286K | |
| kf5-sonnet-5.110.0.pkg | 2023-10-06 06:46 | 278K | |
| kf5-style-qtcurve-1...> | 2023-10-14 14:41 | 291K | |
| kf5-syndication-5.11..> | 2023-10-06 07:55 | 177K | |
| kf5-syntax-highlight..> | 2023-10-06 07:51 | 1.6M | |
| kf5-threadweaver-5.1..> | 2023-10-06 08:08 | 62K | |
| kfind-23.08.1.pkg | 2023-10-08 15:48 | 453K | |
| kfloppy-23.04.3.pkg | 2023-10-07 06:28 | 348K | |
| kfourinline-23.08.1.pkg | 2023-10-07 03:05 | 791K | |
| kfr-5.0.3.pkg | 2023-10-10 09:14 | 583K | |
| kgeography-23.08.1.pkg | 2023-10-07 00:54 | 10M | |
| kgeotag-1.4.0_1.pkg | 2023-10-09 14:31 | 447K | |
| kget-23.08.1.pkg | 2023-10-14 03:48 | 5.5M | |
| kgoldrunner-23.08.1.pkg | 2023-10-14 18:32 | 4.8M | |
| kgpg-23.08.1.pkg | 2023-10-07 00:15 | 3.0M | |
| kgraphviewer-2.4.3_8..> | 2023-10-11 13:41 | 1.6M | |
| khangman-23.08.1.pkg | 2023-10-06 23:36 | 6.2M | |
| khelpcenter-23.08.1.pkg | 2023-10-07 08:48 | 4.8M | |
| khmeros-5.0_2.pkg | 2023-10-10 01:22 | 285K | |
| kibi-0.2.2_24.pkg | 2023-10-11 01:53 | 202K | |
| kicad-7.0.2_3,2.pkg | 2023-10-07 20:54 | 39M | |
| kicad-devel-r2023062..> | 2023-10-07 16:05 | 40M | |
| kicad-doc-7.0.2_2.pkg | 2023-10-08 15:51 | 263M | |
| kicad-library-footpr..> | 2023-10-10 13:39 | 23M | |
| kicad-library-footpr..> | 2023-10-09 00:02 | 23M | |
| kicad-library-packag..> | 2023-10-14 11:55 | 358M | |
| kicad-library-packag..> | 2023-10-08 23:38 | 359M | |
| kicad-library-symbol..> | 2023-10-10 17:06 | 2.4M | |
| kicad-library-symbol..> | 2023-10-08 16:11 | 2.4M | |
| kicad-library-tmpl-7..> | 2023-10-11 06:14 | 1.1M | |
| kicad-library-tmpl-d..> | 2023-10-08 18:55 | 1.1M | |
| kickoff-0.7.0_5.pkg | 2023-10-10 02:19 | 1.1M | |
| kickpass-0.2.0_2.pkg | 2023-10-14 05:30 | 25K | |
| kickshaw-0.5.26_1.pkg | 2023-10-14 16:34 | 72K | |
| kiconvtool-0.99.pkg | 2023-10-14 10:20 | 8.4K | |
| kid3-kf5-3.9.4_1.pkg | 2023-10-14 05:50 | 2.4M | |
| kid3-qt5-3.9.4_1.pkg | 2023-10-09 17:40 | 2.0M | |
| kid3-qt6-3.9.4_1.pkg | 2023-10-08 13:00 | 2.1M | |
| kidentitymanagement-..> | 2023-10-06 10:19 | 107K | |
| kig-23.08.1.pkg | 2023-10-07 00:34 | 3.4M | |
| kigo-23.08.1.pkg | 2023-10-14 13:22 | 5.1M | |
| kile-3.0.b3_43.pkg | 2023-10-14 11:17 | 3.9M | |
| killbots-23.08.1.pkg | 2023-10-06 23:40 | 1.3M | |
| kim-api-2.3.0_1.pkg | 2023-10-06 19:19 | 615K | |
| kimagemapeditor-23.0..> | 2023-10-09 18:43 | 1.1M | |
| kimap-23.08.1.pkg | 2023-10-06 09:50 | 201K | |
| kineto-g20211104_14.pkg | 2023-10-08 18:06 | 2.1M | |
| kio-extras-23.08.1_1..> | 2023-10-06 23:03 | 1.1M | |
| kio-fuse-5.0.1_1.pkg | 2023-10-11 03:34 | 58K | |
| kio-gdrive-23.08.1.pkg | 2023-10-09 20:00 | 111K | |
| kio-zeroconf-23.08.1..> | 2023-10-10 20:33 | 42K | |
| kipi-plugins-23.08.1..> | 2023-10-06 20:25 | 1.2M | |
| kippo-0.9_1.pkg | 2023-10-08 12:31 | 383K | |
| kirigami-addons-0.11..> | 2023-10-06 19:42 | 131K | |
| kirigami-gallery-23...> | 2023-10-09 04:20 | 270K | |
| kiriki-23.08.1.pkg | 2023-10-07 02:33 | 457K | |
| kismet-2016.07.r1_2,..> | 2023-10-14 05:02 | 1.0M | |
| kiss-templates-0.19_..> | 2023-10-08 15:47 | 23K | |
| kissat-3.1.0.pkg | 2023-10-10 16:32 | 205K | |
| kitinerary-23.08.1.pkg | 2023-10-06 18:58 | 1.2M | |
| kitty-0.30.0.pkg | 2023-10-14 01:52 | 10M | |
| kiwix-tools-3.5.0_1.pkg | 2023-10-14 06:48 | 27K | |
| kjumpingcube-23.08.1..> | 2023-10-07 05:26 | 433K | |
| kk-libreoffice-7.5.5..> | 2023-10-08 07:55 | 711K | |
| kktdirect-0.5_13.pkg | 2023-10-14 17:51 | 192K | |
| klatexformula-4.0.0_..> | 2023-10-09 01:32 | 2.6M | |
| klavaro-3.14.pkg | 2023-10-08 13:20 | 725K | |
| klayout-0.28.3.pkg | 2023-10-10 04:10 | 31M | |
| kldap-23.08.1.pkg | 2023-10-06 09:54 | 193K | |
| kldfind-0.61.pkg | 2023-10-10 03:13 | 5.2K | |
| kldpatch-20090116.pkg | 2023-10-10 09:38 | 11K | |
| klee-3.0.pkg | 2023-10-09 08:53 | 687K | |
| kleopatra-23.08.1.pkg | 2023-10-10 10:26 | 2.9M | |
| klettres-23.08.1.pkg | 2023-10-07 06:18 | 38M | |
| klg-php80-1.5_1.pkg | 2023-10-11 02:51 | 13K | |
| klg-php81-1.5_1.pkg | 2023-10-08 23:19 | 13K | |
| klg-php82-1.5_1.pkg | 2023-10-08 14:41 | 13K | |
| klg-php83-1.5_1.pkg | 2023-10-09 14:31 | 13K | |
| klib-g20210616.pkg | 2023-10-07 17:01 | 76K | |
| klickety-23.08.1.pkg | 2023-10-07 03:07 | 1.5M | |
| klines-23.08.1.pkg | 2023-10-07 01:14 | 1.5M | |
| klish-2.1.4.pkg | 2023-10-10 05:12 | 158K | |
| klog-2.2.1.pkg | 2023-10-09 23:00 | 1.3M | |
| klondike-1.9_4.pkg | 2023-10-10 18:04 | 30K | |
| kludge3d-20040822_16..> | 2023-10-10 16:28 | 110K | |
| klystrack-1.7.6_1.pkg | 2023-10-10 10:10 | 294K | |
| km-libreoffice-7.5.5..> | 2023-10-07 13:57 | 3.0M | |
| kmag-23.08.1.pkg | 2023-10-07 10:53 | 781K | |
| kmahjongg-23.08.1.pkg | 2023-10-07 09:05 | 4.0M | |
| kmail-23.08.1.pkg | 2023-10-07 06:08 | 6.7M | |
| kmail-account-wizard..> | 2023-10-06 22:23 | 410K | |
| kmailtransport-23.08..> | 2023-10-06 15:02 | 199K | |
| kmbox-23.08.1.pkg | 2023-10-06 09:47 | 26K | |
| kmcp-0.9.4.pkg | 2023-10-11 01:51 | 3.1M | |
| kmfl-european-latin-..> | 2023-10-09 16:02 | 203K | |
| kmfl-khmer-1.0.pkg | 2023-10-09 16:18 | 1.6K | |
| kmfl-sil-ezra-2.4_5.pkg | 2023-10-10 03:46 | 88K | |
| kmfl-sil-galatia-1.0..> | 2023-10-09 22:39 | 186K | |
| kmfl-sil-ipa-unicode..> | 2023-10-14 15:16 | 561K | |
| kmfl-sil-panafrican-..> | 2023-10-14 04:42 | 645K | |
| kmfl-sil-yi-20020903..> | 2023-10-09 00:03 | 7.6K | |
| kmfl-varamozhi-malay..> | 2023-10-10 07:04 | 5.5K | |
| kmflcomp-0.9.9_2.pkg | 2023-10-07 04:53 | 125K | |
| kmime-23.08.1.pkg | 2023-10-06 09:43 | 151K | |
| kmines-23.08.1.pkg | 2023-10-07 06:05 | 1.0M | |
| kmix-23.08.1.pkg | 2023-10-14 09:28 | 1.2M | |
| kmousetool-23.08.1.pkg | 2023-10-08 01:02 | 204K | |
| kmouth-23.08.1.pkg | 2023-10-07 12:31 | 1.8M | |
| kmplayer-0.12.0b_7,3..> | 2023-10-10 16:27 | 649K | |
| kmplot-23.08.1.pkg | 2023-10-07 03:08 | 3.2M | |
| kmr_Latn-libreoffice..> | 2023-10-07 14:04 | 229K | |
| kms-cmake-utils-6.18..> | 2023-10-10 22:41 | 8.8K | |
| kmscube-s20230712.pkg | 2023-10-08 12:43 | 71K | |
| kmymoney-5.1.3_3.pkg | 2023-10-14 09:54 | 14M | |
| kn-aspell-0.01.1.pkg | 2023-10-11 16:05 | 421K | |
| kn-libreoffice-7.5.5..> | 2023-10-07 14:11 | 374K | |
| knavalbattle-23.08.1..> | 2023-10-07 05:30 | 1.4M | |
| knc-1.7.1.pkg | 2023-10-14 10:08 | 21K | |
| knetwalk-23.08.1.pkg | 2023-10-07 07:52 | 1.1M | |
| knews-1.0b.1_14.pkg | 2023-10-08 13:02 | 219K | |
| knightcap-3.6_9.pkg | 2023-10-09 14:17 | 110K | |
| knights-23.08.1.pkg | 2023-10-07 03:01 | 3.4M | |
| knock-0.8,1.pkg | 2023-10-08 13:54 | 21K | |
| knocker-0.8.0.pkg | 2023-10-08 22:06 | 16K | |
| knockpy-5.4.0_2.pkg | 2023-10-14 12:38 | 39K | |
| knot-resolver-5.7.0.pkg | 2023-10-09 08:41 | 631K | |
| knot3-3.3.1.pkg | 2023-10-14 12:43 | 1.0M | |
| knot3-lib-3.3.1.pkg | 2023-10-07 15:17 | 514K | |
| knotes-23.08.1.pkg | 2023-10-10 12:33 | 599K | |
| knotter-0.9.6.202202..> | 2023-10-09 13:37 | 2.9M | |
| knxd-0.14.59.pkg | 2023-10-10 06:22 | 286K | |
| ko-FreeWnn-lib-1.1.1..> | 2023-10-07 19:28 | 188K | |
| ko-FreeWnn-server-1...> | 2023-10-14 05:34 | 370K | |
| ko-aleefonts-ttf-13...> | 2023-10-11 01:05 | 202K | |
| ko-baekmukfonts-bdf-..> | 2023-10-08 16:39 | 6.7M | |
| ko-baekmukfonts-ttf-..> | 2023-10-10 06:03 | 8.3M | |
| ko-d2coding-ttf-1.3...> | 2023-10-10 06:09 | 3.0M | |
| ko-engdic-0.2_1.pkg | 2023-10-11 01:05 | 2.2M | |
| ko-fcitx-hangul-0.3...> | 2023-10-09 04:04 | 19K | |
| ko-fcitx5-hangul-5.0..> | 2023-10-09 03:55 | 49K | |
| ko-h2ps-2.06.pkg | 2023-10-10 14:04 | 26K | |
| ko-hanyangfonts-1.0_..> | 2023-10-09 11:11 | 2.3M | |
| ko-hcode-2.1.3_1.pkg | 2023-10-07 16:42 | 14K | |
| ko-hmconv-1.0.3_1.pkg | 2023-10-08 20:47 | 12K | |
| ko-hpscat-jshin-1.3...> | 2023-10-14 17:21 | 170K | |
| ko-hunspell-0.7.90.pkg | 2023-10-09 13:20 | 595K | |
| ko-ibus-hangul-1.5.1..> | 2023-10-09 02:57 | 40K | |
| ko-imhangul-gtk2-2.1..> | 2023-10-09 17:14 | 14K | |
| ko-imhangul-gtk3-3.1..> | 2023-10-10 10:32 | 14K | |
| ko-kaistfonts-ksc-1...> | 2023-10-10 01:59 | 731K | |
| ko-ko.TeX-0.1.1.2008..> | 2023-10-09 16:48 | 1.0M | |
| ko-ko.TeX-fonts-base..> | 2023-10-08 10:50 | 35M | |
| ko-ko.TeX-fonts-extr..> | 2023-10-09 12:06 | 55M | |
| ko-libhangul-0.1.0_3..> | 2023-10-07 21:17 | 1.8M | |
| ko-libreoffice-7.5.5..> | 2023-10-08 00:44 | 2.9M | |
| ko-munhwafonts-cid-1..> | 2023-10-10 13:04 | 8.7M | |
| ko-nabi-1.0.0_2.pkg | 2023-10-14 12:33 | 500K | |
| ko-nanum-barun-gothi..> | 2023-10-08 04:11 | 6.1M | |
| ko-nanum-barun-gothi..> | 2023-10-09 03:52 | 5.1M | |
| ko-nanum-barun-pen-2..> | 2023-10-07 22:46 | 2.7M | |
| ko-nanum-barun-pen-o..> | 2023-10-14 17:04 | 1.7M | |
| ko-nanum-brush-20220..> | 2023-10-07 12:52 | 838K | |
| ko-nanum-brush-otf-2..> | 2023-10-14 17:41 | 752K | |
| ko-nanum-gothic-2022..> | 2023-10-08 00:50 | 5.7M | |
| ko-nanum-gothic-codi..> | 2023-10-09 10:22 | 1.0M | |
| ko-nanum-gothic-eco-..> | 2023-10-08 19:33 | 8.0M | |
| ko-nanum-gothic-eco-..> | 2023-10-08 19:40 | 5.8M | |
| ko-nanum-gothic-otf-..> | 2023-10-09 17:28 | 4.0M | |
| ko-nanum-myeongjo-20..> | 2023-10-07 17:51 | 2.7M | |
| ko-nanum-myeongjo-ec..> | 2023-10-14 17:54 | 5.8M | |
| ko-nanum-myeongjo-ec..> | 2023-10-09 17:35 | 3.2M | |
| ko-nanum-myeongjo-ot..> | 2023-10-14 06:54 | 1.6M | |
| ko-nanum-pen-2022021..> | 2023-10-07 11:05 | 889K | |
| ko-nanum-pen-otf-202..> | 2023-10-10 18:04 | 865K | |
| ko-nanum-square-2022..> | 2023-10-08 00:36 | 833K | |
| ko-nanum-square-otf-..> | 2023-10-10 05:54 | 842K | |
| ko-nanum-square-roun..> | 2023-10-07 22:33 | 822K | |
| ko-nanum-square-roun..> | 2023-10-09 23:15 | 731K | |
| ko-nanumfonts-202202..> | 2023-10-10 14:58 | 612 | |
| ko-nhpf-1.42_1.pkg | 2023-10-09 02:31 | 27K | |
| ko-scim-hangul-0.4.0..> | 2023-10-09 21:49 | 34K | |
| ko-scim-tables-0.5.1..> | 2023-10-10 20:31 | 98K | |
| ko-sourcehansans-otf..> | 2023-10-14 19:03 | 76M | |
| ko-sourcehanserif-ot..> | 2023-10-14 06:13 | 98M | |
| ko-spoqahansans-ttf-..> | 2023-10-09 21:01 | 37M | |
| ko-unfonts-core-1.0...> | 2023-10-10 00:32 | 14M | |
| ko-unfonts-extra-1.0..> | 2023-10-09 16:28 | 6.4M | |
| ko-uniksc-0.9.pkg | 2023-10-14 04:35 | 23K | |
| kobodeluxe-0.5.1_14.pkg | 2023-10-10 08:49 | 1.4M | |
| kodaskanna-0.1.0_3.pkg | 2023-10-09 13:04 | 32K | |
| kodi-20.2_3.pkg | 2023-10-06 20:44 | 26M | |
| kodi-addon-game.libr..> | 2023-10-08 03:56 | 105K | |
| kodi-addon-game.libr..> | 2023-10-11 07:07 | 49K | |
| kodi-addon-game.libr..> | 2023-10-14 11:05 | 756K | |
| kodi-addon-game.libr..> | 2023-10-11 05:36 | 846K | |
| kodi-addon-game.libr..> | 2023-10-08 14:16 | 77K | |
| kodi-addon-game.libr..> | 2023-10-14 04:44 | 794K | |
| kodi-addon-inputstre..> | 2023-10-10 07:03 | 948K | |
| kodi-addon-periphera..> | 2023-10-10 03:54 | 176K | |
| kodi-addon-pvr.hts-2..> | 2023-10-10 14:54 | 235K | |
| kodi-addon-pvr.iptvs..> | 2023-10-14 06:02 | 353K | |
| kodi-addon-screensav..> | 2023-10-10 04:22 | 141K | |
| kodi-addon-screensav..> | 2023-10-09 19:47 | 613K | |
| kodi-addon-screensav..> | 2023-10-10 03:52 | 259K | |
| kodi-addon-visualiza..> | 2023-10-08 14:02 | 355K | |
| kodi-addon-visualiza..> | 2023-10-08 17:29 | 12M | |
| kodi-addon-visualiza..> | 2023-10-14 18:58 | 302K | |
| kodi-platform-201907..> | 2023-10-07 05:24 | 7.2K | |
| kohana-3.3.6.pkg | 2023-10-08 22:24 | 906K | |
| koi8-u-gemini-x11-1...> | 2023-10-07 05:52 | 328K | |
| koi8-u-monaco-x11-1...> | 2023-10-14 11:09 | 20K | |
| kok-libreoffice-7.5...> | 2023-10-07 18:21 | 273K | |
| kokkos-4.1.00.pkg | 2023-10-07 04:03 | 577K | |
| kolf-23.08.1.pkg | 2023-10-07 07:43 | 1.2M | |
| kollision-23.08.1.pkg | 2023-10-07 07:27 | 369K | |
| kolourpaint-23.08.1.pkg | 2023-10-07 01:11 | 5.6M | |
| kommit-1.0.2_1.pkg | 2023-10-12 02:24 | 456K | |
| komodo-edit-11.0.2.pkg | 2023-10-10 11:56 | 51M | |
| kompare-23.08.1.pkg | 2023-10-09 10:05 | 866K | |
| komposter-g20201211_..> | 2023-10-14 12:40 | 137K | |
| kongress-1.0.1_2.pkg | 2023-10-14 10:36 | 85K | |
| konqueror-23.08.1.pkg | 2023-10-10 02:59 | 9.5M | |
| konquest-23.08.1.pkg | 2023-10-07 02:23 | 943K | |
| konsole-23.08.1.pkg | 2023-10-07 00:35 | 1.6M | |
| kontact-23.08.1.pkg | 2023-10-07 08:24 | 785K | |
| kontactinterface-23...> | 2023-10-06 15:09 | 44K | |
| kontrast-23.08.1.pkg | 2023-10-09 03:55 | 166K | |
| konversation-23.08.1..> | 2023-10-09 20:21 | 4.6M | |
| kooha-2.2.3_10.pkg | 2023-10-14 10:05 | 587K | |
| kooka-0.61.323_4,1.pkg | 2023-10-09 07:37 | 508K | |
| kookbook-0.2.1_3.pkg | 2023-10-09 14:03 | 80K | |
| kopete-23.08.1.pkg | 2023-10-07 00:17 | 8.9M | |
| kopia-0.14.1.pkg | 2023-10-08 20:02 | 9.0M | |
| kops-1.27.1.pkg | 2023-10-10 19:29 | 32M | |
| korganizer-23.08.1.pkg | 2023-10-07 03:16 | 2.2M | |
| kosmindoormap-23.08...> | 2023-10-07 13:43 | 387K | |
| kosmorro-0.10.12.pkg | 2023-10-09 12:51 | 503K | |
| kotlin-1.9.0.pkg | 2023-10-09 21:53 | 75M | |
| kpat-23.08.1.pkg | 2023-10-07 04:41 | 3.6M | |
| kpcli-3.1_1.pkg | 2023-10-14 06:09 | 54K | |
| kpeoplevcard-0.1_1.pkg | 2023-10-07 23:05 | 13K | |
| kphotoalbum-5.11.0_2..> | 2023-10-08 23:28 | 7.7M | |
| kpimtextedit-23.08.1..> | 2023-10-06 09:52 | 376K | |
| kpkpass-23.08.1.pkg | 2023-10-06 16:08 | 29K | |
| kplib-1.1.1.pkg | 2023-10-09 06:18 | 51K | |
| kplot-0.1.15.pkg | 2023-10-11 22:11 | 49K | |
| kpmcore-23.08.1.pkg | 2023-10-08 23:28 | 567K | |
| kpmenu-1.4.1_15.pkg | 2023-10-09 09:54 | 1.7M | |
| kproperty-3.2.0_2.pkg | 2023-10-06 23:50 | 193K | |
| kpublictransport-23...> | 2023-10-07 01:45 | 618K | |
| kqtquickcharts-23.08..> | 2023-10-08 08:07 | 47K | |
| kquickimageeditor-0...> | 2023-10-07 16:07 | 27K | |
| kraft-1.1.pkg | 2023-10-11 09:12 | 3.3M | |
| krank-07_11.pkg | 2023-10-09 20:15 | 22M | |
| krb5-1.21.2.pkg | 2023-10-06 23:05 | 1.2M | |
| krb5-119-1.19.4.pkg | 2023-10-08 13:29 | 1.1M | |
| krb5-120-1.20.2.pkg | 2023-10-09 00:49 | 1.1M | |
| krb5-121-1.21.2.pkg | 2023-10-09 09:10 | 1.2M | |
| krb5-appl-1.0.3_4.pkg | 2023-10-09 04:19 | 229K | |
| krb5-devel-1.22.2023..> | 2023-10-11 16:36 | 1.2M | |
| krdc-23.08.1.pkg | 2023-10-07 05:34 | 1.6M | |
| krename-5.0.2_3.pkg | 2023-10-11 13:38 | 418K | |
| kreport-3.2.0_9.pkg | 2023-10-08 01:37 | 370K | |
| kreversi-23.08.1.pkg | 2023-10-07 07:07 | 1.0M | |
| krfb-23.08.1.pkg | 2023-10-07 04:15 | 1.3M | |
| krill-0.13.1_3.pkg | 2023-10-14 05:38 | 8.3M | |
| krita-5.1.5_18.pkg | 2023-10-07 17:43 | 70M | |
| krita-gmic-plugin-3...> | 2023-10-14 15:53 | 9.2M | |
| kronometer-2.3.0_1.pkg | 2023-10-09 21:27 | 203K | |
| kronosnet-1.26.pkg | 2023-10-07 13:04 | 232K | |
| kross-interpreters-2..> | 2023-10-08 17:18 | 45K | |
| kruler-23.08.1.pkg | 2023-10-07 09:37 | 267K | |
| krusader-2.8.0_2.pkg | 2023-10-11 06:05 | 3.7M | |
| ks-libreoffice-7.5.5..> | 2023-10-07 23:25 | 228K | |
| ksanecore-23.08.1.pkg | 2023-10-06 16:50 | 62K | |
| kseexpr-4.0.4.0_1.pkg | 2023-10-07 08:24 | 392K | |
| ksh-1.0.7.pkg | 2023-10-07 23:30 | 559K | |
| ksh93-93.u_3,2.pkg | 2023-10-08 09:34 | 595K | |
| kshisen-23.08.1.pkg | 2023-10-07 01:14 | 1.0M | |
| kshutdown-5.2_2.pkg | 2023-10-14 09:16 | 151K | |
| ksirk-23.08.1.pkg | 2023-10-07 02:53 | 4.8M | |
| ksmtp-23.08.1.pkg | 2023-10-06 09:56 | 51K | |
| ksnakeduel-23.08.1.pkg | 2023-10-07 09:26 | 475K | |
| ksnip-1.10.1.pkg | 2023-10-10 10:45 | 484K | |
| kspaceduel-23.08.1.pkg | 2023-10-07 09:21 | 669K | |
| ksql-0.3.5.pkg | 2023-10-09 02:46 | 81K | |
| ksquares-23.08.1.pkg | 2023-10-07 08:42 | 366K | |
| kst-2.0.8.20220216_3..> | 2023-10-10 02:05 | 3.4M | |
| kstars-3.6.6,1.pkg | 2023-10-08 20:27 | 69M | |
| kstart-4.3.pkg | 2023-10-10 00:43 | 34K | |
| ksudoku-23.08.1.pkg | 2023-10-07 01:10 | 1.7M | |
| ksystemlog-23.08.1.pkg | 2023-10-07 07:43 | 2.0M | |
| kteatime-23.08.1.pkg | 2023-10-07 04:18 | 331K | |
| ktechlab-0.51.0_1.pkg | 2023-10-14 06:36 | 1.4M | |
| ktextaddons-1.2.1_2.pkg | 2023-10-06 09:27 | 452K | |
| ktimer-23.08.1.pkg | 2023-10-07 08:00 | 439K | |
| ktimetracker-5.0.1_3..> | 2023-10-14 10:06 | 436K | |
| ktnef-23.08.1.pkg | 2023-10-06 21:11 | 114K | |
| ktoblzcheck-1.53_8.pkg | 2023-10-07 01:40 | 86K | |
| ktorrent-23.08.1.pkg | 2023-10-09 06:59 | 2.2M | |
| ktouch-23.08.1.pkg | 2023-10-09 14:52 | 4.4M | |
| ktp-accounts-kcm-23...> | 2023-10-08 11:57 | 299K | |
| ktp-approver-23.04.3..> | 2023-10-08 05:34 | 45K | |
| ktp-auth-handler-23...> | 2023-10-07 21:16 | 67K | |
| ktp-call-ui-23.04.3_..> | 2023-10-14 13:12 | 163K | |
| ktp-common-internals..> | 2023-10-06 21:48 | 741K | |
| ktp-contact-list-23...> | 2023-10-07 09:57 | 204K | |
| ktp-contact-runner-2..> | 2023-10-07 12:09 | 47K | |
| ktp-desktop-applets-..> | 2023-10-07 22:53 | 44K | |
| ktp-filetransfer-han..> | 2023-10-07 01:29 | 49K | |
| ktp-kded-module-23.0..> | 2023-10-08 06:12 | 140K | |
| ktp-send-file-23.04...> | 2023-10-07 22:04 | 31K | |
| ktp-text-ui-23.04.3_..> | 2023-10-07 16:32 | 717K | |
| ktuberling-23.08.1.pkg | 2023-10-06 23:57 | 44M | |
| kturtle-23.08.1.pkg | 2023-10-07 05:54 | 2.2M | |
| ku-aspell-0.20.1_1,1..> | 2023-10-10 23:09 | 73K | |
| kube-apiserver-1.27...> | 2023-10-09 11:49 | 19M | |
| kube-controller-mana..> | 2023-10-09 18:13 | 17M | |
| kube-scheduler-1.27...> | 2023-10-14 06:05 | 10M | |
| kubectl-1.28.2.pkg | 2023-10-07 05:19 | 13M | |
| kubrick-23.08.1.pkg | 2023-10-07 03:59 | 486K | |
| kuklomenos-0.4.5_4.pkg | 2023-10-09 23:27 | 154K | |
| kuku-2.1.0.pkg | 2023-10-14 04:13 | 21K | |
| kuserfeedback-1.2.0_..> | 2023-10-06 17:37 | 386K | |
| kvazaar-2.2.0_1.pkg | 2023-10-08 21:05 | 358K | |
| kvmclock-kmod-0.0.0...> | 2023-10-10 21:46 | 4.6K | |
| kwalletmanager-23.08..> | 2023-10-07 00:54 | 956K | |
| kwave-23.08.1.pkg | 2023-10-09 11:56 | 6.1M | |
| kwinft-5.27.0_2.pkg | 2023-10-09 15:54 | 4.9M | |
| kwordquiz-23.08.1.pkg | 2023-10-07 02:35 | 2.5M | |
| kxstitch-2.2.0_5.pkg | 2023-10-14 14:26 | 1.9M | |
| ky-aspell-0.01.0.pkg | 2023-10-08 12:00 | 65K | |
| kyotocabinet-1.2.80.pkg | 2023-10-07 21:44 | 1.4M | |
| kyototycoon-0.9.56_6..> | 2023-10-14 07:52 | 1.0M | |
| kyra-2.1.3_6.pkg | 2023-10-09 16:55 | 296K | |
| kyua-0.13_6,3.pkg | 2023-10-09 16:17 | 3.4M | |
| kzip-20200115_1.pkg | 2023-10-09 10:32 | 192K | |
| l-smash-2.18.0.10.pkg | 2023-10-07 09:29 | 306K | |
| l0pht-watch-1.1_1.pkg | 2023-10-08 18:57 | 409K | |
| l2a-1.2.pkg | 2023-10-10 05:47 | 15K | |
| l2p-1.1.1_5.pkg | 2023-10-09 14:22 | 8.7K | |
| l2tpd-0.69_11.pkg | 2023-10-10 04:07 | 43K | |
| la-aspell-20020503.0..> | 2023-10-09 17:27 | 118K | |
| la-capitaine-icon-th..> | 2023-10-07 06:58 | 1.6M | |
| lab-0.25.2.0.2023022..> | 2023-10-14 02:28 | 4.6M | |
| labplot-2.10.1.pkg | 2023-10-10 20:51 | 14M | |
| labwc-0.6.4.pkg | 2023-10-09 15:29 | 97K | |
| lacheck-1.26_1.pkg | 2023-10-10 15:02 | 22K | |
| ladder-1.00_2.pkg | 2023-10-10 14:12 | 11K | |
| ladspa-1.17_1.pkg | 2023-10-06 17:44 | 27K | |
| ladvd-1.1.2_1.pkg | 2023-10-14 18:30 | 40K | |
| lafontaine-0.4.1_11.pkg | 2023-10-08 13:36 | 84K | |
| lagrange-1.16.5.pkg | 2023-10-09 03:49 | 4.0M | |
| lamarc-2.1.8_1,1.pkg | 2023-10-14 10:07 | 2.7M | |
| lambda-0.1.4_2.pkg | 2023-10-08 13:31 | 29K | |
| lambdamoo-1.8.1_1.pkg | 2023-10-08 15:14 | 134K | |
| lame-3.100_4.pkg | 2023-10-05 16:47 | 350K | |
| lammps-2023.08.02.pkg | 2023-10-07 12:31 | 27M | |
| lamprop-2020.12.28.pkg | 2023-10-10 02:12 | 115K | |
| lander-0.7.3_1.pkg | 2023-10-09 09:09 | 1.4M | |
| landrop-0.4.0.pkg | 2023-10-09 06:49 | 147K | |
| languageclient-neovi..> | 2023-10-14 14:01 | 1.2M | |
| lapack++-2.5.4_11.pkg | 2023-10-08 21:54 | 438K | |
| lapack-3.11.0_1.pkg | 2023-10-06 09:16 | 7.0M | |
| lapack95-1.0_20.pkg | 2023-10-08 22:27 | 768K | |
| lapacke-3.11.0_1.pkg | 2023-10-06 12:49 | 524K | |
| lapackpp-2022.05.00_..> | 2023-10-08 01:37 | 284K | |
| lapce-0.2.8_4.pkg | 2023-10-09 23:22 | 14M | |
| lapispuzzle-1.2_9.pkg | 2023-10-07 22:36 | 29K | |
| larbin-2.6.3_3.pkg | 2023-10-08 21:35 | 69K | |
| largetifftools-1.4.1..> | 2023-10-09 03:25 | 34K | |
| larswm-7.5.3_2.pkg | 2023-10-10 14:12 | 84K | |
| lasem-0.5.1_2.pkg | 2023-10-10 00:18 | 380K | |
| lash-0.5.4_19.pkg | 2023-10-08 05:00 | 109K | |
| lasi-1.1.3_1.pkg | 2023-10-07 07:38 | 434K | |
| laspack-1.12.2.pkg | 2023-10-11 22:53 | 105K | |
| lasso-2.8.2.pkg | 2023-10-07 15:54 | 320K | |
| lastpass-cli-1.3.6.pkg | 2023-10-10 00:37 | 68K | |
| laszip-3.4.3.pkg | 2023-10-06 19:48 | 111K | |
| latd-1.31.pkg | 2023-10-10 13:58 | 68K | |
| laternamagica-0.5_5.pkg | 2023-10-08 02:27 | 49K | |
| latex-beamer-3.57_1.pkg | 2023-10-14 15:34 | 549K | |
| latex-biber-2.19,1.pkg | 2023-10-10 23:17 | 269K | |
| latex-jlisting-0.2.pkg | 2023-10-11 02:57 | 2.7K | |
| latex-ltablex-1.0_2.pkg | 2023-10-09 15:46 | 229K | |
| latex-mk-2.1_5.pkg | 2023-10-10 01:44 | 229K | |
| latex-resume-2001082..> | 2023-10-10 10:45 | 8.0K | |
| latex-service-0.1_11..> | 2023-10-07 21:42 | 4.8K | |
| latex2html-2016_1.pkg | 2023-10-09 03:15 | 683K | |
| latex2rtf-2.3.17_1.pkg | 2023-10-09 07:28 | 141K | |
| latexdiff-1.3.3.pkg | 2023-10-09 07:31 | 99K | |
| lato-g20180831_1.pkg | 2023-10-07 14:11 | 2.7M | |
| latte-1.2.2_2.pkg | 2023-10-07 09:59 | 393K | |
| latte-dock-0.10.9_1.pkg | 2023-10-14 16:48 | 1.2M | |
| latte-integrale-1.7...> | 2023-10-08 22:21 | 7.4M | |
| lattice-ice40-exampl..> | 2023-10-07 23:31 | 15K | |
| lattice-ice40-exampl..> | 2023-10-07 21:03 | 14K | |
| lattice-ice40-tools-..> | 2023-10-09 05:32 | 856 | |
| lava-1.0.1.pkg | 2023-10-09 21:46 | 2.2K | |
| lavalauncher-2.1.1.pkg | 2023-10-09 06:29 | 32K | |
| layan-gtk-themes-202..> | 2023-10-14 10:03 | 157K | |
| lazarus-gtk2-2.2.6.pkg | 2023-10-08 03:16 | 166M | |
| lazarus-gtk2-devel-2..> | 2023-10-09 02:38 | 149M | |
| lazarus-qt5-2.2.6_1.pkg | 2023-10-08 10:02 | 167M | |
| lazarus-qt5-devel-2...> | 2023-10-08 17:48 | 150M | |
| lazpaint-gtk2-7.1.6_..> | 2023-10-09 04:50 | 3.0M | |
| lazpaint-qt5-7.1.6_8..> | 2023-10-09 19:31 | 3.0M | |
| lazperf-2.0.0.pkg | 2023-10-06 20:31 | 67K | |
| lazycli-0.1.15_7.pkg | 2023-10-10 18:33 | 652K | |
| lazygit-0.40.2_1.pkg | 2023-10-10 03:21 | 4.3M | |
| lazyread-2.0.pkg | 2023-10-11 13:49 | 13K | |
| lb-libreoffice-7.5.5..> | 2023-10-08 00:50 | 108K | |
| lbann-0.102.254_1.pkg | 2023-10-14 14:41 | 6.3M | |
| lbdb-0.42.1.pkg | 2023-10-09 07:16 | 45K | |
| lbl-cf-1.2.5.pkg | 2023-10-07 21:28 | 6.1K | |
| lbl-hf-1.9.pkg | 2023-10-07 10:28 | 18K | |
| lbrate-1.1_2.pkg | 2023-10-10 13:16 | 19K | |
| lbreakout-010315_9.pkg | 2023-10-09 09:46 | 530K | |
| lbreakout2-2.6.5_1.pkg | 2023-10-14 18:49 | 2.4M | |
| lbreakouthd-1.1.1_1.pkg | 2023-10-14 08:34 | 3.5M | |
| lbzip2-2.5.pkg | 2023-10-14 13:30 | 84K | |
| lc-1.0.pkg | 2023-10-09 01:32 | 6.0K | |
| lcab-1.0b12.pkg | 2023-10-10 02:51 | 8.0K | |
| lcalc-2.0.5_1.pkg | 2023-10-08 10:00 | 770K | |
| lcdproc-0.5.9.pkg | 2023-10-09 21:15 | 255K | |
| lcdtest-1.18_10.pkg | 2023-10-10 07:01 | 13K | |
| lci-0.11.2_4.pkg | 2023-10-09 07:40 | 196K | |
| lcms-1.19_7,1.pkg | 2023-10-06 08:52 | 234K | |
| lcms2-2.15_2.pkg | 2023-10-05 17:44 | 2.1M | |
| lcov-1.15.pkg | 2023-10-06 17:36 | 92K | |
| ldap-account-manager..> | 2023-10-09 20:35 | 23M | |
| ldap-stats-5.2_1.pkg | 2023-10-09 03:49 | 7.7K | |
| ldapbrowser-2.8.2_4.pkg | 2023-10-14 14:10 | 627K | |
| ldapdiff-1.4.1_4.pkg | 2023-10-11 14:33 | 26K | |
| ldapdns-2.07_4.pkg | 2023-10-10 09:16 | 82K | |
| ldapscripts-2.0.8_1.pkg | 2023-10-09 06:11 | 44K | |
| ldapsdk-6.0.7_1,1.pkg | 2023-10-08 23:28 | 7.1K | |
| ldapsh-2.00_4,1.pkg | 2023-10-10 12:53 | 41K | |
| ldapvi-1.7_6.pkg | 2023-10-10 01:16 | 61K | |
| ldb15-1.5.6_2.pkg | 2023-10-14 15:06 | 197K | |
| ldb20-2.0.10_1.pkg | 2023-10-14 15:24 | 176K | |
| ldb21-2.1.5_1.pkg | 2023-10-08 13:45 | 180K | |
| ldb22-2.2.3.pkg | 2023-10-08 10:13 | 181K | |
| ldc-1.32.0_1.pkg | 2023-10-06 12:43 | 14M | |
| ldns-1.8.3.pkg | 2023-10-07 04:48 | 543K | |
| ldraw-20220211,1.pkg | 2023-10-07 14:34 | 39M | |
| ldview-4.5_1.pkg | 2023-10-14 07:13 | 742K | |
| le-1.16.8.pkg | 2023-10-09 04:35 | 165K | |
| leafnode-1.12.0.pkg | 2023-10-09 03:32 | 307K | |
| leafpad-0.8.19_2.pkg | 2023-10-14 05:02 | 95K | |
| leafpak-1.1.1.pkg | 2023-10-10 00:27 | 8.3K | |
| league-gothic-1.601.pkg | 2023-10-08 20:33 | 48K | |
| league-spartan-2.220..> | 2023-10-10 13:51 | 231K | |
| leaktracer-2.4.pkg | 2023-10-08 13:01 | 11K | |
| lean-3.51.1.pkg | 2023-10-09 18:05 | 3.8M | |
| leatherman-1.12.9_1.pkg | 2023-10-07 09:39 | 619K | |
| lebiniou-3.66.0_5.pkg | 2023-10-14 07:33 | 426K | |
| lebiniou-data-3.66.0..> | 2023-10-08 09:38 | 51M | |
| led-2.0_1.pkg | 2023-10-08 15:37 | 68K | |
| ledger-3.2.1_5.pkg | 2023-10-14 17:57 | 843K | |
| ledgersmb-1.2.26_2.pkg | 2023-10-10 20:09 | 1.3M | |
| ledit-2.04_1.pkg | 2023-10-10 08:12 | 129K | |
| leela-zero-0.17.30_4..> | 2023-10-08 02:04 | 395K | |
| lefthook-1.4.8_2.pkg | 2023-10-14 02:37 | 2.1M | |
| leftwm-0.4.2_1.pkg | 2023-10-14 07:14 | 7.3M | |
| legend-of-edgar-1.36..> | 2023-10-10 14:07 | 86M | |
| legesmotus-0.4.0_8.pkg | 2023-10-08 15:38 | 1.1M | |
| leiningen-2.9.10_1.pkg | 2023-10-09 23:10 | 11M | |
| lemon-3.34.pkg | 2023-10-08 04:24 | 45K | |
| lemonbar-1.4_1.pkg | 2023-10-09 12:53 | 18K | |
| lemonbar-xft-g202012..> | 2023-10-09 21:49 | 22K | |
| lens-0.2_2.pkg | 2023-10-09 14:53 | 6.4K | |
| lensfun-0.3.95_2.pkg | 2023-10-07 00:23 | 338K | |
| lenticular-lv2-0.5.0..> | 2023-10-14 06:06 | 233K | |
| leo_center-0.4.70_1.pkg | 2023-10-09 04:54 | 5.7M | |
| leocad-23.03.pkg | 2023-10-10 04:20 | 1.4M | |
| leofs-1.4.3_2.pkg | 2023-10-11 06:06 | 19M | |
| leproxy-0.2.2.pkg | 2023-10-14 08:00 | 51K | |
| lepton-eda-1.9.18_3.pkg | 2023-10-09 10:00 | 6.4M | |
| leptonica-1.82.0_1.pkg | 2023-10-06 20:56 | 1.1M | |
| lerc-4.0.0.pkg | 2023-10-06 10:41 | 163K | |
| less-551_1.pkg | 2023-10-10 00:39 | 99K | |
| lesspipe-2.06.pkg | 2023-10-10 09:44 | 31K | |
| lesstif-0.95.2_7,2.pkg | 2023-10-07 20:29 | 1.3M | |
| lets-0.0.53_1.pkg | 2023-10-09 15:10 | 2.5M | |
| letsdns-1.0.1_2.pkg | 2023-10-08 15:32 | 28K | |
| level-zero-1.14.0.pkg | 2023-10-06 08:45 | 251K | |
| leveldb-1.23_1.pkg | 2023-10-06 16:22 | 166K | |
| levmar-2.6_15.pkg | 2023-10-14 09:37 | 105K | |
| lewton-0.10.2_21.pkg | 2023-10-10 03:01 | 312K | |
| lexter-1.0.3_6.pkg | 2023-10-09 15:10 | 167K | |
| lf-31.pkg | 2023-10-09 18:29 | 1.2M | |
| lfcbase-1.18.5.pkg | 2023-10-06 20:35 | 193K | |
| lfcxml-1.3.6.pkg | 2023-10-07 05:49 | 47K | |
| lfe-2.1.1.pkg | 2023-10-09 09:35 | 760K | |
| lfm-3.1.pkg | 2023-10-08 17:44 | 137K | |
| lfpfonts-fix-0.82_5.pkg | 2023-10-14 03:41 | 286K | |
| lfpfonts-var-0.83_5.pkg | 2023-10-11 01:58 | 351K | |
| lft-3.91,2.pkg | 2023-10-09 13:41 | 63K | |
| lftp-4.9.2.pkg | 2023-10-07 09:42 | 914K | |
| lfview-1.1a_3.pkg | 2023-10-11 06:13 | 40K | |
| lg-1.9.s20140622_1.pkg | 2023-10-10 07:58 | 38K | |
| lgeneral-1.4.4.pkg | 2023-10-09 09:11 | 1.6M | |
| lha-1.14i_9.pkg | 2023-10-08 09:49 | 102K | |
| lha-ac-1.14i.2021112..> | 2023-10-08 12:08 | 56K | |
| lhasa-0.3.1.pkg | 2023-10-08 10:41 | 53K | |
| lib2geom-1.3.pkg | 2023-10-07 04:24 | 470K | |
| lib3ds-1.3.0_7.pkg | 2023-10-08 09:06 | 79K | |
| lib765-0.4.2_2.pkg | 2023-10-09 10:43 | 30K | |
| lib1541img-1.1_1.pkg | 2023-10-08 11:12 | 44K | |
| libArcus-4.13.1_2,1.pkg | 2023-10-07 06:25 | 43K | |
| libCello-1.1.7_1.pkg | 2023-10-09 08:33 | 56K | |
| libCharon-4.13.0.pkg | 2023-10-08 11:21 | 21K | |
| libEMF-1.0.13_1.pkg | 2023-10-07 06:07 | 611K | |
| libFS-1.0.8_1.pkg | 2023-10-07 08:07 | 34K | |
| libGLU-9.0.2_2.pkg | 2023-10-06 09:07 | 190K | |
| libHX-4.14.pkg | 2023-10-07 15:17 | 92K | |
| libICE-1.1.0_2,1.pkg | 2023-10-05 16:42 | 93K | |
| libIDL-0.8.14_5.pkg | 2023-10-07 09:34 | 132K | |
| libQGLViewer-2.7.2_1..> | 2023-10-06 15:28 | 1.5M | |
| libRmath-4.3.1.pkg | 2023-10-07 18:49 | 148K | |
| libSM-1.2.3_1,1.pkg | 2023-10-05 16:42 | 23K | |
| libSavitar-4.13.1.pkg | 2023-10-07 14:33 | 52K | |
| libX11-1.8.6_1,1.pkg | 2023-10-05 17:22 | 1.6M | |
| libXScrnSaver-1.2.4.pkg | 2023-10-05 17:31 | 14K | |
| libXau-1.0.9.pkg | 2023-10-05 16:41 | 11K | |
| libXaw-1.0.14,2.pkg | 2023-10-05 17:33 | 470K | |
| libXcm-0.5.4.pkg | 2023-10-06 23:33 | 39K | |
| libXcomposite-0.4.6,..> | 2023-10-05 17:29 | 10K | |
| libXcursor-1.2.0.pkg | 2023-10-05 17:30 | 34K | |
| libXdamage-1.1.6.pkg | 2023-10-05 17:29 | 6.0K | |
| libXdmcp-1.1.3.pkg | 2023-10-05 16:41 | 14K | |
| libXext-1.3.4,1.pkg | 2023-10-05 17:23 | 94K | |
| libXfixes-6.0.0.pkg | 2023-10-05 17:24 | 14K | |
| libXfont-1.5.4_3,2.pkg | 2023-10-06 14:30 | 154K | |
| libXfont2-2.0.5_1.pkg | 2023-10-06 10:12 | 162K | |
| libXft-2.3.7.pkg | 2023-10-05 17:41 | 76K | |
| libXi-1.8,1.pkg | 2023-10-05 17:25 | 124K | |
| libXinerama-1.1.4_2,..> | 2023-10-05 17:30 | 9.6K | |
| libXmu-1.1.3,1.pkg | 2023-10-05 17:25 | 95K | |
| libXpm-3.5.15.pkg | 2023-10-05 17:32 | 92K | |
| libXpresent-1.0.0.pkg | 2023-10-06 17:48 | 8.7K | |
| libXrandr-1.5.2.pkg | 2023-10-05 17:29 | 30K | |
| libXrender-0.9.10_2.pkg | 2023-10-05 17:23 | 29K | |
| libXres-1.2.2.pkg | 2023-10-06 11:29 | 9.0K | |
| libXt-1.2.1,1.pkg | 2023-10-05 17:24 | 452K | |
| libXtst-1.2.3_2.pkg | 2023-10-05 17:26 | 19K | |
| libXv-1.0.12,1.pkg | 2023-10-05 17:30 | 36K | |
| libXvMC-1.0.12.pkg | 2023-10-07 02:27 | 25K | |
| libXxf86dga-1.1.6.pkg | 2023-10-06 15:21 | 19K | |
| libXxf86vm-1.1.4_3.pkg | 2023-10-05 17:29 | 17K | |
| liba52-0.8.0.pkg | 2023-10-06 08:23 | 47K | |
| libaacs-0.11.1.pkg | 2023-10-07 13:00 | 75K | |
| libabigail-2.0_2.pkg | 2023-10-14 16:25 | 1.5M | |
| libabw-0.1.3_3.pkg | 2023-10-06 19:59 | 81K | |
| libac-g20190308_1.pkg | 2023-10-07 19:15 | 15K | |
| libaccounts-glib-1.2..> | 2023-10-06 07:05 | 112K | |
| libaccounts-qt5-1.16..> | 2023-10-06 09:13 | 200K | |
| libad9361-iio-0.3.pkg | 2023-10-07 21:54 | 77K | |
| libadplug-2.3.3.pkg | 2023-10-07 19:32 | 417K | |
| libadwaita-1.4.0.pkg | 2023-10-06 17:31 | 3.2M | |
| libaec-1.0.6.pkg | 2023-10-05 16:45 | 24K | |
| libafterbase-0.92_3.pkg | 2023-10-10 00:19 | 55K | |
| libafterimage-1.20_8..> | 2023-10-07 23:13 | 282K | |
| libaiff-6.0.pkg | 2023-10-08 09:49 | 17K | |
| libamrnb-11.0.0.0_2,..> | 2023-10-08 14:40 | 244K | |
| libamrwb-11.0.0.0_3.pkg | 2023-10-08 15:29 | 159K | |
| libansilove-1.4.1.pkg | 2023-10-07 10:58 | 43K | |
| libantlr3c-3.4_1.pkg | 2023-10-06 17:22 | 112K | |
| libantlr4-4.13.0.pkg | 2023-10-14 11:00 | 604K | |
| libao-1.2.0_6.pkg | 2023-10-05 17:02 | 46K | |
| libappindicator-12.1..> | 2023-10-08 09:59 | 58K | |
| libapreq2-2.17.pkg | 2023-10-06 22:01 | 65K | |
| libaravis-0.8.20_2.pkg | 2023-10-08 00:45 | 288K | |
| libarc-2.0.2_2.pkg | 2023-10-07 02:31 | 63K | |
| libarchive-3.7.1,1.pkg | 2023-10-06 10:06 | 503K | |
| libarchive-qt-2.0.6.pkg | 2023-10-07 02:23 | 76K | |
| libarea-20191031_1.pkg | 2023-10-07 10:37 | 340K | |
| libarena-0.3.7.pkg | 2023-10-08 12:55 | 15K | |
| libargon2-20190702.pkg | 2023-10-05 16:49 | 57K | |
| libarms-5.01_2.pkg | 2023-10-08 23:47 | 423K | |
| libart_lgpl-2.3.21_3..> | 2023-10-06 23:48 | 80K | |
| libartnet-1.1.2.pkg | 2023-10-10 11:36 | 33K | |
| libasr-1.0.4.pkg | 2023-10-06 18:48 | 33K | |
| libasr-devel-2016021..> | 2023-10-10 23:20 | 35K | |
| libass-0.17.1_1.pkg | 2023-10-06 07:06 | 146K | |
| libassa-3.5.1_1.pkg | 2023-10-14 12:29 | 326K | |
| libassetml-1.2.1_16.pkg | 2023-10-10 13:13 | 23K | |
| libassuan-2.5.6.pkg | 2023-10-05 17:10 | 75K | |
| libast-0.7_13.pkg | 2023-10-07 12:56 | 163K | |
| libastylej-3.0.1_2.pkg | 2023-10-10 13:39 | 105K | |
| libastylej-arduino-3..> | 2023-10-07 15:07 | 105K | |
| libatomic_ops-7.8.0.pkg | 2023-10-05 16:45 | 90K | |
| libaudec-0.3.4_1.pkg | 2023-10-08 03:56 | 44K | |
| libaudiofile-0.3.6_4..> | 2023-10-07 04:38 | 185K | |
| libaura-3.1.20051222..> | 2023-10-07 02:55 | 11K | |
| libavif-1.0.1.pkg | 2023-10-06 12:49 | 127K | |
| libavl-1.4.0_1.pkg | 2023-10-09 02:49 | 20K | |
| libayatana-appindica..> | 2023-10-08 02:56 | 77K | |
| libayatana-indicator..> | 2023-10-07 00:04 | 93K | |
| libb2-0.98.1_1.pkg | 2023-10-08 20:51 | 38K | |
| libb64-1.2.1.pkg | 2023-10-06 20:39 | 5.0K | |
| libbacktrace-1.0.pkg | 2023-10-07 20:28 | 60K | |
| libbde-a.20221031.pkg | 2023-10-07 00:22 | 697K | |
| libbdplus-0.2.0.pkg | 2023-10-08 15:01 | 73K | |
| libbegemot-1.11_5.pkg | 2023-10-14 06:34 | 83K | |
| libbfd-2.40.pkg | 2023-10-08 10:27 | 3.3M | |
| libbgpdump-1.6.0.pkg | 2023-10-07 16:09 | 70K | |
| libbigwig-0.4.7.pkg | 2023-10-14 17:38 | 34K | |
| libbind-6.0_1.pkg | 2023-10-09 21:09 | 213K | |
| libbinio-1.5.pkg | 2023-10-07 09:29 | 30K | |
| libbluray-1.3.4,1.pkg | 2023-10-06 14:50 | 143K | |
| libboard-0.9.4_10.pkg | 2023-10-09 11:37 | 3.4M | |
| libbpfjit-g202008280..> | 2023-10-14 06:11 | 7.6K | |
| libbpg-0.9.8_1.pkg | 2023-10-10 19:50 | 412K | |
| libbpm-0.3_1.pkg | 2023-10-10 07:37 | 184K | |
| libbraiding-1.1.pkg | 2023-10-07 21:00 | 138K | |
| libbs2b-3.1.0_7.pkg | 2023-10-07 08:37 | 17K | |
| libbson-1.24.2.pkg | 2023-10-07 01:36 | 596K | |
| libbt-1.06.pkg | 2023-10-09 15:35 | 170K | |
| libbtc-g20210428_1.pkg | 2023-10-09 13:34 | 291K | |
| libburn-1.5.6.pkg | 2023-10-06 21:58 | 366K | |
| libc6-shim-20230629.pkg | 2023-10-08 20:50 | 883K | |
| libcabinet-0.30_2.pkg | 2023-10-09 22:21 | 52K | |
| libcaca-0.99.b19_2.pkg | 2023-10-07 09:19 | 408K | |
| libcanberra-0.30_9.pkg | 2023-10-05 16:50 | 33K | |
| libcanberra-gtk2-0.3..> | 2023-10-07 10:45 | 16K | |
| libcanberra-gtk3-0.3..> | 2023-10-06 06:39 | 13K | |
| libcapn-1.1.0.pkg | 2023-10-09 22:07 | 21K | |
| libcbor-0.10.2.pkg | 2023-10-06 07:14 | 31K | |
| libccd-2.1.pkg | 2023-10-06 16:10 | 22K | |
| libccp4-6.5.1_5.pkg | 2023-10-08 02:56 | 383K | |
| libcdada-0.4.0.pkg | 2023-10-08 00:39 | 129K | |
| libcdaudio-0.99.12p2..> | 2023-10-07 02:36 | 56K | |
| libcdb-g2020082801.pkg | 2023-10-10 09:15 | 25K | |
| libcddb-1.3.2_4.pkg | 2023-10-05 17:01 | 57K | |
| libcddb-doc-1.3.0.pkg | 2023-10-14 04:43 | 63K | |
| libcdio-2.1.0.pkg | 2023-10-05 17:06 | 300K | |
| libcdio-paranoia-10...> | 2023-10-06 14:13 | 74K | |
| libcdr01-0.1.7_6.pkg | 2023-10-06 22:30 | 334K | |
| libcds-2.3.3.102_1.pkg | 2023-10-10 17:26 | 362K | |
| libcec-6.0.2_1.pkg | 2023-10-06 16:44 | 272K | |
| libcelero-2.9.0.pkg | 2023-10-10 21:56 | 107K | |
| libcerf-2.3.pkg | 2023-10-09 08:11 | 49K | |
| libcfu-0.04.a_3.pkg | 2023-10-07 22:43 | 41K | |
| libchamplain-0.12.20..> | 2023-10-06 20:49 | 146K | |
| libchipcard-5.1.6.pkg | 2023-10-09 07:09 | 274K | |
| libchk-1.10.3.pkg | 2023-10-07 22:51 | 5.2K | |
| libcidr-1.2.3.pkg | 2023-10-08 09:53 | 133K | |
| libcifpp-5.1.0.1_1.pkg | 2023-10-07 16:29 | 58M | |
| libcii-1.1.pkg | 2023-10-14 05:20 | 137K | |
| libcint-5.4.0.pkg | 2023-10-06 18:27 | 468K | |
| libcircllhist-g20221..> | 2023-10-07 21:52 | 188K | |
| libcjson-1.7.16.pkg | 2023-10-05 17:45 | 35K | |
| libclc-15.0.4.pkg | 2023-10-06 23:59 | 8.6M | |
| libcli-1.9.6_1.pkg | 2023-10-09 01:50 | 19K | |
| libclipboard-1.1.pkg | 2023-10-10 15:59 | 8.4K | |
| libcmime-0.2.1_4.pkg | 2023-10-07 02:26 | 40K | |
| libcmis-0.5.2_8.pkg | 2023-10-06 23:10 | 756K | |
| libcoap-4.3.2.pkg | 2023-10-14 04:16 | 5.5M | |
| libcombine-0.2.20.pkg | 2023-10-10 00:59 | 271K | |
| libcompizconfig-0.8...> | 2023-10-09 01:04 | 76K | |
| libcomprex-0.3.3_13.pkg | 2023-10-10 21:07 | 193K | |
| libcomps-0.1.19.pkg | 2023-10-08 03:03 | 96K | |
| libconcord-1.2_3.pkg | 2023-10-07 23:33 | 79K | |
| libconcurrent-0.0.20..> | 2023-10-08 22:17 | 6.9K | |
| libconfig-1.7.3.pkg | 2023-10-06 12:12 | 94K | |
| libconfuse-3.3_2.pkg | 2023-10-06 14:45 | 55K | |
| libconvolve-0.0.8_8.pkg | 2023-10-14 17:43 | 10K | |
| libcouchbase-3.3.8.pkg | 2023-10-10 23:21 | 743K | |
| libcoverart-1.0.0_6.pkg | 2023-10-08 06:07 | 33K | |
| libcprime-4.3.0_1.pkg | 2023-10-07 03:03 | 132K | |
| libcpuid-0.6.3.pkg | 2023-10-06 21:01 | 72K | |
| libcreg-e.20221022.pkg | 2023-10-07 05:19 | 606K | |
| libcroco-0.6.13_2.pkg | 2023-10-06 19:28 | 204K | |
| libcrossguid-0.2.2.5..> | 2023-10-06 15:42 | 11K | |
| libcryptui-3.12.2_4.pkg | 2023-10-07 03:43 | 664K | |
| libcsptr-2.0.4.24.pkg | 2023-10-08 12:38 | 6.5K | |
| libcss-0.9.1.pkg | 2023-10-07 13:04 | 124K | |
| libcsv-3.0.3_3.pkg | 2023-10-08 09:29 | 16K | |
| libctl-4.5.0_2.pkg | 2023-10-08 11:25 | 220K | |
| libcuckoo-0.3.1.pkg | 2023-10-06 22:32 | 31K | |
| libcue-2.1.0.pkg | 2023-10-08 06:24 | 18K | |
| libcutl-1.10.0_21.pkg | 2023-10-06 11:24 | 114K | |
| libcwd-1.0.6_6.pkg | 2023-10-09 05:37 | 95K | |
| libcyaml-1.4.1.pkg | 2023-10-08 05:44 | 35K | |
| libdaemon-0.14_1.pkg | 2023-10-05 16:43 | 24K | |
| libdap-3.20.11.pkg | 2023-10-08 15:41 | 1.7M | |
| libdaq-3.0.12.pkg | 2023-10-08 04:54 | 117K | |
| libdatachannel-0.19...> | 2023-10-14 12:45 | 701K | |
| libdatadog-2.1.0_4.pkg | 2023-10-09 13:16 | 3.3M | |
| libdatovka-0.3.0.pkg | 2023-10-08 10:15 | 200K | |
| libdatrie-0.2.13_1.pkg | 2023-10-05 16:42 | 29K | |
| libdazzle-3.44.0_1.pkg | 2023-10-06 19:47 | 459K | |
| libdbi-0.9.0_3.pkg | 2023-10-07 08:52 | 653K | |
| libdbi-drivers-0.9.0..> | 2023-10-08 05:45 | 373K | |
| libdbusmenu-16.04.0_..> | 2023-10-06 13:53 | 112K | |
| libdbusmenu-qt5-0.9...> | 2023-10-06 09:13 | 145K | |
| libdbusmenu-qt6-0.9...> | 2023-10-11 19:38 | 165K | |
| libdc-5.0.10.pkg | 2023-10-07 20:05 | 445K | |
| libdc1394-2.2.6.pkg | 2023-10-05 17:03 | 128K | |
| libdca-0.0.7.pkg | 2023-10-06 08:38 | 107K | |
| libdcadec-0.2.0_1.pkg | 2023-10-08 18:04 | 145K | |
| libddoc-0.8.0_3.pkg | 2023-10-08 00:10 | 55K | |
| libddwaf-1.14.0_1.pkg | 2023-10-09 03:15 | 289K | |
| libde265-1.0.12.pkg | 2023-10-06 10:54 | 196K | |
| libdecaf-1.0.0_3.pkg | 2023-10-09 19:30 | 131K | |
| libdecor-0.1.1.pkg | 2023-10-06 10:18 | 27K | |
| libdeflate-1.19.pkg | 2023-10-05 17:38 | 77K | |
| libdevq-0.0.4.pkg | 2023-10-12 11:16 | 9.7K | |
| libdfui-4.1.20060122..> | 2023-10-07 15:38 | 24K | |
| libdiff-0.1.0.pkg | 2023-10-07 01:33 | 16K | |
| libdill-2.14.pkg | 2023-10-10 11:56 | 202K | |
| libdisasm-0.23_2.pkg | 2023-10-09 06:32 | 133K | |
| libdiscid-0.6.4_1.pkg | 2023-10-07 08:50 | 14K | |
| libdisorder-0.0.2_1.pkg | 2023-10-09 16:00 | 7.9K | |
| libdispatch-5.5,1.pkg | 2023-10-08 09:55 | 142K | |
| libdisplay-info-0.1...> | 2023-10-07 03:24 | 90K | |
| libdistance-0.2.2_1.pkg | 2023-10-08 00:30 | 39K | |
| libdivide-5.0_1.pkg | 2023-10-07 01:12 | 18K | |
| libdivsufsort-2.0.1...> | 2023-10-12 00:01 | 20K | |
| libdkim-1.0.21.pkg | 2023-10-10 20:52 | 45K | |
| libdmapsharing-2.9.4..> | 2023-10-10 09:49 | 112K | |
| libdmtx-0.7.5.pkg | 2023-10-05 17:35 | 70K | |
| libdnet-1.13_4.pkg | 2023-10-06 16:33 | 68K | |
| libdnf-0.70.2_1.pkg | 2023-10-08 02:55 | 1.2M | |
| libdnsres-0.1a_10.pkg | 2023-10-08 23:36 | 119K | |
| libdockapp-0.7.2.pkg | 2023-10-08 03:28 | 43K | |
| libdom-0.4.1.pkg | 2023-10-07 22:53 | 112K | |
| libdomainkeys-0.69_1..> | 2023-10-08 09:20 | 24K | |
| libdombey-5.56.pkg | 2023-10-14 13:53 | 60K | |
| libdparse-0.20.0_3.pkg | 2023-10-07 01:11 | 571K | |
| libdrizzle-0.8_7.pkg | 2023-10-07 12:31 | 55K | |
| libdrizzle-redux-5.1..> | 2023-10-09 05:20 | 456K | |
| libdrm-2.4.116,1.pkg | 2023-10-05 17:22 | 252K | |
| libds-2.2.pkg | 2023-10-09 22:29 | 35K | |
| libdsk-1.4.2.pkg | 2023-10-07 19:00 | 423K | |
| libdsp-5.0.2_3.pkg | 2023-10-08 22:16 | 224K | |
| libdssialsacompat-1...> | 2023-10-06 17:56 | 11K | |
| libdv-1.0.0_8.pkg | 2023-10-07 09:29 | 76K | |
| libdvbcsa-1.1.0_1.pkg | 2023-10-08 09:21 | 24K | |
| libdvbpsi-1.3.3.pkg | 2023-10-06 23:02 | 102K | |
| libdvdcss-1.4.3.pkg | 2023-10-07 21:23 | 68K | |
| libdvdnav-6.1.1.pkg | 2023-10-05 16:46 | 76K | |
| libdvdread-6.1.3.pkg | 2023-10-05 16:45 | 123K | |
| libdwarf-20161124.pkg | 2023-10-07 09:55 | 672K | |
| libdynamite-0.1.1_4.pkg | 2023-10-09 08:07 | 8.2K | |
| libe-0.11.0.pkg | 2023-10-07 11:37 | 73K | |
| libe-book-0.1.3_27.pkg | 2023-10-06 21:50 | 729K | |
| libeXosip2-5.3.0.pkg | 2023-10-09 19:58 | 214K | |
| libeatmydata-9.pkg | 2023-10-14 18:55 | 3.2K | |
| libebml-1.4.4.pkg | 2023-10-06 15:55 | 62K | |
| libebur128-1.2.6.pkg | 2023-10-10 00:59 | 14K | |
| libecap-1.0.1.pkg | 2023-10-14 10:47 | 30K | |
| libecc-0.14.0_2.pkg | 2023-10-08 18:01 | 41K | |
| libechonest-2.3.1_6.pkg | 2023-10-09 14:46 | 132K | |
| libecpint-1.0.7.pkg | 2023-10-07 10:52 | 250K | |
| libecwj2-3.3_4.pkg | 2023-10-09 16:27 | 776K | |
| libedit-3.1.20221030..> | 2023-10-05 16:42 | 140K | |
| libefp-1.5.0.pkg | 2023-10-10 00:26 | 3.9M | |
| libegit2-emacs_canna..> | 2023-10-14 06:39 | 101K | |
| libegit2-emacs_devel..> | 2023-10-14 10:27 | 101K | |
| libegit2-emacs_devel..> | 2023-10-10 07:09 | 101K | |
| libegit2-emacs_nox-g..> | 2023-10-14 11:00 | 102K | |
| libegit2-g20200515_1..> | 2023-10-09 20:26 | 101K | |
| libei-1.1.0.pkg | 2023-10-06 10:51 | 88K | |
| libeio-4.18_2.pkg | 2023-10-07 00:59 | 23K | |
| libelf-0.8.13_3.pkg | 2023-10-07 04:11 | 58K | |
| libemos-4.5.9_4.pkg | 2023-10-08 13:23 | 16M | |
| libepc-0.4.6_1.pkg | 2023-10-14 18:16 | 70K | |
| libepoll-shim-0.0.20..> | 2023-10-05 17:38 | 23K | |
| libepoxy-1.5.9.pkg | 2023-10-05 17:29 | 279K | |
| libepp-nicbr-1.18.pkg | 2023-10-09 23:37 | 616K | |
| libepubgen-0.1.1_1.pkg | 2023-10-06 19:23 | 111K | |
| liberasurecode-1.6.3..> | 2023-10-14 16:17 | 286K | |
| liberation-fonts-ttf..> | 2023-10-06 22:47 | 1.4M | |
| liberator-2.0.2_2.pkg | 2023-10-10 16:58 | 426K | |
| libertinus-7.040.pkg | 2023-10-10 21:02 | 1.6M | |
| libesedb-e.20220806.pkg | 2023-10-07 14:26 | 755K | |
| libesmtp-1.1.0,1.pkg | 2023-10-07 09:18 | 53K | |
| libestr-0.1.11_1.pkg | 2023-10-07 21:31 | 13K | |
| libetonyek01-0.1.10_..> | 2023-10-06 20:27 | 550K | |
| libetpan-1.9.4.pkg | 2023-10-07 05:15 | 494K | |
| libev-4.33,1.pkg | 2023-10-06 16:54 | 112K | |
| libevdev-1.9.1.20200..> | 2023-10-05 17:22 | 52K | |
| libevdevplus-0.2.1.pkg | 2023-10-14 10:28 | 21K | |
| libevent-2.1.12.pkg | 2023-10-05 16:44 | 319K | |
| libevent-devel-2.2.1..> | 2023-10-07 19:00 | 348K | |
| libevhtp-1.2.16_4.pkg | 2023-10-07 00:25 | 44K | |
| libevt-a.20221022.pkg | 2023-10-08 02:40 | 695K | |
| libevtx-a.20221101.pkg | 2023-10-08 07:28 | 775K | |
| libewf-20140814.pkg | 2023-10-07 10:02 | 1.0M | |
| libexif-0.6.24.pkg | 2023-10-05 17:09 | 449K | |
| libexif-gtk-0.5.0_1.pkg | 2023-10-07 15:11 | 53K | |
| libexo-4.18.0_1.pkg | 2023-10-06 16:40 | 240K | |
| libexplain-1.3.D012_..> | 2023-10-08 04:44 | 3.0M | |
| libexttextcat-3.4.6.pkg | 2023-10-06 20:12 | 189K | |
| libfabric-1.15.1_1.pkg | 2023-10-06 09:37 | 505K | |
| libfakekey-0.3.pkg | 2023-10-08 07:27 | 4.8K | |
| libfaketime-0.9.10.pkg | 2023-10-08 21:56 | 28K | |
| libfame-0.9.1_6.pkg | 2023-10-07 05:07 | 108K | |
| libfap-1.5.pkg | 2023-10-10 01:07 | 47K | |
| libfastcommon-1.0.43..> | 2023-10-08 07:39 | 126K | |
| libfastjson-1.2304.0..> | 2023-10-08 07:22 | 44K | |
| libfb-2.0.2_3.pkg | 2023-10-10 09:15 | 21K | |
| libfec-3.0.1_4.pkg | 2023-10-09 08:23 | 33K | |
| libffcall-2.4_1.pkg | 2023-10-08 04:21 | 60K | |
| libffi-3.4.4.pkg | 2023-10-05 16:40 | 41K | |
| libffi33-3.3_2.pkg | 2023-10-07 10:03 | 15K | |
| libffi321-3.2.1_3.pkg | 2023-10-07 17:25 | 14K | |
| libfido2-1.13.0.pkg | 2023-10-06 07:22 | 236K | |
| libfilezilla-0.31.1.pkg | 2023-10-08 11:22 | 397K | |
| libfilteraudio-0.0.1..> | 2023-10-07 19:17 | 129K | |
| libfirm-1.21.0_2.pkg | 2023-10-08 03:02 | 1.9M | |
| libfishsound-1.0.0_5..> | 2023-10-07 16:16 | 75K | |
| libfixbuf-2.4.1.pkg | 2023-10-06 23:58 | 149K | |
| libfixmath-g20220915..> | 2023-10-08 22:09 | 63K | |
| libfixposix-0.4.3_2.pkg | 2023-10-14 09:36 | 16K | |
| libflame-5.2.0.pkg | 2023-10-14 11:46 | 4.5M | |
| libflatarray-0.3.0_1..> | 2023-10-08 16:49 | 55K | |
| libfm-1.3.2_2.pkg | 2023-10-07 04:18 | 523K | |
| libfm-extra-1.3.2_2.pkg | 2023-10-06 18:02 | 12K | |
| libfm-gtk3-1.3.2_2.pkg | 2023-10-08 11:42 | 523K | |
| libfm-qt-1.3.0.pkg | 2023-10-07 06:58 | 522K | |
| libfmt-9.1.0.pkg | 2023-10-06 15:11 | 164K | |
| libfo-0.6.3_4.pkg | 2023-10-07 12:18 | 1.1M | |
| libfolia-2.15.pkg | 2023-10-07 17:11 | 598K | |
| libfontenc-1.1.7.pkg | 2023-10-05 16:42 | 18K | |
| libformfactor-0.1.3.pkg | 2023-10-09 14:51 | 28K | |
| libfort-0.4.2.11.pkg | 2023-10-08 21:44 | 44K | |
| libfortuna-0.1.1.pkg | 2023-10-10 06:29 | 82K | |
| libfprint-0.7.0_2.pkg | 2023-10-08 11:19 | 239K | |
| libfpx-1.3.1.10.pkg | 2023-10-14 04:34 | 378K | |
| libfreefare-0.4.0_2.pkg | 2023-10-14 18:57 | 91K | |
| libfreehand-0.1.2_26..> | 2023-10-06 19:26 | 234K | |
| libfsapfs-e.20221102..> | 2023-10-07 05:15 | 854K | |
| libfsext-e.20220829.pkg | 2023-10-07 09:47 | 715K | |
| libfsfat-e.20220925.pkg | 2023-10-07 09:34 | 689K | |
| libfshfs-e.20220831.pkg | 2023-10-07 04:50 | 783K | |
| libfsntfs-e.20221023..> | 2023-10-07 02:31 | 842K | |
| libfsxfs-e.20220829.pkg | 2023-10-07 06:34 | 711K | |
| libftdi-0.20_18.pkg | 2023-10-06 16:25 | 65K | |
| libftdi1-1.5_4.pkg | 2023-10-06 17:17 | 130K | |
| libfvde-20220915.pkg | 2023-10-07 07:26 | 916K | |
| libfwnt-20220922.pkg | 2023-10-06 19:14 | 128K | |
| libfwsi-e.20220927.pkg | 2023-10-07 00:06 | 483K | |
| libfyaml-0.7.12.pkg | 2023-10-12 04:18 | 319K | |
| libg15-3.0.7.pkg | 2023-10-07 01:57 | 12K | |
| libg15render-3.0.4.pkg | 2023-10-08 07:06 | 18K | |
| libg19-1.1.1_1.pkg | 2023-10-07 15:06 | 8.3K | |
| libg19draw-1.0.0_2.pkg | 2023-10-10 18:56 | 11K | |
| libg722-1.0.2_1.pkg | 2023-10-08 13:06 | 7.3K | |
| libgal-0.5.0_1.pkg | 2023-10-10 12:37 | 4.7M | |
| libgamepad-0.1.2.pkg | 2023-10-07 23:16 | 11K | |
| libgav1-0.18.0_1.pkg | 2023-10-10 18:48 | 732K | |
| libgcrypt-1.10.2.pkg | 2023-10-05 17:16 | 887K | |
| libgd-2.3.3_7,1.pkg | 2023-10-05 17:48 | 204K | |
| libgda5-5.2.10_2.pkg | 2023-10-08 05:29 | 4.2M | |
| libgda5-jdbc-5.2.10_..> | 2023-10-08 17:56 | 78K | |
| libgda5-ldap-5.2.10_..> | 2023-10-14 18:20 | 43K | |
| libgda5-postgresql-5..> | 2023-10-09 16:44 | 150K | |
| libgda5-ui-5.2.10_2.pkg | 2023-10-14 15:12 | 4.4M | |
| libgdamm-4.99.11_2.pkg | 2023-10-09 17:35 | 172K | |
| libgdata-0.18.1.pkg | 2023-10-06 13:33 | 591K | |
| libgdiplus-6.1_1.pkg | 2023-10-07 01:06 | 242K | |
| libgdsii-0.21.pkg | 2023-10-07 19:49 | 60K | |
| libgee-0.20.6_1.pkg | 2023-10-06 17:39 | 256K | |
| libgee06-0.6.8_2.pkg | 2023-10-10 22:51 | 100K | |
| libgeotiff-1.7.1_5.pkg | 2023-10-06 10:43 | 106K | |
| libgepub-0.6.0_4.pkg | 2023-10-06 18:03 | 22K | |
| libgetar-1.1.3.pkg | 2023-10-08 12:26 | 655K | |
| libgff-2.0.0.pkg | 2023-10-08 03:14 | 124K | |
| libgfx-1.1.0_13.pkg | 2023-10-07 18:16 | 58K | |
| libghemical-3.0.0_19..> | 2023-10-07 13:25 | 690K | |
| libght-0.1.0_10.pkg | 2023-10-10 04:37 | 31K | |
| libgig-4.3.0_1.pkg | 2023-10-06 20:41 | 462K | |
| libgit2-1.6.4.pkg | 2023-10-06 09:09 | 692K | |
| libgit2-glib-1.2.0.pkg | 2023-10-07 01:48 | 184K | |
| libglade2-2.6.4_13.pkg | 2023-10-06 18:31 | 56K | |
| libglademm-2.6.7_15.pkg | 2023-10-08 00:35 | 39K | |
| libgltext-0.3.1_9.pkg | 2023-10-08 20:55 | 27K | |
| libgltf-0.1.0_1.pkg | 2023-10-09 01:41 | 157K | |
| libglvnd-1.6.0_2.pkg | 2023-10-05 17:24 | 339K | |
| libgme-0.6.3_1.pkg | 2023-10-06 23:34 | 135K | |
| libgnome-games-suppo..> | 2023-10-06 19:56 | 43K | |
| libgnome-keyring-3.1..> | 2023-10-06 21:46 | 121K | |
| libgnomecanvas-2.30...> | 2023-10-07 10:59 | 222K | |
| libgnomecanvasmm-2.2..> | 2023-10-14 09:31 | 107K | |
| libgnomekbd-3.26.1_1..> | 2023-10-06 15:19 | 143K | |
| libgnt-2.14.3_3.pkg | 2023-10-08 03:17 | 164K | |
| libgnuregex-6.0.pkg | 2023-10-08 05:50 | 52K | |
| libgpc-2.32.pkg | 2023-10-14 10:19 | 20K | |
| libgpg-error-1.47.pkg | 2023-10-05 17:09 | 318K | |
| libgphoto2-2.5.26_3.pkg | 2023-10-06 12:35 | 1.2M | |
| libgpkg-0.9.18_3.pkg | 2023-10-09 06:24 | 495K | |
| libgpod-0.8.3_11.pkg | 2023-10-07 12:15 | 386K | |
| libgpr-23.0.0_1.pkg | 2023-10-09 09:30 | 7.1M | |
| libgrading-0.1.8_1.pkg | 2023-10-09 03:50 | 34K | |
| libgraphqlparser-0.7..> | 2023-10-07 06:32 | 69K | |
| libgravatar-23.08.1.pkg | 2023-10-06 15:02 | 38K | |
| libgridxc-1.1.0_1.pkg | 2023-10-14 11:14 | 363K | |
| libgrss-0.7.0_2.pkg | 2023-10-07 22:56 | 99K | |
| libgsasl-2.2.0.pkg | 2023-10-08 10:08 | 268K | |
| libgsf-1.14.50.pkg | 2023-10-06 12:49 | 362K | |
| libgta-1.0.8.pkg | 2023-10-09 23:33 | 46K | |
| libgtextutils-0.7.pkg | 2023-10-07 15:30 | 28K | |
| libgtop-2.40.0_1.pkg | 2023-10-06 13:02 | 187K | |
| libgudev-237.pkg | 2023-10-05 17:49 | 38K | |
| libgusb-0.3.10_1.pkg | 2023-10-05 17:53 | 62K | |
| libgutenfetch-1.2_6.pkg | 2023-10-08 09:37 | 58K | |
| libgweather-40.0_4.pkg | 2023-10-06 13:49 | 2.5M | |
| libgweather4-4.2.0_1..> | 2023-10-06 13:30 | 3.7M | |
| libgxps-0.3.2_1.pkg | 2023-10-06 20:48 | 76K | |
| libhandy-1.6.2_1.pkg | 2023-10-06 18:02 | 396K | |
| libhandy0-0.0.13_2.pkg | 2023-10-08 08:24 | 161K | |
| libharu-2.4.3.pkg | 2023-10-07 07:32 | 614K | |
| libhdhomerun-2021121..> | 2023-10-07 00:55 | 51K | |
| libheif-1.16.1.pkg | 2023-10-06 11:50 | 288K | |
| libheinz-0.2.0.pkg | 2023-10-07 12:42 | 5.1K | |
| libhijack-0.8.1.pkg | 2023-10-08 12:28 | 16K | |
| libhoard-3.13.pkg | 2023-10-14 07:01 | 15K | |
| libhomfly-1.02.r6.pkg | 2023-10-07 11:40 | 25K | |
| libhsclient-1.0.6.20..> | 2023-10-08 17:52 | 138K | |
| libhsts-0.1.0.pkg | 2023-10-07 20:20 | 10K | |
| libhtp-0.5.45.pkg | 2023-10-09 07:08 | 114K | |
| libhubbub-0.3.7.pkg | 2023-10-07 05:42 | 71K | |
| libibuddy-0.0.2.pkg | 2023-10-09 04:23 | 9.8K | |
| libical-3.0.16.pkg | 2023-10-06 08:17 | 762K | |
| libiconv-1.17.pkg | 2023-10-05 16:42 | 610K | |
| libid3tag-0.16.2.pkg | 2023-10-06 12:53 | 32K | |
| libident-0.32_4.pkg | 2023-10-08 00:35 | 12K | |
| libidn-1.38.pkg | 2023-10-05 17:34 | 207K | |
| libidn2-2.3.4.pkg | 2023-10-05 17:15 | 133K | |
| libiio-0.25.pkg | 2023-10-07 01:47 | 82K | |
| libijs-0.35_5.pkg | 2023-10-08 00:04 | 22K | |
| libilbc-3.0.4_1.pkg | 2023-10-09 12:15 | 63K | |
| libimagequant-4.2.1.pkg | 2023-10-06 10:13 | 388K | |
| libimg-1.4.12_1.pkg | 2023-10-11 00:53 | 291K | |
| libimobiledevice-1.3..> | 2023-10-06 17:43 | 214K | |
| libindicator-12.10.1..> | 2023-10-08 08:28 | 44K | |
| libinjection-3.10.0_..> | 2023-10-07 12:48 | 132K | |
| libinotify-20211018.pkg | 2023-10-05 16:44 | 24K | |
| libinput-1.24.0.pkg | 2023-10-05 17:52 | 256K | |
| libinstpatch-1.1.6_1..> | 2023-10-07 10:05 | 282K | |
| libint-1.2.1.15.pkg | 2023-10-06 22:24 | 1.3M | |
| libint2-2.7.2_1.pkg | 2023-10-08 06:26 | 20M | |
| libint2-psi4-0.1.2.7..> | 2023-10-08 12:09 | 93M | |
| libiodbc-3.52.16.pkg | 2023-10-08 03:06 | 278K | |
| libiptcdata-1.0.4_2.pkg | 2023-10-08 04:33 | 54K | |
| libiqxmlrpc-0.13.5_1..> | 2023-10-09 20:39 | 164K | |
| libircclient-1.10.pkg | 2023-10-07 13:12 | 64K | |
| libirman-0.5.2.pkg | 2023-10-07 23:49 | 28K | |
| libiscsi-1.19.0.2302..> | 2023-10-10 17:43 | 125K | |
| libisofs-1.5.6.pkg | 2023-10-06 23:19 | 378K | |
| libixion-0.17.0_4.pkg | 2023-10-06 16:31 | 295K | |
| libixp-0.5_1.pkg | 2023-10-07 22:17 | 30K | |
| libjitterentropy-3.4..> | 2023-10-07 21:05 | 23K | |
| libjodycode-3.1.pkg | 2023-10-07 19:39 | 13K | |
| libjpeg-turbo-3.0.0_..> | 2023-10-06 23:14 | 372K | |
| libjwt-1.15.3.pkg | 2023-10-07 18:41 | 27K | |
| libjxl-0.8.2_3.pkg | 2023-10-06 06:58 | 6.8M | |
| libk8055-0.2.pkg | 2023-10-09 15:46 | 20K | |
| libkcddb-23.08.1.pkg | 2023-10-06 19:49 | 498K | |
| libkcompactdisc-23.0..> | 2023-10-06 20:30 | 56K | |
| libkdcraw-23.08.1.pkg | 2023-10-06 14:12 | 33K | |
| libkdegames-23.08.1.pkg | 2023-10-06 19:04 | 8.8M | |
| libkdepim-23.08.1.pkg | 2023-10-06 14:49 | 84K | |
| libkeduvocdocument-2..> | 2023-10-06 22:39 | 150K | |
| libkexiv2-23.08.1.pkg | 2023-10-06 13:48 | 122K | |
| libkeyfinder-2.2.6.pkg | 2023-10-07 14:19 | 42K | |
| libkgapi-23.08.1.pkg | 2023-10-06 14:12 | 499K | |
| libkipi-23.08.1.pkg | 2023-10-06 15:48 | 92K | |
| libkiwix-12.1.0.pkg | 2023-10-08 00:10 | 493K | |
| libklel-1.1.0_2.pkg | 2023-10-08 10:24 | 96K | |
| libkleo-23.08.1.pkg | 2023-10-06 09:59 | 634K | |
| libkmahjongg-23.08.1..> | 2023-10-06 21:57 | 2.1M | |
| libkmfl-0.9.9_2.pkg | 2023-10-07 17:44 | 22K | |
| libkml-1.3.0_25.pkg | 2023-10-06 10:12 | 891K | |
| libkolabxml-1.1.6_16..> | 2023-10-06 14:50 | 566K | |
| libkomparediff2-23.0..> | 2023-10-07 01:40 | 97K | |
| libkpass-6_2.pkg | 2023-10-07 10:21 | 13K | |
| libksane-23.08.1.pkg | 2023-10-06 19:16 | 141K | |
| libksba-1.6.3.pkg | 2023-10-05 17:10 | 171K | |
| libksieve-23.08.1.pkg | 2023-10-06 16:55 | 641K | |
| libktorrent-23.08.1.pkg | 2023-10-07 17:38 | 603K | |
| libkvkontakte-5.0.0_..> | 2023-10-09 22:11 | 64K | |
| liblangtag-0.6.4.pkg | 2023-10-06 17:00 | 281K | |
| liblas-1.8.1_23.pkg | 2023-10-07 05:46 | 599K | |
| liblastfm-qt5-1.0.9...> | 2023-10-09 21:59 | 164K | |
| liblcf-0.8.pkg | 2023-10-07 13:38 | 476K | |
| libliftoff-0.4.1.pkg | 2023-10-07 09:49 | 14K | |
| liblinear-2.47.pkg | 2023-10-09 23:58 | 49K | |
| liblingoteach-0.2.1_..> | 2023-10-07 14:31 | 26K | |
| liblinphone-5.2.94.pkg | 2023-10-07 11:13 | 11M | |
| liblnk-20221023.pkg | 2023-10-08 01:40 | 562K | |
| liblo-0.31_2.pkg | 2023-10-06 18:06 | 86K | |
| liblockfile-1.17.pkg | 2023-10-07 09:45 | 24K | |
| liblogging-1.0.6.pkg | 2023-10-08 02:40 | 91K | |
| liblognorm-2.0.6.pkg | 2023-10-12 06:33 | 108K | |
| liblouis-3.26.0.pkg | 2023-10-10 20:08 | 2.1M | |
| liblpm-g2020082801.pkg | 2023-10-08 15:10 | 13K | |
| liblqr-1-0.4.2.pkg | 2023-10-06 11:52 | 39K | |
| liblrdf-0.6.1.pkg | 2023-10-07 01:56 | 22K | |
| liblscp-0.9.11.pkg | 2023-10-08 02:20 | 29K | |
| libltc-1.3.2.pkg | 2023-10-08 02:25 | 34K | |
| libltdl-2.4.7.pkg | 2023-10-05 16:46 | 29K | |
| liblug-1.0.6_5.pkg | 2023-10-10 19:15 | 61K | |
| libluksde-e.20221103..> | 2023-10-07 08:01 | 590K | |
| liblxi-1.18.pkg | 2023-10-07 19:51 | 15K | |
| liblxqt-1.3.0.pkg | 2023-10-06 22:11 | 118K | |
| liblz4-1.9.4,1.pkg | 2023-10-05 17:18 | 138K | |
| liblzxcomp-20050705.pkg | 2023-10-07 20:02 | 15K | |
| libmaa-1.4.7,1.pkg | 2023-10-07 03:23 | 111K | |
| libmad-0.16.3.pkg | 2023-10-06 13:38 | 63K | |
| libmaia-0.9.0_4.pkg | 2023-10-08 06:41 | 42K | |
| libmaitretarot-0.1.9..> | 2023-10-06 21:06 | 19K | |
| libmanette-0.2.6.pkg | 2023-10-14 12:59 | 46K | |
| libmatekbd-1.26.0_1.pkg | 2023-10-06 16:22 | 151K | |
| libmatemixer-1.26.0_..> | 2023-10-06 16:25 | 153K | |
| libmateweather-1.26...> | 2023-10-06 16:14 | 2.7M | |
| libmatheval-1.1.11_5..> | 2023-10-07 12:57 | 47K | |
| libmatroska-1.7.1.pkg | 2023-10-06 22:12 | 115K | |
| libmatthew-0.8.1_1.pkg | 2023-10-08 05:35 | 45K | |
| libmaxminddb-1.7.1_1..> | 2023-10-06 19:17 | 33K | |
| libmba-0.9.1_1.pkg | 2023-10-07 21:27 | 105K | |
| libmbd-0.12.5_1.pkg | 2023-10-07 01:10 | 359K | |
| libmcfp-1.2.4.pkg | 2023-10-07 06:08 | 11K | |
| libmcrypt-2.5.8_3.pkg | 2023-10-06 14:25 | 111K | |
| libmdf-1.0.27.pkg | 2023-10-08 15:25 | 51K | |
| libmediaart-1.9.6.pkg | 2023-10-06 12:59 | 25K | |
| libmediainfo-23.07.pkg | 2023-10-06 20:06 | 5.0M | |
| libmediawiki-5.38.0_..> | 2023-10-06 15:52 | 67K | |
| libmemcache-1.4.0.r2..> | 2023-10-07 16:32 | 47K | |
| libmemcached-1.1.4_1..> | 2023-10-06 13:41 | 246K | |
| libmesh-1.7.0_4.pkg | 2023-10-10 06:20 | 5.2M | |
| libmesode-0.10.1.pkg | 2023-10-10 03:43 | 67K | |
| libmetalink-0.1.3.pkg | 2023-10-09 08:56 | 62K | |
| libmicro-0.4.1.pkg | 2023-10-11 03:44 | 182K | |
| libmicrodns-0.2.0.pkg | 2023-10-08 04:26 | 13K | |
| libmicrohttpd-0.9.77..> | 2023-10-06 16:44 | 225K | |
| libmikmod-3.3.11.1_1..> | 2023-10-06 16:52 | 213K | |
| libmill-1.18.pkg | 2023-10-08 16:42 | 96K | |
| libmilter-8.17.2.pkg | 2023-10-08 03:38 | 132K | |
| libmimedir-0.5.1_2.pkg | 2023-10-08 12:13 | 20K | |
| libmissing-20130815_..> | 2023-10-09 04:14 | 11K | |
| libmng-1.0.10_4.pkg | 2023-10-06 09:25 | 215K | |
| libmodbus-3.1.7_1.pkg | 2023-10-07 22:46 | 101K | |
| libmodi-e.20221023.pkg | 2023-10-07 02:15 | 834K | |
| libmodplug-0.8.9.1.r..> | 2023-10-06 17:32 | 164K | |
| libmodulemd-2.13.0.pkg | 2023-10-07 04:06 | 203K | |
| libmongo-client-0.1...> | 2023-10-14 16:18 | 60K | |
| libmongocrypt-1.8.1.pkg | 2023-10-14 04:41 | 334K | |
| libmorph-0.1.2_2.pkg | 2023-10-08 22:33 | 13K | |
| libmowgli-1.0.0.pkg | 2023-10-11 08:01 | 38K | |
| libmowgli2-2.1.3.pkg | 2023-10-08 06:10 | 87K | |
| libmp3-archive-perl-..> | 2023-10-08 08:33 | 21K | |
| libmp3splt-0.9.2_3.pkg | 2023-10-08 03:05 | 205K | |
| libmpcbdm-0.0.3_1.pkg | 2023-10-14 05:45 | 41K | |
| libmpd-11.8.17_2.pkg | 2023-10-07 13:24 | 75K | |
| libmpdclient-2.20_1.pkg | 2023-10-07 07:03 | 101K | |
| libmpeg2-0.5.1_6.pkg | 2023-10-07 09:22 | 113K | |
| libmrss-0.19.2_8.pkg | 2023-10-07 13:38 | 35K | |
| libmsiecf-a.20221024..> | 2023-10-07 13:16 | 614K | |
| libmsocket-0.4_6.pkg | 2023-10-14 09:37 | 31K | |
| libmspack-0.11alpha.pkg | 2023-10-05 16:46 | 67K | |
| libmspub01-0.1.4_23.pkg | 2023-10-06 23:01 | 129K | |
| libmswstr-0.0.1.pkg | 2023-10-09 07:31 | 44K | |
| libmsym-0.2.3.pkg | 2023-10-07 03:10 | 90K | |
| libmt_client-0.1.98_..> | 2023-10-07 03:07 | 13K | |
| libmtdev-1.1.6_1.pkg | 2023-10-05 16:43 | 19K | |
| libmtp-1.1.18.pkg | 2023-10-06 13:45 | 255K | |
| libmtrie-1.0.3.pkg | 2023-10-11 09:20 | 4.6K | |
| libmusicbrainz5-5.1...> | 2023-10-06 16:48 | 137K | |
| libmusicxml-3.22.pkg | 2023-10-09 00:57 | 1.5M | |
| libmustache-0.5.0_3.pkg | 2023-10-08 03:00 | 59K | |
| libmwaw03-0.3.22.pkg | 2023-10-06 20:44 | 2.0M | |
| libmypaint-1.6.1_2.pkg | 2023-10-06 20:41 | 197K | |
| libmysofa-1.3.1.pkg | 2023-10-06 07:39 | 1.1M | |
| libnaji-0.6.4_1.pkg | 2023-10-08 11:30 | 64K | |
| libnatpmp-20220122_2..> | 2023-10-07 14:16 | 12K | |
| libndi-g20200630_2.pkg | 2023-10-09 16:15 | 11K | |
| libndp-1.8.pkg | 2023-10-09 08:49 | 23K | |
| libnegf-1.1.3.pkg | 2023-10-07 03:40 | 564K | |
| libnest2d-ultimaker-..> | 2023-10-07 09:03 | 58K | |
| libnet-1.2,1.pkg | 2023-10-06 17:01 | 117K | |
| libneurosim-1.2.0.pkg | 2023-10-08 16:02 | 66K | |
| libnfc-1.8.0.pkg | 2023-10-08 10:31 | 149K | |
| libnfs-5.0.2.pkg | 2023-10-06 15:13 | 214K | |
| libnghttp2-1.55.1_1.pkg | 2023-10-05 16:41 | 129K | |
| libnghttp3-0.13.0.pkg | 2023-10-09 16:16 | 103K | |
| libngtcp2-0.17.0.pkg | 2023-10-14 02:51 | 212K | |
| libnice-0.1.21_1.pkg | 2023-10-06 07:38 | 191K | |
| libnice-gst1-0.1.21_..> | 2023-10-06 10:44 | 7.9K | |
| libnids-1.24_5.pkg | 2023-10-07 10:49 | 43K | |
| libnitrokey-3.7.pkg | 2023-10-07 15:01 | 279K | |
| libnjs-0.8.1.pkg | 2023-10-10 20:53 | 1.1M | |
| libnoise-1.0.0_4.pkg | 2023-10-10 03:09 | 68K | |
| libnormaliz-3.9.0_3.pkg | 2023-10-07 22:50 | 3.2M | |
| libnotify-0.8.2.pkg | 2023-10-06 07:18 | 31K | |
| libnova-0.15.0_1.pkg | 2023-10-07 07:05 | 845K | |
| libnpupnp-5.0.1.pkg | 2023-10-07 20:35 | 175K | |
| libnsbmp-0.1.6.pkg | 2023-10-07 14:11 | 9.2K | |
| libnsgif-0.2.1.pkg | 2023-10-06 16:13 | 8.1K | |
| libnspsl-0.1.6.pkg | 2023-10-07 20:41 | 44K | |
| libnss-cache-0.21.pkg | 2023-10-09 23:24 | 5.2K | |
| libnss-mysql-1.5_5.pkg | 2023-10-11 20:31 | 8.4K | |
| libnss-pgsql-1.5.0_2..> | 2023-10-12 04:20 | 22K | |
| libnsutils-0.1.0.pkg | 2023-10-08 11:56 | 6.1K | |
| libntlm-1.6.pkg | 2023-10-07 08:20 | 17K | |
| libnumbertext-1.0.11..> | 2023-10-06 19:13 | 202K | |
| libnuml-1.1.6.pkg | 2023-10-07 04:00 | 1.1M | |
| libnvpair-2.0.pkg | 2023-10-14 12:09 | 41K | |
| libnxml-0.18.3_4.pkg | 2023-10-07 03:43 | 31K | |
| liboauth-1.0.3_4.pkg | 2023-10-06 11:13 | 32K | |
| libobjc2-2.1_3.pkg | 2023-10-06 10:13 | 75K | |
| libocas-0.96.pkg | 2023-10-09 06:36 | 41K | |
| libodbc++-0.2.5_5.pkg | 2023-10-11 06:02 | 126K | |
| libodfgen01-0.1.8_2.pkg | 2023-10-06 21:14 | 218K | |
| libofx-0.10.9.pkg | 2023-10-07 12:51 | 586K | |
| libogg-1.3.5,4.pkg | 2023-10-05 16:42 | 192K | |
| liboggz-1.1.1_4.pkg | 2023-10-08 06:42 | 167K | |
| liboglappth-1.0.0_5.pkg | 2023-10-08 05:55 | 48K | |
| liboil-0.3.17_3.pkg | 2023-10-07 18:41 | 294K | |
| libolecf-a.20221024.pkg | 2023-10-08 10:02 | 674K | |
| libomemo-0.8.1.pkg | 2023-10-08 09:44 | 18K | |
| libomemo-c-0.5.0.pkg | 2023-10-07 01:22 | 136K | |
| libopenbsd-r298107.pkg | 2023-10-07 15:27 | 22K | |
| libopencad-0.2.0_5.pkg | 2023-10-08 20:15 | 169K | |
| libopencm3-0.8.0_1.pkg | 2023-10-11 16:10 | 3.7M | |
| libopenmpt-0.7.3.pkg | 2023-10-07 08:37 | 1.3M | |
| libopennet-0.9.9_1.pkg | 2023-10-08 23:57 | 9.7K | |
| libopenraw-0.3.7_1.pkg | 2023-10-14 06:53 | 1.2M | |
| libopenshot-audio-0...> | 2023-10-07 07:39 | 3.8M | |
| libopentracing-1.6.0..> | 2023-10-07 19:53 | 117K | |
| liboping-1.8.0_2.pkg | 2023-10-07 13:31 | 67K | |
| libopkele-2.0.4_20.pkg | 2023-10-07 15:26 | 163K | |
| libopusenc-0.2.1_1.pkg | 2023-10-08 07:42 | 39K | |
| liboqs-0.8.0.14.pkg | 2023-10-10 06:21 | 353K | |
| liborcus-0.17.2_4.pkg | 2023-10-06 21:42 | 1.1M | |
| liborigin-3.0.1,1.pkg | 2023-10-07 17:07 | 105K | |
| libosinfo-1.10.0_2.pkg | 2023-10-07 11:21 | 251K | |
| libosip2-5.3.1.pkg | 2023-10-08 08:54 | 156K | |
| libosmesa-22.3.7.pkg | 2023-10-06 12:06 | 2.7M | |
| libosmium-2.19.0_1.pkg | 2023-10-07 21:59 | 195K | |
| libosmpbf-1.5.0_5.pkg | 2023-10-10 01:01 | 90K | |
| libotf-0.9.16_1.pkg | 2023-10-07 07:13 | 86K | |
| libotr-4.1.1.pkg | 2023-10-06 15:51 | 93K | |
| libotr3-3.2.1_4.pkg | 2023-10-08 08:05 | 85K | |
| libowfat-0.33.pkg | 2023-10-08 10:08 | 302K | |
| libp11-0.4.12.pkg | 2023-10-07 16:18 | 69K | |
| libpafe-0.0.8_1.pkg | 2023-10-07 06:44 | 17K | |
| libpagemaker-0.0.4_1..> | 2023-10-06 22:34 | 52K | |
| libpaho-mqtt3-1.3.12..> | 2023-10-06 18:15 | 225K | |
| libpano13-2.9.22.pkg | 2023-10-07 17:29 | 380K | |
| libpaper-1.1.28.pkg | 2023-10-05 17:28 | 18K | |
| libpar2-0.4_6.pkg | 2023-10-08 12:01 | 170K | |
| libparserutils-0.2.4..> | 2023-10-06 23:00 | 29K | |
| libparsifal-1.1.0_2.pkg | 2023-10-14 04:07 | 264K | |
| libpasori-02_2.pkg | 2023-10-07 14:21 | 11K | |
| libpbl-1.04.04.pkg | 2023-10-07 22:52 | 114K | |
| libpcap-1.10.4.pkg | 2023-10-06 18:50 | 288K | |
| libpcapnav-0.8_1.pkg | 2023-10-07 11:47 | 39K | |
| libpcd-1.0.1.pkg | 2023-10-08 15:37 | 17K | |
| libpci-3.10.0.pkg | 2023-10-05 16:47 | 60K | |
| libpciaccess-0.17.pkg | 2023-10-05 17:20 | 15K | |
| libpcl-1.12.pkg | 2023-10-09 02:17 | 8.9K | |
| libpdel-0.6.1_1.pkg | 2023-10-07 13:03 | 1.0M | |
| libpeak-0.1.2_2.pkg | 2023-10-12 11:19 | 60K | |
| libpeas-1.34.0_1.pkg | 2023-10-06 12:31 | 1.2M | |
| libpfctl-0.3.pkg | 2023-10-06 14:21 | 12K | |
| libpff-e.20180714_1.pkg | 2023-10-14 08:42 | 794K | |
| libpg_query-13.2.1.0..> | 2023-10-14 06:19 | 1.5M | |
| libpgf-7.21.7.pkg | 2023-10-08 07:46 | 59K | |
| libphdi-e.20221025.pkg | 2023-10-07 02:13 | 721K | |
| libphk-0.3.20080902_..> | 2023-10-08 11:41 | 21K | |
| libphonenumber-8.13...> | 2023-10-06 17:42 | 2.2M | |
| libpillowfight-0.3.0..> | 2023-10-09 06:54 | 18K | |
| libpki-0.9.2_4.pkg | 2023-10-07 15:32 | 395K | |
| libplacebo-6.292.1.pkg | 2023-10-06 06:59 | 435K | |
| libplist-2.2.0_2.pkg | 2023-10-06 12:52 | 80K | |
| libpo6-0.8.0.pkg | 2023-10-07 07:56 | 16K | |
| libpololu-avr-151002..> | 2023-10-09 02:12 | 170K | |
| libpoly-0.1.13.pkg | 2023-10-08 07:36 | 176K | |
| libportal-0.7.1.pkg | 2023-10-06 15:02 | 66K | |
| libportal-gtk3-0.7.1..> | 2023-10-06 16:57 | 8.3K | |
| libportal-gtk4-0.7.1..> | 2023-10-08 00:27 | 8.3K | |
| libportal-qt5-0.7.1.pkg | 2023-10-09 09:16 | 15K | |
| libpostal-1.1_2.pkg | 2023-10-10 23:26 | 716K | |
| libpotrace-1.16.pkg | 2023-10-05 16:45 | 19K | |
| libpqtypes-1.5.1_2.pkg | 2023-10-09 19:37 | 81K | |
| libpredict-2.0.0.pkg | 2023-10-11 15:18 | 31K | |
| libprelude-5.2.0.pkg | 2023-10-07 13:50 | 508K | |
| libpreludedb-5.2.0.pkg | 2023-10-14 05:44 | 214K | |
| libpri-1.6.1.pkg | 2023-10-07 04:05 | 261K | |
| libprojectM-3.1.12_9..> | 2023-10-07 09:46 | 2.7M | |
| libproplist-0.10.1_3..> | 2023-10-14 15:24 | 37K | |
| libproxy-0.4.17_1.pkg | 2023-10-06 07:19 | 45K | |
| libproxy-gnome3-0.4...> | 2023-10-10 18:44 | 14K | |
| libproxy-kde-0.4.17.pkg | 2023-10-08 20:37 | 13K | |
| libproxy-pacrunner-0..> | 2023-10-07 17:41 | 5.9K | |
| libproxy-perl-0.4.17..> | 2023-10-14 06:46 | 4.3K | |
| libproxy-webkit3-0.4..> | 2023-10-14 10:41 | 6.6K | |
| libpru-0.4.pkg | 2023-10-08 11:55 | 9.0K | |
| libpsl-0.21.2_3.pkg | 2023-10-05 17:18 | 59K | |
| libpst-0.6.76_3.pkg | 2023-10-10 16:59 | 739K | |
| libptytty-2.0.pkg | 2023-10-07 00:05 | 18K | |
| libpurple-2.14.12.pkg | 2023-10-07 08:29 | 4.8M | |
| libpuzzle-0.11_11.pkg | 2023-10-07 23:12 | 24K | |
| libpwquality-1.4.5.pkg | 2023-10-06 18:24 | 78K | |
| libqaccessibilitycli..> | 2023-10-07 20:59 | 65K | |
| libqalculate-4.8.1.pkg | 2023-10-06 13:38 | 3.3M | |
| libqb-2.0.6.pkg | 2023-10-06 23:32 | 130K | |
| libqcow-a.20221124.pkg | 2023-10-07 08:01 | 578K | |
| libqrencode-4.1.1.pkg | 2023-10-06 08:04 | 42K | |
| libqsbr-g2020082801.pkg | 2023-10-11 17:20 | 15K | |
| libqtelegram-ae-6.1_..> | 2023-10-07 01:21 | 425K | |
| libqtxdg-3.11.0.pkg | 2023-10-06 18:22 | 111K | |
| libquantum-1.1.1_1.pkg | 2023-10-14 18:14 | 48K | |
| libquotient-qt5-0.8...> | 2023-10-08 04:01 | 772K | |
| libquotient-qt6-0.8...> | 2023-10-08 15:21 | 881K | |
| libqxp-0.0.0_23.pkg | 2023-10-06 19:40 | 89K | |
| libr3-1.0.0_2.pkg | 2023-10-08 05:53 | 13K | |
| libranlip-1.0_2.pkg | 2023-10-09 13:18 | 100K | |
| libraqm-0.10.1.pkg | 2023-10-06 10:27 | 31K | |
| librasterlite2-1.1.0..> | 2023-10-08 00:13 | 840K | |
| librav1e-0.6.6_3.pkg | 2023-10-14 11:53 | 4.6M | |
| libraw-0.21.1_2.pkg | 2023-10-06 11:24 | 562K | |
| librcc-0.2.13_1.pkg | 2023-10-08 04:03 | 96K | |
| librcd-0.1.14_2.pkg | 2023-10-07 01:56 | 24K | |
| librdata-0.1.0.g2021..> | 2023-10-07 22:13 | 17K | |
| librdkafka-2.2.0.pkg | 2023-10-07 22:26 | 5.3M | |
| libreadline-java-0.8..> | 2023-10-08 23:47 | 25K | |
| librecad-2.2.0.2.pkg | 2023-10-08 17:37 | 5.7M | |
| libredwg-0.12.4.pkg | 2023-10-10 04:11 | 6.1M | |
| libregf-a.20221026.pkg | 2023-10-07 01:23 | 658K | |
| librelp-1.11.0.pkg | 2023-10-14 17:03 | 56K | |
| libremidi-4.0.pkg | 2023-10-08 19:11 | 115K | |
| librenms-23.8.2,1.pkg | 2023-10-08 16:40 | 57M | |
| libreoffice-7.5.5.2_..> | 2023-10-07 13:45 | 134M | |
| libreoffice-i18n-7.5..> | 2023-10-10 08:08 | 1.5K | |
| librep-0.92.7_5.pkg | 2023-10-06 20:01 | 718K | |
| librepcb-0.1.6_1.pkg | 2023-10-14 08:27 | 2.7M | |
| librepo-1.15.2.pkg | 2023-10-07 03:17 | 80K | |
| libresonic-standalon..> | 2023-10-14 07:39 | 52M | |
| librespeed-cli-1.0.1..> | 2023-10-10 13:50 | 2.3M | |
| librespeed-go-1.1.5_..> | 2023-10-14 14:00 | 3.8M | |
| librespeed-php80-5.2..> | 2023-10-09 00:15 | 151K | |
| librespeed-php81-5.2..> | 2023-10-14 04:20 | 151K | |
| librespeed-php82-5.2..> | 2023-10-08 20:25 | 151K | |
| librespeed-php83-5.2..> | 2023-10-10 16:40 | 151K | |
| librespot-0.4.2_12.pkg | 2023-10-10 15:19 | 1.1M | |
| libressl-3.7.3_1.pkg | 2023-10-07 03:36 | 3.4M | |
| libressl-devel-3.8.1..> | 2023-10-10 13:42 | 3.3M | |
| libressl-devel-libtl..> | 2023-10-09 08:06 | 1.2M | |
| libressl-libtls-3.7...> | 2023-10-10 02:21 | 1.3M | |
| librest1-0.9.1_1.pkg | 2023-10-06 22:41 | 1.1M | |
| libreswan-4.12.pkg | 2023-10-09 23:53 | 1.1M | |
| libretls-3.7.0.pkg | 2023-10-08 06:47 | 64K | |
| libretro-0.3.pkg | 2023-10-08 20:20 | 1.6K | |
| libretro-2048-0.2022..> | 2023-10-08 07:24 | 27K | |
| libretro-a5200-0.202..> | 2023-10-08 11:56 | 89K | |
| libretro-beetle_bsne..> | 2023-10-07 17:40 | 195K | |
| libretro-beetle_gba-..> | 2023-10-08 03:10 | 125K | |
| libretro-beetle_lynx..> | 2023-10-08 01:55 | 55K | |
| libretro-beetle_ngp-..> | 2023-10-07 16:16 | 75K | |
| libretro-beetle_pce-..> | 2023-10-09 19:47 | 315K | |
| libretro-beetle_pce_..> | 2023-10-07 21:26 | 264K | |
| libretro-beetle_pcfx..> | 2023-10-08 06:04 | 276K | |
| libretro-beetle_psx-..> | 2023-10-07 17:52 | 690K | |
| libretro-beetle_satu..> | 2023-10-10 21:26 | 1.2M | |
| libretro-beetle_supe..> | 2023-10-08 11:35 | 275K | |
| libretro-beetle_vb-0..> | 2023-10-08 05:39 | 48K | |
| libretro-beetle_wswa..> | 2023-10-08 10:52 | 64K | |
| libretro-bluemsx-0.2..> | 2023-10-07 17:46 | 562K | |
| libretro-bsnes-20211..> | 2023-10-09 13:57 | 619K | |
| libretro-cap32-0.202..> | 2023-10-07 20:51 | 202K | |
| libretro-core-info-1..> | 2023-10-08 21:13 | 70K | |
| libretro-desmume2015..> | 2023-10-08 10:13 | 613K | |
| libretro-dosbox-0.20..> | 2023-10-07 16:26 | 606K | |
| libretro-emux-0.2021..> | 2023-10-08 04:37 | 85K | |
| libretro-fbalpha-0.2..> | 2023-10-08 06:06 | 5.2M | |
| libretro-fbneo-0.202..> | 2023-10-07 19:12 | 6.7M | |
| libretro-fceumm-0.20..> | 2023-10-08 07:39 | 264K | |
| libretro-flycast-0.2..> | 2023-10-09 13:00 | 768K | |
| libretro-fmsx-0.2022..> | 2023-10-07 11:21 | 100K | |
| libretro-freeintv-0...> | 2023-10-09 13:20 | 34K | |
| libretro-fuse-0.2022..> | 2023-10-07 15:21 | 643K | |
| libretro-gambatte-0...> | 2023-10-07 11:26 | 185K | |
| libretro-genesis_plu..> | 2023-10-08 11:38 | 572K | |
| libretro-gpsp-0.2022..> | 2023-10-08 02:22 | 215K | |
| libretro-gw-0.202202..> | 2023-10-08 11:12 | 148K | |
| libretro-handy-0.202..> | 2023-10-08 04:16 | 66K | |
| libretro-hatari-0.20..> | 2023-10-07 17:30 | 566K | |
| libretro-kronos-2.1...> | 2023-10-09 04:15 | 707K | |
| libretro-mame-202201..> | 2023-10-14 19:30 | 61M | |
| libretro-mame2000-0...> | 2023-10-07 19:04 | 2.3M | |
| libretro-mame2003-0...> | 2023-10-08 02:33 | 5.8M | |
| libretro-mame2003_pl..> | 2023-10-07 22:02 | 6.1M | |
| libretro-melonds-0.2..> | 2023-10-10 12:37 | 534K | |
| libretro-mgba-0.2022..> | 2023-10-07 19:51 | 300K | |
| libretro-mu-0.202203..> | 2023-10-07 16:53 | 104K | |
| libretro-nestopia-0...> | 2023-10-08 05:27 | 453K | |
| libretro-nxengine-0...> | 2023-10-07 12:30 | 233K | |
| libretro-o2em-0.2022..> | 2023-10-07 19:53 | 111K | |
| libretro-opera-0.202..> | 2023-10-08 02:01 | 206K | |
| libretro-paralleln64..> | 2023-10-08 08:03 | 614K | |
| libretro-pcsx2-0.202..> | 2023-10-08 19:01 | 1.7M | |
| libretro-pcsx_rearme..> | 2023-10-07 15:13 | 452K | |
| libretro-picodrive-0..> | 2023-10-08 08:51 | 296K | |
| libretro-play-0.48_3..> | 2023-10-08 02:02 | 811K | |
| libretro-ppsspp-1.16..> | 2023-10-08 14:39 | 12M | |
| libretro-prboom-0.20..> | 2023-10-08 05:18 | 349K | |
| libretro-prosystem-0..> | 2023-10-07 13:23 | 37K | |
| libretro-px68k-0.202..> | 2023-10-11 09:42 | 144K | |
| libretro-quicknes-0...> | 2023-10-08 01:06 | 104K | |
| libretro-reicast-0.2..> | 2023-10-08 12:43 | 1.5M | |
| libretro-shaders-gls..> | 2023-10-14 05:42 | 24M | |
| libretro-shaders-sla..> | 2023-10-08 21:13 | 34M | |
| libretro-snes9x-1.53..> | 2023-10-08 11:43 | 597K | |
| libretro-snes9x2005-..> | 2023-10-07 18:11 | 181K | |
| libretro-snes9x2010-..> | 2023-10-08 03:25 | 493K | |
| libretro-stella2014-..> | 2023-10-07 17:18 | 314K | |
| libretro-tgbdual-0.2..> | 2023-10-07 21:42 | 31K | |
| libretro-tyrquake-0...> | 2023-10-08 07:44 | 355K | |
| libretro-uae-0.20220..> | 2023-10-08 00:49 | 4.5M | |
| libretro-vbanext-0.2..> | 2023-10-08 10:41 | 165K | |
| libretro-vecx-0.2022..> | 2023-10-08 04:40 | 41K | |
| libretro-vice-x64-0...> | 2023-10-08 13:16 | 920K | |
| libretro-vice-x64sc-..> | 2023-10-14 06:51 | 935K | |
| libretro-vice-x128-0..> | 2023-10-09 07:09 | 1.0M | |
| libretro-vice-xcbm2-..> | 2023-10-10 15:59 | 742K | |
| libretro-vice-xcbm5x..> | 2023-10-14 03:28 | 772K | |
| libretro-vice-xpet-0..> | 2023-10-10 04:45 | 786K | |
| libretro-vice-xplus4..> | 2023-10-10 13:59 | 800K | |
| libretro-vice-xscpu6..> | 2023-10-14 10:16 | 960K | |
| libretro-vice-xvic-0..> | 2023-10-14 15:54 | 773K | |
| libretro-virtualjagu..> | 2023-10-08 09:47 | 325K | |
| libretro-xrick-0.202..> | 2023-10-14 15:56 | 104K | |
| libretro-yabause-0.2..> | 2023-10-07 11:09 | 374K | |
| librevenge-0.0.5.pkg | 2023-10-06 15:25 | 187K | |
| librevisa-0.0.201304..> | 2023-10-07 03:48 | 53K | |
| librevisa-vish-0.0.2..> | 2023-10-08 21:52 | 6.7K | |
| librevisa-vxi-0.0.20..> | 2023-10-14 07:05 | 6.5K | |
| librewolf-109.0.1.2_..> | 2023-10-14 14:41 | 57M | |
| librfm-5.3.16.4_5.pkg | 2023-10-07 20:00 | 2.1M | |
| librist-0.2.7.pkg | 2023-10-07 08:34 | 98K | |
| librnd-4.0.1.pkg | 2023-10-08 02:47 | 1.0M | |
| librolegen-1.0b.pkg | 2023-10-10 18:08 | 13K | |
| librs232-20190531.pkg | 2023-10-09 08:34 | 11K | |
| librsb-1.3.0.2_1.pkg | 2023-10-07 00:23 | 1.9M | |
| librsvg2-2.40.21_3.pkg | 2023-10-11 01:04 | 173K | |
| librsvg2-rust-2.56.4..> | 2023-10-05 21:36 | 3.1M | |
| librsync-2.3.4.pkg | 2023-10-07 06:28 | 32K | |
| librtfcomp-1.3_3.pkg | 2023-10-08 18:43 | 14K | |
| librtmp-2.4.20190330..> | 2023-10-05 17:12 | 77K | |
| librtprocess-0.12.0.pkg | 2023-10-07 12:59 | 112K | |
| librttopo-1.1.0.pkg | 2023-10-06 09:38 | 302K | |
| libruin-0.2.0_4.pkg | 2023-10-08 15:49 | 124K | |
| libs11n-1.2.10_1.pkg | 2023-10-14 18:46 | 409K | |
| libsamplerate-0.2.2_..> | 2023-10-06 12:58 | 955K | |
| libsass-3.6.5.pkg | 2023-10-06 10:02 | 636K | |
| libsbml-5.20.0.pkg | 2023-10-06 20:53 | 3.6M | |
| libscca-a.20221027.pkg | 2023-10-07 12:22 | 641K | |
| libscep-0.09.pkg | 2023-10-08 04:11 | 27K | |
| libscrypt-1.22.pkg | 2023-10-08 05:53 | 14K | |
| libsdb-0.10.1.pkg | 2023-10-10 18:23 | 30K | |
| libsdr-0.1.0_2.pkg | 2023-10-07 06:08 | 87K | |
| libsdr-gui-0.1.0_4.pkg | 2023-10-07 11:17 | 30K | |
| libsearpc-3.2.0_2,1.pkg | 2023-10-07 07:58 | 33K | |
| libsecret-0.20.5_2.pkg | 2023-10-05 17:55 | 1.2M | |
| libsectok-20030619_2..> | 2023-10-07 23:13 | 23K | |
| libsedml-2.0.32.pkg | 2023-10-08 10:56 | 1.7M | |
| libsemigroups-1.3.7_..> | 2023-10-07 16:03 | 702K | |
| libserdes-6.0.2.pkg | 2023-10-10 20:19 | 48K | |
| libserialport-0.1.1_..> | 2023-10-07 03:22 | 38K | |
| libshairport-1.2.0.2..> | 2023-10-14 08:57 | 28K | |
| libsharp2-g20191210.pkg | 2023-10-14 13:32 | 81K | |
| libshbuf-0.0.3.pkg | 2023-10-08 16:30 | 19K | |
| libshhcards-1.0.6.pkg | 2023-10-08 00:31 | 37K | |
| libshhmsg-1.4.2.pkg | 2023-10-08 09:00 | 11K | |
| libshhopt-1.1.7_1.pkg | 2023-10-07 23:28 | 9.7K | |
| libshout-2.4.6.pkg | 2023-10-07 07:20 | 84K | |
| libshumate-1.1.0.pkg | 2023-10-06 21:12 | 1.2M | |
| libsidplay-1.36.60_1..> | 2023-10-07 02:46 | 119K | |
| libsidplay2-2.1.1_9.pkg | 2023-10-07 19:18 | 194K | |
| libsidplayfp-2.4.2_1..> | 2023-10-07 07:29 | 136K | |
| libsieve-2.3.1_2.pkg | 2023-10-07 20:14 | 72K | |
| libsigc++-2.12.0.pkg | 2023-10-06 10:06 | 64K | |
| libsigc++30-3.4.0.pkg | 2023-10-07 07:38 | 42K | |
| libsignal-client-0.9..> | 2023-10-07 02:44 | 566K | |
| libsignal-node-0.30...> | 2023-10-07 14:28 | 2.2M | |
| libsignal-protocol-c..> | 2023-10-07 01:31 | 140K | |
| libsignon-glib-2.1.pkg | 2023-10-06 14:28 | 71K | |
| libsigrok-0.5.2_4.pkg | 2023-10-07 13:00 | 703K | |
| libsigrokdecode-0.5...> | 2023-10-07 15:43 | 264K | |
| libsigscan-e.2022121..> | 2023-10-07 01:45 | 515K | |
| libsigsegv-2.14.pkg | 2023-10-05 17:12 | 12K | |
| libsimdpp-2.1.400.pkg | 2023-10-09 21:35 | 180K | |
| libsixel-1.8.6,1.pkg | 2023-10-08 05:53 | 228K | |
| libslang2-2.3.3.pkg | 2023-10-06 14:27 | 1.4M | |
| libslirp-4.7.0.pkg | 2023-10-07 08:00 | 56K | |
| libsmdev-a.20221028.pkg | 2023-10-06 19:54 | 439K | |
| libsmf-1.3_4.pkg | 2023-10-08 01:46 | 45K | |
| libsmi-0.4.8_1.pkg | 2023-10-07 01:52 | 1.9M | |
| libsml-0.1.1_1.pkg | 2023-10-10 23:15 | 118K | |
| libsmpp34-1.10_2.pkg | 2023-10-10 10:51 | 123K | |
| libsmraw-a.20221028.pkg | 2023-10-06 21:58 | 637K | |
| libsndfile-1.2.2.pkg | 2023-10-05 17:40 | 296K | |
| libsodium-1.0.18.pkg | 2023-10-06 14:51 | 217K | |
| libsoldout-1.4.pkg | 2023-10-07 10:05 | 52K | |
| libsolv-0.7.22.pkg | 2023-10-06 23:55 | 428K | |
| libsonic-0.2.0.65.pkg | 2023-10-09 12:26 | 25K | |
| libsoup-2.74.3.pkg | 2023-10-06 09:06 | 577K | |
| libsoup3-3.2.2.pkg | 2023-10-06 10:25 | 344K | |
| libsoxr-0.1.3_3.pkg | 2023-10-05 17:38 | 73K | |
| libspamtest-20080808..> | 2023-10-12 07:21 | 35K | |
| libspecbleach-0.1.6.pkg | 2023-10-07 20:51 | 20K | |
| libspectre-0.2.12.pkg | 2023-10-06 21:06 | 45K | |
| libspectrum-1.5.0.pkg | 2023-10-08 05:24 | 164K | |
| libspf-1.0.0.p5_1.pkg | 2023-10-09 18:17 | 562K | |
| libspf2-1.2.11.pkg | 2023-10-07 04:25 | 118K | |
| libsphinxclient-2.0...> | 2023-10-10 02:13 | 26K | |
| libspice-server-0.15..> | 2023-10-07 10:48 | 336K | |
| libspiro-20221101,1.pkg | 2023-10-06 17:54 | 20K | |
| libspng-0.7.4.pkg | 2023-10-06 12:46 | 46K | |
| libsrs2-1.0.18_4.pkg | 2023-10-07 11:14 | 21K | |
| libsrs_alt-1.0_2.pkg | 2023-10-10 04:31 | 20K | |
| libsrtp2-2.5.0.pkg | 2023-10-06 20:51 | 59K | |
| libssh-0.10.5.pkg | 2023-10-06 17:12 | 281K | |
| libssh2-1.11.0,3.pkg | 2023-10-05 16:40 | 268K | |
| libssm-1.4.0_3.pkg | 2023-10-14 09:14 | 101K | |
| libstaroffice-0.0.7_..> | 2023-10-06 18:56 | 607K | |
| libstatgrab-0.92.1.pkg | 2023-10-08 11:28 | 118K | |
| libstatgrab0-0.17.pkg | 2023-10-08 22:08 | 21K | |
| libstdc++_stldoc_4.2..> | 2023-10-08 22:09 | 12M | |
| libstocks-0.5.0.pkg | 2023-10-14 06:31 | 16K | |
| libstree-0.4.2_2.pkg | 2023-10-08 10:11 | 21K | |
| libstrfunc-8.3_2.pkg | 2023-10-07 19:48 | 81K | |
| libstroke-0.5.1_6.pkg | 2023-10-07 05:13 | 7.0K | |
| libstrophe-0.12.3.pkg | 2023-10-07 15:16 | 94K | |
| libsunacl-1.0.1.pkg | 2023-10-05 17:02 | 6.4K | |
| libsupertone-0.0.2_9..> | 2023-10-10 12:12 | 19K | |
| libsvg-0.1.4_11.pkg | 2023-10-06 21:54 | 49K | |
| libsvg-cairo-0.1.6_1..> | 2023-10-07 06:11 | 17K | |
| libsvgtiny-0.1.7.pkg | 2023-10-08 14:51 | 20K | |
| libsvm-3.24.pkg | 2023-10-07 07:55 | 85K | |
| libsvm-python-3.24_1..> | 2023-10-09 09:39 | 11K | |
| libsweep-lidar-1.3.0..> | 2023-10-10 06:24 | 17K | |
| libswift-20190302_1.pkg | 2023-10-09 21:21 | 169K | |
| libsx-1.1_4.pkg | 2023-10-08 09:55 | 60K | |
| libsynaptics-0.14.6...> | 2023-10-09 07:29 | 45K | |
| libsysctlmibinfo-1.0..> | 2023-10-08 16:31 | 12K | |
| libsysctlmibinfo2-2...> | 2023-10-07 12:47 | 15K | |
| libsysinfo-0.0.3_2.pkg | 2023-10-05 16:45 | 22K | |
| libsysstat-0.4.6.pkg | 2023-10-07 09:26 | 22K | |
| libtai-0.60_6.pkg | 2023-10-08 03:16 | 23K | |
| libtap-1.12.0.pkg | 2023-10-10 00:28 | 11K | |
| libtar-1.2.20.pkg | 2023-10-10 16:09 | 38K | |
| libtasn1-4.19.0.pkg | 2023-10-05 17:24 | 159K | |
| libtecla-1.6.3.pkg | 2023-10-08 03:20 | 192K | |
| libtermkey-0.22.pkg | 2023-10-06 13:34 | 52K | |
| libtextcat-2.2_6.pkg | 2023-10-08 08:07 | 134K | |
| libtextstyle-0.22.pkg | 2023-10-05 16:46 | 412K | |
| libthai-0.1.29.pkg | 2023-10-05 16:48 | 158K | |
| libtheora-1.1.1_7.pkg | 2023-10-05 16:45 | 169K | |
| libthmap-g2020082801..> | 2023-10-10 05:19 | 21K | |
| libthreadar-1.4.0.pkg | 2023-10-08 08:09 | 55K | |
| libticables2-1.3.5_1..> | 2023-10-07 09:50 | 35K | |
| libticalcs2-1.1.9.pkg | 2023-10-08 09:09 | 138K | |
| libtickit-0.4.4.pkg | 2023-10-06 13:43 | 188K | |
| libticonv-1.1.5.pkg | 2023-10-06 22:34 | 19K | |
| libtifiles2-1.1.7.pkg | 2023-10-07 06:58 | 53K | |
| libtmcg-1.3.18.pkg | 2023-10-10 11:08 | 544K | |
| libtnl-1.5.0_8.pkg | 2023-10-14 15:50 | 778K | |
| libtomcrypt-1.18.2_1..> | 2023-10-07 06:57 | 1.2M | |
| libtommath-1.2.0_2.pkg | 2023-10-06 13:44 | 479K | |
| libtool-2.4.7_1.pkg | 2023-10-05 17:18 | 359K | |
| libtorrent-0.13.8.pkg | 2023-10-08 03:41 | 337K | |
| libtorrent-rasterbar..> | 2023-10-06 20:36 | 2.9M | |
| libtorrent-rasterbar..> | 2023-10-07 16:47 | 3.3M | |
| libtpl-1.6_1.pkg | 2023-10-14 04:13 | 44K | |
| libtpms-0.9.6.pkg | 2023-10-07 22:47 | 570K | |
| libtrace-3.0.19_2.pkg | 2023-10-08 13:53 | 281K | |
| libtranslate-0.99_11..> | 2023-10-10 12:56 | 101K | |
| libtre-0.8.0_3.pkg | 2023-10-07 03:54 | 76K | |
| libtree-3.1.1.pkg | 2023-10-08 21:59 | 13K | |
| libtremor-1.2.1.s201..> | 2023-10-10 08:11 | 90K | |
| libtsm-3.pkg | 2023-10-08 12:55 | 25K | |
| libtubo-5.0.14.pkg | 2023-10-07 04:30 | 23K | |
| libtuner-1.1.5.pkg | 2023-10-07 18:43 | 163K | |
| libtuntap-0.4_2.pkg | 2023-10-09 16:28 | 8.1K | |
| libu2f-host-1.1.10_1..> | 2023-10-07 03:34 | 39K | |
| libublio-20070103_3.pkg | 2023-10-06 19:28 | 13K | |
| libubox-20180803_3.pkg | 2023-10-07 19:33 | 118K | |
| libucl-0.8.2.pkg | 2023-10-07 06:16 | 117K | |
| libudev-devd-0.5.1.pkg | 2023-10-05 17:18 | 16K | |
| libudisks-2.10.0.pkg | 2023-10-06 14:03 | 850K | |
| libuecc-7_2.pkg | 2023-10-09 14:19 | 31K | |
| libuinputplus-0.2.1.pkg | 2023-10-14 12:56 | 11K | |
| libukcprog-1.0.2_5.pkg | 2023-10-09 17:51 | 29K | |
| libunibreak-5.1,1.pkg | 2023-10-05 16:45 | 26K | |
| libunicode-0.4_11.pkg | 2023-10-07 09:32 | 52K | |
| libuninameslist-2022..> | 2023-10-06 18:25 | 1.2M | |
| libuninum-2.7_4.pkg | 2023-10-07 11:47 | 58K | |
| libunique-3.0.2_4.pkg | 2023-10-06 19:10 | 30K | |
| libunistring-1.1.pkg | 2023-10-05 17:01 | 547K | |
| libunit-1.31.0.pkg | 2023-10-14 15:17 | 109K | |
| libunp-1.0_1.pkg | 2023-10-09 22:37 | 31K | |
| libunrar-6.2.10,1.pkg | 2023-10-08 09:07 | 177K | |
| libunwind-20211201_2..> | 2023-10-05 16:43 | 127K | |
| liburcu-0.14.0.pkg | 2023-10-07 05:23 | 152K | |
| libusbmuxd-2.0.2.pkg | 2023-10-06 13:45 | 41K | |
| libusipp-2.25.pkg | 2023-10-09 09:13 | 97K | |
| libusrsctp-0.9.5.0.pkg | 2023-10-08 01:58 | 225K | |
| libutf-2.10_3.pkg | 2023-10-07 21:18 | 26K | |
| libutf-8-1.0,1.pkg | 2023-10-07 13:19 | 12K | |
| libutp-g20230213.pkg | 2023-10-07 14:11 | 32K | |
| libuutil-1.0.3.pkg | 2023-10-09 11:05 | 26K | |
| libuv-1.46.0.pkg | 2023-10-05 17:21 | 119K | |
| libuvc-0.0.7_1.pkg | 2023-10-07 05:34 | 46K | |
| libv4l-1.23.0_2.pkg | 2023-10-05 17:50 | 360K | |
| libva-2.20.0.pkg | 2023-10-05 17:42 | 167K | |
| libva-glx-2.20.0.pkg | 2023-10-07 03:53 | 9.6K | |
| libva-intel-driver-2..> | 2023-10-14 03:36 | 898K | |
| libva-intel-hybrid-d..> | 2023-10-08 04:54 | 354K | |
| libva-intel-media-dr..> | 2023-10-10 03:00 | 54M | |
| libva-nvidia-driver-..> | 2023-10-08 15:38 | 34K | |
| libva-utils-2.20.0.pkg | 2023-10-10 14:38 | 488K | |
| libva-vdpau-driver-0..> | 2023-10-08 12:16 | 28K | |
| libvanessa_adt-0.0.9..> | 2023-10-08 04:13 | 25K | |
| libvanessa_logger-0...> | 2023-10-07 00:57 | 14K | |
| libvanessa_socket-0...> | 2023-10-08 11:38 | 26K | |
| libvc-003_4.pkg | 2023-10-08 09:01 | 36K | |
| libvdpau-1.5.pkg | 2023-10-05 17:32 | 60K | |
| libvdpau-va-gl-0.4.2..> | 2023-10-11 01:25 | 51K | |
| libvdwxc-0.4.6.20190..> | 2023-10-08 01:53 | 1.5M | |
| libversion-3.0.3.pkg | 2023-10-08 00:35 | 25K | |
| libvex-g20230201_1.pkg | 2023-10-14 07:36 | 1.3M | |
| libvhdi-20221124.pkg | 2023-10-07 01:04 | 586K | |
| libvirt-9.7.0.pkg | 2023-10-07 05:56 | 6.6M | |
| libvirt-dbus-1.4.1.pkg | 2023-10-11 02:06 | 52K | |
| libvirt-glib-4.0.0_3..> | 2023-10-08 11:49 | 284K | |
| libvirt-java-0.5.3.pkg | 2023-10-09 20:42 | 266K | |
| libvisio01-0.1.7_11.pkg | 2023-10-06 22:35 | 186K | |
| libvisual-0.2.0_5.pkg | 2023-10-10 11:36 | 76K | |
| libvisual04-0.4.0_6.pkg | 2023-10-06 21:45 | 136K | |
| libvisual04-plugins-..> | 2023-10-09 17:55 | 75K | |
| libvlcpp-0.1.0.20210..> | 2023-10-08 13:58 | 38K | |
| libvmdk-20221124.pkg | 2023-10-07 06:53 | 653K | |
| libvmime-0.9.2_13.pkg | 2023-10-08 15:27 | 1.3M | |
| libvncserver-0.9.14_..> | 2023-10-06 21:32 | 205K | |
| libvolume_id-0.81.1.pkg | 2023-10-09 21:59 | 26K | |
| libvorbis-1.3.7_2,3.pkg | 2023-10-05 16:42 | 344K | |
| libvpx-1.13.0.pkg | 2023-10-05 16:53 | 1.3M | |
| libvsgpt-e.20221029.pkg | 2023-10-07 03:14 | 559K | |
| libvshadow-20221030.pkg | 2023-10-07 05:31 | 596K | |
| libvslvm-e.20221025.pkg | 2023-10-07 04:03 | 668K | |
| libvterm-0.3.3.pkg | 2023-10-07 01:28 | 56K | |
| libwacom-1.5.pkg | 2023-10-05 17:50 | 73K | |
| libwapcaplet-0.4.3.pkg | 2023-10-07 06:22 | 6.8K | |
| libwasmtime-12.0.2.pkg | 2023-10-07 17:39 | 4.8M | |
| libwebsockets-4.3.2_..> | 2023-10-06 19:18 | 461K | |
| libwfut-0.2.3_8.pkg | 2023-10-10 19:56 | 105K | |
| libwhisker-2.5_2.pkg | 2023-10-09 14:44 | 98K | |
| libwmf-0.2.13_2.pkg | 2023-10-06 10:54 | 2.1M | |
| libwmf-nox11-0.2.13_..> | 2023-10-06 18:43 | 2.1M | |
| libwnck-2.30.7_3.pkg | 2023-10-06 18:39 | 371K | |
| libwnck3-3.36.0_1.pkg | 2023-10-06 16:30 | 325K | |
| libwpd010-0.10.3_7.pkg | 2023-10-06 18:10 | 153K | |
| libwpe-1.12.0.pkg | 2023-10-06 09:01 | 42K | |
| libwpg03-0.3.4.pkg | 2023-10-06 19:53 | 47K | |
| libwps-0.4.14.pkg | 2023-10-06 18:38 | 651K | |
| libwps03-0.3.1_13.pkg | 2023-10-09 15:26 | 184K | |
| libwraster-0.95.9_3.pkg | 2023-10-07 07:13 | 58K | |
| libwww-5.4.2.pkg | 2023-10-07 04:33 | 653K | |
| libx86-1.1_2.pkg | 2023-10-08 06:48 | 64K | |
| libx264-0.164.3095.pkg | 2023-10-05 17:34 | 673K | |
| libxalloc-1.0.4.pkg | 2023-10-07 19:31 | 4.1K | |
| libxaw3dxft-1.6.2.h.pkg | 2023-10-07 15:05 | 261K | |
| libxc-6.0.0_2.pkg | 2023-10-06 17:51 | 4.7M | |
| libxcb-1.15_1.pkg | 2023-10-05 17:16 | 1.0M | |
| libxcrypt-4.4.36.pkg | 2023-10-14 11:15 | 87K | |
| libxcvt-0.1.2_1.pkg | 2023-10-06 10:26 | 8.5K | |
| libxdf-0.991.pkg | 2023-10-08 11:47 | 52K | |
| libxdg-basedir-1.2.2..> | 2023-10-07 08:10 | 10K | |
| libxdiff-0.23_1.pkg | 2023-10-07 18:52 | 38K | |
| libxfce4menu-4.18.4.pkg | 2023-10-06 14:05 | 309K | |
| libxfce4util-4.18.1.pkg | 2023-10-06 11:46 | 98K | |
| libxine-1.2.13_5.pkg | 2023-10-08 02:04 | 2.4M | |
| libxisf-0.2.9.pkg | 2023-10-08 01:41 | 99K | |
| libxkbcommon-1.5.0.pkg | 2023-10-05 17:41 | 193K | |
| libxkbfile-1.1.0.pkg | 2023-10-05 17:24 | 104K | |
| libxklavier-5.3_3,1.pkg | 2023-10-06 13:21 | 89K | |
| libxls-1.6.2.pkg | 2023-10-08 07:13 | 35K | |
| libxlsxwriter-1.1.5.pkg | 2023-10-08 03:39 | 662K | |
| libxml++-2.40.1_2,1.pkg | 2023-10-06 13:28 | 126K | |
| libxml++30-2.91.3.pkg | 2023-10-10 00:25 | 120K | |
| libxml++50-5.0.2.pkg | 2023-10-09 17:36 | 118K | |
| libxml2-2.10.4_1.pkg | 2023-10-05 16:42 | 1.1M | |
| libxmlb-0.3.14.pkg | 2023-10-06 12:25 | 189K | |
| libxmlbird-1.2.12.pkg | 2023-10-08 08:32 | 22K | |
| libxmp-4.6.0.pkg | 2023-10-07 08:13 | 399K | |
| libxo-0.6.1_1.pkg | 2023-10-11 05:44 | 229K | |
| libxode-0.71_6.pkg | 2023-10-09 09:19 | 27K | |
| libxs-1.2.0_7.pkg | 2023-10-09 15:06 | 230K | |
| libxshmfence-1.3.2.pkg | 2023-10-05 16:43 | 4.5K | |
| libxslt-1.1.37.pkg | 2023-10-05 17:18 | 278K | |
| libxsmm-1.17_1.pkg | 2023-10-08 01:59 | 2.2M | |
| libxspf-1.2.0_2.pkg | 2023-10-07 05:56 | 133K | |
| libxtend-0.1.9.pkg | 2023-10-06 18:38 | 96K | |
| libyaml-0.2.5.pkg | 2023-10-05 16:46 | 72K | |
| libyang-1.0.240.pkg | 2023-10-06 23:44 | 501K | |
| libyang2-2.1.80.pkg | 2023-10-06 23:44 | 503K | |
| libyubikey-1.13.pkg | 2023-10-06 20:14 | 15K | |
| libyuv-0.0.1789_2.pkg | 2023-10-09 18:20 | 292K | |
| libzakalwe-g20230909..> | 2023-10-07 11:45 | 159K | |
| libzapojit-0.0.3_2.pkg | 2023-10-08 06:42 | 72K | |
| libzdb-3.2.3.pkg | 2023-10-06 23:30 | 83K | |
| libzen-23.07,1.pkg | 2023-10-06 17:47 | 155K | |
| libzim-8.2.1.pkg | 2023-10-07 00:46 | 237K | |
| libzip-1.10.0.pkg | 2023-10-06 09:32 | 239K | |
| libzippp-7.0.1.10.1.pkg | 2023-10-10 00:22 | 25K | |
| libzmf-0.0.2_28.pkg | 2023-10-06 21:36 | 59K | |
| libzmq2-2.2.0_3.pkg | 2023-10-07 08:31 | 201K | |
| libzmq3-3.2.5_1.pkg | 2023-10-08 15:34 | 268K | |
| libzmq4-4.3.4.pkg | 2023-10-06 08:29 | 593K | |
| libzookeeper-3.8.1.pkg | 2023-10-07 18:34 | 132K | |
| libzrtpcppcore-4.6.6..> | 2023-10-11 21:23 | 177K | |
| libzvbi-0.2.35_3.pkg | 2023-10-08 08:13 | 309K | |
| lidarr-1.3.5.3530.pkg | 2023-10-08 12:54 | 22M | |
| lidia-2.3.0_3.pkg | 2023-10-08 12:25 | 20M | |
| lifelines-3.1.1_1.pkg | 2023-10-14 14:56 | 1.9M | |
| liferea-1.14.5.pkg | 2023-10-11 00:15 | 1.0M | |
| liggghts-3.8.0.58_4.pkg | 2023-10-08 14:13 | 1.6M | |
| lightdm-1.32.0_1.pkg | 2023-10-07 02:55 | 219K | |
| lightdm-gtk-greeter-..> | 2023-10-07 10:30 | 73K | |
| lightdm-gtk-greeter-..> | 2023-10-10 01:04 | 135K | |
| lightgbm-4.1.0.pkg | 2023-10-14 12:40 | 1.4M | |
| lightning-2.2.2.pkg | 2023-10-14 06:53 | 151K | |
| lightsoff-40.0.1_1.pkg | 2023-10-07 03:00 | 474K | |
| lightsquid-1.8_4.pkg | 2023-10-09 22:33 | 49K | |
| lighttpd-1.4.71.pkg | 2023-10-07 20:27 | 383K | |
| lightweight-java-pro..> | 2023-10-10 11:44 | 10K | |
| lightzone-4.1.8.3_10..> | 2023-10-09 06:07 | 8.6M | |
| lilv-0.24.12_1.pkg | 2023-10-07 02:10 | 76K | |
| lilypond-2.24.2.pkg | 2023-10-07 18:35 | 3.8M | |
| lilypond-devel-2.25...> | 2023-10-09 21:10 | 3.4M | |
| lilyterm-0.9.9.4_2.pkg | 2023-10-14 11:26 | 161K | |
| lime-5.2.94.pkg | 2023-10-07 05:43 | 352K | |
| limereport-1.5.35_1.pkg | 2023-10-14 12:17 | 3.6M | |
| limesuite-22.09.0_1.pkg | 2023-10-09 18:23 | 2.6M | |
| limesurvey-5.6.23.pkg | 2023-10-10 09:34 | 52M | |
| linbox-1.7.0_1.pkg | 2023-10-08 11:06 | 852K | |
| lincity-1.13.1_8.pkg | 2023-10-14 11:13 | 428K | |
| lincity-ng-2.0_19.pkg | 2023-10-10 22:31 | 34M | |
| linden-hill-g2011052..> | 2023-10-09 03:45 | 76K | |
| lineak-defaultplugin..> | 2023-10-09 22:48 | 34K | |
| lineak-xosdplugin-0...> | 2023-10-14 06:52 | 11K | |
| lineakd-0.9_4.pkg | 2023-10-08 03:34 | 232K | |
| linenoise-1.0.34.pkg | 2023-10-14 05:47 | 11K | |
| linenoise-ng-1.0.1.pkg | 2023-10-14 18:58 | 25K | |
| lingeling-g20220515.pkg | 2023-10-08 09:39 | 462K | |
| lingot-1.0.1_4.pkg | 2023-10-10 14:01 | 78K | |
| lingoteach-0.3.9_17.pkg | 2023-10-10 18:15 | 238K | |
| link-grammar-5.10.5.pkg | 2023-10-10 18:02 | 2.3M | |
| linklint-2.3.6.d.pkg | 2023-10-09 14:47 | 35K | |
| linknx-0.0.1.32.pkg | 2023-10-10 22:52 | 207K | |
| links-2.29_2,1.pkg | 2023-10-11 05:42 | 2.8M | |
| links1-1.04,1.pkg | 2023-10-07 22:37 | 338K | |
| linpack-1.0_15.pkg | 2023-10-08 15:29 | 203K | |
| linphone-5.0.18,1.pkg | 2023-10-08 13:53 | 2.3M | |
| linrad-4.02_8.pkg | 2023-10-11 18:13 | 597K | |
| linrename-2.25.2.pkg | 2023-10-09 20:29 | 5.5K | |
| linux-baudline-1.08_..> | 2023-10-10 10:00 | 764K | |
| linux-bcompare-4.3.7..> | 2023-10-09 01:22 | 14M | |
| linux-bitwarden-cli-..> | 2023-10-10 21:03 | 17M | |
| linux-c7-7.9.2009_1.pkg | 2023-10-14 12:14 | 1.4K | |
| linux-c7-alsa-lib-1...> | 2023-10-06 18:02 | 676K | |
| linux-c7-alsa-lib-de..> | 2023-10-06 19:29 | 673K | |
| linux-c7-alsa-plugin..> | 2023-10-07 04:50 | 14K | |
| linux-c7-alsa-plugin..> | 2023-10-07 12:33 | 44K | |
| linux-c7-alsa-utils-..> | 2023-10-08 03:23 | 1.0M | |
| linux-c7-aspell-0.60..> | 2023-10-08 06:15 | 852K | |
| linux-c7-at-spi2-atk..> | 2023-10-07 00:48 | 111K | |
| linux-c7-at-spi2-cor..> | 2023-10-06 19:14 | 140K | |
| linux-c7-atk-2.28.1_..> | 2023-10-06 20:25 | 240K | |
| linux-c7-audiofile-0..> | 2023-10-08 01:29 | 211K | |
| linux-c7-avahi-libs-..> | 2023-10-07 01:33 | 74K | |
| linux-c7-ca-certific..> | 2023-10-14 17:42 | 786K | |
| linux-c7-cairo-1.15...> | 2023-10-06 17:27 | 1.2M | |
| linux-c7-cairo-gobje..> | 2023-10-07 04:28 | 13K | |
| linux-c7-cups-libs-1..> | 2023-10-07 18:46 | 455K | |
| linux-c7-curl-7.29.0..> | 2023-10-07 04:06 | 544K | |
| linux-c7-cyrus-sasl-..> | 2023-10-06 17:20 | 170K | |
| linux-c7-dbus-libs-1..> | 2023-10-06 16:19 | 354K | |
| linux-c7-devtools-7...> | 2023-10-06 22:04 | 43M | |
| linux-c7-dosfstools-..> | 2023-10-07 17:43 | 84K | |
| linux-c7-dri-18.3.4_..> | 2023-10-06 15:02 | 66M | |
| linux-c7-elfutils-li..> | 2023-10-05 16:58 | 188K | |
| linux-c7-elfutils-li..> | 2023-10-05 17:02 | 462K | |
| linux-c7-expat-2.1.0..> | 2023-10-05 16:46 | 119K | |
| linux-c7-expat-devel..> | 2023-10-07 10:47 | 44K | |
| linux-c7-flac-libs-1..> | 2023-10-06 15:58 | 268K | |
| linux-c7-fontconfig-..> | 2023-10-05 16:55 | 288K | |
| linux-c7-freetype-2...> | 2023-10-05 16:53 | 608K | |
| linux-c7-fribidi-1.0..> | 2023-10-06 15:58 | 79K | |
| linux-c7-gdk-pixbuf2..> | 2023-10-06 20:01 | 620K | |
| linux-c7-glx-utils-8..> | 2023-10-07 22:20 | 36K | |
| linux-c7-gnutls-3.3...> | 2023-10-08 07:22 | 1.0M | |
| linux-c7-graphite2-1..> | 2023-10-06 14:05 | 179K | |
| linux-c7-gsm-1.0.13.pkg | 2023-10-06 15:57 | 35K | |
| linux-c7-gtk2-2.24.3..> | 2023-10-08 10:02 | 4.7M | |
| linux-c7-gtk3-3.22.3..> | 2023-10-07 11:20 | 6.4M | |
| linux-c7-harfbuzz-1...> | 2023-10-06 17:23 | 417K | |
| linux-c7-icu-50.2_1.pkg | 2023-10-07 03:07 | 12M | |
| linux-c7-jasper-libs..> | 2023-10-06 16:35 | 248K | |
| linux-c7-jbigkit-lib..> | 2023-10-06 14:00 | 61K | |
| linux-c7-jpeg-1.2.90..> | 2023-10-06 15:30 | 211K | |
| linux-c7-libaio-0.3...> | 2023-10-08 01:49 | 15K | |
| linux-c7-libasyncns-..> | 2023-10-06 22:54 | 28K | |
| linux-c7-libcroco-0...> | 2023-10-06 19:59 | 156K | |
| linux-c7-libdrm-2.4...> | 2023-10-05 17:03 | 247K | |
| linux-c7-libepoxy-1...> | 2023-10-07 01:38 | 344K | |
| linux-c7-libgcrypt-1..> | 2023-10-05 17:06 | 399K | |
| linux-c7-libgfortran..> | 2023-10-06 16:57 | 455K | |
| linux-c7-libglade2-2..> | 2023-10-07 18:58 | 79K | |
| linux-c7-libglvnd-1...> | 2023-10-05 17:05 | 400K | |
| linux-c7-libgpg-erro..> | 2023-10-05 16:58 | 72K | |
| linux-c7-libogg-1.3...> | 2023-10-05 17:11 | 25K | |
| linux-c7-libpciacces..> | 2023-10-05 16:58 | 31K | |
| linux-c7-libpng-1.5...> | 2023-10-05 16:45 | 248K | |
| linux-c7-librsvg2-2...> | 2023-10-07 08:02 | 192K | |
| linux-c7-libsigc++20..> | 2023-10-08 04:58 | 33K | |
| linux-c7-libsndfile-..> | 2023-10-06 21:57 | 249K | |
| linux-c7-libssh2-1.8..> | 2023-10-06 19:23 | 132K | |
| linux-c7-libtasn1-4...> | 2023-10-06 22:25 | 336K | |
| linux-c7-libthai-0.1..> | 2023-10-06 16:19 | 185K | |
| linux-c7-libtheora-1..> | 2023-10-07 21:02 | 199K | |
| linux-c7-libtiff-4.0..> | 2023-10-06 16:31 | 272K | |
| linux-c7-libtool-ltd..> | 2023-10-10 10:18 | 39K | |
| linux-c7-libunwind-1..> | 2023-10-07 09:51 | 87K | |
| linux-c7-libv4l-0.9...> | 2023-10-08 06:49 | 298K | |
| linux-c7-libvorbis-1..> | 2023-10-06 16:09 | 305K | |
| linux-c7-libxkbcommo..> | 2023-10-07 07:02 | 159K | |
| linux-c7-libxml2-2.9..> | 2023-10-06 15:56 | 1.1M | |
| linux-c7-libxslt-1.1..> | 2023-10-14 03:55 | 325K | |
| linux-c7-ltp-2020060..> | 2023-10-10 08:27 | 18M | |
| linux-c7-lttng-ust-2..> | 2023-10-07 07:01 | 159K | |
| linux-c7-lz4-1.8.3.pkg | 2023-10-05 17:06 | 99K | |
| linux-c7-make-3.82_1..> | 2023-10-09 03:53 | 383K | |
| linux-c7-motif-2.3.4..> | 2023-10-07 16:46 | 2.1M | |
| linux-c7-nettle-2.7...> | 2023-10-06 23:15 | 393K | |
| linux-c7-nspr-4.34.0..> | 2023-10-06 13:56 | 204K | |
| linux-c7-nss-3.79.0.pkg | 2023-10-06 16:03 | 2.1M | |
| linux-c7-numactl-lib..> | 2023-10-07 23:16 | 36K | |
| linux-c7-openal-soft..> | 2023-10-07 15:18 | 395K | |
| linux-c7-openldap-2...> | 2023-10-06 20:27 | 487K | |
| linux-c7-openssl-dev..> | 2023-10-07 15:45 | 1.2M | |
| linux-c7-p11-kit-0.2..> | 2023-10-07 08:02 | 547K | |
| linux-c7-pango-1.42...> | 2023-10-06 23:08 | 361K | |
| linux-c7-pixman-0.34..> | 2023-10-06 15:32 | 433K | |
| linux-c7-power9-func..> | 2023-10-10 19:53 | 3.1M | |
| linux-c7-power10-fun..> | 2023-10-14 06:08 | 3.2M | |
| linux-c7-pulseaudio-..> | 2023-10-07 03:44 | 798K | |
| linux-c7-pulseaudio-..> | 2023-10-07 15:29 | 52K | |
| linux-c7-qt-4.8.7_4.pkg | 2023-10-06 20:01 | 7.7M | |
| linux-c7-qt-x11-4.8...> | 2023-10-07 06:13 | 23M | |
| linux-c7-qtwebkit-2...> | 2023-10-07 12:16 | 9.1M | |
| linux-c7-sdl-1.2.15_..> | 2023-10-07 07:01 | 334K | |
| linux-c7-sdl20-2.0.1..> | 2023-10-07 15:03 | 477K | |
| linux-c7-sdl_image-1..> | 2023-10-08 08:27 | 31K | |
| linux-c7-sdl_mixer-1..> | 2023-10-08 02:20 | 76K | |
| linux-c7-sdl_ttf-2.0..> | 2023-10-08 10:13 | 16K | |
| linux-c7-sqlite-3.7...> | 2023-10-06 15:31 | 670K | |
| linux-c7-strace-4.24..> | 2023-10-08 22:17 | 283K | |
| linux-c7-systemd-lib..> | 2023-10-06 15:22 | 507K | |
| linux-c7-tcl85-8.5.1..> | 2023-10-07 11:43 | 2.0M | |
| linux-c7-tcp_wrapper..> | 2023-10-06 20:14 | 65K | |
| linux-c7-tk85-8.5.13..> | 2023-10-07 12:50 | 1.7M | |
| linux-c7-trousers-0...> | 2023-10-07 09:07 | 391K | |
| linux-c7-unixODBC-2...> | 2023-10-09 18:36 | 569K | |
| linux-c7-userspace-r..> | 2023-10-06 20:01 | 62K | |
| linux-c7-wayland-1.1..> | 2023-10-05 17:07 | 89K | |
| linux-c7-xcb-util-0...> | 2023-10-07 09:37 | 14K | |
| linux-c7-xcb-util-im..> | 2023-10-08 01:14 | 16K | |
| linux-c7-xcb-util-ke..> | 2023-10-08 11:06 | 8.8K | |
| linux-c7-xorg-libs-7..> | 2023-10-05 17:01 | 3.4M | |
| linux-c7-zlib-devel-..> | 2023-10-07 15:35 | 35K | |
| linux-doom3-1.3.1.13..> | 2023-10-11 04:51 | 6.6M | |
| linux-doom3-demo-1.1..> | 2023-10-14 06:18 | 458M | |
| linux-dotnet-cli-2.0..> | 2023-10-07 06:29 | 29K | |
| linux-dotnet-runtime..> | 2023-10-07 20:54 | 18M | |
| linux-dotnet-sdk-2.1..> | 2023-10-10 04:47 | 187M | |
| linux-dotnet10-runti..> | 2023-10-08 02:55 | 21M | |
| linux-dotnet10-sdk-1..> | 2023-10-08 20:08 | 141M | |
| linux-dotnet11-runti..> | 2023-10-08 00:27 | 22M | |
| linux-dwarffortress-..> | 2023-10-14 13:33 | 9.7M | |
| linux-enemyterritory..> | 2023-10-07 23:12 | 251M | |
| linux-enemyterritory..> | 2023-10-09 22:31 | 9.0M | |
| linux-enemyterritory..> | 2023-10-10 22:34 | 434K | |
| linux-enemyterritory..> | 2023-10-10 15:05 | 437M | |
| linux-etqw-demo-serv..> | 2023-10-09 08:56 | 132M | |
| linux-etqw-server-1...> | 2023-10-11 13:12 | 428M | |
| linux-foldingathome-..> | 2023-10-08 18:14 | 3.1M | |
| linux-gputest-0.7.0.pkg | 2023-10-09 11:51 | 1.7M | |
| linux-j-504b_4.pkg | 2023-10-09 18:37 | 2.6M | |
| linux-jabref-5.3,1.pkg | 2023-10-09 13:03 | 155M | |
| linux-laudio-0.4.pkg | 2023-10-09 02:20 | 424K | |
| linux-miniconda-inst..> | 2023-10-09 01:52 | 2.2K | |
| linux-nerogame-2.0_2..> | 2023-10-08 13:10 | 38M | |
| linux-nvidia-libs-30..> | 2023-10-10 21:54 | 40M | |
| linux-nvidia-libs-34..> | 2023-10-10 11:59 | 60M | |
| linux-nvidia-libs-39..> | 2023-10-12 11:22 | 67M | |
| linux-nvidia-libs-47..> | 2023-10-09 17:45 | 102M | |
| linux-nvidia-libs-53..> | 2023-10-09 10:09 | 159M | |
| linux-nwnclient-1.69..> | 2023-10-09 09:16 | 284M | |
| linux-opera-12.16_3.pkg | 2023-10-08 20:58 | 13M | |
| linux-quake3-1.32c.pkg | 2023-10-08 22:40 | 1.8M | |
| linux-quake3-demo-1...> | 2023-10-09 10:03 | 44M | |
| linux-quake4-1.4.2_1..> | 2023-10-09 01:52 | 243M | |
| linux-quake4-demo-1...> | 2023-10-11 19:48 | 316M | |
| linux-rkbin-g2019071..> | 2023-10-09 09:11 | 1.8M | |
| linux-sublime-2.0.2_..> | 2023-10-14 07:05 | 4.5M | |
| linux-sublime-merge-..> | 2023-10-08 21:27 | 5.0M | |
| linux-sublime-text4-..> | 2023-10-11 01:30 | 15M | |
| linux-sublime3-3.2.2..> | 2023-10-09 02:25 | 11M | |
| linux-tsmuxer-1.10.6..> | 2023-10-11 00:28 | 5.2M | |
| linux-unigine-heaven..> | 2023-10-14 05:11 | 262M | |
| linux-unigine-sanctu..> | 2023-10-14 18:26 | 27M | |
| linux-unigine-superp..> | 2023-10-09 03:49 | 1.3G | |
| linux-unigine-tropic..> | 2023-10-11 01:18 | 54M | |
| linux-unigine-valley..> | 2023-10-10 15:09 | 357M | |
| linux-ut2003-demo-22..> | 2023-10-08 14:30 | 110M | |
| linux-virtual-jay-pe..> | 2023-10-09 17:30 | 4.4M | |
| linux-wps-office-11...> | 2023-10-08 22:16 | 232M | |
| linux-wps-office-zh_..> | 2023-10-10 02:50 | 329M | |
| linux-zotero-6.0.10_..> | 2023-10-10 20:19 | 54M | |
| linux_base-c7-7.9.20..> | 2023-10-05 16:42 | 35M | |
| linux_dvbwrapper-kmo..> | 2023-10-08 17:45 | 3.3K | |
| linux_libusb-13.1.0.pkg | 2023-10-07 19:04 | 57K | |
| linuxdcpp-1.1.0_21.pkg | 2023-10-08 19:59 | 819K | |
| linuxdoc-1.1_2.pkg | 2023-10-07 12:56 | 6.5K | |
| linuxdoc-tools-0.9.8..> | 2023-10-06 18:54 | 417K | |
| linuxfdisk-2.11z_1.pkg | 2023-10-09 18:28 | 94K | |
| linuxlibertine-4.7.5..> | 2023-10-09 00:03 | 3.4M | |
| linuxlibertine-g-201..> | 2023-10-06 22:53 | 2.9M | |
| linuxsampler-2.2.0_3..> | 2023-10-07 08:14 | 2.0M | |
| linwarrior-20100320_..> | 2023-10-09 20:48 | 1.8M | |
| lion-20060630.pkg | 2023-10-08 16:53 | 65K | |
| liquibase-4.3.5.pkg | 2023-10-14 10:08 | 6.4M | |
| liquid-dsp-1.3.2_1.pkg | 2023-10-07 23:46 | 543K | |
| liquidsfz-0.3.1_1.pkg | 2023-10-14 19:02 | 184K | |
| lirc-0.9.0_13,1.pkg | 2023-10-11 14:49 | 372K | |
| lis-2.1.3.pkg | 2023-10-08 13:03 | 417K | |
| listadmin-2.40.pkg | 2023-10-14 10:17 | 20K | |
| listener-2.2_3.pkg | 2023-10-08 14:33 | 19K | |
| listres-1.0.4_2.pkg | 2023-10-10 04:05 | 6.4K | |
| listserialc-1.1.0.pkg | 2023-10-07 14:37 | 4.3K | |
| lite-editor-1.11.pkg | 2023-10-14 17:49 | 225K | |
| lite-xl-2.1.1.pkg | 2023-10-10 15:50 | 426K | |
| litecoin-0.21.2.1_5.pkg | 2023-10-10 22:23 | 4.7M | |
| litecoin-daemon-0.21..> | 2023-10-10 01:22 | 2.4M | |
| litecoin-utils-0.21...> | 2023-10-09 11:20 | 1.5M | |
| liteide-38.2_4.pkg | 2023-10-09 00:42 | 8.2M | |
| litestream-0.3.9_12.pkg | 2023-10-10 10:59 | 5.4M | |
| litmus-0.13_2.pkg | 2023-10-10 08:54 | 40K | |
| littlefly-lv2-1.0.pkg | 2023-10-09 16:59 | 93K | |
| liveMedia-2022.06.16..> | 2023-10-06 18:47 | 554K | |
| livego-0.0.15_15.pkg | 2023-10-10 16:45 | 2.7M | |
| lizard-1.0.pkg | 2023-10-09 21:55 | 135K | |
| lizardfs-3.12.0_19.pkg | 2023-10-11 05:02 | 2.3M | |
| lizzie-0.6.105_2.pkg | 2023-10-08 23:54 | 3.4M | |
| ljclive-0.4.10_2.pkg | 2023-10-12 07:23 | 23K | |
| ljdeps-1.0_6.pkg | 2023-10-14 09:22 | 1.2K | |
| lla-0.99.1_1.pkg | 2023-10-10 01:14 | 3.2K | |
| llbuild-s.2017.12.10..> | 2023-10-14 07:47 | 329K | |
| lldpd-1.0.14.pkg | 2023-10-09 18:18 | 229K | |
| lldpd-tiny-1.0.14.pkg | 2023-10-08 22:29 | 256K | |
| llhttp-9.0.1.pkg | 2023-10-08 18:58 | 37K | |
| lll_spect-1.0_4.pkg | 2023-10-14 16:44 | 23K | |
| llvm-15,1.pkg | 2023-10-06 00:11 | 9.8K | |
| llvm-cheri-14.0.d202..> | 2023-10-06 05:22 | 61M | |
| llvm-devel-18.0.d202..> | 2023-10-06 11:48 | 304M | |
| llvm-devel-lite-18.0..> | 2023-10-06 07:47 | 96M | |
| llvm-morello-13.0.d2..> | 2023-10-06 01:59 | 57M | |
| llvm10-10.0.1_10.pkg | 2023-10-06 09:00 | 98M | |
| llvm11-11.0.1_7.pkg | 2023-10-06 05:08 | 107M | |
| llvm12-12.0.1_10.pkg | 2023-10-06 03:30 | 114M | |
| llvm13-13.0.1_4.pkg | 2023-10-06 08:32 | 159M | |
| llvm14-14.0.6_1.pkg | 2023-10-06 09:12 | 171M | |
| llvm15-15.0.7_5.pkg | 2023-10-05 21:57 | 138M | |
| llvm15-lite-15.0.7_5..> | 2023-10-06 07:37 | 66M | |
| llvm16-16.0.6_5.pkg | 2023-10-06 06:57 | 189M | |
| llvm16-lite-16.0.6_5..> | 2023-10-06 06:52 | 76M | |
| llvm17-17.0.1.pkg | 2023-10-06 09:43 | 215M | |
| llvm17-lite-17.0.1.pkg | 2023-10-06 05:55 | 78M | |
| lm-solve-0.14.2.pkg | 2023-10-10 02:19 | 56K | |
| lm4tools-0.1.3.20160..> | 2023-10-09 04:19 | 13K | |
| lmarbles-1.0.8_5.pkg | 2023-10-09 03:39 | 668K | |
| lmbench-3.0.a9_3,1.pkg | 2023-10-14 05:19 | 418K | |
| lmclock-1.2_2.pkg | 2023-10-09 17:15 | 5.3K | |
| lmdb-0.9.31,1.pkg | 2023-10-05 16:59 | 106K | |
| lmdbg-1.3.0.pkg | 2023-10-14 13:53 | 48K | |
| lmfit-9.0.pkg | 2023-10-08 22:51 | 48K | |
| lmmon-0.65_1.pkg | 2023-10-08 12:24 | 6.6K | |
| lmms-1.2.2_8,2.pkg | 2023-10-09 14:29 | 12M | |
| lmon-1.2_1.pkg | 2023-10-08 20:13 | 9.3K | |
| lms-3.40.1.pkg | 2023-10-09 20:28 | 1.3M | |
| lmtp2nntp-1.4.1.pkg | 2023-10-09 06:02 | 126K | |
| lnav-0.11.2.pkg | 2023-10-09 02:06 | 2.2M | |
| lndir-1.0.3_2.pkg | 2023-10-08 16:16 | 6.9K | |
| lnphost-1.0a.pkg | 2023-10-09 08:16 | 13K | |
| lo-libreoffice-7.5.5..> | 2023-10-08 07:07 | 2.5M | |
| local-php-security-c..> | 2023-10-09 09:54 | 1.9M | |
| locale-en_DK-0.1.1.pkg | 2023-10-08 19:29 | 1.6K | |
| localedata-5.4_2.pkg | 2023-10-07 07:42 | 59K | |
| localize-0.0.1_12.pkg | 2023-10-07 17:34 | 27K | |
| locarna-2.0.0.pkg | 2023-10-10 03:05 | 1.7M | |
| locator-0.1.pkg | 2023-10-09 18:06 | 6.3K | |
| loccount-2.12_14.pkg | 2023-10-09 03:28 | 825K | |
| lockfile-progs-0.1.1..> | 2023-10-07 15:40 | 9.3K | |
| lockfree-malloc-0.0...> | 2023-10-09 18:09 | 7.1K | |
| log4c-1.2.4_1.pkg | 2023-10-09 03:42 | 70K | |
| log4cplus-2.1.0.pkg | 2023-10-07 15:17 | 571K | |
| log4cpp-1.1.4.pkg | 2023-10-06 21:57 | 184K | |
| log4cxx-1.1.0.pkg | 2023-10-07 11:57 | 563K | |
| log4j-1.2.17.pkg | 2023-10-06 20:36 | 1.3M | |
| log4net-1.2.10_5.pkg | 2023-10-08 06:26 | 540K | |
| log4sh-1.4.2.pkg | 2023-10-10 03:33 | 29K | |
| log4shib-2.0.1.pkg | 2023-10-06 19:25 | 89K | |
| loganalyzer-php80-4...> | 2023-10-14 10:53 | 3.6M | |
| loganalyzer-php81-4...> | 2023-10-14 11:11 | 3.6M | |
| loganalyzer-php82-4...> | 2023-10-14 12:46 | 3.6M | |
| loganalyzer-php83-4...> | 2023-10-14 08:24 | 3.6M | |
| logcheck-1.4.3.pkg | 2023-10-10 21:24 | 87K | |
| logisim-2.7.1.pkg | 2023-10-14 15:04 | 5.6M | |
| logitechmediaserver-..> | 2023-10-07 02:47 | 17M | |
| logitechmediaserver-..> | 2023-10-08 03:38 | 54K | |
| logitechmediaserver-..> | 2023-10-10 04:08 | 50K | |
| logitechmediaserver-..> | 2023-10-10 01:20 | 101K | |
| logitechmediaserver-..> | 2023-10-09 06:15 | 130K | |
| logrotate-3.13.0_1.pkg | 2023-10-07 16:11 | 35K | |
| logstalgia-1.1.4_2.pkg | 2023-10-09 12:30 | 1.7M | |
| logstash-forwarder-0..> | 2023-10-09 07:03 | 1.5M | |
| logstash7-7.17.11.pkg | 2023-10-08 12:05 | 140M | |
| logstash8-8.8.2.pkg | 2023-10-07 23:44 | 124M | |
| logsurfer-1.8_1.pkg | 2023-10-10 09:49 | 46K | |
| logswan-2.1.13.pkg | 2023-10-09 13:46 | 11K | |
| logtool-1.3.1_1.pkg | 2023-10-09 09:36 | 29K | |
| logtools-0.13e_2.pkg | 2023-10-14 13:31 | 27K | |
| loguru-2.1.0.21.pkg | 2023-10-09 15:35 | 25K | |
| logwatch-7.5.1.pkg | 2023-10-08 17:24 | 298K | |
| lokalize-23.08.1.pkg | 2023-10-09 13:26 | 2.2M | |
| loki-0.1.7.pkg | 2023-10-08 22:37 | 317K | |
| lolcat-1.2.8.pkg | 2023-10-08 21:51 | 8.2K | |
| lollypop-1.4.16_2.pkg | 2023-10-09 09:30 | 441K | |
| lookat-1.4.4.pkg | 2023-10-14 13:46 | 41K | |
| lookatme-2.5.5_1.pkg | 2023-10-10 14:26 | 60K | |
| lookout-1.4_1.pkg | 2023-10-09 14:46 | 9.0K | |
| loook-0.9.0.pkg | 2023-10-10 08:30 | 12K | |
| lordsawar-0.3.2_3.pkg | 2023-10-09 08:27 | 23M | |
| loudmouth-1.5.4.pkg | 2023-10-06 20:52 | 74K | |
| lout-3.42.2_1.pkg | 2023-10-08 16:41 | 1.3M | |
| love-11.4.pkg | 2023-10-07 22:15 | 1.7M | |
| love07-0.7.2_25.pkg | 2023-10-07 11:46 | 279K | |
| love08-0.8.0_20.pkg | 2023-10-10 16:18 | 334K | |
| love5-0.5.0_31.pkg | 2023-10-08 20:25 | 332K | |
| love10-0.10.2_4.pkg | 2023-10-08 09:20 | 945K | |
| lowdown-1.0.2.pkg | 2023-10-07 22:04 | 443K | |
| lp_solve-5.5.2.5.pkg | 2023-10-06 17:03 | 497K | |
| lpairs-1.0.5.pkg | 2023-10-10 18:12 | 209K | |
| lpc21isp-1.97.pkg | 2023-10-09 14:52 | 194K | |
| lpcnet-20210629_1.pkg | 2023-10-07 14:21 | 7.3M | |
| lprps-2.5_1.pkg | 2023-10-10 16:23 | 28K | |
| lr-1.6_1.pkg | 2023-10-08 14:51 | 26K | |
| lrcalc-2.1.pkg | 2023-10-08 00:56 | 67K | |
| lrng-20130314.pkg | 2023-10-09 07:06 | 375K | |
| lrslib-7.2,1.pkg | 2023-10-07 21:48 | 156K | |
| lrzip-0.651.pkg | 2023-10-10 01:08 | 175K | |
| lrzsz-0.12.20_4.pkg | 2023-10-08 10:57 | 65K | |
| ls-lint-2.1.0_1.pkg | 2023-10-10 12:54 | 759K | |
| ls-qpack-2.5.3.pkg | 2023-10-10 06:04 | 196K | |
| lsblk-3.7.pkg | 2023-10-08 10:53 | 5.1K | |
| lscolors-0.15.0_1.pkg | 2023-10-09 23:36 | 145K | |
| lscpu-1.2.0_1.pkg | 2023-10-06 17:06 | 7.6K | |
| lsd-0.23.1_6.pkg | 2023-10-09 04:06 | 621K | |
| lsdvd-0.17_5.pkg | 2023-10-07 12:47 | 13K | |
| lsix-1.8.pkg | 2023-10-14 16:57 | 526K | |
| lskat-23.08.1.pkg | 2023-10-06 23:30 | 1.2M | |
| lsknobs-1.0.pkg | 2023-10-09 11:28 | 2.0K | |
| lsof-4.97.0,8.pkg | 2023-10-06 14:14 | 110K | |
| lsop-0.2.pkg | 2023-10-14 14:50 | 5.6K | |
| lsp-plugins-lv2-1.2...> | 2023-10-09 15:39 | 5.5M | |
| lsw-0.3_2.pkg | 2023-10-08 16:02 | 3.7K | |
| lsyncd-2.2.3.pkg | 2023-10-14 18:37 | 50K | |
| lt-aspell-1.2.1.0_1,..> | 2023-10-09 17:31 | 670K | |
| lt-hyphen-2004.04.15..> | 2023-10-09 13:16 | 3.7K | |
| lt-libreoffice-7.5.5..> | 2023-10-08 01:08 | 3.0M | |
| ltfs-2.4.6.0.pkg | 2023-10-08 23:27 | 1.0M | |
| ltl2ba-1.3.pkg | 2023-10-09 09:38 | 24K | |
| ltrace-0.6.0.pkg | 2023-10-09 04:16 | 70K | |
| ltris-1.2.1,1.pkg | 2023-10-14 03:40 | 1.1M | |
| lttoolbox-3.7.1_1.pkg | 2023-10-07 06:04 | 435K | |
| lua-mode-20210802_5.pkg | 2023-10-11 00:50 | 22K | |
| lua-mode-emacs_canna..> | 2023-10-10 20:07 | 22K | |
| lua-mode-emacs_devel..> | 2023-10-09 02:13 | 22K | |
| lua-mode-emacs_devel..> | 2023-10-08 22:27 | 22K | |
| lua-mode-emacs_nox-2..> | 2023-10-09 07:36 | 22K | |
| lua-rds-parser-0.06.pkg | 2023-10-09 14:57 | 4.1K | |
| lua-resty-core-0.1.2..> | 2023-10-07 20:11 | 29K | |
| lua-resty-dns-0.22.pkg | 2023-10-09 13:48 | 10K | |
| lua-resty-http-0.17...> | 2023-10-09 07:44 | 16K | |
| lua-resty-lrucache-0..> | 2023-10-07 01:56 | 7.1K | |
| lua-resty-redis-0.29..> | 2023-10-14 06:10 | 3.8K | |
| lua-resty-string-0.1..> | 2023-10-09 09:51 | 6.3K | |
| lua51-5.1.5_9.pkg | 2023-10-06 19:50 | 168K | |
| lua51-argon2-3.0.1.pkg | 2023-10-10 22:34 | 4.1K | |
| lua51-argparse-0.7.1..> | 2023-10-14 18:49 | 12K | |
| lua51-bcrypt-2.3.1.pkg | 2023-10-09 03:21 | 11K | |
| lua51-bitlib-24_1.pkg | 2023-10-08 18:21 | 2.5K | |
| lua51-bitop-1.0.2_2.pkg | 2023-10-08 12:37 | 3.2K | |
| lua51-cjson-2.1.0_1.pkg | 2023-10-10 00:31 | 11K | |
| lua51-cqueues-202007..> | 2023-10-08 02:29 | 318K | |
| lua51-gettext-1.6.pkg | 2023-10-09 21:28 | 2.9K | |
| lua51-iconv-7_4.pkg | 2023-10-10 06:46 | 3.3K | |
| lua51-icu-utils-0.0...> | 2023-10-09 02:07 | 4.6K | |
| lua51-json-1.3.4_1.pkg | 2023-10-10 15:26 | 13K | |
| lua51-lgi-0.9.2_3.pkg | 2023-10-11 15:53 | 75K | |
| lua51-libevent-0.4.6..> | 2023-10-14 08:35 | 11K | |
| lua51-lpeg-1.1.0.pkg | 2023-10-07 15:09 | 27K | |
| lua51-lsqlite3-0.9.5..> | 2023-10-09 07:01 | 534K | |
| lua51-lua-gd-2.0.33r..> | 2023-10-10 23:27 | 382K | |
| lua51-luaexpat-1.5.1..> | 2023-10-08 22:19 | 14K | |
| lua51-luafilesystem-..> | 2023-10-07 23:08 | 22K | |
| lua51-lualdap-1.3.1.pkg | 2023-10-08 21:31 | 14K | |
| lua51-luarocks-3.9.2..> | 2023-10-07 18:18 | 130K | |
| lua51-luasec-1.3.2.pkg | 2023-10-14 12:26 | 27K | |
| lua51-luasocket-3.1...> | 2023-10-07 16:27 | 159K | |
| lua51-luasql-firebir..> | 2023-10-09 01:29 | 8.5K | |
| lua51-luasql-mysql-2..> | 2023-10-08 12:28 | 7.0K | |
| lua51-luasql-odbc-2...> | 2023-10-09 01:36 | 8.8K | |
| lua51-luasql-postgre..> | 2023-10-10 02:34 | 6.5K | |
| lua51-luasql-sqlite3..> | 2023-10-11 22:11 | 6.5K | |
| lua51-luaunbound-1.0..> | 2023-10-09 16:15 | 5.2K | |
| lua51-lyaml-6.2.4_1.pkg | 2023-10-09 10:42 | 24K | |
| lua51-lzlib-0.4.3_1.pkg | 2023-10-10 10:55 | 13K | |
| lua51-mpd-0.1_1.pkg | 2023-10-08 21:32 | 11K | |
| lua51-posix-36.2.1.pkg | 2023-10-08 18:56 | 93K | |
| lua51-pty-1.26.pkg | 2023-10-09 00:06 | 5.0K | |
| lua51-puremagic-1.0...> | 2023-10-14 08:16 | 5.5K | |
| lua51-stdlib-41.2.2_..> | 2023-10-09 19:52 | 73K | |
| lua51-stdlib-debug-1..> | 2023-10-07 04:50 | 7.1K | |
| lua51-stdlib-normali..> | 2023-10-08 01:52 | 25K | |
| lua51-xapian-1.4.23.pkg | 2023-10-09 17:22 | 473K | |
| lua51-zlib-1.2_1.pkg | 2023-10-10 13:25 | 5.3K | |
| lua52-5.2.4.pkg | 2023-10-06 19:18 | 176K | |
| lua52-argon2-3.0.1.pkg | 2023-10-10 16:02 | 4.0K | |
| lua52-argparse-0.7.1..> | 2023-10-11 04:19 | 12K | |
| lua52-bcrypt-2.3.1.pkg | 2023-10-09 09:17 | 11K | |
| lua52-bitlib-24_1.pkg | 2023-10-10 22:50 | 2.5K | |
| lua52-bitop-1.0.2_2.pkg | 2023-10-07 06:59 | 2.9K | |
| lua52-cjson-2.1.0_1.pkg | 2023-10-09 14:15 | 11K | |
| lua52-cqueues-202007..> | 2023-10-10 23:00 | 314K | |
| lua52-iconv-7_4.pkg | 2023-10-14 04:37 | 3.3K | |
| lua52-icu-utils-0.0...> | 2023-10-09 13:36 | 4.6K | |
| lua52-json-1.3.4_1.pkg | 2023-10-10 19:22 | 13K | |
| lua52-lgi-0.9.2_3.pkg | 2023-10-09 04:36 | 75K | |
| lua52-libevent-0.4.6..> | 2023-10-10 19:23 | 11K | |
| lua52-lpeg-1.1.0.pkg | 2023-10-06 23:31 | 27K | |
| lua52-lsqlite3-0.9.5..> | 2023-10-09 18:26 | 535K | |
| lua52-lua-gd-2.0.33r..> | 2023-10-14 08:21 | 382K | |
| lua52-luaexpat-1.5.1..> | 2023-10-14 15:50 | 14K | |
| lua52-luafilesystem-..> | 2023-10-08 11:27 | 22K | |
| lua52-lualdap-1.3.1.pkg | 2023-10-09 03:08 | 14K | |
| lua52-luarocks-3.9.2..> | 2023-10-08 06:46 | 130K | |
| lua52-luasec-1.3.2.pkg | 2023-10-14 18:46 | 26K | |
| lua52-luasocket-3.1...> | 2023-10-07 10:03 | 158K | |
| lua52-luasql-firebir..> | 2023-10-09 01:40 | 8.3K | |
| lua52-luasql-mysql-2..> | 2023-10-09 12:41 | 6.8K | |
| lua52-luasql-odbc-2...> | 2023-10-08 20:50 | 8.6K | |
| lua52-luasql-postgre..> | 2023-10-10 16:41 | 6.2K | |
| lua52-luasql-sqlite3..> | 2023-10-09 19:07 | 6.3K | |
| lua52-luaunbound-1.0..> | 2023-10-14 04:52 | 5.3K | |
| lua52-lyaml-6.2.4_1.pkg | 2023-10-08 15:48 | 24K | |
| lua52-lzlib-0.4.3_1.pkg | 2023-10-14 13:19 | 13K | |
| lua52-posix-36.2.1.pkg | 2023-10-09 22:08 | 66K | |
| lua52-puremagic-1.0...> | 2023-10-09 07:45 | 5.5K | |
| lua52-stdlib-41.2.2_..> | 2023-10-11 10:15 | 73K | |
| lua52-stdlib-debug-1..> | 2023-10-07 05:26 | 7.1K | |
| lua52-stdlib-normali..> | 2023-10-07 11:08 | 25K | |
| lua52-sysctl-2.1.pkg | 2023-10-12 02:06 | 7.4K | |
| lua52-xapian-1.4.23.pkg | 2023-10-10 09:09 | 475K | |
| lua53-5.3.6.pkg | 2023-10-05 16:43 | 281K | |
| lua53-argon2-3.0.1.pkg | 2023-10-09 15:59 | 4.0K | |
| lua53-argparse-0.7.1..> | 2023-10-11 02:28 | 12K | |
| lua53-bcrypt-2.3.1.pkg | 2023-10-09 13:30 | 11K | |
| lua53-bitlib-24_1.pkg | 2023-10-10 18:29 | 2.5K | |
| lua53-bitop-1.0.2_2.pkg | 2023-10-10 20:23 | 3.0K | |
| lua53-cjson-2.1.0_1.pkg | 2023-10-09 03:59 | 11K | |
| lua53-cqueues-202007..> | 2023-10-14 16:49 | 312K | |
| lua53-iconv-7_4.pkg | 2023-10-14 10:38 | 3.4K | |
| lua53-icu-utils-0.0...> | 2023-10-08 11:57 | 4.6K | |
| lua53-json-1.3.4_1.pkg | 2023-10-10 03:35 | 13K | |
| lua53-lgi-0.9.2_3.pkg | 2023-10-07 04:25 | 75K | |
| lua53-libevent-0.4.6..> | 2023-10-09 07:39 | 11K | |
| lua53-lpeg-1.1.0.pkg | 2023-10-08 07:10 | 26K | |
| lua53-lsqlite3-0.9.5..> | 2023-10-08 14:14 | 535K | |
| lua53-lua-gd-2.0.33r..> | 2023-10-09 12:08 | 382K | |
| lua53-luaexpat-1.5.1..> | 2023-10-09 13:25 | 14K | |
| lua53-luafilesystem-..> | 2023-10-08 18:02 | 22K | |
| lua53-lualdap-1.3.1.pkg | 2023-10-09 17:19 | 14K | |
| lua53-luarocks-3.9.2..> | 2023-10-07 12:36 | 130K | |
| lua53-luasec-1.3.2.pkg | 2023-10-11 02:06 | 27K | |
| lua53-luasocket-3.1...> | 2023-10-07 23:24 | 158K | |
| lua53-luasql-firebir..> | 2023-10-09 04:31 | 8.3K | |
| lua53-luasql-mysql-2..> | 2023-10-10 04:04 | 6.8K | |
| lua53-luasql-odbc-2...> | 2023-10-09 22:12 | 8.6K | |
| lua53-luasql-postgre..> | 2023-10-09 01:29 | 6.2K | |
| lua53-luasql-sqlite3..> | 2023-10-08 15:00 | 6.2K | |
| lua53-luaunbound-1.0..> | 2023-10-09 10:48 | 5.3K | |
| lua53-lyaml-6.2.4_1.pkg | 2023-10-10 07:52 | 24K | |
| lua53-pgsql-1.6.8_1.pkg | 2023-10-10 04:01 | 15K | |
| lua53-posix-36.2.1.pkg | 2023-10-08 13:06 | 67K | |
| lua53-puremagic-1.0...> | 2023-10-09 21:28 | 5.5K | |
| lua53-stdlib-41.2.2_..> | 2023-10-09 02:27 | 73K | |
| lua53-stdlib-debug-1..> | 2023-10-07 04:47 | 7.1K | |
| lua53-stdlib-normali..> | 2023-10-08 03:05 | 25K | |
| lua53-sysctl-2.1.pkg | 2023-10-14 16:34 | 7.5K | |
| lua53-xapian-1.4.23.pkg | 2023-10-10 07:40 | 474K | |
| lua54-5.4.6.pkg | 2023-10-05 16:42 | 317K | |
| lua54-Penlight-1.13...> | 2023-10-14 04:57 | 101K | |
| lua54-argon2-3.0.1.pkg | 2023-10-11 07:22 | 4.0K | |
| lua54-argparse-0.7.1..> | 2023-10-07 00:36 | 12K | |
| lua54-bcrypt-2.3.1.pkg | 2023-10-14 17:42 | 11K | |
| lua54-bitlib-24_1.pkg | 2023-10-09 06:29 | 2.5K | |
| lua54-bitop-1.0.2_2.pkg | 2023-10-06 22:53 | 3.0K | |
| lua54-cjson-2.1.0_1.pkg | 2023-10-14 09:32 | 11K | |
| lua54-cqueues-202007..> | 2023-10-08 21:06 | 312K | |
| lua54-iconv-7_4.pkg | 2023-10-14 05:50 | 3.4K | |
| lua54-icu-utils-0.0...> | 2023-10-09 07:48 | 4.6K | |
| lua54-json-1.3.4_1.pkg | 2023-10-14 07:29 | 13K | |
| lua54-lgi-0.9.2_3.pkg | 2023-10-14 07:04 | 76K | |
| lua54-libevent-0.4.6..> | 2023-10-06 20:03 | 11K | |
| lua54-lpeg-1.1.0.pkg | 2023-10-08 09:47 | 27K | |
| lua54-lsqlite3-0.9.5..> | 2023-10-10 05:05 | 535K | |
| lua54-lua-gd-2.0.33r..> | 2023-10-14 18:37 | 382K | |
| lua54-luacheck-0.25...> | 2023-10-07 22:28 | 67K | |
| lua54-luaexpat-1.5.1..> | 2023-10-06 21:57 | 14K | |
| lua54-luafilesystem-..> | 2023-10-06 20:14 | 22K | |
| lua54-lualdap-1.3.1.pkg | 2023-10-09 08:40 | 14K | |
| lua54-luarocks-3.9.2..> | 2023-10-08 10:59 | 130K | |
| lua54-luasec-1.3.2.pkg | 2023-10-06 19:52 | 27K | |
| lua54-luasocket-3.1...> | 2023-10-06 17:51 | 158K | |
| lua54-luasql-firebir..> | 2023-10-10 05:24 | 8.4K | |
| lua54-luasql-mysql-2..> | 2023-10-10 05:52 | 6.9K | |
| lua54-luasql-odbc-2...> | 2023-10-09 18:51 | 8.7K | |
| lua54-luasql-postgre..> | 2023-10-08 23:17 | 6.3K | |
| lua54-luasql-sqlite3..> | 2023-10-10 03:36 | 6.4K | |
| lua54-luaunbound-1.0..> | 2023-10-06 18:39 | 5.3K | |
| lua54-lunit-0.5.pkg | 2023-10-09 14:00 | 11K | |
| lua54-lyaml-6.2.4_1.pkg | 2023-10-09 19:48 | 24K | |
| lua54-pgsql-1.6.8_1.pkg | 2023-10-09 15:09 | 15K | |
| lua54-posix-36.2.1.pkg | 2023-10-10 18:58 | 67K | |
| lua54-puremagic-1.0...> | 2023-10-14 08:27 | 5.5K | |
| lua54-stdlib-41.2.2_..> | 2023-10-14 03:50 | 73K | |
| lua54-stdlib-debug-1..> | 2023-10-07 09:30 | 7.1K | |
| lua54-stdlib-normali..> | 2023-10-08 06:32 | 25K | |
| lua54-sysctl-2.1.pkg | 2023-10-09 07:49 | 7.5K | |
| lua54-xapian-1.4.23.pkg | 2023-10-08 07:48 | 474K | |
| luabind-0.9.1_17.pkg | 2023-10-07 10:23 | 162K | |
| luajava-1.1_2.pkg | 2023-10-10 07:19 | 143K | |
| luajit-2.0.5_6.pkg | 2023-10-07 09:32 | 373K | |
| luajit-devel-2.1.0.2..> | 2023-10-06 20:15 | 441K | |
| luajit-openresty-2.1..> | 2023-10-06 19:15 | 1.3M | |
| luakit-2.3.3,1.pkg | 2023-10-10 21:51 | 411K | |
| luakit-devel-2.3.3.0..> | 2023-10-11 13:35 | 412K | |
| lucene++-3.0.8_5.pkg | 2023-10-07 20:23 | 1.6M | |
| lucene-3.6.2.pkg | 2023-10-08 01:27 | 17M | |
| lucene5-5.5.5.pkg | 2023-10-07 09:29 | 18M | |
| luckybackup-0.5.0_2.pkg | 2023-10-14 16:24 | 4.7M | |
| lugaru-1.2_2,1.pkg | 2023-10-10 10:53 | 33M | |
| luit-20230201.pkg | 2023-10-06 14:47 | 37K | |
| lumina-1.6.2_1,3.pkg | 2023-10-09 18:27 | 924 | |
| lumina-archiver-1.6...> | 2023-10-08 03:57 | 167K | |
| lumina-calculator-1...> | 2023-10-08 06:15 | 33K | |
| lumina-core-1.6.2_7.pkg | 2023-10-08 06:49 | 7.9M | |
| lumina-coreutils-1.6..> | 2023-10-07 21:53 | 538K | |
| lumina-fileinfo-1.6...> | 2023-10-07 14:55 | 161K | |
| lumina-fm-1.6.2.pkg | 2023-10-08 05:34 | 351K | |
| lumina-mediaplayer-1..> | 2023-10-07 19:44 | 198K | |
| lumina-pdf-1.6.2_13.pkg | 2023-10-07 22:17 | 66K | |
| lumina-photo-1.6.2.pkg | 2023-10-07 19:43 | 133K | |
| lumina-screenshot-1...> | 2023-10-08 03:42 | 170K | |
| lumina-textedit-1.6...> | 2023-10-08 11:32 | 188K | |
| lumina-themes-201710..> | 2023-10-09 06:44 | 202M | |
| luminance-hdr-2.6.1...> | 2023-10-10 15:27 | 4.5M | |
| luna-1.9.pkg | 2023-10-08 13:46 | 10K | |
| luola-1.3.2_7.pkg | 2023-10-11 11:28 | 4.5M | |
| lupe-0.08c.pkg | 2023-10-09 11:07 | 12K | |
| luppp-1.2.1_4.pkg | 2023-10-10 16:23 | 117K | |
| lurch-0.7.0_1.pkg | 2023-10-10 04:39 | 22K | |
| lurker-2.3_3.pkg | 2023-10-09 14:50 | 379K | |
| luscus-0.8.6_4.pkg | 2023-10-14 14:49 | 199K | |
| lusernet-0.4.2_12.pkg | 2023-10-08 05:46 | 90K | |
| lutok-0.4_8.pkg | 2023-10-07 19:59 | 189K | |
| luv-1.45.0.0.pkg | 2023-10-07 01:26 | 78K | |
| lux-0.19.0_2.pkg | 2023-10-10 04:41 | 4.6M | |
| lux-pv-1.1.8.pkg | 2023-10-14 11:59 | 2.8M | |
| lv-4.51.20200728.pkg | 2023-10-12 02:06 | 311K | |
| lv-aspell-0.5.5.1_1,..> | 2023-10-09 22:56 | 181K | |
| lv-libreoffice-7.5.5..> | 2023-10-08 04:52 | 2.8M | |
| lv2-1.18.4_2.pkg | 2023-10-06 15:45 | 188K | |
| lv2file-0.95_1.pkg | 2023-10-09 23:06 | 13K | |
| lv2lint-0.16.2_1.pkg | 2023-10-08 09:31 | 26K | |
| lv2proc-0.5.1_2.pkg | 2023-10-08 14:47 | 11K | |
| lvtk-2.0.0.r1.14.pkg | 2023-10-12 07:22 | 27K | |
| lwjgl-2.9.4.20161208..> | 2023-10-08 11:15 | 1.4M | |
| lwm-1.2.4.pkg | 2023-10-09 03:49 | 31K | |
| lwp-2.8.pkg | 2023-10-07 11:19 | 27K | |
| lxappearance-0.6.3_1..> | 2023-10-06 23:24 | 74K | |
| lxappearance-obconf-..> | 2023-10-07 14:49 | 47K | |
| lxde-common-0.99.2_2..> | 2023-10-08 06:24 | 791K | |
| lxde-icon-theme-0.5...> | 2023-10-07 00:24 | 4.3M | |
| lxde-meta-1.0_8.pkg | 2023-10-10 23:25 | 964 | |
| lxhotkey-0.1.1_2.pkg | 2023-10-08 04:03 | 53K | |
| lxi-tools-2.5.pkg | 2023-10-09 14:41 | 20K | |
| lximage-qt-1.3.0.pkg | 2023-10-08 09:20 | 189K | |
| lxinput-0.3.5_1.pkg | 2023-10-07 19:11 | 52K | |
| lxmenu-data-0.1.5.pkg | 2023-10-07 07:10 | 45K | |
| lxmf-0.3.2.pkg | 2023-10-08 08:16 | 49K | |
| lxpanel-0.9.3_4.pkg | 2023-10-08 11:07 | 1.1M | |
| lxqt-1.3.0.pkg | 2023-10-10 20:50 | 952 | |
| lxqt-about-1.3.0.pkg | 2023-10-07 19:47 | 52K | |
| lxqt-admin-1.3.0.pkg | 2023-10-08 02:23 | 80K | |
| lxqt-archiver-0.8.0.pkg | 2023-10-07 13:01 | 199K | |
| lxqt-build-tools-0.1..> | 2023-10-06 14:04 | 20K | |
| lxqt-config-1.3.0_1.pkg | 2023-10-07 11:26 | 416K | |
| lxqt-globalkeys-1.3...> | 2023-10-06 23:29 | 155K | |
| lxqt-notificationd-1..> | 2023-10-07 23:07 | 75K | |
| lxqt-openssh-askpass..> | 2023-10-07 17:52 | 13K | |
| lxqt-panel-1.3.0_1.pkg | 2023-10-08 07:06 | 606K | |
| lxqt-policykit-1.3.0..> | 2023-10-07 17:30 | 21K | |
| lxqt-powermanagement..> | 2023-10-08 10:52 | 117K | |
| lxqt-qtplugin-1.3.0.pkg | 2023-10-07 19:36 | 27K | |
| lxqt-runner-1.3.0.pkg | 2023-10-08 09:00 | 71K | |
| lxqt-session-1.3.0.pkg | 2023-10-07 10:16 | 145K | |
| lxqt-sudo-1.3.0.pkg | 2023-10-07 14:44 | 40K | |
| lxqt-themes-1.2.0.pkg | 2023-10-07 15:13 | 25M | |
| lxrandr-0.3.2_1.pkg | 2023-10-07 11:30 | 48K | |
| lxsession-0.5.5.pkg | 2023-10-08 00:39 | 259K | |
| lxsplit-0.2.4_3.pkg | 2023-10-11 00:57 | 7.3K | |
| lxtask-0.1.10_1.pkg | 2023-10-08 00:36 | 54K | |
| lxterminal-0.4.0_1.pkg | 2023-10-08 07:28 | 84K | |
| ly-0.6.0.pkg | 2023-10-14 05:24 | 37K | |
| lychee-0.13.0_3.pkg | 2023-10-09 21:21 | 3.1M | |
| lynis-3.0.8.pkg | 2023-10-10 20:23 | 246K | |
| lynx-2.8.9.1_1,1.pkg | 2023-10-06 23:16 | 1.6M | |
| lynx-current-2.9.0d1..> | 2023-10-10 18:54 | 1.6M | |
| lyra-1.6.1.pkg | 2023-10-08 20:21 | 25K | |
| lysdr-0.0.6_5.pkg | 2023-10-09 10:36 | 15K | |
| lyx-2.3.7.pkg | 2023-10-14 02:55 | 18M | |
| lz4json-20191229.pkg | 2023-10-14 14:07 | 3.6K | |
| lzbench-1.8.1.pkg | 2023-10-08 16:14 | 1.3M | |
| lzfse-20160707.pkg | 2023-10-09 11:11 | 20K | |
| lzip-1.23.pkg | 2023-10-08 22:17 | 64K | |
| lziprecover-1.23.pkg | 2023-10-14 14:17 | 103K | |
| lzlib-1.13.pkg | 2023-10-08 07:11 | 42K | |
| lzma-19.00.pkg | 2023-10-07 08:30 | 96K | |
| lzmalib-0.0.1_1.pkg | 2023-10-14 14:14 | 102K | |
| lzo2-2.10_1.pkg | 2023-10-06 15:43 | 113K | |
| lzop-1.04.pkg | 2023-10-07 07:34 | 65K | |
| lzr-1_2.pkg | 2023-10-09 08:21 | 1.6M | |
| m-aneos-1.0.1_1.pkg | 2023-10-10 21:59 | 122K | |
| m2vrequantiser-1.1.pkg | 2023-10-10 22:15 | 12K | |
| m4-1.4.19,1.pkg | 2023-10-05 17:17 | 248K | |
| m17n-db-1.8.0.pkg | 2023-10-07 03:30 | 1.2M | |
| m17n-docs-1.5.5.pkg | 2023-10-10 20:37 | 1.1M | |
| m17n-im-config-0.9.0..> | 2023-10-10 14:30 | 24K | |
| m17n-lib-1.8.0_4.pkg | 2023-10-08 02:50 | 385K | |
| mDNSResponder-1790.8..> | 2023-10-08 00:44 | 402K | |
| mDNSResponder_nss-17..> | 2023-10-14 06:36 | 12K | |
| mac-3.99.4.5.7_1.pkg | 2023-10-06 22:03 | 99K | |
| mac-robber-1.02.pkg | 2023-10-09 09:38 | 5.7K | |
| mac-telnet-1.0.0.a1.pkg | 2023-10-09 22:03 | 37K | |
| mac_nonet-kmod-g2015..> | 2023-10-08 17:44 | 2.5K | |
| mac_rtprio-kmod-g201..> | 2023-10-14 16:27 | 2.3K | |
| macchanger-1.7.0_2.pkg | 2023-10-10 03:37 | 178K | |
| mackerel-agent-0.77...> | 2023-10-09 19:45 | 1.9M | |
| macopix-1.7.4_15.pkg | 2023-10-11 15:56 | 3.8M | |
| mad_fcl-1.7.pkg | 2023-10-09 17:43 | 92K | |
| madbomber-0.2.5_15.pkg | 2023-10-09 20:17 | 2.1M | |
| madfufw-1.0_1.pkg | 2023-10-09 11:16 | 15K | |
| madness-0.10.1.20180..> | 2023-10-09 03:10 | 7.1M | |
| madonctl-2.3.2_8.pkg | 2023-10-09 12:23 | 2.8M | |
| madplay-0.15.2b_9.pkg | 2023-10-07 02:58 | 49K | |
| madronalib-1.6.1016_..> | 2023-10-09 03:12 | 173K | |
| madsonic-jetty-6.2.9..> | 2023-10-09 09:35 | 66M | |
| maelstrom-3.0.6_14.pkg | 2023-10-10 02:34 | 675K | |
| maeparser-1.3.1_1.pkg | 2023-10-06 16:45 | 85K | |
| mafft-7.267.pkg | 2023-10-07 12:43 | 943K | |
| mage-1.15.0_1,1.pkg | 2023-10-07 00:08 | 1.1M | |
| magia-0.2.0_15.pkg | 2023-10-10 12:33 | 1.2M | |
| magic-8.3.315.pkg | 2023-10-07 19:35 | 1.5M | |
| magic_enum-0.9.3.pkg | 2023-10-07 16:27 | 23K | |
| magiccube4d-2.2_3.pkg | 2023-10-08 23:28 | 56K | |
| magicfilter-2.3.i.pkg | 2023-10-14 06:32 | 23K | |
| magicpoint-1.13a_19.pkg | 2023-10-14 04:10 | 608K | |
| magicrescue-1.1.10.pkg | 2023-10-14 10:41 | 61K | |
| magit-3.3.0_11.pkg | 2023-10-07 22:29 | 621K | |
| magit-devel-3.3.0.73..> | 2023-10-08 06:02 | 604K | |
| magit-devel-emacs_ca..> | 2023-10-08 00:39 | 604K | |
| magit-devel-emacs_de..> | 2023-10-08 03:57 | 590K | |
| magit-devel-emacs_de..> | 2023-10-08 11:15 | 590K | |
| magit-devel-emacs_no..> | 2023-10-08 04:24 | 604K | |
| magit-emacs_canna-3...> | 2023-10-08 07:17 | 621K | |
| magit-emacs_devel-3...> | 2023-10-07 13:19 | 621K | |
| magit-emacs_devel_no..> | 2023-10-08 09:53 | 621K | |
| magit-emacs_nox-3.3...> | 2023-10-07 13:22 | 621K | |
| magnum-2020.06.2037_..> | 2023-10-08 11:07 | 1.3M | |
| magnum-plugins-2020...> | 2023-10-10 18:47 | 614K | |
| magpie-0.9.3.pkg | 2023-10-06 20:23 | 1.8M | |
| mahjong-1.16_1.pkg | 2023-10-14 17:02 | 182K | |
| mai-libreoffice-7.5...> | 2023-10-07 13:52 | 224K | |
| maia-1.0.4_11.pkg | 2023-10-14 06:47 | 889K | |
| mail-expire-0.9.2.pkg | 2023-10-10 13:01 | 11K | |
| mail2nntp-1.0.pkg | 2023-10-09 22:37 | 3.2K | |
| mail2sms-1.3.5_1.pkg | 2023-10-11 12:57 | 51K | |
| mailagent-3.1.106_1.pkg | 2023-10-10 23:54 | 303K | |
| mailcommon-23.08.1_1..> | 2023-10-06 18:23 | 714K | |
| maildrop-3.1.6.pkg | 2023-10-08 20:09 | 365K | |
| mailest-0.9.24_15.pkg | 2023-10-14 14:38 | 47K | |
| mailest-emacs_canna-..> | 2023-10-09 00:16 | 47K | |
| mailest-emacs_devel-..> | 2023-10-09 15:57 | 47K | |
| mailest-emacs_devel_..> | 2023-10-10 22:21 | 47K | |
| mailest-emacs_nox-0...> | 2023-10-14 18:13 | 47K | |
| mailfromd-8.17.1.pkg | 2023-10-07 21:48 | 734K | |
| mailfront-2.22.pkg | 2023-10-11 17:09 | 89K | |
| mailgraph-1.14_10.pkg | 2023-10-14 04:22 | 15K | |
| mailhog-1.0.1_14.pkg | 2023-10-09 20:09 | 3.0M | |
| mailimporter-23.08.1..> | 2023-10-06 15:34 | 219K | |
| mailman-2.1.39_1.pkg | 2023-10-09 21:59 | 3.5M | |
| mailman-exim4-2.1.39..> | 2023-10-08 12:04 | 3.5M | |
| mailman-postfix-2.1...> | 2023-10-11 10:09 | 3.5M | |
| mailpit-1.8.4_1.pkg | 2023-10-11 15:57 | 5.8M | |
| mailslurper-1.14.2.g..> | 2023-10-09 21:46 | 4.9M | |
| mailsync-5.2.1_4.pkg | 2023-10-09 00:16 | 62K | |
| mailutils-3.16_1.pkg | 2023-10-06 12:56 | 1.8M | |
| mailx-0.5_2.pkg | 2023-10-14 07:00 | 53K | |
| mailzu-php80-0.8.r3_..> | 2023-10-10 01:14 | 375K | |
| mailzu-php81-0.8.r3_..> | 2023-10-11 03:04 | 375K | |
| maim-5.7.4_6.pkg | 2023-10-14 04:32 | 73K | |
| maitretarot-0.1.98_7..> | 2023-10-08 10:26 | 14K | |
| make++-2.0.pkg | 2023-10-14 05:27 | 660K | |
| makedepend-1.0.6,1.pkg | 2023-10-05 16:54 | 20K | |
| makefaq-2.5_1.pkg | 2023-10-09 13:08 | 24K | |
| makeindex-3.0.8_1.pkg | 2023-10-10 04:41 | 37K | |
| makemkv-1.17.4.pkg | 2023-10-10 02:30 | 11M | |
| makenl-3.5.1.pkg | 2023-10-09 00:09 | 76K | |
| makepasswd-1.10_7.pkg | 2023-10-10 21:22 | 7.9K | |
| makepatch-2.05_1.pkg | 2023-10-14 04:09 | 31K | |
| makeself-2.5.0.pkg | 2023-10-09 10:42 | 20K | |
| mako-1.8.0.pkg | 2023-10-11 08:23 | 41K | |
| malbolge-0.1.1.pkg | 2023-10-09 19:58 | 7.8K | |
| maliit-framework-2.3..> | 2023-10-07 11:41 | 326K | |
| maliit-keyboard-2.3...> | 2023-10-10 14:23 | 25M | |
| malint-0.2.pkg | 2023-10-09 23:04 | 15K | |
| malloy-0.6.2.pkg | 2023-10-14 07:53 | 1.6M | |
| malo-firmware-kmod-3..> | 2023-10-08 12:33 | 27K | |
| maltrail-0.60.pkg | 2023-10-10 04:07 | 6.0M | |
| mamba-2.5.pkg | 2023-10-14 08:09 | 383K | |
| mame-0.258_1.pkg | 2023-10-07 19:08 | 69M | |
| man2html-3.1.2022071..> | 2023-10-05 16:51 | 18K | |
| man2web-0.88_2.pkg | 2023-10-14 09:38 | 22K | |
| manaplus-2.1.3.17_4.pkg | 2023-10-14 03:35 | 9.4M | |
| mancala-1.0.3.pkg | 2023-10-14 10:28 | 12K | |
| manck-1.2_2.pkg | 2023-10-10 00:31 | 9.4K | |
| mandelbulber-2.30_2.pkg | 2023-10-10 15:00 | 107M | |
| mangband-1.5.3.pkg | 2023-10-08 14:10 | 1.6M | |
| manrope-4.504.pkg | 2023-10-09 23:55 | 1.2M | |
| mantis-php80-2.25.6,..> | 2023-10-09 04:38 | 13M | |
| mantis-php81-2.25.6,..> | 2023-10-10 06:10 | 13M | |
| mantis-php82-2.25.6,..> | 2023-10-12 03:56 | 13M | |
| mantis-php83-2.25.6,..> | 2023-10-09 03:57 | 13M | |
| mantra-0.1.1.pkg | 2023-10-09 14:09 | 2.7K | |
| manu-gothica-0_5.pkg | 2023-10-14 05:45 | 35K | |
| mapcache-1.14.0_3.pkg | 2023-10-10 15:36 | 160K | |
| mapchan-3.2_3.pkg | 2023-10-09 12:52 | 21K | |
| mapdir-1.2.1.pkg | 2023-10-11 15:50 | 7.9K | |
| mapm3-3.0_1.pkg | 2023-10-08 22:27 | 282K | |
| mapnik-3.1.0_3.pkg | 2023-10-08 11:00 | 3.1M | |
| mapserver-8.0.1_3.pkg | 2023-10-11 00:21 | 1.1M | |
| mapyrus-1.802.pkg | 2023-10-10 05:04 | 3.0M | |
| mar-0.5.pkg | 2023-10-09 18:14 | 24K | |
| maradns-2.0.15.pkg | 2023-10-08 13:25 | 438K | |
| marble-23.08.1.pkg | 2023-10-07 05:15 | 45M | |
| marblemarcher-1.4.5_..> | 2023-10-10 15:08 | 46M | |
| marco-1.26.0_1.pkg | 2023-10-06 21:26 | 1.1M | |
| mari0-1.6.2.pkg | 2023-10-10 13:08 | 3.1M | |
| mariadb-connector-c-..> | 2023-10-07 01:53 | 325K | |
| mariadb-connector-od..> | 2023-10-10 09:48 | 86K | |
| mariadb105-client-10..> | 2023-10-07 10:43 | 1.7M | |
| mariadb105-server-10..> | 2023-10-09 18:55 | 28M | |
| mariadb106-client-10..> | 2023-10-08 12:04 | 1.9M | |
| mariadb106-server-10..> | 2023-10-08 14:28 | 42M | |
| mariadb1011-client-1..> | 2023-10-07 16:56 | 2.1M | |
| mariadb1011-server-1..> | 2023-10-08 13:29 | 43M | |
| marisa-trie-0.2.6_1,..> | 2023-10-06 15:50 | 102K | |
| markdown-1.0.1_2.pkg | 2023-10-14 17:27 | 15K | |
| markdown-mode.el-2.6..> | 2023-10-08 00:41 | 157K | |
| markdown-mode.el-ema..> | 2023-10-08 08:35 | 157K | |
| markdown-mode.el-ema..> | 2023-10-07 16:53 | 157K | |
| markdown-mode.el-ema..> | 2023-10-07 16:27 | 157K | |
| markdown-mode.el-ema..> | 2023-10-08 01:02 | 157K | |
| markdownfmt-1.1.67_1..> | 2023-10-14 13:09 | 861K | |
| markdownpart-23.08.1..> | 2023-10-14 08:34 | 33K | |
| marker-2023.05.02.pkg | 2023-10-10 06:36 | 2.3M | |
| marl-g20210818.pkg | 2023-10-10 14:23 | 55K | |
| mashmap-3.1.1.pkg | 2023-10-10 08:24 | 155K | |
| masqmail-0.3.5.pkg | 2023-10-14 04:05 | 109K | |
| massadmin-2.3_1.pkg | 2023-10-10 00:59 | 12K | |
| masscan-1.3.2.pkg | 2023-10-10 20:04 | 191K | |
| massif-visualizer-0...> | 2023-10-14 03:34 | 86K | |
| massxpert-6.0.3.pkg | 2023-10-10 23:38 | 1.1M | |
| masterserver-0.4.1.pkg | 2023-10-08 16:04 | 27K | |
| mastodon-4.1.7.pkg | 2023-10-08 18:24 | 31M | |
| match-1.0.pkg | 2023-10-08 17:14 | 33K | |
| matcha-gtk-themes-20..> | 2023-10-10 19:54 | 1.9M | |
| mate-1.26.0_2.pkg | 2023-10-14 06:13 | 1.1K | |
| mate-applet-appmenu-..> | 2023-10-10 09:05 | 53K | |
| mate-applets-1.26.0_..> | 2023-10-07 11:28 | 6.7M | |
| mate-backgrounds-1.2..> | 2023-10-07 02:28 | 44M | |
| mate-base-1.26.0_1.pkg | 2023-10-07 18:21 | 1.1K | |
| mate-calc-1.26.0_4.pkg | 2023-10-07 19:13 | 687K | |
| mate-common-1.26.0.pkg | 2023-10-08 23:32 | 11K | |
| mate-control-center-..> | 2023-10-07 08:25 | 2.3M | |
| mate-desktop-1.26.0_..> | 2023-10-06 17:42 | 724K | |
| mate-dock-applet-21...> | 2023-10-14 17:10 | 158K | |
| mate-icon-theme-1.26..> | 2023-10-06 21:14 | 13M | |
| mate-icon-theme-faen..> | 2023-10-10 13:41 | 19M | |
| mate-indicator-apple..> | 2023-10-09 14:40 | 81K | |
| mate-installed-setti..> | 2023-10-10 06:51 | 2.9K | |
| mate-media-1.26.0_4.pkg | 2023-10-07 20:04 | 220K | |
| mate-menus-1.26.0.pkg | 2023-10-06 18:20 | 126K | |
| mate-notification-da..> | 2023-10-07 02:09 | 115K | |
| mate-pam-helper-1.3.pkg | 2023-10-07 09:45 | 3.5K | |
| mate-panel-1.26.2_2,..> | 2023-10-06 22:53 | 1.9M | |
| mate-polkit-1.26.0_1..> | 2023-10-06 23:31 | 48K | |
| mate-power-manager-1..> | 2023-10-07 18:22 | 5.4M | |
| mate-screensaver-1.2..> | 2023-10-07 20:11 | 4.5M | |
| mate-session-manager..> | 2023-10-07 00:16 | 307K | |
| mate-settings-daemon..> | 2023-10-06 20:33 | 539K | |
| mate-system-monitor-..> | 2023-10-08 00:02 | 1.9M | |
| mate-terminal-1.26.0..> | 2023-10-08 01:56 | 1.2M | |
| mate-themes-3.22.23_..> | 2023-10-07 01:40 | 5.1M | |
| mate-user-guide-1.26..> | 2023-10-07 00:34 | 7.9M | |
| mate-utils-1.26.0_2.pkg | 2023-10-07 11:47 | 6.6M | |
| materia-gtk-theme-20..> | 2023-10-14 19:01 | 237K | |
| material-icons-ttf-5..> | 2023-10-09 22:29 | 72K | |
| materialdesign-ttf-7..> | 2023-10-10 15:54 | 452K | |
| math77-6.0_10.pkg | 2023-10-14 18:35 | 1.1M | |
| mathgl-2.5_6.pkg | 2023-10-14 17:36 | 8.2M | |
| mathicsscript-6.0.0_..> | 2023-10-09 20:23 | 52K | |
| mathlibtools-1.2.0_1..> | 2023-10-09 04:09 | 42K | |
| mathml-xsd-2_3.pkg | 2023-10-14 08:59 | 12K | |
| mathomatic-16.0.5_2.pkg | 2023-10-10 04:45 | 233K | |
| mathopd-1.5p8_1.pkg | 2023-10-14 06:37 | 56K | |
| mathpresso-g20230108..> | 2023-10-09 13:45 | 31K | |
| matio-1.5.23_2.pkg | 2023-10-06 13:29 | 233K | |
| matplotlib-cpp-g2021..> | 2023-10-09 23:43 | 14K | |
| matplotplusplus-1.2...> | 2023-10-09 04:49 | 2.8M | |
| matreshka-21.0.pkg | 2023-10-08 14:32 | 19M | |
| matrix-conduit-0.6.0..> | 2023-10-10 00:13 | 8.1M | |
| matterbridge-1.26.0_..> | 2023-10-09 20:23 | 9.4M | |
| matterircd-0.27.1_1.pkg | 2023-10-10 16:50 | 3.8M | |
| mattermost-server-7...> | 2023-10-09 13:41 | 16M | |
| mattermost-webapp-7...> | 2023-10-08 04:23 | 57M | |
| maude-2.7.1_2.pkg | 2023-10-09 08:11 | 898K | |
| maven-3.8.8_1.pkg | 2023-10-06 15:44 | 7.6M | |
| maven-wrapper-2.pkg | 2023-10-05 16:39 | 1.0K | |
| maven39-3.9.4.pkg | 2023-10-09 09:44 | 8.6M | |
| maven363-3.6.3.pkg | 2023-10-07 14:45 | 8.7M | |
| mawk-1.3.4.20230404.pkg | 2023-10-07 10:52 | 80K | |
| maxcso-1.13.0.27.pkg | 2023-10-08 20:22 | 72K | |
| maxima-5.47.0_4.pkg | 2023-10-08 05:01 | 21M | |
| maxr-0.2.10.pkg | 2023-10-08 14:06 | 11M | |
| mb2md-3.20_1.pkg | 2023-10-09 17:24 | 14K | |
| mbasecalc-1.1_8.pkg | 2023-10-14 08:53 | 8.3K | |
| mbdyn-1.7.3_7.pkg | 2023-10-14 08:23 | 1.8M | |
| mbedtls-2.28.4.pkg | 2023-10-05 17:03 | 891K | |
| mbelib-1.3.0.pkg | 2023-10-08 03:36 | 47K | |
| mbgtools-f.1.0.0.pkg | 2023-10-14 04:45 | 116K | |
| mblaze-1.2.pkg | 2023-10-10 19:21 | 129K | |
| mbox-importer-23.08...> | 2023-10-06 18:57 | 28K | |
| mbox2imap-1.0_2.pkg | 2023-10-08 13:22 | 4.3K | |
| mbox2mdir-1.4.pkg | 2023-10-10 12:15 | 4.5K | |
| mboxgrep-0.7.12a.pkg | 2023-10-12 03:19 | 20K | |
| mboxstats-3.1.pkg | 2023-10-14 16:29 | 26K | |
| mbpurple-0.3.0_6.pkg | 2023-10-10 20:05 | 70K | |
| mbrowse-0.4.3_3.pkg | 2023-10-08 21:25 | 20K | |
| mbuffer-20230301.pkg | 2023-10-07 20:22 | 37K | |
| mbx2mbox-0.34_1.pkg | 2023-10-10 07:24 | 5.4K | |
| mc-4.8.30.pkg | 2023-10-09 19:33 | 1.7M | |
| mc-nox11-4.8.30.pkg | 2023-10-10 00:36 | 1.7M | |
| mcabber-1.1.2.pkg | 2023-10-14 14:40 | 234K | |
| mcelog-178.pkg | 2023-10-14 06:28 | 43K | |
| mcfly-0.8.1_3.pkg | 2023-10-12 07:56 | 1.3M | |
| mcjoin-2.11.pkg | 2023-10-14 08:19 | 26K | |
| mclk-lv2-0.2.3.pkg | 2023-10-09 16:08 | 6.7K | |
| mcmc-jags-4.3.1_1.pkg | 2023-10-08 22:59 | 1.5M | |
| mcpp-2.7.2_3.pkg | 2023-10-07 04:24 | 275K | |
| mcron-1.2.3.pkg | 2023-10-10 06:38 | 426K | |
| mcrypt-2.6.8_3.pkg | 2023-10-09 21:33 | 50K | |
| mcsim-6.2.0_2.pkg | 2023-10-14 07:33 | 420K | |
| mcstas-2.5.pkg | 2023-10-08 07:07 | 155K | |
| mcstas-comps-2.5_3.pkg | 2023-10-11 17:36 | 37M | |
| mctc-lib-0.3.1_1.pkg | 2023-10-06 18:23 | 216K | |
| mcweject-1.1.pkg | 2023-10-14 12:42 | 6.7K | |
| mcwm-20130209.pkg | 2023-10-10 10:46 | 23K | |
| mcxtrace-1.2.pkg | 2023-10-08 03:52 | 162K | |
| mcxtrace-comps-1.2.pkg | 2023-10-14 07:41 | 1.4M | |
| md4c-0.4.7.pkg | 2023-10-09 07:13 | 66K | |
| md5deep-4.4_3.pkg | 2023-10-08 21:58 | 101K | |
| mda-lv2-1.2.6.pkg | 2023-10-08 16:16 | 1.8M | |
| mdal-1.0.3.pkg | 2023-10-08 00:12 | 756K | |
| mdata-client-2015100..> | 2023-10-08 08:00 | 38K | |
| mdbook-0.4.34_1.pkg | 2023-10-07 22:06 | 2.8M | |
| mdbook-linkcheck-0.7..> | 2023-10-07 12:58 | 2.4M | |
| mdbook-mermaid-0.12...> | 2023-10-08 05:49 | 1.0M | |
| mdbtools-1.0.0_1.pkg | 2023-10-08 04:04 | 177K | |
| mdbx-0.11.14.pkg | 2023-10-10 12:01 | 383K | |
| mdcached-1.0.9_1.pkg | 2023-10-10 16:43 | 83K | |
| mdds-2.0.3.pkg | 2023-10-05 16:39 | 109K | |
| mdf2iso-0.3.1.pkg | 2023-10-09 08:55 | 5.6K | |
| mdk-1.3.0_2.pkg | 2023-10-09 08:21 | 216K | |
| mdns-repeater-1.11.pkg | 2023-10-12 03:52 | 6.6K | |
| mdnsd-0.7.g.107_1,1.pkg | 2023-10-09 02:09 | 18K | |
| mdocml-1.14.6.pkg | 2023-10-11 18:10 | 564K | |
| mdp-1.0.15_1.pkg | 2023-10-08 23:55 | 18K | |
| mdpop3d-0.97.pkg | 2023-10-12 06:28 | 15K | |
| mdspan-0.6.0.pkg | 2023-10-14 11:21 | 25K | |
| mdtest-1.9.3_14.pkg | 2023-10-08 13:14 | 28K | |
| mdynamix-5.2.8_5.pkg | 2023-10-14 13:22 | 188K | |
| meandmyshadow-0.5a_2..> | 2023-10-14 12:37 | 14M | |
| meanwhile-1.0.2_6.pkg | 2023-10-10 12:17 | 164K | |
| measurement-kit-0.10..> | 2023-10-14 16:57 | 2.0M | |
| mediainfo-23.07.pkg | 2023-10-07 09:52 | 21K | |
| mediastreamer-5.2.94..> | 2023-10-07 04:32 | 474K | |
| mediawiki135-php80-1..> | 2023-10-11 16:07 | 34M | |
| mediawiki135-php81-1..> | 2023-10-09 16:41 | 34M | |
| mediawiki135-php82-1..> | 2023-10-14 17:30 | 34M | |
| mediawiki135-php83-1..> | 2023-10-10 12:55 | 34M | |
| mediawiki138-php80-1..> | 2023-10-10 08:23 | 38M | |
| mediawiki138-php81-1..> | 2023-10-09 16:08 | 38M | |
| mediawiki138-php82-1..> | 2023-10-09 15:11 | 38M | |
| mediawiki138-php83-1..> | 2023-10-10 19:47 | 38M | |
| mediawiki139-php80-1..> | 2023-10-09 03:01 | 38M | |
| mediawiki139-php81-1..> | 2023-10-14 11:10 | 38M | |
| mediawiki139-php82-1..> | 2023-10-14 10:09 | 38M | |
| mediawiki139-php83-1..> | 2023-10-09 14:38 | 38M | |
| mediawiki140-php80-1..> | 2023-10-09 08:57 | 41M | |
| mediawiki140-php81-1..> | 2023-10-14 04:09 | 41M | |
| mediawiki140-php82-1..> | 2023-10-12 10:30 | 41M | |
| mediawiki140-php83-1..> | 2023-10-10 12:30 | 41M | |
| medit-2012.02.05_5.pkg | 2023-10-09 22:03 | 1.7M | |
| mednafen-1.26.1_3,1.pkg | 2023-10-14 04:19 | 3.8M | |
| medusa-2.2_1.pkg | 2023-10-10 05:50 | 153K | |
| meek-0.37.0_10.pkg | 2023-10-07 06:51 | 2.6M | |
| meep-1.27.0.pkg | 2023-10-09 09:34 | 1.9M | |
| megacli-8.07.14.pkg | 2023-10-09 23:46 | 668K | |
| megacmd-1.6.3_1.pkg | 2023-10-14 15:25 | 2.8M | |
| megaglest-3.13.0_11.pkg | 2023-10-09 17:12 | 2.3M | |
| megaglest-data-3.13...> | 2023-10-07 23:01 | 282M | |
| megahit-1.2.9_1.pkg | 2023-10-10 06:27 | 489K | |
| megamario-1.7_5.pkg | 2023-10-10 02:43 | 24M | |
| megatools-1.10.3.pkg | 2023-10-09 03:38 | 175K | |
| meh-0.3.27_2.pkg | 2023-10-11 13:07 | 14K | |
| meilisearch-1.3.3_1.pkg | 2023-10-09 06:21 | 72M | |
| meld-3.22.0,1.pkg | 2023-10-11 05:25 | 513K | |
| melonds-qt5-0.9.5.pkg | 2023-10-09 21:15 | 1.0M | |
| melonds-qt6-0.9.5.pkg | 2023-10-08 19:15 | 1.0M | |
| memcached-1.6.21.pkg | 2023-10-07 02:41 | 180K | |
| memdump-1.01.pkg | 2023-10-10 21:09 | 7.3K | |
| memfetch-0.05b.pkg | 2023-10-11 22:53 | 8.6K | |
| memonix-1.6.070713_1..> | 2023-10-14 18:49 | 6.3M | |
| memtest86+-5.01_5.pkg | 2023-10-09 00:12 | 59K | |
| memtest86-4.3.7.pkg | 2023-10-12 10:27 | 397K | |
| memtester-4.6.0.pkg | 2023-10-10 07:42 | 12K | |
| mencal-3.0.pkg | 2023-10-08 12:02 | 4.9K | |
| mencoder-1.5.0.20230..> | 2023-10-08 00:21 | 840K | |
| menhir-20170712_1.pkg | 2023-10-07 04:23 | 1.2M | |
| menu-cache-1.1.0.pkg | 2023-10-06 19:01 | 37K | |
| menumaker-0.99.14.pkg | 2023-10-08 15:16 | 90K | |
| mepo-1.1.2_1.pkg | 2023-10-10 15:36 | 1.3M | |
| meqcc-1.4.pkg | 2023-10-10 00:57 | 42K | |
| mercator-0.3.3_10.pkg | 2023-10-07 15:40 | 65K | |
| mercurial-6.5.2.pkg | 2023-10-07 00:56 | 4.8M | |
| mergelog-4.5_2.pkg | 2023-10-08 21:39 | 7.3K | |
| mergify-g20180512_1.pkg | 2023-10-09 18:50 | 4.4K | |
| meritous-1.5.pkg | 2023-10-09 19:59 | 1.0M | |
| merkaartor-0.19.0_16..> | 2023-10-14 08:18 | 2.5M | |
| merkuro-23.08.1.pkg | 2023-10-09 17:33 | 1.0M | |
| mesa-demos-8.4.0_3.pkg | 2023-10-06 17:42 | 1.4M | |
| mesa-devel-23.2.0.b...> | 2023-10-08 23:24 | 34M | |
| mesa-dri-22.3.7_3.pkg | 2023-10-05 22:20 | 10M | |
| mesa-gallium-va-22.3..> | 2023-10-10 18:55 | 1.9M | |
| mesa-gallium-vdpau-2..> | 2023-10-09 02:16 | 2.3M | |
| mesa-gallium-xa-22.3..> | 2023-10-08 05:23 | 1.1M | |
| mesa-libs-22.3.7_2.pkg | 2023-10-05 22:07 | 267K | |
| mesen-0.9.8.4_4.pkg | 2023-10-08 17:56 | 6.6M | |
| meshdev-0.5_1.pkg | 2023-10-10 09:21 | 41K | |
| meshlab-2020.05_1.pkg | 2023-10-11 07:54 | 4.5M | |
| meshoptimizer-0.19.pkg | 2023-10-14 09:40 | 53K | |
| meslo-1.2.1_1.pkg | 2023-10-14 14:39 | 463K | |
| meson-1.2.1.pkg | 2023-10-05 17:16 | 1.3M | |
| mesquite-mesh-toolki..> | 2023-10-09 01:46 | 728K | |
| mess822-0.58_2.pkg | 2023-10-08 16:41 | 70K | |
| messagelib-23.08.1_1..> | 2023-10-06 15:19 | 6.0M | |
| metabase-0.41.5.pkg | 2023-10-10 14:15 | 243M | |
| metacam-1.2.pkg | 2023-10-10 04:53 | 37K | |
| metacity-3.44.0_1.pkg | 2023-10-06 21:23 | 791K | |
| metacity-aluminumall..> | 2023-10-11 06:54 | 15K | |
| metacity-aluminumall..> | 2023-10-10 20:09 | 12K | |
| metacity-aluminumall..> | 2023-10-09 04:34 | 12K | |
| metacity-aluminumall..> | 2023-10-09 06:12 | 12K | |
| metacity-aquaextreme..> | 2023-10-08 14:42 | 8.7K | |
| metacity-digital-cre..> | 2023-10-10 01:23 | 6.5K | |
| metacity-digital-har..> | 2023-10-09 20:03 | 6.3K | |
| metacity-longhornins..> | 2023-10-11 03:14 | 8.0K | |
| metacity-milk-theme-..> | 2023-10-09 08:51 | 8.4K | |
| metacity-theme-micro..> | 2023-10-08 05:46 | 14K | |
| metacity-themes-2004..> | 2023-10-14 03:56 | 728 | |
| metaeuk-6_2.pkg | 2023-10-08 13:37 | 3.4M | |
| metalink-checker-1.3..> | 2023-10-09 18:59 | 6.4K | |
| metalink-tools-0.3.6..> | 2023-10-08 19:45 | 41K | |
| metalock-0.8.0_4.pkg | 2023-10-11 00:57 | 388K | |
| metalog-3_1,1.pkg | 2023-10-09 19:56 | 43K | |
| metamail-2.7_16.pkg | 2023-10-08 05:39 | 132K | |
| metapixel-1.0.2_12.pkg | 2023-10-09 00:30 | 52K | |
| metasploit-6.2.23_9.pkg | 2023-10-08 15:26 | 48M | |
| metauml-0.2.5_5.pkg | 2023-10-09 08:00 | 1.1M | |
| meteo-0.9.9.2.pkg | 2023-10-09 20:26 | 87K | |
| metis-5.1.0_9.pkg | 2023-10-06 08:36 | 597K | |
| mew-6.9_3.pkg | 2023-10-07 16:29 | 783K | |
| mew-devel-6.9.48_1.pkg | 2023-10-09 11:35 | 795K | |
| mew-devel-emacs_cann..> | 2023-10-14 18:39 | 795K | |
| mew-devel-emacs_deve..> | 2023-10-08 13:51 | 795K | |
| mew-devel-emacs_deve..> | 2023-10-10 07:14 | 795K | |
| mew-devel-emacs_nox-..> | 2023-10-09 14:38 | 795K | |
| mew-emacs_canna-6.9_..> | 2023-10-07 10:45 | 783K | |
| mew-emacs_devel-6.9_..> | 2023-10-07 20:22 | 783K | |
| mew-emacs_devel_nox-..> | 2023-10-08 10:06 | 783K | |
| mew-emacs_nox-6.9_3.pkg | 2023-10-07 19:27 | 783K | |
| mfem-4.4_9.pkg | 2023-10-07 05:24 | 3.3M | |
| mfid-0.03_1.pkg | 2023-10-09 14:45 | 8.1K | |
| mfmod_ldap-1.2.pkg | 2023-10-09 16:05 | 26K | |
| mfmod_openmetrics-1...> | 2023-10-10 02:00 | 25K | |
| mfmod_pcre-1.1.1.pkg | 2023-10-09 18:27 | 22K | |
| mftrace-1.2.20.pkg | 2023-10-07 08:00 | 22K | |
| mg-20230501,1.pkg | 2023-10-11 16:06 | 102K | |
| mg-static-20230501,1..> | 2023-10-08 15:52 | 541K | |
| mgba-0.10.2_4.pkg | 2023-10-14 05:14 | 2.3M | |
| mgdiff-1.0_5.pkg | 2023-10-08 17:10 | 39K | |
| mgetty-1.1.37_2.pkg | 2023-10-09 13:46 | 402K | |
| mgopen-1.1_1.pkg | 2023-10-09 02:49 | 548K | |
| mhash-0.9.9.9_5.pkg | 2023-10-07 08:40 | 123K | |
| mhonarc-2.6.24.pkg | 2023-10-08 06:39 | 740K | |
| mhwaveedit-1.4.24_6.pkg | 2023-10-08 12:28 | 275K | |
| mi-aspell-0.50.0_1,1..> | 2023-10-11 02:28 | 140K | |
| miau-0.6.6_3.pkg | 2023-10-14 12:35 | 70K | |
| mickey-0.1.13.pkg | 2023-10-14 17:06 | 26K | |
| micro-2.0.12.pkg | 2023-10-11 15:53 | 3.5M | |
| micro_httpd-2014.08...> | 2023-10-14 12:21 | 7.5K | |
| micro_inetd-2014.08...> | 2023-10-10 14:32 | 4.5K | |
| micro_proxy-20140814..> | 2023-10-10 23:46 | 7.3K | |
| microbin-2.0.4_2.pkg | 2023-10-10 21:16 | 3.5M | |
| micropython-1.17_2.pkg | 2023-10-14 16:57 | 212K | |
| microsocks-1.0.3.pkg | 2023-10-10 04:52 | 7.1K | |
| microsoft-gsl-4.0.0.pkg | 2023-10-08 09:21 | 18K | |
| middleman-1.9.1_2.pkg | 2023-10-14 06:08 | 160K | |
| midi-matrix-lv2-0.28..> | 2023-10-09 11:05 | 224K | |
| midifile-g20200602_1..> | 2023-10-08 08:17 | 208K | |
| midiomatic-lv2-0.2.1..> | 2023-10-08 18:34 | 104K | |
| midipp-2.1.7_1.pkg | 2023-10-10 00:57 | 237K | |
| midisharelight-g2020..> | 2023-10-07 09:15 | 20K | |
| midori-9.0_8.pkg | 2023-10-10 03:34 | 714K | |
| midpoint-4.4.1.pkg | 2023-10-14 03:42 | 165M | |
| mifluz-0.26.0_1.pkg | 2023-10-14 14:24 | 596K | |
| migrate-3.6.11.pkg | 2023-10-09 10:20 | 3.3M | |
| mikmod-3.2.8.pkg | 2023-10-14 13:24 | 79K | |
| miktex-21.8_10.pkg | 2023-10-14 11:29 | 15M | |
| mikutter-5.0.4.pkg | 2023-10-09 17:52 | 1.6M | |
| milkytracker-1.04.00..> | 2023-10-10 02:47 | 924K | |
| mill-0.10.11.pkg | 2023-10-14 09:25 | 63M | |
| miller-5.10.2.pkg | 2023-10-07 13:26 | 281K | |
| milter-bogom-1.9.2_4..> | 2023-10-08 17:18 | 18K | |
| milter-callback-1.6...> | 2023-10-08 13:57 | 33K | |
| milter-greylist-4.6...> | 2023-10-14 10:22 | 121K | |
| milter-manager-2.1.6..> | 2023-10-14 13:41 | 560K | |
| milter-regex-2.7_2.pkg | 2023-10-10 10:28 | 20K | |
| milton-1.9.1_2.pkg | 2023-10-09 05:08 | 566K | |
| mimalloc-2.1.2.pkg | 2023-10-07 12:21 | 74K | |
| mime-construct-1.11_..> | 2023-10-07 17:06 | 15K | |
| mime-support-3.62.pkg | 2023-10-07 08:41 | 13K | |
| mime4j-0.7.2_1.pkg | 2023-10-14 10:15 | 359K | |
| mimedefang-2.86.pkg | 2023-10-09 14:58 | 184K | |
| mimelib-1.1.2_2.pkg | 2023-10-14 10:20 | 177K | |
| mimetex-20120331.1.7..> | 2023-10-08 20:14 | 533K | |
| mimir-2.15_1.pkg | 2023-10-10 19:26 | 62K | |
| min12xxw-0.0.9.pkg | 2023-10-10 04:11 | 19K | |
| minc2-2.2.00_14,1.pkg | 2023-10-14 08:42 | 719K | |
| minder-2.0.2_3.pkg | 2023-10-10 10:54 | 21K | |
| minder-app-1.14.0_3.pkg | 2023-10-08 12:53 | 588K | |
| mindfocus-0.88_2.pkg | 2023-10-08 17:39 | 45K | |
| mindforger-1.54.0_1.pkg | 2023-10-09 23:36 | 826K | |
| mindterm-binary-1.2...> | 2023-10-08 18:54 | 215K | |
| minecraft-client-1.7..> | 2023-10-09 18:11 | 252K | |
| minecraft-server-1.2..> | 2023-10-14 12:28 | 46M | |
| mined-2022.27_1.pkg | 2023-10-14 04:29 | 3.0M | |
| minerbold-1.4_1.pkg | 2023-10-11 05:03 | 157K | |
| minetest-5.7.0_1.pkg | 2023-10-08 05:31 | 6.1M | |
| minetest_game-5.7.0.pkg | 2023-10-14 10:22 | 2.0M | |
| minetestmapper-20220..> | 2023-10-10 17:36 | 51K | |
| ming-0.4.8.pkg | 2023-10-06 22:18 | 472K | |
| mingw32-bin-msvcrt-r..> | 2023-10-06 18:44 | 1.5M | |
| mingw32-binutils-2.4..> | 2023-10-06 21:45 | 2.3M | |
| mingw32-directx-2002..> | 2023-10-08 18:36 | 48K | |
| mingw32-gcc-4.8.1_6,..> | 2023-10-07 08:02 | 29M | |
| mingw32-libffi-3.0.1..> | 2023-10-09 22:39 | 32K | |
| mingw32-libgmp-6.0.0..> | 2023-10-14 08:00 | 352K | |
| mingw32-libyaml-0.1...> | 2023-10-14 11:14 | 52K | |
| mingw32-openssl-1.0...> | 2023-10-09 00:37 | 1.6M | |
| mingw32-pdcurses-3.4..> | 2023-10-09 06:27 | 49K | |
| mingw32-pthreads-2.8..> | 2023-10-12 11:15 | 43K | |
| mingw32-zlib-1.2.8_3..> | 2023-10-08 04:07 | 71K | |
| mini_httpd-1.30_3.pkg | 2023-10-14 10:40 | 36K | |
| mini_sendmail-1.3.9.pkg | 2023-10-08 17:42 | 385K | |
| miniaudio-0.11.15,1.pkg | 2023-10-07 21:42 | 473K | |
| minicom-2.8.pkg | 2023-10-10 20:34 | 249K | |
| minidlna-1.3.2_4,1.pkg | 2023-10-14 09:57 | 140K | |
| minidnn-g20200330_1.pkg | 2023-10-14 10:07 | 90K | |
| miniflux-2.0.48.pkg | 2023-10-09 06:12 | 4.7M | |
| minify-2.12.9_1.pkg | 2023-10-14 06:15 | 1.4M | |
| minikube-1.31.2.pkg | 2023-10-12 03:21 | 12M | |
| minilens-1.2_1.pkg | 2023-10-10 07:01 | 8.0M | |
| minimalist-2.5.3.pkg | 2023-10-09 16:46 | 32K | |
| minimap2-2.25.pkg | 2023-10-07 11:19 | 122K | |
| minimp3-g20211130,1.pkg | 2023-10-09 01:56 | 18K | |
| minimunin-0.5.pkg | 2023-10-12 11:15 | 4.6K | |
| minio-2023.04.20.17...> | 2023-10-14 05:27 | 25M | |
| minio-client-2023.01..> | 2023-10-10 18:19 | 6.5M | |
| minipot-0.2.3.pkg | 2023-10-14 11:50 | 3.8K | |
| minipro-0.5.pkg | 2023-10-10 12:21 | 42K | |
| minirsyslogd-1.02_1.pkg | 2023-10-09 16:50 | 22K | |
| minisat-2.2.1_2.pkg | 2023-10-06 23:54 | 194K | |
| minisatip-1.2.86,1.pkg | 2023-10-14 17:17 | 277K | |
| minised-1.15.pkg | 2023-10-09 18:18 | 16K | |
| miniserve-0.24.0_2.pkg | 2023-10-14 15:08 | 1.5M | |
| minisign-0.11.pkg | 2023-10-08 23:21 | 12K | |
| minissdpd-1.6.0.pkg | 2023-10-10 18:00 | 19K | |
| minitube-3.9.3_3.pkg | 2023-10-08 22:55 | 1.0M | |
| miniupnpc-2.2.5.pkg | 2023-10-07 01:12 | 46K | |
| miniupnpd-2.3.3_1,1.pkg | 2023-10-10 16:49 | 68K | |
| minixmlto-0.0.7.pkg | 2023-10-05 17:18 | 1.9K | |
| minizinc-2.6.4_1.pkg | 2023-10-08 02:50 | 1.6M | |
| minizinc-ide-2.6.4_2..> | 2023-10-10 07:30 | 814K | |
| minizinc-solvers-202..> | 2023-10-10 22:53 | 608 | |
| minizip-1.2.11.pkg | 2023-10-05 17:34 | 42K | |
| minizip-ng-3.0.8.pkg | 2023-10-06 17:12 | 64K | |
| minorminer-0.2.12.pkg | 2023-10-10 21:43 | 43K | |
| mint-themes-0.0.41cf..> | 2023-10-10 09:37 | 95K | |
| mio2jack-g20180501_3..> | 2023-10-09 14:09 | 3.6K | |
| mips-binutils-2.40_4..> | 2023-10-08 05:00 | 2.1M | |
| mips-gcc9-9.5.0_11.pkg | 2023-10-08 15:52 | 19M | |
| mips64-binutils-2.40..> | 2023-10-08 11:03 | 2.1M | |
| mips64-gcc9-9.5.0_11..> | 2023-10-09 07:32 | 19M | |
| mir-core-1.1.62_3.pkg | 2023-10-06 15:50 | 59K | |
| miracl-5.6_8,1.pkg | 2023-10-08 21:48 | 119K | |
| miredo-1.2.6_6.pkg | 2023-10-10 23:49 | 78K | |
| mirmon-2.11_1.pkg | 2023-10-14 08:26 | 33K | |
| mirror-2.9_2.pkg | 2023-10-09 08:24 | 52K | |
| mirrormagic-3.3.0.pkg | 2023-10-09 05:30 | 2.9M | |
| mirrorselect-0.9.0_1..> | 2023-10-14 02:57 | 2.5M | |
| mirtk-2.0.0.178_9.pkg | 2023-10-08 16:32 | 4.3M | |
| miruo-0.9.6b.pkg | 2023-10-08 23:45 | 18K | |
| miscom-1.0.pkg | 2023-10-14 10:37 | 76K | |
| missey-1.2.0_1.pkg | 2023-10-10 14:21 | 17K | |
| mit-scheme-9.2_4.pkg | 2023-10-10 16:55 | 23M | |
| mixal-1.11.pkg | 2023-10-09 12:08 | 32K | |
| mixer-1.0.pkg | 2023-10-14 10:42 | 808 | |
| mixer.app-1.8.0_2.pkg | 2023-10-08 23:21 | 17K | |
| mixertui-1.4.2_2.pkg | 2023-10-08 21:55 | 14K | |
| mixxx-2.3.2_9.pkg | 2023-10-14 15:45 | 12M | |
| mjpegtools-2.1.0_17.pkg | 2023-10-07 08:14 | 939K | |
| mjpg-streamer-g20210..> | 2023-10-10 13:18 | 259K | |
| mk-aspell-0.50.0_1,1..> | 2023-10-08 22:20 | 1.2M | |
| mk-configure-0.38.2.pkg | 2023-10-06 22:45 | 185K | |
| mk-libreoffice-7.5.5..> | 2023-10-08 07:51 | 2.6M | |
| mk-livestatus-1.2.8p..> | 2023-10-08 06:37 | 159K | |
| mkbold-1.0_2.pkg | 2023-10-09 15:03 | 1.6K | |
| mkbold-mkitalic-0.11..> | 2023-10-07 04:00 | 24K | |
| mkcatalog-1.1.pkg | 2023-10-10 19:59 | 3.3K | |
| mkclean-0.9.0.pkg | 2023-10-10 06:29 | 136K | |
| mkcomposecache-1.2.1..> | 2023-10-09 23:31 | 4.1K | |
| mkcue-1.pkg | 2023-10-14 12:41 | 3.9K | |
| mkdesktop-5.0.pkg | 2023-10-09 16:41 | 4.5K | |
| mkfontscale-1.2.1.pkg | 2023-10-05 17:39 | 19K | |
| mkfwimage-r1_1.pkg | 2023-10-09 22:53 | 5.2K | |
| mkgmap-r4910.pkg | 2023-10-14 12:12 | 3.1M | |
| mkgmap-splitter-r653..> | 2023-10-09 08:39 | 1.4M | |
| mkhexgrid-0.1.1_22.pkg | 2023-10-14 14:09 | 51K | |
| mkitalic-1.0_2.pkg | 2023-10-10 00:18 | 3.5K | |
| mkjail-0.0.4.pkg | 2023-10-09 12:10 | 7.3K | |
| mknmz-wwwoffle-0.7.2..> | 2023-10-09 18:32 | 19K | |
| mkntpwd-1.0.pkg | 2023-10-14 17:03 | 7.1K | |
| mkp224o-1.6.1.pkg | 2023-10-09 08:22 | 70K | |
| mkreadmes-1.3.pkg | 2023-10-09 12:10 | 13K | |
| mksh-59c.pkg | 2023-10-08 05:14 | 206K | |
| mktorrent-1.1_1.pkg | 2023-10-14 16:17 | 8.9K | |
| mkvalidator-0.5.0.pkg | 2023-10-09 08:14 | 99K | |
| mkvtoolnix-79.0.pkg | 2023-10-07 11:29 | 9.2M | |
| mkvtoolnix-nogui-79...> | 2023-10-09 12:48 | 3.2M | |
| ml-aspell-0.04.1.pkg | 2023-10-08 14:40 | 1.1M | |
| ml-libreoffice-7.5.5..> | 2023-10-08 06:31 | 347K | |
| ml1-4.12_1.pkg | 2023-10-10 10:20 | 741K | |
| mlclock-1.1_3.pkg | 2023-10-14 15:32 | 7.5K | |
| mldonkey-3.1.7.2.pkg | 2023-10-10 14:39 | 11M | |
| mldonkey-core-3.1.7...> | 2023-10-14 12:19 | 2.8M | |
| mldonkey-gui-3.1.7.2..> | 2023-10-09 20:35 | 2.5M | |
| mle-1.7.2.pkg | 2023-10-14 10:01 | 89K | |
| mlkit-4.7.3.pkg | 2023-10-09 06:41 | 10M | |
| mlmmj-1.3.0_11.pkg | 2023-10-09 14:01 | 175K | |
| mlmmj-archive-mid-0...> | 2023-10-09 15:03 | 31K | |
| mlmmj-archiver-0.4.pkg | 2023-10-14 05:00 | 79K | |
| mlmmj-webview-0.0.6.pkg | 2023-10-14 13:36 | 105K | |
| mlpack-4.2.0.pkg | 2023-10-10 20:07 | 6.8M | |
| mls-1.3_2.pkg | 2023-10-09 15:08 | 39K | |
| mlt7-7.18.0_2.pkg | 2023-10-06 16:01 | 574K | |
| mlt7-glaxnimate-qt5-..> | 2023-10-06 20:00 | 808K | |
| mlt7-glaxnimate-qt6-..> | 2023-10-09 20:45 | 846K | |
| mlt7-qt5-7.18.0.pkg | 2023-10-06 21:12 | 116K | |
| mlt7-qt6-7.18.0.pkg | 2023-10-09 05:00 | 119K | |
| mlterm-3.9.3.pkg | 2023-10-09 08:10 | 2.3M | |
| mlton-20210816_1.pkg | 2023-10-07 21:53 | 5.1M | |
| mlvpn-2.3.1_2.pkg | 2023-10-08 13:19 | 38K | |
| mm-1.4.2_1.pkg | 2023-10-08 11:56 | 25K | |
| mm-common-0.9.12.pkg | 2023-10-14 13:01 | 238K | |
| mmail-0.52.pkg | 2023-10-14 16:27 | 113K | |
| mmake-2.3_1.pkg | 2023-10-14 04:54 | 13K | |
| mmc-utils-20230807.pkg | 2023-10-11 16:05 | 37K | |
| mmdb2-2.0.22.pkg | 2023-10-07 07:08 | 429K | |
| mmdnn-0.3.1_1.pkg | 2023-10-10 07:47 | 414K | |
| mmencode-2.7.pkg | 2023-10-08 11:57 | 8.9K | |
| mmex-1.2.7_18.pkg | 2023-10-10 05:02 | 3.8M | |
| mmh-0.4.pkg | 2023-10-08 20:05 | 499K | |
| mmix-20160804_1.pkg | 2023-10-14 11:10 | 350K | |
| mmr-1.6.0_1.pkg | 2023-10-08 17:59 | 54K | |
| mmtc-0.3.2_5.pkg | 2023-10-08 21:40 | 474K | |
| mmtf-cpp-1.1.0_1.pkg | 2023-10-07 20:06 | 19K | |
| mmv-1.01b.19_1.pkg | 2023-10-14 11:58 | 22K | |
| mmve-0.2.0.pkg | 2023-10-09 19:27 | 1.7K | |
| mn-aspell-0.06.2,2.pkg | 2023-10-11 15:06 | 3.5M | |
| mn-libreoffice-7.5.5..> | 2023-10-08 09:28 | 602K | |
| mni-libreoffice-7.5...> | 2023-10-08 10:08 | 265K | |
| mnn-2.6.0.pkg | 2023-10-09 20:30 | 2.4M | |
| mnogosearch-3.4.1_1.pkg | 2023-10-08 23:41 | 1.8M | |
| moab-5.3.1_3.pkg | 2023-10-07 10:24 | 1.7M | |
| moagg-1.95b_1.pkg | 2023-10-11 05:03 | 2.4M | |
| moar-1.16.0_1.pkg | 2023-10-07 21:01 | 1.6M | |
| mobile-broadband-pro..> | 2023-10-10 08:14 | 59K | |
| moc-2.5.2_9.pkg | 2023-10-10 23:58 | 176K | |
| mod_amd-g20150926_1.pkg | 2023-10-10 11:06 | 4.3K | |
| mod_dav_svn-1.14.2.pkg | 2023-10-11 17:22 | 78K | |
| mod_php80-8.0.30.pkg | 2023-10-10 15:02 | 1.5M | |
| mod_php81-8.1.23.pkg | 2023-10-07 13:14 | 1.7M | |
| mod_php82-8.2.10.pkg | 2023-10-11 14:31 | 1.7M | |
| mod_php83-8.3.0.r1.pkg | 2023-10-10 05:24 | 1.7M | |
| mod_rivet-3.2.0.pkg | 2023-10-11 18:25 | 102K | |
| mod_webauth-4.7.0_2.pkg | 2023-10-14 15:19 | 124K | |
| modd-0.8_17.pkg | 2023-10-14 18:37 | 1.4M | |
| modernish-0.16.5.pkg | 2023-10-09 21:50 | 247K | |
| modlogan-0.8.13_18.pkg | 2023-10-11 13:17 | 429K | |
| modman-1.12.pkg | 2023-10-08 22:15 | 11K | |
| modplug-tools-0.5.6.pkg | 2023-10-11 07:08 | 6.4K | |
| modsecurity3-3.0.8.pkg | 2023-10-07 11:06 | 817K | |
| modsecurity3-nginx-1..> | 2023-10-10 10:59 | 8.1K | |
| modules-4.6.0.pkg | 2023-10-14 01:29 | 379K | |
| mog-0.6.0_2.pkg | 2023-10-14 12:44 | 9.6K | |
| mohawk-2.0.21.pkg | 2023-10-09 01:51 | 39K | |
| moinmoin-1.9.11.pkg | 2023-10-10 11:36 | 8.7M | |
| moinmoincli-4.6.0.pkg | 2023-10-14 08:30 | 6.4K | |
| mojave-gtk-themes-20..> | 2023-10-08 16:44 | 3.2M | |
| mol2ps-0.4b_12.pkg | 2023-10-14 12:58 | 285K | |
| molden-7.1_1,1.pkg | 2023-10-14 10:12 | 3.3M | |
| molequeue-0.9.0_3.pkg | 2023-10-07 22:41 | 433K | |
| molgif-g20180108_15.pkg | 2023-10-09 08:40 | 714K | |
| molsketch-0.7.3.pkg | 2023-10-09 22:44 | 1.5M | |
| mondulkiri-2_3.pkg | 2023-10-10 16:36 | 248K | |
| monero-cli-0.18.2.2_..> | 2023-10-10 02:52 | 14M | |
| mongo-c-driver-1.24...> | 2023-10-07 11:42 | 1.7M | |
| mongodb-tools-100.8...> | 2023-10-09 16:19 | 24M | |
| mongodb42-4.2.24.pkg | 2023-10-11 00:48 | 32M | |
| mongodb42-tools-4.2...> | 2023-10-10 07:07 | 13M | |
| mongodb44-4.4.24.pkg | 2023-10-08 04:15 | 39M | |
| mongodb50-5.0.20.pkg | 2023-10-10 09:17 | 43M | |
| mongodb60-6.0.9.pkg | 2023-10-08 19:03 | 34M | |
| mongodb70-7.0.1.pkg | 2023-10-09 20:03 | 42M | |
| mongoose-5.6.pkg | 2023-10-08 23:56 | 33K | |
| monit-5.33.0.pkg | 2023-10-09 02:14 | 299K | |
| monitord-0.4.1_7.pkg | 2023-10-08 13:12 | 9.9K | |
| monitoring-plugins-2..> | 2023-10-07 19:11 | 368K | |
| monitorix-3.14.0.pkg | 2023-10-14 06:44 | 229K | |
| monkeysphere-0.43.pkg | 2023-10-14 07:34 | 78K | |
| mono-5.20.pkg | 2023-10-14 04:07 | 956 | |
| mono-addins-1.3_4.pkg | 2023-10-08 03:37 | 430K | |
| mono-basic-4.7_2.pkg | 2023-10-08 22:46 | 661K | |
| mono5.10-5.10.1.57_5..> | 2023-10-12 01:15 | 65M | |
| mono5.20-5.20.1.34_3..> | 2023-10-06 21:10 | 70M | |
| mono6.8-6.8.0.123_2.pkg | 2023-10-07 13:52 | 72M | |
| monocypher-4.0.2.pkg | 2023-10-14 05:30 | 99K | |
| monoid-0.61_1.pkg | 2023-10-14 05:25 | 214K | |
| monolith-2.7.0_8.pkg | 2023-10-14 10:24 | 1.2M | |
| mons-0.8.2.pkg | 2023-10-14 04:59 | 18K | |
| monsterz-0.7.1_17.pkg | 2023-10-14 05:50 | 1.7M | |
| montecarlo_fonts-1.0..> | 2023-10-10 00:53 | 4.6K | |
| montserrat-7.222.pkg | 2023-10-08 04:15 | 2.0M | |
| moo-1.5_1.pkg | 2023-10-08 21:11 | 12K | |
| moodbar-1.2.1.pkg | 2023-10-07 11:36 | 17K | |
| moodle41-php80-4.1.5..> | 2023-10-09 03:37 | 40M | |
| moodle41-php81-4.1.5..> | 2023-10-14 13:44 | 40M | |
| moodle42-php80-4.2.2..> | 2023-10-08 21:50 | 41M | |
| moodle42-php81-4.2.2..> | 2023-10-14 11:23 | 41M | |
| moon-buggy-1.0.51_4.pkg | 2023-10-09 12:19 | 36K | |
| moonlander-1.0_14.pkg | 2023-10-09 21:41 | 1.2M | |
| moonlight-embedded-2..> | 2023-10-08 13:01 | 116K | |
| moony-lv2-0.36.0_1.pkg | 2023-10-10 12:34 | 591K | |
| moosefs2-cgi-2.0.91.pkg | 2023-10-07 10:19 | 43K | |
| moosefs2-cgiserv-2.0..> | 2023-10-14 09:11 | 8.3K | |
| moosefs2-chunkserver..> | 2023-10-14 17:03 | 96K | |
| moosefs2-cli-2.0.91.pkg | 2023-10-14 10:02 | 35K | |
| moosefs2-client-2.0...> | 2023-10-09 12:33 | 117K | |
| moosefs2-master-2.0...> | 2023-10-10 00:51 | 206K | |
| moosefs2-metalogger-..> | 2023-10-10 05:30 | 30K | |
| moosefs2-netdump-2.0..> | 2023-10-10 23:57 | 8.8K | |
| moosefs3-cgi-3.0.117..> | 2023-10-08 09:53 | 52K | |
| moosefs3-cgiserv-3.0..> | 2023-10-10 07:22 | 8.5K | |
| moosefs3-chunkserver..> | 2023-10-14 15:03 | 163K | |
| moosefs3-cli-3.0.117..> | 2023-10-09 06:56 | 44K | |
| moosefs3-client-3.0...> | 2023-10-10 09:22 | 789K | |
| moosefs3-master-3.0...> | 2023-10-10 02:43 | 304K | |
| moosefs3-metalogger-..> | 2023-10-14 18:43 | 32K | |
| moosefs3-netdump-3.0..> | 2023-10-09 17:09 | 10K | |
| mopac-22.0.6_1,1.pkg | 2023-10-07 22:40 | 1.8M | |
| mopd-2.5.3_2.pkg | 2023-10-09 21:45 | 58K | |
| moregroupware-0.7.4_..> | 2023-10-10 18:28 | 1.5M | |
| moreutils-0.67_2.pkg | 2023-10-09 23:33 | 53K | |
| moria-5.5.2.pkg | 2023-10-10 21:56 | 217K | |
| morla-0.16.1_14.pkg | 2023-10-09 10:24 | 263K | |
| morse-robotics-1.4.1..> | 2023-10-08 01:45 | 78M | |
| morty-0.2.0.12_15.pkg | 2023-10-10 17:51 | 1.9M | |
| mosh-1.4.0.pkg | 2023-10-09 02:58 | 161K | |
| mosh-scheme-0.2.7_6.pkg | 2023-10-14 10:09 | 1.0M | |
| mosml-2.10.1_1.pkg | 2023-10-14 18:16 | 1.5M | |
| mosquitto-2.0.15_1.pkg | 2023-10-07 07:40 | 303K | |
| most-5.2.0.pkg | 2023-10-11 00:55 | 52K | |
| mothur-1.48.0.pkg | 2023-10-11 05:01 | 4.4M | |
| motion-4.3.2_8.pkg | 2023-10-10 21:54 | 274K | |
| motogt-20110505_9.pkg | 2023-10-10 20:47 | 61M | |
| motsognir-1.0.13.pkg | 2023-10-09 10:20 | 32K | |
| mountsmb2-0.90.2.pkg | 2023-10-12 07:22 | 7.2K | |
| mourier-g20170925_1.pkg | 2023-10-10 05:14 | 5.8K | |
| mousai-0.7.5_4.pkg | 2023-10-09 02:49 | 785K | |
| mouseclock-1.0_5.pkg | 2023-10-09 13:01 | 5.9K | |
| mousepad-0.6.1.pkg | 2023-10-07 13:46 | 379K | |
| moveable-type-fonts-..> | 2023-10-10 10:19 | 488K | |
| movine-0.11.0_7.pkg | 2023-10-14 13:32 | 1.4M | |
| movingmotif-2.3.0_3.pkg | 2023-10-14 18:48 | 74K | |
| movit-1.6.3_1.pkg | 2023-10-06 13:44 | 334K | |
| mozjpeg-4.1.1.pkg | 2023-10-08 13:45 | 563K | |
| mozo-1.26.1_1.pkg | 2023-10-07 17:58 | 99K | |
| mozplugger-2.1.6.pkg | 2023-10-09 14:10 | 51K | |
| mp-5.61.pkg | 2023-10-09 04:35 | 253K | |
| mp-a4-3.0.1.pkg | 2023-10-09 23:44 | 23K | |
| mp-letter-3.0.1.pkg | 2023-10-07 14:08 | 23K | |
| mp-player-0.6_1.pkg | 2023-10-09 02:50 | 29K | |
| mp2d-f20190610.pkg | 2023-10-14 14:57 | 38K | |
| mp3-archive-tools-0...> | 2023-10-09 07:24 | 57K | |
| mp3_check-1.98_1.pkg | 2023-10-07 18:11 | 12K | |
| mp3asm-0.1.3.1_1.pkg | 2023-10-09 23:27 | 16K | |
| mp3blaster-3.2.6_2.pkg | 2023-10-09 19:36 | 143K | |
| mp3burn-0.4.2_2.pkg | 2023-10-10 22:23 | 9.3K | |
| mp3cd-1.027_1,1.pkg | 2023-10-09 14:41 | 15K | |
| mp3check-1.6.pkg | 2023-10-08 18:06 | 10K | |
| mp3ck-0.04.pkg | 2023-10-14 18:01 | 9.6K | |
| mp3gain-1.6.2.pkg | 2023-10-07 20:37 | 32K | |
| mp3guessenc-0.27.5.pkg | 2023-10-10 00:42 | 26K | |
| mp3info-0.8.5a.pkg | 2023-10-10 20:28 | 28K | |
| mp3lint-0.9_1.pkg | 2023-10-08 15:51 | 57K | |
| mp3mover-2.1.1_1.pkg | 2023-10-08 17:17 | 10K | |
| mp3plot-0.6.0_34.pkg | 2023-10-09 03:31 | 56K | |
| mp3rename-0.6.pkg | 2023-10-09 03:21 | 6.2K | |
| mp3riot-1.3_1.pkg | 2023-10-08 13:57 | 33K | |
| mp3splt-2.6.2.pkg | 2023-10-09 02:28 | 38K | |
| mp3stat-2.6.01_13.pkg | 2023-10-08 19:09 | 26K | |
| mp3unicode-1.2.1_2.pkg | 2023-10-14 10:26 | 12K | |
| mp3val-0.1.8.pkg | 2023-10-08 05:22 | 16K | |
| mp3wrap-0.5.pkg | 2023-10-09 05:10 | 11K | |
| mp4v2-2.1.3.pkg | 2023-10-08 04:43 | 339K | |
| mp_doccer-1.2.2.pkg | 2023-10-08 08:00 | 7.2K | |
| mpack-1.6_3.pkg | 2023-10-07 22:22 | 30K | |
| mpage-2.5.7.pkg | 2023-10-08 03:16 | 42K | |
| mpatrol-1.4.8_5.pkg | 2023-10-14 18:25 | 2.5M | |
| mpb-1.11.1_4.pkg | 2023-10-09 18:02 | 184K | |
| mpc-1.3.1_1.pkg | 2023-10-05 17:31 | 103K | |
| mpc-qt-23.02_1.pkg | 2023-10-08 19:00 | 585K | |
| mpd-l2tp-ipv6pd-clie..> | 2023-10-09 15:29 | 4.1K | |
| mpd5-5.9_16.pkg | 2023-10-08 09:41 | 386K | |
| mpdas-0.4.5_3.pkg | 2023-10-14 15:07 | 36K | |
| mpdcon-1.5.1_12.pkg | 2023-10-08 09:03 | 93K | |
| mpdecimal-2.5.1.pkg | 2023-10-05 16:46 | 320K | |
| mpdscribble-0.22_1.pkg | 2023-10-11 18:22 | 23K | |
| mpeg_encode-1.5b.pkg | 2023-10-07 22:06 | 152K | |
| mpexpr-1.2_1.pkg | 2023-10-09 08:30 | 61K | |
| mpfi-1.5.4.pkg | 2023-10-07 04:45 | 68K | |
| mpfr-4.2.1,1.pkg | 2023-10-05 17:25 | 473K | |
| mpfrc++-3.7.0.pkg | 2023-10-10 12:09 | 16K | |
| mpfrcx-0.6.3_1.pkg | 2023-10-07 05:58 | 64K | |
| mpg123-1.31.3_1.pkg | 2023-10-05 16:44 | 308K | |
| mpg123.el-1.60_1.pkg | 2023-10-07 17:32 | 30K | |
| mpg321-0.2.10_11.pkg | 2023-10-08 22:38 | 24K | |
| mph-1.2.pkg | 2023-10-14 15:09 | 10K | |
| mpich-3.4.3_2.pkg | 2023-10-06 11:32 | 4.5M | |
| mpifx-1.4.pkg | 2023-10-06 22:49 | 597K | |
| mping-2.01.pkg | 2023-10-09 22:46 | 17K | |
| mping-fraubsd-0.1.4.pkg | 2023-10-08 13:53 | 4.0K | |
| mpir-3.0.0_1.pkg | 2023-10-06 21:32 | 501K | |
| mplayer-1.5.0.202303..> | 2023-10-07 02:07 | 1.1M | |
| mplayer-skins-1.1.5.pkg | 2023-10-06 22:34 | 216K | |
| mplex-1.1.pkg | 2023-10-08 15:39 | 16K | |
| mpop-1.4.16_3.pkg | 2023-10-09 03:38 | 125K | |
| mppp-0.27_2.pkg | 2023-10-06 19:59 | 156K | |
| mpqc-2.3.1_48.pkg | 2023-10-07 07:11 | 31M | |
| mprime-30.7b9_1.pkg | 2023-10-09 09:30 | 1.5M | |
| mprocs-0.6.4_9.pkg | 2023-10-10 21:47 | 849K | |
| mps-0.20.16_4.pkg | 2023-10-10 05:55 | 43K | |
| mpsolve-3.2.1_1.pkg | 2023-10-14 08:06 | 255K | |
| mptd-0.01_1.pkg | 2023-10-14 04:02 | 8.6K | |
| mptsd-1.1.27.pkg | 2023-10-08 23:29 | 61K | |
| mpv-0.36.0_4,1.pkg | 2023-10-07 08:38 | 1.4M | |
| mpv-mpris-1.1.pkg | 2023-10-09 01:38 | 9.8K | |
| mpvpaper-1.3_3.pkg | 2023-10-08 13:09 | 39K | |
| mpz-1.0.23_1.pkg | 2023-10-09 03:46 | 374K | |
| mqtt2prometheus-0.1...> | 2023-10-09 11:58 | 3.0M | |
| mr-aspell-0.10.0_2,2..> | 2023-10-14 05:24 | 462K | |
| mr-libreoffice-7.5.5..> | 2023-10-07 22:31 | 373K | |
| mrbayes-3.2.7_2.pkg | 2023-10-09 06:18 | 4.8M | |
| mrboom-5.2_1.pkg | 2023-10-08 18:43 | 1.6M | |
| mrc-1.3.10.pkg | 2023-10-08 07:53 | 49K | |
| mrchem-1.1.3.pkg | 2023-10-08 02:16 | 698K | |
| mrcpp-1.5.0.pkg | 2023-10-06 23:48 | 28M | |
| mroonga-13.05.pkg | 2023-10-14 13:19 | 741K | |
| mrouted-3.9.8_1.pkg | 2023-10-08 15:29 | 98K | |
| mrtg-2.17.10_1,1.pkg | 2023-10-07 10:02 | 364K | |
| mrtg-ping-probe-2.2...> | 2023-10-07 13:03 | 14K | |
| mrxvt-0.4.2_11.pkg | 2023-10-10 05:45 | 123K | |
| mrxvt-devel-0.5.4_12..> | 2023-10-14 16:21 | 190K | |
| ms-aspell-0.50.0_1,1..> | 2023-10-08 22:17 | 106K | |
| msbuild-15.8.p_2.pkg | 2023-10-07 20:30 | 7.1M | |
| mscgen-0.20_7.pkg | 2023-10-14 14:27 | 46K | |
| mscompress-0.3.pkg | 2023-10-14 09:23 | 7.4K | |
| msdl-1.2.7r2.pkg | 2023-10-10 05:41 | 54K | |
| msend-3.0_3.pkg | 2023-10-10 03:03 | 20K | |
| msglint-1.04.pkg | 2023-10-14 05:03 | 25K | |
| msgpack-c-6.0.0.pkg | 2023-10-06 19:13 | 31K | |
| msgpack-cxx-6.1.0.pkg | 2023-10-07 03:19 | 214K | |
| msgpack-d-1.0.4_3.pkg | 2023-10-07 22:17 | 98K | |
| msgpuck-2.0_6.pkg | 2023-10-08 09:32 | 31K | |
| msiklm-g20211104.pkg | 2023-10-10 18:56 | 10K | |
| msitools-0.101_2.pkg | 2023-10-14 17:35 | 573K | |
| msktutil-1.2.1.pkg | 2023-10-08 19:28 | 76K | |
| msl-1.7.4.pkg | 2023-10-09 09:26 | 2.4M | |
| msms-2.6.1.pkg | 2023-10-10 03:56 | 368K | |
| msmtp-1.8.24.pkg | 2023-10-08 12:34 | 146K | |
| msoak-0.8.pkg | 2023-10-10 01:15 | 17K | |
| msopenh264-5.2.0_2.pkg | 2023-10-08 22:57 | 9.7K | |
| msort-8.53_3.pkg | 2023-10-14 15:44 | 119K | |
| msp430-debug-stack-3..> | 2023-10-08 06:31 | 3.2M | |
| mspdebug-0.25.202004..> | 2023-10-09 23:48 | 388K | |
| mstch-1.0.2.1_4.pkg | 2023-10-14 06:35 | 36K | |
| mstflint-4.22.0.1.pkg | 2023-10-08 13:33 | 2.1M | |
| mstore-0.2.0_2.pkg | 2023-10-06 22:02 | 254K | |
| mswebrtc-1.1.2_2.pkg | 2023-10-14 18:25 | 197K | |
| msyslog-1.08g_3.pkg | 2023-10-09 09:41 | 77K | |
| mt-aspell-0.50.0_1,1..> | 2023-10-14 06:17 | 4.8M | |
| mt_dolphin_ia-0.1.98..> | 2023-10-07 22:04 | 5.6K | |
| mt_gtk_client-0.1.98..> | 2023-10-10 04:15 | 30K | |
| mtasc-1.14_2.pkg | 2023-10-08 20:45 | 495K | |
| mtaserver-0.5_2.pkg | 2023-10-14 18:29 | 61K | |
| mtbl-1.5.1.pkg | 2023-10-07 09:55 | 82K | |
| mtf-0.2.1_1.pkg | 2023-10-10 16:10 | 16K | |
| mtm-1.2.1.pkg | 2023-10-09 09:31 | 19K | |
| mtools-4.0.43.pkg | 2023-10-07 00:20 | 175K | |
| mtop-0.6.6_5.pkg | 2023-10-14 08:23 | 30K | |
| mtpaint-3.50.09_4.pkg | 2023-10-11 17:21 | 605K | |
| mtpfs-1.1_4.pkg | 2023-10-10 20:41 | 12K | |
| mtr-0.95_1.pkg | 2023-10-09 18:59 | 55K | |
| mtr-nox11-0.95_1.pkg | 2023-10-07 20:49 | 47K | |
| mtrace-5.2_1.pkg | 2023-10-09 16:59 | 26K | |
| mtrxmath-1.0.2.pkg | 2023-10-14 13:34 | 6.7K | |
| mtx-1.3.12_1.pkg | 2023-10-11 10:51 | 49K | |
| mtxclient-0.9.2_3.pkg | 2023-10-07 15:03 | 829K | |
| mtxorbd-1.0.2.pkg | 2023-10-10 04:41 | 22K | |
| mu-1.8.13_2.pkg | 2023-10-07 08:12 | 443K | |
| mu4e-1.8.13_6.pkg | 2023-10-08 11:10 | 277K | |
| mu4e-emacs_canna-1.8..> | 2023-10-07 21:35 | 277K | |
| mu4e-emacs_devel-1.8..> | 2023-10-07 15:19 | 277K | |
| mu4e-emacs_devel_nox..> | 2023-10-07 19:41 | 277K | |
| mu4e-emacs_nox-1.8.1..> | 2023-10-08 06:45 | 277K | |
| mu4e-maildirs-0.8.20..> | 2023-10-09 02:06 | 16K | |
| mu4e-maildirs-emacs_..> | 2023-10-14 14:37 | 16K | |
| mu4e-maildirs-emacs_..> | 2023-10-09 07:55 | 16K | |
| mu4e-maildirs-emacs_..> | 2023-10-10 14:18 | 16K | |
| mu4e-maildirs-emacs_..> | 2023-10-08 12:10 | 16K | |
| mucommander-1.1.0.1.pkg | 2023-10-10 17:53 | 3.4M | |
| muh-2.2a.pkg | 2023-10-09 22:06 | 31K | |
| mujs-1.3.3_1.pkg | 2023-10-08 09:58 | 285K | |
| mulberry-4.0.8_2.pkg | 2023-10-10 21:22 | 3.7M | |
| multi-aterm-0.2.1_3.pkg | 2023-10-10 08:57 | 72K | |
| multican-0.0.5_3.pkg | 2023-10-10 01:13 | 27K | |
| multicat-2.3.pkg | 2023-10-08 22:38 | 20K | |
| multicharge-0.2.0_1.pkg | 2023-10-07 04:32 | 107K | |
| multichoose-1.0.3.2.pkg | 2023-10-08 21:10 | 21K | |
| multimarkdown-6.7.0.pkg | 2023-10-14 09:33 | 1.4M | |
| multimc-0.6.11.pkg | 2023-10-10 19:01 | 1.8M | |
| multimon-ng-1.1.0_1.pkg | 2023-10-14 05:43 | 36K | |
| multisort-1.1.pkg | 2023-10-09 03:38 | 3.8K | |
| multisuck-1.0.4.pkg | 2023-10-14 09:13 | 13K | |
| multitail-6.5.0.pkg | 2023-10-09 13:10 | 125K | |
| multiwatch-1.0.0_2.pkg | 2023-10-09 16:28 | 5.9K | |
| multiwfn-3.8.pkg | 2023-10-14 13:22 | 6.3M | |
| mumble-1.5.517_3.pkg | 2023-10-10 23:35 | 3.8M | |
| mummer-4.0.0.b2.2_3.pkg | 2023-10-09 06:01 | 426K | |
| mumps-edf-5.1.2.a7_4..> | 2023-10-06 23:47 | 3.1M | |
| mumps4-4.10.0_4.pkg | 2023-10-09 15:09 | 2.7M | |
| munge-0.5.15.pkg | 2023-10-06 09:17 | 110K | |
| munger-5.12.pkg | 2023-10-07 19:02 | 199K | |
| munin-common-2.0.73.pkg | 2023-10-07 05:58 | 25K | |
| munin-contrib-g.2023..> | 2023-10-10 06:26 | 7.7M | |
| munin-master-2.0.73.pkg | 2023-10-09 18:11 | 529K | |
| munin-node-2.0.73.pkg | 2023-10-07 20:38 | 283K | |
| munkres-cpp-1.0.0.6.pkg | 2023-10-14 17:58 | 15K | |
| muon-0.2.0.pkg | 2023-10-08 15:14 | 639K | |
| muparser-2.3.4.pkg | 2023-10-07 09:52 | 144K | |
| muparserx-4.0.12.pkg | 2023-10-07 15:45 | 192K | |
| mupdf-1.20.3_1,1.pkg | 2023-10-07 22:09 | 24M | |
| mupen64plus-2.5.pkg | 2023-10-08 20:34 | 1.0K | |
| mupen64plus-audio-sd..> | 2023-10-08 03:48 | 7.5K | |
| mupen64plus-core-2.5..> | 2023-10-07 04:24 | 426K | |
| mupen64plus-input-sd..> | 2023-10-07 14:30 | 18K | |
| mupen64plus-plugins-..> | 2023-10-09 18:03 | 572 | |
| mupen64plus-qt-1.14_..> | 2023-10-11 04:48 | 235K | |
| mupen64plus-rsp-cxd4..> | 2023-10-08 03:49 | 22K | |
| mupen64plus-rsp-hle-..> | 2023-10-07 22:10 | 29K | |
| mupen64plus-rsp-z64-..> | 2023-10-07 23:21 | 25K | |
| mupen64plus-ui-conso..> | 2023-10-07 20:53 | 16K | |
| mupen64plus-video-ar..> | 2023-10-08 08:49 | 58K | |
| mupen64plus-video-gl..> | 2023-10-08 02:47 | 228K | |
| mupen64plus-video-gl..> | 2023-10-08 03:12 | 406K | |
| mupen64plus-video-ri..> | 2023-10-07 14:48 | 243K | |
| mupen64plus-video-z6..> | 2023-10-08 04:59 | 34K | |
| murex-5.0.9310.pkg | 2023-10-08 19:12 | 3.0M | |
| murmur-1.3.3_6.pkg | 2023-10-09 09:32 | 444K | |
| murmur-cli-0.0.0.202..> | 2023-10-09 17:17 | 2.4M | |
| muscle-3.8.1551.pkg | 2023-10-11 01:15 | 138K | |
| muse-emacs-3.20_25.pkg | 2023-10-10 06:27 | 348K | |
| muse-emacs_canna-3.2..> | 2023-10-11 00:21 | 348K | |
| muse-emacs_devel-3.2..> | 2023-10-09 17:23 | 348K | |
| muse-emacs_devel_nox..> | 2023-10-14 03:07 | 348K | |
| muse-emacs_nox-3.20_..> | 2023-10-14 03:25 | 348K | |
| muse-sequencer-4.2.0..> | 2023-10-14 11:08 | 6.5M | |
| musepack-2011.08.10.pkg | 2023-10-07 09:59 | 118K | |
| musescore-4.1.1.pkg | 2023-10-08 10:40 | 65M | |
| musiccontrol-0.3_3.pkg | 2023-10-09 20:44 | 32K | |
| musicpc-0.34_1.pkg | 2023-10-07 12:57 | 181K | |
| musicpd-0.23.13_1.pkg | 2023-10-07 20:05 | 473K | |
| musikcube-3.0.2.pkg | 2023-10-14 14:52 | 2.2M | |
| musique-1.11.pkg | 2023-10-08 23:37 | 508K | |
| mustache-4.1.pkg | 2023-10-07 11:14 | 70K | |
| mutagen-0.17.2_2.pkg | 2023-10-10 17:28 | 4.8M | |
| mutt-2.2.12.pkg | 2023-10-08 02:51 | 1.7M | |
| mutt_vc_query-002.pkg | 2023-10-10 13:11 | 7.6K | |
| mutter-42.4_2.pkg | 2023-10-06 21:42 | 1.8M | |
| muttprint-0.73_5.pkg | 2023-10-08 20:55 | 1.6M | |
| mvdsv-0.34,2.pkg | 2023-10-14 10:59 | 198K | |
| mvfst-g20230828.pkg | 2023-10-07 02:35 | 1.1M | |
| mx4j-3.0.2_1.pkg | 2023-10-09 16:31 | 3.5M | |
| mxascii-1.1.pkg | 2023-10-09 19:48 | 8.6K | |
| mxflib-1.0.1.pkg | 2023-10-09 14:13 | 1.6M | |
| mxico-1.0.1_2.pkg | 2023-10-14 03:40 | 41K | |
| mxkill-1.2.pkg | 2023-10-09 17:20 | 26K | |
| mxml-3.1.pkg | 2023-10-07 01:04 | 744K | |
| mxnet-1.9.1_3.pkg | 2023-10-07 10:22 | 14M | |
| mxp-1.3_5.pkg | 2023-10-09 02:29 | 30K | |
| my-libreoffice-7.5.5..> | 2023-10-08 11:01 | 301K | |
| mybashburn-1.0.2_5.pkg | 2023-10-10 21:50 | 71K | |
| mybb-1.8.33.pkg | 2023-10-10 15:35 | 1.3M | |
| mydumper-0.15.1.3.pkg | 2023-10-09 16:35 | 93K | |
| mygui-3.4.2.pkg | 2023-10-07 03:41 | 562K | |
| mygui-dummy-3.4.2.pkg | 2023-10-08 17:48 | 13K | |
| mygui-ogre-3.4.2.pkg | 2023-10-08 00:32 | 43K | |
| mygui-opengl-3.4.2.pkg | 2023-10-09 11:59 | 137K | |
| mymoon-1.2.a_5.pkg | 2023-10-11 02:37 | 5.0K | |
| mypaint-2.0.1_3.pkg | 2023-10-10 04:03 | 4.5M | |
| mypaint-brushes-1.3...> | 2023-10-06 22:06 | 1.3M | |
| mypaint-brushes2-2.0..> | 2023-10-08 08:15 | 1.4M | |
| myphpmoney-1.3.r3,1.pkg | 2023-10-14 14:59 | 491K | |
| myrddin-0.3.1_1.pkg | 2023-10-09 01:19 | 600K | |
| myrepos-1.20180726.pkg | 2023-10-14 18:56 | 29K | |
| myrescue-0.9.4.pkg | 2023-10-10 20:30 | 8.8K | |
| mysql++-3.3.0.pkg | 2023-10-08 09:17 | 172K | |
| mysql-connector-c++-..> | 2023-10-10 11:45 | 1.0M | |
| mysql-connector-j-8...> | 2023-10-07 22:21 | 2.3M | |
| mysql-connector-java..> | 2023-10-14 17:18 | 1.0M | |
| mysql-connector-odbc..> | 2023-10-08 15:00 | 1.2M | |
| mysql-snmp-1.2.17.pkg | 2023-10-10 15:08 | 32K | |
| mysql2pgsql-1.2,1.pkg | 2023-10-09 19:31 | 13K | |
| mysql57-client-5.7.4..> | 2023-10-07 00:16 | 1.9M | |
| mysql57-server-5.7.4..> | 2023-10-07 20:29 | 14M | |
| mysql80-client-8.0.3..> | 2023-10-06 07:57 | 5.1M | |
| mysql80-server-8.0.3..> | 2023-10-06 09:15 | 23M | |
| mysqlbackup-2.8.pkg | 2023-10-14 10:42 | 16K | |
| mysqld_exporter-0.12..> | 2023-10-14 12:53 | 2.6M | |
| mysqldump-secure-0.1..> | 2023-10-09 22:11 | 32K | |
| mysqlphp2postgres-0...> | 2023-10-09 03:42 | 8.0K | |
| mysqlreport-3.5_3.pkg | 2023-10-08 15:48 | 37K | |
| mysqlsla-2.03_3.pkg | 2023-10-09 12:55 | 30K | |
| mysqltuner-1.9.9.pkg | 2023-10-09 16:28 | 51K | |
| mysqlviz-0.3_1.pkg | 2023-10-10 16:04 | 14K | |
| mysqlwsrep57-server-..> | 2023-10-09 10:36 | 8.5M | |
| mytetra-1.43.27.pkg | 2023-10-14 12:39 | 1.7M | |
| mythes-1.2.4_7.pkg | 2023-10-06 20:29 | 8.7K | |
| mythplugin-mythmusic..> | 2023-10-09 09:57 | 1.0M | |
| mythplugin-mythweb-3..> | 2023-10-10 19:39 | 1.0M | |
| mythtv-33.1_3,1.pkg | 2023-10-07 16:09 | 44M | |
| mytop-1.7.pkg | 2023-10-08 12:45 | 25K | |
| myxer-1.2.1_26.pkg | 2023-10-14 12:36 | 205K | |
| n2n-2.8.pkg | 2023-10-09 07:40 | 62K | |
| n98-magerun-1.98.0.pkg | 2023-10-14 06:50 | 4.2M | |
| nInvaders-0.1.1_1.pkg | 2023-10-14 08:40 | 20K | |
| naev-0.10.6_2.pkg | 2023-10-10 21:36 | 422M | |
| nagcon-0.0.32.pkg | 2023-10-14 03:54 | 13K | |
| nagios-3.5.1_12.pkg | 2023-10-07 23:24 | 948K | |
| nagios-certexp-plugi..> | 2023-10-09 06:33 | 3.1K | |
| nagios-check_bacula9..> | 2023-10-09 13:17 | 6.4K | |
| nagios-check_bacula1..> | 2023-10-08 20:49 | 6.4K | |
| nagios-check_bacula1..> | 2023-10-10 23:38 | 6.4K | |
| nagios-check_clamav-..> | 2023-10-14 14:23 | 3.2K | |
| nagios-check_cpu_usa..> | 2023-10-09 07:45 | 1.7K | |
| nagios-check_dhcp.pl..> | 2023-10-09 00:55 | 2.4K | |
| nagios-check_email_d..> | 2023-10-10 14:32 | 31K | |
| nagios-check_hdd_hea..> | 2023-10-08 13:03 | 3.2K | |
| nagios-check_hp_blad..> | 2023-10-09 05:26 | 13K | |
| nagios-check_mysql_s..> | 2023-10-09 16:52 | 6.5K | |
| nagios-check_netsnmp..> | 2023-10-09 22:33 | 4.2K | |
| nagios-check_ports-0..> | 2023-10-10 12:53 | 3.9K | |
| nagios-check_postgre..> | 2023-10-14 15:48 | 138K | |
| nagios-check_postgre..> | 2023-10-08 12:44 | 2.5K | |
| nagios-check_puppet-..> | 2023-10-09 02:45 | 6.6K | |
| nagios-check_redis-0..> | 2023-10-08 15:53 | 1.6K | |
| nagios-check_relayd_..> | 2023-10-10 16:26 | 2.3K | |
| nagios-check_smartmo..> | 2023-10-10 07:57 | 3.6K | |
| nagios-check_tftp-1...> | 2023-10-10 02:25 | 7.8K | |
| nagios-check_zpools-..> | 2023-10-09 21:31 | 2.3K | |
| nagios-geom-1.3.pkg | 2023-10-10 19:03 | 2.0K | |
| nagios-openldap-plug..> | 2023-10-09 02:12 | 13K | |
| nagios-pf-plugin-0.1..> | 2023-10-09 18:01 | 4.0K | |
| nagios-plugins-2.4.4..> | 2023-10-06 21:34 | 388K | |
| nagios-snmp-plugins-..> | 2023-10-14 03:14 | 14K | |
| nagios-snmp-plugins-..> | 2023-10-08 16:52 | 39K | |
| nagios-statd-3.12_2.pkg | 2023-10-09 22:34 | 12K | |
| nagios4-4.4.13_1,1.pkg | 2023-10-07 07:18 | 1.4M | |
| nagiosgraph-1.5.2_3.pkg | 2023-10-14 05:40 | 75K | |
| nagiosql-3.5.0.20230..> | 2023-10-10 09:47 | 838K | |
| nagnu-1.1.3_1.pkg | 2023-10-10 05:54 | 7.9K | |
| nagstamon-3.12.0.pkg | 2023-10-11 03:33 | 635K | |
| nagtail-0.0.31.pkg | 2023-10-14 06:24 | 12K | |
| nagvis-1.9.36.pkg | 2023-10-09 05:44 | 1.4M | |
| najitool-0.8.4_2.pkg | 2023-10-10 03:45 | 61K | |
| nakenchat-3.00.b1.pkg | 2023-10-14 16:28 | 23K | |
| naludump-0.1.1_1.pkg | 2023-10-10 16:14 | 45K | |
| namazu2-2.0.21_2.pkg | 2023-10-07 10:32 | 365K | |
| namecoin-24.0,1.pkg | 2023-10-09 14:48 | 6.1M | |
| namecoin-daemon-24.0..> | 2023-10-11 13:19 | 3.7M | |
| namecoin-utils-24.0,..> | 2023-10-10 14:56 | 9.4M | |
| namefix-4.0.2_2.pkg | 2023-10-09 07:40 | 114K | |
| namesilo_ddns-2.3.1.pkg | 2023-10-14 10:10 | 3.1K | |
| nana-2.5_1.pkg | 2023-10-10 13:39 | 57K | |
| nano-7.2.pkg | 2023-10-07 19:54 | 586K | |
| nano-signal-slot-2.0..> | 2023-10-10 18:12 | 4.1K | |
| nanoblogger-3.4.2_1.pkg | 2023-10-07 17:10 | 69K | |
| nanoblogger-extra-3...> | 2023-10-09 22:19 | 57K | |
| nanodbc-2.14.0.pkg | 2023-10-10 07:57 | 97K | |
| nanoflann-1.5.0.pkg | 2023-10-08 04:24 | 19K | |
| nanogui-g20220215_1.pkg | 2023-10-08 20:31 | 911K | |
| nanomsg-1.1.5_1.pkg | 2023-10-07 22:46 | 180K | |
| nanonote-1.4.0.pkg | 2023-10-09 16:18 | 61K | |
| nanopb-0.4.7.7.pkg | 2023-10-07 17:50 | 57K | |
| nanort-g20201207.pkg | 2023-10-09 03:09 | 17K | |
| nanosvg-g20221204.pkg | 2023-10-08 03:40 | 26K | |
| nanovna-saver-0.5.3_..> | 2023-10-10 16:27 | 221K | |
| nant-0.92_4.pkg | 2023-10-14 18:25 | 1.1M | |
| narcissu2-1.1_2.pkg | 2023-10-09 22:34 | 269M | |
| nas-1.9.4_3.pkg | 2023-10-06 22:06 | 430K | |
| nasawash-0.50.pkg | 2023-10-08 16:53 | 7.2K | |
| nasm-2.16.01,2.pkg | 2023-10-05 16:49 | 542K | |
| nast-0.2.1.g20210616..> | 2023-10-10 23:41 | 52K | |
| nats-nkeys-0.4.5.pkg | 2023-10-14 15:14 | 639K | |
| nats-nsc-2.8.1.pkg | 2023-10-14 03:00 | 3.4M | |
| nats-server-2.9.22_1..> | 2023-10-14 15:05 | 3.7M | |
| nats-streaming-serve..> | 2023-10-10 11:33 | 5.3M | |
| nats-top-0.6.0_3.pkg | 2023-10-08 20:07 | 2.0M | |
| natscli-0.0.35_8.pkg | 2023-10-08 14:55 | 5.6M | |
| naturaldocs-1.52_2,1..> | 2023-10-10 10:55 | 276K | |
| nautilus-42.2_3.pkg | 2023-10-06 18:55 | 2.1M | |
| nautilus-python-1.2...> | 2023-10-10 13:45 | 8.8K | |
| nautilus-sendto-3.8...> | 2023-10-08 23:57 | 48K | |
| nauty-2.8.6,1.pkg | 2023-10-06 14:14 | 1.9M | |
| nawk-20121220_1.pkg | 2023-10-14 18:49 | 56K | |
| nazghul-0.7.1_5.pkg | 2023-10-14 17:56 | 6.4M | |
| nb-aspell-0.50.1.0_1..> | 2023-10-09 15:01 | 2.9M | |
| nb-libreoffice-7.5.5..> | 2023-10-08 05:33 | 3.0M | |
| nbd-server-3.24,1.pkg | 2023-10-09 13:44 | 51K | |
| nbdkit-1.20.4_1.pkg | 2023-10-09 15:01 | 390K | |
| nbench-2.2.3.pkg | 2023-10-10 02:50 | 262K | |
| nbfc-0.1.pkg | 2023-10-10 09:12 | 14K | |
| nbosd-0.5.0_7.pkg | 2023-10-09 08:51 | 5.7K | |
| nbsdgames-5.pkg | 2023-10-09 13:41 | 99K | |
| nbsmtp-1.00_3.pkg | 2023-10-14 05:48 | 15K | |
| nbtscan-1.7.2.pkg | 2023-10-07 23:45 | 14K | |
| nc-1.0.1_1.pkg | 2023-10-14 14:52 | 7.2K | |
| ncbi-blast+-2.14.1.pkg | 2023-10-07 22:26 | 208M | |
| ncbi-cxx-toolkit-27...> | 2023-10-14 19:27 | 33M | |
| ncbi-entrez-direct-1..> | 2023-10-07 11:35 | 1.8M | |
| ncbi-toolkit-2017.01..> | 2023-10-09 19:32 | 91M | |
| ncbi-vdb-2.11.0_6.pkg | 2023-10-09 09:55 | 2.4M | |
| ncc-2.8_3.pkg | 2023-10-14 19:01 | 104K | |
| ncdc-1.22.1_3.pkg | 2023-10-09 09:15 | 178K | |
| ncdu-1.18.1.pkg | 2023-10-09 13:37 | 41K | |
| ncdu2-2.2.2_4.pkg | 2023-10-08 15:57 | 216K | |
| ncftp-3.2.6_2.pkg | 2023-10-07 05:04 | 293K | |
| ncid-1.11_1.pkg | 2023-10-09 19:06 | 813K | |
| ncmpc-0.48.pkg | 2023-10-09 14:27 | 344K | |
| ncmpcpp-0.9.2_9.pkg | 2023-10-09 14:17 | 624K | |
| ncnf-3.0.1_5.pkg | 2023-10-11 00:14 | 84K | |
| ncnn-20230816.pkg | 2023-10-09 13:02 | 13M | |
| ncp-1.2.4.pkg | 2023-10-09 17:53 | 20K | |
| ncpamixer-1.3.3.5_1.pkg | 2023-10-14 05:44 | 30K | |
| ncrack-0.7.pkg | 2023-10-14 06:55 | 605K | |
| ncrypt-0.8.1_1.pkg | 2023-10-10 06:43 | 41K | |
| ncspot-0.13.4_2.pkg | 2023-10-10 11:05 | 3.4M | |
| ncurses-6.4.pkg | 2023-10-06 20:18 | 1.2M | |
| ndesk-dbus-0.6.1a_3.pkg | 2023-10-08 09:54 | 43K | |
| ndesk-dbus-glib-0.4...> | 2023-10-10 10:08 | 5.7K | |
| ndesk-options-0.2.1_..> | 2023-10-08 15:55 | 49K | |
| ndiff-2.00_4.pkg | 2023-10-09 08:45 | 72K | |
| ndisc6-1.0.7.pkg | 2023-10-14 14:28 | 60K | |
| ndmpd-1.2_1.pkg | 2023-10-08 17:03 | 61K | |
| ndoutils-2.1.3.pkg | 2023-10-08 15:08 | 1.5M | |
| ndpi-4.6.d20230510,1..> | 2023-10-07 10:47 | 809K | |
| ndpmon-1.4.0_8.pkg | 2023-10-14 02:46 | 25K | |
| ndproxy-3.2.pkg | 2023-10-08 12:38 | 12K | |
| nds-aspell-0.01.0_1,..> | 2023-10-10 07:17 | 32K | |
| ne-3.3.2.pkg | 2023-10-14 02:42 | 775K | |
| ne-libreoffice-7.5.5..> | 2023-10-07 14:06 | 2.7M | |
| neXtaw-0.15.1_5.pkg | 2023-10-08 07:08 | 262K | |
| neatvnc-0.6.0_2.pkg | 2023-10-07 12:40 | 33K | |
| nebula-1.7.2_2.pkg | 2023-10-10 04:01 | 4.7M | |
| nec2c-1.3.pkg | 2023-10-08 19:22 | 99K | |
| nedit-5.7.pkg | 2023-10-11 10:51 | 471K | |
| neko-2.2.0_12.pkg | 2023-10-09 07:16 | 336K | |
| nemesis-1.8.5_1,1.pkg | 2023-10-09 21:49 | 57K | |
| nemo-5.4.2_2.pkg | 2023-10-08 03:56 | 1.0M | |
| nemu-3.2.0.pkg | 2023-10-11 06:18 | 85K | |
| nenscript-1.13.3.pkg | 2023-10-09 10:42 | 16K | |
| neo-0.6.1.pkg | 2023-10-10 14:42 | 29K | |
| neo-cowsay-2.0.4_13.pkg | 2023-10-14 02:23 | 928K | |
| neo4j-4.4.24.pkg | 2023-10-10 17:54 | 95M | |
| neochat-23.08.1_1.pkg | 2023-10-11 11:35 | 1.3M | |
| neofetch-7.1.0_1.pkg | 2023-10-08 18:08 | 79K | |
| neolink-0.3.0_19.pkg | 2023-10-09 15:25 | 791K | |
| neomutt-20230517.pkg | 2023-10-14 16:50 | 1.6M | |
| neon-0.32.4.pkg | 2023-10-06 13:48 | 191K | |
| neovim-0.9.2.pkg | 2023-10-08 01:10 | 5.8M | |
| neovim-gtk-1.0.4_5.pkg | 2023-10-14 04:06 | 967K | |
| neovim-qt5-0.2.17.66..> | 2023-10-08 21:36 | 606K | |
| neovim-qt6-0.2.17.66..> | 2023-10-10 20:30 | 678K | |
| nepenthes-0.2.2_17.pkg | 2023-10-09 22:34 | 758K | |
| nerd-fonts-2.1.0.pkg | 2023-10-10 22:48 | 230M | |
| nerdctl-1.2.1_4.pkg | 2023-10-11 05:37 | 8.2M | |
| nesasm-20040314_1.pkg | 2023-10-09 15:07 | 53K | |
| nest-3.5_1.pkg | 2023-10-09 20:12 | 10M | |
| nestopia-1.52.0_1.pkg | 2023-10-09 21:36 | 855K | |
| net-snmp-5.9.1_4,1.pkg | 2023-10-06 19:43 | 2.3M | |
| net2ftp-1.4.pkg | 2023-10-09 22:03 | 2.5M | |
| net6-1.3.14_9.pkg | 2023-10-07 09:35 | 106K | |
| netatalk3-3.1.16,1.pkg | 2023-10-10 23:27 | 498K | |
| netbeans-17.pkg | 2023-10-08 21:01 | 379M | |
| netbox-3.6.1.pkg | 2023-10-11 00:23 | 5.1M | |
| netcat-1.10_3.pkg | 2023-10-09 14:17 | 415K | |
| netcdf-4.9.2.pkg | 2023-10-06 10:23 | 910K | |
| netcdf-cxx-4.3.1_3.pkg | 2023-10-07 05:26 | 159K | |
| netcdf-fortran-4.6.0..> | 2023-10-07 09:09 | 311K | |
| netdata-1.42.4.pkg | 2023-10-11 12:50 | 11M | |
| netdata-go-0.55.0.pkg | 2023-10-11 20:11 | 11M | |
| netdisco-2.061001.pkg | 2023-10-08 16:53 | 2.6M | |
| netdisco-mibs-4.034.pkg | 2023-10-07 22:18 | 38M | |
| netdot-1.0.7_4.pkg | 2023-10-11 01:34 | 1.0M | |
| netdumpd-20220406.pkg | 2023-10-09 20:12 | 18K | |
| netease-music-tui-0...> | 2023-10-10 00:27 | 1.4M | |
| netembryo-0.1.1_2.pkg | 2023-10-10 15:05 | 16K | |
| netevent-0.2.1.79_2.pkg | 2023-10-14 16:21 | 47K | |
| netgen-6.2.2304.pkg | 2023-10-08 23:30 | 3.1M | |
| netgen-lvs-1.5.256.pkg | 2023-10-07 12:34 | 224K | |
| nethack32-3.2.3_7.pkg | 2023-10-09 00:21 | 843K | |
| nethack33-3.3.1_11.pkg | 2023-10-09 00:13 | 1.0M | |
| nethack33-nox11-3.3...> | 2023-10-10 09:34 | 1.0M | |
| nethack34-3.4.3_9.pkg | 2023-10-08 21:27 | 1.1M | |
| nethack34-nox11-3.4...> | 2023-10-10 05:34 | 1.1M | |
| nethack36-3.6.7.pkg | 2023-10-10 15:59 | 1.6M | |
| nethack36-nox11-3.6...> | 2023-10-10 09:27 | 1.6M | |
| netherearth-0.51_12.pkg | 2023-10-14 04:53 | 263K | |
| nethogs-0.8.5_1.pkg | 2023-10-08 17:43 | 24K | |
| netio-1.33.pkg | 2023-10-14 15:15 | 12K | |
| netleak-0.1a_2.pkg | 2023-10-08 16:57 | 14K | |
| netmagis-common-2.3...> | 2023-10-08 00:47 | 117K | |
| netmagis-database-2...> | 2023-10-10 06:20 | 42K | |
| netmagis-detecteq-2...> | 2023-10-10 04:31 | 5.1K | |
| netmagis-metro-2.3.6..> | 2023-10-14 09:05 | 50K | |
| netmagis-servers-2.3..> | 2023-10-09 15:13 | 10K | |
| netmagis-topo-2.3.6_..> | 2023-10-14 12:11 | 172K | |
| netmagis-utils-2.3.6..> | 2023-10-09 11:20 | 4.7K | |
| netmagis-www-2.3.6_1..> | 2023-10-10 05:06 | 191K | |
| netmap-0.1.3_2.pkg | 2023-10-08 14:03 | 45K | |
| netmask-2.4_2.pkg | 2023-10-08 22:36 | 7.4K | |
| netpbm-11.03.05.pkg | 2023-10-06 19:14 | 1.2M | |
| netperf-2.7.1.p20210..> | 2023-10-09 19:53 | 179K | |
| netperfmeter-1.9.0.pkg | 2023-10-09 01:02 | 115K | |
| netpipes-4.2.pkg | 2023-10-09 12:17 | 48K | |
| netqmail-1.06_6.pkg | 2023-10-06 22:08 | 242K | |
| netqmail-mysql-1.06...> | 2023-10-08 17:44 | 250K | |
| netqmail-tls-1.06.20..> | 2023-10-14 11:44 | 255K | |
| netradiant-20150621_..> | 2023-10-10 09:15 | 1.7M | |
| netrek-BRMH-2.2.2_2.pkg | 2023-10-10 18:23 | 258K | |
| netrek-client-cow-3...> | 2023-10-09 13:02 | 1.1M | |
| netrik-1.16.1.pkg | 2023-10-09 12:35 | 152K | |
| netron-4.1.9.pkg | 2023-10-08 15:59 | 930K | |
| netscape-java40-1999..> | 2023-10-07 17:47 | 1.6M | |
| netscript-1.7.1_4.pkg | 2023-10-11 02:42 | 49K | |
| netsed-1.3.pkg | 2023-10-10 11:16 | 12K | |
| netselect-0.4.pkg | 2023-10-10 19:52 | 12K | |
| netspoc-3.2_1.pkg | 2023-10-08 20:32 | 180K | |
| netstiff-20080331.pkg | 2023-10-10 09:20 | 19K | |
| netstrain-3.0.pkg | 2023-10-08 20:32 | 9.5K | |
| netsurf-3.10_8.pkg | 2023-10-08 12:14 | 1.1M | |
| netsurf-buildsystem-..> | 2023-10-06 13:49 | 13K | |
| nettle-3.9.1.pkg | 2023-10-05 17:29 | 1.4M | |
| nettoe-1.5.1_1.pkg | 2023-10-10 13:10 | 21K | |
| netty-4.1.53.pkg | 2023-10-08 11:21 | 12M | |
| netwalk-0.4.11_3.pkg | 2023-10-09 15:27 | 69K | |
| netwib-5.38.0_2.pkg | 2023-10-10 01:49 | 315K | |
| networkmgr-6.2.pkg | 2023-10-10 15:23 | 1.1M | |
| netxms-3.9.420.pkg | 2023-10-09 06:32 | 1.0M | |
| nevada-toolset-g2020..> | 2023-10-10 22:17 | 195K | |
| neverball-1.6.0_4.pkg | 2023-10-09 23:52 | 48M | |
| newfile-1.0.14_6.pkg | 2023-10-09 14:59 | 37K | |
| newlisp-10.7.5_3.pkg | 2023-10-10 16:45 | 676K | |
| newmat-1.1_1.pkg | 2023-10-09 09:31 | 230K | |
| newsboat-2.30.1_5.pkg | 2023-10-08 17:52 | 1.7M | |
| newsfetch-1.21_2.pkg | 2023-10-14 06:09 | 12K | |
| newsfish-1.2.6.pkg | 2023-10-08 19:23 | 20K | |
| newsgrab-0.4.0_1.pkg | 2023-10-14 15:46 | 12K | |
| newspost-2.1.1_1.pkg | 2023-10-08 20:27 | 36K | |
| newsstar-1.5.6_4.pkg | 2023-10-10 14:46 | 84K | |
| newsx-1.6_4.pkg | 2023-10-10 04:30 | 86K | |
| newt-0.52.22.pkg | 2023-10-06 17:14 | 94K | |
| newtonsoft-json-9.0...> | 2023-10-08 09:40 | 221K | |
| newvox-1.0_8.pkg | 2023-10-10 01:00 | 5.3K | |
| nexfontsel-3.0.1_4.pkg | 2023-10-10 07:42 | 23K | |
| nextcloud-appointmen..> | 2023-10-10 12:47 | 1.3M | |
| nextcloud-appointmen..> | 2023-10-10 10:29 | 1.3M | |
| nextcloud-appointmen..> | 2023-10-10 07:46 | 1.3M | |
| nextcloud-calendar-p..> | 2023-10-10 04:53 | 9.7M | |
| nextcloud-calendar-p..> | 2023-10-09 12:10 | 9.7M | |
| nextcloud-calendar-p..> | 2023-10-09 00:51 | 9.7M | |
| nextcloud-contacts-p..> | 2023-10-08 20:19 | 3.2M | |
| nextcloud-contacts-p..> | 2023-10-10 07:42 | 3.2M | |
| nextcloud-contacts-p..> | 2023-10-09 09:12 | 3.2M | |
| nextcloud-cospend-ph..> | 2023-10-12 09:48 | 3.6M | |
| nextcloud-cospend-ph..> | 2023-10-09 13:26 | 3.6M | |
| nextcloud-cospend-ph..> | 2023-10-14 09:51 | 3.6M | |
| nextcloud-deck-php80..> | 2023-10-09 12:19 | 8.9M | |
| nextcloud-deck-php81..> | 2023-10-09 17:52 | 8.9M | |
| nextcloud-deck-php82..> | 2023-10-14 08:38 | 8.9M | |
| nextcloud-end_to_end..> | 2023-10-11 01:24 | 1.3M | |
| nextcloud-end_to_end..> | 2023-10-09 04:52 | 1.3M | |
| nextcloud-end_to_end..> | 2023-10-08 20:22 | 1.3M | |
| nextcloud-forms-php8..> | 2023-10-09 12:07 | 3.5M | |
| nextcloud-forms-php8..> | 2023-10-14 13:45 | 3.5M | |
| nextcloud-forms-php8..> | 2023-10-14 06:31 | 3.5M | |
| nextcloud-groupfolde..> | 2023-10-08 20:17 | 2.3M | |
| nextcloud-groupfolde..> | 2023-10-10 05:01 | 2.3M | |
| nextcloud-groupfolde..> | 2023-10-14 13:15 | 2.3M | |
| nextcloud-mail-php80..> | 2023-10-14 13:57 | 18M | |
| nextcloud-mail-php81..> | 2023-10-09 07:42 | 18M | |
| nextcloud-mail-php82..> | 2023-10-10 06:38 | 18M | |
| nextcloud-notes-php8..> | 2023-10-11 16:26 | 4.1M | |
| nextcloud-notes-php8..> | 2023-10-10 12:02 | 4.1M | |
| nextcloud-notes-php8..> | 2023-10-14 11:52 | 4.1M | |
| nextcloud-passman-ph..> | 2023-10-11 18:08 | 1.7M | |
| nextcloud-passman-ph..> | 2023-10-09 08:09 | 1.7M | |
| nextcloud-passman-ph..> | 2023-10-10 09:35 | 1.7M | |
| nextcloud-php80-27.1..> | 2023-10-08 00:59 | 144M | |
| nextcloud-php81-27.1..> | 2023-10-07 17:35 | 144M | |
| nextcloud-php82-27.1..> | 2023-10-08 08:52 | 144M | |
| nextcloud-spreed-sig..> | 2023-10-10 09:06 | 9.5M | |
| nextcloud-talk-php80..> | 2023-10-12 02:07 | 26M | |
| nextcloud-talk-php81..> | 2023-10-08 20:40 | 26M | |
| nextcloud-talk-php82..> | 2023-10-14 17:24 | 26M | |
| nextcloud-tasks-php8..> | 2023-10-09 08:04 | 5.7M | |
| nextcloud-tasks-php8..> | 2023-10-08 15:00 | 5.7M | |
| nextcloud-tasks-php8..> | 2023-10-14 07:37 | 5.7M | |
| nextcloud-twofactor_..> | 2023-10-14 18:49 | 341K | |
| nextcloud-twofactor_..> | 2023-10-10 16:51 | 341K | |
| nextcloud-twofactor_..> | 2023-10-10 09:54 | 341K | |
| nextcloud-twofactor_..> | 2023-10-10 19:49 | 443K | |
| nextcloud-twofactor_..> | 2023-10-09 00:59 | 443K | |
| nextcloud-twofactor_..> | 2023-10-09 18:23 | 443K | |
| nextcloud-twofactor_..> | 2023-10-09 21:11 | 6.8M | |
| nextcloud-twofactor_..> | 2023-10-10 17:59 | 6.8M | |
| nextcloud-twofactor_..> | 2023-10-09 16:18 | 6.8M | |
| nextcloudclient-3.9...> | 2023-10-09 21:52 | 3.7M | |
| nextdns-1.39.4_2.pkg | 2023-10-11 14:16 | 2.2M | |
| nextgo-3.0_11.pkg | 2023-10-07 10:43 | 119K | |
| nextpnr-0.4_1,1.pkg | 2023-10-14 09:35 | 34M | |
| nexuiz-2.5.2_21.pkg | 2023-10-11 00:55 | 879M | |
| nexus2-oss-2.15.1.pkg | 2023-10-09 03:08 | 81M | |
| nezd-0.1.0_1.pkg | 2023-10-08 22:10 | 25K | |
| nfcutils-0.1.2_1.pkg | 2023-10-09 22:27 | 5.0K | |
| nfdump-1.6.20_1.pkg | 2023-10-08 07:02 | 240K | |
| nfft-3.5.3_1.pkg | 2023-10-14 05:07 | 2.2M | |
| nflib-1.0.0.23_4.pkg | 2023-10-09 06:46 | 75K | |
| nfpm-2.32.0_2.pkg | 2023-10-12 00:20 | 3.8M | |
| nfs-exporter-0.4.2_5..> | 2023-10-11 04:49 | 600K | |
| nfsen-1.3.8_1.pkg | 2023-10-08 22:59 | 159K | |
| nfsshell-20130510_4.pkg | 2023-10-14 10:49 | 23K | |
| nfstrace-0.4.3.2_1.pkg | 2023-10-11 11:20 | 257K | |
| nfy-0.2.pkg | 2023-10-10 08:44 | 5.3K | |
| ng_ipacct-20210316_1..> | 2023-10-09 22:16 | 20K | |
| ng_mikrotik_eoip-1.0..> | 2023-10-09 10:46 | 3.1K | |
| nget-0.27.1_7.pkg | 2023-10-08 13:04 | 235K | |
| nghttp2-1.55.1.pkg | 2023-10-08 09:29 | 563K | |
| nginx-1.24.0_12,3.pkg | 2023-10-08 00:43 | 462K | |
| nginx-devel-1.25.2_4..> | 2023-10-11 13:09 | 514K | |
| nginx-lite-1.24.0,3.pkg | 2023-10-11 16:07 | 340K | |
| nginx-naxsi-1.24.0,3..> | 2023-10-09 02:44 | 552K | |
| nginx-prometheus-exp..> | 2023-10-11 07:36 | 2.7M | |
| nginx-ultimate-bad-b..> | 2023-10-11 17:51 | 11K | |
| nginx-vts-exporter-0..> | 2023-10-09 04:01 | 2.4M | |
| ngircd-26.1,1.pkg | 2023-10-14 03:40 | 162K | |
| ngraph-6.3.54_1.pkg | 2023-10-11 18:22 | 911K | |
| ngrep-1.45_4.pkg | 2023-10-09 23:47 | 43K | |
| ngrok-2.2.8_1.pkg | 2023-10-09 16:43 | 2.8M | |
| ngs-sdk-3.0.1.pkg | 2023-10-10 11:09 | 95K | |
| ngspice_rework-41.pkg | 2023-10-07 17:03 | 1.8M | |
| ngspice_rework-shlib..> | 2023-10-07 07:50 | 2.0M | |
| nheko-0.11.3_2.pkg | 2023-10-10 04:09 | 2.1M | |
| nibbleblog-3.0.2_2.pkg | 2023-10-11 20:29 | 279K | |
| nickle-2.93.pkg | 2023-10-10 10:46 | 356K | |
| nifmon-1.4.pkg | 2023-10-10 17:16 | 11K | |
| nift-2.4.11_1.pkg | 2023-10-09 19:31 | 806K | |
| nifticlib-2.0.0_1.pkg | 2023-10-07 17:50 | 215K | |
| nightfall-1.92_5.pkg | 2023-10-10 03:33 | 405K | |
| nighthawk-3.0.0_6.pkg | 2023-10-09 22:35 | 557K | |
| nikto-2.1.6,1.pkg | 2023-10-14 02:42 | 332K | |
| nim-2.0.0_1.pkg | 2023-10-07 13:41 | 6.7M | |
| nimble-0.14.2.pkg | 2023-10-09 15:58 | 424K | |
| nimuh-1.02_12.pkg | 2023-10-09 22:14 | 47M | |
| nini-1.1.0_3.pkg | 2023-10-07 10:36 | 336K | |
| ninix-aya-5.0.9.pkg | 2023-10-14 08:38 | 230K | |
| ninja-1.11.1,2.pkg | 2023-10-05 17:14 | 110K | |
| nip2-8.7.1_13.pkg | 2023-10-10 06:57 | 3.6M | |
| nist-kat-0.0.2015.02..> | 2023-10-11 22:54 | 13M | |
| nitpicker-1.2.1,1.pkg | 2023-10-10 09:34 | 13K | |
| nitrogen-1.6.1_5.pkg | 2023-10-07 20:05 | 147K | |
| nitrokey-app-1.4.2_1..> | 2023-10-09 21:39 | 374K | |
| nitroshare-0.3.4.642..> | 2023-10-09 04:31 | 264K | |
| njam-1.25_12.pkg | 2023-10-10 17:07 | 1.3M | |
| njs-0.8.1.pkg | 2023-10-14 03:05 | 263K | |
| nl-aspell-0.50.2_1,1..> | 2023-10-10 16:32 | 1.4M | |
| nl-hunspell-2.10.pkg | 2023-10-10 02:59 | 654K | |
| nl-hyphen-2005.10.16..> | 2023-10-10 08:44 | 47K | |
| nl-libreoffice-7.5.5..> | 2023-10-07 18:56 | 3.1M | |
| nl-mythes-2015.12.10..> | 2023-10-10 16:33 | 790K | |
| nlarn-0.7.6.pkg | 2023-10-14 16:55 | 237K | |
| nlcglib-1.0.b.202306..> | 2023-10-10 02:47 | 269K | |
| nll-20230909a.pkg | 2023-10-09 02:27 | 116K | |
| nll-nosdl-20230909a.pkg | 2023-10-09 06:45 | 114K | |
| nload-0.7.4_1.pkg | 2023-10-08 22:10 | 49K | |
| nlohmann-json-3.11.2..> | 2023-10-06 16:26 | 107K | |
| nlopt-2.7.1_2.pkg | 2023-10-06 13:29 | 361K | |
| nmap-7.94.pkg | 2023-10-05 16:52 | 5.7M | |
| nmealib-0.5.3.pkg | 2023-10-12 09:02 | 20K | |
| nmh-1.8.pkg | 2023-10-07 18:39 | 1.1M | |
| nmh-devel-2023.08.27..> | 2023-10-09 21:09 | 1.1M | |
| nmrpflash-0.9.21.pkg | 2023-10-14 07:16 | 19K | |
| nms-1.0.1,1.pkg | 2023-10-09 16:41 | 11K | |
| nmsg-1.1.1.pkg | 2023-10-07 00:20 | 305K | |
| nn-6.7.3_1.pkg | 2023-10-09 22:19 | 314K | |
| nn-aspell-0.50.1.1_1..> | 2023-10-08 16:45 | 1.8M | |
| nn-insight-1.0.7_7.pkg | 2023-10-10 13:05 | 777K | |
| nn-libreoffice-7.5.5..> | 2023-10-07 15:28 | 3.0M | |
| nnap-1.1.pkg | 2023-10-14 16:37 | 5.1K | |
| nncp-8.8.1_8.pkg | 2023-10-14 09:15 | 13M | |
| nng-1.5.2.pkg | 2023-10-09 07:46 | 169K | |
| nnn-4.8.pkg | 2023-10-10 00:30 | 113K | |
| nntp-1.5.12.2_12.pkg | 2023-10-09 03:14 | 101K | |
| noattach-1.2_4.pkg | 2023-10-14 10:58 | 17K | |
| nocc-1.9.13.pkg | 2023-10-10 01:56 | 845K | |
| node-18.16.0.pkg | 2023-10-05 19:00 | 596 | |
| node-thrift-0.16.0_2..> | 2023-10-09 06:15 | 58K | |
| node10-10.24.1_3.pkg | 2023-10-14 13:15 | 5.1M | |
| node12-12.22.1_2.pkg | 2023-10-14 02:35 | 6.3M | |
| node14-14.21.1_2.pkg | 2023-10-14 06:56 | 6.9M | |
| node18-18.17.1.pkg | 2023-10-05 19:00 | 8.1M | |
| node20-20.6.0.pkg | 2023-10-07 13:20 | 8.7M | |
| node_exporter-1.5.0_..> | 2023-10-08 18:19 | 3.4M | |
| noffle-1.1.5_3.pkg | 2023-10-08 13:06 | 89K | |
| noip-2.1.9_4.pkg | 2023-10-09 19:26 | 28K | |
| noise-repellent-lv2-..> | 2023-10-10 04:53 | 8.5K | |
| noise-suppression-fo..> | 2023-10-14 10:38 | 1.8M | |
| nologin-1.0_1.pkg | 2023-10-14 13:34 | 4.3K | |
| nologinmsg-1.0_1.pkg | 2023-10-12 09:47 | 4.4K | |
| nomacs-3.16_10.pkg | 2023-10-09 09:38 | 1.9M | |
| nomad-1.5.3_3.pkg | 2023-10-07 07:45 | 15M | |
| nomad-pot-driver-0.9..> | 2023-10-07 11:26 | 3.6M | |
| nomadnet-0.3.6.pkg | 2023-10-14 14:58 | 187K | |
| nomarch-1.4.pkg | 2023-10-14 17:21 | 21K | |
| nomyso-4.3.pkg | 2023-10-14 12:36 | 18K | |
| nonsense-0.6_2.pkg | 2023-10-09 17:21 | 97K | |
| nordic-theme-2.1.0.pkg | 2023-10-09 12:39 | 4.4M | |
| norm-1.5r6_3.pkg | 2023-10-05 17:35 | 225K | |
| normalize-0.7.7_11.pkg | 2023-10-08 01:16 | 45K | |
| normalizemime-1.19_1..> | 2023-10-08 22:55 | 30K | |
| nosefart-1.92f_1.pkg | 2023-10-14 17:20 | 37K | |
| noson-app-5.4.1_1.pkg | 2023-10-08 15:14 | 1.2M | |
| nosqlbench-0.0.20151..> | 2023-10-10 05:03 | 283K | |
| nostromo-1.9.6.pkg | 2023-10-08 23:49 | 34K | |
| nostt-1.1.1_1.pkg | 2023-10-14 08:53 | 11K | |
| notcurses-3.0.8_3.pkg | 2023-10-10 02:46 | 6.4M | |
| note-1.3.26.pkg | 2023-10-09 01:22 | 52K | |
| notekit-0.2.0_1.pkg | 2023-10-10 06:04 | 187K | |
| notepadnext-0.6.3.pkg | 2023-10-14 10:22 | 1.3M | |
| notes-2.1.0.pkg | 2023-10-14 06:21 | 2.1M | |
| noti-3.7.0_4.pkg | 2023-10-10 16:19 | 2.7M | |
| notification-daemon-..> | 2023-10-08 03:33 | 43K | |
| notify-osd-0.9.34_4.pkg | 2023-10-08 06:55 | 102K | |
| notify-sharp-3.0.3_2..> | 2023-10-14 12:14 | 12K | |
| notmuch-0.38.pkg | 2023-10-07 00:54 | 218K | |
| notmuch-emacs-0.38.pkg | 2023-10-10 01:32 | 226K | |
| notmuch-emacs_canna-..> | 2023-10-10 05:52 | 226K | |
| notmuch-emacs_devel-..> | 2023-10-14 02:37 | 226K | |
| notmuch-emacs_devel_..> | 2023-10-14 10:19 | 226K | |
| notmuch-emacs_nox-0...> | 2023-10-09 08:42 | 226K | |
| notmuch-mutt-0.38.pkg | 2023-10-08 17:09 | 7.8K | |
| noto-2.0.pkg | 2023-10-08 08:21 | 1.0K | |
| noto-basic-2.0_2.pkg | 2023-10-05 17:43 | 1.4M | |
| noto-emoji-2.038.pkg | 2023-10-07 08:08 | 8.9M | |
| noto-extra-2.0_1.pkg | 2023-10-07 02:18 | 58M | |
| noto-hk-2.004.pkg | 2023-10-07 02:57 | 764 | |
| noto-jp-2.004.pkg | 2023-10-07 03:10 | 756 | |
| noto-kr-2.004.pkg | 2023-10-07 09:24 | 756 | |
| noto-sans-hk-2.004.pkg | 2023-10-06 19:46 | 120M | |
| noto-sans-jp-2.004.pkg | 2023-10-06 20:26 | 115M | |
| noto-sans-kr-2.004.pkg | 2023-10-06 21:07 | 113M | |
| noto-sans-sc-2.004.pkg | 2023-10-06 22:57 | 132M | |
| noto-sans-tc-2.004.pkg | 2023-10-06 22:56 | 120M | |
| noto-sc-2.004.pkg | 2023-10-07 07:36 | 756 | |
| noto-serif-hk-2.001.pkg | 2023-10-06 19:29 | 142M | |
| noto-serif-jp-2.001.pkg | 2023-10-06 21:28 | 134M | |
| noto-serif-kr-2.001.pkg | 2023-10-06 20:41 | 134M | |
| noto-serif-sc-2.001.pkg | 2023-10-06 21:29 | 160M | |
| noto-serif-tc-2.001.pkg | 2023-10-06 22:39 | 142M | |
| noto-tc-2.004.pkg | 2023-10-07 02:30 | 756 | |
| novelwriter-2.0.7_1.pkg | 2023-10-10 17:58 | 580K | |
| novnc-1.4.0.pkg | 2023-10-08 01:00 | 597K | |
| nox-2023.4.22.pkg | 2023-10-10 18:43 | 67K | |
| npadmin-0.8.7_1.pkg | 2023-10-08 19:18 | 51K | |
| npapi-xine-1.0.2_14.pkg | 2023-10-08 13:10 | 17K | |
| npc-0.83.pkg | 2023-10-09 18:08 | 24K | |
| nplot-0.9.11_3.pkg | 2023-10-10 12:11 | 45K | |
| npm-9.7.2.pkg | 2023-10-06 16:48 | 520 | |
| npm-node18-9.7.2.pkg | 2023-10-06 15:23 | 2.0M | |
| npm-node20-9.7.2.pkg | 2023-10-10 09:50 | 2.0M | |
| npmount-0.1.1.pkg | 2023-10-07 15:54 | 11K | |
| npretty-0.9.3.1_4.pkg | 2023-10-11 05:43 | 31K | |
| npth-1.6.pkg | 2023-10-05 16:45 | 12K | |
| npush-0.7.pkg | 2023-10-09 03:19 | 76K | |
| nq-0.5.pkg | 2023-10-10 04:05 | 11K | |
| nqc-3.1.r6_1.pkg | 2023-10-08 20:56 | 135K | |
| nqptp-1.2.3.pkg | 2023-10-07 11:36 | 13K | |
| nqueens-1.0.pkg | 2023-10-08 21:04 | 3.8K | |
| nr-libreoffice-7.5.5..> | 2023-10-07 19:22 | 197K | |
| nrg2iso-0.4.pkg | 2023-10-14 15:21 | 3.8K | |
| nrpe-4.1.0.pkg | 2023-10-14 13:20 | 42K | |
| ns3-3.35_2.pkg | 2023-10-10 19:41 | 18M | |
| nsca-2.9.2_1.pkg | 2023-10-10 15:57 | 23K | |
| nsca-client-2.9.2_1.pkg | 2023-10-09 09:48 | 16K | |
| nsca-ng-1.6.pkg | 2023-10-08 11:59 | 39K | |
| nsca-ng-client-1.6.pkg | 2023-10-14 10:36 | 35K | |
| nsca27-2.7.2_8.pkg | 2023-10-09 10:08 | 21K | |
| nsca27-client-2.7.2_..> | 2023-10-10 03:10 | 16K | |
| nscde-2.3.pkg | 2023-10-12 09:58 | 25M | |
| nsd-4.7.0.pkg | 2023-10-10 18:55 | 454K | |
| nsd_exporter-0.1.0_1..> | 2023-10-08 22:17 | 2.3M | |
| nsf-1.0.pkg | 2023-10-08 21:18 | 8.9K | |
| nsgenbind-0.8.pkg | 2023-10-07 12:06 | 47K | |
| nsh-0.4.2_18.pkg | 2023-10-10 09:26 | 3.6M | |
| nslint-3.1.pkg | 2023-10-14 17:50 | 25K | |
| nsnake-2.2.0.pkg | 2023-10-14 13:48 | 8.4K | |
| nsnotifyd-2.0.pkg | 2023-10-12 06:52 | 24K | |
| nso-libreoffice-7.5...> | 2023-10-07 17:54 | 222K | |
| nsping-0.8_2.pkg | 2023-10-09 09:43 | 8.4K | |
| nspr-4.35.pkg | 2023-10-05 16:49 | 238K | |
| nsq-1.2.1_14.pkg | 2023-10-10 04:38 | 8.1M | |
| nss-3.93_1.pkg | 2023-10-05 17:55 | 2.0M | |
| nss-pam-ldapd-0.9.12..> | 2023-10-10 03:48 | 94K | |
| nss-pam-ldapd-sasl-0..> | 2023-10-11 20:36 | 94K | |
| nss_compat_ossl-0.9...> | 2023-10-08 20:44 | 37K | |
| nss_mdns-0.14.1.2020..> | 2023-10-11 15:52 | 17K | |
| nss_ndb-1.0.24.pkg | 2023-10-09 19:52 | 34K | |
| nss_resinit-20060412..> | 2023-10-08 23:40 | 4.4K | |
| nss_wrapper-1.1.3_2.pkg | 2023-10-08 05:34 | 20K | |
| nsscache-0.49.pkg | 2023-10-10 13:49 | 160K | |
| nstat-g20230601,1.pkg | 2023-10-08 22:09 | 7.2K | |
| nsxiv-28.pkg | 2023-10-07 15:23 | 39K | |
| nsync-1.24.0.pkg | 2023-10-07 05:27 | 35K | |
| nsysctl-2.1.2.pkg | 2023-10-09 21:28 | 17K | |
| ntfs2btrfs-20230501.pkg | 2023-10-09 03:53 | 140K | |
| ntfy-2.7.0.14.pkg | 2023-10-08 22:52 | 54K | |
| ntimed-0.0.2015.01.3..> | 2023-10-08 17:46 | 22K | |
| ntk-1.3.1001_1.pkg | 2023-10-07 11:14 | 809K | |
| ntl-11.5.1_1.pkg | 2023-10-06 09:23 | 2.4M | |
| ntopng-5.6.d20230828..> | 2023-10-09 08:45 | 4.3M | |
| ntp-4.2.8p17_1.pkg | 2023-10-08 12:34 | 1.7M | |
| ntpa-0.8.2_6.pkg | 2023-10-11 12:41 | 453K | |
| ntpd-rs-0.3.7_1.pkg | 2023-10-09 08:17 | 2.5M | |
| ntpsec-1.2.1.52_1.pkg | 2023-10-14 11:19 | 1.6M | |
| ntpstat-0.6.pkg | 2023-10-10 02:07 | 3.5K | |
| ntraceroute-6.4.2_3.pkg | 2023-10-09 17:08 | 13K | |
| nttcp-1.47_3.pkg | 2023-10-14 04:17 | 22K | |
| nuclearchess-1.0.0_1..> | 2023-10-09 06:12 | 1.2M | |
| nuclei-2.9.11_1.pkg | 2023-10-10 17:22 | 12M | |
| nucleus-0.77_6.pkg | 2023-10-11 05:02 | 180K | |
| nuitka-py39-1.8.pkg | 2023-10-10 01:41 | 2.6M | |
| nuklear-4.10.6.pkg | 2023-10-09 23:26 | 174K | |
| nullmailer-2.2_1,1.pkg | 2023-10-11 03:20 | 73K | |
| numchar-1.0.pkg | 2023-10-08 18:20 | 5.3K | |
| numdiff-5.9.0_1.pkg | 2023-10-14 03:31 | 527K | |
| numix-gtk-theme-2.6...> | 2023-10-08 23:31 | 103K | |
| numix-icon-theme-21...> | 2023-10-14 06:03 | 2.4M | |
| numix-icon-theme-cir..> | 2023-10-07 20:10 | 1.7M | |
| numlockx-1.2.pkg | 2023-10-07 06:49 | 4.3K | |
| numptyphysics-0.3.r2..> | 2023-10-08 08:52 | 253K | |
| numptyphysics-npcomp..> | 2023-10-14 09:29 | 212K | |
| nurbs++-3.0.11_10.pkg | 2023-10-14 16:18 | 1.0M | |
| nushell-0.84.0_1.pkg | 2023-10-09 17:39 | 4.2M | |
| nusoap-0.9.5.pkg | 2023-10-10 15:20 | 73K | |
| nuspell-5.1.3.pkg | 2023-10-08 18:50 | 149K | |
| nut-2.8.0_23.pkg | 2023-10-09 02:15 | 1.6M | |
| nut-devel-2023.09.02..> | 2023-10-10 13:51 | 1.6M | |
| nut_exporter-3.0.0_2..> | 2023-10-09 12:35 | 2.9M | |
| nuttcp-8.2.2.pkg | 2023-10-09 01:40 | 70K | |
| nux-1.6_3,1.pkg | 2023-10-08 15:07 | 536K | |
| nvc-1.10.3.pkg | 2023-10-08 15:09 | 10M | |
| nvclock-0.8.b4_8.pkg | 2023-10-14 10:12 | 226K | |
| nvi-m17n-1.79.200406..> | 2023-10-14 11:23 | 275K | |
| nvi2-2.2.0_2.pkg | 2023-10-10 13:44 | 186K | |
| nvidia-driver-304-30..> | 2023-10-10 07:31 | 12M | |
| nvidia-driver-340-34..> | 2023-10-14 08:47 | 19M | |
| nvidia-driver-390-39..> | 2023-10-10 11:48 | 24M | |
| nvidia-driver-470-47..> | 2023-10-09 09:24 | 65M | |
| nvidia-driver-535.10..> | 2023-10-07 16:44 | 93M | |
| nvidia-hybrid-graphi..> | 2023-10-14 12:24 | 3.5K | |
| nvidia-hybrid-graphi..> | 2023-10-14 06:24 | 3.5K | |
| nvidia-secondary-dri..> | 2023-10-07 23:02 | 24M | |
| nvidia-secondary-dri..> | 2023-10-07 23:36 | 93M | |
| nvidia-settings-470...> | 2023-10-06 21:16 | 707K | |
| nvidia-texture-tools..> | 2023-10-07 19:13 | 347K | |
| nvidia-xconfig-525.1..> | 2023-10-07 14:21 | 73K | |
| nvidia_gpu_prometheu..> | 2023-10-14 04:00 | 2.1M | |
| nvimpager-0.12.0.pkg | 2023-10-08 17:22 | 14K | |
| nvme-cli-1.8.1.pkg | 2023-10-10 17:44 | 299K | |
| nvramtool-r6440.pkg | 2023-10-09 18:58 | 22K | |
| nwcc-0.8.3.pkg | 2023-10-10 02:13 | 853K | |
| nwchem-7.2.0_1.pkg | 2023-10-07 07:58 | 24M | |
| nwchem-data-7.2.0.pkg | 2023-10-05 16:40 | 5.8M | |
| nwg-bar-0.1.3_2.pkg | 2023-10-11 22:02 | 1.1M | |
| nwg-dock-0.3.7_1.pkg | 2023-10-10 14:02 | 1.2M | |
| nwg-dock-hyprland-0...> | 2023-10-09 15:23 | 1.1M | |
| nwg-drawer-0.3.9_2.pkg | 2023-10-09 10:30 | 1.3M | |
| nwg-launchers-0.7.1...> | 2023-10-10 20:50 | 263K | |
| nwg-look-0.2.4_2.pkg | 2023-10-09 03:33 | 1.0M | |
| nwg-menu-0.1.1_16.pkg | 2023-10-09 15:14 | 1.1M | |
| nwndata-1.29_3.pkg | 2023-10-08 01:52 | 1.0G | |
| nwreckdum-0.0.6_2.pkg | 2023-10-09 23:05 | 6.9K | |
| nx-2.4.0.pkg | 2023-10-10 09:56 | 3.2M | |
| nxcomp-3.5.0.32_3.pkg | 2023-10-06 21:29 | 444K | |
| nxengine-2.6.5.1_2.pkg | 2023-10-10 18:19 | 1.3M | |
| nxproxy-3.5.99.20.pkg | 2023-10-07 07:16 | 7.8K | |
| ny-aspell-0.01.0_1,2..> | 2023-10-10 19:08 | 39K | |
| nyan-lang-g20180708_..> | 2023-10-07 12:01 | 200K | |
| nyancat-1.5.2,1.pkg | 2023-10-10 15:44 | 9.8K | |
| nylon-1.21_10.pkg | 2023-10-14 14:51 | 18K | |
| nyquist-3.16.pkg | 2023-10-14 02:54 | 4.7M | |
| nyx-2.1.0_1.pkg | 2023-10-09 13:14 | 127K | |
| nzbget-21.1_2.pkg | 2023-10-14 15:02 | 963K | |
| nzbhydra2-4.7.4.pkg | 2023-10-14 08:51 | 77M | |
| nzbperl-0.6.8_1.pkg | 2023-10-14 16:41 | 25K | |
| o2em-1.17_4.pkg | 2023-10-11 13:50 | 618K | |
| o3read-0.0.4.pkg | 2023-10-10 05:40 | 15K | |
| oak-1.5.0.pkg | 2023-10-14 03:39 | 14K | |
| oaml-1.3.4_2.pkg | 2023-10-10 15:09 | 159K | |
| oath-toolkit-2.6.9.pkg | 2023-10-08 05:41 | 282K | |
| oauth2-proxy-7.4.0_8..> | 2023-10-08 12:08 | 4.6M | |
| obake-0.7.0.24_9.pkg | 2023-10-07 09:45 | 176K | |
| obby-0.4.8_6.pkg | 2023-10-08 09:33 | 174K | |
| obconf-2.0.4_5.pkg | 2023-10-08 04:52 | 124K | |
| obconf-qt-0.16.2.pkg | 2023-10-08 03:29 | 115K | |
| obexapp-1.4.15_4.pkg | 2023-10-10 15:11 | 69K | |
| obfs4proxy-tor-0.0.1..> | 2023-10-07 07:56 | 1.8M | |
| obhttpd-7.3.20230714..> | 2023-10-10 08:19 | 751K | |
| objconv-2.54.1.pkg | 2023-10-09 13:52 | 519K | |
| objecthash-20160802_..> | 2023-10-11 05:53 | 4.9K | |
| objfw-1.0.3.pkg | 2023-10-10 11:22 | 1.9M | |
| oblige-7.70_1.pkg | 2023-10-14 18:46 | 1.6M | |
| obliterate-0.5.pkg | 2023-10-10 16:06 | 6.4K | |
| obpager-1.8.pkg | 2023-10-10 13:57 | 20K | |
| observium-php80-0.19..> | 2023-10-09 03:33 | 48M | |
| observium-php81-0.19..> | 2023-10-09 03:58 | 48M | |
| obsidian-1.3.5_1.pkg | 2023-10-10 17:54 | 58M | |
| obuparse-g20230712.pkg | 2023-10-06 20:58 | 20K | |
| oc-4.9_15.pkg | 2023-10-14 10:47 | 18M | |
| oc-libreoffice-7.5.5..> | 2023-10-07 13:52 | 504K | |
| ocaml-4.08.1.pkg | 2023-10-06 11:17 | 82M | |
| ocaml-annexlib-0.13...> | 2023-10-08 12:23 | 94K | |
| ocaml-autoconf-1.1_1..> | 2023-10-07 08:01 | 5.8K | |
| ocaml-base64-2.0.0_1..> | 2023-10-08 17:37 | 34K | |
| ocaml-bz2-0.6.0_3.pkg | 2023-10-14 10:44 | 14K | |
| ocaml-cairo-0.6.4.pkg | 2023-10-07 07:46 | 378K | |
| ocaml-calendar-2.03...> | 2023-10-14 10:59 | 143K | |
| ocaml-camlidl-1.05_3..> | 2023-10-10 16:05 | 693K | |
| ocaml-camljava-0.3_4..> | 2023-10-09 04:31 | 37K | |
| ocaml-camlp4-4.08+1.pkg | 2023-10-06 15:13 | 19M | |
| ocaml-camlp5-7.14_1.pkg | 2023-10-08 04:42 | 2.5M | |
| ocaml-camomile-1.0.2..> | 2023-10-09 19:02 | 3.5M | |
| ocaml-camomile-examp..> | 2023-10-10 00:00 | 19K | |
| ocaml-cfg-2.2.0_1.pkg | 2023-10-08 10:38 | 217K | |
| ocaml-classes-4.00_1..> | 2023-10-10 21:50 | 15K | |
| ocaml-cmdliner-1.0.4..> | 2023-10-07 00:40 | 351K | |
| ocaml-cppo-1.6.9_1.pkg | 2023-10-07 02:47 | 356K | |
| ocaml-cryptgps-0.2.1..> | 2023-10-10 19:53 | 121K | |
| ocaml-cryptokit-1.11..> | 2023-10-14 15:52 | 694K | |
| ocaml-csv-1.2.1_3.pkg | 2023-10-10 18:07 | 27K | |
| ocaml-dbm-1.0_1.pkg | 2023-10-10 09:22 | 11K | |
| ocaml-dune-3.7.1.pkg | 2023-10-06 21:02 | 7.5M | |
| ocaml-expat-0.9.1_5.pkg | 2023-10-09 00:57 | 22K | |
| ocaml-extlib-1.7.9_1..> | 2023-10-07 10:05 | 1.1M | |
| ocaml-findlib-1.9.6.pkg | 2023-10-06 17:14 | 714K | |
| ocaml-gsl-1.19.1_7.pkg | 2023-10-14 10:55 | 1.7M | |
| ocaml-ipaddr-3.1.0.pkg | 2023-10-08 14:40 | 341K | |
| ocaml-jsonm-1.0.2_1.pkg | 2023-10-14 10:17 | 623K | |
| ocaml-lablgl-1.05_5,..> | 2023-10-07 06:10 | 280K | |
| ocaml-lablgtk2-2.18...> | 2023-10-07 10:23 | 2.4M | |
| ocaml-lablgtk3-3.1.1..> | 2023-10-07 14:39 | 9.9M | |
| ocaml-labltk-8.06.7.pkg | 2023-10-06 14:37 | 1.5M | |
| ocaml-lacaml-8.0.7_1..> | 2023-10-09 13:18 | 2.1M | |
| ocaml-lwt-2.5.2_1.pkg | 2023-10-08 01:26 | 2.5M | |
| ocaml-magic-0.7.3_4.pkg | 2023-10-08 20:18 | 374K | |
| ocaml-nox11-4.08.1.pkg | 2023-10-10 09:29 | 82M | |
| ocaml-num-1.4_1.pkg | 2023-10-07 04:50 | 224K | |
| ocaml-ocamlbuild-0.1..> | 2023-10-06 13:13 | 1.1M | |
| ocaml-ocamlgraph-1.8..> | 2023-10-07 17:08 | 1.5M | |
| ocaml-ocurl-0.9.2_1.pkg | 2023-10-11 01:45 | 366K | |
| ocaml-opam-2.1.5_1.pkg | 2023-10-06 23:01 | 2.7M | |
| ocaml-ounit-1.0.3_3.pkg | 2023-10-10 10:32 | 22K | |
| ocaml-parmap-1.2.4.pkg | 2023-10-06 23:39 | 233K | |
| ocaml-pcre-7.2.3_2.pkg | 2023-10-06 20:58 | 301K | |
| ocaml-pomap-4.1.1_1.pkg | 2023-10-10 02:04 | 330K | |
| ocaml-ppx-tools-6.6.pkg | 2023-10-08 20:14 | 11M | |
| ocaml-re-1.4.1_1.pkg | 2023-10-10 13:27 | 623K | |
| ocaml-react-1.2.1_1.pkg | 2023-10-07 05:13 | 102K | |
| ocaml-res-5.0.1_1.pkg | 2023-10-08 02:55 | 477K | |
| ocaml-result-1.5_1.pkg | 2023-10-09 22:30 | 11K | |
| ocaml-sdl-0.9.1_5.pkg | 2023-10-08 00:47 | 177K | |
| ocaml-sem-0.0.2_4.pkg | 2023-10-10 12:21 | 19K | |
| ocaml-sexplib0-0.16...> | 2023-10-07 23:13 | 285K | |
| ocaml-sqlite3-4.0.5_..> | 2023-10-14 05:40 | 111K | |
| ocaml-ssl-0.5.13.pkg | 2023-10-07 00:38 | 134K | |
| ocaml-text-0.8_1.pkg | 2023-10-06 23:36 | 395K | |
| ocaml-topkg-1.0.7_1.pkg | 2023-10-07 05:45 | 543K | |
| ocaml-type_conv-113...> | 2023-10-07 05:28 | 438K | |
| ocaml-uchar-0.0.2_2.pkg | 2023-10-07 06:03 | 688 | |
| ocaml-ulex-1.1_2.pkg | 2023-10-09 04:13 | 27K | |
| ocaml-uutf-1.0.3_1.pkg | 2023-10-08 11:49 | 659K | |
| ocaml-xstr-0.2.1_3.pkg | 2023-10-08 15:03 | 56K | |
| ocaml-xstrp4-1.8.2_1..> | 2023-10-09 14:01 | 25K | |
| ocaml-zarith-1.13.pkg | 2023-10-07 10:21 | 189K | |
| ocaml-zip-1.11_1.pkg | 2023-10-10 17:04 | 203K | |
| ocean-spectroscopy-c..> | 2023-10-09 04:28 | 1.8M | |
| ocl-icd-2.3.1_1.pkg | 2023-10-06 14:03 | 53K | |
| oclgrind-21.10,1.pkg | 2023-10-14 07:28 | 11M | |
| oclock-1.0.4.pkg | 2023-10-10 03:06 | 9.6K | |
| ocp-0.2.106_1,1.pkg | 2023-10-08 14:40 | 1.4M | |
| ocrad-0.28.pkg | 2023-10-07 15:28 | 175K | |
| ocserv-1.2.1.pkg | 2023-10-14 16:49 | 418K | |
| ocsinventory-agent-2..> | 2023-10-10 03:46 | 141K | |
| ocsinventory-ocsrepo..> | 2023-10-07 12:47 | 3.1M | |
| ocsinventory-server-..> | 2023-10-09 23:55 | 95K | |
| octave-8.3.0.pkg | 2023-10-06 14:31 | 19M | |
| octave-forge-2023090..> | 2023-10-08 20:53 | 2.6K | |
| octave-forge-actuari..> | 2023-10-07 23:08 | 36K | |
| octave-forge-audio-2..> | 2023-10-08 04:43 | 502K | |
| octave-forge-automat..> | 2023-10-08 10:47 | 29K | |
| octave-forge-base-1...> | 2023-10-06 14:36 | 3.0K | |
| octave-forge-benchma..> | 2023-10-08 00:04 | 13K | |
| octave-forge-bim-1.1..> | 2023-10-07 06:50 | 39K | |
| octave-forge-bioinfo..> | 2023-10-07 21:02 | 13K | |
| octave-forge-biosig-..> | 2023-10-08 04:09 | 1.4M | |
| octave-forge-bsltl-1..> | 2023-10-08 10:44 | 59K | |
| octave-forge-cfitsio..> | 2023-10-07 20:01 | 456K | |
| octave-forge-cgi-0.1..> | 2023-10-07 20:24 | 11K | |
| octave-forge-civil-e..> | 2023-10-08 04:22 | 32K | |
| octave-forge-coder-1..> | 2023-10-07 22:05 | 712K | |
| octave-forge-communi..> | 2023-10-08 10:02 | 925K | |
| octave-forge-control..> | 2023-10-06 23:11 | 4.8M | |
| octave-forge-csg-too..> | 2023-10-07 23:04 | 323K | |
| octave-forge-data-sm..> | 2023-10-08 09:52 | 18K | |
| octave-forge-datafra..> | 2023-10-07 19:00 | 68K | |
| octave-forge-dicom-0..> | 2023-10-07 10:43 | 1.2M | |
| octave-forge-divand-..> | 2023-10-08 04:41 | 1.1M | |
| octave-forge-doctest..> | 2023-10-08 10:02 | 35K | |
| octave-forge-econome..> | 2023-10-07 16:47 | 39K | |
| octave-forge-fda-1.0..> | 2023-10-07 22:26 | 2.8M | |
| octave-forge-femocta..> | 2023-10-07 13:45 | 35M | |
| octave-forge-fenv-0...> | 2023-10-07 20:36 | 35K | |
| octave-forge-fileio-..> | 2023-10-06 23:39 | 1.4M | |
| octave-forge-financi..> | 2023-10-08 01:10 | 75K | |
| octave-forge-fits-1...> | 2023-10-08 03:50 | 51K | |
| octave-forge-fpl-1.3..> | 2023-10-06 23:17 | 20K | |
| octave-forge-fuzzy-l..> | 2023-10-07 23:20 | 83K | |
| octave-forge-ga-0.10..> | 2023-10-07 13:00 | 30K | |
| octave-forge-general..> | 2023-10-07 11:34 | 83K | |
| octave-forge-generat..> | 2023-10-07 14:54 | 61K | |
| octave-forge-geograp..> | 2023-10-08 10:46 | 65K | |
| octave-forge-geometr..> | 2023-10-07 08:39 | 527K | |
| octave-forge-gnuplot..> | 2023-10-08 02:11 | 103K | |
| octave-forge-gsl-2.1..> | 2023-10-07 16:39 | 332K | |
| octave-forge-ident-1..> | 2023-10-08 04:07 | 29K | |
| octave-forge-image-2..> | 2023-10-08 09:52 | 1.0M | |
| octave-forge-informa..> | 2023-10-07 14:30 | 33K | |
| octave-forge-integra..> | 2023-10-08 01:57 | 37K | |
| octave-forge-interna..> | 2023-10-07 12:48 | 156K | |
| octave-forge-interva..> | 2023-10-08 10:28 | 3.1M | |
| octave-forge-io-2.6...> | 2023-10-07 08:47 | 284K | |
| octave-forge-irsa-1...> | 2023-10-08 07:11 | 36K | |
| octave-forge-level-s..> | 2023-10-08 07:08 | 450K | |
| octave-forge-linear-..> | 2023-10-07 14:39 | 44K | |
| octave-forge-lssa-0...> | 2023-10-08 06:47 | 96K | |
| octave-forge-ltfat-2..> | 2023-10-08 08:49 | 4.6M | |
| octave-forge-mapping..> | 2023-10-07 13:37 | 3.5M | |
| octave-forge-matgeom..> | 2023-10-06 21:59 | 435K | |
| octave-forge-mccabe-..> | 2023-10-08 10:54 | 98K | |
| octave-forge-miscell..> | 2023-10-08 07:38 | 138K | |
| octave-forge-missing..> | 2023-10-07 17:56 | 6.2K | |
| octave-forge-mqtt-0...> | 2023-10-07 11:29 | 451K | |
| octave-forge-msh-1.0..> | 2023-10-06 22:29 | 37K | |
| octave-forge-multico..> | 2023-10-07 15:37 | 33K | |
| octave-forge-mvn-1.1..> | 2023-10-08 08:13 | 21K | |
| octave-forge-nan-3.7..> | 2023-10-06 23:31 | 494K | |
| octave-forge-ncarray..> | 2023-10-07 21:26 | 35K | |
| octave-forge-netcdf-..> | 2023-10-07 09:08 | 621K | |
| octave-forge-nnet-0...> | 2023-10-07 23:38 | 644K | |
| octave-forge-nurbs-1..> | 2023-10-07 16:48 | 384K | |
| octave-forge-oct2mat..> | 2023-10-07 21:30 | 8.8K | |
| octave-forge-octave-..> | 2023-10-08 07:49 | 12K | |
| octave-forge-octclip..> | 2023-10-08 10:55 | 2.2M | |
| octave-forge-octproj..> | 2023-10-08 09:27 | 7.6M | |
| octave-forge-odebvp-..> | 2023-10-08 01:51 | 18K | |
| octave-forge-onsas-0..> | 2023-10-08 04:32 | 11M | |
| octave-forge-optics-..> | 2023-10-08 02:08 | 47K | |
| octave-forge-optim-1..> | 2023-10-07 05:18 | 499K | |
| octave-forge-optimin..> | 2023-10-08 02:04 | 91K | |
| octave-forge-outlier..> | 2023-10-08 09:47 | 33K | |
| octave-forge-paralle..> | 2023-10-07 13:43 | 1.5M | |
| octave-forge-pde1dm-..> | 2023-10-08 11:33 | 375K | |
| octave-forge-pkg-oct..> | 2023-10-08 01:00 | 128K | |
| octave-forge-plot-1...> | 2023-10-07 14:44 | 14K | |
| octave-forge-ponchon..> | 2023-10-08 03:30 | 144K | |
| octave-forge-prompt-..> | 2023-10-07 21:41 | 17K | |
| octave-forge-psychro..> | 2023-10-07 18:12 | 611K | |
| octave-forge-pythoni..> | 2023-10-08 02:37 | 308K | |
| octave-forge-quatern..> | 2023-10-08 11:13 | 237K | |
| octave-forge-queuein..> | 2023-10-08 08:00 | 934K | |
| octave-forge-secs1d-..> | 2023-10-08 07:42 | 365K | |
| octave-forge-secs2d-..> | 2023-10-08 08:11 | 120K | |
| octave-forge-secs3d-..> | 2023-10-08 09:35 | 29K | |
| octave-forge-signal-..> | 2023-10-07 00:08 | 633K | |
| octave-forge-simp-1...> | 2023-10-07 15:43 | 128K | |
| octave-forge-sockets..> | 2023-10-07 04:01 | 353K | |
| octave-forge-sole-0...> | 2023-10-07 10:52 | 42K | |
| octave-forge-sparser..> | 2023-10-07 21:13 | 214K | |
| octave-forge-special..> | 2023-10-08 09:37 | 8.2K | |
| octave-forge-splines..> | 2023-10-06 18:22 | 35K | |
| octave-forge-sqlite-..> | 2023-10-08 09:06 | 382K | |
| octave-forge-statist..> | 2023-10-06 22:21 | 7.2M | |
| octave-forge-statist..> | 2023-10-08 00:02 | 1.1M | |
| octave-forge-stk-2.8..> | 2023-10-08 08:29 | 491K | |
| octave-forge-strings..> | 2023-10-08 03:02 | 56K | |
| octave-forge-struct-..> | 2023-10-06 21:50 | 135K | |
| octave-forge-symband..> | 2023-10-07 13:34 | 128K | |
| octave-forge-symboli..> | 2023-10-08 02:37 | 277K | |
| octave-forge-tcl-oct..> | 2023-10-07 16:55 | 23K | |
| octave-forge-tsa-4.6..> | 2023-10-08 02:04 | 82K | |
| octave-forge-velas-1..> | 2023-10-08 11:03 | 3.6M | |
| octave-forge-video-2..> | 2023-10-08 06:34 | 273K | |
| octave-forge-websock..> | 2023-10-08 05:57 | 14K | |
| octave-forge-zenity-..> | 2023-10-07 11:34 | 27K | |
| octave-forge-zeromq-..> | 2023-10-07 17:06 | 453K | |
| octomap-1.9.8.pkg | 2023-10-06 15:54 | 272K | |
| octopkg-0.3.3.pkg | 2023-10-10 18:17 | 348K | |
| octopus-11.4_5.pkg | 2023-10-09 17:13 | 29M | |
| octosql-0.12.2_2.pkg | 2023-10-14 03:45 | 5.1M | |
| odamex-0.7.0_3.pkg | 2023-10-10 16:07 | 2.8M | |
| odbc-cpp-wrapper-1.1..> | 2023-10-10 16:17 | 104K | |
| ode-0.16.2,1.pkg | 2023-10-08 02:23 | 389K | |
| odo-0.2.2.pkg | 2023-10-10 04:35 | 5.3K | |
| ods2-1.3_1.pkg | 2023-10-11 13:50 | 37K | |
| ods2reader-19930601_..> | 2023-10-08 17:44 | 7.5K | |
| ods2sql-0.4.0_27.pkg | 2023-10-14 04:12 | 613K | |
| odt2txt-0.5.pkg | 2023-10-09 15:03 | 11K | |
| office-code-pro-1.00..> | 2023-10-10 18:54 | 162K | |
| oftpd-0.3.7.pkg | 2023-10-09 07:04 | 32K | |
| ogdf-2020.02.pkg | 2023-10-10 03:07 | 3.7M | |
| ogg2mp3-0.6.1_4.pkg | 2023-10-08 17:36 | 4.6K | |
| oggvideotools-0.9.1_..> | 2023-10-09 09:30 | 274K | |
| ogmrip-1.0.1_15.pkg | 2023-10-08 21:28 | 357K | |
| ogmtools-1.5_17.pkg | 2023-10-07 14:58 | 100K | |
| ogre3d-1.11.6_13.pkg | 2023-10-07 01:24 | 125M | |
| ogre3d19-1.9.0_21.pkg | 2023-10-08 09:38 | 103M | |
| oha-0.6.1_1.pkg | 2023-10-09 21:20 | 1.2M | |
| ohmu-1.1.0_4.pkg | 2023-10-14 05:06 | 20K | |
| ohmyzsh-20230913.pkg | 2023-10-10 15:04 | 1.6M | |
| ohsnap-1.8.0_1.pkg | 2023-10-09 22:07 | 28K | |
| ohsnap-otb-1.8.0_1.pkg | 2023-10-09 23:37 | 24K | |
| oidentd-2.5.1.pkg | 2023-10-10 22:05 | 29K | |
| oidn-2.0.1_1.pkg | 2023-10-07 19:23 | 23M | |
| oink-g20210710_4.pkg | 2023-10-08 14:54 | 240K | |
| oinkmaster-2.0_1.pkg | 2023-10-09 02:28 | 36K | |
| ois-1.5.1.pkg | 2023-10-14 15:20 | 57K | |
| okc321-1.1.pkg | 2023-10-14 07:32 | 30K | |
| oksh-7.3,1.pkg | 2023-10-09 18:02 | 162K | |
| oksh-static-7.3,1.pkg | 2023-10-09 15:27 | 551K | |
| okteta-0.26.13_1,1.pkg | 2023-10-07 09:13 | 1.3M | |
| okular-23.08.1.pkg | 2023-10-06 23:39 | 6.8M | |
| ola-0.10.9_1.pkg | 2023-10-08 01:31 | 2.6M | |
| oldrunner-20120131.pkg | 2023-10-09 22:31 | 28K | |
| oldschool-pc-fonts-2..> | 2023-10-10 03:30 | 3.9M | |
| olive-video-editor-0..> | 2023-10-08 22:14 | 7.0M | |
| olm-3.2.13.pkg | 2023-10-07 04:16 | 97K | |
| olsrd-0.9.8_1.pkg | 2023-10-09 04:22 | 192K | |
| om-libreoffice-7.5.5..> | 2023-10-07 22:36 | 2.7M | |
| omake-0.10.6_1.pkg | 2023-10-07 06:57 | 1.3M | |
| omega-0.90.4_1.pkg | 2023-10-10 10:51 | 266K | |
| omi-20030719.pkg | 2023-10-10 20:19 | 54K | |
| omniORB-4.3.1.pkg | 2023-10-07 07:11 | 4.3M | |
| omnibackup-0.2.1.pkg | 2023-10-10 02:09 | 38K | |
| omnitty-0.3.0_4.pkg | 2023-10-09 09:53 | 12K | |
| omping-0.0.4.pkg | 2023-10-09 16:53 | 76K | |
| ompl-1.6.0_1.pkg | 2023-10-08 22:35 | 1.7M | |
| ondir-0.2.4_1.pkg | 2023-10-09 09:42 | 8.7K | |
| oneVPL-2022.1.5.pkg | 2023-10-07 16:27 | 3.0M | |
| onednn-3.2.1.pkg | 2023-10-08 15:31 | 7.3M | |
| onednn252-2.5.2.pkg | 2023-10-07 18:35 | 5.9M | |
| onedrive-2.4.25.pkg | 2023-10-10 17:06 | 760K | |
| onefetch-2.18.1_2.pkg | 2023-10-11 00:17 | 3.4M | |
| oneko-sakura-1.2_2.pkg | 2023-10-08 19:28 | 26K | |
| onenetd-12.pkg | 2023-10-14 06:42 | 9.3K | |
| oneshot-1.5.1_15.pkg | 2023-10-10 11:27 | 2.5M | |
| onetbb-2021.10.0.pkg | 2023-10-06 14:31 | 298K | |
| oniguruma-6.9.8_1.pkg | 2023-10-05 17:43 | 228K | |
| onioncat-4.10.0.pkg | 2023-10-14 14:52 | 52K | |
| onionscan-0.2_17.pkg | 2023-10-14 03:30 | 2.6M | |
| onis-0.8.2.pkg | 2023-10-14 07:29 | 92K | |
| onnx-1.14.1.pkg | 2023-10-06 16:50 | 880K | |
| onscripter-1byte-202..> | 2023-10-08 20:19 | 150K | |
| onscripter-20230825.pkg | 2023-10-08 16:59 | 166K | |
| oo2c-2.1.11_14.pkg | 2023-10-08 21:15 | 1.6M | |
| ookla-speedtest-1.2...> | 2023-10-10 01:08 | 625K | |
| oolite-1.88_5.pkg | 2023-10-09 00:38 | 96M | |
| ooni-mini-0.23.0_14.pkg | 2023-10-09 23:08 | 4.4M | |
| oonsoo-1.2_3.pkg | 2023-10-08 22:49 | 60K | |
| op-1.34_2.pkg | 2023-10-08 15:39 | 32K | |
| opa-0.41.0_13.pkg | 2023-10-14 02:15 | 6.6M | |
| open-1.4.pkg | 2023-10-14 16:06 | 5.9K | |
| open-adventure-1.16.pkg | 2023-10-14 18:39 | 49K | |
| open-beagle-3.0.3_1.pkg | 2023-10-10 23:19 | 1.2M | |
| open-isns-0.101.pkg | 2023-10-09 04:36 | 121K | |
| open-motif-2.3.8_3.pkg | 2023-10-06 15:02 | 3.6M | |
| open-motif-devel-202..> | 2023-10-09 01:41 | 3.6M | |
| open-sans-20180831.pkg | 2023-10-08 07:26 | 560K | |
| open-vm-tools-12.2.5..> | 2023-10-10 13:08 | 1.6M | |
| open-vm-tools-nox11-..> | 2023-10-09 13:13 | 1.5M | |
| open62541-1.3.7.pkg | 2023-10-09 21:57 | 531K | |
| openal-soft-1.21.1_4..> | 2023-10-06 07:47 | 439K | |
| openarc-1.0.0.b3.202..> | 2023-10-14 05:51 | 109K | |
| openarena-0.8.8.s191..> | 2023-10-08 11:27 | 663K | |
| openarena-data-0.8.8..> | 2023-10-05 16:43 | 379M | |
| openarena-oax-B51_1.pkg | 2023-10-14 12:41 | 471K | |
| openarena-server-0.8..> | 2023-10-07 06:49 | 298K | |
| openbabel-3.1.1.178.pkg | 2023-10-07 02:12 | 3.9M | |
| openbgpd-5.2.2012120..> | 2023-10-10 03:31 | 149K | |
| openbgpd6-6.9p0.pkg | 2023-10-08 13:10 | 192K | |
| openbgpd7-7.7.pkg | 2023-10-14 07:40 | 229K | |
| openblas-0.3.20_1,1.pkg | 2023-10-06 09:02 | 7.5M | |
| openbmp-0.14.0_12.pkg | 2023-10-10 23:09 | 695K | |
| openbor-7138_2.pkg | 2023-10-09 05:23 | 579K | |
| openbor3482-3482_2.pkg | 2023-10-08 12:04 | 588K | |
| openbor3711-3711_2.pkg | 2023-10-10 13:53 | 580K | |
| openbor3979-3979_2.pkg | 2023-10-14 11:04 | 598K | |
| openbor4432-4432_5.pkg | 2023-10-14 07:04 | 750K | |
| openbox-3.6_9.pkg | 2023-10-07 07:10 | 357K | |
| openbox-arc-theme-20..> | 2023-10-14 04:15 | 2.8K | |
| openbsm-1.1.p2_1.pkg | 2023-10-08 15:52 | 182K | |
| openbubbles-1.2_5.pkg | 2023-10-09 01:33 | 846K | |
| openbve-1.9.2.2.pkg | 2023-10-08 20:09 | 12M | |
| openca-ocspd-3.1.3.pkg | 2023-10-10 17:58 | 33K | |
| opencart-4.0.2.2.pkg | 2023-10-10 09:30 | 14M | |
| opencascade-7.7.0_6.pkg | 2023-10-06 16:00 | 33M | |
| opencascade740-7.4.0..> | 2023-10-07 12:24 | 32M | |
| opencbm-0.4.99.104.pkg | 2023-10-08 11:36 | 801K | |
| opencbm-kmod-0.4.99...> | 2023-10-07 20:46 | 9.7K | |
| opencbm-plugin-xa154..> | 2023-10-08 14:30 | 5.2K | |
| opencity-0.0.6.5_4.pkg | 2023-10-14 19:00 | 7.5M | |
| opencl-3.0.14.pkg | 2023-10-05 16:39 | 77K | |
| opencl-clang-llvm11-..> | 2023-10-07 08:10 | 82K | |
| opencl-clang-llvm12-..> | 2023-10-07 07:04 | 83K | |
| opencl-clang-llvm13-..> | 2023-10-07 01:21 | 84K | |
| opencl-clang-llvm14-..> | 2023-10-07 03:14 | 89K | |
| opencl-clang-llvm15-..> | 2023-10-14 06:11 | 86K | |
| opencl-clang-llvm16-..> | 2023-10-14 03:03 | 10M | |
| openclonk-8.1_4.pkg | 2023-10-09 04:38 | 109M | |
| opencoarrays-2.10.1.pkg | 2023-10-14 13:48 | 54K | |
| opencollada-1.6.68_4..> | 2023-10-08 08:25 | 4.1M | |
| opencolorio-2.2.1_4.pkg | 2023-10-06 20:44 | 2.3M | |
| opencolorio-tools-2...> | 2023-10-09 10:18 | 3.4M | |
| openconnect-9.12.pkg | 2023-10-08 11:56 | 212K | |
| openconnect-freebsd-..> | 2023-10-08 21:52 | 2.6K | |
| openconnect-gui-1.5...> | 2023-10-09 13:30 | 357K | |
| opencore-amr-0.1.6.pkg | 2023-10-07 08:02 | 188K | |
| opencpn-5.2.4_5.pkg | 2023-10-08 18:49 | 32M | |
| opencryptoki-3.19.0.pkg | 2023-10-07 21:51 | 591K | |
| opencsg-1.4.2_7.pkg | 2023-10-07 11:59 | 44K | |
| openct-0.6.20_2.pkg | 2023-10-10 21:42 | 196K | |
| openctm-1.0.3_3.pkg | 2023-10-11 17:11 | 190K | |
| opencv-4.6.0_13.pkg | 2023-10-06 16:07 | 22M | |
| opencvs-20151230.pkg | 2023-10-10 10:23 | 122K | |
| opencyc-0.7.0_3.pkg | 2023-10-09 13:02 | 27M | |
| opendbviewer-1.1.1_1..> | 2023-10-09 19:37 | 233K | |
| opendbx-1.4.6_6.pkg | 2023-10-10 16:44 | 73K | |
| opendchub-0.8.3_1.pkg | 2023-10-09 21:14 | 71K | |
| opendht-2.6.0.4.pkg | 2023-10-08 02:44 | 528K | |
| opendircolors-0.0.2.pkg | 2023-10-09 14:33 | 8.6K | |
| opendkim-2.10.3_16.pkg | 2023-10-08 04:25 | 312K | |
| opendmarc-1.4.2.pkg | 2023-10-14 02:38 | 116K | |
| opendnssec2-2.1.13.pkg | 2023-10-14 19:01 | 410K | |
| opendx-4.4.4_37.pkg | 2023-10-06 19:20 | 11M | |
| openems-0.0.35.110.pkg | 2023-10-10 11:47 | 378K | |
| openenroth-g20230128..> | 2023-10-14 11:13 | 1.3M | |
| openexr-3.2.0.pkg | 2023-10-05 17:48 | 1.0M | |
| openexr-website-docs..> | 2023-10-10 05:17 | 9.1M | |
| openfhe-1.0.4.pkg | 2023-10-08 15:07 | 1.4M | |
| openfire-4.7.5,1.pkg | 2023-10-10 01:30 | 41M | |
| openfortivpn-1.20.5.pkg | 2023-10-08 19:29 | 42K | |
| openfpgaloader-0.11...> | 2023-10-14 08:09 | 1.3M | |
| openfst-1.8.1.pkg | 2023-10-09 03:49 | 4.2M | |
| openfts-0.40_5.pkg | 2023-10-09 15:22 | 83K | |
| openfx-arena-2.4.3_1..> | 2023-10-14 06:30 | 612K | |
| openfx-misc-2.4.3.pkg | 2023-10-10 09:02 | 2.8M | |
| opengl-man-657.2.pkg | 2023-10-11 04:53 | 359K | |
| openglad-0.98_10.pkg | 2023-10-09 19:58 | 453K | |
| opengrok-1.7.42.pkg | 2023-10-14 12:21 | 42M | |
| opengv-g20200806_1.pkg | 2023-10-11 07:33 | 593K | |
| openh264-2.3.0,2.pkg | 2023-10-05 16:50 | 539K | |
| openhab-4.0.3.pkg | 2023-10-07 10:24 | 94M | |
| openhab-addons-4.0.3..> | 2023-10-14 18:06 | 375M | |
| openhab2-2.5.12.pkg | 2023-10-07 13:03 | 74M | |
| openhab2-addons-2.5...> | 2023-10-10 10:00 | 187M | |
| openhantek-3.3.3.pkg | 2023-10-09 17:27 | 512K | |
| openicc-config-0.1.0..> | 2023-10-07 00:58 | 47K | |
| openiked-2.2.pkg | 2023-10-09 18:41 | 149K | |
| openiked-portable-7...> | 2023-10-14 03:17 | 196K | |
| openimageio-2.4.13.0..> | 2023-10-07 02:39 | 3.1M | |
| openipmi-2.0.29.pkg | 2023-10-07 19:44 | 1.0M | |
| openjade-1.3.3p1_4.pkg | 2023-10-08 05:18 | 1.5M | |
| openjazz-20190106.pkg | 2023-10-09 23:20 | 97K | |
| openjdk8-8.382.05.1.pkg | 2023-10-06 12:01 | 81M | |
| openjdk8-jre-8.382.0..> | 2023-10-08 20:11 | 26M | |
| openjdk11-11.0.20+8...> | 2023-10-06 17:27 | 159M | |
| openjdk11-jre-11.0.2..> | 2023-10-08 21:20 | 24M | |
| openjdk17-17.0.8+7.1..> | 2023-10-07 01:05 | 154M | |
| openjdk17-jre-17.0.8..> | 2023-10-08 20:22 | 25M | |
| openjdk18-18.0.2+9.1..> | 2023-10-08 05:23 | 154M | |
| openjdk19-19.0.2+7.1..> | 2023-10-10 07:15 | 159M | |
| openjfx14-14.0.2.1+1..> | 2023-10-07 03:34 | 82M | |
| openjk-g20221013_1.pkg | 2023-10-09 11:22 | 2.8M | |
| openjpeg-2.5.0_1.pkg | 2023-10-05 17:47 | 303K | |
| openjpeg15-1.5.2_2.pkg | 2023-10-07 04:22 | 138K | |
| openjph-0.9.0.pkg | 2023-10-08 15:15 | 112K | |
| openkim-models-2021...> | 2023-10-07 06:52 | 42M | |
| openldap24-client-2...> | 2023-10-09 14:22 | 1.0M | |
| openldap24-server-2...> | 2023-10-09 23:00 | 1.1M | |
| openldap25-client-2...> | 2023-10-07 20:07 | 1.0M | |
| openldap25-server-2...> | 2023-10-14 09:50 | 1.3M | |
| openldap26-client-2...> | 2023-10-05 17:37 | 1.0M | |
| openldap26-server-2...> | 2023-10-07 11:48 | 1.3M | |
| openlibm-0.8.0.pkg | 2023-10-08 08:04 | 147K | |
| openlierox-0.58.r5_3..> | 2023-10-10 02:13 | 54M | |
| openlldp-0.4.a_2.pkg | 2023-10-08 14:08 | 24K | |
| openmc-0.13.3_1.pkg | 2023-10-07 22:52 | 754K | |
| openmdns-0.7_3.pkg | 2023-10-09 14:21 | 2.4M | |
| openmesh-9.0_1.pkg | 2023-10-09 04:07 | 1.0M | |
| openmodelica-1.20.0_..> | 2023-10-10 06:59 | 20M | |
| openmolcas-23.06.pkg | 2023-10-08 18:30 | 32M | |
| openmortal-0.7_13.pkg | 2023-10-08 20:28 | 46M | |
| openmpi-4.1.5_1.pkg | 2023-10-06 12:04 | 2.7M | |
| openmpi3-3.1.6_2.pkg | 2023-10-09 23:18 | 2.6M | |
| openmsx-18.0_1.pkg | 2023-10-07 14:59 | 3.7M | |
| openmvg-2.0_11.pkg | 2023-10-08 20:05 | 2.7M | |
| openmvs-2.2.0_1.pkg | 2023-10-14 03:54 | 1.4M | |
| openmw-0.48.0.pkg | 2023-10-09 09:04 | 7.7M | |
| openmx-3.8.5_8.pkg | 2023-10-09 02:08 | 78M | |
| opennn-6.0.4.pkg | 2023-10-14 10:01 | 1.5M | |
| openntpd-6.8p1_7,2.pkg | 2023-10-10 11:14 | 49K | |
| opennurbs-20130711_3..> | 2023-10-07 00:57 | 11M | |
| openobex-1.7.2.pkg | 2023-10-08 10:34 | 129K | |
| openocd-0.11.0_1.pkg | 2023-10-06 20:40 | 1.4M | |
| openomf-0.6.5_6.pkg | 2023-10-09 16:32 | 5.2M | |
| openpgl-0.5.0_1.pkg | 2023-10-07 11:14 | 200K | |
| openpgm-5.2.122_6.pkg | 2023-10-05 17:35 | 305K | |
| openprinting-1.0_5.pkg | 2023-10-08 16:41 | 81K | |
| openr2-1.3.3.pkg | 2023-10-07 03:06 | 71K | |
| openra-20210321.pkg | 2023-10-09 02:23 | 22M | |
| openradius-0.9.12c_4..> | 2023-10-10 09:49 | 171K | |
| openrct2-0.4.6.pkg | 2023-10-09 12:35 | 27M | |
| openresolv-3.13.2.pkg | 2023-10-09 23:19 | 21K | |
| openresty-1.21.4.2.pkg | 2023-10-10 13:59 | 1.2M | |
| openrgb-0.8.pkg | 2023-10-09 00:04 | 1.3M | |
| openrm-1.6.0.2_4.pkg | 2023-10-10 11:29 | 3.3M | |
| openroad-2.0.2930_4,..> | 2023-10-07 22:32 | 14M | |
| openrsync-0.0.202004..> | 2023-10-08 12:23 | 109K | |
| opensaml-3.2.1_3.pkg | 2023-10-08 09:08 | 1.1M | |
| opensbi-1.3.1.pkg | 2023-10-07 17:07 | 65K | |
| opensc-0.23.0.pkg | 2023-10-11 00:21 | 1.6M | |
| openscad-2021.01.01...> | 2023-10-08 19:23 | 5.5M | |
| openscad-devel-2022...> | 2023-10-10 12:23 | 5.9M | |
| openscop-0.9.7.pkg | 2023-10-08 00:12 | 127K | |
| openseachest-23.03.1..> | 2023-10-09 18:23 | 863K | |
| opensearch-2.9.0.pkg | 2023-10-07 12:53 | 556M | |
| opensearch-dashboard..> | 2023-10-08 02:19 | 158M | |
| opensearch13-1.3.10.pkg | 2023-10-14 11:24 | 213M | |
| openshadinglanguage-..> | 2023-10-07 18:41 | 2.1M | |
| openshot-3.1.1.pkg | 2023-10-10 10:36 | 84M | |
| opensips31-3.1.11_2.pkg | 2023-10-11 05:55 | 3.4M | |
| openslide-3.4.1.293_..> | 2023-10-08 02:40 | 96K | |
| openslp-2.0.0_1.pkg | 2023-10-06 18:07 | 383K | |
| opensmtpd-6.8.0,1.pkg | 2023-10-07 05:55 | 283K | |
| opensmtpd-extras-6.7..> | 2023-10-08 14:53 | 632 | |
| opensmtpd-extras-que..> | 2023-10-10 22:25 | 17K | |
| opensmtpd-extras-sch..> | 2023-10-14 18:03 | 20K | |
| opensmtpd-extras-tab..> | 2023-10-08 02:14 | 26K | |
| opensmtpd-extras-tab..> | 2023-10-07 20:51 | 18K | |
| opensmtpd-extras-tab..> | 2023-10-08 06:44 | 17K | |
| opensmtpd-extras-tab..> | 2023-10-07 15:57 | 17K | |
| opensmtpd-extras-tab..> | 2023-10-07 21:06 | 19K | |
| opensmtpd-extras-tab..> | 2023-10-07 22:30 | 16K | |
| opensmtpd-extras-tab..> | 2023-10-08 05:53 | 20K | |
| opensmtpd-filter-rsp..> | 2023-10-08 21:25 | 1.6M | |
| opensmtpd-filter-sen..> | 2023-10-10 15:47 | 673K | |
| opensolaris-libm-200..> | 2023-10-12 06:41 | 649K | |
| opensonic-0.1.4_5.pkg | 2023-10-11 03:56 | 9.3M | |
| openspades-0.1.3_4.pkg | 2023-10-08 12:34 | 10M | |
| openssh-portable-9.3..> | 2023-10-09 18:05 | 886K | |
| openssh-portable-hpn..> | 2023-10-09 09:38 | 893K | |
| openssl-1.1.1w,1.pkg | 2023-10-08 03:37 | 3.9M | |
| openssl-agent-0.16.0..> | 2023-10-14 08:52 | 61K | |
| openssl-quictls-3.0...> | 2023-10-10 09:23 | 6.1M | |
| openssl-unsafe-1.0.2..> | 2023-10-07 12:29 | 1.9M | |
| openssl30-3.0.11_1.pkg | 2023-10-08 00:50 | 6.2M | |
| openssl31-3.1.3_1.pkg | 2023-10-08 23:52 | 6.5M | |
| openssl32-3.2.0.a1.pkg | 2023-10-10 15:03 | 7.1M | |
| openssn-1.4_6.pkg | 2023-10-08 13:07 | 5.6M | |
| opensubdiv-3.5.0_6.pkg | 2023-10-07 16:43 | 31M | |
| opensurge-0.1.r765_8..> | 2023-10-11 12:24 | 158M | |
| opensycl-0.9.4.pkg | 2023-10-08 23:53 | 499K | |
| opentelemetry-cpp-1...> | 2023-10-14 17:25 | 393K | |
| opentelemetry-proto-..> | 2023-10-14 13:34 | 13K | |
| opentimelineio-0.15_..> | 2023-10-10 02:58 | 203K | |
| opentimer-g20221116.pkg | 2023-10-08 18:34 | 519K | |
| opentoonz-1.5.0_6.pkg | 2023-10-10 10:01 | 20M | |
| openttd-13.0_1.pkg | 2023-10-08 15:05 | 5.9M | |
| openttd-opengfx-7.1.pkg | 2023-10-09 06:11 | 2.8M | |
| openttd-openmsx-0.4...> | 2023-10-10 03:29 | 82K | |
| openttd-opensfx-1.0...> | 2023-10-14 11:08 | 9.4M | |
| openturns-1.20_12.pkg | 2023-10-07 08:26 | 15M | |
| opentyrian-2.1.20221..> | 2023-10-10 10:12 | 226K | |
| openuniverse-1.0.b3_..> | 2023-10-10 08:58 | 3.8M | |
| openupsd-0.3.1_1.pkg | 2023-10-14 18:55 | 29K | |
| openvanilla-framewor..> | 2023-10-07 16:14 | 5.2K | |
| openvas-22.7.0.pkg | 2023-10-07 04:07 | 236K | |
| openvdb-10.0.1_9.pkg | 2023-10-06 21:06 | 6.5M | |
| openvkl-1.3.0_9.pkg | 2023-10-07 09:32 | 4.7M | |
| openvmps-1.4.06.pkg | 2023-10-14 15:05 | 16K | |
| openvpn-2.6.6.pkg | 2023-10-07 11:57 | 587K | |
| openvpn-admin-1.9.4_..> | 2023-10-14 12:25 | 47K | |
| openvpn-auth-ldap-2...> | 2023-10-08 21:29 | 52K | |
| openvpn-auth-radius-..> | 2023-10-09 16:42 | 98K | |
| openvpn-auth-script-..> | 2023-10-09 09:00 | 3.3K | |
| openvpn-devel-g20230..> | 2023-10-08 22:40 | 561K | |
| openvsp-3.35.3.pkg | 2023-10-14 17:50 | 24M | |
| openvswitch-2.17.3.pkg | 2023-10-14 14:52 | 1.8M | |
| openwince-include-0...> | 2023-10-14 18:06 | 43K | |
| openxcom-1.0_12.pkg | 2023-10-10 04:11 | 1.2M | |
| openyahtzee-1.9.3_5.pkg | 2023-10-10 02:40 | 132K | |
| openzwave-1.4.3254.pkg | 2023-10-11 13:08 | 595K | |
| openzwave-devel-1.6...> | 2023-10-08 13:41 | 11M | |
| ophcrack-3.8.0_1.pkg | 2023-10-08 23:19 | 186K | |
| opkg-openwrt-2018080..> | 2023-10-09 03:43 | 67K | |
| opsin-3.0.20190223_1..> | 2023-10-09 14:34 | 6.6M | |
| optar-2015.02.09_2.pkg | 2023-10-10 03:14 | 33K | |
| optimfrog-5.100.pkg | 2023-10-09 06:29 | 325K | |
| optipng-0.7.7.pkg | 2023-10-07 10:04 | 75K | |
| optpp-2.4_2.pkg | 2023-10-09 04:52 | 679K | |
| opus-1.4.pkg | 2023-10-05 16:48 | 329K | |
| opus-tools-0.2_2.pkg | 2023-10-09 12:42 | 54K | |
| opusfile-0.12_1.pkg | 2023-10-06 13:12 | 76K | |
| opustags-1.9.0.pkg | 2023-10-10 07:15 | 34K | |
| or-aspell-0.03.1_1,2..> | 2023-10-10 04:19 | 13K | |
| or-libreoffice-7.5.5..> | 2023-10-07 20:31 | 385K | |
| or-tools-9.5_4.pkg | 2023-10-07 18:55 | 4.6M | |
| ora2pg-24.1.pkg | 2023-10-09 19:53 | 367K | |
| orage-4.18.0_1.pkg | 2023-10-08 12:32 | 928K | |
| orange3-3.29.1_4.pkg | 2023-10-07 03:39 | 3.2M | |
| orangehrm-5.5.pkg | 2023-10-10 01:44 | 10M | |
| orbit-lv2-0.1.661.pkg | 2023-10-09 16:18 | 45K | |
| orbital_eunuchs_snip..> | 2023-10-11 17:11 | 3.7M | |
| orbiton-2.64.1_1.pkg | 2023-10-09 22:01 | 3.6M | |
| orbitron-g20110525.pkg | 2023-10-14 11:22 | 41K | |
| orc-0.4.34_1.pkg | 2023-10-05 17:27 | 257K | |
| orca-43.1_2.pkg | 2023-10-08 09:53 | 2.0M | |
| orcania-2.3.3.pkg | 2023-10-06 13:39 | 19K | |
| oregano-0.84.43_4.pkg | 2023-10-10 06:33 | 1.1M | |
| oroborus-2.0.20.pkg | 2023-10-14 08:27 | 124K | |
| orpie-1.5.2_8.pkg | 2023-10-10 20:32 | 743K | |
| orthanc-1.11.0_9.pkg | 2023-10-08 00:10 | 1.5M | |
| orthanc-dicomweb-1.8..> | 2023-10-14 15:27 | 1.3M | |
| orthanc-mysql-4.3_5.pkg | 2023-10-10 05:24 | 375K | |
| orthanc-postgresql-4..> | 2023-10-10 01:23 | 449K | |
| orthanc-webviewer-2...> | 2023-10-14 14:18 | 568K | |
| orthorobot-1.1.1.1_1..> | 2023-10-10 02:13 | 3.3M | |
| ortp-5.2.94.pkg | 2023-10-06 22:50 | 109K | |
| orville-write-2.55_1..> | 2023-10-12 11:59 | 41K | |
| osbf-lua-2.0.4.pkg | 2023-10-09 14:06 | 40K | |
| osc-1.3.1.pkg | 2023-10-10 04:19 | 419K | |
| oscam-1.20.20210729.pkg | 2023-10-10 01:59 | 602K | |
| osdclock-0.5_10.pkg | 2023-10-14 15:00 | 4.5K | |
| osdlyrics-0.4.3_7.pkg | 2023-10-09 12:07 | 221K | |
| osdmixer-0.9_7.pkg | 2023-10-08 11:57 | 4.2K | |
| osg-3.6.5_62.pkg | 2023-10-07 02:04 | 6.4M | |
| osg34-3.4.1_55.pkg | 2023-10-07 19:34 | 6.0M | |
| osgearth-3.4_2.pkg | 2023-10-10 07:07 | 9.5M | |
| osgg-1.0_2.pkg | 2023-10-09 10:30 | 131K | |
| osinfo-db-20230719.pkg | 2023-10-07 04:06 | 163K | |
| osinfo-db-tools-1.10..> | 2023-10-06 19:28 | 40K | |
| osm-gps-map-1.1.0_1.pkg | 2023-10-08 01:11 | 105K | |
| osm2mp-r475_2.pkg | 2023-10-14 06:15 | 43K | |
| osm2pgrouting-2.3.8_..> | 2023-10-09 23:30 | 99K | |
| osm2pgsql-1.9.2.pkg | 2023-10-08 21:12 | 459K | |
| osmium-tool-1.15.0.pkg | 2023-10-11 02:18 | 529K | |
| osmosis-0.48.3.pkg | 2023-10-10 13:50 | 14M | |
| ospray-2.10.0_6.pkg | 2023-10-08 06:39 | 3.0M | |
| ospray-studio-0.11.1..> | 2023-10-14 03:33 | 1.3M | |
| osqp-0.6.3.pkg | 2023-10-09 07:25 | 54K | |
| osrm-backend-5.26.0_..> | 2023-10-14 18:35 | 3.6M | |
| osrtspproxy-2.0_1.pkg | 2023-10-10 01:42 | 41K | |
| oss-4.2.b2019_4.pkg | 2023-10-07 00:54 | 925K | |
| ossec-hids-3.7.0.pkg | 2023-10-10 14:07 | 712 | |
| ossec-hids-agent-3.7..> | 2023-10-08 03:53 | 274K | |
| ossec-hids-agent-con..> | 2023-10-10 21:06 | 4.5K | |
| ossec-hids-local-3.7..> | 2023-10-07 01:22 | 620K | |
| ossec-hids-local-con..> | 2023-10-07 14:33 | 6.2K | |
| ossec-hids-server-3...> | 2023-10-07 17:41 | 620K | |
| ossec-hids-server-co..> | 2023-10-10 23:21 | 7.2K | |
| ossim-2.11.1_3.pkg | 2023-10-10 11:52 | 4.4M | |
| osslsigncode-2.6.pkg | 2023-10-14 06:34 | 47K | |
| ossp-al-0.9.3_1.pkg | 2023-10-10 11:17 | 22K | |
| ossp-cfg-0.9.11_1.pkg | 2023-10-08 21:53 | 47K | |
| ossp-ex-1.0.6_1.pkg | 2023-10-07 09:30 | 17K | |
| ossp-l2-0.9.13_1.pkg | 2023-10-14 13:11 | 105K | |
| ossp-sa-1.2.6_1.pkg | 2023-10-08 08:52 | 41K | |
| ossp-uuid-1.6.2_9.pkg | 2023-10-07 06:13 | 72K | |
| ossp-val-0.9.4_1.pkg | 2023-10-09 03:13 | 23K | |
| ossp-var-1.1.3_1.pkg | 2023-10-08 07:02 | 42K | |
| ossp-xds-0.9.3_1.pkg | 2023-10-09 16:48 | 26K | |
| osticket-php81-1.17...> | 2023-10-09 01:20 | 37M | |
| osv-scanner-1.4.0.pkg | 2023-10-14 02:04 | 4.8M | |
| ot-recorder-0.9.2.pkg | 2023-10-08 14:41 | 346K | |
| otf2bdf-3.1.pkg | 2023-10-09 10:06 | 14K | |
| otk-0.96_4.pkg | 2023-10-12 11:15 | 85K | |
| otpw-1.5.pkg | 2023-10-10 14:03 | 33K | |
| otrs-6.0.29_2.pkg | 2023-10-09 10:04 | 7.3M | |
| ots-9.1.0_1.pkg | 2023-10-07 05:36 | 267K | |
| ott-0.28_1.pkg | 2023-10-14 10:00 | 963K | |
| otter-3.3f_4.pkg | 2023-10-09 14:02 | 798K | |
| otter-browser-1.0.03..> | 2023-10-10 08:55 | 2.2M | |
| ouch-0.4.2_1.pkg | 2023-10-09 14:09 | 955K | |
| oura-1.8.1_4.pkg | 2023-10-09 21:09 | 1.1M | |
| outcome-2.2.7.202308..> | 2023-10-09 15:11 | 72K | |
| ov-0.15.0_3.pkg | 2023-10-09 06:47 | 2.4M | |
| ovs-1.05_5.pkg | 2023-10-09 14:59 | 24K | |
| owamp-3.3.pkg | 2023-10-08 15:20 | 246K | |
| owfs-3.2p4_2.pkg | 2023-10-09 15:44 | 597K | |
| owl-lisp-0.1.23.pkg | 2023-10-14 09:21 | 236K | |
| owncast-0.0.13_2.pkg | 2023-10-09 19:46 | 15M | |
| owncloud-php80-10.13..> | 2023-10-09 03:10 | 46M | |
| owncloud-php81-10.13..> | 2023-10-09 14:56 | 46M | |
| owncloud-php82-10.13..> | 2023-10-09 02:15 | 46M | |
| owncloud-php83-10.13..> | 2023-10-09 16:20 | 46M | |
| owncloudclient-2.8.2..> | 2023-10-09 16:28 | 1.4M | |
| owntone-28.5_5.pkg | 2023-10-10 02:05 | 657K | |
| owrep-1.2.pkg | 2023-10-08 14:21 | 14K | |
| ox-text-editor-0.2.7..> | 2023-10-10 20:50 | 669K | |
| oxipng-8.0.0_7.pkg | 2023-10-08 00:46 | 498K | |
| oxygen-fonts-5.4.3.pkg | 2023-10-09 14:03 | 47K | |
| oyranos-0.9.6_17.pkg | 2023-10-08 02:32 | 951K | |
| oysttyer-2.10.0.pkg | 2023-10-09 08:14 | 68K | |
| p0f-3.09b_1.pkg | 2023-10-09 18:20 | 68K | |
| p4-2023.1.2468153.pkg | 2023-10-07 14:43 | 1.9M | |
| p4.el-10.6_1.pkg | 2023-10-11 05:49 | 27K | |
| p4api-2023.1.2468153..> | 2023-10-07 13:06 | 1.3M | |
| p4delta-1.3.2.pkg | 2023-10-14 05:14 | 12K | |
| p4genpatch-1.pkg | 2023-10-08 21:40 | 4.1K | |
| p5-AI-Categorizer-0...> | 2023-10-08 12:51 | 108K | |
| p5-AI-DecisionTree-0..> | 2023-10-07 13:29 | 21K | |
| p5-AI-Genetic-0.05_1..> | 2023-10-09 16:43 | 29K | |
| p5-AI-NeuralNet-Back..> | 2023-10-08 15:00 | 35K | |
| p5-AI-Pathfinding-AS..> | 2023-10-14 17:25 | 6.5K | |
| p5-AI-Perceptron-1.0..> | 2023-10-08 15:19 | 8.7K | |
| p5-AI-Prolog-0.741_1..> | 2023-10-09 12:54 | 100K | |
| p5-AMF-Perl-0.15_3.pkg | 2023-10-07 14:46 | 34K | |
| p5-ARGV-Struct-0.06.pkg | 2023-10-08 07:42 | 6.9K | |
| p5-AWS-Signature4-1...> | 2023-10-08 11:21 | 9.0K | |
| p5-AcePerl-1.92_5.pkg | 2023-10-10 17:51 | 261K | |
| p5-Acme-6502-0.77_2.pkg | 2023-10-09 01:46 | 18K | |
| p5-Acme-ButFirst-1.0..> | 2023-10-09 18:07 | 4.1K | |
| p5-Acme-Comment-1.04..> | 2023-10-09 07:26 | 8.3K | |
| p5-Acme-Damn-0.06.pkg | 2023-10-07 04:17 | 9.0K | |
| p5-Acme-GuessNumber-..> | 2023-10-08 21:18 | 5.5K | |
| p5-Acme-HTTP-0.10.pkg | 2023-10-07 19:07 | 5.9K | |
| p5-Acme-MetaSyntacti..> | 2023-10-08 12:17 | 56K | |
| p5-Acme-Monta-0.01_1..> | 2023-10-08 04:07 | 3.7K | |
| p5-Acme-Steganograph..> | 2023-10-07 18:43 | 6.5K | |
| p5-Adapter-Async-0.0..> | 2023-10-06 21:53 | 20K | |
| p5-AddressBook-0.16_..> | 2023-10-08 19:10 | 45K | |
| p5-Agent-3.20_1.pkg | 2023-10-14 02:38 | 18K | |
| p5-Algorithm-Account..> | 2023-10-08 10:47 | 11K | |
| p5-Algorithm-Annotat..> | 2023-10-07 08:25 | 3.0K | |
| p5-Algorithm-Backoff..> | 2023-10-08 10:14 | 34K | |
| p5-Algorithm-BinPack..> | 2023-10-10 00:10 | 6.0K | |
| p5-Algorithm-Bucketi..> | 2023-10-09 13:41 | 13K | |
| p5-Algorithm-C3-0.11..> | 2023-10-05 16:48 | 7.9K | |
| p5-Algorithm-CheckDi..> | 2023-10-09 20:46 | 134K | |
| p5-Algorithm-ChooseS..> | 2023-10-09 14:54 | 4.5K | |
| p5-Algorithm-Cluster..> | 2023-10-08 18:55 | 39K | |
| p5-Algorithm-Combina..> | 2023-10-06 23:04 | 20K | |
| p5-Algorithm-Cron-0...> | 2023-10-07 16:25 | 7.9K | |
| p5-Algorithm-CurveFi..> | 2023-10-10 18:59 | 10K | |
| p5-Algorithm-Depende..> | 2023-10-08 03:08 | 33K | |
| p5-Algorithm-Depende..> | 2023-10-10 00:00 | 7.3K | |
| p5-Algorithm-Diff-1...> | 2023-10-05 16:54 | 36K | |
| p5-Algorithm-Evoluti..> | 2023-10-14 06:12 | 217K | |
| p5-Algorithm-FloodCo..> | 2023-10-07 10:39 | 13K | |
| p5-Algorithm-Include..> | 2023-10-08 23:41 | 6.6K | |
| p5-Algorithm-Interva..> | 2023-10-14 05:49 | 4.5K | |
| p5-Algorithm-LCS-1.0..> | 2023-10-14 15:07 | 9.0K | |
| p5-Algorithm-LUHN-1...> | 2023-10-08 19:44 | 6.1K | |
| p5-Algorithm-Line-Br..> | 2023-10-09 21:21 | 4.9K | |
| p5-Algorithm-MarkovC..> | 2023-10-09 23:44 | 7.2K | |
| p5-Algorithm-Merge-0..> | 2023-10-08 10:20 | 9.2K | |
| p5-Algorithm-MinMax-..> | 2023-10-14 17:05 | 3.2K | |
| p5-Algorithm-Munkres..> | 2023-10-09 06:47 | 8.3K | |
| p5-Algorithm-NaiveBa..> | 2023-10-08 07:55 | 11K | |
| p5-Algorithm-Network..> | 2023-10-09 05:21 | 35K | |
| p5-Algorithm-Numeric..> | 2023-10-08 22:34 | 5.9K | |
| p5-Algorithm-Pair-Be..> | 2023-10-09 20:56 | 10K | |
| p5-Algorithm-Pair-Sw..> | 2023-10-09 04:25 | 8.5K | |
| p5-Algorithm-Permute..> | 2023-10-08 02:46 | 13K | |
| p5-Algorithm-RabinKa..> | 2023-10-10 16:00 | 9.8K | |
| p5-Algorithm-SVM-0.1..> | 2023-10-07 19:29 | 55K | |
| p5-Alias-2.32_3.pkg | 2023-10-14 16:34 | 15K | |
| p5-Alien-Base-Module..> | 2023-10-06 15:49 | 73K | |
| p5-Alien-Build-2.80.pkg | 2023-10-05 17:09 | 386K | |
| p5-Alien-GSL-1.07_1.pkg | 2023-10-07 15:22 | 4.7K | |
| p5-Alien-Gimp-0.10.pkg | 2023-10-08 01:31 | 3.3K | |
| p5-Alien-LibGumbo-0...> | 2023-10-06 22:20 | 8.2K | |
| p5-Alien-SDL-1.446_1..> | 2023-10-07 01:51 | 13K | |
| p5-Alien-wxWidgets-0..> | 2023-10-11 08:37 | 14K | |
| p5-Alt-Crypt-RSA-Big..> | 2023-10-06 19:55 | 55K | |
| p5-Alzabo-0.92_1.pkg | 2023-10-07 09:51 | 310K | |
| p5-Amazon-SQS-Simple..> | 2023-10-09 07:30 | 16K | |
| p5-Amazon-SimpleDB-0..> | 2023-10-09 10:00 | 22K | |
| p5-Amon2-6.16.pkg | 2023-10-07 01:54 | 423K | |
| p5-Amon2-DBI-0.33.pkg | 2023-10-14 11:00 | 5.1K | |
| p5-Amon2-Lite-0.13.pkg | 2023-10-14 17:23 | 11K | |
| p5-Amon2-Plugin-LogD..> | 2023-10-08 15:08 | 3.1K | |
| p5-Amon2-Plugin-Web-..> | 2023-10-08 02:31 | 5.2K | |
| p5-Amon2-Plugin-Web-..> | 2023-10-09 16:30 | 11K | |
| p5-Any-Daemon-0.96,1..> | 2023-10-12 12:19 | 8.7K | |
| p5-Any-Moose-0.27.pkg | 2023-10-06 16:08 | 5.8K | |
| p5-Any-Moose-Convert..> | 2023-10-10 09:41 | 3.9K | |
| p5-Any-Template-1.01..> | 2023-10-07 13:36 | 20K | |
| p5-Any-URI-Escape-0...> | 2023-10-07 02:54 | 3.1K | |
| p5-AnyData-0.12.pkg | 2023-10-08 02:36 | 70K | |
| p5-AnyEvent-7.17,1.pkg | 2023-10-06 14:16 | 354K | |
| p5-AnyEvent-AIO-1.1_..> | 2023-10-06 16:46 | 3.1K | |
| p5-AnyEvent-BDB-1.1_..> | 2023-10-09 18:54 | 3.1K | |
| p5-AnyEvent-CacheDNS..> | 2023-10-06 17:40 | 5.2K | |
| p5-AnyEvent-Connecti..> | 2023-10-07 11:02 | 8.1K | |
| p5-AnyEvent-Connecto..> | 2023-10-07 11:29 | 9.5K | |
| p5-AnyEvent-CouchDB-..> | 2023-10-09 16:11 | 29K | |
| p5-AnyEvent-DBD-Pg-0..> | 2023-10-14 06:08 | 6.0K | |
| p5-AnyEvent-DBI-3.04..> | 2023-10-08 03:23 | 14K | |
| p5-AnyEvent-DBI-Abst..> | 2023-10-14 03:59 | 3.0K | |
| p5-AnyEvent-DBus-0.3..> | 2023-10-14 06:04 | 4.7K | |
| p5-AnyEvent-DNS-EtcH..> | 2023-10-07 14:44 | 6.3K | |
| p5-AnyEvent-Filesys-..> | 2023-10-07 18:45 | 26K | |
| p5-AnyEvent-Fork-1.3..> | 2023-10-07 07:36 | 33K | |
| p5-AnyEvent-Gearman-..> | 2023-10-09 06:13 | 23K | |
| p5-AnyEvent-Graphite..> | 2023-10-09 19:25 | 6.4K | |
| p5-AnyEvent-HTTP-2.2..> | 2023-10-06 18:03 | 27K | |
| p5-AnyEvent-HTTP-LWP..> | 2023-10-10 19:00 | 8.9K | |
| p5-AnyEvent-HTTPD-0...> | 2023-10-08 07:01 | 24K | |
| p5-AnyEvent-I3-0.17.pkg | 2023-10-07 07:17 | 9.0K | |
| p5-AnyEvent-IRC-0.97..> | 2023-10-14 07:29 | 40K | |
| p5-AnyEvent-MPRPC-0...> | 2023-10-14 12:11 | 15K | |
| p5-AnyEvent-MQTT-1.1..> | 2023-10-09 01:24 | 22K | |
| p5-AnyEvent-Memcache..> | 2023-10-09 23:49 | 16K | |
| p5-AnyEvent-MessageP..> | 2023-10-07 14:52 | 3.7K | |
| p5-AnyEvent-RPC-0.05..> | 2023-10-08 14:52 | 8.4K | |
| p5-AnyEvent-RabbitMQ..> | 2023-10-08 09:08 | 54K | |
| p5-AnyEvent-Redis-0...> | 2023-10-14 06:29 | 11K | |
| p5-AnyEvent-ReverseH..> | 2023-10-07 15:52 | 4.5K | |
| p5-AnyEvent-Run-0.01..> | 2023-10-14 03:04 | 7.1K | |
| p5-AnyEvent-SCGI-1.1..> | 2023-10-08 10:49 | 5.5K | |
| p5-AnyEvent-SNMP-6.0..> | 2023-10-08 01:40 | 8.1K | |
| p5-AnyEvent-Subproce..> | 2023-10-08 11:43 | 71K | |
| p5-AnyEvent-Task-0.8..> | 2023-10-14 08:50 | 24K | |
| p5-AnyEvent-Twitter-..> | 2023-10-07 22:17 | 9.1K | |
| p5-AnyEvent-Twitter-..> | 2023-10-08 03:35 | 7.9K | |
| p5-AnyEvent-WebSocke..> | 2023-10-14 14:35 | 19K | |
| p5-AnyEvent-Worker-0..> | 2023-10-14 18:15 | 9.3K | |
| p5-AnyEvent-XMPP-0.5..> | 2023-10-09 15:36 | 197K | |
| p5-AnyMQ-0.35_1.pkg | 2023-10-07 14:22 | 12K | |
| p5-AnyMQ-AMQP-0.30_1..> | 2023-10-10 12:19 | 4.4K | |
| p5-Apache-ASP-2.63.pkg | 2023-10-10 22:28 | 230K | |
| p5-Apache-Admin-Conf..> | 2023-10-07 01:27 | 17K | |
| p5-Apache-AuthCookie..> | 2023-10-07 09:29 | 71K | |
| p5-Apache-AuthTicket..> | 2023-10-08 13:51 | 28K | |
| p5-Apache-Clean-2.00..> | 2023-10-09 20:35 | 4.9K | |
| p5-Apache-Config-Pre..> | 2023-10-07 15:26 | 27K | |
| p5-Apache-ConfigFile..> | 2023-10-08 20:48 | 22K | |
| p5-Apache-ConfigPars..> | 2023-10-14 10:37 | 28K | |
| p5-Apache-DB-0.18_1.pkg | 2023-10-10 14:21 | 131K | |
| p5-Apache-DBI-1.12_2..> | 2023-10-07 11:18 | 30K | |
| p5-Apache-Defaults-1..> | 2023-10-08 07:21 | 8.7K | |
| p5-Apache-Htgroup-1...> | 2023-10-10 11:17 | 5.7K | |
| p5-Apache-Htpasswd-1..> | 2023-10-07 03:18 | 10K | |
| p5-Apache-LogFormat-..> | 2023-10-05 16:56 | 7.8K | |
| p5-Apache-MP3-4.00_4..> | 2023-10-10 09:33 | 139K | |
| p5-Apache-ParseFormD..> | 2023-10-10 13:38 | 8.0K | |
| p5-Apache-ParseLog-1..> | 2023-10-09 00:08 | 31K | |
| p5-Apache-Profiler-0..> | 2023-10-09 07:54 | 6.7K | |
| p5-Apache-Session-1...> | 2023-10-07 01:55 | 93K | |
| p5-Apache-Session-PH..> | 2023-10-14 10:10 | 6.7K | |
| p5-Apache-Session-SQ..> | 2023-10-10 01:40 | 4.4K | |
| p5-Apache-Session-Sh..> | 2023-10-10 01:55 | 6.2K | |
| p5-Apache-Session-Wr..> | 2023-10-07 19:56 | 18K | |
| p5-Apache-SessionX-2..> | 2023-10-11 00:40 | 13K | |
| p5-Apache-Singleton-..> | 2023-10-10 10:31 | 8.1K | |
| p5-Apache-Solr-1.09.pkg | 2023-10-14 10:39 | 41K | |
| p5-Apache2-SOAP-0.73..> | 2023-10-07 16:41 | 5.6K | |
| p5-Apache2-SiteContr..> | 2023-10-07 11:58 | 32K | |
| p5-ApacheBench-0.73_..> | 2023-10-11 03:39 | 41K | |
| p5-App-Acmeman-3.05.pkg | 2023-10-14 03:22 | 33K | |
| p5-App-Build-0.74_1.pkg | 2023-10-10 05:40 | 15K | |
| p5-App-CLI-0.500.pkg | 2023-10-07 01:31 | 17K | |
| p5-App-CLI-Extension..> | 2023-10-08 14:14 | 20K | |
| p5-App-Cache-0.37_1.pkg | 2023-10-08 05:48 | 6.1K | |
| p5-App-Cmd-0.336.pkg | 2023-10-07 03:18 | 58K | |
| p5-App-Control-1.07.pkg | 2023-10-07 05:53 | 6.6K | |
| p5-App-DSC-DataTool-..> | 2023-10-08 08:04 | 73K | |
| p5-App-FatPacker-0.0..> | 2023-10-14 14:55 | 14K | |
| p5-App-Genpass-2.401..> | 2023-10-09 07:42 | 15K | |
| p5-App-GitGot-1.339.pkg | 2023-10-14 13:47 | 62K | |
| p5-App-GitHub-1.0.1_..> | 2023-10-10 09:12 | 10K | |
| p5-App-Info-0.57_1.pkg | 2023-10-14 05:42 | 117K | |
| p5-App-Nopaste-1.013..> | 2023-10-06 17:31 | 42K | |
| p5-App-Options-1.12_..> | 2023-10-07 06:26 | 41K | |
| p5-App-Rad-1.05_1.pkg | 2023-10-07 17:28 | 44K | |
| p5-App-Regather-0.85..> | 2023-10-10 11:33 | 42K | |
| p5-App-RunCron-0.08.pkg | 2023-10-09 21:50 | 17K | |
| p5-App-SD-0.75_2.pkg | 2023-10-14 09:37 | 102K | |
| p5-App-SVN-Bisect-1...> | 2023-10-10 12:57 | 18K | |
| p5-App-Sqitch-1.3.0.pkg | 2023-10-08 13:23 | 682K | |
| p5-App-TLSMe-0.11000..> | 2023-10-10 10:13 | 16K | |
| p5-App-Trace-0.50_2.pkg | 2023-10-07 20:06 | 8.7K | |
| p5-App-ZFSCurses-1.2..> | 2023-10-09 09:36 | 30K | |
| p5-App-cpanminus-1.7..> | 2023-10-07 13:34 | 226K | |
| p5-App-cpanminus-rep..> | 2023-10-09 09:22 | 14K | |
| p5-App-cpanoutdated-..> | 2023-10-14 15:14 | 7.1K | |
| p5-App-gist-0.16_1.pkg | 2023-10-14 05:18 | 6.5K | |
| p5-App-local-lib-hel..> | 2023-10-08 08:19 | 20K | |
| p5-App-perlbrew-0.98..> | 2023-10-14 04:53 | 50K | |
| p5-App-scan_prereqs_..> | 2023-10-14 13:18 | 8.9K | |
| p5-AppConfig-1.71.pkg | 2023-10-05 17:03 | 61K | |
| p5-AppConfig-Std-1.1..> | 2023-10-08 02:17 | 7.0K | |
| p5-Archive-Any-0.094..> | 2023-10-07 20:33 | 13K | |
| p5-Archive-Any-Lite-..> | 2023-10-07 04:42 | 5.3K | |
| p5-Archive-Any-Plugi..> | 2023-10-09 21:43 | 2.9K | |
| p5-Archive-Extract-0..> | 2023-10-06 15:33 | 19K | |
| p5-Archive-Extract-L..> | 2023-10-10 14:40 | 8.1K | |
| p5-Archive-Libarchiv..> | 2023-10-09 18:38 | 95K | |
| p5-Archive-Peek-0.37..> | 2023-10-08 06:29 | 3.6K | |
| p5-Archive-Rar-2.02_..> | 2023-10-07 21:17 | 20K | |
| p5-Archive-SimpleExt..> | 2023-10-14 08:11 | 7.4K | |
| p5-Archive-Tar-3.02.pkg | 2023-10-14 15:52 | 44K | |
| p5-Archive-Tar-Wrapp..> | 2023-10-09 13:17 | 17K | |
| p5-Archive-Zip-1.68.pkg | 2023-10-06 17:59 | 77K | |
| p5-Ark-0.1.r1_2.pkg | 2023-10-08 13:21 | 29K | |
| p5-Array-Compare-3.0..> | 2023-10-07 09:38 | 10K | |
| p5-Array-Diff-0.09.pkg | 2023-10-07 09:07 | 4.8K | |
| p5-Array-FileReader-..> | 2023-10-11 02:12 | 3.8K | |
| p5-Array-Group-4.2.pkg | 2023-10-05 17:11 | 4.8K | |
| p5-Array-Heap-3.22.pkg | 2023-10-09 17:49 | 16K | |
| p5-Array-IntSpan-2.0..> | 2023-10-08 23:41 | 20K | |
| p5-Array-Iterator-0...> | 2023-10-07 01:49 | 22K | |
| p5-Array-LineReader-..> | 2023-10-14 04:52 | 7.3K | |
| p5-Array-PrintCols-2..> | 2023-10-07 11:27 | 6.1K | |
| p5-Array-RefElem-1.0..> | 2023-10-07 15:15 | 5.9K | |
| p5-Array-Unique-0.09..> | 2023-10-07 19:53 | 14K | |
| p5-Array-Utils-0.5.pkg | 2023-10-10 14:11 | 4.1K | |
| p5-Array-Window-1.02..> | 2023-10-08 04:17 | 8.6K | |
| p5-AsciiDB-TagFile-1..> | 2023-10-09 20:47 | 8.2K | |
| p5-Asm-Preproc-1.03.pkg | 2023-10-07 05:05 | 19K | |
| p5-Asterisk-FastAGI-..> | 2023-10-10 19:27 | 4.9K | |
| p5-Astro-0.78.pkg | 2023-10-09 07:42 | 40K | |
| p5-Astro-ADS-1.26_1.pkg | 2023-10-08 14:11 | 28K | |
| p5-Astro-App-Satpass..> | 2023-10-10 10:06 | 301K | |
| p5-Astro-Catalog-4.3..> | 2023-10-14 05:12 | 202K | |
| p5-Astro-Constants-0..> | 2023-10-09 02:28 | 26K | |
| p5-Astro-Coords-0.21..> | 2023-10-07 18:45 | 92K | |
| p5-Astro-DSS-1.6.1_1..> | 2023-10-09 08:09 | 8.5K | |
| p5-Astro-FITS-CFITSI..> | 2023-10-07 21:29 | 187K | |
| p5-Astro-FITS-Header..> | 2023-10-07 09:11 | 50K | |
| p5-Astro-Flux-0.01_1..> | 2023-10-07 14:37 | 14K | |
| p5-Astro-Hipparcos-0..> | 2023-10-09 15:51 | 35K | |
| p5-Astro-MoonPhase-0..> | 2023-10-14 08:48 | 11K | |
| p5-Astro-PAL-1.09.pkg | 2023-10-06 20:47 | 185K | |
| p5-Astro-SIMBAD-2.0...> | 2023-10-14 10:16 | 21K | |
| p5-Astro-SIMBAD-Clie..> | 2023-10-07 03:31 | 34K | |
| p5-Astro-SpaceTrack-..> | 2023-10-07 01:34 | 86K | |
| p5-Astro-SunTime-0.0..> | 2023-10-10 03:59 | 2.2K | |
| p5-Astro-Sunrise-0.9..> | 2023-10-10 09:13 | 21K | |
| p5-Astro-Telescope-0..> | 2023-10-07 06:24 | 43K | |
| p5-Astro-WaveBand-0...> | 2023-10-07 09:28 | 13K | |
| p5-Astro-satpass-0.1..> | 2023-10-07 13:37 | 300K | |
| p5-Async-Interrupt-1..> | 2023-10-09 17:37 | 27K | |
| p5-Async-MergePoint-..> | 2023-10-09 21:01 | 7.0K | |
| p5-AtExit-2.05.pkg | 2023-10-14 14:50 | 11K | |
| p5-Attribute-Handler..> | 2023-10-07 06:16 | 18K | |
| p5-Attribute-Handler..> | 2023-10-07 10:32 | 15K | |
| p5-Attribute-Persist..> | 2023-10-09 17:30 | 4.2K | |
| p5-Audio-CD-0.04_3.pkg | 2023-10-09 04:53 | 17K | |
| p5-Audio-Ecasound-1...> | 2023-10-09 10:07 | 24K | |
| p5-Audio-FLAC-Header..> | 2023-10-08 01:03 | 20K | |
| p5-Audio-M4P-0.57.pkg | 2023-10-08 15:12 | 30K | |
| p5-Audio-MPD-2.004_2..> | 2023-10-10 02:21 | 35K | |
| p5-Audio-MPD-Common-..> | 2023-10-07 21:53 | 31K | |
| p5-Audio-Mixer-0.7_3..> | 2023-10-09 17:18 | 11K | |
| p5-Audio-Musepack-1...> | 2023-10-09 19:37 | 6.2K | |
| p5-Audio-Scan-1.01.pkg | 2023-10-08 00:08 | 111K | |
| p5-Audio-Scrobbler-0..> | 2023-10-10 10:04 | 11K | |
| p5-Audio-WMA-1.3_1.pkg | 2023-10-08 13:13 | 13K | |
| p5-Audio-Wav-0.14_2.pkg | 2023-10-08 08:41 | 22K | |
| p5-Auth-YubikeyDecry..> | 2023-10-11 05:37 | 5.5K | |
| p5-AuthCAS-1.6_2.pkg | 2023-10-14 14:39 | 9.7K | |
| p5-Authen-Bitcard-0...> | 2023-10-14 04:36 | 9.0K | |
| p5-Authen-Captcha-1...> | 2023-10-10 08:01 | 88K | |
| p5-Authen-CyrusSASL-..> | 2023-10-10 02:02 | 4.9K | |
| p5-Authen-DecHpwd-2...> | 2023-10-06 14:07 | 12K | |
| p5-Authen-Htpasswd-0..> | 2023-10-08 01:40 | 12K | |
| p5-Authen-Krb5-1.9_2..> | 2023-10-10 04:43 | 39K | |
| p5-Authen-Krb5-Simpl..> | 2023-10-07 16:34 | 8.2K | |
| p5-Authen-Libwrap-0...> | 2023-10-08 09:09 | 11K | |
| p5-Authen-NTLM-1.09_..> | 2023-10-05 16:53 | 11K | |
| p5-Authen-OATH-1.0.0..> | 2023-10-11 02:52 | 5.4K | |
| p5-Authen-PAAS-1.1.1..> | 2023-10-10 17:54 | 32K | |
| p5-Authen-PAM-0.16_2..> | 2023-10-07 07:30 | 21K | |
| p5-Authen-Passphrase..> | 2023-10-06 17:55 | 96K | |
| p5-Authen-PluggableC..> | 2023-10-14 15:39 | 58K | |
| p5-Authen-Radius-0.3..> | 2023-10-07 13:11 | 38K | |
| p5-Authen-SASL-2.17.pkg | 2023-10-05 17:01 | 38K | |
| p5-Authen-SASL-Cyrus..> | 2023-10-10 00:56 | 42K | |
| p5-Authen-SASL-SASLp..> | 2023-10-06 22:17 | 3.7K | |
| p5-Authen-SCRAM-0.01..> | 2023-10-06 23:18 | 17K | |
| p5-Authen-Simple-0.5..> | 2023-10-07 23:26 | 14K | |
| p5-Authen-Simple-DBI..> | 2023-10-14 08:38 | 4.9K | |
| p5-Authen-Simple-DBM..> | 2023-10-09 21:17 | 5.5K | |
| p5-Authen-Simple-HTT..> | 2023-10-09 18:09 | 4.8K | |
| p5-Authen-Simple-Ker..> | 2023-10-14 06:08 | 4.2K | |
| p5-Authen-Simple-LDA..> | 2023-10-10 03:19 | 7.8K | |
| p5-Authen-Simple-Net..> | 2023-10-10 08:40 | 10K | |
| p5-Authen-Simple-PAM..> | 2023-10-10 16:20 | 4.4K | |
| p5-Authen-Simple-Pas..> | 2023-10-10 15:10 | 5.2K | |
| p5-Authen-Simple-RAD..> | 2023-10-09 14:35 | 4.6K | |
| p5-Authen-Simple-SMB..> | 2023-10-08 13:38 | 4.5K | |
| p5-Authen-Simple-SSH..> | 2023-10-10 23:31 | 4.5K | |
| p5-Authen-Smb-0.91_1..> | 2023-10-08 03:15 | 60K | |
| p5-Authen-TacacsPlus..> | 2023-10-07 11:14 | 15K | |
| p5-Authen-Ticket-0.0..> | 2023-10-10 10:53 | 27K | |
| p5-Authen-TypeKey-0...> | 2023-10-14 04:29 | 6.5K | |
| p5-AutoLoader-5.74.pkg | 2023-10-10 09:55 | 22K | |
| p5-AutoXS-Header-1.0..> | 2023-10-07 02:57 | 4.0K | |
| p5-Avro-1.11.2.pkg | 2023-10-08 08:23 | 17K | |
| p5-B-C-1.57.pkg | 2023-10-11 02:21 | 277K | |
| p5-B-COW-0.007.pkg | 2023-10-08 12:10 | 6.5K | |
| p5-B-Compiling-0.06.pkg | 2023-10-06 23:56 | 5.4K | |
| p5-B-Debug-1.26.pkg | 2023-10-10 11:27 | 9.6K | |
| p5-B-Deobfuscate-0.2..> | 2023-10-09 22:48 | 18K | |
| p5-B-Flags-0.17.pkg | 2023-10-08 05:53 | 9.7K | |
| p5-B-Generate-1.56.pkg | 2023-10-09 19:55 | 21K | |
| p5-B-Graph-0.51_1.pkg | 2023-10-14 11:45 | 15K | |
| p5-B-Hooks-AtRuntime..> | 2023-10-07 23:25 | 14K | |
| p5-B-Hooks-EndOfScop..> | 2023-10-05 16:50 | 12K | |
| p5-B-Hooks-OP-Annota..> | 2023-10-07 05:03 | 10K | |
| p5-B-Hooks-OP-Check-..> | 2023-10-05 16:52 | 6.9K | |
| p5-B-Hooks-OP-Check-..> | 2023-10-07 21:06 | 8.6K | |
| p5-B-Hooks-OP-PPAddr..> | 2023-10-06 23:05 | 7.3K | |
| p5-B-Hooks-Parser-0...> | 2023-10-06 22:24 | 10K | |
| p5-B-Keywords-1.26.pkg | 2023-10-06 17:27 | 8.3K | |
| p5-B-OPCheck-0.32.pkg | 2023-10-07 16:31 | 8.0K | |
| p5-B-Size2-2.07_1.pkg | 2023-10-08 04:52 | 14K | |
| p5-B-Utils-0.27.pkg | 2023-10-06 13:56 | 24K | |
| p5-BBS-Client-0.03_1..> | 2023-10-09 09:20 | 7.2K | |
| p5-BBS-UserInfo-0.01..> | 2023-10-08 18:17 | 2.6K | |
| p5-BBS-UserInfo-Mapl..> | 2023-10-10 16:01 | 3.8K | |
| p5-BBS-UserInfo-Mapl..> | 2023-10-10 17:15 | 3.8K | |
| p5-BBS-UserInfo-Ptt-..> | 2023-10-10 04:45 | 3.8K | |
| p5-BBS-UserInfo-SOB-..> | 2023-10-08 21:29 | 3.8K | |
| p5-BBS-UserInfo-Wret..> | 2023-10-08 20:18 | 3.9K | |
| p5-BDB-1.92.pkg | 2023-10-07 10:16 | 56K | |
| p5-BFD-0.31_1.pkg | 2023-10-06 17:22 | 3.8K | |
| p5-BIND-Conf_Parser-..> | 2023-10-10 06:20 | 12K | |
| p5-BIND-Config-Parse..> | 2023-10-07 16:47 | 4.8K | |
| p5-BS-Event-0.3_2.pkg | 2023-10-08 00:58 | 7.7K | |
| p5-BSD-Jail-Object-0..> | 2023-10-09 18:44 | 12K | |
| p5-BSD-Process-0.07_..> | 2023-10-14 07:10 | 29K | |
| p5-BSD-Resource-1.29..> | 2023-10-06 15:46 | 21K | |
| p5-BSD-Sysctl-0.12.3..> | 2023-10-06 23:47 | 22K | |
| p5-BSD-devstat-0.02_..> | 2023-10-10 01:00 | 8.4K | |
| p5-BSD-getloadavg-0...> | 2023-10-10 23:14 | 6.9K | |
| p5-BSD-stat-1.35_1.pkg | 2023-10-10 12:22 | 14K | |
| p5-BSON-1.12.2.pkg | 2023-10-06 21:25 | 87K | |
| p5-BSON-XS-0.8.4.pkg | 2023-10-07 01:22 | 61K | |
| p5-BZ-Client-1.04_3.pkg | 2023-10-10 00:02 | 24K | |
| p5-BackupPC-XS-0.62.pkg | 2023-10-08 06:29 | 88K | |
| p5-Badger-0.16.pkg | 2023-10-07 04:10 | 467K | |
| p5-Barcode-ZBar-0.10..> | 2023-10-09 21:26 | 37K | |
| p5-Baseball-Sabermet..> | 2023-10-10 17:19 | 12K | |
| p5-Bash-Completion-0..> | 2023-10-11 00:57 | 23K | |
| p5-Beanstalk-Client-..> | 2023-10-07 23:04 | 19K | |
| p5-Benchmark-Forking..> | 2023-10-10 23:16 | 9.6K | |
| p5-Benchmark-Stopwat..> | 2023-10-12 02:25 | 6.3K | |
| p5-Benchmark-Timer-0..> | 2023-10-08 07:36 | 12K | |
| p5-Bencode-1.502.pkg | 2023-10-14 12:03 | 6.4K | |
| p5-BerkeleyDB-0.65.pkg | 2023-10-07 10:01 | 113K | |
| p5-Best-0.15_1.pkg | 2023-10-07 01:55 | 11K | |
| p5-BibTeX-Parser-1.0..> | 2023-10-09 03:45 | 14K | |
| p5-BigIP-ParseConfig..> | 2023-10-09 23:25 | 6.5K | |
| p5-BigIP-iControl-0...> | 2023-10-09 23:25 | 22K | |
| p5-Bigtop-0.38_3.pkg | 2023-10-10 07:52 | 441K | |
| p5-Bio-ASN1-EntrezGe..> | 2023-10-07 14:34 | 36K | |
| p5-Bio-Cluster-1.7.3..> | 2023-10-07 05:58 | 50K | |
| p5-Bio-Coordinate-1...> | 2023-10-07 13:16 | 54K | |
| p5-Bio-DB-EMBL-1.7.4..> | 2023-10-10 12:44 | 5.5K | |
| p5-Bio-DB-NCBIHelper..> | 2023-10-14 11:40 | 52K | |
| p5-Bio-Das-1.17_4.pkg | 2023-10-11 22:54 | 117K | |
| p5-Bio-Das-Lite-2.11..> | 2023-10-09 19:35 | 18K | |
| p5-Bio-FeatureIO-1.6..> | 2023-10-08 04:30 | 50K | |
| p5-Bio-GFF3-2.0_2.pkg | 2023-10-10 08:05 | 23K | |
| p5-Bio-Glite-0.10_2.pkg | 2023-10-09 06:55 | 15K | |
| p5-Bio-Graphics-2.40..> | 2023-10-11 16:16 | 579K | |
| p5-Bio-MAGETAB-1.31_..> | 2023-10-09 23:28 | 168K | |
| p5-Bio-NEXUS-0.78_1.pkg | 2023-10-10 12:35 | 161K | |
| p5-Bio-Phylo-2.0.1.pkg | 2023-10-10 10:01 | 552K | |
| p5-Bio-SCF-1.03_2.pkg | 2023-10-07 12:31 | 15K | |
| p5-Bio-Variation-1.7..> | 2023-10-06 22:21 | 69K | |
| p5-BioPerl-1.007007_..> | 2023-10-06 16:43 | 2.7M | |
| p5-BioPerl-Run-1.007..> | 2023-10-09 23:07 | 603K | |
| p5-Bit-ShiftReg-2.0_..> | 2023-10-10 11:59 | 13K | |
| p5-Bit-Vector-7.4_1.pkg | 2023-10-05 17:03 | 127K | |
| p5-Bit-Vector-Minima..> | 2023-10-07 08:32 | 4.2K | |
| p5-Blog-Spam-1.0.2_2..> | 2023-10-10 15:33 | 62K | |
| p5-Bloom-Filter-1.2.pkg | 2023-10-10 16:24 | 5.8K | |
| p5-Border-Style-0.01..> | 2023-10-10 00:01 | 7.2K | |
| p5-BorderStyle-3.0.2..> | 2023-10-06 21:57 | 30K | |
| p5-BorderStyleBase-0..> | 2023-10-10 13:23 | 10K | |
| p5-BorderStyles-Stan..> | 2023-10-07 08:00 | 80K | |
| p5-Bot-BasicBot-0.93..> | 2023-10-07 12:48 | 22K | |
| p5-Bot-Training-0.07..> | 2023-10-07 16:48 | 6.9K | |
| p5-Bot-Training-Mega..> | 2023-10-09 04:01 | 10K | |
| p5-Bot-Training-Star..> | 2023-10-14 12:15 | 4.7K | |
| p5-Boulder-1.30_1.pkg | 2023-10-14 16:55 | 118K | |
| p5-Brackup-1.10_3.pkg | 2023-10-10 13:21 | 97K | |
| p5-Brannigan-1.1.000..> | 2023-10-06 23:40 | 45K | |
| p5-Bread-Board-0.37.pkg | 2023-10-08 00:50 | 113K | |
| p5-Bread-Board-Decla..> | 2023-10-10 05:47 | 25K | |
| p5-Browser-Open-0.04..> | 2023-10-06 15:04 | 4.5K | |
| p5-Bucardo-5.6.0.pkg | 2023-10-09 21:18 | 203K | |
| p5-Bundle-Perl6-0.12..> | 2023-10-14 10:02 | 5.3K | |
| p5-Business-CreditCa..> | 2023-10-08 04:17 | 10K | |
| p5-Business-EDI-0.05..> | 2023-10-10 19:29 | 524K | |
| p5-Business-Hours-0...> | 2023-10-07 02:40 | 7.7K | |
| p5-Business-IS-PIN-0..> | 2023-10-14 04:36 | 6.5K | |
| p5-Business-ISBN-3.0..> | 2023-10-08 02:04 | 16K | |
| p5-Business-ISBN-Dat..> | 2023-10-07 07:32 | 18K | |
| p5-Business-ISIN-0.2..> | 2023-10-09 09:03 | 5.7K | |
| p5-Business-ISMN-1.1..> | 2023-10-07 21:02 | 11K | |
| p5-Business-ISSN-1.0..> | 2023-10-07 11:31 | 5.3K | |
| p5-Business-MaxMind-..> | 2023-10-14 09:51 | 13K | |
| p5-Business-OCV-0.1_..> | 2023-10-08 00:36 | 23K | |
| p5-Business-OnlinePa..> | 2023-10-14 17:57 | 5.2K | |
| p5-Business-OnlinePa..> | 2023-10-07 20:20 | 25K | |
| p5-Business-OnlinePa..> | 2023-10-10 01:24 | 25K | |
| p5-Business-OnlinePa..> | 2023-10-14 12:01 | 6.7K | |
| p5-Business-OnlinePa..> | 2023-10-10 05:37 | 6.0K | |
| p5-Business-OnlinePa..> | 2023-10-14 06:22 | 4.8K | |
| p5-Business-OnlinePa..> | 2023-10-09 21:22 | 5.6K | |
| p5-Business-OnlinePa..> | 2023-10-10 00:25 | 5.8K | |
| p5-Business-OnlinePa..> | 2023-10-10 18:29 | 8.4K | |
| p5-Business-OnlinePa..> | 2023-10-14 02:44 | 5.0K | |
| p5-Business-OnlinePa..> | 2023-10-09 14:23 | 4.0K | |
| p5-Business-OnlinePa..> | 2023-10-08 13:25 | 4.4K | |
| p5-Business-OnlinePa..> | 2023-10-09 18:31 | 6.2K | |
| p5-Business-OnlinePa..> | 2023-10-09 20:53 | 5.3K | |
| p5-Business-OnlinePa..> | 2023-10-09 15:02 | 9.2K | |
| p5-Business-OnlinePa..> | 2023-10-11 23:56 | 5.2K | |
| p5-Business-OnlinePa..> | 2023-10-14 03:50 | 10K | |
| p5-Business-OnlinePa..> | 2023-10-10 16:21 | 4.4K | |
| p5-Business-OnlinePa..> | 2023-10-10 14:17 | 6.3K | |
| p5-Business-PayPal-0..> | 2023-10-11 12:16 | 18K | |
| p5-Business-PayPal-E..> | 2023-10-09 02:35 | 8.4K | |
| p5-Business-PayPal-I..> | 2023-10-10 07:21 | 12K | |
| p5-Business-Stripe-0..> | 2023-10-11 02:40 | 13K | |
| p5-Business-TW-Invoi..> | 2023-10-14 10:57 | 5.1K | |
| p5-Business-TW-TSIB-..> | 2023-10-08 15:36 | 5.5K | |
| p5-Business-TW-TSIB-..> | 2023-10-10 12:25 | 5.9K | |
| p5-Business-UPS-2.02..> | 2023-10-09 19:14 | 9.4K | |
| p5-Business-WorldPay..> | 2023-10-08 22:34 | 12K | |
| p5-Bytes-Random-Secu..> | 2023-10-07 06:05 | 24K | |
| p5-Bytes-Random-Secu..> | 2023-10-06 19:45 | 16K | |
| p5-C-Scan-0.74_1.pkg | 2023-10-10 21:14 | 13K | |
| p5-CACertOrg-CA-2021..> | 2023-10-08 08:20 | 8.2K | |
| p5-CAD-Calc-0.27_2.pkg | 2023-10-07 03:05 | 17K | |
| p5-CAD-Drawing-0.26_..> | 2023-10-07 18:10 | 78K | |
| p5-CAD-Drawing-Templ..> | 2023-10-09 01:39 | 12K | |
| p5-CAM-PDF-1.60_1.pkg | 2023-10-06 16:05 | 143K | |
| p5-CBOR-XS-1.30.pkg | 2023-10-07 03:45 | 44K | |
| p5-CDB_File-1.02.pkg | 2023-10-07 00:01 | 21K | |
| p5-CDB_File-Generato..> | 2023-10-14 07:03 | 5.5K | |
| p5-CDDB-1.222_1.pkg | 2023-10-08 04:30 | 25K | |
| p5-CDDB-File-1.05_2.pkg | 2023-10-08 00:36 | 5.5K | |
| p5-CDDB_get-2.28_3,1..> | 2023-10-07 19:46 | 12K | |
| p5-CGI-4.57.pkg | 2023-10-05 17:05 | 153K | |
| p5-CGI-Ajax-0.707_1.pkg | 2023-10-08 13:32 | 23K | |
| p5-CGI-Application-4..> | 2023-10-06 18:05 | 57K | |
| p5-CGI-Application-D..> | 2023-10-08 08:11 | 39K | |
| p5-CGI-Application-D..> | 2023-10-10 19:41 | 6.0K | |
| p5-CGI-Application-P..> | 2023-10-11 15:06 | 3.1K | |
| p5-CGI-Application-P..> | 2023-10-14 11:23 | 58K | |
| p5-CGI-Application-P..> | 2023-10-08 20:54 | 18K | |
| p5-CGI-Application-P..> | 2023-10-08 01:12 | 93K | |
| p5-CGI-Application-P..> | 2023-10-10 07:22 | 40K | |
| p5-CGI-Application-P..> | 2023-10-06 18:35 | 14K | |
| p5-CGI-Application-P..> | 2023-10-10 02:18 | 4.5K | |
| p5-CGI-Application-P..> | 2023-10-10 18:41 | 7.3K | |
| p5-CGI-Application-P..> | 2023-10-11 21:21 | 6.8K | |
| p5-CGI-Application-P..> | 2023-10-09 03:16 | 6.1K | |
| p5-CGI-Application-P..> | 2023-10-07 07:01 | 17K | |
| p5-CGI-Application-P..> | 2023-10-07 00:23 | 7.3K | |
| p5-CGI-Application-P..> | 2023-10-14 05:27 | 8.5K | |
| p5-CGI-Application-P..> | 2023-10-10 00:21 | 5.1K | |
| p5-CGI-Application-P..> | 2023-10-14 14:11 | 6.9K | |
| p5-CGI-Application-P..> | 2023-10-14 03:15 | 6.4K | |
| p5-CGI-Application-P..> | 2023-10-09 05:30 | 12K | |
| p5-CGI-Application-P..> | 2023-10-11 07:56 | 12K | |
| p5-CGI-Application-P..> | 2023-10-09 04:40 | 11K | |
| p5-CGI-Application-P..> | 2023-10-07 14:36 | 5.8K | |
| p5-CGI-Application-P..> | 2023-10-08 05:12 | 11K | |
| p5-CGI-Application-P..> | 2023-10-09 18:09 | 5.7K | |
| p5-CGI-Application-P..> | 2023-10-08 05:21 | 17K | |
| p5-CGI-Application-P..> | 2023-10-14 11:51 | 10K | |
| p5-CGI-Application-P..> | 2023-10-07 22:56 | 7.8K | |
| p5-CGI-Application-S..> | 2023-10-08 13:23 | 5.9K | |
| p5-CGI-ArgChecker-0...> | 2023-10-10 11:01 | 4.9K | |
| p5-CGI-Builder-1.36_..> | 2023-10-07 22:29 | 57K | |
| p5-CGI-Builder-TT2-0..> | 2023-10-11 03:39 | 12K | |
| p5-CGI-Cache-1.4214.pkg | 2023-10-14 06:47 | 16K | |
| p5-CGI-Compile-0.26.pkg | 2023-10-07 20:53 | 11K | |
| p5-CGI-Compress-Gzip..> | 2023-10-14 08:53 | 16K | |
| p5-CGI-Cookie-Splitt..> | 2023-10-07 06:30 | 6.1K | |
| p5-CGI-Cookie-XS-0.1..> | 2023-10-07 15:05 | 35K | |
| p5-CGI-Deurl-XS-0.08..> | 2023-10-06 17:13 | 8.7K | |
| p5-CGI-Emulate-PSGI-..> | 2023-10-07 04:00 | 7.5K | |
| p5-CGI-EncryptForm-1..> | 2023-10-11 17:20 | 10K | |
| p5-CGI-Enurl-1.07_2.pkg | 2023-10-09 07:00 | 6.2K | |
| p5-CGI-Ex-2.54.pkg | 2023-10-14 09:07 | 215K | |
| p5-CGI-Expand-2.05_1..> | 2023-10-07 20:53 | 10K | |
| p5-CGI-ExtDirect-3.2..> | 2023-10-10 22:51 | 14K | |
| p5-CGI-FCKeditor-0.0..> | 2023-10-08 16:43 | 4.4K | |
| p5-CGI-Fast-2.16.pkg | 2023-10-08 04:48 | 8.2K | |
| p5-CGI-FastTemplate-..> | 2023-10-14 04:06 | 18K | |
| p5-CGI-FormBuilder-3..> | 2023-10-08 03:55 | 163K | |
| p5-CGI-Framework-0.2..> | 2023-10-14 14:05 | 37K | |
| p5-CGI-Kwiki-0.18_4.pkg | 2023-10-11 11:27 | 77K | |
| p5-CGI-Lite-3.03.pkg | 2023-10-14 14:33 | 22K | |
| p5-CGI-Minimal-1.30.pkg | 2023-10-08 16:27 | 25K | |
| p5-CGI-PSGI-0.15_1.pkg | 2023-10-06 19:07 | 7.0K | |
| p5-CGI-Pager-1.01_1.pkg | 2023-10-10 20:52 | 8.5K | |
| p5-CGI-Prototype-0.9..> | 2023-10-11 09:53 | 21K | |
| p5-CGI-Response-0.03..> | 2023-10-11 01:05 | 10K | |
| p5-CGI-SSI-0.92_2.pkg | 2023-10-08 12:44 | 11K | |
| p5-CGI-Session-4.48_..> | 2023-10-07 08:56 | 87K | |
| p5-CGI-Session-Drive..> | 2023-10-14 09:34 | 3.6K | |
| p5-CGI-Session-Expir..> | 2023-10-10 17:45 | 11K | |
| p5-CGI-Simple-1.280.pkg | 2023-10-06 15:11 | 89K | |
| p5-CGI-SpeedyCGI-2.2..> | 2023-10-07 01:14 | 71K | |
| p5-CGI-Struct-1.21_1..> | 2023-10-06 14:33 | 12K | |
| p5-CGI-Thin-0.52_1.pkg | 2023-10-09 12:49 | 9.7K | |
| p5-CGI-Tiny-1.002.pkg | 2023-10-10 10:28 | 50K | |
| p5-CGI-Untaint-1.26_..> | 2023-10-07 00:49 | 16K | |
| p5-CGI-Untaint-date-..> | 2023-10-07 20:04 | 3.9K | |
| p5-CGI-Untaint-email..> | 2023-10-07 15:54 | 2.9K | |
| p5-CGI-Upload-1.13.pkg | 2023-10-14 04:30 | 9.1K | |
| p5-CGI-Utils-0.12_1.pkg | 2023-10-11 10:53 | 22K | |
| p5-CGI-XMLApplicatio..> | 2023-10-10 04:35 | 29K | |
| p5-CGP-CLI-2.7.5_1.pkg | 2023-10-10 16:04 | 13K | |
| p5-CHI-0.600.pkg | 2023-10-07 03:41 | 99K | |
| p5-CHI-Driver-DBI-1...> | 2023-10-14 02:53 | 7.0K | |
| p5-CHI-Driver-Memcac..> | 2023-10-09 16:52 | 9.3K | |
| p5-CHI-Driver-Redis-..> | 2023-10-08 13:31 | 4.6K | |
| p5-CHI-Driver-TokyoT..> | 2023-10-08 23:09 | 5.1K | |
| p5-CIF-Client-0.21_3..> | 2023-10-08 12:31 | 16K | |
| p5-CLASS-1.1.7.pkg | 2023-10-08 22:28 | 3.2K | |
| p5-CLI-Osprey-0.08.pkg | 2023-10-06 17:19 | 26K | |
| p5-CPAN-Changes-0.40..> | 2023-10-07 11:22 | 25K | |
| p5-CPAN-Checksums-2...> | 2023-10-07 08:19 | 8.2K | |
| p5-CPAN-DistnameInfo..> | 2023-10-06 17:49 | 5.1K | |
| p5-CPAN-Inject-1.14_..> | 2023-10-07 14:54 | 12K | |
| p5-CPAN-Meta-2.15001..> | 2023-10-09 15:00 | 115K | |
| p5-CPAN-Meta-Check-0..> | 2023-10-08 10:15 | 4.2K | |
| p5-CPAN-Meta-Require..> | 2023-10-10 06:40 | 15K | |
| p5-CPAN-Meta-YAML-0...> | 2023-10-09 18:03 | 9.9K | |
| p5-CPAN-Mini-1.11101..> | 2023-10-08 13:19 | 21K | |
| p5-CPAN-Perl-Release..> | 2023-10-07 16:31 | 5.8K | |
| p5-CPAN-Recent-Uploa..> | 2023-10-10 17:56 | 6.6K | |
| p5-CPAN-Reporter-1.2..> | 2023-10-07 19:10 | 51K | |
| p5-CPAN-Reporter-Smo..> | 2023-10-14 09:30 | 19K | |
| p5-CPAN-SQLite-0.199..> | 2023-10-09 00:55 | 52K | |
| p5-CPAN-Site-1.15.pkg | 2023-10-08 12:43 | 14K | |
| p5-CPAN-Testers-Comm..> | 2023-10-08 04:11 | 35K | |
| p5-CPAN-Testers-Repo..> | 2023-10-07 03:57 | 21K | |
| p5-CPAN-Uploader-0.1..> | 2023-10-08 08:47 | 11K | |
| p5-CPAN-YACSmoke-0.0..> | 2023-10-10 05:09 | 18K | |
| p5-CPANPLUS-0.9914.pkg | 2023-10-07 14:34 | 213K | |
| p5-CPANPLUS-Dist-Bui..> | 2023-10-09 14:00 | 13K | |
| p5-CPS-0.19.pkg | 2023-10-08 21:08 | 32K | |
| p5-CPU-Z80-Assembler..> | 2023-10-07 22:02 | 83K | |
| p5-CQL-Parser-1.13_1..> | 2023-10-07 20:00 | 38K | |
| p5-CSP-0.34_1.pkg | 2023-10-09 13:31 | 20K | |
| p5-CSS-1.09_1.pkg | 2023-10-07 08:01 | 47K | |
| p5-CSS-Compressor-0...> | 2023-10-10 00:01 | 7.3K | |
| p5-CSS-Croco-0.09_2.pkg | 2023-10-09 10:01 | 31K | |
| p5-CSS-DOM-0.17.pkg | 2023-10-06 18:16 | 104K | |
| p5-CSS-Inliner-4003.pkg | 2023-10-10 13:21 | 22K | |
| p5-CSS-Minifier-0.01..> | 2023-10-07 23:54 | 6.0K | |
| p5-CSS-Minifier-XS-0..> | 2023-10-07 03:55 | 11K | |
| p5-CSS-Packer-2.09.pkg | 2023-10-07 10:20 | 6.6K | |
| p5-CSS-SAC-0.08_2.pkg | 2023-10-09 01:28 | 68K | |
| p5-CSS-Sass-3.6.4.pkg | 2023-10-08 23:52 | 1.0M | |
| p5-CSS-Simple-3220.pkg | 2023-10-08 20:31 | 8.2K | |
| p5-CSS-Squish-0.10_1..> | 2023-10-07 08:05 | 8.9K | |
| p5-CSS-Tiny-1.20.pkg | 2023-10-07 23:09 | 7.8K | |
| p5-Cache-2.11.pkg | 2023-10-06 15:14 | 63K | |
| p5-Cache-AgainstFile..> | 2023-10-08 21:58 | 24K | |
| p5-Cache-BDB-0.04_1.pkg | 2023-10-10 00:50 | 17K | |
| p5-Cache-Cache-1.08.pkg | 2023-10-06 17:29 | 55K | |
| p5-Cache-FastMmap-1...> | 2023-10-07 00:06 | 41K | |
| p5-Cache-LRU-0.04_1.pkg | 2023-10-06 21:26 | 3.7K | |
| p5-Cache-Memcached-1..> | 2023-10-06 15:47 | 17K | |
| p5-Cache-Memcached-F..> | 2023-10-07 20:35 | 46K | |
| p5-Cache-Memcached-M..> | 2023-10-06 21:06 | 40K | |
| p5-Cache-Memcached-T..> | 2023-10-14 11:31 | 3.4K | |
| p5-Cache-Memcached-X..> | 2023-10-14 17:05 | 14K | |
| p5-Cache-Memcached-l..> | 2023-10-08 12:57 | 12K | |
| p5-Cache-Mmap-0.11_1..> | 2023-10-08 23:39 | 17K | |
| p5-Cache-Simple-Time..> | 2023-10-06 19:18 | 3.6K | |
| p5-Cairo-1.109_1.pkg | 2023-10-06 13:46 | 74K | |
| p5-Cairo-GObject-1.0..> | 2023-10-06 18:42 | 6.3K | |
| p5-Calendar-Simple-2..> | 2023-10-07 09:00 | 7.3K | |
| p5-Call-Context-0.02..> | 2023-10-06 21:45 | 3.3K | |
| p5-Callback-Frame-1...> | 2023-10-08 11:18 | 14K | |
| p5-Canary-Stability-..> | 2023-10-06 14:51 | 920 | |
| p5-Captcha-reCAPTCHA..> | 2023-10-14 04:13 | 11K | |
| p5-Captcha-reCAPTCHA..> | 2023-10-14 11:58 | 7.2K | |
| p5-Capture-Tiny-0.48..> | 2023-10-05 17:07 | 16K | |
| p5-Capture-Tiny-Exte..> | 2023-10-09 11:15 | 11K | |
| p5-Carp-1.50.pkg | 2023-10-08 02:29 | 18K | |
| p5-Carp-Always-0.16.pkg | 2023-10-07 23:03 | 5.2K | |
| p5-Carp-Always-Color..> | 2023-10-14 11:07 | 7.3K | |
| p5-Carp-Assert-0.22.pkg | 2023-10-06 20:30 | 13K | |
| p5-Carp-Assert-More-..> | 2023-10-07 03:41 | 12K | |
| p5-Carp-Clan-6.08.pkg | 2023-10-05 16:51 | 8.3K | |
| p5-Carp-Clan-Share-0..> | 2023-10-07 04:17 | 4.1K | |
| p5-Carp-Datum-0.1.3_..> | 2023-10-09 02:12 | 52K | |
| p5-Carp-REPL-0.18.pkg | 2023-10-07 05:33 | 9.3K | |
| p5-Catalyst-Action-R..> | 2023-10-07 05:29 | 49K | |
| p5-Catalyst-Action-R..> | 2023-10-06 22:08 | 5.4K | |
| p5-Catalyst-Action-S..> | 2023-10-14 05:29 | 4.9K | |
| p5-Catalyst-ActionRo..> | 2023-10-07 17:04 | 7.7K | |
| p5-Catalyst-Authenti..> | 2023-10-08 04:55 | 13K | |
| p5-Catalyst-Authenti..> | 2023-10-14 17:15 | 14K | |
| p5-Catalyst-Authenti..> | 2023-10-08 09:35 | 24K | |
| p5-Catalyst-Authenti..> | 2023-10-10 00:04 | 23K | |
| p5-Catalyst-Componen..> | 2023-10-06 23:41 | 6.0K | |
| p5-Catalyst-Componen..> | 2023-10-06 19:34 | 3.5K | |
| p5-Catalyst-Controll..> | 2023-10-06 23:52 | 6.1K | |
| p5-Catalyst-Controll..> | 2023-10-14 14:00 | 6.9K | |
| p5-Catalyst-Controll..> | 2023-10-14 18:38 | 13K | |
| p5-Catalyst-Controll..> | 2023-10-08 06:18 | 32K | |
| p5-Catalyst-Controll..> | 2023-10-10 22:15 | 4.6K | |
| p5-Catalyst-Controll..> | 2023-10-14 12:19 | 10K | |
| p5-Catalyst-Controll..> | 2023-10-09 16:44 | 32K | |
| p5-Catalyst-Devel-1...> | 2023-10-06 23:50 | 60K | |
| p5-Catalyst-Dispatch..> | 2023-10-07 21:43 | 13K | |
| p5-Catalyst-Engine-A..> | 2023-10-08 23:37 | 17K | |
| p5-Catalyst-Engine-H..> | 2023-10-09 17:47 | 9.3K | |
| p5-Catalyst-Engine-P..> | 2023-10-08 14:29 | 14K | |
| p5-Catalyst-Enzyme-0..> | 2023-10-14 16:33 | 42K | |
| p5-Catalyst-Helper-C..> | 2023-10-08 23:33 | 4.7K | |
| p5-Catalyst-Manual-5..> | 2023-10-08 04:20 | 354K | |
| p5-Catalyst-Model-Ad..> | 2023-10-08 10:40 | 17K | |
| p5-Catalyst-Model-CD..> | 2023-10-07 19:12 | 6.6K | |
| p5-Catalyst-Model-CD..> | 2023-10-10 09:33 | 5.9K | |
| p5-Catalyst-Model-CD..> | 2023-10-09 13:36 | 4.1K | |
| p5-Catalyst-Model-DB..> | 2023-10-09 18:39 | 5.5K | |
| p5-Catalyst-Model-DB..> | 2023-10-07 01:06 | 34K | |
| p5-Catalyst-Model-Dy..> | 2023-10-10 17:58 | 3.5K | |
| p5-Catalyst-Model-LD..> | 2023-10-08 18:54 | 18K | |
| p5-Catalyst-Model-Me..> | 2023-10-09 23:41 | 5.1K | |
| p5-Catalyst-Model-Or..> | 2023-10-09 02:35 | 5.7K | |
| p5-Catalyst-Model-Ta..> | 2023-10-11 16:05 | 3.7K | |
| p5-Catalyst-Model-XM..> | 2023-10-10 13:38 | 9.0K | |
| p5-Catalyst-Model-Xa..> | 2023-10-14 11:10 | 8.3K | |
| p5-Catalyst-Plugin-A..> | 2023-10-09 10:45 | 10K | |
| p5-Catalyst-Plugin-A..> | 2023-10-07 02:46 | 82K | |
| p5-Catalyst-Plugin-A..> | 2023-10-10 17:32 | 5.8K | |
| p5-Catalyst-Plugin-A..> | 2023-10-09 18:58 | 6.4K | |
| p5-Catalyst-Plugin-A..> | 2023-10-09 04:36 | 10K | |
| p5-Catalyst-Plugin-A..> | 2023-10-14 13:17 | 15K | |
| p5-Catalyst-Plugin-A..> | 2023-10-08 00:05 | 5.2K | |
| p5-Catalyst-Plugin-A..> | 2023-10-09 13:38 | 69K | |
| p5-Catalyst-Plugin-B..> | 2023-10-09 13:19 | 3.3K | |
| p5-Catalyst-Plugin-C..> | 2023-10-08 14:56 | 5.6K | |
| p5-Catalyst-Plugin-C..> | 2023-10-07 14:30 | 21K | |
| p5-Catalyst-Plugin-C..> | 2023-10-08 00:49 | 3.5K | |
| p5-Catalyst-Plugin-C..> | 2023-10-09 07:29 | 3.4K | |
| p5-Catalyst-Plugin-C..> | 2023-10-14 11:10 | 3.2K | |
| p5-Catalyst-Plugin-C..> | 2023-10-10 21:44 | 4.3K | |
| p5-Catalyst-Plugin-C..> | 2023-10-06 19:14 | 13K | |
| p5-Catalyst-Plugin-C..> | 2023-10-10 05:21 | 6.4K | |
| p5-Catalyst-Plugin-C..> | 2023-10-08 22:41 | 4.3K | |
| p5-Catalyst-Plugin-D..> | 2023-10-10 20:26 | 3.8K | |
| p5-Catalyst-Plugin-D..> | 2023-10-08 11:33 | 4.2K | |
| p5-Catalyst-Plugin-E..> | 2023-10-09 21:04 | 5.0K | |
| p5-Catalyst-Plugin-E..> | 2023-10-14 18:06 | 27K | |
| p5-Catalyst-Plugin-F..> | 2023-10-09 00:37 | 5.6K | |
| p5-Catalyst-Plugin-F..> | 2023-10-09 21:39 | 11K | |
| p5-Catalyst-Plugin-F..> | 2023-10-08 02:19 | 3.5K | |
| p5-Catalyst-Plugin-I..> | 2023-10-08 01:13 | 14K | |
| p5-Catalyst-Plugin-L..> | 2023-10-09 09:04 | 5.6K | |
| p5-Catalyst-Plugin-L..> | 2023-10-10 10:07 | 5.8K | |
| p5-Catalyst-Plugin-L..> | 2023-10-10 17:34 | 4.3K | |
| p5-Catalyst-Plugin-P..> | 2023-10-10 17:00 | 15K | |
| p5-Catalyst-Plugin-P..> | 2023-10-10 10:50 | 5.8K | |
| p5-Catalyst-Plugin-P..> | 2023-10-10 13:46 | 3.3K | |
| p5-Catalyst-Plugin-P..> | 2023-10-10 02:49 | 5.4K | |
| p5-Catalyst-Plugin-R..> | 2023-10-10 11:20 | 6.1K | |
| p5-Catalyst-Plugin-S..> | 2023-10-10 12:20 | 13K | |
| p5-Catalyst-Plugin-S..> | 2023-10-14 16:01 | 28K | |
| p5-Catalyst-Plugin-S..> | 2023-10-06 19:11 | 36K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 21:55 | 4.9K | |
| p5-Catalyst-Plugin-S..> | 2023-10-08 12:03 | 6.3K | |
| p5-Catalyst-Plugin-S..> | 2023-10-08 04:12 | 7.1K | |
| p5-Catalyst-Plugin-S..> | 2023-10-10 12:38 | 9.7K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 19:58 | 2.9K | |
| p5-Catalyst-Plugin-S..> | 2023-10-08 13:03 | 7.7K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 15:19 | 9.8K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 08:50 | 6.3K | |
| p5-Catalyst-Plugin-S..> | 2023-10-09 22:28 | 6.0K | |
| p5-Catalyst-Plugin-S..> | 2023-10-08 00:46 | 5.1K | |
| p5-Catalyst-Plugin-S..> | 2023-10-11 02:28 | 4.8K | |
| p5-Catalyst-Plugin-S..> | 2023-10-10 01:14 | 4.5K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 15:25 | 5.5K | |
| p5-Catalyst-Plugin-S..> | 2023-10-10 15:44 | 7.3K | |
| p5-Catalyst-Plugin-S..> | 2023-10-07 12:00 | 6.0K | |
| p5-Catalyst-Plugin-S..> | 2023-10-09 16:38 | 3.9K | |
| p5-Catalyst-Plugin-S..> | 2023-10-06 20:00 | 14K | |
| p5-Catalyst-Plugin-S..> | 2023-10-10 07:21 | 6.8K | |
| p5-Catalyst-Plugin-S..> | 2023-10-08 05:50 | 4.5K | |
| p5-Catalyst-Plugin-T..> | 2023-10-14 11:38 | 2.7K | |
| p5-Catalyst-Plugin-U..> | 2023-10-14 09:29 | 4.0K | |
| p5-Catalyst-Plugin-X..> | 2023-10-10 00:38 | 7.6K | |
| p5-Catalyst-Runtime-..> | 2023-10-06 15:47 | 338K | |
| p5-Catalyst-TraitFor..> | 2023-10-14 07:15 | 6.8K | |
| p5-Catalyst-TraitFor..> | 2023-10-08 10:03 | 3.1K | |
| p5-Catalyst-View-Cle..> | 2023-10-14 14:19 | 6.7K | |
| p5-Catalyst-View-Ema..> | 2023-10-07 15:46 | 18K | |
| p5-Catalyst-View-Gra..> | 2023-10-14 12:33 | 13K | |
| p5-Catalyst-View-HTM..> | 2023-10-11 13:21 | 7.0K | |
| p5-Catalyst-View-HTM..> | 2023-10-11 03:32 | 9.2K | |
| p5-Catalyst-View-JSO..> | 2023-10-08 01:25 | 15K | |
| p5-Catalyst-View-Jem..> | 2023-10-14 11:58 | 6.5K | |
| p5-Catalyst-View-Mas..> | 2023-10-09 20:46 | 8.5K | |
| p5-Catalyst-View-RES..> | 2023-10-10 09:15 | 2.9K | |
| p5-Catalyst-View-RRD..> | 2023-10-10 22:34 | 7.2K | |
| p5-Catalyst-View-TT-..> | 2023-10-07 03:56 | 24K | |
| p5-Catalyst-View-TT-..> | 2023-10-09 08:50 | 12K | |
| p5-Catalyst-View-TT-..> | 2023-10-07 13:22 | 6.6K | |
| p5-Catalyst-View-Tem..> | 2023-10-08 23:29 | 7.9K | |
| p5-Catalyst-View-Tem..> | 2023-10-08 08:34 | 6.4K | |
| p5-Catalyst-View-XML..> | 2023-10-10 02:44 | 7.3K | |
| p5-Catalyst-View-XML..> | 2023-10-10 06:38 | 3.4K | |
| p5-Catalyst-View-XSL..> | 2023-10-08 20:44 | 13K | |
| p5-Catalyst-View-vCa..> | 2023-10-09 10:48 | 4.0K | |
| p5-CatalystX-AppBuil..> | 2023-10-10 05:11 | 8.6K | |
| p5-CatalystX-Compone..> | 2023-10-06 21:41 | 5.8K | |
| p5-CatalystX-InjectC..> | 2023-10-07 03:57 | 4.5K | |
| p5-CatalystX-LeakChe..> | 2023-10-07 21:49 | 4.4K | |
| p5-CatalystX-Profile..> | 2023-10-07 13:37 | 5.3K | |
| p5-CatalystX-REPL-0...> | 2023-10-07 11:02 | 4.5K | |
| p5-CatalystX-RoleApp..> | 2023-10-07 08:48 | 3.3K | |
| p5-CatalystX-SimpleL..> | 2023-10-07 10:25 | 32K | |
| p5-CatalystX-Virtual..> | 2023-10-09 18:41 | 5.8K | |
| p5-Cflow-1.053_2.pkg | 2023-10-08 03:14 | 32K | |
| p5-Chart-2.4.10.pkg | 2023-10-07 00:39 | 65K | |
| p5-Chart-Clicker-2.9..> | 2023-10-14 07:32 | 106K | |
| p5-Chart-Gnuplot-0.2..> | 2023-10-14 18:24 | 34K | |
| p5-Chart-Graph-3.2_1..> | 2023-10-07 19:57 | 69K | |
| p5-Chart-Math-Axis-1..> | 2023-10-07 23:48 | 7.9K | |
| p5-Chart-PNGgraph-1...> | 2023-10-09 17:15 | 5.7K | |
| p5-Chatbot-Eliza-1.0..> | 2023-10-08 00:50 | 22K | |
| p5-Check-ISA-0.09.pkg | 2023-10-06 17:08 | 7.6K | |
| p5-Chemistry-3DBuild..> | 2023-10-08 03:56 | 5.3K | |
| p5-Chemistry-Bond-Fi..> | 2023-10-06 17:47 | 12K | |
| p5-Chemistry-Canonic..> | 2023-10-06 16:35 | 6.2K | |
| p5-Chemistry-Element..> | 2023-10-09 19:47 | 11K | |
| p5-Chemistry-File-MD..> | 2023-10-07 17:21 | 10K | |
| p5-Chemistry-File-Mo..> | 2023-10-08 05:20 | 5.7K | |
| p5-Chemistry-File-PD..> | 2023-10-07 04:50 | 6.6K | |
| p5-Chemistry-File-SL..> | 2023-10-08 04:54 | 10K | |
| p5-Chemistry-File-SM..> | 2023-10-07 00:17 | 7.2K | |
| p5-Chemistry-File-SM..> | 2023-10-06 20:58 | 10K | |
| p5-Chemistry-File-VR..> | 2023-10-07 14:38 | 10K | |
| p5-Chemistry-File-XY..> | 2023-10-07 22:11 | 4.2K | |
| p5-Chemistry-Formula..> | 2023-10-07 11:51 | 9.2K | |
| p5-Chemistry-Interna..> | 2023-10-07 01:19 | 11K | |
| p5-Chemistry-Isotope..> | 2023-10-07 18:19 | 24K | |
| p5-Chemistry-MacroMo..> | 2023-10-06 20:25 | 6.8K | |
| p5-Chemistry-MidasPa..> | 2023-10-08 03:53 | 10K | |
| p5-Chemistry-Mok-0.2..> | 2023-10-08 10:11 | 15K | |
| p5-Chemistry-Mol-0.3..> | 2023-10-06 14:10 | 61K | |
| p5-Chemistry-Pattern..> | 2023-10-06 18:37 | 13K | |
| p5-Chemistry-Reactio..> | 2023-10-07 21:05 | 6.9K | |
| p5-Chemistry-Ring-0...> | 2023-10-06 17:28 | 11K | |
| p5-Chess-PGN-Parse-0..> | 2023-10-09 14:40 | 21K | |
| p5-Child-0.013.pkg | 2023-10-10 00:08 | 26K | |
| p5-Chooser-2.0.0_2.pkg | 2023-10-11 13:50 | 11K | |
| p5-Cisco-CopyConfig-..> | 2023-10-09 16:55 | 8.0K | |
| p5-Cisco-Hash-0.02_1..> | 2023-10-14 17:18 | 4.5K | |
| p5-Cisco-IPPhone-0.0..> | 2023-10-10 16:28 | 14K | |
| p5-Cisco-Reconfig-0...> | 2023-10-07 19:16 | 15K | |
| p5-Cisco-UCS-0.51_1,..> | 2023-10-11 10:07 | 99K | |
| p5-Clamd-1.04_5.pkg | 2023-10-11 00:34 | 6.8K | |
| p5-Class-Accessor-0...> | 2023-10-05 17:06 | 18K | |
| p5-Class-Accessor-Ch..> | 2023-10-06 16:03 | 4.8K | |
| p5-Class-Accessor-Ch..> | 2023-10-09 08:27 | 5.7K | |
| p5-Class-Accessor-Co..> | 2023-10-07 06:28 | 16K | |
| p5-Class-Accessor-Co..> | 2023-10-07 15:12 | 11K | |
| p5-Class-Accessor-Fa..> | 2023-10-08 11:57 | 4.3K | |
| p5-Class-Accessor-Fa..> | 2023-10-08 10:25 | 9.0K | |
| p5-Class-Accessor-Gr..> | 2023-10-05 17:03 | 16K | |
| p5-Class-Accessor-In..> | 2023-10-06 22:43 | 6.8K | |
| p5-Class-Accessor-Li..> | 2023-10-06 16:43 | 5.6K | |
| p5-Class-Accessor-Lv..> | 2023-10-08 11:53 | 6.7K | |
| p5-Class-Accessor-Na..> | 2023-10-07 02:43 | 5.4K | |
| p5-Class-Adapter-1.0..> | 2023-10-07 00:23 | 15K | |
| p5-Class-AlzaboWrapp..> | 2023-10-08 02:52 | 15K | |
| p5-Class-ArrayObject..> | 2023-10-07 19:54 | 11K | |
| p5-Class-AutoClass-1..> | 2023-10-10 09:43 | 24K | |
| p5-Class-Autouse-2.0..> | 2023-10-07 04:36 | 21K | |
| p5-Class-Base-0.09.pkg | 2023-10-07 12:38 | 14K | |
| p5-Class-BlackHole-0..> | 2023-10-08 16:58 | 4.5K | |
| p5-Class-C3-0.35.pkg | 2023-10-05 16:49 | 16K | |
| p5-Class-C3-Adopt-NE..> | 2023-10-06 13:57 | 7.2K | |
| p5-Class-C3-Componen..> | 2023-10-05 17:04 | 8.1K | |
| p5-Class-C3-XS-0.15.pkg | 2023-10-07 03:07 | 11K | |
| p5-Class-CSV-1.03_1.pkg | 2023-10-07 16:17 | 8.8K | |
| p5-Class-Closure-0.3..> | 2023-10-08 21:39 | 10K | |
| p5-Class-CodeStyler-..> | 2023-10-10 10:02 | 4.5K | |
| p5-Class-Component-0..> | 2023-10-11 15:06 | 20K | |
| p5-Class-Constant-0...> | 2023-10-09 06:01 | 7.2K | |
| p5-Class-Container-0..> | 2023-10-06 16:48 | 16K | |
| p5-Class-Contract-1...> | 2023-10-14 10:05 | 36K | |
| p5-Class-DBI-3.0.17_..> | 2023-10-06 22:41 | 88K | |
| p5-Class-DBI-Abstrac..> | 2023-10-07 21:11 | 4.4K | |
| p5-Class-DBI-AsForm-..> | 2023-10-08 09:21 | 5.0K | |
| p5-Class-DBI-AutoLoa..> | 2023-10-14 14:02 | 6.8K | |
| p5-Class-DBI-BaseDSN..> | 2023-10-07 17:21 | 4.5K | |
| p5-Class-DBI-DATA-Sc..> | 2023-10-07 23:36 | 4.8K | |
| p5-Class-DBI-DDL-1.0..> | 2023-10-09 23:44 | 13K | |
| p5-Class-DBI-FromCGI..> | 2023-10-14 11:42 | 7.4K | |
| p5-Class-DBI-FromFor..> | 2023-10-07 21:04 | 3.4K | |
| p5-Class-DBI-LazyInf..> | 2023-10-14 17:11 | 4.0K | |
| p5-Class-DBI-Loader-..> | 2023-10-07 08:03 | 16K | |
| p5-Class-DBI-Loader-..> | 2023-10-07 23:33 | 4.2K | |
| p5-Class-DBI-Oracle-..> | 2023-10-07 23:49 | 4.8K | |
| p5-Class-DBI-Pager-0..> | 2023-10-07 18:30 | 4.7K | |
| p5-Class-DBI-Pg-0.09..> | 2023-10-07 15:55 | 6.4K | |
| p5-Class-DBI-Plugin-..> | 2023-10-07 08:48 | 4.2K | |
| p5-Class-DBI-Plugin-..> | 2023-10-08 06:18 | 4.3K | |
| p5-Class-DBI-Plugin-..> | 2023-10-10 22:48 | 6.0K | |
| p5-Class-DBI-Plugin-..> | 2023-10-10 22:52 | 7.7K | |
| p5-Class-DBI-Plugin-..> | 2023-10-10 07:37 | 12K | |
| p5-Class-DBI-Plugin-..> | 2023-10-08 09:34 | 3.9K | |
| p5-Class-DBI-Plugin-..> | 2023-10-09 14:06 | 6.5K | |
| p5-Class-DBI-Plugin-..> | 2023-10-07 01:17 | 3.2K | |
| p5-Class-DBI-Replica..> | 2023-10-08 17:22 | 4.8K | |
| p5-Class-DBI-SAK-1.4..> | 2023-10-09 18:27 | 5.8K | |
| p5-Class-DBI-SQLite-..> | 2023-10-07 21:22 | 4.4K | |
| p5-Class-DBI-Sweet-0..> | 2023-10-08 04:53 | 21K | |
| p5-Class-DBI-ToSax-0..> | 2023-10-09 16:02 | 6.3K | |
| p5-Class-DBI-Untaint..> | 2023-10-09 02:30 | 3.6K | |
| p5-Class-DBI-mysql-1..> | 2023-10-08 04:23 | 6.1K | |
| p5-Class-Data-Config..> | 2023-10-07 00:02 | 4.6K | |
| p5-Class-Data-Inheri..> | 2023-10-05 16:49 | 5.0K | |
| p5-Class-Data-Lite-0..> | 2023-10-07 17:19 | 4.5K | |
| p5-Class-Date-1.1.17..> | 2023-10-06 21:53 | 32K | |
| p5-Class-Declare-0.1..> | 2023-10-09 15:28 | 43K | |
| p5-Class-Default-1.5..> | 2023-10-07 09:20 | 7.0K | |
| p5-Class-Delegation-..> | 2023-10-14 12:37 | 21K | |
| p5-Class-EHierarchy-..> | 2023-10-07 18:56 | 22K | |
| p5-Class-ErrorHandle..> | 2023-10-05 17:07 | 3.8K | |
| p5-Class-Factory-1.0..> | 2023-10-07 07:25 | 15K | |
| p5-Class-Factory-Uti..> | 2023-10-06 18:47 | 4.5K | |
| p5-Class-Field-0.24.pkg | 2023-10-08 11:31 | 5.0K | |
| p5-Class-Fields-0.20..> | 2023-10-07 19:09 | 27K | |
| p5-Class-Forward-0.1..> | 2023-10-08 16:11 | 6.2K | |
| p5-Class-Generate-1...> | 2023-10-07 10:55 | 66K | |
| p5-Class-Gomor-1.03.pkg | 2023-10-06 16:16 | 13K | |
| p5-Class-Handle-1.07..> | 2023-10-08 05:11 | 8.8K | |
| p5-Class-Hook-0.06.pkg | 2023-10-08 17:00 | 6.0K | |
| p5-Class-ISA-0.36_1.pkg | 2023-10-06 14:33 | 6.6K | |
| p5-Class-Inflate-0.0..> | 2023-10-09 09:45 | 11K | |
| p5-Class-Inner-0.200..> | 2023-10-08 10:56 | 5.4K | |
| p5-Class-InsideOut-1..> | 2023-10-06 15:52 | 29K | |
| p5-Class-Inspector-1..> | 2023-10-05 16:50 | 13K | |
| p5-Class-Interfaces-..> | 2023-10-07 06:27 | 9.4K | |
| p5-Class-Load-0.25.pkg | 2023-10-05 16:49 | 9.2K | |
| p5-Class-Load-XS-0.1..> | 2023-10-05 16:51 | 6.4K | |
| p5-Class-Loader-2.03..> | 2023-10-05 17:01 | 5.9K | |
| p5-Class-MakeMethods..> | 2023-10-07 15:07 | 280K | |
| p5-Class-Measure-0.1..> | 2023-10-06 18:40 | 11K | |
| p5-Class-Method-Modi..> | 2023-10-05 16:49 | 12K | |
| p5-Class-Method-Modi..> | 2023-10-08 03:22 | 4.8K | |
| p5-Class-MethodMaker..> | 2023-10-06 14:21 | 204K | |
| p5-Class-MethodMappe..> | 2023-10-10 02:42 | 8.0K | |
| p5-Class-Mix-0.006.pkg | 2023-10-05 17:04 | 7.2K | |
| p5-Class-Mixin-1.00_..> | 2023-10-14 14:34 | 5.3K | |
| p5-Class-MixinFactor..> | 2023-10-07 17:09 | 25K | |
| p5-Class-Multimethod..> | 2023-10-06 23:13 | 23K | |
| p5-Class-Multimethod..> | 2023-10-08 09:17 | 20K | |
| p5-Class-NamedParms-..> | 2023-10-07 01:00 | 8.1K | |
| p5-Class-Null-2.1107..> | 2023-10-10 07:20 | 6.1K | |
| p5-Class-OOorNO-0.01..> | 2023-10-09 19:37 | 12K | |
| p5-Class-ObjectTempl..> | 2023-10-07 22:00 | 5.8K | |
| p5-Class-ObjectTempl..> | 2023-10-10 13:40 | 5.7K | |
| p5-Class-Observable-..> | 2023-10-07 01:59 | 13K | |
| p5-Class-ParmList-1...> | 2023-10-06 23:50 | 12K | |
| p5-Class-Prototyped-..> | 2023-10-08 04:59 | 44K | |
| p5-Class-ReturnValue..> | 2023-10-06 19:15 | 6.3K | |
| p5-Class-Roles-0.30_..> | 2023-10-11 00:14 | 7.8K | |
| p5-Class-STL-Contain..> | 2023-10-08 05:59 | 16K | |
| p5-Class-Singleton-1..> | 2023-10-05 16:52 | 9.1K | |
| p5-Class-Spiffy-0.15..> | 2023-10-14 15:24 | 18K | |
| p5-Class-StateMachin..> | 2023-10-09 14:07 | 13K | |
| p5-Class-Std-0.013.pkg | 2023-10-06 18:12 | 39K | |
| p5-Class-Std-Fast-0...> | 2023-10-07 06:29 | 16K | |
| p5-Class-Std-Utils-0..> | 2023-10-07 23:15 | 7.2K | |
| p5-Class-StrongSingl..> | 2023-10-07 01:40 | 10K | |
| p5-Class-Tangram-1.5..> | 2023-10-07 19:51 | 47K | |
| p5-Class-Throwable-0..> | 2023-10-07 09:40 | 14K | |
| p5-Class-Tiny-1.008.pkg | 2023-10-05 16:51 | 12K | |
| p5-Class-Tiny-Chaine..> | 2023-10-06 18:46 | 3.3K | |
| p5-Class-Tom-3.02_3.pkg | 2023-10-07 23:42 | 5.4K | |
| p5-Class-Trigger-0.1..> | 2023-10-06 16:42 | 7.9K | |
| p5-Class-Unload-0.11..> | 2023-10-06 15:43 | 3.3K | |
| p5-Class-Virtual-0.0..> | 2023-10-07 01:51 | 8.1K | |
| p5-Class-WhiteHole-0..> | 2023-10-10 22:21 | 3.6K | |
| p5-Class-Workflow-0...> | 2023-10-08 17:36 | 61K | |
| p5-Class-XPath-1.4_1..> | 2023-10-07 08:45 | 11K | |
| p5-Class-XSAccessor-..> | 2023-10-05 16:53 | 29K | |
| p5-ClearSilver-0.10...> | 2023-10-07 17:10 | 84K | |
| p5-Clipboard-0.28.pkg | 2023-10-06 14:41 | 36K | |
| p5-Clone-0.46.pkg | 2023-10-05 16:50 | 7.7K | |
| p5-Clone-Choose-0.01..> | 2023-10-05 16:52 | 6.2K | |
| p5-Clone-Fast-0.97_1..> | 2023-10-08 00:03 | 17K | |
| p5-Clone-More-0.90.2..> | 2023-10-14 13:58 | 21K | |
| p5-Clone-PP-1.08.pkg | 2023-10-06 18:06 | 6.0K | |
| p5-Code-Perl-0.03_2.pkg | 2023-10-07 10:12 | 12K | |
| p5-Color-ANSI-Util-0..> | 2023-10-06 18:34 | 8.6K | |
| p5-Color-Calc-1.074_..> | 2023-10-07 05:28 | 14K | |
| p5-Color-Library-0.0..> | 2023-10-06 17:18 | 360K | |
| p5-Color-Palette-0.1..> | 2023-10-14 06:35 | 11K | |
| p5-Color-RGB-Util-0...> | 2023-10-06 17:17 | 13K | |
| p5-Color-Rgb-1.4_1.pkg | 2023-10-10 01:52 | 6.8K | |
| p5-Color-Scheme-1.08..> | 2023-10-08 09:30 | 13K | |
| p5-Color-Theme-Role-..> | 2023-10-09 21:41 | 8.4K | |
| p5-ColorThemeBase-St..> | 2023-10-06 19:17 | 15K | |
| p5-ColorThemeUtil-AN..> | 2023-10-07 04:31 | 3.8K | |
| p5-ColorThemes-Stand..> | 2023-10-07 04:44 | 5.0K | |
| p5-Commandable-0.11.pkg | 2023-10-07 06:31 | 37K | |
| p5-Commands-Guarded-..> | 2023-10-09 14:08 | 21K | |
| p5-CommitBit-0.02_3.pkg | 2023-10-10 12:56 | 19K | |
| p5-Compiler-Lexer-0...> | 2023-10-07 01:51 | 63K | |
| p5-Complete-Common-0..> | 2023-10-05 17:10 | 6.4K | |
| p5-Complete-Path-0.2..> | 2023-10-08 18:17 | 7.8K | |
| p5-Complete-Sah-0.01..> | 2023-10-06 21:03 | 7.7K | |
| p5-Complete-Sequence..> | 2023-10-06 19:55 | 6.6K | |
| p5-Complete-Util-0.6..> | 2023-10-06 17:17 | 17K | |
| p5-Compress-Bzip2-2...> | 2023-10-06 19:02 | 46K | |
| p5-Compress-LZ4-0.25..> | 2023-10-08 06:12 | 39K | |
| p5-Compress-LZF-3.80..> | 2023-10-08 07:08 | 14K | |
| p5-Compress-LZO-1.09..> | 2023-10-08 09:10 | 10K | |
| p5-Compress-LZW-0.04..> | 2023-10-07 16:56 | 10K | |
| p5-Compress-LeadingB..> | 2023-10-14 06:23 | 5.0K | |
| p5-Compress-Raw-Bzip..> | 2023-10-06 17:19 | 40K | |
| p5-Compress-Raw-Lzma..> | 2023-10-07 06:52 | 29K | |
| p5-Compress-Raw-Zlib..> | 2023-10-06 17:19 | 38K | |
| p5-Compress-Snappy-0..> | 2023-10-07 06:17 | 10K | |
| p5-Compress-Zstd-0.2..> | 2023-10-07 05:27 | 300K | |
| p5-Config-AST-1.07.pkg | 2023-10-06 21:26 | 34K | |
| p5-Config-AWS-0.12.pkg | 2023-10-07 20:09 | 8.1K | |
| p5-Config-Any-0.33.pkg | 2023-10-05 17:07 | 25K | |
| p5-Config-ApacheForm..> | 2023-10-11 22:53 | 18K | |
| p5-Config-Auto-0.44_..> | 2023-10-07 19:59 | 13K | |
| p5-Config-AutoConf-0..> | 2023-10-06 22:58 | 35K | |
| p5-Config-Fast-1.07_..> | 2023-10-14 11:04 | 11K | |
| p5-Config-General-2...> | 2023-10-05 17:00 | 50K | |
| p5-Config-GitLike-1...> | 2023-10-06 15:05 | 31K | |
| p5-Config-Grammar-1...> | 2023-10-07 22:31 | 19K | |
| p5-Config-INI-0.029.pkg | 2023-10-07 02:00 | 19K | |
| p5-Config-INI-Reader..> | 2023-10-08 10:59 | 3.9K | |
| p5-Config-INI-Simple..> | 2023-10-07 13:19 | 3.9K | |
| p5-Config-Identity-0..> | 2023-10-07 08:01 | 7.2K | |
| p5-Config-IniFiles-3..> | 2023-10-07 00:33 | 35K | |
| p5-Config-IniHash-3...> | 2023-10-07 04:26 | 9.6K | |
| p5-Config-IniRegEx-0..> | 2023-10-09 08:31 | 6.2K | |
| p5-Config-JFDI-0.065..> | 2023-10-08 00:30 | 11K | |
| p5-Config-JSON-1.520..> | 2023-10-10 11:08 | 9.6K | |
| p5-Config-MVP-2.2000..> | 2023-10-06 23:30 | 41K | |
| p5-Config-MVP-Reader..> | 2023-10-08 05:12 | 3.2K | |
| p5-Config-Merge-1.04..> | 2023-10-08 04:53 | 22K | |
| p5-Config-Model-2.15..> | 2023-10-07 15:13 | 394K | |
| p5-Config-Model-Back..> | 2023-10-14 08:13 | 7.7K | |
| p5-Config-Model-Test..> | 2023-10-08 18:53 | 28K | |
| p5-Config-MySQL-0.02..> | 2023-10-08 10:28 | 10K | |
| p5-Config-Objective-..> | 2023-10-10 23:33 | 31K | |
| p5-Config-Options-0...> | 2023-10-07 04:15 | 9.5K | |
| p5-Config-Parser-1.0..> | 2023-10-07 01:44 | 16K | |
| p5-Config-Parser-lda..> | 2023-10-07 18:22 | 5.2K | |
| p5-Config-Perl-V-0.3..> | 2023-10-06 23:20 | 9.5K | |
| p5-Config-Properties..> | 2023-10-09 16:55 | 13K | |
| p5-Config-Record-1.1..> | 2023-10-07 12:11 | 10K | |
| p5-Config-Setting-0...> | 2023-10-10 09:47 | 20K | |
| p5-Config-Simple-4.5..> | 2023-10-06 21:22 | 23K | |
| p5-Config-Std-0.903.pkg | 2023-10-06 20:18 | 19K | |
| p5-Config-Tiny-2.29.pkg | 2023-10-05 16:56 | 10K | |
| p5-Config-Validator-..> | 2023-10-14 06:49 | 14K | |
| p5-Config-Versioned-..> | 2023-10-07 09:22 | 17K | |
| p5-Config-Wrest-1.03..> | 2023-10-10 18:56 | 28K | |
| p5-Config-YAML-1.42_..> | 2023-10-07 23:23 | 6.6K | |
| p5-ConfigReader-0.5_..> | 2023-10-09 18:42 | 7.7K | |
| p5-ConfigReader-Simp..> | 2023-10-07 03:14 | 11K | |
| p5-Connector-1.51.pkg | 2023-10-08 09:51 | 138K | |
| p5-Const-Exporter-1...> | 2023-10-06 22:52 | 8.5K | |
| p5-Const-Fast-0.014_..> | 2023-10-06 18:18 | 5.9K | |
| p5-Context-Preserve-..> | 2023-10-05 16:58 | 5.3K | |
| p5-Contextual-Return..> | 2023-10-07 14:54 | 50K | |
| p5-Continuity-1.6.pkg | 2023-10-07 05:26 | 44K | |
| p5-Convert-ASCII-Arm..> | 2023-10-06 18:12 | 7.1K | |
| p5-Convert-ASN1-0.34..> | 2023-10-06 15:08 | 27K | |
| p5-Convert-BER-1.32_..> | 2023-10-09 08:28 | 26K | |
| p5-Convert-Base32-0...> | 2023-10-09 03:58 | 4.2K | |
| p5-Convert-Bencode-1..> | 2023-10-07 19:36 | 4.4K | |
| p5-Convert-Bencode_X..> | 2023-10-10 20:46 | 12K | |
| p5-Convert-BinHex-1...> | 2023-10-06 14:02 | 27K | |
| p5-Convert-Binary-C-..> | 2023-10-08 03:13 | 241K | |
| p5-Convert-Color-0.1..> | 2023-10-06 17:27 | 42K | |
| p5-Convert-Color-XTe..> | 2023-10-06 20:33 | 5.3K | |
| p5-Convert-Cyrillic-..> | 2023-10-11 21:21 | 17K | |
| p5-Convert-IBM390-0...> | 2023-10-11 12:16 | 56K | |
| p5-Convert-Moji-0.11..> | 2023-10-07 15:07 | 11K | |
| p5-Convert-Morse-0.0..> | 2023-10-09 05:14 | 6.0K | |
| p5-Convert-NLS_DATE_..> | 2023-10-06 15:08 | 5.3K | |
| p5-Convert-PEM-0.08_..> | 2023-10-06 16:49 | 13K | |
| p5-Convert-Recode-1...> | 2023-10-08 10:01 | 4.0K | |
| p5-Convert-Scalar-1...> | 2023-10-07 00:20 | 15K | |
| p5-Convert-TNEF-0.18..> | 2023-10-07 09:06 | 11K | |
| p5-Convert-UU-0.52.0..> | 2023-10-14 07:41 | 8.4K | |
| p5-Convert-UUlib-1.7..> | 2023-10-07 05:22 | 96K | |
| p5-Cookie-Baker-0.11..> | 2023-10-05 16:56 | 6.3K | |
| p5-Coro-6.570,1.pkg | 2023-10-06 22:02 | 189K | |
| p5-Corona-0.1004_1.pkg | 2023-10-08 23:51 | 7.5K | |
| p5-CouchDB-View-0.00..> | 2023-10-07 20:38 | 9.8K | |
| p5-Cpanel-JSON-XS-4...> | 2023-10-05 16:53 | 105K | |
| p5-Crypt-Anubis-1.0...> | 2023-10-09 18:14 | 16K | |
| p5-Crypt-AppleTwoFis..> | 2023-10-08 18:32 | 29K | |
| p5-Crypt-Argon2-0.01..> | 2023-10-08 08:59 | 27K | |
| p5-Crypt-Bcrypt-0.01..> | 2023-10-07 09:07 | 16K | |
| p5-Crypt-Blowfish-2...> | 2023-10-06 14:14 | 13K | |
| p5-Crypt-Blowfish_PP..> | 2023-10-07 19:15 | 9.7K | |
| p5-Crypt-CAST5-0.05_..> | 2023-10-07 00:39 | 20K | |
| p5-Crypt-CAST5_PP-1...> | 2023-10-06 21:14 | 16K | |
| p5-Crypt-CBC-3.04.pkg | 2023-10-05 17:06 | 28K | |
| p5-Crypt-CBCeasy-0.2..> | 2023-10-09 03:12 | 7.9K | |
| p5-Crypt-CFB-0.02_1.pkg | 2023-10-07 16:48 | 5.5K | |
| p5-Crypt-Caesar-0.01..> | 2023-10-14 04:16 | 3.0K | |
| p5-Crypt-Camellia_PP..> | 2023-10-14 04:50 | 7.1K | |
| p5-Crypt-Chimera-1.0..> | 2023-10-10 17:19 | 5.2K | |
| p5-Crypt-CipherSaber..> | 2023-10-07 23:35 | 6.6K | |
| p5-Crypt-Cracklib-1...> | 2023-10-09 03:18 | 21K | |
| p5-Crypt-Ctr-0.01_2.pkg | 2023-10-09 08:38 | 4.2K | |
| p5-Crypt-Curve25519-..> | 2023-10-06 18:56 | 20K | |
| p5-Crypt-DES-2.07_2.pkg | 2023-10-05 17:03 | 9.7K | |
| p5-Crypt-DES_EDE3-0...> | 2023-10-06 14:40 | 3.9K | |
| p5-Crypt-DES_PP-1.00..> | 2023-10-07 15:20 | 7.5K | |
| p5-Crypt-DH-0.07_1.pkg | 2023-10-08 07:56 | 6.6K | |
| p5-Crypt-DH-GMP-0.00..> | 2023-10-06 18:51 | 14K | |
| p5-Crypt-DSA-1.17_1.pkg | 2023-10-06 20:32 | 25K | |
| p5-Crypt-Dining-1.01..> | 2023-10-10 19:35 | 6.3K | |
| p5-Crypt-ECB-2.22.pkg | 2023-10-07 00:02 | 12K | |
| p5-Crypt-Eksblowfish..> | 2023-10-06 15:11 | 43K | |
| p5-Crypt-Enigma-1.4_..> | 2023-10-10 10:19 | 8.0K | |
| p5-Crypt-Format-0.07..> | 2023-10-06 20:41 | 3.4K | |
| p5-Crypt-GCrypt-1.26..> | 2023-10-09 15:02 | 29K | |
| p5-Crypt-GOST-1.00_1..> | 2023-10-08 05:14 | 9.3K | |
| p5-Crypt-GOST_PP-1.1..> | 2023-10-10 19:14 | 4.3K | |
| p5-Crypt-GPG-1.64.pkg | 2023-10-07 12:25 | 18K | |
| p5-Crypt-GeneratePas..> | 2023-10-09 08:20 | 168K | |
| p5-Crypt-GpgME-0.09.pkg | 2023-10-09 17:52 | 28K | |
| p5-Crypt-HCE_MD5-0.7..> | 2023-10-08 17:14 | 4.6K | |
| p5-Crypt-HCE_SHA-0.7..> | 2023-10-08 03:13 | 4.2K | |
| p5-Crypt-HSXKPasswd-..> | 2023-10-09 09:29 | 4.2M | |
| p5-Crypt-IDEA-1.10_1..> | 2023-10-06 20:59 | 8.2K | |
| p5-Crypt-Imail-0.01_..> | 2023-10-14 04:54 | 3.8K | |
| p5-Crypt-JWT-0.034.pkg | 2023-10-07 23:34 | 27K | |
| p5-Crypt-Juniper-0.0..> | 2023-10-14 10:38 | 4.1K | |
| p5-Crypt-Khazad-1.0...> | 2023-10-09 01:06 | 18K | |
| p5-Crypt-LE-0.39.pkg | 2023-10-14 09:36 | 42K | |
| p5-Crypt-LibSCEP-0.0..> | 2023-10-09 08:34 | 29K | |
| p5-Crypt-License-2.0..> | 2023-10-08 19:34 | 21K | |
| p5-Crypt-Lite-0.82.1..> | 2023-10-08 19:50 | 7.0K | |
| p5-Crypt-Loki97-1.0...> | 2023-10-14 11:20 | 13K | |
| p5-Crypt-MySQL-0.04_..> | 2023-10-06 15:33 | 6.5K | |
| p5-Crypt-NULL-1.02_1..> | 2023-10-14 11:06 | 3.3K | |
| p5-Crypt-OFB-0.01_1.pkg | 2023-10-10 05:36 | 4.3K | |
| p5-Crypt-OICQ-1.1_1.pkg | 2023-10-08 07:09 | 3.4K | |
| p5-Crypt-OTP-2.00_1.pkg | 2023-10-09 13:23 | 5.4K | |
| p5-Crypt-OpenPGP-1.1..> | 2023-10-07 01:21 | 123K | |
| p5-Crypt-OpenSSL-AES..> | 2023-10-08 02:16 | 8.4K | |
| p5-Crypt-OpenSSL-Big..> | 2023-10-06 15:04 | 21K | |
| p5-Crypt-OpenSSL-CA-..> | 2023-10-08 18:11 | 84K | |
| p5-Crypt-OpenSSL-DSA..> | 2023-10-07 03:08 | 17K | |
| p5-Crypt-OpenSSL-EC-..> | 2023-10-07 18:49 | 38K | |
| p5-Crypt-OpenSSL-ECD..> | 2023-10-10 04:51 | 9.6K | |
| p5-Crypt-OpenSSL-Gue..> | 2023-10-05 17:01 | 5.7K | |
| p5-Crypt-OpenSSL-PKC..> | 2023-10-07 21:09 | 15K | |
| p5-Crypt-OpenSSL-RSA..> | 2023-10-06 16:07 | 20K | |
| p5-Crypt-OpenSSL-Ran..> | 2023-10-06 14:46 | 7.1K | |
| p5-Crypt-OpenSSL-Ver..> | 2023-10-08 08:06 | 10K | |
| p5-Crypt-OpenSSL-X50..> | 2023-10-07 03:31 | 26K | |
| p5-Crypt-PBKDF2-0.16..> | 2023-10-05 17:00 | 18K | |
| p5-Crypt-PKCS10-2.00..> | 2023-10-07 19:41 | 32K | |
| p5-Crypt-PWSafe3-1.2..> | 2023-10-07 15:54 | 40K | |
| p5-Crypt-PassGen-0.0..> | 2023-10-11 11:01 | 24K | |
| p5-Crypt-Passwd-XS-0..> | 2023-10-14 07:18 | 21K | |
| p5-Crypt-PasswdMD5-1..> | 2023-10-06 15:15 | 5.1K | |
| p5-Crypt-Password-Ut..> | 2023-10-07 19:42 | 7.5K | |
| p5-Crypt-Perl-0.34.pkg | 2023-10-07 02:49 | 135K | |
| p5-Crypt-Primes-0.50..> | 2023-10-06 17:16 | 20K | |
| p5-Crypt-RC4-2.02_1.pkg | 2023-10-05 17:04 | 5.4K | |
| p5-Crypt-RC5-2.00_1.pkg | 2023-10-08 15:26 | 3.8K | |
| p5-Crypt-RC6-1.0_1.pkg | 2023-10-07 04:28 | 7.8K | |
| p5-Crypt-RHash-1.00.pkg | 2023-10-07 04:18 | 130K | |
| p5-Crypt-RIPEMD160-0..> | 2023-10-06 21:47 | 16K | |
| p5-Crypt-RSA-1.99_2.pkg | 2023-10-06 21:44 | 51K | |
| p5-Crypt-RSA-Parse-0..> | 2023-10-07 01:05 | 6.0K | |
| p5-Crypt-RSA-Yandex-..> | 2023-10-10 21:11 | 26K | |
| p5-Crypt-Rabbit-1.0...> | 2023-10-14 09:23 | 8.9K | |
| p5-Crypt-RandPasswd-..> | 2023-10-07 06:26 | 18K | |
| p5-Crypt-Random-1.54..> | 2023-10-06 13:45 | 8.6K | |
| p5-Crypt-Random-Seed..> | 2023-10-06 19:54 | 17K | |
| p5-Crypt-Random-Sour..> | 2023-10-07 04:48 | 28K | |
| p5-Crypt-Random-TESH..> | 2023-10-06 16:04 | 14K | |
| p5-Crypt-Rijndael-1...> | 2023-10-05 17:02 | 16K | |
| p5-Crypt-Rijndael_PP..> | 2023-10-08 09:27 | 23K | |
| p5-Crypt-SKey-0.10_3..> | 2023-10-08 14:23 | 10K | |
| p5-Crypt-SMIME-0.28.pkg | 2023-10-08 04:12 | 25K | |
| p5-Crypt-SSLeay-0.72..> | 2023-10-06 19:13 | 35K | |
| p5-Crypt-SSSS-0.3.pkg | 2023-10-09 16:32 | 5.2K | |
| p5-Crypt-Salt-0.01_1..> | 2023-10-08 15:49 | 3.2K | |
| p5-Crypt-SaltedHash-..> | 2023-10-06 21:46 | 10K | |
| p5-Crypt-Serpent-1.0..> | 2023-10-11 00:40 | 14K | |
| p5-Crypt-Shark-1.0.1..> | 2023-10-10 02:35 | 44K | |
| p5-Crypt-Simple-0.06..> | 2023-10-09 03:50 | 5.9K | |
| p5-Crypt-SmbHash-0.1..> | 2023-10-08 05:07 | 9.4K | |
| p5-Crypt-Sodium-0.11..> | 2023-10-09 20:34 | 13K | |
| p5-Crypt-Solitaire-2..> | 2023-10-10 19:52 | 5.9K | |
| p5-Crypt-TEA-1.26.pkg | 2023-10-07 10:10 | 8.1K | |
| p5-Crypt-T_e_a-2.12_..> | 2023-10-14 07:14 | 17K | |
| p5-Crypt-Tea_JS-2.23..> | 2023-10-14 05:13 | 23K | |
| p5-Crypt-TripleDES-0..> | 2023-10-09 16:39 | 6.7K | |
| p5-Crypt-Twofish-2.1..> | 2023-10-06 19:39 | 14K | |
| p5-Crypt-Twofish2-1...> | 2023-10-07 16:43 | 13K | |
| p5-Crypt-Twofish_PP-..> | 2023-10-08 21:26 | 23K | |
| p5-Crypt-URandom-0.3..> | 2023-10-06 16:22 | 7.5K | |
| p5-Crypt-UnixCrypt-1..> | 2023-10-07 02:17 | 8.4K | |
| p5-Crypt-UnixCrypt_X..> | 2023-10-05 17:12 | 14K | |
| p5-Crypt-X509-0.55.pkg | 2023-10-07 20:04 | 17K | |
| p5-Crypt-X509-CRL-0...> | 2023-10-08 07:31 | 13K | |
| p5-Crypt-XTEA-0.0108..> | 2023-10-09 13:37 | 7.8K | |
| p5-Crypt-xDBM_File-1..> | 2023-10-09 15:06 | 4.6K | |
| p5-CryptX-0.078.pkg | 2023-10-05 17:01 | 594K | |
| p5-Cstools-3.44.pkg | 2023-10-10 10:34 | 33K | |
| p5-Curses-1.44.pkg | 2023-10-05 17:02 | 81K | |
| p5-Curses-Applicatio..> | 2023-10-09 10:01 | 11K | |
| p5-Curses-Forms-1.99..> | 2023-10-07 17:01 | 22K | |
| p5-Curses-UI-0.9609_..> | 2023-10-08 11:55 | 167K | |
| p5-Curses-Widgets-1...> | 2023-10-07 07:14 | 65K | |
| p5-Cvs-0.07_2.pkg | 2023-10-09 23:24 | 60K | |
| p5-Cwd-Guard-0.05.pkg | 2023-10-11 08:38 | 3.8K | |
| p5-DBD-AnyData-0.110..> | 2023-10-09 11:49 | 29K | |
| p5-DBD-CSV-0.60,1.pkg | 2023-10-07 20:54 | 28K | |
| p5-DBD-Excel-0.06_1.pkg | 2023-10-09 20:35 | 19K | |
| p5-DBD-Google-0.51_2..> | 2023-10-09 04:29 | 19K | |
| p5-DBD-InterBase-0.4..> | 2023-10-09 03:29 | 67K | |
| p5-DBD-LDAP-1.00.pkg | 2023-10-10 17:29 | 28K | |
| p5-DBD-MariaDB-1.21.pkg | 2023-10-10 04:34 | 97K | |
| p5-DBD-Mock-1.59_1.pkg | 2023-10-08 04:49 | 42K | |
| p5-DBD-Multi-0.16_1.pkg | 2023-10-14 12:32 | 10K | |
| p5-DBD-ODBC-1.61.pkg | 2023-10-10 03:56 | 160K | |
| p5-DBD-Pg-3.17.0.pkg | 2023-10-07 00:51 | 172K | |
| p5-DBD-PgLite-0.11_2..> | 2023-10-14 03:35 | 35K | |
| p5-DBD-PgPP-0.08_1.pkg | 2023-10-10 04:47 | 18K | |
| p5-DBD-SQLite-1.72.pkg | 2023-10-06 19:53 | 2.4M | |
| p5-DBD-SQLite2-0.38.pkg | 2023-10-10 05:04 | 162K | |
| p5-DBD-Sybase-1.23.pkg | 2023-10-10 12:19 | 90K | |
| p5-DBD-XBase-1.08.pkg | 2023-10-10 17:07 | 78K | |
| p5-DBD-cego-1.5.3.pkg | 2023-10-09 15:49 | 25K | |
| p5-DBD-mysql-4.050_1..> | 2023-10-07 08:52 | 93K | |
| p5-DBI-1.643.pkg | 2023-10-05 17:02 | 699K | |
| p5-DBI-Shell-11.97.pkg | 2023-10-07 11:03 | 47K | |
| p5-DBICx-Deploy-0.02..> | 2023-10-09 14:59 | 6.8K | |
| p5-DBICx-MapMaker-0...> | 2023-10-14 18:34 | 5.5K | |
| p5-DBICx-Sugar-0.020..> | 2023-10-06 19:29 | 8.4K | |
| p5-DBICx-TestDatabas..> | 2023-10-07 16:27 | 6.3K | |
| p5-DBICx-TxnInsert-0..> | 2023-10-14 11:02 | 3.8K | |
| p5-DBIWrapper-0.30_1..> | 2023-10-10 17:15 | 48K | |
| p5-DBIx-Abstract-1.0..> | 2023-10-09 01:29 | 18K | |
| p5-DBIx-Admin-Create..> | 2023-10-07 00:27 | 12K | |
| p5-DBIx-Admin-DSNMan..> | 2023-10-07 03:05 | 10K | |
| p5-DBIx-Admin-TableI..> | 2023-10-08 05:47 | 17K | |
| p5-DBIx-AnyDBD-2.03.pkg | 2023-10-08 10:12 | 10K | |
| p5-DBIx-Browse-2.09_..> | 2023-10-09 11:11 | 18K | |
| p5-DBIx-Class-0.0828..> | 2023-10-06 14:52 | 690K | |
| p5-DBIx-Class-AsFdat..> | 2023-10-10 21:08 | 3.0K | |
| p5-DBIx-Class-AuditL..> | 2023-10-10 01:17 | 27K | |
| p5-DBIx-Class-BitFie..> | 2023-10-11 01:29 | 8.2K | |
| p5-DBIx-Class-Candy-..> | 2023-10-07 04:58 | 15K | |
| p5-DBIx-Class-Cursor..> | 2023-10-06 21:54 | 3.7K | |
| p5-DBIx-Class-Custom..> | 2023-10-10 03:22 | 7.0K | |
| p5-DBIx-Class-DateTi..> | 2023-10-08 03:23 | 4.7K | |
| p5-DBIx-Class-Deploy..> | 2023-10-07 12:19 | 93K | |
| p5-DBIx-Class-Digest..> | 2023-10-09 21:37 | 7.6K | |
| p5-DBIx-Class-Dynami..> | 2023-10-06 16:23 | 4.2K | |
| p5-DBIx-Class-Dynami..> | 2023-10-08 12:18 | 5.2K | |
| p5-DBIx-Class-Encode..> | 2023-10-14 08:45 | 3.8K | |
| p5-DBIx-Class-Encode..> | 2023-10-08 00:06 | 23K | |
| p5-DBIx-Class-Fixtur..> | 2023-10-08 08:10 | 24K | |
| p5-DBIx-Class-Frozen..> | 2023-10-10 17:44 | 7.7K | |
| p5-DBIx-Class-Helper..> | 2023-10-08 00:29 | 159K | |
| p5-DBIx-Class-Inflat..> | 2023-10-06 22:32 | 4.3K | |
| p5-DBIx-Class-Inflat..> | 2023-10-08 12:02 | 7.7K | |
| p5-DBIx-Class-Inflat..> | 2023-10-09 16:02 | 5.1K | |
| p5-DBIx-Class-Inflat..> | 2023-10-08 11:07 | 10K | |
| p5-DBIx-Class-Intros..> | 2023-10-07 02:05 | 4.6K | |
| p5-DBIx-Class-Loader..> | 2023-10-14 09:23 | 19K | |
| p5-DBIx-Class-Migrat..> | 2023-10-14 16:52 | 241K | |
| p5-DBIx-Class-MooseC..> | 2023-10-09 17:03 | 11K | |
| p5-DBIx-Class-Passph..> | 2023-10-06 22:14 | 6.8K | |
| p5-DBIx-Class-QueryL..> | 2023-10-08 21:08 | 16K | |
| p5-DBIx-Class-QueryP..> | 2023-10-10 03:55 | 4.3K | |
| p5-DBIx-Class-Result..> | 2023-10-09 08:57 | 4.0K | |
| p5-DBIx-Class-Result..> | 2023-10-07 20:57 | 16K | |
| p5-DBIx-Class-Schema..> | 2023-10-06 22:54 | 8.6K | |
| p5-DBIx-Class-Schema..> | 2023-10-06 19:24 | 154K | |
| p5-DBIx-Class-Schema..> | 2023-10-08 11:39 | 43K | |
| p5-DBIx-Class-Storag..> | 2023-10-10 08:05 | 6.9K | |
| p5-DBIx-Class-TimeSt..> | 2023-10-07 10:00 | 3.8K | |
| p5-DBIx-Class-Tree-0..> | 2023-10-06 22:39 | 13K | |
| p5-DBIx-Class-Tree-N..> | 2023-10-10 22:31 | 15K | |
| p5-DBIx-Class-UUIDCo..> | 2023-10-08 05:35 | 19K | |
| p5-DBIx-Class-Virtua..> | 2023-10-07 23:04 | 6.9K | |
| p5-DBIx-Class-WebFor..> | 2023-10-08 23:45 | 4.4K | |
| p5-DBIx-Connector-0...> | 2023-10-06 21:06 | 34K | |
| p5-DBIx-ContextualFe..> | 2023-10-05 17:11 | 5.3K | |
| p5-DBIx-Custom-0.400..> | 2023-10-08 14:28 | 49K | |
| p5-DBIx-DBHResolver-..> | 2023-10-08 03:10 | 19K | |
| p5-DBIx-DBSchema-0.4..> | 2023-10-06 20:52 | 52K | |
| p5-DBIx-DataSource-0..> | 2023-10-10 21:40 | 9.5K | |
| p5-DBIx-DisconnectAl..> | 2023-10-07 09:44 | 3.5K | |
| p5-DBIx-Dump-0.04_2.pkg | 2023-10-11 08:34 | 4.2K | |
| p5-DBIx-HA-1.1_1.pkg | 2023-10-14 11:49 | 17K | |
| p5-DBIx-Handler-0.15..> | 2023-10-08 05:36 | 7.6K | |
| p5-DBIx-Inspector-0...> | 2023-10-08 06:21 | 16K | |
| p5-DBIx-Introspector..> | 2023-10-07 06:17 | 14K | |
| p5-DBIx-Lite-0.33.pkg | 2023-10-09 08:58 | 32K | |
| p5-DBIx-Log4perl-0.2..> | 2023-10-08 20:30 | 25K | |
| p5-DBIx-MySQLSequenc..> | 2023-10-14 18:59 | 12K | |
| p5-DBIx-NoSQL-0.0021..> | 2023-10-09 01:48 | 26K | |
| p5-DBIx-Password-1.9..> | 2023-10-14 18:40 | 4.2K | |
| p5-DBIx-Perlish-1.06..> | 2023-10-09 20:12 | 48K | |
| p5-DBIx-QueryLog-0.4..> | 2023-10-10 06:46 | 10K | |
| p5-DBIx-QuickDB-0.00..> | 2023-10-07 11:32 | 54K | |
| p5-DBIx-Recordset-0...> | 2023-10-14 13:22 | 94K | |
| p5-DBIx-RetryOverDis..> | 2023-10-08 17:24 | 8.6K | |
| p5-DBIx-SQLEngine-0...> | 2023-10-08 22:08 | 245K | |
| p5-DBIx-SQLite-Simpl..> | 2023-10-08 05:54 | 8.8K | |
| p5-DBIx-Safe-1.2.5_3..> | 2023-10-07 19:39 | 9.8K | |
| p5-DBIx-SearchBuilde..> | 2023-10-07 02:44 | 95K | |
| p5-DBIx-Sequence-1.5..> | 2023-10-14 08:24 | 11K | |
| p5-DBIx-Simple-1.37.pkg | 2023-10-07 11:08 | 30K | |
| p5-DBIx-Skinny-0.074..> | 2023-10-08 06:26 | 63K | |
| p5-DBIx-Skinny-Infla..> | 2023-10-09 22:00 | 6.5K | |
| p5-DBIx-Skinny-Mixin..> | 2023-10-09 16:12 | 2.8K | |
| p5-DBIx-Skinny-Pager..> | 2023-10-10 07:58 | 15K | |
| p5-DBIx-Skinny-Schem..> | 2023-10-09 02:11 | 8.4K | |
| p5-DBIx-Sunny-0.9992..> | 2023-10-10 19:39 | 14K | |
| p5-DBIx-TableHash-1...> | 2023-10-09 00:59 | 21K | |
| p5-DBIx-Tracer-0.03.pkg | 2023-10-08 07:50 | 5.7K | |
| p5-DBIx-TransactionM..> | 2023-10-07 01:03 | 7.4K | |
| p5-DBIx-Tree-1.98.pkg | 2023-10-08 22:14 | 12K | |
| p5-DBIx-VersionedDDL..> | 2023-10-09 14:22 | 14K | |
| p5-DBIx-Wrapper-0.29..> | 2023-10-08 17:17 | 42K | |
| p5-DBIx-XHTML_Table-..> | 2023-10-08 18:56 | 27K | |
| p5-DBIx-XML_RDB-0.05..> | 2023-10-09 14:10 | 8.1K | |
| p5-DBM-Deep-2.0016.pkg | 2023-10-07 09:11 | 92K | |
| p5-DB_File-Lock-0.05..> | 2023-10-09 17:41 | 8.3K | |
| p5-DJabberd-0.85_2.pkg | 2023-10-09 12:21 | 112K | |
| p5-DNS-Config-0.66_1..> | 2023-10-10 09:33 | 12K | |
| p5-DNS-EasyDNS-0.04_..> | 2023-10-09 14:41 | 7.5K | |
| p5-DNS-Zone-0.85_1.pkg | 2023-10-14 08:55 | 7.5K | |
| p5-DNS-ZoneParse-1.1..> | 2023-10-10 19:29 | 17K | |
| p5-DNS-ldns-1.8.3.pkg | 2023-10-10 00:21 | 120K | |
| p5-DNS-nsdiff-1.82_1..> | 2023-10-08 16:56 | 23K | |
| p5-DR-Tarantool-0.44..> | 2023-10-08 09:54 | 75K | |
| p5-DSC-2.04.pkg | 2023-10-07 21:50 | 24K | |
| p5-DWH_File-0.24_2.pkg | 2023-10-08 20:47 | 46K | |
| p5-Daemon-Control-0...> | 2023-10-08 07:40 | 17K | |
| p5-Daemon-Generic-0...> | 2023-10-08 20:04 | 20K | |
| p5-Dancer-1.3520.pkg | 2023-10-06 21:52 | 382K | |
| p5-Dancer-Debug-0.03..> | 2023-10-10 05:52 | 11K | |
| p5-Dancer-Logger-Log..> | 2023-10-08 12:56 | 7.4K | |
| p5-Dancer-Logger-Sys..> | 2023-10-08 23:17 | 4.8K | |
| p5-Dancer-Plugin-Aut..> | 2023-10-08 00:48 | 27K | |
| p5-Dancer-Plugin-Aut..> | 2023-10-08 17:45 | 6.6K | |
| p5-Dancer-Plugin-COR..> | 2023-10-10 17:07 | 10K | |
| p5-Dancer-Plugin-DBI..> | 2023-10-07 13:18 | 7.5K | |
| p5-Dancer-Plugin-Dat..> | 2023-10-10 09:25 | 12K | |
| p5-Dancer-Plugin-Dat..> | 2023-10-07 06:58 | 20K | |
| p5-Dancer-Plugin-Ema..> | 2023-10-10 07:39 | 8.1K | |
| p5-Dancer-Plugin-Ext..> | 2023-10-08 12:40 | 5.7K | |
| p5-Dancer-Plugin-Fee..> | 2023-10-09 11:14 | 5.2K | |
| p5-Dancer-Plugin-Fla..> | 2023-10-09 08:26 | 5.5K | |
| p5-Dancer-Plugin-Lex..> | 2023-10-08 16:49 | 9.2K | |
| p5-Dancer-Plugin-Mem..> | 2023-10-12 11:46 | 5.1K | |
| p5-Dancer-Plugin-Pas..> | 2023-10-08 03:13 | 15K | |
| p5-Dancer-Plugin-RES..> | 2023-10-07 01:18 | 6.6K | |
| p5-Dancer-Plugin-RPC..> | 2023-10-09 17:57 | 40K | |
| p5-Dancer-Plugin-Red..> | 2023-10-12 03:52 | 5.5K | |
| p5-Dancer-Plugin-Sit..> | 2023-10-14 13:19 | 7.9K | |
| p5-Dancer-Plugin-Swa..> | 2023-10-08 08:31 | 776K | |
| p5-Dancer-Plugin-Val..> | 2023-10-14 05:22 | 4.1K | |
| p5-Dancer-Session-Co..> | 2023-10-08 07:24 | 6.7K | |
| p5-Dancer-Session-Me..> | 2023-10-14 12:32 | 3.7K | |
| p5-Dancer-Template-X..> | 2023-10-14 12:20 | 4.9K | |
| p5-Dancer2-0.400001.pkg | 2023-10-06 19:26 | 427K | |
| p5-Dancer2-Plugin-Aj..> | 2023-10-14 03:35 | 4.1K | |
| p5-Dancer2-Plugin-Au..> | 2023-10-07 07:26 | 54K | |
| p5-Dancer2-Plugin-Au..> | 2023-10-07 15:15 | 11K | |
| p5-Dancer2-Plugin-Au..> | 2023-10-09 17:29 | 13K | |
| p5-Dancer2-Plugin-Au..> | 2023-10-09 13:42 | 5.7K | |
| p5-Dancer2-Plugin-Au..> | 2023-10-09 07:24 | 7.0K | |
| p5-Dancer2-Plugin-DB..> | 2023-10-07 02:51 | 6.7K | |
| p5-Dancer2-Plugin-Da..> | 2023-10-08 00:37 | 13K | |
| p5-Dancer2-Plugin-De..> | 2023-10-07 22:37 | 5.9K | |
| p5-Dancer2-Plugin-Em..> | 2023-10-09 16:12 | 7.9K | |
| p5-Dancer2-Plugin-Fo..> | 2023-10-08 18:37 | 17K | |
| p5-Dancer2-Plugin-In..> | 2023-10-09 12:26 | 32K | |
| p5-Dancer2-Plugin-Pa..> | 2023-10-08 03:55 | 19K | |
| p5-Dancer2-Plugin-Pa..> | 2023-10-09 19:00 | 4.5K | |
| p5-Dancer2-Session-D..> | 2023-10-07 23:38 | 14K | |
| p5-Danga-Socket-1.62..> | 2023-10-06 23:09 | 18K | |
| p5-Danga-Socket-Call..> | 2023-10-07 07:34 | 4.9K | |
| p5-Data-ACL-0.02_1.pkg | 2023-10-09 09:26 | 4.2K | |
| p5-Data-AMF-0.09_1.pkg | 2023-10-07 10:15 | 31K | |
| p5-Data-Alias-1.28.pkg | 2023-10-07 14:57 | 30K | |
| p5-Data-Binary-0.01.pkg | 2023-10-07 01:52 | 3.4K | |
| p5-Data-Bind-0.30_2.pkg | 2023-10-08 06:58 | 12K | |
| p5-Data-Buffer-0.04_..> | 2023-10-06 18:23 | 8.7K | |
| p5-Data-Capture-0.27..> | 2023-10-07 07:01 | 3.0K | |
| p5-Data-ClearSilver-..> | 2023-10-09 14:52 | 6.7K | |
| p5-Data-Clone-0.004_..> | 2023-10-06 21:36 | 10K | |
| p5-Data-Compare-1.22..> | 2023-10-05 17:02 | 15K | |
| p5-Data-Currency-0.0..> | 2023-10-14 10:04 | 7.1K | |
| p5-Data-Diver-1.0101..> | 2023-10-11 00:44 | 11K | |
| p5-Data-Dmp-0.242.pkg | 2023-10-05 17:06 | 11K | |
| p5-Data-Domain-1.12.pkg | 2023-10-08 08:17 | 37K | |
| p5-Data-Dump-1.25.pkg | 2023-10-06 14:02 | 22K | |
| p5-Data-Dump-Color-0..> | 2023-10-14 19:03 | 202K | |
| p5-Data-Dump-Streame..> | 2023-10-06 18:02 | 62K | |
| p5-Data-DumpXML-1.06..> | 2023-10-14 12:08 | 10K | |
| p5-Data-Dumper-2.183..> | 2023-10-07 21:16 | 38K | |
| p5-Data-Dumper-Conci..> | 2023-10-05 17:07 | 12K | |
| p5-Data-Dumper-Inter..> | 2023-10-14 09:13 | 36K | |
| p5-Data-Dumper-Perlt..> | 2023-10-10 00:38 | 5.8K | |
| p5-Data-Dumper-Simpl..> | 2023-10-08 11:23 | 9.7K | |
| p5-Data-Entropy-0.00..> | 2023-10-06 15:25 | 38K | |
| p5-Data-Float-0.013.pkg | 2023-10-05 17:01 | 22K | |
| p5-Data-Flow-1.02_1.pkg | 2023-10-07 19:41 | 7.2K | |
| p5-Data-FormValidato..> | 2023-10-07 08:42 | 71K | |
| p5-Data-FormValidato..> | 2023-10-10 19:48 | 11K | |
| p5-Data-GUID-0.051.pkg | 2023-10-06 16:01 | 7.6K | |
| p5-Data-Google-Visua..> | 2023-10-10 19:46 | 13K | |
| p5-Data-Google-Visua..> | 2023-10-07 21:18 | 15K | |
| p5-Data-Grouper-0.06..> | 2023-10-09 06:45 | 13K | |
| p5-Data-HashArray-1...> | 2023-10-08 07:31 | 8.9K | |
| p5-Data-HexDump-0.04..> | 2023-10-07 06:18 | 6.1K | |
| p5-Data-HexDump-Rang..> | 2023-10-08 05:39 | 46K | |
| p5-Data-Hexdumper-3...> | 2023-10-11 10:15 | 10K | |
| p5-Data-Hexify-1.00_..> | 2023-10-14 14:37 | 6.2K | |
| p5-Data-Hierarchy-0...> | 2023-10-07 05:24 | 9.2K | |
| p5-Data-ICal-0.24.pkg | 2023-10-07 07:36 | 53K | |
| p5-Data-ICal-DateTim..> | 2023-10-10 09:07 | 9.4K | |
| p5-Data-IEEE754-0.02..> | 2023-10-07 03:36 | 4.1K | |
| p5-Data-IPV4-Range-P..> | 2023-10-07 19:30 | 5.6K | |
| p5-Data-Inherited-1...> | 2023-10-07 09:38 | 5.7K | |
| p5-Data-Inspect-0.04..> | 2023-10-07 06:09 | 7.8K | |
| p5-Data-Integer-0.00..> | 2023-10-05 17:04 | 17K | |
| p5-Data-JavaScript-1..> | 2023-10-14 14:59 | 7.2K | |
| p5-Data-JavaScript-A..> | 2023-10-11 15:51 | 9.0K | |
| p5-Data-Lazy-0.6_1.pkg | 2023-10-06 21:37 | 10K | |
| p5-Data-Localize-0.0..> | 2023-10-10 09:20 | 54K | |
| p5-Data-Lock-1.03.pkg | 2023-10-09 09:27 | 9.0K | |
| p5-Data-MessagePack-..> | 2023-10-06 18:08 | 24K | |
| p5-Data-MessagePack-..> | 2023-10-07 01:21 | 8.1K | |
| p5-Data-Miscellany-1..> | 2023-10-06 21:20 | 8.5K | |
| p5-Data-Model-0.0000..> | 2023-10-08 16:15 | 74K | |
| p5-Data-Munge-0.100.pkg | 2023-10-06 15:35 | 10K | |
| p5-Data-Object-2.05.pkg | 2023-10-09 14:22 | 75K | |
| p5-Data-Object-Args-..> | 2023-10-08 15:51 | 5.0K | |
| p5-Data-Object-Attri..> | 2023-10-07 00:04 | 7.2K | |
| p5-Data-Object-Cast-..> | 2023-10-07 07:37 | 5.4K | |
| p5-Data-Object-Class..> | 2023-10-07 01:21 | 3.6K | |
| p5-Data-Object-Class..> | 2023-10-08 09:22 | 2.9K | |
| p5-Data-Object-Data-..> | 2023-10-09 18:05 | 6.5K | |
| p5-Data-Object-Excep..> | 2023-10-07 05:09 | 4.7K | |
| p5-Data-Object-Kind-..> | 2023-10-07 12:58 | 3.7K | |
| p5-Data-Object-Name-..> | 2023-10-06 18:11 | 4.7K | |
| p5-Data-Object-Opts-..> | 2023-10-14 16:31 | 5.5K | |
| p5-Data-Object-Plugi..> | 2023-10-07 16:38 | 3.2K | |
| p5-Data-Object-Role-..> | 2023-10-08 11:19 | 3.7K | |
| p5-Data-Object-Role-..> | 2023-10-10 22:07 | 4.3K | |
| p5-Data-Object-Role-..> | 2023-10-07 14:19 | 4.0K | |
| p5-Data-Object-Role-..> | 2023-10-07 21:16 | 4.0K | |
| p5-Data-Object-Role-..> | 2023-10-09 18:34 | 4.4K | |
| p5-Data-Object-Role-..> | 2023-10-09 17:55 | 4.6K | |
| p5-Data-Object-Role-..> | 2023-10-07 19:21 | 3.4K | |
| p5-Data-Object-Role-..> | 2023-10-14 12:18 | 3.6K | |
| p5-Data-Object-Role-..> | 2023-10-07 23:40 | 3.8K | |
| p5-Data-Object-Role-..> | 2023-10-08 01:49 | 3.5K | |
| p5-Data-Object-Role-..> | 2023-10-08 03:16 | 3.5K | |
| p5-Data-Object-Role-..> | 2023-10-07 10:43 | 3.8K | |
| p5-Data-Object-RoleH..> | 2023-10-07 19:21 | 2.9K | |
| p5-Data-Object-Space..> | 2023-10-06 20:43 | 14K | |
| p5-Data-Object-State..> | 2023-10-14 07:02 | 4.1K | |
| p5-Data-Object-Struc..> | 2023-10-09 14:13 | 3.4K | |
| p5-Data-Object-Try-2..> | 2023-10-07 08:06 | 6.4K | |
| p5-Data-Object-Types..> | 2023-10-07 07:25 | 19K | |
| p5-Data-Object-Vars-..> | 2023-10-10 05:36 | 4.8K | |
| p5-Data-ObjectDriver..> | 2023-10-07 01:56 | 112K | |
| p5-Data-OptList-0.11..> | 2023-10-05 16:48 | 7.3K | |
| p5-Data-Page-2.03.pkg | 2023-10-06 23:07 | 6.3K | |
| p5-Data-Page-NoTotal..> | 2023-10-08 05:25 | 3.9K | |
| p5-Data-Page-Pageset..> | 2023-10-07 01:51 | 6.0K | |
| p5-Data-Pageset-1.06..> | 2023-10-11 11:42 | 6.8K | |
| p5-Data-ParseBinary-..> | 2023-10-08 21:40 | 60K | |
| p5-Data-Password-1.1..> | 2023-10-07 12:20 | 6.1K | |
| p5-Data-Path-1.4.1_1..> | 2023-10-08 18:25 | 4.8K | |
| p5-Data-Peek-0.52.pkg | 2023-10-10 09:43 | 19K | |
| p5-Data-Perl-0.00201..> | 2023-10-06 14:12 | 38K | |
| p5-Data-Phrasebook-0..> | 2023-10-07 04:11 | 35K | |
| p5-Data-Phrasebook-L..> | 2023-10-07 22:43 | 7.9K | |
| p5-Data-Printer-1.00..> | 2023-10-07 07:00 | 116K | |
| p5-Data-Properties-1..> | 2023-10-09 15:49 | 7.7K | |
| p5-Data-Rand-0.0.4_1..> | 2023-10-08 04:25 | 11K | |
| p5-Data-Rand-Obscure..> | 2023-10-07 10:30 | 9.3K | |
| p5-Data-Random-0.13.pkg | 2023-10-07 07:21 | 122K | |
| p5-Data-Range-Compar..> | 2023-10-07 10:05 | 29K | |
| p5-Data-Record-0.02_..> | 2023-10-06 22:31 | 8.9K | |
| p5-Data-Recursive-En..> | 2023-10-10 16:22 | 5.1K | |
| p5-Data-Remember-0.1..> | 2023-10-08 22:41 | 35K | |
| p5-Data-Report-1.001..> | 2023-10-14 08:28 | 21K | |
| p5-Data-Rmap-0.65.pkg | 2023-10-06 15:12 | 12K | |
| p5-Data-RoundRobin-0..> | 2023-10-10 05:36 | 3.4K | |
| p5-Data-Rx-0.200008.pkg | 2023-10-11 18:20 | 41K | |
| p5-Data-SExpression-..> | 2023-10-07 15:25 | 15K | |
| p5-Data-Sah-Normaliz..> | 2023-10-06 16:17 | 5.6K | |
| p5-Data-Section-0.20..> | 2023-10-06 19:14 | 9.3K | |
| p5-Data-Section-Simp..> | 2023-10-07 06:44 | 4.8K | |
| p5-Data-Serializable..> | 2023-10-10 15:14 | 7.0K | |
| p5-Data-Serializer-0..> | 2023-10-06 20:15 | 56K | |
| p5-Data-Serializer-S..> | 2023-10-09 23:41 | 3.8K | |
| p5-Data-ShowTable-4...> | 2023-10-07 21:16 | 45K | |
| p5-Data-SpreadPagina..> | 2023-10-08 22:59 | 6.3K | |
| p5-Data-Stag-0.14_2.pkg | 2023-10-06 14:57 | 131K | |
| p5-Data-Stream-Bulk-..> | 2023-10-06 17:41 | 33K | |
| p5-Data-Structure-Ut..> | 2023-10-07 09:30 | 18K | |
| p5-Data-Swap-0.08_1.pkg | 2023-10-07 20:57 | 7.9K | |
| p5-Data-Table-1.78.pkg | 2023-10-14 08:31 | 53K | |
| p5-Data-Taxonomy-Tag..> | 2023-10-09 14:20 | 8.7K | |
| p5-Data-TemporaryBag..> | 2023-10-06 19:59 | 5.8K | |
| p5-Data-Throttler-0...> | 2023-10-06 21:21 | 10K | |
| p5-Data-Throttler-Me..> | 2023-10-07 09:43 | 6.6K | |
| p5-Data-Thunk-0.07_1..> | 2023-10-14 10:56 | 11K | |
| p5-Data-TreeDumper-0..> | 2023-10-06 21:32 | 32K | |
| p5-Data-TreeDumper-R..> | 2023-10-10 16:36 | 8.6K | |
| p5-Data-Types-0.17.pkg | 2023-10-07 02:11 | 8.9K | |
| p5-Data-URIEncode-0...> | 2023-10-14 10:04 | 10K | |
| p5-Data-UUID-1.226.pkg | 2023-10-06 14:26 | 13K | |
| p5-Data-Uniqid-0.12_..> | 2023-10-07 23:05 | 3.7K | |
| p5-Data-Unixish-1.57..> | 2023-10-07 23:55 | 124K | |
| p5-Data-Util-0.67.pkg | 2023-10-06 23:57 | 49K | |
| p5-Data-Validate-0.0..> | 2023-10-14 07:30 | 9.1K | |
| p5-Data-Validate-Dom..> | 2023-10-08 01:06 | 8.8K | |
| p5-Data-Validate-Ema..> | 2023-10-11 03:39 | 7.0K | |
| p5-Data-Validate-IP-..> | 2023-10-07 08:53 | 10K | |
| p5-Data-Validate-URI..> | 2023-10-10 10:24 | 9.0K | |
| p5-Data-Validator-1...> | 2023-10-08 05:27 | 24K | |
| p5-Data-Visitor-0.32..> | 2023-10-06 15:09 | 16K | |
| p5-Data-Visitor-Enco..> | 2023-10-08 12:05 | 5.9K | |
| p5-Data-Visitor-Tiny..> | 2023-10-07 23:52 | 5.1K | |
| p5-Data-Walk-2.01.pkg | 2023-10-09 06:30 | 10K | |
| p5-DataStruct-Flat-0..> | 2023-10-07 19:25 | 3.3K | |
| p5-Date-Business-1.2..> | 2023-10-08 18:52 | 7.5K | |
| p5-Date-Calc-6.4.pkg | 2023-10-06 15:37 | 164K | |
| p5-Date-Calc-Iterato..> | 2023-10-10 20:13 | 6.0K | |
| p5-Date-Calc-XS-6.4.pkg | 2023-10-09 18:33 | 40K | |
| p5-Date-Chinese-1.12..> | 2023-10-10 14:11 | 4.8K | |
| p5-Date-DayOfWeek-1...> | 2023-10-08 15:11 | 15K | |
| p5-Date-Easter-1.22.pkg | 2023-10-07 23:43 | 5.0K | |
| p5-Date-Extract-0.07..> | 2023-10-07 06:01 | 8.4K | |
| p5-Date-EzDate-1.16.pkg | 2023-10-09 13:45 | 35K | |
| p5-Date-Handler-1.2_..> | 2023-10-09 08:24 | 32K | |
| p5-Date-Holidays-DK-..> | 2023-10-09 11:13 | 4.0K | |
| p5-Date-ICal-2.682.pkg | 2023-10-08 00:26 | 23K | |
| p5-Date-ISO-1.31_1.pkg | 2023-10-14 11:22 | 6.8K | |
| p5-Date-Leapyear-1.7..> | 2023-10-07 07:07 | 2.6K | |
| p5-Date-Manip-6.92.pkg | 2023-10-06 13:58 | 888K | |
| p5-Date-Pcalc-6.1_1.pkg | 2023-10-07 22:22 | 187K | |
| p5-Date-Piece-0.0.3_..> | 2023-10-08 19:41 | 17K | |
| p5-Date-Range-1.41_1..> | 2023-10-07 00:04 | 5.3K | |
| p5-Date-Roman-1.06_1..> | 2023-10-14 06:08 | 18K | |
| p5-Date-Simple-3.03_..> | 2023-10-06 22:26 | 30K | |
| p5-DateConvert-0.16_..> | 2023-10-09 02:19 | 15K | |
| p5-DateTime-1.59.pkg | 2023-10-05 16:54 | 84K | |
| p5-DateTime-Astro-1...> | 2023-10-06 15:44 | 35K | |
| p5-DateTime-Calendar..> | 2023-10-06 23:50 | 12K | |
| p5-DateTime-Calendar..> | 2023-10-07 17:22 | 16K | |
| p5-DateTime-Calendar..> | 2023-10-08 12:54 | 9.9K | |
| p5-DateTime-Calendar..> | 2023-10-14 08:11 | 87K | |
| p5-DateTime-Calendar..> | 2023-10-14 12:35 | 17K | |
| p5-DateTime-Calendar..> | 2023-10-07 19:20 | 12K | |
| p5-DateTime-Calendar..> | 2023-10-07 00:19 | 6.6K | |
| p5-DateTime-Calendar..> | 2023-10-08 19:59 | 9.3K | |
| p5-DateTime-Calendar..> | 2023-10-14 04:37 | 16K | |
| p5-DateTime-Cron-Sim..> | 2023-10-11 20:29 | 3.7K | |
| p5-DateTime-Event-Ch..> | 2023-10-06 22:59 | 4.6K | |
| p5-DateTime-Event-Cr..> | 2023-10-08 04:57 | 10K | |
| p5-DateTime-Event-Ea..> | 2023-10-14 08:14 | 19K | |
| p5-DateTime-Event-IC..> | 2023-10-06 14:37 | 9.6K | |
| p5-DateTime-Event-Lu..> | 2023-10-09 23:24 | 6.4K | |
| p5-DateTime-Event-Na..> | 2023-10-10 00:54 | 16K | |
| p5-DateTime-Event-Ra..> | 2023-10-08 09:11 | 7.6K | |
| p5-DateTime-Event-Re..> | 2023-10-05 17:03 | 16K | |
| p5-DateTime-Event-Su..> | 2023-10-07 01:50 | 21K | |
| p5-DateTime-Event-Zo..> | 2023-10-10 06:51 | 5.5K | |
| p5-DateTime-Fiscal-Y..> | 2023-10-09 13:03 | 5.9K | |
| p5-DateTime-Format-B..> | 2023-10-10 03:26 | 9.8K | |
| p5-DateTime-Format-B..> | 2023-10-08 19:34 | 4.2K | |
| p5-DateTime-Format-B..> | 2023-10-06 14:13 | 52K | |
| p5-DateTime-Format-D..> | 2023-10-10 02:26 | 6.5K | |
| p5-DateTime-Format-D..> | 2023-10-06 15:48 | 8.4K | |
| p5-DateTime-Format-D..> | 2023-10-07 00:54 | 5.8K | |
| p5-DateTime-Format-D..> | 2023-10-07 05:18 | 15K | |
| p5-DateTime-Format-E..> | 2023-10-10 03:34 | 31K | |
| p5-DateTime-Format-E..> | 2023-10-10 14:05 | 8.8K | |
| p5-DateTime-Format-F..> | 2023-10-06 18:08 | 27K | |
| p5-DateTime-Format-H..> | 2023-10-07 01:15 | 7.9K | |
| p5-DateTime-Format-I..> | 2023-10-08 13:05 | 7.0K | |
| p5-DateTime-Format-I..> | 2023-10-06 16:19 | 9.4K | |
| p5-DateTime-Format-I..> | 2023-10-06 22:18 | 15K | |
| p5-DateTime-Format-M..> | 2023-10-06 18:49 | 10K | |
| p5-DateTime-Format-M..> | 2023-10-06 17:18 | 5.0K | |
| p5-DateTime-Format-N..> | 2023-10-06 16:41 | 63K | |
| p5-DateTime-Format-O..> | 2023-10-06 16:10 | 7.4K | |
| p5-DateTime-Format-P..> | 2023-10-06 16:12 | 14K | |
| p5-DateTime-Format-R..> | 2023-10-09 13:11 | 4.9K | |
| p5-DateTime-Format-R..> | 2023-10-14 11:14 | 3.7K | |
| p5-DateTime-Format-R..> | 2023-10-09 17:37 | 6.6K | |
| p5-DateTime-Format-S..> | 2023-10-06 21:33 | 5.1K | |
| p5-DateTime-Format-S..> | 2023-10-05 17:01 | 19K | |
| p5-DateTime-Format-W..> | 2023-10-06 19:11 | 5.7K | |
| p5-DateTime-Format-X..> | 2023-10-08 11:42 | 3.1K | |
| p5-DateTime-Function..> | 2023-10-11 16:36 | 3.9K | |
| p5-DateTime-HiRes-0...> | 2023-10-06 13:58 | 3.8K | |
| p5-DateTime-Incomple..> | 2023-10-08 02:54 | 18K | |
| p5-DateTime-Locale-1..> | 2023-10-05 16:53 | 3.0M | |
| p5-DateTime-Precise-..> | 2023-10-07 14:16 | 34K | |
| p5-DateTime-Set-0.39..> | 2023-10-05 16:59 | 38K | |
| p5-DateTime-TimeZone..> | 2023-10-05 16:53 | 241K | |
| p5-DateTime-TimeZone..> | 2023-10-08 14:03 | 7.7K | |
| p5-DateTime-TimeZone..> | 2023-10-14 07:21 | 8.7K | |
| p5-DateTime-Util-Cal..> | 2023-10-07 00:57 | 7.9K | |
| p5-DateTimeX-Easy-0...> | 2023-10-06 20:25 | 13K | |
| p5-Debug-Client-0.31..> | 2023-10-09 23:58 | 14K | |
| p5-Decision-ACL-0.02..> | 2023-10-10 02:10 | 13K | |
| p5-Declare-Constrain..> | 2023-10-07 10:19 | 42K | |
| p5-DefHash-2.0.1.pkg | 2023-10-09 19:16 | 7.8K | |
| p5-DelimMatch-1.06.pkg | 2023-10-08 10:53 | 10K | |
| p5-Dev-Bollocks-0.06..> | 2023-10-08 03:10 | 9.9K | |
| p5-Devel-ArgNames-0...> | 2023-10-05 16:56 | 3.8K | |
| p5-Devel-Autoflush-0..> | 2023-10-07 03:50 | 3.9K | |
| p5-Devel-Backtrace-0..> | 2023-10-09 10:49 | 17K | |
| p5-Devel-BeginLift-0..> | 2023-10-09 13:56 | 7.1K | |
| p5-Devel-CallChecker..> | 2023-10-05 16:55 | 12K | |
| p5-Devel-Caller-2.07..> | 2023-10-05 17:01 | 7.5K | |
| p5-Devel-Caller-Igno..> | 2023-10-07 21:16 | 3.9K | |
| p5-Devel-Caller-Perl..> | 2023-10-07 17:11 | 4.2K | |
| p5-Devel-Callsite-1...> | 2023-10-07 16:54 | 8.9K | |
| p5-Devel-CheckBin-0...> | 2023-10-07 00:50 | 3.1K | |
| p5-Devel-CheckCompil..> | 2023-10-05 16:59 | 7.0K | |
| p5-Devel-CheckLib-1...> | 2023-10-06 17:05 | 14K | |
| p5-Devel-CheckOS-1.9..> | 2023-10-07 05:53 | 71K | |
| p5-Devel-Confess-0.0..> | 2023-10-09 05:08 | 15K | |
| p5-Devel-Constants-1..> | 2023-10-10 13:07 | 7.4K | |
| p5-Devel-CoreStack-1..> | 2023-10-14 06:05 | 3.4K | |
| p5-Devel-Cover-1.40.pkg | 2023-10-06 22:13 | 169K | |
| p5-Devel-Cover-Repor..> | 2023-10-14 13:20 | 8.8K | |
| p5-Devel-Cycle-1.12.pkg | 2023-10-07 02:22 | 8.1K | |
| p5-Devel-DProfPP-1.3..> | 2023-10-11 07:58 | 6.4K | |
| p5-Devel-Declare-0.0..> | 2023-10-05 16:57 | 29K | |
| p5-Devel-Declare-Par..> | 2023-10-07 10:12 | 28K | |
| p5-Devel-Diagram-1.0..> | 2023-10-10 08:49 | 17K | |
| p5-Devel-Ditto-0.06_..> | 2023-10-09 09:13 | 8.9K | |
| p5-Devel-Dumpvar-1.0..> | 2023-10-10 23:22 | 7.1K | |
| p5-Devel-EvalContext..> | 2023-10-10 15:00 | 5.3K | |
| p5-Devel-Events-0.09..> | 2023-10-07 21:50 | 61K | |
| p5-Devel-Events-Obje..> | 2023-10-11 04:37 | 12K | |
| p5-Devel-FindPerl-0...> | 2023-10-08 12:44 | 6.0K | |
| p5-Devel-Gladiator-0..> | 2023-10-09 10:09 | 7.0K | |
| p5-Devel-GlobalDestr..> | 2023-10-05 16:50 | 4.2K | |
| p5-Devel-GlobalDestr..> | 2023-10-08 23:04 | 4.7K | |
| p5-Devel-Hide-0.0015..> | 2023-10-06 17:45 | 9.4K | |
| p5-Devel-InheritName..> | 2023-10-07 17:13 | 6.2K | |
| p5-Devel-KYTProf-0.9..> | 2023-10-08 22:57 | 9.7K | |
| p5-Devel-Leak-0.03_2..> | 2023-10-07 21:45 | 7.3K | |
| p5-Devel-Leak-Cb-0.0..> | 2023-10-08 18:02 | 5.4K | |
| p5-Devel-Leak-Object..> | 2023-10-14 17:11 | 6.5K | |
| p5-Devel-LeakGuard-O..> | 2023-10-09 14:47 | 15K | |
| p5-Devel-LeakTrace-0..> | 2023-10-08 16:41 | 7.1K | |
| p5-Devel-LexAlias-0...> | 2023-10-06 15:13 | 6.0K | |
| p5-Devel-MAT-0.51.pkg | 2023-10-08 04:46 | 155K | |
| p5-Devel-MAT-Dumper-..> | 2023-10-07 06:40 | 28K | |
| p5-Devel-Messenger-0..> | 2023-10-07 14:24 | 10K | |
| p5-Devel-Modlist-0.8..> | 2023-10-10 12:41 | 11K | |
| p5-Devel-NYTProf-6.1..> | 2023-10-07 01:23 | 347K | |
| p5-Devel-OverloadInf..> | 2023-10-05 16:51 | 5.2K | |
| p5-Devel-PPPort-3.68..> | 2023-10-10 05:47 | 170K | |
| p5-Devel-PackagePath..> | 2023-10-08 01:13 | 5.2K | |
| p5-Devel-PartialDump..> | 2023-10-05 16:52 | 9.9K | |
| p5-Devel-PatchPerl-2..> | 2023-10-07 10:20 | 138K | |
| p5-Devel-Platform-In..> | 2023-10-07 02:41 | 29K | |
| p5-Devel-Pointer-1.0..> | 2023-10-10 20:02 | 6.0K | |
| p5-Devel-Profile-1.0..> | 2023-10-10 03:28 | 9.1K | |
| p5-Devel-REPL-1.0030..> | 2023-10-06 20:17 | 83K | |
| p5-Devel-Refactor-0...> | 2023-10-10 12:40 | 10K | |
| p5-Devel-Refcount-0...> | 2023-10-07 13:04 | 8.7K | |
| p5-Devel-Required-0...> | 2023-10-09 17:31 | 8.4K | |
| p5-Devel-RingBuffer-..> | 2023-10-07 22:29 | 31K | |
| p5-Devel-STrace-0.31..> | 2023-10-10 19:11 | 14K | |
| p5-Devel-SimpleTrace..> | 2023-10-08 16:17 | 6.1K | |
| p5-Devel-Size-0.83.pkg | 2023-10-06 17:21 | 15K | |
| p5-Devel-Size-Report..> | 2023-10-10 15:30 | 13K | |
| p5-Devel-SmallProf-2..> | 2023-10-11 00:24 | 9.2K | |
| p5-Devel-StackTrace-..> | 2023-10-05 16:49 | 15K | |
| p5-Devel-StackTrace-..> | 2023-10-05 16:59 | 5.3K | |
| p5-Devel-StackTrace-..> | 2023-10-06 20:17 | 4.5K | |
| p5-Devel-StealthDebu..> | 2023-10-10 17:24 | 9.2K | |
| p5-Devel-StrictMode-..> | 2023-10-08 02:29 | 5.2K | |
| p5-Devel-Symdump-2.1..> | 2023-10-06 14:02 | 8.7K | |
| p5-Devel-Timer-0.14.pkg | 2023-10-09 20:03 | 8.5K | |
| p5-Devel-Trace-0.12_..> | 2023-10-14 19:01 | 4.4K | |
| p5-Devel-TraceCalls-..> | 2023-10-07 19:42 | 20K | |
| p5-Devel-TraceSAX-0...> | 2023-10-09 22:07 | 6.9K | |
| p5-Devel-TraceUse-2...> | 2023-10-09 00:15 | 13K | |
| p5-Devel-ebug-0.64.pkg | 2023-10-09 19:16 | 47K | |
| p5-Devel-ptkdb-1.109..> | 2023-10-09 20:34 | 40K | |
| p5-Device-Gsm-1.61.pkg | 2023-10-08 00:51 | 49K | |
| p5-Device-Modem-1.59..> | 2023-10-07 09:10 | 50K | |
| p5-Device-RAID-Polle..> | 2023-10-09 21:30 | 28K | |
| p5-Device-SerialPort..> | 2023-10-06 20:17 | 47K | |
| p5-Device-USB-0.35_2..> | 2023-10-09 18:40 | 51K | |
| p5-Digest-1.20.pkg | 2023-10-07 17:05 | 14K | |
| p5-Digest-Adler32-0...> | 2023-10-10 23:48 | 3.1K | |
| p5-Digest-Bcrypt-1.2..> | 2023-10-07 06:33 | 8.0K | |
| p5-Digest-BubbleBabb..> | 2023-10-06 21:50 | 4.5K | |
| p5-Digest-CRC-0.24.pkg | 2023-10-05 17:06 | 9.5K | |
| p5-Digest-Crc32-0.01..> | 2023-10-10 11:04 | 3.0K | |
| p5-Digest-DJB-1.00_1..> | 2023-10-11 14:54 | 5.4K | |
| p5-Digest-DMAC-1.1.4..> | 2023-10-10 21:42 | 5.5K | |
| p5-Digest-EMAC-1.2_2..> | 2023-10-09 00:56 | 5.4K | |
| p5-Digest-Elf-1.42.pkg | 2023-10-14 03:06 | 5.4K | |
| p5-Digest-FNV-2.00_1..> | 2023-10-09 03:10 | 10K | |
| p5-Digest-GOST-0.06.pkg | 2023-10-14 04:43 | 14K | |
| p5-Digest-HMAC-1.04.pkg | 2023-10-05 16:51 | 7.3K | |
| p5-Digest-Hashcash-0..> | 2023-10-10 07:56 | 15K | |
| p5-Digest-Haval256-1..> | 2023-10-07 10:06 | 18K | |
| p5-Digest-JHash-0.10..> | 2023-10-06 22:41 | 7.0K | |
| p5-Digest-MD2-2.04_2..> | 2023-10-06 17:28 | 8.9K | |
| p5-Digest-MD4-1.9_2.pkg | 2023-10-06 15:14 | 24K | |
| p5-Digest-MD5-2.58.pkg | 2023-10-07 02:54 | 18K | |
| p5-Digest-MD5-File-0..> | 2023-10-07 02:18 | 6.5K | |
| p5-Digest-MD5-M4p-0...> | 2023-10-07 05:21 | 9.5K | |
| p5-Digest-MD5-Revers..> | 2023-10-08 21:51 | 5.1K | |
| p5-Digest-ManberHash..> | 2023-10-14 14:39 | 7.4K | |
| p5-Digest-MurmurHash..> | 2023-10-10 06:12 | 6.4K | |
| p5-Digest-Nilsimsa-0..> | 2023-10-10 16:36 | 12K | |
| p5-Digest-Pearson-1...> | 2023-10-10 10:54 | 6.6K | |
| p5-Digest-Pearson-Pu..> | 2023-10-11 10:15 | 3.8K | |
| p5-Digest-Perl-MD4-1..> | 2023-10-14 18:46 | 8.9K | |
| p5-Digest-Perl-MD5-1..> | 2023-10-05 17:01 | 8.7K | |
| p5-Digest-SHA-6.04.pkg | 2023-10-09 14:14 | 34K | |
| p5-Digest-SHA-PurePe..> | 2023-10-10 00:50 | 21K | |
| p5-Digest-SHA1-2.13_..> | 2023-10-05 17:05 | 14K | |
| p5-Digest-SHA3-1.05.pkg | 2023-10-05 16:56 | 28K | |
| p5-Digest-SV1-0.01_1..> | 2023-10-09 19:07 | 6.4K | |
| p5-Digest-Tiger-0.03..> | 2023-10-08 23:55 | 16K | |
| p5-Digest-TransformP..> | 2023-10-07 12:49 | 6.6K | |
| p5-Digest-Whirlpool-..> | 2023-10-09 17:28 | 21K | |
| p5-Dir-Project-3.026..> | 2023-10-14 10:18 | 17K | |
| p5-Dir-Purge-1.02_1.pkg | 2023-10-08 19:55 | 7.8K | |
| p5-Dir-Self-0.11_1.pkg | 2023-10-06 22:48 | 3.6K | |
| p5-Dir-Watch-0.0.0_1..> | 2023-10-14 14:52 | 3.9K | |
| p5-Directory-Queue-2..> | 2023-10-14 06:06 | 31K | |
| p5-Directory-Scratch..> | 2023-10-06 21:20 | 14K | |
| p5-Directory-Scratch..> | 2023-10-07 06:31 | 6.1K | |
| p5-Dist-CheckConflic..> | 2023-10-05 16:49 | 7.3K | |
| p5-Dist-Joseki-0.20_..> | 2023-10-07 16:36 | 46K | |
| p5-Dist-Metadata-0.9..> | 2023-10-10 09:39 | 30K | |
| p5-Dist-Zilla-6.030.pkg | 2023-10-09 12:13 | 344K | |
| p5-DocSet-0.19_3.pkg | 2023-10-08 15:54 | 127K | |
| p5-Doxygen-Filter-Pe..> | 2023-10-10 06:14 | 18K | |
| p5-Dumbbench-0.503.pkg | 2023-10-10 21:11 | 38K | |
| p5-DynaLoader-Functi..> | 2023-10-05 16:53 | 10K | |
| p5-EV-4.33,1.pkg | 2023-10-06 16:15 | 226K | |
| p5-EasyTCP-0.26_2.pkg | 2023-10-10 07:58 | 28K | |
| p5-Email-Abstract-3...> | 2023-10-06 17:47 | 19K | |
| p5-Email-Address-1.9..> | 2023-10-06 16:24 | 13K | |
| p5-Email-Address-Lis..> | 2023-10-07 07:09 | 7.7K | |
| p5-Email-Address-Loo..> | 2023-10-10 02:37 | 7.4K | |
| p5-Email-Address-Use..> | 2023-10-10 03:07 | 2.9K | |
| p5-Email-Address-XS-..> | 2023-10-06 16:49 | 25K | |
| p5-Email-AddressPars..> | 2023-10-09 03:16 | 12K | |
| p5-Email-Date-1.104.pkg | 2023-10-09 01:37 | 4.7K | |
| p5-Email-Date-Format..> | 2023-10-05 17:01 | 4.6K | |
| p5-Email-Delete-2.00..> | 2023-10-09 23:48 | 8.0K | |
| p5-Email-Filter-1.03..> | 2023-10-09 14:38 | 9.5K | |
| p5-Email-Find-0.10_1..> | 2023-10-05 17:00 | 9.4K | |
| p5-Email-Folder-0.86..> | 2023-10-07 02:37 | 17K | |
| p5-Email-Folder-IMAP..> | 2023-10-07 18:39 | 4.0K | |
| p5-Email-Folder-IMAP..> | 2023-10-10 18:42 | 3.7K | |
| p5-Email-Folder-POP3..> | 2023-10-10 11:04 | 3.4K | |
| p5-Email-FolderType-..> | 2023-10-06 21:18 | 11K | |
| p5-Email-FolderType-..> | 2023-10-07 08:57 | 3.4K | |
| p5-Email-LocalDelive..> | 2023-10-07 02:52 | 9.4K | |
| p5-Email-LocalDelive..> | 2023-10-10 04:48 | 3.5K | |
| p5-Email-MIME-1.953.pkg | 2023-10-06 21:28 | 33K | |
| p5-Email-MIME-Attach..> | 2023-10-14 11:35 | 4.9K | |
| p5-Email-MIME-Conten..> | 2023-10-06 16:23 | 9.2K | |
| p5-Email-MIME-Create..> | 2023-10-07 00:43 | 23K | |
| p5-Email-MIME-Creato..> | 2023-10-10 18:13 | 5.3K | |
| p5-Email-MIME-Encodi..> | 2023-10-06 17:56 | 4.5K | |
| p5-Email-MIME-RFC204..> | 2023-10-14 05:16 | 25K | |
| p5-Email-MessageID-1..> | 2023-10-06 16:41 | 4.9K | |
| p5-Email-Outlook-Mes..> | 2023-10-07 09:29 | 19K | |
| p5-Email-Reply-1.204..> | 2023-10-08 12:36 | 8.1K | |
| p5-Email-Send-2.201.pkg | 2023-10-07 00:21 | 23K | |
| p5-Email-Sender-2.50..> | 2023-10-06 20:26 | 67K | |
| p5-Email-Sender-Tran..> | 2023-10-09 17:00 | 5.5K | |
| p5-Email-Sender-Tran..> | 2023-10-10 18:47 | 4.8K | |
| p5-Email-Simple-2.21..> | 2023-10-06 15:17 | 18K | |
| p5-Email-Simple-From..> | 2023-10-09 10:31 | 6.4K | |
| p5-Email-Stuffer-0.0..> | 2023-10-07 05:55 | 15K | |
| p5-Email-Valid-1.203..> | 2023-10-05 16:59 | 13K | |
| p5-Email-Valid-Loose..> | 2023-10-07 08:38 | 3.3K | |
| p5-Emplacken-0.01_2.pkg | 2023-10-09 18:28 | 15K | |
| p5-Encode-3.19.pkg | 2023-10-08 10:39 | 1.0M | |
| p5-Encode-Base32-Cro..> | 2023-10-11 06:03 | 5.9K | |
| p5-Encode-Base32-GMP..> | 2023-10-09 17:10 | 7.4K | |
| p5-Encode-Base58-GMP..> | 2023-10-10 00:52 | 7.3K | |
| p5-Encode-CNMap-0.32..> | 2023-10-09 00:06 | 167K | |
| p5-Encode-Detect-1.0..> | 2023-10-06 21:10 | 65K | |
| p5-Encode-Detect-CJK..> | 2023-10-07 04:20 | 21K | |
| p5-Encode-DoubleEnco..> | 2023-10-09 12:53 | 3.9K | |
| p5-Encode-HanConvert..> | 2023-10-09 19:01 | 415K | |
| p5-Encode-HanExtra-0..> | 2023-10-07 05:34 | 1.1M | |
| p5-Encode-IMAPUTF7-1..> | 2023-10-07 20:35 | 6.0K | |
| p5-Encode-JIS2K-0.03..> | 2023-10-07 08:44 | 229K | |
| p5-Encode-Locale-1.0..> | 2023-10-05 16:50 | 9.0K | |
| p5-Encode-Punycode-1..> | 2023-10-14 11:43 | 4.5K | |
| p5-Encode-compat-0.0..> | 2023-10-10 20:09 | 11K | |
| p5-Encoding-BER-1.02..> | 2023-10-08 21:43 | 22K | |
| p5-Encoding-FixLatin..> | 2023-10-08 21:53 | 14K | |
| p5-Env-PS1-0.06_1.pkg | 2023-10-09 09:31 | 11K | |
| p5-Env-Path-0.19_1.pkg | 2023-10-06 19:44 | 15K | |
| p5-Error-0.17029.pkg | 2023-10-05 17:04 | 20K | |
| p5-Error-Helper-1.0...> | 2023-10-06 23:33 | 5.9K | |
| p5-Eval-Closure-0.14..> | 2023-10-05 16:50 | 7.9K | |
| p5-Eval-Context-0.09..> | 2023-10-08 09:02 | 19K | |
| p5-Eval-LineNumbers-..> | 2023-10-07 23:10 | 4.1K | |
| p5-Eval-WithLexicals..> | 2023-10-08 01:18 | 9.6K | |
| p5-Event-1.28.pkg | 2023-10-06 18:30 | 66K | |
| p5-Event-ExecFlow-0...> | 2023-10-10 13:11 | 32K | |
| p5-Event-Join-0.06_1..> | 2023-10-07 02:24 | 5.0K | |
| p5-Event-Lib-1.03_7.pkg | 2023-10-09 13:42 | 39K | |
| p5-Event-Notify-0.00..> | 2023-10-07 02:47 | 5.0K | |
| p5-Event-RPC-1.03_3.pkg | 2023-10-10 07:22 | 50K | |
| p5-Event-tcp-0.14_1.pkg | 2023-10-10 13:09 | 7.1K | |
| p5-Every-0.08_1.pkg | 2023-10-10 09:01 | 4.3K | |
| p5-Excel-Template-0...> | 2023-10-09 23:10 | 73K | |
| p5-Excel-Writer-XLSX..> | 2023-10-06 19:56 | 418K | |
| p5-Exception-Class-1..> | 2023-10-05 16:50 | 21K | |
| p5-Exception-Class-D..> | 2023-10-08 16:20 | 13K | |
| p5-Exception-Class-T..> | 2023-10-08 15:11 | 9.3K | |
| p5-Exception-Handler..> | 2023-10-09 10:00 | 3.7K | |
| p5-Expect-1.35.pkg | 2023-10-07 10:01 | 48K | |
| p5-Expect-Simple-0.0..> | 2023-10-08 02:41 | 8.1K | |
| p5-ExportTo-0.03.pkg | 2023-10-07 21:42 | 5.6K | |
| p5-Exporter-5.68_1.pkg | 2023-10-06 20:40 | 19K | |
| p5-Exporter-Declare-..> | 2023-10-06 21:54 | 36K | |
| p5-Exporter-Easy-0.1..> | 2023-10-06 19:25 | 12K | |
| p5-Exporter-Lite-0.0..> | 2023-10-06 18:01 | 7.1K | |
| p5-Exporter-Tidy-0.0..> | 2023-10-08 06:02 | 6.3K | |
| p5-Exporter-Tiny-1.0..> | 2023-10-05 16:53 | 32K | |
| p5-ExtUtils-AutoInst..> | 2023-10-08 01:14 | 17K | |
| p5-ExtUtils-CBuilder..> | 2023-10-11 13:50 | 22K | |
| p5-ExtUtils-CChecker..> | 2023-10-05 16:54 | 12K | |
| p5-ExtUtils-Config-0..> | 2023-10-05 16:49 | 3.5K | |
| p5-ExtUtils-Constant..> | 2023-10-09 09:04 | 34K | |
| p5-ExtUtils-CppGuess..> | 2023-10-07 02:32 | 8.6K | |
| p5-ExtUtils-Depends-..> | 2023-10-05 16:50 | 12K | |
| p5-ExtUtils-F77-1.26..> | 2023-10-06 22:12 | 11K | |
| p5-ExtUtils-Helpers-..> | 2023-10-05 16:51 | 9.0K | |
| p5-ExtUtils-Install-..> | 2023-10-09 08:26 | 30K | |
| p5-ExtUtils-InstallP..> | 2023-10-05 16:50 | 11K | |
| p5-ExtUtils-LibBuild..> | 2023-10-07 01:23 | 6.0K | |
| p5-ExtUtils-MakeMake..> | 2023-10-10 01:59 | 246K | |
| p5-ExtUtils-MakeMake..> | 2023-10-06 17:33 | 5.3K | |
| p5-ExtUtils-MakeMake..> | 2023-10-07 09:32 | 7.6K | |
| p5-ExtUtils-Manifest..> | 2023-10-08 17:37 | 13K | |
| p5-ExtUtils-ParseXS-..> | 2023-10-09 06:27 | 56K | |
| p5-ExtUtils-PkgConfi..> | 2023-10-05 17:05 | 6.5K | |
| p5-ExtUtils-XSBuilde..> | 2023-10-06 18:48 | 57K | |
| p5-ExtUtils-XSpp-0.1..> | 2023-10-07 15:58 | 98K | |
| p5-FAQ-OMatic-2.719_..> | 2023-10-09 12:48 | 177K | |
| p5-FCGI-0.82.pkg | 2023-10-07 05:22 | 28K | |
| p5-FCGI-Async-0.22_2..> | 2023-10-14 16:10 | 9.5K | |
| p5-FCGI-Client-0.09.pkg | 2023-10-09 12:21 | 18K | |
| p5-FCGI-Engine-0.22.pkg | 2023-10-14 11:57 | 42K | |
| p5-FCGI-ProcManager-..> | 2023-10-08 03:05 | 14K | |
| p5-FCGI-Spawn-0.16.7..> | 2023-10-10 07:08 | 34K | |
| p5-FEAR-API-0.489_3.pkg | 2023-10-08 21:10 | 39K | |
| p5-FFI-C-Stat-0.02.pkg | 2023-10-07 13:05 | 7.5K | |
| p5-FFI-CheckLib-0.31..> | 2023-10-05 17:06 | 14K | |
| p5-FFI-Platypus-2.08..> | 2023-10-07 02:33 | 297K | |
| p5-FFI-Platypus-Decl..> | 2023-10-07 15:18 | 9.0K | |
| p5-FFI-Platypus-Type..> | 2023-10-07 21:14 | 7.7K | |
| p5-FFI-Platypus-Type..> | 2023-10-08 06:26 | 5.1K | |
| p5-FFmpeg-Command-0...> | 2023-10-10 19:35 | 6.9K | |
| p5-FLV-Info-0.24_1.pkg | 2023-10-10 18:27 | 63K | |
| p5-FSA-Rules-0.35.pkg | 2023-10-14 08:35 | 22K | |
| p5-Facebook-Graph-1...> | 2023-10-14 18:47 | 72K | |
| p5-Fax-Hylafax-Clien..> | 2023-10-14 16:22 | 11K | |
| p5-Feature-Compat-Tr..> | 2023-10-06 14:32 | 8.1K | |
| p5-Feed-Find-0.07_1.pkg | 2023-10-07 04:05 | 5.1K | |
| p5-Feersum-1.410.pkg | 2023-10-08 21:22 | 61K | |
| p5-Fennec-Lite-0.004..> | 2023-10-09 07:48 | 12K | |
| p5-File-Append-TempF..> | 2023-10-08 14:30 | 8.1K | |
| p5-File-Assets-0.064..> | 2023-10-09 06:27 | 27K | |
| p5-File-Attributes-0..> | 2023-10-07 22:28 | 12K | |
| p5-File-Attributes-R..> | 2023-10-09 09:06 | 5.1K | |
| p5-File-BOM-0.18.pkg | 2023-10-10 10:42 | 13K | |
| p5-File-BackupCopy-1..> | 2023-10-07 13:30 | 7.8K | |
| p5-File-BaseDir-0.09..> | 2023-10-06 23:06 | 12K | |
| p5-File-BasicFlock-9..> | 2023-10-09 13:23 | 3.1K | |
| p5-File-Binary-1.7_2..> | 2023-10-10 01:29 | 6.6K | |
| p5-File-Cache-0.16_1..> | 2023-10-09 22:47 | 21K | |
| p5-File-Cat-1.2_1.pkg | 2023-10-09 19:10 | 3.1K | |
| p5-File-ChangeNotify..> | 2023-10-06 18:34 | 24K | |
| p5-File-Cmp-1.09.pkg | 2023-10-14 03:18 | 13K | |
| p5-File-ConfigDir-0...> | 2023-10-06 14:17 | 9.1K | |
| p5-File-Copy-Link-0...> | 2023-10-08 11:00 | 11K | |
| p5-File-Copy-Recursi..> | 2023-10-06 21:20 | 14K | |
| p5-File-Copy-Recursi..> | 2023-10-10 14:47 | 11K | |
| p5-File-CountLines-0..> | 2023-10-06 21:11 | 6.2K | |
| p5-File-CounterFile-..> | 2023-10-08 08:25 | 5.2K | |
| p5-File-CreationTime..> | 2023-10-14 05:08 | 4.8K | |
| p5-File-DesktopEntry..> | 2023-10-07 09:21 | 14K | |
| p5-File-Dir-Dumper-0..> | 2023-10-14 08:23 | 22K | |
| p5-File-DirCompare-0..> | 2023-10-10 18:40 | 6.1K | |
| p5-File-DirSync-1.22..> | 2023-10-14 18:37 | 19K | |
| p5-File-ExtAttr-1.09..> | 2023-10-10 05:52 | 19K | |
| p5-File-FcntlLock-0...> | 2023-10-08 23:47 | 28K | |
| p5-File-Fetch-1.04.pkg | 2023-10-14 10:38 | 19K | |
| p5-File-Find-Closure..> | 2023-10-07 10:04 | 7.2K | |
| p5-File-Find-Object-..> | 2023-10-07 03:39 | 21K | |
| p5-File-Find-Object-..> | 2023-10-08 04:18 | 31K | |
| p5-File-Find-Rule-0...> | 2023-10-05 16:57 | 22K | |
| p5-File-Find-Rule-Fi..> | 2023-10-08 06:09 | 4.1K | |
| p5-File-Find-Rule-Pe..> | 2023-10-07 05:14 | 5.7K | |
| p5-File-Find-Rule-VC..> | 2023-10-07 17:27 | 5.7K | |
| p5-File-Finder-0.53_..> | 2023-10-08 21:58 | 20K | |
| p5-File-Flat-1.07.pkg | 2023-10-07 22:46 | 15K | |
| p5-File-Flock-2014.0..> | 2023-10-07 23:51 | 13K | |
| p5-File-Flock-Retry-..> | 2023-10-06 18:33 | 6.3K | |
| p5-File-FnMatch-0.02..> | 2023-10-08 06:20 | 8.1K | |
| p5-File-Format-RIFF-..> | 2023-10-09 23:36 | 16K | |
| p5-File-Grep-0.02_1.pkg | 2023-10-07 16:45 | 6.2K | |
| p5-File-HStore-0.10_..> | 2023-10-09 14:18 | 6.5K | |
| p5-File-HomeDir-1.00..> | 2023-10-05 16:47 | 34K | |
| p5-File-HomeDir-Path..> | 2023-10-11 08:22 | 5.0K | |
| p5-File-HomeDir-Tiny..> | 2023-10-08 08:14 | 4.5K | |
| p5-File-Inplace-0.20..> | 2023-10-14 07:51 | 6.1K | |
| p5-File-Iterator-0.1..> | 2023-10-08 12:27 | 5.8K | |
| p5-File-KeePass-2.03..> | 2023-10-08 11:22 | 31K | |
| p5-File-KeePass-Agen..> | 2023-10-08 23:25 | 21K | |
| p5-File-LibMagic-1.2..> | 2023-10-07 09:08 | 22K | |
| p5-File-Listing-6.16..> | 2023-10-05 16:53 | 8.5K | |
| p5-File-LoadLines-1...> | 2023-10-14 14:55 | 5.8K | |
| p5-File-Locate-0.62.pkg | 2023-10-09 14:39 | 14K | |
| p5-File-Log-1.05_1.pkg | 2023-10-09 01:28 | 11K | |
| p5-File-MMagic-1.30_..> | 2023-10-06 21:55 | 19K | |
| p5-File-MMagic-XS-0...> | 2023-10-07 13:40 | 28K | |
| p5-File-Map-0.71.pkg | 2023-10-07 05:18 | 22K | |
| p5-File-MimeInfo-0.3..> | 2023-10-08 07:46 | 39K | |
| p5-File-Modified-0.1..> | 2023-10-10 02:28 | 8.7K | |
| p5-File-Monitor-1.00..> | 2023-10-11 05:04 | 28K | |
| p5-File-Mork-0.3_1.pkg | 2023-10-10 07:40 | 13K | |
| p5-File-NCopy-0.36_2..> | 2023-10-08 09:17 | 9.8K | |
| p5-File-NFSLock-1.29..> | 2023-10-05 17:06 | 13K | |
| p5-File-Next-1.18.pkg | 2023-10-06 16:32 | 11K | |
| p5-File-Path-2.18.pkg | 2023-10-14 07:54 | 22K | |
| p5-File-Path-Expand-..> | 2023-10-06 22:55 | 2.8K | |
| p5-File-Path-Tiny-1...> | 2023-10-10 11:07 | 10K | |
| p5-File-PathConvert-..> | 2023-10-08 13:06 | 13K | |
| p5-File-Pid-1.01_2.pkg | 2023-10-07 18:50 | 4.5K | |
| p5-File-Pid-Quick-1...> | 2023-10-09 22:10 | 6.8K | |
| p5-File-Policy-1.005..> | 2023-10-06 22:44 | 11K | |
| p5-File-Random-0.21.pkg | 2023-10-09 13:52 | 9.7K | |
| p5-File-ReadBackward..> | 2023-10-06 17:18 | 8.1K | |
| p5-File-Remove-1.58.pkg | 2023-10-05 17:03 | 9.8K | |
| p5-File-Rename-2.01.pkg | 2023-10-10 04:36 | 17K | |
| p5-File-Rsync-0.49_1..> | 2023-10-09 07:33 | 16K | |
| p5-File-RsyncP-0.76.pkg | 2023-10-11 01:56 | 80K | |
| p5-File-SafeDO-0.14_..> | 2023-10-07 07:51 | 4.9K | |
| p5-File-Scan-1.43_1.pkg | 2023-10-11 01:14 | 33K | |
| p5-File-Scan-ClamAV-..> | 2023-10-08 04:02 | 8.2K | |
| p5-File-SearchPath-0..> | 2023-10-07 18:46 | 8.1K | |
| p5-File-Share-0.27.pkg | 2023-10-06 18:16 | 4.4K | |
| p5-File-ShareDir-1.1..> | 2023-10-05 16:51 | 12K | |
| p5-File-ShareDir-Dis..> | 2023-10-07 11:19 | 14K | |
| p5-File-ShareDir-Ins..> | 2023-10-05 16:52 | 7.5K | |
| p5-File-ShareDir-PAR..> | 2023-10-10 18:07 | 7.4K | |
| p5-File-ShareDir-Pat..> | 2023-10-07 15:38 | 5.0K | |
| p5-File-ShareDir-Pro..> | 2023-10-08 07:00 | 14K | |
| p5-File-ShareDir-Tar..> | 2023-10-07 08:12 | 4.9K | |
| p5-File-Signature-1...> | 2023-10-08 05:02 | 11K | |
| p5-File-Slurp-9999.2..> | 2023-10-06 17:26 | 15K | |
| p5-File-Slurp-Tiny-0..> | 2023-10-05 17:06 | 4.7K | |
| p5-File-Slurp-Tree-1..> | 2023-10-09 17:22 | 4.3K | |
| p5-File-Slurper-0.01..> | 2023-10-06 21:41 | 5.8K | |
| p5-File-Sort-1.01_1.pkg | 2023-10-07 16:10 | 18K | |
| p5-File-Spec-Native-..> | 2023-10-07 20:10 | 4.8K | |
| p5-File-Stat-Bits-1...> | 2023-10-07 04:14 | 6.0K | |
| p5-File-Stat-ModeStr..> | 2023-10-07 23:59 | 4.6K | |
| p5-File-Stream-2.30_..> | 2023-10-08 22:04 | 9.7K | |
| p5-File-Sync-0.11_1.pkg | 2023-10-08 04:30 | 6.7K | |
| p5-File-Tail-1.3.pkg | 2023-10-07 21:15 | 14K | |
| p5-File-Tail-Dir-0.1..> | 2023-10-07 12:26 | 13K | |
| p5-File-Tail-Multi-0..> | 2023-10-09 09:30 | 17K | |
| p5-File-Tail-Scribe-..> | 2023-10-14 13:27 | 13K | |
| p5-File-Tee-0.07_1.pkg | 2023-10-14 06:13 | 8.6K | |
| p5-File-Temp-0.2311.pkg | 2023-10-09 18:17 | 38K | |
| p5-File-Tempdir-0.02..> | 2023-10-07 03:27 | 3.6K | |
| p5-File-Touch-0.12.pkg | 2023-10-10 20:52 | 5.4K | |
| p5-File-TreeCreate-0..> | 2023-10-10 13:08 | 6.6K | |
| p5-File-Type-0.22_1.pkg | 2023-10-06 19:09 | 12K | |
| p5-File-Util-4.16195..> | 2023-10-07 18:06 | 109K | |
| p5-File-Which-1.27.pkg | 2023-10-05 16:47 | 10K | |
| p5-File-Write-Rotate..> | 2023-10-07 09:52 | 16K | |
| p5-File-chdir-0.1011..> | 2023-10-05 17:03 | 8.8K | |
| p5-File-chmod-0.42.pkg | 2023-10-07 01:26 | 9.2K | |
| p5-File-pushd-1.016.pkg | 2023-10-07 09:52 | 7.1K | |
| p5-FileHandle-Fmode-..> | 2023-10-06 18:49 | 7.2K | |
| p5-FileHandle-Unget-..> | 2023-10-07 06:01 | 9.4K | |
| p5-Filesys-Df-0.92_1..> | 2023-10-08 00:40 | 9.7K | |
| p5-Filesys-DfPortabl..> | 2023-10-08 14:23 | 8.9K | |
| p5-Filesys-DiskFree-..> | 2023-10-08 17:48 | 5.7K | |
| p5-Filesys-DiskSpace..> | 2023-10-10 02:51 | 5.8K | |
| p5-Filesys-DiskUsage..> | 2023-10-14 18:08 | 8.7K | |
| p5-Filesys-Notify-KQ..> | 2023-10-07 15:03 | 4.8K | |
| p5-Filesys-Notify-Si..> | 2023-10-05 16:59 | 5.3K | |
| p5-Filesys-Statvfs-0..> | 2023-10-10 17:47 | 6.6K | |
| p5-Filesys-Virtual-0..> | 2023-10-06 22:25 | 3.9K | |
| p5-Filesys-Virtual-D..> | 2023-10-09 03:50 | 5.4K | |
| p5-Filesys-Virtual-P..> | 2023-10-06 23:50 | 8.1K | |
| p5-Filesys-ZFS-1.5.pkg | 2023-10-10 17:52 | 9.0K | |
| p5-Filesys-ZFS-Stat-..> | 2023-10-11 13:07 | 4.6K | |
| p5-Filter-1.64.pkg | 2023-10-05 17:05 | 53K | |
| p5-Filter-CBC-0.10_2..> | 2023-10-08 13:19 | 9.8K | |
| p5-Filter-Crypto-2.1..> | 2023-10-11 00:43 | 61K | |
| p5-Filter-Simple-0.9..> | 2023-10-07 02:10 | 15K | |
| p5-Filter-Template-1..> | 2023-10-08 02:48 | 14K | |
| p5-Finance-Amortizat..> | 2023-10-08 19:10 | 5.6K | |
| p5-Finance-Bitcoin-0..> | 2023-10-14 11:14 | 14K | |
| p5-Finance-Currency-..> | 2023-10-09 09:13 | 7.0K | |
| p5-Finance-Currency-..> | 2023-10-08 09:38 | 4.4K | |
| p5-Finance-Currency-..> | 2023-10-10 07:57 | 12K | |
| p5-Finance-Quote-1.5..> | 2023-10-07 02:53 | 178K | |
| p5-Finance-QuoteHist..> | 2023-10-14 11:02 | 29K | |
| p5-Finance-QuoteTW-0..> | 2023-10-11 18:04 | 18K | |
| p5-Finance-TW-Emergi..> | 2023-10-14 09:51 | 3.9K | |
| p5-Finance-TW-TSEQuo..> | 2023-10-08 19:29 | 6.9K | |
| p5-Finance-YahooQuot..> | 2023-10-09 14:32 | 15K | |
| p5-Find-Lib-1.04_1.pkg | 2023-10-14 17:58 | 8.1K | |
| p5-FindBin-libs-2.11..> | 2023-10-07 04:51 | 19K | |
| p5-Firefox-Marionett..> | 2023-10-09 23:11 | 271K | |
| p5-Flea-0.04_2.pkg | 2023-10-08 21:28 | 8.2K | |
| p5-Flickr-API-1.28.pkg | 2023-10-06 17:24 | 38K | |
| p5-Flickr-Upload-1.6..> | 2023-10-06 20:23 | 20K | |
| p5-Fliggy-0.009003_1..> | 2023-10-14 07:23 | 7.5K | |
| p5-Font-AFM-1.20_1.pkg | 2023-10-05 17:01 | 10K | |
| p5-Font-FreeType-0.1..> | 2023-10-10 04:38 | 52K | |
| p5-Font-TTF-1.06.pkg | 2023-10-06 20:25 | 305K | |
| p5-Font-TTFMetrics-0..> | 2023-10-14 18:22 | 17K | |
| p5-Forest-0.10_1.pkg | 2023-10-06 22:00 | 47K | |
| p5-Form-Sensible-0.2..> | 2023-10-14 18:11 | 122K | |
| p5-FormValidator-Lit..> | 2023-10-07 12:54 | 37K | |
| p5-Format-Human-Byte..> | 2023-10-08 03:37 | 4.9K | |
| p5-FreeBSD-Ports-0.0..> | 2023-10-14 17:53 | 12K | |
| p5-FreeBSD-Ports-IND..> | 2023-10-11 15:17 | 5.6K | |
| p5-FreezeThaw-0.5001..> | 2023-10-06 21:05 | 12K | |
| p5-Frontier-RPC-0.07..> | 2023-10-10 00:36 | 23K | |
| p5-Function-Fallback..> | 2023-10-07 09:50 | 5.3K | |
| p5-Function-Paramete..> | 2023-10-05 17:04 | 49K | |
| p5-Furl-3.14_1.pkg | 2023-10-07 01:39 | 40K | |
| p5-FurlX-Coro-1.02_1..> | 2023-10-08 17:15 | 6.5K | |
| p5-Fuse-0.16.1_2.pkg | 2023-10-07 11:16 | 38K | |
| p5-Fuse-Simple-1.00_..> | 2023-10-08 22:34 | 14K | |
| p5-FusionInventory-A..> | 2023-10-09 17:16 | 734K | |
| p5-Future-0.50.pkg | 2023-10-05 17:06 | 72K | |
| p5-Future-AsyncAwait..> | 2023-10-06 14:12 | 46K | |
| p5-Future-IO-0.14.pkg | 2023-10-11 03:17 | 18K | |
| p5-FuzzyOcr-devel-3...> | 2023-10-10 00:34 | 103K | |
| p5-GD-2.78.pkg | 2023-10-06 17:40 | 120K | |
| p5-GD-Arrow-0.01_5.pkg | 2023-10-07 12:23 | 4.3K | |
| p5-GD-Barcode-2.00.pkg | 2023-10-09 12:08 | 480K | |
| p5-GD-Graph-1.56.pkg | 2023-10-07 07:38 | 78K | |
| p5-GD-Graph-histogra..> | 2023-10-10 09:05 | 5.9K | |
| p5-GD-Graph-ohlc-0.9..> | 2023-10-12 11:15 | 10K | |
| p5-GD-Graph3d-0.63_6..> | 2023-10-07 23:18 | 18K | |
| p5-GD-SVG-0.33_6.pkg | 2023-10-07 14:48 | 39K | |
| p5-GD-SecurityImage-..> | 2023-10-07 18:32 | 30K | |
| p5-GD-TextUtil-0.86_..> | 2023-10-06 20:51 | 23K | |
| p5-GD-Thumbnail-1.46..> | 2023-10-08 11:02 | 12K | |
| p5-GDBM-1.14_5.pkg | 2023-10-07 17:49 | 9.4K | |
| p5-GDS2-3.35.pkg | 2023-10-10 21:06 | 44K | |
| p5-GIS-Distance-0.20..> | 2023-10-07 05:43 | 36K | |
| p5-GIS-Distance-Fast..> | 2023-10-06 22:04 | 20K | |
| p5-GIS-Distance-Lite..> | 2023-10-10 19:42 | 3.6K | |
| p5-GMail-IMAPD-0.94_..> | 2023-10-10 00:43 | 11K | |
| p5-GPS-0.17_1.pkg | 2023-10-14 13:17 | 27K | |
| p5-GPS-Babel-0.11_1.pkg | 2023-10-11 06:03 | 15K | |
| p5-GPS-OID-0.07_1.pkg | 2023-10-09 18:00 | 4.7K | |
| p5-GPS-Point-0.20.pkg | 2023-10-07 15:00 | 9.2K | |
| p5-GSSAPI-0.28_2.pkg | 2023-10-05 16:57 | 37K | |
| p5-Games-Alak-0.19_1..> | 2023-10-08 20:43 | 9.3K | |
| p5-Games-AlphaBeta-0..> | 2023-10-10 15:52 | 25K | |
| p5-Games-Bingo-0.18_..> | 2023-10-07 17:38 | 26K | |
| p5-Games-Bingo-Bot-0..> | 2023-10-09 17:01 | 8.3K | |
| p5-Games-Bingo-Print..> | 2023-10-09 19:45 | 9.2K | |
| p5-Games-Dice-0.046.pkg | 2023-10-10 00:19 | 9.8K | |
| p5-Games-Dissociate-..> | 2023-10-10 14:42 | 12K | |
| p5-Games-GuessWord-0..> | 2023-10-07 20:29 | 4.9K | |
| p5-Games-Tournament-..> | 2023-10-14 18:35 | 13K | |
| p5-Gantry-3.64_1.pkg | 2023-10-07 11:03 | 2.3M | |
| p5-Gazelle-0.49.pkg | 2023-10-12 12:45 | 23K | |
| p5-Gearman-2.004.015..> | 2023-10-08 07:51 | 43K | |
| p5-Gearman-Client-As..> | 2023-10-11 00:40 | 6.8K | |
| p5-Gearman-Server-1...> | 2023-10-10 02:10 | 20K | |
| p5-Gearman-XS-0.12_3..> | 2023-10-08 13:08 | 37K | |
| p5-Genezzo-0.72_2.pkg | 2023-10-08 18:19 | 480K | |
| p5-Geo-Address-Forma..> | 2023-10-10 17:07 | 11K | |
| p5-Geo-BUFR-1.39.pkg | 2023-10-11 00:50 | 112K | |
| p5-Geo-Cache-0.11_1.pkg | 2023-10-08 11:39 | 5.0K | |
| p5-Geo-Caching-0.11_..> | 2023-10-08 22:38 | 5.7K | |
| p5-Geo-Calc-0.12.pkg | 2023-10-09 16:52 | 11K | |
| p5-Geo-Coder-Bing-0...> | 2023-10-09 17:20 | 7.0K | |
| p5-Geo-Coder-Google-..> | 2023-10-07 19:15 | 11K | |
| p5-Geo-Coder-Googlev..> | 2023-10-08 14:55 | 6.6K | |
| p5-Geo-Coder-Mapques..> | 2023-10-09 02:26 | 7.0K | |
| p5-Geo-Coder-Multima..> | 2023-10-09 23:48 | 5.3K | |
| p5-Geo-Coder-Multipl..> | 2023-10-09 07:51 | 8.4K | |
| p5-Geo-Coder-Navteq-..> | 2023-10-10 16:02 | 7.4K | |
| p5-Geo-Coder-OSM-0.0..> | 2023-10-14 17:28 | 6.7K | |
| p5-Geo-Coder-OpenCag..> | 2023-10-11 15:30 | 6.7K | |
| p5-Geo-Coder-Ovi-0.0..> | 2023-10-09 05:50 | 6.5K | |
| p5-Geo-Coder-PlaceFi..> | 2023-10-10 19:39 | 6.7K | |
| p5-Geo-Coder-TomTom-..> | 2023-10-08 21:26 | 6.0K | |
| p5-Geo-Coordinates-C..> | 2023-10-07 02:55 | 17K | |
| p5-Geo-Coordinates-C..> | 2023-10-07 14:51 | 2.3M | |
| p5-Geo-Coordinates-T..> | 2023-10-07 01:14 | 5.5K | |
| p5-Geo-Coordinates-U..> | 2023-10-09 18:05 | 13K | |
| p5-Geo-Distance-0.25..> | 2023-10-07 10:04 | 11K | |
| p5-Geo-Distance-XS-0..> | 2023-10-09 16:48 | 11K | |
| p5-Geo-EOP-0.50.pkg | 2023-10-08 22:12 | 46K | |
| p5-Geo-GDAL-FFI-0.10..> | 2023-10-09 13:54 | 61K | |
| p5-Geo-GML-0.18.pkg | 2023-10-07 11:15 | 546K | |
| p5-Geo-GeoNames-1.13..> | 2023-10-08 20:11 | 11K | |
| p5-Geo-Gpx-1.09.pkg | 2023-10-08 10:11 | 24K | |
| p5-Geo-IP-PurePerl-1..> | 2023-10-07 01:16 | 15K | |
| p5-Geo-IPfree-1.1600..> | 2023-10-10 14:25 | 437K | |
| p5-Geo-JSON-0.007.pkg | 2023-10-14 13:46 | 42K | |
| p5-Geo-METAR-1.15_1.pkg | 2023-10-09 17:45 | 17K | |
| p5-Geo-Parse-OSM-0.4..> | 2023-10-11 01:10 | 12K | |
| p5-Geo-Postcodes-0.3..> | 2023-10-08 03:34 | 43K | |
| p5-Geo-Postcodes-DK-..> | 2023-10-09 04:32 | 20K | |
| p5-Geo-Postcodes-NO-..> | 2023-10-14 08:53 | 40K | |
| p5-Geo-ShapeFile-3.0..> | 2023-10-14 05:00 | 30K | |
| p5-Geo-Weather-1.41_..> | 2023-10-08 15:41 | 10K | |
| p5-Geo-WebService-El..> | 2023-10-07 05:27 | 15K | |
| p5-GeoIP2-2.006002.pkg | 2023-10-14 10:43 | 81K | |
| p5-Geography-Countri..> | 2023-10-06 14:10 | 11K | |
| p5-Geometry-Primitiv..> | 2023-10-06 19:09 | 26K | |
| p5-Getargs-Long-1.10..> | 2023-10-07 17:50 | 19K | |
| p5-Getopt-ArgvFile-1..> | 2023-10-07 05:47 | 20K | |
| p5-Getopt-Attribute-..> | 2023-10-07 06:50 | 5.0K | |
| p5-Getopt-Compact-0...> | 2023-10-07 00:41 | 13K | |
| p5-Getopt-Compact-Wi..> | 2023-10-07 19:18 | 13K | |
| p5-Getopt-Declare-1...> | 2023-10-07 21:06 | 52K | |
| p5-Getopt-EX-1.15.1_..> | 2023-10-07 19:26 | 54K | |
| p5-Getopt-Euclid-0.4..> | 2023-10-08 11:06 | 38K | |
| p5-Getopt-GUI-Long-0..> | 2023-10-14 18:54 | 20K | |
| p5-Getopt-Long-2.54.pkg | 2023-10-08 07:49 | 40K | |
| p5-Getopt-Long-Descr..> | 2023-10-05 17:04 | 23K | |
| p5-Getopt-Lucid-1.10..> | 2023-10-07 09:36 | 26K | |
| p5-Getopt-Tabular-0...> | 2023-10-08 11:41 | 36K | |
| p5-Giovanni-1.12.pkg | 2023-10-14 17:14 | 15K | |
| p5-Git-PurePerl-0.53..> | 2023-10-06 21:46 | 13K | |
| p5-Git-Repository-1...> | 2023-10-07 00:38 | 43K | |
| p5-Git-Repository-Pl..> | 2023-10-08 13:08 | 11K | |
| p5-Git-Sub-0.163320.pkg | 2023-10-09 18:55 | 4.1K | |
| p5-Git-Version-Compa..> | 2023-10-06 20:38 | 7.6K | |
| p5-Git-Wrapper-0.048..> | 2023-10-08 04:56 | 27K | |
| p5-GitDDL-0.03.pkg | 2023-10-07 15:06 | 5.9K | |
| p5-GitDDL-Migrator-0..> | 2023-10-09 08:16 | 7.2K | |
| p5-Glib-1.3294.pkg | 2023-10-06 14:55 | 321K | |
| p5-Glib-Object-Intro..> | 2023-10-06 20:21 | 59K | |
| p5-GnuPG-0.19_1.pkg | 2023-10-14 05:44 | 23K | |
| p5-GnuPG-Interface-1..> | 2023-10-07 03:50 | 50K | |
| p5-Goo-0.09_3.pkg | 2023-10-10 05:00 | 218K | |
| p5-Goo-Canvas2-0.06_..> | 2023-10-08 04:20 | 6.9K | |
| p5-Google-Chart-0.05..> | 2023-10-10 09:25 | 42K | |
| p5-Google-Checkout-1..> | 2023-10-09 10:03 | 115K | |
| p5-Google-Data-JSON-..> | 2023-10-11 01:24 | 9.7K | |
| p5-Google-ProtocolBu..> | 2023-10-08 04:20 | 30K | |
| p5-Google-SAML-Reque..> | 2023-10-07 14:24 | 7.4K | |
| p5-Google-SAML-Respo..> | 2023-10-10 01:37 | 12K | |
| p5-Google-Search-0.0..> | 2023-10-14 11:50 | 13K | |
| p5-Graph-0.9727,1.pkg | 2023-10-06 15:19 | 94K | |
| p5-Graph-Easy-0.76.pkg | 2023-10-11 15:18 | 243K | |
| p5-Graph-ReadWrite-2..> | 2023-10-06 22:26 | 39K | |
| p5-Graph-SocialMap-0..> | 2023-10-07 15:06 | 6.5K | |
| p5-Graph-Writer-Grap..> | 2023-10-07 01:06 | 5.0K | |
| p5-GraphQL-0.54.pkg | 2023-10-09 11:01 | 109K | |
| p5-GraphViz-2.25.pkg | 2023-10-06 21:20 | 52K | |
| p5-GraphViz-DBI-1.10..> | 2023-10-09 20:29 | 5.7K | |
| p5-GraphViz-Data-Str..> | 2023-10-14 16:36 | 23K | |
| p5-GraphViz-Traverse..> | 2023-10-14 05:40 | 9.0K | |
| p5-GraphViz2-2.67.pkg | 2023-10-07 19:38 | 48K | |
| p5-GraphViz2-DBI-2.5..> | 2023-10-10 10:03 | 7.2K | |
| p5-GraphViz2-Data-Gr..> | 2023-10-09 16:11 | 6.8K | |
| p5-GraphViz2-Parse-I..> | 2023-10-08 14:42 | 5.9K | |
| p5-GraphViz2-Parse-R..> | 2023-10-09 17:51 | 6.2K | |
| p5-GraphViz2-Parse-X..> | 2023-10-10 05:26 | 5.0K | |
| p5-Graphics-Color-0...> | 2023-10-06 20:02 | 23K | |
| p5-Graphics-ColorNam..> | 2023-10-06 16:46 | 29K | |
| p5-Graphics-ColorNam..> | 2023-10-06 21:54 | 16K | |
| p5-Graphics-ColorUti..> | 2023-10-08 07:36 | 20K | |
| p5-Graphics-GnuplotI..> | 2023-10-10 02:17 | 18K | |
| p5-Graphics-Primitiv..> | 2023-10-07 05:38 | 65K | |
| p5-Graphics-Primitiv..> | 2023-10-07 18:23 | 12K | |
| p5-Graphics-TIFF-20.pkg | 2023-10-07 11:38 | 25K | |
| p5-Gravatar-URL-1.07..> | 2023-10-09 18:17 | 15K | |
| p5-Growl-GNTP-0.21.pkg | 2023-10-14 14:38 | 8.5K | |
| p5-Grutatxt-2.20.pkg | 2023-10-08 06:28 | 20K | |
| p5-Gtk3-0.034_1.pkg | 2023-10-07 05:12 | 24K | |
| p5-Gtk3-ImageView-10..> | 2023-10-07 11:08 | 13K | |
| p5-Gtk3-SimpleList-0..> | 2023-10-07 22:34 | 14K | |
| p5-Guard-1.023_1.pkg | 2023-10-06 16:34 | 11K | |
| p5-Gungho-0.09008_2.pkg | 2023-10-07 21:17 | 121K | |
| p5-GunghoX-FollowLin..> | 2023-10-11 05:52 | 25K | |
| p5-Gzip-Faster-0.21.pkg | 2023-10-09 11:47 | 26K | |
| p5-HOP-Lexer-0.032_2..> | 2023-10-11 02:43 | 25K | |
| p5-HOP-Stream-0.03_1..> | 2023-10-07 12:00 | 12K | |
| p5-HTML-Adsense-0.2_..> | 2023-10-08 12:44 | 5.0K | |
| p5-HTML-Breadcrumbs-..> | 2023-10-10 07:13 | 11K | |
| p5-HTML-CalendarMont..> | 2023-10-08 20:54 | 20K | |
| p5-HTML-Chunks-1.55...> | 2023-10-09 05:57 | 18K | |
| p5-HTML-Clean-1.4.pkg | 2023-10-08 07:11 | 13K | |
| p5-HTML-ContentExtra..> | 2023-10-09 13:42 | 6.6K | |
| p5-HTML-Copy-1.31_1.pkg | 2023-10-11 05:36 | 9.2K | |
| p5-HTML-DOM-0.058.pkg | 2023-10-06 18:38 | 237K | |
| p5-HTML-Declare-2.6.pkg | 2023-10-08 06:40 | 5.9K | |
| p5-HTML-Defang-1.07.pkg | 2023-10-08 13:32 | 29K | |
| p5-HTML-Defaultify-1..> | 2023-10-08 19:33 | 19K | |
| p5-HTML-Diff-0.60_1,..> | 2023-10-14 06:05 | 6.7K | |
| p5-HTML-Display-0.40..> | 2023-10-07 10:26 | 26K | |
| p5-HTML-Element-Exte..> | 2023-10-06 15:01 | 28K | |
| p5-HTML-Element-Libr..> | 2023-10-06 17:28 | 32K | |
| p5-HTML-Element-Repl..> | 2023-10-08 09:37 | 4.0K | |
| p5-HTML-Email-Obfusc..> | 2023-10-07 11:48 | 7.3K | |
| p5-HTML-Encoding-0.6..> | 2023-10-06 15:40 | 16K | |
| p5-HTML-Entities-Imo..> | 2023-10-08 23:10 | 9.5K | |
| p5-HTML-Entities-Int..> | 2023-10-06 19:24 | 3.7K | |
| p5-HTML-Entities-Num..> | 2023-10-14 06:50 | 7.9K | |
| p5-HTML-Escape-1.11.pkg | 2023-10-07 21:26 | 6.7K | |
| p5-HTML-EscapeEvil-0..> | 2023-10-09 17:14 | 8.0K | |
| p5-HTML-ExtractConte..> | 2023-10-10 23:16 | 7.4K | |
| p5-HTML-ExtractMain-..> | 2023-10-09 18:25 | 5.5K | |
| p5-HTML-Field-1.19_1..> | 2023-10-14 15:10 | 18K | |
| p5-HTML-FillInForm-2..> | 2023-10-06 15:17 | 13K | |
| p5-HTML-FillInForm-F..> | 2023-10-10 19:42 | 3.8K | |
| p5-HTML-FillInForm-L..> | 2023-10-06 19:30 | 21K | |
| p5-HTML-Form-6.11.pkg | 2023-10-05 16:56 | 28K | |
| p5-HTML-FormFu-2.07.pkg | 2023-10-06 21:48 | 371K | |
| p5-HTML-FormFu-Image..> | 2023-10-14 18:52 | 9.0K | |
| p5-HTML-FormFu-Model..> | 2023-10-08 03:02 | 24K | |
| p5-HTML-FormFu-Multi..> | 2023-10-07 02:59 | 7.9K | |
| p5-HTML-FormHandler-..> | 2023-10-07 09:41 | 418K | |
| p5-HTML-FormHandler-..> | 2023-10-08 14:47 | 23K | |
| p5-HTML-Format-2.12.pkg | 2023-10-06 15:19 | 37K | |
| p5-HTML-FormatExtern..> | 2023-10-07 08:24 | 38K | |
| p5-HTML-FormatText-W..> | 2023-10-06 22:45 | 7.9K | |
| p5-HTML-FormatText-W..> | 2023-10-07 08:04 | 7.8K | |
| p5-HTML-Fraction-0.5..> | 2023-10-07 18:47 | 4.6K | |
| p5-HTML-FromANSI-2.0..> | 2023-10-11 01:14 | 10K | |
| p5-HTML-FromANSI-Tin..> | 2023-10-07 13:44 | 9.9K | |
| p5-HTML-FromText-2.0..> | 2023-10-06 15:20 | 13K | |
| p5-HTML-GenToc-3.20_..> | 2023-10-08 15:18 | 38K | |
| p5-HTML-GenerateUtil..> | 2023-10-07 17:57 | 18K | |
| p5-HTML-GoogleMaps-1..> | 2023-10-09 13:02 | 8.1K | |
| p5-HTML-Gumbo-0.18_1..> | 2023-10-07 01:49 | 17K | |
| p5-HTML-HTML5-Entiti..> | 2023-10-07 13:35 | 18K | |
| p5-HTML-HTML5-Parser..> | 2023-10-14 08:47 | 80K | |
| p5-HTML-HTMLDoc-0.10..> | 2023-10-09 19:17 | 17K | |
| p5-HTML-Highlight-0...> | 2023-10-09 03:22 | 7.9K | |
| p5-HTML-LinkExtracto..> | 2023-10-07 14:12 | 10K | |
| p5-HTML-LinkList-0.1..> | 2023-10-07 12:30 | 18K | |
| p5-HTML-Lint-2.32.pkg | 2023-10-06 22:54 | 27K | |
| p5-HTML-Location-1.0..> | 2023-10-07 10:07 | 7.3K | |
| p5-HTML-Macro-1.30.pkg | 2023-10-14 06:08 | 27K | |
| p5-HTML-Mason-1.60.pkg | 2023-10-06 19:22 | 300K | |
| p5-HTML-Mason-PSGIHa..> | 2023-10-07 06:51 | 4.7K | |
| p5-HTML-MobileConver..> | 2023-10-08 22:55 | 5.3K | |
| p5-HTML-Packer-2.10.pkg | 2023-10-10 16:58 | 8.2K | |
| p5-HTML-Pager-0.03_1..> | 2023-10-09 12:40 | 12K | |
| p5-HTML-Parser-3.81.pkg | 2023-10-05 16:53 | 76K | |
| p5-HTML-Parser-Simpl..> | 2023-10-10 11:15 | 25K | |
| p5-HTML-Perlinfo-1.6..> | 2023-10-08 21:48 | 42K | |
| p5-HTML-PrettyPrinte..> | 2023-10-07 17:57 | 20K | |
| p5-HTML-Prototype-1...> | 2023-10-07 08:19 | 62K | |
| p5-HTML-QRCode-0.01_..> | 2023-10-09 18:07 | 3.5K | |
| p5-HTML-Query-0.09_1..> | 2023-10-07 10:41 | 21K | |
| p5-HTML-QuickCheck-1..> | 2023-10-08 21:55 | 5.3K | |
| p5-HTML-Quoted-0.05.pkg | 2023-10-07 09:27 | 5.3K | |
| p5-HTML-RSSAutodisco..> | 2023-10-07 20:29 | 6.7K | |
| p5-HTML-ResolveLink-..> | 2023-10-08 04:13 | 4.6K | |
| p5-HTML-Restrict-3.0..> | 2023-10-10 00:22 | 14K | |
| p5-HTML-RewriteAttri..> | 2023-10-06 23:42 | 10K | |
| p5-HTML-RobotsMETA-0..> | 2023-10-07 05:37 | 6.0K | |
| p5-HTML-SBC-0.15_2.pkg | 2023-10-10 19:48 | 12K | |
| p5-HTML-Scrubber-0.1..> | 2023-10-06 17:57 | 14K | |
| p5-HTML-Seamstress-6..> | 2023-10-14 05:27 | 59K | |
| p5-HTML-Selector-XPa..> | 2023-10-05 17:07 | 7.6K | |
| p5-HTML-Shakan-2.10_..> | 2023-10-11 20:29 | 55K | |
| p5-HTML-SimpleLinkEx..> | 2023-10-06 20:02 | 10K | |
| p5-HTML-SimpleParse-..> | 2023-10-07 17:07 | 10K | |
| p5-HTML-StickyQuery-..> | 2023-10-07 06:02 | 6.5K | |
| p5-HTML-StickyQuery-..> | 2023-10-14 17:16 | 4.7K | |
| p5-HTML-Stream-1.60_..> | 2023-10-08 04:30 | 27K | |
| p5-HTML-Strip-2.12.pkg | 2023-10-07 10:55 | 14K | |
| p5-HTML-StripScripts..> | 2023-10-07 05:15 | 26K | |
| p5-HTML-StripScripts..> | 2023-10-07 22:59 | 4.9K | |
| p5-HTML-Summary-0.02..> | 2023-10-08 02:15 | 13K | |
| p5-HTML-SuperForm-1...> | 2023-10-06 21:20 | 30K | |
| p5-HTML-T5-0.013.pkg | 2023-10-07 16:48 | 19K | |
| p5-HTML-Table-2.08a_..> | 2023-10-08 03:21 | 24K | |
| p5-HTML-TableContent..> | 2023-10-14 10:34 | 7.7K | |
| p5-HTML-TableExtract..> | 2023-10-06 18:14 | 24K | |
| p5-HTML-TableLayout-..> | 2023-10-08 16:48 | 24K | |
| p5-HTML-TableParser-..> | 2023-10-11 02:34 | 21K | |
| p5-HTML-TableTiler-1..> | 2023-10-07 13:19 | 9.8K | |
| p5-HTML-TagCloud-0.3..> | 2023-10-08 04:31 | 6.5K | |
| p5-HTML-TagCloud-Ext..> | 2023-10-10 05:09 | 8.4K | |
| p5-HTML-TagFilter-1...> | 2023-10-09 17:50 | 21K | |
| p5-HTML-TagParser-0...> | 2023-10-07 23:21 | 9.9K | |
| p5-HTML-Tagset-3.20_..> | 2023-10-05 16:51 | 9.2K | |
| p5-HTML-Template-2.9..> | 2023-10-05 17:12 | 53K | |
| p5-HTML-Template-Ass..> | 2023-10-14 02:54 | 16K | |
| p5-HTML-Template-Com..> | 2023-10-07 19:02 | 88K | |
| p5-HTML-Template-Exp..> | 2023-10-08 21:18 | 11K | |
| p5-HTML-Template-Has..> | 2023-10-08 11:42 | 5.5K | |
| p5-HTML-Template-JIT..> | 2023-10-10 07:10 | 17K | |
| p5-HTML-Template-Plu..> | 2023-10-07 14:53 | 16K | |
| p5-HTML-Template-Pro..> | 2023-10-14 16:40 | 80K | |
| p5-HTML-Tidy-1.60.pkg | 2023-10-08 03:38 | 17K | |
| p5-HTML-Tidy5-1.06.pkg | 2023-10-09 00:25 | 18K | |
| p5-HTML-Tiny-1.05_1.pkg | 2023-10-07 15:13 | 14K | |
| p5-HTML-Toc-1.12_1.pkg | 2023-10-07 18:43 | 29K | |
| p5-HTML-TokeParser-S..> | 2023-10-06 17:24 | 28K | |
| p5-HTML-Tree-5.07.pkg | 2023-10-05 16:58 | 191K | |
| p5-HTML-TreeBuilder-..> | 2023-10-06 14:01 | 11K | |
| p5-HTML-TreeBuilder-..> | 2023-10-05 17:06 | 9.1K | |
| p5-HTML-Truncate-0.2..> | 2023-10-11 02:40 | 13K | |
| p5-HTML-Widgets-Sele..> | 2023-10-14 12:42 | 9.6K | |
| p5-HTML-WikiConverte..> | 2023-10-07 19:55 | 43K | |
| p5-HTML-WikiConverte..> | 2023-10-14 15:36 | 5.0K | |
| p5-HTML-WikiConverte..> | 2023-10-08 11:59 | 6.0K | |
| p5-HTML-WikiConverte..> | 2023-10-14 17:39 | 4.0K | |
| p5-HTML-WikiConverte..> | 2023-10-09 05:43 | 8.3K | |
| p5-HTML-WikiConverte..> | 2023-10-11 01:02 | 7.7K | |
| p5-HTML-WikiConverte..> | 2023-10-09 10:57 | 5.5K | |
| p5-HTML-WikiConverte..> | 2023-10-10 02:35 | 5.1K | |
| p5-HTML-WikiConverte..> | 2023-10-09 02:50 | 5.2K | |
| p5-HTML-WikiConverte..> | 2023-10-08 16:03 | 4.3K | |
| p5-HTML-WikiConverte..> | 2023-10-09 10:48 | 4.5K | |
| p5-HTML-WikiConverte..> | 2023-10-09 17:14 | 4.0K | |
| p5-HTML-WikiConverte..> | 2023-10-11 03:39 | 4.4K | |
| p5-HTML-WikiConverte..> | 2023-10-11 16:09 | 4.2K | |
| p5-HTML-WikiConverte..> | 2023-10-08 19:10 | 4.1K | |
| p5-HTML-WikiConverte..> | 2023-10-09 22:00 | 4.2K | |
| p5-HTML-WikiConverte..> | 2023-10-14 16:41 | 4.3K | |
| p5-HTML5-DOM-1.25.pkg | 2023-10-10 17:34 | 456K | |
| p5-HTTP-AnyUA-0.904.pkg | 2023-10-12 02:07 | 50K | |
| p5-HTTP-Async-0.33.pkg | 2023-10-08 01:51 | 18K | |
| p5-HTTP-Body-1.22.pkg | 2023-10-06 14:17 | 17K | |
| p5-HTTP-BrowserDetec..> | 2023-10-06 21:55 | 33K | |
| p5-HTTP-Cache-Transp..> | 2023-10-06 20:34 | 9.4K | |
| p5-HTTP-CookieJar-0...> | 2023-10-05 16:53 | 12K | |
| p5-HTTP-Cookies-6.10..> | 2023-10-05 16:53 | 20K | |
| p5-HTTP-Cookies-Mozi..> | 2023-10-14 12:10 | 6.0K | |
| p5-HTTP-Cookies-iCab..> | 2023-10-11 00:20 | 4.2K | |
| p5-HTTP-Cookies-w3m-..> | 2023-10-10 05:21 | 3.0K | |
| p5-HTTP-DAV-0.49.pkg | 2023-10-09 22:46 | 84K | |
| p5-HTTP-Daemon-6.16.pkg | 2023-10-06 19:32 | 17K | |
| p5-HTTP-Daemon-SSL-1..> | 2023-10-09 14:38 | 5.8K | |
| p5-HTTP-Date-6.06.pkg | 2023-10-05 16:50 | 7.8K | |
| p5-HTTP-Engine-0.030..> | 2023-10-07 08:50 | 54K | |
| p5-HTTP-Engine-Middl..> | 2023-10-07 12:46 | 38K | |
| p5-HTTP-Entity-Parse..> | 2023-10-05 17:00 | 17K | |
| p5-HTTP-Exception-0...> | 2023-10-06 23:18 | 25K | |
| p5-HTTP-HeaderParser..> | 2023-10-07 23:16 | 18K | |
| p5-HTTP-Headers-Acti..> | 2023-10-06 22:58 | 58K | |
| p5-HTTP-Headers-Fast..> | 2023-10-05 17:00 | 8.6K | |
| p5-HTTP-Link-Parser-..> | 2023-10-07 17:24 | 7.8K | |
| p5-HTTP-Lite-2.44.pkg | 2023-10-05 17:03 | 14K | |
| p5-HTTP-MHTTP-0.15_1..> | 2023-10-10 07:38 | 18K | |
| p5-HTTP-Message-6.44..> | 2023-10-05 16:52 | 74K | |
| p5-HTTP-MobileAgent-..> | 2023-10-07 09:40 | 30K | |
| p5-HTTP-MobileAgent-..> | 2023-10-08 07:35 | 3.2K | |
| p5-HTTP-MobileAgent-..> | 2023-10-10 02:52 | 6.7K | |
| p5-HTTP-MultiPartPar..> | 2023-10-05 16:55 | 7.0K | |
| p5-HTTP-Negotiate-6...> | 2023-10-05 16:53 | 10K | |
| p5-HTTP-OAI-4.12_1.pkg | 2023-10-14 11:28 | 89K | |
| p5-HTTP-Parser-0.06_..> | 2023-10-06 21:34 | 7.4K | |
| p5-HTTP-Parser-XS-0...> | 2023-10-06 19:29 | 16K | |
| p5-HTTP-Proxy-0.304.pkg | 2023-10-07 08:50 | 77K | |
| p5-HTTP-ProxyPAC-0.3..> | 2023-10-14 17:28 | 13K | |
| p5-HTTP-Recorder-0.0..> | 2023-10-08 05:22 | 13K | |
| p5-HTTP-Request-AsCG..> | 2023-10-07 02:18 | 6.2K | |
| p5-HTTP-Request-Para..> | 2023-10-07 04:16 | 4.7K | |
| p5-HTTP-Response-Enc..> | 2023-10-08 03:34 | 5.2K | |
| p5-HTTP-Router-0.05_..> | 2023-10-14 15:33 | 16K | |
| p5-HTTP-Server-Simpl..> | 2023-10-06 14:05 | 19K | |
| p5-HTTP-Server-Simpl..> | 2023-10-10 08:46 | 4.2K | |
| p5-HTTP-Server-Simpl..> | 2023-10-14 11:47 | 8.1K | |
| p5-HTTP-Server-Simpl..> | 2023-10-06 18:18 | 4.2K | |
| p5-HTTP-Server-Simpl..> | 2023-10-07 09:28 | 5.5K | |
| p5-HTTP-Server-Simpl..> | 2023-10-07 18:38 | 6.0K | |
| p5-HTTP-Session-0.49..> | 2023-10-07 14:35 | 33K | |
| p5-HTTP-Session-Stat..> | 2023-10-10 12:12 | 3.6K | |
| p5-HTTP-Session-Stor..> | 2023-10-08 15:37 | 4.3K | |
| p5-HTTP-Session2-1.1..> | 2023-10-06 19:15 | 20K | |
| p5-HTTP-Simple-0.004..> | 2023-10-07 11:10 | 6.8K | |
| p5-HTTP-SimpleLinkCh..> | 2023-10-07 06:20 | 7.9K | |
| p5-HTTP-Size-1.153.pkg | 2023-10-07 07:12 | 5.8K | |
| p5-HTTP-Thin-0.006.pkg | 2023-10-07 09:32 | 4.1K | |
| p5-HTTP-Throwable-0...> | 2023-10-10 23:40 | 97K | |
| p5-HTTP-Tiny-0.088.pkg | 2023-10-06 23:05 | 30K | |
| p5-HTTP-Tiny-Multipa..> | 2023-10-07 00:31 | 4.1K | |
| p5-HTTP-Tiny-SPDY-0...> | 2023-10-09 02:09 | 7.0K | |
| p5-HTTP-Tiny-UA-0.00..> | 2023-10-07 06:36 | 8.7K | |
| p5-HTTP-Tiny-UNIX-0...> | 2023-10-09 16:51 | 4.7K | |
| p5-HTTP-WebTest-2.04..> | 2023-10-10 16:21 | 105K | |
| p5-HTTP-XSCookies-0...> | 2023-10-06 15:49 | 13K | |
| p5-HTTPD-Log-Filter-..> | 2023-10-09 13:00 | 11K | |
| p5-HTTPD-User-Manage..> | 2023-10-08 16:13 | 51K | |
| p5-Hailo-0.75.pkg | 2023-10-07 05:40 | 63K | |
| p5-Hash-AsObject-0.1..> | 2023-10-07 23:29 | 8.1K | |
| p5-Hash-AutoHash-1.1..> | 2023-10-06 23:38 | 26K | |
| p5-Hash-AutoHash-Arg..> | 2023-10-08 05:06 | 23K | |
| p5-Hash-Case-1.030.pkg | 2023-10-06 20:23 | 13K | |
| p5-Hash-Diff-0.007.pkg | 2023-10-10 00:27 | 3.4K | |
| p5-Hash-FieldHash-0...> | 2023-10-09 05:07 | 13K | |
| p5-Hash-Flatten-1.19..> | 2023-10-06 16:38 | 7.9K | |
| p5-Hash-Merge-0.302.pkg | 2023-10-05 16:55 | 9.7K | |
| p5-Hash-Merge-Simple..> | 2023-10-06 16:13 | 5.0K | |
| p5-Hash-MoreUtils-0...> | 2023-10-06 19:18 | 7.9K | |
| p5-Hash-MultiKey-0.0..> | 2023-10-08 21:43 | 8.7K | |
| p5-Hash-MultiValue-0..> | 2023-10-05 16:55 | 10K | |
| p5-Hash-NoRef-0.03_2..> | 2023-10-10 19:58 | 6.4K | |
| p5-Hash-Objectify-0...> | 2023-10-10 10:41 | 6.7K | |
| p5-Hash-Ordered-0.01..> | 2023-10-06 15:10 | 24K | |
| p5-Hash-Slice-0.03.pkg | 2023-10-07 23:15 | 5.2K | |
| p5-Hash-Union-0.03_1..> | 2023-10-10 13:08 | 5.9K | |
| p5-Hash-Util-FieldHa..> | 2023-10-06 15:18 | 6.6K | |
| p5-Hash-WithDefaults..> | 2023-10-06 18:37 | 6.1K | |
| p5-Hatena-Keyword-0...> | 2023-10-09 12:54 | 7.9K | |
| p5-Heap-0.80_1.pkg | 2023-10-05 17:06 | 30K | |
| p5-Heap-Simple-0.13_..> | 2023-10-08 06:03 | 24K | |
| p5-Heap-Simple-Perl-..> | 2023-10-14 04:15 | 13K | |
| p5-Heap-Simple-XS-0...> | 2023-10-12 05:07 | 29K | |
| p5-Heimdal-Kadm5-0.0..> | 2023-10-10 04:05 | 25K | |
| p5-Hijk-0.28.pkg | 2023-10-07 06:05 | 17K | |
| p5-Hook-LexWrap-0.26..> | 2023-10-06 18:34 | 9.1K | |
| p5-I18N-AcceptLangua..> | 2023-10-09 07:50 | 9.8K | |
| p5-I18N-Charset-1.39..> | 2023-10-07 21:14 | 24K | |
| p5-I18N-LangTags-0.3..> | 2023-10-11 06:15 | 42K | |
| p5-IMAP-Admin-1.6.8.pkg | 2023-10-14 13:33 | 14K | |
| p5-IMAP-Client-0.13_..> | 2023-10-10 23:19 | 48K | |
| p5-IMAP-Sieve-0.4.9_..> | 2023-10-10 22:17 | 3.6K | |
| p5-IMDB-Film-0.53_1.pkg | 2023-10-10 08:49 | 26K | |
| p5-IO-AIO-4.80.pkg | 2023-10-06 14:08 | 106K | |
| p5-IO-All-0.87.pkg | 2023-10-06 21:57 | 55K | |
| p5-IO-All-LWP-0.14_2..> | 2023-10-08 22:19 | 13K | |
| p5-IO-Any-0.09_2.pkg | 2023-10-08 22:45 | 8.5K | |
| p5-IO-Async-0.802.pkg | 2023-10-07 04:32 | 252K | |
| p5-IO-Async-Resolver..> | 2023-10-08 02:49 | 9.0K | |
| p5-IO-Async-SSL-0.25..> | 2023-10-08 05:32 | 12K | |
| p5-IO-BufferedSelect..> | 2023-10-08 09:14 | 5.4K | |
| p5-IO-CSVHeaderFile-..> | 2023-10-10 13:02 | 4.9K | |
| p5-IO-Callback-2.00.pkg | 2023-10-14 14:16 | 11K | |
| p5-IO-Capture-0.05_1..> | 2023-10-07 01:53 | 25K | |
| p5-IO-CaptureOutput-..> | 2023-10-06 23:05 | 9.3K | |
| p5-IO-Compress-2.206..> | 2023-10-06 19:14 | 204K | |
| p5-IO-Compress-Brotl..> | 2023-10-07 16:12 | 276K | |
| p5-IO-Compress-Lzf-2..> | 2023-10-14 05:24 | 26K | |
| p5-IO-Compress-Lzma-..> | 2023-10-07 14:22 | 58K | |
| p5-IO-Compress-Lzop-..> | 2023-10-10 20:32 | 28K | |
| p5-IO-Digest-0.11_2.pkg | 2023-10-06 18:19 | 3.1K | |
| p5-IO-Event-0.813_1.pkg | 2023-10-07 04:07 | 27K | |
| p5-IO-FDPass-1.3.pkg | 2023-10-06 22:27 | 8.3K | |
| p5-IO-File-AtomicCha..> | 2023-10-07 03:24 | 6.5K | |
| p5-IO-HTML-1.004.pkg | 2023-10-05 16:50 | 13K | |
| p5-IO-Handle-Util-0...> | 2023-10-06 19:20 | 21K | |
| p5-IO-Interactive-1...> | 2023-10-06 16:48 | 7.9K | |
| p5-IO-Interface-1.09..> | 2023-10-06 14:36 | 19K | |
| p5-IO-KQueue-0.39.pkg | 2023-10-07 00:36 | 12K | |
| p5-IO-Lambda-1.23_1.pkg | 2023-10-08 21:50 | 124K | |
| p5-IO-LockedFile-0.2..> | 2023-10-07 04:47 | 11K | |
| p5-IO-MultiPipe-0.0...> | 2023-10-10 14:57 | 5.1K | |
| p5-IO-Multiplex-1.16..> | 2023-10-06 22:39 | 15K | |
| p5-IO-NestedCapture-..> | 2023-10-10 12:06 | 11K | |
| p5-IO-Null-1.01_1.pkg | 2023-10-07 22:34 | 4.8K | |
| p5-IO-Pager-2.10.pkg | 2023-10-06 23:51 | 49K | |
| p5-IO-Pipely-0.006.pkg | 2023-10-05 17:06 | 11K | |
| p5-IO-Prompt-0.99700..> | 2023-10-08 04:51 | 15K | |
| p5-IO-Prompt-Simple-..> | 2023-10-08 03:32 | 8.3K | |
| p5-IO-Prompt-Tiny-0...> | 2023-10-07 01:21 | 5.0K | |
| p5-IO-Prompter-0.004..> | 2023-10-14 12:20 | 55K | |
| p5-IO-Pty-Easy-0.10.pkg | 2023-10-07 15:04 | 7.8K | |
| p5-IO-SessionData-1...> | 2023-10-06 17:40 | 4.2K | |
| p5-IO-Socket-INET6-2..> | 2023-10-06 22:28 | 10K | |
| p5-IO-Socket-IP-0.42..> | 2023-10-05 16:51 | 21K | |
| p5-IO-Socket-Multica..> | 2023-10-07 10:04 | 15K | |
| p5-IO-Socket-Multica..> | 2023-10-07 14:46 | 13K | |
| p5-IO-Socket-SSL-2.0..> | 2023-10-05 16:52 | 179K | |
| p5-IO-Socket-Socks-0..> | 2023-10-08 07:04 | 22K | |
| p5-IO-Socket-Socks-W..> | 2023-10-14 12:27 | 16K | |
| p5-IO-Socket-Timeout..> | 2023-10-07 07:42 | 6.9K | |
| p5-IO-Socket-UNIX-Ut..> | 2023-10-07 10:59 | 4.2K | |
| p5-IO-String-1.08_1.pkg | 2023-10-05 17:06 | 7.5K | |
| p5-IO-Stringy-2.113.pkg | 2023-10-05 17:00 | 43K | |
| p5-IO-Stty-0.04.pkg | 2023-10-09 09:32 | 11K | |
| p5-IO-Tee-0.66.pkg | 2023-10-06 19:53 | 6.1K | |
| p5-IO-TieCombine-1.0..> | 2023-10-06 19:57 | 8.1K | |
| p5-IO-Toolkit-1.008_..> | 2023-10-07 12:10 | 8.4K | |
| p5-IO-Tty-1.17.pkg | 2023-10-05 17:04 | 27K | |
| p5-IO-Util-1.5_2,1.pkg | 2023-10-07 02:02 | 17K | |
| p5-IO-YAML-0.10_1.pkg | 2023-10-10 09:34 | 12K | |
| p5-IO-Zlib-1.14.pkg | 2023-10-08 19:46 | 9.6K | |
| p5-IOC-0.29_3.pkg | 2023-10-08 07:24 | 83K | |
| p5-IP-Anonymous-0.04..> | 2023-10-07 19:40 | 7.3K | |
| p5-IP-Country-2.28_1..> | 2023-10-07 06:38 | 261K | |
| p5-IPC-Cache-0.02_1.pkg | 2023-10-08 04:16 | 7.2K | |
| p5-IPC-Cmd-1.04.pkg | 2023-10-07 00:39 | 26K | |
| p5-IPC-DirQueue-1.0_..> | 2023-10-08 12:43 | 36K | |
| p5-IPC-Locker-1.502.pkg | 2023-10-08 07:29 | 43K | |
| p5-IPC-MM-0.03_1.pkg | 2023-10-14 12:14 | 20K | |
| p5-IPC-MMA-0.81_2.pkg | 2023-10-09 23:54 | 53K | |
| p5-IPC-Mmap-0.21_1.pkg | 2023-10-07 03:52 | 12K | |
| p5-IPC-Mmap-Share-0...> | 2023-10-10 04:02 | 6.4K | |
| p5-IPC-Open3-Simple-..> | 2023-10-09 07:17 | 6.1K | |
| p5-IPC-PerlSSH-0.17.pkg | 2023-10-11 06:41 | 32K | |
| p5-IPC-PubSub-0.29_2..> | 2023-10-14 10:10 | 10K | |
| p5-IPC-Run-20220807...> | 2023-10-06 15:01 | 103K | |
| p5-IPC-Run-SafeHandl..> | 2023-10-09 20:15 | 4.3K | |
| p5-IPC-Run3-0.048_1.pkg | 2023-10-06 16:21 | 27K | |
| p5-IPC-Session-0.05_..> | 2023-10-08 18:04 | 7.6K | |
| p5-IPC-ShareLite-0.1..> | 2023-10-06 15:29 | 18K | |
| p5-IPC-Shareable-1.1..> | 2023-10-09 09:33 | 24K | |
| p5-IPC-SharedCache-1..> | 2023-10-09 23:15 | 18K | |
| p5-IPC-ShellCmd-0.00..> | 2023-10-07 00:31 | 20K | |
| p5-IPC-Signal-1.00_1..> | 2023-10-06 14:53 | 3.8K | |
| p5-IPC-System-Simple..> | 2023-10-06 18:25 | 19K | |
| p5-IPv6-Address-0.20..> | 2023-10-10 02:07 | 12K | |
| p5-IRC-Bot-Hangman-0..> | 2023-10-14 11:14 | 39K | |
| p5-IRC-Utils-0.12_1.pkg | 2023-10-06 21:16 | 14K | |
| p5-IRI-0.011.pkg | 2023-10-06 21:11 | 8.0K | |
| p5-Ima-DBI-0.35_1.pkg | 2023-10-06 17:30 | 17K | |
| p5-Image-Base-1.17_1..> | 2023-10-07 17:16 | 15K | |
| p5-Image-Base-SVG-5.pkg | 2023-10-10 07:28 | 8.1K | |
| p5-Image-Caa-1.01_1.pkg | 2023-10-11 00:28 | 199K | |
| p5-Image-Compare-1.0..> | 2023-10-14 12:29 | 30K | |
| p5-Image-Delivery-0...> | 2023-10-10 03:46 | 14K | |
| p5-Image-ExifTool-12..> | 2023-10-07 01:40 | 3.5M | |
| p5-Image-ExifTool-de..> | 2023-10-14 16:45 | 3.6M | |
| p5-Image-Grab-1.4.2_..> | 2023-10-10 14:16 | 12K | |
| p5-Image-Heatmap-0.5..> | 2023-10-10 22:59 | 29K | |
| p5-Image-IPTCInfo-1...> | 2023-10-09 10:59 | 35K | |
| p5-Image-Imgur-0.01_..> | 2023-10-08 20:46 | 4.2K | |
| p5-Image-Imlib2-2.03..> | 2023-10-07 14:56 | 32K | |
| p5-Image-Info-1.44.pkg | 2023-10-08 01:55 | 63K | |
| p5-Image-LibExif-0.0..> | 2023-10-09 18:46 | 6.6K | |
| p5-Image-Magick-Iter..> | 2023-10-08 15:37 | 7.7K | |
| p5-Image-Math-Constr..> | 2023-10-08 03:21 | 7.5K | |
| p5-Image-MetaData-GQ..> | 2023-10-09 17:55 | 7.7K | |
| p5-Image-MetaData-JP..> | 2023-10-07 16:40 | 193K | |
| p5-Image-OCR-Tessera..> | 2023-10-14 05:40 | 9.9K | |
| p5-Image-PBMlib-2.00..> | 2023-10-08 08:26 | 21K | |
| p5-Image-PNG-Libpng-..> | 2023-10-07 00:43 | 115K | |
| p5-Image-PNG-QRCode-..> | 2023-10-08 21:29 | 24K | |
| p5-Image-Pngslimmer-..> | 2023-10-08 15:53 | 16K | |
| p5-Image-Sane-5_1.pkg | 2023-10-07 21:13 | 25K | |
| p5-Image-Scale-0.14_..> | 2023-10-12 04:19 | 40K | |
| p5-Image-Size-3.300.pkg | 2023-10-06 19:43 | 29K | |
| p5-Imager-1.019_1.pkg | 2023-10-06 20:31 | 793K | |
| p5-Imager-Graph-0.10..> | 2023-10-07 02:04 | 53K | |
| p5-Imager-Plot-0.09_..> | 2023-10-14 15:46 | 14K | |
| p5-Imager-QRCode-0.0..> | 2023-10-09 14:34 | 33K | |
| p5-Imlib2-1.0.0_12.pkg | 2023-10-09 19:59 | 15K | |
| p5-Import-Base-1.004..> | 2023-10-08 13:18 | 15K | |
| p5-Import-Into-1.002..> | 2023-10-05 17:06 | 8.2K | |
| p5-Importer-0.026.pkg | 2023-10-05 16:54 | 21K | |
| p5-Inline-0.86.pkg | 2023-10-06 19:14 | 70K | |
| p5-Inline-ASM-0.03_2..> | 2023-10-09 13:03 | 11K | |
| p5-Inline-C-0.82.pkg | 2023-10-07 07:42 | 66K | |
| p5-Inline-CPP-0.80.pkg | 2023-10-08 10:30 | 50K | |
| p5-Inline-Files-0.71..> | 2023-10-07 14:20 | 18K | |
| p5-Inline-Filters-0...> | 2023-10-09 08:18 | 9.0K | |
| p5-Inline-Java-0.540..> | 2023-10-08 13:08 | 127K | |
| p5-Inline-Python-0.5..> | 2023-10-09 00:57 | 39K | |
| p5-Inline-TT-0.07_1.pkg | 2023-10-08 01:12 | 7.2K | |
| p5-Inline-Tcl-0.09_1..> | 2023-10-12 10:28 | 11K | |
| p5-InlineX-C2XS-0.27..> | 2023-10-09 07:12 | 28K | |
| p5-InlineX-CPP2XS-0...> | 2023-10-09 17:02 | 27K | |
| p5-Input-Validator-0..> | 2023-10-14 15:46 | 35K | |
| p5-Interchange6-0.12..> | 2023-10-07 17:06 | 23K | |
| p5-Interchange6-Sche..> | 2023-10-07 07:12 | 183K | |
| p5-Interpolation-0.7..> | 2023-10-10 06:54 | 12K | |
| p5-Ioctl-0.81_1.pkg | 2023-10-08 08:10 | 7.6K | |
| p5-Iodef-Pb-Simple-0..> | 2023-10-10 00:29 | 28K | |
| p5-Iterator-0.03_2.pkg | 2023-10-07 07:00 | 16K | |
| p5-Iterator-DBI-0.02..> | 2023-10-08 21:34 | 5.8K | |
| p5-Iterator-File-1.0..> | 2023-10-10 04:32 | 22K | |
| p5-Iterator-IO-0.02_..> | 2023-10-09 20:59 | 8.6K | |
| p5-Iterator-Misc-0.0..> | 2023-10-09 15:24 | 7.7K | |
| p5-Iterator-Simple-0..> | 2023-10-06 17:53 | 11K | |
| p5-Iterator-Simple-L..> | 2023-10-06 22:08 | 5.2K | |
| p5-Iterator-Util-0.0..> | 2023-10-07 19:25 | 12K | |
| p5-JE-0.066_1.pkg | 2023-10-07 09:19 | 163K | |
| p5-JIRA-REST-0.023.pkg | 2023-10-08 02:41 | 16K | |
| p5-JQuery-1.06_2.pkg | 2023-10-11 05:11 | 289K | |
| p5-JSAN-0.07_8.pkg | 2023-10-08 16:25 | 10K | |
| p5-JSON-4.10.pkg | 2023-10-06 14:51 | 76K | |
| p5-JSON-API-1.1.1.pkg | 2023-10-09 13:54 | 9.6K | |
| p5-JSON-Any-1.40.pkg | 2023-10-06 16:58 | 11K | |
| p5-JSON-DWIW-0.47_1.pkg | 2023-10-10 02:29 | 53K | |
| p5-JSON-Hyper-0.011_..> | 2023-10-07 19:13 | 12K | |
| p5-JSON-MaybeXS-1.00..> | 2023-10-05 16:56 | 9.0K | |
| p5-JSON-PP-4.16.pkg | 2023-10-14 10:40 | 51K | |
| p5-JSON-Parse-0.62.pkg | 2023-10-06 18:54 | 76K | |
| p5-JSON-Path-1.0.3.pkg | 2023-10-07 04:11 | 25K | |
| p5-JSON-Pointer-0.07..> | 2023-10-11 02:15 | 17K | |
| p5-JSON-RPC-1.06_1.pkg | 2023-10-07 12:07 | 52K | |
| p5-JSON-RPC-Common-0..> | 2023-10-09 19:41 | 43K | |
| p5-JSON-RPC-Dispatch..> | 2023-10-14 10:12 | 16K | |
| p5-JSON-Schema-0.016..> | 2023-10-09 19:05 | 24K | |
| p5-JSON-Tiny-0.58.pkg | 2023-10-14 05:42 | 10K | |
| p5-JSON-Validator-5...> | 2023-10-08 11:25 | 83K | |
| p5-JSON-WebToken-0.1..> | 2023-10-07 16:14 | 8.6K | |
| p5-JSON-XS-4.03.pkg | 2023-10-06 17:08 | 78K | |
| p5-JSON-XS-VersionOn..> | 2023-10-07 22:56 | 3.0K | |
| p5-Jabber-Lite-0.8.1..> | 2023-10-10 11:28 | 55K | |
| p5-Jabber-SimpleSend..> | 2023-10-10 10:05 | 4.3K | |
| p5-Java-4.7_5.pkg | 2023-10-07 13:00 | 51K | |
| p5-JavaScript-Minifi..> | 2023-10-07 13:09 | 7.7K | |
| p5-JavaScript-Minifi..> | 2023-10-07 01:09 | 11K | |
| p5-JavaScript-Packer..> | 2023-10-08 09:56 | 10K | |
| p5-JavaScript-RPC-0...> | 2023-10-09 12:27 | 7.8K | |
| p5-JavaScript-Squish..> | 2023-10-09 16:05 | 17K | |
| p5-JavaScript-Value-..> | 2023-10-07 20:55 | 4.9K | |
| p5-Jemplate-0.300.pkg | 2023-10-07 20:26 | 53K | |
| p5-Jifty-1.50430.pkg | 2023-10-08 09:20 | 1.2M | |
| p5-Jifty-DBI-0.78.pkg | 2023-10-07 03:35 | 147K | |
| p5-Jonk-0.05_1.pkg | 2023-10-10 22:04 | 17K | |
| p5-Kafka-0.8010_2.pkg | 2023-10-10 01:52 | 81K | |
| p5-Keyword-Declare-0..> | 2023-10-07 22:42 | 47K | |
| p5-Keyword-Pluggable..> | 2023-10-07 12:54 | 9.6K | |
| p5-Keyword-Simple-0...> | 2023-10-07 03:56 | 8.4K | |
| p5-KinoSearch1-1.01_..> | 2023-10-08 08:00 | 250K | |
| p5-Kwalify-1.23.pkg | 2023-10-08 09:13 | 13K | |
| p5-KyotoCabinet-1.20..> | 2023-10-08 14:44 | 42K | |
| p5-LEGO-RCX-1.01_1.pkg | 2023-10-10 04:10 | 12K | |
| p5-LMAP-CID2SPF-0.9_..> | 2023-10-10 17:12 | 3.2K | |
| p5-LMDB_File-0.12.pkg | 2023-10-10 20:59 | 49K | |
| p5-LV-0.006_1.pkg | 2023-10-06 21:39 | 5.9K | |
| p5-LWP-Authen-Negoti..> | 2023-10-09 11:35 | 6.5K | |
| p5-LWP-Authen-OAuth-..> | 2023-10-08 15:00 | 7.0K | |
| p5-LWP-Authen-OAuth2..> | 2023-10-09 16:50 | 83K | |
| p5-LWP-Authen-Wsse-0..> | 2023-10-14 05:09 | 4.6K | |
| p5-LWP-ConnCache-Max..> | 2023-10-07 19:26 | 3.2K | |
| p5-LWP-MediaTypes-6...> | 2023-10-05 16:50 | 17K | |
| p5-LWP-Online-1.08_1..> | 2023-10-09 21:54 | 9.4K | |
| p5-LWP-Protocol-PSGI..> | 2023-10-09 19:52 | 8.4K | |
| p5-LWP-Protocol-conn..> | 2023-10-08 06:52 | 4.9K | |
| p5-LWP-Protocol-http..> | 2023-10-14 10:38 | 5.5K | |
| p5-LWP-Protocol-http..> | 2023-10-06 18:16 | 4.9K | |
| p5-LWP-Protocol-sock..> | 2023-10-09 10:57 | 7.5K | |
| p5-LWP-UserAgent-Cac..> | 2023-10-07 12:32 | 9.2K | |
| p5-LWP-UserAgent-Det..> | 2023-10-07 09:12 | 6.7K | |
| p5-LWP-UserAgent-POE..> | 2023-10-08 19:39 | 6.0K | |
| p5-LWP-UserAgent-Wit..> | 2023-10-14 08:39 | 3.6K | |
| p5-LWPx-ParanoidAgen..> | 2023-10-08 11:00 | 15K | |
| p5-LWPx-TimedHTTP-1...> | 2023-10-08 16:48 | 8.2K | |
| p5-LaTeX-Driver-1.2...> | 2023-10-07 15:41 | 29K | |
| p5-LaTeX-Encode-0.09..> | 2023-10-07 15:41 | 19K | |
| p5-LaTeX-Pod-0.23.pkg | 2023-10-14 13:51 | 11K | |
| p5-LaTeX-TOM-1.06.pkg | 2023-10-07 12:46 | 27K | |
| p5-LaTeX-Table-1.0.6..> | 2023-10-11 06:30 | 66K | |
| p5-LaTeX-ToUnicode-0..> | 2023-10-07 15:34 | 10K | |
| p5-LaTeXML-0.8.7.pkg | 2023-10-14 17:10 | 2.1M | |
| p5-Layout-Manager-0...> | 2023-10-08 04:56 | 23K | |
| p5-Lchown-1.01_2.pkg | 2023-10-07 10:21 | 6.4K | |
| p5-Lexical-Alias-0.0..> | 2023-10-08 04:29 | 7.6K | |
| p5-Lexical-Import-0...> | 2023-10-10 06:24 | 11K | |
| p5-Lexical-Persisten..> | 2023-10-06 15:54 | 13K | |
| p5-Lexical-SealRequi..> | 2023-10-07 20:33 | 13K | |
| p5-Lexical-Var-0.010..> | 2023-10-05 17:11 | 20K | |
| p5-Library-CallNumbe..> | 2023-10-08 13:48 | 9.0K | |
| p5-Lingua-Conjunctio..> | 2023-10-10 22:15 | 7.0K | |
| p5-Lingua-DetectCyri..> | 2023-10-10 12:25 | 24K | |
| p5-Lingua-EN-Address..> | 2023-10-09 09:12 | 26K | |
| p5-Lingua-EN-Fathom-..> | 2023-10-09 08:47 | 9.5K | |
| p5-Lingua-EN-FindNum..> | 2023-10-05 16:56 | 4.2K | |
| p5-Lingua-EN-Gender-..> | 2023-10-14 06:40 | 3.9K | |
| p5-Lingua-EN-Infinit..> | 2023-10-14 03:41 | 11K | |
| p5-Lingua-EN-Inflect..> | 2023-10-05 16:58 | 46K | |
| p5-Lingua-EN-Inflect..> | 2023-10-05 17:06 | 4.2K | |
| p5-Lingua-EN-Inflect..> | 2023-10-06 15:13 | 6.6K | |
| p5-Lingua-EN-MatchNa..> | 2023-10-09 04:23 | 6.1K | |
| p5-Lingua-EN-NameCas..> | 2023-10-09 08:47 | 8.1K | |
| p5-Lingua-EN-NamePar..> | 2023-10-07 23:47 | 24K | |
| p5-Lingua-EN-NamedEn..> | 2023-10-10 14:43 | 1.2M | |
| p5-Lingua-EN-Nicknam..> | 2023-10-07 16:37 | 26K | |
| p5-Lingua-EN-Number-..> | 2023-10-05 17:06 | 4.0K | |
| p5-Lingua-EN-Numbers..> | 2023-10-07 20:19 | 7.5K | |
| p5-Lingua-EN-Numbers..> | 2023-10-08 18:37 | 5.1K | |
| p5-Lingua-EN-Numbers..> | 2023-10-06 22:20 | 5.0K | |
| p5-Lingua-EN-PluralT..> | 2023-10-07 00:00 | 11K | |
| p5-Lingua-EN-Sentenc..> | 2023-10-07 10:11 | 10K | |
| p5-Lingua-EN-Squeeze..> | 2023-10-08 22:46 | 16K | |
| p5-Lingua-EN-Summari..> | 2023-10-14 09:47 | 7.5K | |
| p5-Lingua-EN-Syllabl..> | 2023-10-08 03:03 | 4.8K | |
| p5-Lingua-EN-Tagger-..> | 2023-10-05 17:04 | 446K | |
| p5-Lingua-EN-Words2N..> | 2023-10-05 16:54 | 5.5K | |
| p5-Lingua-Han-PinYin..> | 2023-10-09 09:57 | 129K | |
| p5-Lingua-Han-Utils-..> | 2023-10-07 18:55 | 4.9K | |
| p5-Lingua-Ident-1.7_..> | 2023-10-08 19:57 | 9.0K | |
| p5-Lingua-Identify-0..> | 2023-10-14 10:55 | 117K | |
| p5-Lingua-Ispell-0.0..> | 2023-10-10 19:54 | 11K | |
| p5-Lingua-JA-Fold-0...> | 2023-10-10 04:54 | 6.6K | |
| p5-Lingua-JA-Romaniz..> | 2023-10-08 17:01 | 67K | |
| p5-Lingua-KO-Hangul-..> | 2023-10-07 12:24 | 9.8K | |
| p5-Lingua-KO-Romaniz..> | 2023-10-07 12:42 | 4.7K | |
| p5-Lingua-PT-Stemmer..> | 2023-10-05 16:54 | 7.2K | |
| p5-Lingua-Preferred-..> | 2023-10-06 19:16 | 6.4K | |
| p5-Lingua-RU-Charset..> | 2023-10-09 23:23 | 5.1K | |
| p5-Lingua-Stem-2.31.pkg | 2023-10-05 16:58 | 42K | |
| p5-Lingua-Stem-Fr-0...> | 2023-10-05 16:54 | 7.4K | |
| p5-Lingua-Stem-It-0...> | 2023-10-05 16:54 | 6.1K | |
| p5-Lingua-Stem-Ru-0...> | 2023-10-05 16:54 | 5.2K | |
| p5-Lingua-Stem-Snowb..> | 2023-10-07 03:51 | 60K | |
| p5-Lingua-Stem-Snowb..> | 2023-10-05 16:54 | 4.7K | |
| p5-Lingua-Stem-Snowb..> | 2023-10-05 16:54 | 6.5K | |
| p5-Lingua-Stem-Snowb..> | 2023-10-05 16:55 | 6.4K | |
| p5-Lingua-StopWords-..> | 2023-10-07 01:56 | 14K | |
| p5-Lingua-Translit-0..> | 2023-10-07 11:04 | 22K | |
| p5-Lingua-Treebank-0..> | 2023-10-09 15:23 | 44K | |
| p5-Lingua-ZH-HanDete..> | 2023-10-10 00:34 | 4.6K | |
| p5-Lingua-ZH-Keyword..> | 2023-10-14 15:31 | 4.3K | |
| p5-Lingua-ZH-Numbers..> | 2023-10-14 12:18 | 7.9K | |
| p5-Lingua-ZH-Romaniz..> | 2023-10-08 04:29 | 111K | |
| p5-Lingua-ZH-Segment..> | 2023-10-09 17:15 | 3.2K | |
| p5-Lingua-ZH-Summari..> | 2023-10-09 23:38 | 4.8K | |
| p5-Lingua-ZH-TaBE-0...> | 2023-10-07 09:45 | 21K | |
| p5-Lingua-ZH-Toke-0...> | 2023-10-08 02:06 | 6.1K | |
| p5-Lingua-ZH-WordSeg..> | 2023-10-09 12:34 | 887K | |
| p5-Lingua-ZH-Wrap-0...> | 2023-10-07 15:04 | 4.5K | |
| p5-Linux-Cpuinfo-1.1..> | 2023-10-14 09:57 | 8.3K | |
| p5-List-AllUtils-0.1..> | 2023-10-06 22:28 | 31K | |
| p5-List-BinarySearch..> | 2023-10-06 17:41 | 19K | |
| p5-List-Compare-0.53..> | 2023-10-07 09:16 | 61K | |
| p5-List-Cycle-1.04.pkg | 2023-10-10 00:05 | 5.0K | |
| p5-List-Flatten-0.01..> | 2023-10-08 06:59 | 3.6K | |
| p5-List-Gen-0.974_1.pkg | 2023-10-08 11:58 | 121K | |
| p5-List-Group-1.3_1.pkg | 2023-10-09 00:39 | 3.7K | |
| p5-List-MoreUtils-0...> | 2023-10-05 16:56 | 35K | |
| p5-List-MoreUtils-XS..> | 2023-10-05 16:54 | 34K | |
| p5-List-Objects-Type..> | 2023-10-14 15:58 | 5.5K | |
| p5-List-Objects-With..> | 2023-10-07 10:13 | 72K | |
| p5-List-Pairwise-1.0..> | 2023-10-07 10:44 | 8.9K | |
| p5-List-Permutor-0.0..> | 2023-10-14 08:17 | 3.6K | |
| p5-List-PowerSet-0.0..> | 2023-10-14 18:39 | 4.4K | |
| p5-List-Regexp-1.04.pkg | 2023-10-09 16:46 | 8.3K | |
| p5-List-Rotation-Cyc..> | 2023-10-06 15:13 | 3.4K | |
| p5-List-SomeUtils-0...> | 2023-10-06 18:01 | 24K | |
| p5-List-SomeUtils-XS..> | 2023-10-06 15:19 | 25K | |
| p5-List-Uniq-0.20_1.pkg | 2023-10-14 08:22 | 5.2K | |
| p5-List-Util-Weighte..> | 2023-10-07 18:02 | 3.8K | |
| p5-List-UtilsBy-0.12..> | 2023-10-05 17:12 | 12K | |
| p5-List-UtilsBy-XS-0..> | 2023-10-07 07:00 | 17K | |
| p5-Locale-Codes-3.64..> | 2023-10-07 09:32 | 238K | |
| p5-Locale-Currency-F..> | 2023-10-07 19:24 | 12K | |
| p5-Locale-Geocode-1...> | 2023-10-10 05:48 | 51K | |
| p5-Locale-Maketext-1..> | 2023-10-09 17:56 | 81K | |
| p5-Locale-Maketext-F..> | 2023-10-07 04:51 | 8.8K | |
| p5-Locale-Maketext-G..> | 2023-10-06 22:04 | 28K | |
| p5-Locale-Maketext-L..> | 2023-10-07 00:17 | 81K | |
| p5-Locale-Maketext-S..> | 2023-10-10 16:09 | 8.2K | |
| p5-Locale-Msgfmt-0.1..> | 2023-10-10 08:03 | 7.9K | |
| p5-Locale-PGetText-0..> | 2023-10-08 13:27 | 6.5K | |
| p5-Locale-PO-0.27_1.pkg | 2023-10-07 01:07 | 10K | |
| p5-Locale-SubCountry..> | 2023-10-06 21:32 | 59K | |
| p5-Locale-US-3.04.pkg | 2023-10-10 08:43 | 4.7K | |
| p5-Locale-XGettext-0..> | 2023-10-08 04:18 | 38K | |
| p5-Locale-gettext-1...> | 2023-10-05 17:07 | 9.8K | |
| p5-Locale-libintl-1...> | 2023-10-05 17:07 | 692K | |
| p5-LockFile-Simple-0..> | 2023-10-07 09:21 | 15K | |
| p5-Log-Accounting-SV..> | 2023-10-08 13:06 | 8.6K | |
| p5-Log-Accounting-SV..> | 2023-10-10 18:03 | 3.6K | |
| p5-Log-Agent-1.005.pkg | 2023-10-07 02:05 | 96K | |
| p5-Log-Agent-Logger-..> | 2023-10-09 17:32 | 9.8K | |
| p5-Log-Any-1.717.pkg | 2023-10-06 17:22 | 71K | |
| p5-Log-Any-Adapter-D..> | 2023-10-08 20:52 | 3.4K | |
| p5-Log-Any-Adapter-L..> | 2023-10-08 10:35 | 4.2K | |
| p5-Log-Any-App-0.540..> | 2023-10-08 12:16 | 34K | |
| p5-Log-Any-IfLOG-0.0..> | 2023-10-07 18:28 | 5.2K | |
| p5-Log-Colorize-Help..> | 2023-10-10 19:32 | 8.0K | |
| p5-Log-Contextual-0...> | 2023-10-07 05:04 | 42K | |
| p5-Log-Defer-0.312.pkg | 2023-10-08 03:00 | 12K | |
| p5-Log-Dispatch-2.71..> | 2023-10-06 14:28 | 58K | |
| p5-Log-Dispatch-Arra..> | 2023-10-07 05:54 | 3.4K | |
| p5-Log-Dispatch-Arra..> | 2023-10-07 15:21 | 5.0K | |
| p5-Log-Dispatch-Colo..> | 2023-10-08 20:41 | 4.3K | |
| p5-Log-Dispatch-Conf..> | 2023-10-06 16:08 | 14K | |
| p5-Log-Dispatch-Conf..> | 2023-10-06 19:03 | 6.0K | |
| p5-Log-Dispatch-Conf..> | 2023-10-14 06:36 | 3.3K | |
| p5-Log-Dispatch-DBI-..> | 2023-10-09 19:59 | 4.4K | |
| p5-Log-Dispatch-Dir-..> | 2023-10-07 23:03 | 8.8K | |
| p5-Log-Dispatch-Emai..> | 2023-10-10 03:07 | 5.4K | |
| p5-Log-Dispatch-File..> | 2023-10-14 17:12 | 7.1K | |
| p5-Log-Dispatch-File..> | 2023-10-09 12:24 | 5.0K | |
| p5-Log-Dispatch-File..> | 2023-10-14 12:07 | 21K | |
| p5-Log-Dispatch-File..> | 2023-10-10 09:12 | 8.9K | |
| p5-Log-Dispatch-File..> | 2023-10-08 04:40 | 4.7K | |
| p5-Log-Dispatch-Perl..> | 2023-10-14 06:09 | 5.3K | |
| p5-Log-Dispatch-Scre..> | 2023-10-14 08:08 | 4.0K | |
| p5-Log-Dispatch-Scri..> | 2023-10-08 01:00 | 14K | |
| p5-Log-Dispatchouli-..> | 2023-10-08 00:27 | 21K | |
| p5-Log-Dump-0.14_1.pkg | 2023-10-08 03:11 | 10K | |
| p5-Log-Handler-0.90.pkg | 2023-10-07 10:41 | 75K | |
| p5-Log-Log4perl-1.57..> | 2023-10-06 15:46 | 331K | |
| p5-Log-Log4perl-Appe..> | 2023-10-10 11:18 | 6.0K | |
| p5-Log-Log4perl-Appe..> | 2023-10-08 12:58 | 3.6K | |
| p5-Log-Log4perl-Layo..> | 2023-10-08 03:55 | 11K | |
| p5-Log-Log4perl-Tiny..> | 2023-10-09 17:54 | 27K | |
| p5-Log-Message-0.08_..> | 2023-10-06 16:02 | 20K | |
| p5-Log-Message-Simpl..> | 2023-10-06 23:02 | 5.3K | |
| p5-Log-Minimal-0.19_..> | 2023-10-07 15:22 | 8.4K | |
| p5-Log-Procmail-0.14..> | 2023-10-08 19:58 | 9.3K | |
| p5-Log-Report-1.34.pkg | 2023-10-06 14:05 | 153K | |
| p5-Log-Report-Option..> | 2023-10-05 17:01 | 18K | |
| p5-Log-Simple-1.8_1.pkg | 2023-10-08 16:02 | 4.7K | |
| p5-Log-Syslog-Consta..> | 2023-10-08 04:18 | 4.6K | |
| p5-Log-Syslog-Fast-0..> | 2023-10-10 02:23 | 22K | |
| p5-Log-Trace-1.070_1..> | 2023-10-06 17:20 | 26K | |
| p5-Log-TraceMessages..> | 2023-10-06 16:25 | 5.3K | |
| p5-Log-ger-0.040.pkg | 2023-10-06 15:16 | 39K | |
| p5-Logfile-Rotate-1...> | 2023-10-09 20:43 | 9.7K | |
| p5-Long-Jump-0.00000..> | 2023-10-07 06:53 | 4.8K | |
| p5-Luka-1.08_2.pkg | 2023-10-10 11:04 | 25K | |
| p5-Lvalue-0.21_3.pkg | 2023-10-09 22:45 | 5.5K | |
| p5-MARC-Charset-1.35..> | 2023-10-07 14:16 | 473K | |
| p5-MARC-Lint-1.46_1.pkg | 2023-10-10 20:22 | 37K | |
| p5-MARC-Record-2.0.7..> | 2023-10-08 00:04 | 77K | |
| p5-MARC-XML-1.0.3_1.pkg | 2023-10-09 20:30 | 13K | |
| p5-MCE-1.888.pkg | 2023-10-07 22:14 | 257K | |
| p5-MCE-Shared-1.885.pkg | 2023-10-11 17:20 | 166K | |
| p5-MD5-2.03_1.pkg | 2023-10-07 20:00 | 2.9K | |
| p5-MIDI-0.83_1.pkg | 2023-10-12 03:18 | 91K | |
| p5-MIME-AltWords-0.1..> | 2023-10-11 05:41 | 21K | |
| p5-MIME-Base32-1.303..> | 2023-10-07 06:14 | 5.3K | |
| p5-MIME-Base64-3.16.pkg | 2023-10-14 05:38 | 16K | |
| p5-MIME-Base64-URLSa..> | 2023-10-07 03:25 | 3.8K | |
| p5-MIME-Charset-1.01..> | 2023-10-05 16:53 | 28K | |
| p5-MIME-EcoEncode-0...> | 2023-10-09 22:33 | 17K | |
| p5-MIME-EncWords-1.0..> | 2023-10-07 14:49 | 36K | |
| p5-MIME-Explode-0.39..> | 2023-10-08 10:01 | 18K | |
| p5-MIME-Lite-3.033.pkg | 2023-10-06 23:58 | 67K | |
| p5-MIME-Lite-HTML-1...> | 2023-10-08 03:15 | 17K | |
| p5-MIME-Lite-TT-0.02..> | 2023-10-10 07:32 | 3.7K | |
| p5-MIME-Lite-TT-HTML..> | 2023-10-10 19:29 | 5.7K | |
| p5-MIME-Tools-5.510,..> | 2023-10-06 17:02 | 180K | |
| p5-MIME-Types-2.24.pkg | 2023-10-06 16:07 | 57K | |
| p5-MKDoc-XML-0.75_2.pkg | 2023-10-06 20:14 | 48K | |
| p5-MLDBM-2.05_1.pkg | 2023-10-07 05:59 | 13K | |
| p5-MLDBM-Sync-0.30_1..> | 2023-10-07 15:21 | 12K | |
| p5-MP3-Find-0.07_1.pkg | 2023-10-11 18:04 | 28K | |
| p5-MP3-ID3v1Tag-1.11..> | 2023-10-08 00:11 | 7.8K | |
| p5-MP3-Info-1.26.pkg | 2023-10-07 22:38 | 29K | |
| p5-MP3-Tag-1.16.pkg | 2023-10-08 01:53 | 266K | |
| p5-MP3-Tag-Utils-0.0..> | 2023-10-14 06:01 | 8.5K | |
| p5-MP4-Info-1.13_2.pkg | 2023-10-08 01:02 | 12K | |
| p5-MPEG-ID3v2Tag-0.3..> | 2023-10-09 18:07 | 18K | |
| p5-MR-Tarantool-0.0...> | 2023-10-14 14:52 | 63K | |
| p5-MRO-Compat-0.15.pkg | 2023-10-05 16:49 | 7.9K | |
| p5-MRO-Define-0.02_1..> | 2023-10-07 21:22 | 7.0K | |
| p5-MRTG-Parse-0.03_1..> | 2023-10-09 12:50 | 6.2K | |
| p5-Mac-FileSpec-Unix..> | 2023-10-10 18:31 | 10K | |
| p5-Mac-Macbinary-0.0..> | 2023-10-14 18:05 | 6.0K | |
| p5-Mac-PropertyList-..> | 2023-10-11 06:18 | 23K | |
| p5-Mail-Address-Mobi..> | 2023-10-09 12:47 | 3.7K | |
| p5-Mail-Alias-1.15.pkg | 2023-10-08 18:45 | 8.2K | |
| p5-Mail-Audit-2.228.pkg | 2023-10-07 19:41 | 39K | |
| p5-Mail-Audit-Attach..> | 2023-10-08 16:51 | 7.8K | |
| p5-Mail-Authenticati..> | 2023-10-06 16:17 | 38K | |
| p5-Mail-Box-3.010.pkg | 2023-10-08 00:54 | 342K | |
| p5-Mail-Box-IMAP4-3...> | 2023-10-10 17:37 | 81K | |
| p5-Mail-Box-IMAP4-SS..> | 2023-10-14 03:42 | 5.2K | |
| p5-Mail-Box-POP3-3.0..> | 2023-10-10 23:35 | 43K | |
| p5-Mail-Box-Parser-C..> | 2023-10-08 18:41 | 14K | |
| p5-Mail-Bulkmail-3.1..> | 2023-10-10 08:20 | 105K | |
| p5-Mail-CheckUser-1...> | 2023-10-11 02:57 | 15K | |
| p5-Mail-DKIM-1.20230..> | 2023-10-06 20:18 | 137K | |
| p5-Mail-DMARC-1.2019..> | 2023-10-11 02:52 | 370K | |
| p5-Mail-DeliveryStat..> | 2023-10-08 17:17 | 20K | |
| p5-Mail-DomainKeys-1..> | 2023-10-08 11:26 | 8.8K | |
| p5-Mail-Ezmlm-0.08.2..> | 2023-10-14 17:32 | 28K | |
| p5-Mail-Field-Receiv..> | 2023-10-09 12:34 | 9.8K | |
| p5-Mail-FilterXML-0...> | 2023-10-10 22:37 | 5.2K | |
| p5-Mail-Folder-0.07_..> | 2023-10-14 14:09 | 46K | |
| p5-Mail-Freshmeat-1...> | 2023-10-08 15:56 | 8.2K | |
| p5-Mail-GnuPG-0.23.pkg | 2023-10-09 14:52 | 12K | |
| p5-Mail-Graph-0.14_8..> | 2023-10-11 02:40 | 25K | |
| p5-Mail-IMAPClient-3..> | 2023-10-07 15:08 | 146K | |
| p5-Mail-IMAPTalk-4.0..> | 2023-10-09 12:09 | 62K | |
| p5-Mail-LMLM-0.6807.pkg | 2023-10-09 01:26 | 47K | |
| p5-Mail-ListDetector..> | 2023-10-10 07:49 | 46K | |
| p5-Mail-Mbox-Message..> | 2023-10-07 15:53 | 29K | |
| p5-Mail-MboxParser-0..> | 2023-10-10 06:31 | 43K | |
| p5-Mail-Message-3.01..> | 2023-10-06 18:33 | 433K | |
| p5-Mail-OpenDKIM-420..> | 2023-10-10 13:38 | 47K | |
| p5-Mail-OpenRelay-Si..> | 2023-10-14 09:47 | 3.9K | |
| p5-Mail-POP3Client-2..> | 2023-10-08 03:11 | 16K | |
| p5-Mail-Procmail-1.0..> | 2023-10-09 15:27 | 15K | |
| p5-Mail-Procmailrc-1..> | 2023-10-08 13:08 | 16K | |
| p5-Mail-RBL-1.10_2.pkg | 2023-10-09 14:57 | 5.9K | |
| p5-Mail-RFC822-Addre..> | 2023-10-07 04:18 | 6.0K | |
| p5-Mail-SPF-2.9.0_5.pkg | 2023-10-06 22:37 | 121K | |
| p5-Mail-SRS-0.31_2.pkg | 2023-10-07 12:38 | 36K | |
| p5-Mail-SendEasy-1.2..> | 2023-10-07 20:09 | 16K | |
| p5-Mail-Sender-0.903..> | 2023-10-10 02:13 | 36K | |
| p5-Mail-Sendmail-0.8..> | 2023-10-05 17:02 | 18K | |
| p5-Mail-Spool-0.50_1..> | 2023-10-10 15:07 | 24K | |
| p5-Mail-Tools-2.21.pkg | 2023-10-05 16:54 | 73K | |
| p5-Mail-Transport-3...> | 2023-10-07 08:53 | 44K | |
| p5-Mail-Transport-Db..> | 2023-10-14 11:26 | 30K | |
| p5-Mail-Verify-0.02_..> | 2023-10-10 03:00 | 4.0K | |
| p5-Mail-Verp-0.06_1.pkg | 2023-10-09 18:02 | 5.1K | |
| p5-Mail-Webmail-Gmai..> | 2023-10-08 08:57 | 19K | |
| p5-Make-2.011.pkg | 2023-10-10 20:17 | 25K | |
| p5-Makefile-DOM-0.00..> | 2023-10-07 13:45 | 62K | |
| p5-Makefile-Parser-0..> | 2023-10-09 14:54 | 48K | |
| p5-Mango-1.30_2.pkg | 2023-10-10 05:10 | 65K | |
| p5-Markapl-0.14_1.pkg | 2023-10-09 08:07 | 16K | |
| p5-Markup-Perl-0.5_1..> | 2023-10-09 00:54 | 7.8K | |
| p5-Marpa-0.208_1.pkg | 2023-10-10 05:13 | 260K | |
| p5-Marpa-HTML-0.112_..> | 2023-10-10 04:35 | 48K | |
| p5-Marpa-PP-0.014_2.pkg | 2023-10-07 17:10 | 169K | |
| p5-Marpa-XS-1.008000..> | 2023-10-08 02:09 | 221K | |
| p5-Mason-2.24.pkg | 2023-10-09 10:01 | 152K | |
| p5-MasonX-Interp-Wit..> | 2023-10-14 04:49 | 21K | |
| p5-MasonX-Profiler-0..> | 2023-10-14 07:18 | 4.4K | |
| p5-MasonX-Request-Wi..> | 2023-10-10 22:37 | 12K | |
| p5-MasonX-WebApp-0.1..> | 2023-10-09 10:05 | 19K | |
| p5-Math-Algebra-Symb..> | 2023-10-09 07:53 | 40K | |
| p5-Math-Base36-0.14,..> | 2023-10-08 11:08 | 3.4K | |
| p5-Math-Base85-0.5.pkg | 2023-10-08 20:54 | 4.0K | |
| p5-Math-BaseCalc-1.0..> | 2023-10-10 19:13 | 5.8K | |
| p5-Math-BaseCnv-1.14..> | 2023-10-10 08:31 | 15K | |
| p5-Math-Bezier-0.01_..> | 2023-10-09 16:28 | 4.7K | |
| p5-Math-Bezier-Conve..> | 2023-10-07 07:43 | 5.9K | |
| p5-Math-BigInt-1.999..> | 2023-10-06 15:38 | 151K | |
| p5-Math-BigInt-FastC..> | 2023-10-10 03:19 | 10K | |
| p5-Math-BigInt-GMP-1..> | 2023-10-06 15:58 | 15K | |
| p5-Math-BigInt-Lite-..> | 2023-10-10 18:53 | 13K | |
| p5-Math-BigInt-Pari-..> | 2023-10-10 22:17 | 6.1K | |
| p5-Math-BigRat-0.262..> | 2023-10-08 06:31 | 25K | |
| p5-Math-CDF-0.1_2.pkg | 2023-10-07 11:48 | 47K | |
| p5-Math-Calc-Units-1..> | 2023-10-07 01:58 | 21K | |
| p5-Math-Cephes-0.530..> | 2023-10-08 13:41 | 190K | |
| p5-Math-Combinatoric..> | 2023-10-09 01:32 | 14K | |
| p5-Math-Complex-1.59..> | 2023-10-08 06:21 | 36K | |
| p5-Math-ConvexHull-1..> | 2023-10-10 12:52 | 5.8K | |
| p5-Math-Currency-0.5..> | 2023-10-09 19:01 | 29K | |
| p5-Math-Derivative-1..> | 2023-10-07 08:16 | 4.6K | |
| p5-Math-Evol-1.13.pkg | 2023-10-09 01:21 | 18K | |
| p5-Math-Expr-0.4_1.pkg | 2023-10-09 03:25 | 30K | |
| p5-Math-FFT-1.36.pkg | 2023-10-09 18:09 | 36K | |
| p5-Math-Financial-0...> | 2023-10-10 11:15 | 9.6K | |
| p5-Math-FixedPrecisi..> | 2023-10-08 06:55 | 5.6K | |
| p5-Math-Fleximal-0.0..> | 2023-10-09 22:41 | 9.4K | |
| p5-Math-GMP-2.25.pkg | 2023-10-06 22:40 | 25K | |
| p5-Math-GMPf-0.51.pkg | 2023-10-14 10:32 | 57K | |
| p5-Math-GMPq-0.55.pkg | 2023-10-14 04:30 | 50K | |
| p5-Math-GMPz-0.58.pkg | 2023-10-08 04:31 | 88K | |
| p5-Math-GSL-0.43_1.pkg | 2023-10-08 15:22 | 2.0M | |
| p5-Math-Geometry-0.0..> | 2023-10-09 18:12 | 4.8K | |
| p5-Math-Geometry-Pla..> | 2023-10-07 08:44 | 27K | |
| p5-Math-Geometry-Pla..> | 2023-10-06 21:58 | 25K | |
| p5-Math-Geometry-Pla..> | 2023-10-07 07:02 | 21K | |
| p5-Math-Geometry-Pla..> | 2023-10-06 22:26 | 9.7K | |
| p5-Math-Geometry-Vor..> | 2023-10-08 15:43 | 19K | |
| p5-Math-Gradient-0.0..> | 2023-10-09 18:34 | 5.6K | |
| p5-Math-Int64-0.54.pkg | 2023-10-06 22:56 | 32K | |
| p5-Math-Int128-0.22_..> | 2023-10-07 09:11 | 29K | |
| p5-Math-Interpolate-..> | 2023-10-09 20:34 | 11K | |
| p5-Math-Intersection..> | 2023-10-08 16:24 | 5.3K | |
| p5-Math-Logic-1.19_1..> | 2023-10-09 09:47 | 15K | |
| p5-Math-MPC-1.31_1.pkg | 2023-10-10 09:51 | 86K | |
| p5-Math-MPFR-4.27.pkg | 2023-10-08 03:35 | 151K | |
| p5-Math-Matrix-0.94.pkg | 2023-10-07 18:35 | 47K | |
| p5-Math-MatrixReal-2..> | 2023-10-07 02:47 | 63K | |
| p5-Math-NumberCrunch..> | 2023-10-09 01:36 | 68K | |
| p5-Math-Pari-2.01080..> | 2023-10-06 12:42 | 1.5M | |
| p5-Math-Polygon-1.10..> | 2023-10-08 04:28 | 34K | |
| p5-Math-Polygon-Tree..> | 2023-10-08 05:45 | 7.5K | |
| p5-Math-Polynomial-S..> | 2023-10-14 10:34 | 26K | |
| p5-Math-Prime-Util-0..> | 2023-10-06 17:05 | 400K | |
| p5-Math-Prime-Util-G..> | 2023-10-06 14:04 | 221K | |
| p5-Math-Prime-XS-0.2..> | 2023-10-09 14:40 | 11K | |
| p5-Math-ProvablePrim..> | 2023-10-06 22:14 | 15K | |
| p5-Math-RPN-1.11_1.pkg | 2023-10-14 02:46 | 11K | |
| p5-Math-Random-0.72.pkg | 2023-10-07 11:18 | 44K | |
| p5-Math-Random-ISAAC..> | 2023-10-06 22:38 | 14K | |
| p5-Math-Random-ISAAC..> | 2023-10-06 17:01 | 9.1K | |
| p5-Math-Random-MT-1...> | 2023-10-14 07:38 | 9.3K | |
| p5-Math-Random-MT-Au..> | 2023-10-08 12:36 | 46K | |
| p5-Math-Random-OO-0...> | 2023-10-08 09:52 | 18K | |
| p5-Math-Random-Secur..> | 2023-10-08 07:33 | 13K | |
| p5-Math-RandomOrg-0...> | 2023-10-14 05:24 | 5.5K | |
| p5-Math-Round-0.07.pkg | 2023-10-06 17:54 | 6.1K | |
| p5-Math-Round-Var-1...> | 2023-10-06 22:26 | 6.3K | |
| p5-Math-Sequence-1.0..> | 2023-10-08 10:08 | 6.9K | |
| p5-Math-Series-1.01_..> | 2023-10-10 21:53 | 7.9K | |
| p5-Math-SigFigs-1.21..> | 2023-10-10 09:01 | 7.9K | |
| p5-Math-SimpleVariab..> | 2023-10-14 03:07 | 4.9K | |
| p5-Math-Spline-0.02_..> | 2023-10-08 10:42 | 4.7K | |
| p5-Math-String-1.30.pkg | 2023-10-07 00:34 | 71K | |
| p5-Math-Symbolic-0.6..> | 2023-10-06 21:01 | 125K | |
| p5-Math-Symbolic-Cus..> | 2023-10-08 07:23 | 7.2K | |
| p5-Math-Symbolic-Cus..> | 2023-10-06 23:40 | 4.6K | |
| p5-Math-Symbolic-Cus..> | 2023-10-08 10:29 | 4.2K | |
| p5-Math-Symbolic-Cus..> | 2023-10-11 06:54 | 7.9K | |
| p5-Math-Symbolic-Cus..> | 2023-10-06 23:45 | 13K | |
| p5-Math-Symbolic-Cus..> | 2023-10-07 20:58 | 5.2K | |
| p5-Math-Symbolic-Cus..> | 2023-10-08 02:04 | 16K | |
| p5-Math-SymbolicX-Bi..> | 2023-10-07 13:32 | 5.3K | |
| p5-Math-SymbolicX-Co..> | 2023-10-07 18:30 | 6.2K | |
| p5-Math-SymbolicX-Er..> | 2023-10-10 14:00 | 5.3K | |
| p5-Math-SymbolicX-In..> | 2023-10-07 17:18 | 10K | |
| p5-Math-SymbolicX-No..> | 2023-10-08 09:19 | 5.1K | |
| p5-Math-SymbolicX-Pa..> | 2023-10-07 00:59 | 7.2K | |
| p5-Math-SymbolicX-St..> | 2023-10-08 07:41 | 10K | |
| p5-Math-TrulyRandom-..> | 2023-10-09 13:59 | 6.8K | |
| p5-Math-Units-1.3_1.pkg | 2023-10-08 06:29 | 11K | |
| p5-Math-Utils-1.14.pkg | 2023-10-07 15:07 | 16K | |
| p5-Math-Vec-1.01_1.pkg | 2023-10-06 21:34 | 15K | |
| p5-Math-VecStat-0.08..> | 2023-10-08 16:59 | 6.8K | |
| p5-Math-VectorReal-1..> | 2023-10-05 17:03 | 15K | |
| p5-MathML-Entities-0..> | 2023-10-10 00:08 | 14K | |
| p5-MaxMind-DB-Common..> | 2023-10-07 02:37 | 9.6K | |
| p5-MaxMind-DB-Reader..> | 2023-10-08 09:02 | 13K | |
| p5-MaxMind-DB-Reader..> | 2023-10-08 12:50 | 14K | |
| p5-MaxMind-DB-Writer..> | 2023-10-14 07:01 | 46K | |
| p5-Maypole-2.13_6.pkg | 2023-10-10 03:25 | 253K | |
| p5-Maypole-Authentic..> | 2023-10-10 00:55 | 6.6K | |
| p5-Maypole-Component..> | 2023-10-09 04:29 | 3.1K | |
| p5-McBain-2.001000.pkg | 2023-10-07 20:36 | 33K | |
| p5-McBain-WithPSGI-2..> | 2023-10-14 15:46 | 8.5K | |
| p5-Mcrypt-2.5.7.0_4.pkg | 2023-10-10 03:25 | 11K | |
| p5-Mcstas-Tools-2.5_..> | 2023-10-14 16:16 | 148K | |
| p5-Media-Type-Simple..> | 2023-10-09 04:21 | 12K | |
| p5-MediaWiki-1.13_1.pkg | 2023-10-14 09:44 | 21K | |
| p5-MediaWiki-API-0.5..> | 2023-10-10 07:14 | 20K | |
| p5-Memcached-libmemc..> | 2023-10-08 09:39 | 125K | |
| p5-Memoize-1.16.pkg | 2023-10-08 21:28 | 37K | |
| p5-Memoize-ExpireLRU..> | 2023-10-05 16:58 | 7.2K | |
| p5-Meta-Builder-0.00..> | 2023-10-06 18:06 | 16K | |
| p5-MetaCPAN-Client-2..> | 2023-10-07 00:47 | 60K | |
| p5-Metabase-Client-S..> | 2023-10-07 04:22 | 6.3K | |
| p5-Metabase-Fact-0.0..> | 2023-10-06 21:27 | 58K | |
| p5-Metadata-0.24_1.pkg | 2023-10-14 17:20 | 21K | |
| p5-Method-Alias-1.03..> | 2023-10-07 08:02 | 4.9K | |
| p5-Method-Signatures..> | 2023-10-14 09:15 | 40K | |
| p5-Method-Signatures..> | 2023-10-07 09:34 | 7.0K | |
| p5-Metrics-Any-0.10.pkg | 2023-10-07 11:27 | 42K | |
| p5-Minilla-3.0.15_1.pkg | 2023-10-08 14:06 | 73K | |
| p5-Minion-10.25.pkg | 2023-10-10 08:58 | 1.2M | |
| p5-Misc-Quality-0.1_..> | 2023-10-07 10:00 | 2.5K | |
| p5-Mixin-Event-Dispa..> | 2023-10-06 16:13 | 18K | |
| p5-Mixin-Linewise-0...> | 2023-10-06 20:36 | 11K | |
| p5-Mknod-0.02_1.pkg | 2023-10-08 23:51 | 6.3K | |
| p5-Mo-0.40,1.pkg | 2023-10-11 00:12 | 47K | |
| p5-Mobile-UserAgent-..> | 2023-10-10 21:34 | 16K | |
| p5-Mock-MonkeyPatch-..> | 2023-10-08 21:33 | 8.8K | |
| p5-Mock-Quick-1.111.pkg | 2023-10-09 14:28 | 28K | |
| p5-Mock-Sub-1.09.pkg | 2023-10-14 16:09 | 13K | |
| p5-ModPerl-VersionUt..> | 2023-10-07 16:25 | 3.7K | |
| p5-Modern-Perl-1.202..> | 2023-10-07 11:35 | 7.7K | |
| p5-Module-Build-0.42..> | 2023-10-05 16:48 | 185K | |
| p5-Module-Build-Conv..> | 2023-10-10 05:22 | 20K | |
| p5-Module-Build-Kwal..> | 2023-10-14 16:02 | 7.6K | |
| p5-Module-Build-Plug..> | 2023-10-06 23:08 | 17K | |
| p5-Module-Build-Plug..> | 2023-10-06 23:13 | 4.3K | |
| p5-Module-Build-Plug..> | 2023-10-07 16:12 | 4.0K | |
| p5-Module-Build-Prer..> | 2023-10-07 03:36 | 5.3K | |
| p5-Module-Build-Tiny..> | 2023-10-05 16:51 | 8.1K | |
| p5-Module-Build-Usin..> | 2023-10-06 14:25 | 8.7K | |
| p5-Module-Build-With..> | 2023-10-14 08:16 | 14K | |
| p5-Module-Build-XSUt..> | 2023-10-05 17:05 | 7.4K | |
| p5-Module-CPANTS-Ana..> | 2023-10-07 15:28 | 52K | |
| p5-Module-CPANfile-1..> | 2023-10-06 15:17 | 22K | |
| p5-Module-CheckDeps-..> | 2023-10-14 17:05 | 5.9K | |
| p5-Module-CheckVersi..> | 2023-10-09 15:25 | 100K | |
| p5-Module-Collect-0...> | 2023-10-07 08:58 | 5.9K | |
| p5-Module-Compile-0...> | 2023-10-08 06:13 | 19K | |
| p5-Module-CoreList-5..> | 2023-10-14 02:35 | 65K | |
| p5-Module-Dependency..> | 2023-10-08 21:51 | 42K | |
| p5-Module-Depends-0...> | 2023-10-08 20:02 | 8.1K | |
| p5-Module-Extract-0...> | 2023-10-08 08:12 | 6.8K | |
| p5-Module-Extract-Us..> | 2023-10-07 20:07 | 6.0K | |
| p5-Module-ExtractUse..> | 2023-10-08 23:19 | 28K | |
| p5-Module-Find-0.16.pkg | 2023-10-05 17:04 | 8.1K | |
| p5-Module-Functions-..> | 2023-10-10 23:20 | 4.7K | |
| p5-Module-Implementa..> | 2023-10-05 16:49 | 6.5K | |
| p5-Module-Info-0.37.pkg | 2023-10-07 00:23 | 22K | |
| p5-Module-Info-File-..> | 2023-10-11 12:40 | 7.0K | |
| p5-Module-Inspector-..> | 2023-10-09 08:44 | 8.6K | |
| p5-Module-Install-1...> | 2023-10-06 22:10 | 126K | |
| p5-Module-Install-Au..> | 2023-10-09 04:36 | 4.0K | |
| p5-Module-Install-Au..> | 2023-10-07 06:08 | 3.9K | |
| p5-Module-Install-Re..> | 2023-10-10 13:41 | 5.7K | |
| p5-Module-Install-Re..> | 2023-10-10 18:09 | 3.7K | |
| p5-Module-Install-Te..> | 2023-10-14 07:20 | 6.8K | |
| p5-Module-Install-Te..> | 2023-10-07 16:55 | 3.3K | |
| p5-Module-Install-XS..> | 2023-10-10 10:55 | 12K | |
| p5-Module-Installed-..> | 2023-10-06 16:44 | 8.9K | |
| p5-Module-List-0.004..> | 2023-10-06 23:27 | 7.4K | |
| p5-Module-Load-0.36.pkg | 2023-10-07 06:50 | 7.3K | |
| p5-Module-Load-Condi..> | 2023-10-11 22:11 | 11K | |
| p5-Module-Load-Util-..> | 2023-10-07 01:18 | 8.2K | |
| p5-Module-Loaded-0.0..> | 2023-10-09 22:00 | 4.0K | |
| p5-Module-Loader-0.0..> | 2023-10-07 19:52 | 6.1K | |
| p5-Module-Manifest-1..> | 2023-10-08 06:18 | 8.9K | |
| p5-Module-Math-Depen..> | 2023-10-07 15:42 | 4.8K | |
| p5-Module-Metadata-1..> | 2023-10-08 11:05 | 17K | |
| p5-Module-Path-0.19.pkg | 2023-10-07 04:40 | 8.1K | |
| p5-Module-Pluggable-..> | 2023-10-05 16:57 | 18K | |
| p5-Module-Pluggable-..> | 2023-10-06 20:10 | 4.0K | |
| p5-Module-Pluggable-..> | 2023-10-07 11:46 | 5.5K | |
| p5-Module-Reader-0.0..> | 2023-10-07 15:06 | 10K | |
| p5-Module-Recursive-..> | 2023-10-08 04:10 | 4.0K | |
| p5-Module-Refresh-0...> | 2023-10-06 18:12 | 5.4K | |
| p5-Module-Release-2...> | 2023-10-11 12:16 | 43K | |
| p5-Module-Reload-1.1..> | 2023-10-14 05:46 | 4.2K | |
| p5-Module-Reload-Sel..> | 2023-10-14 11:18 | 14K | |
| p5-Module-Runtime-0...> | 2023-10-05 16:48 | 13K | |
| p5-Module-Runtime-Co..> | 2023-10-05 16:50 | 3.7K | |
| p5-Module-ScanDeps-1..> | 2023-10-06 15:53 | 27K | |
| p5-Module-Setup-0.09..> | 2023-10-07 18:57 | 91K | |
| p5-Module-Signature-..> | 2023-10-06 21:12 | 17K | |
| p5-Module-Starter-1...> | 2023-10-07 16:40 | 34K | |
| p5-Module-Starter-PB..> | 2023-10-14 13:00 | 11K | |
| p5-Module-Starter-Pl..> | 2023-10-09 02:49 | 8.3K | |
| p5-Module-Starter-Pl..> | 2023-10-14 10:16 | 6.2K | |
| p5-Module-Used-v1.2...> | 2023-10-08 01:10 | 12K | |
| p5-Module-Util-1.09_..> | 2023-10-06 15:17 | 13K | |
| p5-Module-Version-0...> | 2023-10-09 16:37 | 11K | |
| p5-Module-Versions-0..> | 2023-10-07 08:32 | 15K | |
| p5-Module-Versions-R..> | 2023-10-07 01:34 | 5.6K | |
| p5-MogileFS-Client-1..> | 2023-10-07 08:53 | 25K | |
| p5-MogileFS-Network-..> | 2023-10-14 11:44 | 9.9K | |
| p5-MogileFS-Server-2..> | 2023-10-08 08:52 | 155K | |
| p5-MogileFS-Utils-2...> | 2023-10-09 12:47 | 61K | |
| p5-Mojo-IOLoop-Delay..> | 2023-10-07 04:10 | 7.8K | |
| p5-Mojo-IOLoop-ForkC..> | 2023-10-08 10:03 | 14K | |
| p5-Mojo-Log-Clearabl..> | 2023-10-08 00:51 | 6.8K | |
| p5-Mojo-Pg-4.27.pkg | 2023-10-09 19:05 | 37K | |
| p5-Mojo-RabbitMQ-Cli..> | 2023-10-14 11:15 | 46K | |
| p5-Mojo-Server-FastC..> | 2023-10-09 08:46 | 7.8K | |
| p5-Mojo-Weixin-1.4.6..> | 2023-10-10 03:55 | 102K | |
| p5-MojoMojo-1.12_1.pkg | 2023-10-10 16:50 | 902K | |
| p5-MojoX-Log-Dispatc..> | 2023-10-08 17:21 | 8.3K | |
| p5-MojoX-Renderer-Xs..> | 2023-10-10 10:18 | 6.5K | |
| p5-Mojolicious-9.34.pkg | 2023-10-06 20:16 | 871K | |
| p5-Mojolicious-Plugi..> | 2023-10-09 16:51 | 12K | |
| p5-Mojolicious-Plugi..> | 2023-10-14 16:42 | 5.6K | |
| p5-Mojolicious-Plugi..> | 2023-10-10 04:13 | 5.4K | |
| p5-Mojolicious-Plugi..> | 2023-10-08 21:18 | 11K | |
| p5-Mojolicious-Plugi..> | 2023-10-10 01:06 | 6.8K | |
| p5-Mojolicious-Plugi..> | 2023-10-09 06:39 | 9.1K | |
| p5-Mojolicious-Plugi..> | 2023-10-14 13:30 | 56K | |
| p5-Mojolicious-Plugi..> | 2023-10-10 02:19 | 5.6K | |
| p5-Mojolicious-Plugi..> | 2023-10-08 19:51 | 12K | |
| p5-Mojolicious-Plugi..> | 2023-10-09 18:41 | 3.6K | |
| p5-Mon-0.11_1.pkg | 2023-10-14 12:37 | 21K | |
| p5-MongoDB-2.2.2.pkg | 2023-10-07 11:48 | 289K | |
| p5-Mongoose-2.00.pkg | 2023-10-14 04:28 | 53K | |
| p5-Monitor-Simple-0...> | 2023-10-14 07:21 | 56K | |
| p5-Monitoring-Livest..> | 2023-10-09 14:58 | 22K | |
| p5-Monitoring-Plugin..> | 2023-10-08 22:47 | 49K | |
| p5-Monoceros-0.28_1.pkg | 2023-10-10 21:34 | 17K | |
| p5-Moo-2.005005.pkg | 2023-10-05 16:55 | 43K | |
| p5-MooX-Aliases-0.00..> | 2023-10-07 09:46 | 4.6K | |
| p5-MooX-Attribute-EN..> | 2023-10-08 04:55 | 4.7K | |
| p5-MooX-Cmd-0.017.pkg | 2023-10-10 12:34 | 19K | |
| p5-MooX-ConfigFromFi..> | 2023-10-06 22:39 | 18K | |
| p5-MooX-File-ConfigD..> | 2023-10-06 18:27 | 5.9K | |
| p5-MooX-HandlesVia-0..> | 2023-10-06 17:44 | 16K | |
| p5-MooX-Locale-Passt..> | 2023-10-06 19:55 | 4.1K | |
| p5-MooX-Options-4.10..> | 2023-10-07 00:21 | 34K | |
| p5-MooX-Role-Paramet..> | 2023-10-10 08:22 | 9.7K | |
| p5-MooX-Singleton-1...> | 2023-10-07 02:37 | 3.3K | |
| p5-MooX-StrictConstr..> | 2023-10-06 19:15 | 7.8K | |
| p5-MooX-Thunking-0.0..> | 2023-10-07 22:03 | 3.6K | |
| p5-MooX-Traits-0.005..> | 2023-10-07 02:45 | 9.0K | |
| p5-MooX-TypeTiny-0.0..> | 2023-10-06 16:20 | 4.3K | |
| p5-MooX-Types-MooseL..> | 2023-10-05 17:06 | 13K | |
| p5-MooX-Types-MooseL..> | 2023-10-06 22:30 | 3.4K | |
| p5-MooX-late-0.100.pkg | 2023-10-06 20:34 | 7.0K | |
| p5-Moos-0.30_1.pkg | 2023-10-09 17:58 | 22K | |
| p5-Moose-2.2206,1.pkg | 2023-10-05 16:53 | 702K | |
| p5-Moose-Autobox-0.1..> | 2023-10-07 08:00 | 32K | |
| p5-Moose-Policy-0.05..> | 2023-10-08 00:40 | 13K | |
| p5-Moose-Test-0.01_1..> | 2023-10-10 01:51 | 5.8K | |
| p5-MooseX-Aliases-0...> | 2023-10-06 15:52 | 10K | |
| p5-MooseX-App-1.42.pkg | 2023-10-10 10:35 | 85K | |
| p5-MooseX-App-Cmd-0...> | 2023-10-07 17:45 | 7.8K | |
| p5-MooseX-ArrayRef-0..> | 2023-10-06 18:44 | 6.2K | |
| p5-MooseX-Async-0.07..> | 2023-10-14 02:54 | 10K | |
| p5-MooseX-Attribute-..> | 2023-10-06 16:07 | 17K | |
| p5-MooseX-Attribute-..> | 2023-10-07 22:07 | 6.1K | |
| p5-MooseX-AttributeH..> | 2023-10-06 23:42 | 88K | |
| p5-MooseX-AttributeS..> | 2023-10-08 15:17 | 31K | |
| p5-MooseX-Authorized..> | 2023-10-09 15:03 | 9.3K | |
| p5-MooseX-ClassAttri..> | 2023-10-06 20:47 | 25K | |
| p5-MooseX-Clone-0.06..> | 2023-10-06 16:16 | 19K | |
| p5-MooseX-CompileTim..> | 2023-10-06 16:28 | 3.6K | |
| p5-MooseX-ConfigFrom..> | 2023-10-05 17:03 | 6.5K | |
| p5-MooseX-CoverableM..> | 2023-10-07 07:50 | 3.4K | |
| p5-MooseX-Daemonize-..> | 2023-10-08 02:02 | 33K | |
| p5-MooseX-Declare-0...> | 2023-10-06 15:19 | 76K | |
| p5-MooseX-Emulate-Cl..> | 2023-10-06 14:59 | 8.2K | |
| p5-MooseX-Extended-0..> | 2023-10-08 15:41 | 69K | |
| p5-MooseX-FollowPBP-..> | 2023-10-07 21:48 | 5.9K | |
| p5-MooseX-Getopt-0.7..> | 2023-10-06 15:04 | 45K | |
| p5-MooseX-Has-Option..> | 2023-10-10 13:53 | 11K | |
| p5-MooseX-Has-Sugar-..> | 2023-10-07 08:46 | 13K | |
| p5-MooseX-HasDefault..> | 2023-10-08 06:52 | 3.8K | |
| p5-MooseX-IOC-0.03_3..> | 2023-10-14 10:55 | 6.5K | |
| p5-MooseX-InsideOut-..> | 2023-10-07 04:03 | 5.4K | |
| p5-MooseX-LazyRequir..> | 2023-10-05 16:58 | 7.4K | |
| p5-MooseX-Lists-0.05..> | 2023-10-10 07:18 | 5.5K | |
| p5-MooseX-Log-Log4pe..> | 2023-10-07 13:23 | 8.7K | |
| p5-MooseX-MarkAsMeth..> | 2023-10-06 22:01 | 7.9K | |
| p5-MooseX-Meta-TypeC..> | 2023-10-05 16:57 | 4.0K | |
| p5-MooseX-Meta-TypeC..> | 2023-10-08 02:53 | 8.8K | |
| p5-MooseX-MetaDescri..> | 2023-10-08 04:35 | 13K | |
| p5-MooseX-Method-Sig..> | 2023-10-05 17:05 | 21K | |
| p5-MooseX-MethodAttr..> | 2023-10-05 17:11 | 30K | |
| p5-MooseX-MultiInitA..> | 2023-10-14 18:57 | 8.7K | |
| p5-MooseX-MultiMetho..> | 2023-10-14 09:37 | 6.2K | |
| p5-MooseX-MungeHas-0..> | 2023-10-07 08:54 | 8.3K | |
| p5-MooseX-NonMoose-0..> | 2023-10-06 21:41 | 15K | |
| p5-MooseX-Object-Plu..> | 2023-10-06 16:42 | 9.5K | |
| p5-MooseX-OneArgNew-..> | 2023-10-06 19:23 | 4.7K | |
| p5-MooseX-POE-0.215_..> | 2023-10-07 08:46 | 25K | |
| p5-MooseX-Params-Val..> | 2023-10-07 09:13 | 12K | |
| p5-MooseX-RelatedCla..> | 2023-10-06 18:33 | 3.6K | |
| p5-MooseX-Role-Logga..> | 2023-10-09 16:56 | 7.1K | |
| p5-MooseX-Role-Match..> | 2023-10-08 04:25 | 6.8K | |
| p5-MooseX-Role-Param..> | 2023-10-05 17:06 | 34K | |
| p5-MooseX-Role-Stric..> | 2023-10-09 04:14 | 7.2K | |
| p5-MooseX-Role-WarnO..> | 2023-10-07 10:19 | 6.0K | |
| p5-MooseX-Runnable-0..> | 2023-10-09 02:47 | 25K | |
| p5-MooseX-SemiAfford..> | 2023-10-08 08:06 | 6.1K | |
| p5-MooseX-SetOnce-0...> | 2023-10-07 17:14 | 4.0K | |
| p5-MooseX-SimpleConf..> | 2023-10-07 23:52 | 5.6K | |
| p5-MooseX-Singleton-..> | 2023-10-08 07:56 | 17K | |
| p5-MooseX-Storage-0...> | 2023-10-06 17:20 | 58K | |
| p5-MooseX-StrictCons..> | 2023-10-06 17:31 | 9.5K | |
| p5-MooseX-Test-Role-..> | 2023-10-14 04:39 | 6.6K | |
| p5-MooseX-TraitFor-M..> | 2023-10-07 09:03 | 5.1K | |
| p5-MooseX-Traits-0.1..> | 2023-10-05 16:55 | 7.2K | |
| p5-MooseX-Traits-Plu..> | 2023-10-06 17:15 | 6.6K | |
| p5-MooseX-Transactio..> | 2023-10-09 06:40 | 6.8K | |
| p5-MooseX-Types-0.50..> | 2023-10-05 16:53 | 45K | |
| p5-MooseX-Types-Comm..> | 2023-10-06 21:21 | 12K | |
| p5-MooseX-Types-Date..> | 2023-10-06 22:19 | 6.2K | |
| p5-MooseX-Types-Date..> | 2023-10-08 08:04 | 6.4K | |
| p5-MooseX-Types-Date..> | 2023-10-07 04:08 | 5.7K | |
| p5-MooseX-Types-Date..> | 2023-10-08 09:16 | 3.3K | |
| p5-MooseX-Types-Date..> | 2023-10-10 13:22 | 4.7K | |
| p5-MooseX-Types-ISO8..> | 2023-10-14 09:32 | 8.6K | |
| p5-MooseX-Types-JSON..> | 2023-10-10 09:08 | 3.4K | |
| p5-MooseX-Types-Load..> | 2023-10-06 18:39 | 5.0K | |
| p5-MooseX-Types-Path..> | 2023-10-06 16:51 | 5.7K | |
| p5-MooseX-Types-Path..> | 2023-10-05 17:00 | 6.4K | |
| p5-MooseX-Types-Perl..> | 2023-10-08 06:55 | 5.8K | |
| p5-MooseX-Types-Port..> | 2023-10-08 07:56 | 4.7K | |
| p5-MooseX-Types-Set-..> | 2023-10-07 07:31 | 4.4K | |
| p5-MooseX-Types-Sign..> | 2023-10-07 05:44 | 5.2K | |
| p5-MooseX-Types-Stri..> | 2023-10-05 16:54 | 4.2K | |
| p5-MooseX-Types-Stru..> | 2023-10-05 16:55 | 28K | |
| p5-MooseX-Types-URI-..> | 2023-10-07 01:31 | 5.7K | |
| p5-MooseX-Types-Vari..> | 2023-10-07 18:47 | 9.3K | |
| p5-MooseX-Util-0.006..> | 2023-10-08 02:24 | 8.5K | |
| p5-Mouse-2.5.10,1.pkg | 2023-10-06 15:16 | 148K | |
| p5-MouseX-App-Cmd-0...> | 2023-10-08 15:35 | 7.5K | |
| p5-MouseX-AttributeH..> | 2023-10-09 23:53 | 25K | |
| p5-MouseX-ConfigFrom..> | 2023-10-07 10:13 | 4.6K | |
| p5-MouseX-Foreign-1...> | 2023-10-08 09:12 | 13K | |
| p5-MouseX-Getopt-0.3..> | 2023-10-06 22:30 | 32K | |
| p5-MouseX-NativeTrai..> | 2023-10-06 23:44 | 51K | |
| p5-MouseX-StrictCons..> | 2023-10-07 03:45 | 3.0K | |
| p5-MouseX-Traits-0.1..> | 2023-10-07 05:25 | 5.7K | |
| p5-MouseX-Types-0.06..> | 2023-10-06 21:03 | 7.6K | |
| p5-MouseX-Types-Path..> | 2023-10-07 01:30 | 3.5K | |
| p5-Mozilla-CA-202308..> | 2023-10-05 16:50 | 121K | |
| p5-Mozilla-PublicSuf..> | 2023-10-07 18:30 | 38K | |
| p5-Msgcat-1.03_1.pkg | 2023-10-10 14:01 | 7.6K | |
| p5-Multiplex-CMD-0.0..> | 2023-10-09 18:25 | 5.1K | |
| p5-Music-Audioscrobb..> | 2023-10-10 13:05 | 18K | |
| p5-Music-Audioscrobb..> | 2023-10-07 14:17 | 12K | |
| p5-MusicBrainz-DiscI..> | 2023-10-08 06:32 | 11K | |
| p5-MySQL-Diff-0.50.pkg | 2023-10-09 16:36 | 22K | |
| p5-NEXT-0.69.pkg | 2023-10-07 22:56 | 11K | |
| p5-NNTPClient-0.37_1..> | 2023-10-08 02:15 | 19K | |
| p5-NSNMP-0.5_1.pkg | 2023-10-08 14:19 | 22K | |
| p5-Nagios-Object-0.2..> | 2023-10-09 20:00 | 54K | |
| p5-Nagios-Plugin-0.3..> | 2023-10-08 11:02 | 48K | |
| p5-Nagios-Plugin-Bea..> | 2023-10-11 21:21 | 5.8K | |
| p5-Nagios-Plugin-LDA..> | 2023-10-11 02:57 | 6.2K | |
| p5-Nagios-Plugins-Me..> | 2023-10-09 14:27 | 7.2K | |
| p5-Net-3.15,1.pkg | 2023-10-08 22:54 | 101K | |
| p5-Net-ACL-0.07_2.pkg | 2023-10-10 15:32 | 60K | |
| p5-Net-ACME2-0.35.pkg | 2023-10-08 10:14 | 46K | |
| p5-Net-AMQP-0.06_1.pkg | 2023-10-07 02:27 | 83K | |
| p5-Net-AMQP-RabbitMQ..> | 2023-10-08 06:04 | 71K | |
| p5-Net-AOLIM-1.61_2.pkg | 2023-10-09 19:56 | 27K | |
| p5-Net-APNS-0.0202_1..> | 2023-10-14 13:53 | 6.0K | |
| p5-Net-APNs-Extended..> | 2023-10-14 16:06 | 9.8K | |
| p5-Net-ARP-1.0.12.pkg | 2023-10-08 20:47 | 8.4K | |
| p5-Net-Abuse-Utils-0..> | 2023-10-14 11:11 | 13K | |
| p5-Net-Abuse-Utils-S..> | 2023-10-10 04:12 | 4.7K | |
| p5-Net-Address-Ether..> | 2023-10-08 18:08 | 8.2K | |
| p5-Net-Address-IPv4-..> | 2023-10-08 07:48 | 4.4K | |
| p5-Net-Akismet-0.05_..> | 2023-10-14 14:57 | 6.3K | |
| p5-Net-Amazon-0.62_1..> | 2023-10-11 11:18 | 369K | |
| p5-Net-Amazon-AWIS-0..> | 2023-10-09 11:00 | 10K | |
| p5-Net-Amazon-AWSSig..> | 2023-10-08 21:23 | 5.9K | |
| p5-Net-Amazon-EC2-0...> | 2023-10-14 06:34 | 116K | |
| p5-Net-Amazon-Mechan..> | 2023-10-09 11:25 | 66K | |
| p5-Net-Amazon-Route5..> | 2023-10-10 18:55 | 25K | |
| p5-Net-Amazon-S3-0.9..> | 2023-10-07 15:41 | 265K | |
| p5-Net-Amazon-Signat..> | 2023-10-10 18:14 | 4.6K | |
| p5-Net-Amazon-Signat..> | 2023-10-10 17:29 | 4.4K | |
| p5-Net-Amazon-Signat..> | 2023-10-08 01:26 | 6.3K | |
| p5-Net-Amazon-Thumbn..> | 2023-10-09 00:29 | 8.5K | |
| p5-Net-Analysis-0.41..> | 2023-10-14 16:05 | 60K | |
| p5-Net-Appliance-Phr..> | 2023-10-09 20:52 | 8.9K | |
| p5-Net-Appliance-Ses..> | 2023-10-07 23:25 | 23K | |
| p5-Net-Async-Cassand..> | 2023-10-10 12:36 | 26K | |
| p5-Net-Async-FastCGI..> | 2023-10-07 22:45 | 21K | |
| p5-Net-Async-HTTP-0...> | 2023-10-14 12:27 | 28K | |
| p5-Net-Async-XMPP-0...> | 2023-10-09 02:31 | 13K | |
| p5-Net-BGP-0.18.pkg | 2023-10-08 21:17 | 63K | |
| p5-Net-BitTorrent-0...> | 2023-10-14 06:42 | 114K | |
| p5-Net-BitTorrent-Fi..> | 2023-10-14 11:33 | 6.3K | |
| p5-Net-BitTorrent-Pe..> | 2023-10-09 23:00 | 8.6K | |
| p5-Net-Blogger-1.03.pkg | 2023-10-08 22:38 | 56K | |
| p5-Net-Bonjour-0.96_..> | 2023-10-07 02:54 | 14K | |
| p5-Net-CIDR-0.21.pkg | 2023-10-07 00:27 | 12K | |
| p5-Net-CIDR-Lite-0.2..> | 2023-10-06 18:48 | 9.0K | |
| p5-Net-CIDR-MobileJP..> | 2023-10-08 11:43 | 6.1K | |
| p5-Net-CIDR-Set-0.13..> | 2023-10-14 12:35 | 18K | |
| p5-Net-CLI-Interact-..> | 2023-10-07 05:17 | 95K | |
| p5-Net-CSTA-0.04_1.pkg | 2023-10-09 01:06 | 11K | |
| p5-Net-CUPS-0.64.pkg | 2023-10-09 21:27 | 43K | |
| p5-Net-CascadeCopy-0..> | 2023-10-10 22:41 | 12K | |
| p5-Net-Cassandra-0.3..> | 2023-10-14 08:56 | 19K | |
| p5-Net-Cassandra-Eas..> | 2023-10-10 12:51 | 34K | |
| p5-Net-Connection-0...> | 2023-10-07 02:03 | 8.3K | |
| p5-Net-Connection-Ma..> | 2023-10-08 07:40 | 53K | |
| p5-Net-Connection-So..> | 2023-10-08 10:54 | 36K | |
| p5-Net-Connection-ls..> | 2023-10-08 11:25 | 5.4K | |
| p5-Net-Connection-nc..> | 2023-10-14 14:43 | 10K | |
| p5-Net-Curl-0.52_1.pkg | 2023-10-14 18:41 | 82K | |
| p5-Net-DAAP-Client-0..> | 2023-10-08 07:02 | 12K | |
| p5-Net-DAAP-DMAP-1.2..> | 2023-10-07 02:18 | 9.2K | |
| p5-Net-DAV-Server-1...> | 2023-10-10 08:53 | 22K | |
| p5-Net-DBus-1.2.0_1.pkg | 2023-10-08 11:42 | 168K | |
| p5-Net-DHCP-0.700.pkg | 2023-10-10 12:40 | 42K | |
| p5-Net-DHCP-Watch-2...> | 2023-10-08 01:33 | 7.1K | |
| p5-Net-DHCPClient-1...> | 2023-10-14 04:49 | 8.5K | |
| p5-Net-DLookup-1.01_..> | 2023-10-09 14:11 | 12K | |
| p5-Net-DNS-1.40,1.pkg | 2023-10-05 16:54 | 321K | |
| p5-Net-DNS-Async-1.0..> | 2023-10-09 06:44 | 5.8K | |
| p5-Net-DNS-Check-0.4..> | 2023-10-14 05:11 | 57K | |
| p5-Net-DNS-Codes-0.1..> | 2023-10-06 20:33 | 8.9K | |
| p5-Net-DNS-Lite-0.12..> | 2023-10-09 16:56 | 8.3K | |
| p5-Net-DNS-Match-0.0..> | 2023-10-09 16:29 | 4.1K | |
| p5-Net-DNS-Paranoid-..> | 2023-10-10 17:54 | 6.6K | |
| p5-Net-DNS-RR-SRV-He..> | 2023-10-07 22:49 | 4.8K | |
| p5-Net-DNS-Resolver-..> | 2023-10-10 19:42 | 4.3K | |
| p5-Net-DNS-Resolver-..> | 2023-10-06 17:02 | 8.8K | |
| p5-Net-DNS-SEC-1.21.pkg | 2023-10-07 00:46 | 34K | |
| p5-Net-DNS-TestNS-1...> | 2023-10-09 10:56 | 16K | |
| p5-Net-DNS-ToolKit-0..> | 2023-10-07 00:19 | 151K | |
| p5-Net-DNS-Zone-Pars..> | 2023-10-10 01:54 | 18K | |
| p5-Net-DNS-ZoneFile-..> | 2023-10-07 16:29 | 3.3K | |
| p5-Net-DNSBL-MultiDa..> | 2023-10-08 01:42 | 33K | |
| p5-Net-DNSBL-Statist..> | 2023-10-09 21:19 | 10K | |
| p5-Net-DRI-0.96_2.pkg | 2023-10-11 06:29 | 527K | |
| p5-Net-Daemon-0.48_1..> | 2023-10-07 03:04 | 30K | |
| p5-Net-Daemon-SSL-1...> | 2023-10-14 11:43 | 4.8K | |
| p5-Net-Delicious-1.1..> | 2023-10-10 03:59 | 50K | |
| p5-Net-Dict-2.22.pkg | 2023-10-14 14:40 | 14K | |
| p5-Net-DirectConnect..> | 2023-10-08 02:15 | 115K | |
| p5-Net-Divert-0.01_2..> | 2023-10-10 00:13 | 7.2K | |
| p5-Net-Domain-Expire..> | 2023-10-10 05:12 | 8.4K | |
| p5-Net-Domain-TLD-1...> | 2023-10-05 16:54 | 25K | |
| p5-Net-Dropbox-API-1..> | 2023-10-11 02:57 | 7.7K | |
| p5-Net-EPP-0.25.pkg | 2023-10-08 11:05 | 103K | |
| p5-Net-EPP-Proxy-0.0..> | 2023-10-14 15:28 | 8.8K | |
| p5-Net-FS-Flickr-0.1..> | 2023-10-10 10:35 | 39K | |
| p5-Net-FS-Gmail-0.2_..> | 2023-10-08 21:28 | 6.9K | |
| p5-Net-FTP-AutoRecon..> | 2023-10-08 09:52 | 6.7K | |
| p5-Net-FTP-Common-7...> | 2023-10-09 03:26 | 17K | |
| p5-Net-FTP-File-0.06..> | 2023-10-07 17:51 | 10K | |
| p5-Net-FTP-Recursive..> | 2023-10-09 19:57 | 17K | |
| p5-Net-FTPSSL-0.42.pkg | 2023-10-08 14:23 | 67K | |
| p5-Net-FTPServer-1.1..> | 2023-10-09 10:34 | 138K | |
| p5-Net-FastCGI-0.14_..> | 2023-10-07 09:15 | 26K | |
| p5-Net-Finger-1.06_1..> | 2023-10-11 05:06 | 5.0K | |
| p5-Net-FireEagle-1.6..> | 2023-10-09 07:29 | 11K | |
| p5-Net-Flickr-API-1...> | 2023-10-07 04:07 | 8.3K | |
| p5-Net-Flickr-Backup..> | 2023-10-14 12:29 | 21K | |
| p5-Net-Flickr-RDF-2...> | 2023-10-07 22:27 | 22K | |
| p5-Net-Flow-1.003.pkg | 2023-10-14 18:06 | 26K | |
| p5-Net-Frame-1.21.pkg | 2023-10-07 08:42 | 42K | |
| p5-Net-Frame-Device-..> | 2023-10-09 06:31 | 8.4K | |
| p5-Net-Frame-Dump-1...> | 2023-10-07 11:49 | 22K | |
| p5-Net-Frame-Layer-I..> | 2023-10-07 21:08 | 30K | |
| p5-Net-Frame-Layer-I..> | 2023-10-08 02:37 | 21K | |
| p5-Net-Frame-Simple-..> | 2023-10-07 18:26 | 8.7K | |
| p5-Net-FreeDB-0.10_1..> | 2023-10-10 11:34 | 15K | |
| p5-Net-FreshBooks-AP..> | 2023-10-10 14:00 | 76K | |
| p5-Net-GPSD3-0.19.pkg | 2023-10-09 13:40 | 43K | |
| p5-Net-GeoPlanet-0.2..> | 2023-10-09 14:02 | 6.2K | |
| p5-Net-GitHub-1.05.pkg | 2023-10-07 18:56 | 61K | |
| p5-Net-Gnats-0.22.pkg | 2023-10-11 17:09 | 96K | |
| p5-Net-Google-1.0.1_..> | 2023-10-07 11:38 | 32K | |
| p5-Net-Google-Analyt..> | 2023-10-14 08:20 | 21K | |
| p5-Net-Google-AuthSu..> | 2023-10-07 08:55 | 11K | |
| p5-Net-Google-Calend..> | 2023-10-14 11:02 | 38K | |
| p5-Net-Google-Code-0..> | 2023-10-07 20:11 | 48K | |
| p5-Net-Google-DataAP..> | 2023-10-07 22:53 | 22K | |
| p5-Net-Google-Picasa..> | 2023-10-09 11:35 | 42K | |
| p5-Net-Google-SafeBr..> | 2023-10-09 10:16 | 41K | |
| p5-Net-Google-Spread..> | 2023-10-09 13:31 | 23K | |
| p5-Net-Groonga-HTTP-..> | 2023-10-08 21:05 | 10K | |
| p5-Net-Growl-0.99_1.pkg | 2023-10-09 14:57 | 5.7K | |
| p5-Net-GrowlClient-0..> | 2023-10-10 10:06 | 8.2K | |
| p5-Net-HL7-0.76.pkg | 2023-10-10 01:14 | 33K | |
| p5-Net-HTTP-6.23.pkg | 2023-10-05 16:52 | 21K | |
| p5-Net-HTTP-Spore-0...> | 2023-10-07 21:31 | 67K | |
| p5-Net-HTTP-Spore-Mi..> | 2023-10-11 00:54 | 3.9K | |
| p5-Net-HTTPS-Any-0.1..> | 2023-10-07 04:39 | 5.7K | |
| p5-Net-HTTPS-NB-0.15..> | 2023-10-07 02:58 | 6.2K | |
| p5-Net-Hiveminder-0...> | 2023-10-10 08:09 | 11K | |
| p5-Net-IDN-Encode-2...> | 2023-10-06 20:38 | 72K | |
| p5-Net-IDN-Nameprep-..> | 2023-10-09 18:36 | 4.8K | |
| p5-Net-ILO-0.54_1.pkg | 2023-10-11 04:53 | 22K | |
| p5-Net-IMAP-Client-0..> | 2023-10-09 03:47 | 41K | |
| p5-Net-IMAP-Server-1..> | 2023-10-09 08:27 | 54K | |
| p5-Net-IMAP-Simple-1..> | 2023-10-07 04:29 | 38K | |
| p5-Net-IMAP-Simple-S..> | 2023-10-07 23:55 | 2.8K | |
| p5-Net-INET6Glue-0.6..> | 2023-10-07 20:55 | 8.5K | |
| p5-Net-IP-1.26_1.pkg | 2023-10-07 09:56 | 24K | |
| p5-Net-IP-Match-Rege..> | 2023-10-08 11:24 | 12K | |
| p5-Net-IP-Match-XS-0..> | 2023-10-08 02:00 | 6.8K | |
| p5-Net-IP-Minimal-0...> | 2023-10-06 16:32 | 4.2K | |
| p5-Net-IP-RangeCompa..> | 2023-10-14 13:04 | 11K | |
| p5-Net-IP-Resolver-0..> | 2023-10-14 09:31 | 4.7K | |
| p5-Net-IP-XS-0.22.pkg | 2023-10-14 12:17 | 48K | |
| p5-Net-IPAddress-1.1..> | 2023-10-08 11:40 | 5.3K | |
| p5-Net-IPTrie-0.7_2.pkg | 2023-10-09 23:17 | 12K | |
| p5-Net-IPv4Addr-0.10..> | 2023-10-10 15:14 | 9.0K | |
| p5-Net-IPv6Addr-1.02..> | 2023-10-06 20:05 | 17K | |
| p5-Net-IRR-0.09.pkg | 2023-10-07 17:59 | 8.0K | |
| p5-Net-Ident-1.23_1.pkg | 2023-10-08 00:45 | 19K | |
| p5-Net-Ifconfig-Wrap..> | 2023-10-07 22:16 | 11K | |
| p5-Net-Interface-1.0..> | 2023-10-10 05:35 | 58K | |
| p5-Net-Jabber-2.0_1.pkg | 2023-10-07 11:05 | 88K | |
| p5-Net-Jifty-0.14_1.pkg | 2023-10-08 00:40 | 14K | |
| p5-Net-LDAP-AutoDNs-..> | 2023-10-08 14:40 | 5.8K | |
| p5-Net-LDAP-AutoServ..> | 2023-10-14 12:17 | 6.8K | |
| p5-Net-LDAP-Express-..> | 2023-10-11 22:11 | 11K | |
| p5-Net-LDAP-FilterBu..> | 2023-10-09 04:26 | 5.8K | |
| p5-Net-LDAP-LDAPhash..> | 2023-10-08 12:25 | 3.9K | |
| p5-Net-LDAP-Makepath..> | 2023-10-09 16:07 | 4.6K | |
| p5-Net-LDAP-Server-0..> | 2023-10-08 01:25 | 6.9K | |
| p5-Net-LDAP-Server-T..> | 2023-10-09 04:09 | 12K | |
| p5-Net-LDAP-posixAcc..> | 2023-10-06 23:40 | 6.0K | |
| p5-Net-LDAP-posixGro..> | 2023-10-07 03:29 | 4.8K | |
| p5-Net-LMTP-0.02.pkg | 2023-10-10 08:57 | 9.2K | |
| p5-Net-LibIDN-0.12_5..> | 2023-10-06 20:25 | 14K | |
| p5-Net-LibIDN2-1.02.pkg | 2023-10-09 10:05 | 14K | |
| p5-Net-LibLO-0.06_3.pkg | 2023-10-09 02:26 | 28K | |
| p5-Net-Libdnet-0.99.pkg | 2023-10-06 18:34 | 41K | |
| p5-Net-Libdnet6-0.28..> | 2023-10-08 01:58 | 5.1K | |
| p5-Net-LimeLight-Pur..> | 2023-10-11 09:01 | 9.7K | |
| p5-Net-MAC-2.103622_..> | 2023-10-09 07:15 | 14K | |
| p5-Net-MAC-Vendor-1...> | 2023-10-10 20:41 | 8.2K | |
| p5-Net-MQTT-1.143260..> | 2023-10-08 05:29 | 48K | |
| p5-Net-ManageSieve-0..> | 2023-10-09 09:50 | 16K | |
| p5-Net-Mosso-CloudFi..> | 2023-10-14 08:17 | 15K | |
| p5-Net-MovableType-1..> | 2023-10-09 00:04 | 18K | |
| p5-Net-NBName-0.26_1..> | 2023-10-08 14:48 | 18K | |
| p5-Net-NBsocket-0.24..> | 2023-10-07 06:47 | 11K | |
| p5-Net-NIS-0.44_1.pkg | 2023-10-08 03:03 | 23K | |
| p5-Net-NIS-Listgroup..> | 2023-10-10 20:02 | 11K | |
| p5-Net-NSCA-Client-0..> | 2023-10-14 14:55 | 46K | |
| p5-Net-NTP-1.5.pkg | 2023-10-14 05:12 | 8.0K | |
| p5-Net-Nessus-XMLRPC..> | 2023-10-08 19:11 | 10K | |
| p5-Net-NetSend-0.12_..> | 2023-10-09 03:54 | 12K | |
| p5-Net-Netcat-0.05.pkg | 2023-10-14 10:41 | 6.1K | |
| p5-Net-Netmask-2.000..> | 2023-10-06 21:00 | 19K | |
| p5-Net-Nmsg-0.17_2.pkg | 2023-10-08 14:32 | 63K | |
| p5-Net-Nslookup-2.04..> | 2023-10-10 10:35 | 6.2K | |
| p5-Net-OAuth-0.28_1.pkg | 2023-10-06 14:38 | 59K | |
| p5-Net-OAuth-Simple-..> | 2023-10-08 09:09 | 13K | |
| p5-Net-OAuth2-0.67.pkg | 2023-10-06 23:58 | 33K | |
| p5-Net-OSCAR-1.928_1..> | 2023-10-08 22:08 | 118K | |
| p5-Net-OpenID-Common..> | 2023-10-07 03:27 | 31K | |
| p5-Net-OpenID-Consum..> | 2023-10-07 14:43 | 48K | |
| p5-Net-OpenID-JanRai..> | 2023-10-08 19:09 | 45K | |
| p5-Net-OpenID-Server..> | 2023-10-08 18:39 | 17K | |
| p5-Net-OpenSSH-0.84.pkg | 2023-10-07 22:52 | 91K | |
| p5-Net-OpenSSH-Paral..> | 2023-10-11 09:53 | 24K | |
| p5-Net-OpenStack-Att..> | 2023-10-09 09:20 | 6.6K | |
| p5-Net-OpenVPN-Manag..> | 2023-10-08 22:01 | 13K | |
| p5-Net-POP3-SSLWrapp..> | 2023-10-14 08:00 | 2.9K | |
| p5-Net-Packet-3.27_1..> | 2023-10-07 04:48 | 141K | |
| p5-Net-Packet-Target..> | 2023-10-08 02:05 | 5.0K | |
| p5-Net-ParseWhois-0...> | 2023-10-11 00:50 | 22K | |
| p5-Net-Patricia-1.22..> | 2023-10-07 20:01 | 23K | |
| p5-Net-Pcap-0.21.pkg | 2023-10-06 16:51 | 46K | |
| p5-Net-PcapUtils-0.0..> | 2023-10-08 04:18 | 6.8K | |
| p5-Net-Ping-2.75.pkg | 2023-10-14 10:29 | 31K | |
| p5-Net-Ping-External..> | 2023-10-14 15:52 | 9.1K | |
| p5-Net-Plurk-0.11_1.pkg | 2023-10-08 20:02 | 14K | |
| p5-Net-Printer-1.12_..> | 2023-10-08 16:48 | 9.8K | |
| p5-Net-Proxy-0.13_1.pkg | 2023-10-09 16:28 | 55K | |
| p5-Net-PubSubHubbub-..> | 2023-10-09 14:36 | 4.3K | |
| p5-Net-QMTP-0.06_1.pkg | 2023-10-09 11:41 | 11K | |
| p5-Net-RBLClient-0.5..> | 2023-10-08 19:42 | 12K | |
| p5-Net-RNDC-0.003.pkg | 2023-10-09 00:19 | 17K | |
| p5-Net-RTP-0.09_2.pkg | 2023-10-10 16:06 | 29K | |
| p5-Net-RabbitFoot-1...> | 2023-10-14 08:44 | 28K | |
| p5-Net-RabbitMQ-0.2...> | 2023-10-09 02:44 | 42K | |
| p5-Net-Radius-2.103_..> | 2023-10-07 14:56 | 20K | |
| p5-Net-Radius-Server..> | 2023-10-09 21:21 | 90K | |
| p5-Net-Random-2.32.pkg | 2023-10-09 01:32 | 9.6K | |
| p5-Net-RawIP-0.25_1,..> | 2023-10-07 17:48 | 45K | |
| p5-Net-Rendezvous-Pu..> | 2023-10-09 11:01 | 6.3K | |
| p5-Net-Riak-0.1702.pkg | 2023-10-10 07:12 | 55K | |
| p5-Net-Rsh-0.05_1.pkg | 2023-10-11 13:50 | 2.8K | |
| p5-Net-SAML2-0.74.pkg | 2023-10-08 19:29 | 60K | |
| p5-Net-SAP-0.10_4.pkg | 2023-10-10 07:26 | 17K | |
| p5-Net-SCP-0.08_2.pkg | 2023-10-09 16:39 | 9.1K | |
| p5-Net-SCP-Expect-0...> | 2023-10-14 05:19 | 12K | |
| p5-Net-SDP-0.07_2.pkg | 2023-10-08 00:59 | 29K | |
| p5-Net-SFTP-0.12_1.pkg | 2023-10-08 07:26 | 25K | |
| p5-Net-SFTP-Foreign-..> | 2023-10-08 10:34 | 91K | |
| p5-Net-SIP-0.836.pkg | 2023-10-14 15:43 | 217K | |
| p5-Net-SMPP-1.19_2.pkg | 2023-10-10 16:56 | 44K | |
| p5-Net-SMS-Clickatel..> | 2023-10-10 09:05 | 6.1K | |
| p5-Net-SMS-Mollie-0...> | 2023-10-14 10:42 | 7.1K | |
| p5-Net-SMS-PChome-0...> | 2023-10-10 17:14 | 7.3K | |
| p5-Net-SMTP-Server-1..> | 2023-10-10 17:54 | 13K | |
| p5-Net-SMTP-TLS-0.12..> | 2023-10-07 09:04 | 7.6K | |
| p5-Net-SMTP-TLS-ButM..> | 2023-10-08 09:18 | 8.3K | |
| p5-Net-SMTPS-0.03_2.pkg | 2023-10-08 09:15 | 5.1K | |
| p5-Net-SMTP_auth-0.0..> | 2023-10-09 04:15 | 5.8K | |
| p5-Net-SNMP-6.0.1_1.pkg | 2023-10-07 01:35 | 76K | |
| p5-Net-SNMP-Util-1.0..> | 2023-10-11 18:20 | 36K | |
| p5-Net-SNMPTrapd-0.1..> | 2023-10-08 20:45 | 19K | |
| p5-Net-SNPP-1.17_2.pkg | 2023-10-08 17:42 | 20K | |
| p5-Net-SPDY-0.1.5_2.pkg | 2023-10-07 20:06 | 30K | |
| p5-Net-SSH-0.09_1.pkg | 2023-10-08 02:57 | 7.6K | |
| p5-Net-SSH-Authorize..> | 2023-10-09 22:13 | 21K | |
| p5-Net-SSH-Expect-1...> | 2023-10-09 14:40 | 22K | |
| p5-Net-SSH-Mechanize..> | 2023-10-10 12:32 | 29K | |
| p5-Net-SSH-Perl-2.14..> | 2023-10-07 08:18 | 261K | |
| p5-Net-SSH2-0.73.pkg | 2023-10-07 09:10 | 93K | |
| p5-Net-SSL-ExpireDat..> | 2023-10-09 08:36 | 8.0K | |
| p5-Net-SSLGlue-1.058..> | 2023-10-08 07:48 | 25K | |
| p5-Net-SSLeay-1.92.pkg | 2023-10-05 16:50 | 280K | |
| p5-Net-STF-Client-1...> | 2023-10-09 07:55 | 9.7K | |
| p5-Net-STOMP-Client-..> | 2023-10-10 18:58 | 59K | |
| p5-Net-SenderBase-1...> | 2023-10-08 04:05 | 11K | |
| p5-Net-Server-2.014.pkg | 2023-10-07 09:32 | 160K | |
| p5-Net-Server-Coro-1..> | 2023-10-07 22:25 | 8.8K | |
| p5-Net-Server-Mail-0..> | 2023-10-07 14:25 | 33K | |
| p5-Net-Server-Mail-E..> | 2023-10-10 14:37 | 4.7K | |
| p5-Net-Server-SS-Pre..> | 2023-10-14 15:28 | 3.5K | |
| p5-Net-SinFP-2.10.pkg | 2023-10-08 23:22 | 33K | |
| p5-Net-Snort-Parser-..> | 2023-10-08 12:28 | 20K | |
| p5-Net-Stomp-0.61.pkg | 2023-10-12 12:45 | 23K | |
| p5-Net-Subnet-1.03_1..> | 2023-10-09 03:41 | 6.3K | |
| p5-Net-Syslog-0.04_1..> | 2023-10-09 13:45 | 4.4K | |
| p5-Net-TCLink-3.4_2.pkg | 2023-10-08 06:56 | 13K | |
| p5-Net-TacacsPlus-1...> | 2023-10-14 16:01 | 34K | |
| p5-Net-TcpDumpLog-0...> | 2023-10-14 09:42 | 7.3K | |
| p5-Net-Telnet-3.05.pkg | 2023-10-06 19:09 | 50K | |
| p5-Net-Telnet-Cisco-..> | 2023-10-07 15:21 | 19K | |
| p5-Net-Telnet-Cisco-..> | 2023-10-09 07:37 | 7.0K | |
| p5-Net-Telnet-Netscr..> | 2023-10-08 20:46 | 9.7K | |
| p5-Net-TiVo-0.11_1.pkg | 2023-10-09 05:13 | 12K | |
| p5-Net-Todoist-0.06_..> | 2023-10-14 15:06 | 6.5K | |
| p5-Net-Trac-0.16_1.pkg | 2023-10-08 02:22 | 28K | |
| p5-Net-Traceroute-1...> | 2023-10-07 20:44 | 17K | |
| p5-Net-Traceroute-Pu..> | 2023-10-09 11:09 | 19K | |
| p5-Net-Traceroute6-0..> | 2023-10-14 05:36 | 13K | |
| p5-Net-Trackback-1.0..> | 2023-10-10 04:04 | 23K | |
| p5-Net-Twitter-4.010..> | 2023-10-07 01:57 | 125K | |
| p5-Net-Twitter-Lite-..> | 2023-10-10 17:00 | 77K | |
| p5-Net-UPS-0.16_1.pkg | 2023-10-10 14:07 | 41K | |
| p5-Net-UPnP-1.4.6.pkg | 2023-10-07 06:20 | 40K | |
| p5-Net-VNC-0.40_3.pkg | 2023-10-10 17:59 | 18K | |
| p5-Net-Wake-0.02_1.pkg | 2023-10-09 07:51 | 3.7K | |
| p5-Net-WhitePages-1...> | 2023-10-08 07:12 | 5.1K | |
| p5-Net-Whois-1.9_1.pkg | 2023-10-08 07:21 | 8.1K | |
| p5-Net-Whois-ARIN-0...> | 2023-10-14 03:17 | 19K | |
| p5-Net-Whois-IP-1.19..> | 2023-10-08 08:27 | 6.7K | |
| p5-Net-Whois-RIPE-2...> | 2023-10-09 18:24 | 200K | |
| p5-Net-Whois-Raw-2.9..> | 2023-10-07 17:53 | 46K | |
| p5-Net-Works-0.22.pkg | 2023-10-08 04:51 | 21K | |
| p5-Net-Write-1.05_1.pkg | 2023-10-06 20:08 | 13K | |
| p5-Net-XMPP-1.05_1.pkg | 2023-10-07 09:57 | 100K | |
| p5-Net-XMPP2-0.14_2.pkg | 2023-10-08 21:28 | 191K | |
| p5-Net-XWhois-0.90_5..> | 2023-10-07 21:05 | 17K | |
| p5-Net-YAP-0.6_1.pkg | 2023-10-14 05:10 | 3.5K | |
| p5-Net-YASA-0.03_1.pkg | 2023-10-09 08:59 | 9.8K | |
| p5-Net-Yadis-1.0_2.pkg | 2023-10-08 08:06 | 7.6K | |
| p5-Net-Z3950-SimpleS..> | 2023-10-10 05:43 | 49K | |
| p5-Net-Z3950-ZOOM-1...> | 2023-10-08 19:49 | 70K | |
| p5-Net-eBay-0.62.pkg | 2023-10-09 06:54 | 26K | |
| p5-Net-ext-1.011_2.pkg | 2023-10-09 08:25 | 113K | |
| p5-Net-sFlow-0.11_1.pkg | 2023-10-10 13:50 | 18K | |
| p5-Net-uFTP-0.161_1.pkg | 2023-10-14 15:01 | 12K | |
| p5-Net-vCard-0.5_1.pkg | 2023-10-09 23:30 | 14K | |
| p5-NetAddr-IP-4.079.pkg | 2023-10-06 15:54 | 77K | |
| p5-NetAddr-IP-Count-..> | 2023-10-09 01:21 | 5.5K | |
| p5-NetAddr-IP-Find-0..> | 2023-10-10 10:40 | 4.0K | |
| p5-NetAddr-IP-Lite-1..> | 2023-10-09 12:08 | 32K | |
| p5-NetAddr-MAC-0.97.pkg | 2023-10-07 13:41 | 16K | |
| p5-NetApp-500.002_1.pkg | 2023-10-08 20:28 | 60K | |
| p5-NetCDF-1.2.4_9.pkg | 2023-10-09 07:49 | 20K | |
| p5-NetPacket-1.6.0.pkg | 2023-10-07 11:32 | 44K | |
| p5-News-Article-1.27..> | 2023-10-07 16:30 | 29K | |
| p5-News-Article-NoCe..> | 2023-10-09 10:49 | 5.7K | |
| p5-News-Newsrc-1.11_..> | 2023-10-08 11:06 | 13K | |
| p5-Newsletter-0.033.pkg | 2023-10-09 16:36 | 28K | |
| p5-Nexmo-SMS-0.06_2.pkg | 2023-10-07 21:48 | 23K | |
| p5-Nginx-ReadBody-0...> | 2023-10-09 16:47 | 13K | |
| p5-Nginx-Simple-0.07..> | 2023-10-08 22:51 | 22K | |
| p5-Nmap-Parser-1.37.pkg | 2023-10-08 01:07 | 24K | |
| p5-Nmap-Scanner-1.0_..> | 2023-10-10 20:44 | 63K | |
| p5-No-Worries-1.7.pkg | 2023-10-07 20:12 | 68K | |
| p5-Number-Bytes-Huma..> | 2023-10-07 15:50 | 12K | |
| p5-Number-Compare-0...> | 2023-10-05 16:55 | 3.7K | |
| p5-Number-Format-1.7..> | 2023-10-06 17:52 | 21K | |
| p5-Number-Format-Met..> | 2023-10-07 08:10 | 4.4K | |
| p5-Number-Fraction-3..> | 2023-10-09 00:09 | 12K | |
| p5-Number-Misc-1.2.pkg | 2023-10-09 15:57 | 6.8K | |
| p5-Number-Nary-1.100..> | 2023-10-10 15:55 | 7.8K | |
| p5-Number-RecordLoca..> | 2023-10-07 12:24 | 4.8K | |
| p5-Number-Spell-0.04..> | 2023-10-07 23:28 | 5.0K | |
| p5-Number-Tolerant-1..> | 2023-10-07 23:42 | 38K | |
| p5-Number-Uncertaint..> | 2023-10-07 04:41 | 5.8K | |
| p5-Number-WithError-..> | 2023-10-07 23:44 | 18K | |
| p5-Number-WithError-..> | 2023-10-09 22:29 | 7.1K | |
| p5-OAI-Harvester-1.2..> | 2023-10-10 03:52 | 57K | |
| p5-ODF-lpOD-1.127.pkg | 2023-10-08 11:01 | 349K | |
| p5-ODF-lpOD_Helper-6..> | 2023-10-08 23:55 | 45K | |
| p5-OLE-Storage_Lite-..> | 2023-10-05 17:03 | 14K | |
| p5-OOTools-2.40.pkg | 2023-10-07 00:59 | 51K | |
| p5-ORLite-1.98_1.pkg | 2023-10-08 11:52 | 27K | |
| p5-ORLite-Migrate-1...> | 2023-10-14 04:53 | 16K | |
| p5-OSSP-uuid-1.6.2_9..> | 2023-10-07 22:15 | 15K | |
| p5-Object-AUTHORITY-..> | 2023-10-07 10:34 | 5.2K | |
| p5-Object-Accessor-0..> | 2023-10-06 22:57 | 13K | |
| p5-Object-Array-0.06..> | 2023-10-07 21:12 | 10K | |
| p5-Object-Container-..> | 2023-10-08 02:55 | 16K | |
| p5-Object-Declare-0...> | 2023-10-06 22:43 | 9.8K | |
| p5-Object-Destroyer-..> | 2023-10-08 04:56 | 11K | |
| p5-Object-Enum-0.07...> | 2023-10-14 17:22 | 6.0K | |
| p5-Object-Event-1.22..> | 2023-10-07 04:14 | 14K | |
| p5-Object-Import-1.0..> | 2023-10-10 04:12 | 18K | |
| p5-Object-InsideOut-..> | 2023-10-07 13:38 | 112K | |
| p5-Object-MultiType-..> | 2023-10-07 17:24 | 10K | |
| p5-Object-Pad-0.80.1..> | 2023-10-06 16:59 | 98K | |
| p5-Object-Pluggable-..> | 2023-10-06 17:37 | 19K | |
| p5-Object-Realize-La..> | 2023-10-07 01:02 | 13K | |
| p5-Object-Role-0.001..> | 2023-10-07 09:20 | 4.7K | |
| p5-Object-Signature-..> | 2023-10-06 17:41 | 7.0K | |
| p5-Object-Simple-3.1..> | 2023-10-07 14:21 | 12K | |
| p5-Object-Tiny-1.09.pkg | 2023-10-07 04:37 | 8.9K | |
| p5-Object-Tiny-Lvalu..> | 2023-10-08 13:02 | 3.0K | |
| p5-Object-Tiny-RW-1...> | 2023-10-10 11:42 | 3.7K | |
| p5-Ogg-Vorbis-Header..> | 2023-10-07 15:44 | 17K | |
| p5-Ogg-Vorbis-Header..> | 2023-10-10 07:08 | 8.4K | |
| p5-Olson-Abbreviatio..> | 2023-10-07 04:43 | 5.8K | |
| p5-Opcodes-0.14_1.pkg | 2023-10-08 03:02 | 12K | |
| p5-OpenAI-API-0.37.pkg | 2023-10-09 01:38 | 43K | |
| p5-OpenAPI-Client-1...> | 2023-10-10 10:36 | 13K | |
| p5-OpenCA-CRL-0.9.6_..> | 2023-10-14 09:32 | 9.1K | |
| p5-OpenCA-CRR-0.0.2_..> | 2023-10-09 03:15 | 5.3K | |
| p5-OpenCA-REQ-0.9.60..> | 2023-10-08 20:03 | 10K | |
| p5-OpenCA-X509-0.9.1..> | 2023-10-10 17:51 | 7.6K | |
| p5-OpenOffice-OODoc-..> | 2023-10-14 05:29 | 427K | |
| p5-OrePAN2-0.49_1.pkg | 2023-10-08 02:10 | 34K | |
| p5-Oryx-0.24_2.pkg | 2023-10-07 10:45 | 132K | |
| p5-Ouch-0.0501.pkg | 2023-10-07 11:01 | 9.4K | |
| p5-OurNet-BBS-1.66_6..> | 2023-10-11 11:10 | 75K | |
| p5-OurNet-BBSAgent-1..> | 2023-10-07 11:33 | 22K | |
| p5-PAR-1.018.pkg | 2023-10-07 04:33 | 67K | |
| p5-PAR-Dist-0.52.pkg | 2023-10-06 17:41 | 19K | |
| p5-PAR-Packer-1.059.pkg | 2023-10-08 07:51 | 2.3M | |
| p5-PBKDF2-Tiny-0.005..> | 2023-10-06 22:03 | 6.9K | |
| p5-PCSC-Card-1.4.14.pkg | 2023-10-08 04:46 | 30K | |
| p5-PDF-API2-2.044.pkg | 2023-10-06 23:59 | 1.3M | |
| p5-PDF-API2-Simple-1..> | 2023-10-10 13:22 | 13K | |
| p5-PDF-API2-XS-1.002..> | 2023-10-06 21:08 | 6.3K | |
| p5-PDF-API3-3.001_1.pkg | 2023-10-09 16:14 | 3.3M | |
| p5-PDF-Builder-3.025..> | 2023-10-08 01:08 | 1.7M | |
| p5-PDF-Create-1.46.pkg | 2023-10-10 04:08 | 47K | |
| p5-PDF-FromHTML-0.33..> | 2023-10-09 18:34 | 76K | |
| p5-PDF-Reuse-0.39_1.pkg | 2023-10-09 22:40 | 73K | |
| p5-PDF-Table-1.005.pkg | 2023-10-10 18:57 | 46K | |
| p5-PDF-Template-0.22..> | 2023-10-08 18:52 | 62K | |
| p5-PDF-Tiny-0.09.pkg | 2023-10-09 19:37 | 33K | |
| p5-PDF-WebKit-1.2.pkg | 2023-10-10 20:33 | 7.8K | |
| p5-PDF-Writer-0.06_1..> | 2023-10-07 23:21 | 9.9K | |
| p5-PDFLib-0.14_1.pkg | 2023-10-08 02:10 | 21K | |
| p5-PGP-0.3a_2.pkg | 2023-10-09 11:54 | 15K | |
| p5-PGP-Sign-1.04.pkg | 2023-10-07 04:40 | 17K | |
| p5-PGPLOT-2.21_17.pkg | 2023-10-07 09:30 | 55K | |
| p5-PHP-Serialization..> | 2023-10-08 16:43 | 6.6K | |
| p5-PHP-Session-0.27_..> | 2023-10-08 07:40 | 10K | |
| p5-POD2-Base-0.043_1..> | 2023-10-14 07:52 | 16K | |
| p5-POE-1.370.pkg | 2023-10-05 17:12 | 438K | |
| p5-POE-API-Hooks-1.0..> | 2023-10-11 00:02 | 6.3K | |
| p5-POE-API-Peek-2.20..> | 2023-10-07 05:59 | 11K | |
| p5-POE-Component-Chi..> | 2023-10-08 21:55 | 11K | |
| p5-POE-Component-Cli..> | 2023-10-06 19:39 | 13K | |
| p5-POE-Component-Cli..> | 2023-10-07 18:58 | 7.9K | |
| p5-POE-Component-Cli..> | 2023-10-08 11:04 | 6.6K | |
| p5-POE-Component-Cli..> | 2023-10-14 12:01 | 17K | |
| p5-POE-Component-Cli..> | 2023-10-07 07:47 | 44K | |
| p5-POE-Component-Cli..> | 2023-10-07 08:48 | 15K | |
| p5-POE-Component-Cli..> | 2023-10-06 22:38 | 21K | |
| p5-POE-Component-Cli..> | 2023-10-07 11:32 | 18K | |
| p5-POE-Component-Cli..> | 2023-10-10 07:07 | 19K | |
| p5-POE-Component-Cli..> | 2023-10-09 13:58 | 16K | |
| p5-POE-Component-Cli..> | 2023-10-09 08:01 | 16K | |
| p5-POE-Component-Cli..> | 2023-10-10 21:08 | 8.1K | |
| p5-POE-Component-Cli..> | 2023-10-08 12:16 | 18K | |
| p5-POE-Component-Cli..> | 2023-10-09 09:58 | 3.9K | |
| p5-POE-Component-Cli..> | 2023-10-10 19:52 | 12K | |
| p5-POE-Component-Cli..> | 2023-10-09 03:17 | 15K | |
| p5-POE-Component-Con..> | 2023-10-09 07:12 | 15K | |
| p5-POE-Component-Cro..> | 2023-10-10 08:17 | 3.6K | |
| p5-POE-Component-DBI..> | 2023-10-14 07:04 | 20K | |
| p5-POE-Component-Dae..> | 2023-10-11 00:20 | 61K | |
| p5-POE-Component-Deb..> | 2023-10-14 05:43 | 7.9K | |
| p5-POE-Component-Dir..> | 2023-10-09 21:33 | 18K | |
| p5-POE-Component-Eas..> | 2023-10-09 00:08 | 33K | |
| p5-POE-Component-Gen..> | 2023-10-07 16:53 | 39K | |
| p5-POE-Component-Hai..> | 2023-10-07 22:50 | 5.8K | |
| p5-POE-Component-IKC..> | 2023-10-09 02:06 | 77K | |
| p5-POE-Component-IRC..> | 2023-10-07 05:45 | 193K | |
| p5-POE-Component-IRC..> | 2023-10-10 22:15 | 5.3K | |
| p5-POE-Component-IRC..> | 2023-10-08 20:28 | 6.2K | |
| p5-POE-Component-IRC..> | 2023-10-08 12:10 | 4.4K | |
| p5-POE-Component-IRC..> | 2023-10-09 03:49 | 5.9K | |
| p5-POE-Component-IRC..> | 2023-10-09 22:05 | 11K | |
| p5-POE-Component-IRC..> | 2023-10-08 14:00 | 11K | |
| p5-POE-Component-IRC..> | 2023-10-10 03:57 | 5.8K | |
| p5-POE-Component-IRC..> | 2023-10-14 06:08 | 6.3K | |
| p5-POE-Component-IRC..> | 2023-10-10 03:55 | 5.6K | |
| p5-POE-Component-IRC..> | 2023-10-09 22:22 | 5.8K | |
| p5-POE-Component-Jab..> | 2023-10-10 08:24 | 43K | |
| p5-POE-Component-Job..> | 2023-10-09 20:07 | 12K | |
| p5-POE-Component-LaD..> | 2023-10-14 05:31 | 28K | |
| p5-POE-Component-Log..> | 2023-10-14 18:50 | 6.1K | |
| p5-POE-Component-Pca..> | 2023-10-08 12:28 | 6.8K | |
| p5-POE-Component-Plu..> | 2023-10-07 07:23 | 19K | |
| p5-POE-Component-Pub..> | 2023-10-08 08:57 | 15K | |
| p5-POE-Component-RRD..> | 2023-10-09 05:27 | 9.5K | |
| p5-POE-Component-RSS..> | 2023-10-11 01:11 | 6.5K | |
| p5-POE-Component-RSS..> | 2023-10-10 03:01 | 7.2K | |
| p5-POE-Component-Res..> | 2023-10-06 18:28 | 15K | |
| p5-POE-Component-SMT..> | 2023-10-10 21:55 | 9.8K | |
| p5-POE-Component-SNM..> | 2023-10-14 16:54 | 19K | |
| p5-POE-Component-SSL..> | 2023-10-06 22:51 | 27K | |
| p5-POE-Component-Sch..> | 2023-10-08 00:47 | 7.5K | |
| p5-POE-Component-Ser..> | 2023-10-09 13:17 | 11K | |
| p5-POE-Component-Ser..> | 2023-10-08 02:46 | 12K | |
| p5-POE-Component-Ser..> | 2023-10-14 12:18 | 31K | |
| p5-POE-Component-Ser..> | 2023-10-08 01:11 | 70K | |
| p5-POE-Component-Ser..> | 2023-10-08 17:28 | 16K | |
| p5-POE-Component-Ser..> | 2023-10-14 12:02 | 4.2K | |
| p5-POE-Component-Ser..> | 2023-10-14 18:05 | 19K | |
| p5-POE-Component-Ser..> | 2023-10-08 11:54 | 27K | |
| p5-POE-Component-Ser..> | 2023-10-10 19:31 | 35K | |
| p5-POE-Component-Ser..> | 2023-10-08 22:28 | 6.2K | |
| p5-POE-Component-Syn..> | 2023-10-06 22:31 | 15K | |
| p5-POE-Component-TST..> | 2023-10-08 00:20 | 3.3K | |
| p5-POE-Devel-Profile..> | 2023-10-09 06:52 | 11K | |
| p5-POE-Filter-Bzip2-..> | 2023-10-09 06:59 | 4.0K | |
| p5-POE-Filter-DNS-TC..> | 2023-10-07 12:13 | 4.0K | |
| p5-POE-Filter-HTTP-P..> | 2023-10-06 23:18 | 6.1K | |
| p5-POE-Filter-IRCD-2..> | 2023-10-06 19:31 | 6.2K | |
| p5-POE-Filter-LZF-1...> | 2023-10-11 03:32 | 3.8K | |
| p5-POE-Filter-LZO-1...> | 2023-10-09 14:43 | 4.1K | |
| p5-POE-Filter-LZW-1...> | 2023-10-11 00:38 | 3.9K | |
| p5-POE-Filter-SSL-0...> | 2023-10-09 09:11 | 27K | |
| p5-POE-Filter-Transp..> | 2023-10-07 15:09 | 8.1K | |
| p5-POE-Filter-XML-1...> | 2023-10-08 06:11 | 17K | |
| p5-POE-Filter-Zlib-2..> | 2023-10-07 08:53 | 7.6K | |
| p5-POE-Loop-AnyEvent..> | 2023-10-08 07:25 | 5.2K | |
| p5-POE-Loop-Glib-0.0..> | 2023-10-08 01:46 | 8.0K | |
| p5-POE-Loop-Tk-1.305..> | 2023-10-10 05:50 | 11K | |
| p5-POE-Quickie-0.18_..> | 2023-10-08 12:27 | 10K | |
| p5-POE-Session-Irssi..> | 2023-10-10 15:19 | 7.0K | |
| p5-POE-Session-Multi..> | 2023-10-07 23:14 | 7.6K | |
| p5-POE-Stage-0.0600_..> | 2023-10-12 08:37 | 73K | |
| p5-POE-Test-Loops-1...> | 2023-10-05 17:03 | 56K | |
| p5-POE-XS-Loop-Poll-..> | 2023-10-14 04:15 | 12K | |
| p5-POE-XS-Queue-Arra..> | 2023-10-09 12:45 | 16K | |
| p5-POEx-Role-PSGISer..> | 2023-10-07 20:16 | 15K | |
| p5-POEx-Role-Session..> | 2023-10-06 20:32 | 27K | |
| p5-POEx-Role-Streami..> | 2023-10-07 04:18 | 6.5K | |
| p5-POEx-Role-TCPServ..> | 2023-10-07 04:47 | 5.6K | |
| p5-POEx-Types-1.1009..> | 2023-10-06 17:21 | 3.8K | |
| p5-POSIX-Regex-1.000..> | 2023-10-14 03:47 | 10K | |
| p5-POSIX-Run-Capture..> | 2023-10-09 23:20 | 20K | |
| p5-POSIX-Socket-0.09..> | 2023-10-10 08:43 | 11K | |
| p5-POSIX-getpeername..> | 2023-10-07 21:08 | 5.7K | |
| p5-POSIX-strftime-Co..> | 2023-10-05 16:54 | 8.0K | |
| p5-POSIX-strptime-0...> | 2023-10-09 12:03 | 6.4K | |
| p5-PPI-1.276.pkg | 2023-10-05 16:55 | 292K | |
| p5-PPI-HTML-1.08_1.pkg | 2023-10-14 18:46 | 8.9K | |
| p5-PPI-XS-0.910.pkg | 2023-10-09 04:27 | 6.4K | |
| p5-PPIx-EditorTools-..> | 2023-10-14 07:14 | 32K | |
| p5-PPIx-QuoteLike-0...> | 2023-10-07 07:10 | 57K | |
| p5-PPIx-Regexp-0.088..> | 2023-10-07 06:25 | 230K | |
| p5-PPIx-Utilities-1...> | 2023-10-09 12:30 | 16K | |
| p5-PPIx-Utils-0.003.pkg | 2023-10-06 23:39 | 24K | |
| p5-PPR-0.001008.pkg | 2023-10-07 07:33 | 60K | |
| p5-PPerl-0.25_4.pkg | 2023-10-10 20:03 | 18K | |
| p5-PSGI-1.102_1.pkg | 2023-10-07 10:24 | 40K | |
| p5-PV-1.5_1.pkg | 2023-10-10 08:32 | 14K | |
| p5-Package-Constants..> | 2023-10-07 03:31 | 3.7K | |
| p5-Package-Deprecati..> | 2023-10-05 16:51 | 7.9K | |
| p5-Package-Generator..> | 2023-10-07 09:21 | 7.5K | |
| p5-Package-MoreUtil-..> | 2023-10-07 04:35 | 5.3K | |
| p5-Package-Stash-0.4..> | 2023-10-05 16:49 | 14K | |
| p5-Package-Stash-XS-..> | 2023-10-05 16:48 | 13K | |
| p5-Package-Util-Lite..> | 2023-10-07 09:19 | 4.4K | |
| p5-Package-Variant-1..> | 2023-10-06 15:12 | 10K | |
| p5-PadWalker-2.5.pkg | 2023-10-05 16:55 | 11K | |
| p5-Pango-1.227_2.pkg | 2023-10-06 16:15 | 153K | |
| p5-Parallel-Async-0...> | 2023-10-14 14:31 | 11K | |
| p5-Parallel-Fork-Bos..> | 2023-10-14 06:33 | 7.1K | |
| p5-Parallel-ForkMana..> | 2023-10-07 00:05 | 22K | |
| p5-Parallel-Iterator..> | 2023-10-06 18:25 | 13K | |
| p5-Parallel-Prefork-..> | 2023-10-06 23:01 | 11K | |
| p5-Parallel-Pvm-1.4...> | 2023-10-10 19:58 | 38K | |
| p5-Parallel-Scoreboa..> | 2023-10-08 11:26 | 9.1K | |
| p5-ParallelUserAgent..> | 2023-10-08 04:11 | 61K | |
| p5-Params-CallbackRe..> | 2023-10-07 19:42 | 47K | |
| p5-Params-Check-0.38..> | 2023-10-14 09:40 | 13K | |
| p5-Params-Classify-0..> | 2023-10-05 16:57 | 17K | |
| p5-Params-Coerce-0.1..> | 2023-10-08 06:16 | 9.9K | |
| p5-Params-Util-1.102..> | 2023-10-05 16:48 | 18K | |
| p5-Params-Validate-1..> | 2023-10-05 16:53 | 42K | |
| p5-Params-Validate-D..> | 2023-10-08 20:46 | 17K | |
| p5-Params-Validation..> | 2023-10-05 16:52 | 18K | |
| p5-Paranoid-2.10.pkg | 2023-10-08 00:31 | 190K | |
| p5-Paranoid-Log-Emai..> | 2023-10-10 21:53 | 4.9K | |
| p5-Paranoid-Log-Sysl..> | 2023-10-08 23:00 | 4.5K | |
| p5-Parse-ANSIColor-T..> | 2023-10-07 02:26 | 11K | |
| p5-Parse-BooleanLogi..> | 2023-10-10 23:21 | 11K | |
| p5-Parse-CPAN-Packag..> | 2023-10-10 00:16 | 12K | |
| p5-Parse-CPAN-Packag..> | 2023-10-07 00:08 | 6.2K | |
| p5-Parse-CSV-2.07.pkg | 2023-10-09 21:11 | 11K | |
| p5-Parse-Distname-0...> | 2023-10-06 19:00 | 7.3K | |
| p5-Parse-EDID-1.0.7.pkg | 2023-10-10 00:45 | 9.0K | |
| p5-Parse-ErrorString..> | 2023-10-08 22:00 | 15K | |
| p5-Parse-ExuberantCT..> | 2023-10-08 13:22 | 15K | |
| p5-Parse-FixedLength..> | 2023-10-10 14:00 | 16K | |
| p5-Parse-Flex-0.12_1..> | 2023-10-09 15:28 | 11K | |
| p5-Parse-HTTP-UserAg..> | 2023-10-14 13:39 | 26K | |
| p5-Parse-IRC-1.22.pkg | 2023-10-10 14:17 | 8.3K | |
| p5-Parse-LocalDistri..> | 2023-10-07 06:15 | 7.9K | |
| p5-Parse-MIME-1.006.pkg | 2023-10-09 04:21 | 5.6K | |
| p5-Parse-Method-Sign..> | 2023-10-05 17:00 | 20K | |
| p5-Parse-Netstat-0.1..> | 2023-10-10 21:19 | 29K | |
| p5-Parse-PMFile-0.44..> | 2023-10-06 20:03 | 12K | |
| p5-Parse-PerlConfig-..> | 2023-10-14 18:05 | 14K | |
| p5-Parse-PhoneNumber..> | 2023-10-10 10:15 | 5.7K | |
| p5-Parse-PlainConfig..> | 2023-10-14 05:13 | 41K | |
| p5-Parse-Range-0.96_..> | 2023-10-07 12:56 | 5.8K | |
| p5-Parse-RecDescent-..> | 2023-10-06 14:38 | 128K | |
| p5-Parse-Snort-0.9.pkg | 2023-10-08 20:31 | 13K | |
| p5-Parse-Syslog-1.10..> | 2023-10-08 03:13 | 9.0K | |
| p5-Parse-Syslog-Mail..> | 2023-10-09 12:37 | 7.5K | |
| p5-Parse-VarName-0.0..> | 2023-10-07 10:02 | 4.0K | |
| p5-Parse-Win32Regist..> | 2023-10-08 13:15 | 70K | |
| p5-Parse-Yapp-1.21.pkg | 2023-10-05 17:06 | 34K | |
| p5-ParseLex-2.21_1.pkg | 2023-10-07 10:56 | 46K | |
| p5-ParseTemplate-3.0..> | 2023-10-07 07:11 | 12K | |
| p5-Parser-MGC-0.21.pkg | 2023-10-06 18:19 | 40K | |
| p5-PatchReader-0.9.6..> | 2023-10-07 09:09 | 11K | |
| p5-Path-Abstract-0.0..> | 2023-10-07 09:30 | 12K | |
| p5-Path-Class-0.37.pkg | 2023-10-05 17:04 | 34K | |
| p5-Path-Class-File-L..> | 2023-10-14 12:55 | 5.6K | |
| p5-Path-Class-URI-0...> | 2023-10-14 03:11 | 6.5K | |
| p5-Path-Dispatcher-1..> | 2023-10-06 19:38 | 51K | |
| p5-Path-Dispatcher-D..> | 2023-10-07 04:20 | 6.7K | |
| p5-Path-Extended-0.2..> | 2023-10-14 12:27 | 28K | |
| p5-Path-FindDev-0.5...> | 2023-10-07 05:03 | 8.9K | |
| p5-Path-IsDev-1.0010..> | 2023-10-06 20:26 | 61K | |
| p5-Path-Iterator-Rul..> | 2023-10-07 01:11 | 36K | |
| p5-Path-Resource-0.0..> | 2023-10-07 22:03 | 9.9K | |
| p5-Path-Tiny-0.144.pkg | 2023-10-05 16:54 | 44K | |
| p5-PathTools-3.7500.pkg | 2023-10-06 20:05 | 65K | |
| p5-Paws-0.45_1.pkg | 2023-10-09 06:52 | 51M | |
| p5-PayflowPro-4706.pkg | 2023-10-09 03:28 | 146K | |
| p5-Pegex-0.75.pkg | 2023-10-06 20:15 | 100K | |
| p5-Perl-Critic-1.150..> | 2023-10-07 19:13 | 773K | |
| p5-Perl-Critic-Bangs..> | 2023-10-11 14:33 | 25K | |
| p5-Perl-Critic-Depre..> | 2023-10-09 17:46 | 20K | |
| p5-Perl-Critic-Itch-..> | 2023-10-08 23:28 | 5.9K | |
| p5-Perl-Critic-Moose..> | 2023-10-10 19:53 | 20K | |
| p5-Perl-Critic-More-..> | 2023-10-10 21:34 | 29K | |
| p5-Perl-Critic-Pulp-..> | 2023-10-10 19:56 | 201K | |
| p5-Perl-Critic-Swift..> | 2023-10-10 09:54 | 13K | |
| p5-Perl-Critic-Tics-..> | 2023-10-10 12:06 | 13K | |
| p5-Perl-Lint-0.25_1.pkg | 2023-10-09 09:05 | 62K | |
| p5-Perl-Metrics-Lite..> | 2023-10-10 00:10 | 20K | |
| p5-Perl-Metrics-Simp..> | 2023-10-09 07:29 | 30K | |
| p5-Perl-MinimumVersi..> | 2023-10-08 04:11 | 18K | |
| p5-Perl-OSType-1.010..> | 2023-10-07 09:09 | 5.2K | |
| p5-Perl-PrereqScanne..> | 2023-10-07 10:04 | 25K | |
| p5-Perl-PrereqScanne..> | 2023-10-08 09:32 | 13K | |
| p5-Perl-PrereqScanne..> | 2023-10-07 03:01 | 79K | |
| p5-Perl-Tidy-2023090..> | 2023-10-07 02:01 | 510K | |
| p5-Perl-Unsafe-Signa..> | 2023-10-08 16:42 | 6.3K | |
| p5-Perl-Version-1.01..> | 2023-10-08 06:28 | 24K | |
| p5-Perl-osnames-0.12..> | 2023-10-07 06:07 | 6.7K | |
| p5-Perl4-CoreLibs-0...> | 2023-10-08 07:29 | 35K | |
| p5-Perl6-Builtins-0...> | 2023-10-09 05:40 | 5.7K | |
| p5-Perl6-Export-0.07..> | 2023-10-06 19:22 | 4.7K | |
| p5-Perl6-Export-Attr..> | 2023-10-08 02:40 | 9.3K | |
| p5-Perl6-Form-0.04_2..> | 2023-10-07 07:08 | 87K | |
| p5-Perl6-Junction-1...> | 2023-10-06 18:42 | 6.2K | |
| p5-Perl6-Rules-0.03_..> | 2023-10-08 18:44 | 42K | |
| p5-Perl6-Say-0.16_1.pkg | 2023-10-09 17:29 | 6.5K | |
| p5-Perl6-Slurp-0.051..> | 2023-10-11 00:14 | 9.2K | |
| p5-Perl6-Subs-0.05_2..> | 2023-10-09 23:34 | 16K | |
| p5-PerlCryptLib-1.12..> | 2023-10-14 04:53 | 42K | |
| p5-PerlIO-Layers-0.0..> | 2023-10-06 21:54 | 10K | |
| p5-PerlIO-Util-0.72_..> | 2023-10-08 05:26 | 32K | |
| p5-PerlIO-eol-0.19.pkg | 2023-10-07 07:56 | 11K | |
| p5-PerlIO-gzip-0.20.pkg | 2023-10-06 18:57 | 11K | |
| p5-PerlIO-locale-0.1..> | 2023-10-09 12:56 | 5.3K | |
| p5-PerlIO-utf8_stric..> | 2023-10-06 15:30 | 7.7K | |
| p5-PerlIO-via-Bzip2-..> | 2023-10-07 04:21 | 3.8K | |
| p5-PerlIO-via-MD5-0...> | 2023-10-09 19:45 | 4.2K | |
| p5-PerlIO-via-Timeou..> | 2023-10-06 20:00 | 5.3K | |
| p5-PerlIO-via-Unidec..> | 2023-10-09 21:27 | 7.6K | |
| p5-PerlIO-via-dynami..> | 2023-10-05 17:10 | 4.6K | |
| p5-PerlIO-via-symlin..> | 2023-10-07 01:30 | 3.3K | |
| p5-PerlMol-0.3500_2.pkg | 2023-10-09 22:04 | 6.4K | |
| p5-PerlPoint-Convert..> | 2023-10-14 05:29 | 449K | |
| p5-PerlPoint-Package..> | 2023-10-08 06:35 | 281K | |
| p5-PerlX-Maybe-1.202..> | 2023-10-07 07:48 | 9.1K | |
| p5-PerlX-Maybe-XS-1...> | 2023-10-10 16:15 | 5.6K | |
| p5-Perlanet-3.0.3.pkg | 2023-10-10 04:19 | 39K | |
| p5-Perlbal-1.80_1.pkg | 2023-10-07 09:34 | 223K | |
| p5-Perlbal-Plugin-PS..> | 2023-10-14 18:19 | 4.2K | |
| p5-Petal-2.26.pkg | 2023-10-07 08:49 | 67K | |
| p5-Petal-CodePerl-0...> | 2023-10-09 04:01 | 30K | |
| p5-Petal-Mail-0.31_2..> | 2023-10-09 16:47 | 10K | |
| p5-Petal-Utils-0.06_..> | 2023-10-08 02:39 | 14K | |
| p5-Pg-2.1.1_6,1.pkg | 2023-10-09 02:17 | 28K | |
| p5-Phone-Info-0.0.1_..> | 2023-10-10 17:02 | 8.7K | |
| p5-Physics-Unit-0.54..> | 2023-10-10 05:36 | 56K | |
| p5-Pid-File-Flock-0...> | 2023-10-08 01:23 | 6.3K | |
| p5-Pipeline-3.12_2.pkg | 2023-10-10 16:26 | 44K | |
| p5-Pithub-0.01041.pkg | 2023-10-08 07:42 | 136K | |
| p5-PkgConfig-0.25026..> | 2023-10-06 16:23 | 31K | |
| p5-PkgConfig-LibPkgC..> | 2023-10-09 14:11 | 30K | |
| p5-PlRPC-0.2020_2.pkg | 2023-10-07 14:45 | 23K | |
| p5-Plack-1.0050.pkg | 2023-10-05 17:04 | 225K | |
| p5-Plack-App-Proxy-0..> | 2023-10-10 16:28 | 22K | |
| p5-Plack-Builder-Con..> | 2023-10-08 14:33 | 5.6K | |
| p5-Plack-Handler-Any..> | 2023-10-11 07:58 | 4.8K | |
| p5-Plack-Handler-Any..> | 2023-10-10 05:45 | 3.4K | |
| p5-Plack-Handler-Any..> | 2023-10-10 19:17 | 4.0K | |
| p5-Plack-Handler-CLI..> | 2023-10-08 21:47 | 6.2K | |
| p5-Plack-Handler-SCG..> | 2023-10-09 08:04 | 3.4K | |
| p5-Plack-Middleware-..> | 2023-10-08 13:00 | 4.3K | |
| p5-Plack-Middleware-..> | 2023-10-10 18:48 | 2.9K | |
| p5-Plack-Middleware-..> | 2023-10-09 10:51 | 6.1K | |
| p5-Plack-Middleware-..> | 2023-10-08 22:37 | 9.5K | |
| p5-Plack-Middleware-..> | 2023-10-10 18:54 | 4.0K | |
| p5-Plack-Middleware-..> | 2023-10-09 06:19 | 10K | |
| p5-Plack-Middleware-..> | 2023-10-07 21:19 | 3.5K | |
| p5-Plack-Middleware-..> | 2023-10-08 11:20 | 63K | |
| p5-Plack-Middleware-..> | 2023-10-07 09:28 | 5.6K | |
| p5-Plack-Middleware-..> | 2023-10-07 13:36 | 5.2K | |
| p5-Plack-Middleware-..> | 2023-10-09 20:15 | 11K | |
| p5-Plack-Middleware-..> | 2023-10-10 01:17 | 4.7K | |
| p5-Plack-Middleware-..> | 2023-10-06 14:03 | 3.7K | |
| p5-Plack-Middleware-..> | 2023-10-09 00:38 | 2.9K | |
| p5-Plack-Middleware-..> | 2023-10-08 01:41 | 2.8K | |
| p5-Plack-Middleware-..> | 2023-10-08 06:07 | 4.5K | |
| p5-Plack-Middleware-..> | 2023-10-10 04:52 | 3.8K | |
| p5-Plack-Middleware-..> | 2023-10-08 22:47 | 55K | |
| p5-Plack-Middleware-..> | 2023-10-09 17:55 | 3.5K | |
| p5-Plack-Middleware-..> | 2023-10-09 21:30 | 4.6K | |
| p5-Plack-Middleware-..> | 2023-10-06 15:21 | 5.6K | |
| p5-Plack-Middleware-..> | 2023-10-09 08:26 | 3.8K | |
| p5-Plack-Middleware-..> | 2023-10-14 15:04 | 5.7K | |
| p5-Plack-Middleware-..> | 2023-10-06 14:54 | 3.1K | |
| p5-Plack-Middleware-..> | 2023-10-08 12:13 | 6.5K | |
| p5-Plack-Middleware-..> | 2023-10-06 15:21 | 3.4K | |
| p5-Plack-Middleware-..> | 2023-10-10 02:14 | 8.3K | |
| p5-Plack-Middleware-..> | 2023-10-10 02:36 | 12K | |
| p5-Plack-Middleware-..> | 2023-10-06 21:00 | 40K | |
| p5-Plack-Middleware-..> | 2023-10-14 05:25 | 21K | |
| p5-Plack-Middleware-..> | 2023-10-11 04:53 | 3.0K | |
| p5-Plack-Middleware-..> | 2023-10-09 12:42 | 5.0K | |
| p5-Plack-Middleware-..> | 2023-10-08 11:59 | 12K | |
| p5-Plack-Middleware-..> | 2023-10-10 14:36 | 3.5K | |
| p5-Plack-Server-Coro..> | 2023-10-11 06:04 | 4.3K | |
| p5-Plack-Server-POE-..> | 2023-10-10 00:45 | 4.1K | |
| p5-Plack-Server-Reve..> | 2023-10-11 00:38 | 3.3K | |
| p5-Plack-Test-Extern..> | 2023-10-06 14:24 | 3.6K | |
| p5-Plagger-0.7.17_5.pkg | 2023-10-09 19:15 | 381K | |
| p5-Plucene-1.25_5.pkg | 2023-10-08 00:34 | 131K | |
| p5-Plucene-Analysis-..> | 2023-10-10 09:16 | 6.4K | |
| p5-Plucene-Plugin-An..> | 2023-10-14 17:51 | 5.8K | |
| p5-Plucene-Simple-1...> | 2023-10-14 03:56 | 6.6K | |
| p5-Plugtools-1.3.0_2..> | 2023-10-07 21:20 | 25K | |
| p5-Plugtools-Plugins..> | 2023-10-12 11:15 | 7.2K | |
| p5-PocketIO-0.17000.pkg | 2023-10-09 21:52 | 48K | |
| p5-Pod-Abstract-0.20..> | 2023-10-08 07:31 | 62K | |
| p5-Pod-Autopod-1.215..> | 2023-10-08 12:43 | 17K | |
| p5-Pod-Constants-0.1..> | 2023-10-09 11:33 | 10K | |
| p5-Pod-Coverage-0.23..> | 2023-10-06 17:23 | 17K | |
| p5-Pod-Coverage-Moos..> | 2023-10-09 12:27 | 6.2K | |
| p5-Pod-Coverage-Trus..> | 2023-10-09 16:07 | 5.0K | |
| p5-Pod-DocBook-1.2_3..> | 2023-10-10 13:45 | 22K | |
| p5-Pod-Elemental-0.1..> | 2023-10-07 18:41 | 62K | |
| p5-Pod-Escapes-1.07.pkg | 2023-10-08 01:42 | 9.7K | |
| p5-Pod-Eventual-0.09..> | 2023-10-07 04:19 | 10K | |
| p5-Pod-HtmlEasy-1.01..> | 2023-10-08 15:26 | 27K | |
| p5-Pod-LaTeX-0.61.pkg | 2023-10-07 00:01 | 28K | |
| p5-Pod-Markdown-3.30..> | 2023-10-06 23:45 | 25K | |
| p5-Pod-MinimumVersio..> | 2023-10-07 21:18 | 15K | |
| p5-Pod-POM-2.01.pkg | 2023-10-07 07:42 | 73K | |
| p5-Pod-POM-View-HTML..> | 2023-10-10 09:04 | 20K | |
| p5-Pod-POM-View-Rest..> | 2023-10-14 03:45 | 12K | |
| p5-Pod-Parser-1.66.pkg | 2023-10-06 14:11 | 76K | |
| p5-Pod-Perldoc-3.25_..> | 2023-10-09 14:22 | 57K | |
| p5-Pod-ProjectDocs-0..> | 2023-10-14 14:11 | 14K | |
| p5-Pod-Readme-1.2.3.pkg | 2023-10-14 18:45 | 30K | |
| p5-Pod-Section-0.02.pkg | 2023-10-09 06:56 | 8.8K | |
| p5-Pod-Simple-3.45.pkg | 2023-10-07 02:09 | 186K | |
| p5-Pod-Site-0.56_1.pkg | 2023-10-08 15:01 | 51K | |
| p5-Pod-Spell-1.26.pkg | 2023-10-07 09:26 | 21K | |
| p5-Pod-Strip-1.100.pkg | 2023-10-07 17:47 | 4.1K | |
| p5-Pod-Stripper-0.22..> | 2023-10-14 05:22 | 7.3K | |
| p5-Pod-Tests-1.20.pkg | 2023-10-10 13:01 | 11K | |
| p5-Pod-Tree-1.31.pkg | 2023-10-09 06:55 | 73K | |
| p5-Pod-Usage-2.03.pkg | 2023-10-09 13:34 | 18K | |
| p5-Pod-WSDL-0.063_1.pkg | 2023-10-09 15:18 | 39K | |
| p5-Pod-WikiDoc-0.21.pkg | 2023-10-08 09:25 | 36K | |
| p5-Pod-XML-0.99_4.pkg | 2023-10-09 17:53 | 9.4K | |
| p5-Pod-Xhtml-1.61_1.pkg | 2023-10-07 00:22 | 18K | |
| p5-PodToHTML-0.08_2.pkg | 2023-10-06 16:35 | 13K | |
| p5-PostScript-0.06_2..> | 2023-10-09 14:07 | 21K | |
| p5-PostScript-PPD-0...> | 2023-10-09 21:15 | 8.7K | |
| p5-PostScript-Simple..> | 2023-10-09 21:52 | 29K | |
| p5-PostgreSQL-PLPerl..> | 2023-10-08 22:09 | 11K | |
| p5-PostgreSQL-PLPerl..> | 2023-10-10 11:11 | 4.9K | |
| p5-Pragmatic-1.7_1.pkg | 2023-10-10 19:56 | 7.0K | |
| p5-Prima-1.68.002_1.pkg | 2023-10-09 09:10 | 2.3M | |
| p5-Probe-Perl-0.03.pkg | 2023-10-07 09:02 | 6.3K | |
| p5-Proc-BackOff-0.02..> | 2023-10-08 15:38 | 13K | |
| p5-Proc-Background-1..> | 2023-10-07 10:39 | 28K | |
| p5-Proc-Daemon-0.23.pkg | 2023-10-07 13:20 | 17K | |
| p5-Proc-FastSpawn-1...> | 2023-10-06 22:08 | 9.2K | |
| p5-Proc-Find-Parents..> | 2023-10-06 13:58 | 4.9K | |
| p5-Proc-Fork-0.808.pkg | 2023-10-09 08:27 | 7.1K | |
| p5-Proc-Guard-0.07.pkg | 2023-10-07 05:08 | 5.2K | |
| p5-Proc-InvokeEditor..> | 2023-10-06 23:47 | 7.8K | |
| p5-Proc-PID-File-1.2..> | 2023-10-06 22:49 | 9.6K | |
| p5-Proc-PidUtil-0.09..> | 2023-10-09 16:38 | 4.7K | |
| p5-Proc-Pidfile-1.10..> | 2023-10-07 22:32 | 6.5K | |
| p5-Proc-ProcessTable..> | 2023-10-05 17:05 | 24K | |
| p5-Proc-ProcessTable..> | 2023-10-08 19:35 | 14K | |
| p5-Proc-ProcessTable..> | 2023-10-07 11:12 | 5.2K | |
| p5-Proc-ProcessTable..> | 2023-10-08 07:50 | 70K | |
| p5-Proc-ProcessTable..> | 2023-10-10 22:51 | 11K | |
| p5-Proc-Queue-1.23_1..> | 2023-10-08 07:08 | 11K | |
| p5-Proc-Reliable-1.1..> | 2023-10-10 08:04 | 17K | |
| p5-Proc-SafeExec-1.5..> | 2023-10-07 01:48 | 20K | |
| p5-Proc-Simple-1.32.pkg | 2023-10-07 00:46 | 13K | |
| p5-Proc-Wait3-0.05_1..> | 2023-10-06 17:00 | 6.3K | |
| p5-Proc-WaitStat-1.0..> | 2023-10-07 03:40 | 4.5K | |
| p5-Process-Status-0...> | 2023-10-10 10:50 | 5.6K | |
| p5-Proclet-0.35_2.pkg | 2023-10-10 12:20 | 16K | |
| p5-Progress-Any-0.22..> | 2023-10-09 06:22 | 22K | |
| p5-Project-Gantt-1.0..> | 2023-10-14 05:26 | 49K | |
| p5-Project-Libs-0.02..> | 2023-10-08 08:34 | 5.0K | |
| p5-Promises-0.94.pkg | 2023-10-10 02:04 | 59K | |
| p5-Prophet-0.751_2.pkg | 2023-10-07 17:07 | 298K | |
| p5-Protocol-ACME-0.1..> | 2023-10-08 20:23 | 29K | |
| p5-Protocol-Cassandr..> | 2023-10-08 02:29 | 38K | |
| p5-Protocol-HTTP2-1...> | 2023-10-14 16:38 | 36K | |
| p5-Protocol-SocketIO..> | 2023-10-07 20:39 | 11K | |
| p5-Protocol-WebSocke..> | 2023-10-07 20:47 | 46K | |
| p5-Protocol-XMLRPC-0..> | 2023-10-12 09:47 | 33K | |
| p5-Protocol-XMPP-0.0..> | 2023-10-08 00:59 | 56K | |
| p5-Pthread-GetThread..> | 2023-10-14 04:32 | 4.8K | |
| p5-Pugs-Compiler-Rul..> | 2023-10-14 13:18 | 81K | |
| p5-Qmail-Envelope-0...> | 2023-10-14 08:29 | 5.4K | |
| p5-Quantum-Superposi..> | 2023-10-07 04:27 | 18K | |
| p5-Qudo-0.0214_1.pkg | 2023-10-08 23:20 | 36K | |
| p5-Queue-Beanstalk-0..> | 2023-10-08 14:29 | 9.1K | |
| p5-Quota-1.8.2.pkg | 2023-10-07 20:06 | 20K | |
| p5-RADIUS-UserFile-1..> | 2023-10-11 00:14 | 11K | |
| p5-RDF-Core-0.51_1.pkg | 2023-10-07 02:12 | 95K | |
| p5-RDF-Notation3-0.9..> | 2023-10-07 13:20 | 31K | |
| p5-RDF-Query-2.918.pkg | 2023-10-07 11:01 | 268K | |
| p5-RDF-Simple-0.421.pkg | 2023-10-07 03:17 | 21K | |
| p5-RDF-Trine-1.019_1..> | 2023-10-07 08:26 | 239K | |
| p5-RDFStore-0.51_3.pkg | 2023-10-07 07:44 | 370K | |
| p5-RDR-Collector-1.0..> | 2023-10-10 11:19 | 17K | |
| p5-REST-Application-..> | 2023-10-10 00:50 | 19K | |
| p5-REST-Client-273.pkg | 2023-10-07 02:21 | 7.9K | |
| p5-REST-Google-1.0.8..> | 2023-10-14 12:26 | 30K | |
| p5-REST-Google-Apps-..> | 2023-10-10 00:02 | 8.6K | |
| p5-RPC-EPC-Service-0..> | 2023-10-09 10:09 | 10K | |
| p5-RPC-ExtDirect-3.2..> | 2023-10-08 11:38 | 111K | |
| p5-RPC-Simple-1.002_..> | 2023-10-14 13:42 | 35K | |
| p5-RPC-XML-0.82.pkg | 2023-10-08 06:00 | 159K | |
| p5-RPSL-Parser-0.040..> | 2023-10-07 17:07 | 11K | |
| p5-RRD-Simple-1.44_7..> | 2023-10-14 18:55 | 32K | |
| p5-RRDTool-OO-0.36_1..> | 2023-10-07 15:10 | 31K | |
| p5-RT-Client-REST-0...> | 2023-10-07 20:56 | 71K | |
| p5-RT-Extension-Comm..> | 2023-10-09 20:57 | 17K | |
| p5-RT-Extension-Grav..> | 2023-10-09 15:07 | 4.3K | |
| p5-RT-Extension-LDAP..> | 2023-10-09 06:03 | 22K | |
| p5-RT-Extension-Repe..> | 2023-10-09 14:06 | 18K | |
| p5-RT-Extension-Repe..> | 2023-10-10 21:01 | 19K | |
| p5-RT44-RT-Extension..> | 2023-10-14 04:35 | 20K | |
| p5-RT44-RTx-Calendar..> | 2023-10-09 16:22 | 13K | |
| p5-RT50-RT-Extension..> | 2023-10-09 19:42 | 20K | |
| p5-RT50-RTx-Calendar..> | 2023-10-10 02:19 | 13K | |
| p5-RTF-Parser-1.12_1..> | 2023-10-09 03:16 | 37K | |
| p5-RTF-Tokenizer-1.2..> | 2023-10-08 05:14 | 12K | |
| p5-RTF-Writer-1.11_1..> | 2023-10-08 16:56 | 54K | |
| p5-Rcs-1.05_1.pkg | 2023-10-09 16:38 | 23K | |
| p5-Rcs-Agent-1.05_1.pkg | 2023-10-08 13:11 | 17K | |
| p5-Reaction-0.002005..> | 2023-10-10 21:15 | 360K | |
| p5-Readonly-2.05.pkg | 2023-10-05 17:01 | 16K | |
| p5-Readonly-XS-1.05_..> | 2023-10-09 14:15 | 6.6K | |
| p5-ReadonlyX-1.04.pkg | 2023-10-09 10:43 | 12K | |
| p5-Reaper-1.00_1.pkg | 2023-10-09 18:00 | 7.3K | |
| p5-Reddit-0.30.03.pkg | 2023-10-10 08:23 | 6.1K | |
| p5-Reddit-Client-1.3..> | 2023-10-10 17:28 | 65K | |
| p5-Redis-1.9950.pkg | 2023-10-07 15:11 | 40K | |
| p5-Redis-Fast-0.36.pkg | 2023-10-14 06:38 | 65K | |
| p5-Redis-JobQueue-1...> | 2023-10-10 15:23 | 41K | |
| p5-Redis-RateLimit-1..> | 2023-10-14 12:09 | 8.6K | |
| p5-Redis-hiredis-0.1..> | 2023-10-09 03:40 | 22K | |
| p5-RedisDB-2.57.pkg | 2023-10-14 11:45 | 42K | |
| p5-RedisDB-Parser-2...> | 2023-10-07 10:54 | 20K | |
| p5-Ref-Util-0.204.pkg | 2023-10-06 16:47 | 13K | |
| p5-Ref-Util-XS-0.117..> | 2023-10-05 16:52 | 9.1K | |
| p5-Reflex-0.100.pkg | 2023-10-10 12:25 | 298K | |
| p5-Regex-PreSuf-1.17..> | 2023-10-10 19:55 | 5.5K | |
| p5-Regexp-Assemble-0..> | 2023-10-07 07:11 | 51K | |
| p5-Regexp-Assemble-C..> | 2023-10-09 18:38 | 3.5K | |
| p5-Regexp-Bind-0.05_..> | 2023-10-08 08:35 | 5.8K | |
| p5-Regexp-Common-201..> | 2023-10-06 16:23 | 161K | |
| p5-Regexp-Common-Ema..> | 2023-10-10 00:31 | 3.2K | |
| p5-Regexp-Common-net..> | 2023-10-07 05:07 | 2.9K | |
| p5-Regexp-Common-pro..> | 2023-10-10 18:48 | 11K | |
| p5-Regexp-Common-tim..> | 2023-10-09 20:13 | 20K | |
| p5-Regexp-Compare-0...> | 2023-10-09 14:30 | 29K | |
| p5-Regexp-Copy-0.06_..> | 2023-10-10 09:41 | 6.6K | |
| p5-Regexp-Debugger-0..> | 2023-10-10 09:37 | 40K | |
| p5-Regexp-DefaultFla..> | 2023-10-07 14:22 | 3.7K | |
| p5-Regexp-Grammars-1..> | 2023-10-09 01:53 | 104K | |
| p5-Regexp-IPv6-0.03_..> | 2023-10-07 06:17 | 3.3K | |
| p5-Regexp-Lexer-0.05..> | 2023-10-08 00:47 | 9.1K | |
| p5-Regexp-Log-0.06_1..> | 2023-10-08 08:36 | 10K | |
| p5-Regexp-Log-Common..> | 2023-10-10 06:43 | 9.5K | |
| p5-Regexp-Pattern-Pe..> | 2023-10-06 23:10 | 12K | |
| p5-Regexp-RegGrp-2.0..> | 2023-10-07 00:04 | 7.3K | |
| p5-Regexp-Shellish-0..> | 2023-10-06 18:11 | 4.9K | |
| p5-Regexp-Stringify-..> | 2023-10-05 17:00 | 5.0K | |
| p5-Regexp-Subst-Para..> | 2023-10-10 02:02 | 5.0K | |
| p5-Regexp-Trie-0.02.pkg | 2023-10-06 19:23 | 3.9K | |
| p5-Relations-0.95_1.pkg | 2023-10-08 02:10 | 16K | |
| p5-Relations-Query-0..> | 2023-10-09 08:29 | 12K | |
| p5-Religion-1.04_1.pkg | 2023-10-11 09:35 | 7.6K | |
| p5-Reply-0.42.pkg | 2023-10-11 21:22 | 63K | |
| p5-ResourcePool-1.01..> | 2023-10-08 08:13 | 63K | |
| p5-ResourcePool-Reso..> | 2023-10-09 22:43 | 18K | |
| p5-ResourcePool-Reso..> | 2023-10-14 04:35 | 2.1K | |
| p5-ResourcePool-Reso..> | 2023-10-14 07:20 | 8.4K | |
| p5-Resources-1.04_1.pkg | 2023-10-08 20:54 | 27K | |
| p5-Return-MultiLevel..> | 2023-10-06 17:09 | 6.0K | |
| p5-Return-Type-0.007..> | 2023-10-08 05:24 | 6.7K | |
| p5-Return-Value-1.66..> | 2023-10-06 22:39 | 9.1K | |
| p5-Rex-1.14.3.pkg | 2023-10-09 10:35 | 352K | |
| p5-Rinci-1.1.103.pkg | 2023-10-08 14:12 | 82K | |
| p5-Role-Basic-0.13_2..> | 2023-10-07 03:47 | 22K | |
| p5-Role-HasMessage-0..> | 2023-10-06 21:55 | 5.7K | |
| p5-Role-Hooks-0.008.pkg | 2023-10-06 15:16 | 8.2K | |
| p5-Role-Identifiable..> | 2023-10-06 21:59 | 5.0K | |
| p5-Role-REST-Client-..> | 2023-10-14 06:05 | 11K | |
| p5-Role-Tiny-2.00200..> | 2023-10-05 16:50 | 13K | |
| p5-Roman-1.24.pkg | 2023-10-08 07:03 | 4.5K | |
| p5-Rose-DB-0.785,1.pkg | 2023-10-06 23:08 | 117K | |
| p5-Rose-DB-Object-0...> | 2023-10-07 06:59 | 484K | |
| p5-Rose-DBx-Object-M..> | 2023-10-08 05:36 | 7.4K | |
| p5-Rose-DBx-Object-R..> | 2023-10-09 13:27 | 42K | |
| p5-Rose-DateTime-0.5..> | 2023-10-06 15:56 | 18K | |
| p5-Rose-HTML-Objects..> | 2023-10-09 03:08 | 281K | |
| p5-Rose-Object-0.860..> | 2023-10-06 15:25 | 51K | |
| p5-Rose-URI-1.02.pkg | 2023-10-07 14:42 | 11K | |
| p5-Router-Boom-1.03.pkg | 2023-10-06 18:57 | 13K | |
| p5-Router-R3-0.01100..> | 2023-10-10 16:40 | 20K | |
| p5-Router-Simple-0.1..> | 2023-10-07 06:09 | 20K | |
| p5-Router-Simple-Sin..> | 2023-10-09 15:15 | 4.4K | |
| p5-Routes-Tiny-0.21.pkg | 2023-10-11 17:19 | 14K | |
| p5-RunApp-0.13_1.pkg | 2023-10-07 10:45 | 25K | |
| p5-RundeckAPI-1.3.4...> | 2023-10-10 23:19 | 6.1K | |
| p5-S3-20071102_2.pkg | 2023-10-09 05:26 | 8.7K | |
| p5-SCGI-0.6_1.pkg | 2023-10-08 07:30 | 9.1K | |
| p5-SDL-2.548_5.pkg | 2023-10-08 10:22 | 655K | |
| p5-SES-1.01_2.pkg | 2023-10-10 08:25 | 6.3K | |
| p5-SGML-DTDParse-2.0..> | 2023-10-09 00:56 | 53K | |
| p5-SGML-Parser-OpenS..> | 2023-10-07 19:24 | 37K | |
| p5-SGMLSpm-1.03_2.pkg | 2023-10-06 14:02 | 26K | |
| p5-SHA-2.01_1.pkg | 2023-10-09 21:21 | 3.3K | |
| p5-SMS-SMS77-0.01_2.pkg | 2023-10-09 05:16 | 8.9K | |
| p5-SMS-Send-1.06_1.pkg | 2023-10-08 00:47 | 16K | |
| p5-SMS-Send-DeviceGs..> | 2023-10-08 20:57 | 4.9K | |
| p5-SMS-Send-NexmoUni..> | 2023-10-08 15:38 | 4.0K | |
| p5-SMS-Send-TW-HiAir..> | 2023-10-09 20:46 | 4.2K | |
| p5-SMS-Send-TW-PChom..> | 2023-10-14 15:04 | 4.3K | |
| p5-SMS-Send-TW-Socke..> | 2023-10-10 15:07 | 5.1K | |
| p5-SMS-Send-TW-chtsn..> | 2023-10-09 23:44 | 5.0K | |
| p5-SMS-Send-TW-emome..> | 2023-10-08 19:59 | 4.2K | |
| p5-SNMP-Info-3.95.pkg | 2023-10-07 10:28 | 704K | |
| p5-SNMP-MIB-Compiler..> | 2023-10-10 14:40 | 24K | |
| p5-SNMP-Persist-0.05..> | 2023-10-08 13:44 | 6.3K | |
| p5-SNMP-Simple-0.02_..> | 2023-10-08 14:30 | 6.8K | |
| p5-SNMP-Trapinfo-1.0..> | 2023-10-09 22:47 | 9.8K | |
| p5-SNMP-Util-1.8_2.pkg | 2023-10-12 07:21 | 19K | |
| p5-SNMP_Session-1.13..> | 2023-10-06 20:57 | 34K | |
| p5-SOAP-0.28_1.pkg | 2023-10-09 07:44 | 70K | |
| p5-SOAP-Amazon-S3-0...> | 2023-10-11 06:09 | 7.5K | |
| p5-SOAP-Data-Builder..> | 2023-10-07 23:00 | 9.4K | |
| p5-SOAP-Lite-1.27.pkg | 2023-10-06 23:05 | 183K | |
| p5-SOAP-MySOAP-0.023..> | 2023-10-08 06:43 | 2.8K | |
| p5-SOAP-Transport-FT..> | 2023-10-10 12:14 | 4.4K | |
| p5-SOAP-Transport-HT..> | 2023-10-14 02:58 | 6.2K | |
| p5-SOAP-Transport-JA..> | 2023-10-09 12:29 | 7.3K | |
| p5-SOAP-WSDL-3.004_1..> | 2023-10-07 10:03 | 233K | |
| p5-SOAP-XML-Client-2..> | 2023-10-11 14:54 | 19K | |
| p5-SOCKS-0.03_1.pkg | 2023-10-08 05:04 | 8.8K | |
| p5-SPOPS-0.87.pkg | 2023-10-09 06:11 | 416K | |
| p5-SQL-Abstract-2.00..> | 2023-10-05 17:00 | 99K | |
| p5-SQL-Abstract-Clas..> | 2023-10-05 17:06 | 45K | |
| p5-SQL-Abstract-Limi..> | 2023-10-07 06:43 | 15K | |
| p5-SQL-Abstract-More..> | 2023-10-08 03:04 | 37K | |
| p5-SQL-Abstract-Pg-1..> | 2023-10-08 11:16 | 7.0K | |
| p5-SQL-Abstract-Plug..> | 2023-10-07 21:46 | 6.0K | |
| p5-SQL-Interp-1.27.pkg | 2023-10-07 13:17 | 27K | |
| p5-SQL-Maker-1.22_1.pkg | 2023-10-07 14:44 | 35K | |
| p5-SQL-NamedPlacehol..> | 2023-10-07 18:20 | 4.1K | |
| p5-SQL-ReservedWords..> | 2023-10-06 17:15 | 29K | |
| p5-SQL-Statement-1.4..> | 2023-10-07 00:39 | 156K | |
| p5-SQL-Tokenizer-0.2..> | 2023-10-09 10:02 | 4.8K | |
| p5-SQL-Translator-1...> | 2023-10-06 18:25 | 374K | |
| p5-SQLite-Work-0.16...> | 2023-10-08 19:40 | 54K | |
| p5-SRU-1.01_1.pkg | 2023-10-09 18:15 | 44K | |
| p5-SSN-Validate-0.18..> | 2023-10-09 06:48 | 9.9K | |
| p5-STF-Dispatcher-PS..> | 2023-10-10 22:55 | 20K | |
| p5-SUPER-1.20190531.pkg | 2023-10-06 21:46 | 7.3K | |
| p5-SVG-2.87.pkg | 2023-10-07 09:50 | 55K | |
| p5-SVG-DOM2-1.00_2.pkg | 2023-10-09 17:08 | 18K | |
| p5-SVG-Graph-0.04_1.pkg | 2023-10-10 10:14 | 51K | |
| p5-SVG-Metadata-0.28..> | 2023-10-08 12:36 | 25K | |
| p5-SVG-Parser-1.03_1..> | 2023-10-07 10:33 | 20K | |
| p5-SVN-ACL-0.02_6.pkg | 2023-10-10 10:07 | 4.0K | |
| p5-SVN-Access-0.11.pkg | 2023-10-07 15:21 | 16K | |
| p5-SVN-Agent-0.04_3.pkg | 2023-10-08 18:17 | 4.8K | |
| p5-SVN-Dump-0.08.pkg | 2023-10-07 04:40 | 21K | |
| p5-SVN-Dumpfile-0.13..> | 2023-10-09 18:54 | 36K | |
| p5-SVN-Hook-0.28_1.pkg | 2023-10-10 09:19 | 8.1K | |
| p5-SVN-Hooks-1.36.pkg | 2023-10-11 13:50 | 62K | |
| p5-SVN-Log-0.03_6.pkg | 2023-10-08 02:45 | 7.4K | |
| p5-SVN-Look-0.43.pkg | 2023-10-08 02:59 | 9.0K | |
| p5-SVN-Mirror-0.75_3..> | 2023-10-07 01:59 | 23K | |
| p5-SVN-Notify-2.87.pkg | 2023-10-08 09:29 | 78K | |
| p5-SVN-Notify-Config..> | 2023-10-10 03:06 | 6.8K | |
| p5-SVN-Notify-Filter..> | 2023-10-11 07:33 | 6.7K | |
| p5-SVN-Notify-Filter..> | 2023-10-09 13:16 | 6.3K | |
| p5-SVN-Notify-Filter..> | 2023-10-09 19:02 | 4.7K | |
| p5-SVN-Notify-Filter..> | 2023-10-10 00:57 | 5.9K | |
| p5-SVN-Notify-Mirror..> | 2023-10-08 22:19 | 27K | |
| p5-SVN-Notify-Snapsh..> | 2023-10-09 20:07 | 12K | |
| p5-SVN-S4-1.062.pkg | 2023-10-14 11:26 | 80K | |
| p5-SVN-Simple-0.28_3..> | 2023-10-06 20:43 | 7.2K | |
| p5-SVN-Statistics-0...> | 2023-10-09 16:57 | 3.5K | |
| p5-SVN-Web-0.63_3.pkg | 2023-10-09 12:21 | 119K | |
| p5-SWF-Builder-0.16_..> | 2023-10-08 01:15 | 84K | |
| p5-SWF-Chart-1.4_1.pkg | 2023-10-09 00:15 | 11K | |
| p5-SWF-File-0.42_2,1..> | 2023-10-07 08:56 | 52K | |
| p5-Safe-Hole-0.13_1.pkg | 2023-10-07 15:18 | 11K | |
| p5-Safe-Isa-1.000010..> | 2023-10-06 14:21 | 5.6K | |
| p5-Sah-0.9.51.pkg | 2023-10-14 04:18 | 72K | |
| p5-Samba-LDAP-0.05_2..> | 2023-10-14 09:13 | 37K | |
| p5-Samba-SIDhelper-0..> | 2023-10-14 12:39 | 4.8K | |
| p5-Sane-0.05_1.pkg | 2023-10-09 21:30 | 24K | |
| p5-Scalar-Defer-0.23..> | 2023-10-06 19:55 | 7.3K | |
| p5-Scalar-Does-0.203..> | 2023-10-07 09:22 | 20K | |
| p5-Scalar-List-Utils..> | 2023-10-05 16:51 | 50K | |
| p5-Scalar-Listify-0...> | 2023-10-05 17:07 | 3.7K | |
| p5-Scalar-String-0.0..> | 2023-10-05 17:07 | 11K | |
| p5-Scalar-Util-Looks..> | 2023-10-06 23:38 | 4.6K | |
| p5-Scalar-Util-Numer..> | 2023-10-07 04:13 | 6.9K | |
| p5-Schedule-At-1.15_..> | 2023-10-10 21:42 | 7.2K | |
| p5-Schedule-Cron-1.0..> | 2023-10-14 08:37 | 27K | |
| p5-Schedule-Cron-Eve..> | 2023-10-07 19:09 | 13K | |
| p5-Schedule-Load-3.0..> | 2023-10-14 14:30 | 95K | |
| p5-Schedule-Match-0...> | 2023-10-08 18:45 | 9.6K | |
| p5-Scope-Container-0..> | 2023-10-07 16:07 | 3.8K | |
| p5-Scope-Container-D..> | 2023-10-08 19:44 | 5.6K | |
| p5-Scope-Guard-0.21.pkg | 2023-10-05 17:03 | 4.6K | |
| p5-Scope-Upper-0.34.pkg | 2023-10-06 14:39 | 34K | |
| p5-Scrappy-0.9411209..> | 2023-10-14 07:11 | 64K | |
| p5-Script-isAperlScr..> | 2023-10-08 00:26 | 5.1K | |
| p5-Search-Elasticsea..> | 2023-10-07 21:44 | 168K | |
| p5-Search-Elasticsea..> | 2023-10-08 16:15 | 58K | |
| p5-Search-Elasticsea..> | 2023-10-14 15:14 | 74K | |
| p5-Search-Elasticsea..> | 2023-10-09 03:51 | 78K | |
| p5-Search-Elasticsea..> | 2023-10-09 08:06 | 78K | |
| p5-Search-Estraier-0..> | 2023-10-09 07:03 | 31K | |
| p5-Search-InvertedIn..> | 2023-10-10 02:18 | 54K | |
| p5-Search-Namazu-0.9..> | 2023-10-08 12:27 | 14K | |
| p5-Search-Odeum-0.02..> | 2023-10-10 17:25 | 17K | |
| p5-Search-QueryParse..> | 2023-10-07 19:45 | 11K | |
| p5-Search-QueryParse..> | 2023-10-09 02:08 | 14K | |
| p5-Search-Saryer-0.4..> | 2023-10-10 04:22 | 8.5K | |
| p5-Search-Sitemap-2...> | 2023-10-09 15:58 | 33K | |
| p5-Search-VectorSpac..> | 2023-10-14 12:10 | 6.5K | |
| p5-Search-Xapian-1.2..> | 2023-10-07 21:29 | 165K | |
| p5-Search-Xapian12-1..> | 2023-10-09 02:15 | 160K | |
| p5-Selenium-Remote-D..> | 2023-10-09 03:55 | 770K | |
| p5-Sendmail-AccessDB..> | 2023-10-09 10:02 | 7.9K | |
| p5-Sendmail-Milter-0..> | 2023-10-09 22:33 | 30K | |
| p5-Senna-0.51_5.pkg | 2023-10-08 10:18 | 58K | |
| p5-Sentinel-0.07.pkg | 2023-10-08 01:52 | 8.9K | |
| p5-Sereal-5.004.pkg | 2023-10-07 14:44 | 6.3K | |
| p5-Sereal-Decoder-5...> | 2023-10-06 22:27 | 91K | |
| p5-Sereal-Encoder-5...> | 2023-10-06 19:39 | 91K | |
| p5-Server-Starter-0...> | 2023-10-06 23:09 | 14K | |
| p5-Session-Storage-S..> | 2023-10-07 06:01 | 13K | |
| p5-Session-Token-1.5..> | 2023-10-06 19:24 | 25K | |
| p5-Set-Array-0.30_1.pkg | 2023-10-07 18:32 | 21K | |
| p5-Set-ConsistentHas..> | 2023-10-08 16:25 | 7.1K | |
| p5-Set-Crontab-1.03_..> | 2023-10-07 02:24 | 4.1K | |
| p5-Set-CrossProduct-..> | 2023-10-06 16:05 | 12K | |
| p5-Set-Infinite-0.65..> | 2023-10-05 16:55 | 36K | |
| p5-Set-IntSpan-1.19_..> | 2023-10-06 17:56 | 22K | |
| p5-Set-IntSpan-Fast-..> | 2023-10-07 10:34 | 16K | |
| p5-Set-IntSpan-Fast-..> | 2023-10-09 20:31 | 8.9K | |
| p5-Set-NestedGroups-..> | 2023-10-07 16:50 | 9.2K | |
| p5-Set-Object-1.42.pkg | 2023-10-05 17:05 | 36K | |
| p5-Set-Partition-0.0..> | 2023-10-09 09:03 | 6.4K | |
| p5-Set-Scalar-1.29.pkg | 2023-10-06 14:01 | 25K | |
| p5-Set-Tiny-0.04.pkg | 2023-10-14 15:19 | 6.9K | |
| p5-Set-Window-1.01_1..> | 2023-10-09 08:37 | 6.8K | |
| p5-Shell-Base-0.05_1..> | 2023-10-10 07:08 | 24K | |
| p5-Shell-Command-0.0..> | 2023-10-07 05:31 | 3.1K | |
| p5-Shell-Config-Gene..> | 2023-10-06 14:21 | 12K | |
| p5-Shell-EnvImporter..> | 2023-10-10 12:44 | 18K | |
| p5-Shell-GetEnv-0.10..> | 2023-10-07 04:59 | 14K | |
| p5-Shell-Guess-0.09.pkg | 2023-10-05 17:05 | 9.1K | |
| p5-Shell-Parser-0.04..> | 2023-10-07 00:58 | 8.7K | |
| p5-Shell-Perl-0.0040..> | 2023-10-07 02:15 | 20K | |
| p5-Shell-Source-0.01..> | 2023-10-10 19:19 | 4.5K | |
| p5-ShipIt-0.60_1.pkg | 2023-10-08 05:58 | 36K | |
| p5-ShipIt-Step-Manif..> | 2023-10-08 23:39 | 3.6K | |
| p5-Shout-2.1_2.pkg | 2023-10-10 07:03 | 21K | |
| p5-Signal-Mask-0.008..> | 2023-10-06 17:13 | 5.3K | |
| p5-Sisimai-4.25.16.pkg | 2023-10-08 07:43 | 375K | |
| p5-Slurp-0.4_1.pkg | 2023-10-09 02:38 | 3.7K | |
| p5-Smart-Comments-1...> | 2023-10-10 08:20 | 18K | |
| p5-Snort-Rule-1.07_1..> | 2023-10-08 01:19 | 6.7K | |
| p5-Socket-2.037.pkg | 2023-10-08 17:49 | 31K | |
| p5-Socket-Class-2.25..> | 2023-10-09 13:19 | 103K | |
| p5-Socket-GetAddrInf..> | 2023-10-05 17:02 | 31K | |
| p5-Socket-Multicast6..> | 2023-10-06 23:48 | 9.4K | |
| p5-Socket6-0.29.pkg | 2023-10-06 17:34 | 16K | |
| p5-Software-License-..> | 2023-10-07 06:11 | 111K | |
| p5-Software-License-..> | 2023-10-10 20:19 | 37K | |
| p5-Solr-0.03_1.pkg | 2023-10-09 07:18 | 13K | |
| p5-Sort-ArbBiLex-4.0..> | 2023-10-09 02:53 | 22K | |
| p5-Sort-Array-0.26_1..> | 2023-10-09 19:46 | 7.3K | |
| p5-Sort-ArrayOfArray..> | 2023-10-14 04:37 | 6.7K | |
| p5-Sort-Fields-1.001..> | 2023-10-10 00:35 | 6.8K | |
| p5-Sort-Key-1.33_1.pkg | 2023-10-07 06:32 | 33K | |
| p5-Sort-Key-DateTime..> | 2023-10-14 04:33 | 3.9K | |
| p5-Sort-Key-IPv4-0.0..> | 2023-10-11 12:15 | 8.0K | |
| p5-Sort-Key-Top-0.08..> | 2023-10-10 02:03 | 16K | |
| p5-Sort-Maker-0.06_1..> | 2023-10-07 01:38 | 27K | |
| p5-Sort-Naturally-1...> | 2023-10-06 17:07 | 11K | |
| p5-Sort-Sub-0.120.pkg | 2023-10-07 04:48 | 47K | |
| p5-Sort-Tree-1.09_1.pkg | 2023-10-14 10:34 | 9.0K | |
| p5-Sort-Versions-1.6..> | 2023-10-06 15:13 | 5.5K | |
| p5-Specio-0.48.pkg | 2023-10-05 16:52 | 125K | |
| p5-Sphinx-Config-0.1..> | 2023-10-08 02:33 | 11K | |
| p5-Sphinx-Manager-0...> | 2023-10-11 09:39 | 9.3K | |
| p5-Sphinx-Search-0.3..> | 2023-10-14 14:30 | 30K | |
| p5-Spiffy-0.46_1.pkg | 2023-10-06 19:09 | 20K | |
| p5-Spoon-0.24_2.pkg | 2023-10-09 10:47 | 36K | |
| p5-Spreadsheet-Gener..> | 2023-10-07 01:49 | 6.5K | |
| p5-Spreadsheet-Parse..> | 2023-10-06 15:04 | 103K | |
| p5-Spreadsheet-Parse..> | 2023-10-14 16:05 | 20K | |
| p5-Spreadsheet-Read-..> | 2023-10-09 04:55 | 47K | |
| p5-Spreadsheet-ReadS..> | 2023-10-07 13:29 | 29K | |
| p5-Spreadsheet-Write..> | 2023-10-08 02:29 | 473K | |
| p5-Spreadsheet-Write..> | 2023-10-09 16:39 | 12K | |
| p5-Spreadsheet-Write..> | 2023-10-10 22:15 | 8.2K | |
| p5-Spreadsheet-Write..> | 2023-10-09 00:03 | 127K | |
| p5-Spreadsheet-XLSX-..> | 2023-10-06 19:05 | 19K | |
| p5-SpringGraph-0.05_..> | 2023-10-08 04:08 | 11K | |
| p5-Squatting-0.83.pkg | 2023-10-08 03:11 | 62K | |
| p5-Squatting-On-PSGI..> | 2023-10-08 23:32 | 3.3K | |
| p5-Starlet-0.31.pkg | 2023-10-07 06:58 | 10K | |
| p5-Starlink-AST-1.05..> | 2023-10-09 11:24 | 1.4M | |
| p5-Starman-0.4016.pkg | 2023-10-07 23:17 | 22K | |
| p5-Stat-lsMode-0.51.pkg | 2023-10-09 10:50 | 6.4K | |
| p5-Statistics-Basic-..> | 2023-10-08 06:27 | 55K | |
| p5-Statistics-Benfor..> | 2023-10-09 08:27 | 6.3K | |
| p5-Statistics-CaseRe..> | 2023-10-08 03:49 | 18K | |
| p5-Statistics-ChiSqu..> | 2023-10-05 17:05 | 14K | |
| p5-Statistics-Contin..> | 2023-10-07 10:39 | 8.9K | |
| p5-Statistics-Descri..> | 2023-10-06 21:11 | 52K | |
| p5-Statistics-Descri..> | 2023-10-10 18:50 | 13K | |
| p5-Statistics-Distri..> | 2023-10-06 21:13 | 7.1K | |
| p5-Statistics-Foreca..> | 2023-10-14 07:51 | 4.6K | |
| p5-Statistics-Freque..> | 2023-10-10 11:22 | 2.7K | |
| p5-Statistics-LTU-2...> | 2023-10-08 13:22 | 17K | |
| p5-Statistics-LineFi..> | 2023-10-14 17:59 | 14K | |
| p5-Statistics-Lite-3..> | 2023-10-14 15:15 | 6.0K | |
| p5-Statistics-OLS-0...> | 2023-10-11 02:37 | 11K | |
| p5-Statistics-R-0.34..> | 2023-10-10 04:49 | 19K | |
| p5-Statistics-Regres..> | 2023-10-06 13:59 | 12K | |
| p5-Statistics-TTest-..> | 2023-10-07 05:23 | 10K | |
| p5-Storable-3.25.pkg | 2023-10-08 09:39 | 63K | |
| p5-Storable-AMF-1.00..> | 2023-10-09 23:25 | 27K | |
| p5-Store-CouchDB-4.3..> | 2023-10-10 14:57 | 14K | |
| p5-Stream-1.00_1.pkg | 2023-10-07 09:46 | 3.6K | |
| p5-Stream-Buffered-0..> | 2023-10-05 16:55 | 3.7K | |
| p5-Stream-Reader-0.0..> | 2023-10-14 02:56 | 8.5K | |
| p5-String-Approx-3.2..> | 2023-10-06 16:19 | 28K | |
| p5-String-BufferStac..> | 2023-10-06 21:42 | 8.0K | |
| p5-String-CRC32-2.10..> | 2023-10-06 14:14 | 7.5K | |
| p5-String-CamelCase-..> | 2023-10-06 19:21 | 4.0K | |
| p5-String-Checker-0...> | 2023-10-07 23:36 | 7.2K | |
| p5-String-Compare-Co..> | 2023-10-06 22:47 | 9.7K | |
| p5-String-Diff-0.07.pkg | 2023-10-10 04:17 | 6.3K | |
| p5-String-Divert-0.9..> | 2023-10-08 22:15 | 15K | |
| p5-String-Dump-0.09_..> | 2023-10-09 06:11 | 12K | |
| p5-String-Ediff-0.09..> | 2023-10-07 23:12 | 11K | |
| p5-String-Errf-0.007..> | 2023-10-06 17:25 | 8.6K | |
| p5-String-Escape-201..> | 2023-10-07 00:30 | 14K | |
| p5-String-Flogger-1...> | 2023-10-07 08:39 | 4.8K | |
| p5-String-Format-1.1..> | 2023-10-07 06:02 | 6.7K | |
| p5-String-Formatter-..> | 2023-10-06 14:56 | 17K | |
| p5-String-Fraction-0..> | 2023-10-09 16:48 | 3.0K | |
| p5-String-HexConvert..> | 2023-10-07 11:03 | 3.3K | |
| p5-String-Interpolat..> | 2023-10-09 14:56 | 8.3K | |
| p5-String-KeyboardDi..> | 2023-10-09 15:23 | 8.5K | |
| p5-String-Koremutake..> | 2023-10-06 23:31 | 4.6K | |
| p5-String-LCSS-1.00.pkg | 2023-10-10 03:16 | 3.8K | |
| p5-String-LRC-1.01_2..> | 2023-10-08 11:22 | 9.1K | |
| p5-String-MkPasswd-0..> | 2023-10-12 12:19 | 9.4K | |
| p5-String-Multibyte-..> | 2023-10-10 07:29 | 44K | |
| p5-String-Pad-0.021.pkg | 2023-10-07 00:10 | 5.0K | |
| p5-String-Parity-1.3..> | 2023-10-08 07:55 | 4.5K | |
| p5-String-Print-0.94..> | 2023-10-05 16:57 | 25K | |
| p5-String-Random-0.3..> | 2023-10-06 16:01 | 12K | |
| p5-String-RewritePre..> | 2023-10-06 14:12 | 4.0K | |
| p5-String-RexxParse-..> | 2023-10-14 16:22 | 11K | |
| p5-String-Scanf-2.1_..> | 2023-10-08 20:33 | 5.5K | |
| p5-String-ShellQuote..> | 2023-10-06 20:22 | 9.5K | |
| p5-String-ShowDiff-0..> | 2023-10-08 23:25 | 6.2K | |
| p5-String-Similarity..> | 2023-10-14 13:36 | 8.5K | |
| p5-String-Strip-1.02..> | 2023-10-10 01:42 | 6.6K | |
| p5-String-TT-0.03_1.pkg | 2023-10-07 17:37 | 5.8K | |
| p5-String-Tagged-0.2..> | 2023-10-06 19:08 | 28K | |
| p5-String-Tagged-Ter..> | 2023-10-07 04:38 | 11K | |
| p5-String-ToIdentifi..> | 2023-10-06 17:07 | 8.7K | |
| p5-String-Tokenizer-..> | 2023-10-07 01:13 | 11K | |
| p5-String-Trim-0.005..> | 2023-10-11 01:13 | 5.0K | |
| p5-String-Truncate-1..> | 2023-10-07 09:47 | 7.2K | |
| p5-String-TtyLength-..> | 2023-10-06 21:52 | 4.5K | |
| p5-String-Urandom-0...> | 2023-10-09 20:03 | 6.6K | |
| p5-String-Util-1.34.pkg | 2023-10-06 21:20 | 10K | |
| p5-Struct-Dumb-0.14.pkg | 2023-10-06 15:16 | 10K | |
| p5-Sub-Alias-1.0.0.pkg | 2023-10-09 20:29 | 5.7K | |
| p5-Sub-Current-0.03.pkg | 2023-10-10 22:56 | 5.0K | |
| p5-Sub-Delete-1.0000..> | 2023-10-06 14:06 | 4.8K | |
| p5-Sub-Exporter-0.99..> | 2023-10-05 16:49 | 45K | |
| p5-Sub-Exporter-ForM..> | 2023-10-05 16:51 | 5.3K | |
| p5-Sub-Exporter-Glob..> | 2023-10-07 00:02 | 4.9K | |
| p5-Sub-Exporter-Lexi..> | 2023-10-09 11:42 | 6.0K | |
| p5-Sub-Exporter-Prog..> | 2023-10-05 16:49 | 4.7K | |
| p5-Sub-HandlesVia-0...> | 2023-10-06 16:57 | 118K | |
| p5-Sub-Identify-0.14..> | 2023-10-05 16:50 | 7.2K | |
| p5-Sub-Infix-0.004_1..> | 2023-10-06 22:13 | 5.0K | |
| p5-Sub-Info-0.002.pkg | 2023-10-14 18:55 | 4.8K | |
| p5-Sub-Install-0.929..> | 2023-10-05 16:48 | 7.5K | |
| p5-Sub-Installer-0.0..> | 2023-10-09 23:08 | 6.3K | |
| p5-Sub-Multi-0.003_1..> | 2023-10-08 12:55 | 3.8K | |
| p5-Sub-Name-0.27,1.pkg | 2023-10-05 16:52 | 8.0K | |
| p5-Sub-Override-0.09..> | 2023-10-06 14:40 | 6.9K | |
| p5-Sub-Prototype-0.0..> | 2023-10-07 10:08 | 5.2K | |
| p5-Sub-Quote-2.00600..> | 2023-10-05 16:50 | 18K | |
| p5-Sub-Signatures-0...> | 2023-10-10 11:34 | 13K | |
| p5-Sub-Uplevel-0.280..> | 2023-10-05 16:59 | 9.2K | |
| p5-Sub-WrapPackages-..> | 2023-10-09 06:22 | 12K | |
| p5-Subtitles-1.04_1.pkg | 2023-10-14 02:56 | 18K | |
| p5-Sudo-0.33_1.pkg | 2023-10-10 09:15 | 8.4K | |
| p5-Switch-2.17_1.pkg | 2023-10-07 12:02 | 16K | |
| p5-Symbol-Get-0.08.pkg | 2023-10-06 21:48 | 4.3K | |
| p5-Symbol-Global-Nam..> | 2023-10-07 01:31 | 3.6K | |
| p5-Symbol-Util-0.020..> | 2023-10-10 11:48 | 9.5K | |
| p5-Syntax-Highlight-..> | 2023-10-14 06:28 | 333K | |
| p5-Syntax-Highlight-..> | 2023-10-07 22:28 | 8.2K | |
| p5-Syntax-Highlight-..> | 2023-10-06 23:28 | 31K | |
| p5-Syntax-Highlight-..> | 2023-10-07 14:19 | 7.1K | |
| p5-Syntax-Keyword-Dy..> | 2023-10-06 16:23 | 11K | |
| p5-Syntax-Keyword-Ga..> | 2023-10-08 05:26 | 6.9K | |
| p5-Syntax-Keyword-Ju..> | 2023-10-06 20:19 | 14K | |
| p5-Syntax-Keyword-Ma..> | 2023-10-07 06:46 | 16K | |
| p5-Syntax-Keyword-Tr..> | 2023-10-05 17:05 | 23K | |
| p5-Sys-CPU-0.61.pkg | 2023-10-08 10:18 | 5.5K | |
| p5-Sys-CpuLoad-0.31.pkg | 2023-10-09 14:59 | 7.1K | |
| p5-Sys-Filesystem-1...> | 2023-10-14 12:45 | 50K | |
| p5-Sys-Gamin-0.1_3.pkg | 2023-10-08 17:18 | 18K | |
| p5-Sys-Group-GIDhelp..> | 2023-10-06 21:06 | 4.3K | |
| p5-Sys-HostIP-1.9.3_..> | 2023-10-14 10:42 | 7.1K | |
| p5-Sys-Hostname-FQDN..> | 2023-10-14 17:00 | 8.1K | |
| p5-Sys-Hostname-Long..> | 2023-10-08 11:28 | 8.1K | |
| p5-Sys-Info-0.7811.pkg | 2023-10-14 14:11 | 4.8K | |
| p5-Sys-Info-Base-0.7..> | 2023-10-07 04:41 | 25K | |
| p5-Sys-Info-Driver-B..> | 2023-10-08 11:00 | 12K | |
| p5-Sys-Load-0.2_1.pkg | 2023-10-14 04:20 | 5.3K | |
| p5-Sys-MemInfo-0.99.pkg | 2023-10-07 20:56 | 7.0K | |
| p5-Sys-Mmap-0.20.pkg | 2023-10-07 11:37 | 14K | |
| p5-Sys-RunAlone-0.13..> | 2023-10-09 20:57 | 6.6K | |
| p5-Sys-RunAlways-0.0..> | 2023-10-10 00:21 | 4.9K | |
| p5-Sys-Sendfile-0.17..> | 2023-10-11 15:30 | 6.9K | |
| p5-Sys-Sendfile-Free..> | 2023-10-07 00:53 | 6.1K | |
| p5-Sys-Sig-0.05_1.pkg | 2023-10-14 11:27 | 4.3K | |
| p5-Sys-SigAction-0.2..> | 2023-10-06 17:30 | 14K | |
| p5-Sys-Syscall-0.25_..> | 2023-10-06 18:16 | 6.0K | |
| p5-Sys-Syslog-0.36.pkg | 2023-10-14 06:09 | 29K | |
| p5-Sys-Trace-0.03_1.pkg | 2023-10-08 12:40 | 13K | |
| p5-Sys-User-UIDhelpe..> | 2023-10-06 21:36 | 4.3K | |
| p5-Sys-Virt-1.1.1_5.pkg | 2023-10-10 08:27 | 192K | |
| p5-Sysadm-Install-0...> | 2023-10-08 01:02 | 21K | |
| p5-SyslogScan-0.32_3..> | 2023-10-10 05:41 | 54K | |
| p5-System-Command-1...> | 2023-10-06 21:43 | 19K | |
| p5-System-Info-0.058..> | 2023-10-10 09:47 | 38K | |
| p5-System-Sub-0.1628..> | 2023-10-08 00:02 | 12K | |
| p5-System2-0.84_1.pkg | 2023-10-10 23:26 | 6.3K | |
| p5-T2-0.10_3.pkg | 2023-10-09 07:46 | 46K | |
| p5-TAP-Formatter-JUn..> | 2023-10-10 10:43 | 17K | |
| p5-TAP-Harness-JUnit..> | 2023-10-14 02:55 | 9.5K | |
| p5-TAP-SimpleOutput-..> | 2023-10-08 16:29 | 8.8K | |
| p5-TFTP-1.0.pkg | 2023-10-07 23:31 | 7.4K | |
| p5-TOML-0.97.pkg | 2023-10-07 20:42 | 5.9K | |
| p5-TOML-Parser-0.91_..> | 2023-10-07 03:49 | 7.9K | |
| p5-Tail-Stat-0.26.pkg | 2023-10-14 15:38 | 38K | |
| p5-Taint-Runtime-0.0..> | 2023-10-09 15:17 | 13K | |
| p5-Taint-Util-0.08_2..> | 2023-10-09 13:06 | 8.9K | |
| p5-Tangram-2.12.pkg | 2023-10-07 01:51 | 193K | |
| p5-Task-Catalyst-4.0..> | 2023-10-09 10:55 | 4.3K | |
| p5-Task-Math-Symboli..> | 2023-10-08 12:01 | 3.2K | |
| p5-Task-Plack-0.28.pkg | 2023-10-08 18:29 | 5.1K | |
| p5-Task-Tiny-0.002.pkg | 2023-10-09 11:24 | 3.3K | |
| p5-Task-Weaken-1.06.pkg | 2023-10-05 16:53 | 4.6K | |
| p5-Tatsumaki-0.1013_..> | 2023-10-09 19:03 | 13K | |
| p5-Tcl-1.27.pkg | 2023-10-14 10:04 | 35K | |
| p5-TeX-Encode-2.010.pkg | 2023-10-07 12:48 | 19K | |
| p5-TeX-Hyphen-1.18.pkg | 2023-10-11 03:39 | 25K | |
| p5-Tee-0.14_2.pkg | 2023-10-14 05:45 | 9.4K | |
| p5-Template-Alloy-1...> | 2023-10-07 16:19 | 158K | |
| p5-Template-AutoFilt..> | 2023-10-08 11:46 | 8.7K | |
| p5-Template-DBI-2.65..> | 2023-10-10 10:50 | 17K | |
| p5-Template-Declare-..> | 2023-10-07 05:16 | 62K | |
| p5-Template-Extract-..> | 2023-10-07 21:54 | 18K | |
| p5-Template-GD-2.66_..> | 2023-10-07 07:00 | 44K | |
| p5-Template-Iterator..> | 2023-10-09 01:19 | 5.3K | |
| p5-Template-Magic-1...> | 2023-10-09 00:43 | 72K | |
| p5-Template-Multilin..> | 2023-10-10 23:33 | 10K | |
| p5-Template-Mustache..> | 2023-10-14 11:09 | 10K | |
| p5-Template-Plugin-A..> | 2023-10-11 14:54 | 5.7K | |
| p5-Template-Plugin-C..> | 2023-10-07 10:36 | 3.1K | |
| p5-Template-Plugin-C..> | 2023-10-08 09:16 | 3.5K | |
| p5-Template-Plugin-C..> | 2023-10-07 10:02 | 4.1K | |
| p5-Template-Plugin-C..> | 2023-10-07 16:09 | 5.3K | |
| p5-Template-Plugin-C..> | 2023-10-09 18:57 | 3.1K | |
| p5-Template-Plugin-D..> | 2023-10-09 00:05 | 5.2K | |
| p5-Template-Plugin-F..> | 2023-10-08 19:39 | 3.2K | |
| p5-Template-Plugin-F..> | 2023-10-09 02:09 | 3.3K | |
| p5-Template-Plugin-F..> | 2023-10-11 01:16 | 3.3K | |
| p5-Template-Plugin-F..> | 2023-10-08 16:44 | 3.4K | |
| p5-Template-Plugin-F..> | 2023-10-08 19:57 | 3.4K | |
| p5-Template-Plugin-G..> | 2023-10-12 10:28 | 18K | |
| p5-Template-Plugin-H..> | 2023-10-07 00:45 | 3.5K | |
| p5-Template-Plugin-J..> | 2023-10-10 10:33 | 4.1K | |
| p5-Template-Plugin-J..> | 2023-10-07 23:30 | 3.0K | |
| p5-Template-Plugin-L..> | 2023-10-11 12:56 | 7.2K | |
| p5-Template-Plugin-M..> | 2023-10-09 23:55 | 5.8K | |
| p5-Template-Plugin-M..> | 2023-10-14 07:20 | 2.8K | |
| p5-Template-Plugin-M..> | 2023-10-10 01:23 | 3.2K | |
| p5-Template-Plugin-N..> | 2023-10-07 21:22 | 6.4K | |
| p5-Template-Plugin-S..> | 2023-10-08 14:28 | 4.5K | |
| p5-Template-Plugin-S..> | 2023-10-07 11:56 | 7.2K | |
| p5-Template-Plugin-V..> | 2023-10-11 03:56 | 7.2K | |
| p5-Template-Plugin-X..> | 2023-10-14 13:40 | 3.0K | |
| p5-Template-Plugin-Y..> | 2023-10-14 06:20 | 4.0K | |
| p5-Template-Provider..> | 2023-10-11 00:43 | 4.9K | |
| p5-Template-Provider..> | 2023-10-08 04:48 | 8.0K | |
| p5-Template-Provider..> | 2023-10-09 08:22 | 5.4K | |
| p5-Template-Semantic..> | 2023-10-14 03:08 | 23K | |
| p5-Template-Simple-0..> | 2023-10-10 02:38 | 17K | |
| p5-Template-Stash-Au..> | 2023-10-10 19:41 | 5.6K | |
| p5-Template-Timer-1...> | 2023-10-06 22:30 | 4.6K | |
| p5-Template-Tiny-1.1..> | 2023-10-06 17:11 | 7.5K | |
| p5-Template-Toolkit-..> | 2023-10-06 15:16 | 488K | |
| p5-Template-Toolkit-..> | 2023-10-07 20:18 | 8.9K | |
| p5-Teng-0.34.pkg | 2023-10-10 19:44 | 65K | |
| p5-Tenjin-1.000001.pkg | 2023-10-10 00:40 | 32K | |
| p5-Term-ANSIColor-5...> | 2023-10-07 06:49 | 32K | |
| p5-Term-ANSIScreen-1..> | 2023-10-09 12:55 | 11K | |
| p5-Term-Animation-2...> | 2023-10-07 15:29 | 24K | |
| p5-Term-App-Roles-0...> | 2023-10-07 02:18 | 7.5K | |
| p5-Term-App-Util-Col..> | 2023-10-06 18:32 | 5.2K | |
| p5-Term-App-Util-Int..> | 2023-10-06 16:28 | 4.2K | |
| p5-Term-App-Util-Siz..> | 2023-10-06 20:38 | 5.1K | |
| p5-Term-Bash-Complet..> | 2023-10-07 03:21 | 11K | |
| p5-Term-CallEditor-1..> | 2023-10-07 17:10 | 12K | |
| p5-Term-Choose-1.762..> | 2023-10-06 16:41 | 33K | |
| p5-Term-Choose-Util-..> | 2023-10-06 19:06 | 15K | |
| p5-Term-Clui-1.76.pkg | 2023-10-07 23:14 | 29K | |
| p5-Term-Detect-Softw..> | 2023-10-06 18:18 | 7.6K | |
| p5-Term-EditLine-0.1..> | 2023-10-08 15:15 | 21K | |
| p5-Term-Encoding-0.0..> | 2023-10-07 03:12 | 3.2K | |
| p5-Term-Form-0.554.pkg | 2023-10-07 04:44 | 18K | |
| p5-Term-Menus-3.026.pkg | 2023-10-11 05:45 | 66K | |
| p5-Term-ProgressBar-..> | 2023-10-06 16:34 | 20K | |
| p5-Term-ProgressBar-..> | 2023-10-06 21:31 | 3.1K | |
| p5-Term-ProgressBar-..> | 2023-10-07 01:27 | 5.8K | |
| p5-Term-Prompt-1.04_..> | 2023-10-08 06:19 | 13K | |
| p5-Term-QRCode-0.01_..> | 2023-10-08 18:02 | 3.8K | |
| p5-Term-Query-2.0_1.pkg | 2023-10-09 11:13 | 24K | |
| p5-Term-RawInput-1.2..> | 2023-10-07 11:29 | 5.7K | |
| p5-Term-ReadKey-2.38..> | 2023-10-05 17:03 | 17K | |
| p5-Term-ReadLine-1.1..> | 2023-10-08 11:30 | 9.4K | |
| p5-Term-ReadLine-Gnu..> | 2023-10-07 01:49 | 79K | |
| p5-Term-ReadLine-Per..> | 2023-10-06 23:31 | 37K | |
| p5-Term-ReadLine-TTY..> | 2023-10-10 03:16 | 39K | |
| p5-Term-ReadLine-Zoi..> | 2023-10-10 15:49 | 53K | |
| p5-Term-ReadPassword..> | 2023-10-07 08:21 | 8.4K | |
| p5-Term-Screen-1.06.pkg | 2023-10-07 05:37 | 9.7K | |
| p5-Term-ScreenColor-..> | 2023-10-08 06:48 | 11K | |
| p5-Term-Shell-0.13.pkg | 2023-10-07 14:57 | 27K | |
| p5-Term-ShellUI-0.92..> | 2023-10-07 17:32 | 40K | |
| p5-Term-Size-0.211.pkg | 2023-10-06 16:17 | 7.1K | |
| p5-Term-Size-Any-0.0..> | 2023-10-06 21:57 | 4.5K | |
| p5-Term-Size-Perl-0...> | 2023-10-06 15:39 | 5.4K | |
| p5-Term-Sk-0.18.pkg | 2023-10-06 21:54 | 10K | |
| p5-Term-Table-0.016.pkg | 2023-10-05 16:56 | 26K | |
| p5-Term-TablePrint-0..> | 2023-10-08 00:42 | 16K | |
| p5-Term-Title-0.09.pkg | 2023-10-07 21:19 | 5.0K | |
| p5-Term-UI-0.50.pkg | 2023-10-07 09:25 | 16K | |
| p5-Term-VT102-0.91_1..> | 2023-10-07 06:37 | 26K | |
| p5-Term-VT102-Boundl..> | 2023-10-08 06:19 | 4.0K | |
| p5-Term-Visual-0.08_..> | 2023-10-08 18:52 | 21K | |
| p5-Test-API-0.010.pkg | 2023-10-07 20:37 | 6.5K | |
| p5-Test-Able-0.11_1.pkg | 2023-10-07 23:56 | 30K | |
| p5-Test-Able-Runner-..> | 2023-10-09 07:01 | 8.6K | |
| p5-Test-Aggregate-0...> | 2023-10-09 14:37 | 30K | |
| p5-Test-Archive-Liba..> | 2023-10-10 03:14 | 5.6K | |
| p5-Test-Assertions-1..> | 2023-10-08 17:20 | 25K | |
| p5-Test-Auto-0.14.pkg | 2023-10-08 13:11 | 11K | |
| p5-Test-Base-0.89.pkg | 2023-10-07 07:42 | 28K | |
| p5-Test-Benchmark-0...> | 2023-10-11 14:08 | 6.3K | |
| p5-Test-BinaryData-0..> | 2023-10-14 11:37 | 8.1K | |
| p5-Test-Bits-0.02_1.pkg | 2023-10-14 06:16 | 4.8K | |
| p5-Test-CPAN-Meta-0...> | 2023-10-14 04:26 | 13K | |
| p5-Test-CPAN-Meta-YA..> | 2023-10-08 05:49 | 13K | |
| p5-Test-CheckDeps-0...> | 2023-10-14 16:04 | 4.2K | |
| p5-Test-CheckManifes..> | 2023-10-07 06:05 | 7.1K | |
| p5-Test-Class-0.52.pkg | 2023-10-06 19:28 | 43K | |
| p5-Test-Class-Most-0..> | 2023-10-14 14:55 | 8.1K | |
| p5-Test-ClassAPI-1.0..> | 2023-10-07 18:37 | 8.0K | |
| p5-Test-Classy-0.10_..> | 2023-10-08 17:32 | 14K | |
| p5-Test-CleanNamespa..> | 2023-10-08 17:51 | 6.0K | |
| p5-Test-Cmd-1.09.pkg | 2023-10-07 22:39 | 33K | |
| p5-Test-Command-0.11..> | 2023-10-11 01:17 | 11K | |
| p5-Test-Command-Simp..> | 2023-10-08 15:41 | 7.0K | |
| p5-Test-Compile-3.3...> | 2023-10-08 12:08 | 12K | |
| p5-Test-Corpus-Audio..> | 2023-10-08 23:13 | 23K | |
| p5-Test-Cukes-0.11_1..> | 2023-10-08 15:04 | 8.1K | |
| p5-Test-DBIC-Expecte..> | 2023-10-14 09:42 | 13K | |
| p5-Test-DBIx-Class-0..> | 2023-10-10 07:09 | 75K | |
| p5-Test-Data-1.244.pkg | 2023-10-09 20:54 | 15K | |
| p5-Test-Database-1.1..> | 2023-10-09 08:57 | 40K | |
| p5-Test-DatabaseRow-..> | 2023-10-10 07:06 | 27K | |
| p5-Test-Debugger-0.1..> | 2023-10-08 03:14 | 11K | |
| p5-Test-Declare-0.06..> | 2023-10-10 12:37 | 4.1K | |
| p5-Test-Deep-1.204.pkg | 2023-10-05 16:55 | 79K | |
| p5-Test-Deep-Unorder..> | 2023-10-09 09:26 | 5.8K | |
| p5-Test-Dependencies..> | 2023-10-11 02:22 | 8.5K | |
| p5-Test-DependentMod..> | 2023-10-10 04:07 | 11K | |
| p5-Test-DiagINC-0.01..> | 2023-10-14 07:35 | 7.4K | |
| p5-Test-Differences-..> | 2023-10-05 17:03 | 12K | |
| p5-Test-Dir-1.014_1.pkg | 2023-10-14 09:39 | 8.6K | |
| p5-Test-Distribution..> | 2023-10-08 13:28 | 12K | |
| p5-Test-EOL-1.5_1.pkg | 2023-10-14 12:16 | 6.7K | |
| p5-Test-Email-0.07_2..> | 2023-10-10 10:08 | 11K | |
| p5-Test-Exception-0...> | 2023-10-05 17:02 | 11K | |
| p5-Test-Exit-0.11.pkg | 2023-10-10 06:09 | 4.2K | |
| p5-Test-Expect-0.34.pkg | 2023-10-14 05:33 | 4.6K | |
| p5-Test-FailWarnings..> | 2023-10-06 19:24 | 5.7K | |
| p5-Test-Fake-HTTPD-0..> | 2023-10-09 12:36 | 6.6K | |
| p5-Test-Fatal-0.017.pkg | 2023-10-07 10:56 | 8.6K | |
| p5-Test-File-1.44.4.pkg | 2023-10-10 22:52 | 14K | |
| p5-Test-File-Content..> | 2023-10-07 22:53 | 7.7K | |
| p5-Test-File-ShareDi..> | 2023-10-08 11:34 | 24K | |
| p5-Test-Filename-0.0..> | 2023-10-14 03:26 | 4.9K | |
| p5-Test-Fixme-0.16.pkg | 2023-10-09 22:25 | 7.8K | |
| p5-Test-Fixture-DBI-..> | 2023-10-08 18:02 | 19K | |
| p5-Test-Fixture-DBIC..> | 2023-10-14 14:16 | 3.8K | |
| p5-Test-Future-IO-Im..> | 2023-10-14 18:23 | 5.5K | |
| p5-Test-Groonga-0.06..> | 2023-10-10 21:40 | 3.4K | |
| p5-Test-Group-0.20.pkg | 2023-10-14 15:48 | 39K | |
| p5-Test-HTML-Tidy-1...> | 2023-10-09 01:26 | 4.3K | |
| p5-Test-HTTP-0.22.pkg | 2023-10-08 14:13 | 12K | |
| p5-Test-HTTP-LocalSe..> | 2023-10-10 03:12 | 16K | |
| p5-Test-HTTP-Server-..> | 2023-10-06 23:10 | 6.8K | |
| p5-Test-Harness-3.47..> | 2023-10-10 21:11 | 213K | |
| p5-Test-Harness-Stra..> | 2023-10-06 23:30 | 21K | |
| p5-Test-HasVersion-0..> | 2023-10-09 23:04 | 6.3K | |
| p5-Test-HexDifferenc..> | 2023-10-14 07:06 | 9.3K | |
| p5-Test-HexString-0...> | 2023-10-09 08:49 | 4.7K | |
| p5-Test-Identity-0.0..> | 2023-10-14 07:15 | 3.7K | |
| p5-Test-If-0.01_1.pkg | 2023-10-08 21:22 | 3.4K | |
| p5-Test-InDistDir-1...> | 2023-10-10 08:59 | 4.2K | |
| p5-Test-Inline-2.214..> | 2023-10-09 14:59 | 49K | |
| p5-Test-Inter-1.10.pkg | 2023-10-06 20:04 | 37K | |
| p5-Test-JSON-0.11_2.pkg | 2023-10-10 19:37 | 4.9K | |
| p5-Test-Kwalitee-1.2..> | 2023-10-14 05:29 | 11K | |
| p5-Test-LWP-UserAgen..> | 2023-10-07 01:11 | 15K | |
| p5-Test-Lazy-0.061_1..> | 2023-10-14 10:36 | 13K | |
| p5-Test-LeakTrace-0...> | 2023-10-10 23:21 | 22K | |
| p5-Test-LectroTest-0..> | 2023-10-09 07:27 | 63K | |
| p5-Test-Lib-0.003.pkg | 2023-10-11 05:28 | 3.1K | |
| p5-Test-Lives-1.003.pkg | 2023-10-14 17:08 | 3.6K | |
| p5-Test-LoadAllModul..> | 2023-10-07 18:56 | 3.1K | |
| p5-Test-Log-Log4perl..> | 2023-10-08 05:54 | 9.4K | |
| p5-Test-Log4perl-0.1..> | 2023-10-08 21:13 | 9.4K | |
| p5-Test-LongString-0..> | 2023-10-06 20:41 | 8.4K | |
| p5-Test-Manifest-2.0..> | 2023-10-06 21:34 | 8.8K | |
| p5-Test-ManyParams-0..> | 2023-10-10 07:19 | 11K | |
| p5-Test-Memory-Cycle..> | 2023-10-07 14:42 | 5.1K | |
| p5-Test-Metrics-Any-..> | 2023-10-14 11:57 | 5.6K | |
| p5-Test-Mini-Unit-v1..> | 2023-10-11 14:33 | 8.5K | |
| p5-Test-Mini-v1.1.3_..> | 2023-10-07 20:40 | 28K | |
| p5-Test-Mock-Guard-0..> | 2023-10-14 08:29 | 6.0K | |
| p5-Test-Mock-LWP-0.0..> | 2023-10-07 05:42 | 10K | |
| p5-Test-Mock-LWP-Dis..> | 2023-10-09 01:54 | 7.1K | |
| p5-Test-Mock-One-0.0..> | 2023-10-09 17:27 | 9.5K | |
| p5-Test-Mock-Redis-0..> | 2023-10-09 03:13 | 14K | |
| p5-Test-MockDateTime..> | 2023-10-14 15:09 | 4.5K | |
| p5-Test-MockModule-0..> | 2023-10-07 03:52 | 12K | |
| p5-Test-MockObject-1..> | 2023-10-06 17:41 | 21K | |
| p5-Test-MockRandom-1..> | 2023-10-08 21:48 | 12K | |
| p5-Test-MockTime-0.1..> | 2023-10-07 10:29 | 5.4K | |
| p5-Test-MockTime-HiR..> | 2023-10-09 13:49 | 4.3K | |
| p5-Test-Modern-0.013..> | 2023-10-09 10:21 | 21K | |
| p5-Test-Module-Used-..> | 2023-10-11 03:32 | 7.3K | |
| p5-Test-Moose-More-0..> | 2023-10-14 05:12 | 19K | |
| p5-Test-More-UTF8-0...> | 2023-10-07 04:01 | 3.3K | |
| p5-Test-Most-0.38.pkg | 2023-10-06 15:17 | 19K | |
| p5-Test-Name-FromLin..> | 2023-10-10 20:41 | 3.7K | |
| p5-Test-Needs-0.0020..> | 2023-10-09 17:57 | 6.4K | |
| p5-Test-Net-LDAP-0.0..> | 2023-10-14 18:44 | 21K | |
| p5-Test-Net-RabbitMQ..> | 2023-10-09 02:07 | 7.8K | |
| p5-Test-Nginx-0.30.pkg | 2023-10-10 01:31 | 91K | |
| p5-Test-NoTabs-1.4.pkg | 2023-10-11 12:40 | 5.8K | |
| p5-Test-NoWarnings-1..> | 2023-10-06 17:04 | 7.8K | |
| p5-Test-Number-Delta..> | 2023-10-07 08:56 | 8.5K | |
| p5-Test-Object-0.08.pkg | 2023-10-08 13:20 | 5.3K | |
| p5-Test-OpenLDAP-0.0..> | 2023-10-10 13:03 | 19K | |
| p5-Test-Output-1.034..> | 2023-10-08 02:46 | 8.7K | |
| p5-Test-POE-Client-T..> | 2023-10-10 11:39 | 12K | |
| p5-Test-POE-Server-T..> | 2023-10-07 06:58 | 12K | |
| p5-Test-Parser-1.9_1..> | 2023-10-10 17:04 | 72K | |
| p5-Test-Perl-Critic-..> | 2023-10-09 11:36 | 11K | |
| p5-Test-PerlTidy-202..> | 2023-10-14 04:16 | 11K | |
| p5-Test-Pod-1.52.pkg | 2023-10-06 20:22 | 6.6K | |
| p5-Test-Pod-Coverage..> | 2023-10-06 21:04 | 6.9K | |
| p5-Test-Pod-Coverage..> | 2023-10-09 14:08 | 6.2K | |
| p5-Test-Portability-..> | 2023-10-12 03:55 | 8.0K | |
| p5-Test-Prereq-2.003..> | 2023-10-10 11:58 | 9.0K | |
| p5-Test-RandomResult..> | 2023-10-08 16:18 | 5.2K | |
| p5-Test-Refcount-0.1..> | 2023-10-11 10:31 | 8.6K | |
| p5-Test-Regexp-20170..> | 2023-10-08 16:19 | 15K | |
| p5-Test-Reporter-1.6..> | 2023-10-07 07:38 | 22K | |
| p5-Test-Reporter-Tra..> | 2023-10-07 12:24 | 6.4K | |
| p5-Test-Requires-0.1..> | 2023-10-07 02:54 | 3.9K | |
| p5-Test-Requires-Git..> | 2023-10-10 01:35 | 6.6K | |
| p5-Test-RequiresInte..> | 2023-10-06 15:36 | 4.0K | |
| p5-Test-Roo-1.004.pkg | 2023-10-14 09:30 | 24K | |
| p5-Test-Script-1.29.pkg | 2023-10-14 07:55 | 10K | |
| p5-Test-Script-Run-0..> | 2023-10-08 10:30 | 7.9K | |
| p5-Test-SharedFork-0..> | 2023-10-06 17:45 | 5.2K | |
| p5-Test-Signature-1...> | 2023-10-10 07:50 | 7.8K | |
| p5-Test-Simple-1.302..> | 2023-10-05 16:58 | 347K | |
| p5-Test-Singleton-1...> | 2023-10-09 17:50 | 4.1K | |
| p5-Test-Snapshot-0.0..> | 2023-10-10 13:50 | 5.4K | |
| p5-Test-Spec-0.54.pkg | 2023-10-10 03:41 | 36K | |
| p5-Test-Spelling-0.2..> | 2023-10-07 16:12 | 11K | |
| p5-Test-Strict-0.52_..> | 2023-10-08 13:41 | 9.9K | |
| p5-Test-SubCalls-1.1..> | 2023-10-10 23:40 | 5.1K | |
| p5-Test-Synopsis-0.0..> | 2023-10-08 14:39 | 4.9K | |
| p5-Test-Sys-Info-0.2..> | 2023-10-10 03:24 | 5.6K | |
| p5-Test-TAP-HTMLMatr..> | 2023-10-09 15:02 | 17K | |
| p5-Test-TAP-Model-0...> | 2023-10-07 15:37 | 21K | |
| p5-Test-TCP-2.22.pkg | 2023-10-07 02:09 | 14K | |
| p5-Test-TableDriven-..> | 2023-10-07 01:15 | 5.8K | |
| p5-Test-Taint-1.08.pkg | 2023-10-08 12:51 | 8.6K | |
| p5-Test-TempDir-Tiny..> | 2023-10-10 10:16 | 8.4K | |
| p5-Test-Time-0.092.pkg | 2023-10-10 16:12 | 3.2K | |
| p5-Test-Timer-2.12.pkg | 2023-10-14 18:22 | 14K | |
| p5-Test-TinyMocker-0..> | 2023-10-09 22:37 | 6.0K | |
| p5-Test-Tk-3.02.pkg | 2023-10-07 05:37 | 6.3K | |
| p5-Test-TrailingSpac..> | 2023-10-10 15:12 | 8.4K | |
| p5-Test-Trap-0.3.5.pkg | 2023-10-07 23:53 | 36K | |
| p5-Test-UNIXSock-0.4..> | 2023-10-10 23:59 | 6.1K | |
| p5-Test-URI-1.084.pkg | 2023-10-10 23:22 | 4.3K | |
| p5-Test-Unit-0.25_3.pkg | 2023-10-10 03:31 | 83K | |
| p5-Test-UseAllModule..> | 2023-10-07 10:31 | 5.0K | |
| p5-Test-Version-2.09..> | 2023-10-09 07:01 | 7.9K | |
| p5-Test-WWW-Declare-..> | 2023-10-10 06:26 | 8.3K | |
| p5-Test-WWW-Mechaniz..> | 2023-10-08 09:14 | 22K | |
| p5-Test-WWW-Mechaniz..> | 2023-10-10 15:12 | 2.9K | |
| p5-Test-WWW-Mechaniz..> | 2023-10-14 12:35 | 6.6K | |
| p5-Test-WWW-Mechaniz..> | 2023-10-08 15:02 | 11K | |
| p5-Test-WWW-Mechaniz..> | 2023-10-14 18:14 | 10K | |
| p5-Test-WWW-Selenium..> | 2023-10-10 12:56 | 52K | |
| p5-Test-Warn-0.37.pkg | 2023-10-05 17:04 | 10K | |
| p5-Test-Warnings-0.0..> | 2023-10-08 06:20 | 12K | |
| p5-Test-Weaken-3.022..> | 2023-10-10 18:50 | 32K | |
| p5-Test-Without-Modu..> | 2023-10-09 19:36 | 4.9K | |
| p5-Test-XML-0.08_1.pkg | 2023-10-09 22:09 | 15K | |
| p5-Test-XML-Valid-0...> | 2023-10-11 05:54 | 3.9K | |
| p5-Test-XPath-0.19.pkg | 2023-10-09 08:47 | 14K | |
| p5-Test-YAML-1.07.pkg | 2023-10-14 07:50 | 4.5K | |
| p5-Test-YAML-Meta-0...> | 2023-10-12 09:48 | 3.4K | |
| p5-Test-YAML-Valid-0..> | 2023-10-07 00:08 | 5.5K | |
| p5-Test-mysqld-1.001..> | 2023-10-14 06:49 | 7.7K | |
| p5-Test-postgresql-0..> | 2023-10-08 15:51 | 6.0K | |
| p5-Test-utf8-1.02.pkg | 2023-10-08 13:45 | 7.9K | |
| p5-Test2-Harness-1.0..> | 2023-10-07 22:13 | 548K | |
| p5-Test2-Harness-UI-..> | 2023-10-10 10:56 | 474K | |
| p5-Test2-Plugin-Cove..> | 2023-10-07 01:10 | 21K | |
| p5-Test2-Plugin-DBIP..> | 2023-10-07 00:31 | 4.0K | |
| p5-Test2-Plugin-IOEv..> | 2023-10-07 05:08 | 5.3K | |
| p5-Test2-Plugin-MemU..> | 2023-10-07 04:47 | 3.7K | |
| p5-Test2-Plugin-NoWa..> | 2023-10-09 12:52 | 6.8K | |
| p5-Test2-Plugin-UUID..> | 2023-10-06 23:33 | 3.1K | |
| p5-Test2-Suite-0.000..> | 2023-10-05 17:04 | 387K | |
| p5-Test2-Tools-Expla..> | 2023-10-09 15:11 | 5.7K | |
| p5-Test2-Tools-FFI-0..> | 2023-10-09 21:26 | 11K | |
| p5-Test2-Tools-Memor..> | 2023-10-09 10:22 | 4.5K | |
| p5-TestGen4Web-Runne..> | 2023-10-09 12:54 | 10K | |
| p5-Text-ANSI-Util-0...> | 2023-10-06 19:46 | 20K | |
| p5-Text-ANSI-WideUti..> | 2023-10-07 06:47 | 6.2K | |
| p5-Text-ANSITable-0...> | 2023-10-07 16:35 | 108K | |
| p5-Text-ASCIIMathML-..> | 2023-10-14 18:45 | 23K | |
| p5-Text-ASCIITable-0..> | 2023-10-06 17:52 | 22K | |
| p5-Text-Affixes-0.09..> | 2023-10-07 14:17 | 5.7K | |
| p5-Text-Aligner-0.16..> | 2023-10-06 14:39 | 9.6K | |
| p5-Text-AsciiTeX-0.0..> | 2023-10-14 12:28 | 24K | |
| p5-Text-Aspell-0.09_..> | 2023-10-07 13:39 | 18K | |
| p5-Text-Authinfo-0.0..> | 2023-10-11 16:16 | 6.4K | |
| p5-Text-Autoformat-1..> | 2023-10-05 17:00 | 26K | |
| p5-Text-Balanced-2.0..> | 2023-10-07 00:57 | 35K | |
| p5-Text-Bastardize-0..> | 2023-10-09 10:56 | 4.9K | |
| p5-Text-BibTeX-0.89.pkg | 2023-10-07 10:19 | 227K | |
| p5-Text-Bidi-2.18.pkg | 2023-10-14 06:51 | 52K | |
| p5-Text-Bind-0.04_1.pkg | 2023-10-10 05:35 | 10K | |
| p5-Text-Brew-0.02_1.pkg | 2023-10-07 00:19 | 5.9K | |
| p5-Text-CSV-2.03.pkg | 2023-10-07 05:17 | 105K | |
| p5-Text-CSV-Encoded-..> | 2023-10-10 20:39 | 19K | |
| p5-Text-CSV-Hashify-..> | 2023-10-10 16:02 | 11K | |
| p5-Text-CSV-Simple-1..> | 2023-10-09 18:12 | 6.5K | |
| p5-Text-CSV_XS-1.51.pkg | 2023-10-06 22:55 | 99K | |
| p5-Text-Capitalize-1..> | 2023-10-14 04:02 | 17K | |
| p5-Text-CharWidth-0...> | 2023-10-05 17:01 | 6.5K | |
| p5-Text-Chomp-0.02_1..> | 2023-10-14 12:50 | 4.3K | |
| p5-Text-ClearSilver-..> | 2023-10-09 23:05 | 103K | |
| p5-Text-Colorizer-0...> | 2023-10-07 01:57 | 14K | |
| p5-Text-Context-3.7_..> | 2023-10-07 18:43 | 7.7K | |
| p5-Text-Context-Eith..> | 2023-10-07 07:06 | 5.9K | |
| p5-Text-DHCPLeases-1..> | 2023-10-14 16:24 | 16K | |
| p5-Text-Decorator-1...> | 2023-10-09 17:55 | 22K | |
| p5-Text-Delimited-2...> | 2023-10-09 18:01 | 7.0K | |
| p5-Text-Diff-1.45.pkg | 2023-10-05 16:56 | 22K | |
| p5-Text-Diff-HTML-0...> | 2023-10-08 07:11 | 6.4K | |
| p5-Text-Diff-Parser-..> | 2023-10-10 12:59 | 9.6K | |
| p5-Text-Diff3-0.10_1..> | 2023-10-09 03:58 | 34K | |
| p5-Text-Distill-0.2.pkg | 2023-10-10 10:12 | 16K | |
| p5-Text-DoubleMetaph..> | 2023-10-14 07:04 | 15K | |
| p5-Text-Emoticon-0.0..> | 2023-10-07 06:19 | 3.2K | |
| p5-Text-Emoticon-Goo..> | 2023-10-14 07:48 | 3.0K | |
| p5-Text-Emoticon-MSN..> | 2023-10-07 19:31 | 4.5K | |
| p5-Text-EtText-2.2_2..> | 2023-10-09 11:37 | 27K | |
| p5-Text-Extract-Word..> | 2023-10-08 00:42 | 8.3K | |
| p5-Text-ExtractWords..> | 2023-10-07 16:12 | 10K | |
| p5-Text-FIGlet-2.19...> | 2023-10-14 12:04 | 57K | |
| p5-Text-FillIn-0.05_..> | 2023-10-14 14:50 | 14K | |
| p5-Text-Filter-1.10_..> | 2023-10-07 23:22 | 16K | |
| p5-Text-Filter-Chain..> | 2023-10-08 12:52 | 5.5K | |
| p5-Text-FindIndent-0..> | 2023-10-11 00:18 | 9.9K | |
| p5-Text-FixEOL-1.08.pkg | 2023-10-09 01:51 | 13K | |
| p5-Text-FixedLength-..> | 2023-10-07 11:58 | 6.3K | |
| p5-Text-FixedLength-..> | 2023-10-09 06:24 | 5.5K | |
| p5-Text-Flow-0.01_1.pkg | 2023-10-07 03:31 | 9.1K | |
| p5-Text-Flowchart-1...> | 2023-10-09 09:16 | 20K | |
| p5-Text-Flowed-0.14_..> | 2023-10-14 13:11 | 5.9K | |
| p5-Text-Format+NWrap..> | 2023-10-08 13:50 | 15K | |
| p5-Text-Format-0.62.pkg | 2023-10-08 09:49 | 15K | |
| p5-Text-FormatTable-..> | 2023-10-07 13:17 | 6.7K | |
| p5-Text-German-0.06_..> | 2023-10-05 16:54 | 12K | |
| p5-Text-Glob-0.11.pkg | 2023-10-05 16:56 | 4.7K | |
| p5-Text-Graphics-1.0..> | 2023-10-08 14:21 | 8.6K | |
| p5-Text-Greeking-0.1..> | 2023-10-10 20:51 | 6.6K | |
| p5-Text-Greeking-zh_..> | 2023-10-14 09:26 | 8.3K | |
| p5-Text-Haml-0.99011..> | 2023-10-07 16:59 | 15K | |
| p5-Text-Hatena-0.20_..> | 2023-10-08 20:08 | 9.8K | |
| p5-Text-Highlight-0...> | 2023-10-11 12:57 | 46K | |
| p5-Text-HikiDoc-1.02..> | 2023-10-14 16:25 | 14K | |
| p5-Text-Hogan-2.03.pkg | 2023-10-07 22:20 | 16K | |
| p5-Text-Hyphen-0.2,1..> | 2023-10-07 14:38 | 19K | |
| p5-Text-Hyphen-RU-0...> | 2023-10-08 12:21 | 18K | |
| p5-Text-Iconv-1.7_4.pkg | 2023-10-05 17:04 | 11K | |
| p5-Text-LTSV-0.08_1.pkg | 2023-10-11 21:21 | 6.4K | |
| p5-Text-Language-Gue..> | 2023-10-14 11:50 | 7.8K | |
| p5-Text-Levenshtein-..> | 2023-10-10 16:23 | 7.1K | |
| p5-Text-Levenshtein-..> | 2023-10-07 01:12 | 8.9K | |
| p5-Text-Levenshtein-..> | 2023-10-10 06:46 | 7.0K | |
| p5-Text-LevenshteinX..> | 2023-10-09 14:41 | 6.2K | |
| p5-Text-Locus-1.04.pkg | 2023-10-06 18:26 | 7.2K | |
| p5-Text-Lorem-0.34.pkg | 2023-10-11 06:22 | 4.5K | |
| p5-Text-Markdown-1.0..> | 2023-10-07 09:20 | 23K | |
| p5-Text-MarkdownTabl..> | 2023-10-08 06:05 | 6.4K | |
| p5-Text-Match-FastAl..> | 2023-10-09 23:56 | 15K | |
| p5-Text-Metaphone-20..> | 2023-10-07 17:01 | 9.0K | |
| p5-Text-MicroMason-2..> | 2023-10-08 21:07 | 144K | |
| p5-Text-MicroTemplat..> | 2023-10-07 07:40 | 12K | |
| p5-Text-MicroTemplat..> | 2023-10-09 20:27 | 19K | |
| p5-Text-MultiMarkdow..> | 2023-10-07 11:08 | 20K | |
| p5-Text-MultiMarkdow..> | 2023-10-14 02:59 | 4.9K | |
| p5-Text-NSP-1.31.pkg | 2023-10-10 02:50 | 678K | |
| p5-Text-NeatTemplate..> | 2023-10-08 09:30 | 13K | |
| p5-Text-Netstring-0...> | 2023-10-08 10:37 | 5.2K | |
| p5-Text-Ngram-0.15_1..> | 2023-10-07 13:20 | 9.0K | |
| p5-Text-Ngrams-2.007..> | 2023-10-12 10:27 | 21K | |
| p5-Text-NonWideChar-..> | 2023-10-07 03:42 | 3.9K | |
| p5-Text-Original-1.5..> | 2023-10-09 09:10 | 4.3K | |
| p5-Text-Outdent-0.01..> | 2023-10-07 03:51 | 5.0K | |
| p5-Text-PDF-0.31.pkg | 2023-10-06 14:34 | 77K | |
| p5-Text-Padding-1.11..> | 2023-10-08 15:35 | 5.3K | |
| p5-Text-ParagraphDif..> | 2023-10-10 08:43 | 11K | |
| p5-Text-ParseWords-3..> | 2023-10-06 22:50 | 6.8K | |
| p5-Text-Password-Pro..> | 2023-10-07 04:56 | 5.2K | |
| p5-Text-Patch-1.8_1.pkg | 2023-10-06 21:23 | 5.9K | |
| p5-Text-Pipe-0.10_1.pkg | 2023-10-11 04:56 | 81K | |
| p5-Text-Prefix-XS-0...> | 2023-10-14 12:28 | 18K | |
| p5-Text-QRCode-0.05_..> | 2023-10-08 00:07 | 7.1K | |
| p5-Text-Query-0.09_1..> | 2023-10-08 02:15 | 32K | |
| p5-Text-Query-SQL-0...> | 2023-10-14 15:13 | 18K | |
| p5-Text-Quote-0.33.pkg | 2023-10-07 13:07 | 14K | |
| p5-Text-Quoted-2.10.pkg | 2023-10-07 08:40 | 6.1K | |
| p5-Text-RecordParser..> | 2023-10-06 15:31 | 34K | |
| p5-Text-Reflow-1.17.pkg | 2023-10-08 20:28 | 20K | |
| p5-Text-Reform-1.20_..> | 2023-10-05 16:56 | 29K | |
| p5-Text-Report-1.004..> | 2023-10-14 07:31 | 29K | |
| p5-Text-Repository-1..> | 2023-10-09 07:53 | 8.3K | |
| p5-Text-Roman-3.5.pkg | 2023-10-08 07:27 | 6.8K | |
| p5-Text-Sass-0.97_2.pkg | 2023-10-08 11:26 | 16K | |
| p5-Text-Shellwords-1..> | 2023-10-08 02:58 | 3.5K | |
| p5-Text-Similarity-0..> | 2023-10-07 19:38 | 25K | |
| p5-Text-SimpleTable-..> | 2023-10-06 14:27 | 5.4K | |
| p5-Text-SimpleTable-..> | 2023-10-09 15:21 | 5.6K | |
| p5-Text-SimpleTempla..> | 2023-10-07 16:36 | 7.8K | |
| p5-Text-Soundex-3.05..> | 2023-10-06 18:11 | 11K | |
| p5-Text-SpellChecker..> | 2023-10-09 10:07 | 7.3K | |
| p5-Text-Striphigh-0...> | 2023-10-08 18:43 | 5.3K | |
| p5-Text-Table-1.135.pkg | 2023-10-06 18:24 | 25K | |
| p5-Text-Table-ASV-0...> | 2023-10-08 11:03 | 5.3K | |
| p5-Text-Table-Any-0...> | 2023-10-09 19:03 | 12K | |
| p5-Text-Table-CSV-0...> | 2023-10-07 15:19 | 4.7K | |
| p5-Text-Table-HTML-0..> | 2023-10-07 10:13 | 6.3K | |
| p5-Text-Table-HTML-D..> | 2023-10-07 20:34 | 190K | |
| p5-Text-Table-LTSV-0..> | 2023-10-08 03:58 | 4.7K | |
| p5-Text-Table-Manifo..> | 2023-10-07 05:20 | 20K | |
| p5-Text-Table-More-0..> | 2023-10-07 11:46 | 20K | |
| p5-Text-Table-Org-0...> | 2023-10-08 09:01 | 6.2K | |
| p5-Text-Table-Paragr..> | 2023-10-07 10:45 | 5.2K | |
| p5-Text-Table-Sprint..> | 2023-10-07 18:58 | 7.4K | |
| p5-Text-Table-TSV-0...> | 2023-10-07 11:56 | 4.5K | |
| p5-Text-Table-Tickit..> | 2023-10-07 13:04 | 3.8K | |
| p5-Text-Table-Tiny-1..> | 2023-10-07 23:15 | 9.3K | |
| p5-Text-Table-TinyBo..> | 2023-10-07 15:16 | 6.6K | |
| p5-Text-Table-TinyCo..> | 2023-10-08 02:56 | 4.8K | |
| p5-Text-Table-TinyCo..> | 2023-10-07 18:10 | 5.1K | |
| p5-Text-Table-TinyWi..> | 2023-10-07 22:28 | 4.8K | |
| p5-Text-Table-XLSX-0..> | 2023-10-08 10:11 | 3.8K | |
| p5-Text-Tabs+Wrap-20..> | 2023-10-06 17:00 | 11K | |
| p5-Text-TabularDispl..> | 2023-10-05 17:05 | 9.3K | |
| p5-Text-Tags-0.04_1.pkg | 2023-10-07 20:46 | 9.7K | |
| p5-Text-Template-1.6..> | 2023-10-06 22:14 | 44K | |
| p5-Text-Template-Sim..> | 2023-10-06 21:20 | 72K | |
| p5-Text-TestBase-0.1..> | 2023-10-14 07:39 | 14K | |
| p5-Text-Textile-2.13..> | 2023-10-07 21:21 | 40K | |
| p5-Text-Tmpl-0.33_1.pkg | 2023-10-14 14:04 | 39K | |
| p5-Text-Trac-0.24.pkg | 2023-10-07 07:07 | 12K | |
| p5-Text-Trim-1.04.pkg | 2023-10-07 04:50 | 5.6K | |
| p5-Text-Truncate-1.0..> | 2023-10-07 21:15 | 3.8K | |
| p5-Text-Typography-0..> | 2023-10-08 07:17 | 10K | |
| p5-Text-Unaccent-1.0..> | 2023-10-09 12:20 | 18K | |
| p5-Text-Unaccent-Pur..> | 2023-10-09 13:57 | 48K | |
| p5-Text-UnicodeBox-0..> | 2023-10-08 08:55 | 27K | |
| p5-Text-Unidecode-1...> | 2023-10-05 16:46 | 92K | |
| p5-Text-VimColor-0.2..> | 2023-10-11 04:19 | 28K | |
| p5-Text-VisualWidth-..> | 2023-10-09 06:53 | 10K | |
| p5-Text-WideChar-Uti..> | 2023-10-06 21:23 | 10K | |
| p5-Text-WikiCreole-0..> | 2023-10-10 00:40 | 12K | |
| p5-Text-WikiFormat-0..> | 2023-10-07 07:29 | 19K | |
| p5-Text-WordDiff-0.0..> | 2023-10-07 02:47 | 24K | |
| p5-Text-WrapI18N-0.0..> | 2023-10-06 14:42 | 5.0K | |
| p5-Text-Wrapper-1.05..> | 2023-10-07 09:59 | 7.0K | |
| p5-Text-Xslate-3.4.0..> | 2023-10-06 21:13 | 151K | |
| p5-Text-Xslate-Bridg..> | 2023-10-08 09:27 | 8.1K | |
| p5-Text-sprintfn-0.0..> | 2023-10-07 01:38 | 6.9K | |
| p5-Text-vCard-3.09.pkg | 2023-10-08 09:36 | 33K | |
| p5-Text-vFile-asData..> | 2023-10-06 22:29 | 6.9K | |
| p5-Text-xSV-0.21_1.pkg | 2023-10-08 17:23 | 16K | |
| p5-TheSchwartz-1.12.pkg | 2023-10-08 10:23 | 38K | |
| p5-TheSchwartz-Simpl..> | 2023-10-09 19:57 | 5.1K | |
| p5-TheSchwartz-Worke..> | 2023-10-14 10:54 | 7.0K | |
| p5-Thread-Apartment-..> | 2023-10-09 20:48 | 45K | |
| p5-Thread-Cancel-1.1..> | 2023-10-14 14:42 | 5.0K | |
| p5-Thread-Pool-Simpl..> | 2023-10-10 01:54 | 5.3K | |
| p5-Thread-Queue-3.13..> | 2023-10-09 12:53 | 10K | |
| p5-Thread-Queue-Dupl..> | 2023-10-07 16:30 | 20K | |
| p5-Thread-Suspend-1...> | 2023-10-09 08:27 | 6.4K | |
| p5-Thrift-0.16.0,1.pkg | 2023-10-09 12:58 | 13K | |
| p5-Thrift-XS-1.04_2.pkg | 2023-10-10 06:40 | 52K | |
| p5-Throwable-1.001.pkg | 2023-10-06 17:25 | 12K | |
| p5-Tickit-0.74.pkg | 2023-10-06 18:28 | 124K | |
| p5-Tickit-Widget-Tab..> | 2023-10-07 02:57 | 20K | |
| p5-Tickit-Widgets-0...> | 2023-10-06 19:23 | 117K | |
| p5-Tie-Array-Pack-0...> | 2023-10-09 22:44 | 6.1K | |
| p5-Tie-Array-Sorted-..> | 2023-10-07 08:46 | 6.2K | |
| p5-Tie-CPHash-2.000.pkg | 2023-10-10 12:36 | 7.8K | |
| p5-Tie-Cache-0.21_1.pkg | 2023-10-07 12:26 | 11K | |
| p5-Tie-DBI-1.08.pkg | 2023-10-10 21:38 | 32K | |
| p5-Tie-DB_File-Split..> | 2023-10-07 12:01 | 11K | |
| p5-Tie-DB_FileLock-0..> | 2023-10-08 23:40 | 7.4K | |
| p5-Tie-DNS-1.151560,..> | 2023-10-10 19:36 | 9.6K | |
| p5-Tie-DxHash-1.05_2..> | 2023-10-14 09:09 | 9.4K | |
| p5-Tie-EncryptedHash..> | 2023-10-06 15:39 | 11K | |
| p5-Tie-File-1.07.pkg | 2023-10-06 23:56 | 33K | |
| p5-Tie-File-AsHash-0..> | 2023-10-10 03:49 | 7.5K | |
| p5-Tie-FileLRUCache-..> | 2023-10-08 07:37 | 12K | |
| p5-Tie-Function-0.02..> | 2023-10-06 18:10 | 3.4K | |
| p5-Tie-Hash-Indexed-..> | 2023-10-08 00:37 | 17K | |
| p5-Tie-Hash-MultiVal..> | 2023-10-14 13:02 | 7.2K | |
| p5-Tie-Hash-Regex-1...> | 2023-10-11 01:02 | 4.9K | |
| p5-Tie-Hash-Sorted-0..> | 2023-10-12 12:19 | 7.2K | |
| p5-Tie-Hash-TwoWay-1..> | 2023-10-09 02:37 | 4.8K | |
| p5-Tie-IxHash-1.23_1..> | 2023-10-05 17:05 | 8.4K | |
| p5-Tie-LLHash-1.004.pkg | 2023-10-07 14:54 | 7.2K | |
| p5-Tie-LevelDB-0.07_..> | 2023-10-09 13:04 | 26K | |
| p5-Tie-NetAddr-IP-1...> | 2023-10-08 18:53 | 4.8K | |
| p5-Tie-RefHash-1.40.pkg | 2023-10-09 20:05 | 6.1K | |
| p5-Tie-RefHash-Weak-..> | 2023-10-05 17:03 | 5.7K | |
| p5-Tie-RegexpHash-0...> | 2023-10-10 09:51 | 6.9K | |
| p5-Tie-Restore-0.11_..> | 2023-10-07 22:57 | 3.0K | |
| p5-Tie-ShareLite-0.0..> | 2023-10-14 10:47 | 7.9K | |
| p5-Tie-Simple-1.04.pkg | 2023-10-07 07:03 | 13K | |
| p5-Tie-Syslog-2.04.0..> | 2023-10-09 06:18 | 10K | |
| p5-Tie-TinyURL-0.02_..> | 2023-10-09 01:45 | 4.7K | |
| p5-Tie-ToObject-0.03..> | 2023-10-05 17:02 | 3.4K | |
| p5-Tie-Util-0.04.pkg | 2023-10-10 08:38 | 9.0K | |
| p5-Tie-iCal-0.15_1.pkg | 2023-10-10 09:06 | 8.7K | |
| p5-Tiffany-1.01_1.pkg | 2023-10-14 16:21 | 27K | |
| p5-Time-Clock-1.03_1..> | 2023-10-06 17:13 | 9.1K | |
| p5-Time-Crontab-0.04..> | 2023-10-07 10:25 | 5.2K | |
| p5-Time-Duration-1.2..> | 2023-10-06 22:44 | 9.9K | |
| p5-Time-Duration-Par..> | 2023-10-06 22:27 | 4.4K | |
| p5-Time-Elapsed-0.33..> | 2023-10-08 10:09 | 12K | |
| p5-Time-Format-1.12_..> | 2023-10-07 10:12 | 22K | |
| p5-Time-HiRes-1.9764..> | 2023-10-07 10:59 | 26K | |
| p5-Time-Human-1.03_1..> | 2023-10-10 00:52 | 5.2K | |
| p5-Time-Interval-1.2..> | 2023-10-14 15:11 | 7.0K | |
| p5-Time-Local-1.35.pkg | 2023-10-09 17:51 | 12K | |
| p5-Time-Mock-0.0.2_1..> | 2023-10-11 14:10 | 6.8K | |
| p5-Time-Moment-0.44.pkg | 2023-10-08 07:22 | 59K | |
| p5-Time-Moment-Role-..> | 2023-10-09 13:19 | 5.1K | |
| p5-Time-Object-1.00_..> | 2023-10-09 05:02 | 16K | |
| p5-Time-Out-0.11_1.pkg | 2023-10-08 15:45 | 4.6K | |
| p5-Time-ParseDate-20..> | 2023-10-08 08:52 | 26K | |
| p5-Time-Period-1.25.pkg | 2023-10-07 16:43 | 11K | |
| p5-Time-Piece-1.3300..> | 2023-10-07 22:46 | 27K | |
| p5-Time-Piece-MySQL-..> | 2023-10-09 17:14 | 4.5K | |
| p5-Time-Piece-Range-..> | 2023-10-08 05:01 | 3.3K | |
| p5-Time-Progress-2.1..> | 2023-10-07 00:01 | 10K | |
| p5-Time-Stopwatch-1...> | 2023-10-10 05:18 | 6.3K | |
| p5-Time-Warp-0.55.pkg | 2023-10-06 22:36 | 7.3K | |
| p5-Time-modules-2013..> | 2023-10-07 00:34 | 26K | |
| p5-Time-timegm-0.01.pkg | 2023-10-07 00:32 | 5.6K | |
| p5-TimeDate-2.33,1.pkg | 2023-10-05 16:49 | 32K | |
| p5-Tk-804.035_2.pkg | 2023-10-06 18:32 | 1.9M | |
| p5-Tk-Action-1.09339..> | 2023-10-10 15:52 | 4.8K | |
| p5-Tk-Autoscroll-1.1..> | 2023-10-14 09:02 | 6.2K | |
| p5-Tk-Clock-0.41.pkg | 2023-10-14 12:01 | 16K | |
| p5-Tk-ColourChooser-..> | 2023-10-10 22:28 | 8.7K | |
| p5-Tk-Contrib-0.08.pkg | 2023-10-08 06:06 | 17K | |
| p5-Tk-CursorControl-..> | 2023-10-08 19:09 | 14K | |
| p5-Tk-DKW-0.03_5.pkg | 2023-10-14 07:49 | 57K | |
| p5-Tk-Date-0.44_2.pkg | 2023-10-10 01:49 | 20K | |
| p5-Tk-DynaTabFrame-0..> | 2023-10-07 20:23 | 26K | |
| p5-Tk-Enscript-1.10_..> | 2023-10-14 10:36 | 5.4K | |
| p5-Tk-FileDialog-1.3..> | 2023-10-14 04:40 | 14K | |
| p5-Tk-FontDialog-0.1..> | 2023-10-07 10:17 | 12K | |
| p5-Tk-GBARR-2.08_4.pkg | 2023-10-08 03:37 | 20K | |
| p5-Tk-Getopt-0.51.pkg | 2023-10-09 15:21 | 25K | |
| p5-Tk-HistEntry-0.45..> | 2023-10-09 18:39 | 9.1K | |
| p5-Tk-JComboBox-1.14..> | 2023-10-08 01:42 | 63K | |
| p5-Tk-JPEG-Lite-2.01..> | 2023-10-09 08:25 | 13K | |
| p5-Tk-Pod-0.9943.pkg | 2023-10-09 12:25 | 77K | |
| p5-Tk-ResizeButton-0..> | 2023-10-10 07:59 | 5.6K | |
| p5-Tk-Role-Dialog-1...> | 2023-10-09 02:06 | 7.4K | |
| p5-Tk-Role-HasWidget..> | 2023-10-07 15:18 | 5.2K | |
| p5-Tk-Splashscreen-1..> | 2023-10-10 03:38 | 7.3K | |
| p5-Tk-Sugar-1.093190..> | 2023-10-08 08:52 | 6.4K | |
| p5-Tk-TableMatrix-1...> | 2023-10-06 19:09 | 104K | |
| p5-Tk-ToolBar-0.12.pkg | 2023-10-14 14:32 | 56K | |
| p5-Tk-WaitBox-1.3_1.pkg | 2023-10-08 00:37 | 7.3K | |
| p5-Tk-XMLViewer-0.21..> | 2023-10-08 14:16 | 14K | |
| p5-Toader-1.2.1_2.pkg | 2023-10-09 17:49 | 177K | |
| p5-Toadfarm-0.83.pkg | 2023-10-10 11:19 | 40K | |
| p5-TokyoCabinet-1.34..> | 2023-10-09 05:09 | 68K | |
| p5-ToolSet-1.00_1.pkg | 2023-10-10 15:52 | 11K | |
| p5-TraceFuncs-0.1_1.pkg | 2023-10-10 18:47 | 5.6K | |
| p5-Tree-Authz-0.03_1..> | 2023-10-09 16:54 | 18K | |
| p5-Tree-Binary-1.09.pkg | 2023-10-08 07:28 | 46K | |
| p5-Tree-Binary-Dicti..> | 2023-10-14 04:06 | 4.8K | |
| p5-Tree-DAG_Node-1.3..> | 2023-10-07 02:45 | 48K | |
| p5-Tree-Nary-1.30_1,..> | 2023-10-09 20:54 | 12K | |
| p5-Tree-Node-0.08_2.pkg | 2023-10-10 07:28 | 18K | |
| p5-Tree-Parser-0.15_..> | 2023-10-10 17:51 | 16K | |
| p5-Tree-R-0.072.pkg | 2023-10-08 00:19 | 6.0K | |
| p5-Tree-RedBlack-0.5..> | 2023-10-08 16:53 | 8.9K | |
| p5-Tree-Simple-1.34.pkg | 2023-10-05 17:04 | 32K | |
| p5-Tree-Simple-View-..> | 2023-10-07 22:57 | 33K | |
| p5-Tree-Simple-Visit..> | 2023-10-06 14:33 | 64K | |
| p5-Tree-Suffix-0.22.pkg | 2023-10-08 17:29 | 13K | |
| p5-Tree-Trie-1.9.pkg | 2023-10-06 22:16 | 20K | |
| p5-TrimGalore-0.6.5.pkg | 2023-10-10 05:35 | 23M | |
| p5-Try-Catch-1.1.0.pkg | 2023-10-08 06:33 | 5.3K | |
| p5-Try-Tiny-0.31.pkg | 2023-10-05 16:48 | 16K | |
| p5-Try-Tiny-Retry-0...> | 2023-10-09 16:58 | 7.9K | |
| p5-TryCatch-1.003002..> | 2023-10-14 10:04 | 14K | |
| p5-Twiggy-0.1026.pkg | 2023-10-08 02:36 | 13K | |
| p5-Twiggy-TLS-0.0020..> | 2023-10-14 07:14 | 7.0K | |
| p5-Twitter-API-1.000..> | 2023-10-07 10:02 | 69K | |
| p5-Type-Tiny-2.00400..> | 2023-10-05 16:55 | 335K | |
| p5-Type-Tiny-Signatu..> | 2023-10-14 06:20 | 3.8K | |
| p5-Type-Tiny-XS-0.02..> | 2023-10-05 16:53 | 21K | |
| p5-Types-Core-0.3.2.pkg | 2023-10-10 22:51 | 15K | |
| p5-Types-Path-Tiny-0..> | 2023-10-06 21:27 | 5.6K | |
| p5-Types-Serialiser-..> | 2023-10-06 14:03 | 9.6K | |
| p5-Types-URI-0.007.pkg | 2023-10-07 06:01 | 4.8K | |
| p5-Types-UUID-0.004.pkg | 2023-10-06 22:26 | 4.4K | |
| p5-UDCode-1.03_1.pkg | 2023-10-07 22:43 | 3.8K | |
| p5-UI-Dialog-1.21.pkg | 2023-10-14 04:46 | 114K | |
| p5-UML-Class-Simple-..> | 2023-10-10 22:04 | 26K | |
| p5-UML-Sequence-0.08..> | 2023-10-09 21:27 | 49K | |
| p5-UML-State-0.02_1.pkg | 2023-10-09 14:22 | 20K | |
| p5-UNIVERSAL-can-1.2..> | 2023-10-06 15:20 | 5.3K | |
| p5-UNIVERSAL-isa-1.2..> | 2023-10-06 15:18 | 5.8K | |
| p5-UNIVERSAL-moniker..> | 2023-10-06 18:20 | 3.6K | |
| p5-UNIVERSAL-ref-0.1..> | 2023-10-08 09:40 | 7.8K | |
| p5-UNIVERSAL-require..> | 2023-10-06 14:56 | 5.9K | |
| p5-UNIVERSAL-which-0..> | 2023-10-14 10:24 | 4.3K | |
| p5-URBL-Prepare-0.09..> | 2023-10-07 07:41 | 8.1K | |
| p5-URI-5.21.pkg | 2023-10-05 16:48 | 81K | |
| p5-URI-Based-1.03.pkg | 2023-10-07 12:23 | 4.0K | |
| p5-URI-Encode-0.09_1..> | 2023-10-07 15:21 | 6.4K | |
| p5-URI-Encode-XS-0.1..> | 2023-10-08 09:26 | 9.0K | |
| p5-URI-Escape-JavaSc..> | 2023-10-08 19:27 | 3.9K | |
| p5-URI-Escape-XS-0.1..> | 2023-10-06 22:01 | 11K | |
| p5-URI-Fast-0.55.pkg | 2023-10-09 11:41 | 42K | |
| p5-URI-Fetch-0.130.pkg | 2023-10-07 08:32 | 12K | |
| p5-URI-Find-20160806..> | 2023-10-06 22:40 | 22K | |
| p5-URI-FromHash-0.05..> | 2023-10-06 22:03 | 5.7K | |
| p5-URI-GoogleChart-1..> | 2023-10-09 09:50 | 12K | |
| p5-URI-Match-0.00001..> | 2023-10-08 00:07 | 4.5K | |
| p5-URI-Nested-0.10.pkg | 2023-10-07 00:44 | 6.2K | |
| p5-URI-Normalize-0.0..> | 2023-10-09 12:46 | 5.2K | |
| p5-URI-OpenURL-0.4.6..> | 2023-10-10 02:53 | 11K | |
| p5-URI-ParseSearchSt..> | 2023-10-10 00:09 | 12K | |
| p5-URI-Query-0.16.pkg | 2023-10-09 15:20 | 9.5K | |
| p5-URI-Sequin-1.2_1.pkg | 2023-10-09 21:25 | 27K | |
| p5-URI-SmartURI-0.03..> | 2023-10-07 19:53 | 8.9K | |
| p5-URI-Template-0.24..> | 2023-10-07 23:37 | 6.2K | |
| p5-URI-Template-Rest..> | 2023-10-07 19:19 | 7.3K | |
| p5-URI-Title-1.904.pkg | 2023-10-08 15:45 | 12K | |
| p5-URI-ToDisk-1.12_2..> | 2023-10-14 03:35 | 6.9K | |
| p5-URI-UTF8-Punycode..> | 2023-10-09 17:50 | 10K | |
| p5-URI-cpan-1.009.pkg | 2023-10-11 02:34 | 12K | |
| p5-URI-db-0.20.pkg | 2023-10-08 10:28 | 18K | |
| p5-URI-imap-1.01_1.pkg | 2023-10-07 06:55 | 2.5K | |
| p5-URI-imaps-1.04.pkg | 2023-10-07 21:53 | 2.4K | |
| p5-URI-ws-0.03.pkg | 2023-10-05 17:07 | 4.6K | |
| p5-URL-Encode-0.03.pkg | 2023-10-07 01:57 | 7.0K | |
| p5-URL-Encode-XS-0.0..> | 2023-10-06 17:42 | 8.1K | |
| p5-URN-OASIS-SAML2-0..> | 2023-10-08 10:20 | 4.0K | |
| p5-UUID-0.28.pkg | 2023-10-07 11:35 | 13K | |
| p5-UUID-Random-0.04_..> | 2023-10-08 10:51 | 2.9K | |
| p5-UUID-Random-Patch..> | 2023-10-09 08:52 | 3.7K | |
| p5-UUID-Tiny-1.04_1.pkg | 2023-10-06 16:30 | 14K | |
| p5-UUID-URandom-0.00..> | 2023-10-07 08:07 | 4.5K | |
| p5-Ubic-1.58.pkg | 2023-10-10 19:33 | 162K | |
| p5-Unicode-CaseFold-..> | 2023-10-07 02:14 | 10K | |
| p5-Unicode-CheckUTF8..> | 2023-10-08 21:20 | 6.4K | |
| p5-Unicode-Collate-1..> | 2023-10-07 15:09 | 538K | |
| p5-Unicode-EastAsian..> | 2023-10-05 16:46 | 9.0K | |
| p5-Unicode-Escape-0...> | 2023-10-08 11:58 | 6.4K | |
| p5-Unicode-IMAPUtf7-..> | 2023-10-09 17:12 | 5.7K | |
| p5-Unicode-LineBreak..> | 2023-10-05 16:55 | 107K | |
| p5-Unicode-Map-0.112..> | 2023-10-06 20:55 | 138K | |
| p5-Unicode-Map8-0.13..> | 2023-10-06 20:43 | 42K | |
| p5-Unicode-MapUTF8-1..> | 2023-10-07 09:50 | 11K | |
| p5-Unicode-Normalize..> | 2023-10-06 14:25 | 61K | |
| p5-Unicode-Recursive..> | 2023-10-11 13:21 | 4.2K | |
| p5-Unicode-String-2...> | 2023-10-06 18:09 | 88K | |
| p5-Unicode-Stringpre..> | 2023-10-06 16:10 | 25K | |
| p5-Unicode-Tussle-1...> | 2023-10-09 10:51 | 390K | |
| p5-Unicode-UTF8simpl..> | 2023-10-06 22:26 | 25K | |
| p5-Unicode-Unihan-0...> | 2023-10-07 19:59 | 4.4M | |
| p5-Uniq-0.01_1.pkg | 2023-10-09 20:22 | 3.8K | |
| p5-Unix-ConfigFile-0..> | 2023-10-11 05:42 | 25K | |
| p5-Unix-Groups-0.01.pkg | 2023-10-14 18:42 | 6.9K | |
| p5-Unix-Groups-FFI-1..> | 2023-10-07 16:55 | 5.2K | |
| p5-Unix-Lsof-0.1.0.pkg | 2023-10-08 12:20 | 23K | |
| p5-Unix-Mknod-0.04_1..> | 2023-10-08 18:56 | 9.6K | |
| p5-Unix-Passwd-File-..> | 2023-10-09 12:45 | 18K | |
| p5-Unix-Processors-2..> | 2023-10-07 09:55 | 11K | |
| p5-Unix-Statgrab-0.1..> | 2023-10-08 21:07 | 92K | |
| p5-Unix-Syslog-1.1_1..> | 2023-10-07 06:29 | 14K | |
| p5-Unix-Uptime-0.370..> | 2023-10-10 10:22 | 14K | |
| p5-Unix-setuid-0.02.pkg | 2023-10-10 15:10 | 4.4K | |
| p5-User-1.9_1.pkg | 2023-10-07 09:58 | 4.3K | |
| p5-User-Identity-1.0..> | 2023-10-06 16:57 | 65K | |
| p5-Util-Any-0.25.pkg | 2023-10-14 17:23 | 20K | |
| p5-VCG-0.5_2.pkg | 2023-10-07 19:40 | 6.8K | |
| p5-VCP-Dest-svk-0.29..> | 2023-10-10 05:56 | 9.0K | |
| p5-VCP-Source-cvsbk-..> | 2023-10-10 08:04 | 5.5K | |
| p5-VCP-autrijus-0.9...> | 2023-10-06 19:33 | 350K | |
| p5-VCS-0.25.pkg | 2023-10-10 02:34 | 26K | |
| p5-VCS-CVS-2.06_1.pkg | 2023-10-10 13:07 | 15K | |
| p5-VCS-Lite-0.12.pkg | 2023-10-08 08:58 | 18K | |
| p5-VM-EC2-1.28_1.pkg | 2023-10-06 20:01 | 741K | |
| p5-VM-EC2-Security-C..> | 2023-10-07 05:43 | 3.0K | |
| p5-VUser-Google-Prov..> | 2023-10-09 10:10 | 33K | |
| p5-Validate-Net-0.6_..> | 2023-10-07 22:00 | 6.1K | |
| p5-Validation-Class-..> | 2023-10-08 05:41 | 234K | |
| p5-Validator-Custom-..> | 2023-10-09 01:14 | 44K | |
| p5-Variable-Disposit..> | 2023-10-06 16:01 | 4.9K | |
| p5-Variable-Eject-0...> | 2023-10-14 04:29 | 4.6K | |
| p5-Variable-Magic-0...> | 2023-10-05 16:49 | 29K | |
| p5-Venus-3.55.pkg | 2023-10-08 10:06 | 456K | |
| p5-Verilog-Perl-3.47..> | 2023-10-10 15:53 | 371K | |
| p5-Version-Next-1.00..> | 2023-10-07 19:18 | 5.8K | |
| p5-Vimana-2010.09303..> | 2023-10-14 07:13 | 54K | |
| p5-Visio-1.010_2.pkg | 2023-10-08 22:11 | 19K | |
| p5-Vroom-0.42.pkg | 2023-10-08 12:54 | 19K | |
| p5-W3C-LinkChecker-4..> | 2023-10-07 14:06 | 33K | |
| p5-W3C-LogValidator-..> | 2023-10-08 18:52 | 44K | |
| p5-WAP-wbxml-1.14_1.pkg | 2023-10-14 12:54 | 44K | |
| p5-WDDX-1.02_2.pkg | 2023-10-10 05:39 | 32K | |
| p5-WWW-2ch-0.07_2.pkg | 2023-10-09 12:22 | 16K | |
| p5-WWW-AtMovies-TV-0..> | 2023-10-09 12:06 | 4.1K | |
| p5-WWW-Babelfish-0.1..> | 2023-10-09 23:57 | 8.9K | |
| p5-WWW-Baseball-NPB-..> | 2023-10-14 11:23 | 5.4K | |
| p5-WWW-BitTorrent-0...> | 2023-10-09 03:46 | 5.6K | |
| p5-WWW-Comic-1.06_2.pkg | 2023-10-09 17:06 | 30K | |
| p5-WWW-Contact-0.51.pkg | 2023-10-14 10:36 | 43K | |
| p5-WWW-Curl-4.17_5.pkg | 2023-10-08 08:02 | 42K | |
| p5-WWW-DHL-0.03_2.pkg | 2023-10-10 00:33 | 4.1K | |
| p5-WWW-Dilbert-1.19_..> | 2023-10-07 10:10 | 5.6K | |
| p5-WWW-Facebook-API-..> | 2023-10-08 18:30 | 110K | |
| p5-WWW-Form-UrlEncod..> | 2023-10-05 16:55 | 9.2K | |
| p5-WWW-FreeProxy-0.0..> | 2023-10-09 20:22 | 8.8K | |
| p5-WWW-GMail-0.07_1.pkg | 2023-10-09 14:35 | 8.9K | |
| p5-WWW-GitHub-Gist-0..> | 2023-10-09 09:12 | 7.0K | |
| p5-WWW-Google-Calcul..> | 2023-10-12 08:41 | 3.6K | |
| p5-WWW-Google-News-0..> | 2023-10-09 22:34 | 7.7K | |
| p5-WWW-Google-News-T..> | 2023-10-09 23:46 | 6.2K | |
| p5-WWW-Google-PageRa..> | 2023-10-10 09:15 | 5.5K | |
| p5-WWW-HatenaDiary-0..> | 2023-10-14 04:11 | 7.4K | |
| p5-WWW-HatenaLogin-0..> | 2023-10-07 23:49 | 5.5K | |
| p5-WWW-HatenaStar-0...> | 2023-10-09 03:13 | 4.1K | |
| p5-WWW-Hotmail-0.10_..> | 2023-10-08 16:23 | 7.5K | |
| p5-WWW-IMDb-0.01_2.pkg | 2023-10-10 04:01 | 8.2K | |
| p5-WWW-Instapaper-Cl..> | 2023-10-10 13:23 | 6.8K | |
| p5-WWW-LongURL-0.05_..> | 2023-10-08 14:57 | 4.1K | |
| p5-WWW-Mechanize-2.1..> | 2023-10-05 17:04 | 89K | |
| p5-WWW-Mechanize-CGI..> | 2023-10-08 00:27 | 4.2K | |
| p5-WWW-Mechanize-Dec..> | 2023-10-09 21:34 | 3.4K | |
| p5-WWW-Mechanize-For..> | 2023-10-07 10:38 | 31K | |
| p5-WWW-Mechanize-GZi..> | 2023-10-07 20:55 | 3.9K | |
| p5-WWW-Mechanize-Met..> | 2023-10-10 00:30 | 4.1K | |
| p5-WWW-Mechanize-Plu..> | 2023-10-07 19:36 | 24K | |
| p5-WWW-Mechanize-Plu..> | 2023-10-10 13:57 | 6.5K | |
| p5-WWW-Mechanize-She..> | 2023-10-14 16:37 | 26K | |
| p5-WWW-Mechanize-Spa..> | 2023-10-10 10:39 | 4.5K | |
| p5-WWW-Mechanize-Tre..> | 2023-10-07 10:31 | 5.5K | |
| p5-WWW-Mediawiki-Cli..> | 2023-10-09 19:08 | 37K | |
| p5-WWW-Mixi-0.50_1.pkg | 2023-10-10 18:20 | 73K | |
| p5-WWW-Mixi-Scraper-..> | 2023-10-08 21:38 | 46K | |
| p5-WWW-Myspace-0.92_..> | 2023-10-09 13:19 | 142K | |
| p5-WWW-NicoVideo-Dow..> | 2023-10-08 13:47 | 4.8K | |
| p5-WWW-NioTV-0.04_2.pkg | 2023-10-10 21:38 | 4.3K | |
| p5-WWW-OAuth-1.000_1..> | 2023-10-06 23:17 | 23K | |
| p5-WWW-OpenSVN-0.1.3..> | 2023-10-14 18:54 | 4.9K | |
| p5-WWW-OpenSearch-0...> | 2023-10-10 11:26 | 20K | |
| p5-WWW-Pastebin-Past..> | 2023-10-06 15:25 | 12K | |
| p5-WWW-Plurk-0.02_3.pkg | 2023-10-08 12:54 | 20K | |
| p5-WWW-Robot-0.026_1..> | 2023-10-14 05:03 | 21K | |
| p5-WWW-RobotRules-6...> | 2023-10-05 16:53 | 10K | |
| p5-WWW-RobotRules-Pa..> | 2023-10-07 04:40 | 4.3K | |
| p5-WWW-Salesforce-0...> | 2023-10-09 15:15 | 24K | |
| p5-WWW-Scraper-ISBN-..> | 2023-10-08 10:49 | 15K | |
| p5-WWW-Scraper-ISBN-..> | 2023-10-09 20:25 | 11K | |
| p5-WWW-Scraper-ISBN-..> | 2023-10-14 13:35 | 5.3K | |
| p5-WWW-Scripter-0.03..> | 2023-10-07 09:39 | 39K | |
| p5-WWW-Scripter-Plug..> | 2023-10-09 00:57 | 12K | |
| p5-WWW-Scripter-Plug..> | 2023-10-07 23:57 | 15K | |
| p5-WWW-Search-2.519.pkg | 2023-10-08 01:03 | 84K | |
| p5-WWW-Search-AltaVi..> | 2023-10-09 02:17 | 37K | |
| p5-WWW-Search-Google..> | 2023-10-08 14:01 | 2.7K | |
| p5-WWW-Search-MSN-0...> | 2023-10-09 00:29 | 4.5K | |
| p5-WWW-Shorten-0rz-0..> | 2023-10-10 02:38 | 3.8K | |
| p5-WWW-Shorten-3.094..> | 2023-10-07 10:00 | 29K | |
| p5-WWW-Shorten-Bitly..> | 2023-10-08 07:21 | 13K | |
| p5-WWW-Shorten-Googl..> | 2023-10-09 20:29 | 4.9K | |
| p5-WWW-Shorten-Yourl..> | 2023-10-14 12:58 | 8.8K | |
| p5-WWW-SourceForge-0..> | 2023-10-14 04:05 | 15K | |
| p5-WWW-Spinn3r-3.007..> | 2023-10-10 17:42 | 12K | |
| p5-WWW-TV-0.14_1.pkg | 2023-10-09 00:55 | 14K | |
| p5-WWW-TWSMS-0.01_1.pkg | 2023-10-14 15:55 | 6.0K | |
| p5-WWW-Telegram-BotA..> | 2023-10-14 11:34 | 14K | |
| p5-WWW-TinySong-1.01..> | 2023-10-10 13:10 | 10K | |
| p5-WWW-Tumblr-5.00_1..> | 2023-10-10 05:24 | 17K | |
| p5-WWW-VenusEnvy-1.1..> | 2023-10-08 09:39 | 5.8K | |
| p5-WWW-WebArchive-0...> | 2023-10-08 13:17 | 9.9K | |
| p5-WWW-Wikipedia-2.0..> | 2023-10-10 00:26 | 12K | |
| p5-WWW-Wordnik-API-0..> | 2023-10-10 13:58 | 11K | |
| p5-WWW-Yandex-TIC-0...> | 2023-10-14 06:25 | 4.7K | |
| p5-WWW-iTunesConnect..> | 2023-10-10 11:09 | 11K | |
| p5-Want-0.29_1.pkg | 2023-10-06 16:34 | 21K | |
| p5-WeakRef-0.01_1.pkg | 2023-10-14 14:14 | 5.8K | |
| p5-Weather-Undergrou..> | 2023-10-10 10:05 | 9.8K | |
| p5-Web-Machine-0.17.pkg | 2023-10-07 00:40 | 45K | |
| p5-Web-Query-1.00.pkg | 2023-10-09 19:54 | 18K | |
| p5-Web-Scraper-0.38.pkg | 2023-10-06 17:33 | 16K | |
| p5-Web-Scraper-Confi..> | 2023-10-07 01:55 | 4.7K | |
| p5-Web-Simple-0.033.pkg | 2023-10-10 04:50 | 52K | |
| p5-Web-oEmbed-0.04_1..> | 2023-10-11 00:38 | 7.0K | |
| p5-WebDAO-2.25.pkg | 2023-10-10 05:13 | 72K | |
| p5-WebDriver-Tiny-0...> | 2023-10-08 21:41 | 15K | |
| p5-WebService-Baseca..> | 2023-10-09 09:38 | 18K | |
| p5-WebService-Blogli..> | 2023-10-07 13:10 | 6.5K | |
| p5-WebService-Buzzur..> | 2023-10-09 13:30 | 12K | |
| p5-WebService-CIA-1...> | 2023-10-14 05:15 | 24K | |
| p5-WebService-Dropbo..> | 2023-10-07 21:51 | 19K | |
| p5-WebService-GData-..> | 2023-10-10 23:40 | 165K | |
| p5-WebService-Google..> | 2023-10-08 20:14 | 20K | |
| p5-WebService-Google..> | 2023-10-14 06:04 | 4.7K | |
| p5-WebService-IMDB-0..> | 2023-10-09 06:25 | 46K | |
| p5-WebService-ISBNDB..> | 2023-10-10 15:20 | 87K | |
| p5-WebService-Linode..> | 2023-10-14 04:39 | 27K | |
| p5-WebService-MovieP..> | 2023-10-10 09:41 | 8.4K | |
| p5-WebService-MusicB..> | 2023-10-07 11:46 | 8.3K | |
| p5-WebService-NoPast..> | 2023-10-08 15:10 | 4.7K | |
| p5-WebService-Prowl-..> | 2023-10-08 21:05 | 11K | |
| p5-WebService-Pushov..> | 2023-10-14 11:49 | 9.2K | |
| p5-WebService-Rakute..> | 2023-10-09 01:23 | 11K | |
| p5-WebService-Redmin..> | 2023-10-12 02:07 | 9.9K | |
| p5-WebService-Simple..> | 2023-10-07 12:42 | 23K | |
| p5-WebService-Techno..> | 2023-10-09 21:37 | 28K | |
| p5-WebService-Valida..> | 2023-10-07 10:50 | 8.6K | |
| p5-WebService-Valida..> | 2023-10-07 10:59 | 13K | |
| p5-WebService-YouTub..> | 2023-10-10 01:41 | 20K | |
| p5-What-1.01_2.pkg | 2023-10-07 19:59 | 9.1K | |
| p5-Woothee-1.10.0.pkg | 2023-10-08 21:46 | 27K | |
| p5-WordNet-QueryData..> | 2023-10-08 07:47 | 16K | |
| p5-WordNet-Similarit..> | 2023-10-08 16:27 | 4.3M | |
| p5-WordPress-XMLRPC-..> | 2023-10-10 17:22 | 18K | |
| p5-Workflow-1.62.pkg | 2023-10-07 11:50 | 184K | |
| p5-X-Tiny-0.22.pkg | 2023-10-07 03:29 | 12K | |
| p5-X11-GUITest-0.28_..> | 2023-10-09 10:41 | 34K | |
| p5-X11-IdleTime-0.09..> | 2023-10-10 12:43 | 5.2K | |
| p5-X11-Protocol-0.56..> | 2023-10-07 02:59 | 84K | |
| p5-X11-Protocol-Othe..> | 2023-10-08 09:49 | 183K | |
| p5-X11-Resolution-0...> | 2023-10-11 04:07 | 4.1K | |
| p5-X11-XCB-0.16_2.pkg | 2023-10-09 18:44 | 81K | |
| p5-X11-Xlib-0.18_2.pkg | 2023-10-09 14:45 | 172K | |
| p5-X500-DN-0.29_1.pkg | 2023-10-08 10:57 | 7.6K | |
| p5-XML-ApacheFOP-0.0..> | 2023-10-12 04:41 | 9.1K | |
| p5-XML-Atom-0.43.pkg | 2023-10-07 04:11 | 37K | |
| p5-XML-Atom-Ext-Open..> | 2023-10-09 11:59 | 5.6K | |
| p5-XML-Atom-Filter-0..> | 2023-10-09 23:59 | 4.5K | |
| p5-XML-Atom-SimpleFe..> | 2023-10-07 00:20 | 14K | |
| p5-XML-Atom-Stream-0..> | 2023-10-14 07:34 | 5.9K | |
| p5-XML-Atom-Syndicat..> | 2023-10-14 16:05 | 46K | |
| p5-XML-AutoWriter-0...> | 2023-10-06 17:14 | 39K | |
| p5-XML-Bare-0.53_2.pkg | 2023-10-07 20:55 | 33K | |
| p5-XML-Canonical-0.1..> | 2023-10-09 22:43 | 6.6K | |
| p5-XML-CanonicalizeX..> | 2023-10-08 05:37 | 7.8K | |
| p5-XML-Catalog-1.0.3..> | 2023-10-07 03:40 | 6.9K | |
| p5-XML-Clean-1.06_1.pkg | 2023-10-08 13:14 | 5.5K | |
| p5-XML-Code-0.4_1.pkg | 2023-10-09 16:19 | 7.7K | |
| p5-XML-CommonNS-0.06..> | 2023-10-06 20:57 | 5.4K | |
| p5-XML-Compile-1.63.pkg | 2023-10-06 16:50 | 196K | |
| p5-XML-Compile-Cache..> | 2023-10-06 22:45 | 18K | |
| p5-XML-Compile-Dumpe..> | 2023-10-14 04:12 | 7.1K | |
| p5-XML-Compile-SOAP-..> | 2023-10-07 01:24 | 124K | |
| p5-XML-Compile-SOAP-..> | 2023-10-10 12:28 | 9.1K | |
| p5-XML-Compile-SOAP-..> | 2023-10-08 21:30 | 45K | |
| p5-XML-Compile-SOAP-..> | 2023-10-10 17:26 | 14K | |
| p5-XML-Compile-Teste..> | 2023-10-07 01:59 | 7.5K | |
| p5-XML-Compile-WSDL1..> | 2023-10-07 13:32 | 23K | |
| p5-XML-DBMS-1.03_1.pkg | 2023-10-10 13:40 | 20K | |
| p5-XML-DOM-1.46.pkg | 2023-10-05 17:01 | 98K | |
| p5-XML-DOM-Lite-0.16..> | 2023-10-07 21:04 | 31K | |
| p5-XML-DOM-XPath-0.1..> | 2023-10-05 17:11 | 5.6K | |
| p5-XML-DOM2-0.06_2.pkg | 2023-10-11 20:29 | 43K | |
| p5-XML-DOMHandler-1...> | 2023-10-08 21:14 | 5.8K | |
| p5-XML-DT-0.69.pkg | 2023-10-14 11:53 | 24K | |
| p5-XML-DTDParser-2.0..> | 2023-10-08 01:05 | 7.9K | |
| p5-XML-Declare-0.06_..> | 2023-10-08 18:20 | 5.0K | |
| p5-XML-Descent-1.04_..> | 2023-10-07 06:34 | 12K | |
| p5-XML-DifferenceMar..> | 2023-10-09 04:27 | 26K | |
| p5-XML-Directory-1.0..> | 2023-10-14 11:06 | 12K | |
| p5-XML-DoubleEncoded..> | 2023-10-06 21:53 | 4.8K | |
| p5-XML-Driver-HTML-0..> | 2023-10-10 01:53 | 7.3K | |
| p5-XML-Dumper-0.81_1..> | 2023-10-07 22:15 | 13K | |
| p5-XML-Elemental-2.1..> | 2023-10-07 01:15 | 22K | |
| p5-XML-Enc-0.13.pkg | 2023-10-07 23:27 | 9.1K | |
| p5-XML-Encoding-2.11..> | 2023-10-08 03:10 | 14K | |
| p5-XML-Entities-1.00..> | 2023-10-07 16:07 | 22K | |
| p5-XML-FOAF-0.04_2.pkg | 2023-10-07 18:47 | 8.6K | |
| p5-XML-Fast-0.17.pkg | 2023-10-09 13:59 | 24K | |
| p5-XML-Feed-0.63.pkg | 2023-10-07 23:24 | 23K | |
| p5-XML-Feed-Deduper-..> | 2023-10-14 09:32 | 4.5K | |
| p5-XML-FeedPP-0.95.pkg | 2023-10-07 06:43 | 20K | |
| p5-XML-Filter-Buffer..> | 2023-10-05 17:03 | 3.9K | |
| p5-XML-Filter-DOMFil..> | 2023-10-09 16:02 | 6.6K | |
| p5-XML-Filter-Detect..> | 2023-10-08 03:18 | 8.5K | |
| p5-XML-Filter-Generi..> | 2023-10-09 07:50 | 11K | |
| p5-XML-Filter-Reinde..> | 2023-10-10 05:14 | 6.5K | |
| p5-XML-Filter-SAX1to..> | 2023-10-08 13:54 | 5.2K | |
| p5-XML-Filter-SAXT-0..> | 2023-10-07 00:33 | 4.7K | |
| p5-XML-Filter-XInclu..> | 2023-10-07 10:16 | 4.6K | |
| p5-XML-Filter-XSLT-0..> | 2023-10-08 00:07 | 4.5K | |
| p5-XML-Flow-0.86_1.pkg | 2023-10-07 12:48 | 7.9K | |
| p5-XML-GDOME-0.86_5.pkg | 2023-10-07 22:08 | 93K | |
| p5-XML-Generator-1.1..> | 2023-10-07 19:43 | 29K | |
| p5-XML-Generator-DBI..> | 2023-10-08 16:04 | 10K | |
| p5-XML-Generator-Per..> | 2023-10-10 18:59 | 18K | |
| p5-XML-Grove-0.46.a_..> | 2023-10-10 17:09 | 42K | |
| p5-XML-Handler-AxPoi..> | 2023-10-14 04:12 | 24K | |
| p5-XML-Handler-Dtd2D..> | 2023-10-10 18:01 | 14K | |
| p5-XML-Handler-Dtd2H..> | 2023-10-08 05:32 | 21K | |
| p5-XML-Handler-HTMLW..> | 2023-10-10 19:56 | 8.9K | |
| p5-XML-Handler-Trees..> | 2023-10-07 17:47 | 11K | |
| p5-XML-Handler-YAWri..> | 2023-10-07 15:03 | 12K | |
| p5-XML-Hash-LX-0.07,..> | 2023-10-07 17:35 | 9.3K | |
| p5-XML-LibXML-2.0209..> | 2023-10-05 17:05 | 292K | |
| p5-XML-LibXML-Cache-..> | 2023-10-08 19:12 | 8.2K | |
| p5-XML-LibXML-Iterat..> | 2023-10-07 12:09 | 15K | |
| p5-XML-LibXML-Pretty..> | 2023-10-10 00:28 | 14K | |
| p5-XML-LibXML-SAX-Ch..> | 2023-10-07 05:16 | 3.9K | |
| p5-XML-LibXML-Simple..> | 2023-10-05 17:07 | 20K | |
| p5-XML-LibXSLT-2.002..> | 2023-10-07 03:54 | 38K | |
| p5-XML-Liberal-0.32.pkg | 2023-10-07 03:35 | 13K | |
| p5-XML-Literal-0.02_..> | 2023-10-09 12:22 | 4.5K | |
| p5-XML-Mini-1.38_1.pkg | 2023-10-10 06:03 | 51K | |
| p5-XML-MyXML-1.08_1,..> | 2023-10-07 19:55 | 19K | |
| p5-XML-Namespace-0.0..> | 2023-10-06 19:51 | 6.5K | |
| p5-XML-NamespaceFact..> | 2023-10-06 15:55 | 4.0K | |
| p5-XML-NamespaceSupp..> | 2023-10-05 16:51 | 9.9K | |
| p5-XML-Node-0.11_1.pkg | 2023-10-08 12:14 | 6.7K | |
| p5-XML-NodeFilter-0...> | 2023-10-07 00:50 | 11K | |
| p5-XML-OPML-0.26_1.pkg | 2023-10-08 10:56 | 11K | |
| p5-XML-OPML-LibXML-0..> | 2023-10-09 02:17 | 4.3K | |
| p5-XML-Parsepp-0.08.pkg | 2023-10-12 12:34 | 13K | |
| p5-XML-Parser-2.46.pkg | 2023-10-05 16:47 | 141K | |
| p5-XML-Parser-EasyTr..> | 2023-10-08 20:21 | 5.7K | |
| p5-XML-Parser-Lite-0..> | 2023-10-06 16:44 | 7.7K | |
| p5-XML-Parser-Lite-T..> | 2023-10-06 15:14 | 11K | |
| p5-XML-Parser-Style-..> | 2023-10-08 05:11 | 8.4K | |
| p5-XML-Parser-Style-..> | 2023-10-10 13:52 | 7.2K | |
| p5-XML-Pastor-1.0.4_..> | 2023-10-10 01:48 | 172K | |
| p5-XML-Quote-1.02_1.pkg | 2023-10-08 17:16 | 8.4K | |
| p5-XML-RAI-1.3031,2.pkg | 2023-10-09 23:37 | 22K | |
| p5-XML-RPC-1.1.pkg | 2023-10-14 14:10 | 6.6K | |
| p5-XML-RPC-Fast-0.8_..> | 2023-10-14 15:06 | 27K | |
| p5-XML-RSS-1.62.pkg | 2023-10-07 08:47 | 45K | |
| p5-XML-RSS-Feed-2.40..> | 2023-10-07 15:10 | 25K | |
| p5-XML-RSS-JavaScrip..> | 2023-10-10 10:13 | 5.8K | |
| p5-XML-RSS-LibXML-0...> | 2023-10-07 06:30 | 26K | |
| p5-XML-RSS-Liberal-0..> | 2023-10-07 16:10 | 3.5K | |
| p5-XML-RSS-Parser-4...> | 2023-10-08 04:04 | 23K | |
| p5-XML-RSS-SimpleGen..> | 2023-10-07 19:29 | 35K | |
| p5-XML-RSSLite-0.17.pkg | 2023-10-08 12:41 | 8.2K | |
| p5-XML-Reader-0.67.pkg | 2023-10-09 14:59 | 96K | |
| p5-XML-RegExp-0.04_1..> | 2023-10-05 16:58 | 4.2K | |
| p5-XML-Rewrite-0.10_..> | 2023-10-09 06:42 | 23K | |
| p5-XML-Rules-1.16_2.pkg | 2023-10-14 10:59 | 42K | |
| p5-XML-SAX-1.02.pkg | 2023-10-05 16:53 | 43K | |
| p5-XML-SAX-Base-1.09..> | 2023-10-05 16:52 | 22K | |
| p5-XML-SAX-Expat-0.5..> | 2023-10-05 16:54 | 6.7K | |
| p5-XML-SAX-Expat-Inc..> | 2023-10-11 12:57 | 5.5K | |
| p5-XML-SAX-ExpatXS-1..> | 2023-10-10 16:58 | 107K | |
| p5-XML-SAX-Machines-..> | 2023-10-07 13:00 | 68K | |
| p5-XML-SAX-Simple-0...> | 2023-10-09 01:16 | 3.2K | |
| p5-XML-SAX-Writer-0...> | 2023-10-06 14:12 | 16K | |
| p5-XML-SAXDriver-CSV..> | 2023-10-09 13:16 | 5.6K | |
| p5-XML-SAXDriver-Exc..> | 2023-10-10 13:50 | 5.9K | |
| p5-XML-STX-0.43_2.pkg | 2023-10-10 03:14 | 52K | |
| p5-XML-Schematron-1...> | 2023-10-09 17:20 | 14K | |
| p5-XML-SemanticDiff-..> | 2023-10-07 19:58 | 17K | |
| p5-XML-Sig-0.64.pkg | 2023-10-08 10:53 | 20K | |
| p5-XML-Simple-2.25.pkg | 2023-10-05 16:57 | 61K | |
| p5-XML-SimpleObject-..> | 2023-10-07 04:28 | 6.6K | |
| p5-XML-SimpleObject-..> | 2023-10-10 12:33 | 9.8K | |
| p5-XML-Smart-1.79_1.pkg | 2023-10-09 07:42 | 69K | |
| p5-XML-Stream-1.24.pkg | 2023-10-06 21:53 | 51K | |
| p5-XML-Tiny-2.07.pkg | 2023-10-08 08:33 | 12K | |
| p5-XML-TinyXML-0.34_..> | 2023-10-10 08:44 | 57K | |
| p5-XML-TokeParser-0...> | 2023-10-06 19:32 | 12K | |
| p5-XML-Toolkit-0.15_..> | 2023-10-10 20:20 | 44K | |
| p5-XML-TreeBuilder-5..> | 2023-10-08 11:52 | 12K | |
| p5-XML-TreePP-0.43.pkg | 2023-10-06 19:28 | 16K | |
| p5-XML-Twig-3.52.pkg | 2023-10-06 14:15 | 175K | |
| p5-XML-Validate-1.02..> | 2023-10-08 22:08 | 23K | |
| p5-XML-Validator-Sch..> | 2023-10-07 18:45 | 44K | |
| p5-XML-WBXML-0.09_2.pkg | 2023-10-09 01:26 | 7.4K | |
| p5-XML-Writer-0.900.pkg | 2023-10-06 15:06 | 18K | |
| p5-XML-XBEL-1.4_1.pkg | 2023-10-12 05:07 | 31K | |
| p5-XML-XML2JSON-0.06..> | 2023-10-08 03:02 | 9.5K | |
| p5-XML-XPath-1.48.pkg | 2023-10-05 17:02 | 62K | |
| p5-XML-XPathEngine-0..> | 2023-10-05 16:58 | 29K | |
| p5-XML-XQL-0.68_1.pkg | 2023-10-09 02:20 | 86K | |
| p5-XML-XSLT-0.48_1.pkg | 2023-10-09 23:33 | 28K | |
| p5-XML-XUpdate-LibXM..> | 2023-10-09 02:21 | 14K | |
| p5-XMLRPC-Lite-0.717..> | 2023-10-07 18:44 | 20K | |
| p5-XPC-0.2_2.pkg | 2023-10-09 06:16 | 24K | |
| p5-XS-Object-Magic-0..> | 2023-10-07 16:17 | 12K | |
| p5-XS-Parse-Keyword-..> | 2023-10-05 17:00 | 53K | |
| p5-XS-Parse-Sublike-..> | 2023-10-05 17:05 | 37K | |
| p5-XSLoader-0.24.pkg | 2023-10-08 17:53 | 9.0K | |
| p5-XString-0.005.pkg | 2023-10-05 16:49 | 5.7K | |
| p5-XTerm-Conf-0.10.pkg | 2023-10-09 16:12 | 12K | |
| p5-XXX-0.38.pkg | 2023-10-06 16:27 | 6.9K | |
| p5-Xapian-1.4.23.0.pkg | 2023-10-07 17:15 | 575K | |
| p5-Xporter-0.1.2_2.pkg | 2023-10-07 19:11 | 7.7K | |
| p5-Xymon-0.01_1.pkg | 2023-10-14 16:41 | 3.3K | |
| p5-Xymon-Client-0.08..> | 2023-10-14 05:34 | 3.7K | |
| p5-Xymon-Server-0.02..> | 2023-10-10 04:05 | 3.3K | |
| p5-YAML-1.30.pkg | 2023-10-05 17:10 | 54K | |
| p5-YAML-AppConfig-0...> | 2023-10-09 03:59 | 12K | |
| p5-YAML-LibYAML-0.88..> | 2023-10-05 17:00 | 62K | |
| p5-YAML-PP-0.034.pkg | 2023-10-06 13:54 | 97K | |
| p5-YAML-Shell-0.71.pkg | 2023-10-14 07:15 | 8.7K | |
| p5-YAML-Syck-1.34.pkg | 2023-10-06 16:38 | 63K | |
| p5-YAML-Tiny-1.73.pkg | 2023-10-05 16:47 | 20K | |
| p5-YAML-Tiny-Color-0..> | 2023-10-07 15:17 | 5.8K | |
| p5-YAPE-HTML-1.11_1.pkg | 2023-10-08 15:53 | 22K | |
| p5-YAPE-Regex-4.00_1..> | 2023-10-07 20:16 | 20K | |
| p5-YAPE-Regex-Explai..> | 2023-10-10 20:37 | 7.8K | |
| p5-Yada-Yada-Yada-1...> | 2023-10-14 05:16 | 3.3K | |
| p5-Yahoo-BBAuth-0.50..> | 2023-10-09 09:23 | 7.6K | |
| p5-Yahoo-Search-1.11..> | 2023-10-09 04:51 | 59K | |
| p5-ZML-1.0.0_1.pkg | 2023-10-09 02:21 | 9.5K | |
| p5-ZMQ-FFI-1.17.pkg | 2023-10-08 12:10 | 40K | |
| p5-Zen-Koans-0.05_1.pkg | 2023-10-08 13:27 | 40K | |
| p5-Zenoss-1.11_1.pkg | 2023-10-08 19:08 | 83K | |
| p5-accessors-1.01_1.pkg | 2023-10-07 11:48 | 18K | |
| p5-accessors-fast-0...> | 2023-10-09 21:16 | 6.5K | |
| p5-ack-3.7.0.pkg | 2023-10-09 22:23 | 60K | |
| p5-alias-module-0.00..> | 2023-10-07 02:29 | 3.6K | |
| p5-aliased-0.34.pkg | 2023-10-05 16:55 | 9.4K | |
| p5-arclog-3.04_3.pkg | 2023-10-08 17:47 | 22K | |
| p5-asa-1.03_1.pkg | 2023-10-06 17:10 | 6.8K | |
| p5-asterisk-perl-1.0..> | 2023-10-07 17:52 | 33K | |
| p5-autobox-2.84.pkg | 2023-10-06 16:17 | 23K | |
| p5-autobox-Core-1.33..> | 2023-10-06 23:03 | 29K | |
| p5-autobox-Transform..> | 2023-10-07 21:20 | 25K | |
| p5-autodie-2.29.pkg | 2023-10-10 16:58 | 63K | |
| p5-autovivification-..> | 2023-10-07 14:20 | 18K | |
| p5-bareword-filehand..> | 2023-10-05 16:53 | 6.0K | |
| p5-bignum-0.66.pkg | 2023-10-09 09:40 | 35K | |
| p5-boolean-0.46.pkg | 2023-10-06 15:09 | 6.1K | |
| p5-bsdconv-11.3.0.pkg | 2023-10-08 16:03 | 11K | |
| p5-capitalization-0...> | 2023-10-06 22:48 | 3.5K | |
| p5-carton-1.0.28_1.pkg | 2023-10-09 09:31 | 41K | |
| p5-chklinks-3.09_1.pkg | 2023-10-14 11:50 | 12K | |
| p5-common-sense-3.75..> | 2023-10-05 17:01 | 7.6K | |
| p5-constant-1.33.pkg | 2023-10-14 04:31 | 11K | |
| p5-constant-boolean-..> | 2023-10-14 05:14 | 3.7K | |
| p5-constant-def-0.01..> | 2023-10-07 21:18 | 5.7K | |
| p5-constant-defer-6.pkg | 2023-10-06 19:42 | 12K | |
| p5-constant-lexical-..> | 2023-10-06 16:35 | 8.7K | |
| p5-cpan-listchanges-..> | 2023-10-09 06:52 | 6.8K | |
| p5-curry-2.000001.pkg | 2023-10-06 17:16 | 3.9K | |
| p5-dTemplate-2.5_1.pkg | 2023-10-10 09:56 | 26K | |
| p5-dicewaregen-1.4.pkg | 2023-10-09 23:24 | 3.2K | |
| p5-docx2txt-1.4.pkg | 2023-10-14 10:03 | 9.7K | |
| p5-enum-1.110.pkg | 2023-10-08 11:19 | 8.2K | |
| p5-eperl-2.2.14_1.pkg | 2023-10-08 22:14 | 28K | |
| p5-ex-lib-0.90_1.pkg | 2023-10-07 03:47 | 2.6K | |
| p5-excel2csv-1.07.pkg | 2023-10-09 14:16 | 12K | |
| p5-experimental-0.03..> | 2023-10-07 08:05 | 11K | |
| p5-feedgnuplot-1.59.pkg | 2023-10-09 20:52 | 39K | |
| p5-forks-0.36_2.pkg | 2023-10-07 13:19 | 82K | |
| p5-github_creator-0...> | 2023-10-14 10:27 | 5.9K | |
| p5-goto-file-0.005.pkg | 2023-10-07 05:13 | 5.0K | |
| p5-iCal-Parser-1.21.pkg | 2023-10-10 06:04 | 10K | |
| p5-indirect-0.39.pkg | 2023-10-05 16:52 | 19K | |
| p5-interface-0.03_1.pkg | 2023-10-08 12:11 | 9.6K | |
| p5-ip2location-perl-..> | 2023-10-11 09:42 | 11K | |
| p5-jQuery-File-Uploa..> | 2023-10-14 07:25 | 27K | |
| p5-jmx4perl-1.11_4.pkg | 2023-10-08 16:01 | 290K | |
| p5-latest-0.03_2.pkg | 2023-10-14 18:11 | 4.0K | |
| p5-ldap2pf-20170424.pkg | 2023-10-09 03:46 | 10K | |
| p5-ldap2pw-20170922.pkg | 2023-10-09 04:32 | 11K | |
| p5-lexical-underscor..> | 2023-10-06 19:29 | 5.1K | |
| p5-lib-abs-0.92_1.pkg | 2023-10-06 21:45 | 5.1K | |
| p5-libalarm-1.0_2.pkg | 2023-10-11 22:53 | 17K | |
| p5-libapreq2-2.16.pkg | 2023-10-07 08:08 | 86K | |
| p5-libservlet-0.9.2_..> | 2023-10-09 12:19 | 119K | |
| p5-libsoldout-0.02_2..> | 2023-10-10 20:48 | 6.0K | |
| p5-libvorbis-0.05_6.pkg | 2023-10-09 10:57 | 13K | |
| p5-libwww-6.70.pkg | 2023-10-05 16:54 | 143K | |
| p5-libxml-0.08_1.pkg | 2023-10-05 16:57 | 62K | |
| p5-libxml-enno-1.02_..> | 2023-10-14 17:16 | 240K | |
| p5-local-lib-2.00002..> | 2023-10-05 17:04 | 52K | |
| p5-match-simple-0.01..> | 2023-10-07 05:21 | 14K | |
| p5-match-simple-XS-0..> | 2023-10-07 06:50 | 7.3K | |
| p5-mem-0.4.7.pkg | 2023-10-07 02:19 | 8.0K | |
| p5-ming-0.4.8.pkg | 2023-10-10 02:41 | 157K | |
| p5-mixin-0.08.pkg | 2023-10-08 01:05 | 11K | |
| p5-mocked-0.09_2.pkg | 2023-10-10 23:20 | 5.9K | |
| p5-multidimensional-..> | 2023-10-05 16:53 | 5.2K | |
| p5-mysql-genocide-0...> | 2023-10-14 17:18 | 9.4K | |
| p5-nagios-plugin-che..> | 2023-10-10 04:22 | 41K | |
| p5-namespace-autocle..> | 2023-10-05 16:52 | 7.5K | |
| p5-namespace-clean-0..> | 2023-10-05 16:50 | 11K | |
| p5-namespace-clean-x..> | 2023-10-08 21:12 | 11K | |
| p5-namespace-sweep-0..> | 2023-10-09 19:23 | 6.2K | |
| p5-openxpki-3.24.2.pkg | 2023-10-09 21:49 | 2.2M | |
| p5-openxpki-i18n-3.2..> | 2023-10-08 00:49 | 96K | |
| p5-orz-0.13_1.pkg | 2023-10-09 09:12 | 2.5K | |
| p5-pQuery-0.24.pkg | 2023-10-14 18:21 | 21K | |
| p5-parent-0.241.pkg | 2023-10-14 17:23 | 4.2K | |
| p5-perl-ldap-0.6800.pkg | 2023-10-06 19:14 | 300K | |
| p5-pip-1.19_1.pkg | 2023-10-14 03:33 | 15K | |
| p5-plog-0.10.pkg | 2023-10-09 10:30 | 9.9K | |
| p5-plutil-1.7.pkg | 2023-10-08 14:21 | 6.2K | |
| p5-pod2pdf-0.42_2.pkg | 2023-10-14 12:46 | 13K | |
| p5-podlators-5.01.pkg | 2023-10-08 06:09 | 68K | |
| p5-prefork-1.05.pkg | 2023-10-06 22:45 | 9.2K | |
| p5-qpsmtpd-0.93_3.pkg | 2023-10-11 00:38 | 214K | |
| p5-relative-0.04_1.pkg | 2023-10-09 13:54 | 6.3K | |
| p5-reslog-3.16_3.pkg | 2023-10-10 15:17 | 17K | |
| p5-routines-0.02.pkg | 2023-10-06 15:09 | 7.0K | |
| p5-sdf-2.001_2.pkg | 2023-10-09 15:01 | 488K | |
| p5-self-0.36.pkg | 2023-10-11 20:29 | 7.0K | |
| p5-self-init-0.01_1.pkg | 2023-10-10 07:17 | 4.5K | |
| p5-signatures-0.14.pkg | 2023-10-07 03:10 | 12K | |
| p5-srv2pf-20211010.pkg | 2023-10-10 00:41 | 7.9K | |
| p5-strictures-2.0000..> | 2023-10-05 16:55 | 13K | |
| p5-subatom-0.12.pkg | 2023-10-08 21:30 | 9.9K | |
| p5-subversion-1.14.2..> | 2023-10-06 16:04 | 1.0M | |
| p5-superclass-0.003.pkg | 2023-10-06 22:27 | 4.9K | |
| p5-syntax-0.004_1.pkg | 2023-10-06 16:33 | 4.5K | |
| p5-tagged-0.40_1.pkg | 2023-10-08 06:20 | 35K | |
| p5-threads-2.21.pkg | 2023-10-07 10:59 | 37K | |
| p5-threads-shared-1...> | 2023-10-08 09:06 | 26K | |
| p5-tokyotyrant-1.16_..> | 2023-10-08 00:47 | 22K | |
| p5-transdecoder-5.7...> | 2023-10-09 11:50 | 84K | |
| p5-true-1.0.2.pkg | 2023-10-07 23:59 | 10K | |
| p5-type1inst-0.6.1_6..> | 2023-10-08 03:48 | 21K | |
| p5-uni-perl-0.91_2.pkg | 2023-10-07 11:36 | 3.4K | |
| p5-utf8-all-0.024.pkg | 2023-10-07 21:42 | 8.6K | |
| p5-v6-0.047.pkg | 2023-10-09 17:10 | 62K | |
| p5-version-0.9929.pkg | 2023-10-07 15:22 | 44K | |
| p5-xmltv-0.5.70_1.pkg | 2023-10-07 01:38 | 596K | |
| p8-platform-2.1.0.1_..> | 2023-10-06 14:19 | 58K | |
| p11-kit-0.24.1_2.pkg | 2023-10-05 17:31 | 454K | |
| p910nd-0.97_1.pkg | 2023-10-10 20:52 | 8.7K | |
| pa-aspell-0.01.1_1,2..> | 2023-10-12 09:47 | 20K | |
| pa_IN-libreoffice-7...> | 2023-10-08 00:53 | 362K | |
| pacemaker2-2.1.5.pkg | 2023-10-10 06:15 | 2.9M | |
| pachi-1.0_8.pkg | 2023-10-14 07:26 | 2.5M | |
| packddir-0.0.6.pkg | 2023-10-10 10:55 | 7.5K | |
| packer-1.8.6_3.pkg | 2023-10-14 12:41 | 21M | |
| packetq-1.4.1_3.pkg | 2023-10-08 13:21 | 98K | |
| packit-1.8.1.pkg | 2023-10-14 08:03 | 27K | |
| packmol-18.169_1.pkg | 2023-10-14 06:55 | 77K | |
| packmule-1.1.pkg | 2023-10-09 01:22 | 10K | |
| packr-2.8.3_14.pkg | 2023-10-09 03:58 | 2.2M | |
| packter-agent-2.5_2.pkg | 2023-10-09 04:25 | 21K | |
| pacman-6.0.2.pkg | 2023-10-14 05:07 | 272K | |
| pacmanarena-0.15_4.pkg | 2023-10-08 13:47 | 9.0M | |
| pacparser-1.4.2.2023..> | 2023-10-11 02:11 | 457K | |
| pacpl-6.1.3_1.pkg | 2023-10-11 16:26 | 63K | |
| padauk-2.8_2.pkg | 2023-10-14 18:20 | 251K | |
| padring-g20210731.pkg | 2023-10-10 00:18 | 85K | |
| pads-1.2_6.pkg | 2023-10-14 05:42 | 95K | |
| padthv1-lv2-0.9.32.pkg | 2023-10-09 05:42 | 333K | |
| paexec-1.1.4.pkg | 2023-10-10 08:06 | 119K | |
| pageedit-qt5-1.9.20.pkg | 2023-10-14 11:37 | 2.2M | |
| pageedit-qt6-1.9.20.pkg | 2023-10-09 03:56 | 519K | |
| pagmo2-2.19.0_3.pkg | 2023-10-06 21:28 | 4.0M | |
| paicc-1.4.pkg | 2023-10-14 11:29 | 17K | |
| paje-1.97_12.pkg | 2023-10-07 17:18 | 287K | |
| pal-0.4.3_3.pkg | 2023-10-10 22:37 | 67K | |
| pal-astronomical-0.9..> | 2023-10-09 18:30 | 60K | |
| paladin-2.0.1_15.pkg | 2023-10-08 17:04 | 659K | |
| palapeli-23.08.1.pkg | 2023-10-07 09:37 | 2.2M | |
| palisade-1.11.6.pkg | 2023-10-09 20:42 | 1.5M | |
| palomino-20131231_10..> | 2023-10-14 17:35 | 63M | |
| palp-2.20.pkg | 2023-10-08 00:54 | 797K | |
| pam-modules-2.5.pkg | 2023-10-08 13:31 | 77K | |
| pam-pgsql-0.7.3.2_2.pkg | 2023-10-14 11:11 | 17K | |
| pam_fprint-20080330_..> | 2023-10-10 19:13 | 7.0K | |
| pam_google_authentic..> | 2023-10-08 13:45 | 36K | |
| pam_helper-1.2.pkg | 2023-10-07 09:40 | 3.3K | |
| pam_howdy-3.0.0.b.20..> | 2023-10-14 07:58 | 20K | |
| pam_jail-0.4.pkg | 2023-10-09 03:23 | 4.6K | |
| pam_kde-1.0.pkg | 2023-10-08 20:13 | 836 | |
| pam_krb5-4.11_1.pkg | 2023-10-09 23:54 | 37K | |
| pam_krb5-heimdal_bas..> | 2023-10-08 16:52 | 36K | |
| pam_krb5-heimdal_por..> | 2023-10-09 07:34 | 36K | |
| pam_krb5-rh-2.4.13.pkg | 2023-10-09 14:30 | 53K | |
| pam_ldap-186_1.pkg | 2023-10-08 23:58 | 28K | |
| pam_mkhomedir-0.2.pkg | 2023-10-07 02:39 | 6.2K | |
| pam_mysql-0.8.2.pkg | 2023-10-09 16:42 | 34K | |
| pam_ocra-1.6.pkg | 2023-10-08 22:16 | 21K | |
| pam_p11-0.5.0.pkg | 2023-10-09 18:08 | 13K | |
| pam_pkcs11-0.6.12.pkg | 2023-10-10 13:10 | 121K | |
| pam_pwdfile-1.0.pkg | 2023-10-09 15:11 | 7.7K | |
| pam_require-0.7.pkg | 2023-10-09 07:10 | 3.1K | |
| pam_rssh-1.1.0_2.pkg | 2023-10-10 15:17 | 224K | |
| pam_script-1.1.9.pkg | 2023-10-09 11:03 | 22K | |
| pam_search_list-0.1_..> | 2023-10-11 03:03 | 5.6K | |
| pam_ssh_agent_auth-0..> | 2023-10-10 11:25 | 106K | |
| pam_u2f-1.3.0.pkg | 2023-10-10 10:02 | 35K | |
| pam_wrapper-1.0.6_2.pkg | 2023-10-07 10:33 | 29K | |
| pam_xdg-0.8.1.pkg | 2023-10-09 15:02 | 6.8K | |
| pam_yubico-2.27.pkg | 2023-10-09 23:31 | 32K | |
| paman-0.9.4_13.pkg | 2023-10-09 02:43 | 56K | |
| pamixer-1.4.15_7.pkg | 2023-10-09 14:27 | 40K | |
| paml-4.10.7.pkg | 2023-10-08 20:49 | 3.5M | |
| pamtester-0.1.2.pkg | 2023-10-11 06:18 | 10K | |
| pan-0.145_2.pkg | 2023-10-10 20:33 | 950K | |
| pancho-9.3.9_1.pkg | 2023-10-14 12:22 | 24K | |
| panda-0.5.4_11.pkg | 2023-10-09 02:28 | 1.5M | |
| panda-cclient-201306..> | 2023-10-06 22:06 | 1.0M | |
| panda-imap-20130621_..> | 2023-10-14 12:09 | 517K | |
| pandora_agent-6.0.2.pkg | 2023-10-10 16:14 | 42K | |
| pandora_console-6.0...> | 2023-10-14 11:27 | 18M | |
| pandora_server-6.0.2..> | 2023-10-09 19:51 | 283K | |
| pango-1.50.14.pkg | 2023-10-05 17:55 | 2.0M | |
| pangolin-0.8.54_4.pkg | 2023-10-11 13:38 | 898K | |
| pangomm-2.40.1_6.pkg | 2023-10-06 16:12 | 110K | |
| pangox-compat-0.0.2_..> | 2023-10-06 21:32 | 52K | |
| pangzero-1.3_3.pkg | 2023-10-09 23:54 | 3.5M | |
| panicmail-1.1.pkg | 2023-10-14 14:34 | 3.5K | |
| panoglview-0.2.2_10.pkg | 2023-10-09 04:12 | 41K | |
| panomatic-0.9.4_13.pkg | 2023-10-07 18:37 | 405K | |
| pantomime-1.4.0.pkg | 2023-10-07 01:32 | 209K | |
| paperkey-1.6.pkg | 2023-10-09 06:45 | 25K | |
| papersize-default-a4..> | 2023-10-08 15:38 | 604 | |
| papersize-default-le..> | 2023-10-14 13:28 | 608 | |
| papilio-loader-2.8_2..> | 2023-10-09 22:38 | 33K | |
| papirus-icon-theme-2..> | 2023-10-14 13:49 | 24M | |
| paprefs-1.2_5.pkg | 2023-10-11 00:25 | 52K | |
| paps-0.7.1.pkg | 2023-10-11 10:17 | 15K | |
| paq-20140131_6.pkg | 2023-10-10 02:08 | 846K | |
| par2cmdline-0.8.1_2.pkg | 2023-10-08 06:12 | 96K | |
| par2cmdline-turbo-1...> | 2023-10-14 05:01 | 441K | |
| par_format-1.53.0.pkg | 2023-10-09 04:07 | 27K | |
| parafly-0.1.0_9,1.pkg | 2023-10-09 16:54 | 20K | |
| paraget-0.3.0_3.pkg | 2023-10-09 14:38 | 18K | |
| parallel-20230822.pkg | 2023-10-08 03:38 | 1.9M | |
| parallel-hashmap-1.3..> | 2023-10-10 12:19 | 92K | |
| parallels-tools-0.1...> | 2023-10-10 09:24 | 4.4K | |
| paratype-2.005_2.pkg | 2023-10-10 13:17 | 1.5M | |
| paraview-5.11.1_11.pkg | 2023-10-08 00:03 | 51M | |
| parcellite-1.2.1_1,1..> | 2023-10-08 20:36 | 244K | |
| parchive-1.1.pkg | 2023-10-09 08:39 | 26K | |
| paredit-mode.el-24_1..> | 2023-10-10 02:56 | 24K | |
| paredit-mode.el-emac..> | 2023-10-08 23:20 | 24K | |
| paredit-mode.el-emac..> | 2023-10-14 15:19 | 24K | |
| paredit-mode.el-emac..> | 2023-10-14 10:57 | 24K | |
| paredit-mode.el-emac..> | 2023-10-14 14:35 | 24K | |
| pari-2.15.4,2.pkg | 2023-10-06 22:22 | 5.1M | |
| pari-elldata-2021.03..> | 2023-10-07 21:11 | 45M | |
| pari-galdata-2008.04..> | 2023-10-07 14:59 | 37K | |
| pari-galpol-2018.06...> | 2023-10-07 15:09 | 8.2M | |
| pari-nflistdata-2022..> | 2023-10-08 21:29 | 3.3M | |
| pari-nftables-2008.0..> | 2023-10-08 03:53 | 5.7M | |
| pari-seadata-2009.06..> | 2023-10-08 09:23 | 17M | |
| parinfer-rust-0.4.3...> | 2023-10-09 03:07 | 424K | |
| paritwine-0.1_3.pkg | 2023-10-09 01:41 | 49K | |
| parkverbot-1.5.pkg | 2023-10-10 02:54 | 7.4K | |
| parley-23.08.1.pkg | 2023-10-07 04:35 | 7.3M | |
| parmgridgen-1.0_16.pkg | 2023-10-08 21:22 | 89K | |
| parol-g20221230_7.pkg | 2023-10-09 09:41 | 947K | |
| parol-ls-g20221230_7..> | 2023-10-09 15:09 | 1.1M | |
| parole-4.18.0_2.pkg | 2023-10-07 20:46 | 377K | |
| parpd-1.3.pkg | 2023-10-14 05:44 | 25K | |
| parrot-8.1.0_19.pkg | 2023-10-09 06:26 | 2.5M | |
| partio-1.14.6_2.pkg | 2023-10-14 16:27 | 366K | |
| pas2dox-0.50.r1.pkg | 2023-10-09 10:58 | 82K | |
| pasm-0.84.pkg | 2023-10-14 04:53 | 29K | |
| pass-otp-1.2.0.pkg | 2023-10-14 08:13 | 6.1K | |
| pass-secrets-s202302..> | 2023-10-09 12:58 | 103K | |
| pass-update-2.1.pkg | 2023-10-09 01:55 | 6.1K | |
| passage-4_7.pkg | 2023-10-10 04:11 | 48K | |
| passh-1.0.1.pkg | 2023-10-09 19:53 | 11K | |
| passivedns-1.2.1.25.pkg | 2023-10-14 13:15 | 20K | |
| password-store-1.7.4..> | 2023-10-08 09:13 | 38K | |
| passwordsafe-1.12.0_..> | 2023-10-09 17:41 | 10M | |
| pastebinit-1.5.1.pkg | 2023-10-09 15:12 | 7.6K | |
| pastel-0.9.0_8.pkg | 2023-10-09 13:19 | 3.3M | |
| pastix-6.3.0.pkg | 2023-10-10 08:21 | 596K | |
| patapizza-tetris-1.0..> | 2023-10-14 15:54 | 40K | |
| patch-2.7.6_2.pkg | 2023-10-06 18:10 | 99K | |
| patchage-1.0.10_1.pkg | 2023-10-14 11:39 | 189K | |
| patchelf-0.14.3.pkg | 2023-10-07 07:03 | 64K | |
| patchutils-0.4.2_1.pkg | 2023-10-07 00:39 | 70K | |
| pathalias-9.16.pkg | 2023-10-09 15:04 | 23K | |
| pathchirp-2.4.1_1.pkg | 2023-10-11 00:57 | 21K | |
| pathload-1.3.2.pkg | 2023-10-14 14:50 | 24K | |
| pathneck-1.3.pkg | 2023-10-14 03:23 | 20K | |
| pathological-1.1.3_1..> | 2023-10-10 01:38 | 5.3M | |
| pathrate-2.4.1.pkg | 2023-10-14 16:01 | 19K | |
| patsh-0.2.1_1.pkg | 2023-10-10 09:27 | 397K | |
| pauker-1.8.pkg | 2023-10-10 00:44 | 7.0M | |
| pavucontrol-5.0_4.pkg | 2023-10-07 21:44 | 148K | |
| pavucontrol-qt-1.2.0..> | 2023-10-09 17:38 | 131K | |
| pavuk-0.9.35_6.pkg | 2023-10-09 09:54 | 345K | |
| pavumeter-0.9.3_14.pkg | 2023-10-10 08:21 | 18K | |
| pax-utils-1.3.4.pkg | 2023-10-08 19:20 | 73K | |
| payara-5.2020.4.pkg | 2023-10-10 06:21 | 128M | |
| pbasic-2.1.pkg | 2023-10-14 17:44 | 65K | |
| pbbam-0.18.0_8.pkg | 2023-10-14 09:47 | 614K | |
| pbc-0.5.14_1.pkg | 2023-10-09 03:49 | 156K | |
| pbimaker-1.3_1.pkg | 2023-10-08 21:46 | 11K | |
| pbnc-1.0_1.pkg | 2023-10-09 00:12 | 4.0K | |
| pbseqan-g20171011.pkg | 2023-10-11 04:47 | 1.0M | |
| pbzip2-1.1.13.pkg | 2023-10-06 23:54 | 29K | |
| pc-mixer-20171212_4.pkg | 2023-10-10 06:25 | 79K | |
| pc-networkmanager-20..> | 2023-10-14 10:14 | 189K | |
| pcal-4.11.0.pkg | 2023-10-10 18:40 | 138K | |
| pcapfix-1.1.7.pkg | 2023-10-10 09:33 | 23K | |
| pcaudiolib-1.2_1.pkg | 2023-10-05 16:43 | 6.1K | |
| pcb-4.2.0_3,1.pkg | 2023-10-09 08:29 | 1.8M | |
| pcb-rnd-3.1.1.pkg | 2023-10-11 16:37 | 2.8M | |
| pcc-1.1.0_1.pkg | 2023-10-09 08:34 | 244K | |
| pcc-libs-1.1.0.pkg | 2023-10-08 06:21 | 18K | |
| pcdm-201710031254_4.pkg | 2023-10-10 02:53 | 8.9M | |
| pcemu-1.01b_6.pkg | 2023-10-10 08:48 | 280K | |
| pcf2bdf-1.07.pkg | 2023-10-07 22:32 | 12K | |
| pcg-cpp-0.98.1.59.pkg | 2023-10-10 22:47 | 21K | |
| pcgen-6.06.01_1.pkg | 2023-10-10 13:05 | 56M | |
| pchecker-1.26.pkg | 2023-10-09 16:59 | 7.4K | |
| pciids-20230810.pkg | 2023-10-05 16:39 | 237K | |
| pciutils-3.10.0.pkg | 2023-10-07 11:34 | 51K | |
| pcl-1.6_1.pkg | 2023-10-07 12:56 | 8.7K | |
| pcl-pointclouds-1.12..> | 2023-10-08 00:09 | 14M | |
| pcmanfm-1.3.2_1.pkg | 2023-10-08 05:11 | 263K | |
| pcmanfm-gtk3-1.3.2_1..> | 2023-10-14 08:27 | 263K | |
| pcmanfm-qt-1.3.0.pkg | 2023-10-08 10:23 | 409K | |
| pcmsolver-1.3.0_1.pkg | 2023-10-09 07:15 | 801K | |
| pcpustat-1.6.pkg | 2023-10-10 11:24 | 6.9K | |
| pcre++-0.9.5_5.pkg | 2023-10-14 11:48 | 71K | |
| pcre-8.45_3.pkg | 2023-10-05 16:44 | 1.2M | |
| pcre2-10.42.pkg | 2023-10-05 17:22 | 1.3M | |
| pcsc-cyberjack-3.99...> | 2023-10-09 13:27 | 168K | |
| pcsc-lite-2.0.0,2.pkg | 2023-10-06 21:37 | 98K | |
| pcsc-tools-1.6.2.pkg | 2023-10-10 01:25 | 134K | |
| pd-0.47.1_3.pkg | 2023-10-08 09:12 | 1.4M | |
| pd-cyclone-0.2.b3_1.pkg | 2023-10-11 00:04 | 569K | |
| pdal-2.5.4.pkg | 2023-10-07 07:20 | 1.9M | |
| pdcurses-3.5.pkg | 2023-10-09 03:32 | 113K | |
| pdf-renderer-0.9.1,1..> | 2023-10-09 11:44 | 1.6M | |
| pdf-tools-1.1.0_2.pkg | 2023-10-09 11:17 | 214K | |
| pdf-tools-emacs_cann..> | 2023-10-14 09:29 | 214K | |
| pdf-tools-emacs_deve..> | 2023-10-08 21:22 | 214K | |
| pdf2djvu-0.9.19.pkg | 2023-10-08 18:14 | 141K | |
| pdf2svg-0.2.3_49.pkg | 2023-10-10 10:10 | 4.3K | |
| pdf4tcl-0.8.pkg | 2023-10-10 21:53 | 71K | |
| pdfarranger-1.9.1_7.pkg | 2023-10-09 23:51 | 170K | |
| pdfbox-2.0.14_1.pkg | 2023-10-09 23:46 | 4.3M | |
| pdfchain-0.4.4.2_3.pkg | 2023-10-10 00:06 | 243K | |
| pdfcrack-0.16.pkg | 2023-10-14 08:55 | 27K | |
| pdfedit-0.4.5_17.pkg | 2023-10-09 08:41 | 3.4M | |
| pdfgrep-2.1.1_48.pkg | 2023-10-10 02:07 | 39K | |
| pdflib-7.0.5_6.pkg | 2023-10-06 21:22 | 3.5M | |
| pdflib-perl-7.0.5_6.pkg | 2023-10-07 01:55 | 3.7M | |
| pdfmixtool-qt5-1.1.1..> | 2023-10-14 15:05 | 244K | |
| pdfmixtool-qt6-1.1.1..> | 2023-10-08 17:38 | 259K | |
| pdfoutline-5.4_2.pkg | 2023-10-08 04:21 | 5.1K | |
| pdfpc-4.6.0_3.pkg | 2023-10-09 12:20 | 148K | |
| pdfresurrect-0.23.pkg | 2023-10-10 00:46 | 13K | |
| pdfsandwich-0.1.7_39..> | 2023-10-09 12:46 | 304K | |
| pdfstitch-0.6.pkg | 2023-10-09 18:37 | 3.6K | |
| pdftk-3.3.3.pkg | 2023-10-08 07:57 | 943K | |
| pdftohtml-0.40a_2.pkg | 2023-10-08 14:42 | 277K | |
| pdixtract-1.5_1.pkg | 2023-10-14 06:36 | 6.5K | |
| pdksh-5.2.14p2_6.pkg | 2023-10-07 22:31 | 158K | |
| pdmenu-1.3.6.pkg | 2023-10-14 06:05 | 28K | |
| pdnmesh-0.2.2_21.pkg | 2023-10-08 20:38 | 1.2M | |
| pdnsd-1.2.9a.pkg | 2023-10-10 05:24 | 180K | |
| pdsh-2.34_1.pkg | 2023-10-09 08:48 | 76K | |
| pdumpfs-1.3_5.pkg | 2023-10-08 13:31 | 55K | |
| peaclock-0.4.3_6.pkg | 2023-10-10 02:53 | 174K | |
| peak-classifier-0.1...> | 2023-10-08 07:16 | 13K | |
| pear-merger-0.9.6.pkg | 2023-10-08 09:13 | 41K | |
| peazip-gtk2-9.2.0.pkg | 2023-10-14 10:14 | 3.5M | |
| peazip-qt5-9.2.0.pkg | 2023-10-08 17:16 | 3.5M | |
| peco-0.5.11_3.pkg | 2023-10-09 02:29 | 956K | |
| peda-1.2.pkg | 2023-10-10 09:43 | 55K | |
| peek-1.5.1_2.pkg | 2023-10-10 20:09 | 133K | |
| pefs-kmod-g20230913,..> | 2023-10-09 04:26 | 73K | |
| peg-0.1.18.pkg | 2023-10-14 15:26 | 32K | |
| peg-e-1.3.2_1.pkg | 2023-10-10 01:45 | 233K | |
| pegtl-3.2.7.pkg | 2023-10-14 17:48 | 58K | |
| peksystray-0.4.0_2.pkg | 2023-10-09 08:22 | 7.1K | |
| pekwm-0.3.0_1,1.pkg | 2023-10-14 05:44 | 1.2M | |
| pen-0.34.1.pkg | 2023-10-10 03:47 | 73K | |
| pencil2d-0.6.6_3.pkg | 2023-10-08 13:27 | 1.5M | |
| pengpong-0.3_13.pkg | 2023-10-09 11:01 | 100K | |
| penguin-command-1.6...> | 2023-10-14 06:35 | 837K | |
| penguinsap-0.1.pkg | 2023-10-09 22:42 | 25K | |
| pengupop-2.2.6_3.pkg | 2023-10-08 13:13 | 1.5M | |
| peps-2.0_7.pkg | 2023-10-08 05:18 | 46K | |
| perceptualdiff-2.1_3..> | 2023-10-14 11:51 | 18K | |
| percona-pam-for-mysq..> | 2023-10-10 00:19 | 11K | |
| percona-toolkit-3.5...> | 2023-10-14 04:40 | 879K | |
| percona57-client-5.7..> | 2023-10-07 10:49 | 2.0M | |
| percona57-pam-for-my..> | 2023-10-11 00:09 | 11K | |
| percona57-server-5.7..> | 2023-10-08 23:48 | 15M | |
| perdition-2.2_1.pkg | 2023-10-09 13:41 | 92K | |
| performance-0.5.0_7.pkg | 2023-10-06 22:26 | 84K | |
| perftest-4.4.0.7_1.pkg | 2023-10-09 14:39 | 150K | |
| perkeep-0.11_14.pkg | 2023-10-09 13:42 | 17M | |
| perl2html-0.9.2_1.pkg | 2023-10-08 22:07 | 31K | |
| perl5-5.34.1_3.pkg | 2023-10-05 16:46 | 14M | |
| perl5-devel-5.39.0.6..> | 2023-10-11 10:51 | 14M | |
| perl5.32-5.32.1_4.pkg | 2023-10-09 01:22 | 14M | |
| perl5.36-5.36.1_1.pkg | 2023-10-10 04:26 | 15M | |
| perl5.38-5.38.0_1.pkg | 2023-10-10 12:05 | 14M | |
| perlconsole-0.4_2.pkg | 2023-10-09 19:56 | 8.2K | |
| perlinnoise-3.0.0.pkg | 2023-10-10 01:55 | 4.2K | |
| permlib-0.2.9_2.pkg | 2023-10-08 11:29 | 60K | |
| perp-2.07.pkg | 2023-10-08 19:27 | 143K | |
| persepolis-3.2.0_2.pkg | 2023-10-14 08:03 | 502K | |
| personality-1.0.pkg | 2023-10-11 21:21 | 6.1K | |
| peruse-1.80_2.pkg | 2023-10-09 09:10 | 562K | |
| perwindowlayoutd-0.6..> | 2023-10-14 18:12 | 7.1K | |
| pet-0.5.0_2.pkg | 2023-10-09 02:52 | 2.7M | |
| petanque-1.1.0.pkg | 2023-10-10 02:11 | 55K | |
| petiga-g20221208_3.pkg | 2023-10-14 14:29 | 387K | |
| pev-0.80_1.pkg | 2023-10-08 15:37 | 144K | |
| pfbtopfa-1.0_1.pkg | 2023-10-10 21:53 | 4.2K | |
| pfe-0.33.71_2.pkg | 2023-10-09 05:54 | 516K | |
| pfetch-0.6.0.pkg | 2023-10-08 23:42 | 14K | |
| pffft-g20210806.pkg | 2023-10-08 09:42 | 56K | |
| pflogsumm-1.1.5_1,1.pkg | 2023-10-14 14:56 | 36K | |
| pflogx-0.86.pkg | 2023-10-08 22:27 | 33K | |
| pfm-2.12.3_1.pkg | 2023-10-09 01:03 | 225K | |
| pfqueue-0.5.6_1.pkg | 2023-10-14 11:19 | 41K | |
| pfstat-2.5_7.pkg | 2023-10-09 00:34 | 26K | |
| pfstools-2.1.0_19.pkg | 2023-10-09 20:32 | 279K | |
| pftabled-1.09_2.pkg | 2023-10-10 09:24 | 13K | |
| pftables-0.1.1.pkg | 2023-10-10 14:03 | 1.8K | |
| pftop-0.8_4.pkg | 2023-10-14 06:10 | 69K | |
| pftpd-1.0.3_2.pkg | 2023-10-09 18:13 | 34K | |
| pg-gvm-22.4.0_2.pkg | 2023-10-06 23:34 | 6.6K | |
| pg.el-0.20_3.pkg | 2023-10-06 19:53 | 33K | |
| pg.el-emacs_canna-0...> | 2023-10-06 19:34 | 33K | |
| pg.el-emacs_devel-0...> | 2023-10-06 22:30 | 33K | |
| pg.el-emacs_devel_no..> | 2023-10-06 18:45 | 33K | |
| pg.el-emacs_nox-0.20..> | 2023-10-06 21:24 | 33K | |
| pgFormatter-5.5.pkg | 2023-10-08 21:52 | 63K | |
| pg_activity-3.4.1.pkg | 2023-10-14 07:40 | 442K | |
| pg_citus-12.0.0.pkg | 2023-10-10 02:03 | 746K | |
| pg_ed25519-0.2.pkg | 2023-10-10 03:12 | 47K | |
| pg_filedump-14.1.pkg | 2023-10-09 08:04 | 43K | |
| pg_hashids-1.3.pkg | 2023-10-10 06:47 | 8.8K | |
| pg_partman-4.6.0.pkg | 2023-10-14 07:58 | 171K | |
| pg_qualstats-2.1.0.pkg | 2023-10-08 06:23 | 24K | |
| pg_stat_kcache-2.2.1..> | 2023-10-07 16:59 | 14K | |
| pg_tileserv-1.0.9_10..> | 2023-10-14 12:06 | 3.8M | |
| pgaccess-1.00.201409..> | 2023-10-10 20:00 | 1.0M | |
| pgadmin3-1.22.2_8.pkg | 2023-10-10 10:32 | 4.8M | |
| pgagroal-1.4.2.pkg | 2023-10-14 05:57 | 109K | |
| pgbackrest-2.47.pkg | 2023-10-09 23:50 | 319K | |
| pgbadger-12.2.pkg | 2023-10-09 09:08 | 316K | |
| pgbarman-py39-3.8.0.pkg | 2023-10-14 05:09 | 1.5M | |
| pgbouncer-1.20.1.pkg | 2023-10-10 02:11 | 173K | |
| pgdbf-0.6.2.pkg | 2023-10-14 08:50 | 12K | |
| pget-0.2.1.pkg | 2023-10-14 02:29 | 2.1M | |
| pgfouine-1.2.pkg | 2023-10-09 11:11 | 399K | |
| pgloader3-3.6.3.pkg | 2023-10-14 06:31 | 15M | |
| pglogd-2.3_4.pkg | 2023-10-09 18:35 | 19K | |
| pglogical-2.4.3.pkg | 2023-10-09 22:15 | 121K | |
| pgmetrics-1.15.2_1.pkg | 2023-10-10 09:42 | 3.3M | |
| pgmodeler-1.0.5.pkg | 2023-10-14 13:40 | 4.1M | |
| pgpdump-0.35.pkg | 2023-10-10 09:39 | 17K | |
| pgpgpg-0.13_5.pkg | 2023-10-07 01:48 | 9.7K | |
| pgpin-010323_1.pkg | 2023-10-08 09:27 | 208K | |
| pgplot-5.2.2_30.pkg | 2023-10-06 20:21 | 365K | |
| pgpmoose-1.19_1.pkg | 2023-10-08 13:04 | 15K | |
| pgpool-II-43-4.3.7.pkg | 2023-10-11 08:05 | 1.3M | |
| pgpool-II-44-4.4.4.pkg | 2023-10-14 12:20 | 1.3M | |
| pgpool-II40-4.0.24.pkg | 2023-10-11 18:15 | 1.1M | |
| pgpool-II41-4.1.17.pkg | 2023-10-14 06:14 | 1.2M | |
| pgpool-II42-4.2.12.pkg | 2023-10-10 05:33 | 1.3M | |
| pgreplay-1.3.0_2.pkg | 2023-10-14 12:42 | 26K | |
| pgroonga-3.0.2.pkg | 2023-10-09 12:19 | 143K | |
| pgrouting-3.5.0_2.pkg | 2023-10-14 11:39 | 655K | |
| pgsphere-1.1.5_4.pkg | 2023-10-10 16:05 | 78K | |
| pgtcl-2.1.1_2.pkg | 2023-10-08 02:24 | 75K | |
| pgtcl-postgresql11-2..> | 2023-10-09 11:55 | 75K | |
| pgtcl-postgresql12-2..> | 2023-10-14 11:42 | 75K | |
| pgtcl-postgresql13-2..> | 2023-10-10 09:03 | 75K | |
| pgtcl-postgresql14-2..> | 2023-10-10 06:29 | 75K | |
| pgtcl-postgresql15-2..> | 2023-10-07 03:41 | 75K | |
| pgtcl-postgresql16-2..> | 2023-10-14 11:19 | 75K | |
| pgtop-0.11.pkg | 2023-10-09 12:54 | 24K | |
| pguri-1.20151224_2.pkg | 2023-10-08 18:34 | 6.9K | |
| pgxnclient-1.3.2_1.pkg | 2023-10-10 11:15 | 54K | |
| phabricator-php80-20..> | 2023-10-10 12:36 | 6.6M | |
| phabricator-php81-20..> | 2023-10-10 06:50 | 6.6M | |
| phabricator-php82-20..> | 2023-10-12 12:10 | 6.6M | |
| phabricator-php83-20..> | 2023-10-10 05:22 | 6.6M | |
| phalanx-25.pkg | 2023-10-14 14:28 | 292K | |
| pharo-1.4_3.pkg | 2023-10-08 15:19 | 8.7M | |
| phasar-1222.pkg | 2023-10-08 21:49 | 1.5M | |
| phd2-2.6.10_8.pkg | 2023-10-08 16:02 | 9.8M | |
| phex-3.4.2.116_1.pkg | 2023-10-09 15:51 | 7.5M | |
| phlipple-0.8.5_7.pkg | 2023-10-10 20:25 | 2.5M | |
| phluid-0.0.3_13.pkg | 2023-10-09 11:05 | 249K | |
| pho-1.0_1.pkg | 2023-10-09 09:02 | 30K | |
| phoc-0.31.0.pkg | 2023-10-10 18:45 | 125K | |
| phonon-designerplugi..> | 2023-10-10 12:36 | 15K | |
| phonon-gstreamer-qt5..> | 2023-10-07 00:21 | 114K | |
| phonon-qt5-4.11.1_3.pkg | 2023-10-06 12:52 | 248K | |
| phonon-vlc-0.11.3_2.pkg | 2023-10-09 18:47 | 78K | |
| phonopy-2.20.0.pkg | 2023-10-14 10:57 | 35K | |
| phoon_14Aug-2014.pkg | 2023-10-09 18:15 | 13K | |
| phoronix-test-suite-..> | 2023-10-09 11:21 | 2.5M | |
| phoronix-test-suite-..> | 2023-10-08 13:58 | 2.5M | |
| phoronix-test-suite-..> | 2023-10-09 02:33 | 2.5M | |
| phoronix-test-suite-..> | 2023-10-11 00:07 | 2.5M | |
| photivo-0.0.2015.03...> | 2023-10-14 18:05 | 1.5M | |
| photoflare-1.6.12.pkg | 2023-10-08 20:39 | 697K | |
| photopc-3.07_1.pkg | 2023-10-11 00:38 | 59K | |
| photoprint-0.4.2.p2_..> | 2023-10-10 05:34 | 1.0M | |
| photoqt-1.6_10.pkg | 2023-10-09 22:37 | 735K | |
| phototonic-2.1.136_1..> | 2023-10-09 07:08 | 268K | |
| php-Psr_Log-1.0.2.pkg | 2023-10-08 12:48 | 3.7K | |
| php-fpm_exporter-2.2..> | 2023-10-10 00:27 | 3.1M | |
| php-geshi-1.0.9.1.pkg | 2023-10-08 22:08 | 690K | |
| php-mode.el-1.25.0_1..> | 2023-10-10 15:28 | 100K | |
| php-mode.el-emacs_ca..> | 2023-10-10 06:28 | 100K | |
| php-mode.el-emacs_de..> | 2023-10-09 10:04 | 100K | |
| php-mode.el-emacs_de..> | 2023-10-09 12:57 | 100K | |
| php-mode.el-emacs_no..> | 2023-10-09 22:01 | 100K | |
| php80-8.0.30.pkg | 2023-10-05 17:42 | 4.1M | |
| php80-Ice37-3.7.6.pkg | 2023-10-10 08:37 | 166K | |
| php80-aphpbreakdown-..> | 2023-10-10 05:44 | 50K | |
| php80-aphpunit-2.1.pkg | 2023-10-14 15:26 | 13K | |
| php80-bcmath-8.0.30.pkg | 2023-10-06 14:30 | 20K | |
| php80-brotli-0.13.1.pkg | 2023-10-09 22:25 | 9.7K | |
| php80-bsdconv-11.6.0..> | 2023-10-08 17:43 | 7.8K | |
| php80-bz2-8.0.30.pkg | 2023-10-07 09:15 | 10K | |
| php80-calendar-8.0.3..> | 2023-10-07 12:50 | 15K | |
| php80-composer-1.10...> | 2023-10-08 07:07 | 390K | |
| php80-composer2-2.6...> | 2023-10-07 13:20 | 517K | |
| php80-ctype-8.0.30.pkg | 2023-10-06 16:16 | 5.4K | |
| php80-curl-8.0.30.pkg | 2023-10-06 17:35 | 34K | |
| php80-dba-8.0.30.pkg | 2023-10-14 15:41 | 24K | |
| php80-dddbl-2.0.1.pkg | 2023-10-09 14:09 | 9.2K | |
| php80-deployer-6.4.3..> | 2023-10-14 07:29 | 328K | |
| php80-dom-8.0.30.pkg | 2023-10-06 09:34 | 55K | |
| php80-enchant-8.0.30..> | 2023-10-10 15:03 | 9.7K | |
| php80-exif-8.0.30.pkg | 2023-10-06 23:37 | 29K | |
| php80-extensions-1.1..> | 2023-10-10 05:58 | 1.0K | |
| php80-facedetect-1.1..> | 2023-10-09 16:53 | 6.9K | |
| php80-ffi-8.0.30.pkg | 2023-10-10 07:09 | 59K | |
| php80-fileinfo-8.0.3..> | 2023-10-07 06:01 | 290K | |
| php80-filter-8.0.30.pkg | 2023-10-07 06:39 | 20K | |
| php80-ftp-8.0.30.pkg | 2023-10-08 01:11 | 24K | |
| php80-gd-8.0.30.pkg | 2023-10-06 16:51 | 31K | |
| php80-geos-1.0.0.pkg | 2023-10-10 09:28 | 17K | |
| php80-gettext-8.0.30..> | 2023-10-06 16:43 | 6.3K | |
| php80-gmp-8.0.30.pkg | 2023-10-07 01:46 | 20K | |
| php80-iconv-8.0.30.pkg | 2023-10-06 17:18 | 17K | |
| php80-ilias-8.4.pkg | 2023-10-09 17:18 | 122M | |
| php80-imap-8.0.30.pkg | 2023-10-07 05:23 | 33K | |
| php80-intl-8.0.30.pkg | 2023-10-06 17:07 | 126K | |
| php80-kanboard-1.2.3..> | 2023-10-08 14:18 | 2.3M | |
| php80-ldap-8.0.30.pkg | 2023-10-06 17:07 | 30K | |
| php80-libawl-0.64.pkg | 2023-10-08 02:28 | 82K | |
| php80-lz4-0.4.3.pkg | 2023-10-09 14:40 | 5.5K | |
| php80-matomo-4.13.3.pkg | 2023-10-14 03:46 | 13M | |
| php80-maxminddb-1.6...> | 2023-10-10 05:41 | 6.7K | |
| php80-mbstring-8.0.3..> | 2023-10-06 16:41 | 744K | |
| php80-mysqli-8.0.30.pkg | 2023-10-06 12:22 | 43K | |
| php80-odbc-8.0.30.pkg | 2023-10-09 03:52 | 26K | |
| php80-opcache-8.0.30..> | 2023-10-06 16:49 | 451K | |
| php80-opencc-0.0.0.2..> | 2023-10-14 12:25 | 5.2K | |
| php80-pcntl-8.0.30.pkg | 2023-10-07 06:15 | 14K | |
| php80-pdo-8.0.30.pkg | 2023-10-06 15:23 | 47K | |
| php80-pdo_dblib-8.0...> | 2023-10-11 00:43 | 12K | |
| php80-pdo_firebird-8..> | 2023-10-08 14:07 | 15K | |
| php80-pdo_mysql-8.0...> | 2023-10-06 16:56 | 15K | |
| php80-pdo_odbc-8.0.3..> | 2023-10-09 14:16 | 12K | |
| php80-pdo_pgsql-8.0...> | 2023-10-06 16:17 | 18K | |
| php80-pdo_sqlite-8.0..> | 2023-10-06 17:47 | 12K | |
| php80-pear-1.10.13.pkg | 2023-10-06 08:56 | 249K | |
| php80-pear-Auth-1.6...> | 2023-10-08 07:01 | 47K | |
| php80-pear-Auth_HTTP..> | 2023-10-09 22:56 | 8.9K | |
| php80-pear-Auth_Pref..> | 2023-10-11 00:54 | 11K | |
| php80-pear-Auth_RADI..> | 2023-10-14 12:09 | 8.7K | |
| php80-pear-Auth_SASL..> | 2023-10-07 05:46 | 9.3K | |
| php80-pear-Auth_SASL..> | 2023-10-09 09:11 | 9.0K | |
| php80-pear-Benchmark..> | 2023-10-09 04:07 | 8.9K | |
| php80-pear-Cache-1.5..> | 2023-10-07 12:32 | 28K | |
| php80-pear-Cache_Lit..> | 2023-10-08 10:28 | 31K | |
| php80-pear-Config-1...> | 2023-10-10 13:22 | 30K | |
| php80-pear-Console_C..> | 2023-10-14 14:27 | 5.4K | |
| php80-pear-Console_C..> | 2023-10-07 15:12 | 37K | |
| php80-pear-Console_G..> | 2023-10-08 09:20 | 17K | |
| php80-pear-Console_T..> | 2023-10-06 20:55 | 12K | |
| php80-pear-Contact_V..> | 2023-10-10 10:42 | 16K | |
| php80-pear-Contact_V..> | 2023-10-08 22:23 | 10K | |
| php80-pear-Crypt_Blo..> | 2023-10-09 18:14 | 16K | |
| php80-pear-Crypt_CBC..> | 2023-10-09 02:08 | 4.3K | |
| php80-pear-Crypt_CHA..> | 2023-10-07 18:47 | 5.9K | |
| php80-pear-Crypt_Dif..> | 2023-10-11 00:28 | 11K | |
| php80-pear-Crypt_GPG..> | 2023-10-09 19:35 | 283K | |
| php80-pear-Crypt_HMA..> | 2023-10-08 01:19 | 8.3K | |
| php80-pear-Crypt_Mic..> | 2023-10-09 14:35 | 3.7K | |
| php80-pear-Crypt_RC4..> | 2023-10-09 08:04 | 2.9K | |
| php80-pear-Crypt_RSA..> | 2023-10-10 09:05 | 20K | |
| php80-pear-Crypt_XXT..> | 2023-10-10 05:45 | 6.8K | |
| php80-pear-DB-1.11.0..> | 2023-10-07 01:26 | 83K | |
| php80-pear-DBA-1.1.1..> | 2023-10-08 00:48 | 13K | |
| php80-pear-DBA_Relat..> | 2023-10-09 12:51 | 19K | |
| php80-pear-DB_DataOb..> | 2023-10-07 16:24 | 68K | |
| php80-pear-DB_DataOb..> | 2023-10-14 09:38 | 59K | |
| php80-pear-DB_Pager-..> | 2023-10-08 19:56 | 4.5K | |
| php80-pear-DB_QueryT..> | 2023-10-10 10:15 | 38K | |
| php80-pear-DB_Sqlite..> | 2023-10-10 14:00 | 18K | |
| php80-pear-DB_Table-..> | 2023-10-09 07:43 | 90K | |
| php80-pear-DB_ldap-1..> | 2023-10-10 20:25 | 10K | |
| php80-pear-DB_ldap2-..> | 2023-10-08 21:51 | 18K | |
| php80-pear-Date-1.4...> | 2023-10-07 09:54 | 42K | |
| php80-pear-Date_Holi..> | 2023-10-07 16:10 | 33K | |
| php80-pear-Date_Holi..> | 2023-10-10 09:17 | 5.5K | |
| php80-pear-Date_Holi..> | 2023-10-10 15:22 | 4.6K | |
| php80-pear-Date_Holi..> | 2023-10-10 04:37 | 4.3K | |
| php80-pear-Date_Holi..> | 2023-10-10 16:50 | 3.6K | |
| php80-pear-Date_Holi..> | 2023-10-10 06:34 | 4.2K | |
| php80-pear-Date_Holi..> | 2023-10-14 10:46 | 12K | |
| php80-pear-Date_Holi..> | 2023-10-08 12:54 | 5.1K | |
| php80-pear-Date_Holi..> | 2023-10-14 09:11 | 4.9K | |
| php80-pear-Date_Holi..> | 2023-10-09 12:27 | 4.5K | |
| php80-pear-Date_Holi..> | 2023-10-09 15:14 | 8.8K | |
| php80-pear-Date_Holi..> | 2023-10-14 13:17 | 5.4K | |
| php80-pear-Date_Holi..> | 2023-10-14 05:58 | 4.0K | |
| php80-pear-Date_Holi..> | 2023-10-10 13:03 | 4.0K | |
| php80-pear-Date_Holi..> | 2023-10-10 17:15 | 3.5K | |
| php80-pear-Date_Holi..> | 2023-10-10 05:36 | 4.1K | |
| php80-pear-Date_Holi..> | 2023-10-14 05:50 | 6.3K | |
| php80-pear-Date_Holi..> | 2023-10-09 03:56 | 9.1K | |
| php80-pear-Date_Holi..> | 2023-10-08 18:47 | 5.2K | |
| php80-pear-Date_Holi..> | 2023-10-10 06:25 | 3.8K | |
| php80-pear-Event_Dis..> | 2023-10-07 07:34 | 8.9K | |
| php80-pear-FSM-1.4.0..> | 2023-10-09 09:50 | 11K | |
| php80-pear-File-1.4...> | 2023-10-08 03:31 | 8.7K | |
| php80-pear-File_Arch..> | 2023-10-10 10:30 | 52K | |
| php80-pear-File_Bitt..> | 2023-10-10 05:07 | 70K | |
| php80-pear-File_DNS-..> | 2023-10-14 10:02 | 10K | |
| php80-pear-File_Find..> | 2023-10-07 20:24 | 8.6K | |
| php80-pear-File_Fort..> | 2023-10-14 10:09 | 14K | |
| php80-pear-File_Fsta..> | 2023-10-10 00:51 | 7.4K | |
| php80-pear-File_Gett..> | 2023-10-11 10:57 | 7.6K | |
| php80-pear-File_HtAc..> | 2023-10-09 19:56 | 5.5K | |
| php80-pear-File_Iter..> | 2023-10-08 04:27 | 1.6K | |
| php80-pear-File_MARC..> | 2023-10-12 03:55 | 75K | |
| php80-pear-File_PDF-..> | 2023-10-09 20:29 | 36K | |
| php80-pear-File_Pass..> | 2023-10-09 05:57 | 21K | |
| php80-pear-File_SMBP..> | 2023-10-09 14:42 | 5.7K | |
| php80-pear-Games_Che..> | 2023-10-10 19:55 | 81K | |
| php80-pear-HTML_AJAX..> | 2023-10-08 06:19 | 89K | |
| php80-pear-HTML_BBCo..> | 2023-10-14 07:14 | 16K | |
| php80-pear-HTML_CSS-..> | 2023-10-09 08:21 | 38K | |
| php80-pear-HTML_Comm..> | 2023-10-07 04:35 | 5.0K | |
| php80-pear-HTML_Comm..> | 2023-10-08 09:30 | 9.4K | |
| php80-pear-HTML_Cryp..> | 2023-10-08 14:03 | 5.0K | |
| php80-pear-HTML_Form..> | 2023-10-10 05:18 | 14K | |
| php80-pear-HTML_Java..> | 2023-10-14 14:42 | 8.8K | |
| php80-pear-HTML_Page..> | 2023-10-09 13:15 | 18K | |
| php80-pear-HTML_Quic..> | 2023-10-08 11:45 | 84K | |
| php80-pear-HTML_Quic..> | 2023-10-08 19:36 | 143K | |
| php80-pear-HTML_Quic..> | 2023-10-09 13:37 | 17K | |
| php80-pear-HTML_Quic..> | 2023-10-09 06:11 | 14K | |
| php80-pear-HTML_Quic..> | 2023-10-10 05:20 | 7.3K | |
| php80-pear-HTML_Quic..> | 2023-10-11 06:16 | 3.1K | |
| php80-pear-HTML_Quic..> | 2023-10-09 01:35 | 27K | |
| php80-pear-HTML_Sele..> | 2023-10-10 19:04 | 6.2K | |
| php80-pear-HTML_Sele..> | 2023-10-14 09:11 | 8.3K | |
| php80-pear-HTML_Tabl..> | 2023-10-07 15:46 | 15K | |
| php80-pear-HTML_TagC..> | 2023-10-14 14:31 | 12K | |
| php80-pear-HTML_Temp..> | 2023-10-07 18:31 | 146K | |
| php80-pear-HTML_Temp..> | 2023-10-07 20:05 | 22K | |
| php80-pear-HTML_Temp..> | 2023-10-09 07:29 | 18K | |
| php80-pear-HTML_Temp..> | 2023-10-09 13:43 | 28K | |
| php80-pear-HTML_Tree..> | 2023-10-09 14:38 | 48K | |
| php80-pear-HTTP-1.4...> | 2023-10-07 04:09 | 9.0K | |
| php80-pear-HTTP_Clie..> | 2023-10-08 20:27 | 10K | |
| php80-pear-HTTP_Down..> | 2023-10-09 13:17 | 14K | |
| php80-pear-HTTP_Floo..> | 2023-10-09 13:42 | 6.5K | |
| php80-pear-HTTP_Head..> | 2023-10-08 03:14 | 11K | |
| php80-pear-HTTP_Requ..> | 2023-10-07 05:27 | 16K | |
| php80-pear-HTTP_Requ..> | 2023-10-07 12:47 | 108K | |
| php80-pear-HTTP_Serv..> | 2023-10-14 13:40 | 7.4K | |
| php80-pear-HTTP_Sess..> | 2023-10-08 16:26 | 16K | |
| php80-pear-HTTP_Uplo..> | 2023-10-09 20:56 | 9.4K | |
| php80-pear-HTTP_WebD..> | 2023-10-09 15:54 | 9.2K | |
| php80-pear-HTTP_WebD..> | 2023-10-14 08:47 | 28K | |
| php80-pear-Horde_Cry..> | 2023-10-09 21:00 | 115K | |
| php80-pear-Horde_Cry..> | 2023-10-06 18:19 | 24K | |
| php80-pear-Horde_Ima..> | 2023-10-08 16:47 | 595K | |
| php80-pear-Horde_Ima..> | 2023-10-08 10:27 | 200K | |
| php80-pear-Horde_Kol..> | 2023-10-07 13:17 | 85K | |
| php80-pear-Horde_Log..> | 2023-10-06 17:46 | 15K | |
| php80-pear-Horde_Map..> | 2023-10-06 17:45 | 18K | |
| php80-pear-Horde_Smt..> | 2023-10-06 21:07 | 31K | |
| php80-pear-Horde_Vfs..> | 2023-10-07 16:40 | 62K | |
| php80-pear-I18N-1.0...> | 2023-10-08 04:16 | 29K | |
| php80-pear-I18Nv2-0...> | 2023-10-09 20:29 | 200K | |
| php80-pear-Image_3D-..> | 2023-10-09 12:08 | 92K | |
| php80-pear-Image_Bar..> | 2023-10-14 05:50 | 13K | |
| php80-pear-Image_Bar..> | 2023-10-11 20:29 | 15K | |
| php80-pear-Image_Can..> | 2023-10-07 16:34 | 37K | |
| php80-pear-Image_Col..> | 2023-10-07 02:33 | 9.3K | |
| php80-pear-Image_Gra..> | 2023-10-10 03:33 | 325K | |
| php80-pear-Image_Gra..> | 2023-10-10 10:51 | 16K | |
| php80-pear-Image_Tra..> | 2023-10-08 12:43 | 385K | |
| php80-pear-LiveUser-..> | 2023-10-08 02:52 | 62K | |
| php80-pear-LiveUser_..> | 2023-10-14 11:56 | 53K | |
| php80-pear-Log-1.13...> | 2023-10-08 11:01 | 40K | |
| php80-pear-MDB-1.3.0..> | 2023-10-07 19:35 | 125K | |
| php80-pear-MDB2-2.5...> | 2023-10-07 23:06 | 102K | |
| php80-pear-MDB2_Driv..> | 2023-10-14 11:48 | 34K | |
| php80-pear-MDB2_Driv..> | 2023-10-09 08:01 | 29K | |
| php80-pear-MDB2_Sche..> | 2023-10-10 06:11 | 63K | |
| php80-pear-MDB_Query..> | 2023-10-14 06:28 | 42K | |
| php80-pear-MIME_Type..> | 2023-10-07 16:13 | 19K | |
| php80-pear-Mail-1.5...> | 2023-10-08 01:10 | 21K | |
| php80-pear-Mail_Mbox..> | 2023-10-09 09:56 | 14K | |
| php80-pear-Mail_Mime..> | 2023-10-07 04:48 | 35K | |
| php80-pear-Mail_Queu..> | 2023-10-09 23:07 | 20K | |
| php80-pear-Mail_mime..> | 2023-10-07 16:21 | 13K | |
| php80-pear-Math_BigI..> | 2023-10-06 15:08 | 24K | |
| php80-pear-Math_Comb..> | 2023-10-14 08:58 | 5.8K | |
| php80-pear-Math_Frac..> | 2023-10-08 19:08 | 4.7K | |
| php80-pear-Net_CDDB-..> | 2023-10-14 10:03 | 46K | |
| php80-pear-Net_Check..> | 2023-10-08 05:00 | 2.6K | |
| php80-pear-Net_Cyrus..> | 2023-10-10 12:15 | 6.2K | |
| php80-pear-Net_DIME-..> | 2023-10-10 01:28 | 7.5K | |
| php80-pear-Net_DNS2-..> | 2023-10-08 03:50 | 68K | |
| php80-pear-Net_DNSBL..> | 2023-10-09 13:41 | 8.5K | |
| php80-pear-Net_Dict-..> | 2023-10-08 22:29 | 6.4K | |
| php80-pear-Net_FTP-1..> | 2023-10-08 22:10 | 30K | |
| php80-pear-Net_Finge..> | 2023-10-09 09:43 | 2.3K | |
| php80-pear-Net_Gearm..> | 2023-10-14 17:21 | 17K | |
| php80-pear-Net_Geo-1..> | 2023-10-09 02:29 | 8.1K | |
| php80-pear-Net_GeoIP..> | 2023-10-08 12:40 | 13K | |
| php80-pear-Net_Growl..> | 2023-10-09 16:08 | 457K | |
| php80-pear-Net_IDNA-..> | 2023-10-09 19:24 | 16K | |
| php80-pear-Net_IMAP-..> | 2023-10-08 08:53 | 35K | |
| php80-pear-Net_IPv4-..> | 2023-10-08 11:03 | 6.7K | |
| php80-pear-Net_IPv6-..> | 2023-10-07 11:25 | 12K | |
| php80-pear-Net_Ident..> | 2023-10-10 22:28 | 3.8K | |
| php80-pear-Net_LDAP-..> | 2023-10-14 16:35 | 63K | |
| php80-pear-Net_LDAP2..> | 2023-10-09 07:15 | 80K | |
| php80-pear-Net_LMTP-..> | 2023-10-14 13:36 | 6.7K | |
| php80-pear-Net_MAC-0..> | 2023-10-10 11:19 | 5.7K | |
| php80-pear-Net_NNTP-..> | 2023-10-14 11:30 | 32K | |
| php80-pear-Net_Nmap-..> | 2023-10-08 14:15 | 23K | |
| php80-pear-Net_POP3-..> | 2023-10-10 11:26 | 9.6K | |
| php80-pear-Net_Ping-..> | 2023-10-09 01:34 | 9.6K | |
| php80-pear-Net_Ports..> | 2023-10-11 01:17 | 3.4K | |
| php80-pear-Net_SMS-0..> | 2023-10-08 17:35 | 18K | |
| php80-pear-Net_SMTP-..> | 2023-10-06 11:05 | 15K | |
| php80-pear-Net_Serve..> | 2023-10-08 10:24 | 17K | |
| php80-pear-Net_Sieve..> | 2023-10-14 15:02 | 14K | |
| php80-pear-Net_Smart..> | 2023-10-11 01:09 | 101K | |
| php80-pear-Net_Socke..> | 2023-10-06 10:09 | 7.0K | |
| php80-pear-Net_Trace..> | 2023-10-09 03:23 | 7.2K | |
| php80-pear-Net_URL-1..> | 2023-10-06 20:00 | 6.6K | |
| php80-pear-Net_URL2-..> | 2023-10-07 03:24 | 18K | |
| php80-pear-Net_URL_M..> | 2023-10-10 00:34 | 13K | |
| php80-pear-Net_UserA..> | 2023-10-08 22:55 | 12K | |
| php80-pear-Net_UserA..> | 2023-10-09 15:19 | 30K | |
| php80-pear-Net_Vpopm..> | 2023-10-09 10:09 | 20K | |
| php80-pear-Net_Whois..> | 2023-10-10 15:54 | 6.7K | |
| php80-pear-Numbers_R..> | 2023-10-09 07:29 | 6.5K | |
| php80-pear-Numbers_W..> | 2023-10-09 08:03 | 43K | |
| php80-pear-OLE-1.0.0..> | 2023-10-07 09:57 | 13K | |
| php80-pear-PEAR_Info..> | 2023-10-09 15:00 | 44K | |
| php80-pear-PEAR_Pack..> | 2023-10-14 10:33 | 33K | |
| php80-pear-PEAR_Pack..> | 2023-10-10 09:24 | 34K | |
| php80-pear-PEAR_Pack..> | 2023-10-07 17:09 | 20K | |
| php80-pear-PHPTAL-1...> | 2023-10-10 10:44 | 148K | |
| php80-pear-PHP_Archi..> | 2023-10-09 15:01 | 45K | |
| php80-pear-PHP_Array..> | 2023-10-10 10:48 | 8.1K | |
| php80-pear-PHP_Beaut..> | 2023-10-09 00:01 | 66K | |
| php80-pear-PHP_CodeC..> | 2023-10-08 21:29 | 5.3K | |
| php80-pear-PHP_CodeS..> | 2023-10-14 17:19 | 609K | |
| php80-pear-PHP_Compa..> | 2023-10-14 18:43 | 41K | |
| php80-pear-PHP_Compa..> | 2023-10-11 06:36 | 133K | |
| php80-pear-PHP_Parse..> | 2023-10-10 19:02 | 81K | |
| php80-pear-PHP_Parse..> | 2023-10-10 13:08 | 133K | |
| php80-pear-PHP_Shell..> | 2023-10-09 15:08 | 84K | |
| php80-pear-PHP_Timer..> | 2023-10-10 03:18 | 1.4K | |
| php80-pear-PHP_Token..> | 2023-10-08 07:01 | 4.2K | |
| php80-pear-PHP_UML-1..> | 2023-10-09 21:51 | 405K | |
| php80-pear-Pager-2.5..> | 2023-10-07 04:43 | 31K | |
| php80-pear-Payment_D..> | 2023-10-14 18:08 | 38K | |
| php80-pear-PhpDocume..> | 2023-10-14 11:54 | 944K | |
| php80-pear-SOAP-0.14..> | 2023-10-14 10:37 | 72K | |
| php80-pear-Sebastian..> | 2023-10-14 11:12 | 1.4K | |
| php80-pear-Sebastian..> | 2023-10-14 16:33 | 2.2K | |
| php80-pear-Sebastian..> | 2023-10-14 06:05 | 1.3K | |
| php80-pear-Services_..> | 2023-10-09 20:43 | 15K | |
| php80-pear-Services_..> | 2023-10-09 22:05 | 27K | |
| php80-pear-Services_..> | 2023-10-10 13:13 | 16K | |
| php80-pear-Services_..> | 2023-10-10 19:24 | 3.5K | |
| php80-pear-Services_..> | 2023-10-10 22:31 | 9.8K | |
| php80-pear-Services_..> | 2023-10-09 15:32 | 22K | |
| php80-pear-Services_..> | 2023-10-10 07:02 | 71K | |
| php80-pear-Services_..> | 2023-10-09 17:53 | 37K | |
| php80-pear-Services_..> | 2023-10-10 09:47 | 3.9K | |
| php80-pear-Services_..> | 2023-10-14 02:33 | 9.5K | |
| php80-pear-Services_..> | 2023-10-08 16:47 | 5.1K | |
| php80-pear-Services_..> | 2023-10-14 13:55 | 8.7K | |
| php80-pear-Services_..> | 2023-10-12 06:52 | 10K | |
| php80-pear-Services_..> | 2023-10-09 21:28 | 4.7K | |
| php80-pear-Services_..> | 2023-10-09 21:47 | 5.9K | |
| php80-pear-Services_..> | 2023-10-08 16:33 | 55K | |
| php80-pear-Services_..> | 2023-10-10 19:13 | 11K | |
| php80-pear-Services_..> | 2023-10-09 17:32 | 13K | |
| php80-pear-Services_..> | 2023-10-10 12:49 | 43K | |
| php80-pear-Services_..> | 2023-10-09 11:49 | 14K | |
| php80-pear-Services_..> | 2023-10-11 05:04 | 12K | |
| php80-pear-Services_..> | 2023-10-14 09:11 | 4.2K | |
| php80-pear-Spreadshe..> | 2023-10-08 05:13 | 47K | |
| php80-pear-Structure..> | 2023-10-07 07:58 | 42K | |
| php80-pear-Structure..> | 2023-10-07 20:00 | 4.0K | |
| php80-pear-Structure..> | 2023-10-09 10:21 | 4.7K | |
| php80-pear-Structure..> | 2023-10-10 20:09 | 3.1K | |
| php80-pear-Structure..> | 2023-10-14 16:20 | 4.7K | |
| php80-pear-Structure..> | 2023-10-10 19:02 | 4.5K | |
| php80-pear-Structure..> | 2023-10-10 14:34 | 3.6K | |
| php80-pear-Structure..> | 2023-10-10 18:19 | 9.3K | |
| php80-pear-Structure..> | 2023-10-09 15:30 | 4.7K | |
| php80-pear-Structure..> | 2023-10-09 19:54 | 6.6K | |
| php80-pear-Structure..> | 2023-10-07 10:06 | 4.9K | |
| php80-pear-Structure..> | 2023-10-10 17:35 | 6.3K | |
| php80-pear-Structure..> | 2023-10-14 11:09 | 5.4K | |
| php80-pear-Structure..> | 2023-10-09 13:23 | 4.4K | |
| php80-pear-Structure..> | 2023-10-14 18:21 | 4.3K | |
| php80-pear-Structure..> | 2023-10-08 21:10 | 12K | |
| php80-pear-Symfony_C..> | 2023-10-07 17:47 | 76K | |
| php80-pear-Symfony_C..> | 2023-10-07 12:28 | 33K | |
| php80-pear-Symfony_C..> | 2023-10-10 10:11 | 37K | |
| php80-pear-System_Co..> | 2023-10-11 00:18 | 6.9K | |
| php80-pear-Testing_S..> | 2023-10-09 11:27 | 2.3M | |
| php80-pear-Text_Diff..> | 2023-10-10 16:27 | 20K | |
| php80-pear-Text_Figl..> | 2023-10-14 04:51 | 8.4K | |
| php80-pear-Text_High..> | 2023-10-10 10:59 | 79K | |
| php80-pear-Text_Pass..> | 2023-10-08 21:14 | 5.9K | |
| php80-pear-Text_Spel..> | 2023-10-10 07:41 | 115K | |
| php80-pear-Text_Temp..> | 2023-10-07 20:06 | 1.4K | |
| php80-pear-Text_Wiki..> | 2023-10-09 08:06 | 75K | |
| php80-pear-TheSeer_D..> | 2023-10-09 15:15 | 2.8K | |
| php80-pear-TheSeer_f..> | 2023-10-07 12:11 | 4.9K | |
| php80-pear-TheSeer_f..> | 2023-10-08 22:44 | 6.4K | |
| php80-pear-Translati..> | 2023-10-14 17:00 | 46K | |
| php80-pear-UDDI-0.2...> | 2023-10-10 08:16 | 7.3K | |
| php80-pear-URI_Templ..> | 2023-10-09 14:07 | 7.0K | |
| php80-pear-VFS-0.3.0..> | 2023-10-09 09:57 | 36K | |
| php80-pear-Validate-..> | 2023-10-07 10:15 | 20K | |
| php80-pear-Validate_..> | 2023-10-09 09:21 | 9.3K | |
| php80-pear-Validate_..> | 2023-10-11 21:22 | 10K | |
| php80-pear-Validate_..> | 2023-10-10 19:30 | 6.9K | |
| php80-pear-Validate_..> | 2023-10-11 22:11 | 6.2K | |
| php80-pear-Validate_..> | 2023-10-11 07:07 | 9.1K | |
| php80-pear-Var_Dump-..> | 2023-10-10 05:04 | 17K | |
| php80-pear-VersionCo..> | 2023-10-14 13:10 | 15K | |
| php80-pear-VersionCo..> | 2023-10-14 18:08 | 27K | |
| php80-pear-XML_Beaut..> | 2023-10-09 20:40 | 13K | |
| php80-pear-XML_DTD-0..> | 2023-10-07 18:27 | 32K | |
| php80-pear-XML_Feed_..> | 2023-10-14 18:40 | 265K | |
| php80-pear-XML_GRDDL..> | 2023-10-09 03:19 | 43K | |
| php80-pear-XML_HTMLS..> | 2023-10-09 09:27 | 15K | |
| php80-pear-XML_NITF-..> | 2023-10-14 11:24 | 7.9K | |
| php80-pear-XML_Parse..> | 2023-10-06 19:18 | 13K | |
| php80-pear-XML_Query..> | 2023-10-10 16:21 | 296K | |
| php80-pear-XML_RPC-1..> | 2023-10-08 03:52 | 23K | |
| php80-pear-XML_RPC2-..> | 2023-10-09 02:34 | 56K | |
| php80-pear-XML_RSS-1..> | 2023-10-08 07:15 | 8.2K | |
| php80-pear-XML_SVG-1..> | 2023-10-09 01:22 | 8.8K | |
| php80-pear-XML_Seria..> | 2023-10-07 03:50 | 30K | |
| php80-pear-XML_Trans..> | 2023-10-14 12:20 | 26K | |
| php80-pear-XML_Tree-..> | 2023-10-09 15:31 | 5.2K | |
| php80-pear-XML_Util-..> | 2023-10-06 20:08 | 17K | |
| php80-pear-XML_Wddx-..> | 2023-10-09 22:28 | 6.7K | |
| php80-pear-YAML-1.0...> | 2023-10-09 07:39 | 10K | |
| php80-pear-channel-d..> | 2023-10-07 02:29 | 1.1K | |
| php80-pear-channel-e..> | 2023-10-07 01:14 | 1.1K | |
| php80-pear-channel-g..> | 2023-10-08 05:24 | 1.0K | |
| php80-pear-channel-h..> | 2023-10-06 09:10 | 1.0K | |
| php80-pear-channel-h..> | 2023-10-08 03:11 | 1.4K | |
| php80-pear-channel-o..> | 2023-10-09 22:53 | 1.0K | |
| php80-pear-channel-p..> | 2023-10-07 19:00 | 1.0K | |
| php80-pear-channel-p..> | 2023-10-08 01:32 | 1.0K | |
| php80-pear-channel-p..> | 2023-10-14 04:07 | 1.1K | |
| php80-pear-channel-p..> | 2023-10-10 15:22 | 1.0K | |
| php80-pear-channel-p..> | 2023-10-07 21:13 | 1.1K | |
| php80-pear-channel-s..> | 2023-10-08 07:26 | 1.1K | |
| php80-pear-channel-s..> | 2023-10-07 05:43 | 1.1K | |
| php80-pear-channel-t..> | 2023-10-07 09:06 | 1.0K | |
| php80-pear-channel-t..> | 2023-10-07 21:19 | 1.1K | |
| php80-pear-codegen-1..> | 2023-10-10 00:08 | 42K | |
| php80-pear-doctrine-..> | 2023-10-07 17:30 | 52K | |
| php80-pear-doctrine-..> | 2023-10-09 00:57 | 113K | |
| php80-pear-ezc_Base-..> | 2023-10-08 08:55 | 210K | |
| php80-pear-ezc_Conso..> | 2023-10-08 19:45 | 736K | |
| php80-pear-geshi-ges..> | 2023-10-10 06:57 | 641K | |
| php80-pear-horde-Hor..> | 2023-10-06 20:40 | 310K | |
| php80-pear-horde-Hor..> | 2023-10-06 21:53 | 37K | |
| php80-pear-horde-Hor..> | 2023-10-10 07:39 | 58K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:09 | 52K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:48 | 15K | |
| php80-pear-horde-Hor..> | 2023-10-09 13:18 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-06 16:35 | 36K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:16 | 26K | |
| php80-pear-horde-Hor..> | 2023-10-06 23:03 | 29K | |
| php80-pear-horde-Hor..> | 2023-10-06 16:18 | 2.1M | |
| php80-pear-horde-Hor..> | 2023-10-06 16:14 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-06 14:28 | 6.3K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:51 | 12K | |
| php80-pear-horde-Hor..> | 2023-10-07 06:06 | 1.1M | |
| php80-pear-horde-Hor..> | 2023-10-06 19:59 | 12K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:38 | 71K | |
| php80-pear-horde-Hor..> | 2023-10-06 23:07 | 42K | |
| php80-pear-horde-Hor..> | 2023-10-06 13:34 | 63K | |
| php80-pear-horde-Hor..> | 2023-10-08 23:18 | 28K | |
| php80-pear-horde-Hor..> | 2023-10-07 23:31 | 189K | |
| php80-pear-horde-Hor..> | 2023-10-06 15:18 | 71K | |
| php80-pear-horde-Hor..> | 2023-10-14 18:04 | 546K | |
| php80-pear-horde-Hor..> | 2023-10-06 10:41 | 24K | |
| php80-pear-horde-Hor..> | 2023-10-08 19:26 | 1.2M | |
| php80-pear-horde-Hor..> | 2023-10-10 00:17 | 135K | |
| php80-pear-horde-Hor..> | 2023-10-06 15:18 | 22K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:24 | 16K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:24 | 25K | |
| php80-pear-horde-Hor..> | 2023-10-07 03:18 | 15K | |
| php80-pear-horde-Hor..> | 2023-10-06 17:23 | 94K | |
| php80-pear-horde-Hor..> | 2023-10-06 11:58 | 10K | |
| php80-pear-horde-Hor..> | 2023-10-10 06:04 | 32K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:26 | 21K | |
| php80-pear-horde-Hor..> | 2023-10-08 13:42 | 34K | |
| php80-pear-horde-Hor..> | 2023-10-06 22:53 | 15K | |
| php80-pear-horde-Hor..> | 2023-10-07 10:12 | 52K | |
| php80-pear-horde-Hor..> | 2023-10-14 18:07 | 21K | |
| php80-pear-horde-Hor..> | 2023-10-14 02:47 | 138K | |
| php80-pear-horde-Hor..> | 2023-10-07 01:48 | 56K | |
| php80-pear-horde-Hor..> | 2023-10-09 08:34 | 17K | |
| php80-pear-horde-Hor..> | 2023-10-06 23:11 | 17K | |
| php80-pear-horde-Hor..> | 2023-10-06 23:12 | 29K | |
| php80-pear-horde-Hor..> | 2023-10-06 12:44 | 35K | |
| php80-pear-horde-Hor..> | 2023-10-10 00:00 | 18K | |
| php80-pear-horde-Hor..> | 2023-10-10 16:52 | 15K | |
| php80-pear-horde-Hor..> | 2023-10-06 15:03 | 121K | |
| php80-pear-horde-Hor..> | 2023-10-06 21:32 | 261K | |
| php80-pear-horde-Hor..> | 2023-10-10 02:31 | 84K | |
| php80-pear-horde-Hor..> | 2023-10-06 11:51 | 202K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:45 | 20K | |
| php80-pear-horde-Hor..> | 2023-10-07 21:33 | 6.9K | |
| php80-pear-horde-Hor..> | 2023-10-06 21:12 | 16K | |
| php80-pear-horde-Hor..> | 2023-10-14 18:44 | 45K | |
| php80-pear-horde-Hor..> | 2023-10-06 17:39 | 36K | |
| php80-pear-horde-Hor..> | 2023-10-06 21:29 | 50K | |
| php80-pear-horde-Hor..> | 2023-10-14 04:40 | 12K | |
| php80-pear-horde-Hor..> | 2023-10-11 04:44 | 32K | |
| php80-pear-horde-Hor..> | 2023-10-06 17:24 | 11K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:29 | 39K | |
| php80-pear-horde-Hor..> | 2023-10-14 08:54 | 37K | |
| php80-pear-horde-Hor..> | 2023-10-14 12:24 | 14K | |
| php80-pear-horde-Hor..> | 2023-10-14 10:27 | 5.7K | |
| php80-pear-horde-Hor..> | 2023-10-06 22:14 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:12 | 16K | |
| php80-pear-horde-Hor..> | 2023-10-09 22:28 | 30K | |
| php80-pear-horde-Hor..> | 2023-10-14 10:09 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-08 13:39 | 10K | |
| php80-pear-horde-Hor..> | 2023-10-08 17:16 | 2.9K | |
| php80-pear-horde-Hor..> | 2023-10-14 16:20 | 186K | |
| php80-pear-horde-Hor..> | 2023-10-06 21:29 | 24K | |
| php80-pear-horde-Hor..> | 2023-10-06 22:04 | 54K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:17 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-09 21:40 | 13K | |
| php80-pear-horde-Hor..> | 2023-10-06 16:55 | 18K | |
| php80-pear-horde-Hor..> | 2023-10-06 12:05 | 14K | |
| php80-pear-horde-Hor..> | 2023-10-06 11:21 | 6.4K | |
| php80-pear-horde-Hor..> | 2023-10-06 12:23 | 24K | |
| php80-pear-horde-Hor..> | 2023-10-08 03:59 | 112K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:42 | 14K | |
| php80-pear-horde-Hor..> | 2023-10-09 14:31 | 28K | |
| php80-pear-horde-Hor..> | 2023-10-06 17:22 | 50K | |
| php80-pear-horde-Hor..> | 2023-10-10 12:18 | 23K | |
| php80-pear-horde-Hor..> | 2023-10-06 12:48 | 14K | |
| php80-pear-horde-Hor..> | 2023-10-07 23:01 | 21K | |
| php80-pear-horde-Hor..> | 2023-10-11 18:04 | 26K | |
| php80-pear-horde-Hor..> | 2023-10-06 19:46 | 30K | |
| php80-pear-horde-Hor..> | 2023-10-06 09:46 | 16K | |
| php80-pear-horde-Hor..> | 2023-10-08 16:45 | 18K | |
| php80-pear-horde-Hor..> | 2023-10-06 16:48 | 16K | |
| php80-pear-horde-Hor..> | 2023-10-06 10:07 | 34K | |
| php80-pear-horde-Hor..> | 2023-10-06 18:49 | 40K | |
| php80-pear-horde-Hor..> | 2023-10-07 23:46 | 11K | |
| php80-pear-horde-Hor..> | 2023-10-07 00:22 | 25K | |
| php80-pear-pdepend_s..> | 2023-10-14 12:22 | 32K | |
| php80-pear-phing-2.6..> | 2023-10-11 06:20 | 357K | |
| php80-pear-pirum-Pir..> | 2023-10-08 17:22 | 14K | |
| php80-pear-twig-twig..> | 2023-10-08 18:45 | 91K | |
| php80-pecl-APCu-5.1...> | 2023-10-07 06:50 | 49K | |
| php80-pecl-amqp-1.11..> | 2023-10-14 15:09 | 45K | |
| php80-pecl-ast-1.1.0..> | 2023-10-10 12:43 | 17K | |
| php80-pecl-bitset-3...> | 2023-10-06 15:40 | 9.6K | |
| php80-pecl-couchbase..> | 2023-10-14 14:00 | 27K | |
| php80-pecl-crypto-0...> | 2023-10-11 19:21 | 30K | |
| php80-pecl-dio-0.2.1..> | 2023-10-10 05:53 | 11K | |
| php80-pecl-ds-1.4.0.pkg | 2023-10-08 22:55 | 52K | |
| php80-pecl-eio-3.0.0..> | 2023-10-08 15:26 | 26K | |
| php80-pecl-ev-1.1.5.pkg | 2023-10-09 15:53 | 34K | |
| php80-pecl-event-3.0..> | 2023-10-08 14:44 | 41K | |
| php80-pecl-excimer-1..> | 2023-10-14 18:10 | 20K | |
| php80-pecl-expect-0...> | 2023-10-08 12:43 | 6.9K | |
| php80-pecl-gnupg-1.5..> | 2023-10-08 07:46 | 16K | |
| php80-pecl-grpc-1.58..> | 2023-10-08 12:32 | 2.3M | |
| php80-pecl-horde_lz4..> | 2023-10-10 16:22 | 4.0K | |
| php80-pecl-http-4.2...> | 2023-10-14 09:53 | 128K | |
| php80-pecl-igbinary-..> | 2023-10-10 19:13 | 24K | |
| php80-pecl-imagick-3..> | 2023-10-09 16:03 | 114K | |
| php80-pecl-inotify-3..> | 2023-10-09 14:54 | 6.2K | |
| php80-pecl-json_post..> | 2023-10-09 10:07 | 4.8K | |
| php80-pecl-krb5-1.1...> | 2023-10-09 03:41 | 22K | |
| php80-pecl-leveldb-0..> | 2023-10-09 16:04 | 12K | |
| php80-pecl-libsodium..> | 2023-10-09 18:48 | 22K | |
| php80-pecl-lzf-1.7.0..> | 2023-10-09 14:35 | 7.1K | |
| php80-pecl-mailparse..> | 2023-10-14 05:56 | 25K | |
| php80-pecl-mcrypt-1...> | 2023-10-06 15:40 | 13K | |
| php80-pecl-memcache-..> | 2023-10-06 18:15 | 40K | |
| php80-pecl-memcached..> | 2023-10-06 16:27 | 47K | |
| php80-pecl-mongodb-1..> | 2023-10-09 22:06 | 556K | |
| php80-pecl-msgpack-2..> | 2023-10-07 20:16 | 23K | |
| php80-pecl-mustache-..> | 2023-10-08 22:21 | 24K | |
| php80-pecl-oauth-2.0..> | 2023-10-09 00:13 | 33K | |
| php80-pecl-pam-2.2.4..> | 2023-10-09 02:08 | 7.9K | |
| php80-pecl-pkcs11-1...> | 2023-10-08 15:08 | 42K | |
| php80-pecl-proctitle..> | 2023-10-09 18:28 | 3.6K | |
| php80-pecl-protobuf-..> | 2023-10-09 15:14 | 153K | |
| php80-pecl-psr-1.2.0..> | 2023-10-08 20:28 | 15K | |
| php80-pecl-qrencode-..> | 2023-10-14 16:29 | 6.3K | |
| php80-pecl-radius-1...> | 2023-10-08 01:45 | 30K | |
| php80-pecl-raphf-2.0..> | 2023-10-07 19:39 | 10K | |
| php80-pecl-rar-4.2.0..> | 2023-10-09 20:44 | 139K | |
| php80-pecl-rdkafka-6..> | 2023-10-08 12:28 | 39K | |
| php80-pecl-redis-5.3..> | 2023-10-08 06:21 | 153K | |
| php80-pecl-rrd-2.0.3..> | 2023-10-10 13:01 | 12K | |
| php80-pecl-runkit7-4..> | 2023-10-09 17:47 | 37K | |
| php80-pecl-scrypt-2...> | 2023-10-09 14:02 | 16K | |
| php80-pecl-smbclient..> | 2023-10-08 09:10 | 21K | |
| php80-pecl-solr-2.6...> | 2023-10-09 17:08 | 71K | |
| php80-pecl-ssh2-1.3...> | 2023-10-08 01:08 | 25K | |
| php80-pecl-stomp-2.0..> | 2023-10-09 14:01 | 17K | |
| php80-pecl-swoole-5...> | 2023-10-09 07:18 | 748K | |
| php80-pecl-sync-1.1...> | 2023-10-09 06:44 | 13K | |
| php80-pecl-timezoned..> | 2023-10-08 22:42 | 231K | |
| php80-pecl-uploadpro..> | 2023-10-14 10:18 | 6.5K | |
| php80-pecl-uuid-1.2...> | 2023-10-07 15:17 | 6.4K | |
| php80-pecl-uv-0.3.0.pkg | 2023-10-10 14:17 | 45K | |
| php80-pecl-vips-1.0...> | 2023-10-10 22:55 | 16K | |
| php80-pecl-vld-0.18...> | 2023-10-09 07:36 | 16K | |
| php80-pecl-xdebug-3...> | 2023-10-08 21:58 | 120K | |
| php80-pecl-xdiff-2.1..> | 2023-10-09 01:19 | 8.5K | |
| php80-pecl-xmlrpc-1...> | 2023-10-07 23:46 | 36K | |
| php80-pecl-yac-2.2.1..> | 2023-10-10 13:12 | 20K | |
| php80-pecl-yaconf-1...> | 2023-10-09 05:20 | 11K | |
| php80-pecl-yaf-3.3.5..> | 2023-10-09 10:29 | 87K | |
| php80-pecl-yaml-2.2...> | 2023-10-09 13:04 | 19K | |
| php80-pecl-yar-2.3.2..> | 2023-10-14 11:45 | 30K | |
| php80-pecl-zephir_pa..> | 2023-10-08 04:44 | 40K | |
| php80-pecl-zookeeper..> | 2023-10-09 02:49 | 22K | |
| php80-pgsql-8.0.30.pkg | 2023-10-06 17:56 | 43K | |
| php80-phalcon-5.3.0.pkg | 2023-10-11 12:48 | 1.8M | |
| php80-phar-8.0.30.pkg | 2023-10-07 08:07 | 106K | |
| php80-posix-8.0.30.pkg | 2023-10-06 16:34 | 12K | |
| php80-pspell-8.0.30.pkg | 2023-10-14 05:18 | 8.5K | |
| php80-readline-8.0.3..> | 2023-10-07 13:11 | 13K | |
| php80-session-8.0.30..> | 2023-10-06 15:05 | 35K | |
| php80-shmop-8.0.30.pkg | 2023-10-08 21:48 | 6.5K | |
| php80-simplexml-8.0...> | 2023-10-06 16:45 | 22K | |
| php80-snappy-0.2.1.pkg | 2023-10-09 05:14 | 3.9K | |
| php80-snmp-8.0.30.pkg | 2023-10-07 20:15 | 20K | |
| php80-snuffleupagus-..> | 2023-10-10 06:08 | 67K | |
| php80-soap-8.0.30.pkg | 2023-10-06 17:00 | 110K | |
| php80-sockets-8.0.30..> | 2023-10-06 16:52 | 38K | |
| php80-sodium-8.0.30.pkg | 2023-10-08 07:48 | 24K | |
| php80-sqlite3-8.0.30..> | 2023-10-06 17:44 | 21K | |
| php80-sysvmsg-8.0.30..> | 2023-10-07 10:52 | 7.9K | |
| php80-sysvsem-8.0.30..> | 2023-10-07 06:32 | 6.3K | |
| php80-sysvshm-8.0.30..> | 2023-10-08 12:04 | 7.3K | |
| php80-tarantool-0.3...> | 2023-10-08 17:22 | 44K | |
| php80-tidy-8.0.30.pkg | 2023-10-08 02:18 | 18K | |
| php80-tokenizer-8.0...> | 2023-10-07 10:16 | 11K | |
| php80-xapian-1.4.23.pkg | 2023-10-09 11:21 | 261K | |
| php80-xml-8.0.30.pkg | 2023-10-06 08:28 | 19K | |
| php80-xmlreader-8.0...> | 2023-10-07 09:28 | 13K | |
| php80-xmlwriter-8.0...> | 2023-10-07 01:18 | 14K | |
| php80-xsl-8.0.30.pkg | 2023-10-07 01:05 | 13K | |
| php80-zephir-0.17.0.pkg | 2023-10-10 11:17 | 1.5M | |
| php80-zip-8.0.30.pkg | 2023-10-07 00:56 | 24K | |
| php80-zlib-8.0.30.pkg | 2023-10-06 08:32 | 18K | |
| php80-zstd-0.11.0.pkg | 2023-10-09 16:19 | 8.0K | |
| php81-8.1.23.pkg | 2023-10-05 17:41 | 4.4M | |
| php81-Ice37-3.7.6.pkg | 2023-10-10 03:37 | 166K | |
| php81-aphpbreakdown-..> | 2023-10-10 10:27 | 50K | |
| php81-aphpunit-2.1.pkg | 2023-10-10 13:25 | 13K | |
| php81-bcmath-8.1.23.pkg | 2023-10-06 15:18 | 19K | |
| php81-brotli-0.13.1.pkg | 2023-10-12 06:28 | 9.7K | |
| php81-bsdconv-11.6.0..> | 2023-10-09 03:24 | 7.8K | |
| php81-bz2-8.1.23.pkg | 2023-10-07 06:56 | 10K | |
| php81-calendar-8.1.2..> | 2023-10-07 10:07 | 15K | |
| php81-composer-1.10...> | 2023-10-08 08:24 | 390K | |
| php81-composer2-2.6...> | 2023-10-08 08:05 | 517K | |
| php81-ctype-8.1.23.pkg | 2023-10-06 16:08 | 5.0K | |
| php81-curl-8.1.23.pkg | 2023-10-06 16:59 | 35K | |
| php81-dba-8.1.23.pkg | 2023-10-14 12:29 | 22K | |
| php81-dddbl-2.0.1.pkg | 2023-10-09 12:17 | 9.2K | |
| php81-deployer-6.4.3..> | 2023-10-09 21:12 | 328K | |
| php81-dom-8.1.23.pkg | 2023-10-06 10:03 | 64K | |
| php81-enchant-8.1.23..> | 2023-10-09 19:53 | 9.6K | |
| php81-exif-8.1.23.pkg | 2023-10-07 02:35 | 29K | |
| php81-extensions-1.1..> | 2023-10-09 13:26 | 1.0K | |
| php81-ffi-8.1.23.pkg | 2023-10-09 16:14 | 62K | |
| php81-fileinfo-8.1.2..> | 2023-10-07 01:23 | 299K | |
| php81-filter-8.1.23.pkg | 2023-10-06 22:35 | 20K | |
| php81-ftp-8.1.23.pkg | 2023-10-07 13:13 | 24K | |
| php81-gd-8.1.23.pkg | 2023-10-06 17:03 | 32K | |
| php81-geos-1.0.0.pkg | 2023-10-08 16:23 | 17K | |
| php81-gettext-8.1.23..> | 2023-10-06 16:42 | 6.2K | |
| php81-gmp-8.1.23.pkg | 2023-10-07 01:48 | 21K | |
| php81-iconv-8.1.23.pkg | 2023-10-06 17:52 | 17K | |
| php81-imap-8.1.23.pkg | 2023-10-07 07:24 | 33K | |
| php81-intl-8.1.23.pkg | 2023-10-06 18:21 | 127K | |
| php81-kanboard-1.2.3..> | 2023-10-08 17:20 | 2.3M | |
| php81-ldap-8.1.23.pkg | 2023-10-06 15:47 | 31K | |
| php81-libawl-0.64.pkg | 2023-10-07 20:44 | 82K | |
| php81-lz4-0.4.3.pkg | 2023-10-09 13:41 | 5.5K | |
| php81-matomo-4.13.3.pkg | 2023-10-10 00:26 | 13M | |
| php81-maxminddb-1.6...> | 2023-10-11 13:07 | 6.7K | |
| php81-mbstring-8.1.2..> | 2023-10-06 16:15 | 747K | |
| php81-mysqli-8.1.23.pkg | 2023-10-06 13:27 | 46K | |
| php81-odbc-8.1.23.pkg | 2023-10-08 04:55 | 26K | |
| php81-opcache-8.1.23..> | 2023-10-06 16:42 | 331K | |
| php81-opencc-0.0.0.2..> | 2023-10-08 12:48 | 5.2K | |
| php81-pcntl-8.1.23.pkg | 2023-10-07 03:39 | 14K | |
| php81-pdo-8.1.23.pkg | 2023-10-06 15:18 | 47K | |
| php81-pdo_dblib-8.1...> | 2023-10-10 10:28 | 12K | |
| php81-pdo_firebird-8..> | 2023-10-09 04:15 | 15K | |
| php81-pdo_mysql-8.1...> | 2023-10-06 18:15 | 16K | |
| php81-pdo_odbc-8.1.2..> | 2023-10-07 10:17 | 12K | |
| php81-pdo_pgsql-8.1...> | 2023-10-06 16:36 | 18K | |
| php81-pdo_sqlite-8.1..> | 2023-10-06 17:35 | 12K | |
| php81-pear-1.10.13.pkg | 2023-10-06 09:06 | 249K | |
| php81-pear-Auth-1.6...> | 2023-10-08 12:55 | 47K | |
| php81-pear-Auth_HTTP..> | 2023-10-08 16:47 | 8.9K | |
| php81-pear-Auth_Pref..> | 2023-10-10 00:59 | 11K | |
| php81-pear-Auth_RADI..> | 2023-10-08 23:53 | 8.7K | |
| php81-pear-Auth_SASL..> | 2023-10-07 08:14 | 9.3K | |
| php81-pear-Auth_SASL..> | 2023-10-08 15:32 | 9.0K | |
| php81-pear-Benchmark..> | 2023-10-08 12:08 | 8.9K | |
| php81-pear-Cache-1.5..> | 2023-10-08 03:21 | 28K | |
| php81-pear-Cache_Lit..> | 2023-10-07 11:50 | 31K | |
| php81-pear-Config-1...> | 2023-10-09 12:31 | 30K | |
| php81-pear-Console_C..> | 2023-10-14 04:20 | 5.4K | |
| php81-pear-Console_C..> | 2023-10-08 00:41 | 37K | |
| php81-pear-Console_G..> | 2023-10-08 08:28 | 17K | |
| php81-pear-Console_T..> | 2023-10-06 20:27 | 12K | |
| php81-pear-Contact_V..> | 2023-10-10 01:37 | 16K | |
| php81-pear-Contact_V..> | 2023-10-11 05:02 | 10K | |
| php81-pear-Crypt_Blo..> | 2023-10-09 12:59 | 16K | |
| php81-pear-Crypt_CBC..> | 2023-10-14 10:10 | 4.3K | |
| php81-pear-Crypt_CHA..> | 2023-10-07 20:23 | 5.8K | |
| php81-pear-Crypt_Dif..> | 2023-10-11 17:03 | 11K | |
| php81-pear-Crypt_GPG..> | 2023-10-08 13:23 | 283K | |
| php81-pear-Crypt_HMA..> | 2023-10-07 19:48 | 8.3K | |
| php81-pear-Crypt_Mic..> | 2023-10-11 01:58 | 3.7K | |
| php81-pear-Crypt_RC4..> | 2023-10-09 02:45 | 2.9K | |
| php81-pear-Crypt_RSA..> | 2023-10-09 14:07 | 20K | |
| php81-pear-Crypt_XXT..> | 2023-10-09 13:18 | 6.8K | |
| php81-pear-DB-1.11.0..> | 2023-10-07 02:24 | 83K | |
| php81-pear-DBA-1.1.1..> | 2023-10-07 20:17 | 13K | |
| php81-pear-DBA_Relat..> | 2023-10-10 09:45 | 19K | |
| php81-pear-DB_DataOb..> | 2023-10-07 11:46 | 68K | |
| php81-pear-DB_DataOb..> | 2023-10-14 13:12 | 59K | |
| php81-pear-DB_Pager-..> | 2023-10-08 14:07 | 4.5K | |
| php81-pear-DB_QueryT..> | 2023-10-11 16:36 | 38K | |
| php81-pear-DB_Sqlite..> | 2023-10-14 18:51 | 18K | |
| php81-pear-DB_Table-..> | 2023-10-08 23:18 | 90K | |
| php81-pear-DB_ldap-1..> | 2023-10-14 12:32 | 10K | |
| php81-pear-DB_ldap2-..> | 2023-10-10 10:51 | 18K | |
| php81-pear-Date-1.4...> | 2023-10-07 06:30 | 41K | |
| php81-pear-Date_Holi..> | 2023-10-08 06:49 | 33K | |
| php81-pear-Date_Holi..> | 2023-10-09 15:22 | 5.5K | |
| php81-pear-Date_Holi..> | 2023-10-10 02:48 | 4.6K | |
| php81-pear-Date_Holi..> | 2023-10-09 07:02 | 4.3K | |
| php81-pear-Date_Holi..> | 2023-10-09 17:55 | 3.6K | |
| php81-pear-Date_Holi..> | 2023-10-10 08:00 | 4.2K | |
| php81-pear-Date_Holi..> | 2023-10-14 15:48 | 12K | |
| php81-pear-Date_Holi..> | 2023-10-12 07:20 | 5.1K | |
| php81-pear-Date_Holi..> | 2023-10-10 18:19 | 4.9K | |
| php81-pear-Date_Holi..> | 2023-10-08 12:02 | 4.5K | |
| php81-pear-Date_Holi..> | 2023-10-10 19:54 | 8.8K | |
| php81-pear-Date_Holi..> | 2023-10-10 09:08 | 5.4K | |
| php81-pear-Date_Holi..> | 2023-10-09 18:05 | 4.0K | |
| php81-pear-Date_Holi..> | 2023-10-10 14:16 | 4.0K | |
| php81-pear-Date_Holi..> | 2023-10-09 23:16 | 3.5K | |
| php81-pear-Date_Holi..> | 2023-10-09 11:30 | 4.1K | |
| php81-pear-Date_Holi..> | 2023-10-11 13:22 | 6.3K | |
| php81-pear-Date_Holi..> | 2023-10-09 09:59 | 9.1K | |
| php81-pear-Date_Holi..> | 2023-10-14 11:58 | 5.2K | |
| php81-pear-Date_Holi..> | 2023-10-11 11:01 | 3.7K | |
| php81-pear-Event_Dis..> | 2023-10-07 07:28 | 8.9K | |
| php81-pear-FSM-1.4.0..> | 2023-10-10 00:32 | 11K | |
| php81-pear-File-1.4...> | 2023-10-08 01:19 | 8.7K | |
| php81-pear-File_Arch..> | 2023-10-08 13:14 | 52K | |
| php81-pear-File_Bitt..> | 2023-10-09 19:16 | 70K | |
| php81-pear-File_DNS-..> | 2023-10-10 22:15 | 10K | |
| php81-pear-File_Find..> | 2023-10-08 07:28 | 8.6K | |
| php81-pear-File_Fort..> | 2023-10-10 20:33 | 14K | |
| php81-pear-File_Fsta..> | 2023-10-10 02:39 | 7.5K | |
| php81-pear-File_Gett..> | 2023-10-10 16:24 | 7.6K | |
| php81-pear-File_HtAc..> | 2023-10-14 12:22 | 5.5K | |
| php81-pear-File_Iter..> | 2023-10-08 09:56 | 1.6K | |
| php81-pear-File_MARC..> | 2023-10-14 13:53 | 75K | |
| php81-pear-File_PDF-..> | 2023-10-11 07:30 | 36K | |
| php81-pear-File_Pass..> | 2023-10-08 21:51 | 21K | |
| php81-pear-File_SMBP..> | 2023-10-10 17:23 | 5.7K | |
| php81-pear-Games_Che..> | 2023-10-09 16:50 | 81K | |
| php81-pear-HTML_AJAX..> | 2023-10-07 21:47 | 89K | |
| php81-pear-HTML_BBCo..> | 2023-10-14 06:53 | 16K | |
| php81-pear-HTML_CSS-..> | 2023-10-14 03:02 | 38K | |
| php81-pear-HTML_Comm..> | 2023-10-07 02:35 | 5.0K | |
| php81-pear-HTML_Comm..> | 2023-10-08 11:03 | 9.4K | |
| php81-pear-HTML_Cryp..> | 2023-10-09 16:05 | 5.0K | |
| php81-pear-HTML_Form..> | 2023-10-08 19:30 | 14K | |
| php81-pear-HTML_Java..> | 2023-10-11 00:24 | 8.8K | |
| php81-pear-HTML_Page..> | 2023-10-09 17:33 | 18K | |
| php81-pear-HTML_Quic..> | 2023-10-08 05:21 | 84K | |
| php81-pear-HTML_Quic..> | 2023-10-09 18:51 | 143K | |
| php81-pear-HTML_Quic..> | 2023-10-09 06:24 | 17K | |
| php81-pear-HTML_Quic..> | 2023-10-10 21:50 | 14K | |
| php81-pear-HTML_Quic..> | 2023-10-10 16:01 | 7.3K | |
| php81-pear-HTML_Quic..> | 2023-10-10 04:37 | 3.1K | |
| php81-pear-HTML_Quic..> | 2023-10-08 11:56 | 27K | |
| php81-pear-HTML_Sele..> | 2023-10-14 14:59 | 6.2K | |
| php81-pear-HTML_Sele..> | 2023-10-10 18:10 | 8.3K | |
| php81-pear-HTML_Tabl..> | 2023-10-08 11:01 | 15K | |
| php81-pear-HTML_TagC..> | 2023-10-09 19:16 | 12K | |
| php81-pear-HTML_Temp..> | 2023-10-07 16:10 | 146K | |
| php81-pear-HTML_Temp..> | 2023-10-07 15:05 | 22K | |
| php81-pear-HTML_Temp..> | 2023-10-10 02:00 | 18K | |
| php81-pear-HTML_Temp..> | 2023-10-11 23:56 | 28K | |
| php81-pear-HTML_Tree..> | 2023-10-09 17:18 | 48K | |
| php81-pear-HTTP-1.4...> | 2023-10-07 07:54 | 9.0K | |
| php81-pear-HTTP_Clie..> | 2023-10-11 03:39 | 10K | |
| php81-pear-HTTP_Down..> | 2023-10-10 17:34 | 14K | |
| php81-pear-HTTP_Floo..> | 2023-10-14 11:45 | 6.6K | |
| php81-pear-HTTP_Head..> | 2023-10-07 16:59 | 11K | |
| php81-pear-HTTP_Requ..> | 2023-10-07 01:35 | 16K | |
| php81-pear-HTTP_Requ..> | 2023-10-07 17:09 | 108K | |
| php81-pear-HTTP_Serv..> | 2023-10-09 17:12 | 7.4K | |
| php81-pear-HTTP_Sess..> | 2023-10-09 22:46 | 16K | |
| php81-pear-HTTP_Uplo..> | 2023-10-08 13:13 | 9.4K | |
| php81-pear-HTTP_WebD..> | 2023-10-09 12:24 | 9.2K | |
| php81-pear-HTTP_WebD..> | 2023-10-09 12:53 | 28K | |
| php81-pear-Horde_Cry..> | 2023-10-10 20:13 | 115K | |
| php81-pear-Horde_Cry..> | 2023-10-06 17:32 | 24K | |
| php81-pear-Horde_Ima..> | 2023-10-14 13:18 | 595K | |
| php81-pear-Horde_Ima..> | 2023-10-08 03:16 | 200K | |
| php81-pear-Horde_Kol..> | 2023-10-07 18:50 | 85K | |
| php81-pear-Horde_Log..> | 2023-10-06 16:08 | 15K | |
| php81-pear-Horde_Map..> | 2023-10-06 18:07 | 18K | |
| php81-pear-Horde_Smt..> | 2023-10-06 22:04 | 31K | |
| php81-pear-Horde_Vfs..> | 2023-10-08 06:27 | 62K | |
| php81-pear-I18N-1.0...> | 2023-10-07 19:16 | 29K | |
| php81-pear-I18Nv2-0...> | 2023-10-08 23:56 | 200K | |
| php81-pear-Image_3D-..> | 2023-10-14 06:43 | 90K | |
| php81-pear-Image_Bar..> | 2023-10-12 02:19 | 13K | |
| php81-pear-Image_Bar..> | 2023-10-09 15:24 | 15K | |
| php81-pear-Image_Can..> | 2023-10-07 21:13 | 37K | |
| php81-pear-Image_Col..> | 2023-10-07 07:25 | 9.3K | |
| php81-pear-Image_Gra..> | 2023-10-08 18:14 | 325K | |
| php81-pear-Image_Gra..> | 2023-10-08 19:39 | 16K | |
| php81-pear-Image_Tra..> | 2023-10-09 11:03 | 385K | |
| php81-pear-LiveUser-..> | 2023-10-08 04:12 | 62K | |
| php81-pear-LiveUser_..> | 2023-10-09 14:35 | 53K | |
| php81-pear-Log-1.13...> | 2023-10-07 14:33 | 40K | |
| php81-pear-MDB-1.3.0..> | 2023-10-08 02:18 | 125K | |
| php81-pear-MDB2-2.5...> | 2023-10-07 22:55 | 102K | |
| php81-pear-MDB2_Driv..> | 2023-10-08 18:08 | 34K | |
| php81-pear-MDB2_Driv..> | 2023-10-14 10:22 | 29K | |
| php81-pear-MDB2_Sche..> | 2023-10-14 17:25 | 63K | |
| php81-pear-MDB_Query..> | 2023-10-10 08:07 | 42K | |
| php81-pear-MIME_Type..> | 2023-10-07 21:59 | 19K | |
| php81-pear-Mail-1.5...> | 2023-10-07 17:09 | 21K | |
| php81-pear-Mail_Mbox..> | 2023-10-09 23:58 | 14K | |
| php81-pear-Mail_Mime..> | 2023-10-07 07:01 | 35K | |
| php81-pear-Mail_Queu..> | 2023-10-11 00:24 | 20K | |
| php81-pear-Mail_mime..> | 2023-10-07 21:37 | 13K | |
| php81-pear-Math_BigI..> | 2023-10-06 13:52 | 24K | |
| php81-pear-Math_Comb..> | 2023-10-10 17:33 | 5.8K | |
| php81-pear-Math_Frac..> | 2023-10-14 12:58 | 4.7K | |
| php81-pear-Net_CDDB-..> | 2023-10-14 07:17 | 46K | |
| php81-pear-Net_Check..> | 2023-10-08 07:42 | 2.6K | |
| php81-pear-Net_Cyrus..> | 2023-10-09 11:40 | 6.2K | |
| php81-pear-Net_DIME-..> | 2023-10-08 13:12 | 7.5K | |
| php81-pear-Net_DNS2-..> | 2023-10-08 05:01 | 68K | |
| php81-pear-Net_DNSBL..> | 2023-10-08 12:51 | 8.5K | |
| php81-pear-Net_Dict-..> | 2023-10-14 10:29 | 6.4K | |
| php81-pear-Net_FTP-1..> | 2023-10-09 18:08 | 30K | |
| php81-pear-Net_Finge..> | 2023-10-09 03:44 | 2.3K | |
| php81-pear-Net_Gearm..> | 2023-10-09 19:38 | 17K | |
| php81-pear-Net_Geo-1..> | 2023-10-08 17:28 | 8.1K | |
| php81-pear-Net_GeoIP..> | 2023-10-08 20:16 | 13K | |
| php81-pear-Net_Growl..> | 2023-10-14 10:46 | 457K | |
| php81-pear-Net_IDNA-..> | 2023-10-09 13:43 | 16K | |
| php81-pear-Net_IMAP-..> | 2023-10-07 19:11 | 35K | |
| php81-pear-Net_IPv4-..> | 2023-10-07 11:55 | 6.7K | |
| php81-pear-Net_IPv6-..> | 2023-10-07 10:37 | 12K | |
| php81-pear-Net_Ident..> | 2023-10-08 20:27 | 3.8K | |
| php81-pear-Net_LDAP-..> | 2023-10-08 21:18 | 63K | |
| php81-pear-Net_LDAP2..> | 2023-10-09 14:10 | 80K | |
| php81-pear-Net_LMTP-..> | 2023-10-09 15:09 | 6.7K | |
| php81-pear-Net_MAC-0..> | 2023-10-10 01:07 | 5.6K | |
| php81-pear-Net_NNTP-..> | 2023-10-09 15:13 | 32K | |
| php81-pear-Net_Nmap-..> | 2023-10-10 09:39 | 23K | |
| php81-pear-Net_POP3-..> | 2023-10-09 20:53 | 9.6K | |
| php81-pear-Net_Ping-..> | 2023-10-10 09:08 | 9.6K | |
| php81-pear-Net_Ports..> | 2023-10-10 22:40 | 3.4K | |
| php81-pear-Net_SMS-0..> | 2023-10-14 16:06 | 18K | |
| php81-pear-Net_SMTP-..> | 2023-10-06 10:58 | 15K | |
| php81-pear-Net_Serve..> | 2023-10-08 09:16 | 17K | |
| php81-pear-Net_Sieve..> | 2023-10-14 11:10 | 14K | |
| php81-pear-Net_Smart..> | 2023-10-08 13:01 | 101K | |
| php81-pear-Net_Socke..> | 2023-10-06 10:07 | 7.0K | |
| php81-pear-Net_Trace..> | 2023-10-09 09:17 | 7.2K | |
| php81-pear-Net_URL-1..> | 2023-10-06 19:41 | 6.6K | |
| php81-pear-Net_URL2-..> | 2023-10-07 09:27 | 18K | |
| php81-pear-Net_URL_M..> | 2023-10-09 12:28 | 13K | |
| php81-pear-Net_UserA..> | 2023-10-08 12:12 | 12K | |
| php81-pear-Net_UserA..> | 2023-10-12 12:18 | 30K | |
| php81-pear-Net_Vpopm..> | 2023-10-09 17:23 | 20K | |
| php81-pear-Net_Whois..> | 2023-10-14 10:15 | 6.7K | |
| php81-pear-Numbers_R..> | 2023-10-08 13:32 | 6.5K | |
| php81-pear-Numbers_W..> | 2023-10-12 06:28 | 43K | |
| php81-pear-OLE-1.0.0..> | 2023-10-07 05:34 | 13K | |
| php81-pear-PEAR_Info..> | 2023-10-09 16:25 | 44K | |
| php81-pear-PEAR_Pack..> | 2023-10-08 16:54 | 33K | |
| php81-pear-PEAR_Pack..> | 2023-10-10 15:29 | 34K | |
| php81-pear-PEAR_Pack..> | 2023-10-08 10:36 | 20K | |
| php81-pear-PHPTAL-1...> | 2023-10-08 18:03 | 148K | |
| php81-pear-PHP_Archi..> | 2023-10-09 16:28 | 45K | |
| php81-pear-PHP_Array..> | 2023-10-10 19:42 | 8.1K | |
| php81-pear-PHP_Beaut..> | 2023-10-08 14:31 | 66K | |
| php81-pear-PHP_CodeC..> | 2023-10-14 13:13 | 5.3K | |
| php81-pear-PHP_CodeS..> | 2023-10-09 16:27 | 609K | |
| php81-pear-PHP_Compa..> | 2023-10-09 01:50 | 41K | |
| php81-pear-PHP_Compa..> | 2023-10-10 19:23 | 133K | |
| php81-pear-PHP_Parse..> | 2023-10-14 10:57 | 81K | |
| php81-pear-PHP_Parse..> | 2023-10-14 11:00 | 133K | |
| php81-pear-PHP_Shell..> | 2023-10-10 16:20 | 84K | |
| php81-pear-PHP_Timer..> | 2023-10-08 05:34 | 1.4K | |
| php81-pear-PHP_Token..> | 2023-10-08 05:49 | 4.2K | |
| php81-pear-PHP_UML-1..> | 2023-10-14 17:14 | 405K | |
| php81-pear-Pager-2.5..> | 2023-10-07 03:29 | 31K | |
| php81-pear-Payment_D..> | 2023-10-09 15:14 | 38K | |
| php81-pear-PhpDocume..> | 2023-10-11 06:13 | 945K | |
| php81-pear-SOAP-0.14..> | 2023-10-11 01:11 | 72K | |
| php81-pear-Sebastian..> | 2023-10-07 12:55 | 1.4K | |
| php81-pear-Sebastian..> | 2023-10-07 20:02 | 2.2K | |
| php81-pear-Sebastian..> | 2023-10-14 12:38 | 1.8K | |
| php81-pear-Sebastian..> | 2023-10-09 23:34 | 2.2K | |
| php81-pear-Sebastian..> | 2023-10-08 11:49 | 1.3K | |
| php81-pear-Services_..> | 2023-10-08 21:29 | 15K | |
| php81-pear-Services_..> | 2023-10-09 04:07 | 27K | |
| php81-pear-Services_..> | 2023-10-09 18:57 | 16K | |
| php81-pear-Services_..> | 2023-10-14 08:04 | 3.5K | |
| php81-pear-Services_..> | 2023-10-10 21:58 | 9.8K | |
| php81-pear-Services_..> | 2023-10-09 18:15 | 22K | |
| php81-pear-Services_..> | 2023-10-09 19:03 | 71K | |
| php81-pear-Services_..> | 2023-10-14 13:17 | 37K | |
| php81-pear-Services_..> | 2023-10-08 20:42 | 3.9K | |
| php81-pear-Services_..> | 2023-10-10 07:52 | 9.5K | |
| php81-pear-Services_..> | 2023-10-09 12:51 | 5.1K | |
| php81-pear-Services_..> | 2023-10-09 16:52 | 8.7K | |
| php81-pear-Services_..> | 2023-10-10 02:54 | 10K | |
| php81-pear-Services_..> | 2023-10-10 23:27 | 4.7K | |
| php81-pear-Services_..> | 2023-10-09 08:20 | 5.9K | |
| php81-pear-Services_..> | 2023-10-08 13:31 | 55K | |
| php81-pear-Services_..> | 2023-10-11 01:35 | 11K | |
| php81-pear-Services_..> | 2023-10-09 03:25 | 13K | |
| php81-pear-Services_..> | 2023-10-09 08:28 | 43K | |
| php81-pear-Services_..> | 2023-10-08 17:47 | 14K | |
| php81-pear-Services_..> | 2023-10-09 05:27 | 12K | |
| php81-pear-Services_..> | 2023-10-14 11:02 | 4.2K | |
| php81-pear-Spreadshe..> | 2023-10-08 05:25 | 47K | |
| php81-pear-Structure..> | 2023-10-07 00:01 | 42K | |
| php81-pear-Structure..> | 2023-10-07 21:51 | 4.0K | |
| php81-pear-Structure..> | 2023-10-10 20:39 | 4.7K | |
| php81-pear-Structure..> | 2023-10-09 14:20 | 3.1K | |
| php81-pear-Structure..> | 2023-10-09 06:17 | 4.7K | |
| php81-pear-Structure..> | 2023-10-09 12:42 | 4.5K | |
| php81-pear-Structure..> | 2023-10-09 06:25 | 3.6K | |
| php81-pear-Structure..> | 2023-10-10 12:23 | 9.3K | |
| php81-pear-Structure..> | 2023-10-09 19:09 | 4.7K | |
| php81-pear-Structure..> | 2023-10-10 06:29 | 6.6K | |
| php81-pear-Structure..> | 2023-10-08 03:28 | 4.9K | |
| php81-pear-Structure..> | 2023-10-10 00:50 | 6.3K | |
| php81-pear-Structure..> | 2023-10-14 06:28 | 5.4K | |
| php81-pear-Structure..> | 2023-10-09 23:39 | 4.4K | |
| php81-pear-Structure..> | 2023-10-14 12:11 | 4.3K | |
| php81-pear-Structure..> | 2023-10-14 10:39 | 12K | |
| php81-pear-Symfony_C..> | 2023-10-07 20:05 | 76K | |
| php81-pear-Symfony_C..> | 2023-10-07 01:19 | 33K | |
| php81-pear-Symfony_C..> | 2023-10-12 10:04 | 37K | |
| php81-pear-System_Co..> | 2023-10-09 03:15 | 6.9K | |
| php81-pear-Testing_S..> | 2023-10-10 20:49 | 2.3M | |
| php81-pear-Text_Diff..> | 2023-10-10 07:36 | 20K | |
| php81-pear-Text_Figl..> | 2023-10-14 17:57 | 8.4K | |
| php81-pear-Text_High..> | 2023-10-10 18:14 | 79K | |
| php81-pear-Text_Pass..> | 2023-10-09 12:48 | 5.9K | |
| php81-pear-Text_Spel..> | 2023-10-10 07:09 | 115K | |
| php81-pear-Text_Temp..> | 2023-10-07 22:44 | 1.4K | |
| php81-pear-Text_Wiki..> | 2023-10-11 07:35 | 75K | |
| php81-pear-TheSeer_D..> | 2023-10-10 05:24 | 2.8K | |
| php81-pear-TheSeer_f..> | 2023-10-07 01:04 | 4.9K | |
| php81-pear-TheSeer_f..> | 2023-10-09 22:54 | 6.4K | |
| php81-pear-Translati..> | 2023-10-10 11:05 | 46K | |
| php81-pear-UDDI-0.2...> | 2023-10-11 11:18 | 7.3K | |
| php81-pear-URI_Templ..> | 2023-10-09 14:23 | 7.0K | |
| php81-pear-VFS-0.3.0..> | 2023-10-09 20:34 | 36K | |
| php81-pear-Validate-..> | 2023-10-07 15:05 | 20K | |
| php81-pear-Validate_..> | 2023-10-08 17:46 | 9.3K | |
| php81-pear-Validate_..> | 2023-10-10 16:57 | 10K | |
| php81-pear-Validate_..> | 2023-10-09 07:45 | 6.9K | |
| php81-pear-Validate_..> | 2023-10-09 16:49 | 6.2K | |
| php81-pear-Validate_..> | 2023-10-09 17:34 | 9.1K | |
| php81-pear-Var_Dump-..> | 2023-10-14 15:25 | 17K | |
| php81-pear-VersionCo..> | 2023-10-08 19:34 | 15K | |
| php81-pear-VersionCo..> | 2023-10-10 08:04 | 27K | |
| php81-pear-XML_Beaut..> | 2023-10-09 15:30 | 13K | |
| php81-pear-XML_DTD-0..> | 2023-10-08 10:11 | 32K | |
| php81-pear-XML_Feed_..> | 2023-10-10 02:02 | 265K | |
| php81-pear-XML_GRDDL..> | 2023-10-11 17:51 | 43K | |
| php81-pear-XML_HTMLS..> | 2023-10-14 09:12 | 15K | |
| php81-pear-XML_NITF-..> | 2023-10-08 15:04 | 7.9K | |
| php81-pear-XML_Parse..> | 2023-10-06 19:44 | 14K | |
| php81-pear-XML_Query..> | 2023-10-09 19:40 | 296K | |
| php81-pear-XML_RPC-1..> | 2023-10-07 21:49 | 23K | |
| php81-pear-XML_RPC2-..> | 2023-10-08 19:34 | 56K | |
| php81-pear-XML_RSS-1..> | 2023-10-07 19:15 | 8.2K | |
| php81-pear-XML_SVG-1..> | 2023-10-08 19:30 | 8.8K | |
| php81-pear-XML_Seria..> | 2023-10-07 07:24 | 30K | |
| php81-pear-XML_Trans..> | 2023-10-11 17:09 | 26K | |
| php81-pear-XML_Tree-..> | 2023-10-14 05:12 | 5.2K | |
| php81-pear-XML_Util-..> | 2023-10-06 19:50 | 17K | |
| php81-pear-XML_Wddx-..> | 2023-10-10 12:01 | 6.7K | |
| php81-pear-YAML-1.0...> | 2023-10-09 04:09 | 10K | |
| php81-pear-channel-d..> | 2023-10-07 07:36 | 1.1K | |
| php81-pear-channel-e..> | 2023-10-06 21:38 | 1.1K | |
| php81-pear-channel-g..> | 2023-10-08 03:54 | 1.0K | |
| php81-pear-channel-h..> | 2023-10-06 09:24 | 1.0K | |
| php81-pear-channel-h..> | 2023-10-07 15:19 | 1.4K | |
| php81-pear-channel-o..> | 2023-10-10 15:27 | 1.0K | |
| php81-pear-channel-p..> | 2023-10-08 06:57 | 1.0K | |
| php81-pear-channel-p..> | 2023-10-07 15:51 | 1.0K | |
| php81-pear-channel-p..> | 2023-10-09 09:42 | 1.1K | |
| php81-pear-channel-p..> | 2023-10-08 23:57 | 1.0K | |
| php81-pear-channel-p..> | 2023-10-07 14:16 | 1.1K | |
| php81-pear-channel-s..> | 2023-10-08 11:47 | 1.1K | |
| php81-pear-channel-s..> | 2023-10-06 22:48 | 1.1K | |
| php81-pear-channel-t..> | 2023-10-06 21:52 | 1.0K | |
| php81-pear-channel-t..> | 2023-10-07 12:11 | 1.1K | |
| php81-pear-codegen-1..> | 2023-10-09 19:53 | 42K | |
| php81-pear-doctrine-..> | 2023-10-08 05:40 | 51K | |
| php81-pear-doctrine-..> | 2023-10-09 23:02 | 113K | |
| php81-pear-ezc_Base-..> | 2023-10-07 04:21 | 210K | |
| php81-pear-ezc_Conso..> | 2023-10-07 22:51 | 736K | |
| php81-pear-geshi-ges..> | 2023-10-08 23:13 | 641K | |
| php81-pear-horde-Hor..> | 2023-10-06 20:21 | 310K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:10 | 37K | |
| php81-pear-horde-Hor..> | 2023-10-09 22:02 | 58K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:02 | 52K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:53 | 15K | |
| php81-pear-horde-Hor..> | 2023-10-08 19:08 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-06 17:44 | 36K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:48 | 26K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:37 | 29K | |
| php81-pear-horde-Hor..> | 2023-10-06 17:07 | 2.1M | |
| php81-pear-horde-Hor..> | 2023-10-06 17:08 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-06 14:13 | 6.3K | |
| php81-pear-horde-Hor..> | 2023-10-06 21:19 | 12K | |
| php81-pear-horde-Hor..> | 2023-10-07 01:19 | 1.1M | |
| php81-pear-horde-Hor..> | 2023-10-06 23:01 | 12K | |
| php81-pear-horde-Hor..> | 2023-10-06 18:44 | 71K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:57 | 42K | |
| php81-pear-horde-Hor..> | 2023-10-06 13:35 | 63K | |
| php81-pear-horde-Hor..> | 2023-10-10 03:01 | 28K | |
| php81-pear-horde-Hor..> | 2023-10-07 11:07 | 189K | |
| php81-pear-horde-Hor..> | 2023-10-06 14:13 | 71K | |
| php81-pear-horde-Hor..> | 2023-10-10 01:48 | 546K | |
| php81-pear-horde-Hor..> | 2023-10-06 10:33 | 24K | |
| php81-pear-horde-Hor..> | 2023-10-09 08:57 | 1.2M | |
| php81-pear-horde-Hor..> | 2023-10-10 13:07 | 135K | |
| php81-pear-horde-Hor..> | 2023-10-06 15:03 | 22K | |
| php81-pear-horde-Hor..> | 2023-10-06 16:24 | 16K | |
| php81-pear-horde-Hor..> | 2023-10-06 20:54 | 25K | |
| php81-pear-horde-Hor..> | 2023-10-07 01:36 | 15K | |
| php81-pear-horde-Hor..> | 2023-10-06 16:53 | 94K | |
| php81-pear-horde-Hor..> | 2023-10-06 11:06 | 10K | |
| php81-pear-horde-Hor..> | 2023-10-14 11:35 | 32K | |
| php81-pear-horde-Hor..> | 2023-10-06 17:21 | 21K | |
| php81-pear-horde-Hor..> | 2023-10-10 00:19 | 34K | |
| php81-pear-horde-Hor..> | 2023-10-06 20:24 | 15K | |
| php81-pear-horde-Hor..> | 2023-10-08 04:32 | 52K | |
| php81-pear-horde-Hor..> | 2023-10-14 07:40 | 21K | |
| php81-pear-horde-Hor..> | 2023-10-09 09:12 | 138K | |
| php81-pear-horde-Hor..> | 2023-10-07 04:36 | 56K | |
| php81-pear-horde-Hor..> | 2023-10-10 03:49 | 17K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:34 | 17K | |
| php81-pear-horde-Hor..> | 2023-10-06 23:06 | 29K | |
| php81-pear-horde-Hor..> | 2023-10-06 13:36 | 35K | |
| php81-pear-horde-Hor..> | 2023-10-08 18:49 | 18K | |
| php81-pear-horde-Hor..> | 2023-10-09 03:34 | 15K | |
| php81-pear-horde-Hor..> | 2023-10-06 14:34 | 121K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:41 | 261K | |
| php81-pear-horde-Hor..> | 2023-10-08 21:19 | 84K | |
| php81-pear-horde-Hor..> | 2023-10-06 12:06 | 202K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:39 | 20K | |
| php81-pear-horde-Hor..> | 2023-10-08 02:05 | 6.9K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:28 | 16K | |
| php81-pear-horde-Hor..> | 2023-10-14 11:31 | 45K | |
| php81-pear-horde-Hor..> | 2023-10-06 16:03 | 36K | |
| php81-pear-horde-Hor..> | 2023-10-06 20:46 | 50K | |
| php81-pear-horde-Hor..> | 2023-10-09 22:59 | 12K | |
| php81-pear-horde-Hor..> | 2023-10-08 16:05 | 32K | |
| php81-pear-horde-Hor..> | 2023-10-06 16:01 | 11K | |
| php81-pear-horde-Hor..> | 2023-10-06 21:32 | 39K | |
| php81-pear-horde-Hor..> | 2023-10-10 04:42 | 37K | |
| php81-pear-horde-Hor..> | 2023-10-09 19:08 | 14K | |
| php81-pear-horde-Hor..> | 2023-10-14 12:44 | 5.7K | |
| php81-pear-horde-Hor..> | 2023-10-06 20:59 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-06 18:36 | 16K | |
| php81-pear-horde-Hor..> | 2023-10-10 12:00 | 30K | |
| php81-pear-horde-Hor..> | 2023-10-14 15:50 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-12 09:48 | 10K | |
| php81-pear-horde-Hor..> | 2023-10-09 03:54 | 2.9K | |
| php81-pear-horde-Hor..> | 2023-10-09 14:14 | 186K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:57 | 24K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:59 | 54K | |
| php81-pear-horde-Hor..> | 2023-10-06 17:02 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-09 21:50 | 13K | |
| php81-pear-horde-Hor..> | 2023-10-06 15:51 | 18K | |
| php81-pear-horde-Hor..> | 2023-10-06 11:11 | 14K | |
| php81-pear-horde-Hor..> | 2023-10-06 11:27 | 6.4K | |
| php81-pear-horde-Hor..> | 2023-10-06 12:40 | 24K | |
| php81-pear-horde-Hor..> | 2023-10-07 12:26 | 112K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:37 | 14K | |
| php81-pear-horde-Hor..> | 2023-10-08 21:20 | 28K | |
| php81-pear-horde-Hor..> | 2023-10-06 17:20 | 50K | |
| php81-pear-horde-Hor..> | 2023-10-09 19:23 | 23K | |
| php81-pear-horde-Hor..> | 2023-10-06 12:48 | 14K | |
| php81-pear-horde-Hor..> | 2023-10-07 17:15 | 21K | |
| php81-pear-horde-Hor..> | 2023-10-14 08:41 | 26K | |
| php81-pear-horde-Hor..> | 2023-10-06 22:53 | 30K | |
| php81-pear-horde-Hor..> | 2023-10-06 09:42 | 16K | |
| php81-pear-horde-Hor..> | 2023-10-08 13:42 | 18K | |
| php81-pear-horde-Hor..> | 2023-10-06 16:02 | 16K | |
| php81-pear-horde-Hor..> | 2023-10-06 10:19 | 34K | |
| php81-pear-horde-Hor..> | 2023-10-06 19:01 | 40K | |
| php81-pear-horde-Hor..> | 2023-10-07 20:39 | 11K | |
| php81-pear-horde-Hor..> | 2023-10-07 08:13 | 25K | |
| php81-pear-pdepend_s..> | 2023-10-10 16:57 | 32K | |
| php81-pear-phing-2.6..> | 2023-10-08 20:11 | 357K | |
| php81-pear-pirum-Pir..> | 2023-10-09 19:46 | 14K | |
| php81-pear-twig-twig..> | 2023-10-10 17:44 | 91K | |
| php81-pecl-APCu-5.1...> | 2023-10-07 07:24 | 49K | |
| php81-pecl-amqp-1.11..> | 2023-10-10 04:33 | 46K | |
| php81-pecl-ast-1.1.0..> | 2023-10-09 03:15 | 17K | |
| php81-pecl-bitset-3...> | 2023-10-06 18:11 | 9.6K | |
| php81-pecl-couchbase..> | 2023-10-09 11:45 | 27K | |
| php81-pecl-crypto-0...> | 2023-10-10 17:23 | 30K | |
| php81-pecl-dio-0.2.1..> | 2023-10-09 09:37 | 11K | |
| php81-pecl-ds-1.4.0.pkg | 2023-10-08 19:05 | 52K | |
| php81-pecl-eio-3.0.0..> | 2023-10-10 05:42 | 27K | |
| php81-pecl-ev-1.1.5.pkg | 2023-10-09 10:51 | 35K | |
| php81-pecl-event-3.0..> | 2023-10-08 20:14 | 41K | |
| php81-pecl-excimer-1..> | 2023-10-08 19:45 | 20K | |
| php81-pecl-expect-0...> | 2023-10-08 12:16 | 6.9K | |
| php81-pecl-gnupg-1.5..> | 2023-10-08 10:26 | 16K | |
| php81-pecl-grpc-1.58..> | 2023-10-08 16:25 | 2.3M | |
| php81-pecl-horde_lz4..> | 2023-10-09 17:00 | 4.0K | |
| php81-pecl-http-4.2...> | 2023-10-08 21:15 | 129K | |
| php81-pecl-igbinary-..> | 2023-10-10 10:40 | 24K | |
| php81-pecl-imagick-3..> | 2023-10-07 17:52 | 114K | |
| php81-pecl-inotify-3..> | 2023-10-14 10:59 | 6.2K | |
| php81-pecl-json_post..> | 2023-10-09 01:27 | 4.8K | |
| php81-pecl-krb5-1.1...> | 2023-10-09 08:32 | 22K | |
| php81-pecl-leveldb-0..> | 2023-10-08 17:19 | 12K | |
| php81-pecl-libsodium..> | 2023-10-10 03:48 | 22K | |
| php81-pecl-lzf-1.7.0..> | 2023-10-14 10:59 | 7.1K | |
| php81-pecl-mailparse..> | 2023-10-14 10:57 | 25K | |
| php81-pecl-mcrypt-1...> | 2023-10-06 18:04 | 13K | |
| php81-pecl-memcache-..> | 2023-10-06 18:16 | 40K | |
| php81-pecl-memcached..> | 2023-10-06 16:16 | 46K | |
| php81-pecl-mongodb-1..> | 2023-10-10 21:42 | 558K | |
| php81-pecl-msgpack-2..> | 2023-10-07 11:48 | 23K | |
| php81-pecl-mustache-..> | 2023-10-09 17:19 | 24K | |
| php81-pecl-oauth-2.0..> | 2023-10-09 14:25 | 33K | |
| php81-pecl-pam-2.2.4..> | 2023-10-11 05:10 | 7.9K | |
| php81-pecl-pkcs11-1...> | 2023-10-08 23:15 | 43K | |
| php81-pecl-proctitle..> | 2023-10-14 13:53 | 3.6K | |
| php81-pecl-protobuf-..> | 2023-10-08 18:07 | 153K | |
| php81-pecl-psr-1.2.0..> | 2023-10-10 02:28 | 15K | |
| php81-pecl-qrencode-..> | 2023-10-14 05:38 | 6.4K | |
| php81-pecl-radius-1...> | 2023-10-07 12:42 | 30K | |
| php81-pecl-raphf-2.0..> | 2023-10-07 14:48 | 10K | |
| php81-pecl-rdkafka-6..> | 2023-10-08 14:12 | 39K | |
| php81-pecl-redis-5.3..> | 2023-10-08 07:09 | 154K | |
| php81-pecl-rrd-2.0.3..> | 2023-10-10 19:16 | 12K | |
| php81-pecl-runkit7-4..> | 2023-10-08 19:07 | 37K | |
| php81-pecl-scrypt-2...> | 2023-10-08 20:47 | 16K | |
| php81-pecl-smbclient..> | 2023-10-08 07:54 | 22K | |
| php81-pecl-solr-2.6...> | 2023-10-14 17:41 | 72K | |
| php81-pecl-ssh2-1.3...> | 2023-10-08 02:04 | 25K | |
| php81-pecl-stomp-2.0..> | 2023-10-09 18:10 | 17K | |
| php81-pecl-swoole-5...> | 2023-10-08 20:19 | 749K | |
| php81-pecl-sync-1.1...> | 2023-10-14 17:18 | 13K | |
| php81-pecl-timezoned..> | 2023-10-09 19:27 | 231K | |
| php81-pecl-uploadpro..> | 2023-10-09 22:39 | 6.5K | |
| php81-pecl-uuid-1.2...> | 2023-10-07 23:35 | 6.4K | |
| php81-pecl-uv-0.3.0.pkg | 2023-10-14 16:18 | 46K | |
| php81-pecl-vips-1.0...> | 2023-10-08 13:06 | 16K | |
| php81-pecl-vld-0.18...> | 2023-10-09 14:52 | 16K | |
| php81-pecl-xdebug-3...> | 2023-10-14 14:18 | 121K | |
| php81-pecl-xdiff-2.1..> | 2023-10-10 16:42 | 8.5K | |
| php81-pecl-xmlrpc-1...> | 2023-10-07 05:11 | 36K | |
| php81-pecl-yac-2.2.1..> | 2023-10-14 06:00 | 20K | |
| php81-pecl-yaconf-1...> | 2023-10-10 09:43 | 11K | |
| php81-pecl-yaf-3.3.5..> | 2023-10-09 09:21 | 87K | |
| php81-pecl-yaml-2.2...> | 2023-10-09 06:53 | 19K | |
| php81-pecl-yar-2.3.2..> | 2023-10-14 17:03 | 30K | |
| php81-pecl-zephir_pa..> | 2023-10-08 07:02 | 40K | |
| php81-pecl-zookeeper..> | 2023-10-14 05:07 | 22K | |
| php81-pgsql-8.1.23.pkg | 2023-10-06 18:12 | 43K | |
| php81-phalcon-5.3.0.pkg | 2023-10-10 02:00 | 1.8M | |
| php81-phar-8.1.23.pkg | 2023-10-07 01:14 | 106K | |
| php81-posix-8.1.23.pkg | 2023-10-06 17:33 | 12K | |
| php81-pspell-8.1.23.pkg | 2023-10-10 07:59 | 8.7K | |
| php81-readline-8.1.2..> | 2023-10-07 21:32 | 13K | |
| php81-session-8.1.23..> | 2023-10-06 14:15 | 35K | |
| php81-shmop-8.1.23.pkg | 2023-10-10 13:05 | 6.5K | |
| php81-simplexml-8.1...> | 2023-10-06 17:12 | 23K | |
| php81-snappy-0.2.1.pkg | 2023-10-08 12:01 | 3.9K | |
| php81-snmp-8.1.23.pkg | 2023-10-07 15:06 | 21K | |
| php81-snuffleupagus-..> | 2023-10-14 14:32 | 67K | |
| php81-soap-8.1.23.pkg | 2023-10-06 16:22 | 116K | |
| php81-sockets-8.1.23..> | 2023-10-06 16:39 | 38K | |
| php81-sodium-8.1.23.pkg | 2023-10-07 08:40 | 27K | |
| php81-sqlite3-8.1.23..> | 2023-10-06 18:01 | 21K | |
| php81-sysvmsg-8.1.23..> | 2023-10-07 22:07 | 7.8K | |
| php81-sysvsem-8.1.23..> | 2023-10-07 04:24 | 6.2K | |
| php81-sysvshm-8.1.23..> | 2023-10-07 10:29 | 7.3K | |
| php81-tarantool-0.3...> | 2023-10-10 13:39 | 44K | |
| php81-tidy-8.1.23.pkg | 2023-10-07 22:18 | 18K | |
| php81-tokenizer-8.1...> | 2023-10-07 12:13 | 11K | |
| php81-xapian-1.4.23.pkg | 2023-10-08 03:09 | 261K | |
| php81-xml-8.1.23.pkg | 2023-10-06 08:36 | 19K | |
| php81-xmlreader-8.1...> | 2023-10-07 02:59 | 14K | |
| php81-xmlwriter-8.1...> | 2023-10-07 05:19 | 13K | |
| php81-xsl-8.1.23.pkg | 2023-10-07 09:20 | 13K | |
| php81-zephir-0.17.0.pkg | 2023-10-14 16:26 | 1.5M | |
| php81-zip-8.1.23.pkg | 2023-10-06 23:44 | 25K | |
| php81-zlib-8.1.23.pkg | 2023-10-06 08:39 | 18K | |
| php81-zstd-0.11.0.pkg | 2023-10-08 17:51 | 8.0K | |
| php82-8.2.10.pkg | 2023-10-05 17:43 | 4.5M | |
| php82-Ice37-3.7.6.pkg | 2023-10-10 12:27 | 166K | |
| php82-aphpbreakdown-..> | 2023-10-09 00:56 | 50K | |
| php82-aphpunit-2.1.pkg | 2023-10-09 11:08 | 13K | |
| php82-bcmath-8.2.10.pkg | 2023-10-06 14:01 | 19K | |
| php82-brotli-0.13.1.pkg | 2023-10-11 03:56 | 9.6K | |
| php82-bsdconv-11.6.0..> | 2023-10-14 03:42 | 7.8K | |
| php82-bz2-8.2.10.pkg | 2023-10-07 01:04 | 10K | |
| php82-calendar-8.2.1..> | 2023-10-07 13:01 | 15K | |
| php82-composer-1.10...> | 2023-10-07 15:14 | 390K | |
| php82-composer2-2.6...> | 2023-10-07 19:47 | 517K | |
| php82-ctype-8.2.10.pkg | 2023-10-06 15:52 | 5.0K | |
| php82-curl-8.2.10.pkg | 2023-10-06 18:09 | 41K | |
| php82-dba-8.2.10.pkg | 2023-10-10 20:21 | 22K | |
| php82-dddbl-2.0.1.pkg | 2023-10-10 08:40 | 9.2K | |
| php82-deployer-6.4.3..> | 2023-10-14 08:21 | 328K | |
| php82-dom-8.2.10.pkg | 2023-10-06 09:49 | 65K | |
| php82-enchant-8.2.10..> | 2023-10-14 16:22 | 9.8K | |
| php82-exif-8.2.10.pkg | 2023-10-07 07:04 | 29K | |
| php82-extensions-1.0..> | 2023-10-09 21:29 | 1.0K | |
| php82-ffi-8.2.10.pkg | 2023-10-10 00:15 | 64K | |
| php82-fileinfo-8.2.1..> | 2023-10-07 07:49 | 300K | |
| php82-filter-8.2.10.pkg | 2023-10-07 06:34 | 21K | |
| php82-ftp-8.2.10.pkg | 2023-10-07 21:04 | 25K | |
| php82-gd-8.2.10.pkg | 2023-10-06 16:24 | 33K | |
| php82-geos-1.0.0.pkg | 2023-10-09 17:05 | 17K | |
| php82-gettext-8.2.10..> | 2023-10-06 17:47 | 6.2K | |
| php82-gmp-8.2.10.pkg | 2023-10-07 06:42 | 21K | |
| php82-iconv-8.2.10.pkg | 2023-10-06 17:24 | 17K | |
| php82-imap-8.2.10.pkg | 2023-10-07 09:39 | 34K | |
| php82-intl-8.2.10.pkg | 2023-10-06 16:37 | 135K | |
| php82-kanboard-1.2.3..> | 2023-10-14 17:31 | 2.3M | |
| php82-ldap-8.2.10.pkg | 2023-10-06 17:35 | 32K | |
| php82-libawl-0.64.pkg | 2023-10-08 05:05 | 82K | |
| php82-lz4-0.4.3.pkg | 2023-10-09 09:20 | 5.5K | |
| php82-matomo-4.13.3.pkg | 2023-10-10 23:19 | 13M | |
| php82-maxminddb-1.6...> | 2023-10-08 20:31 | 6.7K | |
| php82-mbstring-8.2.1..> | 2023-10-06 17:50 | 791K | |
| php82-mysqli-8.2.10.pkg | 2023-10-06 12:31 | 48K | |
| php82-odbc-8.2.10.pkg | 2023-10-09 16:13 | 27K | |
| php82-opcache-8.2.10..> | 2023-10-06 16:34 | 323K | |
| php82-opencc-0.0.0.2..> | 2023-10-10 15:44 | 5.2K | |
| php82-pcntl-8.2.10.pkg | 2023-10-07 09:31 | 17K | |
| php82-pdo-8.2.10.pkg | 2023-10-06 15:00 | 50K | |
| php82-pdo_dblib-8.2...> | 2023-10-10 04:44 | 12K | |
| php82-pdo_firebird-8..> | 2023-10-09 02:55 | 15K | |
| php82-pdo_mysql-8.2...> | 2023-10-06 15:57 | 16K | |
| php82-pdo_odbc-8.2.1..> | 2023-10-14 17:08 | 13K | |
| php82-pdo_pgsql-8.2...> | 2023-10-06 16:23 | 18K | |
| php82-pdo_sqlite-8.2..> | 2023-10-06 16:36 | 12K | |
| php82-pear-1.10.13.pkg | 2023-10-06 09:04 | 249K | |
| php82-pear-Auth-1.6...> | 2023-10-09 06:36 | 47K | |
| php82-pear-Auth_HTTP..> | 2023-10-14 12:23 | 8.9K | |
| php82-pear-Auth_Pref..> | 2023-10-09 16:58 | 11K | |
| php82-pear-Auth_RADI..> | 2023-10-08 23:34 | 8.7K | |
| php82-pear-Auth_SASL..> | 2023-10-07 08:28 | 9.3K | |
| php82-pear-Auth_SASL..> | 2023-10-08 12:03 | 9.0K | |
| php82-pear-Benchmark..> | 2023-10-14 10:22 | 8.9K | |
| php82-pear-Cache-1.5..> | 2023-10-07 12:54 | 28K | |
| php82-pear-Cache_Lit..> | 2023-10-07 18:57 | 31K | |
| php82-pear-Config-1...> | 2023-10-08 14:43 | 30K | |
| php82-pear-Console_C..> | 2023-10-09 01:45 | 5.4K | |
| php82-pear-Console_C..> | 2023-10-07 21:10 | 37K | |
| php82-pear-Console_G..> | 2023-10-07 17:04 | 17K | |
| php82-pear-Console_T..> | 2023-10-06 20:38 | 12K | |
| php82-pear-Contact_V..> | 2023-10-14 10:17 | 16K | |
| php82-pear-Contact_V..> | 2023-10-09 10:31 | 10K | |
| php82-pear-Crypt_Blo..> | 2023-10-10 09:41 | 16K | |
| php82-pear-Crypt_CBC..> | 2023-10-11 16:16 | 4.3K | |
| php82-pear-Crypt_CHA..> | 2023-10-07 15:24 | 5.8K | |
| php82-pear-Crypt_Dif..> | 2023-10-08 22:14 | 11K | |
| php82-pear-Crypt_GPG..> | 2023-10-08 23:40 | 283K | |
| php82-pear-Crypt_HMA..> | 2023-10-08 09:33 | 8.3K | |
| php82-pear-Crypt_Mic..> | 2023-10-10 15:03 | 3.7K | |
| php82-pear-Crypt_RC4..> | 2023-10-09 10:12 | 2.9K | |
| php82-pear-Crypt_RSA..> | 2023-10-08 14:25 | 20K | |
| php82-pear-Crypt_XXT..> | 2023-10-09 21:32 | 6.8K | |
| php82-pear-DB-1.11.0..> | 2023-10-07 02:07 | 83K | |
| php82-pear-DBA-1.1.1..> | 2023-10-08 05:48 | 12K | |
| php82-pear-DBA_Relat..> | 2023-10-11 14:33 | 19K | |
| php82-pear-DB_DataOb..> | 2023-10-08 04:23 | 68K | |
| php82-pear-DB_DataOb..> | 2023-10-11 04:07 | 59K | |
| php82-pear-DB_Pager-..> | 2023-10-09 02:32 | 4.5K | |
| php82-pear-DB_QueryT..> | 2023-10-09 12:11 | 39K | |
| php82-pear-DB_Sqlite..> | 2023-10-10 07:11 | 18K | |
| php82-pear-DB_Table-..> | 2023-10-10 13:03 | 90K | |
| php82-pear-DB_ldap-1..> | 2023-10-14 15:05 | 10K | |
| php82-pear-DB_ldap2-..> | 2023-10-14 11:22 | 18K | |
| php82-pear-Date-1.4...> | 2023-10-07 02:33 | 42K | |
| php82-pear-Date_Holi..> | 2023-10-08 06:17 | 33K | |
| php82-pear-Date_Holi..> | 2023-10-08 23:09 | 5.5K | |
| php82-pear-Date_Holi..> | 2023-10-09 01:35 | 4.6K | |
| php82-pear-Date_Holi..> | 2023-10-08 13:52 | 4.3K | |
| php82-pear-Date_Holi..> | 2023-10-08 19:09 | 3.6K | |
| php82-pear-Date_Holi..> | 2023-10-10 10:32 | 4.2K | |
| php82-pear-Date_Holi..> | 2023-10-14 16:58 | 12K | |
| php82-pear-Date_Holi..> | 2023-10-09 07:32 | 5.2K | |
| php82-pear-Date_Holi..> | 2023-10-11 00:12 | 4.9K | |
| php82-pear-Date_Holi..> | 2023-10-10 00:20 | 4.5K | |
| php82-pear-Date_Holi..> | 2023-10-10 09:50 | 8.8K | |
| php82-pear-Date_Holi..> | 2023-10-10 23:46 | 5.4K | |
| php82-pear-Date_Holi..> | 2023-10-10 11:14 | 4.0K | |
| php82-pear-Date_Holi..> | 2023-10-10 23:02 | 4.0K | |
| php82-pear-Date_Holi..> | 2023-10-09 14:24 | 3.5K | |
| php82-pear-Date_Holi..> | 2023-10-09 11:04 | 4.1K | |
| php82-pear-Date_Holi..> | 2023-10-09 12:39 | 6.3K | |
| php82-pear-Date_Holi..> | 2023-10-10 22:31 | 9.1K | |
| php82-pear-Date_Holi..> | 2023-10-10 13:12 | 5.2K | |
| php82-pear-Date_Holi..> | 2023-10-10 04:00 | 3.8K | |
| php82-pear-Event_Dis..> | 2023-10-07 05:58 | 8.9K | |
| php82-pear-FSM-1.4.0..> | 2023-10-09 06:40 | 11K | |
| php82-pear-File-1.4...> | 2023-10-07 12:56 | 8.7K | |
| php82-pear-File_Arch..> | 2023-10-08 17:46 | 52K | |
| php82-pear-File_Bitt..> | 2023-10-14 12:46 | 70K | |
| php82-pear-File_DNS-..> | 2023-10-09 14:32 | 10K | |
| php82-pear-File_Find..> | 2023-10-08 09:13 | 8.6K | |
| php82-pear-File_Fort..> | 2023-10-14 07:14 | 14K | |
| php82-pear-File_Fsta..> | 2023-10-09 18:04 | 7.4K | |
| php82-pear-File_Gett..> | 2023-10-14 13:26 | 7.6K | |
| php82-pear-File_HtAc..> | 2023-10-14 15:06 | 5.5K | |
| php82-pear-File_Iter..> | 2023-10-07 14:26 | 1.6K | |
| php82-pear-File_MARC..> | 2023-10-14 05:17 | 75K | |
| php82-pear-File_PDF-..> | 2023-10-08 23:42 | 36K | |
| php82-pear-File_Pass..> | 2023-10-10 23:21 | 21K | |
| php82-pear-File_SMBP..> | 2023-10-09 08:43 | 5.7K | |
| php82-pear-Games_Che..> | 2023-10-10 15:44 | 81K | |
| php82-pear-HTML_AJAX..> | 2023-10-08 08:57 | 89K | |
| php82-pear-HTML_BBCo..> | 2023-10-11 15:17 | 16K | |
| php82-pear-HTML_CSS-..> | 2023-10-14 12:31 | 38K | |
| php82-pear-HTML_Comm..> | 2023-10-07 06:18 | 5.0K | |
| php82-pear-HTML_Comm..> | 2023-10-07 10:53 | 9.4K | |
| php82-pear-HTML_Cryp..> | 2023-10-08 14:15 | 5.0K | |
| php82-pear-HTML_Form..> | 2023-10-08 20:22 | 14K | |
| php82-pear-HTML_Java..> | 2023-10-09 10:10 | 8.8K | |
| php82-pear-HTML_Page..> | 2023-10-10 15:54 | 18K | |
| php82-pear-HTML_Quic..> | 2023-10-08 09:02 | 84K | |
| php82-pear-HTML_Quic..> | 2023-10-11 04:54 | 143K | |
| php82-pear-HTML_Quic..> | 2023-10-14 16:51 | 17K | |
| php82-pear-HTML_Quic..> | 2023-10-10 15:52 | 14K | |
| php82-pear-HTML_Quic..> | 2023-10-09 00:24 | 7.3K | |
| php82-pear-HTML_Quic..> | 2023-10-14 12:54 | 3.1K | |
| php82-pear-HTML_Quic..> | 2023-10-09 01:58 | 27K | |
| php82-pear-HTML_Sele..> | 2023-10-10 15:09 | 6.2K | |
| php82-pear-HTML_Sele..> | 2023-10-14 18:53 | 8.3K | |
| php82-pear-HTML_Tabl..> | 2023-10-07 10:03 | 15K | |
| php82-pear-HTML_TagC..> | 2023-10-09 12:35 | 12K | |
| php82-pear-HTML_Temp..> | 2023-10-08 00:47 | 146K | |
| php82-pear-HTML_Temp..> | 2023-10-10 05:19 | 22K | |
| php82-pear-HTML_Temp..> | 2023-10-08 23:55 | 18K | |
| php82-pear-HTML_Temp..> | 2023-10-09 07:07 | 28K | |
| php82-pear-HTML_Tree..> | 2023-10-08 16:59 | 48K | |
| php82-pear-HTTP-1.4...> | 2023-10-07 09:31 | 9.0K | |
| php82-pear-HTTP_Clie..> | 2023-10-10 11:58 | 10K | |
| php82-pear-HTTP_Down..> | 2023-10-10 01:03 | 14K | |
| php82-pear-HTTP_Floo..> | 2023-10-09 21:23 | 6.6K | |
| php82-pear-HTTP_Head..> | 2023-10-08 01:39 | 11K | |
| php82-pear-HTTP_Requ..> | 2023-10-07 03:10 | 16K | |
| php82-pear-HTTP_Requ..> | 2023-10-08 09:15 | 108K | |
| php82-pear-HTTP_Serv..> | 2023-10-10 19:46 | 7.3K | |
| php82-pear-HTTP_Sess..> | 2023-10-10 04:18 | 16K | |
| php82-pear-HTTP_Uplo..> | 2023-10-11 12:15 | 9.4K | |
| php82-pear-HTTP_WebD..> | 2023-10-09 14:52 | 9.2K | |
| php82-pear-HTTP_WebD..> | 2023-10-10 17:14 | 28K | |
| php82-pear-Horde_Cry..> | 2023-10-10 02:21 | 115K | |
| php82-pear-Horde_Cry..> | 2023-10-06 18:04 | 24K | |
| php82-pear-Horde_Ima..> | 2023-10-10 06:23 | 595K | |
| php82-pear-Horde_Ima..> | 2023-10-07 10:09 | 200K | |
| php82-pear-Horde_Kol..> | 2023-10-07 22:30 | 85K | |
| php82-pear-Horde_Log..> | 2023-10-06 17:26 | 15K | |
| php82-pear-Horde_Map..> | 2023-10-06 17:22 | 18K | |
| php82-pear-Horde_Smt..> | 2023-10-06 22:14 | 31K | |
| php82-pear-Horde_Vfs..> | 2023-10-08 02:50 | 62K | |
| php82-pear-I18N-1.0...> | 2023-10-07 12:46 | 29K | |
| php82-pear-I18Nv2-0...> | 2023-10-08 12:41 | 200K | |
| php82-pear-Image_3D-..> | 2023-10-10 17:00 | 91K | |
| php82-pear-Image_Bar..> | 2023-10-10 05:09 | 13K | |
| php82-pear-Image_Bar..> | 2023-10-12 02:05 | 15K | |
| php82-pear-Image_Can..> | 2023-10-07 19:59 | 37K | |
| php82-pear-Image_Col..> | 2023-10-07 05:50 | 9.3K | |
| php82-pear-Image_Gra..> | 2023-10-10 01:33 | 325K | |
| php82-pear-Image_Gra..> | 2023-10-11 01:24 | 16K | |
| php82-pear-Image_Tra..> | 2023-10-09 10:10 | 385K | |
| php82-pear-LiveUser-..> | 2023-10-08 03:27 | 62K | |
| php82-pear-LiveUser_..> | 2023-10-10 01:26 | 53K | |
| php82-pear-Log-1.13...> | 2023-10-07 21:30 | 40K | |
| php82-pear-MDB-1.3.0..> | 2023-10-08 07:46 | 125K | |
| php82-pear-MDB2-2.5...> | 2023-10-07 18:59 | 102K | |
| php82-pear-MDB2_Driv..> | 2023-10-08 21:21 | 34K | |
| php82-pear-MDB2_Driv..> | 2023-10-10 04:04 | 29K | |
| php82-pear-MDB2_Sche..> | 2023-10-09 02:40 | 63K | |
| php82-pear-MDB_Query..> | 2023-10-09 13:12 | 42K | |
| php82-pear-MIME_Type..> | 2023-10-07 11:13 | 19K | |
| php82-pear-Mail-1.5...> | 2023-10-08 00:40 | 21K | |
| php82-pear-Mail_Mbox..> | 2023-10-14 09:28 | 14K | |
| php82-pear-Mail_Mime..> | 2023-10-07 11:06 | 35K | |
| php82-pear-Mail_Queu..> | 2023-10-14 10:09 | 20K | |
| php82-pear-Mail_mime..> | 2023-10-09 15:15 | 13K | |
| php82-pear-Math_BigI..> | 2023-10-06 13:46 | 24K | |
| php82-pear-Math_Comb..> | 2023-10-10 00:29 | 5.8K | |
| php82-pear-Math_Frac..> | 2023-10-14 11:25 | 4.7K | |
| php82-pear-Net_CDDB-..> | 2023-10-09 11:27 | 46K | |
| php82-pear-Net_Check..> | 2023-10-07 16:47 | 2.6K | |
| php82-pear-Net_Cyrus..> | 2023-10-08 16:10 | 6.2K | |
| php82-pear-Net_DIME-..> | 2023-10-09 19:03 | 7.5K | |
| php82-pear-Net_DNS2-..> | 2023-10-07 23:57 | 68K | |
| php82-pear-Net_DNSBL..> | 2023-10-09 18:35 | 8.5K | |
| php82-pear-Net_Dict-..> | 2023-10-09 06:28 | 6.4K | |
| php82-pear-Net_FTP-1..> | 2023-10-09 00:56 | 30K | |
| php82-pear-Net_Finge..> | 2023-10-09 13:49 | 2.3K | |
| php82-pear-Net_Gearm..> | 2023-10-11 06:12 | 17K | |
| php82-pear-Net_Geo-1..> | 2023-10-09 22:05 | 8.1K | |
| php82-pear-Net_GeoIP..> | 2023-10-10 03:51 | 13K | |
| php82-pear-Net_Growl..> | 2023-10-14 17:23 | 457K | |
| php82-pear-Net_IDNA-..> | 2023-10-08 15:00 | 16K | |
| php82-pear-Net_IMAP-..> | 2023-10-08 07:48 | 35K | |
| php82-pear-Net_IPv4-..> | 2023-10-09 16:58 | 6.7K | |
| php82-pear-Net_IPv6-..> | 2023-10-08 14:30 | 12K | |
| php82-pear-Net_Ident..> | 2023-10-09 10:06 | 3.8K | |
| php82-pear-Net_LDAP-..> | 2023-10-10 12:31 | 63K | |
| php82-pear-Net_LDAP2..> | 2023-10-09 04:38 | 80K | |
| php82-pear-Net_LMTP-..> | 2023-10-09 11:56 | 6.7K | |
| php82-pear-Net_MAC-0..> | 2023-10-09 12:15 | 5.7K | |
| php82-pear-Net_NNTP-..> | 2023-10-10 03:28 | 32K | |
| php82-pear-Net_Nmap-..> | 2023-10-09 18:15 | 23K | |
| php82-pear-Net_POP3-..> | 2023-10-14 09:33 | 9.6K | |
| php82-pear-Net_Ping-..> | 2023-10-10 06:19 | 9.6K | |
| php82-pear-Net_Ports..> | 2023-10-14 10:42 | 3.4K | |
| php82-pear-Net_SMS-0..> | 2023-10-09 16:46 | 18K | |
| php82-pear-Net_SMTP-..> | 2023-10-06 11:07 | 15K | |
| php82-pear-Net_Serve..> | 2023-10-07 14:24 | 17K | |
| php82-pear-Net_Sieve..> | 2023-10-14 08:48 | 14K | |
| php82-pear-Net_Smart..> | 2023-10-09 09:40 | 101K | |
| php82-pear-Net_Socke..> | 2023-10-06 10:57 | 7.0K | |
| php82-pear-Net_Trace..> | 2023-10-14 16:04 | 7.2K | |
| php82-pear-Net_URL-1..> | 2023-10-06 19:16 | 6.6K | |
| php82-pear-Net_URL2-..> | 2023-10-06 23:44 | 18K | |
| php82-pear-Net_URL_M..> | 2023-10-14 16:12 | 13K | |
| php82-pear-Net_UserA..> | 2023-10-14 05:07 | 12K | |
| php82-pear-Net_UserA..> | 2023-10-14 12:16 | 30K | |
| php82-pear-Net_Vpopm..> | 2023-10-11 08:38 | 20K | |
| php82-pear-Net_Whois..> | 2023-10-08 18:41 | 6.7K | |
| php82-pear-Numbers_R..> | 2023-10-14 08:40 | 6.5K | |
| php82-pear-Numbers_W..> | 2023-10-10 15:17 | 43K | |
| php82-pear-OLE-1.0.0..> | 2023-10-07 09:27 | 13K | |
| php82-pear-PEAR_Info..> | 2023-10-10 19:40 | 44K | |
| php82-pear-PEAR_Pack..> | 2023-10-14 12:30 | 33K | |
| php82-pear-PEAR_Pack..> | 2023-10-09 08:56 | 34K | |
| php82-pear-PEAR_Pack..> | 2023-10-07 22:54 | 20K | |
| php82-pear-PHPTAL-1...> | 2023-10-11 05:00 | 148K | |
| php82-pear-PHP_Archi..> | 2023-10-10 06:14 | 45K | |
| php82-pear-PHP_Array..> | 2023-10-10 03:32 | 8.1K | |
| php82-pear-PHP_Beaut..> | 2023-10-09 22:39 | 66K | |
| php82-pear-PHP_CodeC..> | 2023-10-10 15:21 | 5.3K | |
| php82-pear-PHP_CodeS..> | 2023-10-10 12:34 | 609K | |
| php82-pear-PHP_Compa..> | 2023-10-09 01:11 | 41K | |
| php82-pear-PHP_Compa..> | 2023-10-14 12:09 | 133K | |
| php82-pear-PHP_Parse..> | 2023-10-09 17:42 | 81K | |
| php82-pear-PHP_Parse..> | 2023-10-14 09:47 | 133K | |
| php82-pear-PHP_Shell..> | 2023-10-08 21:51 | 84K | |
| php82-pear-PHP_Timer..> | 2023-10-09 02:26 | 1.4K | |
| php82-pear-PHP_Token..> | 2023-10-07 15:02 | 4.2K | |
| php82-pear-PHP_UML-1..> | 2023-10-09 13:23 | 405K | |
| php82-pear-Pager-2.5..> | 2023-10-06 23:37 | 31K | |
| php82-pear-Payment_D..> | 2023-10-09 11:40 | 38K | |
| php82-pear-PhpDocume..> | 2023-10-10 23:48 | 944K | |
| php82-pear-SOAP-0.14..> | 2023-10-10 16:27 | 72K | |
| php82-pear-Sebastian..> | 2023-10-09 07:27 | 1.4K | |
| php82-pear-Sebastian..> | 2023-10-09 12:59 | 2.2K | |
| php82-pear-Sebastian..> | 2023-10-10 10:57 | 1.3K | |
| php82-pear-Services_..> | 2023-10-14 15:49 | 15K | |
| php82-pear-Services_..> | 2023-10-11 00:34 | 27K | |
| php82-pear-Services_..> | 2023-10-09 13:37 | 16K | |
| php82-pear-Services_..> | 2023-10-10 22:34 | 3.5K | |
| php82-pear-Services_..> | 2023-10-09 17:04 | 9.8K | |
| php82-pear-Services_..> | 2023-10-11 00:12 | 22K | |
| php82-pear-Services_..> | 2023-10-14 11:40 | 71K | |
| php82-pear-Services_..> | 2023-10-10 03:39 | 37K | |
| php82-pear-Services_..> | 2023-10-14 05:26 | 3.9K | |
| php82-pear-Services_..> | 2023-10-10 13:36 | 9.5K | |
| php82-pear-Services_..> | 2023-10-09 12:49 | 5.1K | |
| php82-pear-Services_..> | 2023-10-14 13:25 | 8.7K | |
| php82-pear-Services_..> | 2023-10-09 00:33 | 10K | |
| php82-pear-Services_..> | 2023-10-08 18:45 | 4.7K | |
| php82-pear-Services_..> | 2023-10-14 10:30 | 5.9K | |
| php82-pear-Services_..> | 2023-10-10 09:18 | 55K | |
| php82-pear-Services_..> | 2023-10-14 16:04 | 11K | |
| php82-pear-Services_..> | 2023-10-09 09:40 | 13K | |
| php82-pear-Services_..> | 2023-10-10 06:14 | 43K | |
| php82-pear-Services_..> | 2023-10-10 00:58 | 14K | |
| php82-pear-Services_..> | 2023-10-14 15:29 | 12K | |
| php82-pear-Services_..> | 2023-10-09 11:22 | 4.2K | |
| php82-pear-Spreadshe..> | 2023-10-08 05:09 | 47K | |
| php82-pear-Structure..> | 2023-10-07 06:29 | 42K | |
| php82-pear-Structure..> | 2023-10-07 10:46 | 4.0K | |
| php82-pear-Structure..> | 2023-10-14 08:09 | 4.7K | |
| php82-pear-Structure..> | 2023-10-08 14:15 | 3.1K | |
| php82-pear-Structure..> | 2023-10-14 09:30 | 4.7K | |
| php82-pear-Structure..> | 2023-10-10 01:56 | 4.5K | |
| php82-pear-Structure..> | 2023-10-09 12:20 | 3.6K | |
| php82-pear-Structure..> | 2023-10-09 06:16 | 9.3K | |
| php82-pear-Structure..> | 2023-10-11 17:20 | 4.7K | |
| php82-pear-Structure..> | 2023-10-10 14:04 | 6.6K | |
| php82-pear-Structure..> | 2023-10-07 22:27 | 4.9K | |
| php82-pear-Structure..> | 2023-10-10 09:27 | 6.3K | |
| php82-pear-Structure..> | 2023-10-08 14:27 | 5.4K | |
| php82-pear-Structure..> | 2023-10-10 04:34 | 4.4K | |
| php82-pear-Structure..> | 2023-10-08 19:52 | 4.3K | |
| php82-pear-Structure..> | 2023-10-09 17:40 | 12K | |
| php82-pear-Symfony_C..> | 2023-10-07 23:37 | 76K | |
| php82-pear-Symfony_C..> | 2023-10-08 05:50 | 33K | |
| php82-pear-Symfony_C..> | 2023-10-08 19:35 | 37K | |
| php82-pear-System_Co..> | 2023-10-11 16:35 | 6.9K | |
| php82-pear-Testing_S..> | 2023-10-10 13:15 | 2.3M | |
| php82-pear-Text_Diff..> | 2023-10-14 08:33 | 20K | |
| php82-pear-Text_Figl..> | 2023-10-08 12:42 | 8.4K | |
| php82-pear-Text_High..> | 2023-10-10 05:11 | 79K | |
| php82-pear-Text_Pass..> | 2023-10-09 07:54 | 5.9K | |
| php82-pear-Text_Spel..> | 2023-10-10 14:25 | 115K | |
| php82-pear-Text_Temp..> | 2023-10-07 18:07 | 1.4K | |
| php82-pear-Text_Wiki..> | 2023-10-10 13:03 | 75K | |
| php82-pear-TheSeer_D..> | 2023-10-09 04:05 | 2.8K | |
| php82-pear-TheSeer_f..> | 2023-10-08 10:56 | 4.9K | |
| php82-pear-TheSeer_f..> | 2023-10-09 22:46 | 6.4K | |
| php82-pear-Translati..> | 2023-10-10 12:01 | 46K | |
| php82-pear-UDDI-0.2...> | 2023-10-14 07:04 | 7.3K | |
| php82-pear-URI_Templ..> | 2023-10-10 00:26 | 7.1K | |
| php82-pear-VFS-0.3.0..> | 2023-10-14 10:15 | 36K | |
| php82-pear-Validate-..> | 2023-10-07 19:53 | 20K | |
| php82-pear-Validate_..> | 2023-10-10 13:37 | 9.3K | |
| php82-pear-Validate_..> | 2023-10-14 10:40 | 10K | |
| php82-pear-Validate_..> | 2023-10-08 22:41 | 6.9K | |
| php82-pear-Validate_..> | 2023-10-14 17:28 | 6.2K | |
| php82-pear-Validate_..> | 2023-10-10 01:02 | 9.1K | |
| php82-pear-Var_Dump-..> | 2023-10-08 15:44 | 17K | |
| php82-pear-VersionCo..> | 2023-10-09 16:09 | 15K | |
| php82-pear-VersionCo..> | 2023-10-09 09:43 | 27K | |
| php82-pear-XML_Beaut..> | 2023-10-09 14:09 | 13K | |
| php82-pear-XML_DTD-0..> | 2023-10-07 22:54 | 32K | |
| php82-pear-XML_Feed_..> | 2023-10-09 03:42 | 265K | |
| php82-pear-XML_GRDDL..> | 2023-10-11 00:40 | 43K | |
| php82-pear-XML_HTMLS..> | 2023-10-09 20:49 | 15K | |
| php82-pear-XML_NITF-..> | 2023-10-10 12:43 | 7.9K | |
| php82-pear-XML_Parse..> | 2023-10-06 22:08 | 13K | |
| php82-pear-XML_Query..> | 2023-10-08 16:30 | 296K | |
| php82-pear-XML_RPC-1..> | 2023-10-08 02:57 | 23K | |
| php82-pear-XML_RPC2-..> | 2023-10-14 06:50 | 56K | |
| php82-pear-XML_RSS-1..> | 2023-10-08 11:34 | 8.2K | |
| php82-pear-XML_SVG-1..> | 2023-10-09 21:22 | 8.8K | |
| php82-pear-XML_Seria..> | 2023-10-07 02:11 | 30K | |
| php82-pear-XML_Trans..> | 2023-10-14 17:05 | 26K | |
| php82-pear-XML_Tree-..> | 2023-10-09 18:34 | 5.2K | |
| php82-pear-XML_Util-..> | 2023-10-06 21:21 | 17K | |
| php82-pear-XML_Wddx-..> | 2023-10-09 02:57 | 6.7K | |
| php82-pear-YAML-1.0...> | 2023-10-09 10:31 | 10K | |
| php82-pear-channel-d..> | 2023-10-07 04:13 | 1.1K | |
| php82-pear-channel-e..> | 2023-10-07 05:39 | 1.1K | |
| php82-pear-channel-g..> | 2023-10-07 20:00 | 1.0K | |
| php82-pear-channel-h..> | 2023-10-06 09:22 | 1.0K | |
| php82-pear-channel-h..> | 2023-10-07 16:51 | 1.4K | |
| php82-pear-channel-o..> | 2023-10-08 16:01 | 1.0K | |
| php82-pear-channel-p..> | 2023-10-07 19:41 | 1.0K | |
| php82-pear-channel-p..> | 2023-10-08 00:23 | 1.0K | |
| php82-pear-channel-p..> | 2023-10-14 18:18 | 1.1K | |
| php82-pear-channel-p..> | 2023-10-09 17:41 | 1.0K | |
| php82-pear-channel-p..> | 2023-10-08 03:22 | 1.1K | |
| php82-pear-channel-s..> | 2023-10-07 11:01 | 1.1K | |
| php82-pear-channel-s..> | 2023-10-07 04:50 | 1.1K | |
| php82-pear-channel-t..> | 2023-10-06 23:33 | 1.0K | |
| php82-pear-channel-t..> | 2023-10-07 16:53 | 1.1K | |
| php82-pear-codegen-1..> | 2023-10-11 05:42 | 42K | |
| php82-pear-doctrine-..> | 2023-10-07 21:39 | 51K | |
| php82-pear-doctrine-..> | 2023-10-08 13:36 | 113K | |
| php82-pear-ezc_Base-..> | 2023-10-07 21:56 | 210K | |
| php82-pear-ezc_Conso..> | 2023-10-09 16:07 | 736K | |
| php82-pear-geshi-ges..> | 2023-10-14 14:10 | 641K | |
| php82-pear-horde-Hor..> | 2023-10-06 23:10 | 310K | |
| php82-pear-horde-Hor..> | 2023-10-06 23:08 | 37K | |
| php82-pear-horde-Hor..> | 2023-10-09 07:34 | 58K | |
| php82-pear-horde-Hor..> | 2023-10-06 21:18 | 52K | |
| php82-pear-horde-Hor..> | 2023-10-06 19:52 | 15K | |
| php82-pear-horde-Hor..> | 2023-10-08 14:58 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-06 18:10 | 36K | |
| php82-pear-horde-Hor..> | 2023-10-06 19:23 | 26K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:19 | 29K | |
| php82-pear-horde-Hor..> | 2023-10-06 18:08 | 2.1M | |
| php82-pear-horde-Hor..> | 2023-10-06 18:02 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-06 13:45 | 6.3K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:49 | 12K | |
| php82-pear-horde-Hor..> | 2023-10-07 03:17 | 1.1M | |
| php82-pear-horde-Hor..> | 2023-10-06 19:39 | 12K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:26 | 71K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:46 | 42K | |
| php82-pear-horde-Hor..> | 2023-10-06 12:25 | 63K | |
| php82-pear-horde-Hor..> | 2023-10-11 00:42 | 28K | |
| php82-pear-horde-Hor..> | 2023-10-07 15:08 | 189K | |
| php82-pear-horde-Hor..> | 2023-10-06 13:45 | 71K | |
| php82-pear-horde-Hor..> | 2023-10-09 03:58 | 546K | |
| php82-pear-horde-Hor..> | 2023-10-06 10:06 | 24K | |
| php82-pear-horde-Hor..> | 2023-10-09 14:40 | 1.2M | |
| php82-pear-horde-Hor..> | 2023-10-10 02:54 | 135K | |
| php82-pear-horde-Hor..> | 2023-10-06 14:07 | 22K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:04 | 16K | |
| php82-pear-horde-Hor..> | 2023-10-06 22:39 | 25K | |
| php82-pear-horde-Hor..> | 2023-10-07 01:07 | 15K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:20 | 94K | |
| php82-pear-horde-Hor..> | 2023-10-06 11:28 | 10K | |
| php82-pear-horde-Hor..> | 2023-10-10 04:32 | 32K | |
| php82-pear-horde-Hor..> | 2023-10-06 16:26 | 21K | |
| php82-pear-horde-Hor..> | 2023-10-11 05:51 | 34K | |
| php82-pear-horde-Hor..> | 2023-10-06 21:47 | 15K | |
| php82-pear-horde-Hor..> | 2023-10-08 02:01 | 52K | |
| php82-pear-horde-Hor..> | 2023-10-10 19:37 | 21K | |
| php82-pear-horde-Hor..> | 2023-10-14 16:18 | 138K | |
| php82-pear-horde-Hor..> | 2023-10-07 06:12 | 56K | |
| php82-pear-horde-Hor..> | 2023-10-14 07:29 | 17K | |
| php82-pear-horde-Hor..> | 2023-10-06 21:15 | 17K | |
| php82-pear-horde-Hor..> | 2023-10-06 19:28 | 29K | |
| php82-pear-horde-Hor..> | 2023-10-06 13:36 | 35K | |
| php82-pear-horde-Hor..> | 2023-10-09 02:26 | 18K | |
| php82-pear-horde-Hor..> | 2023-10-10 04:48 | 15K | |
| php82-pear-horde-Hor..> | 2023-10-06 15:09 | 121K | |
| php82-pear-horde-Hor..> | 2023-10-06 18:44 | 261K | |
| php82-pear-horde-Hor..> | 2023-10-09 18:15 | 84K | |
| php82-pear-horde-Hor..> | 2023-10-06 11:40 | 202K | |
| php82-pear-horde-Hor..> | 2023-10-06 22:28 | 20K | |
| php82-pear-horde-Hor..> | 2023-10-08 09:40 | 6.9K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:24 | 16K | |
| php82-pear-horde-Hor..> | 2023-10-09 09:16 | 45K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:22 | 36K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:14 | 50K | |
| php82-pear-horde-Hor..> | 2023-10-14 02:42 | 12K | |
| php82-pear-horde-Hor..> | 2023-10-11 16:16 | 32K | |
| php82-pear-horde-Hor..> | 2023-10-06 16:08 | 11K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:02 | 39K | |
| php82-pear-horde-Hor..> | 2023-10-12 09:47 | 37K | |
| php82-pear-horde-Hor..> | 2023-10-09 06:34 | 14K | |
| php82-pear-horde-Hor..> | 2023-10-11 12:15 | 5.7K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:47 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-06 19:28 | 16K | |
| php82-pear-horde-Hor..> | 2023-10-09 06:25 | 30K | |
| php82-pear-horde-Hor..> | 2023-10-10 20:21 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-11 17:30 | 10K | |
| php82-pear-horde-Hor..> | 2023-10-10 03:34 | 2.9K | |
| php82-pear-horde-Hor..> | 2023-10-09 17:20 | 186K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:04 | 24K | |
| php82-pear-horde-Hor..> | 2023-10-06 19:59 | 54K | |
| php82-pear-horde-Hor..> | 2023-10-06 15:44 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-14 03:04 | 13K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:52 | 18K | |
| php82-pear-horde-Hor..> | 2023-10-06 11:10 | 14K | |
| php82-pear-horde-Hor..> | 2023-10-06 11:07 | 6.4K | |
| php82-pear-horde-Hor..> | 2023-10-06 13:11 | 24K | |
| php82-pear-horde-Hor..> | 2023-10-08 00:45 | 112K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:43 | 14K | |
| php82-pear-horde-Hor..> | 2023-10-09 20:03 | 28K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:14 | 50K | |
| php82-pear-horde-Hor..> | 2023-10-14 13:07 | 23K | |
| php82-pear-horde-Hor..> | 2023-10-06 13:39 | 14K | |
| php82-pear-horde-Hor..> | 2023-10-08 02:49 | 21K | |
| php82-pear-horde-Hor..> | 2023-10-08 22:21 | 26K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:17 | 30K | |
| php82-pear-horde-Hor..> | 2023-10-06 09:29 | 16K | |
| php82-pear-horde-Hor..> | 2023-10-09 21:31 | 18K | |
| php82-pear-horde-Hor..> | 2023-10-06 17:15 | 16K | |
| php82-pear-horde-Hor..> | 2023-10-06 10:52 | 34K | |
| php82-pear-horde-Hor..> | 2023-10-06 20:52 | 40K | |
| php82-pear-horde-Hor..> | 2023-10-08 00:40 | 11K | |
| php82-pear-horde-Hor..> | 2023-10-07 00:41 | 25K | |
| php82-pear-pdepend_s..> | 2023-10-14 13:18 | 32K | |
| php82-pear-phing-2.6..> | 2023-10-09 17:00 | 357K | |
| php82-pear-pirum-Pir..> | 2023-10-11 21:21 | 14K | |
| php82-pear-twig-twig..> | 2023-10-10 03:57 | 92K | |
| php82-pecl-APCu-5.1...> | 2023-10-07 09:43 | 50K | |
| php82-pecl-ast-1.1.0..> | 2023-10-08 18:47 | 18K | |
| php82-pecl-bitset-3...> | 2023-10-06 17:58 | 9.7K | |
| php82-pecl-couchbase..> | 2023-10-08 15:41 | 26K | |
| php82-pecl-crypto-0...> | 2023-10-09 02:11 | 30K | |
| php82-pecl-dio-0.2.1..> | 2023-10-09 08:45 | 11K | |
| php82-pecl-ds-1.4.0.pkg | 2023-10-09 19:52 | 52K | |
| php82-pecl-eio-3.0.0..> | 2023-10-08 16:24 | 26K | |
| php82-pecl-ev-1.1.5.pkg | 2023-10-08 12:29 | 35K | |
| php82-pecl-event-3.0..> | 2023-10-14 14:37 | 41K | |
| php82-pecl-excimer-1..> | 2023-10-14 11:37 | 20K | |
| php82-pecl-expect-0...> | 2023-10-11 10:00 | 6.9K | |
| php82-pecl-gnupg-1.5..> | 2023-10-07 10:09 | 16K | |
| php82-pecl-grpc-1.58..> | 2023-10-10 18:46 | 2.3M | |
| php82-pecl-horde_lz4..> | 2023-10-09 11:32 | 4.0K | |
| php82-pecl-http-4.2...> | 2023-10-14 18:46 | 130K | |
| php82-pecl-igbinary-..> | 2023-10-08 14:51 | 25K | |
| php82-pecl-imagick-3..> | 2023-10-10 16:24 | 114K | |
| php82-pecl-inotify-3..> | 2023-10-10 21:59 | 6.2K | |
| php82-pecl-json_post..> | 2023-10-10 04:00 | 4.8K | |
| php82-pecl-krb5-1.1...> | 2023-10-10 13:08 | 22K | |
| php82-pecl-leveldb-0..> | 2023-10-14 13:37 | 12K | |
| php82-pecl-libsodium..> | 2023-10-14 06:28 | 22K | |
| php82-pecl-lzf-1.7.0..> | 2023-10-08 15:02 | 7.1K | |
| php82-pecl-mailparse..> | 2023-10-09 16:58 | 25K | |
| php82-pecl-mcrypt-1...> | 2023-10-06 17:20 | 13K | |
| php82-pecl-memcache-..> | 2023-10-06 17:13 | 40K | |
| php82-pecl-memcached..> | 2023-10-06 16:59 | 46K | |
| php82-pecl-mongodb-1..> | 2023-10-14 05:56 | 557K | |
| php82-pecl-msgpack-2..> | 2023-10-07 23:24 | 23K | |
| php82-pecl-mustache-..> | 2023-10-11 01:17 | 24K | |
| php82-pecl-oauth-2.0..> | 2023-10-10 07:39 | 33K | |
| php82-pecl-pam-2.2.4..> | 2023-10-09 05:45 | 7.9K | |
| php82-pecl-pkcs11-1...> | 2023-10-08 14:44 | 43K | |
| php82-pecl-proctitle..> | 2023-10-10 08:08 | 3.6K | |
| php82-pecl-protobuf-..> | 2023-10-10 05:50 | 153K | |
| php82-pecl-psr-1.2.0..> | 2023-10-14 04:44 | 15K | |
| php82-pecl-qrencode-..> | 2023-10-14 13:24 | 6.4K | |
| php82-pecl-radius-1...> | 2023-10-08 09:54 | 30K | |
| php82-pecl-raphf-2.0..> | 2023-10-08 09:23 | 10K | |
| php82-pecl-rdkafka-6..> | 2023-10-09 08:30 | 39K | |
| php82-pecl-redis-5.3..> | 2023-10-08 10:29 | 154K | |
| php82-pecl-rrd-2.0.3..> | 2023-10-09 01:31 | 12K | |
| php82-pecl-runkit7-4..> | 2023-10-08 21:41 | 37K | |
| php82-pecl-scrypt-2...> | 2023-10-10 09:26 | 16K | |
| php82-pecl-smbclient..> | 2023-10-07 14:55 | 21K | |
| php82-pecl-solr-2.6...> | 2023-10-09 12:57 | 72K | |
| php82-pecl-ssh2-1.3...> | 2023-10-08 11:03 | 25K | |
| php82-pecl-stomp-2.0..> | 2023-10-14 10:21 | 17K | |
| php82-pecl-swoole-5...> | 2023-10-09 17:33 | 751K | |
| php82-pecl-sync-1.1...> | 2023-10-10 13:36 | 13K | |
| php82-pecl-timezoned..> | 2023-10-10 01:26 | 231K | |
| php82-pecl-uploadpro..> | 2023-10-09 10:22 | 6.5K | |
| php82-pecl-uuid-1.2...> | 2023-10-08 04:18 | 6.4K | |
| php82-pecl-uv-0.3.0.pkg | 2023-10-14 13:14 | 46K | |
| php82-pecl-vips-1.0...> | 2023-10-09 03:41 | 16K | |
| php82-pecl-vld-0.18...> | 2023-10-10 16:33 | 16K | |
| php82-pecl-xdebug-3...> | 2023-10-08 13:07 | 121K | |
| php82-pecl-xdiff-2.1..> | 2023-10-14 16:51 | 8.5K | |
| php82-pecl-xmlrpc-1...> | 2023-10-07 16:07 | 36K | |
| php82-pecl-yac-2.2.1..> | 2023-10-08 23:41 | 20K | |
| php82-pecl-yaconf-1...> | 2023-10-09 07:56 | 10K | |
| php82-pecl-yaf-3.3.5..> | 2023-10-09 09:25 | 87K | |
| php82-pecl-yaml-2.2...> | 2023-10-14 14:07 | 19K | |
| php82-pecl-yar-2.3.2..> | 2023-10-10 03:30 | 31K | |
| php82-pecl-zephir_pa..> | 2023-10-07 15:28 | 40K | |
| php82-pecl-zookeeper..> | 2023-10-11 01:02 | 22K | |
| php82-pgsql-8.2.10.pkg | 2023-10-06 16:35 | 44K | |
| php82-phalcon-5.3.0.pkg | 2023-10-10 12:22 | 1.8M | |
| php82-phar-8.2.10.pkg | 2023-10-07 04:49 | 107K | |
| php82-posix-8.2.10.pkg | 2023-10-06 17:27 | 12K | |
| php82-pspell-8.2.10.pkg | 2023-10-14 15:51 | 8.7K | |
| php82-readline-8.2.1..> | 2023-10-07 16:39 | 13K | |
| php82-session-8.2.10..> | 2023-10-06 13:46 | 36K | |
| php82-shmop-8.2.10.pkg | 2023-10-14 06:10 | 6.5K | |
| php82-simplexml-8.2...> | 2023-10-06 16:43 | 23K | |
| php82-snappy-0.2.1.pkg | 2023-10-10 00:00 | 3.9K | |
| php82-snmp-8.2.10.pkg | 2023-10-14 03:05 | 22K | |
| php82-snuffleupagus-..> | 2023-10-10 06:10 | 67K | |
| php82-soap-8.2.10.pkg | 2023-10-06 16:27 | 118K | |
| php82-sockets-8.2.10..> | 2023-10-06 15:51 | 39K | |
| php82-sodium-8.2.10.pkg | 2023-10-07 12:15 | 29K | |
| php82-sqlite3-8.2.10..> | 2023-10-06 17:31 | 23K | |
| php82-sysvmsg-8.2.10..> | 2023-10-08 05:58 | 8.0K | |
| php82-sysvsem-8.2.10..> | 2023-10-07 04:53 | 6.2K | |
| php82-sysvshm-8.2.10..> | 2023-10-09 07:29 | 7.2K | |
| php82-tarantool-0.3...> | 2023-10-09 07:01 | 44K | |
| php82-tidy-8.2.10.pkg | 2023-10-07 20:18 | 20K | |
| php82-tokenizer-8.2...> | 2023-10-07 15:28 | 12K | |
| php82-xapian-1.4.23.pkg | 2023-10-14 16:24 | 261K | |
| php82-xml-8.2.10.pkg | 2023-10-06 08:38 | 20K | |
| php82-xmlreader-8.2...> | 2023-10-07 04:46 | 15K | |
| php82-xmlwriter-8.2...> | 2023-10-07 06:36 | 14K | |
| php82-xsl-8.2.10.pkg | 2023-10-07 02:13 | 13K | |
| php82-zephir-0.17.0.pkg | 2023-10-09 22:01 | 1.5M | |
| php82-zip-8.2.10.pkg | 2023-10-07 00:43 | 30K | |
| php82-zlib-8.2.10.pkg | 2023-10-06 08:20 | 18K | |
| php82-zstd-0.11.0.pkg | 2023-10-08 12:19 | 8.0K | |
| php83-8.3.0.r1.pkg | 2023-10-05 17:43 | 4.6M | |
| php83-Ice37-3.7.6.pkg | 2023-10-14 07:04 | 166K | |
| php83-aphpbreakdown-..> | 2023-10-14 03:16 | 50K | |
| php83-aphpunit-2.1.pkg | 2023-10-09 16:44 | 13K | |
| php83-bcmath-8.3.0.r..> | 2023-10-06 15:37 | 20K | |
| php83-brotli-0.13.1.pkg | 2023-10-09 23:56 | 9.6K | |
| php83-bsdconv-11.6.0..> | 2023-10-09 00:50 | 7.8K | |
| php83-bz2-8.3.0.r1.pkg | 2023-10-07 13:25 | 10K | |
| php83-calendar-8.3.0..> | 2023-10-08 08:09 | 15K | |
| php83-composer-1.10...> | 2023-10-07 15:16 | 390K | |
| php83-composer2-2.6...> | 2023-10-07 17:26 | 517K | |
| php83-ctype-8.3.0.r1..> | 2023-10-06 18:27 | 5.0K | |
| php83-curl-8.3.0.r1.pkg | 2023-10-06 18:06 | 42K | |
| php83-dba-8.3.0.r1.pkg | 2023-10-09 18:11 | 23K | |
| php83-dddbl-2.0.1.pkg | 2023-10-09 12:27 | 9.2K | |
| php83-deployer-6.4.3..> | 2023-10-09 16:47 | 328K | |
| php83-dom-8.3.0.r1.pkg | 2023-10-06 10:04 | 70K | |
| php83-enchant-8.3.0...> | 2023-10-11 20:29 | 9.8K | |
| php83-exif-8.3.0.r1.pkg | 2023-10-07 23:14 | 29K | |
| php83-extensions-1.0..> | 2023-10-09 00:02 | 1.0K | |
| php83-ffi-8.3.0.r1.pkg | 2023-10-11 10:58 | 64K | |
| php83-fileinfo-8.3.0..> | 2023-10-08 08:02 | 331K | |
| php83-filter-8.3.0.r..> | 2023-10-07 07:22 | 21K | |
| php83-ftp-8.3.0.r1.pkg | 2023-10-08 04:47 | 25K | |
| php83-gd-8.3.0.r1.pkg | 2023-10-06 16:34 | 33K | |
| php83-geos-1.0.0.pkg | 2023-10-08 20:10 | 17K | |
| php83-gettext-8.3.0...> | 2023-10-06 18:03 | 6.2K | |
| php83-gmp-8.3.0.r1.pkg | 2023-10-08 11:23 | 21K | |
| php83-iconv-8.3.0.r1..> | 2023-10-06 16:40 | 17K | |
| php83-imap-8.3.0.r1.pkg | 2023-10-07 03:59 | 34K | |
| php83-intl-8.3.0.r1.pkg | 2023-10-06 17:59 | 136K | |
| php83-kanboard-1.2.3..> | 2023-10-08 13:38 | 2.3M | |
| php83-ldap-8.3.0.r1.pkg | 2023-10-06 18:25 | 33K | |
| php83-libawl-0.64.pkg | 2023-10-08 09:53 | 82K | |
| php83-lz4-0.4.3.pkg | 2023-10-10 18:27 | 5.5K | |
| php83-matomo-4.13.3.pkg | 2023-10-09 04:15 | 13M | |
| php83-maxminddb-1.6...> | 2023-10-11 21:22 | 6.7K | |
| php83-mbstring-8.3.0..> | 2023-10-06 17:37 | 789K | |
| php83-mysqli-8.3.0.r..> | 2023-10-06 13:21 | 48K | |
| php83-odbc-8.3.0.r1.pkg | 2023-10-09 14:15 | 27K | |
| php83-opcache-8.3.0...> | 2023-10-06 18:30 | 324K | |
| php83-opencc-0.0.0.2..> | 2023-10-08 16:56 | 5.2K | |
| php83-pcntl-8.3.0.r1..> | 2023-10-07 01:56 | 17K | |
| php83-pdo-8.3.0.r1.pkg | 2023-10-06 14:52 | 50K | |
| php83-pdo_dblib-8.3...> | 2023-10-08 15:54 | 12K | |
| php83-pdo_firebird-8..> | 2023-10-09 07:35 | 15K | |
| php83-pdo_mysql-8.3...> | 2023-10-06 16:35 | 13K | |
| php83-pdo_odbc-8.3.0..> | 2023-10-09 17:07 | 13K | |
| php83-pdo_pgsql-8.3...> | 2023-10-06 17:36 | 18K | |
| php83-pdo_sqlite-8.3..> | 2023-10-06 16:31 | 12K | |
| php83-pear-1.10.13.pkg | 2023-10-06 09:07 | 249K | |
| php83-pear-Auth-1.6...> | 2023-10-10 01:22 | 47K | |
| php83-pear-Auth_HTTP..> | 2023-10-09 06:13 | 8.9K | |
| php83-pear-Auth_Pref..> | 2023-10-09 17:07 | 11K | |
| php83-pear-Auth_RADI..> | 2023-10-09 00:44 | 8.7K | |
| php83-pear-Auth_SASL..> | 2023-10-07 06:51 | 9.3K | |
| php83-pear-Auth_SASL..> | 2023-10-10 13:23 | 9.0K | |
| php83-pear-Benchmark..> | 2023-10-14 14:18 | 8.9K | |
| php83-pear-Cache-1.5..> | 2023-10-07 16:14 | 28K | |
| php83-pear-Cache_Lit..> | 2023-10-08 00:21 | 31K | |
| php83-pear-Config-1...> | 2023-10-08 17:12 | 30K | |
| php83-pear-Console_C..> | 2023-10-14 05:41 | 5.4K | |
| php83-pear-Console_C..> | 2023-10-07 19:06 | 37K | |
| php83-pear-Console_G..> | 2023-10-08 09:41 | 17K | |
| php83-pear-Console_T..> | 2023-10-06 22:29 | 12K | |
| php83-pear-Contact_V..> | 2023-10-10 17:00 | 16K | |
| php83-pear-Contact_V..> | 2023-10-09 03:03 | 10K | |
| php83-pear-Crypt_Blo..> | 2023-10-10 02:30 | 16K | |
| php83-pear-Crypt_CBC..> | 2023-10-08 13:10 | 4.3K | |
| php83-pear-Crypt_CHA..> | 2023-10-07 17:52 | 5.9K | |
| php83-pear-Crypt_Dif..> | 2023-10-08 19:08 | 11K | |
| php83-pear-Crypt_GPG..> | 2023-10-09 17:38 | 283K | |
| php83-pear-Crypt_HMA..> | 2023-10-07 19:10 | 8.3K | |
| php83-pear-Crypt_Mic..> | 2023-10-10 17:12 | 3.7K | |
| php83-pear-Crypt_RC4..> | 2023-10-09 01:20 | 2.9K | |
| php83-pear-Crypt_RSA..> | 2023-10-09 07:24 | 20K | |
| php83-pear-Crypt_XXT..> | 2023-10-09 21:39 | 6.8K | |
| php83-pear-DB-1.11.0..> | 2023-10-07 09:09 | 83K | |
| php83-pear-DBA-1.1.1..> | 2023-10-07 18:56 | 13K | |
| php83-pear-DBA_Relat..> | 2023-10-09 04:44 | 19K | |
| php83-pear-DB_DataOb..> | 2023-10-08 08:00 | 68K | |
| php83-pear-DB_DataOb..> | 2023-10-12 05:06 | 59K | |
| php83-pear-DB_Pager-..> | 2023-10-14 04:58 | 4.5K | |
| php83-pear-DB_QueryT..> | 2023-10-14 04:03 | 38K | |
| php83-pear-DB_Sqlite..> | 2023-10-09 23:49 | 18K | |
| php83-pear-DB_Table-..> | 2023-10-09 09:03 | 90K | |
| php83-pear-DB_ldap-1..> | 2023-10-10 06:02 | 10K | |
| php83-pear-DB_ldap2-..> | 2023-10-09 03:42 | 18K | |
| php83-pear-Date-1.4...> | 2023-10-07 09:34 | 41K | |
| php83-pear-Date_Holi..> | 2023-10-08 05:53 | 33K | |
| php83-pear-Date_Holi..> | 2023-10-14 09:01 | 5.5K | |
| php83-pear-Date_Holi..> | 2023-10-10 02:56 | 4.6K | |
| php83-pear-Date_Holi..> | 2023-10-09 22:15 | 4.3K | |
| php83-pear-Date_Holi..> | 2023-10-09 07:52 | 3.6K | |
| php83-pear-Date_Holi..> | 2023-10-08 20:19 | 4.2K | |
| php83-pear-Date_Holi..> | 2023-10-08 15:13 | 12K | |
| php83-pear-Date_Holi..> | 2023-10-14 13:23 | 5.2K | |
| php83-pear-Date_Holi..> | 2023-10-09 21:01 | 4.9K | |
| php83-pear-Date_Holi..> | 2023-10-11 16:05 | 4.5K | |
| php83-pear-Date_Holi..> | 2023-10-14 13:24 | 8.8K | |
| php83-pear-Date_Holi..> | 2023-10-10 05:41 | 5.4K | |
| php83-pear-Date_Holi..> | 2023-10-09 11:14 | 4.0K | |
| php83-pear-Date_Holi..> | 2023-10-14 03:09 | 4.0K | |
| php83-pear-Date_Holi..> | 2023-10-10 06:54 | 3.5K | |
| php83-pear-Date_Holi..> | 2023-10-10 01:09 | 4.1K | |
| php83-pear-Date_Holi..> | 2023-10-11 12:15 | 6.3K | |
| php83-pear-Date_Holi..> | 2023-10-14 09:32 | 9.1K | |
| php83-pear-Date_Holi..> | 2023-10-09 08:56 | 5.2K | |
| php83-pear-Date_Holi..> | 2023-10-14 17:54 | 3.8K | |
| php83-pear-Event_Dis..> | 2023-10-07 07:07 | 8.9K | |
| php83-pear-FSM-1.4.0..> | 2023-10-09 04:37 | 11K | |
| php83-pear-File-1.4...> | 2023-10-07 14:49 | 8.6K | |
| php83-pear-File_Arch..> | 2023-10-09 02:15 | 52K | |
| php83-pear-File_Bitt..> | 2023-10-09 17:34 | 70K | |
| php83-pear-File_DNS-..> | 2023-10-10 04:38 | 10K | |
| php83-pear-File_Find..> | 2023-10-07 21:01 | 8.6K | |
| php83-pear-File_Fort..> | 2023-10-09 17:40 | 14K | |
| php83-pear-File_Fsta..> | 2023-10-10 00:05 | 7.5K | |
| php83-pear-File_Gett..> | 2023-10-09 20:42 | 7.6K | |
| php83-pear-File_HtAc..> | 2023-10-09 14:56 | 5.5K | |
| php83-pear-File_Iter..> | 2023-10-07 21:38 | 1.6K | |
| php83-pear-File_MARC..> | 2023-10-09 11:48 | 75K | |
| php83-pear-File_PDF-..> | 2023-10-14 08:49 | 36K | |
| php83-pear-File_Pass..> | 2023-10-09 16:00 | 21K | |
| php83-pear-File_SMBP..> | 2023-10-11 06:13 | 5.7K | |
| php83-pear-Games_Che..> | 2023-10-08 21:58 | 81K | |
| php83-pear-HTML_AJAX..> | 2023-10-07 18:32 | 89K | |
| php83-pear-HTML_BBCo..> | 2023-10-08 17:38 | 16K | |
| php83-pear-HTML_CSS-..> | 2023-10-10 15:20 | 38K | |
| php83-pear-HTML_Comm..> | 2023-10-07 04:58 | 5.0K | |
| php83-pear-HTML_Comm..> | 2023-10-08 03:06 | 9.4K | |
| php83-pear-HTML_Cryp..> | 2023-10-14 13:53 | 5.0K | |
| php83-pear-HTML_Form..> | 2023-10-08 15:12 | 14K | |
| php83-pear-HTML_Java..> | 2023-10-09 20:17 | 8.8K | |
| php83-pear-HTML_Page..> | 2023-10-14 13:24 | 18K | |
| php83-pear-HTML_Quic..> | 2023-10-08 06:08 | 84K | |
| php83-pear-HTML_Quic..> | 2023-10-14 18:26 | 143K | |
| php83-pear-HTML_Quic..> | 2023-10-09 10:02 | 17K | |
| php83-pear-HTML_Quic..> | 2023-10-09 18:53 | 14K | |
| php83-pear-HTML_Quic..> | 2023-10-14 10:26 | 7.3K | |
| php83-pear-HTML_Quic..> | 2023-10-14 12:04 | 3.1K | |
| php83-pear-HTML_Quic..> | 2023-10-14 09:26 | 27K | |
| php83-pear-HTML_Sele..> | 2023-10-09 13:49 | 6.2K | |
| php83-pear-HTML_Sele..> | 2023-10-14 04:14 | 8.3K | |
| php83-pear-HTML_Tabl..> | 2023-10-08 09:53 | 15K | |
| php83-pear-HTML_TagC..> | 2023-10-14 08:10 | 12K | |
| php83-pear-HTML_Temp..> | 2023-10-07 17:43 | 146K | |
| php83-pear-HTML_Temp..> | 2023-10-09 20:47 | 22K | |
| php83-pear-HTML_Temp..> | 2023-10-09 23:59 | 18K | |
| php83-pear-HTML_Temp..> | 2023-10-09 01:09 | 28K | |
| php83-pear-HTML_Tree..> | 2023-10-14 04:14 | 48K | |
| php83-pear-HTTP-1.4...> | 2023-10-07 04:41 | 9.1K | |
| php83-pear-HTTP_Clie..> | 2023-10-14 14:04 | 10K | |
| php83-pear-HTTP_Down..> | 2023-10-10 17:32 | 14K | |
| php83-pear-HTTP_Floo..> | 2023-10-08 16:03 | 6.6K | |
| php83-pear-HTTP_Head..> | 2023-10-07 10:57 | 11K | |
| php83-pear-HTTP_Requ..> | 2023-10-07 07:07 | 16K | |
| php83-pear-HTTP_Requ..> | 2023-10-08 05:41 | 108K | |
| php83-pear-HTTP_Serv..> | 2023-10-08 12:11 | 7.3K | |
| php83-pear-HTTP_Sess..> | 2023-10-09 18:56 | 16K | |
| php83-pear-HTTP_Uplo..> | 2023-10-08 15:53 | 9.4K | |
| php83-pear-HTTP_WebD..> | 2023-10-10 07:09 | 9.2K | |
| php83-pear-HTTP_WebD..> | 2023-10-08 20:47 | 28K | |
| php83-pear-Horde_Cry..> | 2023-10-10 04:49 | 115K | |
| php83-pear-Horde_Cry..> | 2023-10-06 17:57 | 24K | |
| php83-pear-Horde_Ima..> | 2023-10-08 13:49 | 595K | |
| php83-pear-Horde_Ima..> | 2023-10-08 11:43 | 200K | |
| php83-pear-Horde_Kol..> | 2023-10-07 22:56 | 85K | |
| php83-pear-Horde_Log..> | 2023-10-06 16:33 | 15K | |
| php83-pear-Horde_Map..> | 2023-10-06 15:47 | 18K | |
| php83-pear-Horde_Smt..> | 2023-10-06 21:59 | 31K | |
| php83-pear-Horde_Vfs..> | 2023-10-07 16:46 | 62K | |
| php83-pear-I18N-1.0...> | 2023-10-07 22:23 | 29K | |
| php83-pear-I18Nv2-0...> | 2023-10-10 09:00 | 200K | |
| php83-pear-Image_3D-..> | 2023-10-09 20:56 | 91K | |
| php83-pear-Image_Bar..> | 2023-10-14 16:28 | 13K | |
| php83-pear-Image_Bar..> | 2023-10-10 04:54 | 15K | |
| php83-pear-Image_Can..> | 2023-10-08 06:27 | 37K | |
| php83-pear-Image_Col..> | 2023-10-07 00:43 | 9.3K | |
| php83-pear-Image_Gra..> | 2023-10-14 15:24 | 325K | |
| php83-pear-Image_Gra..> | 2023-10-12 12:19 | 16K | |
| php83-pear-Image_Tra..> | 2023-10-08 12:29 | 385K | |
| php83-pear-LiveUser-..> | 2023-10-07 16:54 | 62K | |
| php83-pear-LiveUser_..> | 2023-10-10 09:38 | 53K | |
| php83-pear-Log-1.13...> | 2023-10-08 04:43 | 40K | |
| php83-pear-MDB-1.3.0..> | 2023-10-08 09:07 | 125K | |
| php83-pear-MDB2-2.5...> | 2023-10-08 11:55 | 102K | |
| php83-pear-MDB2_Driv..> | 2023-10-14 14:56 | 34K | |
| php83-pear-MDB2_Driv..> | 2023-10-09 16:36 | 29K | |
| php83-pear-MDB2_Sche..> | 2023-10-08 18:14 | 63K | |
| php83-pear-MDB_Query..> | 2023-10-10 05:59 | 42K | |
| php83-pear-MIME_Type..> | 2023-10-07 13:38 | 19K | |
| php83-pear-Mail-1.5...> | 2023-10-07 23:22 | 21K | |
| php83-pear-Mail_Mbox..> | 2023-10-08 12:08 | 14K | |
| php83-pear-Mail_Mime..> | 2023-10-07 15:09 | 35K | |
| php83-pear-Mail_Queu..> | 2023-10-11 14:33 | 20K | |
| php83-pear-Mail_mime..> | 2023-10-14 17:19 | 13K | |
| php83-pear-Math_BigI..> | 2023-10-06 14:09 | 24K | |
| php83-pear-Math_Comb..> | 2023-10-10 08:06 | 5.8K | |
| php83-pear-Math_Frac..> | 2023-10-12 04:35 | 4.7K | |
| php83-pear-Net_CDDB-..> | 2023-10-14 18:19 | 46K | |
| php83-pear-Net_Check..> | 2023-10-07 12:09 | 2.6K | |
| php83-pear-Net_Cyrus..> | 2023-10-08 15:40 | 6.2K | |
| php83-pear-Net_DIME-..> | 2023-10-08 19:35 | 7.6K | |
| php83-pear-Net_DNS2-..> | 2023-10-08 01:43 | 68K | |
| php83-pear-Net_DNSBL..> | 2023-10-08 16:54 | 8.5K | |
| php83-pear-Net_Dict-..> | 2023-10-14 04:50 | 6.4K | |
| php83-pear-Net_FTP-1..> | 2023-10-10 08:23 | 30K | |
| php83-pear-Net_Finge..> | 2023-10-09 08:36 | 2.3K | |
| php83-pear-Net_Gearm..> | 2023-10-14 12:42 | 17K | |
| php83-pear-Net_Geo-1..> | 2023-10-10 00:25 | 8.1K | |
| php83-pear-Net_GeoIP..> | 2023-10-10 09:58 | 13K | |
| php83-pear-Net_Growl..> | 2023-10-10 11:47 | 457K | |
| php83-pear-Net_IDNA-..> | 2023-10-08 15:41 | 16K | |
| php83-pear-Net_IMAP-..> | 2023-10-08 07:29 | 35K | |
| php83-pear-Net_IPv4-..> | 2023-10-08 14:51 | 6.7K | |
| php83-pear-Net_IPv6-..> | 2023-10-08 22:46 | 12K | |
| php83-pear-Net_Ident..> | 2023-10-08 22:13 | 3.8K | |
| php83-pear-Net_LDAP-..> | 2023-10-09 01:47 | 63K | |
| php83-pear-Net_LDAP2..> | 2023-10-09 02:47 | 80K | |
| php83-pear-Net_LMTP-..> | 2023-10-08 15:09 | 6.8K | |
| php83-pear-Net_MAC-0..> | 2023-10-14 14:03 | 5.7K | |
| php83-pear-Net_NNTP-..> | 2023-10-09 05:14 | 32K | |
| php83-pear-Net_Nmap-..> | 2023-10-10 01:31 | 23K | |
| php83-pear-Net_POP3-..> | 2023-10-14 04:30 | 9.6K | |
| php83-pear-Net_Ping-..> | 2023-10-14 05:43 | 9.6K | |
| php83-pear-Net_Ports..> | 2023-10-14 07:47 | 3.4K | |
| php83-pear-Net_SMS-0..> | 2023-10-12 11:46 | 18K | |
| php83-pear-Net_SMTP-..> | 2023-10-06 11:22 | 15K | |
| php83-pear-Net_Serve..> | 2023-10-07 17:52 | 17K | |
| php83-pear-Net_Sieve..> | 2023-10-14 13:02 | 14K | |
| php83-pear-Net_Smart..> | 2023-10-14 05:13 | 101K | |
| php83-pear-Net_Socke..> | 2023-10-06 10:13 | 7.0K | |
| php83-pear-Net_Trace..> | 2023-10-09 13:11 | 7.2K | |
| php83-pear-Net_URL-1..> | 2023-10-06 21:10 | 6.6K | |
| php83-pear-Net_URL2-..> | 2023-10-07 00:17 | 18K | |
| php83-pear-Net_URL_M..> | 2023-10-14 07:14 | 13K | |
| php83-pear-Net_UserA..> | 2023-10-10 03:27 | 12K | |
| php83-pear-Net_UserA..> | 2023-10-08 20:04 | 30K | |
| php83-pear-Net_Vpopm..> | 2023-10-10 07:19 | 20K | |
| php83-pear-Net_Whois..> | 2023-10-09 04:24 | 6.7K | |
| php83-pear-Numbers_R..> | 2023-10-10 11:32 | 6.5K | |
| php83-pear-Numbers_W..> | 2023-10-09 16:29 | 43K | |
| php83-pear-OLE-1.0.0..> | 2023-10-07 06:46 | 13K | |
| php83-pear-PEAR_Info..> | 2023-10-14 16:23 | 44K | |
| php83-pear-PEAR_Pack..> | 2023-10-09 23:45 | 33K | |
| php83-pear-PEAR_Pack..> | 2023-10-09 06:01 | 34K | |
| php83-pear-PEAR_Pack..> | 2023-10-08 06:07 | 20K | |
| php83-pear-PHPTAL-1...> | 2023-10-08 18:33 | 148K | |
| php83-pear-PHP_Archi..> | 2023-10-09 23:34 | 45K | |
| php83-pear-PHP_Array..> | 2023-10-09 13:59 | 8.1K | |
| php83-pear-PHP_Beaut..> | 2023-10-09 16:30 | 66K | |
| php83-pear-PHP_CodeC..> | 2023-10-09 15:11 | 5.3K | |
| php83-pear-PHP_CodeS..> | 2023-10-10 16:36 | 609K | |
| php83-pear-PHP_Compa..> | 2023-10-09 04:08 | 41K | |
| php83-pear-PHP_Compa..> | 2023-10-09 08:05 | 133K | |
| php83-pear-PHP_Parse..> | 2023-10-09 21:18 | 81K | |
| php83-pear-PHP_Parse..> | 2023-10-10 18:59 | 133K | |
| php83-pear-PHP_Shell..> | 2023-10-10 14:25 | 84K | |
| php83-pear-PHP_Timer..> | 2023-10-14 05:18 | 1.4K | |
| php83-pear-PHP_Token..> | 2023-10-07 20:44 | 4.2K | |
| php83-pear-PHP_UML-1..> | 2023-10-08 12:28 | 405K | |
| php83-pear-Pager-2.5..> | 2023-10-07 00:55 | 31K | |
| php83-pear-Payment_D..> | 2023-10-09 00:30 | 38K | |
| php83-pear-PhpDocume..> | 2023-10-09 10:25 | 944K | |
| php83-pear-SOAP-0.14..> | 2023-10-10 22:16 | 72K | |
| php83-pear-Sebastian..> | 2023-10-14 08:24 | 1.4K | |
| php83-pear-Sebastian..> | 2023-10-14 17:09 | 2.2K | |
| php83-pear-Sebastian..> | 2023-10-14 07:56 | 1.3K | |
| php83-pear-Services_..> | 2023-10-10 02:34 | 15K | |
| php83-pear-Services_..> | 2023-10-09 18:18 | 27K | |
| php83-pear-Services_..> | 2023-10-09 10:02 | 16K | |
| php83-pear-Services_..> | 2023-10-11 17:19 | 3.5K | |
| php83-pear-Services_..> | 2023-10-10 20:40 | 9.8K | |
| php83-pear-Services_..> | 2023-10-10 17:26 | 22K | |
| php83-pear-Services_..> | 2023-10-09 04:32 | 71K | |
| php83-pear-Services_..> | 2023-10-09 21:28 | 37K | |
| php83-pear-Services_..> | 2023-10-10 11:58 | 3.9K | |
| php83-pear-Services_..> | 2023-10-08 14:24 | 9.5K | |
| php83-pear-Services_..> | 2023-10-08 21:14 | 5.1K | |
| php83-pear-Services_..> | 2023-10-10 17:46 | 8.8K | |
| php83-pear-Services_..> | 2023-10-09 07:00 | 10K | |
| php83-pear-Services_..> | 2023-10-10 05:59 | 4.7K | |
| php83-pear-Services_..> | 2023-10-10 01:30 | 5.9K | |
| php83-pear-Services_..> | 2023-10-09 21:56 | 55K | |
| php83-pear-Services_..> | 2023-10-14 05:28 | 11K | |
| php83-pear-Services_..> | 2023-10-14 13:24 | 13K | |
| php83-pear-Services_..> | 2023-10-09 22:17 | 43K | |
| php83-pear-Services_..> | 2023-10-10 09:19 | 14K | |
| php83-pear-Services_..> | 2023-10-08 17:48 | 12K | |
| php83-pear-Services_..> | 2023-10-10 17:31 | 4.2K | |
| php83-pear-Spreadshe..> | 2023-10-07 20:40 | 47K | |
| php83-pear-Structure..> | 2023-10-07 01:30 | 42K | |
| php83-pear-Structure..> | 2023-10-07 15:20 | 4.0K | |
| php83-pear-Structure..> | 2023-10-09 21:44 | 4.7K | |
| php83-pear-Structure..> | 2023-10-14 10:05 | 3.1K | |
| php83-pear-Structure..> | 2023-10-09 18:15 | 4.7K | |
| php83-pear-Structure..> | 2023-10-08 12:59 | 4.5K | |
| php83-pear-Structure..> | 2023-10-14 09:06 | 3.6K | |
| php83-pear-Structure..> | 2023-10-14 09:28 | 9.3K | |
| php83-pear-Structure..> | 2023-10-08 23:29 | 4.7K | |
| php83-pear-Structure..> | 2023-10-10 14:48 | 6.6K | |
| php83-pear-Structure..> | 2023-10-07 14:29 | 4.9K | |
| php83-pear-Structure..> | 2023-10-10 14:35 | 6.3K | |
| php83-pear-Structure..> | 2023-10-09 00:04 | 5.4K | |
| php83-pear-Structure..> | 2023-10-11 01:02 | 4.4K | |
| php83-pear-Structure..> | 2023-10-09 08:48 | 4.3K | |
| php83-pear-Structure..> | 2023-10-08 14:12 | 12K | |
| php83-pear-Symfony_C..> | 2023-10-08 08:17 | 76K | |
| php83-pear-Symfony_C..> | 2023-10-07 22:27 | 33K | |
| php83-pear-Symfony_C..> | 2023-10-09 23:54 | 37K | |
| php83-pear-System_Co..> | 2023-10-09 23:33 | 6.9K | |
| php83-pear-Testing_S..> | 2023-10-11 06:12 | 2.3M | |
| php83-pear-Text_Diff..> | 2023-10-14 10:23 | 20K | |
| php83-pear-Text_Figl..> | 2023-10-09 22:06 | 8.4K | |
| php83-pear-Text_High..> | 2023-10-10 08:51 | 79K | |
| php83-pear-Text_Pass..> | 2023-10-09 16:33 | 5.9K | |
| php83-pear-Text_Spel..> | 2023-10-09 06:30 | 115K | |
| php83-pear-Text_Temp..> | 2023-10-08 01:57 | 1.4K | |
| php83-pear-Text_Wiki..> | 2023-10-10 02:12 | 75K | |
| php83-pear-TheSeer_D..> | 2023-10-09 09:39 | 2.8K | |
| php83-pear-TheSeer_f..> | 2023-10-08 09:16 | 4.9K | |
| php83-pear-TheSeer_f..> | 2023-10-09 11:19 | 6.4K | |
| php83-pear-Translati..> | 2023-10-14 11:40 | 46K | |
| php83-pear-UDDI-0.2...> | 2023-10-14 18:45 | 7.3K | |
| php83-pear-URI_Templ..> | 2023-10-09 18:35 | 7.1K | |
| php83-pear-VFS-0.3.0..> | 2023-10-10 00:21 | 36K | |
| php83-pear-Validate-..> | 2023-10-08 05:23 | 20K | |
| php83-pear-Validate_..> | 2023-10-08 22:07 | 9.3K | |
| php83-pear-Validate_..> | 2023-10-09 18:55 | 10K | |
| php83-pear-Validate_..> | 2023-10-09 10:08 | 6.9K | |
| php83-pear-Validate_..> | 2023-10-14 18:36 | 6.2K | |
| php83-pear-Validate_..> | 2023-10-09 01:25 | 9.1K | |
| php83-pear-Var_Dump-..> | 2023-10-10 22:03 | 17K | |
| php83-pear-VersionCo..> | 2023-10-10 10:17 | 15K | |
| php83-pear-VersionCo..> | 2023-10-10 01:30 | 27K | |
| php83-pear-XML_Beaut..> | 2023-10-10 09:12 | 13K | |
| php83-pear-XML_DTD-0..> | 2023-10-07 11:02 | 32K | |
| php83-pear-XML_Feed_..> | 2023-10-09 18:35 | 265K | |
| php83-pear-XML_GRDDL..> | 2023-10-08 12:46 | 43K | |
| php83-pear-XML_HTMLS..> | 2023-10-09 13:52 | 15K | |
| php83-pear-XML_NITF-..> | 2023-10-11 06:10 | 7.9K | |
| php83-pear-XML_Parse..> | 2023-10-06 23:10 | 14K | |
| php83-pear-XML_Query..> | 2023-10-10 13:09 | 296K | |
| php83-pear-XML_RPC-1..> | 2023-10-07 19:46 | 23K | |
| php83-pear-XML_RPC2-..> | 2023-10-09 01:46 | 56K | |
| php83-pear-XML_RSS-1..> | 2023-10-08 01:09 | 8.2K | |
| php83-pear-XML_SVG-1..> | 2023-10-09 17:54 | 8.8K | |
| php83-pear-XML_Seria..> | 2023-10-07 04:59 | 30K | |
| php83-pear-XML_Trans..> | 2023-10-09 17:22 | 26K | |
| php83-pear-XML_Tree-..> | 2023-10-08 21:54 | 5.2K | |
| php83-pear-XML_Util-..> | 2023-10-06 21:29 | 17K | |
| php83-pear-XML_Wddx-..> | 2023-10-08 13:12 | 6.7K | |
| php83-pear-YAML-1.0...> | 2023-10-10 22:59 | 10K | |
| php83-pear-channel-d..> | 2023-10-07 01:11 | 1.1K | |
| php83-pear-channel-e..> | 2023-10-07 02:17 | 1.1K | |
| php83-pear-channel-g..> | 2023-10-07 15:07 | 1.0K | |
| php83-pear-channel-h..> | 2023-10-06 09:15 | 1.0K | |
| php83-pear-channel-h..> | 2023-10-08 04:20 | 1.4K | |
| php83-pear-channel-o..> | 2023-10-10 14:14 | 1.0K | |
| php83-pear-channel-p..> | 2023-10-07 14:05 | 1.0K | |
| php83-pear-channel-p..> | 2023-10-07 21:42 | 1.0K | |
| php83-pear-channel-p..> | 2023-10-08 18:33 | 1.1K | |
| php83-pear-channel-p..> | 2023-10-10 01:55 | 1.0K | |
| php83-pear-channel-p..> | 2023-10-07 17:14 | 1.1K | |
| php83-pear-channel-s..> | 2023-10-07 20:54 | 1.1K | |
| php83-pear-channel-s..> | 2023-10-07 02:23 | 1.1K | |
| php83-pear-channel-t..> | 2023-10-07 05:58 | 1.0K | |
| php83-pear-channel-t..> | 2023-10-07 17:23 | 1.1K | |
| php83-pear-codegen-1..> | 2023-10-10 07:13 | 42K | |
| php83-pear-doctrine-..> | 2023-10-07 15:23 | 51K | |
| php83-pear-doctrine-..> | 2023-10-10 09:24 | 113K | |
| php83-pear-ezc_Base-..> | 2023-10-08 02:26 | 210K | |
| php83-pear-ezc_Conso..> | 2023-10-10 14:45 | 736K | |
| php83-pear-geshi-ges..> | 2023-10-10 16:45 | 641K | |
| php83-pear-horde-Hor..> | 2023-10-06 22:48 | 310K | |
| php83-pear-horde-Hor..> | 2023-10-06 19:55 | 37K | |
| php83-pear-horde-Hor..> | 2023-10-08 20:35 | 58K | |
| php83-pear-horde-Hor..> | 2023-10-06 23:10 | 52K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:26 | 15K | |
| php83-pear-horde-Hor..> | 2023-10-10 15:08 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-06 16:34 | 36K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:32 | 26K | |
| php83-pear-horde-Hor..> | 2023-10-06 19:44 | 29K | |
| php83-pear-horde-Hor..> | 2023-10-06 17:09 | 2.1M | |
| php83-pear-horde-Hor..> | 2023-10-06 17:40 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-06 15:13 | 6.3K | |
| php83-pear-horde-Hor..> | 2023-10-06 21:12 | 12K | |
| php83-pear-horde-Hor..> | 2023-10-07 07:41 | 1.1M | |
| php83-pear-horde-Hor..> | 2023-10-06 20:26 | 12K | |
| php83-pear-horde-Hor..> | 2023-10-06 21:11 | 71K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:39 | 42K | |
| php83-pear-horde-Hor..> | 2023-10-06 12:25 | 63K | |
| php83-pear-horde-Hor..> | 2023-10-14 15:55 | 28K | |
| php83-pear-horde-Hor..> | 2023-10-07 11:21 | 189K | |
| php83-pear-horde-Hor..> | 2023-10-06 14:24 | 71K | |
| php83-pear-horde-Hor..> | 2023-10-09 23:24 | 546K | |
| php83-pear-horde-Hor..> | 2023-10-06 10:41 | 24K | |
| php83-pear-horde-Hor..> | 2023-10-14 11:13 | 1.2M | |
| php83-pear-horde-Hor..> | 2023-10-09 11:37 | 135K | |
| php83-pear-horde-Hor..> | 2023-10-06 13:45 | 22K | |
| php83-pear-horde-Hor..> | 2023-10-06 17:39 | 16K | |
| php83-pear-horde-Hor..> | 2023-10-06 22:24 | 25K | |
| php83-pear-horde-Hor..> | 2023-10-07 07:07 | 15K | |
| php83-pear-horde-Hor..> | 2023-10-06 18:06 | 94K | |
| php83-pear-horde-Hor..> | 2023-10-06 12:09 | 10K | |
| php83-pear-horde-Hor..> | 2023-10-08 17:38 | 32K | |
| php83-pear-horde-Hor..> | 2023-10-06 18:23 | 21K | |
| php83-pear-horde-Hor..> | 2023-10-09 07:03 | 34K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:32 | 15K | |
| php83-pear-horde-Hor..> | 2023-10-07 16:56 | 52K | |
| php83-pear-horde-Hor..> | 2023-10-14 04:59 | 21K | |
| php83-pear-horde-Hor..> | 2023-10-09 14:58 | 138K | |
| php83-pear-horde-Hor..> | 2023-10-07 00:54 | 56K | |
| php83-pear-horde-Hor..> | 2023-10-10 05:42 | 17K | |
| php83-pear-horde-Hor..> | 2023-10-06 21:26 | 17K | |
| php83-pear-horde-Hor..> | 2023-10-06 22:30 | 29K | |
| php83-pear-horde-Hor..> | 2023-10-06 12:12 | 35K | |
| php83-pear-horde-Hor..> | 2023-10-08 21:38 | 18K | |
| php83-pear-horde-Hor..> | 2023-10-09 14:15 | 15K | |
| php83-pear-horde-Hor..> | 2023-10-06 14:26 | 121K | |
| php83-pear-horde-Hor..> | 2023-10-06 21:18 | 261K | |
| php83-pear-horde-Hor..> | 2023-10-10 03:28 | 84K | |
| php83-pear-horde-Hor..> | 2023-10-06 12:07 | 202K | |
| php83-pear-horde-Hor..> | 2023-10-06 22:32 | 20K | |
| php83-pear-horde-Hor..> | 2023-10-07 16:12 | 6.9K | |
| php83-pear-horde-Hor..> | 2023-10-06 22:35 | 16K | |
| php83-pear-horde-Hor..> | 2023-10-09 06:37 | 45K | |
| php83-pear-horde-Hor..> | 2023-10-06 17:15 | 36K | |
| php83-pear-horde-Hor..> | 2023-10-06 23:02 | 50K | |
| php83-pear-horde-Hor..> | 2023-10-14 08:50 | 12K | |
| php83-pear-horde-Hor..> | 2023-10-08 13:50 | 33K | |
| php83-pear-horde-Hor..> | 2023-10-06 16:34 | 11K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:32 | 39K | |
| php83-pear-horde-Hor..> | 2023-10-10 21:11 | 37K | |
| php83-pear-horde-Hor..> | 2023-10-09 02:39 | 14K | |
| php83-pear-horde-Hor..> | 2023-10-14 10:53 | 5.7K | |
| php83-pear-horde-Hor..> | 2023-10-06 23:03 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:19 | 16K | |
| php83-pear-horde-Hor..> | 2023-10-10 07:11 | 30K | |
| php83-pear-horde-Hor..> | 2023-10-09 08:46 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-10 07:48 | 10K | |
| php83-pear-horde-Hor..> | 2023-10-08 21:36 | 2.9K | |
| php83-pear-horde-Hor..> | 2023-10-10 11:15 | 186K | |
| php83-pear-horde-Hor..> | 2023-10-06 21:17 | 24K | |
| php83-pear-horde-Hor..> | 2023-10-06 19:13 | 54K | |
| php83-pear-horde-Hor..> | 2023-10-06 15:56 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-09 14:59 | 13K | |
| php83-pear-horde-Hor..> | 2023-10-06 16:18 | 18K | |
| php83-pear-horde-Hor..> | 2023-10-06 11:53 | 14K | |
| php83-pear-horde-Hor..> | 2023-10-06 11:22 | 6.4K | |
| php83-pear-horde-Hor..> | 2023-10-06 13:12 | 24K | |
| php83-pear-horde-Hor..> | 2023-10-07 14:26 | 112K | |
| php83-pear-horde-Hor..> | 2023-10-06 19:03 | 14K | |
| php83-pear-horde-Hor..> | 2023-10-09 07:28 | 28K | |
| php83-pear-horde-Hor..> | 2023-10-06 17:07 | 50K | |
| php83-pear-horde-Hor..> | 2023-10-09 11:15 | 23K | |
| php83-pear-horde-Hor..> | 2023-10-06 12:53 | 14K | |
| php83-pear-horde-Hor..> | 2023-10-07 21:30 | 21K | |
| php83-pear-horde-Hor..> | 2023-10-11 16:36 | 26K | |
| php83-pear-horde-Hor..> | 2023-10-06 20:28 | 30K | |
| php83-pear-horde-Hor..> | 2023-10-06 10:01 | 16K | |
| php83-pear-horde-Hor..> | 2023-10-09 07:36 | 18K | |
| php83-pear-horde-Hor..> | 2023-10-06 16:27 | 16K | |
| php83-pear-horde-Hor..> | 2023-10-06 10:46 | 34K | |
| php83-pear-horde-Hor..> | 2023-10-06 19:18 | 40K | |
| php83-pear-horde-Hor..> | 2023-10-08 08:00 | 11K | |
| php83-pear-horde-Hor..> | 2023-10-07 08:10 | 25K | |
| php83-pear-pdepend_s..> | 2023-10-09 21:21 | 32K | |
| php83-pear-phing-2.6..> | 2023-10-10 01:45 | 357K | |
| php83-pear-pirum-Pir..> | 2023-10-14 07:00 | 14K | |
| php83-pear-twig-twig..> | 2023-10-10 11:42 | 92K | |
| php83-pecl-APCu-5.1...> | 2023-10-08 03:13 | 50K | |
| php83-pecl-ast-1.1.0..> | 2023-10-09 04:16 | 18K | |
| php83-pecl-bitset-3...> | 2023-10-06 15:49 | 9.7K | |
| php83-pecl-couchbase..> | 2023-10-14 04:33 | 26K | |
| php83-pecl-crypto-0...> | 2023-10-09 21:16 | 30K | |
| php83-pecl-dio-0.2.1..> | 2023-10-08 15:50 | 11K | |
| php83-pecl-ds-1.4.0.pkg | 2023-10-09 00:05 | 52K | |
| php83-pecl-eio-3.0.0..> | 2023-10-09 03:35 | 26K | |
| php83-pecl-ev-1.1.5.pkg | 2023-10-09 14:14 | 35K | |
| php83-pecl-event-3.0..> | 2023-10-09 23:56 | 42K | |
| php83-pecl-excimer-1..> | 2023-10-08 21:12 | 20K | |
| php83-pecl-expect-0...> | 2023-10-08 12:53 | 6.9K | |
| php83-pecl-gnupg-1.5..> | 2023-10-07 23:25 | 16K | |
| php83-pecl-grpc-1.58..> | 2023-10-14 18:39 | 2.3M | |
| php83-pecl-horde_lz4..> | 2023-10-14 17:19 | 4.0K | |
| php83-pecl-http-4.2...> | 2023-10-14 11:21 | 130K | |
| php83-pecl-igbinary-..> | 2023-10-09 04:22 | 24K | |
| php83-pecl-imagick-3..> | 2023-10-09 17:22 | 114K | |
| php83-pecl-inotify-3..> | 2023-10-10 09:14 | 6.2K | |
| php83-pecl-json_post..> | 2023-10-09 11:40 | 4.8K | |
| php83-pecl-krb5-1.1...> | 2023-10-10 03:17 | 22K | |
| php83-pecl-leveldb-0..> | 2023-10-09 10:40 | 12K | |
| php83-pecl-libsodium..> | 2023-10-09 03:10 | 22K | |
| php83-pecl-lzf-1.7.0..> | 2023-10-09 08:17 | 7.1K | |
| php83-pecl-mailparse..> | 2023-10-10 19:19 | 25K | |
| php83-pecl-mcrypt-1...> | 2023-10-06 16:33 | 13K | |
| php83-pecl-memcache-..> | 2023-10-06 17:08 | 40K | |
| php83-pecl-memcached..> | 2023-10-06 18:18 | 47K | |
| php83-pecl-mongodb-1..> | 2023-10-09 17:15 | 558K | |
| php83-pecl-msgpack-2..> | 2023-10-07 13:43 | 23K | |
| php83-pecl-mustache-..> | 2023-10-09 01:45 | 24K | |
| php83-pecl-oauth-2.0..> | 2023-10-14 04:42 | 33K | |
| php83-pecl-pam-2.2.4..> | 2023-10-14 14:44 | 7.9K | |
| php83-pecl-pkcs11-1...> | 2023-10-10 20:57 | 43K | |
| php83-pecl-proctitle..> | 2023-10-10 14:37 | 3.6K | |
| php83-pecl-protobuf-..> | 2023-10-10 07:33 | 153K | |
| php83-pecl-psr-1.2.0..> | 2023-10-10 06:32 | 15K | |
| php83-pecl-qrencode-..> | 2023-10-09 07:31 | 6.4K | |
| php83-pecl-radius-1...> | 2023-10-07 16:18 | 30K | |
| php83-pecl-raphf-2.0..> | 2023-10-07 14:28 | 10K | |
| php83-pecl-rdkafka-6..> | 2023-10-14 16:10 | 39K | |
| php83-pecl-redis-5.3..> | 2023-10-08 03:31 | 155K | |
| php83-pecl-rrd-2.0.3..> | 2023-10-10 15:24 | 12K | |
| php83-pecl-scrypt-2...> | 2023-10-14 06:03 | 16K | |
| php83-pecl-smbclient..> | 2023-10-07 13:31 | 22K | |
| php83-pecl-solr-2.6...> | 2023-10-09 18:58 | 72K | |
| php83-pecl-ssh2-1.3...> | 2023-10-07 20:14 | 25K | |
| php83-pecl-stomp-2.0..> | 2023-10-08 21:48 | 17K | |
| php83-pecl-sync-1.1...> | 2023-10-10 02:28 | 13K | |
| php83-pecl-timezoned..> | 2023-10-14 09:35 | 231K | |
| php83-pecl-uploadpro..> | 2023-10-08 14:54 | 6.5K | |
| php83-pecl-uuid-1.2...> | 2023-10-07 16:23 | 6.4K | |
| php83-pecl-uv-0.3.0.pkg | 2023-10-09 12:54 | 46K | |
| php83-pecl-vips-1.0...> | 2023-10-10 02:05 | 16K | |
| php83-pecl-vld-0.18...> | 2023-10-09 19:28 | 16K | |
| php83-pecl-xdiff-2.1..> | 2023-10-09 01:50 | 8.5K | |
| php83-pecl-xmlrpc-1...> | 2023-10-08 06:42 | 36K | |
| php83-pecl-yac-2.2.1..> | 2023-10-11 12:40 | 21K | |
| php83-pecl-yaconf-1...> | 2023-10-08 15:39 | 10K | |
| php83-pecl-yaf-3.3.5..> | 2023-10-11 01:03 | 87K | |
| php83-pecl-yaml-2.2...> | 2023-10-14 11:44 | 19K | |
| php83-pecl-yar-2.3.2..> | 2023-10-08 13:45 | 31K | |
| php83-pecl-zephir_pa..> | 2023-10-07 21:21 | 40K | |
| php83-pecl-zookeeper..> | 2023-10-10 06:28 | 23K | |
| php83-pgsql-8.3.0.r1..> | 2023-10-06 17:59 | 45K | |
| php83-phalcon-5.3.0.pkg | 2023-10-09 11:49 | 1.8M | |
| php83-phar-8.3.0.r1.pkg | 2023-10-07 01:44 | 106K | |
| php83-posix-8.3.0.r1..> | 2023-10-06 16:21 | 13K | |
| php83-pspell-8.3.0.r..> | 2023-10-10 00:47 | 8.8K | |
| php83-readline-8.3.0..> | 2023-10-07 23:51 | 13K | |
| php83-session-8.3.0...> | 2023-10-06 14:48 | 36K | |
| php83-shmop-8.3.0.r1..> | 2023-10-10 17:22 | 6.5K | |
| php83-simplexml-8.3...> | 2023-10-06 16:22 | 23K | |
| php83-snappy-0.2.1.pkg | 2023-10-09 17:29 | 3.9K | |
| php83-snmp-8.3.0.r1.pkg | 2023-10-14 13:57 | 22K | |
| php83-soap-8.3.0.r1.pkg | 2023-10-06 16:58 | 118K | |
| php83-sockets-8.3.0...> | 2023-10-06 16:30 | 40K | |
| php83-sodium-8.3.0.r..> | 2023-10-07 20:10 | 29K | |
| php83-sqlite3-8.3.0...> | 2023-10-06 16:11 | 24K | |
| php83-sysvmsg-8.3.0...> | 2023-10-07 19:15 | 8.1K | |
| php83-sysvsem-8.3.0...> | 2023-10-10 02:57 | 6.2K | |
| php83-sysvshm-8.3.0...> | 2023-10-14 03:04 | 7.3K | |
| php83-tarantool-0.3...> | 2023-10-09 20:30 | 44K | |
| php83-tidy-8.3.0.r1.pkg | 2023-10-08 09:19 | 20K | |
| php83-tokenizer-8.3...> | 2023-10-07 16:02 | 13K | |
| php83-xapian-1.4.23.pkg | 2023-10-08 15:41 | 264K | |
| php83-xml-8.3.0.r1.pkg | 2023-10-06 08:41 | 20K | |
| php83-xmlreader-8.3...> | 2023-10-07 15:20 | 15K | |
| php83-xmlwriter-8.3...> | 2023-10-07 23:42 | 14K | |
| php83-xsl-8.3.0.r1.pkg | 2023-10-07 14:55 | 14K | |
| php83-zephir-0.17.0.pkg | 2023-10-14 05:12 | 1.5M | |
| php83-zip-8.3.0.r1.pkg | 2023-10-08 00:27 | 31K | |
| php83-zlib-8.3.0.r1.pkg | 2023-10-06 08:42 | 18K | |
| php83-zstd-0.11.0.pkg | 2023-10-09 02:15 | 8.0K | |
| phpLiteAdmin-1.9.8.2..> | 2023-10-08 18:12 | 48K | |
| phpMyAdmin-php80-4.9..> | 2023-10-09 08:35 | 6.0M | |
| phpMyAdmin-php81-4.9..> | 2023-10-10 17:16 | 6.0M | |
| phpMyAdmin-php82-4.9..> | 2023-10-11 20:38 | 6.0M | |
| phpMyAdmin-php83-4.9..> | 2023-10-08 13:11 | 6.0M | |
| phpMyAdmin5-php80-5...> | 2023-10-14 11:00 | 7.3M | |
| phpMyAdmin5-php81-5...> | 2023-10-09 07:58 | 7.3M | |
| phpMyAdmin5-php82-5...> | 2023-10-09 07:00 | 7.3M | |
| phpMyAdmin5-php83-5...> | 2023-10-09 11:04 | 7.3M | |
| phpbb-2.0.23.pkg | 2023-10-08 18:37 | 399K | |
| phpbb3-3.3.9.pkg | 2023-10-10 16:59 | 3.4M | |
| phpeclipse-1.2.3_6.pkg | 2023-10-10 15:42 | 13M | |
| phpfpm_exporter-0.6...> | 2023-10-14 06:07 | 2.5M | |
| phpfpmtop-0.2_2.pkg | 2023-10-14 18:07 | 1.7M | |
| phpgroupware-0.9.16...> | 2023-10-11 08:22 | 13M | |
| phpicalendar-RC7-2.4..> | 2023-10-09 08:40 | 219K | |
| phpipam-1.5.2.pkg | 2023-10-11 00:18 | 3.8M | |
| phpldapadmin-php80-1..> | 2023-10-09 22:37 | 827K | |
| phpldapadmin-php81-1..> | 2023-10-14 10:42 | 828K | |
| phpldapadmin-php82-1..> | 2023-10-08 17:11 | 826K | |
| phpldapadmin-php83-1..> | 2023-10-14 09:43 | 827K | |
| phplist-php80-3.6.12..> | 2023-10-10 00:09 | 13M | |
| phplist-php81-3.6.12..> | 2023-10-10 08:26 | 13M | |
| phplot-6.2.0_2.pkg | 2023-10-10 06:20 | 887K | |
| phpmailer-5.2.28.pkg | 2023-10-09 19:03 | 111K | |
| phpmailer6-6.8.0.pkg | 2023-10-09 11:59 | 68K | |
| phpminiadmin-1.9.170..> | 2023-10-10 06:19 | 13K | |
| phpmustache-2.14.2.pkg | 2023-10-10 13:49 | 21K | |
| phpmyfaq-php80-3.1.1..> | 2023-10-14 12:41 | 6.7M | |
| phpmyfaq-php81-3.1.1..> | 2023-10-10 10:27 | 6.7M | |
| phpmyfaq-php82-3.1.1..> | 2023-10-14 06:52 | 6.7M | |
| phpmyfaq-php83-3.1.1..> | 2023-10-09 17:20 | 6.7M | |
| phppgadmin-php80-7.1..> | 2023-10-08 23:32 | 809K | |
| phppgadmin-php81-7.1..> | 2023-10-10 05:18 | 809K | |
| phppgadmin-php82-7.1..> | 2023-10-08 14:39 | 809K | |
| phppgadmin-php83-7.1..> | 2023-10-09 23:18 | 809K | |
| phprecipebook-3.01_5..> | 2023-10-09 13:24 | 629K | |
| phpsysinfo-3.4.3.pkg | 2023-10-10 08:48 | 929K | |
| phpunit8-php80-8.5.3..> | 2023-10-10 13:36 | 393K | |
| phpunit8-php81-8.5.3..> | 2023-10-09 03:58 | 393K | |
| phpunit8-php82-8.5.3..> | 2023-10-10 06:58 | 393K | |
| phpunit8-php83-8.5.3..> | 2023-10-10 10:14 | 393K | |
| phpunit9-php80-9.6.1..> | 2023-10-07 13:28 | 514K | |
| phpunit9-php81-9.6.1..> | 2023-10-07 16:15 | 514K | |
| phpunit9-php82-9.6.1..> | 2023-10-08 01:07 | 514K | |
| phpunit9-php83-9.6.1..> | 2023-10-08 11:56 | 514K | |
| phpunit10-php81-10.3..> | 2023-10-08 13:15 | 472K | |
| phpunit10-php82-10.3..> | 2023-10-09 14:37 | 472K | |
| phpunit10-php83-10.3..> | 2023-10-11 13:07 | 472K | |
| phpvirtualbox-6.1_2.pkg | 2023-10-10 14:28 | 2.7M | |
| phpvirtualbox-legacy..> | 2023-10-08 12:35 | 2.7M | |
| phpweathermap-0.97a_..> | 2023-10-08 12:35 | 2.5M | |
| phpwebftp-3.3b.pkg | 2023-10-14 04:41 | 67K | |
| phybs-20140717.pkg | 2023-10-09 02:58 | 6.5K | |
| phyml-3.3.20220408_1..> | 2023-10-14 12:41 | 881K | |
| physcalc-2.4_1.pkg | 2023-10-09 00:29 | 27K | |
| physfs-3.0.2.pkg | 2023-10-06 19:35 | 134K | |
| pianobar-2022.04.01_..> | 2023-10-10 07:38 | 37K | |
| pianobooster-1.0.0_7..> | 2023-10-10 16:34 | 1.0M | |
| pianod2-329_4.pkg | 2023-10-09 14:03 | 401K | |
| pic2fig-1.4_2.pkg | 2023-10-10 13:03 | 34K | |
| picard-2.9.2.pkg | 2023-10-09 08:24 | 2.1M | |
| picard-plugins-2.0.2..> | 2023-10-08 08:15 | 489K | |
| picard-tools-2.22.9.pkg | 2023-10-07 22:16 | 15M | |
| pichi-1.5.0.pkg | 2023-10-08 14:50 | 2.0M | |
| pick-4.0.0.pkg | 2023-10-10 10:50 | 11K | |
| pickle-4.20.pkg | 2023-10-09 14:59 | 82K | |
| picmi-23.08.1.pkg | 2023-10-07 07:06 | 1.2M | |
| pico-alpine-2.26.pkg | 2023-10-08 19:33 | 338K | |
| picoc-2.1_2.pkg | 2023-10-11 00:07 | 42K | |
| picocom-3.1.pkg | 2023-10-08 12:05 | 33K | |
| picocrypt-1.33_2.pkg | 2023-10-10 14:59 | 2.3M | |
| picojson-1.3.0.pkg | 2023-10-07 10:05 | 8.2K | |
| picom-10.2.pkg | 2023-10-10 09:41 | 155K | |
| picosat-965.pkg | 2023-10-08 03:03 | 111K | |
| picosha2-1.0.0.23.pkg | 2023-10-09 06:35 | 4.1K | |
| picpas-gtk2-0.9.0_10..> | 2023-10-09 08:33 | 1.8M | |
| picpas-qt5-0.9.0_10.pkg | 2023-10-09 10:30 | 1.8M | |
| picprog-1.9.1.pkg | 2023-10-14 12:45 | 66K | |
| picpuz-2.1.1_8.pkg | 2023-10-09 18:27 | 199K | |
| pict-3.7.4.pkg | 2023-10-10 15:28 | 129K | |
| pidgin-2.14.12_2.pkg | 2023-10-07 14:47 | 1.1M | |
| pidgin-bot-sentry-1...> | 2023-10-10 04:51 | 12K | |
| pidgin-encryption-3...> | 2023-10-08 16:20 | 85K | |
| pidgin-fetion-0.98.5..> | 2023-10-14 12:08 | 29K | |
| pidgin-hotkeys-0.2.4..> | 2023-10-14 12:54 | 36K | |
| pidgin-icyque-g20200..> | 2023-10-10 13:52 | 37K | |
| pidgin-latex-1.0_13.pkg | 2023-10-09 19:15 | 6.1K | |
| pidgin-libnotify-0.1..> | 2023-10-14 07:13 | 22K | |
| pidgin-manualsize-0...> | 2023-10-09 04:24 | 4.2K | |
| pidgin-otr-4.0.2_3.pkg | 2023-10-14 14:45 | 99K | |
| pidgin-sipe-1.24.0_4..> | 2023-10-09 02:22 | 305K | |
| pidgin-skypeweb-1.7_..> | 2023-10-08 19:00 | 72K | |
| pidgin-twitter-0.9.2..> | 2023-10-10 15:26 | 33K | |
| pidgin-window_merge-..> | 2023-10-14 10:35 | 7.6K | |
| pidof-20050501.pkg | 2023-10-07 23:28 | 2.9K | |
| pies-1.8.pkg | 2023-10-08 14:28 | 322K | |
| piewm-1.04_4.pkg | 2023-10-14 10:09 | 115K | |
| piglit-20200910_2.pkg | 2023-10-08 14:13 | 41M | |
| pigz-2.8.pkg | 2023-10-06 20:06 | 69K | |
| pijul-1.0.0.b6_2.pkg | 2023-10-10 06:24 | 3.7M | |
| pikchr-0.0.s20220130..> | 2023-10-10 00:12 | 44K | |
| pikopixel-1.0.b10_2,..> | 2023-10-07 18:31 | 414K | |
| pim-data-exporter-23..> | 2023-10-07 08:42 | 439K | |
| pim-sieve-editor-23...> | 2023-10-06 23:05 | 519K | |
| pimcommon-23.08.1_1.pkg | 2023-10-06 14:57 | 380K | |
| pimd-2.3.2.pkg | 2023-10-09 01:28 | 66K | |
| pimdd-0.2.1.0_2.pkg | 2023-10-10 03:32 | 38K | |
| pinball-0.3.20230219..> | 2023-10-08 18:52 | 4.4M | |
| pine-pgp-filters-1.8..> | 2023-10-10 21:08 | 11K | |
| pinentry-1.2.1.pkg | 2023-10-05 17:10 | 16K | |
| pinentry-curses-1.2...> | 2023-10-05 17:10 | 27K | |
| pinentry-efl-1.2.1_1..> | 2023-10-10 17:52 | 30K | |
| pinentry-fltk-1.2.1.pkg | 2023-10-10 18:56 | 34K | |
| pinentry-gnome-1.2.1..> | 2023-10-06 13:50 | 30K | |
| pinentry-gtk2-1.2.1_..> | 2023-10-09 18:01 | 32K | |
| pinentry-qt5-1.2.1.pkg | 2023-10-06 06:50 | 56K | |
| pinentry-tty-1.2.1.pkg | 2023-10-09 03:23 | 23K | |
| pinfo-0.6.13_1.pkg | 2023-10-14 15:17 | 70K | |
| ping_exporter-1.0.1_..> | 2023-10-10 18:19 | 2.8M | |
| pingus-0.7.6_24.pkg | 2023-10-10 21:59 | 12M | |
| pink-pony-1.4.1_40.pkg | 2023-10-14 07:51 | 10M | |
| pinot-1.21_8.pkg | 2023-10-08 14:16 | 1.1M | |
| pinpoint-0.1.4_8.pkg | 2023-10-08 19:46 | 22K | |
| pinta-1.7.1_3.pkg | 2023-10-10 19:20 | 771K | |
| pioneer-20230203.pkg | 2023-10-10 09:32 | 471M | |
| pioneers-15.6_3.pkg | 2023-10-09 15:40 | 3.1M | |
| pipe-2.5_2.pkg | 2023-10-08 03:19 | 1.6M | |
| pipe-viewer-0.4.8.pkg | 2023-10-10 18:27 | 104K | |
| pipebench-0.40.pkg | 2023-10-11 15:17 | 5.9K | |
| pipeglade-4.7.0_3.pkg | 2023-10-10 08:35 | 43K | |
| pipemeter-1.1.5.pkg | 2023-10-09 00:28 | 9.0K | |
| pipenightdreams-0.10..> | 2023-10-10 05:44 | 1.3M | |
| pipepanic-0.1.3_6.pkg | 2023-10-10 20:50 | 59K | |
| pipestatus-0.7.0.pkg | 2023-10-07 16:24 | 2.3K | |
| pipewalker-0.9.4_2.pkg | 2023-10-10 12:01 | 802K | |
| pipewire-0.3.62_3.pkg | 2023-10-05 18:03 | 1.5M | |
| piranha-0.11_8.pkg | 2023-10-07 20:51 | 242K | |
| pircbot-1.5.0_1.pkg | 2023-10-14 17:22 | 120K | |
| pire-0.0.6.pkg | 2023-10-14 06:45 | 262K | |
| pisg-0.73_1.pkg | 2023-10-09 20:01 | 120K | |
| pit-0.1.0.pkg | 2023-10-14 15:12 | 17K | |
| pithos-1.5.1_1.pkg | 2023-10-09 18:07 | 84K | |
| pitivi-2022.06_2.pkg | 2023-10-11 00:59 | 2.4M | |
| piwigo-php80-13.8.0_..> | 2023-10-10 15:52 | 11M | |
| piwigo-php81-13.8.0_..> | 2023-10-08 12:36 | 11M | |
| piwigo-php82-13.8.0_..> | 2023-10-08 17:49 | 11M | |
| piwigo-php83-13.8.0_..> | 2023-10-10 12:19 | 11M | |
| pixd-1.0.0_3.pkg | 2023-10-14 04:56 | 6.4K | |
| pixelize-1.0.0_5.pkg | 2023-10-10 04:57 | 22K | |
| pixen-0.1_11.pkg | 2023-10-07 13:28 | 450K | |
| pixie-2.2.6_39.pkg | 2023-10-10 14:56 | 4.3M | |
| pixiewps-1.4.1.pkg | 2023-10-09 09:05 | 35K | |
| pixman-0.42.2.pkg | 2023-10-05 16:48 | 328K | |
| pixz-1.0.7.pkg | 2023-10-08 04:18 | 17K | |
| pjsip-2.13.1.pkg | 2023-10-08 12:40 | 1.9M | |
| pkcrack-1.2.2.pkg | 2023-10-09 07:50 | 104K | |
| pkcs11-dump-0.3.4.pkg | 2023-10-10 23:49 | 17K | |
| pkcs11-gateway-1.4.pkg | 2023-10-14 12:01 | 55K | |
| pkcs11-helper-1.29.0..> | 2023-10-07 02:24 | 95K | |
| pkcs11-tools-2.6.0.pkg | 2023-10-10 14:07 | 348K | |
| pkesh-1.0.pkg | 2023-10-07 20:55 | 2.8K | |
| pkfonts118-1.0.pkg | 2023-10-09 17:09 | 1.4M | |
| pkfonts240-1.0.pkg | 2023-10-14 09:33 | 2.8M | |
| pkfonts300-1.0.pkg | 2023-10-08 16:04 | 5.0M | |
| pkfonts360-1.0.pkg | 2023-10-11 06:22 | 4.1M | |
| pkfonts400-1.0.pkg | 2023-10-08 19:25 | 5.0M | |
| pkfonts600-1.0.pkg | 2023-10-14 02:44 | 5.4M | |
| pkg-1.20.7.pkg | 2023-10-05 16:38 | 7.6M | |
| pkg-appstream-1.0.1.pkg | 2023-10-14 08:29 | 2.7K | |
| pkg-devel-1.20.99.6.pkg | 2023-10-10 05:05 | 12M | |
| pkg-graph-g20180614_..> | 2023-10-10 02:16 | 192K | |
| pkg-info.el-0.6_13.pkg | 2023-10-07 11:38 | 3.6K | |
| pkg-info.el-emacs_ca..> | 2023-10-08 10:40 | 3.6K | |
| pkg-info.el-emacs_de..> | 2023-10-07 12:56 | 3.6K | |
| pkg-info.el-emacs_de..> | 2023-10-08 08:03 | 3.6K | |
| pkg-info.el-emacs_no..> | 2023-10-07 15:33 | 3.6K | |
| pkg-provides-0.7.3_2..> | 2023-10-10 23:12 | 11K | |
| pkg-rmleaf-0.4.pkg | 2023-10-10 02:49 | 1.9K | |
| pkg_cleanup-2.1.pkg | 2023-10-09 21:58 | 6.1K | |
| pkg_cutleaves-201812..> | 2023-10-08 03:02 | 6.2K | |
| pkg_jail-2.14.pkg | 2023-10-09 22:10 | 19K | |
| pkg_replace-20230418..> | 2023-10-14 11:43 | 17K | |
| pkg_rmleaves-2019010..> | 2023-10-10 23:19 | 3.7K | |
| pkg_search-1.3.pkg | 2023-10-14 18:21 | 4.1K | |
| pkg_tree-1.1_5.pkg | 2023-10-08 09:14 | 4.9K | |
| pkgcompare-1.1.pkg | 2023-10-08 23:29 | 4.8K | |
| pkgconf-2.0.3,1.pkg | 2023-10-05 16:40 | 75K | |
| pkgs_which-0.4.1.pkg | 2023-10-14 16:24 | 9.7K | |
| pks-0.9.6.20040312_1..> | 2023-10-08 15:07 | 103K | |
| pkt-gen-g2023.03.22_..> | 2023-10-09 17:00 | 36K | |
| pktanon-1.4.0_20.pkg | 2023-10-14 11:41 | 90K | |
| pktstat-1.8.5_1.pkg | 2023-10-10 14:09 | 24K | |
| pl-aspell-6.0.200611..> | 2023-10-10 02:54 | 1.8M | |
| pl-fortunepl-2009112..> | 2023-10-09 09:15 | 722K | |
| pl-gnugadu2-2.3.0_18..> | 2023-10-09 12:42 | 438K | |
| pl-hunspell-20230801..> | 2023-10-09 22:47 | 1.0M | |
| pl-hyphen-2007.04.16..> | 2023-10-14 16:38 | 9.7K | |
| pl-libgadu-1.12.2_1,..> | 2023-10-07 16:12 | 93K | |
| pl-libreoffice-7.5.5..> | 2023-10-07 14:15 | 3.2M | |
| pl-libtlen-20041113_..> | 2023-10-08 03:25 | 260K | |
| pl-mythes-1.5_1.pkg | 2023-10-10 23:26 | 742K | |
| pl-napi-2.0.1_1.pkg | 2023-10-11 19:20 | 32K | |
| pl-qnapi-0.2.3_9.pkg | 2023-10-14 12:16 | 450K | |
| pl-tleenx2-20040214_..> | 2023-10-14 14:58 | 150K | |
| pl-trf-0.4.pkg | 2023-10-09 22:19 | 11K | |
| pl-webalizer-2.23.8_..> | 2023-10-14 11:34 | 130K | |
| plan-1.12.pkg | 2023-10-14 10:29 | 259K | |
| plan9port-20220913.pkg | 2023-10-14 08:22 | 34M | |
| planarity-3.0.2.0.pkg | 2023-10-07 17:22 | 111K | |
| plank-0.11.89_3.pkg | 2023-10-09 13:31 | 376K | |
| plans-8.2.1_3.pkg | 2023-10-10 00:28 | 661K | |
| plantri-5.2.pkg | 2023-10-14 15:43 | 115K | |
| plasma-g20180708_2.pkg | 2023-10-11 02:28 | 216K | |
| plasma-kmod-0.1_4.pkg | 2023-10-08 16:13 | 3.9K | |
| plasma-pass-1.2.1_2.pkg | 2023-10-10 16:35 | 50K | |
| plasma-wayland-proto..> | 2023-10-06 05:13 | 30K | |
| plasma5-breeze-5.27...> | 2023-10-06 11:08 | 71M | |
| plasma5-breeze-gtk-5..> | 2023-10-07 07:58 | 180K | |
| plasma5-discover-5.2..> | 2023-10-07 09:18 | 695K | |
| plasma5-drkonqi-5.27..> | 2023-10-06 18:55 | 431K | |
| plasma5-kactivityman..> | 2023-10-06 12:58 | 170K | |
| plasma5-kde-cli-tool..> | 2023-10-06 20:50 | 886K | |
| plasma5-kde-gtk-conf..> | 2023-10-07 06:15 | 60K | |
| plasma5-kdecoration-..> | 2023-10-06 10:31 | 65K | |
| plasma5-kdeplasma-ad..> | 2023-10-07 01:51 | 872K | |
| plasma5-kgamma5-5.27..> | 2023-10-07 05:34 | 151K | |
| plasma5-khotkeys-5.2..> | 2023-10-07 00:51 | 1.9M | |
| plasma5-kinfocenter-..> | 2023-10-06 22:11 | 922K | |
| plasma5-kmenuedit-5...> | 2023-10-06 19:35 | 1.0M | |
| plasma5-kpipewire-5...> | 2023-10-06 20:10 | 68K | |
| plasma5-kscreen-5.27..> | 2023-10-07 05:40 | 224K | |
| plasma5-kscreenlocke..> | 2023-10-06 11:59 | 166K | |
| plasma5-ksshaskpass-..> | 2023-10-07 01:31 | 23K | |
| plasma5-ksysguard-5...> | 2023-10-06 20:48 | 598K | |
| plasma5-ksystemstats..> | 2023-10-07 05:56 | 127K | |
| plasma5-kwallet-pam-..> | 2023-10-07 06:43 | 8.1K | |
| plasma5-kwayland-int..> | 2023-10-06 11:52 | 24K | |
| plasma5-kwin-5.27.8_..> | 2023-10-06 12:40 | 8.2M | |
| plasma5-kwrited-5.27..> | 2023-10-07 06:46 | 13K | |
| plasma5-layer-shell-..> | 2023-10-06 10:39 | 19K | |
| plasma5-libkscreen-5..> | 2023-10-06 10:14 | 208K | |
| plasma5-libksysguard..> | 2023-10-06 13:31 | 934K | |
| plasma5-milou-5.27.8..> | 2023-10-06 12:25 | 62K | |
| plasma5-oxygen-5.27...> | 2023-10-07 06:22 | 2.6M | |
| plasma5-plank-player..> | 2023-10-10 23:13 | 151K | |
| plasma5-plasma-5.27...> | 2023-10-08 05:57 | 1.0K | |
| plasma5-plasma-bigsc..> | 2023-10-09 02:07 | 915K | |
| plasma5-plasma-brows..> | 2023-10-07 00:08 | 102K | |
| plasma5-plasma-deskt..> | 2023-10-07 06:45 | 15M | |
| plasma5-plasma-disks..> | 2023-10-07 04:41 | 100K | |
| plasma5-plasma-integ..> | 2023-10-06 12:51 | 130K | |
| plasma5-plasma-pa-5...> | 2023-10-07 02:25 | 208K | |
| plasma5-plasma-sdk-5..> | 2023-10-07 09:09 | 387K | |
| plasma5-plasma-syste..> | 2023-10-10 15:24 | 200K | |
| plasma5-plasma-works..> | 2023-10-06 14:13 | 19M | |
| plasma5-plasma-works..> | 2023-10-06 20:39 | 90M | |
| plasma5-polkit-kde-a..> | 2023-10-06 23:10 | 53K | |
| plasma5-powerdevil-5..> | 2023-10-07 08:59 | 819K | |
| plasma5-sddm-kcm-5.2..> | 2023-10-09 22:51 | 94K | |
| plasma5-systemsettin..> | 2023-10-06 17:18 | 317K | |
| plasma5-xdg-desktop-..> | 2023-10-06 11:49 | 255K | |
| plasmatube-23.01.0_2..> | 2023-10-10 08:02 | 105K | |
| plata-theme-0.9.9_5.pkg | 2023-10-14 09:26 | 575K | |
| play-1.0_2.pkg | 2023-10-14 18:19 | 6.3K | |
| playerctl-2.3.1_1.pkg | 2023-10-07 19:52 | 115K | |
| playgsf-0.7.1_4.pkg | 2023-10-10 05:47 | 84K | |
| playmidi-2.5_1.pkg | 2023-10-10 17:06 | 31K | |
| playonbsd-4.2.10_10.pkg | 2023-10-09 11:13 | 2.1M | |
| playumidi-0.8.3.pkg | 2023-10-14 11:21 | 13K | |
| plconfig-0.2.pkg | 2023-10-08 18:39 | 7.5K | |
| pldebugger-1.5,1.pkg | 2023-10-10 16:55 | 23K | |
| please-3.0.pkg | 2023-10-11 01:02 | 4.8K | |
| please.build-15.17.0..> | 2023-10-14 15:04 | 11M | |
| plex-ttf-6.3.0.pkg | 2023-10-10 23:23 | 16M | |
| plexil-4.5.0_2.pkg | 2023-10-10 01:45 | 731K | |
| plexmediaserver-1.32..> | 2023-10-14 15:28 | 69M | |
| plexmediaserver-plex..> | 2023-10-14 14:49 | 69M | |
| plib-1.8.5_8.pkg | 2023-10-07 01:15 | 593K | |
| plink-1.90.b6.17_2.pkg | 2023-10-10 14:59 | 804K | |
| plman-2.5.1_2.pkg | 2023-10-09 20:48 | 1.1M | |
| pload-0.9.5_5.pkg | 2023-10-08 12:28 | 10K | |
| plocate-1.1.19.pkg | 2023-10-14 03:27 | 113K | |
| plopfolio-0.1.0_12.pkg | 2023-10-07 23:31 | 38K | |
| ploticus-2.40_12.pkg | 2023-10-07 04:20 | 271K | |
| ploticus-nox11-2.40_..> | 2023-10-10 20:18 | 266K | |
| plotutils-2.6_9,1.pkg | 2023-10-07 05:31 | 1.2M | |
| plow-1.3.1_10.pkg | 2023-10-09 17:14 | 3.6M | |
| plplot-5.15.0_6.pkg | 2023-10-07 17:03 | 685K | |
| plugdaemon-2.5.5_1.pkg | 2023-10-08 17:22 | 13K | |
| pluma-1.26.0_4.pkg | 2023-10-08 07:03 | 2.4M | |
| pluma-plugins-1.26.0..> | 2023-10-08 13:10 | 207K | |
| plumed-2.8.0_1.pkg | 2023-10-07 02:17 | 4.1M | |
| plzip-1.10.pkg | 2023-10-09 03:52 | 81K | |
| pm-lib-20091202_1.pkg | 2023-10-11 06:01 | 156K | |
| pm3umpdl-1.0.0.pkg | 2023-10-08 23:20 | 5.3K | |
| pmacct-1.7.8.pkg | 2023-10-09 07:42 | 1.0M | |
| pmars-0.9.2_3.pkg | 2023-10-10 13:49 | 159K | |
| pmars-sdl-0.9.2_7.pkg | 2023-10-14 06:23 | 65K | |
| pmccabe-2.6.pkg | 2023-10-09 14:33 | 21K | |
| pmd-6.53.0.pkg | 2023-10-11 05:29 | 41M | |
| pmdk-1.13.1.pkg | 2023-10-10 22:15 | 555K | |
| pmenu-2.5.0.pkg | 2023-10-11 15:10 | 16K | |
| pms-0.42_14.pkg | 2023-10-10 18:05 | 135K | |
| pms-devel-0.0.202211..> | 2023-10-10 15:52 | 3.3M | |
| pmt-0.2.pkg | 2023-10-10 23:28 | 6.0K | |
| pmwiki-2.3.25,1.pkg | 2023-10-09 08:38 | 408K | |
| pnetcdf-1.12.3_1.pkg | 2023-10-14 10:46 | 891K | |
| pnews-2.6.6,1.pkg | 2023-10-14 06:22 | 176K | |
| png++-0.2.10.pkg | 2023-10-07 23:00 | 22K | |
| png-1.6.40.pkg | 2023-10-05 17:37 | 293K | |
| png2html-1.1_12.pkg | 2023-10-14 05:03 | 4.2K | |
| png2ico-2002.12.08_5..> | 2023-10-09 23:19 | 20K | |
| pngcheck-3.0.3.pkg | 2023-10-09 09:01 | 50K | |
| pngcrush-1.8.13.pkg | 2023-10-08 04:13 | 39K | |
| pnglite-0.1.17_1.pkg | 2023-10-07 16:05 | 8.2K | |
| pngnq-1.1_3.pkg | 2023-10-11 06:16 | 22K | |
| pngquant-2.18.0.pkg | 2023-10-07 19:17 | 19K | |
| pngrewrite-1.4.0_2.pkg | 2023-10-10 20:52 | 7.4K | |
| pngwriter-0.7.0_2.pkg | 2023-10-09 07:39 | 221K | |
| pnm2ppa-1.13_5.pkg | 2023-10-08 19:45 | 79K | |
| pnp-0.6.26_2.pkg | 2023-10-09 11:51 | 2.2M | |
| pnp-icinga2-0.6.26_2..> | 2023-10-08 21:43 | 2.2M | |
| pnscan-1.14.1.pkg | 2023-10-09 19:19 | 13K | |
| po4a-0.68.pkg | 2023-10-06 18:10 | 2.0M | |
| pocketsphinx-0.8_1.pkg | 2023-10-12 10:08 | 15M | |
| pocl-4.0.pkg | 2023-10-10 19:06 | 11M | |
| poco-1.12.4.pkg | 2023-10-06 21:16 | 2.8M | |
| pod2mdoc-0.2.pkg | 2023-10-14 16:05 | 18K | |
| podcastamatic-1.3_1.pkg | 2023-10-10 22:58 | 12K | |
| podcastdl-0.3.3.pkg | 2023-10-09 02:17 | 5.6K | |
| podofo-0.10.1_3.pkg | 2023-10-07 14:46 | 957K | |
| podofo09-0.9.8_3.pkg | 2023-10-07 13:25 | 1.2M | |
| poe-0.5.1_15.pkg | 2023-10-08 01:08 | 57K | |
| poedit-3.3.1.pkg | 2023-10-09 23:01 | 1.3M | |
| pointcloud-1.2.4.pkg | 2023-10-09 00:06 | 55K | |
| poke-3.2.pkg | 2023-10-14 11:58 | 752K | |
| polari-42.1_1.pkg | 2023-10-08 15:33 | 326K | |
| policyd2-2.0.14_3.pkg | 2023-10-08 22:54 | 86K | |
| polipo-1.1.1_3.pkg | 2023-10-09 12:29 | 156K | |
| polkit-123_1.pkg | 2023-10-05 17:49 | 142K | |
| polkit-gnome-0.105_3..> | 2023-10-06 16:56 | 51K | |
| polkit-qt-1-0.114.0.pkg | 2023-10-05 20:14 | 65K | |
| polo-18.8.b_3.pkg | 2023-10-14 19:00 | 1.2M | |
| poly-lv2-g20210408_1..> | 2023-10-09 12:37 | 70K | |
| poly2tri-g20191130_1..> | 2023-10-09 19:56 | 31K | |
| polybar-3.6.3_3.pkg | 2023-10-08 23:52 | 518K | |
| polyclipper-1.2.4.pkg | 2023-10-08 02:23 | 17K | |
| polyclipping-6.4.2.pkg | 2023-10-06 19:35 | 53K | |
| polyglot-1.4.70.b_1.pkg | 2023-10-10 18:36 | 97K | |
| polygraph-4.13.0_4.pkg | 2023-10-09 04:22 | 2.6M | |
| polylib-5.22.5.pkg | 2023-10-08 11:07 | 132K | |
| polymake-4.10.pkg | 2023-10-09 16:14 | 23M | |
| polyml-5.9_1.pkg | 2023-10-08 14:05 | 1.5M | |
| polyphone-2.3.0_5.pkg | 2023-10-10 14:11 | 1.4M | |
| polytope-0.7.3.pkg | 2023-10-07 15:37 | 1.3M | |
| pomerium-0.8.3_15,1.pkg | 2023-10-10 08:41 | 6.4M | |
| pomsky-0.10_1.pkg | 2023-10-12 09:01 | 291K | |
| pongix-0.4_13.pkg | 2023-10-10 17:13 | 102K | |
| ponscripter-07th-mod..> | 2023-10-07 18:50 | 303K | |
| pooler-1.88.pkg | 2023-10-08 14:51 | 74K | |
| pop-gtk-themes-5.3.1..> | 2023-10-11 17:30 | 234K | |
| pop-icon-theme-20210..> | 2023-10-08 20:27 | 7.4M | |
| popa3d-1.0.3.pkg | 2023-10-14 16:08 | 19K | |
| popa3d-before-sendma..> | 2023-10-14 11:38 | 22K | |
| popcheck-1.3.pkg | 2023-10-09 17:35 | 8.9K | |
| popfile-1.1.3_1.pkg | 2023-10-09 05:12 | 298K | |
| poppler-23.05.0_2.pkg | 2023-10-05 19:41 | 1.1M | |
| poppler-data-0.4.12.pkg | 2023-10-05 16:44 | 1.5M | |
| poppler-glib-23.05.0..> | 2023-10-06 13:12 | 193K | |
| poppler-qt5-23.05.0_..> | 2023-10-06 10:21 | 174K | |
| poppler-qt6-23.05.0_..> | 2023-10-07 12:22 | 161K | |
| poppler-utils-23.05...> | 2023-10-06 18:18 | 170K | |
| poppwd-2.0.pkg | 2023-10-10 10:50 | 8.1K | |
| popstar-0.0.2_2.pkg | 2023-10-14 05:03 | 7.4M | |
| popt-1.19.pkg | 2023-10-05 17:06 | 65K | |
| poptop-1.4.0_1.pkg | 2023-10-09 22:42 | 33K | |
| popular-1.5.5_8.pkg | 2023-10-11 03:34 | 114K | |
| popup-stacks-1.0.pkg | 2023-10-08 17:59 | 81K | |
| port-authoring-tools..> | 2023-10-09 01:48 | 548 | |
| port-index-uniquifie..> | 2023-10-10 20:29 | 536 | |
| port-maintenance-too..> | 2023-10-10 09:44 | 684 | |
| portacl-rc-0.9.0.pkg | 2023-10-14 12:13 | 4.1K | |
| portal-0.4_5.pkg | 2023-10-14 07:07 | 33K | |
| portaudio-19.6.0_7,1..> | 2023-10-06 12:07 | 158K | |
| portconf-1.6_1.pkg | 2023-10-08 07:41 | 2.3K | |
| portconfig-0.5.pkg | 2023-10-14 11:16 | 135K | |
| portdowngrade-1.7.pkg | 2023-10-07 14:40 | 2.8K | |
| portest-0.1.9_1.pkg | 2023-10-09 16:50 | 7.4K | |
| portfind-1.6.3.pkg | 2023-10-10 11:17 | 8.2K | |
| portfmt-1.1.5.pkg | 2023-10-09 04:36 | 202K | |
| portfwd-0.29_1.pkg | 2023-10-09 22:37 | 44K | |
| portgraph-0.0.1.pkg | 2023-10-10 10:38 | 7.7K | |
| portgrep-1.4.1_8.pkg | 2023-10-14 01:35 | 962K | |
| portless-0.2.7_1.pkg | 2023-10-09 21:13 | 4.9K | |
| portlint-2.20.0.pkg | 2023-10-07 07:29 | 32K | |
| portmaster-3.26.pkg | 2023-10-07 12:43 | 41K | |
| portmidi-236.pkg | 2023-10-07 07:36 | 28K | |
| portmon-2.0_1.pkg | 2023-10-10 03:21 | 14K | |
| portoptscli-0.0.1.pkg | 2023-10-11 15:17 | 8.4K | |
| portrac-0.5.1.pkg | 2023-10-08 20:17 | 28K | |
| ports-tools-1.8.pkg | 2023-10-09 07:49 | 22K | |
| portscout-0.8.1.6_1.pkg | 2023-10-10 12:58 | 54K | |
| portsdb-0.3_1.pkg | 2023-10-09 05:50 | 12K | |
| portsearch-1.3.5.pkg | 2023-10-08 15:51 | 13K | |
| portshaker-1.0.19_3.pkg | 2023-10-07 23:39 | 17K | |
| portshaker-config-1...> | 2023-10-09 18:27 | 2.4K | |
| portsreinstall-4.1.0..> | 2023-10-11 03:39 | 107K | |
| porttools-1.11.pkg | 2023-10-08 09:41 | 20K | |
| porttree-1.1.r114_2.pkg | 2023-10-14 04:17 | 8.7K | |
| portupdate-scan-0.4.pkg | 2023-10-10 01:41 | 6.5K | |
| portupgrade-2.4.16_1..> | 2023-10-08 02:25 | 92K | |
| portupgrade-devel-20..> | 2023-10-14 13:16 | 92K | |
| poser-1.1.pkg | 2023-10-08 02:38 | 42K | |
| posixtestsuite-1.5.2..> | 2023-10-11 19:20 | 784 | |
| postal-0.76.pkg | 2023-10-10 15:53 | 49K | |
| posterazor-1.9.7_1.pkg | 2023-10-10 13:16 | 119K | |
| postfinger-1.30.pkg | 2023-10-09 17:14 | 3.8K | |
| postfix-3.8.2,1.pkg | 2023-10-08 04:45 | 1.6M | |
| postfix-current-3.8...> | 2023-10-09 19:02 | 1.6M | |
| postfix-current-ldap..> | 2023-10-11 00:18 | 1.6M | |
| postfix-current-sasl..> | 2023-10-11 17:16 | 1.6M | |
| postfix-ldap-3.8.2,1..> | 2023-10-09 16:58 | 1.6M | |
| postfix-logwatch-1.4..> | 2023-10-10 21:18 | 82K | |
| postfix-mysql-3.8.2,..> | 2023-10-09 01:07 | 1.6M | |
| postfix-pgsql-3.8.2,..> | 2023-10-11 09:27 | 1.6M | |
| postfix-policyd-sf-1..> | 2023-10-09 05:51 | 57K | |
| postfix-policyd-spf-..> | 2023-10-09 04:59 | 4.8K | |
| postfix-policyd-weig..> | 2023-10-14 15:52 | 33K | |
| postfix-postfwd-2.03..> | 2023-10-10 14:49 | 141K | |
| postfix-sasl-3.8.2,1..> | 2023-10-10 19:46 | 1.6M | |
| postfix-sqlite-3.8.2..> | 2023-10-14 02:50 | 1.6M | |
| postfixadmin-lite-ph..> | 2023-10-09 15:08 | 4.1M | |
| postfixadmin-lite-ph..> | 2023-10-14 16:53 | 4.1M | |
| postfixadmin-lite-ph..> | 2023-10-09 08:58 | 4.1M | |
| postfixadmin-lite-ph..> | 2023-10-10 00:04 | 4.1M | |
| postfixadmin-php80-3..> | 2023-10-09 19:36 | 4.2M | |
| postfixadmin-php81-3..> | 2023-10-09 12:52 | 4.2M | |
| postfixadmin-php82-3..> | 2023-10-14 13:50 | 4.2M | |
| postfixadmin-php83-3..> | 2023-10-10 10:05 | 4.2M | |
| postfixadmin33-lite-..> | 2023-10-10 03:14 | 1.3M | |
| postfixadmin33-lite-..> | 2023-10-14 13:10 | 1.3M | |
| postfixadmin33-lite-..> | 2023-10-09 13:05 | 1.3M | |
| postfixadmin33-lite-..> | 2023-10-10 11:20 | 1.3M | |
| postfixadmin33-php80..> | 2023-10-10 10:26 | 1.4M | |
| postfixadmin33-php81..> | 2023-10-09 06:52 | 1.4M | |
| postfixadmin33-php82..> | 2023-10-08 21:55 | 1.4M | |
| postfixadmin33-php83..> | 2023-10-14 09:38 | 1.4M | |
| postforward-1.1.1_9.pkg | 2023-10-14 06:18 | 743K | |
| postgis-jdbc-2.1.7.pkg | 2023-10-11 22:14 | 69K | |
| postgis31-3.1.9.pkg | 2023-10-08 00:38 | 2.0M | |
| postgis32-3.2.5.pkg | 2023-10-08 21:55 | 1.9M | |
| postgis33-3.3.4.pkg | 2023-10-08 05:03 | 1.7M | |
| postgresql-jdbc-42.6..> | 2023-10-07 23:42 | 1.0M | |
| postgresql-libpgeasy..> | 2023-10-10 19:23 | 9.2K | |
| postgresql-libpqxx-7..> | 2023-10-07 23:47 | 371K | |
| postgresql-odbc-16.0..> | 2023-10-10 00:31 | 310K | |
| postgresql-orafce-4...> | 2023-10-09 15:05 | 106K | |
| postgresql-plproxy-2..> | 2023-10-14 16:58 | 33K | |
| postgresql-relay-1.3..> | 2023-10-10 01:56 | 11K | |
| postgresql-repmgr-5...> | 2023-10-09 03:29 | 242K | |
| postgresql11-client-..> | 2023-10-07 06:06 | 2.6M | |
| postgresql11-contrib..> | 2023-10-07 12:00 | 479K | |
| postgresql11-cstore_..> | 2023-10-14 08:18 | 27K | |
| postgresql11-docs-11..> | 2023-10-14 13:23 | 1.8M | |
| postgresql11-plperl-..> | 2023-10-10 04:48 | 137K | |
| postgresql11-plpytho..> | 2023-10-09 22:26 | 55K | |
| postgresql11-pltcl-1..> | 2023-10-08 23:39 | 22K | |
| postgresql11-server-..> | 2023-10-07 21:44 | 12M | |
| postgresql11-wal2jso..> | 2023-10-09 04:24 | 15K | |
| postgresql12-client-..> | 2023-10-07 00:21 | 2.6M | |
| postgresql12-contrib..> | 2023-10-08 16:33 | 485K | |
| postgresql12-docs-12..> | 2023-10-09 08:55 | 1.8M | |
| postgresql12-plperl-..> | 2023-10-09 09:36 | 137K | |
| postgresql12-plpytho..> | 2023-10-14 05:35 | 56K | |
| postgresql12-pltcl-1..> | 2023-10-10 22:16 | 22K | |
| postgresql12-server-..> | 2023-10-08 06:43 | 13M | |
| postgresql13-client-..> | 2023-10-07 04:29 | 2.7M | |
| postgresql13-contrib..> | 2023-10-14 14:56 | 492K | |
| postgresql13-docs-13..> | 2023-10-10 18:13 | 1.8M | |
| postgresql13-plperl-..> | 2023-10-11 06:41 | 139K | |
| postgresql13-plpytho..> | 2023-10-09 00:33 | 55K | |
| postgresql13-pltcl-1..> | 2023-10-09 10:42 | 22K | |
| postgresql13-server-..> | 2023-10-08 06:57 | 13M | |
| postgresql14-client-..> | 2023-10-07 07:05 | 2.8M | |
| postgresql14-contrib..> | 2023-10-08 15:15 | 504K | |
| postgresql14-docs-14..> | 2023-10-09 22:30 | 1.9M | |
| postgresql14-plperl-..> | 2023-10-08 18:27 | 139K | |
| postgresql14-plpytho..> | 2023-10-09 14:56 | 55K | |
| postgresql14-pltcl-1..> | 2023-10-11 07:30 | 22K | |
| postgresql14-server-..> | 2023-10-08 08:59 | 13M | |
| postgresql15-client-..> | 2023-10-05 17:23 | 2.9M | |
| postgresql15-contrib..> | 2023-10-07 04:55 | 515K | |
| postgresql15-docs-15..> | 2023-10-10 20:09 | 1.9M | |
| postgresql15-idn-0.2..> | 2023-10-11 05:06 | 8.0K | |
| postgresql15-mysql_f..> | 2023-10-09 05:29 | 34K | |
| postgresql15-ogr_fdw..> | 2023-10-10 18:11 | 29K | |
| postgresql15-pg_dirt..> | 2023-10-09 23:08 | 5.3K | |
| postgresql15-pg_repa..> | 2023-10-10 07:07 | 50K | |
| postgresql15-pg_simi..> | 2023-10-09 19:50 | 26K | |
| postgresql15-pgaudit..> | 2023-10-10 09:57 | 11K | |
| postgresql15-plperl-..> | 2023-10-09 10:05 | 139K | |
| postgresql15-plpgsql..> | 2023-10-14 06:34 | 73K | |
| postgresql15-plpytho..> | 2023-10-14 13:09 | 54K | |
| postgresql15-pltcl-1..> | 2023-10-08 10:37 | 22K | |
| postgresql15-prefix-..> | 2023-10-14 14:54 | 17K | |
| postgresql15-promsca..> | 2023-10-14 16:53 | 2.6M | |
| postgresql15-rum-1.3..> | 2023-10-09 13:47 | 101K | |
| postgresql15-semver-..> | 2023-10-14 12:02 | 15K | |
| postgresql15-server-..> | 2023-10-07 09:23 | 14M | |
| postgresql15-tds_fdw..> | 2023-10-08 16:39 | 31K | |
| postgresql15-zhparse..> | 2023-10-09 13:23 | 4.0M | |
| postgresql16-client-..> | 2023-10-07 08:01 | 3.1M | |
| postgresql16-contrib..> | 2023-10-11 22:53 | 520K | |
| postgresql16-docs-16..> | 2023-10-09 13:30 | 1.9M | |
| postgresql16-plperl-..> | 2023-10-10 02:28 | 139K | |
| postgresql16-plpytho..> | 2023-10-10 17:52 | 53K | |
| postgresql16-pltcl-1..> | 2023-10-14 13:40 | 22K | |
| postgresql16-server-..> | 2023-10-07 20:00 | 15M | |
| postgrey-1.37_3.pkg | 2023-10-11 02:28 | 42K | |
| postmark-1.53.pkg | 2023-10-10 06:23 | 12K | |
| postsrsd-2.0.8,1.pkg | 2023-10-08 04:01 | 27K | |
| pot-0.15.5.pkg | 2023-10-07 00:01 | 62K | |
| potnet-0.4.4_34.pkg | 2023-10-06 21:58 | 469K | |
| potrace-1.16.pkg | 2023-10-06 22:00 | 84K | |
| poudriere-3.3.7_1.pkg | 2023-10-07 20:22 | 732K | |
| poudriere-devel-3.3...> | 2023-10-09 07:37 | 758K | |
| pounce-3.1.pkg | 2023-10-09 11:08 | 33K | |
| pound-4.7.pkg | 2023-10-14 08:49 | 155K | |
| povray-meta-0.1_3.pkg | 2023-10-07 22:42 | 572 | |
| povray36-3.6.1_15.pkg | 2023-10-14 17:46 | 5.3M | |
| povray37-3.7.0.10_11..> | 2023-10-07 07:00 | 21M | |
| povray38-3.8.0.b.2_8..> | 2023-10-14 10:37 | 23M | |
| powa-archivist-4.2.0..> | 2023-10-14 05:51 | 37K | |
| powder-118.pkg | 2023-10-10 22:07 | 603K | |
| powder-toy-97.0.352_..> | 2023-10-08 22:34 | 958K | |
| powder-toy-devel-s.2..> | 2023-10-08 14:47 | 964K | |
| poweralertd-0.2.0.pkg | 2023-10-09 02:33 | 6.9K | |
| powerarchitect-1.0.9..> | 2023-10-09 06:16 | 23M | |
| powerdns-4.8.2.pkg | 2023-10-09 22:50 | 2.3M | |
| powerdns-recursor-4...> | 2023-10-09 01:22 | 1.7M | |
| powerdxx-0.4.4_1.pkg | 2023-10-14 05:28 | 1.0M | |
| powerline-fonts-0.0...> | 2023-10-09 16:49 | 5.6M | |
| powerman-2.3.20_2.pkg | 2023-10-08 00:27 | 117K | |
| powermanga-0.93.1.pkg | 2023-10-10 19:48 | 9.0M | |
| powermon-1.0.0_1.pkg | 2023-10-11 00:57 | 7.7K | |
| powerpc-binutils-2.4..> | 2023-10-08 05:49 | 2.2M | |
| powerpc-freebsd-sysr..> | 2023-10-08 08:46 | 46M | |
| powerpc-gcc9-9.5.0_1..> | 2023-10-08 15:21 | 20M | |
| powerpc64-binutils-2..> | 2023-10-08 06:45 | 2.3M | |
| powerpc64-freebsd-sy..> | 2023-10-07 20:42 | 39M | |
| powerpc64-gcc9-9.5.0..> | 2023-10-14 19:07 | 20M | |
| powerpc64-rust-boots..> | 2023-10-14 16:53 | 88M | |
| powerpc64le-binutils..> | 2023-10-10 18:47 | 2.3M | |
| powerpcspe-freebsd-s..> | 2023-10-14 11:48 | 35M | |
| powwow-1.2.23.pkg | 2023-10-10 17:13 | 122K | |
| poxml-23.08.1.pkg | 2023-10-09 22:08 | 99K | |
| pp-1.03_1.pkg | 2023-10-09 23:04 | 9.3K | |
| pp3-1.3.3_6.pkg | 2023-10-09 19:23 | 955K | |
| ppl-1.2.pkg | 2023-10-07 07:30 | 10M | |
| ppmcaption-1.1.pkg | 2023-10-14 18:13 | 55K | |
| ppmd-20050811.pkg | 2023-10-14 08:05 | 20K | |
| ppminfo-0.1_5.pkg | 2023-10-09 16:44 | 4.3K | |
| ppower4-0.9.4_8.pkg | 2023-10-08 15:16 | 372K | |
| pprof-g20200905_14.pkg | 2023-10-10 11:52 | 2.8M | |
| pprotectd-0.1.pkg | 2023-10-09 13:14 | 8.1K | |
| ppsei-0.3.pkg | 2023-10-14 14:12 | 4.6K | |
| ppsspp-1.16.2.pkg | 2023-10-10 04:36 | 13M | |
| ppsspp-qt5-1.16.2.pkg | 2023-10-10 08:53 | 13M | |
| pptpclient-1.10.0.pkg | 2023-10-09 02:22 | 30K | |
| ppunpack-1.0.pkg | 2023-10-08 16:43 | 4.7K | |
| pqiv-2.12_22.pkg | 2023-10-09 08:10 | 73K | |
| pqrs-0.3.1_3.pkg | 2023-10-10 09:11 | 1.9M | |
| pr-1.1_1.pkg | 2023-10-10 14:11 | 4.6K | |
| praat-6.3.17.pkg | 2023-10-10 21:08 | 7.5M | |
| pragha-1.3.3_10.pkg | 2023-10-14 08:22 | 280K | |
| prboom-2.5.0_13.pkg | 2023-10-08 15:51 | 400K | |
| prboom-plus-2.5.1.3_..> | 2023-10-09 17:14 | 601K | |
| precice-2.5.0_3.pkg | 2023-10-08 10:24 | 847K | |
| predict-2.2.7.pkg | 2023-10-11 20:29 | 1.2M | |
| preferences-1.2.0_13..> | 2023-10-06 23:32 | 44K | |
| premake-3.7_1.pkg | 2023-10-10 13:34 | 121K | |
| premake4-4.4.b5.pkg | 2023-10-08 03:13 | 110K | |
| premake5-5.0.0.b2.pkg | 2023-10-08 03:53 | 606K | |
| prepflog-0.4.1.pkg | 2023-10-10 13:03 | 10K | |
| presage-0.9.1.pkg | 2023-10-07 15:55 | 9.6M | |
| prestashop-1.7.8.8.pkg | 2023-10-14 14:45 | 46M | |
| price-1.3.0_8.pkg | 2023-10-08 10:27 | 126K | |
| primateplunge-1.1_8.pkg | 2023-10-14 02:52 | 3.8M | |
| primecount-7.4_2.pkg | 2023-10-08 10:39 | 120K | |
| primegen-0.97.pkg | 2023-10-14 15:10 | 11K | |
| primer3-2.3.6.pkg | 2023-10-07 05:35 | 96K | |
| primesieve-8.0,1.pkg | 2023-10-06 23:08 | 97K | |
| primesum-1.7.19.pkg | 2023-10-08 12:28 | 146K | |
| primme-3.2_1.pkg | 2023-10-08 06:47 | 636K | |
| print-manager-23.08...> | 2023-10-07 02:35 | 391K | |
| print-n-times-1.0_1.pkg | 2023-10-07 20:52 | 2.0K | |
| printscreen-1.4_1.pkg | 2023-10-10 18:58 | 1.5K | |
| prips-1.2.0.pkg | 2023-10-08 11:13 | 8.1K | |
| privatebin-1.6.0.pkg | 2023-10-11 14:54 | 535K | |
| privoxy-3.0.34.pkg | 2023-10-09 23:33 | 455K | |
| prng-3.0.2_3.pkg | 2023-10-14 05:31 | 248K | |
| proby-1.0.2_29.pkg | 2023-10-10 02:15 | 880K | |
| procenv-0.60.pkg | 2023-10-10 23:38 | 47K | |
| process-viewer-g2022..> | 2023-10-10 23:19 | 384K | |
| processing-1.5.1,1.pkg | 2023-10-10 21:31 | 33M | |
| prociono-g20110526_1..> | 2023-10-14 04:55 | 22K | |
| procmail-3.22_10.pkg | 2023-10-08 06:41 | 133K | |
| procmail-bgrb-3.24_1..> | 2023-10-09 17:25 | 134K | |
| procmap-1.0.pkg | 2023-10-14 18:22 | 4.4K | |
| prodigal-2.6.3.16.pkg | 2023-10-08 20:48 | 407K | |
| prodigy-lig-1.0.1_2.pkg | 2023-10-11 09:00 | 15K | |
| profanity-0.14.0.pkg | 2023-10-10 00:25 | 418K | |
| profont-400_5.pkg | 2023-10-10 06:22 | 39K | |
| proftpd-1.3.8_2.pkg | 2023-10-07 02:45 | 4.7M | |
| proftpd-mod_clamav-0..> | 2023-10-14 10:52 | 31K | |
| proftpd-mod_ldap-1.3..> | 2023-10-14 06:45 | 88K | |
| proftpd-mod_sql_mysq..> | 2023-10-08 06:16 | 37K | |
| proftpd-mod_sql_odbc..> | 2023-10-14 06:32 | 39K | |
| proftpd-mod_sql_post..> | 2023-10-09 04:44 | 33K | |
| proftpd-mod_sql_sqli..> | 2023-10-14 16:35 | 32K | |
| proftpd-mod_sql_tds-..> | 2023-10-09 06:25 | 31K | |
| proftpd-mod_vroot-0...> | 2023-10-14 10:17 | 54K | |
| profxp-3p2_2.pkg | 2023-10-09 12:36 | 16K | |
| proggy_fonts-1.0_5.pkg | 2023-10-14 07:23 | 75K | |
| proggy_fonts-ttf-1.0..> | 2023-10-09 14:15 | 17K | |
| progsreiserfs-0.3.1...> | 2023-10-08 18:55 | 89K | |
| proguard-7.0.0.pkg | 2023-10-14 10:20 | 4.4M | |
| proj-9.2.1,1.pkg | 2023-10-06 09:43 | 2.2M | |
| proj-data-1.15.pkg | 2023-10-10 09:44 | 693M | |
| projectcenter-0.6.2_..> | 2023-10-14 13:34 | 391K | |
| projectlibre-1.9.3.pkg | 2023-10-09 02:05 | 17M | |
| projectx-0.91.0_1.pkg | 2023-10-08 06:04 | 1.1M | |
| prometheus-2.43.0_2.pkg | 2023-10-14 09:23 | 32M | |
| prometheus-collectd-..> | 2023-10-08 13:15 | 2.7M | |
| prometheus-dnssec-ex..> | 2023-10-10 23:15 | 2.4M | |
| prometheus-postgresq..> | 2023-10-08 19:15 | 3.3M | |
| prometheus1-1.8.2_17..> | 2023-10-08 17:59 | 9.5M | |
| promscale-0.17.0_6.pkg | 2023-10-14 02:17 | 7.3M | |
| prosearch-0.19.4_10.pkg | 2023-10-09 10:25 | 285K | |
| prosody-0.12.4.pkg | 2023-10-07 06:12 | 359K | |
| prosody-modules-2022..> | 2023-10-14 16:51 | 305K | |
| protobuf-3.21.12,1.pkg | 2023-10-05 17:01 | 3.0M | |
| protobuf-c-1.4.1_1.pkg | 2023-10-06 18:32 | 178K | |
| protobuf-java-3.22.2..> | 2023-10-07 04:13 | 1.5M | |
| protobuf25-2.5.0_5.pkg | 2023-10-09 20:41 | 907K | |
| protomol-2.0.3_15.pkg | 2023-10-14 08:53 | 1.6M | |
| prototool-1.10.0_14.pkg | 2023-10-14 18:19 | 3.4M | |
| protovis-3.3.1.pkg | 2023-10-08 15:00 | 214K | |
| protozero-1.7.1.pkg | 2023-10-07 09:49 | 25K | |
| prowlarr-1.8.6.3946.pkg | 2023-10-10 22:32 | 22M | |
| proxsmtp-1.10_2.pkg | 2023-10-09 22:10 | 41K | |
| proxy-suite-1.9.2.4_..> | 2023-10-10 03:58 | 46K | |
| proxychains-3.1_3.pkg | 2023-10-08 15:47 | 15K | |
| proxychains-ng-4.16_..> | 2023-10-10 21:32 | 32K | |
| proxycheck-0.49a.pkg | 2023-10-08 22:38 | 29K | |
| proxygen-2023.09.18...> | 2023-10-09 02:08 | 1.3M | |
| proxyper-347_1.pkg | 2023-10-09 13:29 | 252K | |
| proxytunnel-1.11.pkg | 2023-10-14 10:24 | 22K | |
| prql-compiler-0.9.4_..> | 2023-10-14 17:20 | 1.7M | |
| prtunnel-0.2.7.pkg | 2023-10-09 01:26 | 25K | |
| pructl-0.2_1.pkg | 2023-10-10 01:39 | 7.6K | |
| ps2eps-1.64_5.pkg | 2023-10-14 04:55 | 57K | |
| pscal-1.16.pkg | 2023-10-14 06:29 | 12K | |
| psdim-1.4_8.pkg | 2023-10-10 17:22 | 13K | |
| psearch-2.1.0.pkg | 2023-10-10 06:24 | 20K | |
| pserv-3.4.pkg | 2023-10-08 12:58 | 17K | |
| psftools-1.0.13.pkg | 2023-10-07 20:03 | 157K | |
| psgml-1.4.0_19.pkg | 2023-10-10 14:15 | 203K | |
| psgml-emacs_canna-1...> | 2023-10-14 06:55 | 203K | |
| psgml-emacs_nox-1.4...> | 2023-10-10 01:52 | 203K | |
| psh-1.8.1_4.pkg | 2023-10-09 08:40 | 172K | |
| psi-1.5_1.pkg | 2023-10-08 12:55 | 2.7M | |
| psi4-1.8.1.pkg | 2023-10-09 19:53 | 18M | |
| psi88-1.0_17.pkg | 2023-10-09 20:50 | 55K | |
| psiconv-0.9.9.pkg | 2023-10-08 09:25 | 215K | |
| psimd-g20180906.pkg | 2023-10-08 08:01 | 4.1K | |
| psindustrializer-0.2..> | 2023-10-10 11:23 | 40K | |
| pslib-0.4.6_1.pkg | 2023-10-07 22:42 | 769K | |
| pslist-1.4.0.pkg | 2023-10-09 14:23 | 4.7K | |
| psmisc-22.16_1.pkg | 2023-10-10 04:48 | 59K | |
| pspg-5.7.4.pkg | 2023-10-08 22:35 | 134K | |
| pspp-1.6.2_1.pkg | 2023-10-14 04:17 | 4.4M | |
| pspresent-1.3_6.pkg | 2023-10-09 23:10 | 9.5K | |
| pssh-2.3.5_1.pkg | 2023-10-14 12:24 | 28K | |
| pstack-1.3.pkg | 2023-10-14 07:55 | 14K | |
| pstacku-0.9.2.pkg | 2023-10-14 10:21 | 8.0K | |
| pstoedit-4.00.pkg | 2023-10-07 14:31 | 821K | |
| pstotext-1.9_6.pkg | 2023-10-07 12:56 | 23K | |
| pstreams-0.8.1.pkg | 2023-10-08 09:45 | 12K | |
| pstree-2.40.pkg | 2023-10-11 14:12 | 7.8K | |
| psurface-2.0.0.13_2.pkg | 2023-10-06 21:02 | 418K | |
| psutils-1.17_5.pkg | 2023-10-05 17:32 | 59K | |
| psvn-20150720.214200..> | 2023-10-14 17:20 | 87K | |
| psvn-emacs_canna-201..> | 2023-10-10 14:06 | 87K | |
| psvn-emacs_devel-201..> | 2023-10-14 15:55 | 87K | |
| psvn-emacs_devel_nox..> | 2023-10-10 09:33 | 87K | |
| psvn-emacs_nox-20150..> | 2023-10-10 01:00 | 87K | |
| pt-hunspell-20220621..> | 2023-10-10 23:08 | 1.3M | |
| pt-hyphen-2004.04.15..> | 2023-10-14 17:03 | 1.0K | |
| pt-libreoffice-7.5.5..> | 2023-10-07 14:00 | 3.1M | |
| pt-mythes-2006.08.17..> | 2023-10-09 23:15 | 197K | |
| pt2-clone-1.64.pkg | 2023-10-09 01:08 | 209K | |
| pt_BR-aspell-2009070..> | 2023-10-09 07:42 | 2.3M | |
| pt_BR-libreoffice-7...> | 2023-10-08 04:55 | 3.1M | |
| pt_BR-webalizer-2.23..> | 2023-10-14 06:26 | 130K | |
| pt_PT-aspell-2007051..> | 2023-10-09 16:41 | 252K | |
| pt_PT-webalizer-2.23..> | 2023-10-09 14:34 | 130K | |
| ptex-2.4.2_1.pkg | 2023-10-06 22:53 | 636K | |
| pth-2.0.7_1.pkg | 2023-10-08 09:27 | 153K | |
| pth-hard-2.0.7_1.pkg | 2023-10-08 19:29 | 103K | |
| pthreadpool-0.1.126.pkg | 2023-10-06 16:53 | 18K | |
| pthsem-2.0.8_3.pkg | 2023-10-07 11:04 | 97K | |
| ptl-2.3.3_3.pkg | 2023-10-07 21:03 | 96K | |
| ptlib-2.10.11_6.pkg | 2023-10-08 05:55 | 1.3M | |
| ptmalloc-3.0_2.pkg | 2023-10-08 12:39 | 24K | |
| ptmalloc2-20060605_3..> | 2023-10-10 13:13 | 23K | |
| ptoc-3.58_1.pkg | 2023-10-14 17:50 | 160K | |
| ptpd2-2.3.1.pkg | 2023-10-10 06:38 | 683K | |
| ptsort-1.20170904.pkg | 2023-10-09 04:07 | 8.5K | |
| ptunnel-0.72_1.pkg | 2023-10-14 07:18 | 20K | |
| ptx-kmod-0.0.2011121..> | 2023-10-14 08:40 | 16K | |
| ptypes-2.1.1.pkg | 2023-10-07 15:19 | 305K | |
| publib-0.40.pkg | 2023-10-10 06:29 | 94K | |
| public_suffix_list-2..> | 2023-10-05 16:39 | 68K | |
| publicfile-0.52_3.pkg | 2023-10-09 09:57 | 25K | |
| pubs-0.9.0.pkg | 2023-10-14 06:26 | 90K | |
| puckman-1.0_6.pkg | 2023-10-14 03:30 | 169K | |
| pueue-3.1.2_4.pkg | 2023-10-10 00:53 | 1.7M | |
| puff-1.0.1.pkg | 2023-10-09 11:14 | 26K | |
| pugixml-1.13.pkg | 2023-10-06 15:14 | 78K | |
| pulledpork-0.7.4.pkg | 2023-10-07 04:02 | 34K | |
| pulseaudio-16.1_1.pkg | 2023-10-05 17:57 | 1.4M | |
| pulseaudio-module-sn..> | 2023-10-14 03:26 | 6.7K | |
| pulseaudio-module-xr..> | 2023-10-07 17:37 | 13K | |
| pulseaudio-qt-1.3_2.pkg | 2023-10-07 11:54 | 73K | |
| pulseview-0.4.2_3.pkg | 2023-10-14 17:07 | 543K | |
| punbb-1.4.6.pkg | 2023-10-09 14:51 | 726K | |
| punchy-0.3.0_9.pkg | 2023-10-09 16:36 | 45M | |
| pup-0.4.0.10_15.pkg | 2023-10-14 14:03 | 1.0M | |
| puppet-mode.el-0.2_1..> | 2023-10-09 04:01 | 4.2K | |
| puppet-mode.el-emacs..> | 2023-10-09 06:28 | 4.2K | |
| puppet-mode.el-emacs..> | 2023-10-08 21:44 | 4.2K | |
| puppet-mode.el-emacs..> | 2023-10-10 17:50 | 4.2K | |
| puppet-mode.el-emacs..> | 2023-10-09 22:10 | 4.2K | |
| puppet7-7.26.0.pkg | 2023-10-07 08:53 | 1.2M | |
| puppet8-8.2.0.pkg | 2023-10-08 02:08 | 1.2M | |
| puppetdb-terminus7-7..> | 2023-10-09 11:29 | 19K | |
| puppetdb-terminus8-8..> | 2023-10-14 17:14 | 19K | |
| puppetdb7-7.14.0.pkg | 2023-10-09 20:58 | 45M | |
| puppetdb8-8.1.1.pkg | 2023-10-14 03:20 | 48M | |
| puppetserver7-7.13.0..> | 2023-10-10 08:12 | 56M | |
| puppetserver8-8.2.1.pkg | 2023-10-10 09:11 | 57M | |
| pure-ftpd-1.0.51.pkg | 2023-10-09 10:03 | 183K | |
| pure-sfv-0.3.pkg | 2023-10-09 22:39 | 36K | |
| puredb-2.1_2.pkg | 2023-10-14 10:38 | 15K | |
| purescript-language-..> | 2023-10-10 04:29 | 257K | |
| purple-discord-g2023..> | 2023-10-14 10:01 | 278K | |
| purple-facebook-0.9...> | 2023-10-14 07:07 | 75K | |
| purple-googlechat-g2..> | 2023-10-08 21:25 | 138K | |
| purple-mattermost-2...> | 2023-10-11 02:22 | 187K | |
| purple-plugin-pack-2..> | 2023-10-14 06:57 | 171K | |
| purple-rocketchat-0...> | 2023-10-10 09:35 | 32K | |
| purple-slack-2021030..> | 2023-10-09 13:09 | 44K | |
| pushgateway-1.6.0_2.pkg | 2023-10-09 23:26 | 4.8M | |
| pushmi-1.0.0_9.pkg | 2023-10-08 17:15 | 20K | |
| putty-0.79.pkg | 2023-10-09 15:55 | 892K | |
| putty-nogtk-0.79.pkg | 2023-10-08 12:50 | 622K | |
| puush-0.0.2.pkg | 2023-10-14 07:17 | 30K | |
| pv-1.7.0.pkg | 2023-10-08 04:06 | 50K | |
| pvk-20070406_1.pkg | 2023-10-09 14:53 | 7.5K | |
| pvm-3.4.6_5.pkg | 2023-10-08 03:02 | 800K | |
| pvpgn-1.8.5_1.pkg | 2023-10-08 13:00 | 714K | |
| pwauth-2.3.11.pkg | 2023-10-10 08:45 | 4.6K | |
| pwcbsd-1.4.1_13.pkg | 2023-10-14 06:28 | 35K | |
| pwcview-1.4.1_8.pkg | 2023-10-10 12:28 | 19K | |
| pwd_unmkdb-1.4.pkg | 2023-10-10 11:38 | 4.8K | |
| pwgen-2.08,2.pkg | 2023-10-07 08:11 | 13K | |
| pwhois-2.2.1.0.pkg | 2023-10-08 22:25 | 85K | |
| pwm-2007.07.20_3.pkg | 2023-10-09 21:41 | 70K | |
| pwman-0.4.5_3.pkg | 2023-10-14 11:47 | 37K | |
| pwnat-g20171222.pkg | 2023-10-09 01:15 | 14K | |
| pwned-check-2.2_1,1.pkg | 2023-10-08 11:56 | 4.0K | |
| pwol-1.5.2.pkg | 2023-10-14 18:05 | 17K | |
| pwsafe-0.2.2.b.196.pkg | 2023-10-10 13:13 | 48K | |
| pwsafe-nox11-0.2.2.b..> | 2023-10-09 13:56 | 43K | |
| pxattr-2.1.0.pkg | 2023-10-08 13:01 | 49K | |
| pxe-1.4.2_2.pkg | 2023-10-09 02:52 | 27K | |
| pxe-pdhcp-0.0.2007.pkg | 2023-10-14 06:49 | 8.1K | |
| pxlib-0.6.8.pkg | 2023-10-10 09:14 | 65K | |
| pxp-agent-1.15.18.pkg | 2023-10-10 05:12 | 1.4M | |
| pxtools-0.0.20_4.pkg | 2023-10-08 21:14 | 22K | |
| pxz-0.20220509.pkg | 2023-10-09 07:32 | 8.3K | |
| py3c-1.3.pkg | 2023-10-07 09:56 | 5.3K | |
| py27-cython-0.29.36.pkg | 2023-10-07 05:47 | 1.7M | |
| py27-dnspython1-1.16..> | 2023-10-08 09:35 | 177K | |
| py27-future-0.18.3.pkg | 2023-10-08 03:10 | 621K | |
| py27-game_sdl2-7.4.1..> | 2023-10-08 03:20 | 798K | |
| py27-setuptools44-44..> | 2023-10-06 14:42 | 489K | |
| py27-sqlite3-2.7.18_..> | 2023-10-06 18:20 | 25K | |
| py27-subversion-lts-..> | 2023-10-09 10:01 | 658K | |
| py27-tkinter-2.7.18_..> | 2023-10-07 11:04 | 20K | |
| py38-build-0.10.0_2.pkg | 2023-10-07 01:29 | 27K | |
| py38-cython-0.29.36.pkg | 2023-10-09 07:43 | 1.8M | |
| py38-cython-devel-3...> | 2023-10-14 16:36 | 2.7M | |
| py38-cython3-3.0.2.pkg | 2023-10-09 12:11 | 2.7M | |
| py38-flit-core-3.9.0..> | 2023-10-06 13:38 | 75K | |
| py38-gdbm-3.8.18_7.pkg | 2023-10-14 16:08 | 7.2K | |
| py38-installer-0.7.0..> | 2023-10-06 15:28 | 214K | |
| py38-packaging-23.1.pkg | 2023-10-06 20:09 | 66K | |
| py38-pkgutil-resolve..> | 2023-10-10 12:38 | 3.2K | |
| py38-pyproject_hooks..> | 2023-10-06 21:35 | 14K | |
| py38-setuptools-63.1..> | 2023-10-07 22:19 | 1.1M | |
| py38-setuptools58-58..> | 2023-10-10 05:14 | 805K | |
| py38-sqlite3-3.8.18_..> | 2023-10-11 00:25 | 25K | |
| py38-tkinter-3.8.18_..> | 2023-10-14 13:52 | 20K | |
| py38-tomli-2.0.1_2.pkg | 2023-10-06 17:46 | 19K | |
| py38-wheel-0.41.2.pkg | 2023-10-08 05:31 | 95K | |
| py39-2048-py-0.1.6.pkg | 2023-10-08 12:44 | 7.9K | |
| py39-AnyQt-0.1.1.pkg | 2023-10-06 12:21 | 53K | |
| py39-Automat-20.2.0.pkg | 2023-10-06 09:17 | 49K | |
| py39-AwesomeTkinter-..> | 2023-10-07 22:43 | 58K | |
| py39-BTrees-4.11.3.pkg | 2023-10-08 05:47 | 418K | |
| py39-Babel-2.12.1.pkg | 2023-10-05 17:17 | 5.9M | |
| py39-BuildStream-1.2..> | 2023-10-10 17:43 | 419K | |
| py39-Cerberus-1.3.5.pkg | 2023-10-07 04:34 | 49K | |
| py39-CommonMark-0.9...> | 2023-10-05 17:20 | 79K | |
| py39-CouchDB-1.1_1.pkg | 2023-10-08 12:03 | 97K | |
| py39-CyLP-0.91.6.pkg | 2023-10-14 09:46 | 487K | |
| py39-DTLSSocket-0.1...> | 2023-10-07 12:14 | 62K | |
| py39-DateTime-3.0.3_..> | 2023-10-08 07:38 | 76K | |
| py39-DendroPy-4.6.1.pkg | 2023-10-07 11:25 | 538K | |
| py39-Diofant-0.13.0_..> | 2023-10-14 11:32 | 3.4M | |
| py39-Dumper-1.2.0.pkg | 2023-10-09 02:29 | 13K | |
| py39-Elixir-0.7.1_3.pkg | 2023-10-14 14:03 | 70K | |
| py39-ExifRead-2.1.2.pkg | 2023-10-08 08:24 | 47K | |
| py39-ExtensionClass-..> | 2023-10-14 03:11 | 40K | |
| py39-Extremes-1.1.1_..> | 2023-10-09 23:15 | 3.8K | |
| py39-Faker-15.1.1.pkg | 2023-10-06 23:23 | 2.1M | |
| py39-Fiona-1.8.22_2.pkg | 2023-10-06 22:33 | 408K | |
| py39-Flask-2.3.2.pkg | 2023-10-06 18:41 | 123K | |
| py39-Flask-Admin-1.6..> | 2023-10-14 18:03 | 3.1M | |
| py39-Flask-Assets-2...> | 2023-10-08 19:44 | 12K | |
| py39-Flask-Bcrypt-1...> | 2023-10-12 10:04 | 6.2K | |
| py39-Flask-Bootstrap..> | 2023-10-10 18:36 | 379K | |
| py39-Flask-Cache-0.1..> | 2023-10-07 15:25 | 17K | |
| py39-Flask-Collect-1..> | 2023-10-10 17:08 | 11K | |
| py39-Flask-Compress-..> | 2023-10-07 00:46 | 9.3K | |
| py39-Flask-Cors-3.0...> | 2023-10-07 10:03 | 16K | |
| py39-Flask-FlatPages..> | 2023-10-10 16:09 | 11K | |
| py39-Flask-HTTPAuth-..> | 2023-10-08 09:31 | 11K | |
| py39-Flask-Kerberos-..> | 2023-10-10 09:37 | 4.1K | |
| py39-Flask-Login-0.6..> | 2023-10-08 10:55 | 22K | |
| py39-Flask-Mail-0.9...> | 2023-10-08 02:49 | 12K | |
| py39-Flask-Moment-1...> | 2023-10-09 06:49 | 7.3K | |
| py39-Flask-OAuthlib-..> | 2023-10-11 22:53 | 55K | |
| py39-Flask-Principal..> | 2023-10-07 19:25 | 8.6K | |
| py39-Flask-RESTful-0..> | 2023-10-10 20:32 | 35K | |
| py39-Flask-SAML-0.4...> | 2023-10-10 17:22 | 7.2K | |
| py39-Flask-Sockets-0..> | 2023-10-09 12:02 | 4.1K | |
| py39-Flask-Uploads-0..> | 2023-10-10 08:43 | 11K | |
| py39-Flask-WTF-1.1.1..> | 2023-10-08 03:11 | 18K | |
| py39-FreeBSD-ports-0..> | 2023-10-10 20:48 | 6.4K | |
| py39-Frozen-Flask-0...> | 2023-10-11 00:34 | 24K | |
| py39-Fuzzy-1.2.2.pkg | 2023-10-09 23:28 | 38K | |
| py39-GPy-1.10.0_1.pkg | 2023-10-08 07:35 | 1.1M | |
| py39-GPyOpt-1.2.6_1.pkg | 2023-10-09 20:01 | 102K | |
| py39-Genesis-PyAPI-1..> | 2023-10-07 03:56 | 14K | |
| py39-Genshi-0.7.7.pkg | 2023-10-07 15:33 | 257K | |
| py39-GeoIP2-4.7.0.pkg | 2023-10-07 21:18 | 28K | |
| py39-GridDataFormats..> | 2023-10-07 03:05 | 2.0M | |
| py39-HTSeq-2.0.4.pkg | 2023-10-09 07:39 | 277K | |
| py39-HepMC3-3.2.6.pkg | 2023-10-10 00:50 | 808K | |
| py39-IBMQuantumExper..> | 2023-10-09 05:58 | 17K | |
| py39-Ice-3.6.5_1.pkg | 2023-10-09 04:18 | 410K | |
| py39-Ice37-3.7.6.pkg | 2023-10-08 15:40 | 682K | |
| py39-Jinja2-3.1.2.pkg | 2023-10-05 17:19 | 203K | |
| py39-Jinja2-doc-3.1...> | 2023-10-10 18:09 | 298K | |
| py39-Js2Py-0.74.pkg | 2023-10-07 22:31 | 1.4M | |
| py39-Lektor-3.3.10.pkg | 2023-10-11 07:08 | 1.3M | |
| py39-Levenshtein-0.2..> | 2023-10-07 00:24 | 116K | |
| py39-Louie-2.0.pkg | 2023-10-11 18:04 | 26K | |
| py39-MDAnalysis-2.3...> | 2023-10-08 04:19 | 1.3M | |
| py39-MDAnalysisTests..> | 2023-10-09 04:20 | 41M | |
| py39-ManimPango-0.4...> | 2023-10-08 15:38 | 51K | |
| py39-Mathics3-6.0.2.pkg | 2023-10-08 05:22 | 3.3M | |
| py39-Mathics_Scanner..> | 2023-10-07 07:32 | 83K | |
| py39-Morfessor-2.0.6..> | 2023-10-09 07:04 | 55K | |
| py39-MutatorMath-2.1..> | 2023-10-06 15:21 | 47K | |
| py39-Nasdaq-Data-Lin..> | 2023-10-06 19:44 | 35K | |
| py39-OWSLib-0.28.0.pkg | 2023-10-08 02:24 | 268K | |
| py39-OpenFermion-1.5..> | 2023-10-07 10:57 | 1.0M | |
| py39-OpenFermion-Dir..> | 2023-10-14 05:34 | 21K | |
| py39-OpenMC-0.13.3_1..> | 2023-10-09 07:03 | 1.5M | |
| py39-PYB11Generator-..> | 2023-10-09 08:23 | 24K | |
| py39-Pallets-Sphinx-..> | 2023-10-08 03:55 | 27K | |
| py39-Paste-3.5.2.pkg | 2023-10-06 17:42 | 669K | |
| py39-PeachPy-0.0.1,1..> | 2023-10-10 12:03 | 506K | |
| py39-Pituophis-1.1.pkg | 2023-10-10 15:14 | 14K | |
| py39-Pmw-2.0.1_1.pkg | 2023-10-08 07:09 | 347K | |
| py39-PollyReports-1...> | 2023-10-09 07:50 | 10K | |
| py39-Products.Extern..> | 2023-10-08 11:57 | 28K | |
| py39-Products.PloneL..> | 2023-10-14 14:41 | 30K | |
| py39-Products.Secure..> | 2023-10-09 00:52 | 24K | |
| py39-PuLP-2.7.0_1.pkg | 2023-10-07 03:36 | 1.1M | |
| py39-PubChemPy-1.0.4..> | 2023-10-07 04:36 | 25K | |
| py39-PyExecJS-1.5.1_..> | 2023-10-07 10:01 | 19K | |
| py39-PyFR-1.15.0_1.pkg | 2023-10-08 14:19 | 394K | |
| py39-PyGreSQL-5.2,1.pkg | 2023-10-09 20:52 | 175K | |
| py39-PyHamcrest-2.0...> | 2023-10-14 10:21 | 48K | |
| py39-PyInquirer-1.0...> | 2023-10-12 07:21 | 35K | |
| py39-PyLD-0.7.1.pkg | 2023-10-09 05:39 | 65K | |
| py39-PyMetis-2023.1.pkg | 2023-10-09 04:43 | 210K | |
| py39-PyMuPDF-1.22.5.pkg | 2023-10-07 18:09 | 10M | |
| py39-PyNE-0.7.7_4.pkg | 2023-10-08 23:12 | 26M | |
| py39-PyOgg-0.6.14.a1..> | 2023-10-08 04:54 | 53K | |
| py39-PyOpenGL-3.1.6_..> | 2023-10-06 14:10 | 1.3M | |
| py39-PyOpenGL-accele..> | 2023-10-07 15:27 | 201K | |
| py39-PySCIPOpt-4.3.0..> | 2023-10-09 09:18 | 477K | |
| py39-PySCeS-1.1.1.pkg | 2023-10-10 01:17 | 1.1M | |
| py39-PySceneDetect-0..> | 2023-10-10 07:26 | 133K | |
| py39-PyUserInput-0.1..> | 2023-10-08 21:22 | 43K | |
| py39-PyUtilib-6.0.0.pkg | 2023-10-14 07:08 | 333K | |
| py39-PyWavefront-1.3..> | 2023-10-08 05:48 | 29K | |
| py39-PyWavelets-1.4...> | 2023-10-06 22:08 | 3.3M | |
| py39-Pympler-1.0.1.pkg | 2023-10-14 12:56 | 218K | |
| py39-Pyomo-6.5.0.pkg | 2023-10-08 05:46 | 4.6M | |
| py39-Pyrseas-0.9.1.pkg | 2023-10-11 01:09 | 145K | |
| py39-QDarkStyle-3.1.pkg | 2023-10-07 08:25 | 604K | |
| py39-QSpectrumAnalyz..> | 2023-10-14 13:50 | 54K | |
| py39-QtAwesome-1.2.3..> | 2023-10-07 09:47 | 1.4M | |
| py39-QtPy-2.4.0.pkg | 2023-10-06 22:55 | 98K | |
| py39-RTFDE-0.1.0.pkg | 2023-10-07 05:34 | 61K | |
| py39-RestrictedPytho..> | 2023-10-08 19:32 | 54K | |
| py39-SQLAlchemy-Imag..> | 2023-10-09 10:52 | 46K | |
| py39-Scrapy-2.5.1.pkg | 2023-10-09 23:21 | 323K | |
| py39-SecretStorage-3..> | 2023-10-06 12:22 | 18K | |
| py39-SimpleSoapy-1.5..> | 2023-10-07 01:13 | 10K | |
| py39-SimpleSpectral-..> | 2023-10-07 05:30 | 8.4K | |
| py39-SoapySDR-0.8.1.pkg | 2023-10-06 19:32 | 345K | |
| py39-SoundFile-0.12...> | 2023-10-08 05:55 | 32K | |
| py39-Speedometer-2.9..> | 2023-10-10 20:39 | 24K | |
| py39-StrEnum-0.4.15.pkg | 2023-10-11 23:56 | 9.4K | |
| py39-Tempita-0.5.2.pkg | 2023-10-07 00:35 | 24K | |
| py39-Tenjin-1.1.1.pkg | 2023-10-11 09:09 | 68K | |
| py39-TurboGears2-2.3..> | 2023-10-11 06:36 | 333K | |
| py39-Unipath-1.1.pkg | 2023-10-09 22:29 | 14K | |
| py39-Wand-0.6.11_1.pkg | 2023-10-08 11:00 | 197K | |
| py39-WebError-0.13.1..> | 2023-10-10 05:47 | 93K | |
| py39-WebFlash-0.1a9_..> | 2023-10-10 10:39 | 9.4K | |
| py39-WsgiDAV-3.1.0_1..> | 2023-10-10 16:04 | 192K | |
| py39-XlsxWriter-1.4...> | 2023-10-06 18:50 | 207K | |
| py39-YouCompleteMe-g..> | 2023-10-09 16:12 | 1.2M | |
| py39-YubiOTP-1.0.0_1..> | 2023-10-08 11:51 | 17K | |
| py39-ZopeUndo-2.12.0..> | 2023-10-14 05:21 | 3.8K | |
| py39-Zopkio-0.2.5_6.pkg | 2023-10-11 15:21 | 62K | |
| py39-abipy-0.9.6.pkg | 2023-10-14 16:10 | 11M | |
| py39-about-time-4.2...> | 2023-10-08 06:03 | 14K | |
| py39-absl-0.7.1_1.pkg | 2023-10-08 10:14 | 146K | |
| py39-absl-py-1.4.0.pkg | 2023-10-07 02:29 | 156K | |
| py39-access-1.1.9_1.pkg | 2023-10-07 18:54 | 27K | |
| py39-accessible-pygm..> | 2023-10-07 04:51 | 14K | |
| py39-acefile-0.6.12.pkg | 2023-10-14 02:53 | 78K | |
| py39-acme-2.6.0,1.pkg | 2023-10-07 00:21 | 122K | |
| py39-acora-2.3.pkg | 2023-10-09 15:25 | 113K | |
| py39-actdiag-3.0.0.pkg | 2023-10-09 11:11 | 2.0M | |
| py39-adafruit-ampy-1..> | 2023-10-09 15:46 | 21K | |
| py39-adal-1.2.7_2.pkg | 2023-10-06 21:55 | 59K | |
| py39-adb-1.3.0.9.pkg | 2023-10-10 11:40 | 47K | |
| py39-adblock-0.5.0_4..> | 2023-10-08 09:52 | 1.0M | |
| py39-addict-2.4.0.pkg | 2023-10-08 06:22 | 5.4K | |
| py39-adns-1.4.pkg | 2023-10-08 07:15 | 14K | |
| py39-aeidon-1.12.pkg | 2023-10-08 03:59 | 135K | |
| py39-aenum-2.2.4.pkg | 2023-10-08 11:50 | 151K | |
| py39-aesqlapius-0.0...> | 2023-10-14 18:39 | 22K | |
| py39-afdko-3.9.7.pkg | 2023-10-06 20:22 | 653K | |
| py39-afew-3.0.1.pkg | 2023-10-08 21:01 | 215K | |
| py39-affine-2.4.0_2.pkg | 2023-10-06 17:53 | 24K | |
| py39-agate-1.7.1.pkg | 2023-10-06 19:41 | 94K | |
| py39-agate-dbf-0.2.2..> | 2023-10-07 08:31 | 2.9K | |
| py39-agate-excel-0.2..> | 2023-10-07 02:17 | 7.9K | |
| py39-agate-sql-0.5.9..> | 2023-10-07 01:26 | 8.8K | |
| py39-aggregate6-1.0...> | 2023-10-07 22:29 | 9.0K | |
| py39-ailment-9.0.540..> | 2023-10-08 11:42 | 22K | |
| py39-aioapns-3.0.pkg | 2023-10-08 16:02 | 16K | |
| py39-aiocoap-0.4.7.pkg | 2023-10-08 09:17 | 260K | |
| py39-aiocontextvars-..> | 2023-10-11 01:45 | 4.4K | |
| py39-aiodns-3.0.0.pkg | 2023-10-06 19:48 | 6.1K | |
| py39-aiofiles-23.2.1..> | 2023-10-07 08:50 | 20K | |
| py39-aioftp-0.21.4.pkg | 2023-10-08 07:25 | 55K | |
| py39-aioh2-0.2.2_1.pkg | 2023-10-10 02:54 | 17K | |
| py39-aiohttp-3.8.5.pkg | 2023-10-06 12:09 | 392K | |
| py39-aiohttp-apispec..> | 2023-10-08 04:58 | 1.4M | |
| py39-aiohttp-jinja2-..> | 2023-10-07 10:54 | 10K | |
| py39-aiohttp-middlew..> | 2023-10-10 11:15 | 19K | |
| py39-aiohttp-oauthli..> | 2023-10-09 11:46 | 10K | |
| py39-aiohttp-securit..> | 2023-10-07 21:17 | 9.1K | |
| py39-aiohttp-session..> | 2023-10-07 05:46 | 15K | |
| py39-aiohttp-socks-0..> | 2023-10-08 05:23 | 7.6K | |
| py39-aiohttp-wsgi-0...> | 2023-10-14 10:20 | 16K | |
| py39-aiohttp_cors-0...> | 2023-10-11 00:54 | 22K | |
| py39-aioice-0.9.0.pkg | 2023-10-07 17:55 | 40K | |
| py39-aioitertools-0...> | 2023-10-10 21:32 | 39K | |
| py39-aiologger-0.7.0..> | 2023-10-07 01:56 | 36K | |
| py39-aiomcache-0.7.0..> | 2023-10-06 22:59 | 21K | |
| py39-aiomysql-0.2.0.pkg | 2023-10-08 14:52 | 64K | |
| py39-aiopg-1.4.0.pkg | 2023-10-14 10:50 | 51K | |
| py39-aioquic-0.9.21.pkg | 2023-10-06 11:30 | 142K | |
| py39-aioredis-1.3.1.pkg | 2023-10-06 19:34 | 94K | |
| py39-aiorpcX-0.22.1_..> | 2023-10-07 23:49 | 52K | |
| py39-aiortc-1.5.0_2.pkg | 2023-10-09 21:58 | 159K | |
| py39-aiorwlock-1.3.0..> | 2023-10-08 04:15 | 7.7K | |
| py39-aiosignal-1.3.1..> | 2023-10-06 10:14 | 7.5K | |
| py39-aiosmtpd-1.4.4.pkg | 2023-10-08 11:15 | 193K | |
| py39-aiosqlite-0.19...> | 2023-10-06 11:21 | 26K | |
| py39-aiostream-0.4.5..> | 2023-10-07 09:50 | 31K | |
| py39-airtable-python..> | 2023-10-07 16:06 | 16K | |
| py39-al-0.1.0.pkg | 2023-10-08 19:09 | 125K | |
| py39-alabaster-0.7.1..> | 2023-10-05 17:20 | 11K | |
| py39-alembic-1.12.0.pkg | 2023-10-06 23:45 | 288K | |
| py39-alembic14-1.4.3..> | 2023-10-07 17:15 | 223K | |
| py39-algopy-0.5.7_3.pkg | 2023-10-07 17:11 | 183K | |
| py39-alive-progress-..> | 2023-10-10 17:53 | 95K | |
| py39-all-repos-1.26...> | 2023-10-14 05:16 | 50K | |
| py39-alot-0.9.pkg | 2023-10-10 16:43 | 198K | |
| py39-alpha-vantage-2..> | 2023-10-09 09:57 | 25K | |
| py39-altair-5.1.1.pkg | 2023-10-08 21:14 | 319K | |
| py39-altgraph-0.17.3..> | 2023-10-07 06:08 | 27K | |
| py39-amalgamate-0.1...> | 2023-10-08 08:51 | 15K | |
| py39-amaranth-0.3.16..> | 2023-10-14 05:30 | 15K | |
| py39-ambit-0.7.1.pkg | 2023-10-09 14:19 | 119K | |
| py39-amply-0.1.6.pkg | 2023-10-06 21:07 | 18K | |
| py39-amqp-2.6.1.pkg | 2023-10-06 16:56 | 65K | |
| py39-amqplib-1.0.2_1..> | 2023-10-14 10:20 | 45K | |
| py39-angr-9.0.5405_2..> | 2023-10-09 22:17 | 1.8M | |
| py39-animatplot-0.4...> | 2023-10-07 14:14 | 20K | |
| py39-animatplot-ng-0..> | 2023-10-10 03:12 | 24K | |
| py39-aniso8601-9.0.1..> | 2023-10-06 17:26 | 71K | |
| py39-aniso86016-6.0...> | 2023-10-07 01:59 | 52K | |
| py39-anndata-0.9.2.pkg | 2023-10-07 22:35 | 160K | |
| py39-annotated-types..> | 2023-10-06 20:07 | 13K | |
| py39-annoy-1.17.3.pkg | 2023-10-09 23:08 | 50K | |
| py39-anonfile-1.0.0_..> | 2023-10-08 11:59 | 16K | |
| py39-ansi-0.3.6_2.pkg | 2023-10-07 19:15 | 12K | |
| py39-ansible-8.2.0.pkg | 2023-10-07 18:41 | 27M | |
| py39-ansible-compat-..> | 2023-10-07 23:20 | 33K | |
| py39-ansible-core-2...> | 2023-10-06 23:44 | 2.3M | |
| py39-ansible-iocage-..> | 2023-10-09 22:35 | 6.8K | |
| py39-ansible-kld-g20..> | 2023-10-14 17:24 | 2.1K | |
| py39-ansible-lint-6...> | 2023-10-09 06:51 | 268K | |
| py39-ansible-runner-..> | 2023-10-10 07:27 | 103K | |
| py39-ansible-sysrc-g..> | 2023-10-14 18:00 | 2.9K | |
| py39-antlr4-python3-..> | 2023-10-06 23:32 | 167K | |
| py39-anyascii-0.3.2_..> | 2023-10-07 09:19 | 241K | |
| py39-anyconfig-0.9.1..> | 2023-10-08 14:22 | 78K | |
| py39-anyio-4.0.0.pkg | 2023-10-06 09:54 | 126K | |
| py39-anyio3-3.7.1.pkg | 2023-10-06 10:20 | 123K | |
| py39-anyjson-0.3.3_1..> | 2023-10-09 16:58 | 5.6K | |
| py39-anytree-2.9.0.pkg | 2023-10-08 06:25 | 44K | |
| py39-apache-arrow-13..> | 2023-10-10 06:52 | 3.1M | |
| py39-apache-beam-2.4..> | 2023-10-08 18:30 | 4.4M | |
| py39-apache_conf_par..> | 2023-10-10 02:55 | 23K | |
| py39-apetag-1.2_1.pkg | 2023-10-14 17:15 | 17K | |
| py39-apgl-0.8.1_4.pkg | 2023-10-08 19:47 | 155K | |
| py39-apipkg-1.5.pkg | 2023-10-10 07:24 | 7.3K | |
| py39-apispec-6.3.0.pkg | 2023-10-06 23:23 | 39K | |
| py39-apitran-g201809..> | 2023-10-09 18:05 | 40M | |
| py39-appdirs-1.4.4.pkg | 2023-10-06 09:18 | 11K | |
| py39-applicationinsi..> | 2023-10-06 19:23 | 54K | |
| py39-apptools-5.2.1_..> | 2023-10-06 17:00 | 234K | |
| py39-apscheduler-3.1..> | 2023-10-08 01:11 | 77K | |
| py39-apsw-3.43.0.0.pkg | 2023-10-08 05:32 | 1.1M | |
| py39-arabic-reshaper..> | 2023-10-08 09:58 | 23K | |
| py39-arbor-0.9.0.pkg | 2023-10-14 10:32 | 484K | |
| py39-arch-6.1.0.pkg | 2023-10-10 10:25 | 952K | |
| py39-archinfo-9.0.54..> | 2023-10-06 20:36 | 69K | |
| py39-archspec-0.2.1.pkg | 2023-10-10 08:38 | 41K | |
| py39-argcomplete-3.1..> | 2023-10-06 20:25 | 48K | |
| py39-argh-0.29.3.pkg | 2023-10-08 09:44 | 40K | |
| py39-argon2-cffi-21...> | 2023-10-06 10:09 | 18K | |
| py39-argon2-cffi-bin..> | 2023-10-06 09:55 | 12K | |
| py39-argparse-1.4.0.pkg | 2023-10-06 19:05 | 38K | |
| py39-args-0.1.0.pkg | 2023-10-07 08:27 | 5.8K | |
| py39-arouteserver-1...> | 2023-10-09 18:22 | 237K | |
| py39-arpeggio-2.0.2.pkg | 2023-10-07 05:58 | 67K | |
| py39-arrow-1.2.3.pkg | 2023-10-06 09:15 | 95K | |
| py39-artifacts-20221..> | 2023-10-07 18:18 | 74K | |
| py39-arviz-0.16.1.pkg | 2023-10-08 05:21 | 1.7M | |
| py39-arxiv-1.4.8.pkg | 2023-10-09 07:03 | 16K | |
| py39-arybo-1.1.0_1.pkg | 2023-10-10 15:15 | 52K | |
| py39-asap3-3.12.8_1.pkg | 2023-10-08 23:43 | 640K | |
| py39-ascii-magic-2.3..> | 2023-10-09 13:02 | 717K | |
| py39-asciimatics-1.1..> | 2023-10-08 09:10 | 173K | |
| py39-asciinema-2.3.0..> | 2023-10-11 12:40 | 100K | |
| py39-asciitree-0.3.3..> | 2023-10-07 08:09 | 5.9K | |
| py39-asdf-2.15.1.pkg | 2023-10-08 12:50 | 723K | |
| py39-asdf-standard-1..> | 2023-10-07 06:21 | 26K | |
| py39-asdf-transform-..> | 2023-10-08 07:02 | 45K | |
| py39-asdf-unit-schem..> | 2023-10-07 12:11 | 6.4K | |
| py39-ase-3.22.1_1.pkg | 2023-10-08 03:48 | 2.7M | |
| py39-asgi-csrf-0.9.pkg | 2023-10-07 23:39 | 9.2K | |
| py39-asgi-lifespan-2..> | 2023-10-09 07:32 | 12K | |
| py39-asgiref-3.7.2_1..> | 2023-10-06 13:36 | 32K | |
| py39-asn1-2.7.0,1.pkg | 2023-10-07 16:28 | 14K | |
| py39-asn1crypto-1.5...> | 2023-10-06 17:14 | 154K | |
| py39-asonic-2.0.0.pkg | 2023-10-08 21:02 | 9.0K | |
| py39-aspectlib-2.0.0..> | 2023-10-08 12:45 | 37K | |
| py39-aspy.yaml-1.3.0..> | 2023-10-10 21:49 | 3.2K | |
| py39-ast-decompiler-..> | 2023-10-14 05:50 | 24K | |
| py39-asteval-0.9.31.pkg | 2023-10-06 16:00 | 34K | |
| py39-astlib-0.11.8_1..> | 2023-10-10 23:56 | 392K | |
| py39-astor-0.8.1.pkg | 2023-10-07 04:11 | 40K | |
| py39-astral-3.2.pkg | 2023-10-10 20:02 | 48K | |
| py39-astroML-1.0.2_1..> | 2023-10-14 04:36 | 154K | |
| py39-astroid-2.15.6.pkg | 2023-10-06 12:25 | 361K | |
| py39-astroid253-2.5...> | 2023-10-14 10:54 | 269K | |
| py39-astropy-5.3,2.pkg | 2023-10-06 16:12 | 6.9M | |
| py39-astropy-helpers..> | 2023-10-10 00:26 | 51K | |
| py39-asttokens-2.4.0..> | 2023-10-06 09:32 | 31K | |
| py39-astunparse-1.6...> | 2023-10-06 23:31 | 19K | |
| py39-async-lru-2.0.4..> | 2023-10-09 13:17 | 8.3K | |
| py39-async_generator..> | 2023-10-06 09:02 | 29K | |
| py39-async_timeout-4..> | 2023-10-06 09:17 | 6.5K | |
| py39-asyncmy-0.2.8.pkg | 2023-10-10 09:00 | 734K | |
| py39-asyncpg-0.27.0.pkg | 2023-10-14 13:00 | 470K | |
| py39-asyncssh-2.13.2..> | 2023-10-08 04:08 | 473K | |
| py39-asynctest-0.13...> | 2023-10-14 16:38 | 39K | |
| py39-atomiclong-0.1...> | 2023-10-08 06:00 | 6.1K | |
| py39-atomicwrites-1...> | 2023-10-06 16:18 | 7.6K | |
| py39-atomium-1.0.11_..> | 2023-10-10 02:21 | 74K | |
| py39-atoml-1.1.1_2.pkg | 2023-10-14 08:32 | 58K | |
| py39-atpublic-3.0.pkg | 2023-10-07 04:50 | 5.0K | |
| py39-atspi-2.38.2.pkg | 2023-10-07 09:18 | 54K | |
| py39-attrdict-2.0.1_..> | 2023-10-14 12:22 | 11K | |
| py39-attrs-23.1.0.pkg | 2023-10-06 07:57 | 76K | |
| py39-attrs-strict-1...> | 2023-10-09 23:12 | 17K | |
| py39-aubio-0.4.9_2.pkg | 2023-10-08 15:57 | 54K | |
| py39-audioread-3.0.0..> | 2023-10-07 05:24 | 27K | |
| py39-authheaders-0.1..> | 2023-10-07 17:22 | 83K | |
| py39-authlib-1.2.1.pkg | 2023-10-10 11:58 | 233K | |
| py39-authres-1.2.0.pkg | 2023-10-06 22:24 | 26K | |
| py39-autobahn-22.1.1..> | 2023-10-07 13:43 | 538K | |
| py39-autocommand-2.2..> | 2023-10-06 16:35 | 16K | |
| py39-autoflake-2.2.0..> | 2023-10-14 14:17 | 51K | |
| py39-autograd-1.6.1.pkg | 2023-10-07 17:42 | 90K | |
| py39-autokey-0.95.10..> | 2023-10-09 21:29 | 247K | |
| py39-automaton-3.2.0..> | 2023-10-07 00:04 | 25K | |
| py39-autopage-0.5.1_..> | 2023-10-06 16:12 | 43K | |
| py39-autopep8-2.0.4.pkg | 2023-10-06 17:04 | 71K | |
| py39-autoprop-1.0.1.pkg | 2023-10-07 19:15 | 6.3K | |
| py39-autotiling-1.8.pkg | 2023-10-14 06:53 | 7.7K | |
| py39-av-10.0.0_2.pkg | 2023-10-08 07:22 | 636K | |
| py39-avahi-0.8_1.pkg | 2023-10-08 06:13 | 16K | |
| py39-avogadrolibs-1...> | 2023-10-10 03:43 | 78K | |
| py39-avro-1.11.2.pkg | 2023-10-08 07:24 | 150K | |
| py39-awesome-slugify..> | 2023-10-10 08:28 | 14K | |
| py39-awesomeversion-..> | 2023-10-08 16:27 | 16K | |
| py39-awkward-2.4.2.pkg | 2023-10-14 11:35 | 728K | |
| py39-awkward-cpp-23.pkg | 2023-10-08 04:47 | 483K | |
| py39-aws-lambda-buil..> | 2023-10-14 14:24 | 118K | |
| py39-aws-requests-au..> | 2023-10-07 16:43 | 7.7K | |
| py39-aws-sam-transla..> | 2023-10-08 01:27 | 368K | |
| py39-aws-xray-sdk-2...> | 2023-10-14 08:44 | 113K | |
| py39-awscli-1.29.35.pkg | 2023-10-07 11:45 | 1.6M | |
| py39-awscrt-0.16.26.pkg | 2023-10-11 14:07 | 860K | |
| py39-axisregistry-0...> | 2023-10-07 10:43 | 24K | |
| py39-azure-appconfig..> | 2023-10-08 03:49 | 36K | |
| py39-azure-batch-13...> | 2023-10-07 20:43 | 151K | |
| py39-azure-cli-2.50...> | 2023-10-09 21:53 | 5.5M | |
| py39-azure-cli-acr-2..> | 2023-10-09 12:05 | 89K | |
| py39-azure-cli-base-..> | 2023-10-06 12:42 | 1.4K | |
| py39-azure-cli-core-..> | 2023-10-08 07:35 | 348K | |
| py39-azure-cli-telem..> | 2023-10-07 02:56 | 15K | |
| py39-azure-common-1...> | 2023-10-06 14:20 | 15K | |
| py39-azure-core-1.29..> | 2023-10-06 17:28 | 172K | |
| py39-azure-cosmos-3...> | 2023-10-08 08:50 | 106K | |
| py39-azure-data-tabl..> | 2023-10-09 12:26 | 141K | |
| py39-azure-datalake-..> | 2023-10-07 22:19 | 79K | |
| py39-azure-functions..> | 2023-10-14 02:54 | 46K | |
| py39-azure-graphrbac..> | 2023-10-08 00:06 | 59K | |
| py39-azure-identity-..> | 2023-10-10 03:20 | 94K | |
| py39-azure-keyvault-..> | 2023-10-08 02:04 | 132K | |
| py39-azure-keyvault-..> | 2023-10-08 08:17 | 119K | |
| py39-azure-keyvault-..> | 2023-10-07 17:43 | 234K | |
| py39-azure-keyvault-..> | 2023-10-07 22:15 | 270K | |
| py39-azure-keyvault-..> | 2023-10-07 11:06 | 197K | |
| py39-azure-loganalyt..> | 2023-10-07 10:33 | 11K | |
| py39-azure-mgmt-advi..> | 2023-10-08 09:51 | 33K | |
| py39-azure-mgmt-apim..> | 2023-10-07 23:43 | 420K | |
| py39-azure-mgmt-appc..> | 2023-10-08 08:30 | 113K | |
| py39-azure-mgmt-appc..> | 2023-10-07 12:44 | 152K | |
| py39-azure-mgmt-appl..> | 2023-10-07 18:47 | 125K | |
| py39-azure-mgmt-auth..> | 2023-10-08 05:24 | 329K | |
| py39-azure-mgmt-batc..> | 2023-10-07 21:18 | 136K | |
| py39-azure-mgmt-batc..> | 2023-10-08 05:08 | 70K | |
| py39-azure-mgmt-bill..> | 2023-10-08 09:55 | 96K | |
| py39-azure-mgmt-bots..> | 2023-10-07 12:55 | 63K | |
| py39-azure-mgmt-cdn-..> | 2023-10-08 03:21 | 161K | |
| py39-azure-mgmt-cogn..> | 2023-10-08 03:56 | 103K | |
| py39-azure-mgmt-comp..> | 2023-10-08 00:37 | 2.9M | |
| py39-azure-mgmt-cons..> | 2023-10-07 10:36 | 51K | |
| py39-azure-mgmt-cont..> | 2023-10-07 19:35 | 88K | |
| py39-azure-mgmt-cont..> | 2023-10-07 17:10 | 450K | |
| py39-azure-mgmt-cont..> | 2023-10-08 08:56 | 956K | |
| py39-azure-mgmt-core..> | 2023-10-07 04:03 | 19K | |
| py39-azure-mgmt-cosm..> | 2023-10-08 00:02 | 256K | |
| py39-azure-mgmt-data..> | 2023-10-08 11:07 | 282K | |
| py39-azure-mgmt-data..> | 2023-10-07 17:55 | 118K | |
| py39-azure-mgmt-data..> | 2023-10-07 22:38 | 41K | |
| py39-azure-mgmt-data..> | 2023-10-07 19:36 | 137K | |
| py39-azure-mgmt-depl..> | 2023-10-14 11:16 | 34K | |
| py39-azure-mgmt-devt..> | 2023-10-08 10:21 | 95K | |
| py39-azure-mgmt-dns-..> | 2023-10-07 21:48 | 58K | |
| py39-azure-mgmt-even..> | 2023-10-08 05:04 | 136K | |
| py39-azure-mgmt-even..> | 2023-10-07 10:06 | 198K | |
| py39-azure-mgmt-exte..> | 2023-10-08 00:40 | 30K | |
| py39-azure-mgmt-hdin..> | 2023-10-08 02:52 | 88K | |
| py39-azure-mgmt-imag..> | 2023-10-08 07:15 | 83K | |
| py39-azure-mgmt-iotc..> | 2023-10-07 12:29 | 41K | |
| py39-azure-mgmt-ioth..> | 2023-10-07 15:19 | 262K | |
| py39-azure-mgmt-ioth..> | 2023-10-08 06:14 | 48K | |
| py39-azure-mgmt-keyv..> | 2023-10-07 14:50 | 228K | |
| py39-azure-mgmt-kust..> | 2023-10-07 19:17 | 39K | |
| py39-azure-mgmt-loga..> | 2023-10-07 18:07 | 103K | |
| py39-azure-mgmt-mana..> | 2023-10-08 08:38 | 22K | |
| py39-azure-mgmt-mana..> | 2023-10-07 11:22 | 43K | |
| py39-azure-mgmt-maps..> | 2023-10-08 11:20 | 31K | |
| py39-azure-mgmt-mark..> | 2023-10-07 15:41 | 22K | |
| py39-azure-mgmt-medi..> | 2023-10-08 00:43 | 154K | |
| py39-azure-mgmt-moni..> | 2023-10-08 02:27 | 384K | |
| py39-azure-mgmt-msi-..> | 2023-10-07 17:12 | 89K | |
| py39-azure-mgmt-neta..> | 2023-10-07 12:25 | 157K | |
| py39-azure-mgmt-netw..> | 2023-10-09 09:11 | 685K | |
| py39-azure-mgmt-poli..> | 2023-10-07 12:31 | 74K | |
| py39-azure-mgmt-priv..> | 2023-10-08 03:21 | 35K | |
| py39-azure-mgmt-rdbm..> | 2023-10-07 23:26 | 346K | |
| py39-azure-mgmt-reco..> | 2023-10-08 00:06 | 94K | |
| py39-azure-mgmt-reco..> | 2023-10-07 16:57 | 270K | |
| py39-azure-mgmt-redh..> | 2023-10-08 10:46 | 101K | |
| py39-azure-mgmt-redi..> | 2023-10-07 20:57 | 97K | |
| py39-azure-mgmt-rela..> | 2023-10-07 20:27 | 32K | |
| py39-azure-mgmt-rese..> | 2023-10-10 03:48 | 113K | |
| py39-azure-mgmt-reso..> | 2023-10-07 23:40 | 856K | |
| py39-azure-mgmt-sear..> | 2023-10-08 06:15 | 87K | |
| py39-azure-mgmt-secu..> | 2023-10-07 15:24 | 391K | |
| py39-azure-mgmt-serv..> | 2023-10-08 09:47 | 272K | |
| py39-azure-mgmt-serv..> | 2023-10-07 13:42 | 89K | |
| py39-azure-mgmt-serv..> | 2023-10-08 07:33 | 76K | |
| py39-azure-mgmt-serv..> | 2023-10-08 03:13 | 87K | |
| py39-azure-mgmt-sign..> | 2023-10-08 11:30 | 59K | |
| py39-azure-mgmt-sql-..> | 2023-10-07 10:58 | 572K | |
| py39-azure-mgmt-sqlv..> | 2023-10-08 00:32 | 90K | |
| py39-azure-mgmt-stor..> | 2023-10-08 01:55 | 539K | |
| py39-azure-mgmt-syna..> | 2023-10-08 04:17 | 265K | |
| py39-azure-mgmt-traf..> | 2023-10-07 21:26 | 38K | |
| py39-azure-mgmt-web-..> | 2023-10-08 10:15 | 3.3M | |
| py39-azure-multiapi-..> | 2023-10-08 08:01 | 1.2M | |
| py39-azure-storage-0..> | 2023-10-14 13:16 | 168K | |
| py39-azure-storage-b..> | 2023-10-06 18:45 | 89K | |
| py39-azure-storage-c..> | 2023-10-06 16:06 | 56K | |
| py39-azure-synapse-a..> | 2023-10-07 15:50 | 24K | |
| py39-azure-synapse-a..> | 2023-10-08 03:12 | 379K | |
| py39-azure-synapse-m..> | 2023-10-07 23:09 | 23K | |
| py39-azure-synapse-s..> | 2023-10-07 11:07 | 25K | |
| py39-b2sdk-1.17.3.pkg | 2023-10-07 04:45 | 275K | |
| py39-babelfish-0.6.0..> | 2023-10-07 06:49 | 75K | |
| py39-babelfont-3.0.1..> | 2023-10-08 20:15 | 68K | |
| py39-babi-1.5.5.pkg | 2023-10-10 19:19 | 88K | |
| py39-babi_grammars-0..> | 2023-10-07 20:25 | 236K | |
| py39-backcall-0.2.0.pkg | 2023-10-06 10:29 | 15K | |
| py39-backoff-2.2.1.pkg | 2023-10-07 11:16 | 17K | |
| py39-backports-1.pkg | 2023-10-06 20:30 | 888 | |
| py39-backports.cache..> | 2023-10-10 14:09 | 6.2K | |
| py39-backports.csv-1..> | 2023-10-09 10:43 | 19K | |
| py39-backports.entry..> | 2023-10-11 00:40 | 8.5K | |
| py39-backports.zonei..> | 2023-10-06 12:18 | 37K | |
| py39-backtrader-1.9...> | 2023-10-09 00:15 | 410K | |
| py39-badkeys-0.0.5_1..> | 2023-10-14 16:41 | 370K | |
| py39-banal-1.0.6.pkg | 2023-10-07 00:52 | 7.0K | |
| py39-bandit-1.7.5.pkg | 2023-10-08 17:36 | 123K | |
| py39-base58-2.1.1.pkg | 2023-10-07 01:16 | 6.9K | |
| py39-baycomp-1.0.3.pkg | 2023-10-06 19:53 | 19K | |
| py39-bayesian-optimi..> | 2023-10-07 21:04 | 27K | |
| py39-bcbio-gff-0.7.0..> | 2023-10-07 23:03 | 25K | |
| py39-bcdoc-0.16.0.pkg | 2023-10-14 17:37 | 24K | |
| py39-bcrypt-3.2.2.pkg | 2023-10-06 09:22 | 26K | |
| py39-bdflib-2.0.0.pkg | 2023-10-09 09:19 | 48K | |
| py39-beaker-1.12.1.pkg | 2023-10-05 17:25 | 77K | |
| py39-beartype-0.16.0..> | 2023-10-10 16:02 | 602K | |
| py39-beautifulsoup-4..> | 2023-10-06 09:27 | 198K | |
| py39-beautifultable-..> | 2023-10-08 09:54 | 43K | |
| py39-behave-1.2.6.pkg | 2023-10-14 15:15 | 185K | |
| py39-belier-1.2_1.pkg | 2023-10-14 12:28 | 12K | |
| py39-bencode.py-4.0...> | 2023-10-08 03:06 | 11K | |
| py39-bencoder-0.2.1.pkg | 2023-10-14 10:47 | 3.5K | |
| py39-benford_py-0.5...> | 2023-10-11 06:28 | 45K | |
| py39-beniget-0.4.1.pkg | 2023-10-06 09:31 | 17K | |
| py39-berkeleydb-18.1..> | 2023-10-07 17:23 | 182K | |
| py39-betamax-0.8.1.pkg | 2023-10-14 13:50 | 44K | |
| py39-better-bencode-..> | 2023-10-08 16:03 | 14K | |
| py39-beziers-0.5.0.pkg | 2023-10-06 18:49 | 60K | |
| py39-bibtexparser-1...> | 2023-10-08 10:48 | 51K | |
| py39-bidict-0.21.4.pkg | 2023-10-06 15:58 | 33K | |
| py39-billiard-3.6.3...> | 2023-10-06 22:00 | 145K | |
| py39-binaryornot-0.4..> | 2023-10-06 18:41 | 7.3K | |
| py39-biom-format-2.1..> | 2023-10-09 20:50 | 8.1M | |
| py39-biopython-1.81_..> | 2023-10-06 23:44 | 2.3M | |
| py39-biosig-2.5.2.pkg | 2023-10-10 09:44 | 5.7K | |
| py39-biplist-1.0.3.pkg | 2023-10-14 05:53 | 18K | |
| py39-biscuits-0.3.0.pkg | 2023-10-10 04:39 | 30K | |
| py39-bitarray-2.8.1.pkg | 2023-10-08 06:00 | 190K | |
| py39-bitbox02-6.2.0.pkg | 2023-10-07 13:22 | 68K | |
| py39-bitcoin-1.1.42.pkg | 2023-10-09 03:19 | 57K | |
| py39-bitmath-1.3.3.1..> | 2023-10-09 15:30 | 28K | |
| py39-bitrot-1.0.0.pkg | 2023-10-10 10:27 | 16K | |
| py39-bitstring-3.1.9..> | 2023-10-06 20:36 | 75K | |
| py39-bitvector-3.5.0..> | 2023-10-08 20:00 | 69K | |
| py39-bjoern-3.2.2.pkg | 2023-10-08 15:39 | 21K | |
| py39-black-23.7.0.pkg | 2023-10-06 13:39 | 247K | |
| py39-bleach-6.0.0.pkg | 2023-10-06 09:41 | 224K | |
| py39-blessed-1.20.0.pkg | 2023-10-06 23:32 | 70K | |
| py39-blessings-1.7_1..> | 2023-10-07 21:24 | 22K | |
| py39-blinker-1.6.2.pkg | 2023-10-06 13:29 | 19K | |
| py39-blist-1.3.6_1.pkg | 2023-10-09 12:09 | 55K | |
| py39-blobfile-2.0.2.pkg | 2023-10-09 09:50 | 119K | |
| py39-blockdiag-3.0.0..> | 2023-10-08 02:19 | 2.2M | |
| py39-blockdiagcontri..> | 2023-10-14 13:24 | 4.3M | |
| py39-blosc2-2.2.6.pkg | 2023-10-10 16:23 | 222K | |
| py39-bluelet-0.2.0.pkg | 2023-10-11 06:15 | 15K | |
| py39-bokeh-2.4.3_1.pkg | 2023-10-07 15:43 | 8.5M | |
| py39-boltons-23.0.0.pkg | 2023-10-07 02:53 | 229K | |
| py39-bonsai-1.5.1.pkg | 2023-10-10 19:50 | 99K | |
| py39-boolean.py-4.0.pkg | 2023-10-07 05:20 | 185K | |
| py39-booleanOperatio..> | 2023-10-06 13:37 | 28K | |
| py39-boost-histogram..> | 2023-10-07 11:49 | 724K | |
| py39-boost-libs-1.82..> | 2023-10-06 15:44 | 165K | |
| py39-borgbackup-1.2...> | 2023-10-07 11:55 | 1.3M | |
| py39-borgbackup11-1...> | 2023-10-08 12:32 | 894K | |
| py39-borgmatic-1.8.2..> | 2023-10-14 08:50 | 138K | |
| py39-boto-2.49.0_1.pkg | 2023-10-07 02:18 | 1.3M | |
| py39-boto3-1.28.44.pkg | 2023-10-06 21:28 | 109K | |
| py39-botocore-1.31.4..> | 2023-10-06 15:21 | 5.9M | |
| py39-botocore-stubs-..> | 2023-10-06 21:12 | 26K | |
| py39-bottle-0.12.25.pkg | 2023-10-07 02:37 | 83K | |
| py39-bottle-cork-0.1..> | 2023-10-14 08:00 | 35K | |
| py39-bottleneck-1.3...> | 2023-10-06 11:55 | 107K | |
| py39-box2d-py-2.3.8_..> | 2023-10-09 18:47 | 339K | |
| py39-bps_restpy-9.0...> | 2023-10-09 19:36 | 73K | |
| py39-bracex-2.4.pkg | 2023-10-07 00:41 | 15K | |
| py39-branca-0.6.0_1.pkg | 2023-10-08 04:15 | 34K | |
| py39-bravado-11.0.3.pkg | 2023-10-07 09:32 | 50K | |
| py39-bravado-core-6...> | 2023-10-06 19:45 | 83K | |
| py39-breathe-4.35.0_..> | 2023-10-06 16:52 | 891K | |
| py39-brial-1.2.11_1.pkg | 2023-10-08 06:20 | 97K | |
| py39-brotli-1.1.0.pkg | 2023-10-06 10:06 | 11K | |
| py39-brotlicffi-1.0...> | 2023-10-09 12:26 | 19K | |
| py39-brotlipy-0.7.0.pkg | 2023-10-07 01:43 | 285K | |
| py39-brz-3.2.2_1.pkg | 2023-10-08 12:09 | 5.6M | |
| py39-bsd-1.0.2022042..> | 2023-10-07 20:34 | 772K | |
| py39-bsdconv-11.3.0.pkg | 2023-10-07 14:41 | 6.5K | |
| py39-bt-0.2.9_1.pkg | 2023-10-14 17:01 | 202K | |
| py39-btchip-python-0..> | 2023-10-08 11:05 | 40K | |
| py39-btest-1.1.pkg | 2023-10-07 06:21 | 37K | |
| py39-build-0.10.0_2.pkg | 2023-10-05 17:15 | 27K | |
| py39-buildbot-3.9.2.pkg | 2023-10-08 23:13 | 1.3M | |
| py39-buildbot-consol..> | 2023-10-07 02:51 | 17K | |
| py39-buildbot-grid-v..> | 2023-10-07 03:18 | 13K | |
| py39-buildbot-pkg-3...> | 2023-10-06 19:34 | 7.3K | |
| py39-buildbot-waterf..> | 2023-10-07 01:16 | 156K | |
| py39-buildbot-worker..> | 2023-10-14 18:05 | 196K | |
| py39-buildbot-www-3...> | 2023-10-08 05:39 | 1.9M | |
| py39-bullet3-3.25_1.pkg | 2023-10-10 22:59 | 55M | |
| py39-bup-0.32.pkg | 2023-10-08 23:53 | 205K | |
| py39-bx-python-0.8.1..> | 2023-10-07 01:37 | 767K | |
| py39-bytecode-0.15.0..> | 2023-10-07 11:25 | 61K | |
| py39-bz2file-0.98.pkg | 2023-10-06 21:14 | 10K | |
| py39-cabby-0.1.20.pkg | 2023-10-14 14:47 | 43K | |
| py39-cachecontrol-0...> | 2023-10-06 15:24 | 31K | |
| py39-cached-property..> | 2023-10-07 05:57 | 7.6K | |
| py39-cachelib-0.10.2..> | 2023-10-07 23:41 | 26K | |
| py39-cachetools-5.3...> | 2023-10-06 11:23 | 17K | |
| py39-cachetools3-3.1..> | 2023-10-09 10:44 | 15K | |
| py39-cacheyou-23.3.pkg | 2023-10-10 19:09 | 30K | |
| py39-cachy-0.3.0_2.pkg | 2023-10-09 18:13 | 24K | |
| py39-cadquery-pywrap..> | 2023-10-08 18:49 | 37K | |
| py39-caffeine-ng-4.0..> | 2023-10-08 13:48 | 92K | |
| py39-cairo-1.21.0,1.pkg | 2023-10-05 17:46 | 86K | |
| py39-cairocffi-1.4.0..> | 2023-10-06 23:16 | 111K | |
| py39-cairosvg-2.7.1.pkg | 2023-10-08 05:18 | 71K | |
| py39-caldav-1.2.1.pkg | 2023-10-09 22:04 | 73K | |
| py39-calver-2022.6.2..> | 2023-10-05 17:33 | 7.3K | |
| py39-canonicaljson-2..> | 2023-10-07 07:50 | 7.9K | |
| py39-capstone-5.0.1.pkg | 2023-10-07 07:12 | 128K | |
| py39-capturer-3.0.pkg | 2023-10-14 06:49 | 19K | |
| py39-cartopy-0.22.0.pkg | 2023-10-14 18:21 | 9.7M | |
| py39-case-1.5.3.pkg | 2023-10-14 17:04 | 27K | |
| py39-cassandra-drive..> | 2023-10-08 23:06 | 2.0M | |
| py39-castellan-4.2.0..> | 2023-10-07 19:19 | 99K | |
| py39-catalogue-2.0.9..> | 2023-10-07 10:23 | 25K | |
| py39-cattrs-22.2.0_1..> | 2023-10-06 21:12 | 51K | |
| py39-cbeams-1.0.3.pkg | 2023-10-08 22:13 | 12K | |
| py39-cbor-1.0.0.pkg | 2023-10-07 09:58 | 25K | |
| py39-cbor2-5.4.3.pkg | 2023-10-07 00:59 | 62K | |
| py39-cchardet-2.1.7_..> | 2023-10-09 18:39 | 82K | |
| py39-cclib-1.7.1_1.pkg | 2023-10-08 13:43 | 364K | |
| py39-ccxt-4.0.78.pkg | 2023-10-09 22:35 | 3.6M | |
| py39-cdg-0.1.3_1.pkg | 2023-10-10 06:22 | 5.6K | |
| py39-cdo-1.6.0.pkg | 2023-10-09 13:08 | 19K | |
| py39-cec-0.2.8.pkg | 2023-10-09 19:20 | 19K | |
| py39-celery-4.4.7.pkg | 2023-10-07 05:11 | 615K | |
| py39-celery-progress..> | 2023-10-10 20:07 | 14K | |
| py39-celery-singleto..> | 2023-10-11 12:40 | 8.8K | |
| py39-censys-2.2.4.pkg | 2023-10-09 21:28 | 85K | |
| py39-cepa-1.8.4.pkg | 2023-10-06 23:47 | 515K | |
| py39-cerealizer-0.7_..> | 2023-10-09 17:00 | 14K | |
| py39-cert-human-1.0...> | 2023-10-07 22:42 | 21K | |
| py39-certbot-2.6.0,1..> | 2023-10-07 23:31 | 613K | |
| py39-certbot-apache-..> | 2023-10-10 00:24 | 215K | |
| py39-certbot-dns-clo..> | 2023-10-08 13:06 | 14K | |
| py39-certbot-dns-cpa..> | 2023-10-14 14:12 | 9.1K | |
| py39-certbot-dns-dig..> | 2023-10-10 02:31 | 11K | |
| py39-certbot-dns-dns..> | 2023-10-09 07:43 | 7.5K | |
| py39-certbot-dns-dns..> | 2023-10-08 17:57 | 7.9K | |
| py39-certbot-dns-gan..> | 2023-10-10 17:43 | 8.2K | |
| py39-certbot-dns-geh..> | 2023-10-09 00:18 | 7.7K | |
| py39-certbot-dns-goo..> | 2023-10-10 16:55 | 23K | |
| py39-certbot-dns-lin..> | 2023-10-10 01:59 | 8.6K | |
| py39-certbot-dns-lua..> | 2023-10-14 10:50 | 7.6K | |
| py39-certbot-dns-nso..> | 2023-10-09 08:27 | 7.6K | |
| py39-certbot-dns-ovh..> | 2023-10-08 20:32 | 8.3K | |
| py39-certbot-dns-pow..> | 2023-10-10 15:12 | 7.1K | |
| py39-certbot-dns-rfc..> | 2023-10-11 11:42 | 14K | |
| py39-certbot-dns-rou..> | 2023-10-09 23:26 | 13K | |
| py39-certbot-dns-sak..> | 2023-10-10 07:10 | 7.7K | |
| py39-certbot-dns-sta..> | 2023-10-10 01:06 | 7.5K | |
| py39-certbot-nginx-2..> | 2023-10-08 21:24 | 118K | |
| py39-certifi-2023.7...> | 2023-10-05 17:16 | 144K | |
| py39-certomancer-0.1..> | 2023-10-11 12:40 | 108K | |
| py39-certsrv-2.1.1.pkg | 2023-10-10 13:18 | 8.6K | |
| py39-certstream-1.12..> | 2023-10-10 04:06 | 6.2K | |
| py39-cffi-1.15.1.pkg | 2023-10-05 17:16 | 203K | |
| py39-cffsubr-0.2.9.p..> | 2023-10-07 08:04 | 13K | |
| py39-cfgrib-0.9.10.4..> | 2023-10-14 13:43 | 56K | |
| py39-cfgv-3.4.0.pkg | 2023-10-06 13:04 | 10K | |
| py39-cfn-lint-0.77.5..> | 2023-10-10 09:19 | 1.1M | |
| py39-cftime-1.6.2_1.pkg | 2023-10-06 16:11 | 165K | |
| py39-cfv-3.0.0.pkg | 2023-10-10 00:17 | 71K | |
| py39-chai-1.1.2.pkg | 2023-10-09 04:33 | 35K | |
| py39-chainer-7.8.1_4..> | 2023-10-08 03:59 | 1.1M | |
| py39-chainer-chemist..> | 2023-10-09 01:05 | 206K | |
| py39-chainmap-1.0.3.pkg | 2023-10-10 13:59 | 6.8K | |
| py39-chameleon-4.1.0..> | 2023-10-10 07:28 | 174K | |
| py39-chaospy-4.3.11_..> | 2023-10-06 19:55 | 269K | |
| py39-characteristic-..> | 2023-10-10 07:17 | 22K | |
| py39-chardet-4.0.0,1..> | 2023-10-06 17:16 | 164K | |
| py39-charset-normali..> | 2023-10-05 17:17 | 62K | |
| py39-chart-studio-1...> | 2023-10-07 10:16 | 83K | |
| py39-check-jsonschem..> | 2023-10-14 18:42 | 170K | |
| py39-check-manifest-..> | 2023-10-08 00:25 | 28K | |
| py39-check-sdist-0.1..> | 2023-10-14 18:37 | 12K | |
| py39-cheetah3-3.2.6_..> | 2023-10-06 19:04 | 266K | |
| py39-chempy-0.8.3.pkg | 2023-10-08 21:36 | 320K | |
| py39-cheroot-10.0.0_..> | 2023-10-07 05:20 | 143K | |
| py39-cherrypy-18.8.0..> | 2023-10-08 03:58 | 443K | |
| py39-chevron-0.14.0.pkg | 2023-10-08 11:14 | 15K | |
| py39-cinemagoer-2023..> | 2023-10-14 18:47 | 267K | |
| py39-circuitbreaker-..> | 2023-10-07 04:04 | 9.4K | |
| py39-circuits-3.2.pkg | 2023-10-11 17:20 | 207K | |
| py39-cirq-aqt-1.2.0.pkg | 2023-10-08 21:21 | 28K | |
| py39-cirq-core-1.2.0..> | 2023-10-07 02:08 | 2.0M | |
| py39-cirq-google-1.2..> | 2023-10-06 20:23 | 568K | |
| py39-cirq-ionq-1.2.0..> | 2023-10-09 16:36 | 67K | |
| py39-cirq-pasqal-1.2..> | 2023-10-08 21:34 | 29K | |
| py39-ciscoconfparse-..> | 2023-10-08 13:05 | 119K | |
| py39-ciso8601-2.3.0.pkg | 2023-10-08 14:39 | 13K | |
| py39-citeproc-py-0.6..> | 2023-10-08 02:06 | 118K | |
| py39-citeproc-py-sty..> | 2023-10-14 12:16 | 1.9M | |
| py39-cjdns-0.2.4.pkg | 2023-10-11 09:21 | 13K | |
| py39-cjkwrap-2.2.pkg | 2023-10-14 09:27 | 4.8K | |
| py39-ckanapi-4.7.pkg | 2023-10-10 08:21 | 58K | |
| py39-ckcc-protocol-1..> | 2023-10-07 20:35 | 50K | |
| py39-clang-11.0.pkg | 2023-10-08 10:18 | 48K | |
| py39-claripy-9.0.540..> | 2023-10-08 10:24 | 231K | |
| py39-cld-20150113_1.pkg | 2023-10-09 07:34 | 12K | |
| py39-cle-9.0.5405.pkg | 2023-10-07 12:21 | 191K | |
| py39-cleo-2.0.1_3.pkg | 2023-10-07 00:34 | 118K | |
| py39-cli-helpers-2.3..> | 2023-10-07 21:56 | 26K | |
| py39-cliapp-1.201808..> | 2023-10-08 02:55 | 72K | |
| py39-click-8.1.3.pkg | 2023-10-06 08:35 | 141K | |
| py39-click-completio..> | 2023-10-09 09:34 | 14K | |
| py39-click-creds-0.0..> | 2023-10-07 09:53 | 8.3K | |
| py39-click-default-g..> | 2023-10-06 08:44 | 4.5K | |
| py39-click-default-g..> | 2023-10-07 10:24 | 1.2K | |
| py39-click-help-colo..> | 2023-10-08 03:37 | 6.7K | |
| py39-click-log-0.3.2..> | 2023-10-07 05:27 | 5.0K | |
| py39-click-option-gr..> | 2023-10-09 09:27 | 17K | |
| py39-click-plugins-1..> | 2023-10-06 16:29 | 6.5K | |
| py39-click-threading..> | 2023-10-07 09:28 | 7.1K | |
| py39-click7-7.1.2.pkg | 2023-10-08 05:26 | 118K | |
| py39-cliff-4.3.0.pkg | 2023-10-06 22:40 | 91K | |
| py39-cligj-0.7.2.pkg | 2023-10-06 18:12 | 8.0K | |
| py39-clikit-0.6.2_2.pkg | 2023-10-08 12:48 | 124K | |
| py39-clingcon-5.2.0.pkg | 2023-10-11 07:23 | 143K | |
| py39-clingo-5.6.2_1.pkg | 2023-10-07 23:29 | 1.2M | |
| py39-clint-0.5.1.pkg | 2023-10-08 10:28 | 47K | |
| py39-cloud-init-23.3..> | 2023-10-08 17:12 | 937K | |
| py39-cloud-init-deve..> | 2023-10-14 12:44 | 937K | |
| py39-cloud_sptheme-1..> | 2023-10-09 00:09 | 86K | |
| py39-cloudflare-2.9...> | 2023-10-07 15:07 | 73K | |
| py39-cloudflare-scra..> | 2023-10-09 23:35 | 14K | |
| py39-cloudflare-scra..> | 2023-10-11 07:08 | 11K | |
| py39-cloudpickle-2.2..> | 2023-10-06 16:33 | 33K | |
| py39-cloudscraper-1...> | 2023-10-09 23:32 | 93K | |
| py39-cluster-1.4.1.pkg | 2023-10-10 18:03 | 20K | |
| py39-cma-3.3.0_1.pkg | 2023-10-07 12:37 | 366K | |
| py39-cmaes-0.10.0.pkg | 2023-10-07 17:06 | 32K | |
| py39-cmakedoc-1.0.1.pkg | 2023-10-09 23:09 | 5.0K | |
| py39-cmarkgfm-2022.1..> | 2023-10-08 01:28 | 102K | |
| py39-cmd2-2.4.3_1.pkg | 2023-10-06 17:07 | 197K | |
| py39-cmdtest-0.33.s2..> | 2023-10-11 22:11 | 29K | |
| py39-cmyt-1.2.0_1.pkg | 2023-10-07 15:15 | 50K | |
| py39-coards-1.0.5_3.pkg | 2023-10-09 03:06 | 6.9K | |
| py39-cocotb-1.8.0.pkg | 2023-10-14 10:20 | 282K | |
| py39-codecov-2.1.13.pkg | 2023-10-07 02:32 | 20K | |
| py39-codegen-1.0.pkg | 2023-10-10 23:46 | 9.2K | |
| py39-codesearch-py-g..> | 2023-10-10 11:16 | 73K | |
| py39-cog-3.1.0.pkg | 2023-10-06 20:56 | 43K | |
| py39-cogdumper-1.1.0..> | 2023-10-11 01:06 | 14K | |
| py39-coincurve-18.0...> | 2023-10-08 06:53 | 1.1M | |
| py39-collective.chec..> | 2023-10-09 14:55 | 6.7K | |
| py39-collective.monk..> | 2023-10-08 15:42 | 12K | |
| py39-collidoscope-0...> | 2023-10-08 04:37 | 14K | |
| py39-colorama-0.4.5.pkg | 2023-10-06 11:25 | 20K | |
| py39-colorbrewer-0.2..> | 2023-10-10 22:15 | 8.4K | |
| py39-colorcet-3.0.1.pkg | 2023-10-06 14:38 | 1.7M | |
| py39-colorclass-2.2...> | 2023-10-06 17:58 | 26K | |
| py39-colored-1.4.4.pkg | 2023-10-11 01:02 | 17K | |
| py39-colored-traceba..> | 2023-10-07 16:09 | 5.8K | |
| py39-coloredlogs-15...> | 2023-10-07 04:29 | 54K | |
| py39-colorful-0.5.4.pkg | 2023-10-08 09:28 | 165K | |
| py39-colorlog-6.7.0.pkg | 2023-10-06 23:58 | 13K | |
| py39-colormath-3.0.0..> | 2023-10-07 02:16 | 59K | |
| py39-colorspacious-1..> | 2023-10-07 06:36 | 52K | |
| py39-colorthief-0.2...> | 2023-10-14 03:59 | 9.0K | |
| py39-colorz-1.0.3.pkg | 2023-10-09 05:10 | 8.0K | |
| py39-colour-0.1.5.pkg | 2023-10-07 10:29 | 21K | |
| py39-columnize-0.3.1..> | 2023-10-08 05:09 | 8.6K | |
| py39-comm-0.1.4.pkg | 2023-10-06 10:59 | 8.2K | |
| py39-commandlines-0...> | 2023-10-07 05:30 | 16K | |
| py39-compreffor-0.5...> | 2023-10-07 01:01 | 78K | |
| py39-compressed-rtf-..> | 2023-10-07 06:46 | 8.6K | |
| py39-concurrent-log-..> | 2023-10-09 14:24 | 18K | |
| py39-conditional-1.3..> | 2023-10-10 15:28 | 4.3K | |
| py39-configargparse-..> | 2023-10-06 16:46 | 26K | |
| py39-configobj-5.0.8..> | 2023-10-06 13:36 | 50K | |
| py39-configparser-3...> | 2023-10-07 00:40 | 30K | |
| py39-configupdater-3..> | 2023-10-07 13:13 | 43K | |
| py39-confluent-kafka..> | 2023-10-10 03:35 | 73K | |
| py39-confusable_homo..> | 2023-10-08 02:27 | 95K | |
| py39-confuse-2.0.1.pkg | 2023-10-07 11:05 | 36K | |
| py39-connection_pool..> | 2023-10-07 20:11 | 5.5K | |
| py39-cons-0.4.6.pkg | 2023-10-06 21:40 | 9.1K | |
| py39-constantly-15.1..> | 2023-10-06 09:10 | 9.4K | |
| py39-construct-2.10...> | 2023-10-06 21:10 | 99K | |
| py39-construct-class..> | 2023-10-07 06:46 | 4.9K | |
| py39-contextlib-chdi..> | 2023-10-07 20:24 | 2.6K | |
| py39-contextlib2-0.6..> | 2023-10-07 02:46 | 11K | |
| py39-contourpy-1.0.7..> | 2023-10-06 11:37 | 192K | |
| py39-convertdate-2.2..> | 2023-10-08 02:37 | 49K | |
| py39-cookiecutter-2...> | 2023-10-07 04:03 | 47K | |
| py39-cookies-2.2.1.pkg | 2023-10-09 06:59 | 64K | |
| py39-copier-8.3.0.pkg | 2023-10-10 17:18 | 57K | |
| py39-coreapi-2.3.3.pkg | 2023-10-08 02:49 | 39K | |
| py39-coreschema-0.0...> | 2023-10-07 07:45 | 19K | |
| py39-country-22.3.5.pkg | 2023-10-06 17:01 | 3.4M | |
| py39-cov-core-1.15.0..> | 2023-10-10 04:36 | 8.3K | |
| py39-covdefaults-2.3..> | 2023-10-11 03:27 | 5.9K | |
| py39-coverage-7.3.0.pkg | 2023-10-06 17:22 | 251K | |
| py39-coverage_enable..> | 2023-10-09 17:50 | 2.0K | |
| py39-coveralls-3.3.1..> | 2023-10-08 09:16 | 20K | |
| py39-cpe-1.2.1.pkg | 2023-10-08 14:53 | 56K | |
| py39-cpfx-g20221025.pkg | 2023-10-10 11:41 | 2.6K | |
| py39-cppheaderparser..> | 2023-10-07 22:07 | 57K | |
| py39-cppy-1.2.1_1.pkg | 2023-10-06 10:38 | 6.6K | |
| py39-cram-0.7.pkg | 2023-10-10 10:34 | 26K | |
| py39-cramjam-2.7.0_1..> | 2023-10-07 16:39 | 1.2M | |
| py39-crank-0.8.1.pkg | 2023-10-08 04:55 | 18K | |
| py39-crashtest-0.4.1..> | 2023-10-06 20:32 | 9.8K | |
| py39-crc32c-2.3.pkg | 2023-10-10 05:51 | 16K | |
| py39-crcmod-1.7_2.pkg | 2023-10-07 10:39 | 64K | |
| py39-creole-1.4.10.pkg | 2023-10-14 05:35 | 104K | |
| py39-cron-descriptor..> | 2023-10-07 10:14 | 29K | |
| py39-croniter-0.3.20..> | 2023-10-07 21:45 | 23K | |
| py39-crontab-1.0.1.pkg | 2023-10-08 07:44 | 13K | |
| py39-crossmap-0.5.4_..> | 2023-10-08 10:44 | 130K | |
| py39-crossplane-0.5...> | 2023-10-09 01:39 | 39K | |
| py39-crudini-0.9.4.pkg | 2023-10-08 20:19 | 28K | |
| py39-cryptography-41..> | 2023-10-05 20:58 | 853K | |
| py39-cryptography-le..> | 2023-10-14 16:03 | 361K | |
| py39-cryptography-ve..> | 2023-10-14 15:49 | 28M | |
| py39-cryptominisat-5..> | 2023-10-11 00:02 | 549K | |
| py39-cson-0.8.pkg | 2023-10-07 16:11 | 11K | |
| py39-css-parser-1.0...> | 2023-10-08 02:24 | 228K | |
| py39-csscompressor-0..> | 2023-10-14 12:25 | 63K | |
| py39-cssmin-0.2.0_2.pkg | 2023-10-09 14:19 | 6.0K | |
| py39-cssselect-1.2.0..> | 2023-10-06 16:09 | 176K | |
| py39-cssselect2-0.7...> | 2023-10-06 22:13 | 25K | |
| py39-cssutils-2.7.1,..> | 2023-10-07 15:39 | 486K | |
| py39-csv23-0.3.4.pkg | 2023-10-14 07:33 | 22K | |
| py39-csvkit-1.1.1.pkg | 2023-10-08 09:24 | 54K | |
| py39-ctags-1.0.5_2.pkg | 2023-10-10 11:43 | 16K | |
| py39-ctypescrypto-0...> | 2023-10-10 21:14 | 45K | |
| py39-ctypesgen-1.1.1..> | 2023-10-10 03:43 | 180K | |
| py39-cu2qu-1.6.7p2.pkg | 2023-10-07 08:44 | 34K | |
| py39-curio-1.6.pkg | 2023-10-06 09:16 | 92K | |
| py39-cursive-0.2.3.pkg | 2023-10-14 18:59 | 39K | |
| py39-curtsies-0.4.2.pkg | 2023-10-07 13:28 | 58K | |
| py39-custodian-2023...> | 2023-10-08 08:16 | 129K | |
| py39-custom_inherit-..> | 2023-10-07 11:32 | 17K | |
| py39-cutadapt-3.3_1.pkg | 2023-10-08 04:03 | 150K | |
| py39-cvss-2.2.pkg | 2023-10-14 05:01 | 20K | |
| py39-cvxopt-1.3.2.pkg | 2023-10-07 20:41 | 303K | |
| py39-cvxpy-1.3.2.pkg | 2023-10-09 17:26 | 931K | |
| py39-cwcwidth-0.1.8_..> | 2023-10-07 03:51 | 12K | |
| py39-cxx-7.1.8.pkg | 2023-10-08 09:22 | 54K | |
| py39-cybox-2.1.0.21.pkg | 2023-10-08 02:54 | 770K | |
| py39-cycler-0.11.0.pkg | 2023-10-06 11:31 | 8.7K | |
| py39-cyclonedx-pytho..> | 2023-10-08 10:19 | 111K | |
| py39-cyipopt-1.2.0_1..> | 2023-10-09 18:37 | 94K | |
| py39-cykhash-2.0.1.pkg | 2023-10-07 05:11 | 289K | |
| py39-cymbal-1.0.0.pkg | 2023-10-07 16:50 | 5.1K | |
| py39-cymem-2.0.8.pkg | 2023-10-07 23:24 | 24K | |
| py39-cymruwhois-1.6.pkg | 2023-10-07 19:44 | 8.3K | |
| py39-cypari2-2.1.3.pkg | 2023-10-08 11:28 | 1.2M | |
| py39-cysignals-1.11...> | 2023-10-07 09:16 | 272K | |
| py39-cython-0.29.36.pkg | 2023-10-05 17:16 | 1.8M | |
| py39-cython-devel-3...> | 2023-10-09 03:07 | 2.7M | |
| py39-cython-test-exc..> | 2023-10-09 23:09 | 10K | |
| py39-cython3-3.0.2.pkg | 2023-10-07 05:02 | 2.7M | |
| py39-cytoolz-0.12.2.pkg | 2023-10-11 01:13 | 276K | |
| py39-d2to1-0.2.12.p1..> | 2023-10-07 02:35 | 38K | |
| py39-daemon-2.3.0.pkg | 2023-10-08 06:37 | 24K | |
| py39-daemon-runner-0..> | 2023-10-14 10:59 | 6.9K | |
| py39-daemonize-2.5.0..> | 2023-10-08 01:03 | 6.2K | |
| py39-daemons-1.3.2.pkg | 2023-10-10 12:36 | 17K | |
| py39-dal-20081016_3.pkg | 2023-10-11 06:30 | 40K | |
| py39-darts.util.lru-..> | 2023-10-09 01:49 | 14K | |
| py39-dask-2023.9.1.pkg | 2023-10-06 21:04 | 1.9M | |
| py39-dask-histogram-..> | 2023-10-10 12:40 | 34K | |
| py39-databases-0.7.0..> | 2023-10-07 01:20 | 30K | |
| py39-dataclass-array..> | 2023-10-08 19:14 | 54K | |
| py39-dataclasses-jso..> | 2023-10-07 08:48 | 36K | |
| py39-datadog-0.47.0.pkg | 2023-10-08 23:15 | 135K | |
| py39-datapackage-1.1..> | 2023-10-14 07:21 | 60K | |
| py39-datasette-0.64...> | 2023-10-09 18:57 | 257K | |
| py39-datatest-0.11.1..> | 2023-10-08 12:22 | 169K | |
| py39-dateparser-1.1...> | 2023-10-07 15:39 | 285K | |
| py39-dateutil-2.8.2.pkg | 2023-10-06 08:42 | 269K | |
| py39-dateutils-0.6.1..> | 2023-10-14 07:52 | 8.2K | |
| py39-datrie-0.8.2.pkg | 2023-10-08 03:42 | 104K | |
| py39-dbf-0.99.3.pkg | 2023-10-09 16:19 | 177K | |
| py39-dbfread-2.0.7.pkg | 2023-10-06 22:13 | 28K | |
| py39-dbus-1.3.2.pkg | 2023-10-06 09:45 | 92K | |
| py39-dbutils-3.0.3.pkg | 2023-10-09 14:07 | 28K | |
| py39-ddsketch-2.0.4.pkg | 2023-10-08 09:35 | 25K | |
| py39-ddt-1.6.0.pkg | 2023-10-09 23:46 | 9.6K | |
| py39-ddtrace-1.18.4.pkg | 2023-10-09 10:59 | 1.9M | |
| py39-deap-1.4.1.pkg | 2023-10-14 16:05 | 131K | |
| py39-debtcollector-1..> | 2023-10-06 11:52 | 24K | |
| py39-debugpy-1.6.7_2..> | 2023-10-06 11:41 | 1.6M | |
| py39-debugtools-0.2...> | 2023-10-08 11:43 | 3.3K | |
| py39-decopatch-1.4.1..> | 2023-10-07 21:22 | 22K | |
| py39-decorator-5.1.1..> | 2023-10-06 10:30 | 13K | |
| py39-decoratortools-..> | 2023-10-14 02:55 | 15K | |
| py39-deepTools-3.5.2..> | 2023-10-07 17:08 | 274K | |
| py39-deepdiff-5.8.1.pkg | 2023-10-09 16:45 | 97K | |
| py39-deepmerge-1.1.0..> | 2023-10-07 12:16 | 10K | |
| py39-deeptoolsinterv..> | 2023-10-07 00:38 | 57K | |
| py39-defcon-0.10.2.pkg | 2023-10-06 12:47 | 226K | |
| py39-defusedxml-0.7...> | 2023-10-06 10:03 | 27K | |
| py39-degiro-connecto..> | 2023-10-14 13:43 | 111K | |
| py39-dehinter-4.0.0.pkg | 2023-10-07 10:20 | 12K | |
| py39-demjson-3.0.6.pkg | 2023-10-08 09:05 | 92K | |
| py39-deprecat-2.1.1.pkg | 2023-10-08 05:53 | 12K | |
| py39-deprecated-1.2...> | 2023-10-06 19:29 | 11K | |
| py39-deprecation-2.1..> | 2023-10-06 08:47 | 8.8K | |
| py39-deptry-0.12.0.pkg | 2023-10-08 13:08 | 51K | |
| py39-descartes-1.1.0..> | 2023-10-09 07:52 | 5.9K | |
| py39-detect-secrets-..> | 2023-10-14 12:31 | 130K | |
| py39-detecta-0.0.5_1..> | 2023-10-09 16:06 | 13K | |
| py39-devedeng-4.17.0..> | 2023-10-11 05:39 | 1.6M | |
| py39-devtools-0.12.2..> | 2023-10-09 23:09 | 31K | |
| py39-dexml2-0.5.3.pkg | 2023-10-14 04:20 | 41K | |
| py39-dfdatetime-2022..> | 2023-10-07 06:29 | 53K | |
| py39-dftbplus-23.1.pkg | 2023-10-10 00:24 | 6.8K | |
| py39-dfvfs-20221224.pkg | 2023-10-08 01:28 | 262K | |
| py39-dfwinreg-202212..> | 2023-10-08 09:29 | 38K | |
| py39-dgl-1.1.1.pkg | 2023-10-08 18:12 | 967K | |
| py39-dialect-2.1.1.pkg | 2023-10-14 08:24 | 123K | |
| py39-diazo-1.2.11.pkg | 2023-10-10 07:53 | 124K | |
| py39-dict-toolbox-2...> | 2023-10-07 04:08 | 37K | |
| py39-dict2xml-1.7.3_..> | 2023-10-07 17:45 | 9.4K | |
| py39-dictdiffer-0.9...> | 2023-10-06 15:12 | 19K | |
| py39-diff-cover-7.7...> | 2023-10-09 11:06 | 61K | |
| py39-diff-match-patc..> | 2023-10-06 20:42 | 52K | |
| py39-diffoscope-247.pkg | 2023-10-10 01:47 | 233K | |
| py39-dill-0.3.7.pkg | 2023-10-06 13:32 | 157K | |
| py39-dimod-0.12.11.pkg | 2023-10-06 14:25 | 1.5M | |
| py39-dionysus-topolo..> | 2023-10-09 08:39 | 256K | |
| py39-dipy-1.7.0.pkg | 2023-10-09 09:49 | 5.6M | |
| py39-director-0.2.1.pkg | 2023-10-09 14:05 | 18K | |
| py39-dirhash-0.2.1.pkg | 2023-10-08 03:07 | 16K | |
| py39-dirspec-13.10.pkg | 2023-10-08 23:29 | 7.5K | |
| py39-dirsync-2.2.5.pkg | 2023-10-09 16:53 | 17K | |
| py39-discid-1.2.0.pkg | 2023-10-07 10:03 | 13K | |
| py39-discogs-client-..> | 2023-10-07 17:21 | 22K | |
| py39-discord.py-2.1...> | 2023-10-09 23:44 | 1.0M | |
| py39-disjoint-set-0...> | 2023-10-08 17:00 | 5.9K | |
| py39-diskcache-5.6.1..> | 2023-10-06 17:49 | 62K | |
| py39-dispy-4.10.6.pkg | 2023-10-14 15:05 | 176K | |
| py39-distlib-0.3.7.pkg | 2023-10-06 11:19 | 329K | |
| py39-distributed-202..> | 2023-10-08 06:54 | 1.2M | |
| py39-distro-1.8.0_2.pkg | 2023-10-06 11:12 | 25K | |
| py39-dj-database-url..> | 2023-10-08 03:14 | 7.8K | |
| py39-dj41-django-aut..> | 2023-10-09 06:09 | 203K | |
| py39-dj41-django-cor..> | 2023-10-10 13:02 | 16K | |
| py39-dj41-django-deb..> | 2023-10-07 13:36 | 134K | |
| py39-dj41-django-fil..> | 2023-10-09 15:59 | 65K | |
| py39-dj41-django-gra..> | 2023-10-14 18:25 | 5.7K | |
| py39-dj41-django-js-..> | 2023-10-07 16:50 | 5.7K | |
| py39-dj41-django-mpt..> | 2023-10-10 07:15 | 89K | |
| py39-dj41-django-pro..> | 2023-10-14 18:24 | 29K | |
| py39-dj41-django-red..> | 2023-10-14 07:34 | 38K | |
| py39-dj41-django-ric..> | 2023-10-10 03:17 | 9.8K | |
| py39-dj41-django-rq-..> | 2023-10-09 18:00 | 61K | |
| py39-dj41-django-tab..> | 2023-10-10 22:05 | 81K | |
| py39-dj41-django-tag..> | 2023-10-09 18:56 | 39K | |
| py39-dj41-django-tim..> | 2023-10-09 13:08 | 13K | |
| py39-dj41-djangorest..> | 2023-10-07 00:45 | 862K | |
| py39-dj41-drf-specta..> | 2023-10-10 12:08 | 128K | |
| py39-dj41-drf-specta..> | 2023-10-07 22:18 | 1.9M | |
| py39-dj41-drf-yasg-1..> | 2023-10-11 13:07 | 2.5M | |
| py39-dj41-graphene-d..> | 2023-10-07 19:33 | 152K | |
| py39-dj42-django-aut..> | 2023-10-10 05:29 | 203K | |
| py39-dj42-django-cor..> | 2023-10-07 15:03 | 15K | |
| py39-dj42-django-deb..> | 2023-10-07 02:46 | 134K | |
| py39-dj42-django-fil..> | 2023-10-08 09:37 | 65K | |
| py39-dj42-django-gra..> | 2023-10-07 18:44 | 5.5K | |
| py39-dj42-django-js-..> | 2023-10-07 02:53 | 5.5K | |
| py39-dj42-django-mpt..> | 2023-10-07 10:14 | 89K | |
| py39-dj42-django-pro..> | 2023-10-07 16:12 | 29K | |
| py39-dj42-django-red..> | 2023-10-07 10:40 | 38K | |
| py39-dj42-django-ric..> | 2023-10-07 10:45 | 9.7K | |
| py39-dj42-django-rq-..> | 2023-10-08 02:40 | 61K | |
| py39-dj42-django-tab..> | 2023-10-07 13:16 | 81K | |
| py39-dj42-django-tag..> | 2023-10-07 10:47 | 39K | |
| py39-dj42-django-tim..> | 2023-10-07 23:45 | 14K | |
| py39-dj42-djangorest..> | 2023-10-06 19:32 | 862K | |
| py39-dj42-drf-specta..> | 2023-10-07 12:02 | 128K | |
| py39-dj42-drf-specta..> | 2023-10-07 04:37 | 1.8M | |
| py39-dj42-graphene-d..> | 2023-10-07 06:10 | 151K | |
| py39-django-admin-ra..> | 2023-10-10 10:57 | 14K | |
| py39-django-advanced..> | 2023-10-14 18:23 | 65K | |
| py39-django-allauth-..> | 2023-10-07 02:29 | 676K | |
| py39-django-annoying..> | 2023-10-09 19:40 | 12K | |
| py39-django-appconf-..> | 2023-10-07 03:32 | 7.1K | |
| py39-django-assets-2..> | 2023-10-10 22:41 | 26K | |
| py39-django-auth-ker..> | 2023-10-09 10:58 | 4.4K | |
| py39-django-auth-lda..> | 2023-10-14 11:22 | 203K | |
| py39-django-autocomp..> | 2023-10-11 04:54 | 375K | |
| py39-django-bakery-0..> | 2023-10-07 20:52 | 46K | |
| py39-django-bitfield..> | 2023-10-14 16:20 | 24K | |
| py39-django-bleach-3..> | 2023-10-08 22:31 | 18K | |
| py39-django-bootstra..> | 2023-10-10 16:14 | 13K | |
| py39-django-bootstra..> | 2023-10-08 20:27 | 66K | |
| py39-django-bootstra..> | 2023-10-10 10:34 | 32K | |
| py39-django-braces-1..> | 2023-10-07 11:35 | 21K | |
| py39-django-cacheops..> | 2023-10-10 23:40 | 56K | |
| py39-django-ckeditor..> | 2023-10-09 10:21 | 1.0M | |
| py39-django-classy-t..> | 2023-10-07 08:20 | 21K | |
| py39-django-cms-3.9...> | 2023-10-09 02:28 | 1.5M | |
| py39-django-configur..> | 2023-10-14 09:56 | 2.6M | |
| py39-django-constanc..> | 2023-10-10 14:44 | 40K | |
| py39-django-contact-..> | 2023-10-10 14:16 | 9.6K | |
| py39-django-context-..> | 2023-10-14 06:44 | 3.4K | |
| py39-django-contrib-..> | 2023-10-10 15:09 | 137K | |
| py39-django-cors-hea..> | 2023-10-08 07:56 | 15K | |
| py39-django-countrie..> | 2023-10-14 15:25 | 365K | |
| py39-django-crispy-f..> | 2023-10-07 18:57 | 42K | |
| py39-django-cron-0.6..> | 2023-10-11 12:57 | 26K | |
| py39-django-csp-3.7_..> | 2023-10-08 09:03 | 23K | |
| py39-django-debreach..> | 2023-10-07 19:45 | 7.1K | |
| py39-django-debug-to..> | 2023-10-07 23:31 | 134K | |
| py39-django-dpaste-3..> | 2023-10-14 13:01 | 53K | |
| py39-django-easy-thu..> | 2023-10-07 18:05 | 254K | |
| py39-django-extensio..> | 2023-10-07 22:46 | 251K | |
| py39-django-filer-2...> | 2023-10-11 15:20 | 771K | |
| py39-django-filter-2..> | 2023-10-07 05:55 | 62K | |
| py39-django-formset-..> | 2023-10-08 22:33 | 9.3K | |
| py39-django-formtool..> | 2023-10-08 11:33 | 51K | |
| py39-django-graphiql..> | 2023-10-14 08:02 | 5.5K | |
| py39-django-gravatar..> | 2023-10-07 09:52 | 9.2K | |
| py39-django-guardian..> | 2023-10-10 19:55 | 120K | |
| py39-django-hashid-f..> | 2023-10-08 19:24 | 23K | |
| py39-django-haystack..> | 2023-10-09 22:57 | 168K | |
| py39-django-hierarke..> | 2023-10-10 05:53 | 13K | |
| py39-django-hijack-3..> | 2023-10-11 22:54 | 32K | |
| py39-django-htmlmin-..> | 2023-10-14 17:27 | 10K | |
| py39-django-i18nfiel..> | 2023-10-09 18:58 | 14K | |
| py39-django-jquery-j..> | 2023-10-07 11:35 | 95K | |
| py39-django-js-asset..> | 2023-10-07 07:55 | 5.5K | |
| py39-django-jsonview..> | 2023-10-10 05:32 | 14K | |
| py39-django-ldapdb-1..> | 2023-10-14 13:10 | 33K | |
| py39-django-libsass-..> | 2023-10-09 14:40 | 6.3K | |
| py39-django-mailbox-..> | 2023-10-08 14:28 | 2.7M | |
| py39-django-mailman3..> | 2023-10-07 15:01 | 389K | |
| py39-django-markdown..> | 2023-10-10 17:07 | 37K | |
| py39-django-markwhat..> | 2023-10-09 22:07 | 8.4K | |
| py39-django-mezzanin..> | 2023-10-10 23:14 | 74K | |
| py39-django-mezzanin..> | 2023-10-10 12:03 | 68K | |
| py39-django-model-ut..> | 2023-10-08 01:59 | 38K | |
| py39-django-modelclu..> | 2023-10-07 03:30 | 39K | |
| py39-django-mptt-0.1..> | 2023-10-07 21:25 | 89K | |
| py39-django-netfield..> | 2023-10-11 05:40 | 20K | |
| py39-django-object-a..> | 2023-10-09 08:33 | 11K | |
| py39-django-otp-1.1...> | 2023-10-07 23:13 | 65K | |
| py39-django-otp-yubi..> | 2023-10-14 18:21 | 12K | |
| py39-django-permissi..> | 2023-10-07 00:59 | 5.4K | |
| py39-django-pglocks-..> | 2023-10-08 07:52 | 5.1K | |
| py39-django-photolog..> | 2023-10-09 08:56 | 149K | |
| py39-django-picklefi..> | 2023-10-07 17:09 | 10K | |
| py39-django-pipeline..> | 2023-10-14 05:10 | 45K | |
| py39-django-polymorp..> | 2023-10-08 06:19 | 71K | |
| py39-django-post_off..> | 2023-10-08 18:46 | 95K | |
| py39-django-promethe..> | 2023-10-08 19:00 | 29K | |
| py39-django-pyscss-2..> | 2023-10-07 19:27 | 8.7K | |
| py39-django-radius-1..> | 2023-10-10 11:41 | 9.8K | |
| py39-django-ranged-r..> | 2023-10-07 03:16 | 4.3K | |
| py39-django-recaptch..> | 2023-10-11 03:32 | 23K | |
| py39-django-redis-5...> | 2023-10-10 12:58 | 38K | |
| py39-django-registra..> | 2023-10-09 11:33 | 38K | |
| py39-django-registra..> | 2023-10-09 08:02 | 95K | |
| py39-django-reversio..> | 2023-10-10 04:21 | 2.6M | |
| py39-django-reversio..> | 2023-10-10 19:23 | 40K | |
| py39-django-rich-1.7..> | 2023-10-10 22:17 | 9.7K | |
| py39-django-rq-2.8.1..> | 2023-10-10 18:49 | 61K | |
| py39-django-sekizai-..> | 2023-10-08 05:17 | 11K | |
| py39-django-simple-c..> | 2023-10-08 05:19 | 255K | |
| py39-django-simple-h..> | 2023-10-08 23:42 | 135K | |
| py39-django-smart-se..> | 2023-10-10 02:55 | 36K | |
| py39-django-solo-2.0..> | 2023-10-10 16:37 | 15K | |
| py39-django-sortedm2..> | 2023-10-07 15:01 | 34K | |
| py39-django-star-rat..> | 2023-10-10 10:31 | 35K | |
| py39-django-statici1..> | 2023-10-07 15:55 | 9.7K | |
| py39-django-staticin..> | 2023-10-07 18:55 | 16K | |
| py39-django-storages..> | 2023-10-14 13:28 | 57K | |
| py39-django-tables2-..> | 2023-10-09 16:31 | 81K | |
| py39-django-tagging-..> | 2023-10-14 05:28 | 48K | |
| py39-django-taggit-3..> | 2023-10-07 02:27 | 38K | |
| py39-django-tastypie..> | 2023-10-08 19:01 | 106K | |
| py39-django-template..> | 2023-10-09 04:06 | 5.4K | |
| py39-django-timezone..> | 2023-10-10 11:29 | 13K | |
| py39-django-tinymce-..> | 2023-10-09 01:22 | 674K | |
| py39-django-treebear..> | 2023-10-07 09:37 | 549K | |
| py39-django-voting-1..> | 2023-10-09 18:22 | 17K | |
| py39-django-webpack-..> | 2023-10-07 19:47 | 14K | |
| py39-django-widget-t..> | 2023-10-08 19:20 | 9.5K | |
| py39-django32-3.2.21..> | 2023-10-06 23:05 | 3.9M | |
| py39-django41-4.1.11..> | 2023-10-06 15:09 | 4.0M | |
| py39-django42-4.2.5.pkg | 2023-10-06 17:21 | 3.8M | |
| py39-django_compress..> | 2023-10-08 04:26 | 132K | |
| py39-djangocms-admin..> | 2023-10-07 22:21 | 242K | |
| py39-djangoql-0.17.1..> | 2023-10-08 05:52 | 212K | |
| py39-djangorestframe..> | 2023-10-07 08:37 | 862K | |
| py39-djangorestframe..> | 2023-10-14 05:14 | 16K | |
| py39-djangorestframe..> | 2023-10-11 15:30 | 16K | |
| py39-djangorestframe..> | 2023-10-08 20:21 | 5.1K | |
| py39-dkimpy-1.1.5.pkg | 2023-10-07 01:49 | 58K | |
| py39-dkimpy-milter-1..> | 2023-10-10 17:52 | 46K | |
| py39-dlib-19.24_2.pkg | 2023-10-07 05:10 | 2.2M | |
| py39-dlipower-1.0.17..> | 2023-10-10 16:40 | 16K | |
| py39-dna-features-vi..> | 2023-10-08 20:27 | 40K | |
| py39-dnaio-0.5.1.pkg | 2023-10-07 05:26 | 97K | |
| py39-dns-crawler-1.4..> | 2023-10-09 00:12 | 42K | |
| py39-dns-lexicon-3.1..> | 2023-10-08 03:40 | 262K | |
| py39-dnsdiag-2.1.0.pkg | 2023-10-09 07:10 | 15K | |
| py39-dnslib-0.9.23.pkg | 2023-10-08 11:17 | 86K | |
| py39-dnspython-2.4.2..> | 2023-10-06 13:38 | 331K | |
| py39-docker-6.0.1_1.pkg | 2023-10-07 06:10 | 175K | |
| py39-docker-pycreds-..> | 2023-10-06 20:23 | 6.5K | |
| py39-dockerpty-0.4.1..> | 2023-10-07 21:21 | 16K | |
| py39-docopt-0.6.2_1.pkg | 2023-10-07 02:44 | 24K | |
| py39-docplex-2.23.22..> | 2023-10-06 15:54 | 898K | |
| py39-docrepr-0.2.0.pkg | 2023-10-09 04:57 | 124K | |
| py39-docstring-parse..> | 2023-10-06 21:37 | 48K | |
| py39-docstring-to-ma..> | 2023-10-06 16:44 | 15K | |
| py39-doctest-ignore-..> | 2023-10-09 14:22 | 3.4K | |
| py39-docutils-0.19,1..> | 2023-10-05 17:20 | 629K | |
| py39-docx-generator-..> | 2023-10-09 11:51 | 24K | |
| py39-docx2txt-0.8.pkg | 2023-10-08 11:40 | 4.2K | |
| py39-docxcompose-1.4..> | 2023-10-08 05:51 | 33K | |
| py39-docxtpl-0.16.6.pkg | 2023-10-07 13:11 | 26K | |
| py39-dodgy-0.2.1.pkg | 2023-10-07 10:17 | 7.4K | |
| py39-dogpile.cache-1..> | 2023-10-06 15:54 | 67K | |
| py39-doit-0.36.0.pkg | 2023-10-07 03:30 | 121K | |
| py39-dominate-2.8.0.pkg | 2023-10-09 06:57 | 34K | |
| py39-donut-shellcode..> | 2023-10-08 11:07 | 39K | |
| py39-dot2tex-2.11.3.pkg | 2023-10-08 02:27 | 60K | |
| py39-dotted-0.1.8.pkg | 2023-10-09 21:50 | 14K | |
| py39-dotty-dict-1.3...> | 2023-10-08 03:30 | 9.1K | |
| py39-dparse-0.6.3.pkg | 2023-10-09 14:25 | 18K | |
| py39-dpcontracts-0.6..> | 2023-10-07 01:48 | 11K | |
| py39-dpkt-1.9.6.pkg | 2023-10-07 11:01 | 271K | |
| py39-draftjs-exporte..> | 2023-10-07 07:54 | 32K | |
| py39-drf-spectacular..> | 2023-10-09 10:11 | 128K | |
| py39-drf-spectacular..> | 2023-10-08 02:29 | 1.9M | |
| py39-drf-yasg-1.21.7..> | 2023-10-08 18:34 | 2.5M | |
| py39-drmaa-0.4b3_1.pkg | 2023-10-09 13:12 | 22K | |
| py39-dropbox-11.36.0..> | 2023-10-08 17:15 | 789K | |
| py39-dshell-3.2.2.pkg | 2023-10-09 13:30 | 155K | |
| py39-dtfabric-202212..> | 2023-10-07 01:04 | 51K | |
| py39-dtflickr-1.5_1.pkg | 2023-10-09 09:49 | 29K | |
| py39-ducc0-0.31.0.pkg | 2023-10-10 07:15 | 2.3M | |
| py39-duckdb-0.8.1.pkg | 2023-10-08 17:02 | 8.9M | |
| py39-duecredit-0.9.2..> | 2023-10-09 01:52 | 100K | |
| py39-duet-0.2.9.pkg | 2023-10-06 19:19 | 38K | |
| py39-dugong-3.7.5.pkg | 2023-10-09 00:15 | 30K | |
| py39-dulwich-0.21.2.pkg | 2023-10-06 12:23 | 652K | |
| py39-dunamai-1.18.0.pkg | 2023-10-06 18:29 | 37K | |
| py39-durus-3.9_1.pkg | 2023-10-11 14:12 | 88K | |
| py39-dwave-cloud-cli..> | 2023-10-06 18:39 | 138K | |
| py39-dwave-greedy-0...> | 2023-10-06 19:39 | 5.9K | |
| py39-dwave-hybrid-0...> | 2023-10-08 06:23 | 88K | |
| py39-dwave-inspector..> | 2023-10-07 22:02 | 35K | |
| py39-dwave-neal-0.6...> | 2023-10-07 06:37 | 3.7K | |
| py39-dwave-networkx-..> | 2023-10-06 16:24 | 95K | |
| py39-dwave-ocean-sdk..> | 2023-10-08 15:06 | 4.1K | |
| py39-dwave-preproces..> | 2023-10-06 20:37 | 338K | |
| py39-dwave-samplers-..> | 2023-10-06 16:59 | 448K | |
| py39-dwave-system-1...> | 2023-10-07 00:19 | 102K | |
| py39-dwave-tabu-0.5...> | 2023-10-07 01:42 | 3.8K | |
| py39-dwavebinarycsp-..> | 2023-10-07 22:11 | 29K | |
| py39-dynrules-0.1.0_..> | 2023-10-10 03:22 | 90K | |
| py39-earthpy-0.9.4_2..> | 2023-10-10 01:38 | 1.2M | |
| py39-easygui-0.98.3.pkg | 2023-10-06 15:51 | 99K | |
| py39-easyprocess-0.3..> | 2023-10-07 08:15 | 9.9K | |
| py39-easyzone-1.2.2_..> | 2023-10-14 14:12 | 10K | |
| py39-ebaysdk-2.2.0_1..> | 2023-10-07 22:49 | 71K | |
| py39-ebcdic-1.1.1.pkg | 2023-10-06 23:24 | 11K | |
| py39-ec2-cli-tools-1..> | 2023-10-14 18:06 | 5.8K | |
| py39-eccodes-1.6.0.pkg | 2023-10-08 03:27 | 50K | |
| py39-ecdsa-0.18.0_1.pkg | 2023-10-06 15:50 | 202K | |
| py39-ecos-2.0.12_1.pkg | 2023-10-08 03:52 | 57K | |
| py39-ed2k-tools-0.1.pkg | 2023-10-10 11:08 | 8.3K | |
| py39-ed25519ll-0.6_2..> | 2023-10-09 19:38 | 65K | |
| py39-edalize-0.5.1.pkg | 2023-10-08 08:19 | 147K | |
| py39-editables-0.5.pkg | 2023-10-05 17:33 | 7.0K | |
| py39-editdistance-0...> | 2023-10-10 15:19 | 18K | |
| py39-editorconfig-0...> | 2023-10-06 19:42 | 16K | |
| py39-eemeter-3.2.0.pkg | 2023-10-09 19:57 | 1.2M | |
| py39-eggtestinfo-0.3..> | 2023-10-11 19:20 | 3.6K | |
| py39-einops-0.6.1.pkg | 2023-10-06 19:21 | 59K | |
| py39-ejson-0.1.6.pkg | 2023-10-07 02:11 | 8.2K | |
| py39-elasticsearch-7..> | 2023-10-07 05:13 | 189K | |
| py39-elasticsearch-a..> | 2023-10-09 15:43 | 11K | |
| py39-elasticsearch-c..> | 2023-10-10 06:45 | 135K | |
| py39-elasticsearch-d..> | 2023-10-10 00:58 | 78K | |
| py39-elasticsearch-d..> | 2023-10-14 02:32 | 76K | |
| py39-elasticsearch5-..> | 2023-10-10 05:05 | 68K | |
| py39-elasticsearch6-..> | 2023-10-07 15:22 | 86K | |
| py39-electrum-4.4.6.pkg | 2023-10-10 03:42 | 7.0M | |
| py39-elelabs-zigbee-..> | 2023-10-09 08:57 | 515K | |
| py39-elementpath-4.1..> | 2023-10-06 19:20 | 323K | |
| py39-elf_diff-0.6.0.pkg | 2023-10-08 19:01 | 113K | |
| py39-email-reply-par..> | 2023-10-10 00:52 | 4.7K | |
| py39-email-validator..> | 2023-10-07 07:59 | 31K | |
| py39-emmet-core-0.64..> | 2023-10-07 23:30 | 208K | |
| py39-emoji-1.6.1.pkg | 2023-10-10 20:22 | 256K | |
| py39-empy-3.3.4.pkg | 2023-10-08 04:33 | 56K | |
| py39-enchant-3.2.2_2..> | 2023-10-07 01:47 | 53K | |
| py39-enlighten-1.11...> | 2023-10-07 23:33 | 40K | |
| py39-enmerkar-0.7.1_..> | 2023-10-08 02:29 | 13K | |
| py39-enrich-1.2.7.pkg | 2023-10-07 21:35 | 11K | |
| py39-entrypoint2-1.1..> | 2023-10-07 02:41 | 12K | |
| py39-entrypoints-0.4..> | 2023-10-06 17:31 | 6.2K | |
| py39-enum-compat-0.0..> | 2023-10-08 11:44 | 1.3K | |
| py39-envier-0.4.0_1.pkg | 2023-10-07 23:44 | 16K | |
| py39-envisage-7.0.3.pkg | 2023-10-06 17:06 | 233K | |
| py39-envs-1.3.pkg | 2023-10-07 20:26 | 18K | |
| py39-enzyme-0.4.1_1.pkg | 2023-10-07 21:36 | 48K | |
| py39-epc-0.0.5.pkg | 2023-10-09 09:39 | 36K | |
| py39-epdb-0.15.1.pkg | 2023-10-08 17:00 | 39K | |
| py39-ephem-4.1.4.pkg | 2023-10-14 09:46 | 1.2M | |
| py39-ephemeral-port-..> | 2023-10-09 16:50 | 4.1K | |
| py39-epsilon-0.8.0_1..> | 2023-10-07 13:08 | 155K | |
| py39-errbot-6.1.9_4.pkg | 2023-10-10 18:18 | 235K | |
| py39-esda-2.5.0.pkg | 2023-10-06 21:50 | 169K | |
| py39-esptool-4.5_1.pkg | 2023-10-09 23:12 | 248K | |
| py39-essentia-2.1.b5..> | 2023-10-09 06:59 | 193K | |
| py39-et_xmlfile-1.1...> | 2023-10-06 16:04 | 4.5K | |
| py39-ete3-3.1.3.pkg | 2023-10-14 03:05 | 2.0M | |
| py39-etils-1.4.1.pkg | 2023-10-07 14:37 | 142K | |
| py39-etuples-0.3.9.pkg | 2023-10-07 09:07 | 13K | |
| py39-evalidate-2.0.2..> | 2023-10-08 17:48 | 9.4K | |
| py39-evdev-1.6.0.pkg | 2023-10-05 17:22 | 45K | |
| py39-eventlet-0.33.3..> | 2023-10-06 18:00 | 295K | |
| py39-eventlib-0.1.5_..> | 2023-10-08 11:23 | 15K | |
| py39-evtx2splunk-2.0..> | 2023-10-07 22:50 | 18K | |
| py39-ewah-bool-utils..> | 2023-10-08 04:10 | 244K | |
| py39-ewmh-0.1.6_1.pkg | 2023-10-08 06:17 | 8.6K | |
| py39-exabgp4-4.2.21.pkg | 2023-10-08 16:46 | 701K | |
| py39-exam-0.10.6.pkg | 2023-10-14 07:08 | 12K | |
| py39-exceptiongroup-..> | 2023-10-06 08:48 | 22K | |
| py39-exchange-calend..> | 2023-10-07 19:38 | 186K | |
| py39-execnet-2.0.2.pkg | 2023-10-07 06:31 | 63K | |
| py39-executing-1.2.0..> | 2023-10-06 09:56 | 37K | |
| py39-expiringdict-1...> | 2023-10-07 14:12 | 6.4K | |
| py39-exscript-2.6.pkg | 2023-10-10 14:02 | 207K | |
| py39-extension-helpe..> | 2023-10-06 14:09 | 25K | |
| py39-extract-msg-0.4..> | 2023-10-08 01:56 | 286K | |
| py39-extras-1.0.0_1.pkg | 2023-10-07 09:05 | 8.3K | |
| py39-eyed3-0.9.6.pkg | 2023-10-08 05:30 | 231K | |
| py39-ezc3d-1.5.4.pkg | 2023-10-09 04:57 | 565K | |
| py39-ezdxf-1.0.2_1.pkg | 2023-10-10 19:45 | 1.5M | |
| py39-f3d-2.1.0.pkg | 2023-10-09 05:03 | 90K | |
| py39-fabric-3.2.2,1.pkg | 2023-10-07 14:36 | 68K | |
| py39-fabric3-1.14.pkg | 2023-10-08 09:28 | 114K | |
| py39-face-22.0.0.pkg | 2023-10-07 11:03 | 76K | |
| py39-face_recognitio..> | 2023-10-10 09:16 | 17K | |
| py39-face_recognitio..> | 2023-10-07 15:46 | 87M | |
| py39-factory-boy-3.3..> | 2023-10-08 03:20 | 54K | |
| py39-fail2ban-1.0.2.pkg | 2023-10-10 13:59 | 605K | |
| py39-faiss-1.7.4_1.pkg | 2023-10-09 12:16 | 790K | |
| py39-fake-useragent-..> | 2023-10-08 16:57 | 11K | |
| py39-fakeredis-2.18...> | 2023-10-09 11:43 | 116K | |
| py39-falcon-3.0.1.pkg | 2023-10-08 08:27 | 1.1M | |
| py39-fam-1.1.1_3.pkg | 2023-10-10 10:54 | 5.4K | |
| py39-fast-histogram-..> | 2023-10-07 21:39 | 21K | |
| py39-fastapi-0.103.1..> | 2023-10-07 04:04 | 100K | |
| py39-fastapi-users-1..> | 2023-10-07 19:22 | 105K | |
| py39-fastapi-users-d..> | 2023-10-10 18:16 | 4.5K | |
| py39-fastavro-0.24.2..> | 2023-10-08 04:58 | 342K | |
| py39-fastbencode-0.2..> | 2023-10-08 07:38 | 35K | |
| py39-fastcache-1.1.0..> | 2023-10-14 06:07 | 21K | |
| py39-fastcluster-1.2..> | 2023-10-09 19:24 | 34K | |
| py39-fastdtw-0.3.4_2..> | 2023-10-06 20:59 | 73K | |
| py39-fasteners-0.18.pkg | 2023-10-06 15:13 | 23K | |
| py39-fastentrypoints..> | 2023-10-08 04:29 | 5.1K | |
| py39-fastest_pkg-0.2..> | 2023-10-09 08:19 | 9.2K | |
| py39-fastf1-2.3.0_2.pkg | 2023-10-10 16:03 | 104K | |
| py39-fastimport-0.9...> | 2023-10-10 01:47 | 59K | |
| py39-fastjsonschema-..> | 2023-10-06 08:43 | 31K | |
| py39-fastnumbers-5.0..> | 2023-10-09 14:29 | 105K | |
| py39-fastparquet-202..> | 2023-10-09 08:39 | 378K | |
| py39-fastprogress-1...> | 2023-10-07 15:03 | 14K | |
| py39-fastscapelib-0...> | 2023-10-14 12:00 | 209K | |
| py39-fbmq-2.5.0.pkg | 2023-10-09 19:51 | 19K | |
| py39-fdb-2.0.1_2.pkg | 2023-10-09 03:50 | 267K | |
| py39-feedgenerator-2..> | 2023-10-08 04:11 | 27K | |
| py39-feedparser-6.0...> | 2023-10-08 06:53 | 101K | |
| py39-fenics-basix-0...> | 2023-10-09 02:23 | 148K | |
| py39-fenics-ffcx-0.5..> | 2023-10-08 22:02 | 147K | |
| py39-fenics-ufl-2022..> | 2023-10-09 07:00 | 308K | |
| py39-ffmpeg-python-0..> | 2023-10-07 11:34 | 29K | |
| py39-ffn-0.3.7.pkg | 2023-10-08 00:30 | 41K | |
| py39-fido2-1.1.2_1.pkg | 2023-10-07 07:16 | 216K | |
| py39-fields-5.0.0.pkg | 2023-10-10 04:43 | 19K | |
| py39-fife-0.4.2_5.pkg | 2023-10-07 19:24 | 2.7M | |
| py39-filebytes-0.10...> | 2023-10-07 01:44 | 38K | |
| py39-filedepot-0.10...> | 2023-10-08 14:45 | 46K | |
| py39-filelike-0.4.1_..> | 2023-10-09 08:35 | 59K | |
| py39-filelock-3.12.3..> | 2023-10-06 11:29 | 14K | |
| py39-filemagic-1.6.pkg | 2023-10-07 07:40 | 12K | |
| py39-filetype-1.0.7.pkg | 2023-10-06 20:25 | 19K | |
| py39-financedatabase..> | 2023-10-10 20:43 | 22K | |
| py39-find-libpython-..> | 2023-10-07 11:17 | 11K | |
| py39-findlibs-0.0.5.pkg | 2023-10-07 01:50 | 3.3K | |
| py39-findpython-0.3...> | 2023-10-07 10:32 | 28K | |
| py39-fingerprints-1...> | 2023-10-10 07:42 | 21K | |
| py39-finnhub-python-..> | 2023-10-09 17:11 | 12K | |
| py39-finviz-1.4.6.pkg | 2023-10-09 02:40 | 26K | |
| py39-finvizfinance-0..> | 2023-10-14 05:49 | 53K | |
| py39-fire-0.5.0.pkg | 2023-10-07 10:31 | 147K | |
| py39-firebirdsql-1.1..> | 2023-10-08 19:47 | 104K | |
| py39-first-2.0.2.pkg | 2023-10-08 12:43 | 4.6K | |
| py39-first-server-0...> | 2023-10-09 07:47 | 1.4M | |
| py39-fixtures-4.1.0.pkg | 2023-10-06 18:29 | 65K | |
| py39-flake8-6.1.0.pkg | 2023-10-06 17:31 | 81K | |
| py39-flake8-black-0...> | 2023-10-09 14:47 | 12K | |
| py39-flake8-bugbear-..> | 2023-10-06 20:18 | 39K | |
| py39-flake8-builtins..> | 2023-10-09 02:36 | 8.2K | |
| py39-flake8-comprehe..> | 2023-10-09 20:55 | 9.6K | |
| py39-flake8-docstrin..> | 2023-10-10 15:57 | 5.8K | |
| py39-flake8-future-a..> | 2023-10-09 01:39 | 11K | |
| py39-flake8-import-o..> | 2023-10-14 16:21 | 20K | |
| py39-flake8-polyfill..> | 2023-10-10 18:53 | 6.4K | |
| py39-flake8-print-5...> | 2023-10-14 17:59 | 6.6K | |
| py39-flake8-pyi-23.6..> | 2023-10-08 21:56 | 39K | |
| py39-flake8-quotes-3..> | 2023-10-10 14:08 | 10K | |
| py39-flake8_simplify..> | 2023-10-14 11:37 | 33K | |
| py39-flaky-3.7.0.pkg | 2023-10-14 16:11 | 24K | |
| py39-flanker-0.9.11.pkg | 2023-10-10 21:03 | 174K | |
| py39-flask-api-3.0.pkg | 2023-10-09 03:26 | 117K | |
| py39-flask-apschedul..> | 2023-10-14 16:38 | 16K | |
| py39-flask-babel-1.0..> | 2023-10-08 07:22 | 13K | |
| py39-flask-babelex-0..> | 2023-10-07 14:34 | 12K | |
| py39-flask-caching-2..> | 2023-10-11 05:04 | 36K | |
| py39-flask-json-0.4...> | 2023-10-08 07:26 | 11K | |
| py39-flask-jwt-exten..> | 2023-10-11 01:09 | 30K | |
| py39-flask-marshmall..> | 2023-10-11 14:08 | 12K | |
| py39-flask-migrate-4..> | 2023-10-14 18:25 | 19K | |
| py39-flask-mongoengi..> | 2023-10-10 11:02 | 34K | |
| py39-flask-peewee-3...> | 2023-10-09 20:31 | 185K | |
| py39-flask-restx-1.1..> | 2023-10-07 19:49 | 1.5M | |
| py39-flask-script-2...> | 2023-10-11 16:36 | 21K | |
| py39-flask-security-..> | 2023-10-10 02:57 | 60K | |
| py39-flask-smorest-0..> | 2023-10-09 09:16 | 41K | |
| py39-flask-socketio-..> | 2023-10-07 03:33 | 24K | |
| py39-flask-sqlalchem..> | 2023-10-07 16:05 | 32K | |
| py39-flatbuffers-23...> | 2023-10-07 04:42 | 41K | |
| py39-flatdict-4.0.1.pkg | 2023-10-08 23:26 | 9.3K | |
| py39-flatten-dict-0...> | 2023-10-07 09:48 | 13K | |
| py39-flax-0.6.8_1.pkg | 2023-10-10 09:26 | 251K | |
| py39-fleep-1.0.1.pkg | 2023-10-14 02:52 | 6.6K | |
| py39-flex-6.14.0.pkg | 2023-10-10 17:25 | 82K | |
| py39-flexmock-0.11.3..> | 2023-10-14 13:33 | 32K | |
| py39-flit-3.9.0.pkg | 2023-10-10 02:06 | 63K | |
| py39-flit-core-3.9.0..> | 2023-10-05 17:13 | 75K | |
| py39-flit-scm-1.7.0_..> | 2023-10-06 08:21 | 3.5K | |
| py39-fltk-1.3.8.pkg | 2023-10-12 08:46 | 1.4M | |
| py39-fluent-0.10.0.pkg | 2023-10-08 12:24 | 26K | |
| py39-fluent-logger-0..> | 2023-10-09 20:27 | 16K | |
| py39-fluent.syntax-0..> | 2023-10-07 19:31 | 29K | |
| py39-flufl.bounce-4...> | 2023-10-07 13:39 | 100K | |
| py39-flufl.i18n-3.2.pkg | 2023-10-08 10:56 | 15K | |
| py39-flufl.lock-6.0_..> | 2023-10-08 07:49 | 15K | |
| py39-flup6-1.1.1.pkg | 2023-10-08 00:33 | 60K | |
| py39-flynt-1.0.1.pkg | 2023-10-09 02:25 | 46K | |
| py39-fmoo-audiotools..> | 2023-10-09 05:41 | 1.6M | |
| py39-focker-2.0.pkg | 2023-10-10 03:20 | 7.8K | |
| py39-folium-0.14.0.pkg | 2023-10-11 03:18 | 102K | |
| py39-font-v-2.1.0.pkg | 2023-10-07 20:09 | 30K | |
| py39-fontMath-0.9.3.pkg | 2023-10-06 13:30 | 54K | |
| py39-fontaine-1.4.0_..> | 2023-10-14 16:35 | 3.0M | |
| py39-fontbakery-0.8...> | 2023-10-11 16:21 | 428K | |
| py39-fontfeatures-1...> | 2023-10-07 16:42 | 145K | |
| py39-fontmake-3.5.1.pkg | 2023-10-08 13:58 | 58K | |
| py39-fontparts-0.11...> | 2023-10-06 14:51 | 245K | |
| py39-fontpens-0.2.4.pkg | 2023-10-06 13:11 | 22K | |
| py39-fonttools-4.42...> | 2023-10-06 11:50 | 1.9M | |
| py39-foolscap-23.3.0..> | 2023-10-10 11:42 | 448K | |
| py39-forcediphttpsad..> | 2023-10-07 10:31 | 5.3K | |
| py39-formencode-2.0...> | 2023-10-06 19:10 | 258K | |
| py39-formulaic-0.6.4..> | 2023-10-07 10:34 | 121K | |
| py39-fotokilof-4.4.2..> | 2023-10-08 20:51 | 60K | |
| py39-fpdf-1.7.2.pkg | 2023-10-08 21:29 | 73K | |
| py39-fpylll-0.5.9_1.pkg | 2023-10-07 18:53 | 491K | |
| py39-fqdn-1.4.0.pkg | 2023-10-06 09:55 | 4.0K | |
| py39-fraction-2.2.0.pkg | 2023-10-09 03:30 | 5.9K | |
| py39-fredapi-0.5.1.pkg | 2023-10-09 07:58 | 10K | |
| py39-freebsd-0.9.5.pkg | 2023-10-09 15:06 | 22K | |
| py39-freebsd-sysctl-..> | 2023-10-09 12:48 | 9.7K | |
| py39-freeimagepy-2.0..> | 2023-10-08 21:13 | 691K | |
| py39-freenas.utils-1..> | 2023-10-08 14:34 | 14K | |
| py39-freenit-0.2.29.pkg | 2023-10-09 04:12 | 38K | |
| py39-freetype-py-2.4..> | 2023-10-10 19:56 | 77K | |
| py39-freezegun-1.2.2..> | 2023-10-08 04:39 | 19K | |
| py39-frescobaldi-3.3..> | 2023-10-10 00:57 | 2.6M | |
| py39-fresnel-0.13.4...> | 2023-10-11 01:26 | 524K | |
| py39-frictionless-5...> | 2023-10-07 15:09 | 336K | |
| py39-frictionless-ck..> | 2023-10-08 18:55 | 10K | |
| py39-fritzconnection..> | 2023-10-14 03:46 | 86K | |
| py39-frozendict-2.3...> | 2023-10-06 17:03 | 33K | |
| py39-frozenlist-1.4...> | 2023-10-06 09:33 | 34K | |
| py39-fs-0.5.4_1.pkg | 2023-10-09 02:07 | 399K | |
| py39-fs2-2.4.16.pkg | 2023-10-06 10:16 | 179K | |
| py39-fsph-0.3.0.pkg | 2023-10-14 08:58 | 74K | |
| py39-fsspec-2023.6.0..> | 2023-10-06 18:02 | 227K | |
| py39-ftfy-6.1.1.pkg | 2023-10-08 18:48 | 52K | |
| py39-ftputil-5.0.4.pkg | 2023-10-11 06:12 | 55K | |
| py39-fudge-1.1.1.pkg | 2023-10-08 09:50 | 56K | |
| py39-fuglu-1.2.0.pkg | 2023-10-14 14:35 | 634K | |
| py39-funcparserlib-1..> | 2023-10-07 03:48 | 20K | |
| py39-funcsigs-1.0.2.pkg | 2023-10-06 10:39 | 17K | |
| py39-funcy-1.18.pkg | 2023-10-08 02:00 | 52K | |
| py39-fundamentalanal..> | 2023-10-09 13:02 | 12K | |
| py39-furl-2.1.0.pkg | 2023-10-07 15:41 | 29K | |
| py39-furo-2023.7.26.pkg | 2023-10-06 09:54 | 71K | |
| py39-fury-0.9.0_1.pkg | 2023-10-09 14:14 | 607K | |
| py39-fusepy-3.0.1.pkg | 2023-10-07 16:49 | 19K | |
| py39-future-0.18.3.pkg | 2023-10-05 17:18 | 613K | |
| py39-futurist-2.4.1.pkg | 2023-10-06 21:30 | 46K | |
| py39-fuzzywuzzy-0.18..> | 2023-10-08 09:08 | 15K | |
| py39-fvcore-0.1.5.po..> | 2023-10-07 13:41 | 83K | |
| py39-fypp-3.2.pkg | 2023-10-06 16:51 | 47K | |
| py39-gTTS-2.3.2.pkg | 2023-10-08 11:05 | 40K | |
| py39-gambit-elastics..> | 2023-10-10 05:11 | 3.4K | |
| py39-game-2.5.1.pkg | 2023-10-06 23:26 | 8.9M | |
| py39-game_sdl2-7.4.1..> | 2023-10-09 03:31 | 834K | |
| py39-gapic-generator..> | 2023-10-09 18:19 | 193K | |
| py39-gast-0.5.4.pkg | 2023-10-06 09:22 | 34K | |
| py39-gau2grid-2.0.7_..> | 2023-10-07 14:24 | 276K | |
| py39-gcalcli-4.0.4_1..> | 2023-10-14 13:25 | 48K | |
| py39-gdal-3.7.1.1.pkg | 2023-10-06 12:58 | 935K | |
| py39-gdbm-3.9.18_7.pkg | 2023-10-06 14:46 | 7.3K | |
| py39-gdown-4.7.1.pkg | 2023-10-10 11:37 | 21K | |
| py39-gdspy-1.6.11_1.pkg | 2023-10-08 01:51 | 277K | |
| py39-gdstk-0.9.42.pkg | 2023-10-09 01:39 | 639K | |
| py39-gelidum-0.6.0.pkg | 2023-10-07 17:26 | 54K | |
| py39-gemmi-0.6.3.pkg | 2023-10-08 22:36 | 1.5M | |
| py39-gensim-4.3.2.pkg | 2023-10-07 22:18 | 18M | |
| py39-genson-1.2.2_1.pkg | 2023-10-10 23:31 | 24K | |
| py39-genty-1.3.2.pkg | 2023-10-10 04:03 | 15K | |
| py39-geoalchemy2-0.1..> | 2023-10-09 13:33 | 73K | |
| py39-geocoder-1.38.1..> | 2023-10-07 00:33 | 99K | |
| py39-geojson-3.0.1,1..> | 2023-10-07 16:35 | 21K | |
| py39-geolinks-0.2.3.pkg | 2023-10-07 15:19 | 6.1K | |
| py39-geomdl-5.2.10_1..> | 2023-10-07 22:05 | 194K | |
| py39-geomet-1.0.0.pkg | 2023-10-09 21:27 | 32K | |
| py39-geometer-0.3.5_..> | 2023-10-09 20:44 | 74K | |
| py39-geometric-1.0_1..> | 2023-10-10 07:46 | 434K | |
| py39-geopandas-0.12...> | 2023-10-07 04:07 | 1.1M | |
| py39-geopy-2.4.0.pkg | 2023-10-07 23:30 | 117K | |
| py39-get-reader-1.0...> | 2023-10-07 22:32 | 14K | |
| py39-getmail6-6.18.1..> | 2023-10-08 21:51 | 180K | |
| py39-gevent-22.10.2.pkg | 2023-10-06 20:26 | 1.3M | |
| py39-gevent-websocke..> | 2023-10-07 04:23 | 31K | |
| py39-geventhttpclien..> | 2023-10-10 04:54 | 52K | |
| py39-gffutils-0.11.1..> | 2023-10-10 12:58 | 1.0M | |
| py39-gflanguages-0.5..> | 2023-10-08 03:52 | 517K | |
| py39-ghp-import-2.1...> | 2023-10-06 13:41 | 10K | |
| py39-gi-docgen-2022...> | 2023-10-05 17:25 | 1.1M | |
| py39-giddy-2.3.4_1.pkg | 2023-10-07 05:04 | 78K | |
| py39-gimmik-3.1.1.pkg | 2023-10-08 04:26 | 14K | |
| py39-git-semver-0.3...> | 2023-10-07 16:16 | 4.7K | |
| py39-git-up-2.1.0.pkg | 2023-10-10 03:41 | 39K | |
| py39-git-url-parse-1..> | 2023-10-08 02:57 | 4.9K | |
| py39-gitdb-4.0.10.pkg | 2023-10-06 18:34 | 80K | |
| py39-gitlab-webhook-..> | 2023-10-09 18:44 | 9.6K | |
| py39-gitless-0.8.8.pkg | 2023-10-10 17:30 | 58K | |
| py39-gitpython-3.1.3..> | 2023-10-07 07:22 | 238K | |
| py39-giturlparse-0.1..> | 2023-10-08 05:58 | 18K | |
| py39-gixy-0.1.20.pkg | 2023-10-10 07:00 | 70K | |
| py39-gizeh-0.1.11_3.pkg | 2023-10-10 00:49 | 17K | |
| py39-glance-store-4...> | 2023-10-08 16:16 | 286K | |
| py39-glances-3.3.1.pkg | 2023-10-10 03:27 | 556K | |
| py39-glcontext-2.4.0..> | 2023-10-07 03:55 | 13K | |
| py39-glfw-2.5.5.pkg | 2023-10-10 05:45 | 45K | |
| py39-glob2-0.7.pkg | 2023-10-08 02:25 | 12K | |
| py39-glom-23.3.0.pkg | 2023-10-14 13:24 | 147K | |
| py39-glooey-0.3.3_1.pkg | 2023-10-09 09:20 | 6.8M | |
| py39-gluoncv-0.9.0_2..> | 2023-10-14 14:01 | 1.1M | |
| py39-gluonnlp-0.10.0..> | 2023-10-10 06:59 | 382K | |
| py39-glyphsLib-6.3.0..> | 2023-10-06 22:32 | 539K | |
| py39-glyphsets-0.6.2..> | 2023-10-07 12:35 | 261K | |
| py39-glyphtools-0.8...> | 2023-10-06 23:45 | 13K | |
| py39-gmpy2-2.1.5_1.pkg | 2023-10-06 11:52 | 125K | |
| py39-gmsh-4.11.1_3.pkg | 2023-10-08 08:49 | 7.6M | |
| py39-gntp-1.0.3.pkg | 2023-10-09 18:38 | 162K | |
| py39-gnupg-3.1.1.pkg | 2023-10-09 10:37 | 99K | |
| py39-gnutls-3.1.3.pkg | 2023-10-07 23:04 | 67K | |
| py39-goatools-1.1.6_..> | 2023-10-07 19:24 | 19M | |
| py39-gobject3-3.42.2..> | 2023-10-06 06:55 | 222K | |
| py39-google-3.0.0.pkg | 2023-10-14 09:49 | 45K | |
| py39-google-api-core..> | 2023-10-06 14:15 | 111K | |
| py39-google-api-pyth..> | 2023-10-07 02:59 | 4.5M | |
| py39-google-auth-2.2..> | 2023-10-06 13:22 | 169K | |
| py39-google-auth-htt..> | 2023-10-06 22:11 | 6.9K | |
| py39-google-auth-oau..> | 2023-10-08 10:11 | 16K | |
| py39-google-cloud-ai..> | 2023-10-10 04:04 | 1.7M | |
| py39-google-cloud-ap..> | 2023-10-07 22:45 | 9.4K | |
| py39-google-cloud-au..> | 2023-10-07 23:46 | 8.4K | |
| py39-google-cloud-bi..> | 2023-10-08 05:49 | 255K | |
| py39-google-cloud-bi..> | 2023-10-12 05:55 | 232K | |
| py39-google-cloud-co..> | 2023-10-06 16:05 | 28K | |
| py39-google-cloud-da..> | 2023-10-09 06:53 | 140K | |
| py39-google-cloud-dl..> | 2023-10-10 11:14 | 143K | |
| py39-google-cloud-ia..> | 2023-10-14 06:05 | 61K | |
| py39-google-cloud-lo..> | 2023-10-10 06:52 | 139K | |
| py39-google-cloud-re..> | 2023-10-08 02:19 | 133K | |
| py39-google-cloud-sp..> | 2023-10-11 00:25 | 134K | |
| py39-google-cloud-st..> | 2023-10-06 18:36 | 120K | |
| py39-google-cloud-tr..> | 2023-10-07 22:13 | 8.0K | |
| py39-google-cloud-vi..> | 2023-10-09 17:40 | 152K | |
| py39-google-compute-..> | 2023-10-14 14:34 | 73K | |
| py39-google-crc32c-1..> | 2023-10-06 13:55 | 15K | |
| py39-google-i18n-add..> | 2023-10-06 18:13 | 289K | |
| py39-google-pasta-0...> | 2023-10-07 06:39 | 74K | |
| py39-google-re2-1.0_..> | 2023-10-09 16:09 | 94K | |
| py39-google-resumabl..> | 2023-10-06 17:28 | 55K | |
| py39-googleapis-comm..> | 2023-10-06 11:09 | 121K | |
| py39-googletrans-3.0..> | 2023-10-08 11:18 | 20K | |
| py39-gpaw-22.1.0_2.pkg | 2023-10-10 06:55 | 2.6M | |
| py39-gpgme-1.22.0.pkg | 2023-10-08 08:19 | 210K | |
| py39-gphoto2-2.3.4.pkg | 2023-10-07 20:32 | 219K | |
| py39-gprof2dot-2022...> | 2023-10-07 16:27 | 53K | |
| py39-gpsoauth-0.4.2.pkg | 2023-10-10 06:44 | 6.8K | |
| py39-gpxpy-1.5.0.pkg | 2023-10-08 23:22 | 61K | |
| py39-grab-0.6.41_1.pkg | 2023-10-14 10:04 | 118K | |
| py39-grafana-dashboa..> | 2023-10-10 05:47 | 14K | |
| py39-grako-3.99.9.pkg | 2023-10-11 00:55 | 1.4M | |
| py39-grammalecte-fr-..> | 2023-10-08 14:56 | 3.0M | |
| py39-grandalf-0.7.pkg | 2023-10-08 00:19 | 53K | |
| py39-grapheme-0.6.0.pkg | 2023-10-07 22:30 | 105K | |
| py39-graphene-3.2.2.pkg | 2023-10-06 20:20 | 85K | |
| py39-graphene-django..> | 2023-10-07 15:56 | 151K | |
| py39-graphene-sqlalc..> | 2023-10-08 19:41 | 61K | |
| py39-graphene2-2.1.9..> | 2023-10-08 05:41 | 70K | |
| py39-graphillion-1.5..> | 2023-10-08 22:41 | 216K | |
| py39-graphite-api-1...> | 2023-10-10 09:23 | 128K | |
| py39-graphlib-backpo..> | 2023-10-10 04:07 | 6.9K | |
| py39-graphql-core-3...> | 2023-10-06 14:16 | 256K | |
| py39-graphql-core2-2..> | 2023-10-06 22:11 | 175K | |
| py39-graphql-relay-3..> | 2023-10-06 16:59 | 20K | |
| py39-graphql-relay2-..> | 2023-10-07 08:51 | 26K | |
| py39-graphviz-0.10.1..> | 2023-10-06 22:36 | 24K | |
| py39-graphy-1.0.pkg | 2023-10-14 18:49 | 56K | |
| py39-greenlet-2.0.2_..> | 2023-10-06 14:09 | 156K | |
| py39-grequests-0.7.0..> | 2023-10-07 07:26 | 5.7K | |
| py39-griffe-0.36.2.pkg | 2023-10-08 04:46 | 158K | |
| py39-grip-4.6.1.pkg | 2023-10-09 18:43 | 115K | |
| py39-grizzled-0.9.4_..> | 2023-10-08 04:34 | 99K | |
| py39-grpc-google-iam..> | 2023-10-06 23:45 | 16K | |
| py39-grpc-stubs-1.53..> | 2023-10-09 09:56 | 10K | |
| py39-grpcio-1.58.0.pkg | 2023-10-06 12:09 | 2.9M | |
| py39-grpcio-gcp-0.2...> | 2023-10-09 10:13 | 15K | |
| py39-grpcio-status-1..> | 2023-10-06 13:21 | 4.6K | |
| py39-grpcio-tools-1...> | 2023-10-07 09:19 | 1.6M | |
| py39-gs_api_client-1..> | 2023-10-08 22:54 | 339K | |
| py39-gsd-3.1.1.pkg | 2023-10-07 03:59 | 200K | |
| py39-gspread-5.10.0_..> | 2023-10-14 11:19 | 62K | |
| py39-gssapi-1.8.3.pkg | 2023-10-07 07:53 | 305K | |
| py39-gstat_exporter-..> | 2023-10-09 08:21 | 2.6K | |
| py39-gstreamer1-1.22..> | 2023-10-07 10:36 | 27K | |
| py39-gtfparse-1.3.0_..> | 2023-10-14 18:17 | 12K | |
| py39-gtfslib-1.0.0.pkg | 2023-10-09 19:04 | 88K | |
| py39-guess-language-..> | 2023-10-14 17:35 | 70K | |
| py39-guessit-3.7.1.pkg | 2023-10-07 13:44 | 177K | |
| py39-guietta-1.6.0.pkg | 2023-10-14 16:03 | 65K | |
| py39-gunicorn-21.2.0..> | 2023-10-08 11:21 | 121K | |
| py39-guppy3-3.1.3.pkg | 2023-10-10 22:21 | 537K | |
| py39-gvgen-1.0.pkg | 2023-10-09 02:45 | 117K | |
| py39-gvm-tools-23.4...> | 2023-10-08 02:03 | 123K | |
| py39-gym-0.26.2_1.pkg | 2023-10-08 04:21 | 788K | |
| py39-gym-notices-0.0..> | 2023-10-07 07:19 | 2.2K | |
| py39-gyp-20200512.pkg | 2023-10-06 20:05 | 415K | |
| py39-h2-4.0.0.pkg | 2023-10-06 09:11 | 71K | |
| py39-h3-3.7.6_1.pkg | 2023-10-08 06:32 | 204K | |
| py39-h5json-1.1.3_1.pkg | 2023-10-10 09:00 | 60K | |
| py39-h5py-3.9.0.pkg | 2023-10-06 13:56 | 944K | |
| py39-h11-0.14.0.pkg | 2023-10-06 09:30 | 76K | |
| py39-habanero-1.2.0.pkg | 2023-10-07 12:03 | 33K | |
| py39-haishoku-1.1.8.pkg | 2023-10-14 09:32 | 6.8K | |
| py39-halo-0.0.31.pkg | 2023-10-07 06:58 | 15K | |
| py39-haproxy-log-ana..> | 2023-10-14 04:22 | 194K | |
| py39-haproxyctl-0.5_..> | 2023-10-08 13:24 | 9.4K | |
| py39-hared-1.3.pkg | 2023-10-14 10:04 | 3.9K | |
| py39-hash_ring-1.3.1..> | 2023-10-10 20:11 | 6.3K | |
| py39-hashids-1.3.1_2..> | 2023-10-08 07:18 | 9.2K | |
| py39-hatch-0.23.1.pkg | 2023-10-06 20:06 | 76K | |
| py39-hatch-autorun-1..> | 2023-10-09 15:27 | 6.2K | |
| py39-hatch-fancy-pyp..> | 2023-10-06 07:42 | 13K | |
| py39-hatch-jupyter-b..> | 2023-10-06 10:06 | 25K | |
| py39-hatch-nodejs-ve..> | 2023-10-06 08:41 | 11K | |
| py39-hatch-requireme..> | 2023-10-07 00:59 | 7.7K | |
| py39-hatch-semver-1...> | 2023-10-10 23:28 | 10K | |
| py39-hatch-vcs-0.3.0..> | 2023-10-06 07:36 | 8.8K | |
| py39-hatchling-1.18...> | 2023-10-05 17:35 | 107K | |
| py39-hcloud-1.28.0.pkg | 2023-10-11 12:40 | 87K | |
| py39-hdbscan-0.8.33.pkg | 2023-10-09 20:45 | 401K | |
| py39-hdfs-2.7.2.pkg | 2023-10-08 03:20 | 46K | |
| py39-hdmedians-0.14...> | 2023-10-07 16:09 | 99K | |
| py39-heapdict-1.0.1.pkg | 2023-10-10 06:02 | 4.2K | |
| py39-helpdev-0.7.1_1..> | 2023-10-06 19:48 | 17K | |
| py39-hexdump-3.3.pkg | 2023-10-07 05:18 | 10K | |
| py39-heyoka-1.0.0_1.pkg | 2023-10-14 03:00 | 555K | |
| py39-hg-evolve-11.0...> | 2023-10-10 16:43 | 300K | |
| py39-hglib-2.6.2_1.pkg | 2023-10-07 20:47 | 36K | |
| py39-hgreviewboard-1..> | 2023-10-09 02:52 | 9.3K | |
| py39-hgsvn-0.6.0_1.pkg | 2023-10-09 13:20 | 109K | |
| py39-hgtools-6.3.pkg | 2023-10-14 05:48 | 32K | |
| py39-hid-1.0.4.pkg | 2023-10-08 09:35 | 5.9K | |
| py39-hidapi-0.11.0.p..> | 2023-10-07 05:05 | 29K | |
| py39-hieroglyph-2.1...> | 2023-10-10 04:00 | 747K | |
| py39-hijri-converter..> | 2023-10-09 09:23 | 16K | |
| py39-hiphive-1.2.pkg | 2023-10-10 11:53 | 125K | |
| py39-hiplot-0.1.33.pkg | 2023-10-08 00:24 | 416K | |
| py39-hiredis-2.0.0.pkg | 2023-10-08 03:54 | 9.7K | |
| py39-hist-2.7.2.pkg | 2023-10-09 09:30 | 62K | |
| py39-histoprint-2.4...> | 2023-10-07 11:59 | 22K | |
| py39-hits-0.1.pkg | 2023-10-14 09:28 | 920K | |
| py39-hjson-3.0.2.pkg | 2023-10-08 03:17 | 65K | |
| py39-hkdf-0.0.3.pkg | 2023-10-09 20:27 | 4.4K | |
| py39-holidays-0.9.12..> | 2023-10-07 18:50 | 70K | |
| py39-homebase-1.0.1.pkg | 2023-10-06 17:52 | 17K | |
| py39-honcho-1.0.1_1.pkg | 2023-10-14 13:23 | 27K | |
| py39-hoomd-blue-4.1...> | 2023-10-09 11:45 | 4.2M | |
| py39-horizon-22.1.0.pkg | 2023-10-09 09:09 | 3.0M | |
| py39-horoscopegenera..> | 2023-10-09 21:41 | 7.2K | |
| py39-howdoi-2.0.20_1..> | 2023-10-09 15:23 | 24K | |
| py39-hpack-4.0.0.pkg | 2023-10-06 08:46 | 34K | |
| py39-hpilo-4.4.3.pkg | 2023-10-08 19:36 | 53K | |
| py39-hsaudiotag3k-1...> | 2023-10-08 22:44 | 35K | |
| py39-hsluv-5.0.4.pkg | 2023-10-08 20:38 | 7.6K | |
| py39-hstspreload-202..> | 2023-10-06 19:55 | 1.2M | |
| py39-html2json-0.2.4..> | 2023-10-11 00:44 | 4.5K | |
| py39-html2text-2020...> | 2023-10-07 05:44 | 29K | |
| py39-html2text2018-2..> | 2023-10-10 16:51 | 30K | |
| py39-html3-1.18.pkg | 2023-10-14 12:54 | 11K | |
| py39-html5-parser-0...> | 2023-10-06 18:24 | 125K | |
| py39-html5lib-1.1.pkg | 2023-10-05 17:30 | 171K | |
| py39-htpasswd-2019.1..> | 2023-10-14 16:36 | 2.2K | |
| py39-httmock-1.4.0.pkg | 2023-10-08 21:31 | 7.1K | |
| py39-http-parser-0.9..> | 2023-10-09 17:33 | 65K | |
| py39-http-prompt-2.1..> | 2023-10-14 14:25 | 38K | |
| py39-httpbin-0.7.0_1..> | 2023-10-08 11:36 | 92K | |
| py39-httpcore-0.18.0..> | 2023-10-06 10:40 | 76K | |
| py39-httpie-3.0.2.pkg | 2023-10-08 07:19 | 119K | |
| py39-httplib2-0.22.0..> | 2023-10-06 17:09 | 106K | |
| py39-httpretty-1.1.4..> | 2023-10-08 13:55 | 39K | |
| py39-httpstat-1.3.0.pkg | 2023-10-08 21:32 | 9.9K | |
| py39-httptools-0.6.0..> | 2023-10-10 14:09 | 91K | |
| py39-httpx-0.24.1_1.pkg | 2023-10-06 11:06 | 116K | |
| py39-httpx-auth-0.17..> | 2023-10-08 18:56 | 40K | |
| py39-httpx-cache-0.1..> | 2023-10-10 13:59 | 22K | |
| py39-httpx-gssapi-0...> | 2023-10-08 20:56 | 13K | |
| py39-httpx-oauth-0.1..> | 2023-10-14 18:09 | 22K | |
| py39-httpx-socks-0.5..> | 2023-10-07 21:36 | 7.9K | |
| py39-httpx013-0.13.3..> | 2023-10-07 01:01 | 83K | |
| py39-huepy-1.2.1_1.pkg | 2023-10-08 06:27 | 3.4K | |
| py39-humanfriendly-1..> | 2023-10-06 18:30 | 107K | |
| py39-humanize-4.2.1.pkg | 2023-10-07 04:34 | 48K | |
| py39-hunspell-0.5.5_..> | 2023-10-07 10:39 | 8.4K | |
| py39-hunter-3.6.1.pkg | 2023-10-09 03:47 | 224K | |
| py39-hupper-1.10.3.pkg | 2023-10-07 15:41 | 38K | |
| py39-hvac-1.2.1.pkg | 2023-10-08 21:34 | 148K | |
| py39-hy-0.19.0.pkg | 2023-10-14 17:56 | 106K | |
| py39-hypatia_engine-..> | 2023-10-14 04:45 | 50K | |
| py39-hypercorn-0.14...> | 2023-10-10 19:38 | 83K | |
| py39-hyperframe-6.0...> | 2023-10-06 08:54 | 17K | |
| py39-hyperlink-21.0...> | 2023-10-06 09:11 | 98K | |
| py39-hypothesis-6.84..> | 2023-10-07 22:46 | 523K | |
| py39-hypothesmith-0...> | 2023-10-08 17:09 | 17K | |
| py39-i3-quickterm-1...> | 2023-10-09 03:22 | 9.6K | |
| py39-i3ipc-2.2.1_1.pkg | 2023-10-08 11:40 | 35K | |
| py39-icalendar-4.0.3..> | 2023-10-06 19:27 | 94K | |
| py39-icoextract-0.1...> | 2023-10-10 19:44 | 10K | |
| py39-identify-1.4.30..> | 2023-10-06 13:10 | 69K | |
| py39-idna-3.4_1.pkg | 2023-10-05 17:16 | 65K | |
| py39-idna_ssl-1.1.0.pkg | 2023-10-09 12:41 | 2.8K | |
| py39-ifaddr-0.2.0.pkg | 2023-10-07 09:08 | 13K | |
| py39-igraph-0.10.6.pkg | 2023-10-11 00:07 | 1.1M | |
| py39-ijson-3.2.0.pos..> | 2023-10-06 19:09 | 34K | |
| py39-imageio-2.31.3.pkg | 2023-10-06 18:41 | 415K | |
| py39-imageio-ffmpeg-..> | 2023-10-06 17:27 | 21K | |
| py39-imagesize-1.4.1..> | 2023-10-05 17:17 | 7.9K | |
| py39-imapclient-2.3...> | 2023-10-07 08:06 | 58K | |
| py39-imaplib2-3.6.pkg | 2023-10-08 04:20 | 41K | |
| py39-imdbpy-2021.4.1..> | 2023-10-07 21:19 | 279K | |
| py39-img2pdf-0.4.4_3..> | 2023-10-07 12:41 | 60K | |
| py39-imgkit-1.2.2.pkg | 2023-10-09 02:30 | 13K | |
| py39-iminuit-2.24.0.pkg | 2023-10-09 16:00 | 348K | |
| py39-immutabledict-2..> | 2023-10-07 23:48 | 5.2K | |
| py39-immutables-0.20..> | 2023-10-09 09:51 | 36K | |
| py39-impacket-0.9.17..> | 2023-10-06 23:03 | 1.4M | |
| py39-importlab-0.8_1..> | 2023-10-08 09:57 | 26K | |
| py39-importlib-metad..> | 2023-10-05 17:19 | 32K | |
| py39-importlib-resou..> | 2023-10-06 10:43 | 46K | |
| py39-incremental-21...> | 2023-10-06 09:03 | 21K | |
| py39-indiweb-0.1.7_1..> | 2023-10-08 10:04 | 326K | |
| py39-inequality-1.0...> | 2023-10-07 20:45 | 16K | |
| py39-infinity-1.5.pkg | 2023-10-08 09:21 | 3.4K | |
| py39-inflect-7.0.0.pkg | 2023-10-06 17:51 | 51K | |
| py39-inflection-0.5...> | 2023-10-06 16:45 | 7.6K | |
| py39-influxdb-5.0.0_..> | 2023-10-14 03:33 | 94K | |
| py39-ini2toml-0.12_1..> | 2023-10-10 06:24 | 73K | |
| py39-iniconfig-1.1.1..> | 2023-10-06 14:39 | 5.9K | |
| py39-inifile-0.4.pkg | 2023-10-08 11:54 | 12K | |
| py39-iniparse-0.5.pkg | 2023-10-07 11:48 | 23K | |
| py39-inlinestyler-0...> | 2023-10-14 15:31 | 23K | |
| py39-instabot-0.117...> | 2023-10-08 19:27 | 109K | |
| py39-installer-0.7.0..> | 2023-10-05 17:13 | 214K | |
| py39-intbitset-3.0.2..> | 2023-10-10 19:30 | 51K | |
| py39-intelhex-2.3.0.pkg | 2023-10-09 01:59 | 62K | |
| py39-interegular-0.3..> | 2023-10-06 16:34 | 40K | |
| py39-interface-meta-..> | 2023-10-07 07:18 | 18K | |
| py39-internetarchive..> | 2023-10-14 11:57 | 96K | |
| py39-intervals-0.9.2..> | 2023-10-09 03:57 | 13K | |
| py39-intervaltree-3...> | 2023-10-06 17:00 | 29K | |
| py39-intspan-1.6.1.pkg | 2023-10-10 19:41 | 11K | |
| py39-investiny-0.7.2..> | 2023-10-09 13:07 | 8.8K | |
| py39-investpy-1.0.8_..> | 2023-10-09 23:51 | 3.1M | |
| py39-invoke-2.2.0.pkg | 2023-10-07 03:29 | 212K | |
| py39-iocage-1.2_10.pkg | 2023-10-10 07:33 | 234K | |
| py39-iocage-devel-1...> | 2023-10-14 08:51 | 250K | |
| py39-ioflo-2.0.0.pkg | 2023-10-09 03:46 | 454K | |
| py39-iohexperimenter..> | 2023-10-07 16:11 | 441K | |
| py39-iopath-0.1.9.pkg | 2023-10-07 05:31 | 38K | |
| py39-iowait-0.2.pkg | 2023-10-10 07:23 | 9.4K | |
| py39-ioztat-2.0.1.pkg | 2023-10-09 11:05 | 12K | |
| py39-ipaddr-2.2.0.pkg | 2023-10-07 20:37 | 23K | |
| py39-ipcalc-1.99.0.pkg | 2023-10-08 16:31 | 14K | |
| py39-ipdb-0.13.13_1.pkg | 2023-10-10 22:31 | 14K | |
| py39-iplib-1.2.1.pkg | 2023-10-09 21:30 | 16K | |
| py39-iptools-0.7.0.pkg | 2023-10-09 08:49 | 18K | |
| py39-ipy-1.01.pkg | 2023-10-07 13:36 | 25K | |
| py39-ipydatawidgets-..> | 2023-10-08 16:05 | 117K | |
| py39-ipyfastscape-0...> | 2023-10-10 13:12 | 29K | |
| py39-ipygany-0.5.0_1..> | 2023-10-07 18:00 | 964K | |
| py39-ipykernel-6.25...> | 2023-10-06 12:21 | 215K | |
| py39-ipympl-0.9.3_1.pkg | 2023-10-08 14:38 | 193K | |
| py39-ipyopt-0.12.7_1..> | 2023-10-09 00:21 | 124K | |
| py39-ipyparallel-8.4..> | 2023-10-06 21:15 | 398K | |
| py39-ipython-8.15.0.pkg | 2023-10-06 11:24 | 1.9M | |
| py39-ipython_genutil..> | 2023-10-06 12:27 | 34K | |
| py39-ipywidgets-8.1...> | 2023-10-07 01:09 | 177K | |
| py39-irc-20.3.0.pkg | 2023-10-10 09:28 | 94K | |
| py39-iris-check-modu..> | 2023-10-08 22:41 | 4.1K | |
| py39-iris-client-2.0..> | 2023-10-10 07:41 | 93K | |
| py39-iris-evtx-modul..> | 2023-10-14 04:00 | 9.8K | |
| py39-iris-intelowl-m..> | 2023-10-08 20:28 | 12K | |
| py39-iris-misp-modul..> | 2023-10-10 03:08 | 14K | |
| py39-iris-module-int..> | 2023-10-08 10:44 | 12K | |
| py39-iris-vt-module-..> | 2023-10-09 23:09 | 14K | |
| py39-iris-webhooks-m..> | 2023-10-10 01:03 | 8.1K | |
| py39-irrd4-4.2.7.pkg | 2023-10-10 11:24 | 244K | |
| py39-isbnlib-3.10.14..> | 2023-10-07 22:50 | 63K | |
| py39-isbntools-4.3.2..> | 2023-10-09 15:56 | 42K | |
| py39-iso-639-0.4.5_1..> | 2023-10-09 19:06 | 115K | |
| py39-iso3166-2.1.1.pkg | 2023-10-08 04:15 | 13K | |
| py39-iso8601-2.0.0.pkg | 2023-10-06 11:39 | 11K | |
| py39-isodate-0.6.1.pkg | 2023-10-06 12:16 | 40K | |
| py39-isoduration-20...> | 2023-10-06 09:37 | 14K | |
| py39-isort-5.12.0_1.pkg | 2023-10-06 12:47 | 129K | |
| py39-isosurfaces-0.1..> | 2023-10-10 04:51 | 15K | |
| py39-itanium_demangl..> | 2023-10-08 05:10 | 13K | |
| py39-itemadapter-0.8..> | 2023-10-07 05:41 | 14K | |
| py39-itemloaders-1.1..> | 2023-10-08 11:36 | 14K | |
| py39-iteration-utili..> | 2023-10-14 18:59 | 81K | |
| py39-itertree-1.0.5.pkg | 2023-10-10 09:17 | 164K | |
| py39-itsdangerous-2...> | 2023-10-06 18:13 | 20K | |
| py39-itypes-1.1.0.pkg | 2023-10-07 07:25 | 4.6K | |
| py39-j2cli-0.3.12.b.pkg | 2023-10-14 18:21 | 13K | |
| py39-jacobi-0.8.1.pkg | 2023-10-10 11:13 | 14K | |
| py39-jaconv-0.3.4.pkg | 2023-10-09 11:13 | 17K | |
| py39-jadm-1.0.pkg | 2023-10-14 10:58 | 32K | |
| py39-jailconf-0.2.2.pkg | 2023-10-10 02:53 | 9.2K | |
| py39-janus-1.0.0.pkg | 2023-10-07 21:49 | 11K | |
| py39-jaraco.classes-..> | 2023-10-06 13:30 | 7.4K | |
| py39-jaraco.collecti..> | 2023-10-07 04:05 | 16K | |
| py39-jaraco.context-..> | 2023-10-06 18:29 | 7.2K | |
| py39-jaraco.env-1.0...> | 2023-10-08 01:32 | 3.3K | |
| py39-jaraco.functool..> | 2023-10-06 18:05 | 12K | |
| py39-jaraco.itertool..> | 2023-10-10 05:34 | 18K | |
| py39-jaraco.logging-..> | 2023-10-07 20:38 | 6.5K | |
| py39-jaraco.stream-3..> | 2023-10-07 21:04 | 8.6K | |
| py39-jaraco.text-3.1..> | 2023-10-06 22:57 | 14K | |
| py39-jaraco.timing-2..> | 2023-10-10 20:55 | 3.1K | |
| py39-jaraco.util-15...> | 2023-10-10 03:29 | 8.0K | |
| py39-jarowinkler-1.2..> | 2023-10-14 11:17 | 54K | |
| py39-javaproperties-..> | 2023-10-07 16:39 | 22K | |
| py39-jax-0.4.15.pkg | 2023-10-07 23:01 | 2.3M | |
| py39-jc-1.23.4.pkg | 2023-10-08 20:51 | 580K | |
| py39-jdcal-1.4.1.pkg | 2023-10-14 15:18 | 6.5K | |
| py39-jedi-0.18.1.pkg | 2023-10-06 10:39 | 886K | |
| py39-jeepney-0.8.0_2..> | 2023-10-06 11:24 | 71K | |
| py39-jellyfish-0.11...> | 2023-10-07 03:14 | 242K | |
| py39-jenkins-job-bui..> | 2023-10-14 18:46 | 407K | |
| py39-jep-4.1.1.pkg | 2023-10-11 03:22 | 223K | |
| py39-jinja2-ansible-..> | 2023-10-07 11:06 | 22K | |
| py39-jinja2-cli-0.8...> | 2023-10-10 17:37 | 10K | |
| py39-jinja2-time-0.2..> | 2023-10-10 08:36 | 4.9K | |
| py39-jira-2.0.0_4.pkg | 2023-10-08 00:00 | 85K | |
| py39-jitterentropy-0..> | 2023-10-14 10:25 | 3.9K | |
| py39-jmespath-1.0.1.pkg | 2023-10-06 13:03 | 31K | |
| py39-joblib-1.3.2.pkg | 2023-10-06 15:35 | 368K | |
| py39-jonpy-0.12.pkg | 2023-10-09 23:07 | 71K | |
| py39-josepy-1.13.0.pkg | 2023-10-06 20:33 | 41K | |
| py39-jplephem-2.19.pkg | 2023-10-06 15:31 | 52K | |
| py39-jq-1.5.0.pkg | 2023-10-10 09:54 | 41K | |
| py39-jsbeautifier-1...> | 2023-10-07 02:27 | 119K | |
| py39-jschema-to-pyth..> | 2023-10-08 05:33 | 12K | |
| py39-jsmin-3.0.1.pkg | 2023-10-07 22:36 | 16K | |
| py39-json2html-1.3.0..> | 2023-10-07 09:10 | 7.9K | |
| py39-json5-0.9.11.pkg | 2023-10-06 12:43 | 30K | |
| py39-json_tricks-3.1..> | 2023-10-10 01:25 | 37K | |
| py39-jsondiff-2.0.0.pkg | 2023-10-07 18:08 | 11K | |
| py39-jsonfield-3.1.0..> | 2023-10-10 20:51 | 9.4K | |
| py39-jsonform-0.0.2.pkg | 2023-10-07 06:45 | 4.9K | |
| py39-jsonlines-4.0.0..> | 2023-10-06 22:49 | 12K | |
| py39-jsonnet-0.18.0.pkg | 2023-10-09 06:05 | 8.0K | |
| py39-jsonpatch-1.21_..> | 2023-10-06 18:06 | 14K | |
| py39-jsonpath-ng-1.5..> | 2023-10-07 20:10 | 34K | |
| py39-jsonpath-rw-1.4..> | 2023-10-07 12:19 | 22K | |
| py39-jsonpickle-3.0...> | 2023-10-07 02:50 | 58K | |
| py39-jsonpointer-2.0..> | 2023-10-06 09:57 | 8.1K | |
| py39-jsonref-0.2.pkg | 2023-10-06 16:54 | 15K | |
| py39-jsonrpclib-peli..> | 2023-10-07 21:28 | 48K | |
| py39-jsonschema-4.19..> | 2023-10-06 08:57 | 127K | |
| py39-jsonschema-spec..> | 2023-10-06 13:48 | 19K | |
| py39-jsonschema-spec..> | 2023-10-06 08:13 | 9.3K | |
| py39-jsonschema3-3.2..> | 2023-10-07 03:26 | 86K | |
| py39-jsonschema417-4..> | 2023-10-07 09:43 | 124K | |
| py39-jsonsir-0.0.2.pkg | 2023-10-07 08:07 | 5.6K | |
| py39-jsonslicer-0.1...> | 2023-10-07 17:27 | 14K | |
| py39-jsx-lexer-2.0.1..> | 2023-10-08 04:43 | 3.8K | |
| py39-jtextfsm-0.3.1.pkg | 2023-10-09 01:17 | 18K | |
| py39-junit-xml-1.9.pkg | 2023-10-08 03:25 | 9.3K | |
| py39-junos-eznc-2.6...> | 2023-10-07 10:52 | 212K | |
| py39-jupyter-client-..> | 2023-10-06 09:17 | 143K | |
| py39-jupyter-core-5...> | 2023-10-06 08:55 | 81K | |
| py39-jupyter-events-..> | 2023-10-06 10:31 | 24K | |
| py39-jupyter-jsmol-2..> | 2023-10-10 07:28 | 3.3M | |
| py39-jupyter-kernel-..> | 2023-10-09 11:00 | 15K | |
| py39-jupyter-lsp-2.2..> | 2023-10-08 10:09 | 71K | |
| py39-jupyter-packagi..> | 2023-10-06 09:28 | 23K | |
| py39-jupyter-server-..> | 2023-10-06 11:36 | 380K | |
| py39-jupyter-server-..> | 2023-10-06 13:07 | 22K | |
| py39-jupyter-server-..> | 2023-10-08 07:51 | 1.8M | |
| py39-jupyter-server-..> | 2023-10-06 10:26 | 15K | |
| py39-jupyter-server-..> | 2023-10-06 15:06 | 15K | |
| py39-jupyter-sphinx-..> | 2023-10-14 12:12 | 26K | |
| py39-jupyter-telemet..> | 2023-10-09 07:31 | 8.0K | |
| py39-jupyter-ydoc-0...> | 2023-10-06 12:27 | 13K | |
| py39-jupyter_console..> | 2023-10-14 02:49 | 36K | |
| py39-jupyterlab-3.6...> | 2023-10-06 15:51 | 6.1M | |
| py39-jupyterlab-lsp-..> | 2023-10-10 21:19 | 637K | |
| py39-jupyterlab-pygm..> | 2023-10-06 09:55 | 11K | |
| py39-jupyterlab-serv..> | 2023-10-06 13:40 | 72K | |
| py39-jupyterlab-widg..> | 2023-10-06 21:27 | 166K | |
| py39-jupyterlab_laun..> | 2023-10-10 20:24 | 33K | |
| py39-jwcrypto-1.5.0.pkg | 2023-10-08 08:10 | 125K | |
| py39-kafka-python-1...> | 2023-10-11 00:44 | 320K | |
| py39-kahip-3.15.pkg | 2023-10-09 00:23 | 38K | |
| py39-kaitaistruct-0...> | 2023-10-08 01:02 | 7.5K | |
| py39-kaptan-0.5.12.pkg | 2023-10-14 17:58 | 12K | |
| py39-kartograph-0.6...> | 2023-10-09 19:10 | 113K | |
| py39-kazoo-2.5.0.pkg | 2023-10-08 07:52 | 185K | |
| py39-keep-2.10.1.pkg | 2023-10-07 18:02 | 21K | |
| py39-keepkey-7.2.1_1..> | 2023-10-07 15:57 | 132K | |
| py39-keras-applicati..> | 2023-10-07 20:16 | 44K | |
| py39-keras-preproces..> | 2023-10-07 08:45 | 51K | |
| py39-kerberos-1.3.1.pkg | 2023-10-07 02:05 | 14K | |
| py39-keyring-23.9.3_..> | 2023-10-06 14:26 | 47K | |
| py39-keyrings.alt-4...> | 2023-10-06 20:35 | 30K | |
| py39-keystone-engine..> | 2023-10-07 02:21 | 1.0M | |
| py39-keystoneauth1-5..> | 2023-10-06 16:28 | 350K | |
| py39-keystonemiddlew..> | 2023-10-07 13:19 | 150K | |
| py39-khal-0.10.5.pkg | 2023-10-09 10:48 | 167K | |
| py39-khard-0.18.0.pkg | 2023-10-10 20:35 | 91K | |
| py39-kim-query-3.0.0..> | 2023-10-08 17:30 | 12K | |
| py39-kimpy-2.1.0_1.pkg | 2023-10-07 17:56 | 292K | |
| py39-kinematics-0.1...> | 2023-10-11 00:18 | 15K | |
| py39-kiss-headers-2...> | 2023-10-08 20:36 | 60K | |
| py39-kitchen-1.2.6.pkg | 2023-10-06 23:52 | 55K | |
| py39-kiwisolver-1.4...> | 2023-10-06 11:16 | 57K | |
| py39-klepto-0.2.4.pkg | 2023-10-07 03:15 | 104K | |
| py39-kliff-0.4.1_1.pkg | 2023-10-14 09:18 | 276K | |
| py39-kms-g20221207.pkg | 2023-10-10 06:21 | 748K | |
| py39-knack-0.10.1.pkg | 2023-10-07 01:17 | 86K | |
| py39-kombu-4.6.11.pkg | 2023-10-06 18:45 | 261K | |
| py39-korean-lunar-ca..> | 2023-10-07 01:28 | 13K | |
| py39-kosmorrolib-1.0..> | 2023-10-08 11:47 | 33K | |
| py39-kpLib-1.1.1_1.pkg | 2023-10-14 18:14 | 114K | |
| py39-krb5-0.5.1.pkg | 2023-10-10 07:36 | 285K | |
| py39-kyotocabinet-1...> | 2023-10-14 10:01 | 242K | |
| py39-l18n-2021.3.pkg | 2023-10-07 07:54 | 44K | |
| py39-langdetect-1.0...> | 2023-10-07 14:22 | 720K | |
| py39-langid-1.1.6.20..> | 2023-10-07 07:52 | 1.8M | |
| py39-lark-1.1.7.pkg | 2023-10-06 19:31 | 172K | |
| py39-laserhammer-2.4..> | 2023-10-10 01:19 | 7.3K | |
| py39-latexcodec-2.0...> | 2023-10-06 19:19 | 23K | |
| py39-launchpadlib-1...> | 2023-10-07 11:57 | 153K | |
| py39-lazr.config-2.2..> | 2023-10-08 05:43 | 34K | |
| py39-lazr.delegates-..> | 2023-10-07 04:51 | 13K | |
| py39-lazr.restfulcli..> | 2023-10-07 01:13 | 65K | |
| py39-lazr.uri-1.0.6.pkg | 2023-10-06 16:04 | 18K | |
| py39-lazy-1.4.pkg | 2023-10-07 06:05 | 8.6K | |
| py39-lazy-object-pro..> | 2023-10-06 11:38 | 21K | |
| py39-lazy_loader-0.2..> | 2023-10-07 19:52 | 12K | |
| py39-lcapy-g20171202..> | 2023-10-14 10:08 | 575K | |
| py39-ldap-3.4.0.pkg | 2023-10-07 21:00 | 141K | |
| py39-ldap0-1.4.7.pkg | 2023-10-07 17:20 | 142K | |
| py39-ldap3-2.8.1.pkg | 2023-10-08 07:53 | 411K | |
| py39-ldappool-2.4.1_..> | 2023-10-14 12:34 | 16K | |
| py39-ldns-1.8.3.pkg | 2023-10-09 10:00 | 325K | |
| py39-leather-0.3.4.pkg | 2023-10-06 17:09 | 38K | |
| py39-lerc-4.0.1.pkg | 2023-10-14 12:26 | 174K | |
| py39-lesscpy-0.14.0.pkg | 2023-10-11 01:11 | 70K | |
| py39-leveldb-0.201.pkg | 2023-10-14 13:34 | 15K | |
| py39-leviathan-0.1.1..> | 2023-10-09 20:56 | 4.8K | |
| py39-levmar-0.2.3_1.pkg | 2023-10-09 07:27 | 136K | |
| py39-liac-arff-2.5.0..> | 2023-10-09 08:35 | 19K | |
| py39-libarchive-c-5...> | 2023-10-08 09:28 | 23K | |
| py39-libcloud-3.8.0.pkg | 2023-10-07 08:57 | 1.5M | |
| py39-libcst-1.0.1_2.pkg | 2023-10-07 18:58 | 1.5M | |
| py39-libcst03-0.3.23..> | 2023-10-14 05:49 | 652K | |
| py39-libgetar-1.1.3_..> | 2023-10-10 00:57 | 599K | |
| py39-libimobiledevic..> | 2023-10-10 08:47 | 298K | |
| py39-libioc-0.8.2_2.pkg | 2023-10-09 01:35 | 241K | |
| py39-libnacl-2.1.0.pkg | 2023-10-08 03:11 | 30K | |
| py39-libnuml-1.1.6.pkg | 2023-10-09 21:27 | 211K | |
| py39-libopenshot-0.3..> | 2023-10-07 12:50 | 4.1M | |
| py39-libpeas-1.34.0.pkg | 2023-10-06 13:52 | 9.6K | |
| py39-libplist-2.2.0.pkg | 2023-10-08 00:32 | 105K | |
| py39-libpoly-0.1.13.pkg | 2023-10-14 11:59 | 23K | |
| py39-libproxy-python..> | 2023-10-14 04:13 | 4.1K | |
| py39-libpysal-4.7.0_..> | 2023-10-06 16:13 | 1.7M | |
| py39-librosa-0.10.1.pkg | 2023-10-14 18:08 | 276K | |
| py39-librtmp-0.3.0_1..> | 2023-10-08 21:31 | 41K | |
| py39-libsass-0.22.0.pkg | 2023-10-07 15:24 | 58K | |
| py39-libscrc-1.8.1.pkg | 2023-10-10 01:32 | 42K | |
| py39-libsedml-2.0.32..> | 2023-10-08 22:01 | 539K | |
| py39-libtaxii-1.1.11..> | 2023-10-07 11:07 | 140K | |
| py39-libtmux-0.23.2.pkg | 2023-10-07 23:43 | 68K | |
| py39-libtorrent-rast..> | 2023-10-07 00:12 | 372K | |
| py39-libusb1-3.0.0.pkg | 2023-10-07 01:03 | 64K | |
| py39-libversion-1.2...> | 2023-10-14 17:03 | 6.3K | |
| py39-libvirt-9.7.0.pkg | 2023-10-08 05:34 | 173K | |
| py39-libxml2-2.10.4.pkg | 2023-10-05 17:15 | 172K | |
| py39-libzfs-1.1.2023..> | 2023-10-07 11:08 | 320K | |
| py39-license-express..> | 2023-10-07 21:04 | 99K | |
| py39-lief-0.11.5.pkg | 2023-10-14 18:15 | 2.0M | |
| py39-lifelines-0.19...> | 2023-10-14 18:13 | 242K | |
| py39-lightgbm-3.3.5_..> | 2023-10-09 19:39 | 1.0M | |
| py39-lightning-utili..> | 2023-10-07 20:59 | 30K | |
| py39-limnoria-2021.1..> | 2023-10-08 21:19 | 1.1M | |
| py39-line-profiler-4..> | 2023-10-09 01:31 | 108K | |
| py39-line-protocol-p..> | 2023-10-10 15:53 | 9.8K | |
| py39-linear-tsv-1.1...> | 2023-10-06 20:56 | 5.5K | |
| py39-linearmodels-5...> | 2023-10-14 04:48 | 1.7M | |
| py39-linecache2-1.0...> | 2023-10-06 23:38 | 22K | |
| py39-lineedit-0.1.6.pkg | 2023-10-07 17:14 | 439K | |
| py39-linkify-it-py-2..> | 2023-10-08 18:04 | 27K | |
| py39-liquidctl-1.13...> | 2023-10-08 21:49 | 160K | |
| py39-litecli-1.9.0.pkg | 2023-10-10 08:01 | 70K | |
| py39-littleutils-0.2..> | 2023-10-09 13:32 | 12K | |
| py39-livemark-0.110...> | 2023-10-09 13:31 | 84K | |
| py39-livereload-2.6...> | 2023-10-07 01:17 | 29K | |
| py39-llfuse-1.5.0.pkg | 2023-10-07 04:22 | 156K | |
| py39-llvmcpy-0.1.5_1..> | 2023-10-14 04:30 | 20K | |
| py39-llvmlite-0.39.1..> | 2023-10-06 14:49 | 283K | |
| py39-lmdb-0.97.pkg | 2023-10-09 18:55 | 57K | |
| py39-lmfit-1.2.2.pkg | 2023-10-06 20:58 | 136K | |
| py39-lml-0.1.0.pkg | 2023-10-06 18:45 | 13K | |
| py39-localstack-clie..> | 2023-10-09 22:15 | 9.1K | |
| py39-localzone-0.9.8..> | 2023-10-14 13:50 | 12K | |
| py39-locket-1.0.0.pkg | 2023-10-06 23:26 | 5.5K | |
| py39-lockfile-0.12.2..> | 2023-10-07 06:45 | 15K | |
| py39-locust-0.11.0.pkg | 2023-10-10 16:31 | 249K | |
| py39-log_symbols-0.0..> | 2023-10-06 18:57 | 2.7K | |
| py39-logan-0.7.2_3.pkg | 2023-10-07 08:32 | 10K | |
| py39-logbook-1.1.0.pkg | 2023-10-07 13:30 | 95K | |
| py39-logfury-1.0.1.pkg | 2023-10-06 22:00 | 8.2K | |
| py39-logical-unifica..> | 2023-10-06 18:05 | 17K | |
| py39-logilab-common-..> | 2023-10-09 13:26 | 219K | |
| py39-loguru-0.7.2.pkg | 2023-10-07 17:41 | 84K | |
| py39-logutils-0.3.5.pkg | 2023-10-07 02:42 | 27K | |
| py39-logzero-1.7.0.pkg | 2023-10-08 10:16 | 20K | |
| py39-loompy-3.0.7_1.pkg | 2023-10-07 19:13 | 79K | |
| py39-looseversion-1...> | 2023-10-07 05:15 | 8.0K | |
| py39-lrcalc-2.1.pkg | 2023-10-10 18:46 | 29K | |
| py39-lru-dict-1.2.0.pkg | 2023-10-09 01:44 | 8.6K | |
| py39-lsprotocol-2022..> | 2023-10-11 11:42 | 103K | |
| py39-luminol-0.4_1.pkg | 2023-10-07 09:29 | 33K | |
| py39-lunardate-0.2.0..> | 2023-10-08 00:37 | 7.8K | |
| py39-lupa-2.0.pkg | 2023-10-08 11:58 | 109K | |
| py39-lxml-4.9.3.pkg | 2023-10-05 17:19 | 1.9M | |
| py39-lxml-stubs-0.4...> | 2023-10-10 12:37 | 7.0K | |
| py39-lz4-4.3.2.pkg | 2023-10-07 12:41 | 25K | |
| py39-lzma-0.5.0.pkg | 2023-10-08 03:03 | 72K | |
| py39-lzstring-1.0.4.pkg | 2023-10-07 09:35 | 6.0K | |
| py39-m2crypto-0.39.0..> | 2023-10-07 20:00 | 235K | |
| py39-m2r-0.3.1_1.pkg | 2023-10-06 09:05 | 17K | |
| py39-mac-vendor-look..> | 2023-10-09 18:14 | 6.2K | |
| py39-macholib-1.11.pkg | 2023-10-09 08:05 | 58K | |
| py39-macs2-2.2.9.1.pkg | 2023-10-08 01:22 | 971K | |
| py39-maec-4.1.0.17.pkg | 2023-10-10 10:42 | 209K | |
| py39-magic-5.44.pkg | 2023-10-07 12:12 | 6.9K | |
| py39-magic-wormhole-..> | 2023-10-11 09:54 | 288K | |
| py39-mahotas-1.4.13_..> | 2023-10-10 02:56 | 1.6M | |
| py39-mail-parser-3.1..> | 2023-10-08 07:00 | 28K | |
| py39-mailcap_fix-1.0..> | 2023-10-14 11:03 | 8.5K | |
| py39-mailman-3.3.8_2..> | 2023-10-08 23:00 | 1.4M | |
| py39-mailmanclient-3..> | 2023-10-07 00:16 | 95K | |
| py39-mailnag-2.2.0_1..> | 2023-10-08 17:52 | 208K | |
| py39-mailsuite-1.9.1..> | 2023-10-08 14:31 | 22K | |
| py39-makefun-1.15.1.pkg | 2023-10-07 09:20 | 29K | |
| py39-mako-1.2.4.pkg | 2023-10-05 17:27 | 118K | |
| py39-managesieve3-1...> | 2023-10-09 23:08 | 11K | |
| py39-manuel-1.9.0.pkg | 2023-10-09 04:04 | 38K | |
| py39-mapbox-earcut-1..> | 2023-10-14 02:58 | 63K | |
| py39-mapclassify-2.6..> | 2023-10-06 21:38 | 57K | |
| py39-markdown-3.3.7_..> | 2023-10-05 17:22 | 122K | |
| py39-markdown-callou..> | 2023-10-06 21:33 | 6.9K | |
| py39-markdown-includ..> | 2023-10-14 06:16 | 18K | |
| py39-markdown-it-py-..> | 2023-10-06 08:55 | 102K | |
| py39-markdown2-2.4.1..> | 2023-10-06 21:43 | 61K | |
| py39-marko-2.0.0.pkg | 2023-10-07 00:48 | 66K | |
| py39-markuppy-1.14.pkg | 2023-10-07 06:35 | 11K | |
| py39-markups-4.0.0_1..> | 2023-10-07 10:57 | 19K | |
| py39-markupsafe-2.1...> | 2023-10-05 17:17 | 14K | |
| py39-marrow.mailer-4..> | 2023-10-08 18:03 | 48K | |
| py39-marrow.util-1.2..> | 2023-10-07 14:55 | 36K | |
| py39-marshmallow-3.2..> | 2023-10-06 18:14 | 73K | |
| py39-marshmallow-enu..> | 2023-10-06 22:48 | 4.7K | |
| py39-marshmallow-sql..> | 2023-10-08 19:25 | 21K | |
| py39-mat2-0.13.4.pkg | 2023-10-08 04:39 | 55K | |
| py39-mathics_pygment..> | 2023-10-07 23:47 | 91K | |
| py39-matplotlib-3.7...> | 2023-10-06 13:18 | 5.8M | |
| py39-matplotlib-inli..> | 2023-10-06 10:33 | 11K | |
| py39-matplotlib-scal..> | 2023-10-07 05:40 | 23K | |
| py39-matplotlib2-2.2..> | 2023-10-09 06:09 | 6.8M | |
| py39-matrix-angular-..> | 2023-10-09 02:09 | 636K | |
| py39-matrix-common-1..> | 2023-10-07 22:55 | 8.4K | |
| py39-matrix-synapse-..> | 2023-10-08 18:43 | 3.1M | |
| py39-matrix-synapse-..> | 2023-10-11 10:00 | 18K | |
| py39-maturin-1.2.3.pkg | 2023-10-06 08:05 | 2.1M | |
| py39-maxminddb-2.4.0..> | 2023-10-07 04:31 | 22K | |
| py39-mccabe-0.7.0.pkg | 2023-10-06 12:15 | 10K | |
| py39-mcomix-2.2.1.pkg | 2023-10-08 16:37 | 500K | |
| py39-mdit-py-plugins..> | 2023-10-06 09:28 | 59K | |
| py39-mdp-3.5_4.pkg | 2023-10-10 15:05 | 474K | |
| py39-mdurl-0.1.2_2.pkg | 2023-10-06 08:33 | 12K | |
| py39-mdv-1.7.4_2.pkg | 2023-10-08 01:51 | 59K | |
| py39-mechanicalsoup-..> | 2023-10-10 19:29 | 25K | |
| py39-mechanize-0.4.8..> | 2023-10-06 21:34 | 161K | |
| py39-mediafile-0.12...> | 2023-10-08 00:04 | 37K | |
| py39-mediapy-1.1.9.pkg | 2023-10-14 04:47 | 39K | |
| py39-medikit-0.8.0_1..> | 2023-10-14 12:53 | 74K | |
| py39-memory-profiler..> | 2023-10-14 12:39 | 49K | |
| py39-memory_allocato..> | 2023-10-09 16:10 | 32K | |
| py39-menulibre-2.3.2..> | 2023-10-07 10:18 | 258K | |
| py39-mercantile-1.2...> | 2023-10-08 20:23 | 21K | |
| py39-merge3-0.0.13.pkg | 2023-10-10 18:43 | 9.9K | |
| py39-mergedeep-1.3.4..> | 2023-10-06 15:21 | 4.7K | |
| py39-merkletools-1.0..> | 2023-10-08 11:52 | 4.3K | |
| py39-meshio-5.3.4_1.pkg | 2023-10-07 17:07 | 225K | |
| py39-meson-python-0...> | 2023-10-07 16:09 | 44K | |
| py39-metadata-cleane..> | 2023-10-14 12:59 | 1.2M | |
| py39-metar-1.11.0.pkg | 2023-10-09 14:40 | 166K | |
| py39-metpy-1.5.1.pkg | 2023-10-14 07:28 | 405K | |
| py39-mffpy-0.8.0_1.pkg | 2023-10-09 02:46 | 130K | |
| py39-mgwr-2.1.2_1.pkg | 2023-10-07 19:24 | 61K | |
| py39-microversion-pa..> | 2023-10-14 08:37 | 16K | |
| py39-mido-1.2.10.pkg | 2023-10-07 22:03 | 70K | |
| py39-mike-1.1.2.pkg | 2023-10-11 15:17 | 34K | |
| py39-milc-1.4.2.pkg | 2023-10-07 18:43 | 29K | |
| py39-milter-1.0.5.pkg | 2023-10-08 09:01 | 81K | |
| py39-mime-0.1.0.pkg | 2023-10-09 23:55 | 39K | |
| py39-ming-0.4.8.pkg | 2023-10-10 01:36 | 83K | |
| py39-miniKanren-1.0...> | 2023-10-08 07:43 | 34K | |
| py39-minidb-2.0.7.pkg | 2023-10-07 14:47 | 19K | |
| py39-minidump-0.0.21..> | 2023-10-07 08:30 | 97K | |
| py39-minimongo-0.2.7..> | 2023-10-09 18:18 | 24K | |
| py39-minio-4.0.21.pkg | 2023-10-08 15:31 | 74K | |
| py39-miniupnpc-2.2.5..> | 2023-10-14 11:31 | 25K | |
| py39-minorminer-0.2...> | 2023-10-06 20:35 | 589K | |
| py39-mip-1.14.0.pkg | 2023-10-10 08:18 | 11M | |
| py39-misaka-2.1.1.pkg | 2023-10-07 11:08 | 48K | |
| py39-mistletoe-1.2.1..> | 2023-10-07 20:08 | 80K | |
| py39-mistune-3.0.1.pkg | 2023-10-06 09:36 | 70K | |
| py39-mistune0-0.8.4_..> | 2023-10-06 08:22 | 23K | |
| py39-mistune2-2.0.5.pkg | 2023-10-14 04:15 | 39K | |
| py39-mitogen-0.3.3.pkg | 2023-10-09 13:22 | 325K | |
| py39-mixbox-1.0.5.pkg | 2023-10-07 01:39 | 71K | |
| py39-mixsimulator-0...> | 2023-10-07 18:46 | 75K | |
| py39-mkdocs-1.5.2.pkg | 2023-10-06 16:19 | 2.8M | |
| py39-mkdocs-autorefs..> | 2023-10-06 19:42 | 12K | |
| py39-mkdocs-material..> | 2023-10-08 11:47 | 3.9M | |
| py39-mkdocs-material..> | 2023-10-07 06:07 | 10K | |
| py39-mkdocs-mermaid2..> | 2023-10-08 04:25 | 10K | |
| py39-mkdocs-nature-0..> | 2023-10-14 05:22 | 44K | |
| py39-mkdocs-redirect..> | 2023-10-07 18:58 | 6.2K | |
| py39-mkdocs-simple-h..> | 2023-10-07 14:51 | 4.4K | |
| py39-mkdocstrings-0...> | 2023-10-07 23:12 | 35K | |
| py39-mkdocstrings-cr..> | 2023-10-07 02:54 | 31K | |
| py39-mkdocstrings-py..> | 2023-10-14 13:39 | 32K | |
| py39-mkdocstrings-py..> | 2023-10-07 21:11 | 19K | |
| py39-ml-dtypes-0.2.0..> | 2023-10-07 03:14 | 616K | |
| py39-mmcif-0.81.pkg | 2023-10-09 02:44 | 485K | |
| py39-mmtf-python-1.1..> | 2023-10-07 08:59 | 30K | |
| py39-mnemonic-0.20.pkg | 2023-10-07 03:04 | 51K | |
| py39-mnemosyne-2.10...> | 2023-10-14 10:34 | 941K | |
| py39-mnnpy-0.1.9.5_1..> | 2023-10-08 18:20 | 69K | |
| py39-moarchiving-0.6..> | 2023-10-14 12:32 | 19K | |
| py39-mock-5.1.0.pkg | 2023-10-06 17:59 | 50K | |
| py39-moderngl-5.8.2.pkg | 2023-10-08 06:37 | 109K | |
| py39-moderngl-window..> | 2023-10-12 11:16 | 380K | |
| py39-molecule-4.0.4.pkg | 2023-10-09 12:14 | 198K | |
| py39-molequeue-0.9.0..> | 2023-10-09 15:29 | 3.7K | |
| py39-molmod-1.4.8_1.pkg | 2023-10-14 10:40 | 1.3M | |
| py39-moltemplate-2.2..> | 2023-10-08 23:12 | 645K | |
| py39-momepy-0.5.4_2.pkg | 2023-10-08 11:13 | 213K | |
| py39-mondrian-0.8.1.pkg | 2023-10-07 20:07 | 15K | |
| py39-mongoengine-0.2..> | 2023-10-08 08:18 | 158K | |
| py39-mongokit-0.9.1...> | 2023-10-10 17:45 | 72K | |
| py39-monkeytype-23.3..> | 2023-10-14 16:36 | 59K | |
| py39-monotonic-1.5.pkg | 2023-10-06 21:05 | 4.9K | |
| py39-monty-2023.5.8.pkg | 2023-10-06 22:36 | 62K | |
| py39-more-itertools-..> | 2023-10-06 12:00 | 72K | |
| py39-morse3-2.9.pkg | 2023-10-10 00:03 | 3.1K | |
| py39-moto-4.2.2.pkg | 2023-10-10 08:15 | 2.9M | |
| py39-motor-1.0.pkg | 2023-10-10 22:47 | 47K | |
| py39-mouseinfo-0.1.3..> | 2023-10-07 03:31 | 16K | |
| py39-moviepy-1.0.3_5..> | 2023-10-07 10:34 | 132K | |
| py39-mox-0.5.3_2.pkg | 2023-10-10 06:06 | 27K | |
| py39-mox3-0.28.0.pkg | 2023-10-10 16:53 | 62K | |
| py39-mp-api-0.34.0.pkg | 2023-10-08 17:27 | 93K | |
| py39-mpcontribs-clie..> | 2023-10-07 18:04 | 44K | |
| py39-mpd-0.3.0_1.pkg | 2023-10-09 20:44 | 8.8K | |
| py39-mpi4py-3.1.4_2.pkg | 2023-10-06 12:13 | 1.6M | |
| py39-mpi4py-mpich-3...> | 2023-10-09 12:19 | 1.6M | |
| py39-mpl-interaction..> | 2023-10-14 07:04 | 60K | |
| py39-mpl-scatter-den..> | 2023-10-10 09:09 | 636K | |
| py39-mplfinance-0.12..> | 2023-10-10 20:29 | 100K | |
| py39-mpmath-1.3.0_1.pkg | 2023-10-06 13:24 | 724K | |
| py39-mqttwarn-0.34.1..> | 2023-10-11 01:18 | 125K | |
| py39-mrcfile-1.4.3_1..> | 2023-10-06 21:20 | 45K | |
| py39-mrchem-1.1.3.pkg | 2023-10-10 14:06 | 105K | |
| py39-mrkd-0.2.0_3.pkg | 2023-10-07 10:34 | 9.3K | |
| py39-mrtparse-2.0.0.pkg | 2023-10-10 02:20 | 30K | |
| py39-msal-1.22.0.pkg | 2023-10-06 21:24 | 105K | |
| py39-msal-extensions..> | 2023-10-07 09:46 | 23K | |
| py39-msgpack-1.0.5_1..> | 2023-10-06 12:53 | 63K | |
| py39-msoffcrypto-too..> | 2023-10-06 18:25 | 42K | |
| py39-msrest-0.7.1.pkg | 2023-10-06 19:55 | 90K | |
| py39-msrestazure-0.6..> | 2023-10-07 04:28 | 43K | |
| py39-msrplib-0.20.0_..> | 2023-10-14 04:00 | 40K | |
| py39-muacrypt-0.9.1.pkg | 2023-10-14 17:47 | 95K | |
| py39-mulpyplexer-0.0..> | 2023-10-07 23:56 | 5.1K | |
| py39-multi_key_dict-..> | 2023-10-07 00:48 | 14K | |
| py39-multidict-6.0.4..> | 2023-10-06 09:31 | 28K | |
| py39-multipledispatc..> | 2023-10-06 14:18 | 13K | |
| py39-multiprocess-0...> | 2023-10-07 07:06 | 216K | |
| py39-multiqc-1.15.pkg | 2023-10-07 22:51 | 1.2M | |
| py39-multiset-3.0.1_..> | 2023-10-06 15:56 | 14K | |
| py39-multitasking-0...> | 2023-10-06 15:40 | 5.4K | |
| py39-munch-2.5.0.pkg | 2023-10-06 18:24 | 13K | |
| py39-munkres-1.1.4.pkg | 2023-10-08 03:56 | 11K | |
| py39-munkres10-1.0.1..> | 2023-10-09 03:46 | 13K | |
| py39-murmurhash-1.0...> | 2023-10-07 12:02 | 15K | |
| py39-music21-7.3.3_2..> | 2023-10-08 18:16 | 18M | |
| py39-musicbrainzngs-..> | 2023-10-07 17:43 | 43K | |
| py39-mutagen-1.47.0.pkg | 2023-10-06 16:30 | 274K | |
| py39-mutmut-2.4.3.pkg | 2023-10-09 17:44 | 46K | |
| py39-mwoauth-0.3.8.pkg | 2023-10-11 12:40 | 15K | |
| py39-mwparserfromhel..> | 2023-10-08 05:37 | 102K | |
| py39-mxnet-1.9.1_2.pkg | 2023-10-07 21:20 | 1.0M | |
| py39-mycli-1.27.0.pkg | 2023-10-14 15:02 | 102K | |
| py39-mygpoclient-1.9..> | 2023-10-08 06:35 | 45K | |
| py39-mypy-1.5.1.pkg | 2023-10-06 15:27 | 2.5M | |
| py39-mypy-boto3-s3-1..> | 2023-10-06 18:35 | 79K | |
| py39-mypy-protobuf-3..> | 2023-10-07 03:27 | 27K | |
| py39-mypy_extensions..> | 2023-10-06 11:01 | 5.6K | |
| py39-mysql-connector..> | 2023-10-14 06:25 | 607K | |
| py39-mysqlclient-2.2..> | 2023-10-07 05:18 | 88K | |
| py39-myst-parser-2.0..> | 2023-10-06 09:34 | 120K | |
| py39-mystic-0.4.1.pkg | 2023-10-08 04:17 | 512K | |
| py39-naarad-1.0.15_5..> | 2023-10-07 16:34 | 211K | |
| py39-nagios-check_mo..> | 2023-10-14 17:25 | 11K | |
| py39-nagiosplugin-1...> | 2023-10-07 20:02 | 60K | |
| py39-naiveBayesClass..> | 2023-10-09 18:07 | 7.9K | |
| py39-nanotime-0.5.2.pkg | 2023-10-07 16:58 | 4.2K | |
| py39-napalm-4.1.0.pkg | 2023-10-10 12:32 | 321K | |
| py39-napalm-logs-0.9..> | 2023-10-10 03:01 | 85K | |
| py39-nassl-5.0.1.pkg | 2023-10-08 07:39 | 30K | |
| py39-natsort-8.4.0.pkg | 2023-10-07 07:57 | 44K | |
| py39-natural-0.2.0.pkg | 2023-10-14 14:26 | 36K | |
| py39-nbclassic-1.0.0..> | 2023-10-06 14:24 | 4.4M | |
| py39-nbclient-0.8.0.pkg | 2023-10-06 09:58 | 86K | |
| py39-nbconvert-7.8.0..> | 2023-10-06 10:29 | 227K | |
| py39-nbdime-3.2.1.pkg | 2023-10-09 08:25 | 3.8M | |
| py39-nbformat-5.9.2.pkg | 2023-10-06 09:18 | 72K | |
| py39-nbsphinx-0.9.3.pkg | 2023-10-06 23:31 | 43K | |
| py39-nbval-0.10.0.pkg | 2023-10-10 02:51 | 31K | |
| py39-nbxmpp-2.0.4.pkg | 2023-10-07 18:06 | 238K | |
| py39-ncclient-0.6.13..> | 2023-10-07 07:26 | 89K | |
| py39-ndg-httpsclient..> | 2023-10-07 14:53 | 36K | |
| py39-ndindex-1.7.pkg | 2023-10-07 16:13 | 108K | |
| py39-nest-asyncio-1...> | 2023-10-06 11:19 | 7.0K | |
| py39-netCDF4-1.6.4.pkg | 2023-10-06 20:32 | 461K | |
| py39-netaddr-0.8.0.pkg | 2023-10-06 10:57 | 1.2M | |
| py39-netbox-secrets-..> | 2023-10-11 03:32 | 74K | |
| py39-netcdf-flattene..> | 2023-10-10 00:49 | 17K | |
| py39-netif-1.0.20220..> | 2023-10-08 19:18 | 389K | |
| py39-netifaces-0.11...> | 2023-10-06 11:50 | 9.9K | |
| py39-netmiko-4.2.0.pkg | 2023-10-07 21:53 | 230K | |
| py39-netsnmpagent-0...> | 2023-10-12 04:55 | 24K | |
| py39-netutils-1.6.0.pkg | 2023-10-07 11:49 | 567K | |
| py39-networkx-3.1_1,..> | 2023-10-06 14:00 | 2.2M | |
| py39-nevergrad-0.4.3..> | 2023-10-10 21:15 | 521K | |
| py39-nevow-0.14.0_1.pkg | 2023-10-09 17:02 | 634K | |
| py39-nglview-3.0.7.pkg | 2023-10-06 17:31 | 5.4M | |
| py39-nibabel-5.1.0.pkg | 2023-10-07 17:17 | 3.0M | |
| py39-nicotine-plus-3..> | 2023-10-08 17:41 | 1.2M | |
| py39-nilearn-0.10.1.pkg | 2023-10-08 13:14 | 8.6M | |
| py39-nlopt-2.7.1_1.pkg | 2023-10-10 19:20 | 297K | |
| py39-nltk-3.8.1,2.pkg | 2023-10-07 01:53 | 1.8M | |
| py39-nnpy-1.4.2.pkg | 2023-10-08 16:59 | 15K | |
| py39-node-semver-0.9..> | 2023-10-07 02:03 | 19K | |
| py39-nodeenv-1.8.0.pkg | 2023-10-06 12:46 | 30K | |
| py39-noiseprotocol-0..> | 2023-10-07 07:50 | 27K | |
| py39-normality-2.4.0..> | 2023-10-08 11:50 | 14K | |
| py39-nose-1.3.7_1.pkg | 2023-10-06 19:59 | 201K | |
| py39-nose-cov-1.6.pkg | 2023-10-14 09:12 | 5.2K | |
| py39-nose-timer-1.0...> | 2023-10-10 18:01 | 11K | |
| py39-nose2-0.10.0.pkg | 2023-10-07 20:57 | 193K | |
| py39-nose3-1.3.8.pkg | 2023-10-09 09:53 | 215K | |
| py39-noseofyeti-2.4...> | 2023-10-10 15:49 | 37K | |
| py39-nosexcover-1.0...> | 2023-10-09 19:27 | 4.8K | |
| py39-notebook-6.4.12..> | 2023-10-06 13:52 | 4.5M | |
| py39-notebook-shim-0..> | 2023-10-06 12:21 | 17K | |
| py39-notify2-0.3.1.pkg | 2023-10-08 09:20 | 8.7K | |
| py39-notmuch-0.38.pkg | 2023-10-08 10:34 | 198K | |
| py39-notmuch0-0.38.pkg | 2023-10-10 23:41 | 56K | |
| py39-notus-scanner-2..> | 2023-10-07 23:27 | 250K | |
| py39-npTDMS-1.7.1.pkg | 2023-10-08 04:48 | 164K | |
| py39-ns1-python-0.18..> | 2023-10-10 16:02 | 63K | |
| py39-ntc-templates-3..> | 2023-10-06 23:18 | 180K | |
| py39-ntlm-auth-1.5.0..> | 2023-10-06 14:16 | 35K | |
| py39-ntplib-0.3.4.pkg | 2023-10-14 08:12 | 8.6K | |
| py39-num2words-0.5.9..> | 2023-10-07 16:36 | 89K | |
| py39-numba-0.56.2_5.pkg | 2023-10-06 17:20 | 3.6M | |
| py39-numba-stats-1.3..> | 2023-10-09 11:00 | 23K | |
| py39-numcodecs-0.11...> | 2023-10-07 01:25 | 643K | |
| py39-numdifftools-0...> | 2023-10-09 05:56 | 131K | |
| py39-numexpr-2.8.5.pkg | 2023-10-06 12:10 | 108K | |
| py39-numpoly-1.2.3_1..> | 2023-10-06 18:15 | 113K | |
| py39-numpy-1.25.0,1.pkg | 2023-10-06 10:06 | 16M | |
| py39-numpy-groupies-..> | 2023-10-07 03:39 | 38K | |
| py39-numpy-stl-2.11...> | 2023-10-07 15:37 | 44K | |
| py39-numpydoc-1.5.0.pkg | 2023-10-07 04:18 | 78K | |
| py39-nwdiag-3.0.0.pkg | 2023-10-09 13:48 | 2.1M | |
| py39-nxapi-plumbing-..> | 2023-10-10 23:11 | 9.9K | |
| py39-oauth-1.0.1_2.pkg | 2023-10-14 12:44 | 13K | |
| py39-oauth2-1.9.0.p1..> | 2023-10-10 00:27 | 19K | |
| py39-oauth2client-4...> | 2023-10-06 20:08 | 108K | |
| py39-oauthlib-3.2.2.pkg | 2023-10-06 14:28 | 144K | |
| py39-objgraph-3.6.0.pkg | 2023-10-14 13:41 | 23K | |
| py39-objsize-0.7.0.pkg | 2023-10-08 11:56 | 13K | |
| py39-obspy-1.4.0_1.pkg | 2023-10-10 05:25 | 12M | |
| py39-oci-2.110.1.pkg | 2023-10-07 11:20 | 11M | |
| py39-oci-cli-3.31.0.pkg | 2023-10-09 20:05 | 5.6M | |
| py39-ocrmypdf-14.4.0..> | 2023-10-09 03:46 | 175K | |
| py39-oddt-0.7_2.pkg | 2023-10-14 11:15 | 1.8M | |
| py39-odfpy-1.4.1_2.pkg | 2023-10-07 09:36 | 158K | |
| py39-odoo-16.0.20230..> | 2023-10-09 06:55 | 90M | |
| py39-odoo14-14.0_2.pkg | 2023-10-09 22:45 | 76M | |
| py39-odoo15-15.0_2.pkg | 2023-10-09 02:20 | 82M | |
| py39-offlineimap3-8...> | 2023-10-09 15:19 | 463K | |
| py39-offtrac-0.1.0.pkg | 2023-10-08 00:45 | 4.2K | |
| py39-ofxparse-0.20_2..> | 2023-10-07 12:50 | 50K | |
| py39-olefile-0.46.pkg | 2023-10-06 10:10 | 43K | |
| py39-oletools-0.60.1..> | 2023-10-06 19:51 | 948K | |
| py39-omnijson-0.1.2_..> | 2023-10-10 15:10 | 27K | |
| py39-omniorb-4.3.1.pkg | 2023-10-07 23:58 | 892K | |
| py39-onetimepass-1.0..> | 2023-10-08 07:11 | 6.7K | |
| py39-onigurumacffi-0..> | 2023-10-07 17:43 | 13K | |
| py39-onionbalance-0...> | 2023-10-08 18:48 | 84K | |
| py39-onionprobe-1.1...> | 2023-10-14 04:14 | 60K | |
| py39-onionshare-2.6_..> | 2023-10-14 06:25 | 1.1M | |
| py39-onionshare-cli-..> | 2023-10-08 06:16 | 167K | |
| py39-onlykey-1.2.2_1..> | 2023-10-09 06:36 | 20K | |
| py39-onnx-1.14.1.pkg | 2023-10-08 03:08 | 7.6M | |
| py39-onnx-tf-1.10.0_..> | 2023-10-10 10:46 | 184K | |
| py39-ont-fast5-api-4..> | 2023-10-07 14:51 | 66K | |
| py39-opcodes-0.3.14.pkg | 2023-10-07 13:31 | 151K | |
| py39-openTSNE-1.0.0.pkg | 2023-10-06 19:19 | 278K | |
| py39-openai-0.27.9.pkg | 2023-10-12 12:03 | 110K | |
| py39-openapi-codec-1..> | 2023-10-09 21:00 | 12K | |
| py39-openapi-core-0...> | 2023-10-09 14:14 | 99K | |
| py39-openapi-schema-..> | 2023-10-06 15:26 | 11K | |
| py39-openapi-spec-va..> | 2023-10-06 16:53 | 33K | |
| py39-openbabel-3.1.1..> | 2023-10-09 19:17 | 553K | |
| py39-openbrokerapi-4..> | 2023-10-14 06:35 | 25K | |
| py39-opencensus-0.11..> | 2023-10-10 01:57 | 109K | |
| py39-opencensus-cont..> | 2023-10-08 00:25 | 2.1K | |
| py39-opencolorio-2.2..> | 2023-10-14 17:50 | 521K | |
| py39-opendht-2.6.0.4..> | 2023-10-08 14:14 | 107K | |
| py39-opengrok-tools-..> | 2023-10-14 18:13 | 61K | |
| py39-openimageio-2.4..> | 2023-10-07 19:13 | 433K | |
| py39-openpaperwork-c..> | 2023-10-07 10:06 | 105K | |
| py39-openpaperwork-g..> | 2023-10-14 18:17 | 76K | |
| py39-openpiv-0.23.8_..> | 2023-10-11 06:45 | 20M | |
| py39-openpyxl-3.1.1.pkg | 2023-10-06 18:47 | 334K | |
| py39-opensearch-py-2..> | 2023-10-07 22:05 | 123K | |
| py39-openshadinglang..> | 2023-10-14 03:18 | 66K | |
| py39-openslide-pytho..> | 2023-10-14 13:13 | 24K | |
| py39-openssl-23.2.0,..> | 2023-10-05 20:59 | 80K | |
| py39-openstackdocsth..> | 2023-10-07 14:06 | 885K | |
| py39-openstacksdk-1...> | 2023-10-06 20:22 | 1.5M | |
| py39-openstep-plist-..> | 2023-10-06 17:04 | 143K | |
| py39-opentelemetry-a..> | 2023-10-07 11:08 | 60K | |
| py39-opentelemetry-s..> | 2023-10-09 14:24 | 115K | |
| py39-opentelemetry-s..> | 2023-10-07 15:28 | 27K | |
| py39-opentimelineio-..> | 2023-10-10 22:10 | 709K | |
| py39-opentracing-2.4..> | 2023-10-07 14:48 | 40K | |
| py39-opentype-saniti..> | 2023-10-08 10:10 | 6.5K | |
| py39-opentypespec-1...> | 2023-10-08 06:43 | 28K | |
| py39-openvdb-10.0.1_..> | 2023-10-14 07:09 | 2.0M | |
| py39-opn-cli-1.7.0.pkg | 2023-10-14 14:07 | 229K | |
| py39-opster-5.0.pkg | 2023-10-10 15:58 | 23K | |
| py39-opt-einsum-3.3...> | 2023-10-07 05:25 | 94K | |
| py39-optik-1.5.3.pkg | 2023-10-11 17:51 | 73K | |
| py39-optimize-images..> | 2023-10-09 09:30 | 36K | |
| py39-optking-0.2.1_1..> | 2023-10-07 16:50 | 224K | |
| py39-optuna-2.10.1_1..> | 2023-10-11 04:53 | 350K | |
| py39-opuslib-3.0.1_1..> | 2023-10-07 12:51 | 15K | |
| py39-or-tools-9.5_4.pkg | 2023-10-08 01:41 | 4.2M | |
| py39-orange-canvas-c..> | 2023-10-06 18:06 | 666K | |
| py39-orange-widget-b..> | 2023-10-06 20:05 | 370K | |
| py39-orange3-associa..> | 2023-10-14 03:38 | 70K | |
| py39-orange3-bioinfo..> | 2023-10-07 16:04 | 428K | |
| py39-orange3-datafus..> | 2023-10-09 23:48 | 2.6M | |
| py39-orange3-educati..> | 2023-10-14 05:26 | 290K | |
| py39-orange3-network..> | 2023-10-10 05:18 | 498K | |
| py39-orange3-single-..> | 2023-10-10 13:01 | 3.5M | |
| py39-orange3-text-1...> | 2023-10-14 04:26 | 11M | |
| py39-orange3-timeser..> | 2023-10-09 18:34 | 370K | |
| py39-orca-1.8_1.pkg | 2023-10-08 00:29 | 30K | |
| py39-ordered-set-4.1..> | 2023-10-06 19:05 | 11K | |
| py39-ordereddict-1.1..> | 2023-10-08 09:57 | 4.2K | |
| py39-orderedmultidic..> | 2023-10-06 19:33 | 16K | |
| py39-orjson-3.8.0_10..> | 2023-10-08 04:43 | 236K | |
| py39-ormar-0.12.1.pkg | 2023-10-07 11:26 | 194K | |
| py39-os-api-ref-1.5...> | 2023-10-10 09:48 | 77K | |
| py39-os-brick-6.4.0.pkg | 2023-10-08 01:54 | 369K | |
| py39-os-client-confi..> | 2023-10-07 04:43 | 36K | |
| py39-os-service-type..> | 2023-10-06 14:18 | 19K | |
| py39-os-vif-3.2.0.pkg | 2023-10-10 12:51 | 125K | |
| py39-os-win-5.9.0.pkg | 2023-10-07 03:39 | 367K | |
| py39-osc-lib-2.8.1.pkg | 2023-10-07 09:13 | 108K | |
| py39-oscrypto-1.3.0.pkg | 2023-10-06 21:52 | 222K | |
| py39-oslo.cache-3.5...> | 2023-10-07 02:25 | 66K | |
| py39-oslo.concurrenc..> | 2023-10-06 17:36 | 55K | |
| py39-oslo.config-9.2..> | 2023-10-06 14:41 | 189K | |
| py39-oslo.context-5...> | 2023-10-06 13:53 | 22K | |
| py39-oslo.db-14.0.0.pkg | 2023-10-08 09:17 | 205K | |
| py39-oslo.i18n-6.1.0..> | 2023-10-06 12:00 | 38K | |
| py39-oslo.limit-2.2...> | 2023-10-14 17:27 | 22K | |
| py39-oslo.log-5.3.0.pkg | 2023-10-06 18:27 | 91K | |
| py39-oslo.messaging-..> | 2023-10-07 09:01 | 327K | |
| py39-oslo.metrics-0...> | 2023-10-06 19:07 | 11K | |
| py39-oslo.middleware..> | 2023-10-06 20:59 | 66K | |
| py39-oslo.policy-4.2..> | 2023-10-07 01:06 | 116K | |
| py39-oslo.privsep-3...> | 2023-10-07 08:15 | 44K | |
| py39-oslo.reports-3...> | 2023-10-08 08:36 | 48K | |
| py39-oslo.rootwrap-7..> | 2023-10-08 09:30 | 47K | |
| py39-oslo.serializat..> | 2023-10-06 14:08 | 28K | |
| py39-oslo.service-3...> | 2023-10-06 22:59 | 95K | |
| py39-oslo.upgradeche..> | 2023-10-08 08:36 | 12K | |
| py39-oslo.utils-6.2...> | 2023-10-06 12:26 | 123K | |
| py39-oslo.versionedo..> | 2023-10-07 20:25 | 124K | |
| py39-oslo.vmware-4.2..> | 2023-10-07 12:45 | 234K | |
| py39-oslotest-4.4.1.pkg | 2023-10-14 05:28 | 28K | |
| py39-osmnet-0.1.7.pkg | 2023-10-08 10:52 | 20K | |
| py39-ospd-openvas-22..> | 2023-10-08 00:25 | 147K | |
| py39-osprofiler-4.1...> | 2023-10-07 20:52 | 104K | |
| py39-osqp-0.6.2.post..> | 2023-10-08 00:23 | 179K | |
| py39-outcome-1.2.0.pkg | 2023-10-06 08:44 | 6.2K | |
| py39-overrides-7.4.0..> | 2023-10-06 10:20 | 20K | |
| py39-ovs-2.9.0.pkg | 2023-10-07 07:36 | 128K | |
| py39-ovsdbapp-1.5.0.pkg | 2023-10-08 05:04 | 141K | |
| py39-p4python-2023.1..> | 2023-10-09 17:50 | 1.0M | |
| py39-packageurl-pyth..> | 2023-10-07 00:09 | 30K | |
| py39-packaging-23.1.pkg | 2023-10-05 17:14 | 66K | |
| py39-packaging21-21...> | 2023-10-08 22:40 | 51K | |
| py39-packet-python-1..> | 2023-10-14 16:37 | 12K | |
| py39-pafy-0.5.5_2.pkg | 2023-10-09 04:17 | 51K | |
| py39-pager-3.3_1.pkg | 2023-10-14 15:17 | 12K | |
| py39-paginate-0.5.6.pkg | 2023-10-07 07:20 | 14K | |
| py39-paho-mqtt-1.6.1..> | 2023-10-07 06:35 | 78K | |
| py39-paida-3.2.1.2.1..> | 2023-10-11 14:54 | 277K | |
| py39-palettable-3.3...> | 2023-10-06 21:55 | 121K | |
| py39-pamqp-1.6.1.pkg | 2023-10-07 20:05 | 42K | |
| py39-pandana-0.6.1_2..> | 2023-10-07 13:37 | 115K | |
| py39-pandas-2.0.3,1.pkg | 2023-10-06 13:19 | 10M | |
| py39-pandas-charm-0...> | 2023-10-09 11:20 | 7.2K | |
| py39-pandas-dataread..> | 2023-10-07 05:37 | 132K | |
| py39-pandas-market-c..> | 2023-10-09 14:02 | 109K | |
| py39-pandas-ta-0.3.1..> | 2023-10-12 06:53 | 186K | |
| py39-pandocfilters-1..> | 2023-10-06 09:51 | 9.1K | |
| py39-paperless-2.7.0..> | 2023-10-09 03:31 | 4.5M | |
| py39-papermill-2.4.0..> | 2023-10-14 12:54 | 56K | |
| py39-paragrep-3.3.0.pkg | 2023-10-14 13:25 | 9.9K | |
| py39-parallax-1.0.6.pkg | 2023-10-08 10:09 | 27K | |
| py39-param-1.13.0.pkg | 2023-10-06 11:41 | 137K | |
| py39-parameterized-0..> | 2023-10-08 07:52 | 31K | |
| py39-paramiko-2.11.0..> | 2023-10-06 20:43 | 243K | |
| py39-paramz-0.9.5_2.pkg | 2023-10-07 09:12 | 120K | |
| py39-parfive-2.0.2.pkg | 2023-10-07 10:14 | 42K | |
| py39-parse-1.19.1.pkg | 2023-10-07 05:21 | 23K | |
| py39-parse-type-0.6...> | 2023-10-07 10:56 | 34K | |
| py39-parsedatetime-2..> | 2023-10-06 17:12 | 52K | |
| py39-parsel-1.5.1.pkg | 2023-10-07 04:07 | 16K | |
| py39-parsimonious-0...> | 2023-10-07 22:27 | 61K | |
| py39-parsley-1.3.pkg | 2023-10-08 04:21 | 139K | |
| py39-parso-0.8.3.pkg | 2023-10-06 09:57 | 131K | |
| py39-partd-1.4.0.pkg | 2023-10-06 16:43 | 28K | |
| py39-parver-0.4.pkg | 2023-10-09 14:10 | 24K | |
| py39-pass-audit-1.1.pkg | 2023-10-14 10:48 | 16K | |
| py39-pass-git-helper..> | 2023-10-08 12:07 | 10K | |
| py39-passlib-1.7.4.pkg | 2023-10-06 21:36 | 625K | |
| py39-pastedeploy-3.0..> | 2023-10-06 17:19 | 25K | |
| py39-pastel-0.2.1_1.pkg | 2023-10-07 21:46 | 8.2K | |
| py39-patch-1.16.pkg | 2023-10-09 03:00 | 20K | |
| py39-patch-ng-1.17.4..> | 2023-10-07 02:16 | 26K | |
| py39-path-16.7.1.pkg | 2023-10-08 08:12 | 34K | |
| py39-path-and-addres..> | 2023-10-08 11:01 | 3.5K | |
| py39-path.py-11.5.2.pkg | 2023-10-07 08:14 | 29K | |
| py39-pathable-0.4.3.pkg | 2023-10-06 13:15 | 8.7K | |
| py39-pathlib2-2.3.7.pkg | 2023-10-06 14:06 | 30K | |
| py39-pathos-0.3.1.pkg | 2023-10-07 18:59 | 84K | |
| py39-pathspec-0.11.2..> | 2023-10-05 17:33 | 34K | |
| py39-pathtools-0.1.2..> | 2023-10-07 07:53 | 150K | |
| py39-patiencediff-0...> | 2023-10-07 18:50 | 25K | |
| py39-patool-1.12.pkg | 2023-10-14 03:31 | 60K | |
| py39-patsy-0.5.3_1.pkg | 2023-10-06 17:22 | 285K | |
| py39-paver-1.3.4.pkg | 2023-10-06 23:02 | 292K | |
| py39-pbkdf2-1.3.pkg | 2023-10-06 22:02 | 7.7K | |
| py39-pbr-5.11.1.pkg | 2023-10-06 10:05 | 124K | |
| py39-pcapy-0.11.1.pkg | 2023-10-06 16:00 | 16K | |
| py39-pcapy-ng-1.0.9.pkg | 2023-10-07 10:48 | 22K | |
| py39-pcodedmp-1.2.6.pkg | 2023-10-14 13:34 | 29K | |
| py39-pdagent-1.7.2.pkg | 2023-10-07 17:22 | 162K | |
| py39-pdagent-integra..> | 2023-10-10 05:10 | 6.0K | |
| py39-pdal-3.0.2_2.pkg | 2023-10-14 16:33 | 117K | |
| py39-pdf-redact-tool..> | 2023-10-08 12:07 | 3.5K | |
| py39-pdf2docx-0.5.6.pkg | 2023-10-09 00:39 | 173K | |
| py39-pdfminer.six-20..> | 2023-10-08 06:05 | 4.0M | |
| py39-pdfminer3k-1.3...> | 2023-10-07 11:07 | 165K | |
| py39-pdfrw-0.4.pkg | 2023-10-10 17:53 | 76K | |
| py39-pdftotext-2.2.2..> | 2023-10-08 04:26 | 6.8K | |
| py39-pdm-2.9.1.pkg | 2023-10-08 14:38 | 343K | |
| py39-pdm-autoexport-..> | 2023-10-10 09:38 | 5.0K | |
| py39-pdm-backend-2.1..> | 2023-10-06 17:01 | 135K | |
| py39-pdm-pep517-1.1...> | 2023-10-06 13:22 | 265K | |
| py39-pdoc-14.0.0.pkg | 2023-10-10 02:43 | 159K | |
| py39-pebble-5.0.3.pkg | 2023-10-07 14:31 | 33K | |
| py39-pecan-1.3.3_1.pkg | 2023-10-07 15:26 | 203K | |
| py39-peewee-3.15.0.pkg | 2023-10-06 23:26 | 337K | |
| py39-peewee_migrate-..> | 2023-10-09 23:47 | 33K | |
| py39-pefile-2021.5.2..> | 2023-10-07 09:47 | 92K | |
| py39-pelican-4.8.0.pkg | 2023-10-09 21:32 | 378K | |
| py39-pem-21.2.0.pkg | 2023-10-08 18:46 | 10K | |
| py39-penaltymodel-1...> | 2023-10-07 05:29 | 34K | |
| py39-pendulum-2.1.1_..> | 2023-10-08 04:23 | 141K | |
| py39-pep8-1.7.1_3.pkg | 2023-10-08 01:01 | 48K | |
| py39-pep8-naming-0.1..> | 2023-10-08 03:57 | 13K | |
| py39-pep440-0.1.2_2.pkg | 2023-10-08 13:34 | 4.8K | |
| py39-pep517-0.13.0_2..> | 2023-10-07 13:35 | 26K | |
| py39-pep562-1.1.pkg | 2023-10-10 16:42 | 7.4K | |
| py39-pep621-0.4.0_3.pkg | 2023-10-08 21:45 | 12K | |
| py39-period-0.6.1.pkg | 2023-10-09 10:07 | 13K | |
| py39-periscope-0.2.4..> | 2023-10-10 16:28 | 48K | |
| py39-permutation-0.4..> | 2023-10-10 19:20 | 13K | |
| py39-persistent-4.9...> | 2023-10-06 23:41 | 156K | |
| py39-petl-1.7.14.pkg | 2023-10-07 07:02 | 322K | |
| py39-petname-2.6.pkg | 2023-10-09 17:36 | 11K | |
| py39-petsc4py-3.19.5..> | 2023-10-07 17:42 | 1.0M | |
| py39-pew-1.2.0.pkg | 2023-10-10 14:46 | 26K | |
| py39-pex-1.2.7.pkg | 2023-10-09 08:23 | 141K | |
| py39-pexpect-4.8.0_1..> | 2023-10-06 10:04 | 72K | |
| py39-pg8000-1.28.1.pkg | 2023-10-11 06:15 | 43K | |
| py39-pgcli-3.5.0.pkg | 2023-10-11 08:38 | 115K | |
| py39-pgdbconn-0.8.0_..> | 2023-10-07 13:43 | 5.1K | |
| py39-pglast-1.2.pkg | 2023-10-10 11:54 | 280K | |
| py39-pglite-1.0.13.pkg | 2023-10-14 13:25 | 9.2K | |
| py39-pgmigrate-1.0.7..> | 2023-10-09 12:50 | 17K | |
| py39-pgpdump-1.5.pkg | 2023-10-08 15:59 | 33K | |
| py39-pgpy-0.5.3.pkg | 2023-10-14 13:03 | 131K | |
| py39-pgsanity-0.2.9_..> | 2023-10-10 12:38 | 8.4K | |
| py39-pgspecial-2.1.0..> | 2023-10-08 11:02 | 53K | |
| py39-pgspecial1-1.13..> | 2023-10-10 19:55 | 53K | |
| py39-phabricator-0.8..> | 2023-10-07 21:41 | 25K | |
| py39-phidl-1.0.1_2.pkg | 2023-10-10 05:50 | 100K | |
| py39-phonebox-plugin..> | 2023-10-09 22:34 | 25K | |
| py39-phonenumbers-8...> | 2023-10-08 07:13 | 2.6M | |
| py39-phono3py-1.22.3..> | 2023-10-14 17:15 | 278K | |
| py39-phonopy-2.20.0.pkg | 2023-10-08 09:59 | 494K | |
| py39-photocollage-1...> | 2023-10-11 10:57 | 171K | |
| py39-photofilmstrip-..> | 2023-10-10 16:01 | 378K | |
| py39-phply-1.2.5_2.pkg | 2023-10-07 10:42 | 128K | |
| py39-phpserialize-1...> | 2023-10-11 21:21 | 9.9K | |
| py39-phx-class-regis..> | 2023-10-09 23:44 | 14K | |
| py39-pickledb-0.9.2.pkg | 2023-10-14 14:45 | 6.3K | |
| py39-pickleshare-0.7..> | 2023-10-06 10:17 | 8.2K | |
| py39-pid-3.0.4.pkg | 2023-10-08 10:04 | 11K | |
| py39-piddle-1.0.15,1..> | 2023-10-09 15:09 | 435K | |
| py39-piexif-1.1.3.pkg | 2023-10-08 01:52 | 30K | |
| py39-pika-1.3.2.pkg | 2023-10-07 15:52 | 199K | |
| py39-pika-pool-0.1.3..> | 2023-10-10 04:07 | 7.6K | |
| py39-pikepdf-8.0.0.pkg | 2023-10-07 03:17 | 466K | |
| py39-pillow-10.0.0_1..> | 2023-10-06 11:48 | 599K | |
| py39-pinocchio-0.4.3..> | 2023-10-08 13:00 | 19K | |
| py39-pint-0.22.pkg | 2023-10-06 15:44 | 440K | |
| py39-pint-pandas-0.5..> | 2023-10-09 19:25 | 44K | |
| py39-pip-23.2.1.pkg | 2023-10-06 10:30 | 2.6M | |
| py39-pip-api-0.0.30.pkg | 2023-10-08 07:20 | 159K | |
| py39-pip-audit-2.6.1..> | 2023-10-09 13:39 | 65K | |
| py39-pip-licenses-4...> | 2023-10-14 07:56 | 26K | |
| py39-pip-requirement..> | 2023-10-07 14:46 | 49K | |
| py39-pip-run-12.2.1.pkg | 2023-10-11 06:14 | 22K | |
| py39-pip-shims-0.7.3..> | 2023-10-11 06:20 | 51K | |
| py39-pip-tools-6.14...> | 2023-10-11 14:33 | 78K | |
| py39-pip-tools4-4.5...> | 2023-10-07 19:53 | 56K | |
| py39-pipdeptree-0.13..> | 2023-10-10 16:00 | 17K | |
| py39-pipenv-2023.9.1..> | 2023-10-08 02:29 | 3.2M | |
| py39-pipreqs-0.4.13.pkg | 2023-10-14 14:01 | 31K | |
| py39-pipx-1.2.0.pkg | 2023-10-08 23:23 | 81K | |
| py39-pivy-0.6.8_1.pkg | 2023-10-07 12:22 | 2.1M | |
| py39-pkgconfig-1.5.5..> | 2023-10-06 12:10 | 8.4K | |
| py39-pkginfo-1.9.6.pkg | 2023-10-06 14:32 | 181K | |
| py39-plac-1.3.5.pkg | 2023-10-07 07:32 | 38K | |
| py39-placekey-0.0.12..> | 2023-10-10 05:06 | 16K | |
| py39-plan-0.5.pkg | 2023-10-09 03:55 | 28K | |
| py39-planet-2.1.1.pkg | 2023-10-10 10:06 | 86K | |
| py39-plaso-20221229.pkg | 2023-10-09 06:53 | 1.7M | |
| py39-plastex-3.0.pkg | 2023-10-09 13:07 | 657K | |
| py39-platformdirs-3...> | 2023-10-06 08:29 | 23K | |
| py39-playsound-1.3.0..> | 2023-10-07 21:37 | 8.8K | |
| py39-plette-0.4.4.pkg | 2023-10-08 02:48 | 18K | |
| py39-plex-1.1.5.pkg | 2023-10-09 09:32 | 53K | |
| py39-plotly-4.14.3.pkg | 2023-10-06 21:29 | 5.2M | |
| py39-ploy-2.0.1.pkg | 2023-10-08 00:28 | 89K | |
| py39-ploy_ezjail-2.0..> | 2023-10-10 16:43 | 22K | |
| py39-plucky-0.4.3.pkg | 2023-10-06 15:47 | 11K | |
| py39-pluggy-1.3.0.pkg | 2023-10-05 17:34 | 30K | |
| py39-pluggy0-0.13.1.pkg | 2023-10-06 20:43 | 25K | |
| py39-pluginbase-1.0...> | 2023-10-07 03:21 | 11K | |
| py39-plumbum-1.8.2.pkg | 2023-10-07 05:25 | 169K | |
| py39-plux-1.4.0.pkg | 2023-10-14 12:18 | 24K | |
| py39-ply-3.11.pkg | 2023-10-05 17:30 | 125K | |
| py39-png-0.0.17.pkg | 2023-10-06 18:39 | 45K | |
| py39-pockets-0.9.1.pkg | 2023-10-07 23:03 | 31K | |
| py39-pocketsphinx-0...> | 2023-10-10 10:12 | 24M | |
| py39-podcastparser-0..> | 2023-10-08 05:08 | 19K | |
| py39-poetry-1.6.1.pkg | 2023-10-07 12:20 | 319K | |
| py39-poetry-core-1.7..> | 2023-10-06 08:34 | 570K | |
| py39-poetry-dynamic-..> | 2023-10-06 21:58 | 24K | |
| py39-poetry-plugin-e..> | 2023-10-07 05:36 | 15K | |
| py39-poetry-semver-0..> | 2023-10-10 18:21 | 18K | |
| py39-poetry-types-0...> | 2023-10-11 12:07 | 11K | |
| py39-poetry2setup-1...> | 2023-10-06 19:33 | 3.3K | |
| py39-point-annotator..> | 2023-10-07 07:40 | 872K | |
| py39-pointpats-2.3.0..> | 2023-10-08 10:51 | 78K | |
| py39-polars-0.18.15.pkg | 2023-10-10 13:30 | 12M | |
| py39-polib-1.2.0.pkg | 2023-10-06 21:09 | 31K | |
| py39-pony-0.7.16.pkg | 2023-10-07 17:08 | 532K | |
| py39-pooch-1.7.0.pkg | 2023-10-07 11:18 | 75K | |
| py39-pop-20.1.1.pkg | 2023-10-07 11:25 | 52K | |
| py39-pop-config-8.0...> | 2023-10-07 07:32 | 32K | |
| py39-port-for-0.4.pkg | 2023-10-10 13:14 | 28K | |
| py39-portalocker-2.3..> | 2023-10-06 22:59 | 20K | |
| py39-portend-2.5_1.pkg | 2023-10-07 08:36 | 6.4K | |
| py39-positional-1.2...> | 2023-10-14 07:07 | 7.4K | |
| py39-posix_ipc-1.1.1..> | 2023-10-10 20:29 | 13K | |
| py39-postfix-mta-sts..> | 2023-10-10 20:19 | 38K | |
| py39-postgresql-1.3...> | 2023-10-09 17:19 | 378K | |
| py39-postorius-1.3.7..> | 2023-10-09 17:42 | 1.3M | |
| py39-potr-1.0.1_1.pkg | 2023-10-07 15:41 | 36K | |
| py39-powa-web-4.1.4.pkg | 2023-10-10 03:41 | 568K | |
| py39-power-1.3.pkg | 2023-10-11 11:27 | 17K | |
| py39-powerline-statu..> | 2023-10-09 04:11 | 3.1M | |
| py39-pox-0.3.3.pkg | 2023-10-06 21:49 | 33K | |
| py39-poyo-0.5.0.pkg | 2023-10-06 21:58 | 13K | |
| py39-ppft-1.7.6.7.pkg | 2023-10-07 00:05 | 49K | |
| py39-pplpy-0.8.9.pkg | 2023-10-07 15:38 | 327K | |
| py39-prance-23.6.21...> | 2023-10-06 19:29 | 44K | |
| py39-praw-7.7.1.pkg | 2023-10-07 16:09 | 221K | |
| py39-prawcore-2.3.0.pkg | 2023-10-07 05:57 | 22K | |
| py39-pre-commit-3.4...> | 2023-10-06 15:05 | 227K | |
| py39-pre-commit-hook..> | 2023-10-10 16:54 | 50K | |
| py39-precis_i18n-1.0..> | 2023-10-07 01:45 | 28K | |
| py39-prefixed-0.7.0.pkg | 2023-10-06 23:45 | 9.7K | |
| py39-premailer-3.1.1..> | 2023-10-10 19:20 | 22K | |
| py39-preppy-2.4.1.pkg | 2023-10-11 01:56 | 30K | |
| py39-preshed-4.0.0.pkg | 2023-10-08 18:13 | 77K | |
| py39-pretend-1.0.9.pkg | 2023-10-14 09:47 | 5.4K | |
| py39-pretty_midi-0.2..> | 2023-10-10 11:38 | 5.2M | |
| py39-prettyprinter-0..> | 2023-10-09 00:58 | 64K | |
| py39-prettytable-3.8..> | 2023-10-07 08:33 | 41K | |
| py39-prettytable0-0...> | 2023-10-06 17:31 | 23K | |
| py39-primecountpy-0...> | 2023-10-09 10:34 | 16K | |
| py39-primme-3.2.1_1.pkg | 2023-10-10 07:40 | 750K | |
| py39-priority-2.0.0.pkg | 2023-10-08 09:37 | 11K | |
| py39-priority1-1.3.0..> | 2023-10-06 09:27 | 11K | |
| py39-process-tests-2..> | 2023-10-09 13:54 | 7.5K | |
| py39-proglog-0.1.10.pkg | 2023-10-07 06:24 | 8.8K | |
| py39-progress-1.6.pkg | 2023-10-09 18:58 | 11K | |
| py39-progressbar-2.5..> | 2023-10-07 01:34 | 14K | |
| py39-progressbar2-4...> | 2023-10-07 19:31 | 42K | |
| py39-projpicker-0.3...> | 2023-10-14 06:01 | 498K | |
| py39-prometheus-clie..> | 2023-10-06 10:05 | 80K | |
| py39-prometheus-zfs-..> | 2023-10-09 16:00 | 2.2K | |
| py39-promise-2.3.pkg | 2023-10-06 15:59 | 30K | |
| py39-prompt-toolkit-..> | 2023-10-06 10:04 | 505K | |
| py39-prompt-toolkit1..> | 2023-10-08 17:28 | 319K | |
| py39-prompt-toolkit2..> | 2023-10-07 13:16 | 434K | |
| py39-property-cached..> | 2023-10-08 03:29 | 6.5K | |
| py39-proselint-0.13...> | 2023-10-06 12:02 | 117K | |
| py39-prospector-1.10..> | 2023-10-09 15:34 | 93K | |
| py39-protego-0.1.16.pkg | 2023-10-07 10:52 | 32K | |
| py39-proto-plus-1.22..> | 2023-10-06 16:57 | 47K | |
| py39-protobuf-4.24.3..> | 2023-10-06 10:48 | 308K | |
| py39-protobuf-compil..> | 2023-10-12 11:15 | 10K | |
| py39-proxmoxer-2.0.1..> | 2023-10-08 14:40 | 23K | |
| py39-psautohint-2.4...> | 2023-10-06 16:47 | 143K | |
| py39-pss-1.44.pkg | 2023-10-08 14:12 | 40K | |
| py39-psutil-5.9.5.pkg | 2023-10-06 12:03 | 346K | |
| py39-psycogreen-1.0.pkg | 2023-10-14 09:44 | 4.0K | |
| py39-psycopg-3.1.10.pkg | 2023-10-07 08:37 | 250K | |
| py39-psycopg-c-3.1.1..> | 2023-10-06 21:16 | 255K | |
| py39-psycopg-pool-3...> | 2023-10-06 20:43 | 36K | |
| py39-psycopg2-2.9.7.pkg | 2023-10-07 05:56 | 136K | |
| py39-psycopg2cffi-2...> | 2023-10-08 09:19 | 118K | |
| py39-ptable-0.9.2_1.pkg | 2023-10-08 04:15 | 32K | |
| py39-ptpython-3.0.23..> | 2023-10-08 15:43 | 96K | |
| py39-ptvsd-3.1.0.pkg | 2023-10-08 21:22 | 87K | |
| py39-ptyprocess-0.7...> | 2023-10-06 09:23 | 19K | |
| py39-publicsuffix-1...> | 2023-10-09 07:24 | 73K | |
| py39-publicsuffix2-2..> | 2023-10-07 06:37 | 83K | |
| py39-publicsuffixlis..> | 2023-10-10 05:08 | 81K | |
| py39-pudb-2022.1.3.pkg | 2023-10-14 10:38 | 108K | |
| py39-puddletag-2.2.0..> | 2023-10-14 12:24 | 1.1M | |
| py39-pulsectl-23.5.2..> | 2023-10-08 08:54 | 58K | |
| py39-pum-0.9.14.pkg | 2023-10-09 06:40 | 27K | |
| py39-punjab-0.15.pkg | 2023-10-09 23:04 | 58K | |
| py39-puppetboard-4.2..> | 2023-10-09 22:40 | 1.9M | |
| py39-pupynere-1.0.15..> | 2023-10-10 15:16 | 13K | |
| py39-pure-eval-0.2.2..> | 2023-10-06 09:39 | 17K | |
| py39-puremagic-1.14.pkg | 2023-10-07 21:11 | 30K | |
| py39-purl-1.6.pkg | 2023-10-11 15:30 | 14K | |
| py39-pwntools-4.10.0..> | 2023-10-14 08:46 | 1.1M | |
| py39-py-1.11.0.pkg | 2023-10-06 13:55 | 145K | |
| py39-py-OpenFermion-..> | 2023-10-09 15:33 | 12K | |
| py39-py-cpuinfo-9.0...> | 2023-10-06 19:08 | 38K | |
| py39-py-find-1st-1.1..> | 2023-10-14 15:19 | 7.6K | |
| py39-py-partiql-pars..> | 2023-10-09 19:17 | 22K | |
| py39-py-restclient-1..> | 2023-10-10 00:28 | 28K | |
| py39-py-serializable..> | 2023-10-07 01:04 | 28K | |
| py39-py-ubjson-0.16...> | 2023-10-07 07:37 | 35K | |
| py39-py2bit-0.3.0.pkg | 2023-10-07 09:53 | 16K | |
| py39-py3Dmol-2.0.3.pkg | 2023-10-08 22:22 | 9.5K | |
| py39-py3dns-4.0.0.pkg | 2023-10-07 00:27 | 45K | |
| py39-py3nvml-0.2.7.pkg | 2023-10-14 11:07 | 64K | |
| py39-py3status-3.52.pkg | 2023-10-10 16:40 | 419K | |
| py39-pyBigWig-0.3.21..> | 2023-10-07 02:16 | 51K | |
| py39-pyClamd-0.3.17.pkg | 2023-10-08 22:53 | 15K | |
| py39-pyEDFlib-0.1.34..> | 2023-10-08 22:14 | 1.0M | |
| py39-pyFFTW-0.13.1.pkg | 2023-10-07 08:05 | 112K | |
| py39-pyIOSXR-0.53.pkg | 2023-10-10 13:02 | 14K | |
| py39-pyPEG2-2.15.2.pkg | 2023-10-06 23:05 | 29K | |
| py39-pyTooling-5.0.0..> | 2023-10-08 14:32 | 112K | |
| py39-pyVTK-0.5.18.pkg | 2023-10-09 01:35 | 30K | |
| py39-py_interface-2...> | 2023-10-08 22:28 | 61K | |
| py39-pyacoustid-1.2...> | 2023-10-08 07:27 | 16K | |
| py39-pyaes-1.6.1.pkg | 2023-10-07 08:55 | 33K | |
| py39-pyaff4-0.26.p6.pkg | 2023-10-09 22:20 | 93K | |
| py39-pyahocorasick-2..> | 2023-10-09 07:53 | 28K | |
| py39-pyaixi-1.0.4_1.pkg | 2023-10-09 03:34 | 53K | |
| py39-pyaml-23.5.9.pkg | 2023-10-07 08:09 | 24K | |
| py39-pyang-1.7.8.pkg | 2023-10-10 12:42 | 405K | |
| py39-pyarrow-13.0.0.pkg | 2023-10-10 02:03 | 3.2M | |
| py39-pyasn1-0.5.0.pkg | 2023-10-06 08:40 | 113K | |
| py39-pyasn1-modules-..> | 2023-10-06 08:57 | 200K | |
| py39-pyaudi-1.9.2.1_..> | 2023-10-09 19:20 | 567K | |
| py39-pyaudio-0.2.13.pkg | 2023-10-07 00:20 | 173K | |
| py39-pyautogui-0.9.5..> | 2023-10-07 14:31 | 45K | |
| py39-pyaxo-0.8.2_2.pkg | 2023-10-08 06:51 | 15K | |
| py39-pyberny-0.6.3_1..> | 2023-10-09 19:51 | 36K | |
| py39-pybind11-2.11.1..> | 2023-10-06 10:07 | 167K | |
| py39-pybind11210-2.1..> | 2023-10-08 06:44 | 164K | |
| py39-pybix-0.0.8.pkg | 2023-10-10 14:33 | 17K | |
| py39-pyblake2-1.1.2.pkg | 2023-10-07 03:19 | 15K | |
| py39-pybloom-3.0.0.pkg | 2023-10-10 18:47 | 14K | |
| py39-pybonjour-1.1.1..> | 2023-10-14 02:56 | 22K | |
| py39-pybtex-0.24.0_1..> | 2023-10-07 06:10 | 135K | |
| py39-pybtex-docutils..> | 2023-10-07 20:17 | 7.5K | |
| py39-pybugz-0.13_1.pkg | 2023-10-07 11:38 | 30K | |
| py39-pycadf-3.1.1.pkg | 2023-10-07 08:02 | 35K | |
| py39-pycalendar-2.0_..> | 2023-10-09 09:55 | 121K | |
| py39-pycallgraph-1.0..> | 2023-10-09 02:05 | 45K | |
| py39-pycapsicum-1.0.pkg | 2023-10-14 18:51 | 13K | |
| py39-pycares-4.3.0.pkg | 2023-10-06 15:42 | 71K | |
| py39-pycerberus-0.6.pkg | 2023-10-09 21:59 | 53K | |
| py39-pycha-0.8.1_1.pkg | 2023-10-08 04:15 | 54K | |
| py39-pyclipper-1.2.1..> | 2023-10-06 11:43 | 102K | |
| py39-pycmd-1.2_1.pkg | 2023-10-09 12:21 | 17K | |
| py39-pycocotools-2.0..> | 2023-10-10 11:37 | 81K | |
| py39-pycodeexport-0...> | 2023-10-07 00:59 | 18K | |
| py39-pycodestyle-2.1..> | 2023-10-06 13:48 | 47K | |
| py39-pycognito-2022...> | 2023-10-14 07:13 | 28K | |
| py39-pycoin-0.92.202..> | 2023-10-11 22:11 | 232K | |
| py39-pycoingecko-3.1..> | 2023-10-14 07:25 | 10K | |
| py39-pycollada-0.6_4..> | 2023-10-07 03:51 | 142K | |
| py39-pycompilation-0..> | 2023-10-06 21:01 | 32K | |
| py39-pycomplete-0.4...> | 2023-10-09 19:27 | 18K | |
| py39-pycos-4.8.11_1.pkg | 2023-10-07 21:16 | 227K | |
| py39-pycosat-0.6.3.pkg | 2023-10-14 10:48 | 12K | |
| py39-pycount-0.0.6_1..> | 2023-10-14 15:12 | 5.0K | |
| py39-pycountry-22.3...> | 2023-10-07 05:36 | 3.4M | |
| py39-pycparser-2.21.pkg | 2023-10-05 17:15 | 167K | |
| py39-pycql-0.0.12.pkg | 2023-10-11 12:40 | 36K | |
| py39-pycryptodome-3...> | 2023-10-06 18:00 | 1.3M | |
| py39-pycryptodome-te..> | 2023-10-09 16:43 | 8.7M | |
| py39-pycryptodomex-3..> | 2023-10-06 17:38 | 1.3M | |
| py39-pycsw-2.6.1_1.pkg | 2023-10-14 14:35 | 323K | |
| py39-pyct-0.5.0.pkg | 2023-10-06 12:23 | 23K | |
| py39-pycups-2.0.1.pkg | 2023-10-07 19:24 | 57K | |
| py39-pycurl-7.45.2.pkg | 2023-10-07 19:48 | 60K | |
| py39-pydantic-1.10.1..> | 2023-10-06 13:31 | 1.6M | |
| py39-pydantic-core-2..> | 2023-10-06 22:49 | 1.2M | |
| py39-pydantic-extra-..> | 2023-10-10 12:10 | 25K | |
| py39-pydantic2-2.3.0..> | 2023-10-06 23:39 | 488K | |
| py39-pydash-4.8.0.pkg | 2023-10-08 16:38 | 106K | |
| py39-pydata-sphinx-t..> | 2023-10-07 22:20 | 739K | |
| py39-pydecor-2.0.1.pkg | 2023-10-09 10:18 | 28K | |
| py39-pydenticon-0.3...> | 2023-10-09 18:05 | 7.4K | |
| py39-pyderasn-9.3.pkg | 2023-10-07 04:44 | 80K | |
| py39-pydevd-2.9.6.pkg | 2023-10-14 07:05 | 1.5M | |
| py39-pydicom-2.4.3.pkg | 2023-10-08 21:15 | 1.7M | |
| py39-pydispatcher-2...> | 2023-10-07 15:58 | 15K | |
| py39-pydnstable-0.7...> | 2023-10-14 05:29 | 33K | |
| py39-pydocstyle-6.3...> | 2023-10-06 16:27 | 59K | |
| py39-pydot-1.4.2.pkg | 2023-10-06 12:38 | 37K | |
| py39-pydotplus-2.0.2..> | 2023-10-07 12:01 | 36K | |
| py39-pydrive-1.3.1_1..> | 2023-10-09 13:48 | 36K | |
| py39-pydub-0.25.1_2.pkg | 2023-10-14 17:20 | 51K | |
| py39-pydyf-0.5.0_1.pkg | 2023-10-08 00:36 | 11K | |
| py39-pyeapi-1.0.0.pkg | 2023-10-08 11:02 | 96K | |
| py39-pyee-11.0.0.pkg | 2023-10-07 19:26 | 20K | |
| py39-pyelftools-0.29..> | 2023-10-07 07:10 | 238K | |
| py39-pyelliptic-2.0...> | 2023-10-08 03:51 | 20K | |
| py39-pyenet-1.3.13.p..> | 2023-10-08 03:16 | 62K | |
| py39-pyepsg-0.4.0.pkg | 2023-10-09 18:59 | 6.8K | |
| py39-pyerfa-2.0.0.3_..> | 2023-10-06 14:40 | 305K | |
| py39-pyexcel-0.7.0.pkg | 2023-10-14 11:29 | 100K | |
| py39-pyexcel-ezodf-0..> | 2023-10-07 03:07 | 72K | |
| py39-pyexcel-io-0.6...> | 2023-10-07 03:55 | 52K | |
| py39-pyexcel-ods3-0...> | 2023-10-07 14:52 | 11K | |
| py39-pyexcel-xls-0.7..> | 2023-10-08 00:42 | 14K | |
| py39-pyexcel-xlsx-0...> | 2023-10-07 10:59 | 11K | |
| py39-pyface-8.0.0.pkg | 2023-10-06 16:50 | 1.2M | |
| py39-pyfaidx-0.5.9.5..> | 2023-10-07 12:37 | 37K | |
| py39-pyfasta-0.5.2_5..> | 2023-10-09 18:00 | 21K | |
| py39-pyfcm-1.5.1.pkg | 2023-10-10 19:32 | 17K | |
| py39-pyfda-0.1_13.pkg | 2023-10-09 13:33 | 230K | |
| py39-pyfiglet-1.0.2.pkg | 2023-10-07 08:01 | 534K | |
| py39-pyfixbuf-0.9.0.pkg | 2023-10-09 09:01 | 114K | |
| py39-pyflakes-3.1.0.pkg | 2023-10-06 15:14 | 103K | |
| py39-pyformance-0.4.pkg | 2023-10-08 16:12 | 45K | |
| py39-pyftpdlib-1.5.7..> | 2023-10-14 06:54 | 191K | |
| py39-pygal-2.4.0.pkg | 2023-10-09 17:15 | 152K | |
| py39-pyganim-0.9.2_5..> | 2023-10-07 20:53 | 16K | |
| py39-pygccxml-2.4.0.pkg | 2023-10-07 14:29 | 173K | |
| py39-pygdbmi-0.11.0...> | 2023-10-14 13:21 | 25K | |
| py39-pygeoapi-0.14.0..> | 2023-10-10 19:37 | 306K | |
| py39-pygeodesy-23.4...> | 2023-10-09 11:44 | 1.1M | |
| py39-pygeoip-0.3.2.pkg | 2023-10-10 00:49 | 29K | |
| py39-pygeometa-0.15...> | 2023-10-09 10:01 | 51K | |
| py39-pygeos-0.14.pkg | 2023-10-07 03:47 | 345K | |
| py39-pygit2-1.12.2.pkg | 2023-10-08 01:00 | 172K | |
| py39-pygithub-1.57.pkg | 2023-10-07 09:33 | 196K | |
| py39-pyglet-2.0.9.pkg | 2023-10-07 11:32 | 1.1M | |
| py39-pyglet1-1.5.27.pkg | 2023-10-07 04:24 | 1.2M | |
| py39-pygltflib-1.16...> | 2023-10-08 07:53 | 36K | |
| py39-pygments-2.16.1..> | 2023-10-05 17:16 | 1.5M | |
| py39-pygments-25-2.5..> | 2023-10-14 14:43 | 1.2M | |
| py39-pygmo2-2.19.5.pkg | 2023-10-07 19:01 | 578K | |
| py39-pygmsh-7.1.17_2..> | 2023-10-08 20:26 | 54K | |
| py39-pygost-5.11.pkg | 2023-10-07 10:28 | 148K | |
| py39-pygpx-0.2_1.pkg | 2023-10-10 19:24 | 4.8K | |
| py39-pygraph-0.2.1.4..> | 2023-10-07 21:40 | 41K | |
| py39-pygraphviz-1.6.pkg | 2023-10-06 13:06 | 63K | |
| py39-pygsheets-2.0.6..> | 2023-10-09 02:07 | 158K | |
| py39-pygsl-2.3.3_1.pkg | 2023-10-09 04:31 | 658K | |
| py39-pygslodeiv2-0.9..> | 2023-10-07 07:41 | 139K | |
| py39-pygtail-0.6.1_1..> | 2023-10-09 21:16 | 8.4K | |
| py39-pyhanko-0.20.0_..> | 2023-10-07 18:01 | 530K | |
| py39-pyhanko-certval..> | 2023-10-07 06:37 | 143K | |
| py39-pyhashxx-0.1.3.pkg | 2023-10-09 00:42 | 11K | |
| py39-pyhcl-0.4.4.pkg | 2023-10-08 11:40 | 68K | |
| py39-pyhdfe-0.2.0.pkg | 2023-10-07 20:22 | 29K | |
| py39-pyhull-2015.2.1..> | 2023-10-11 06:54 | 177K | |
| py39-pyicap-1.0.b1.pkg | 2023-10-09 19:10 | 14K | |
| py39-pyicu-2.4.3_6.pkg | 2023-10-06 18:07 | 247K | |
| py39-pyina-0.2.8.pkg | 2023-10-09 06:22 | 49K | |
| py39-pyinotify-0.9.6..> | 2023-10-06 15:34 | 39K | |
| py39-pyinsane2-2.0.1..> | 2023-10-07 12:10 | 41K | |
| py39-pyinstaller-3.5..> | 2023-10-08 06:15 | 1.4M | |
| py39-pyintelowl-4.4...> | 2023-10-08 01:14 | 58K | |
| py39-pyisemail-2.0.1..> | 2023-10-07 09:41 | 28K | |
| py39-pyjacklib-0.1.1..> | 2023-10-08 07:53 | 22K | |
| py39-pyjade-4.0.0_1.pkg | 2023-10-11 01:05 | 56K | |
| py39-pyjq-2.4.0.pkg | 2023-10-09 16:35 | 26K | |
| py39-pyjsparser-2.7...> | 2023-10-07 01:55 | 46K | |
| py39-pyjwt-2.8.0.pkg | 2023-10-06 13:29 | 36K | |
| py39-pyjwt1-1.7.1.pkg | 2023-10-08 04:45 | 26K | |
| py39-pykdtree-1.3.7...> | 2023-10-09 19:38 | 47K | |
| py39-pyked-0.4.1.16_..> | 2023-10-14 08:53 | 88K | |
| py39-pykep-2.6.2_1.pkg | 2023-10-14 04:35 | 7.3M | |
| py39-pykml-0.2.0.pkg | 2023-10-08 02:29 | 44K | |
| py39-pykwalify-1.8.0..> | 2023-10-08 20:30 | 40K | |
| py39-pyla-1.1.7.1_2.pkg | 2023-10-09 02:59 | 547K | |
| py39-pylama-7.7.1.pkg | 2023-10-10 15:16 | 42K | |
| py39-pylast-5.2.0.pkg | 2023-10-08 09:00 | 41K | |
| py39-pylev-1.4.0.pkg | 2023-10-07 10:20 | 5.7K | |
| py39-pylibacl-0.5.2.pkg | 2023-10-14 12:54 | 8.8K | |
| py39-pyliblo-0.10.0_..> | 2023-10-07 03:47 | 61K | |
| py39-pylibmc-1.6.3.pkg | 2023-10-10 20:35 | 33K | |
| py39-pylibsrtp-0.8.0..> | 2023-10-07 19:07 | 13K | |
| py39-pylint-django-2..> | 2023-10-08 11:20 | 74K | |
| py39-pylint-flask-0...> | 2023-10-08 02:17 | 4.0K | |
| py39-pylint-plugin-u..> | 2023-10-07 07:34 | 5.3K | |
| py39-pylint-venv-3.0..> | 2023-10-07 02:37 | 6.0K | |
| py39-pylons-sphinx-t..> | 2023-10-06 15:09 | 129K | |
| py39-pylru-1.2.0.pkg | 2023-10-08 19:31 | 12K | |
| py39-pylru-cache-0.1..> | 2023-10-07 18:57 | 5.3K | |
| py39-pyls-black-0.4...> | 2023-10-06 18:19 | 5.6K | |
| py39-pyls-spyder-0.4..> | 2023-10-07 08:09 | 7.5K | |
| py39-pylsqpack-0.3.1..> | 2023-10-06 10:08 | 63K | |
| py39-pyluach-2.2.0_1..> | 2023-10-07 04:03 | 37K | |
| py39-pymacaroons-0.1..> | 2023-10-07 12:57 | 26K | |
| py39-pymad-0.10_1.pkg | 2023-10-06 21:29 | 6.2K | |
| py39-pymaging-g20130..> | 2023-10-07 11:41 | 29K | |
| py39-pymaging-png-g2..> | 2023-10-10 18:44 | 46K | |
| py39-pymailq-0.9.0_1..> | 2023-10-12 05:08 | 42K | |
| py39-pymarc-5.1.0,1.pkg | 2023-10-14 13:12 | 179K | |
| py39-pymatgen-2022.7..> | 2023-10-07 07:21 | 3.1M | |
| py39-pymatgen-analys..> | 2023-10-08 04:28 | 53K | |
| py39-pymatreader-0.0..> | 2023-10-08 08:21 | 9.0K | |
| py39-pymaven-patch-0..> | 2023-10-09 04:12 | 30K | |
| py39-pymbd-0.12.5_1.pkg | 2023-10-10 21:53 | 39K | |
| py39-pymc3-3.11.5_1.pkg | 2023-10-08 15:46 | 947K | |
| py39-pymdown-extensi..> | 2023-10-07 01:28 | 256K | |
| py39-pymediainfo-4.1..> | 2023-10-08 10:44 | 9.3K | |
| py39-pymeeus-0.5.12.pkg | 2023-10-07 01:10 | 1.0M | |
| py39-pymemcache-4.0...> | 2023-10-10 06:21 | 88K | |
| py39-pymetar-1.4.pkg | 2023-10-08 15:46 | 21K | |
| py39-pyminizip-0.2.6..> | 2023-10-08 16:34 | 63K | |
| py39-pymisp-2.4.162...> | 2023-10-07 19:44 | 350K | |
| py39-pymodbus-3.5.2.pkg | 2023-10-09 16:51 | 246K | |
| py39-pymol-2.5.0.97_..> | 2023-10-14 06:34 | 5.2M | |
| py39-pymongo-3.13.0.pkg | 2023-10-07 09:15 | 451K | |
| py39-pymsgbox-1.0.9.pkg | 2023-10-07 00:43 | 10K | |
| py39-pymssql-2.1.5.pkg | 2023-10-09 10:36 | 168K | |
| py39-pymtbl-0.5.0.pkg | 2023-10-11 01:10 | 52K | |
| py39-pymtl3-3.1.15.pkg | 2023-10-10 00:03 | 646K | |
| py39-pymysql-1.0.2.pkg | 2023-10-07 13:09 | 65K | |
| py39-pynacl-1.5.0.pkg | 2023-10-06 18:27 | 87K | |
| py39-pynamecheap-0.0..> | 2023-10-10 17:11 | 9.7K | |
| py39-pynauty-2.8.6.pkg | 2023-10-14 15:45 | 236K | |
| py39-pyneqsys-0.5.7_..> | 2023-10-08 03:01 | 40K | |
| py39-pynest2d-4.12.1..> | 2023-10-08 00:51 | 117K | |
| py39-pynetbox-7.2.0.pkg | 2023-10-10 10:48 | 186K | |
| py39-pynleq2-0.0.2_8..> | 2023-10-10 07:36 | 44K | |
| py39-pynmsg-0.5.0_2.pkg | 2023-10-14 14:58 | 84K | |
| py39-pynn-0.11.0.pkg | 2023-10-09 19:06 | 354K | |
| py39-pynndescent-0.5..> | 2023-10-08 07:43 | 81K | |
| py39-pynput-1.7.6_2.pkg | 2023-10-07 19:44 | 96K | |
| py39-pynsq-0.9.1.pkg | 2023-10-09 13:01 | 42K | |
| py39-pynvim-0.4.3.pkg | 2023-10-10 12:57 | 55K | |
| py39-pynxos-0.0.5.pkg | 2023-10-08 22:37 | 16K | |
| py39-pynzb-0.1.0_2.pkg | 2023-10-07 19:12 | 8.3K | |
| py39-pyocclient-0.6.pkg | 2023-10-08 22:58 | 43K | |
| py39-pyocr-0.8.4.pkg | 2023-10-07 00:10 | 40K | |
| py39-pyodbc-4.0.32.pkg | 2023-10-09 17:33 | 56K | |
| py39-pyodeint-0.10.4..> | 2023-10-06 23:49 | 161K | |
| py39-pyodesys-0.14.2..> | 2023-10-07 17:48 | 171K | |
| py39-pyopencl-2018.2..> | 2023-10-07 23:28 | 526K | |
| py39-pyosf-1.0.5.pkg | 2023-10-09 16:42 | 37K | |
| py39-pyotp-2.9.0.pkg | 2023-10-14 06:35 | 15K | |
| py39-pyotp2289-1.2.1..> | 2023-10-14 04:34 | 28K | |
| py39-pypa-docs-theme..> | 2023-10-08 13:03 | 2.8K | |
| py39-pypacker-5.0.pkg | 2023-10-07 16:29 | 415K | |
| py39-pypandoc-1.5.pkg | 2023-10-08 10:56 | 21K | |
| py39-pyparsing-3.1.1..> | 2023-10-06 11:16 | 149K | |
| py39-pyparsing2-2.4...> | 2023-10-06 18:22 | 106K | |
| py39-pypatent-1.2.0_..> | 2023-10-09 23:01 | 10K | |
| py39-pypcap-1.3.0.pkg | 2023-10-08 03:05 | 65K | |
| py39-pypdf-3.15.3.pkg | 2023-10-07 20:19 | 397K | |
| py39-pypdf2-1.27.12.pkg | 2023-10-08 11:35 | 108K | |
| py39-pypdf3-1.0.6.pkg | 2023-10-11 14:54 | 93K | |
| py39-pyperclip-1.7.0..> | 2023-10-06 15:16 | 13K | |
| py39-pyperf-2.6.1.pkg | 2023-10-14 08:20 | 176K | |
| py39-pyphen-0.14.0.pkg | 2023-10-08 07:26 | 1.0M | |
| py39-pypillowfight-0..> | 2023-10-14 05:48 | 28K | |
| py39-pyplusplus-1.8...> | 2023-10-14 06:27 | 298K | |
| py39-pypowerwall-0.6..> | 2023-10-08 18:15 | 50K | |
| py39-pyprecice-2.5.0..> | 2023-10-11 05:09 | 85K | |
| py39-pyprind-2.11.3.pkg | 2023-10-08 07:44 | 9.6K | |
| py39-pyproj-3.6.0_1.pkg | 2023-10-06 19:33 | 395K | |
| py39-pyproject-flake..> | 2023-10-14 12:55 | 7.4K | |
| py39-pyproject-fmt-0..> | 2023-10-09 07:55 | 19K | |
| py39-pyproject-metad..> | 2023-10-06 23:12 | 12K | |
| py39-pyproject_hooks..> | 2023-10-05 17:14 | 14K | |
| py39-pypugjs-5.9.12.pkg | 2023-10-10 03:45 | 58K | |
| py39-pypuppetdb-3.1...> | 2023-10-07 18:50 | 42K | |
| py39-pyqir-0.8.2_1.pkg | 2023-10-08 03:47 | 1.2M | |
| py39-pyqrcode-1.2.1.pkg | 2023-10-07 07:15 | 47K | |
| py39-pyqtgraph-0.13...> | 2023-10-06 17:36 | 1.1M | |
| py39-pyqtree-0.24.pkg | 2023-10-07 21:07 | 6.4K | |
| py39-pyqubo-1.4.0_1.pkg | 2023-10-08 01:41 | 175K | |
| py39-pyquery-2.0.0.pkg | 2023-10-06 19:14 | 35K | |
| py39-pyrad-2.4.pkg | 2023-10-07 21:13 | 54K | |
| py39-pyradio-0.9.2.1..> | 2023-10-14 11:15 | 848K | |
| py39-pyral-1.5.2.pkg | 2023-10-08 13:58 | 108K | |
| py39-pyramid-1.7.3_1..> | 2023-10-07 14:33 | 730K | |
| py39-pyramid-mako-1...> | 2023-10-14 16:09 | 20K | |
| py39-pyramid_rpc-0.8..> | 2023-10-14 05:04 | 38K | |
| py39-pyreadr-0.4.9.pkg | 2023-10-10 08:47 | 127K | |
| py39-pyrepl-0.9.0.pkg | 2023-10-14 10:38 | 76K | |
| py39-pyrfc3339-1.1.pkg | 2023-10-06 19:38 | 6.7K | |
| py39-pyright-1.1.326..> | 2023-10-10 07:15 | 24K | |
| py39-pyro-4.77.pkg | 2023-10-14 12:16 | 429K | |
| py39-pyrodigal-2.2.0..> | 2023-10-09 22:53 | 2.4M | |
| py39-pyroma-4.2.pkg | 2023-10-12 07:53 | 30K | |
| py39-pyroute2-0.7.9.pkg | 2023-10-07 11:54 | 625K | |
| py39-pyroute2.minima..> | 2023-10-10 09:33 | 384K | |
| py39-pyroute2.protoc..> | 2023-10-12 08:38 | 16K | |
| py39-pyrr-0.10.3_1.pkg | 2023-10-08 05:39 | 54K | |
| py39-pyrsgis-0.4.1_2..> | 2023-10-07 19:39 | 32K | |
| py39-pyrsistent-0.18..> | 2023-10-06 19:58 | 81K | |
| py39-pysal-23.1.pkg | 2023-10-09 21:49 | 19K | |
| py39-pysam-0.21.0.pkg | 2023-10-07 06:12 | 2.8M | |
| py39-pysaml2-7.4.2.pkg | 2023-10-07 10:21 | 508K | |
| py39-pysaml24-4.9.0_..> | 2023-10-08 19:17 | 427K | |
| py39-pysaml26-6.5.2.pkg | 2023-10-08 03:06 | 455K | |
| py39-pysasl-0.10.0.pkg | 2023-10-07 01:18 | 23K | |
| py39-pyscaffold-4.4...> | 2023-10-09 20:05 | 94K | |
| py39-pyscard-2.0.3.pkg | 2023-10-07 07:00 | 111K | |
| py39-pyscf-2.3.0.pkg | 2023-10-06 20:19 | 8.2M | |
| py39-pyscreenshot-0...> | 2023-10-07 14:41 | 24K | |
| py39-pyscreeze-0.1.2..> | 2023-10-07 01:58 | 16K | |
| py39-pyscss-1.3.7.pkg | 2023-10-07 07:07 | 200K | |
| py39-pysdl2-0.9.16.pkg | 2023-10-08 21:28 | 552K | |
| py39-pysendfile-2.0...> | 2023-10-07 16:12 | 6.6K | |
| py39-pyserial-3.5_2.pkg | 2023-10-06 09:10 | 131K | |
| py39-pyserial-asynci..> | 2023-10-14 07:03 | 10K | |
| py39-pysftp-0.2.9.pkg | 2023-10-10 10:34 | 20K | |
| py39-pysha3-1.0.2.pkg | 2023-10-07 01:17 | 39K | |
| py39-pyshark-0.6.pkg | 2023-10-10 05:25 | 53K | |
| py39-pyshp-2.3.1.pkg | 2023-10-07 20:20 | 59K | |
| py39-pyside2-5.15.2_..> | 2023-10-07 07:57 | 7.2M | |
| py39-pyside2-tools-5..> | 2023-10-08 11:20 | 58K | |
| py39-pyside6-6.5.2.pkg | 2023-10-07 16:10 | 9.2M | |
| py39-pyside6-tools-6..> | 2023-10-10 11:51 | 2.2M | |
| py39-pysimdjson-4.0...> | 2023-10-10 06:42 | 133K | |
| py39-pysmartdl-1.3.4..> | 2023-10-08 13:19 | 26K | |
| py39-pysmb-1.1.27.pkg | 2023-10-10 10:20 | 274K | |
| py39-pysmi-1.1.13.pkg | 2023-10-07 06:22 | 104K | |
| py39-pysmt-0.9.0.pkg | 2023-10-07 00:52 | 398K | |
| py39-pysndfile-1.4.4..> | 2023-10-10 20:53 | 85K | |
| py39-pysnmp-4.4.9_2.pkg | 2023-10-07 13:22 | 456K | |
| py39-pysnmp-mibs-0.1..> | 2023-10-08 22:18 | 2.8M | |
| py39-pysocks-1.7.1.pkg | 2023-10-05 17:16 | 22K | |
| py39-pysodium-0.7.12..> | 2023-10-08 17:10 | 21K | |
| py39-pysofa-0.1.1_3.pkg | 2023-10-11 00:03 | 30K | |
| py39-pysol-cards-0.1..> | 2023-10-06 18:13 | 19K | |
| py39-pyspacewar-1.1...> | 2023-10-14 09:25 | 217K | |
| py39-pysparklines-1...> | 2023-10-09 23:38 | 6.8K | |
| py39-pyspf-2.0.14_1.pkg | 2023-10-07 09:58 | 38K | |
| py39-pyspnego-0.9.2.pkg | 2023-10-07 09:23 | 180K | |
| py39-pysrt-1.1.2.pkg | 2023-10-07 20:13 | 21K | |
| py39-pystache-0.6.0.pkg | 2023-10-07 05:57 | 98K | |
| py39-pystash-0.0.14.pkg | 2023-10-09 23:40 | 14K | |
| py39-pystemmer-2.0.1..> | 2023-10-05 17:18 | 78K | |
| py39-pystorm-3.1.4_1..> | 2023-10-07 18:47 | 27K | |
| py39-pystun-0.1.0_1.pkg | 2023-10-10 12:27 | 8.8K | |
| py39-pysubs2-1.6.1.pkg | 2023-10-10 04:29 | 48K | |
| py39-pysym-0.2.3_3.pkg | 2023-10-08 18:16 | 27K | |
| py39-pytanque-1.1.0.pkg | 2023-10-08 06:18 | 145K | |
| py39-pyte-0.8.1.pkg | 2023-10-07 23:49 | 36K | |
| py39-pytensor-2.16.1..> | 2023-10-09 03:31 | 1.6M | |
| py39-pyteomics-4.6.pkg | 2023-10-08 12:47 | 312K | |
| py39-pytesseract-0.3..> | 2023-10-09 02:18 | 16K | |
| py39-pytest-7.4.2,1.pkg | 2023-10-06 16:10 | 484K | |
| py39-pytest-aiohttp-..> | 2023-10-09 14:40 | 5.8K | |
| py39-pytest-asyncio-..> | 2023-10-07 23:41 | 15K | |
| py39-pytest-azurepip..> | 2023-10-08 15:44 | 10K | |
| py39-pytest-benchmar..> | 2023-10-14 12:25 | 66K | |
| py39-pytest-black-0...> | 2023-10-07 11:37 | 5.4K | |
| py39-pytest-black-mu..> | 2023-10-09 12:17 | 2.4K | |
| py39-pytest-cache-1...> | 2023-10-08 20:33 | 8.7K | |
| py39-pytest-canonica..> | 2023-10-10 05:59 | 6.8K | |
| py39-pytest-capturel..> | 2023-10-09 17:30 | 5.9K | |
| py39-pytest-cases-3...> | 2023-10-10 15:17 | 128K | |
| py39-pytest-checkdoc..> | 2023-10-09 22:31 | 5.5K | |
| py39-pytest-console-..> | 2023-10-14 02:55 | 13K | |
| py39-pytest-cov-4.1...> | 2023-10-14 16:43 | 27K | |
| py39-pytest-cpp-2.4...> | 2023-10-08 15:40 | 19K | |
| py39-pytest-datadir-..> | 2023-10-08 10:10 | 4.3K | |
| py39-pytest-django-4..> | 2023-10-10 00:11 | 31K | |
| py39-pytest-enabler-..> | 2023-10-09 22:38 | 5.4K | |
| py39-pytest-env-0.6...> | 2023-10-14 05:45 | 2.7K | |
| py39-pytest-factoryb..> | 2023-10-10 09:34 | 20K | |
| py39-pytest-fixture-..> | 2023-10-08 02:25 | 6.0K | |
| py39-pytest-flake8-1..> | 2023-10-09 18:03 | 8.2K | |
| py39-pytest-flakes-4..> | 2023-10-08 22:37 | 8.5K | |
| py39-pytest-flask-0...> | 2023-10-09 17:14 | 11K | |
| py39-pytest-forked-1..> | 2023-10-07 02:13 | 5.6K | |
| py39-pytest-freezer-..> | 2023-10-09 18:50 | 3.7K | |
| py39-pytest-helpers-..> | 2023-10-08 17:55 | 11K | |
| py39-pytest-html-3.2..> | 2023-10-10 05:39 | 23K | |
| py39-pytest-httpbin-..> | 2023-10-10 09:17 | 12K | |
| py39-pytest-httpserv..> | 2023-10-09 23:10 | 26K | |
| py39-pytest-isort-3...> | 2023-10-14 05:33 | 8.4K | |
| py39-pytest-jupyter-..> | 2023-10-09 04:30 | 21K | |
| py39-pytest-lazy-fix..> | 2023-10-10 23:59 | 6.2K | |
| py39-pytest-localser..> | 2023-10-10 22:21 | 21K | |
| py39-pytest-markdown..> | 2023-10-11 11:27 | 4.9K | |
| py39-pytest-metadata..> | 2023-10-07 14:15 | 11K | |
| py39-pytest-mock-3.1..> | 2023-10-10 19:39 | 13K | |
| py39-pytest-mpl-0.16..> | 2023-10-08 23:46 | 31K | |
| py39-pytest-mutagen-..> | 2023-10-09 09:17 | 24K | |
| py39-pytest-mypy-0.1..> | 2023-10-09 03:30 | 9.9K | |
| py39-pytest-mypy-plu..> | 2023-10-14 12:26 | 24K | |
| py39-pytest-nunit-1...> | 2023-10-07 11:07 | 22K | |
| py39-pytest-order-1...> | 2023-10-10 17:30 | 21K | |
| py39-pytest-parallel..> | 2023-10-11 06:04 | 9.4K | |
| py39-pytest-pep8-1.0..> | 2023-10-14 11:23 | 6.4K | |
| py39-pytest-plus-0.4..> | 2023-10-14 07:02 | 4.6K | |
| py39-pytest-profilin..> | 2023-10-11 00:50 | 8.6K | |
| py39-pytest-pycodest..> | 2023-10-09 11:33 | 4.8K | |
| py39-pytest-qt-4.2.0..> | 2023-10-10 00:23 | 52K | |
| py39-pytest-random-o..> | 2023-10-14 09:47 | 13K | |
| py39-pytest-randomly..> | 2023-10-09 09:22 | 10K | |
| py39-pytest-regressi..> | 2023-10-14 10:44 | 27K | |
| py39-pytest-regtest-..> | 2023-10-09 22:22 | 9.3K | |
| py39-pytest-relaxed-..> | 2023-10-14 17:57 | 17K | |
| py39-pytest-rerunfai..> | 2023-10-14 17:43 | 17K | |
| py39-pytest-runner-6..> | 2023-10-06 11:51 | 8.4K | |
| py39-pytest-services..> | 2023-10-08 23:53 | 24K | |
| py39-pytest-shutil-1..> | 2023-10-08 02:57 | 20K | |
| py39-pytest-subproce..> | 2023-10-09 23:46 | 26K | |
| py39-pytest-subtests..> | 2023-10-09 06:31 | 10K | |
| py39-pytest-sugar-0...> | 2023-10-11 01:19 | 16K | |
| py39-pytest-timeout-..> | 2023-10-14 08:24 | 15K | |
| py39-pytest-tornado-..> | 2023-10-09 01:49 | 7.5K | |
| py39-pytest-tornasyn..> | 2023-10-14 16:40 | 6.7K | |
| py39-pytest-translat..> | 2023-10-10 04:29 | 9.7K | |
| py39-pytest-trio-0.8..> | 2023-10-10 06:28 | 27K | |
| py39-pytest-twisted-..> | 2023-10-09 08:20 | 13K | |
| py39-pytest-verbose-..> | 2023-10-10 02:36 | 5.9K | |
| py39-pytest-virtuale..> | 2023-10-14 13:42 | 10K | |
| py39-pytest-watcher-..> | 2023-10-10 09:34 | 8.3K | |
| py39-pytest-xdist-2...> | 2023-10-08 01:17 | 53K | |
| py39-pytest-xprocess..> | 2023-10-14 10:18 | 13K | |
| py39-pytest4-4.6.11_..> | 2023-10-07 07:34 | 345K | |
| py39-pytest4-cache-1..> | 2023-10-08 10:47 | 8.7K | |
| py39-pytest4-cov-2.9..> | 2023-10-09 12:19 | 25K | |
| py39-pytest4-flakes-..> | 2023-10-09 15:15 | 8.0K | |
| py39-python-applicat..> | 2023-10-08 10:35 | 61K | |
| py39-python-arango-7..> | 2023-10-09 15:55 | 131K | |
| py39-python-augeas-1..> | 2023-10-08 11:42 | 12K | |
| py39-python-axolotl-..> | 2023-10-08 08:10 | 81K | |
| py39-python-axolotl-..> | 2023-10-07 07:00 | 62K | |
| py39-python-barbican..> | 2023-10-07 00:58 | 110K | |
| py39-python-barcode-..> | 2023-10-09 11:20 | 188K | |
| py39-python-bareos-2..> | 2023-10-11 20:29 | 35K | |
| py39-python-bidi-0.4..> | 2023-10-07 19:13 | 19K | |
| py39-python-binance-..> | 2023-10-14 08:41 | 90K | |
| py39-python-binary-m..> | 2023-10-14 17:24 | 24K | |
| py39-python-bitcoinl..> | 2023-10-07 20:36 | 152K | |
| py39-python-bitcoinr..> | 2023-10-09 22:57 | 6.6K | |
| py39-python-bugzilla..> | 2023-10-08 06:52 | 85K | |
| py39-python-ceilomet..> | 2023-10-10 10:38 | 141K | |
| py39-python-cindercl..> | 2023-10-08 04:18 | 306K | |
| py39-python-consul-1..> | 2023-10-10 22:31 | 34K | |
| py39-python-consul2-..> | 2023-10-14 04:08 | 44K | |
| py39-python-crontab-..> | 2023-10-09 02:18 | 36K | |
| py39-python-dbusmock..> | 2023-10-10 06:51 | 81K | |
| py39-python-decouple..> | 2023-10-08 17:22 | 12K | |
| py39-python-designat..> | 2023-10-10 08:17 | 88K | |
| py39-python-digitalo..> | 2023-10-07 14:56 | 43K | |
| py39-python-distutil..> | 2023-10-07 00:26 | 24K | |
| py39-python-djvulibr..> | 2023-10-10 20:27 | 206K | |
| py39-python-docs-the..> | 2023-10-07 20:01 | 7.9K | |
| py39-python-docx-0.8..> | 2023-10-06 23:22 | 225K | |
| py39-python-dotenv-1..> | 2023-10-07 00:53 | 26K | |
| py39-python-dtrace-0..> | 2023-10-08 18:21 | 52K | |
| py39-python-easyconf..> | 2023-10-07 04:27 | 6.0K | |
| py39-python-editor-1..> | 2023-10-07 09:57 | 4.6K | |
| py39-python-engineio..> | 2023-10-06 16:36 | 64K | |
| py39-python-fcl-0.0...> | 2023-10-07 00:40 | 77K | |
| py39-python-gdsii-0...> | 2023-10-14 18:49 | 24K | |
| py39-python-geohash-..> | 2023-10-14 16:45 | 20K | |
| py39-python-gettext-..> | 2023-10-09 03:25 | 12K | |
| py39-python-gflags-3..> | 2023-10-09 17:38 | 65K | |
| py39-python-gilt-1.2..> | 2023-10-10 16:41 | 14K | |
| py39-python-gist-0.1..> | 2023-10-08 22:07 | 22K | |
| py39-python-gitlab-3..> | 2023-10-08 05:42 | 844K | |
| py39-python-glancecl..> | 2023-10-08 01:27 | 258K | |
| py39-python-gnupg-0...> | 2023-10-07 01:15 | 30K | |
| py39-python-gvm-23.5..> | 2023-10-07 08:00 | 283K | |
| py39-python-heatclie..> | 2023-10-09 06:18 | 274K | |
| py39-python-jenkins-..> | 2023-10-07 21:06 | 36K | |
| py39-python-jose-3.3..> | 2023-10-06 22:03 | 45K | |
| py39-python-json-log..> | 2023-10-06 09:32 | 9.0K | |
| py39-python-jsonrpc-..> | 2023-10-11 06:14 | 12K | |
| py39-python-keystone..> | 2023-10-06 23:46 | 411K | |
| py39-python-lhafile-..> | 2023-10-07 19:04 | 15K | |
| py39-python-libsbml-..> | 2023-10-07 20:09 | 4.7M | |
| py39-python-louvain-..> | 2023-10-06 22:45 | 12K | |
| py39-python-lsp-blac..> | 2023-10-07 03:48 | 7.5K | |
| py39-python-lsp-json..> | 2023-10-06 17:54 | 13K | |
| py39-python-lsp-serv..> | 2023-10-06 19:39 | 100K | |
| py39-python-ly-0.9.8..> | 2023-10-07 10:26 | 308K | |
| py39-python-lzo-1.15..> | 2023-10-08 15:33 | 6.6K | |
| py39-python-magic-0...> | 2023-10-07 07:57 | 16K | |
| py39-python-markdown..> | 2023-10-07 03:58 | 7.0K | |
| py39-python-memcache..> | 2023-10-08 11:16 | 23K | |
| py39-python-mimepars..> | 2023-10-07 01:35 | 5.5K | |
| py39-python-mpd2-3.1..> | 2023-10-07 19:13 | 65K | |
| py39-python-multipar..> | 2023-10-06 15:40 | 53K | |
| py39-python-neutronc..> | 2023-10-07 12:12 | 316K | |
| py39-python-nexus-1...> | 2023-10-14 04:56 | 74K | |
| py39-python-nomad-1...> | 2023-10-09 22:48 | 28K | |
| py39-python-novaclie..> | 2023-10-07 14:46 | 409K | |
| py39-python-nss-1.0...> | 2023-10-06 23:17 | 189K | |
| py39-python-obelisk-..> | 2023-10-11 11:42 | 56K | |
| py39-python-openid-2..> | 2023-10-09 02:41 | 165K | |
| py39-python-openstac..> | 2023-10-14 06:53 | 1.1M | |
| py39-python-pam-1.8...> | 2023-10-07 02:16 | 6.2K | |
| py39-python-pcre-0.7..> | 2023-10-14 12:09 | 16K | |
| py39-python-picard-0..> | 2023-10-10 07:21 | 18K | |
| py39-python-pkcs11-0..> | 2023-10-10 08:00 | 236K | |
| py39-python-poppler-..> | 2023-10-07 06:13 | 91K | |
| py39-python-pptx-0.6..> | 2023-10-08 05:15 | 537K | |
| py39-python-ptrace-0..> | 2023-10-08 16:28 | 118K | |
| py39-python-rapidjso..> | 2023-10-06 19:19 | 160K | |
| py39-python-registry..> | 2023-10-11 19:21 | 140K | |
| py39-python-rpm-pack..> | 2023-10-14 17:29 | 8.8K | |
| py39-python-slimta-5..> | 2023-10-07 17:09 | 133K | |
| py39-python-slugify-..> | 2023-10-06 17:57 | 11K | |
| py39-python-snappy-0..> | 2023-10-07 11:11 | 22K | |
| py39-python-socketio..> | 2023-10-06 20:34 | 57K | |
| py39-python-socks-2...> | 2023-10-06 09:56 | 48K | |
| py39-python-sql-1.4...> | 2023-10-08 14:15 | 65K | |
| py39-python-statsd-2..> | 2023-10-10 17:12 | 14K | |
| py39-python-subunit-..> | 2023-10-08 11:45 | 133K | |
| py39-python-swiftcli..> | 2023-10-08 09:37 | 120K | |
| py39-python-telegram..> | 2023-10-11 02:52 | 365K | |
| py39-python-tools-3...> | 2023-10-09 20:41 | 11K | |
| py39-python-twitter-..> | 2023-10-11 12:57 | 81K | |
| py39-python-utils-3...> | 2023-10-07 00:22 | 34K | |
| py39-python-xapp-2.2..> | 2023-10-07 09:11 | 21K | |
| py39-python-xlib-0.3..> | 2023-10-06 20:06 | 207K | |
| py39-python-xmp-tool..> | 2023-10-08 12:42 | 33K | |
| py39-python3-openid-..> | 2023-10-06 18:34 | 167K | |
| py39-python3-saml-1...> | 2023-10-06 18:33 | 106K | |
| py39-pythonbrew-1.3_..> | 2023-10-14 15:46 | 65K | |
| py39-pythondialog-3...> | 2023-10-09 11:25 | 74K | |
| py39-pythonfinder-2...> | 2023-10-10 12:16 | 45K | |
| py39-pythontidy-1.23..> | 2023-10-11 16:36 | 23K | |
| py39-pythran-0.14.0.pkg | 2023-10-06 10:09 | 1.6M | |
| py39-pytidylib-0.3.2..> | 2023-10-09 05:29 | 9.7K | |
| py39-pytils-0.3.pkg | 2023-10-06 20:27 | 56K | |
| py39-pytimeparse-1.1..> | 2023-10-06 16:14 | 11K | |
| py39-pytkdocs-0.16.1..> | 2023-10-07 00:31 | 55K | |
| py39-pytoml-0.1.21.pkg | 2023-10-14 04:40 | 14K | |
| py39-pytoolconfig-1...> | 2023-10-06 15:31 | 22K | |
| py39-pytools-2022.1...> | 2023-10-07 07:51 | 107K | |
| py39-pytoport-0.4.1...> | 2023-10-08 20:36 | 10K | |
| py39-pytorch-2.0.1.pkg | 2023-10-06 21:25 | 34M | |
| py39-pytorch-lightni..> | 2023-10-10 16:17 | 707K | |
| py39-pytorchvideo-0...> | 2023-10-09 10:54 | 202K | |
| py39-pytradfri-13.0...> | 2023-10-10 05:54 | 55K | |
| py39-pytrie-0.4.0.pkg | 2023-10-07 07:10 | 8.5K | |
| py39-pytsk-20210419.pkg | 2023-10-07 01:04 | 335K | |
| py39-pyttsx3-2.90.12..> | 2023-10-09 00:26 | 42K | |
| py39-pytvmaze-2.0.8.pkg | 2023-10-14 06:52 | 20K | |
| py39-pytweening-1.0...> | 2023-10-07 00:00 | 8.0K | |
| py39-pytz-2023.3,1.pkg | 2023-10-05 17:16 | 153K | |
| py39-pytz-deprecatio..> | 2023-10-06 17:16 | 17K | |
| py39-pytzdata-2020.1..> | 2023-10-07 08:29 | 134K | |
| py39-pyu2f-0.1.5.pkg | 2023-10-08 17:23 | 41K | |
| py39-pyudev-0.22.0.pkg | 2023-10-05 17:27 | 52K | |
| py39-pyunpack-0.3.pkg | 2023-10-07 23:41 | 5.1K | |
| py39-pyupgrade-3.11...> | 2023-10-09 20:48 | 78K | |
| py39-pyusb-1.2.1.pkg | 2023-10-07 02:06 | 76K | |
| py39-pyvcd-0.4.0.pkg | 2023-10-08 04:55 | 37K | |
| py39-pyvex-9.0.5405.pkg | 2023-10-07 05:17 | 1.4M | |
| py39-pyvips-2.2.1_1.pkg | 2023-10-09 18:29 | 93K | |
| py39-pyvirtualdispla..> | 2023-10-08 21:37 | 16K | |
| py39-pyvisa-1.13.0_1..> | 2023-10-08 04:21 | 249K | |
| py39-pyvisa-py-0.7.0..> | 2023-10-09 15:22 | 101K | |
| py39-pyvista-0.34.2_..> | 2023-10-09 06:09 | 1.4M | |
| py39-pywal-3.3.0_2.pkg | 2023-10-07 12:52 | 62K | |
| py39-pywapi-0.3.8.pkg | 2023-10-10 07:30 | 18K | |
| py39-pywatchman-2023..> | 2023-10-08 19:11 | 46K | |
| py39-pywdns-0.10.1_2..> | 2023-10-14 13:00 | 53K | |
| py39-pyweblib-1.3.13..> | 2023-10-08 21:54 | 42K | |
| py39-pywgsim-0.5.2.pkg | 2023-10-07 11:50 | 61K | |
| py39-pywikibot-8.3.1..> | 2023-10-08 16:48 | 878K | |
| py39-pywinrm-0.4.1.pkg | 2023-10-14 04:14 | 53K | |
| py39-pyx-0.16.pkg | 2023-10-10 03:59 | 505K | |
| py39-pyx12-2.3.3.pkg | 2023-10-10 20:21 | 285K | |
| py39-pyxb-x-1.2.6.1.pkg | 2023-10-08 16:51 | 433K | |
| py39-pyxlsb2-0.0.9.pkg | 2023-10-07 18:56 | 60K | |
| py39-pyyaml-include-..> | 2023-10-07 21:14 | 21K | |
| py39-pyyaml5-5.4.1.pkg | 2023-10-09 14:50 | 149K | |
| py39-pyyaml_env_tag-..> | 2023-10-06 13:41 | 2.5K | |
| py39-pyzabbix-1.2.1.pkg | 2023-10-10 17:08 | 9.2K | |
| py39-pyzipper-0.3.5_..> | 2023-10-09 15:24 | 48K | |
| py39-pyzmail-1.0.3.pkg | 2023-10-14 13:16 | 39K | |
| py39-pyzmq-25.0.2.pkg | 2023-10-06 08:47 | 359K | |
| py39-pyznap-1.6.0.pkg | 2023-10-14 05:18 | 37K | |
| py39-pyzor-1.0.0_2.pkg | 2023-10-10 05:20 | 52K | |
| py39-q-2.7.pkg | 2023-10-10 06:03 | 11K | |
| py39-qasync-0.24.0.pkg | 2023-10-06 13:53 | 23K | |
| py39-qats-4.11.1.pkg | 2023-10-09 01:36 | 151K | |
| py39-qcelemental-0.2..> | 2023-10-06 21:55 | 460K | |
| py39-qcengine-0.27.0..> | 2023-10-06 23:53 | 447K | |
| py39-qcs-api-client-..> | 2023-10-07 06:58 | 107K | |
| py39-qdldl-0.1.5.pos..> | 2023-10-06 23:47 | 71K | |
| py39-qmk-1.0.0_1.pkg | 2023-10-14 08:09 | 20K | |
| py39-qpageview-0.6.2..> | 2023-10-07 17:19 | 147K | |
| py39-qrcode-7.4.pkg | 2023-10-07 05:37 | 68K | |
| py39-qrencode-1.2.pkg | 2023-10-14 06:03 | 5.2K | |
| py39-qspin-2.3.3.pkg | 2023-10-14 16:23 | 30K | |
| py39-qstylizer-0.2.2..> | 2023-10-07 08:37 | 41K | |
| py39-qt5-5.15.9_2.pkg | 2023-10-09 04:40 | 612 | |
| py39-qt5-chart-5.15...> | 2023-10-07 13:43 | 170K | |
| py39-qt5-networkauth..> | 2023-10-07 12:40 | 47K | |
| py39-qt5-pyqt-5.15.9..> | 2023-10-06 16:44 | 3.9M | |
| py39-qt5-qscintilla2..> | 2023-10-07 19:14 | 253K | |
| py39-qt5-sip-12.11.1..> | 2023-10-06 09:52 | 55K | |
| py39-qt5-webengine-5..> | 2023-10-06 23:22 | 117K | |
| py39-qt6-3d-6.5.0.pkg | 2023-10-08 06:52 | 444K | |
| py39-qt6-6.5.2.pkg | 2023-10-14 04:52 | 628 | |
| py39-qt6-chart-6.5.0..> | 2023-10-07 12:08 | 157K | |
| py39-qt6-datavis3d-6..> | 2023-10-07 12:05 | 136K | |
| py39-qt6-networkauth..> | 2023-10-08 08:00 | 47K | |
| py39-qt6-pyqt-6.5.2.pkg | 2023-10-07 11:49 | 3.6M | |
| py39-qt6-qscintilla2..> | 2023-10-10 09:11 | 260K | |
| py39-qt6-sip-13.5.2_..> | 2023-10-06 21:53 | 50K | |
| py39-qt6-webengine-6..> | 2023-10-07 21:53 | 117K | |
| py39-qtbuilder-1.15...> | 2023-10-06 09:31 | 2.6M | |
| py39-qtconsole-5.4.4..> | 2023-10-07 07:10 | 167K | |
| py39-qtile-0.18.1_3.pkg | 2023-10-09 17:12 | 508K | |
| py39-qtqr-2.0.b39_11..> | 2023-10-09 09:03 | 43K | |
| py39-quadprog-0.1.11..> | 2023-10-14 17:37 | 69K | |
| py39-quantecon-0.7.1..> | 2023-10-06 22:54 | 262K | |
| py39-quantities-0.14..> | 2023-10-07 14:19 | 128K | |
| py39-queries-2.1.1.pkg | 2023-10-10 06:53 | 29K | |
| py39-querystring-par..> | 2023-10-09 17:15 | 11K | |
| py39-questionary-1.1..> | 2023-10-08 00:13 | 36K | |
| py39-queuelib-1.6.2.pkg | 2023-10-07 16:30 | 20K | |
| py39-quilt3-5.3.1.pkg | 2023-10-09 09:37 | 116K | |
| py39-quodlibet-4.3.0..> | 2023-10-08 15:05 | 1.8M | |
| py39-qutip-4.7.3.pkg | 2023-10-07 14:32 | 2.5M | |
| py39-rabbitpy-1.0.0.pkg | 2023-10-10 03:29 | 68K | |
| py39-radicale-3.1.8_..> | 2023-10-11 13:50 | 134K | |
| py39-radix-0.10.0.pkg | 2023-10-07 06:04 | 21K | |
| py39-raet-0.6.8_1.pkg | 2023-10-09 02:19 | 244K | |
| py39-railroad-diagra..> | 2023-10-09 16:49 | 25K | |
| py39-ramlfications-0..> | 2023-10-10 20:54 | 64K | |
| py39-random2-1.0.1.pkg | 2023-10-06 14:16 | 17K | |
| py39-ranger-1.9.3.pkg | 2023-10-09 16:45 | 344K | |
| py39-rapidfuzz-3.2.0..> | 2023-10-06 19:17 | 1.3M | |
| py39-rapidfuzz-capi-..> | 2023-10-06 17:05 | 4.2K | |
| py39-rarfile-4.0.pkg | 2023-10-08 02:31 | 49K | |
| py39-rasterio-1.3.8.pkg | 2023-10-06 20:11 | 777K | |
| py39-rasterstats-0.1..> | 2023-10-07 02:10 | 24K | |
| py39-ratelim-0.1.6.pkg | 2023-10-06 22:58 | 4.0K | |
| py39-ratelimiter-1.2..> | 2023-10-07 23:47 | 5.2K | |
| py39-rauth-0.7.2_1.pkg | 2023-10-10 06:06 | 21K | |
| py39-raven-6.10.0_1.pkg | 2023-10-07 03:42 | 291K | |
| py39-rawkit-0.6.0.pkg | 2023-10-07 12:55 | 34K | |
| py39-rb-1.10.0.pkg | 2023-10-09 08:02 | 37K | |
| py39-rbtools-2.0_1.pkg | 2023-10-07 15:24 | 337K | |
| py39-rchitect-0.3.40..> | 2023-10-07 15:13 | 75K | |
| py39-rcssmin-1.1.1.pkg | 2023-10-07 07:30 | 18K | |
| py39-rdflib-6.3.2.pkg | 2023-10-06 14:29 | 636K | |
| py39-rdiff-backup-2...> | 2023-10-09 13:10 | 431K | |
| py39-re-assert-1.1.0..> | 2023-10-09 00:02 | 4.5K | |
| py39-readability-lxm..> | 2023-10-08 21:51 | 24K | |
| py39-readchar-3.0.5.pkg | 2023-10-09 06:28 | 8.4K | |
| py39-readme-renderer..> | 2023-10-06 15:19 | 12K | |
| py39-readtime-3.0.0.pkg | 2023-10-07 08:29 | 7.4K | |
| py39-rebulk-3.2.0.pkg | 2023-10-07 07:28 | 86K | |
| py39-recaptcha-1.0.6..> | 2023-10-09 05:46 | 6.1K | |
| py39-recommonmark-0...> | 2023-10-05 21:06 | 17K | |
| py39-recordclass-0.2..> | 2023-10-07 01:32 | 118K | |
| py39-rectangle-packe..> | 2023-10-06 17:55 | 45K | |
| py39-recurring-ical-..> | 2023-10-07 10:11 | 19K | |
| py39-redis-5.0.0.pkg | 2023-10-06 19:39 | 332K | |
| py39-redis2-2.10.6_2..> | 2023-10-07 03:27 | 84K | |
| py39-redis3-3.5.3.pkg | 2023-10-10 14:08 | 104K | |
| py39-redis4-4.6.0.pkg | 2023-10-09 04:07 | 320K | |
| py39-rednose-1.3.0.pkg | 2023-10-14 14:27 | 19K | |
| py39-reedsolo-1.6.0.pkg | 2023-10-07 19:33 | 172K | |
| py39-referencing-0.3..> | 2023-10-06 08:12 | 45K | |
| py39-regex-2022.9.13..> | 2023-10-06 10:59 | 281K | |
| py39-regress-0.4.1_1..> | 2023-10-07 11:12 | 273K | |
| py39-reindent-3.5.1.pkg | 2023-10-08 17:37 | 8.4K | |
| py39-relatorio-0.10...> | 2023-10-11 00:50 | 293K | |
| py39-remote-pdb-2.1...> | 2023-10-14 11:46 | 6.9K | |
| py39-rencode-1.0.6_1..> | 2023-10-07 08:14 | 36K | |
| py39-reno-2.9.2_2.pkg | 2023-10-06 14:27 | 83K | |
| py39-reportlab-3.6.1..> | 2023-10-06 23:14 | 2.4M | |
| py39-repoze.lru-0.7.pkg | 2023-10-06 14:42 | 17K | |
| py39-repoze.sphinx.a..> | 2023-10-07 04:16 | 7.2K | |
| py39-repoze.tm2-2.1,..> | 2023-10-14 11:24 | 12K | |
| py39-repoze.who-2.4.pkg | 2023-10-07 03:53 | 98K | |
| py39-repoze.xmliter-..> | 2023-10-08 06:38 | 8.9K | |
| py39-represent-1.6.0..> | 2023-10-07 11:49 | 16K | |
| py39-requests-2.31.0..> | 2023-10-05 21:02 | 82K | |
| py39-requests-aws4au..> | 2023-10-08 10:01 | 21K | |
| py39-requests-cache-..> | 2023-10-07 05:59 | 83K | |
| py39-requests-cache0..> | 2023-10-07 04:52 | 66K | |
| py39-requests-cache9..> | 2023-10-07 03:27 | 63K | |
| py39-requests-credss..> | 2023-10-08 01:48 | 18K | |
| py39-requests-file-1..> | 2023-10-06 19:41 | 4.5K | |
| py39-requests-ftp-0...> | 2023-10-06 18:36 | 10K | |
| py39-requests-future..> | 2023-10-07 08:06 | 8.0K | |
| py39-requests-gssapi..> | 2023-10-07 21:31 | 14K | |
| py39-requests-kerber..> | 2023-10-07 13:39 | 13K | |
| py39-requests-mock-1..> | 2023-10-14 18:50 | 28K | |
| py39-requests-oauthl..> | 2023-10-06 16:22 | 26K | |
| py39-requests-toolbe..> | 2023-10-06 13:48 | 60K | |
| py39-requests-unixso..> | 2023-10-07 10:17 | 10K | |
| py39-requests-wsgi-a..> | 2023-10-11 00:57 | 5.7K | |
| py39-requests_ntlm-1..> | 2023-10-06 18:20 | 7.8K | |
| py39-requestsexcepti..> | 2023-10-06 16:14 | 2.7K | |
| py39-requirements-de..> | 2023-10-07 13:20 | 31K | |
| py39-requirementslib..> | 2023-10-10 20:31 | 157K | |
| py39-resample-1.6.0.pkg | 2023-10-10 14:04 | 25K | |
| py39-resampy-0.4.2_1..> | 2023-10-08 14:18 | 2.4M | |
| py39-resdk-19.0.1.pkg | 2023-10-07 00:12 | 101K | |
| py39-resolve-march-n..> | 2023-10-10 04:49 | 12K | |
| py39-resolvelib-0.8...> | 2023-10-06 20:18 | 19K | |
| py39-resolvelib05-0...> | 2023-10-11 17:20 | 18K | |
| py39-resolvelib07-0...> | 2023-10-08 19:32 | 19K | |
| py39-resolvelib1-1.0..> | 2023-10-08 04:33 | 21K | |
| py39-resolver-0.2.1_..> | 2023-10-08 06:43 | 3.1K | |
| py39-resource-0.2.1_..> | 2023-10-08 06:03 | 34K | |
| py39-responses-0.23...> | 2023-10-07 16:23 | 77K | |
| py39-respx-0.20.2.pkg | 2023-10-08 02:47 | 40K | |
| py39-restclient-0.11..> | 2023-10-10 09:52 | 13K | |
| py39-restructuredtex..> | 2023-10-09 22:33 | 15K | |
| py39-retry2-0.9.5.pkg | 2023-10-07 06:48 | 4.7K | |
| py39-retrying-1.3.4.pkg | 2023-10-06 16:50 | 8.8K | |
| py39-reverend-0.3.pkg | 2023-10-14 17:56 | 23K | |
| py39-rfc3339-6.2.pkg | 2023-10-06 19:48 | 7.6K | |
| py39-rfc3339-validat..> | 2023-10-06 09:53 | 2.7K | |
| py39-rfc3986-1.5.0,1..> | 2023-10-06 12:15 | 38K | |
| py39-rfc3986-validat..> | 2023-10-06 09:45 | 3.4K | |
| py39-rfc3987-1.3.8.pkg | 2023-10-07 23:52 | 11K | |
| py39-rfc6555-0.1.0.pkg | 2023-10-08 06:03 | 8.4K | |
| py39-rich-13.5.3.pkg | 2023-10-06 13:59 | 354K | |
| py39-rich-cli-1.8.0_..> | 2023-10-09 17:41 | 23K | |
| py39-rich-click-1.6...> | 2023-10-07 01:22 | 23K | |
| py39-rich-rst-1.1.7.pkg | 2023-10-07 16:04 | 16K | |
| py39-rich12-12.6.0_1..> | 2023-10-07 07:45 | 349K | |
| py39-ripe.atlas.cous..> | 2023-10-07 17:30 | 29K | |
| py39-ripe.atlas.saga..> | 2023-10-08 03:15 | 47K | |
| py39-ripe.atlas.tool..> | 2023-10-09 15:33 | 90K | |
| py39-rjsmin-1.2.1.pkg | 2023-10-07 07:45 | 14K | |
| py39-rmf-1.5.1.pkg | 2023-10-08 22:57 | 1.2M | |
| py39-rmsd-1.4_1.pkg | 2023-10-07 11:45 | 25K | |
| py39-rnc2rng-2.6.6.pkg | 2023-10-07 03:26 | 20K | |
| py39-ro-3.6.9_5.pkg | 2023-10-09 04:42 | 747K | |
| py39-robotframework-..> | 2023-10-07 02:38 | 720K | |
| py39-robotframework-..> | 2023-10-09 06:33 | 12K | |
| py39-robotframework-..> | 2023-10-08 17:08 | 74K | |
| py39-robotframework-..> | 2023-10-08 02:32 | 10K | |
| py39-robotframework-..> | 2023-10-09 22:35 | 24K | |
| py39-robotframework-..> | 2023-10-09 10:13 | 99K | |
| py39-robotframework-..> | 2023-10-08 00:21 | 6.2K | |
| py39-robotremoteserv..> | 2023-10-09 18:13 | 17K | |
| py39-rollbar-0.16.3.pkg | 2023-10-10 14:33 | 141K | |
| py39-roman-4.1.pkg | 2023-10-07 17:54 | 5.5K | |
| py39-rope-1.7.0_1.pkg | 2023-10-06 18:28 | 329K | |
| py39-ropgadget-7.4.pkg | 2023-10-08 07:29 | 42K | |
| py39-ropper-1.13.7.pkg | 2023-10-08 10:30 | 125K | |
| py39-ros-catkin-0.8...> | 2023-10-14 18:27 | 43K | |
| py39-ros-catkin_pkg-..> | 2023-10-07 04:43 | 87K | |
| py39-ros-rosdep-0.21..> | 2023-10-09 17:09 | 105K | |
| py39-ros-rosdistro-0..> | 2023-10-07 14:39 | 71K | |
| py39-ros-rosinstall_..> | 2023-10-12 11:15 | 20K | |
| py39-ros-rospkg-1.4...> | 2023-10-07 08:28 | 47K | |
| py39-ros-vcstool-0.3..> | 2023-10-14 18:43 | 53K | |
| py39-ros-vcstools-0...> | 2023-10-07 17:23 | 54K | |
| py39-ros-wstool-0.1...> | 2023-10-09 12:11 | 68K | |
| py39-rose-1.0.0_1.pkg | 2023-10-08 17:47 | 2.7K | |
| py39-routes-2.5.1.pkg | 2023-10-06 15:52 | 51K | |
| py39-rpcq-3.11.0_1.pkg | 2023-10-07 04:27 | 55K | |
| py39-rpds-py-0.10.0_..> | 2023-10-06 08:11 | 226K | |
| py39-rply-0.7.7.pkg | 2023-10-06 21:22 | 25K | |
| py39-rpy2-3.5.14.pkg | 2023-10-07 11:05 | 378K | |
| py39-rpyc-5.3.1_1.pkg | 2023-10-08 07:14 | 109K | |
| py39-rq-1.11.1.pkg | 2023-10-07 03:33 | 109K | |
| py39-rq-scheduler-0...> | 2023-10-09 16:40 | 18K | |
| py39-rrdtool-0.1.16.pkg | 2023-10-09 19:47 | 11K | |
| py39-rsa-4.9.pkg | 2023-10-06 11:23 | 40K | |
| py39-rss2email-3.14.pkg | 2023-10-09 07:52 | 68K | |
| py39-rss2gen-1.1.pkg | 2023-10-07 18:33 | 8.6K | |
| py39-rst2ansi-0.1.5.pkg | 2023-10-10 19:33 | 21K | |
| py39-rst2html5-2.0.pkg | 2023-10-10 20:12 | 31K | |
| py39-rstr-3.2.1.pkg | 2023-10-07 01:41 | 12K | |
| py39-rtf-0.45.pkg | 2023-10-08 15:50 | 47K | |
| py39-rtree-1.0.1_1.pkg | 2023-10-06 20:19 | 37K | |
| py39-rtslib-fb-2.1.7..> | 2023-10-07 10:17 | 69K | |
| py39-ruamel.yaml-0.1..> | 2023-10-06 17:31 | 177K | |
| py39-ruamel.yaml.cli..> | 2023-10-06 15:01 | 105K | |
| py39-rubymarshal-1.2..> | 2023-10-14 07:22 | 15K | |
| py39-ruffus-2.8.3.pkg | 2023-10-10 03:27 | 300K | |
| py39-rules-2.0.1.pkg | 2023-10-09 11:04 | 24K | |
| py39-rush-2021.4.0.pkg | 2023-10-08 07:57 | 22K | |
| py39-rustworkx-0.13...> | 2023-10-06 13:54 | 948K | |
| py39-rvlib-0.0.6_1.pkg | 2023-10-10 18:46 | 124K | |
| py39-rx-3.2.0.pkg | 2023-10-11 03:43 | 199K | |
| py39-rx1-1.6.1.pkg | 2023-10-06 18:04 | 178K | |
| py39-ryu-4.26_2.pkg | 2023-10-14 07:41 | 1.5M | |
| py39-s2-0.10.0_1.pkg | 2023-10-14 07:54 | 91K | |
| py39-s3cmd-2.3.0.pkg | 2023-10-14 05:12 | 176K | |
| py39-s3transfer-0.6...> | 2023-10-06 16:12 | 94K | |
| py39-s4cmd-2.1.0.11.pkg | 2023-10-14 07:55 | 42K | |
| py39-sabctools-7.1.1..> | 2023-10-08 04:16 | 58K | |
| py39-safe-0.4.pkg | 2023-10-10 22:56 | 48K | |
| py39-salt-3006.2.pkg | 2023-10-08 01:47 | 12M | |
| py39-saltyrtc.server..> | 2023-10-08 20:28 | 65K | |
| py39-saneyaml-0.6.0.pkg | 2023-10-09 16:24 | 14K | |
| py39-sarge-0.1.6.pkg | 2023-10-09 21:56 | 30K | |
| py39-sarif-om-1.0.4.pkg | 2023-10-08 10:09 | 22K | |
| py39-sbws-1.7.0.pkg | 2023-10-09 18:42 | 129K | |
| py39-scandir-1.10.0_..> | 2023-10-06 21:58 | 20K | |
| py39-scantree-0.0.1.pkg | 2023-10-07 02:23 | 18K | |
| py39-scarab-0.1.3.pkg | 2023-10-09 17:55 | 28K | |
| py39-scgi-2.2_1.pkg | 2023-10-11 00:18 | 24K | |
| py39-schedule-1.2.0.pkg | 2023-10-08 10:07 | 15K | |
| py39-scheduler-0.8.4..> | 2023-10-14 16:05 | 37K | |
| py39-schema-0.7.5.pkg | 2023-10-08 02:41 | 23K | |
| py39-schematics-patc..> | 2023-10-14 08:04 | 49K | |
| py39-scikit-base-0.5..> | 2023-10-14 10:50 | 157K | |
| py39-scikit-bio-0.5...> | 2023-10-14 03:46 | 1.1M | |
| py39-scikit-build-0...> | 2023-10-06 12:52 | 87K | |
| py39-scikit-build-co..> | 2023-10-07 06:56 | 138K | |
| py39-scikit-fem-8.1...> | 2023-10-09 14:42 | 205K | |
| py39-scikit-fusion-0..> | 2023-10-07 12:52 | 6.4M | |
| py39-scikit-fuzzy-0...> | 2023-10-09 16:17 | 753K | |
| py39-scikit-image-0...> | 2023-10-07 09:01 | 9.3M | |
| py39-scikit-learn-1...> | 2023-10-06 17:49 | 6.6M | |
| py39-scikit-optimize..> | 2023-10-09 05:24 | 114K | |
| py39-scikit-sparse-0..> | 2023-10-06 12:56 | 258K | |
| py39-scimath-5.0.0_1..> | 2023-10-08 13:00 | 148K | |
| py39-scipy-1.11.1.pkg | 2023-10-06 12:47 | 40M | |
| py39-scooby-0.5.12.pkg | 2023-10-08 04:50 | 18K | |
| py39-scoria-1.0.5_1.pkg | 2023-10-08 12:12 | 3.7M | |
| py39-scour-0.38.2.pkg | 2023-10-07 09:57 | 75K | |
| py39-scp-0.14.4.pkg | 2023-10-07 03:40 | 13K | |
| py39-scramp-1.4.4.pkg | 2023-10-07 12:07 | 19K | |
| py39-screeninfo-0.8...> | 2023-10-09 13:09 | 16K | |
| py39-scripttest-1.3...> | 2023-10-09 18:59 | 13K | |
| py39-scrypt-0.8.20.pkg | 2023-10-14 06:11 | 32K | |
| py39-scs-3.2.0_1.pkg | 2023-10-08 06:56 | 62K | |
| py39-sdf-0.1_2.pkg | 2023-10-09 17:08 | 250K | |
| py39-seaborn-0.11.2_..> | 2023-10-07 00:29 | 458K | |
| py39-seafdav-9.0.10.pkg | 2023-10-08 03:11 | 230K | |
| py39-seafobj-9.0.10.pkg | 2023-10-08 06:29 | 34K | |
| py39-secp256k1-0.13...> | 2023-10-07 16:17 | 21K | |
| py39-secure-0.3.0.pkg | 2023-10-06 23:02 | 13K | |
| py39-secure-cookie-0..> | 2023-10-08 04:29 | 15K | |
| py39-securesystemsli..> | 2023-10-08 04:10 | 828K | |
| py39-segregation-2.4..> | 2023-10-07 16:39 | 115K | |
| py39-segyio-1.9.11_1..> | 2023-10-10 08:35 | 81K | |
| py39-selection-0.0.1..> | 2023-10-08 09:39 | 7.8K | |
| py39-selector-0.10.1..> | 2023-10-09 20:42 | 10K | |
| py39-selenium-3.141...> | 2023-10-07 01:25 | 776K | |
| py39-selenium-wire-5..> | 2023-10-09 07:03 | 309K | |
| py39-semantic-versio..> | 2023-10-05 17:15 | 24K | |
| py39-semiphemeral-0...> | 2023-10-14 06:39 | 75K | |
| py39-semver-3.0.1.pkg | 2023-10-06 17:41 | 24K | |
| py39-send2trash-1.8...> | 2023-10-06 10:13 | 20K | |
| py39-sentencepiece-0..> | 2023-10-10 13:58 | 83K | |
| py39-sentinelhub-3.9..> | 2023-10-08 23:33 | 234K | |
| py39-sentry-sdk-1.21..> | 2023-10-07 02:36 | 254K | |
| py39-seqdiag-3.0.0.pkg | 2023-10-14 13:23 | 2.1M | |
| py39-serializable-0...> | 2023-10-08 21:33 | 11K | |
| py39-seriate-1.1.2_1..> | 2023-10-14 09:37 | 6.1K | |
| py39-serpent-1.28.pkg | 2023-10-07 10:45 | 15K | |
| py39-serverfiles-0.3..> | 2023-10-06 20:25 | 11K | |
| py39-service-identit..> | 2023-10-14 09:24 | 16K | |
| py39-service_identit..> | 2023-10-06 09:11 | 14K | |
| py39-session-info-1...> | 2023-10-10 08:43 | 10K | |
| py39-setoptconf-0.3...> | 2023-10-08 01:09 | 17K | |
| py39-setproctitle-1...> | 2023-10-07 04:00 | 11K | |
| py39-setuptools-63.1..> | 2023-10-05 17:14 | 1.1M | |
| py39-setuptools-decl..> | 2023-10-08 06:28 | 9.5K | |
| py39-setuptools-gett..> | 2023-10-14 08:00 | 4.5K | |
| py39-setuptools-git-..> | 2023-10-07 01:27 | 12K | |
| py39-setuptools-pkg-..> | 2023-10-08 09:01 | 16K | |
| py39-setuptools-rust..> | 2023-10-05 20:53 | 37K | |
| py39-setuptools58-58..> | 2023-10-08 16:20 | 803K | |
| py39-setuptools_git_..> | 2023-10-06 22:54 | 2.3K | |
| py39-setuptools_hg-0..> | 2023-10-09 23:57 | 5.2K | |
| py39-setuptools_scm-..> | 2023-10-05 17:14 | 50K | |
| py39-setuptools_scm7..> | 2023-10-06 23:26 | 59K | |
| py39-setuptools_scm_..> | 2023-10-06 09:20 | 2.5K | |
| py39-setzer-54_2.pkg | 2023-10-08 13:27 | 3.3M | |
| py39-sexpdata-1.0.1.pkg | 2023-10-07 11:17 | 13K | |
| py39-sgflib-1.0_1.pkg | 2023-10-08 04:52 | 11K | |
| py39-sgfsummary-1.0_..> | 2023-10-14 17:58 | 5.1K | |
| py39-sgmllib3k-1.0.0..> | 2023-10-07 07:14 | 10K | |
| py39-sgp4-2.22.pkg | 2023-10-06 18:12 | 142K | |
| py39-sh-1.14.3.pkg | 2023-10-07 21:37 | 62K | |
| py39-shap2-0.42.0_1.pkg | 2023-10-09 00:17 | 502K | |
| py39-shapely-1.8.5_1..> | 2023-10-06 17:38 | 117K | |
| py39-shell-gpt-0.9.4..> | 2023-10-14 15:00 | 30K | |
| py39-shellingham-1.5..> | 2023-10-06 19:07 | 12K | |
| py39-shiboken2-5.15...> | 2023-10-06 19:11 | 740K | |
| py39-shiboken6-6.5.2..> | 2023-10-07 05:57 | 1.4M | |
| py39-shodan-1.30.0.pkg | 2023-10-10 21:14 | 69K | |
| py39-shtab-1.6.4.pkg | 2023-10-09 11:55 | 22K | |
| py39-signac-2.1.0.pkg | 2023-10-10 09:24 | 172K | |
| py39-signalr-client-..> | 2023-10-08 06:05 | 9.7K | |
| py39-signedjson-1.1...> | 2023-10-07 15:31 | 8.1K | |
| py39-simhash-2.1.2.pkg | 2023-10-07 21:06 | 6.9K | |
| py39-simple-parsing-..> | 2023-10-07 09:20 | 159K | |
| py39-simple-term-men..> | 2023-10-09 22:09 | 43K | |
| py39-simpleaudio-1.0..> | 2023-10-08 02:20 | 1.6M | |
| py39-simplebayes-1.5..> | 2023-10-14 10:31 | 7.7K | |
| py39-simpleeval-0.9...> | 2023-10-06 23:44 | 19K | |
| py39-simplegeneric-0..> | 2023-10-08 02:44 | 6.0K | |
| py39-simplejson-3.18..> | 2023-10-06 17:23 | 86K | |
| py39-simpleparse-2.2..> | 2023-10-10 21:06 | 172K | |
| py39-simpletal-4.3_1..> | 2023-10-09 08:39 | 44K | |
| py39-simpy-3.0.13.pkg | 2023-10-09 07:02 | 377K | |
| py39-single-version-..> | 2023-10-10 16:52 | 3.8K | |
| py39-siosocks-0.3.0.pkg | 2023-10-14 18:03 | 20K | |
| py39-sip-6.7.9,1.pkg | 2023-10-06 10:03 | 440K | |
| py39-sip4-4.19.25_1.pkg | 2023-10-06 22:01 | 521K | |
| py39-sispy-1.1.0.pkg | 2023-10-10 07:34 | 12K | |
| py39-six-1.16.0.pkg | 2023-10-05 17:21 | 19K | |
| py39-sklearn-pandas-..> | 2023-10-10 07:25 | 15K | |
| py39-skog-0.1.0.pkg | 2023-10-11 00:50 | 7.6K | |
| py39-skrebate-0.62_1..> | 2023-10-09 18:59 | 25K | |
| py39-skyfield-1.46_1..> | 2023-10-06 18:53 | 478K | |
| py39-skyfield-data-5..> | 2023-10-07 04:16 | 15M | |
| py39-slack-sdk-3.22...> | 2023-10-14 14:29 | 285K | |
| py39-slepc4py-3.19.2..> | 2023-10-10 00:45 | 280K | |
| py39-slimit-0.8.1_2.pkg | 2023-10-10 17:40 | 96K | |
| py39-slixmpp-1.7.1.pkg | 2023-10-08 16:04 | 532K | |
| py39-slumber-0.7.1.pkg | 2023-10-06 21:47 | 11K | |
| py39-smart-open-6.4...> | 2023-10-07 03:27 | 68K | |
| py39-smartypants-2.0..> | 2023-10-05 17:19 | 11K | |
| py39-smbpasswd-1.0.2..> | 2023-10-12 07:21 | 7.2K | |
| py39-smbprotocol-1.1..> | 2023-10-09 20:14 | 173K | |
| py39-smmap-5.0.0.pkg | 2023-10-06 17:21 | 31K | |
| py39-snakeviz-2.2.0.pkg | 2023-10-08 12:53 | 159K | |
| py39-sniffio-1.3.0.pkg | 2023-10-06 08:48 | 6.0K | |
| py39-snmp_passpersis..> | 2023-10-14 09:54 | 10K | |
| py39-snmpclitools-0...> | 2023-10-10 01:17 | 36K | |
| py39-snowballstemmer..> | 2023-10-05 17:18 | 144K | |
| py39-snuggs-1.4.7_1.pkg | 2023-10-06 17:18 | 6.8K | |
| py39-soap2py-1.16.pkg | 2023-10-10 10:59 | 72K | |
| py39-soapy_power-1.6..> | 2023-10-08 06:05 | 26K | |
| py39-social-auth-app..> | 2023-10-08 10:03 | 31K | |
| py39-social-auth-cor..> | 2023-10-07 03:18 | 340K | |
| py39-socketio-client..> | 2023-10-07 03:38 | 31K | |
| py39-sockjs-tornado-..> | 2023-10-10 10:35 | 36K | |
| py39-socksio-1.0.0.pkg | 2023-10-10 07:35 | 14K | |
| py39-soco-0.29.1.pkg | 2023-10-08 04:44 | 192K | |
| py39-softlayer-6.1.7..> | 2023-10-12 11:46 | 552K | |
| py39-sonata-1.7.b1.2..> | 2023-10-09 03:27 | 392K | |
| py39-sopel-7.1.9.pkg | 2023-10-10 15:34 | 352K | |
| py39-sorl-thumbnail-..> | 2023-10-08 13:01 | 218K | |
| py39-sortedcontainer..> | 2023-10-06 08:57 | 39K | |
| py39-soundcloud-0.5...> | 2023-10-07 22:38 | 19K | |
| py39-sounddevice-0.4..> | 2023-10-09 11:28 | 44K | |
| py39-soundscrape-0.3..> | 2023-10-14 12:24 | 25K | |
| py39-soupsieve-2.0.1..> | 2023-10-06 09:00 | 52K | |
| py39-sourcemap-0.2.1..> | 2023-10-10 22:37 | 8.2K | |
| py39-south-1.0.2.pkg | 2023-10-09 21:19 | 176K | |
| py39-soxr-0.3.6_1.pkg | 2023-10-08 04:20 | 283K | |
| py39-sozipfile-0.2.0..> | 2023-10-10 09:24 | 48K | |
| py39-spacetrack-0.16..> | 2023-10-08 12:32 | 20K | |
| py39-spaghetti-1.7.4..> | 2023-10-07 03:43 | 71K | |
| py39-spake2-0.8.pkg | 2023-10-08 09:56 | 58K | |
| py39-sparqlwrapper-2..> | 2023-10-09 21:49 | 35K | |
| py39-sparse-0.14.0_1..> | 2023-10-10 13:22 | 115K | |
| py39-spdx-2.5.1.pkg | 2023-10-06 21:16 | 271K | |
| py39-spdx-lookup-0.3..> | 2023-10-07 04:25 | 7.5K | |
| py39-spdx-tools-0.7...> | 2023-10-10 02:31 | 178K | |
| py39-speaklater-1.3_..> | 2023-10-06 23:14 | 4.9K | |
| py39-spectra-0.0.11.pkg | 2023-10-07 01:55 | 27K | |
| py39-spectral-0.22.4..> | 2023-10-10 05:57 | 243K | |
| py39-speech-dispatch..> | 2023-10-07 04:48 | 54K | |
| py39-speechrecogniti..> | 2023-10-07 23:22 | 25M | |
| py39-speedtest-cli-2..> | 2023-10-08 14:10 | 33K | |
| py39-speg-0.3.pkg | 2023-10-07 07:44 | 4.6K | |
| py39-spf-engine-3.0...> | 2023-10-10 04:20 | 74K | |
| py39-spglib-2.1.0.pkg | 2023-10-06 20:02 | 18K | |
| py39-spglm-1.0.8_1.pkg | 2023-10-07 08:18 | 60K | |
| py39-sphinx-5.3.0_1,..> | 2023-10-05 21:04 | 1.7M | |
| py39-sphinx-argparse..> | 2023-10-06 11:14 | 25K | |
| py39-sphinx-autoapi-..> | 2023-10-08 03:58 | 70K | |
| py39-sphinx-autobuil..> | 2023-10-07 15:12 | 13K | |
| py39-sphinx-autodoc-..> | 2023-10-06 12:38 | 27K | |
| py39-sphinx-basic-ng..> | 2023-10-06 09:27 | 11K | |
| py39-sphinx-book-the..> | 2023-10-11 06:20 | 59K | |
| py39-sphinx-copybutt..> | 2023-10-06 09:33 | 11K | |
| py39-sphinx-design-0..> | 2023-10-06 19:18 | 850K | |
| py39-sphinx-examples..> | 2023-10-10 04:46 | 5.9K | |
| py39-sphinx-inline-t..> | 2023-10-06 09:28 | 8.9K | |
| py39-sphinx-intl-2.1..> | 2023-10-09 12:07 | 17K | |
| py39-sphinx-issues-3..> | 2023-10-07 15:19 | 10K | |
| py39-sphinx-markdown..> | 2023-10-05 17:26 | 3.4K | |
| py39-sphinx-me-0.3.pkg | 2023-10-14 08:11 | 7.6K | |
| py39-sphinx-sitemap-..> | 2023-10-10 06:37 | 6.9K | |
| py39-sphinx-tabs-3.4..> | 2023-10-06 16:20 | 12K | |
| py39-sphinx-theme-bu..> | 2023-10-09 06:37 | 913K | |
| py39-sphinx_press_th..> | 2023-10-06 18:03 | 54K | |
| py39-sphinx_rtd_them..> | 2023-10-06 13:37 | 2.5M | |
| py39-sphinx_wikipedi..> | 2023-10-10 00:34 | 1.3K | |
| py39-sphinxcontrib-a..> | 2023-10-10 09:08 | 11K | |
| py39-sphinxcontrib-a..> | 2023-10-05 17:18 | 20K | |
| py39-sphinxcontrib-a..> | 2023-10-06 20:17 | 156K | |
| py39-sphinxcontrib-b..> | 2023-10-10 21:38 | 51K | |
| py39-sphinxcontrib-b..> | 2023-10-08 08:42 | 4.5K | |
| py39-sphinxcontrib-d..> | 2023-10-05 17:18 | 14K | |
| py39-sphinxcontrib-f..> | 2023-10-07 17:14 | 4.4K | |
| py39-sphinxcontrib-h..> | 2023-10-05 17:19 | 24K | |
| py39-sphinxcontrib-h..> | 2023-10-08 12:14 | 31K | |
| py39-sphinxcontrib-i..> | 2023-10-07 09:32 | 14K | |
| py39-sphinxcontrib-j..> | 2023-10-05 17:18 | 4.9K | |
| py39-sphinxcontrib-l..> | 2023-10-08 07:15 | 5.0K | |
| py39-sphinxcontrib-n..> | 2023-10-14 12:44 | 25K | |
| py39-sphinxcontrib-n..> | 2023-10-09 01:30 | 11K | |
| py39-sphinxcontrib-p..> | 2023-10-09 15:57 | 19K | |
| py39-sphinxcontrib-q..> | 2023-10-05 17:19 | 18K | |
| py39-sphinxcontrib-s..> | 2023-10-05 17:18 | 18K | |
| py39-sphinxcontrib-s..> | 2023-10-07 06:47 | 7.9K | |
| py39-sphinxcontrib-t..> | 2023-10-06 09:46 | 15K | |
| py39-sphinxcontrib-w..> | 2023-10-08 01:31 | 43K | |
| py39-sphinxemoji-0.2..> | 2023-10-14 10:25 | 32K | |
| py39-sphinxext-openg..> | 2023-10-08 08:07 | 784K | |
| py39-spinners-0.0.24..> | 2023-10-06 21:24 | 6.1K | |
| py39-spint-1.0.7_1.pkg | 2023-10-08 04:47 | 44K | |
| py39-spktype01-1.0.0..> | 2023-10-14 05:15 | 10K | |
| py39-spktype21-0.1.0..> | 2023-10-06 16:27 | 12K | |
| py39-splinter-0.19.0..> | 2023-10-07 21:10 | 52K | |
| py39-splot-1.1.5.pos..> | 2023-10-07 17:55 | 49K | |
| py39-splunk-hec-1.81..> | 2023-10-06 23:41 | 9.5K | |
| py39-spopt-0.5.0_1.pkg | 2023-10-07 10:20 | 131K | |
| py39-spot-2.11.6.pkg | 2023-10-09 13:59 | 1.0M | |
| py39-spotipy-2.23.0.pkg | 2023-10-11 17:51 | 257K | |
| py39-spreg-1.3.2_1.pkg | 2023-10-06 21:15 | 205K | |
| py39-spvcm-0.3.0_1.pkg | 2023-10-08 02:48 | 4.6M | |
| py39-spyder-kernels-..> | 2023-10-07 07:36 | 135K | |
| py39-spyder-unittest..> | 2023-10-10 19:21 | 81K | |
| py39-spylls-0.1.7.pkg | 2023-10-09 04:19 | 1.2M | |
| py39-spyne-2.14.0_2.pkg | 2023-10-08 21:55 | 636K | |
| py39-sqlalchemy-json..> | 2023-10-08 04:45 | 9.0K | |
| py39-sqlalchemy-migr..> | 2023-10-08 06:41 | 146K | |
| py39-sqlalchemy-util..> | 2023-10-14 12:57 | 114K | |
| py39-sqlalchemy10-1...> | 2023-10-07 14:26 | 2.9M | |
| py39-sqlalchemy11-1...> | 2023-10-08 06:27 | 3.2M | |
| py39-sqlalchemy12-1...> | 2023-10-07 05:40 | 3.4M | |
| py39-sqlalchemy13-1...> | 2023-10-08 08:47 | 3.8M | |
| py39-sqlalchemy14-1...> | 2023-10-06 21:29 | 5.1M | |
| py39-sqlalchemy20-2...> | 2023-10-08 11:49 | 5.9M | |
| py39-sqlglot-17.16.2..> | 2023-10-08 03:59 | 480K | |
| py39-sqlite-fts4-1.0..> | 2023-10-07 20:24 | 7.5K | |
| py39-sqlite-utils-3...> | 2023-10-09 07:13 | 93K | |
| py39-sqlite3-3.9.18_..> | 2023-10-06 09:01 | 26K | |
| py39-sqlmap-1.3.12.pkg | 2023-10-09 03:55 | 6.7M | |
| py39-sqlobject-3.10...> | 2023-10-07 03:00 | 1.0M | |
| py39-sqlparse-0.4.4.pkg | 2023-10-06 12:33 | 59K | |
| py39-sqlrelay-1.9.3.pkg | 2023-10-10 01:58 | 24K | |
| py39-squint-0.1.0.pkg | 2023-10-10 00:47 | 59K | |
| py39-sre-yield-1.2.pkg | 2023-10-07 02:49 | 31K | |
| py39-srsly-2.4.7.pkg | 2023-10-09 13:44 | 498K | |
| py39-sseclient-0.0.2..> | 2023-10-10 16:56 | 6.7K | |
| py39-ssh-audit-3.0.0..> | 2023-10-12 08:37 | 113K | |
| py39-ssh-import-id-5..> | 2023-10-09 16:32 | 11K | |
| py39-sshpubkeys-3.3...> | 2023-10-09 16:19 | 14K | |
| py39-sshtunnel-0.1.5..> | 2023-10-08 10:00 | 32K | |
| py39-sshuttle-1.1.1.pkg | 2023-10-14 10:25 | 89K | |
| py39-sslyze-5.1.3.pkg | 2023-10-08 22:19 | 437K | |
| py39-ssm-0.0.1_1.pkg | 2023-10-09 09:18 | 211K | |
| py39-stack-data-0.6...> | 2023-10-06 10:32 | 34K | |
| py39-stackexchange-2..> | 2023-10-10 13:54 | 42K | |
| py39-starlette-0.31...> | 2023-10-06 20:51 | 115K | |
| py39-statgrab-0.7.1.pkg | 2023-10-09 23:05 | 52K | |
| py39-statsd-4.0.1.pkg | 2023-10-06 16:58 | 22K | |
| py39-statsmodels-0.1..> | 2023-10-06 19:47 | 8.9M | |
| py39-stdlib-list-0.8..> | 2023-10-07 23:00 | 19K | |
| py39-stdnum-1.18.pkg | 2023-10-07 07:23 | 678K | |
| py39-stem-1.8.2.pkg | 2023-10-07 21:46 | 514K | |
| py39-stemming-1.0.1.pkg | 2023-10-14 18:27 | 17K | |
| py39-stevedore-5.1.0..> | 2023-10-06 13:30 | 43K | |
| py39-stix-1.2.0.11.pkg | 2023-10-10 15:23 | 319K | |
| py39-stix2-2.1.0.pkg | 2023-10-09 22:06 | 176K | |
| py39-stix2-patterns-..> | 2023-10-08 03:26 | 65K | |
| py39-stomp.py-8.0.1_..> | 2023-10-08 18:32 | 51K | |
| py39-stone-3.3.1.pkg | 2023-10-08 03:50 | 229K | |
| py39-stopit-1.1.2.pkg | 2023-10-07 15:13 | 13K | |
| py39-strategies-0.2...> | 2023-10-09 10:17 | 9.9K | |
| py39-streamlink-6.1...> | 2023-10-07 21:08 | 636K | |
| py39-streamparse-4.1..> | 2023-10-09 22:29 | 90K | |
| py39-strict-rfc3339-..> | 2023-10-07 21:45 | 7.0K | |
| py39-strictyaml-1.7...> | 2023-10-07 23:40 | 189K | |
| py39-stringbrewer-0...> | 2023-10-07 19:50 | 5.6K | |
| py39-stringcase-1.2...> | 2023-10-07 01:36 | 3.8K | |
| py39-stripe-2.76.0.pkg | 2023-10-14 09:32 | 217K | |
| py39-structlog-18.2...> | 2023-10-07 19:42 | 38K | |
| py39-subliminal-2.1...> | 2023-10-10 18:22 | 90K | |
| py39-subprocess-tee-..> | 2023-10-07 07:58 | 5.9K | |
| py39-subversion-1.14..> | 2023-10-08 08:26 | 697K | |
| py39-suds-1.1.2.pkg | 2023-10-07 02:07 | 167K | |
| py39-sunpy-5.0.0.pkg | 2023-10-12 03:20 | 2.9M | |
| py39-supervisor-4.2...> | 2023-10-07 14:58 | 483K | |
| py39-sure-1.4.11.pkg | 2023-10-09 08:46 | 32K | |
| py39-svg_path-4.0.2.pkg | 2023-10-07 05:59 | 28K | |
| py39-svglib-1.5.1.pkg | 2023-10-07 02:57 | 44K | |
| py39-svgmath-0.3.3.pkg | 2023-10-14 05:47 | 88K | |
| py39-svgwrite-1.4.3.pkg | 2023-10-06 13:41 | 122K | |
| py39-swagger-spec-va..> | 2023-10-06 17:02 | 28K | |
| py39-swapper-1.3.0_1..> | 2023-10-08 10:17 | 6.9K | |
| py39-sym-0.3.5_1.pkg | 2023-10-06 23:48 | 32K | |
| py39-symengine-0.10...> | 2023-10-06 13:57 | 737K | |
| py39-sympy-1.11.1_1.pkg | 2023-10-06 14:02 | 9.2M | |
| py39-synced-collecti..> | 2023-10-07 21:32 | 55K | |
| py39-synr-0.6.0.pkg | 2023-10-08 16:49 | 23K | |
| py39-sysctl-0.3.3.20..> | 2023-10-07 11:28 | 12K | |
| py39-sysv_ipc-1.1.0.pkg | 2023-10-09 13:33 | 17K | |
| py39-ta-lib-0.4.28.pkg | 2023-10-08 01:50 | 272K | |
| py39-tables-3.7.0_2.pkg | 2023-10-07 05:43 | 2.5M | |
| py39-tableschema-1.2..> | 2023-10-08 00:34 | 58K | |
| py39-tableschema-to-..> | 2023-10-14 18:12 | 15K | |
| py39-tabletext-0.1.pkg | 2023-10-11 09:41 | 8.4K | |
| py39-tablib-3.5.0.pkg | 2023-10-08 06:17 | 65K | |
| py39-tabulate-0.8.9.pkg | 2023-10-06 17:55 | 34K | |
| py39-tabulator-1.53...> | 2023-10-07 09:49 | 62K | |
| py39-tacacs_plus-2.6..> | 2023-10-08 14:15 | 24K | |
| py39-tagpy-2022.1.pkg | 2023-10-08 14:22 | 208K | |
| py39-tailer-0.4.1.pkg | 2023-10-09 13:12 | 7.0K | |
| py39-tapi-0.1.7_2.pkg | 2023-10-10 14:09 | 7.4K | |
| py39-tarantool-1.1.1..> | 2023-10-07 15:26 | 113K | |
| py39-tarantool-queue..> | 2023-10-10 10:15 | 13K | |
| py39-tarsnapper-0.4.pkg | 2023-10-14 12:32 | 21K | |
| py39-tartiflette-1.4..> | 2023-10-07 16:24 | 238K | |
| py39-tartiflette-aio..> | 2023-10-09 22:09 | 19K | |
| py39-tartube-2.4.412..> | 2023-10-09 10:13 | 2.8M | |
| py39-taskflow-5.4.0.pkg | 2023-10-07 11:23 | 553K | |
| py39-tasklib-2.5.1.pkg | 2023-10-08 13:34 | 45K | |
| py39-taxii2-client-2..> | 2023-10-10 12:22 | 26K | |
| py39-tblib-1.7.0.pkg | 2023-10-07 06:54 | 15K | |
| py39-tdworkflow-0.8...> | 2023-10-08 18:31 | 45K | |
| py39-technical-1.4.0..> | 2023-10-08 17:19 | 68K | |
| py39-telepath-0.3.pkg | 2023-10-07 02:39 | 15K | |
| py39-telepot-12.7.pkg | 2023-10-08 19:02 | 79K | |
| py39-tempora-5.5.0.pkg | 2023-10-06 22:43 | 20K | |
| py39-tenacity-8.2.3.pkg | 2023-10-07 05:44 | 29K | |
| py39-tendo-0.3.0.pkg | 2023-10-09 08:32 | 29K | |
| py39-term-background..> | 2023-10-08 10:25 | 7.2K | |
| py39-termcolor-2.3.0..> | 2023-10-06 16:18 | 7.8K | |
| py39-termcolor-whl-1..> | 2023-10-10 01:27 | 5.8K | |
| py39-terminado-0.12...> | 2023-10-06 09:29 | 22K | |
| py39-terminaltables-..> | 2023-10-07 07:32 | 18K | |
| py39-termstyle-0.1.1..> | 2023-10-07 12:54 | 4.9K | |
| py39-termtosvg-1.1.0..> | 2023-10-09 06:23 | 69K | |
| py39-tes-1.1.1.pkg | 2023-10-07 15:41 | 10K | |
| py39-testfixtures-6...> | 2023-10-09 01:43 | 157K | |
| py39-testinfra-3.2.0..> | 2023-10-10 08:14 | 68K | |
| py39-testoob-1.15_2.pkg | 2023-10-09 15:10 | 151K | |
| py39-testpath-0.6.0.pkg | 2023-10-08 04:38 | 75K | |
| py39-testrepository-..> | 2023-10-11 17:30 | 125K | |
| py39-testresources-2..> | 2023-10-06 15:44 | 42K | |
| py39-testscenarios-0..> | 2023-10-07 09:38 | 17K | |
| py39-testtools-2.6.0..> | 2023-10-06 19:19 | 308K | |
| py39-text-unidecode-..> | 2023-10-06 15:23 | 51K | |
| py39-textX-3.1.1.pkg | 2023-10-07 17:59 | 99K | |
| py39-textdistance-4...> | 2023-10-07 03:50 | 46K | |
| py39-textfsm-1.1.3_1..> | 2023-10-06 22:18 | 48K | |
| py39-textile-4.0.2.pkg | 2023-10-07 12:32 | 43K | |
| py39-textract-1.6.5_..> | 2023-10-09 14:18 | 28K | |
| py39-texttable-1.6.7..> | 2023-10-07 05:51 | 14K | |
| py39-textual-0.1.18_..> | 2023-10-07 12:48 | 136K | |
| py39-tflite-2.3.0.pkg | 2023-10-11 00:54 | 49K | |
| py39-tflite-support-..> | 2023-10-09 19:37 | 327K | |
| py39-tftpy-0.8.2.pkg | 2023-10-08 01:20 | 37K | |
| py39-theano-1.0.5_2.pkg | 2023-10-08 10:15 | 3.2M | |
| py39-thefuzz-0.19.0.pkg | 2023-10-08 05:49 | 15K | |
| py39-thermocouples_r..> | 2023-10-09 08:13 | 23K | |
| py39-thewalrus-0.20...> | 2023-10-09 21:56 | 105K | |
| py39-threadpoolctl-3..> | 2023-10-06 15:24 | 22K | |
| py39-three-merge-0.1..> | 2023-10-07 02:33 | 5.4K | |
| py39-threema-msgapi-..> | 2023-10-10 11:35 | 48K | |
| py39-thrift-0.16.0,1..> | 2023-10-09 19:02 | 107K | |
| py39-thriftpy2-0.4.1..> | 2023-10-07 18:23 | 184K | |
| py39-throughpy-0.1.pkg | 2023-10-14 11:40 | 3.6K | |
| py39-tiamat-7.10.3.pkg | 2023-10-09 05:49 | 36K | |
| py39-ticketutil-1.8...> | 2023-10-11 22:53 | 31K | |
| py39-tifffile-2023.4..> | 2023-10-06 21:24 | 311K | |
| py39-tiktoken-0.4.0_..> | 2023-10-08 20:11 | 644K | |
| py39-tiledb-0.22.3.pkg | 2023-10-10 10:38 | 948K | |
| py39-time-machine-2...> | 2023-10-12 07:21 | 19K | |
| py39-timelib-0.2.5.pkg | 2023-10-14 15:13 | 129K | |
| py39-timeout-decorat..> | 2023-10-08 02:00 | 6.3K | |
| py39-timple-0.1.5_1.pkg | 2023-10-08 09:44 | 23K | |
| py39-tinyaes-1.0.4.pkg | 2023-10-14 10:06 | 15K | |
| py39-tinyarray-1.2.4..> | 2023-10-09 12:31 | 47K | |
| py39-tinycss-0.4.pkg | 2023-10-07 12:57 | 58K | |
| py39-tinycss2-1.2.1_..> | 2023-10-06 09:15 | 32K | |
| py39-tinynetrc-1.3.1..> | 2023-10-06 19:42 | 4.6K | |
| py39-tinyrpc-1.1.7.pkg | 2023-10-07 21:03 | 44K | |
| py39-tipper-0.1.pkg | 2023-10-08 21:28 | 5.4K | |
| py39-tkcolorpicker-2..> | 2023-10-07 14:23 | 24K | |
| py39-tkinter-3.9.18_..> | 2023-10-06 10:16 | 20K | |
| py39-tktreectrl-2.0...> | 2023-10-09 01:28 | 51K | |
| py39-tld-0.11.11.pkg | 2023-10-07 15:21 | 102K | |
| py39-tldextract-3.3...> | 2023-10-07 00:29 | 85K | |
| py39-tls-parser-2.0...> | 2023-10-07 14:35 | 15K | |
| py39-tlslite-0.4.9_1..> | 2023-10-07 01:41 | 135K | |
| py39-tlslite-ng-0.7...> | 2023-10-08 18:31 | 244K | |
| py39-tmuxp-1.30.1.pkg | 2023-10-11 01:39 | 70K | |
| py39-tobler-0.9.0_2.pkg | 2023-10-07 16:37 | 26K | |
| py39-todoman-4.1.0.pkg | 2023-10-08 20:34 | 49K | |
| py39-tofu-0.5_1.pkg | 2023-10-14 05:41 | 29K | |
| py39-toil-5.6.0.pkg | 2023-10-10 09:30 | 722K | |
| py39-tokenize-rt-5.2..> | 2023-10-08 04:16 | 7.1K | |
| py39-toml-0.10.2.pkg | 2023-10-05 17:21 | 27K | |
| py39-tomli-2.0.1_2.pkg | 2023-10-05 17:14 | 19K | |
| py39-tomli-w-1.0.0_2..> | 2023-10-07 12:06 | 8.6K | |
| py39-tomlkit-0.12.1.pkg | 2023-10-06 08:48 | 215K | |
| py39-toolz-0.12.0.pkg | 2023-10-06 14:56 | 91K | |
| py39-toot-0.28.0.pkg | 2023-10-10 19:43 | 65K | |
| py39-tooz-4.2.0.pkg | 2023-10-08 05:54 | 116K | |
| py39-topologic-space..> | 2023-10-10 03:43 | 235K | |
| py39-toposort-1.5.pkg | 2023-10-06 21:34 | 5.4K | |
| py39-torch-geometric..> | 2023-10-08 22:57 | 968K | |
| py39-torchmetrics-0...> | 2023-10-07 18:04 | 379K | |
| py39-torchvision-0.1..> | 2023-10-07 02:21 | 873K | |
| py39-tornado-6.3.3.pkg | 2023-10-06 08:59 | 595K | |
| py39-tornado4-4.5.3.pkg | 2023-10-07 02:23 | 570K | |
| py39-tornado5-5.1.1.pkg | 2023-10-08 15:09 | 616K | |
| py39-toronado-0.1.0.pkg | 2023-10-08 14:07 | 7.4K | |
| py39-towncrier-22.12..> | 2023-10-06 09:14 | 57K | |
| py39-tox-3.28.0_2.pkg | 2023-10-10 08:55 | 133K | |
| py39-toxcore-c-0.2.0..> | 2023-10-14 11:29 | 19K | |
| py39-toyplot-0.19.0_..> | 2023-10-14 06:03 | 299K | |
| py39-tqdm-4.66.1.pkg | 2023-10-06 17:11 | 94K | |
| py39-traceback2-1.4...> | 2023-10-08 06:35 | 28K | |
| py39-trainstation-1...> | 2023-10-08 05:07 | 34K | |
| py39-traitlets-5.10...> | 2023-10-06 08:23 | 203K | |
| py39-traits-6.4.2.pkg | 2023-10-06 10:36 | 4.9M | |
| py39-traitsui-8.0.0.pkg | 2023-10-06 16:55 | 1.4M | |
| py39-traittypes-0.2...> | 2023-10-07 04:43 | 12K | |
| py39-trans-2.1.0.pkg | 2023-10-14 05:57 | 8.9K | |
| py39-transaction-3.1..> | 2023-10-08 07:03 | 70K | |
| py39-transip-2.1.2_1..> | 2023-10-09 01:43 | 22K | |
| py39-transitions-0.8..> | 2023-10-07 08:31 | 102K | |
| py39-translationstri..> | 2023-10-07 05:20 | 19K | |
| py39-transmission-rp..> | 2023-10-08 20:21 | 43K | |
| py39-transpopy-0.2.0..> | 2023-10-08 12:31 | 6.6K | |
| py39-tree-format-0.1..> | 2023-10-09 13:20 | 6.2K | |
| py39-treelib-1.7.0.pkg | 2023-10-09 17:19 | 25K | |
| py39-tremc-0.9.3.pkg | 2023-10-10 00:55 | 43K | |
| py39-treq-20.9.0.pkg | 2023-10-08 03:36 | 85K | |
| py39-trezor-0.13.7.pkg | 2023-10-07 17:05 | 345K | |
| py39-triangle-202004..> | 2023-10-07 09:28 | 1.0M | |
| py39-trimesh-3.5.25_..> | 2023-10-07 18:04 | 565K | |
| py39-trio-0.22.2.pkg | 2023-10-06 09:28 | 503K | |
| py39-trio-websocket-..> | 2023-10-07 07:42 | 25K | |
| py39-trove-classifie..> | 2023-10-05 17:34 | 15K | |
| py39-trustme-1.1.0.pkg | 2023-10-11 22:11 | 16K | |
| py39-ttfautohint-py-..> | 2023-10-07 17:09 | 30K | |
| py39-ttictoc-0.5.6_1..> | 2023-10-14 09:28 | 6.0K | |
| py39-ttkbootstrap-1...> | 2023-10-07 21:48 | 202K | |
| py39-ttp-0.9.5.pkg | 2023-10-07 09:09 | 114K | |
| py39-ttp-templates-0..> | 2023-10-08 06:35 | 35K | |
| py39-ttrv-1.27.3.pkg | 2023-10-10 23:53 | 214K | |
| py39-ttystatus-0.36.pkg | 2023-10-07 15:44 | 31K | |
| py39-tuf-3.0.0.pkg | 2023-10-10 08:49 | 58K | |
| py39-tuir-1.29.0_2.pkg | 2023-10-09 08:42 | 220K | |
| py39-tvdb_api-3.1.0_..> | 2023-10-07 16:44 | 22K | |
| py39-tvm-0.13.0.pkg | 2023-10-10 08:39 | 13M | |
| py39-tvnamer-3.0.4.pkg | 2023-10-08 15:35 | 38K | |
| py39-tweedledum-1.1...> | 2023-10-06 14:56 | 742K | |
| py39-tweepy-4.14.0.pkg | 2023-10-08 07:14 | 107K | |
| py39-twiggy-0.5.1.pkg | 2023-10-11 00:24 | 36K | |
| py39-twilio-7.17.0.pkg | 2023-10-14 15:24 | 930K | |
| py39-twine-4.0.2_2.pkg | 2023-10-06 18:09 | 44K | |
| py39-twisted-23.8.0.pkg | 2023-10-06 09:32 | 4.3M | |
| py39-twitter-tools-1..> | 2023-10-14 09:39 | 68K | |
| py39-txaio-22.2.1.pkg | 2023-10-07 00:56 | 29K | |
| py39-txamqp-0.8.2.pkg | 2023-10-08 03:12 | 74K | |
| py39-txi2p-tahoe-0.3..> | 2023-10-09 02:48 | 66K | |
| py39-txredisapi-1.4...> | 2023-10-08 16:57 | 40K | |
| py39-txrestapi-0.2.pkg | 2023-10-09 08:47 | 8.3K | |
| py39-txt2tags-3.8.pkg | 2023-10-08 06:04 | 70K | |
| py39-txtorcon-23.0.0..> | 2023-10-07 15:32 | 259K | |
| py39-typechecks-0.1...> | 2023-10-07 21:16 | 3.8K | |
| py39-typeguard-4.1.3..> | 2023-10-08 00:32 | 54K | |
| py39-typer-0.9.0.pkg | 2023-10-07 09:29 | 70K | |
| py39-types-Flask-1.1..> | 2023-10-12 11:34 | 8.6K | |
| py39-types-Jinja2-2...> | 2023-10-07 08:26 | 12K | |
| py39-types-MarkupSaf..> | 2023-10-06 20:39 | 2.8K | |
| py39-types-Pillow-10..> | 2023-10-14 08:05 | 26K | |
| py39-types-PyYAML-6...> | 2023-10-07 02:16 | 8.9K | |
| py39-types-Werkzeug-..> | 2023-10-07 21:47 | 21K | |
| py39-types-click-7.1..> | 2023-10-08 05:12 | 8.7K | |
| py39-types-cryptogra..> | 2023-10-10 23:28 | 13K | |
| py39-types-docutils-..> | 2023-10-14 04:34 | 7.3K | |
| py39-types-futures-3..> | 2023-10-08 22:35 | 3.1K | |
| py39-types-jsonschem..> | 2023-10-09 13:18 | 6.0K | |
| py39-types-mock-5.1...> | 2023-10-09 23:23 | 4.6K | |
| py39-types-protobuf-..> | 2023-10-06 21:14 | 36K | |
| py39-types-psutil-5...> | 2023-10-06 12:50 | 9.9K | |
| py39-types-psycopg2-..> | 2023-10-09 23:55 | 15K | |
| py39-types-python-da..> | 2023-10-07 09:04 | 6.0K | |
| py39-types-requests-..> | 2023-10-08 21:13 | 9.4K | |
| py39-types-retry-0.9..> | 2023-10-06 23:21 | 2.1K | |
| py39-types-setuptool..> | 2023-10-06 12:48 | 24K | |
| py39-types-toml-0.10..> | 2023-10-10 17:19 | 3.4K | |
| py39-types-typed-ast..> | 2023-10-10 18:49 | 3.9K | |
| py39-types-urllib3-1..> | 2023-10-08 06:45 | 9.0K | |
| py39-typing-extensio..> | 2023-10-05 17:15 | 49K | |
| py39-typing-inspect-..> | 2023-10-06 20:37 | 13K | |
| py39-typogrify-2.0.7..> | 2023-10-05 17:21 | 16K | |
| py39-tzdata-2023.3_1..> | 2023-10-06 11:59 | 117K | |
| py39-tzlocal-4.2_1.pkg | 2023-10-06 20:14 | 25K | |
| py39-u-msgpack-pytho..> | 2023-10-08 07:47 | 15K | |
| py39-ua_parser-0.7.1..> | 2023-10-07 11:31 | 45K | |
| py39-ubelt-1.3.3.pkg | 2023-10-11 04:50 | 227K | |
| py39-uc-micro-py-1.0..> | 2023-10-08 06:19 | 5.8K | |
| py39-ucl-0.8.2.pkg | 2023-10-07 23:21 | 5.8K | |
| py39-ueberzug-18.1.8..> | 2023-10-07 21:44 | 62K | |
| py39-ufal.udpipe-1.2..> | 2023-10-08 01:57 | 567K | |
| py39-ufo2ft-2.30.0.pkg | 2023-10-07 16:54 | 137K | |
| py39-ufoLib-2.3.2_1.pkg | 2023-10-11 16:05 | 143K | |
| py39-ufolib2-0.16.0.pkg | 2023-10-06 17:53 | 71K | |
| py39-ufolint-1.2.0.pkg | 2023-10-08 02:49 | 24K | |
| py39-ufonormalizer-0..> | 2023-10-06 15:58 | 28K | |
| py39-ufoprocessor-1...> | 2023-10-06 16:38 | 34K | |
| py39-uharfbuzz-0.37...> | 2023-10-06 23:30 | 105K | |
| py39-uhashring-2.3.pkg | 2023-10-07 14:33 | 14K | |
| py39-uhi-0.3.3.pkg | 2023-10-07 06:37 | 16K | |
| py39-uhid-freebsd-1...> | 2023-10-07 21:22 | 40K | |
| py39-uiCA-g20230312+..> | 2023-10-09 19:51 | 1.2M | |
| py39-ujson-5.8.0.pkg | 2023-10-06 14:04 | 46K | |
| py39-umap-learn-0.5...> | 2023-10-09 04:29 | 123K | |
| py39-uncertainties-3..> | 2023-10-06 17:25 | 114K | |
| py39-unearth-0.10.0.pkg | 2023-10-07 21:36 | 64K | |
| py39-unicodecsv-0.14..> | 2023-10-06 20:37 | 22K | |
| py39-unicodedata2-15..> | 2023-10-06 10:55 | 286K | |
| py39-unicodeitplus-0..> | 2023-10-10 10:53 | 37K | |
| py39-unicorn-1.0.2.pkg | 2023-10-08 05:40 | 32K | |
| py39-unidecode-1.1.1..> | 2023-10-07 02:01 | 184K | |
| py39-unittest2-1.1.0..> | 2023-10-09 17:26 | 160K | |
| py39-unittest2pytest..> | 2023-10-09 23:18 | 16K | |
| py39-unmessage-0.2.0..> | 2023-10-10 05:33 | 71K | |
| py39-unpaddedbase64-..> | 2023-10-07 05:25 | 2.6K | |
| py39-unqlite-0.9.6.pkg | 2023-10-10 00:29 | 257K | |
| py39-untangle-1.2.1_..> | 2023-10-08 09:21 | 7.2K | |
| py39-unyt-2.9.5.pkg | 2023-10-07 20:55 | 159K | |
| py39-update_checker-..> | 2023-10-07 07:39 | 9.0K | |
| py39-upt-0.11.pkg | 2023-10-08 09:36 | 36K | |
| py39-upt-cpan-0.6.1.pkg | 2023-10-14 18:44 | 8.5K | |
| py39-upt-freebsd-0.3..> | 2023-10-10 02:49 | 15K | |
| py39-upt-pypi-0.5.pkg | 2023-10-10 01:43 | 19K | |
| py39-upt-rubygems-0...> | 2023-10-10 02:31 | 8.9K | |
| py39-uptime-3.0.1.pkg | 2023-10-07 14:23 | 9.9K | |
| py39-urbanaccess-0.2..> | 2023-10-09 11:32 | 65K | |
| py39-urbansim-3.2_1.pkg | 2023-10-10 05:55 | 93K | |
| py39-uri-template-1...> | 2023-10-06 09:48 | 15K | |
| py39-uritemplate-3.0..> | 2023-10-06 22:42 | 14K | |
| py39-uritools-4.0.2.pkg | 2023-10-06 23:06 | 15K | |
| py39-url-normalize-1..> | 2023-10-06 22:01 | 7.5K | |
| py39-urlextract-1.8...> | 2023-10-09 14:51 | 28K | |
| py39-urlgrabber-4.0...> | 2023-10-14 10:37 | 83K | |
| py39-urlimport-0.42b..> | 2023-10-09 00:08 | 4.8K | |
| py39-urllib3-1.26.16..> | 2023-10-05 21:01 | 177K | |
| py39-urlman-1.2.0.pkg | 2023-10-08 15:49 | 5.5K | |
| py39-urlobject-2.4.3..> | 2023-10-10 19:06 | 23K | |
| py39-urlwatch-2.28.pkg | 2023-10-09 17:58 | 304K | |
| py39-urwid-2.1.2.pkg | 2023-10-07 01:50 | 362K | |
| py39-urwid-readline-..> | 2023-10-08 07:55 | 14K | |
| py39-urwidtrees-1.0...> | 2023-10-07 19:54 | 26K | |
| py39-us-2.0.2.pkg | 2023-10-10 21:14 | 16K | |
| py39-user_agent-0.1...> | 2023-10-06 22:32 | 19K | |
| py39-user_agents-1.0..> | 2023-10-08 12:19 | 12K | |
| py39-userpath-1.9.1.pkg | 2023-10-06 17:08 | 14K | |
| py39-utidylib-0.9.pkg | 2023-10-09 18:24 | 13K | |
| py39-utm-0.7.0.pkg | 2023-10-07 21:31 | 7.6K | |
| py39-uvicorn-0.23.2.pkg | 2023-10-08 07:33 | 82K | |
| py39-uvloop-0.17.0.pkg | 2023-10-07 11:55 | 901K | |
| py39-valerius-0.2.pkg | 2023-10-07 11:49 | 5.9K | |
| py39-validate-pyproj..> | 2023-10-11 06:54 | 54K | |
| py39-validate_email-..> | 2023-10-08 06:20 | 6.1K | |
| py39-validators-0.21..> | 2023-10-07 07:01 | 29K | |
| py39-validictory-1.1..> | 2023-10-09 17:53 | 37K | |
| py39-varstack-g.2015..> | 2023-10-10 19:41 | 6.3K | |
| py39-vatnumber-1.2_1..> | 2023-10-07 15:43 | 8.4K | |
| py39-vcrpy-5.1.0.pkg | 2023-10-07 04:02 | 63K | |
| py39-vcver-0.2.12.pkg | 2023-10-11 00:38 | 16K | |
| py39-vcversioner-2.1..> | 2023-10-08 02:26 | 9.6K | |
| py39-vdirsyncer-0.19..> | 2023-10-07 20:08 | 88K | |
| py39-vecrec-0.3.0.pkg | 2023-10-08 00:44 | 17K | |
| py39-vedo-2023.4.6_1..> | 2023-10-14 09:00 | 2.8M | |
| py39-venusian-3.0.0,..> | 2023-10-07 00:24 | 15K | |
| py39-verboselogs-1.7..> | 2023-10-10 23:50 | 8.9K | |
| py39-versioneer-0.29..> | 2023-10-06 11:46 | 42K | |
| py39-versioneer-518-..> | 2023-10-06 15:27 | 24K | |
| py39-versioningit-2...> | 2023-10-07 08:54 | 45K | |
| py39-versiontools-1...> | 2023-10-07 07:04 | 18K | |
| py39-verspec-0.1.0.pkg | 2023-10-07 23:01 | 22K | |
| py39-vertex-0.3.1_3.pkg | 2023-10-11 03:17 | 162K | |
| py39-veusz-3.6.2_3.pkg | 2023-10-14 14:46 | 1.6M | |
| py39-vharfbuzz-0.2.0..> | 2023-10-07 11:47 | 7.5K | |
| py39-vici-5.9.11.pkg | 2023-10-08 11:57 | 13K | |
| py39-viewvc-devel-1...> | 2023-10-08 15:36 | 284K | |
| py39-vim-bridge-0.6.pkg | 2023-10-08 13:02 | 4.9K | |
| py39-vincenty-0.1.4.pkg | 2023-10-09 15:26 | 3.8K | |
| py39-vine-1.3.0.pkg | 2023-10-06 13:54 | 20K | |
| py39-virtualenv-20.2..> | 2023-10-06 12:47 | 3.2M | |
| py39-virtualenv-api-..> | 2023-10-09 19:40 | 12K | |
| py39-virtualenv-clon..> | 2023-10-08 10:03 | 9.3K | |
| py39-virtualenvwrapp..> | 2023-10-09 14:32 | 238K | |
| py39-virustotal-api-..> | 2023-10-07 20:43 | 18K | |
| py39-visidata-2.11.pkg | 2023-10-08 19:39 | 420K | |
| py39-visitor-0.1.3.pkg | 2023-10-14 07:15 | 3.3K | |
| py39-vistir-0.8.0.pkg | 2023-10-14 10:40 | 57K | |
| py39-visvis-1.14.0_3..> | 2023-10-14 08:07 | 4.4M | |
| py39-vobject-0.9.6.1..> | 2023-10-08 03:32 | 68K | |
| py39-volatility3-g20..> | 2023-10-14 16:08 | 401K | |
| py39-voluptuous-0.13..> | 2023-10-07 02:00 | 45K | |
| py39-voluptuous-seri..> | 2023-10-10 14:03 | 3.6K | |
| py39-vpn-slice-0.16...> | 2023-10-09 02:42 | 35K | |
| py39-vsts-0.1.25.pkg | 2023-10-07 18:22 | 957K | |
| py39-vsts-cd-manager..> | 2023-10-09 12:43 | 24K | |
| py39-vulndb-0.0.19.pkg | 2023-10-09 13:59 | 43K | |
| py39-vulture-2.9.1.pkg | 2023-10-12 10:28 | 36K | |
| py39-vunit-hdl-4.7.0..> | 2023-10-08 12:21 | 517K | |
| py39-w3lib-1.21.0.pkg | 2023-10-06 21:34 | 26K | |
| py39-wadllib-1.3.6.pkg | 2023-10-06 20:39 | 45K | |
| py39-wagtail-2fa-1.6..> | 2023-10-10 05:56 | 21K | |
| py39-wagtail-5.0.2_1..> | 2023-10-08 11:30 | 5.2M | |
| py39-wagtail-airtabl..> | 2023-10-14 10:37 | 33K | |
| py39-wagtail-bakery-..> | 2023-10-14 12:33 | 12K | |
| py39-wagtail-factori..> | 2023-10-09 23:05 | 14K | |
| py39-wagtail-localiz..> | 2023-10-09 00:29 | 272K | |
| py39-wagtail-transfe..> | 2023-10-09 11:14 | 251K | |
| py39-waitress-2.1.2_..> | 2023-10-06 15:53 | 76K | |
| py39-wandb-0.15.10.pkg | 2023-10-08 06:47 | 2.7M | |
| py39-wapiti-3.0.3.pkg | 2023-10-09 02:09 | 443K | |
| py39-warctools-4.10...> | 2023-10-10 07:19 | 51K | |
| py39-warlock-2.0.1.pkg | 2023-10-07 05:34 | 6.3K | |
| py39-watchdog-3.0.0.pkg | 2023-10-06 13:53 | 268K | |
| py39-watchfiles-0.20..> | 2023-10-10 19:34 | 298K | |
| py39-watchgod-0.8.2_..> | 2023-10-08 13:32 | 17K | |
| py39-watermark-2.4.3..> | 2023-10-10 12:52 | 9.6K | |
| py39-wavedrom-2.0.3...> | 2023-10-06 15:41 | 45K | |
| py39-wavio-0.0.7_1.pkg | 2023-10-14 06:41 | 10K | |
| py39-wcag-contrast-r..> | 2023-10-10 03:28 | 2.8K | |
| py39-wcmatch-8.5.pkg | 2023-10-07 23:00 | 61K | |
| py39-wcwidth-0.2.6.pkg | 2023-10-06 09:52 | 28K | |
| py39-weasyprint-58.0..> | 2023-10-14 12:10 | 390K | |
| py39-web2ldap-1.8.1.pkg | 2023-10-09 01:49 | 500K | |
| py39-webargs-8.3.0.pkg | 2023-10-07 05:18 | 40K | |
| py39-webassets-2.0.pkg | 2023-10-08 03:10 | 165K | |
| py39-webauthn-1.2.1.pkg | 2023-10-14 15:48 | 62K | |
| py39-webcolors-1.13.pkg | 2023-10-06 09:30 | 18K | |
| py39-webdriver_manag..> | 2023-10-08 04:04 | 28K | |
| py39-webencodings-0...> | 2023-10-05 17:29 | 14K | |
| py39-weblib-0.1.30.pkg | 2023-10-07 09:05 | 53K | |
| py39-webob-1.8.7.pkg | 2023-10-06 17:27 | 445K | |
| py39-webpy-0.62.pkg | 2023-10-08 04:24 | 139K | |
| py39-webrtcvad-2.0.1..> | 2023-10-07 22:52 | 27K | |
| py39-websocket-clien..> | 2023-10-06 10:51 | 66K | |
| py39-websockets-11.0..> | 2023-10-06 15:57 | 141K | |
| py39-websockify-0.11..> | 2023-10-09 08:42 | 54K | |
| py39-webtest-3.0.0.pkg | 2023-10-06 19:41 | 49K | |
| py39-webunit-1.3.10_..> | 2023-10-10 18:05 | 33K | |
| py39-weechat-otr-1.9..> | 2023-10-09 03:18 | 16K | |
| py39-werkzeug-2.3.6.pkg | 2023-10-06 18:03 | 437K | |
| py39-wfuzz-3.1.0.pkg | 2023-10-09 07:40 | 189K | |
| py39-whatthepatch-1...> | 2023-10-06 16:55 | 16K | |
| py39-wheel-0.41.2.pkg | 2023-10-05 17:15 | 95K | |
| py39-whichcraft-0.6...> | 2023-10-14 04:34 | 4.6K | |
| py39-whisper-1.1.10.pkg | 2023-10-08 00:30 | 35K | |
| py39-whistle-1.0.1.pkg | 2023-10-07 20:35 | 5.5K | |
| py39-whitenoise-6.2...> | 2023-10-10 07:28 | 29K | |
| py39-whois-0.9.27_1.pkg | 2023-10-14 05:49 | 45K | |
| py39-whoosh-2.7.4.pkg | 2023-10-10 20:21 | 574K | |
| py39-widgetsnbextens..> | 2023-10-06 19:24 | 839K | |
| py39-wikipedia-1.4.0..> | 2023-10-08 08:59 | 17K | |
| py39-wikitools-1.1.1..> | 2023-10-14 15:03 | 32K | |
| py39-willow-1.5.pkg | 2023-10-07 08:50 | 96K | |
| py39-wlc-1.13.pkg | 2023-10-09 15:09 | 60K | |
| py39-wmi-query-0.1.4..> | 2023-10-09 10:05 | 5.7K | |
| py39-woob-3.6.pkg | 2023-10-08 00:15 | 584K | |
| py39-woob-qt-2.0.27_..> | 2023-10-14 06:04 | 280K | |
| py39-woops-0.2.1.pkg | 2023-10-10 18:19 | 5.3K | |
| py39-wordcloud-1.9.2..> | 2023-10-07 03:30 | 141K | |
| py39-wordnet-2.0.1_1..> | 2023-10-14 02:57 | 7.2M | |
| py39-wpgtk-6.5.9.pkg | 2023-10-10 14:27 | 57K | |
| py39-wrapt-1.15.0.pkg | 2023-10-06 10:28 | 40K | |
| py39-wsaccel-0.6.4.pkg | 2023-10-06 09:47 | 72K | |
| py39-wsdd-0.7.1.pkg | 2023-10-08 17:18 | 23K | |
| py39-wsgi-intercept-..> | 2023-10-08 13:21 | 33K | |
| py39-wsgi_xmlrpc-0.2..> | 2023-10-09 19:55 | 4.0K | |
| py39-wsgitools-0.3.1..> | 2023-10-09 02:40 | 48K | |
| py39-wsgiutils-0.7.2..> | 2023-10-09 21:28 | 17K | |
| py39-wsme-0.11.0.pkg | 2023-10-09 15:25 | 106K | |
| py39-wsproto-1.2.0.pkg | 2023-10-06 21:06 | 35K | |
| py39-wstools-0.4.8.pkg | 2023-10-11 01:35 | 96K | |
| py39-wtf-peewee-3.0...> | 2023-10-07 11:51 | 22K | |
| py39-wtforms-2.1_1.pkg | 2023-10-07 06:16 | 292K | |
| py39-wurlitzer-3.0.3..> | 2023-10-06 19:58 | 10K | |
| py39-wxPython42-4.2...> | 2023-10-06 17:46 | 7.8M | |
| py39-x-wr-timezone-0..> | 2023-10-07 07:07 | 8.9K | |
| py39-xandikos-0.2.10..> | 2023-10-11 12:57 | 146K | |
| py39-xapian-1.4.23.pkg | 2023-10-08 03:22 | 845K | |
| py39-xarray-2023.8.0..> | 2023-10-06 22:45 | 1.4M | |
| py39-xarray-einstats..> | 2023-10-07 07:49 | 43K | |
| py39-xarray-simlab-0..> | 2023-10-09 17:17 | 135K | |
| py39-xattr-0.9.8.pkg | 2023-10-06 23:53 | 20K | |
| py39-xcaplib-1.2.2_1..> | 2023-10-14 03:01 | 31K | |
| py39-xcffib-0.11.1.pkg | 2023-10-06 22:27 | 160K | |
| py39-xdg-0.28.pkg | 2023-10-06 15:38 | 68K | |
| py39-xdis-6.0.5.pkg | 2023-10-09 17:31 | 137K | |
| py39-xdoctest-1.1.1.pkg | 2023-10-14 07:50 | 157K | |
| py39-xdot-1.2_3.pkg | 2023-10-06 22:52 | 55K | |
| py39-xenaPython-1.0...> | 2023-10-09 04:56 | 21K | |
| py39-xerox-0.4.1.pkg | 2023-10-07 22:58 | 7.0K | |
| py39-xgboost-1.7.6.pkg | 2023-10-08 06:49 | 182K | |
| py39-xhtml2pdf-0.2.1..> | 2023-10-08 16:30 | 177K | |
| py39-xist-5.34.pkg | 2023-10-08 17:42 | 759K | |
| py39-xkcdpass-1.17.4..> | 2023-10-10 11:13 | 1.4M | |
| py39-xlmmacrodeobfus..> | 2023-10-08 23:53 | 74K | |
| py39-xlrd-2.0.1.pkg | 2023-10-06 18:39 | 142K | |
| py39-xlrd2-1.3.4.pkg | 2023-10-07 11:56 | 172K | |
| py39-xlutils-2.0.0.pkg | 2023-10-08 16:28 | 66K | |
| py39-xlwt-1.3.0.pkg | 2023-10-07 08:04 | 155K | |
| py39-xml-default-dic..> | 2023-10-14 08:56 | 3.9K | |
| py39-xml2rfc-3.18.0.pkg | 2023-10-06 18:39 | 414K | |
| py39-xmldiff-2.6.3.pkg | 2023-10-09 08:15 | 61K | |
| py39-xmlschema-2.4.0..> | 2023-10-07 04:56 | 394K | |
| py39-xmlsec-1.3.13_1..> | 2023-10-06 17:37 | 32K | |
| py39-xmltodict-0.13...> | 2023-10-07 01:24 | 13K | |
| py39-xmodem-0.4.5.pkg | 2023-10-07 23:56 | 31K | |
| py39-xonsh-0.11.0.pkg | 2023-10-08 15:50 | 1.0M | |
| py39-xopen-1.1.0.pkg | 2023-10-07 06:17 | 15K | |
| py39-xstatic-1.0.3.pkg | 2023-10-08 01:39 | 3.5K | |
| py39-xstatic-angular..> | 2023-10-07 17:25 | 364K | |
| py39-xstatic-angular..> | 2023-10-07 11:26 | 51K | |
| py39-xstatic-angular..> | 2023-10-08 06:51 | 139K | |
| py39-xstatic-angular..> | 2023-10-08 02:06 | 11K | |
| py39-xstatic-angular..> | 2023-10-08 10:10 | 5.1K | |
| py39-xstatic-angular..> | 2023-10-08 06:35 | 35K | |
| py39-xstatic-bootstr..> | 2023-10-08 00:34 | 31K | |
| py39-xstatic-bootstr..> | 2023-10-07 16:37 | 175K | |
| py39-xstatic-bootswa..> | 2023-10-08 01:12 | 654K | |
| py39-xstatic-d3-3.5...> | 2023-10-07 11:28 | 65K | |
| py39-xstatic-font-aw..> | 2023-10-07 22:31 | 1.5M | |
| py39-xstatic-hogan-2..> | 2023-10-07 17:14 | 7.3K | |
| py39-xstatic-jasmine..> | 2023-10-07 10:26 | 33K | |
| py39-xstatic-jquery-..> | 2023-10-07 05:39 | 155K | |
| py39-xstatic-jquery-..> | 2023-10-08 04:30 | 13K | |
| py39-xstatic-jquery-..> | 2023-10-08 07:28 | 479K | |
| py39-xstatic-jquery...> | 2023-10-07 23:50 | 6.9K | |
| py39-xstatic-jquery...> | 2023-10-07 19:58 | 18K | |
| py39-xstatic-jsencry..> | 2023-10-07 17:43 | 31K | |
| py39-xstatic-mdi-1.6..> | 2023-10-07 11:52 | 541K | |
| py39-xstatic-objectp..> | 2023-10-07 17:11 | 4.2K | |
| py39-xstatic-ricksha..> | 2023-10-07 20:47 | 25K | |
| py39-xstatic-roboto-..> | 2023-10-08 09:40 | 3.8M | |
| py39-xstatic-smart-t..> | 2023-10-08 06:51 | 12K | |
| py39-xstatic-spin-1...> | 2023-10-08 06:27 | 5.4K | |
| py39-xstatic-term.js..> | 2023-10-08 08:55 | 33K | |
| py39-xstatic-tv4-1.2..> | 2023-10-07 19:29 | 20K | |
| py39-xxhash-3.3.0.pkg | 2023-10-07 02:14 | 14K | |
| py39-xyzservices-202..> | 2023-10-10 17:15 | 37K | |
| py39-y-py-0.6.0_4.pkg | 2023-10-06 11:43 | 485K | |
| py39-yacs-0.1.8.pkg | 2023-10-07 00:15 | 17K | |
| py39-yaml-6.0.pkg | 2023-10-06 09:24 | 148K | |
| py39-yamllint-1.32.0..> | 2023-10-07 20:14 | 59K | |
| py39-yamlordereddict..> | 2023-10-07 03:36 | 4.1K | |
| py39-yandex-money-sd..> | 2023-10-10 07:10 | 7.1K | |
| py39-yapf-0.32.0.pkg | 2023-10-06 17:29 | 224K | |
| py39-yappi-1.4.0.pkg | 2023-10-06 18:08 | 38K | |
| py39-yapps2-2.1.1_1.pkg | 2023-10-09 01:50 | 23K | |
| py39-yara-4.2.3.pkg | 2023-10-08 11:32 | 15K | |
| py39-yara-python-dex..> | 2023-10-08 10:40 | 132K | |
| py39-yarg-0.1.9_1.pkg | 2023-10-07 10:40 | 12K | |
| py39-yarl-1.9.2.pkg | 2023-10-06 10:31 | 59K | |
| py39-yaspin-3.0.1.pkg | 2023-10-09 17:17 | 22K | |
| py39-yaswfp-0.9.3.pkg | 2023-10-08 00:20 | 29K | |
| py39-yattag-1.15.1.pkg | 2023-10-08 09:53 | 23K | |
| py39-yfinance-0.2.28..> | 2023-10-06 21:40 | 90K | |
| py39-yg.lockfile-2.3..> | 2023-10-10 01:45 | 7.3K | |
| py39-youseedee-0.4.1..> | 2023-10-10 08:40 | 13K | |
| py39-ypy-websocket-0..> | 2023-10-06 13:08 | 18K | |
| py39-ystockquote-0.2..> | 2023-10-10 04:46 | 7.7K | |
| py39-yt-4.2.0.pkg | 2023-10-09 12:30 | 5.6M | |
| py39-yubikey-manager..> | 2023-10-08 11:39 | 239K | |
| py39-yunomi-0.3.0_1.pkg | 2023-10-09 07:21 | 28K | |
| py39-z3-solver-4.8.1..> | 2023-10-07 05:17 | 179K | |
| py39-zarr-2.16.1.pkg | 2023-10-07 16:31 | 348K | |
| py39-zbar-py-1.0.4_1..> | 2023-10-08 09:45 | 66K | |
| py39-zclockfile-2.0.pkg | 2023-10-07 01:03 | 9.3K | |
| py39-zconfig-3.0.4.pkg | 2023-10-07 11:37 | 110K | |
| py39-zdaemon-4.1.0.pkg | 2023-10-14 07:40 | 66K | |
| py39-zeep-4.2.1.pkg | 2023-10-07 16:18 | 144K | |
| py39-zeroconf-0.39.4..> | 2023-10-07 14:59 | 106K | |
| py39-zfec-1.5.7.2.pkg | 2023-10-10 09:26 | 47K | |
| py39-zfp-1.0.0_1.pkg | 2023-10-06 22:47 | 67K | |
| py39-zfs-autobackup-..> | 2023-10-14 12:01 | 68K | |
| py39-zict-3.0.0.pkg | 2023-10-07 07:22 | 65K | |
| py39-zipp-3.16.2.pkg | 2023-10-05 17:17 | 11K | |
| py39-zipstream-ng-1...> | 2023-10-09 02:21 | 27K | |
| py39-zita-audiotools..> | 2023-10-08 04:09 | 17K | |
| py39-zita-jacktools-..> | 2023-10-09 21:05 | 104K | |
| py39-zkg-2.14.0.pkg | 2023-10-07 21:07 | 85K | |
| py39-zodb-5.8.1.pkg | 2023-10-14 13:44 | 474K | |
| py39-zodbpickle-3.0...> | 2023-10-08 03:40 | 143K | |
| py39-zope.component-..> | 2023-10-07 13:44 | 89K | |
| py39-zope.configurat..> | 2023-10-08 02:51 | 89K | |
| py39-zope.deprecatio..> | 2023-10-07 07:47 | 14K | |
| py39-zope.event-4.1...> | 2023-10-06 18:05 | 6.4K | |
| py39-zope.i18nmessag..> | 2023-10-07 04:47 | 17K | |
| py39-zope.interface-..> | 2023-10-06 09:25 | 281K | |
| py39-zope.password-3..> | 2023-10-10 00:03 | 17K | |
| py39-zope.proxy-4.6...> | 2023-10-08 20:09 | 50K | |
| py39-zope.schema-4.2..> | 2023-10-06 19:57 | 95K | |
| py39-zope.testbrowse..> | 2023-10-07 07:42 | 80K | |
| py39-zopfli-0.2.3.pkg | 2023-10-06 10:45 | 124K | |
| py39-zpt-2.5.pkg | 2023-10-09 13:47 | 80K | |
| py39-zstandard-0.21...> | 2023-10-07 21:52 | 420K | |
| py39-zstd-1.5.2.6.pkg | 2023-10-11 06:05 | 7.2K | |
| py39-zxcvbn-4.4.28.pkg | 2023-10-07 14:50 | 373K | |
| py310-build-0.10.0_2..> | 2023-10-07 05:38 | 27K | |
| py310-cython-0.29.36..> | 2023-10-07 02:19 | 1.8M | |
| py310-cython-devel-3..> | 2023-10-08 15:42 | 2.7M | |
| py310-cython3-3.0.2.pkg | 2023-10-08 16:49 | 2.7M | |
| py310-flit-core-3.9...> | 2023-10-06 13:31 | 76K | |
| py310-gdbm-3.10.13_7..> | 2023-10-08 12:08 | 7.6K | |
| py310-installer-0.7...> | 2023-10-06 15:24 | 214K | |
| py310-numpy-1.25.0,1..> | 2023-10-08 04:14 | 16M | |
| py310-packaging-23.1..> | 2023-10-06 20:21 | 67K | |
| py310-pyproject_hook..> | 2023-10-06 22:22 | 14K | |
| py310-reals-0.0.4.pkg | 2023-10-08 20:26 | 24K | |
| py310-setuptools-63...> | 2023-10-06 21:09 | 1.1M | |
| py310-setuptools58-5..> | 2023-10-09 13:46 | 808K | |
| py310-sqlite3-3.10.1..> | 2023-10-10 17:31 | 28K | |
| py310-tkinter-3.10.1..> | 2023-10-08 15:48 | 20K | |
| py310-tomli-2.0.1_2.pkg | 2023-10-06 16:55 | 19K | |
| py310-truststore-0.8..> | 2023-10-10 09:03 | 25K | |
| py310-wheel-0.41.2.pkg | 2023-10-08 11:38 | 96K | |
| py311-build-0.10.0_2..> | 2023-10-07 07:59 | 35K | |
| py311-cython-0.29.36..> | 2023-10-07 19:30 | 2.2M | |
| py311-cython-devel-3..> | 2023-10-14 06:52 | 3.0M | |
| py311-cython3-3.0.2.pkg | 2023-10-09 21:10 | 3.1M | |
| py311-flit-core-3.9...> | 2023-10-06 15:17 | 98K | |
| py311-gdbm-3.11.5_7.pkg | 2023-10-08 21:26 | 7.5K | |
| py311-installer-0.7...> | 2023-10-06 16:39 | 222K | |
| py311-numpy-1.25.0,1..> | 2023-10-14 04:52 | 17M | |
| py311-packaging-23.1..> | 2023-10-06 21:17 | 85K | |
| py311-pyproject_hook..> | 2023-10-06 20:22 | 17K | |
| py311-setuptools-63...> | 2023-10-07 06:50 | 1.3M | |
| py311-setuptools58-5..> | 2023-10-09 17:57 | 1.0M | |
| py311-sqlite3-3.11.5..> | 2023-10-14 05:04 | 33K | |
| py311-tkinter-3.11.5..> | 2023-10-11 15:20 | 19K | |
| py311-tomli-2.0.1_2.pkg | 2023-10-08 21:27 | 24K | |
| py311-wheel-0.41.2.pkg | 2023-10-08 09:36 | 126K | |
| pyWeather-0.1b.pkg | 2023-10-10 14:01 | 1.8K | |
| pybind11-2.11.1.pkg | 2023-10-06 16:36 | 149K | |
| pybind11-json-0.2.13..> | 2023-10-10 17:26 | 4.3K | |
| pybrain-0.3.3_5.pkg | 2023-10-09 08:12 | 546K | |
| pycanberra-1_2.pkg | 2023-10-07 17:45 | 7.9K | |
| pycharm-ce-2023.1.4.pkg | 2023-10-08 14:11 | 240M | |
| pycharm-pro-2023.2.1..> | 2023-10-09 17:59 | 347M | |
| pychess-1.0.4.pkg | 2023-10-10 00:16 | 10M | |
| pydbus-common-1.3.2.pkg | 2023-10-06 09:14 | 30K | |
| pydeps-1.11.2.pkg | 2023-10-10 06:34 | 57K | |
| pydf-12.pkg | 2023-10-14 05:40 | 8.8K | |
| pydio-cells-4.2.6.pkg | 2023-10-14 10:01 | 43M | |
| pyenv-2.3.27.pkg | 2023-10-10 10:13 | 251K | |
| pygobject3-common-3...> | 2023-10-06 06:46 | 6.4K | |
| pykep-2.6.2_1.pkg | 2023-10-08 11:10 | 2.1M | |
| pylint-py39-2.17.5.pkg | 2023-10-06 14:31 | 685K | |
| pymsgauth-2.1.0_2.pkg | 2023-10-08 21:29 | 11K | |
| pyobd-0.9.3_8.pkg | 2023-10-10 12:32 | 42K | |
| pyobfuscate-0.3.2013..> | 2023-10-10 09:12 | 11K | |
| pyotherside-qt5-1.5...> | 2023-10-07 22:44 | 67K | |
| pysolfc-2.21.0.pkg | 2023-10-08 03:49 | 45M | |
| pysolfc-cardsets-2.2..> | 2023-10-08 21:32 | 29M | |
| pystring-1.1.4.pkg | 2023-10-06 16:36 | 40K | |
| pysvn-1.9.12.pkg | 2023-10-14 12:28 | 321K | |
| python-3.9_3,2.pkg | 2023-10-10 05:37 | 1.0K | |
| python-doc-html-3.9...> | 2023-10-11 01:56 | 6.1M | |
| python-doc-pdf-a4-3...> | 2023-10-10 02:22 | 15M | |
| python-doc-pdf-lette..> | 2023-10-08 12:55 | 15M | |
| python-doc-text-3.9...> | 2023-10-09 07:15 | 2.2M | |
| python-mode.el-1.0_2..> | 2023-10-10 21:49 | 46K | |
| python2-2_3.pkg | 2023-10-09 12:55 | 1.2K | |
| python3-3_3.pkg | 2023-10-07 12:26 | 1.0K | |
| python27-2.7.18_2.pkg | 2023-10-05 17:15 | 11M | |
| python38-3.8.18.pkg | 2023-10-05 17:13 | 19M | |
| python39-3.9.18.pkg | 2023-10-05 17:13 | 18M | |
| python310-3.10.13.pkg | 2023-10-05 17:13 | 18M | |
| python311-3.11.5.pkg | 2023-10-05 17:23 | 32M | |
| pythonqt-3.4.2.pkg | 2023-10-10 07:54 | 3.2M | |
| pytype-py39-2023.5.8..> | 2023-10-14 07:13 | 2.6M | |
| pyvmomi-7.0.3.pkg | 2023-10-11 06:17 | 384K | |
| q-6.0_1.pkg | 2023-10-09 08:48 | 1.2M | |
| q2p-0.2.20061231_18.pkg | 2023-10-11 08:20 | 8.7M | |
| q2pro-142_14.pkg | 2023-10-09 14:30 | 463K | |
| qFlipper-1.3.0.pkg | 2023-10-10 15:03 | 717K | |
| qTox-1.17.6_4.pkg | 2023-10-10 06:16 | 4.7M | |
| qadsl-1.3.3_3.pkg | 2023-10-10 01:32 | 36K | |
| qalculate-gtk-4.8.1.pkg | 2023-10-09 18:25 | 2.2M | |
| qalculate-qt5-4.8.1.pkg | 2023-10-10 03:40 | 1.0M | |
| qalculate-qt6-4.8.1.pkg | 2023-10-08 16:25 | 1.0M | |
| qaudiosonar-1.8.3_1.pkg | 2023-10-10 06:49 | 42K | |
| qbe-1.1.pkg | 2023-10-06 23:14 | 87K | |
| qbittorrent-4.5.5_3.pkg | 2023-10-08 16:57 | 4.9M | |
| qbittorrent-nox-4.5...> | 2023-10-09 11:12 | 5.9M | |
| qbox-1.76.0.pkg | 2023-10-09 07:49 | 449K | |
| qbrew-0.4.1_8.pkg | 2023-10-14 13:43 | 291K | |
| qca-qt5-2.3.7.pkg | 2023-10-06 06:42 | 581K | |
| qca-qt6-2.3.7.pkg | 2023-10-07 23:54 | 626K | |
| qcad-3.28.1.0_3.pkg | 2023-10-08 09:00 | 26M | |
| qcc-1.01.pkg | 2023-10-09 18:13 | 21K | |
| qccx-1.0.0.pkg | 2023-10-14 17:02 | 37K | |
| qchroot-0.1.pkg | 2023-10-09 15:59 | 10K | |
| qcl-0.6.7.pkg | 2023-10-14 11:51 | 193K | |
| qconf-2.5.pkg | 2023-10-08 15:01 | 61K | |
| qconfirm-0.14.3_1.pkg | 2023-10-10 08:54 | 107K | |
| qcoro-qt5-0.9.0.pkg | 2023-10-06 07:28 | 136K | |
| qcoro-qt6-0.9.0.pkg | 2023-10-10 08:33 | 141K | |
| qcsxcad-0.6.2.9_5.pkg | 2023-10-08 04:08 | 551K | |
| qcustomplot-qt5-2.1...> | 2023-10-08 00:52 | 452K | |
| qd-2.3.23_1.pkg | 2023-10-06 22:52 | 321K | |
| qdbm-1.8.78_4.pkg | 2023-10-07 07:18 | 302K | |
| qdbm-plus-1.8.78_5.pkg | 2023-10-10 05:50 | 136K | |
| qdecoder-12.1.0.pkg | 2023-10-14 14:50 | 40K | |
| qdirstat-1.8.1.pkg | 2023-10-10 10:40 | 558K | |
| qdrant-1.4.1_1.pkg | 2023-10-09 01:24 | 8.6M | |
| qelectrotech-0.9.0,1..> | 2023-10-08 14:55 | 8.5M | |
| qemu-8.1.0.pkg | 2023-10-07 23:34 | 90M | |
| qemu-cheri-0.d202306..> | 2023-10-14 11:45 | 5.5M | |
| qemu-devel-8.0.0.202..> | 2023-10-10 06:04 | 91M | |
| qemu-guest-agent-8.1..> | 2023-10-09 21:06 | 4.4M | |
| qemu-nox11-8.1.0.pkg | 2023-10-09 12:00 | 89M | |
| qemu-powernv-3.0.50_..> | 2023-10-09 08:55 | 3.1M | |
| qemu-tools-8.1.0.pkg | 2023-10-10 04:49 | 5.6M | |
| qemu-user-static-3.1..> | 2023-10-09 01:42 | 6.4M | |
| qemu-user-static-dev..> | 2023-10-09 00:22 | 5.6M | |
| qemu7-7.2.5.pkg | 2023-10-08 20:05 | 83M | |
| qemu7-nox11-7.2.5.pkg | 2023-10-14 15:04 | 80M | |
| qemu7-tools-7.2.5.pkg | 2023-10-14 17:09 | 5.5M | |
| qflow-1.4.100_1.pkg | 2023-10-14 12:46 | 581K | |
| qgis-3.32.3.pkg | 2023-10-14 19:16 | 65M | |
| qgis-ltr-3.28.11.pkg | 2023-10-14 14:59 | 64M | |
| qgit-2.9.pkg | 2023-10-14 11:45 | 321K | |
| qgnomeplatform-0.6.1..> | 2023-10-12 11:53 | 113K | |
| qhttpengine-1.0.1.5_..> | 2023-10-08 02:57 | 59K | |
| qhull-8.0.2_2,1.pkg | 2023-10-06 10:28 | 906K | |
| qhull7-7.3.2_2,1.pkg | 2023-10-14 18:08 | 1.2M | |
| qico-0.59.1.pkg | 2023-10-10 09:41 | 205K | |
| qimageblitz-0.1.0.15..> | 2023-10-08 06:44 | 73K | |
| qiskit-aer-0.10.4_2.pkg | 2023-10-08 14:24 | 620K | |
| qiv-2.3.3_2.pkg | 2023-10-14 18:32 | 38K | |
| qjackcapture-0.2.1_2..> | 2023-10-09 09:01 | 59K | |
| qjackctl-0.9.12.pkg | 2023-10-08 14:02 | 625K | |
| qjail-5.5.pkg | 2023-10-09 09:47 | 76K | |
| qjail54-5.4.pkg | 2023-10-10 05:03 | 73K | |
| qjson-qt5-0.9.0_7.pkg | 2023-10-07 17:31 | 49K | |
| qlas-1.93.pkg | 2023-10-09 23:39 | 13K | |
| qlcplus-4.12.7.pkg | 2023-10-11 11:13 | 8.6M | |
| qlipper-5.1.2.pkg | 2023-10-08 06:50 | 92K | |
| qlogtools-3.1_3.pkg | 2023-10-09 23:10 | 17K | |
| qmail-activedir-0.17..> | 2023-10-09 17:13 | 19K | |
| qmail-autoresponder-..> | 2023-10-08 21:36 | 20K | |
| qmail-conf-0.60_4.pkg | 2023-10-14 06:39 | 15K | |
| qmail-contrib-0.1_2.pkg | 2023-10-09 13:25 | 54K | |
| qmail-dk-0.54_1.pkg | 2023-10-09 22:50 | 22K | |
| qmail-notify-0.93_1.pkg | 2023-10-10 00:08 | 14K | |
| qmail-qfilter-2.1_4.pkg | 2023-10-10 18:42 | 11K | |
| qmail-rblchk-2.4.1_1..> | 2023-10-09 02:18 | 30K | |
| qmail-remove-0.95_1.pkg | 2023-10-14 03:45 | 9.4K | |
| qmailadmin-1.2.15_8,..> | 2023-10-07 23:06 | 219K | |
| qmailanalog-0.70_4.pkg | 2023-10-09 20:11 | 22K | |
| qmailmrtg7-4.2_5.pkg | 2023-10-10 14:41 | 9.0K | |
| qmake-3.3.8_2.pkg | 2023-10-11 19:21 | 695K | |
| qmapshack-1.17.0.pkg | 2023-10-12 01:56 | 47M | |
| qmasm-4.1_1.pkg | 2023-10-09 08:43 | 80K | |
| qmc2-0.243_4.pkg | 2023-10-10 05:30 | 9.8M | |
| qmcpack-3.15.0_1.pkg | 2023-10-09 18:20 | 2.7M | |
| qmdnsengine-0.2.0.pkg | 2023-10-08 02:24 | 58K | |
| qmediamanager-0.1.1_..> | 2023-10-10 03:01 | 18K | |
| qmhandle-1.3.2_2.pkg | 2023-10-09 07:01 | 9.3K | |
| qmidiarp-0.7.0.pkg | 2023-10-09 10:21 | 311K | |
| qmidictl-0.9.10_1.pkg | 2023-10-10 03:57 | 147K | |
| qmidinet-0.9.11.pkg | 2023-10-10 14:28 | 87K | |
| qml-box2d-2.0.201801..> | 2023-10-08 01:18 | 118K | |
| qmls-0.2.pkg | 2023-10-11 15:51 | 13K | |
| qmmp-plugin-pack-qt5..> | 2023-10-12 01:19 | 197K | |
| qmmp-plugin-pack-qt6..> | 2023-10-08 13:17 | 207K | |
| qmmp-qt5-1.6.4_1.pkg | 2023-10-08 10:03 | 1.9M | |
| qmmp-qt6-2.1.4_2.pkg | 2023-10-07 12:40 | 2.0M | |
| qnetwalk-1.9.0_2.pkg | 2023-10-10 11:06 | 89K | |
| qoauth-qt5-2.0.0_7.pkg | 2023-10-07 01:11 | 23K | |
| qof-0.8.8_3.pkg | 2023-10-08 14:10 | 313K | |
| qogir-gtk-themes-202..> | 2023-10-08 00:36 | 1.6M | |
| qogir-icon-themes-20..> | 2023-10-09 08:14 | 10M | |
| qonk-0.3.1_15.pkg | 2023-10-10 08:33 | 167K | |
| qownnotes-23.9.2.pkg | 2023-10-10 08:18 | 3.6M | |
| qpage-3.3_8.pkg | 2023-10-08 15:06 | 46K | |
| qpdf-11.5.0.pkg | 2023-10-06 16:57 | 810K | |
| qpdfview-0.4.18_39.pkg | 2023-10-09 20:34 | 582K | |
| qpopper-4.1.0_6.pkg | 2023-10-10 16:45 | 77K | |
| qpress-20230507.pkg | 2023-10-07 15:12 | 26K | |
| qprint-1.1.pkg | 2023-10-10 13:01 | 8.3K | |
| qpwgraph-0.0.9_1.pkg | 2023-10-09 13:41 | 88K | |
| qqwing-1.3.4_5.pkg | 2023-10-06 20:04 | 29K | |
| qr-code-generator-1...> | 2023-10-07 18:21 | 57K | |
| qr-g20200216_1.pkg | 2023-10-10 04:09 | 5.1K | |
| qrcodegen-1.14.2_1.pkg | 2023-10-08 20:41 | 661K | |
| qrcp-0.10.1_2.pkg | 2023-10-14 14:54 | 2.9M | |
| qrouter-1.4.86.pkg | 2023-10-08 06:58 | 158K | |
| qrq-0.3.4.pkg | 2023-10-10 03:45 | 124K | |
| qrupdate-1.1.2_12.pkg | 2023-10-06 11:10 | 34K | |
| qsampler-0.9.10_1.pkg | 2023-10-10 19:18 | 255K | |
| qschematic-1.4.0.pkg | 2023-10-14 02:40 | 294K | |
| qscheme-0.5.1_10.pkg | 2023-10-08 22:31 | 288K | |
| qscintilla2-designer..> | 2023-10-14 12:19 | 5.9K | |
| qscintilla2-qt5-2.14..> | 2023-10-06 10:00 | 1.6M | |
| qscintilla2-qt6-2.14..> | 2023-10-06 18:59 | 1.6M | |
| qsf-1.2.15.pkg | 2023-10-08 18:04 | 59K | |
| qspeakers-1.6.8.pkg | 2023-10-12 09:00 | 117K | |
| qsstv-9.5.8_2.pkg | 2023-10-08 18:40 | 692K | |
| qstardict-1.3_2.pkg | 2023-10-14 14:58 | 430K | |
| qstat-2.17.pkg | 2023-10-08 03:53 | 175K | |
| qsudo-201711240000_4..> | 2023-10-08 02:00 | 20K | |
| qsynth-0.9.12.pkg | 2023-10-11 14:05 | 252K | |
| qt-maybe-0.0.2015122..> | 2023-10-07 21:05 | 2.2K | |
| qt5-3d-5.15.8p0.pkg | 2023-10-06 20:18 | 1.8M | |
| qt5-5.15.8_4.pkg | 2023-10-10 02:26 | 1.5K | |
| qt5-assistant-5.15.8..> | 2023-10-06 07:06 | 315K | |
| qt5-buildtools-5.15...> | 2023-10-05 17:28 | 927K | |
| qt5-charts-5.15.8p0.pkg | 2023-10-06 15:29 | 564K | |
| qt5-concurrent-5.15...> | 2023-10-06 07:02 | 30K | |
| qt5-connectivity-5.1..> | 2023-10-06 09:52 | 220K | |
| qt5-core-5.15.8p157_..> | 2023-10-05 17:47 | 2.4M | |
| qt5-datavis3d-5.15.8..> | 2023-10-06 22:38 | 452K | |
| qt5-dbus-5.15.8p157.pkg | 2023-10-05 17:55 | 280K | |
| qt5-declarative-5.15..> | 2023-10-05 19:36 | 4.1M | |
| qt5-declarative-test..> | 2023-10-06 06:58 | 77K | |
| qt5-designer-5.15.8p..> | 2023-10-06 07:21 | 3.2M | |
| qt5-doc-5.12.2.pkg | 2023-10-07 23:39 | 232M | |
| qt5-examples-5.15.8.pkg | 2023-10-07 19:45 | 113M | |
| qt5-gamepad-5.15.8p0..> | 2023-10-06 18:54 | 59K | |
| qt5-graphicaleffects..> | 2023-10-06 07:41 | 64K | |
| qt5-gui-5.15.8p157_2..> | 2023-10-05 18:12 | 3.4M | |
| qt5-help-5.15.8p1.pkg | 2023-10-05 19:55 | 169K | |
| qt5-imageformats-5.1..> | 2023-10-06 09:35 | 46K | |
| qt5-l10n-5.15.8p0.pkg | 2023-10-07 16:09 | 1.8M | |
| qt5-linguist-5.15.8p..> | 2023-10-06 11:13 | 406K | |
| qt5-linguisttools-5...> | 2023-10-05 19:55 | 353K | |
| qt5-location-5.15.8p..> | 2023-10-06 07:21 | 1.0M | |
| qt5-multimedia-5.15...> | 2023-10-06 08:20 | 620K | |
| qt5-network-5.15.8p1..> | 2023-10-05 17:52 | 550K | |
| qt5-networkauth-5.15..> | 2023-10-06 15:11 | 57K | |
| qt5-opengl-5.15.8p15..> | 2023-10-06 07:57 | 134K | |
| qt5-pixeltool-5.15.8..> | 2023-10-08 01:48 | 19K | |
| qt5-printsupport-5.1..> | 2023-10-06 06:33 | 168K | |
| qt5-qdbus-5.15.8p1.pkg | 2023-10-06 10:23 | 18K | |
| qt5-qdbusviewer-5.15..> | 2023-10-08 00:51 | 36K | |
| qt5-qdoc-5.15.8p1.pkg | 2023-10-06 08:34 | 493K | |
| qt5-qdoc-data-5.15.8..> | 2023-10-05 16:39 | 159K | |
| qt5-qev-5.15.8p1.pkg | 2023-10-07 20:31 | 4.8K | |
| qt5-qmake-5.15.8p157..> | 2023-10-05 17:24 | 5.0M | |
| qt5-qtdiag-5.15.8p1.pkg | 2023-10-07 17:13 | 23K | |
| qt5-qtpaths-5.15.8p1..> | 2023-10-06 13:19 | 11K | |
| qt5-qtplugininfo-5.1..> | 2023-10-07 16:41 | 8.5K | |
| qt5-quick3d-5.15.8p1..> | 2023-10-06 10:05 | 3.6M | |
| qt5-quickcontrols-5...> | 2023-10-06 13:28 | 824K | |
| qt5-quickcontrols2-5..> | 2023-10-06 07:35 | 1.4M | |
| qt5-quicktimeline-5...> | 2023-10-07 20:42 | 20K | |
| qt5-remoteobjects-5...> | 2023-10-06 09:55 | 321K | |
| qt5-script-5.15.11p0..> | 2023-10-06 07:37 | 511K | |
| qt5-scripttools-5.15..> | 2023-10-06 18:36 | 197K | |
| qt5-scxml-5.15.8p0.pkg | 2023-10-06 21:19 | 219K | |
| qt5-sensors-5.15.8p0..> | 2023-10-06 09:15 | 135K | |
| qt5-serialbus-5.15.8..> | 2023-10-07 10:35 | 142K | |
| qt5-serialport-5.15...> | 2023-10-06 06:56 | 37K | |
| qt5-speech-5.15.8p1_..> | 2023-10-06 06:28 | 29K | |
| qt5-sql-5.15.8p157.pkg | 2023-10-05 19:02 | 89K | |
| qt5-sqldrivers-mysql..> | 2023-10-06 08:00 | 22K | |
| qt5-sqldrivers-odbc-..> | 2023-10-07 15:06 | 33K | |
| qt5-sqldrivers-pgsql..> | 2023-10-07 11:27 | 26K | |
| qt5-sqldrivers-sqlit..> | 2023-10-08 06:04 | 13K | |
| qt5-sqldrivers-sqlit..> | 2023-10-05 19:32 | 22K | |
| qt5-sqldrivers-tds-5..> | 2023-10-07 13:47 | 17K | |
| qt5-style-plugins-5...> | 2023-10-08 11:55 | 384K | |
| qt5-style-qtcurve-1...> | 2023-10-08 05:43 | 203K | |
| qt5-svg-5.15.8p8.pkg | 2023-10-06 06:04 | 127K | |
| qt5-testlib-5.15.8p1..> | 2023-10-05 20:11 | 152K | |
| qt5-uiplugin-5.15.8p..> | 2023-10-05 20:08 | 5.8K | |
| qt5-uitools-5.15.8p1..> | 2023-10-05 20:17 | 145K | |
| qt5-virtualkeyboard-..> | 2023-10-06 12:01 | 517K | |
| qt5-wayland-5.15.8p5..> | 2023-10-05 20:31 | 1.0M | |
| qt5-webchannel-5.15...> | 2023-10-06 07:09 | 67K | |
| qt5-webengine-5.15.8..> | 2023-10-06 14:04 | 45M | |
| qt5-webglplugin-5.15..> | 2023-10-08 00:07 | 200K | |
| qt5-webkit-5.212.0.a..> | 2023-10-06 11:52 | 9.7M | |
| qt5-websockets-5.15...> | 2023-10-06 07:16 | 61K | |
| qt5-websockets-qml-5..> | 2023-10-08 08:23 | 14K | |
| qt5-webview-5.15.8p0..> | 2023-10-06 19:47 | 40K | |
| qt5-widgets-5.15.8p1..> | 2023-10-05 18:25 | 2.4M | |
| qt5-x11extras-5.15.8..> | 2023-10-05 20:19 | 11K | |
| qt5-xml-5.15.8p157.pkg | 2023-10-05 19:35 | 97K | |
| qt5-xmlpatterns-5.15..> | 2023-10-06 09:37 | 1.0M | |
| qt5ct-1.7.pkg | 2023-10-09 03:38 | 182K | |
| qt5pas-2.6_4.pkg | 2023-10-07 00:51 | 424K | |
| qt6-3d-6.5.2.pkg | 2023-10-07 04:22 | 2.1M | |
| qt6-5compat-6.5.2.pkg | 2023-10-06 19:07 | 400K | |
| qt6-6.5.2.pkg | 2023-10-10 20:42 | 1.1K | |
| qt6-base-6.5.2_2.pkg | 2023-10-06 10:49 | 12M | |
| qt6-base_sqldriver-m..> | 2023-10-07 19:02 | 27K | |
| qt6-base_sqldriver-o..> | 2023-10-07 10:30 | 36K | |
| qt6-base_sqldriver-p..> | 2023-10-08 06:56 | 32K | |
| qt6-base_sqldriver-s..> | 2023-10-06 23:14 | 28K | |
| qt6-charts-6.5.2.pkg | 2023-10-07 09:09 | 666K | |
| qt6-datavis3d-6.5.2.pkg | 2023-10-07 01:38 | 528K | |
| qt6-declarative-6.5...> | 2023-10-06 13:14 | 10M | |
| qt6-doc-6.5.2.pkg | 2023-10-07 04:32 | 9.1M | |
| qt6-examples-6.5.2_1..> | 2023-10-07 10:22 | 110M | |
| qt6-httpserver-6.5.2..> | 2023-10-07 01:48 | 59K | |
| qt6-imageformats-6.5..> | 2023-10-06 20:42 | 49K | |
| qt6-languageserver-6..> | 2023-10-06 11:27 | 294K | |
| qt6-location-6.5.2.pkg | 2023-10-07 02:24 | 531K | |
| qt6-lottie-6.5.2.pkg | 2023-10-06 20:42 | 111K | |
| qt6-multimedia-6.5.2..> | 2023-10-06 19:55 | 1.0M | |
| qt6-networkauth-6.5...> | 2023-10-07 06:00 | 69K | |
| qt6-positioning-6.5...> | 2023-10-06 16:43 | 337K | |
| qt6-quick3d-6.5.2.pkg | 2023-10-06 16:58 | 4.6M | |
| qt6-quickeffectmaker..> | 2023-10-07 13:48 | 3.7M | |
| qt6-quicktimeline-6...> | 2023-10-06 14:12 | 42K | |
| qt6-remoteobjects-6...> | 2023-10-06 21:26 | 357K | |
| qt6-scxml-6.5.2.pkg | 2023-10-07 09:51 | 396K | |
| qt6-sensors-6.5.2.pkg | 2023-10-06 22:23 | 147K | |
| qt6-serialbus-6.5.2.pkg | 2023-10-06 15:23 | 203K | |
| qt6-serialport-6.5.2..> | 2023-10-06 12:59 | 46K | |
| qt6-shadertools-6.5...> | 2023-10-06 12:14 | 1.2M | |
| qt6-speech-6.5.2.pkg | 2023-10-06 18:34 | 62K | |
| qt6-svg-6.5.2.pkg | 2023-10-06 16:01 | 147K | |
| qt6-tools-6.5.2.pkg | 2023-10-06 16:32 | 5.1M | |
| qt6-translations-6.5..> | 2023-10-06 23:16 | 1.6M | |
| qt6-virtualkeyboard-..> | 2023-10-07 19:58 | 2.1M | |
| qt6-wayland-6.5.2.pkg | 2023-10-07 09:43 | 940K | |
| qt6-webchannel-6.5.2..> | 2023-10-06 18:10 | 94K | |
| qt6-webengine-6.5.2_..> | 2023-10-07 07:10 | 60M | |
| qt6-websockets-6.5.2..> | 2023-10-06 15:00 | 82K | |
| qt6-webview-6.5.2.pkg | 2023-10-08 00:31 | 63K | |
| qt6ct-0.8_1.pkg | 2023-10-09 03:41 | 145K | |
| qt6pas-6.2.6_1.pkg | 2023-10-10 15:43 | 439K | |
| qtawesome-20150319_4..> | 2023-10-11 00:28 | 28K | |
| qtcreator-11.0.2.pkg | 2023-10-09 08:28 | 39M | |
| qtcurve-1.9.0.pkg | 2023-10-09 23:23 | 520 | |
| qtcurve-utils-1.9.0.pkg | 2023-10-07 09:50 | 286K | |
| qtel-19.09.1_3.pkg | 2023-10-09 13:05 | 135K | |
| qterminal-1.3.0.pkg | 2023-10-07 16:29 | 213K | |
| qtermwidget-1.3.0.pkg | 2023-10-07 07:05 | 183K | |
| qtfeedback-5.0.0.b1...> | 2023-10-07 15:16 | 39K | |
| qtfm-6.2.1_1.pkg | 2023-10-08 15:30 | 316K | |
| qtiplot-doc-0.9.8.9_..> | 2023-10-09 00:12 | 6.5M | |
| qtkeychain-qt5-0.14...> | 2023-10-06 08:26 | 50K | |
| qtkeychain-qt6-0.14...> | 2023-10-08 08:10 | 57K | |
| qtpass-1.4.0.r1.95.pkg | 2023-10-09 23:13 | 308K | |
| qtpbfimageplugin-2.1..> | 2023-10-07 14:31 | 242K | |
| qtractor-0.9.35.pkg | 2023-10-09 22:03 | 1.6M | |
| qtutilities-6.13.1.pkg | 2023-10-08 19:39 | 160K | |
| qtxdg-tools-3.11.0.pkg | 2023-10-07 09:50 | 20K | |
| qu-aspell-0.02.0_1,2..> | 2023-10-10 16:00 | 294K | |
| quadra-1.3.0_6.pkg | 2023-10-09 03:25 | 2.3M | |
| quadrapassel-40.2_1.pkg | 2023-10-07 09:23 | 235K | |
| quagga-1.2.4_11.pkg | 2023-10-09 03:58 | 1.3M | |
| quake-data-1.0.6_2.pkg | 2023-10-07 06:05 | 6.5M | |
| quake-dpmod-20130301..> | 2023-10-11 11:47 | 3.6M | |
| quake-framework-0.5...> | 2023-10-10 06:49 | 2.6M | |
| quake-par-0.03.01.pkg | 2023-10-14 04:00 | 13K | |
| quake-source-1.01_1.pkg | 2023-10-08 08:02 | 78K | |
| quake2-3zb2-0.97_1.pkg | 2023-10-10 04:05 | 1.6M | |
| quake2-ctf-1.52.pkg | 2023-10-08 19:41 | 6.9M | |
| quake2-data-3.20_3.pkg | 2023-10-08 00:41 | 8.2M | |
| quake2-extras-1.0.pkg | 2023-10-14 05:45 | 26M | |
| quake2-lights-1.pkg | 2023-10-09 06:58 | 792K | |
| quake2-matrix-1.pkg | 2023-10-10 09:25 | 5.7M | |
| quake2-psychomod-3.1..> | 2023-10-09 16:29 | 1.2M | |
| quake2-relay-0.4_1.pkg | 2023-10-08 15:49 | 94K | |
| quake2-rogue-3.20.pkg | 2023-10-10 09:20 | 245K | |
| quake2-source-3.21_1..> | 2023-10-09 17:47 | 152K | |
| quake2-xatrix-3.20.pkg | 2023-10-10 17:20 | 191K | |
| quake2lnx-0.16.2_16.pkg | 2023-10-08 18:45 | 360K | |
| quake2max-0.45_15.pkg | 2023-10-14 05:27 | 2.0M | |
| quake3-data-1.32.b.3..> | 2023-10-07 01:02 | 24M | |
| quake3-excessive-003..> | 2023-10-10 18:56 | 106K | |
| quake3-osp-1.03a.pkg | 2023-10-10 22:17 | 44M | |
| quake3-ut-3.7_1.pkg | 2023-10-10 20:59 | 438M | |
| quake3-wfa-3.5b.pkg | 2023-10-10 06:45 | 198M | |
| quakeforge-0.7.2_10.pkg | 2023-10-10 14:46 | 1.3M | |
| quantis-kmod-v18.03...> | 2023-10-14 18:51 | 3.7K | |
| quantlib-1.31.1.pkg | 2023-10-09 17:02 | 23M | |
| quantum++-4.3.4.pkg | 2023-10-14 05:59 | 112K | |
| quantum-espresso-6.7..> | 2023-10-07 14:01 | 25M | |
| quantum-espresso-pse..> | 2023-10-09 04:13 | 147M | |
| quantum-jet-0.2.2.2_..> | 2023-10-08 13:39 | 145K | |
| quantum-parallelizat..> | 2023-10-09 00:41 | 70K | |
| quantumminigolf-1.1...> | 2023-10-14 15:59 | 270K | |
| quaqut-0.2.0_1.pkg | 2023-10-14 11:12 | 18K | |
| quark-server-g202102..> | 2023-10-09 10:21 | 17K | |
| quasi88-0.6.4.pkg | 2023-10-11 17:09 | 487K | |
| quassel-0.14.0_5.pkg | 2023-10-11 00:01 | 2.3M | |
| quassel-core-0.14.0_..> | 2023-10-08 12:40 | 666K | |
| quat-1.20.pkg | 2023-10-08 16:03 | 251K | |
| quat-gui-1.20_17.pkg | 2023-10-10 10:50 | 333K | |
| quazip-qt5-1.4_1.pkg | 2023-10-06 19:49 | 99K | |
| quazip-qt6-1.4_1.pkg | 2023-10-09 16:57 | 107K | |
| qucs-s-2.0.0_1.pkg | 2023-10-09 21:41 | 2.6M | |
| qucsator-0.0.20.4.pkg | 2023-10-14 19:05 | 884K | |
| qudos-0.40.1_21.pkg | 2023-10-08 15:36 | 5.5M | |
| quesa-1.8_9.pkg | 2023-10-09 09:13 | 573K | |
| quesoglc-0.7.2_10.pkg | 2023-10-07 11:11 | 84K | |
| quetoo-0.6.1_10.pkg | 2023-10-11 11:44 | 1.2M | |
| queue-fix-1.4_1.pkg | 2023-10-11 13:26 | 12K | |
| queue-repair-0.9.0_3..> | 2023-10-10 02:55 | 7.4K | |
| quftp-1.0.7_6.pkg | 2023-10-09 14:07 | 35K | |
| quiche-0.12.0_15.pkg | 2023-10-09 16:31 | 10M | |
| quickcheck++-0.0.3.pkg | 2023-10-14 07:42 | 16K | |
| quickcpplib-g2023061..> | 2023-10-07 12:09 | 188K | |
| quickjail-0.2.1.pkg | 2023-10-14 05:59 | 6.5K | |
| quickjs-2021.03.27.pkg | 2023-10-07 15:23 | 1.5M | |
| quickqanava-2.2.0.pkg | 2023-10-09 20:09 | 418K | |
| quicksynergy-0.9.0_9..> | 2023-10-11 01:51 | 12K | |
| quickwit-0.6.3_1.pkg | 2023-10-08 22:54 | 11M | |
| quilt-0.67_1.pkg | 2023-10-09 04:26 | 384K | |
| quilter-2.2.3_5.pkg | 2023-10-09 03:02 | 562K | |
| quimup-1.4.4_2.pkg | 2023-10-09 02:44 | 285K | |
| quirc-0.9.84_6.pkg | 2023-10-14 06:50 | 231K | |
| quisk-4.2.19_1.pkg | 2023-10-09 23:36 | 2.5M | |
| quit-1.2a_1.pkg | 2023-10-10 02:17 | 5.2K | |
| quiterss-0.19.4_2.pkg | 2023-10-14 15:19 | 1.1M | |
| quoted-1.01_3.pkg | 2023-10-11 06:29 | 15K | |
| qutebrowser-3.0.0.pkg | 2023-10-14 02:23 | 2.0M | |
| qutebrowser-qt5-3.0...> | 2023-10-08 23:14 | 2.0M | |
| qvge-0.6.3_1.pkg | 2023-10-09 07:22 | 573K | |
| qview-6.1.pkg | 2023-10-09 18:53 | 447K | |
| qwalk-1.0.1.300_6.pkg | 2023-10-08 13:00 | 1.2M | |
| qwdtools-0.34,2.pkg | 2023-10-14 13:54 | 36K | |
| qwinff-0.2.1.22_1.pkg | 2023-10-14 15:37 | 455K | |
| qwt5-qt5-5.2.3g20210..> | 2023-10-08 12:00 | 1.6M | |
| qwt6-qt5-6.1.6_1.pkg | 2023-10-06 22:51 | 3.2M | |
| qwtplot3d-qt5-0.3.0...> | 2023-10-07 20:04 | 93K | |
| qxgedit-0.9.11.pkg | 2023-10-10 03:48 | 287K | |
| qxlsx-1.4.4.pkg | 2023-10-07 13:43 | 225K | |
| qxmpp-qt5-1.5.5.pkg | 2023-10-07 11:25 | 937K | |
| qxmpp-qt6-1.5.5.pkg | 2023-10-10 10:43 | 1.0M | |
| r1q2-8012_6.pkg | 2023-10-14 09:12 | 387K | |
| r7-office-7.2.2_1.pkg | 2023-10-11 00:35 | 224M | |
| rabbiteer-1.4.1_51.pkg | 2023-10-09 20:25 | 481K | |
| rabbitmq-3.11.19_1.pkg | 2023-10-08 02:37 | 15M | |
| rabbitmq-c-0.13.0.pkg | 2023-10-08 04:06 | 88K | |
| rabs-2.27.6.pkg | 2023-10-14 04:52 | 201K | |
| racket-8.10.pkg | 2023-10-10 10:29 | 162M | |
| racket-minimal-8.10.pkg | 2023-10-10 22:05 | 26M | |
| rackmonkey-1.2.5_5.pkg | 2023-10-09 15:26 | 204K | |
| racktables-php80-0.2..> | 2023-10-14 12:01 | 787K | |
| racktables-php81-0.2..> | 2023-10-14 03:28 | 787K | |
| racktables-php82-0.2..> | 2023-10-10 13:54 | 787K | |
| racktables-php83-0.2..> | 2023-10-09 02:41 | 787K | |
| racoon2-202000908_1.pkg | 2023-10-10 15:03 | 385K | |
| radare2-5.8.8.pkg | 2023-10-10 20:09 | 6.4M | |
| radarr-4.7.5.7809.pkg | 2023-10-09 18:32 | 28M | |
| radcli-1.3.1.pkg | 2023-10-09 20:20 | 118K | |
| raddump-0.3.1.pkg | 2023-10-09 00:56 | 28K | |
| radeontool-1.5.pkg | 2023-10-12 02:06 | 5.4K | |
| radeontop-1.4.pkg | 2023-10-14 15:42 | 23K | |
| radian-0.5.4.pkg | 2023-10-14 13:41 | 67K | |
| radius-engine-1.1_6.pkg | 2023-10-07 22:26 | 78K | |
| radiusclient-0.5.6_3..> | 2023-10-07 00:09 | 54K | |
| radmind-1.15.4_20210..> | 2023-10-10 06:00 | 135K | |
| radns-20110809.2.pkg | 2023-10-09 13:00 | 31K | |
| radreport-1.3.pkg | 2023-10-14 13:26 | 14K | |
| radsecproxy-1.9.2.pkg | 2023-10-14 11:39 | 80K | |
| radvd-2.19_2.pkg | 2023-10-14 07:14 | 65K | |
| rage-0.4.0_1.pkg | 2023-10-09 04:12 | 250K | |
| ragel-6.10_1.pkg | 2023-10-06 20:12 | 453K | |
| raidtest-1.3.pkg | 2023-10-10 07:17 | 5.9K | |
| rainbarf-1.4_1.pkg | 2023-10-09 18:54 | 16K | |
| rainbow-2.0.4.pkg | 2023-10-08 02:19 | 42K | |
| rainloop-php80-1.17...> | 2023-10-14 14:56 | 3.9M | |
| rainloop-php81-1.17...> | 2023-10-10 20:12 | 3.9M | |
| rainloop-php82-1.17...> | 2023-10-09 03:09 | 3.9M | |
| rainloop-php83-1.17...> | 2023-10-09 18:20 | 3.9M | |
| raknet-3.9.2_11,1.pkg | 2023-10-14 18:39 | 5.6M | |
| raleway-4.101.pkg | 2023-10-09 10:34 | 708K | |
| rampler-2.0.0_1.pkg | 2023-10-10 09:02 | 19K | |
| ramspeed-3.5.0.pkg | 2023-10-08 12:32 | 20K | |
| rancid3-3.13_1.pkg | 2023-10-08 07:50 | 217K | |
| rand-1.9_1.pkg | 2023-10-10 13:07 | 6.6K | |
| randlib-1.3.pkg | 2023-10-14 18:46 | 33K | |
| randlm-0.2.5_23.pkg | 2023-10-09 11:18 | 585K | |
| random123-1.14.0.5.pkg | 2023-10-07 03:50 | 37K | |
| randomio-1.4.pkg | 2023-10-14 14:01 | 4.4K | |
| randomx-1.1.10.28.pkg | 2023-10-14 14:42 | 67K | |
| rang-3.2.pkg | 2023-10-07 00:49 | 5.6K | |
| range-v3-0.12.0.pkg | 2023-10-07 04:41 | 211K | |
| rankwidth-0.9_2.pkg | 2023-10-07 19:27 | 10K | |
| rapid-2.01.pkg | 2023-10-10 10:14 | 21K | |
| rapid-photo-download..> | 2023-10-10 01:16 | 8.2M | |
| rapidcheck-g20220314..> | 2023-10-08 21:12 | 152K | |
| rapidfuzz-cpp-2.0.0.pkg | 2023-10-06 15:57 | 42K | |
| rapidjson-1.1.0.709.pkg | 2023-10-06 11:06 | 1.1M | |
| rapidxml-1.13.pkg | 2023-10-14 08:32 | 31K | |
| rapidyaml-0.3.0.pkg | 2023-10-07 08:16 | 74K | |
| raptor-1.4.21_8.pkg | 2023-10-10 17:53 | 325K | |
| raptor2-2.0.16_1.pkg | 2023-10-06 14:45 | 356K | |
| rar-6.23,3.pkg | 2023-10-05 16:39 | 309K | |
| rasqal-0.9.33_1.pkg | 2023-10-06 16:26 | 371K | |
| raster3d-3.0.7_2.pkg | 2023-10-08 02:35 | 1.5M | |
| ratbox-respond-1.0_3..> | 2023-10-09 08:48 | 9.0K | |
| rate-0.9_2.pkg | 2023-10-10 12:08 | 45K | |
| ratelimit-policyd-1...> | 2023-10-10 08:54 | 10K | |
| ratfor-1985.06_15.pkg | 2023-10-10 05:39 | 20K | |
| rathole-0.4.8_3.pkg | 2023-10-10 17:32 | 1.1M | |
| rationl-0.1.0.139.pkg | 2023-10-14 12:11 | 34K | |
| ratmen-2.2.3_1.pkg | 2023-10-10 12:49 | 21K | |
| ratpoison-1.4.9_3.pkg | 2023-10-14 08:03 | 116K | |
| ratproxy-1.58.pkg | 2023-10-09 15:30 | 39K | |
| rats-2.4.pkg | 2023-10-10 12:36 | 84K | |
| raul-2.0.0.pkg | 2023-10-07 23:14 | 10K | |
| rav1e-0.6.6_3.pkg | 2023-10-10 11:09 | 1.1M | |
| rawgl-g20180321_2.pkg | 2023-10-10 04:08 | 55K | |
| rawrec-0.9.991_1.pkg | 2023-10-07 15:16 | 20K | |
| rawstudio-2.0_25.pkg | 2023-10-10 15:50 | 952K | |
| rawtherapee-5.9_3.pkg | 2023-10-11 05:06 | 20M | |
| raylib-4.2.0.pkg | 2023-10-14 12:15 | 611K | |
| raysfilter-1.14_3.pkg | 2023-10-14 07:16 | 31K | |
| rayshade-4.0.6_7.pkg | 2023-10-14 17:52 | 310K | |
| razor-agents-2.84_1.pkg | 2023-10-09 17:45 | 82K | |
| rbenv-1.2.0.pkg | 2023-10-07 14:28 | 13K | |
| rbl-milter-0.30_6.pkg | 2023-10-09 12:35 | 7.4K | |
| rblcheck-1.5_2.pkg | 2023-10-08 20:47 | 5.5K | |
| rbldnsd-0.998.pkg | 2023-10-10 14:12 | 84K | |
| rbllookup-0.0.1.1_1.pkg | 2023-10-14 11:49 | 5.1K | |
| rbllookup-ng-1.1_3.pkg | 2023-10-11 18:04 | 6.1K | |
| rbot-20160325_1,1.pkg | 2023-10-10 09:10 | 429K | |
| rbprof-0.2.1.pkg | 2023-10-10 01:01 | 8.2K | |
| rc-1.7.4_4.pkg | 2023-10-10 01:57 | 283K | |
| rc-subr-jail-5.pkg | 2023-10-07 09:34 | 1.9K | |
| rcadm-0.1.pkg | 2023-10-10 15:01 | 1.3K | |
| rcctools-0.1.1_4.pkg | 2023-10-10 15:39 | 7.7K | |
| rclean-1.14.pkg | 2023-10-10 00:55 | 4.8K | |
| rclint-1.3.0.pkg | 2023-10-14 06:46 | 7.0K | |
| rclock-2.7.10_3.pkg | 2023-10-08 21:51 | 14K | |
| rclone-1.64.0.pkg | 2023-10-08 00:59 | 13M | |
| rclone-browser-1.8.0..> | 2023-10-11 00:08 | 275K | |
| rcm-1.3.6.pkg | 2023-10-08 17:04 | 19K | |
| rcpd-1.3.pkg | 2023-10-10 07:19 | 10K | |
| rcracki_mt-0.7.0.pkg | 2023-10-14 11:47 | 120K | |
| rcs-5.10.1_1.pkg | 2023-10-07 10:07 | 188K | |
| rcs57-5.7.pkg | 2023-10-08 11:43 | 158K | |
| rdap-0.9.0_15.pkg | 2023-10-10 08:48 | 2.2M | |
| rdapper-20150326.pkg | 2023-10-08 13:36 | 9.7K | |
| rdate-20150501.pkg | 2023-10-10 09:30 | 8.7K | |
| rdesktop-1.9.0.pkg | 2023-10-07 08:05 | 179K | |
| rdfind-1.6.0.pkg | 2023-10-14 14:59 | 36K | |
| rdist-6.1.5_7.pkg | 2023-10-11 00:35 | 55K | |
| rdkit-2023.03.3.pkg | 2023-10-07 09:59 | 29M | |
| rdup-1.1.15_2.pkg | 2023-10-09 02:38 | 46K | |
| re-3.5.1.pkg | 2023-10-07 19:04 | 447K | |
| re-flex-3.4.0.pkg | 2023-10-14 14:47 | 320K | |
| re2-20230901.pkg | 2023-10-05 17:43 | 263K | |
| re2c-3.0.pkg | 2023-10-06 18:41 | 403K | |
| re3-g20210219_2.pkg | 2023-10-10 11:31 | 3.4M | |
| re_graph-0.2_3.pkg | 2023-10-10 20:22 | 49K | |
| reactphysics3d-0.9.0..> | 2023-10-10 06:00 | 364K | |
| read-edid-3.0.2.pkg | 2023-10-11 12:57 | 14K | |
| readarr-0.3.5.2217.pkg | 2023-10-10 21:09 | 23M | |
| readerwriterqueue-1...> | 2023-10-14 05:16 | 15K | |
| readline-8.2.1.pkg | 2023-10-05 16:41 | 358K | |
| readosm-1.1.0.pkg | 2023-10-07 13:08 | 24K | |
| readseq-2.1.19.pkg | 2023-10-07 16:45 | 701K | |
| readstat-1.1.8_4.pkg | 2023-10-08 00:54 | 324K | |
| realesrgan-ncnn-vulk..> | 2023-10-08 06:56 | 40M | |
| reallyslick-0.9.1_24..> | 2023-10-14 16:38 | 3.0M | |
| realsr-ncnn-vulkan-2..> | 2023-10-09 06:59 | 59M | |
| realtek-re-kmod-198...> | 2023-10-14 18:56 | 90K | |
| rearx-0.1.4_24.pkg | 2023-10-09 15:02 | 963K | |
| reaver-1.6.6.pkg | 2023-10-14 18:21 | 167K | |
| rebar-2.6.4,1.pkg | 2023-10-08 01:20 | 199K | |
| rebar3-3.22.1,1.pkg | 2023-10-07 09:30 | 793K | |
| rebot3-1.0.2.pkg | 2023-10-10 13:50 | 10K | |
| recastnavigation-1.6..> | 2023-10-07 16:28 | 210K | |
| recmpeg-1.0.5_1.pkg | 2023-10-11 08:34 | 8.5K | |
| recode-3.6_15.pkg | 2023-10-06 18:40 | 468K | |
| recoll-1.33.1_5.pkg | 2023-10-09 03:25 | 2.0M | |
| recombine-1.41_2.pkg | 2023-10-09 09:28 | 114K | |
| recordmydesktop-0.3...> | 2023-10-06 21:07 | 43K | |
| recoverdm-0.20.pkg | 2023-10-09 15:34 | 13K | |
| recoverjpeg-2.6.3_2.pkg | 2023-10-11 02:03 | 24K | |
| recutils-1.9.pkg | 2023-10-08 12:35 | 518K | |
| recvnet-0.0.1_1.pkg | 2023-10-09 06:56 | 4.3K | |
| recycle-7.0.0.pkg | 2023-10-09 21:45 | 4.5K | |
| redasm-2.1.1_1.pkg | 2023-10-09 13:13 | 1.2M | |
| reddsaver-0.4.0_7.pkg | 2023-10-10 16:14 | 1.0M | |
| redeclipse-2.0.0_2.pkg | 2023-10-10 06:18 | 2.4M | |
| redeclipse-data-2.0...> | 2023-10-07 21:01 | 866M | |
| redeclipse-data16-1...> | 2023-10-08 10:09 | 824M | |
| redeclipse16-1.6.0_2..> | 2023-10-10 00:00 | 2.1M | |
| redet-8.26.pkg | 2023-10-08 13:18 | 229K | |
| redir-2.2.1_2.pkg | 2023-10-10 10:50 | 13K | |
| redis-7.2.1.pkg | 2023-10-06 20:20 | 882K | |
| redis-devel-7.2.0.20..> | 2023-10-14 11:25 | 884K | |
| redis6-6.0.20.pkg | 2023-10-09 05:25 | 679K | |
| redis62-6.2.13.pkg | 2023-10-08 20:01 | 739K | |
| redis70-7.0.13.pkg | 2023-10-14 16:59 | 850K | |
| redis_exporter-1.53...> | 2023-10-14 05:11 | 2.7M | |
| redisdesktopmanager-..> | 2023-10-09 11:19 | 1.4M | |
| redisearch-2.2.10.pkg | 2023-10-10 08:54 | 1.2M | |
| redisearch20-2.0.15.pkg | 2023-10-09 00:08 | 1.2M | |
| redisearch22-2.2.10.pkg | 2023-10-10 20:30 | 1.2M | |
| redisjson-2.0.8_13.pkg | 2023-10-08 20:27 | 433K | |
| redkite-1.3.1.pkg | 2023-10-09 09:22 | 87K | |
| redland-1.0.17_4.pkg | 2023-10-06 20:02 | 264K | |
| redland-bindings-1.0..> | 2023-10-10 12:59 | 55K | |
| redmine50-5.0.5_2.pkg | 2023-10-10 19:19 | 2.0M | |
| redo-1.5.pkg | 2023-10-10 12:42 | 46K | |
| redorblack-1.0.pkg | 2023-10-14 13:27 | 13K | |
| redsea-0.20_1.pkg | 2023-10-10 01:16 | 261K | |
| redshift-1.12_1.pkg | 2023-10-10 02:59 | 130K | |
| reduce-20220617_1.pkg | 2023-10-09 20:59 | 11M | |
| reduce-psl-20230308.pkg | 2023-10-14 02:44 | 7.6M | |
| ree-1.4.1.pkg | 2023-10-10 18:49 | 6.3K | |
| reed-5.6.pkg | 2023-10-10 13:52 | 19K | |
| reed-solomon-4.0.pkg | 2023-10-14 19:02 | 16K | |
| refdb-0.9.9_12.pkg | 2023-10-10 00:49 | 860K | |
| referenceassemblies-..> | 2023-10-08 17:02 | 699K | |
| reflex-20230523.pkg | 2023-10-07 16:15 | 103K | |
| regex2dfa-0.1.6_3.pkg | 2023-10-14 09:11 | 2.8M | |
| regexx-0.98.1_6.pkg | 2023-10-10 08:35 | 17K | |
| regexxer-0.10_9.pkg | 2023-10-10 03:07 | 171K | |
| reggae-0.3.11.pkg | 2023-10-09 22:46 | 45K | |
| regoth-0.4.189_3.pkg | 2023-10-09 08:18 | 1.6M | |
| rehex-0.60.1.pkg | 2023-10-09 08:33 | 1.6M | |
| reicast-0.20201231_4..> | 2023-10-09 08:03 | 1.3M | |
| rej-0.16_1.pkg | 2023-10-09 14:35 | 12K | |
| rejik-3.2.12.pkg | 2023-10-09 03:47 | 35K | |
| relayd-7.3.2023.05.0..> | 2023-10-08 05:42 | 808K | |
| rem-2.12.0.pkg | 2023-10-14 07:11 | 44K | |
| remake-1.6_1.pkg | 2023-10-10 12:41 | 323K | |
| remarkable-devd-1.0_..> | 2023-10-10 21:30 | 1.5K | |
| remarp-0.05_1.pkg | 2023-10-08 21:40 | 11K | |
| remind-04.02.06.pkg | 2023-10-09 18:17 | 243K | |
| remmina-1.4.31.pkg | 2023-10-10 16:41 | 869K | |
| remmina-lite-1.4.31.pkg | 2023-10-14 09:31 | 819K | |
| remontoire-1.4.0_1.pkg | 2023-10-09 07:31 | 21K | |
| remotebox-3.1_1.pkg | 2023-10-14 13:41 | 893K | |
| remotedesk-0.1_11.pkg | 2023-10-08 03:19 | 16K | |
| remotery-g20190209.pkg | 2023-10-10 01:00 | 92K | |
| remserial-1.4.pkg | 2023-10-09 02:52 | 8.5K | |
| rename-1.99.2.pkg | 2023-10-08 18:25 | 12K | |
| renameutils-0.12.0_2..> | 2023-10-09 16:28 | 85K | |
| renattach-1.2.4_1.pkg | 2023-10-11 06:17 | 32K | |
| rendercheck-1.5.pkg | 2023-10-09 10:37 | 21K | |
| renewck-1.01.pkg | 2023-10-11 22:53 | 10K | |
| renpy-7.4.11_2.pkg | 2023-10-14 07:11 | 91M | |
| renrot-1.2.0_2.pkg | 2023-10-09 22:55 | 52K | |
| reoback-1.0_2.pkg | 2023-10-14 04:18 | 14K | |
| reop-2.1.1.pkg | 2023-10-14 07:03 | 20K | |
| rep-gtk2-0.90.8.3_1,..> | 2023-10-07 05:17 | 346K | |
| repeater-0.17.pkg | 2023-10-11 05:44 | 24K | |
| replaceit-1.0.1.pkg | 2023-10-10 02:41 | 5.6K | |
| replex-0.1.6.8_1,1.pkg | 2023-10-09 17:40 | 40K | |
| replibyte-0.10.0_7.pkg | 2023-10-14 10:57 | 3.6M | |
| replxx-0.0.4.pkg | 2023-10-14 03:23 | 99K | |
| repng2jpeg-1.0.5_2.pkg | 2023-10-09 08:35 | 3.9K | |
| reportmagic-2.21_4.pkg | 2023-10-14 13:36 | 289K | |
| repos-style-2.0_2.pkg | 2023-10-10 02:59 | 41K | |
| reprise-0.6.1.pkg | 2023-10-14 13:38 | 58K | |
| reproc-14.2.4.7.pkg | 2023-10-08 04:12 | 27K | |
| reproxy-0.11.0_15.pkg | 2023-10-09 17:21 | 3.2M | |
| repsnapper-2.5.a4_11..> | 2023-10-09 08:56 | 657K | |
| reptyr-0.8.0.pkg | 2023-10-10 05:06 | 17K | |
| rescue-1.0.5.pkg | 2023-10-10 03:15 | 3.7M | |
| resid-0.16_3.pkg | 2023-10-09 16:37 | 33K | |
| residualvm-0.3.1_3.pkg | 2023-10-11 17:58 | 2.2M | |
| resolv_wrapper-1.1.5..> | 2023-10-07 22:49 | 9.1K | |
| resource-agents-4.12..> | 2023-10-08 03:37 | 685K | |
| respond-1.3.pkg | 2023-10-14 09:09 | 7.6K | |
| rest-0.8.1_2.pkg | 2023-10-06 10:47 | 95K | |
| rest-server-0.11.0_1..> | 2023-10-11 03:17 | 2.8M | |
| restbed-4.8.pkg | 2023-10-08 17:41 | 633K | |
| restic-0.16.0_2.pkg | 2023-10-14 19:05 | 6.5M | |
| restinio-0.6.18.pkg | 2023-10-07 04:10 | 198K | |
| resume-1.5.1_2.pkg | 2023-10-08 08:07 | 167K | |
| resume-extensions-0...> | 2023-10-14 12:12 | 6.7K | |
| resvg-0.35.0_2.pkg | 2023-10-14 04:06 | 919K | |
| resvg-c-api-0.35.0_2..> | 2023-10-09 09:54 | 1.2M | |
| retail-1.0.1_1.pkg | 2023-10-09 07:53 | 6.6K | |
| retawq-0.2.6.c_11.pkg | 2023-10-14 14:02 | 168K | |
| retcl-0.4.0.pkg | 2023-10-14 12:22 | 6.9K | |
| retext-8.0.1_1.pkg | 2023-10-14 07:02 | 204K | |
| reticulum-0.5.8.pkg | 2023-10-07 01:24 | 406K | |
| retro12-2023.3.pkg | 2023-10-14 16:54 | 228K | |
| retroarch-assets-g20..> | 2023-10-07 11:06 | 114M | |
| retroshare-0.6.4_12.pkg | 2023-10-09 17:22 | 11M | |
| retry-1.0.5.pkg | 2023-10-09 14:32 | 8.0K | |
| revive-1.3.4.pkg | 2023-10-10 13:39 | 2.0M | |
| rex-4.1.pkg | 2023-10-10 07:17 | 35K | |
| rexima-1.4.pkg | 2023-10-12 12:18 | 9.5K | |
| rexx-curl-2.1.0.pkg | 2023-10-10 23:02 | 148K | |
| rexx-imc-1.76_3.pkg | 2023-10-08 22:55 | 202K | |
| rexx-regina-3.9.3.pkg | 2023-10-07 04:36 | 2.2M | |
| rexx-regmath-1.00_1.pkg | 2023-10-09 12:12 | 49K | |
| rexx-regutil-1.26_2.pkg | 2023-10-10 19:03 | 130K | |
| rexx-wrapper-2.4.pkg | 2023-10-14 15:18 | 239K | |
| rezerwar-0.4.2_3.pkg | 2023-10-10 17:58 | 1.6M | |
| rezound-0.13.1.b_6.pkg | 2023-10-08 17:35 | 1.2M | |
| rfbproxy-1.1.1.pkg | 2023-10-08 21:30 | 22K | |
| rfc-3.2.3_4.pkg | 2023-10-09 04:50 | 7.7K | |
| rfcdiff-1.33_1.pkg | 2023-10-10 15:14 | 10K | |
| rfksay-0.1.pkg | 2023-10-10 00:51 | 1.7K | |
| rgb-1.1.0.pkg | 2023-10-08 05:01 | 8.2K | |
| rgbds-0.6.1_2.pkg | 2023-10-07 12:54 | 191K | |
| rgbpaint-0.8.7_10.pkg | 2023-10-10 01:04 | 56K | |
| rgxg-0.1.2.pkg | 2023-10-08 21:23 | 24K | |
| rhash-1.4.3.pkg | 2023-10-05 17:08 | 218K | |
| rhino-1.7.r4_1.pkg | 2023-10-07 14:28 | 1.0M | |
| rhonabwy-1.1.11.pkg | 2023-10-07 05:33 | 147K | |
| rhtvision-2.2.1.1_11..> | 2023-10-11 02:57 | 572K | |
| rhythmbox-3.4.6_2.pkg | 2023-10-10 18:19 | 2.1M | |
| ricochet-1.1.4_29.pkg | 2023-10-08 20:19 | 505K | |
| ridl-g20190530.pkg | 2023-10-08 12:04 | 10K | |
| riece-9.0.0_22,1.pkg | 2023-10-09 05:21 | 174K | |
| riece-emacs_canna-9...> | 2023-10-08 19:37 | 174K | |
| riece-emacs_devel-9...> | 2023-10-14 05:33 | 174K | |
| riece-emacs_devel_no..> | 2023-10-08 16:07 | 174K | |
| riece-emacs_nox-9.0...> | 2023-10-14 11:09 | 174K | |
| riemann-0.3.8_1.pkg | 2023-10-09 10:41 | 84M | |
| riemann-c-client-2.1..> | 2023-10-09 04:47 | 32K | |
| riffdiff-2.26.0.pkg | 2023-10-09 20:12 | 377K | |
| rifiuti2-0.7.0.pkg | 2023-10-09 06:14 | 30K | |
| rigsofrods-caelum-0...> | 2023-10-14 13:12 | 210K | |
| rigsofrods-pagedgeom..> | 2023-10-09 10:55 | 169K | |
| rinetd-0.62_4.pkg | 2023-10-14 11:51 | 19K | |
| ringrtc-2.30.0_1.pkg | 2023-10-08 02:06 | 3.2M | |
| ringtonetools-2.26.pkg | 2023-10-09 11:08 | 44K | |
| rinse-3.2.pkg | 2023-10-08 19:37 | 24K | |
| rinutils-0.10.2.pkg | 2023-10-06 16:25 | 5.8K | |
| rio-terminal-emulato..> | 2023-10-09 12:52 | 3.2M | |
| rioutil-1.5.0_2.pkg | 2023-10-09 02:42 | 52K | |
| ripe-whois-3.2.2.pkg | 2023-10-14 15:54 | 11K | |
| ripes-2.2.6.pkg | 2023-10-10 18:11 | 2.0M | |
| ripgrep-13.0.0_23.pkg | 2023-10-08 00:59 | 1.1M | |
| ripgrep-all-0.9.6_21..> | 2023-10-09 19:55 | 2.0M | |
| ripmime-1.4.1.0.pkg | 2023-10-07 11:45 | 52K | |
| ripole-0.2.2.pkg | 2023-10-07 05:36 | 15K | |
| ripperx-2.7.3_5.pkg | 2023-10-14 10:40 | 100K | |
| riscv-isa-sim-g_2021..> | 2023-10-14 09:47 | 1.8M | |
| riscv32-unknown-elf-..> | 2023-10-07 10:44 | 1.9M | |
| riscv32-unknown-elf-..> | 2023-10-11 00:03 | 29M | |
| riscv64-binutils-2.4..> | 2023-10-07 22:41 | 1.9M | |
| riscv64-freebsd-sysr..> | 2023-10-08 03:50 | 49M | |
| riscv64-gcc9-9.5.0_1..> | 2023-10-09 23:07 | 17M | |
| riscv64-none-elf-bin..> | 2023-10-07 00:44 | 1.8M | |
| riscv64-none-elf-gcc..> | 2023-10-07 20:59 | 28M | |
| ristretto-0.13.1_1.pkg | 2023-10-07 17:56 | 216K | |
| river-0.2.4.pkg | 2023-10-09 12:39 | 175K | |
| rkcommon-1.10.0_3,1.pkg | 2023-10-06 20:43 | 145K | |
| rkhunter-1.4.6_2.pkg | 2023-10-14 09:52 | 223K | |
| rkr-lv2-2.2_1.pkg | 2023-10-10 12:07 | 275K | |
| rkward-0.7.5_3.pkg | 2023-10-08 17:41 | 2.9M | |
| rl-0.2.7.pkg | 2023-10-14 15:06 | 9.0K | |
| rlaunch-1.3.14_2.pkg | 2023-10-14 18:08 | 319K | |
| rlog-1.4_3.pkg | 2023-10-07 10:16 | 243K | |
| rlottie-0.2.49.pkg | 2023-10-14 12:18 | 179K | |
| rlpr-2.06_2.pkg | 2023-10-10 14:43 | 35K | |
| rlvm-0.14.77_4.pkg | 2023-10-09 05:56 | 815K | |
| rlwrap-0.45.2.pkg | 2023-10-07 03:38 | 108K | |
| rman-3.2.pkg | 2023-10-09 02:15 | 42K | |
| rmap-1.2_14.pkg | 2023-10-09 16:29 | 6.1M | |
| rmf-1.5.1.pkg | 2023-10-07 10:58 | 1.3M | |
| rmilter-1.10.0.pkg | 2023-10-09 14:24 | 211K | |
| rmlint-2.10.1.11_1.pkg | 2023-10-09 04:55 | 117K | |
| rna-STAR-2.7.11.a_1.pkg | 2023-10-07 10:56 | 515K | |
| rna-seq-0.1.4.pkg | 2023-10-10 20:04 | 716 | |
| rname-1.0.2.pkg | 2023-10-10 05:19 | 4.5K | |
| rnd_jue-3.3.0.0_7.pkg | 2023-10-08 14:37 | 34M | |
| rndpassw-0.2.2.pkg | 2023-10-14 14:59 | 4.4K | |
| rngstreams-1.0.1_2.pkg | 2023-10-08 11:19 | 12K | |
| rnnoise-g20210122.pkg | 2023-10-07 01:56 | 106K | |
| rnnoise-nu-g20180916..> | 2023-10-08 09:38 | 516K | |
| rnp-0.17.0_1.pkg | 2023-10-09 15:00 | 632K | |
| rntrack-2.1.10_2.pkg | 2023-10-14 17:39 | 154K | |
| rnv-1.7.11_1.pkg | 2023-10-09 22:54 | 86K | |
| ro-aspell-3.3.2,1.pkg | 2023-10-10 06:28 | 8.5M | |
| ro-hunspell-3.3.10.pkg | 2023-10-09 04:00 | 477K | |
| ro-hyphen-3.3.10.pkg | 2023-10-14 10:21 | 3.2K | |
| ro-libreoffice-7.5.5..> | 2023-10-08 10:15 | 2.8M | |
| ro-mythes-3.3_1.pkg | 2023-10-09 18:49 | 833K | |
| robin-hood-hashing-3..> | 2023-10-07 08:08 | 20K | |
| robin-map-0.6.3.pkg | 2023-10-05 16:39 | 16K | |
| robocode-1.9.5.0.pkg | 2023-10-08 22:09 | 15M | |
| robocode-naval-0.9.2..> | 2023-10-09 02:58 | 5.3M | |
| roboctl-0.3.8.pkg | 2023-10-08 21:07 | 72K | |
| robodoc-4.99.44.pkg | 2023-10-14 06:32 | 95K | |
| robotfindskitten-2.8..> | 2023-10-10 22:51 | 35K | |
| roboto-fonts-ttf-2.1..> | 2023-10-08 04:23 | 2.8M | |
| rocinante-0.1.202207..> | 2023-10-10 16:00 | 8.9K | |
| rockdodger-1.1.4.pkg | 2023-10-08 15:57 | 760K | |
| rocksdb-8.5.3.pkg | 2023-10-07 13:23 | 78M | |
| rocksndiamonds-3.3.1..> | 2023-10-14 06:57 | 9.7M | |
| rocksndiamonds-data-..> | 2023-10-14 09:10 | 61M | |
| rocr-1.9.1.pkg | 2023-10-09 14:33 | 247K | |
| rocs-23.08.1_1.pkg | 2023-10-07 06:45 | 1.5M | |
| roct-1.9.1.pkg | 2023-10-07 16:27 | 56K | |
| rodent-5.3.16.3_5.pkg | 2023-10-09 15:55 | 3.2M | |
| rofi-1.7.3.pkg | 2023-10-07 12:29 | 509K | |
| rofi-calc-2.2.0.pkg | 2023-10-08 17:07 | 6.1K | |
| rofi-emoji-3.2.0.pkg | 2023-10-08 23:44 | 63K | |
| rofi-file-browser-ex..> | 2023-10-10 08:01 | 16K | |
| rofi-pass-2.0.2_2.pkg | 2023-10-14 11:31 | 10K | |
| rofi-wayland-1.7.3.pkg | 2023-10-10 02:24 | 518K | |
| rolo-011.pkg | 2023-10-14 12:53 | 19K | |
| root-6.28.04_3.pkg | 2023-10-14 17:18 | 150M | |
| root-tail-1.3.pkg | 2023-10-09 15:14 | 14K | |
| ros-console_bridge-1..> | 2023-10-07 02:11 | 11K | |
| ros-urdfdom-3.0.2.pkg | 2023-10-07 15:21 | 76K | |
| ros-urdfdom_headers-..> | 2023-10-07 08:38 | 12K | |
| rosegarden-22.12.1_1..> | 2023-10-10 06:26 | 7.1M | |
| rosenpass-0.2.0.pkg | 2023-10-09 07:25 | 817K | |
| rospo-0.11.4_2.pkg | 2023-10-10 21:04 | 3.6M | |
| roswell-22.12.14.113..> | 2023-10-09 16:31 | 105K | |
| rotate-1.2.pkg | 2023-10-08 16:16 | 34K | |
| rote-0.2.8_1.pkg | 2023-10-07 15:38 | 12K | |
| rotorouter-1.0_3.pkg | 2023-10-14 12:02 | 5.7K | |
| rottdc-1.0.2_8.pkg | 2023-10-14 08:09 | 495K | |
| roundcube-automatic_..> | 2023-10-14 05:11 | 28K | |
| roundcube-automatic_..> | 2023-10-09 17:43 | 28K | |
| roundcube-calendar-k..> | 2023-10-11 15:30 | 1.4M | |
| roundcube-calendar-k..> | 2023-10-09 08:55 | 1.4M | |
| roundcube-carddav-ph..> | 2023-10-14 08:49 | 454K | |
| roundcube-carddav-ph..> | 2023-10-11 00:07 | 455K | |
| roundcube-classic-ph..> | 2023-10-10 09:06 | 221K | |
| roundcube-classic-ph..> | 2023-10-08 13:48 | 221K | |
| roundcube-contextmen..> | 2023-10-14 10:47 | 48K | |
| roundcube-contextmen..> | 2023-10-10 16:59 | 48K | |
| roundcube-html5_noti..> | 2023-10-09 20:54 | 20K | |
| roundcube-html5_noti..> | 2023-10-14 13:56 | 20K | |
| roundcube-identity_s..> | 2023-10-14 10:20 | 5.3K | |
| roundcube-identity_s..> | 2023-10-09 12:27 | 5.3K | |
| roundcube-identity_s..> | 2023-10-10 22:59 | 5.3K | |
| roundcube-identity_s..> | 2023-10-10 01:00 | 5.3K | |
| roundcube-larry-php8..> | 2023-10-14 17:56 | 246K | |
| roundcube-larry-php8..> | 2023-10-14 15:01 | 246K | |
| roundcube-login_info..> | 2023-10-09 23:09 | 17K | |
| roundcube-login_info..> | 2023-10-09 21:01 | 17K | |
| roundcube-php80-1.6...> | 2023-10-08 01:10 | 4.3M | |
| roundcube-php81-1.6...> | 2023-10-08 09:01 | 4.3M | |
| roundcube-sauserpref..> | 2023-10-09 09:31 | 65K | |
| roundcube-sauserpref..> | 2023-10-08 16:50 | 65K | |
| roundcube-thunderbir..> | 2023-10-08 15:32 | 184K | |
| roundcube-thunderbir..> | 2023-10-14 16:08 | 184K | |
| roundcube-twofactor_..> | 2023-10-08 16:35 | 1.1M | |
| roundcube-twofactor_..> | 2023-10-10 16:44 | 1.1M | |
| roundcube-veximaccou..> | 2023-10-09 02:10 | 22K | |
| roundcube-veximaccou..> | 2023-10-10 00:57 | 22K | |
| roundcube-yubikey_au..> | 2023-10-10 06:44 | 14K | |
| roundcube-yubikey_au..> | 2023-10-08 16:32 | 14K | |
| routers2-2.23.pkg | 2023-10-07 23:52 | 208K | |
| routers2-extensions-..> | 2023-10-11 01:42 | 30K | |
| routers2-extras-2.23..> | 2023-10-11 01:09 | 55K | |
| routinator-0.12.2.pkg | 2023-10-08 18:16 | 2.4M | |
| routino-3.4.1.pkg | 2023-10-07 15:53 | 1.7M | |
| rovclock-0.6e.pkg | 2023-10-09 03:03 | 7.3K | |
| rox-filer-2.11_12.pkg | 2023-10-09 03:57 | 1.0M | |
| roxterm-3.12.1_1.pkg | 2023-10-09 01:54 | 412K | |
| rp-pppoe-3.15.pkg | 2023-10-14 15:11 | 80K | |
| rpc2-2.14.pkg | 2023-10-09 19:37 | 200K | |
| rpcalc-0.8.2_10.pkg | 2023-10-14 05:47 | 62K | |
| rpclib-2.3.0.pkg | 2023-10-09 19:43 | 374K | |
| rpcs3-0.0.29.15620.pkg | 2023-10-09 01:22 | 7.4M | |
| rpg-cli-1.0.1_14.pkg | 2023-10-08 17:24 | 535K | |
| rpi-firmware-1.20230..> | 2023-10-14 11:07 | 4.5M | |
| rpl-1.4.1.pkg | 2023-10-08 17:33 | 12K | |
| rpm2cpio-1.4_2.pkg | 2023-10-07 08:04 | 900 | |
| rpm4-4.18.1_1.pkg | 2023-10-06 19:21 | 837K | |
| rpsl2acl-1.01.pkg | 2023-10-10 00:23 | 8.2K | |
| rrdbot-0.9.7.d202003..> | 2023-10-14 12:54 | 261K | |
| rrdman-1.0.1_5.pkg | 2023-10-09 02:31 | 7.3K | |
| rrdmerge-0.0.1_2.pkg | 2023-10-08 14:11 | 4.5K | |
| rrdtool-1.8.0_2.pkg | 2023-10-06 20:12 | 696K | |
| rrdtool12-1.2.30_8.pkg | 2023-10-10 00:32 | 533K | |
| rsclock-0.1.9_3.pkg | 2023-10-10 03:20 | 174K | |
| rscsi-2023.04.19.pkg | 2023-10-08 07:59 | 15K | |
| rset-2.6.pkg | 2023-10-09 09:04 | 25K | |
| rsfetch-2.0.0_35.pkg | 2023-10-08 20:45 | 1.1M | |
| rsgain-3.4.pkg | 2023-10-10 05:55 | 69K | |
| rshim-user-space-2.0..> | 2023-10-14 06:37 | 37K | |
| rsibreak-0.12.15_3.pkg | 2023-10-10 05:13 | 509K | |
| rslsync-2.7.3.pkg | 2023-10-14 18:05 | 11M | |
| rsnapshot-1.4.4_1.pkg | 2023-10-14 08:25 | 79K | |
| rspamd-3.6.pkg | 2023-10-07 20:08 | 3.4M | |
| rspamd-devel-3.7.a1...> | 2023-10-09 06:57 | 3.5M | |
| rsplib-3.3.1.pkg | 2023-10-09 09:56 | 669K | |
| rss-bridge-2023.07.1..> | 2023-10-14 13:41 | 1.2M | |
| rssguard-4.5.0.pkg | 2023-10-09 14:34 | 4.5M | |
| rsskit-0.4_9.pkg | 2023-10-08 07:32 | 34K | |
| rssroll-0.11.0.pkg | 2023-10-09 16:35 | 32K | |
| rsstail-2.1.pkg | 2023-10-08 21:09 | 7.8K | |
| rsstool-1.0.0_4.pkg | 2023-10-14 03:10 | 52K | |
| rsvndump-0.6.1.pkg | 2023-10-09 10:16 | 34K | |
| rsync-3.2.7.pkg | 2023-10-06 17:50 | 372K | |
| rsync-bpc-3.1.3.0.pkg | 2023-10-09 02:28 | 215K | |
| rsyncbackup-1.1_1.pkg | 2023-10-11 06:07 | 40K | |
| rsyncrypto-1.14_1.pkg | 2023-10-10 13:12 | 52K | |
| rsynth-2.0_7.pkg | 2023-10-10 23:37 | 27K | |
| rsyslog-8.2308.0.pkg | 2023-10-10 01:34 | 379K | |
| rt44-4.4.6.pkg | 2023-10-07 15:00 | 6.2M | |
| rt50-5.0.4.pkg | 2023-10-08 02:16 | 13M | |
| rtaudio-6.0.1.pkg | 2023-10-07 17:31 | 42K | |
| rtc-2020.07.07.1_1.pkg | 2023-10-10 06:58 | 4.0K | |
| rtf2latex2e-2.2.2.pkg | 2023-10-14 10:26 | 136K | |
| rtfm-1.0.pkg | 2023-10-10 13:17 | 5.8K | |
| rtfreader-1.0_1.pkg | 2023-10-08 17:06 | 6.0K | |
| rtg-0.7.5.pkg | 2023-10-10 09:19 | 100K | |
| rth-1.7.0_2.pkg | 2023-10-11 01:51 | 3.0M | |
| rtl-433-22.11.pkg | 2023-10-10 13:16 | 273K | |
| rtl-sdr-0.6.0_3,1.pkg | 2023-10-06 20:36 | 78K | |
| rtmidi-6.0.0.pkg | 2023-10-07 00:37 | 29K | |
| rtmpdump-2.4.2019033..> | 2023-10-06 17:15 | 45K | |
| rtorrent-0.9.8.pkg | 2023-10-08 20:32 | 343K | |
| rtpproxy-2.1.1.pkg | 2023-10-14 06:18 | 122K | |
| rtptools-1.22.pkg | 2023-10-09 19:54 | 42K | |
| rtrlib-0.8.0_1.pkg | 2023-10-07 06:34 | 54K | |
| rtsx-2.0.n,1.pkg | 2023-10-08 17:40 | 20K | |
| rttr-0.9.6.16_3.pkg | 2023-10-06 22:51 | 240K | |
| rtty-4.0.pkg | 2023-10-09 04:32 | 19K | |
| rtx-2023.9.1.pkg | 2023-10-14 06:05 | 2.4M | |
| ru-artwiz-ru-2004103..> | 2023-10-09 08:36 | 15K | |
| ru-aspell-0.99.f7.1_..> | 2023-10-09 14:44 | 1.4M | |
| ru-bugzilla44-4.4.4.pkg | 2023-10-10 03:01 | 207K | |
| ru-d1489-1.5.1.pkg | 2023-10-09 20:46 | 8.3K | |
| ru-emkatic-gtk2-0.41..> | 2023-10-14 10:13 | 1.8M | |
| ru-emkatic-qt5-0.41_..> | 2023-10-11 00:48 | 1.8M | |
| ru-eric6-21.11.pkg | 2023-10-09 10:56 | 387K | |
| ru-hunspell-20131101..> | 2023-10-14 13:54 | 564K | |
| ru-hyphen-2004.04.15..> | 2023-10-09 13:29 | 7.8K | |
| ru-koi2koi-1998.04.1..> | 2023-10-10 22:37 | 7.2K | |
| ru-koi8rPS-1.0_1.pkg | 2023-10-10 00:31 | 626K | |
| ru-libgd-2.3.3_7,1.pkg | 2023-10-14 16:26 | 205K | |
| ru-libreoffice-7.5.5..> | 2023-10-08 10:02 | 3.2M | |
| ru-mueller-dic-1.2_4..> | 2023-10-14 08:48 | 4.8M | |
| ru-mythes-2007.06.13..> | 2023-10-14 05:30 | 186K | |
| ru-p5-XML-Parser-enc..> | 2023-10-10 10:06 | 1.3K | |
| ru-russian-0.6.0.pkg | 2023-10-10 23:46 | 22K | |
| ru-rux-0.82.pkg | 2023-10-10 12:15 | 11K | |
| ru-stardict-bars-2.4..> | 2023-10-11 15:06 | 9.2M | |
| ru-stardict-computer..> | 2023-10-08 14:31 | 308K | |
| ru-stardict-dal-2.4...> | 2023-10-08 20:54 | 8.1M | |
| ru-stardict-engcom-2..> | 2023-10-11 01:28 | 141K | |
| ru-stardict-mueller7..> | 2023-10-14 11:24 | 2.8M | |
| ru-stardict-mueller7..> | 2023-10-09 22:46 | 3.4M | |
| ru-stardict-pc-2.4.2..> | 2023-10-11 01:09 | 297K | |
| ru-wordpress-ru_RU-6..> | 2023-10-08 16:32 | 15M | |
| ru-xcode-4.1.pkg | 2023-10-09 17:12 | 14K | |
| ru-xruskb-1.15.4_3.pkg | 2023-10-14 17:51 | 71K | |
| rubberband-3.2.1_1.pkg | 2023-10-07 21:48 | 314K | |
| rubiks-20070912.pkg | 2023-10-08 09:39 | 240K | |
| rubix-1.0.6_8.pkg | 2023-10-08 21:53 | 28K | |
| rubrica-2.1.6_3.pkg | 2023-10-09 09:27 | 374K | |
| ruby-3.1.4_1,1.pkg | 2023-10-05 17:40 | 8.3M | |
| ruby-build-20230919.pkg | 2023-10-11 01:42 | 67K | |
| ruby-install-0.9.1.pkg | 2023-10-11 04:53 | 11K | |
| ruby-rd-mode.el-0.6...> | 2023-10-11 11:01 | 4.5K | |
| ruby-subversion-1.14..> | 2023-10-08 12:52 | 542K | |
| ruby30-3.0.6_1,1.pkg | 2023-10-10 07:10 | 7.8M | |
| ruby31-bdb-0.6.6_9.pkg | 2023-10-07 10:15 | 391K | |
| ruby31-bio-1.5.1.pkg | 2023-10-08 17:00 | 496K | |
| ruby31-bsearch-1.5_1..> | 2023-10-07 15:23 | 2.0K | |
| ruby31-escape-0.2.pkg | 2023-10-10 11:18 | 4.5K | |
| ruby31-format-1.09.pkg | 2023-10-08 19:37 | 21K | |
| ruby31-gd-0.8.0_9.pkg | 2023-10-14 10:28 | 38K | |
| ruby31-gems-3.4.19.pkg | 2023-10-05 17:41 | 449K | |
| ruby31-htree-0.8_1.pkg | 2023-10-10 07:22 | 287K | |
| ruby31-libpafe-ruby-..> | 2023-10-07 23:18 | 7.8K | |
| ruby31-qdbm-1.8.78_4..> | 2023-10-10 11:03 | 28K | |
| ruby31-rdtool-0.6.38..> | 2023-10-08 00:34 | 42K | |
| ruby31-rttool-1.0.3_..> | 2023-10-14 18:04 | 13K | |
| ruby31-setup.rb-3.4...> | 2023-10-09 13:05 | 30K | |
| ruby31-smf-0.15.15_1..> | 2023-10-08 21:47 | 38K | |
| ruby31-taglib-1.1_1.pkg | 2023-10-10 03:58 | 2.7K | |
| ruby31-tokyocabinet-..> | 2023-10-07 12:46 | 57K | |
| ruby31-xapian-1.4.23..> | 2023-10-07 11:44 | 580K | |
| ruby32-3.2.2_1,1.pkg | 2023-10-09 22:57 | 8.6M | |
| ruby33-3.3.0.p2,1.pkg | 2023-10-11 16:12 | 8.5M | |
| rubygem-CFPropertyLi..> | 2023-10-06 14:04 | 14K | |
| rubygem-StreetAddres..> | 2023-10-08 16:45 | 8.3K | |
| rubygem-abbrev-0.1.1..> | 2023-10-10 01:15 | 4.8K | |
| rubygem-abstract-1.0..> | 2023-10-08 13:10 | 9.5K | |
| rubygem-ace-rails-ap..> | 2023-10-14 09:49 | 956K | |
| rubygem-acme-client-..> | 2023-10-07 13:04 | 19K | |
| rubygem-actioncable5..> | 2023-10-07 09:14 | 35K | |
| rubygem-actioncable5..> | 2023-10-07 08:32 | 36K | |
| rubygem-actioncable5..> | 2023-10-07 08:21 | 35K | |
| rubygem-actioncable6..> | 2023-10-07 07:31 | 36K | |
| rubygem-actioncable6..> | 2023-10-07 06:07 | 36K | |
| rubygem-actioncable7..> | 2023-10-06 22:34 | 37K | |
| rubygem-actionmailbo..> | 2023-10-07 00:00 | 18K | |
| rubygem-actionmailbo..> | 2023-10-07 01:10 | 19K | |
| rubygem-actionmailbo..> | 2023-10-06 19:14 | 19K | |
| rubygem-actionmailer..> | 2023-10-07 07:31 | 22K | |
| rubygem-actionmailer..> | 2023-10-07 02:48 | 24K | |
| rubygem-actionmailer..> | 2023-10-07 05:42 | 24K | |
| rubygem-actionmailer..> | 2023-10-07 05:24 | 24K | |
| rubygem-actionmailer..> | 2023-10-07 02:25 | 25K | |
| rubygem-actionmailer..> | 2023-10-07 09:05 | 25K | |
| rubygem-actionmailer..> | 2023-10-06 20:56 | 25K | |
| rubygem-actionpack-a..> | 2023-10-09 13:29 | 13K | |
| rubygem-actionpack-p..> | 2023-10-10 09:07 | 13K | |
| rubygem-actionpack-x..> | 2023-10-09 12:12 | 3.0K | |
| rubygem-actionpack-x..> | 2023-10-10 04:04 | 3.0K | |
| rubygem-actionpack-x..> | 2023-10-07 12:54 | 3.0K | |
| rubygem-actionpack4-..> | 2023-10-06 15:14 | 152K | |
| rubygem-actionpack5-..> | 2023-10-06 15:35 | 168K | |
| rubygem-actionpack50..> | 2023-10-06 14:26 | 172K | |
| rubygem-actionpack52..> | 2023-10-06 15:18 | 174K | |
| rubygem-actionpack60..> | 2023-10-06 13:40 | 177K | |
| rubygem-actionpack61..> | 2023-10-06 15:09 | 183K | |
| rubygem-actionpack70..> | 2023-10-06 14:03 | 187K | |
| rubygem-actiontext60..> | 2023-10-06 23:24 | 14K | |
| rubygem-actiontext61..> | 2023-10-07 03:23 | 16K | |
| rubygem-actiontext70..> | 2023-10-06 19:06 | 75K | |
| rubygem-actionview4-..> | 2023-10-06 12:16 | 116K | |
| rubygem-actionview5-..> | 2023-10-06 12:16 | 130K | |
| rubygem-actionview50..> | 2023-10-06 13:24 | 122K | |
| rubygem-actionview52..> | 2023-10-06 13:01 | 131K | |
| rubygem-actionview60..> | 2023-10-06 13:00 | 136K | |
| rubygem-actionview61..> | 2023-10-06 13:33 | 137K | |
| rubygem-actionview70..> | 2023-10-06 12:15 | 143K | |
| rubygem-active_model..> | 2023-10-10 00:43 | 52K | |
| rubygem-active_model..> | 2023-10-14 13:50 | 52K | |
| rubygem-active_recor..> | 2023-10-09 22:36 | 3.8K | |
| rubygem-active_scaff..> | 2023-10-08 17:04 | 255K | |
| rubygem-activejob4-4..> | 2023-10-06 20:11 | 16K | |
| rubygem-activejob5-5..> | 2023-10-06 19:42 | 22K | |
| rubygem-activejob50-..> | 2023-10-06 22:50 | 21K | |
| rubygem-activejob52-..> | 2023-10-06 19:54 | 22K | |
| rubygem-activejob60-..> | 2023-10-06 16:52 | 26K | |
| rubygem-activejob61-..> | 2023-10-06 18:07 | 28K | |
| rubygem-activejob70-..> | 2023-10-06 13:52 | 28K | |
| rubygem-activemessag..> | 2023-10-08 21:20 | 38K | |
| rubygem-activemodel-..> | 2023-10-08 11:09 | 8.2K | |
| rubygem-activemodel4..> | 2023-10-06 17:51 | 38K | |
| rubygem-activemodel5..> | 2023-10-06 21:35 | 43K | |
| rubygem-activemodel5..> | 2023-10-06 19:41 | 45K | |
| rubygem-activemodel5..> | 2023-10-06 17:45 | 47K | |
| rubygem-activemodel6..> | 2023-10-06 14:34 | 49K | |
| rubygem-activemodel6..> | 2023-10-06 13:43 | 52K | |
| rubygem-activemodel7..> | 2023-10-06 13:00 | 51K | |
| rubygem-activerecord..> | 2023-10-10 03:28 | 7.3K | |
| rubygem-activerecord..> | 2023-10-07 20:53 | 4.6K | |
| rubygem-activerecord..> | 2023-10-14 18:10 | 58K | |
| rubygem-activerecord..> | 2023-10-08 03:18 | 281K | |
| rubygem-activerecord..> | 2023-10-10 10:26 | 2.6K | |
| rubygem-activerecord..> | 2023-10-10 21:19 | 8.9K | |
| rubygem-activerecord..> | 2023-10-07 00:06 | 262K | |
| rubygem-activerecord..> | 2023-10-07 05:10 | 278K | |
| rubygem-activerecord..> | 2023-10-07 05:26 | 285K | |
| rubygem-activerecord..> | 2023-10-06 22:00 | 279K | |
| rubygem-activerecord..> | 2023-10-06 18:15 | 321K | |
| rubygem-activerecord..> | 2023-10-06 15:40 | 337K | |
| rubygem-activerecord..> | 2023-10-06 15:37 | 372K | |
| rubygem-activeresour..> | 2023-10-08 13:50 | 34K | |
| rubygem-activeresour..> | 2023-10-07 01:23 | 32K | |
| rubygem-activestorag..> | 2023-10-07 07:01 | 39K | |
| rubygem-activestorag..> | 2023-10-06 20:23 | 44K | |
| rubygem-activestorag..> | 2023-10-06 18:42 | 48K | |
| rubygem-activestorag..> | 2023-10-06 17:39 | 54K | |
| rubygem-activesuppor..> | 2023-10-06 09:28 | 196K | |
| rubygem-activesuppor..> | 2023-10-06 10:10 | 216K | |
| rubygem-activesuppor..> | 2023-10-06 10:25 | 215K | |
| rubygem-activesuppor..> | 2023-10-06 10:21 | 226K | |
| rubygem-activesuppor..> | 2023-10-06 10:04 | 176K | |
| rubygem-activesuppor..> | 2023-10-06 10:26 | 181K | |
| rubygem-activesuppor..> | 2023-10-06 10:40 | 184K | |
| rubygem-acts-as-tagg..> | 2023-10-08 00:08 | 48K | |
| rubygem-acts_as_tagg..> | 2023-10-10 06:54 | 13K | |
| rubygem-addressable-..> | 2023-10-06 10:48 | 75K | |
| rubygem-adsf-1.4.6.pkg | 2023-10-09 20:00 | 5.5K | |
| rubygem-aes_key_wrap..> | 2023-10-06 14:06 | 5.1K | |
| rubygem-afm-0.2.2.pkg | 2023-10-06 12:09 | 11K | |
| rubygem-after_commit..> | 2023-10-08 22:26 | 17K | |
| rubygem-ai4r-1.13.pkg | 2023-10-08 21:08 | 50K | |
| rubygem-airborne-0.3..> | 2023-10-09 18:56 | 22K | |
| rubygem-airbrussh-1...> | 2023-10-07 08:06 | 17K | |
| rubygem-akami-1.3.1.pkg | 2023-10-07 14:27 | 20K | |
| rubygem-akismet-3.0...> | 2023-10-08 02:36 | 6.7K | |
| rubygem-albino-1.3.3..> | 2023-10-09 09:44 | 6.8K | |
| rubygem-algebra-0.2...> | 2023-10-09 06:35 | 139K | |
| rubygem-algebrick-0...> | 2023-10-06 20:33 | 20K | |
| rubygem-algorithms-1..> | 2023-10-10 12:27 | 279K | |
| rubygem-aliyun-sdk-0..> | 2023-10-06 17:40 | 63K | |
| rubygem-allison-2.0...> | 2023-10-06 13:43 | 21K | |
| rubygem-amalgalite-1..> | 2023-10-09 19:18 | 925K | |
| rubygem-amatch-0.4.1..> | 2023-10-07 22:01 | 39K | |
| rubygem-amazing_prin..> | 2023-10-06 21:17 | 40K | |
| rubygem-amazon-ec2-0..> | 2023-10-07 10:56 | 80K | |
| rubygem-amazon-ecs-2..> | 2023-10-09 05:21 | 25K | |
| rubygem-amq-protocol..> | 2023-10-07 09:11 | 38K | |
| rubygem-amqp-1.8.0.pkg | 2023-10-08 05:07 | 1.1M | |
| rubygem-amqp-utils-0..> | 2023-10-14 15:40 | 10K | |
| rubygem-analogger-1...> | 2023-10-08 13:01 | 19K | |
| rubygem-android_key_..> | 2023-10-07 02:37 | 11K | |
| rubygem-anemone-0.7...> | 2023-10-09 18:07 | 21K | |
| rubygem-annoy-0.5.6.pkg | 2023-10-07 02:19 | 6.6K | |
| rubygem-ansi-1.5.0.pkg | 2023-10-07 22:43 | 31K | |
| rubygem-apipie-bindi..> | 2023-10-06 19:57 | 27K | |
| rubygem-apipie-param..> | 2023-10-06 21:52 | 6.6K | |
| rubygem-apollo_uploa..> | 2023-10-08 07:10 | 7.7K | |
| rubygem-app_config-2..> | 2023-10-11 02:51 | 5.2K | |
| rubygem-app_store_co..> | 2023-10-08 11:23 | 16K | |
| rubygem-appraisal-2...> | 2023-10-09 00:13 | 22K | |
| rubygem-archive-tar-..> | 2023-10-09 12:16 | 1.9K | |
| rubygem-archive-zip-..> | 2023-10-06 19:33 | 49K | |
| rubygem-arel-9.0.0,1..> | 2023-10-06 18:15 | 28K | |
| rubygem-arel-helpers..> | 2023-10-06 21:38 | 9.0K | |
| rubygem-arel6-6.0.4.pkg | 2023-10-06 22:42 | 26K | |
| rubygem-arel7-7.1.4,..> | 2023-10-06 21:41 | 28K | |
| rubygem-arel8-8.0.0,..> | 2023-10-06 19:15 | 28K | |
| rubygem-arr-pm-0.0.1..> | 2023-10-07 22:55 | 28K | |
| rubygem-arrayfields-..> | 2023-10-07 07:55 | 13K | |
| rubygem-asana-2.0.3.pkg | 2023-10-09 23:12 | 60K | |
| rubygem-asana1-1.0.0..> | 2023-10-07 10:58 | 58K | |
| rubygem-ascii85-1.1...> | 2023-10-06 11:19 | 8.5K | |
| rubygem-asciidoctor-..> | 2023-10-06 12:24 | 225K | |
| rubygem-asciidoctor-..> | 2023-10-09 03:48 | 11M | |
| rubygem-asciidoctor-..> | 2023-10-10 08:09 | 656K | |
| rubygem-asciidoctor-..> | 2023-10-08 09:23 | 7.9K | |
| rubygem-asciidoctor-..> | 2023-10-07 12:48 | 36K | |
| rubygem-asciidoctor-..> | 2023-10-06 18:03 | 1.5M | |
| rubygem-asciidoctor-..> | 2023-10-09 13:24 | 5.8K | |
| rubygem-asciidoctor-..> | 2023-10-07 10:58 | 4.7K | |
| rubygem-asetus-0.4.0..> | 2023-10-07 06:19 | 7.6K | |
| rubygem-aspectr-0.3...> | 2023-10-07 05:55 | 5.5K | |
| rubygem-asset_sync-2..> | 2023-10-11 11:42 | 37K | |
| rubygem-ast-2.4.2.pkg | 2023-10-06 13:29 | 8.1K | |
| rubygem-astrolabe-1...> | 2023-10-10 11:17 | 12K | |
| rubygem-async-2.6.4.pkg | 2023-10-06 16:10 | 21K | |
| rubygem-async-http-0..> | 2023-10-07 08:16 | 25K | |
| rubygem-async-io-1.3..> | 2023-10-06 20:22 | 15K | |
| rubygem-async-pool-0..> | 2023-10-06 18:56 | 6.3K | |
| rubygem-async-rest-0..> | 2023-10-08 11:10 | 5.5K | |
| rubygem-async-websoc..> | 2023-10-08 12:43 | 7.3K | |
| rubygem-async_sinatr..> | 2023-10-10 04:17 | 8.2K | |
| rubygem-atk-4.2.0.pkg | 2023-10-06 20:02 | 12K | |
| rubygem-atlassian-jw..> | 2023-10-07 06:16 | 5.3K | |
| rubygem-atomic-1.1.1..> | 2023-10-08 02:37 | 13K | |
| rubygem-attic-0.5.3.pkg | 2023-10-07 07:42 | 6.9K | |
| rubygem-attr_encrypt..> | 2023-10-08 01:41 | 25K | |
| rubygem-attr_encrypt..> | 2023-10-07 02:26 | 25K | |
| rubygem-attr_json-2...> | 2023-10-08 20:04 | 39K | |
| rubygem-attr_require..> | 2023-10-06 15:43 | 5.0K | |
| rubygem-authlogic-6...> | 2023-10-09 06:41 | 41K | |
| rubygem-autoprefixer..> | 2023-10-08 10:05 | 835K | |
| rubygem-autoprefixer..> | 2023-10-08 02:33 | 490K | |
| rubygem-av-0.9.0_1.pkg | 2023-10-07 15:02 | 72K | |
| rubygem-avro-1.11.2.pkg | 2023-10-07 16:44 | 43K | |
| rubygem-awesome_nest..> | 2023-10-09 11:09 | 18K | |
| rubygem-awesome_prin..> | 2023-10-07 06:31 | 38K | |
| rubygem-awrence-1.1...> | 2023-10-07 05:54 | 4.2K | |
| rubygem-aws-crt-0.1...> | 2023-10-10 11:34 | 37M | |
| rubygem-aws-eventstr..> | 2023-10-06 12:41 | 9.2K | |
| rubygem-aws-partitio..> | 2023-10-06 13:56 | 45K | |
| rubygem-aws-s3-0.6.3..> | 2023-10-07 12:09 | 116K | |
| rubygem-aws-sdk-3.1...> | 2023-10-14 12:40 | 5.5K | |
| rubygem-aws-sdk-acce..> | 2023-10-07 03:47 | 40K | |
| rubygem-aws-sdk-acco..> | 2023-10-07 06:35 | 19K | |
| rubygem-aws-sdk-acm-..> | 2023-10-07 06:18 | 32K | |
| rubygem-aws-sdk-acmp..> | 2023-10-07 03:56 | 44K | |
| rubygem-aws-sdk-alex..> | 2023-10-07 09:31 | 52K | |
| rubygem-aws-sdk-ampl..> | 2023-10-07 06:20 | 33K | |
| rubygem-aws-sdk-ampl..> | 2023-10-07 06:04 | 31K | |
| rubygem-aws-sdk-ampl..> | 2023-10-07 09:56 | 44K | |
| rubygem-aws-sdk-apig..> | 2023-10-06 23:27 | 63K | |
| rubygem-aws-sdk-apig..> | 2023-10-07 04:52 | 15K | |
| rubygem-aws-sdk-apig..> | 2023-10-07 09:30 | 48K | |
| rubygem-aws-sdk-appc..> | 2023-10-07 05:14 | 37K | |
| rubygem-aws-sdk-appc..> | 2023-10-07 07:20 | 16K | |
| rubygem-aws-sdk-appf..> | 2023-10-07 01:35 | 26K | |
| rubygem-aws-sdk-appf..> | 2023-10-07 07:28 | 58K | |
| rubygem-aws-sdk-appi..> | 2023-10-06 23:51 | 20K | |
| rubygem-aws-sdk-appl..> | 2023-10-07 09:16 | 36K | |
| rubygem-aws-sdk-appl..> | 2023-10-07 00:53 | 17K | |
| rubygem-aws-sdk-appl..> | 2023-10-07 01:34 | 35K | |
| rubygem-aws-sdk-appl..> | 2023-10-07 05:13 | 32K | |
| rubygem-aws-sdk-appm..> | 2023-10-07 02:46 | 48K | |
| rubygem-aws-sdk-appr..> | 2023-10-07 06:59 | 24K | |
| rubygem-aws-sdk-appr..> | 2023-10-07 03:29 | 37K | |
| rubygem-aws-sdk-apps..> | 2023-10-07 03:23 | 54K | |
| rubygem-aws-sdk-apps..> | 2023-10-07 05:30 | 43K | |
| rubygem-aws-sdk-arcz..> | 2023-10-07 00:41 | 18K | |
| rubygem-aws-sdk-athe..> | 2023-10-07 09:06 | 53K | |
| rubygem-aws-sdk-audi..> | 2023-10-07 03:49 | 51K | |
| rubygem-aws-sdk-augm..> | 2023-10-06 23:25 | 17K | |
| rubygem-aws-sdk-auto..> | 2023-10-07 02:26 | 93K | |
| rubygem-aws-sdk-auto..> | 2023-10-07 05:16 | 25K | |
| rubygem-aws-sdk-back..> | 2023-10-07 00:02 | 60K | |
| rubygem-aws-sdk-back..> | 2023-10-07 06:54 | 25K | |
| rubygem-aws-sdk-back..> | 2023-10-07 08:34 | 19K | |
| rubygem-aws-sdk-batc..> | 2023-10-07 09:51 | 65K | |
| rubygem-aws-sdk-bill..> | 2023-10-07 01:32 | 33K | |
| rubygem-aws-sdk-brak..> | 2023-10-07 08:55 | 24K | |
| rubygem-aws-sdk-budg..> | 2023-10-07 00:33 | 30K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 04:12 | 88K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 09:15 | 26K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 08:28 | 37K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 00:54 | 27K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 08:11 | 38K | |
| rubygem-aws-sdk-chim..> | 2023-10-07 08:19 | 48K | |
| rubygem-aws-sdk-clea..> | 2023-10-07 09:30 | 38K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 06:33 | 22K | |
| rubygem-aws-sdk-clou..> | 2023-10-06 23:48 | 23K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 03:52 | 50K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 01:45 | 93K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 00:13 | 105K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 03:47 | 22K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 04:17 | 23K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 01:44 | 30K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 09:44 | 22K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 02:37 | 56K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 06:50 | 15K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 03:51 | 63K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 06:15 | 51K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 06:26 | 41K | |
| rubygem-aws-sdk-clou..> | 2023-10-06 23:50 | 48K | |
| rubygem-aws-sdk-clou..> | 2023-10-07 02:36 | 29K | |
| rubygem-aws-sdk-code..> | 2023-10-07 01:50 | 37K | |
| rubygem-aws-sdk-code..> | 2023-10-07 08:02 | 58K | |
| rubygem-aws-sdk-code..> | 2023-10-07 01:20 | 29K | |
| rubygem-aws-sdk-code..> | 2023-10-07 07:20 | 69K | |
| rubygem-aws-sdk-code..> | 2023-10-07 00:02 | 59K | |
| rubygem-aws-sdk-code..> | 2023-10-07 07:56 | 32K | |
| rubygem-aws-sdk-code..> | 2023-10-07 09:23 | 31K | |
| rubygem-aws-sdk-code..> | 2023-10-07 08:17 | 24K | |
| rubygem-aws-sdk-code..> | 2023-10-07 06:12 | 48K | |
| rubygem-aws-sdk-code..> | 2023-10-07 02:07 | 24K | |
| rubygem-aws-sdk-code..> | 2023-10-07 06:49 | 19K | |
| rubygem-aws-sdk-code..> | 2023-10-07 05:57 | 21K | |
| rubygem-aws-sdk-cogn..> | 2023-10-07 01:30 | 29K | |
| rubygem-aws-sdk-cogn..> | 2023-10-07 04:35 | 91K | |
| rubygem-aws-sdk-cogn..> | 2023-10-07 03:45 | 23K | |
| rubygem-aws-sdk-comp..> | 2023-10-07 05:38 | 70K | |
| rubygem-aws-sdk-comp..> | 2023-10-07 05:06 | 29K | |
| rubygem-aws-sdk-comp..> | 2023-10-07 00:13 | 49K | |
| rubygem-aws-sdk-conf..> | 2023-10-07 08:05 | 89K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 02:43 | 123K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 02:14 | 22K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 05:19 | 30K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 06:17 | 16K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 06:25 | 22K | |
| rubygem-aws-sdk-conn..> | 2023-10-07 06:06 | 30K | |
| rubygem-aws-sdk-cont..> | 2023-10-07 03:14 | 16K | |
| rubygem-aws-sdk-core..> | 2023-10-06 17:43 | 277K | |
| rubygem-aws-sdk-core..> | 2023-10-07 03:04 | 1.4M | |
| rubygem-aws-sdk-core..> | 2023-10-07 22:14 | 275K | |
| rubygem-aws-sdk-cost..> | 2023-10-07 05:08 | 17K | |
| rubygem-aws-sdk-cost..> | 2023-10-07 04:12 | 65K | |
| rubygem-aws-sdk-cust..> | 2023-10-07 07:06 | 53K | |
| rubygem-aws-sdk-data..> | 2023-10-07 07:18 | 115K | |
| rubygem-aws-sdk-data..> | 2023-10-07 07:32 | 34K | |
| rubygem-aws-sdk-data..> | 2023-10-07 03:35 | 26K | |
| rubygem-aws-sdk-data..> | 2023-10-07 01:57 | 59K | |
| rubygem-aws-sdk-dax-..> | 2023-10-07 06:12 | 28K | |
| rubygem-aws-sdk-dete..> | 2023-10-07 02:20 | 26K | |
| rubygem-aws-sdk-devi..> | 2023-10-07 02:15 | 61K | |
| rubygem-aws-sdk-devo..> | 2023-10-07 07:17 | 47K | |
| rubygem-aws-sdk-dire..> | 2023-10-06 23:58 | 45K | |
| rubygem-aws-sdk-dire..> | 2023-10-07 04:54 | 50K | |
| rubygem-aws-sdk-dlm-..> | 2023-10-07 04:37 | 26K | |
| rubygem-aws-sdk-docd..> | 2023-10-07 02:27 | 58K | |
| rubygem-aws-sdk-docd..> | 2023-10-07 04:43 | 20K | |
| rubygem-aws-sdk-drs-..> | 2023-10-07 09:13 | 42K | |
| rubygem-aws-sdk-dyna..> | 2023-10-06 23:42 | 98K | |
| rubygem-aws-sdk-dyna..> | 2023-10-07 04:23 | 25K | |
| rubygem-aws-sdk-ebs-..> | 2023-10-06 23:57 | 21K | |
| rubygem-aws-sdk-ec2-..> | 2023-10-07 08:12 | 494K | |
| rubygem-aws-sdk-ec2i..> | 2023-10-07 03:19 | 17K | |
| rubygem-aws-sdk-ecr-..> | 2023-10-07 04:27 | 46K | |
| rubygem-aws-sdk-ecrp..> | 2023-10-07 07:44 | 29K | |
| rubygem-aws-sdk-ecs-..> | 2023-10-07 08:20 | 115K | |
| rubygem-aws-sdk-efs-..> | 2023-10-07 00:36 | 41K | |
| rubygem-aws-sdk-eks-..> | 2023-10-07 05:10 | 53K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 03:08 | 85K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 06:33 | 58K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 09:46 | 18K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 09:50 | 36K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 02:36 | 50K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 00:09 | 51K | |
| rubygem-aws-sdk-elas..> | 2023-10-07 09:25 | 49K | |
| rubygem-aws-sdk-emr-..> | 2023-10-07 03:04 | 72K | |
| rubygem-aws-sdk-emrc..> | 2023-10-07 06:59 | 28K | |
| rubygem-aws-sdk-emrs..> | 2023-10-07 07:06 | 26K | |
| rubygem-aws-sdk-enti..> | 2023-10-07 05:20 | 23K | |
| rubygem-aws-sdk-even..> | 2023-10-07 00:25 | 56K | |
| rubygem-aws-sdk-fins..> | 2023-10-07 08:26 | 37K | |
| rubygem-aws-sdk-fins..> | 2023-10-07 03:31 | 32K | |
| rubygem-aws-sdk-fire..> | 2023-10-07 05:11 | 46K | |
| rubygem-aws-sdk-fis-..> | 2023-10-07 08:51 | 24K | |
| rubygem-aws-sdk-fms-..> | 2023-10-07 06:26 | 53K | |
| rubygem-aws-sdk-fore..> | 2023-10-07 05:52 | 16K | |
| rubygem-aws-sdk-fore..> | 2023-10-07 08:20 | 62K | |
| rubygem-aws-sdk-frau..> | 2023-10-07 06:49 | 51K | |
| rubygem-aws-sdk-fsx-..> | 2023-10-07 04:22 | 93K | |
| rubygem-aws-sdk-game..> | 2023-10-07 07:45 | 106K | |
| rubygem-aws-sdk-game..> | 2023-10-07 05:43 | 26K | |
| rubygem-aws-sdk-glac..> | 2023-10-07 02:00 | 50K | |
| rubygem-aws-sdk-glob..> | 2023-10-07 03:25 | 38K | |
| rubygem-aws-sdk-glue..> | 2023-10-07 04:17 | 172K | |
| rubygem-aws-sdk-glue..> | 2023-10-07 00:19 | 44K | |
| rubygem-aws-sdk-gree..> | 2023-10-07 07:20 | 44K | |
| rubygem-aws-sdk-gree..> | 2023-10-07 05:48 | 40K | |
| rubygem-aws-sdk-grou..> | 2023-10-06 23:54 | 37K | |
| rubygem-aws-sdk-guar..> | 2023-10-07 05:02 | 66K | |
| rubygem-aws-sdk-heal..> | 2023-10-07 09:26 | 27K | |
| rubygem-aws-sdk-heal..> | 2023-10-07 01:40 | 22K | |
| rubygem-aws-sdk-hone..> | 2023-10-07 05:42 | 29K | |
| rubygem-aws-sdk-iam-..> | 2023-10-07 07:48 | 110K | |
| rubygem-aws-sdk-iden..> | 2023-10-07 05:42 | 24K | |
| rubygem-aws-sdk-imag..> | 2023-10-07 07:43 | 57K | |
| rubygem-aws-sdk-impo..> | 2023-10-07 00:33 | 18K | |
| rubygem-aws-sdk-insp..> | 2023-10-07 09:04 | 38K | |
| rubygem-aws-sdk-insp..> | 2023-10-07 05:31 | 54K | |
| rubygem-aws-sdk-inte..> | 2023-10-07 01:53 | 25K | |
| rubygem-aws-sdk-iot-..> | 2023-10-07 06:52 | 147K | |
| rubygem-aws-sdk-iot1..> | 2023-10-07 06:47 | 19K | |
| rubygem-aws-sdk-iot1..> | 2023-10-07 02:55 | 20K | |
| rubygem-aws-sdk-iota..> | 2023-10-07 04:07 | 38K | |
| rubygem-aws-sdk-iotd..> | 2023-10-07 09:15 | 19K | |
| rubygem-aws-sdk-iotd..> | 2023-10-07 07:43 | 21K | |
| rubygem-aws-sdk-iote..> | 2023-10-07 01:53 | 37K | |
| rubygem-aws-sdk-iote..> | 2023-10-07 09:51 | 22K | |
| rubygem-aws-sdk-iotf..> | 2023-10-07 02:47 | 17K | |
| rubygem-aws-sdk-iotf..> | 2023-10-07 05:34 | 43K | |
| rubygem-aws-sdk-iotj..> | 2023-10-07 06:53 | 17K | |
| rubygem-aws-sdk-iotr..> | 2023-10-07 08:17 | 21K | |
| rubygem-aws-sdk-iots..> | 2023-10-06 23:49 | 18K | |
| rubygem-aws-sdk-iots..> | 2023-10-07 03:45 | 62K | |
| rubygem-aws-sdk-iott..> | 2023-10-07 05:37 | 29K | |
| rubygem-aws-sdk-iott..> | 2023-10-07 09:53 | 36K | |
| rubygem-aws-sdk-iotw..> | 2023-10-07 04:35 | 64K | |
| rubygem-aws-sdk-ivs-..> | 2023-10-07 06:57 | 31K | |
| rubygem-aws-sdk-ivsc..> | 2023-10-07 04:58 | 23K | |
| rubygem-aws-sdk-ivsr..> | 2023-10-07 05:15 | 21K | |
| rubygem-aws-sdk-kafk..> | 2023-10-07 03:09 | 40K | |
| rubygem-aws-sdk-kafk..> | 2023-10-07 00:44 | 25K | |
| rubygem-aws-sdk-kend..> | 2023-10-06 23:20 | 97K | |
| rubygem-aws-sdk-kend..> | 2023-10-07 07:28 | 19K | |
| rubygem-aws-sdk-keys..> | 2023-10-07 09:52 | 25K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 05:35 | 45K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 04:39 | 34K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 02:13 | 49K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 03:25 | 34K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 07:47 | 29K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 04:50 | 17K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 09:06 | 16K | |
| rubygem-aws-sdk-kine..> | 2023-10-07 03:53 | 14K | |
| rubygem-aws-sdk-kms-..> | 2023-10-06 19:27 | 87K | |
| rubygem-aws-sdk-lake..> | 2023-10-07 06:18 | 44K | |
| rubygem-aws-sdk-lamb..> | 2023-10-07 08:28 | 67K | |
| rubygem-aws-sdk-lamb..> | 2023-10-07 03:07 | 19K | |
| rubygem-aws-sdk-lex-..> | 2023-10-06 23:31 | 27K | |
| rubygem-aws-sdk-lexm..> | 2023-10-07 02:37 | 51K | |
| rubygem-aws-sdk-lexm..> | 2023-10-07 03:18 | 110K | |
| rubygem-aws-sdk-lexr..> | 2023-10-07 02:28 | 31K | |
| rubygem-aws-sdk-lice..> | 2023-10-07 07:23 | 42K | |
| rubygem-aws-sdk-lice..> | 2023-10-07 05:26 | 17K | |
| rubygem-aws-sdk-lice..> | 2023-10-07 04:10 | 19K | |
| rubygem-aws-sdk-ligh..> | 2023-10-07 07:24 | 120K | |
| rubygem-aws-sdk-loca..> | 2023-10-07 00:42 | 57K | |
| rubygem-aws-sdk-look..> | 2023-10-07 07:48 | 40K | |
| rubygem-aws-sdk-look..> | 2023-10-07 00:36 | 31K | |
| rubygem-aws-sdk-look..> | 2023-10-07 01:37 | 35K | |
| rubygem-aws-sdk-mach..> | 2023-10-07 03:37 | 39K | |
| rubygem-aws-sdk-maci..> | 2023-10-07 04:43 | 18K | |
| rubygem-aws-sdk-maci..> | 2023-10-07 01:05 | 64K | |
| rubygem-aws-sdk-main..> | 2023-10-07 07:35 | 35K | |
| rubygem-aws-sdk-mana..> | 2023-10-07 04:41 | 33K | |
| rubygem-aws-sdk-mana..> | 2023-10-07 04:27 | 20K | |
| rubygem-aws-sdk-mana..> | 2023-10-07 07:53 | 30K | |
| rubygem-aws-sdk-mark..> | 2023-10-07 00:30 | 22K | |
| rubygem-aws-sdk-mark..> | 2023-10-07 07:11 | 17K | |
| rubygem-aws-sdk-mark..> | 2023-10-07 02:11 | 16K | |
| rubygem-aws-sdk-mark..> | 2023-10-06 23:19 | 21K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 04:40 | 50K | |
| rubygem-aws-sdk-medi..> | 2023-10-06 23:57 | 139K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 05:14 | 116K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 02:28 | 30K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 04:45 | 28K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 02:25 | 26K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 06:33 | 23K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 02:29 | 18K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 03:48 | 43K | |
| rubygem-aws-sdk-medi..> | 2023-10-07 05:23 | 24K | |
| rubygem-aws-sdk-memo..> | 2023-10-07 00:12 | 39K | |
| rubygem-aws-sdk-mgn-..> | 2023-10-07 05:43 | 47K | |
| rubygem-aws-sdk-migr..> | 2023-10-07 00:32 | 24K | |
| rubygem-aws-sdk-migr..> | 2023-10-07 04:01 | 16K | |
| rubygem-aws-sdk-migr..> | 2023-10-07 05:56 | 27K | |
| rubygem-aws-sdk-migr..> | 2023-10-07 01:21 | 31K | |
| rubygem-aws-sdk-migr..> | 2023-10-07 06:54 | 34K | |
| rubygem-aws-sdk-mobi..> | 2023-10-06 23:22 | 19K | |
| rubygem-aws-sdk-mq-1..> | 2023-10-07 01:53 | 32K | |
| rubygem-aws-sdk-mtur..> | 2023-10-07 01:59 | 40K | |
| rubygem-aws-sdk-mwaa..> | 2023-10-07 07:21 | 24K | |
| rubygem-aws-sdk-nept..> | 2023-10-07 05:08 | 72K | |
| rubygem-aws-sdk-nept..> | 2023-10-07 00:35 | 44K | |
| rubygem-aws-sdk-netw..> | 2023-10-07 06:26 | 48K | |
| rubygem-aws-sdk-netw..> | 2023-10-07 06:30 | 52K | |
| rubygem-aws-sdk-nimb..> | 2023-10-07 05:26 | 44K | |
| rubygem-aws-sdk-oam-..> | 2023-10-06 23:30 | 20K | |
| rubygem-aws-sdk-omic..> | 2023-10-07 05:33 | 55K | |
| rubygem-aws-sdk-open..> | 2023-10-06 23:55 | 28K | |
| rubygem-aws-sdk-open..> | 2023-10-07 04:39 | 60K | |
| rubygem-aws-sdk-opsw..> | 2023-10-07 08:47 | 64K | |
| rubygem-aws-sdk-opsw..> | 2023-10-07 08:17 | 32K | |
| rubygem-aws-sdk-orga..> | 2023-10-07 07:39 | 58K | |
| rubygem-aws-sdk-osis..> | 2023-10-07 08:38 | 21K | |
| rubygem-aws-sdk-outp..> | 2023-10-07 01:26 | 29K | |
| rubygem-aws-sdk-pano..> | 2023-10-07 02:16 | 34K | |
| rubygem-aws-sdk-paym..> | 2023-10-07 02:12 | 29K | |
| rubygem-aws-sdk-paym..> | 2023-10-07 04:09 | 30K | |
| rubygem-aws-sdk-pcac..> | 2023-10-07 08:14 | 32K | |
| rubygem-aws-sdk-pers..> | 2023-10-07 01:59 | 50K | |
| rubygem-aws-sdk-pers..> | 2023-10-07 07:13 | 17K | |
| rubygem-aws-sdk-pers..> | 2023-10-07 08:00 | 17K | |
| rubygem-aws-sdk-pi-1..> | 2023-10-07 08:29 | 28K | |
| rubygem-aws-sdk-pinp..> | 2023-10-07 02:19 | 102K | |
| rubygem-aws-sdk-pinp..> | 2023-10-07 08:20 | 42K | |
| rubygem-aws-sdk-pinp..> | 2023-10-07 03:08 | 18K | |
| rubygem-aws-sdk-pinp..> | 2023-10-07 04:34 | 39K | |
| rubygem-aws-sdk-pipe..> | 2023-10-07 00:56 | 36K | |
| rubygem-aws-sdk-poll..> | 2023-10-07 06:34 | 27K | |
| rubygem-aws-sdk-pric..> | 2023-10-06 23:47 | 19K | |
| rubygem-aws-sdk-priv..> | 2023-10-07 02:47 | 28K | |
| rubygem-aws-sdk-prom..> | 2023-10-07 05:53 | 23K | |
| rubygem-aws-sdk-prot..> | 2023-10-07 05:32 | 57K | |
| rubygem-aws-sdk-qldb..> | 2023-10-07 05:28 | 27K | |
| rubygem-aws-sdk-qldb..> | 2023-10-07 01:36 | 17K | |
| rubygem-aws-sdk-quic..> | 2023-10-07 03:37 | 194K | |
| rubygem-aws-sdk-ram-..> | 2023-10-07 04:28 | 38K | |
| rubygem-aws-sdk-rds-..> | 2023-10-06 23:21 | 202K | |
| rubygem-aws-sdk-rdsd..> | 2023-10-07 03:44 | 23K | |
| rubygem-aws-sdk-recy..> | 2023-10-07 03:42 | 19K | |
| rubygem-aws-sdk-reds..> | 2023-10-07 09:56 | 103K | |
| rubygem-aws-sdk-reds..> | 2023-10-07 00:34 | 24K | |
| rubygem-aws-sdk-reds..> | 2023-10-07 01:43 | 33K | |
| rubygem-aws-sdk-reko..> | 2023-10-07 07:30 | 98K | |
| rubygem-aws-sdk-resi..> | 2023-10-06 23:25 | 46K | |
| rubygem-aws-sdk-reso..> | 2023-10-07 01:15 | 26K | |
| rubygem-aws-sdk-reso..> | 2023-10-07 01:15 | 27K | |
| rubygem-aws-sdk-reso..> | 2023-10-06 23:56 | 23K | |
| rubygem-aws-sdk-reso..> | 2023-10-07 13:27 | 18K | |
| rubygem-aws-sdk-reso..> | 2023-10-07 21:23 | 47K | |
| rubygem-aws-sdk-robo..> | 2023-10-07 07:07 | 50K | |
| rubygem-aws-sdk-role..> | 2023-10-07 08:25 | 23K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 01:37 | 86K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 00:24 | 40K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 07:43 | 18K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 09:19 | 27K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 01:23 | 24K | |
| rubygem-aws-sdk-rout..> | 2023-10-07 06:11 | 50K | |
| rubygem-aws-sdk-s3-1..> | 2023-10-07 03:35 | 194K | |
| rubygem-aws-sdk-s3co..> | 2023-10-07 08:49 | 71K | |
| rubygem-aws-sdk-s3ou..> | 2023-10-07 03:29 | 18K | |
| rubygem-aws-sdk-s311..> | 2023-10-09 02:38 | 190K | |
| rubygem-aws-sdk-s311..> | 2023-10-14 13:38 | 192K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 02:13 | 309K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 06:46 | 16K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 00:26 | 18K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 06:19 | 32K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 05:04 | 14K | |
| rubygem-aws-sdk-sage..> | 2023-10-07 07:24 | 21K | |
| rubygem-aws-sdk-savi..> | 2023-10-07 02:32 | 20K | |
| rubygem-aws-sdk-sche..> | 2023-10-07 01:03 | 26K | |
| rubygem-aws-sdk-sche..> | 2023-10-07 01:27 | 26K | |
| rubygem-aws-sdk-secr..> | 2023-10-07 04:39 | 39K | |
| rubygem-aws-sdk-secu..> | 2023-10-07 05:48 | 192K | |
| rubygem-aws-sdk-secu..> | 2023-10-07 08:48 | 31K | |
| rubygem-aws-sdk-serv..> | 2023-10-07 03:26 | 25K | |
| rubygem-aws-sdk-serv..> | 2023-10-07 04:27 | 66K | |
| rubygem-aws-sdk-serv..> | 2023-10-06 23:19 | 38K | |
| rubygem-aws-sdk-serv..> | 2023-10-07 00:54 | 24K | |
| rubygem-aws-sdk-ses-..> | 2023-10-06 23:25 | 62K | |
| rubygem-aws-sdk-sesv..> | 2023-10-07 06:54 | 73K | |
| rubygem-aws-sdk-shie..> | 2023-10-07 03:44 | 35K | |
| rubygem-aws-sdk-sign..> | 2023-10-06 23:59 | 30K | |
| rubygem-aws-sdk-simp..> | 2023-10-07 09:37 | 18K | |
| rubygem-aws-sdk-sims..> | 2023-10-07 09:47 | 23K | |
| rubygem-aws-sdk-sms-..> | 2023-10-07 09:16 | 31K | |
| rubygem-aws-sdk-snow..> | 2023-10-07 00:45 | 40K | |
| rubygem-aws-sdk-snow..> | 2023-10-07 07:44 | 23K | |
| rubygem-aws-sdk-sns-..> | 2023-10-07 10:01 | 46K | |
| rubygem-aws-sdk-sqs-..> | 2023-10-07 07:00 | 45K | |
| rubygem-aws-sdk-ssm-..> | 2023-10-07 06:20 | 158K | |
| rubygem-aws-sdk-ssmc..> | 2023-10-07 04:25 | 33K | |
| rubygem-aws-sdk-ssmi..> | 2023-10-07 06:55 | 35K | |
| rubygem-aws-sdk-ssms..> | 2023-10-07 02:10 | 23K | |
| rubygem-aws-sdk-sso-..> | 2023-10-14 03:59 | 5.6K | |
| rubygem-aws-sdk-ssoa..> | 2023-10-06 23:53 | 28K | |
| rubygem-aws-sdk-ssoo..> | 2023-10-08 15:43 | 5.5K | |
| rubygem-aws-sdk-stat..> | 2023-10-07 00:03 | 41K | |
| rubygem-aws-sdk-stor..> | 2023-10-07 05:16 | 72K | |
| rubygem-aws-sdk-supp..> | 2023-10-07 06:30 | 29K | |
| rubygem-aws-sdk-supp..> | 2023-10-07 03:41 | 18K | |
| rubygem-aws-sdk-swf-..> | 2023-10-07 08:49 | 52K | |
| rubygem-aws-sdk-synt..> | 2023-10-07 04:51 | 30K | |
| rubygem-aws-sdk-text..> | 2023-10-07 07:11 | 37K | |
| rubygem-aws-sdk-time..> | 2023-10-07 00:02 | 28K | |
| rubygem-aws-sdk-time..> | 2023-10-07 07:30 | 30K | |
| rubygem-aws-sdk-tnb-..> | 2023-10-07 06:21 | 28K | |
| rubygem-aws-sdk-tran..> | 2023-10-07 01:16 | 50K | |
| rubygem-aws-sdk-tran..> | 2023-10-07 09:59 | 29K | |
| rubygem-aws-sdk-tran..> | 2023-10-06 23:16 | 61K | |
| rubygem-aws-sdk-tran..> | 2023-10-07 09:44 | 32K | |
| rubygem-aws-sdk-veri..> | 2023-10-07 07:49 | 34K | |
| rubygem-aws-sdk-voic..> | 2023-10-07 05:30 | 30K | |
| rubygem-aws-sdk-vpcl..> | 2023-10-07 09:40 | 38K | |
| rubygem-aws-sdk-waf-..> | 2023-10-07 09:30 | 61K | |
| rubygem-aws-sdk-wafr..> | 2023-10-07 04:25 | 62K | |
| rubygem-aws-sdk-wafv..> | 2023-10-07 05:47 | 79K | |
| rubygem-aws-sdk-well..> | 2023-10-07 06:53 | 43K | |
| rubygem-aws-sdk-work..> | 2023-10-07 00:07 | 38K | |
| rubygem-aws-sdk-work..> | 2023-10-07 08:47 | 24K | |
| rubygem-aws-sdk-work..> | 2023-10-07 01:49 | 47K | |
| rubygem-aws-sdk-work..> | 2023-10-07 05:57 | 15K | |
| rubygem-aws-sdk-work..> | 2023-10-07 02:53 | 52K | |
| rubygem-aws-sdk-work..> | 2023-10-07 00:18 | 32K | |
| rubygem-aws-sdk-xray..> | 2023-10-07 05:18 | 39K | |
| rubygem-aws-sdk2-2.1..> | 2023-10-10 21:38 | 1.1K | |
| rubygem-aws-ses-0.7...> | 2023-10-07 17:06 | 18K | |
| rubygem-aws-sigv2-1...> | 2023-10-06 19:44 | 7.5K | |
| rubygem-aws-sigv4-1...> | 2023-10-06 13:47 | 14K | |
| rubygem-axiom-types-..> | 2023-10-06 15:03 | 21K | |
| rubygem-azure-0.7.10..> | 2023-10-08 04:59 | 76K | |
| rubygem-azure-core-0..> | 2023-10-07 08:20 | 19K | |
| rubygem-azure-storag..> | 2023-10-07 15:39 | 59K | |
| rubygem-azure-storag..> | 2023-10-07 06:49 | 23K | |
| rubygem-azure-storag..> | 2023-10-06 18:35 | 37K | |
| rubygem-azure-storag..> | 2023-10-09 07:44 | 12K | |
| rubygem-azure-storag..> | 2023-10-10 09:25 | 9.4K | |
| rubygem-azure-storag..> | 2023-10-09 01:01 | 14K | |
| rubygem-azure_cognit..> | 2023-10-08 05:31 | 8.4K | |
| rubygem-azure_cognit..> | 2023-10-07 18:25 | 14K | |
| rubygem-azure_cognit..> | 2023-10-08 07:11 | 29K | |
| rubygem-azure_cognit..> | 2023-10-07 22:19 | 24K | |
| rubygem-azure_cognit..> | 2023-10-07 23:05 | 18K | |
| rubygem-azure_cognit..> | 2023-10-08 04:49 | 15K | |
| rubygem-azure_cognit..> | 2023-10-08 07:51 | 10K | |
| rubygem-azure_cognit..> | 2023-10-08 03:48 | 36K | |
| rubygem-azure_cognit..> | 2023-10-07 16:59 | 20K | |
| rubygem-azure_cognit..> | 2023-10-08 02:13 | 35K | |
| rubygem-azure_cognit..> | 2023-10-08 04:20 | 14K | |
| rubygem-azure_cognit..> | 2023-10-07 21:16 | 29K | |
| rubygem-azure_cognit..> | 2023-10-08 09:49 | 17K | |
| rubygem-azure_cognit..> | 2023-10-07 14:27 | 56K | |
| rubygem-azure_cognit..> | 2023-10-07 17:51 | 11K | |
| rubygem-azure_cognit..> | 2023-10-07 16:59 | 18K | |
| rubygem-azure_cognit..> | 2023-10-07 10:57 | 9.0K | |
| rubygem-azure_cognit..> | 2023-10-07 22:32 | 16K | |
| rubygem-azure_cognit..> | 2023-10-08 06:09 | 10K | |
| rubygem-azure_cognit..> | 2023-10-07 15:15 | 13K | |
| rubygem-azure_cognit..> | 2023-10-08 07:34 | 15K | |
| rubygem-azure_cognit..> | 2023-10-07 15:41 | 19K | |
| rubygem-azure_cognit..> | 2023-10-07 19:29 | 22K | |
| rubygem-azure_cognit..> | 2023-10-07 15:37 | 21K | |
| rubygem-azure_event_..> | 2023-10-07 15:04 | 23K | |
| rubygem-azure_graph_..> | 2023-10-07 23:49 | 20K | |
| rubygem-azure_key_va..> | 2023-10-08 08:50 | 99K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 20:59 | 40K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 18:26 | 19K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 23:24 | 36K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 22:45 | 20K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 20:24 | 256K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 11:53 | 21K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 21:33 | 9.0K | |
| rubygem-azure_mgmt_a..> | 2023-10-08 01:44 | 23K | |
| rubygem-azure_mgmt_a..> | 2023-10-07 11:03 | 15K | |
| rubygem-azure_mgmt_a..> | 2023-10-08 03:51 | 49K | |
| rubygem-azure_mgmt_a..> | 2023-10-08 04:11 | 16K | |
| rubygem-azure_mgmt_a..> | 2023-10-08 04:44 | 11K | |
| rubygem-azure_mgmt_b..> | 2023-10-07 15:17 | 66K | |
| rubygem-azure_mgmt_b..> | 2023-10-07 18:48 | 57K | |
| rubygem-azure_mgmt_b..> | 2023-10-07 10:05 | 14K | |
| rubygem-azure_mgmt_b..> | 2023-10-07 23:11 | 26K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 22:06 | 107K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 15:29 | 26K | |
| rubygem-azure_mgmt_c..> | 2023-10-08 11:18 | 11K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 18:28 | 330K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 17:47 | 83K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 11:27 | 50K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 11:51 | 79K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 10:38 | 95K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 21:20 | 159K | |
| rubygem-azure_mgmt_c..> | 2023-10-08 07:59 | 39K | |
| rubygem-azure_mgmt_c..> | 2023-10-07 20:16 | 48K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 01:48 | 203K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 00:59 | 117K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 05:26 | 24K | |
| rubygem-azure_mgmt_d..> | 2023-10-07 20:05 | 28K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 03:51 | 24K | |
| rubygem-azure_mgmt_d..> | 2023-10-07 18:43 | 40K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 00:31 | 24K | |
| rubygem-azure_mgmt_d..> | 2023-10-07 10:44 | 12K | |
| rubygem-azure_mgmt_d..> | 2023-10-07 10:40 | 78K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 08:28 | 13K | |
| rubygem-azure_mgmt_d..> | 2023-10-08 01:41 | 22K | |
| rubygem-azure_mgmt_e..> | 2023-10-08 06:48 | 35K | |
| rubygem-azure_mgmt_e..> | 2023-10-07 15:36 | 103K | |
| rubygem-azure_mgmt_e..> | 2023-10-08 07:00 | 40K | |
| rubygem-azure_mgmt_f..> | 2023-10-08 06:18 | 8.7K | |
| rubygem-azure_mgmt_h..> | 2023-10-07 19:52 | 14K | |
| rubygem-azure_mgmt_h..> | 2023-10-08 11:24 | 42K | |
| rubygem-azure_mgmt_h..> | 2023-10-08 02:58 | 20K | |
| rubygem-azure_mgmt_i..> | 2023-10-08 02:29 | 14K | |
| rubygem-azure_mgmt_i..> | 2023-10-08 05:44 | 14K | |
| rubygem-azure_mgmt_i..> | 2023-10-08 06:04 | 64K | |
| rubygem-azure_mgmt_k..> | 2023-10-08 00:54 | 35K | |
| rubygem-azure_mgmt_k..> | 2023-10-08 04:14 | 15K | |
| rubygem-azure_mgmt_k..> | 2023-10-07 14:08 | 65K | |
| rubygem-azure_mgmt_l..> | 2023-10-07 11:06 | 29K | |
| rubygem-azure_mgmt_l..> | 2023-10-08 05:42 | 9.5K | |
| rubygem-azure_mgmt_l..> | 2023-10-08 10:07 | 13K | |
| rubygem-azure_mgmt_l..> | 2023-10-08 01:46 | 77K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 04:00 | 19K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 12:32 | 31K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 00:03 | 12K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 10:53 | 19K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 21:21 | 26K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 04:34 | 9.1K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 01:19 | 121K | |
| rubygem-azure_mgmt_m..> | 2023-10-08 11:53 | 23K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 10:35 | 21K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 15:19 | 108K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 12:27 | 8.9K | |
| rubygem-azure_mgmt_m..> | 2023-10-07 11:27 | 33K | |
| rubygem-azure_mgmt_n..> | 2023-10-08 11:21 | 70K | |
| rubygem-azure_mgmt_n..> | 2023-10-08 01:55 | 1.1M | |
| rubygem-azure_mgmt_n..> | 2023-10-08 07:35 | 18K | |
| rubygem-azure_mgmt_o..> | 2023-10-07 13:39 | 49K | |
| rubygem-azure_mgmt_o..> | 2023-10-07 16:42 | 12K | |
| rubygem-azure_mgmt_p..> | 2023-10-08 06:15 | 20K | |
| rubygem-azure_mgmt_p..> | 2023-10-08 09:07 | 29K | |
| rubygem-azure_mgmt_p..> | 2023-10-07 22:05 | 38K | |
| rubygem-azure_mgmt_p..> | 2023-10-08 02:35 | 11K | |
| rubygem-azure_mgmt_p..> | 2023-10-07 23:42 | 24K | |
| rubygem-azure_mgmt_p..> | 2023-10-07 23:06 | 12K | |
| rubygem-azure_mgmt_p..> | 2023-10-08 08:59 | 11K | |
| rubygem-azure_mgmt_p..> | 2023-10-07 17:02 | 15K | |
| rubygem-azure_mgmt_r..> | 2023-10-07 16:08 | 20K | |
| rubygem-azure_mgmt_r..> | 2023-10-08 03:17 | 123K | |
| rubygem-azure_mgmt_r..> | 2023-10-07 23:20 | 117K | |
| rubygem-azure_mgmt_r..> | 2023-10-07 17:27 | 29K | |
| rubygem-azure_mgmt_r..> | 2023-10-07 23:18 | 23K | |
| rubygem-azure_mgmt_r..> | 2023-10-08 04:44 | 32K | |
| rubygem-azure_mgmt_r..> | 2023-10-08 11:45 | 24K | |
| rubygem-azure_mgmt_r..> | 2023-10-08 00:45 | 11K | |
| rubygem-azure_mgmt_r..> | 2023-10-07 17:32 | 102K | |
| rubygem-azure_mgmt_r..> | 2023-10-08 10:42 | 22K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 21:56 | 17K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 17:04 | 14K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 11:43 | 116K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 23:01 | 7.1K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 21:26 | 41K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 19:31 | 37K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 23:09 | 27K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 07:16 | 150K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 10:16 | 19K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 00:50 | 52K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 04:18 | 139K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 19:21 | 36K | |
| rubygem-azure_mgmt_s..> | 2023-10-07 13:07 | 42K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 04:09 | 29K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 03:10 | 27K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 04:29 | 17K | |
| rubygem-azure_mgmt_s..> | 2023-10-08 06:05 | 81K | |
| rubygem-azure_mgmt_t..> | 2023-10-07 16:24 | 31K | |
| rubygem-azure_mgmt_t..> | 2023-10-08 04:00 | 25K | |
| rubygem-azure_mgmt_v..> | 2023-10-08 09:35 | 24K | |
| rubygem-azure_mgmt_w..> | 2023-10-07 13:06 | 321K | |
| rubygem-azure_sdk-0...> | 2023-10-14 16:22 | 276K | |
| rubygem-azure_servic..> | 2023-10-08 09:23 | 324K | |
| rubygem-babel-source..> | 2023-10-07 01:07 | 342K | |
| rubygem-babel-transp..> | 2023-10-08 03:15 | 2.1K | |
| rubygem-babosa-2.0.0..> | 2023-10-08 05:44 | 17K | |
| rubygem-backports-3...> | 2023-10-08 10:38 | 116K | |
| rubygem-backup-4.4.1..> | 2023-10-14 15:56 | 70K | |
| rubygem-bacon-1.2.0.pkg | 2023-10-14 02:53 | 15K | |
| rubygem-baf-0.14.1.pkg | 2023-10-08 04:32 | 4.9K | |
| rubygem-base32-0.3.4..> | 2023-10-08 07:21 | 5.5K | |
| rubygem-base64-0.1.1..> | 2023-10-06 17:57 | 3.5K | |
| rubygem-batch-loader..> | 2023-10-07 16:24 | 14K | |
| rubygem-bcp47_spec-0..> | 2023-10-06 21:01 | 3.6K | |
| rubygem-bcrypt-3.1.1..> | 2023-10-06 20:07 | 28K | |
| rubygem-bcrypt-ruby-..> | 2023-10-07 04:17 | 6.0K | |
| rubygem-bcrypt_pbkdf..> | 2023-10-07 07:35 | 17K | |
| rubygem-bdb1-0.2.5_3..> | 2023-10-10 21:49 | 64K | |
| rubygem-beefcake-1.2..> | 2023-10-06 23:03 | 16K | |
| rubygem-benchmark-0...> | 2023-10-14 05:51 | 8.6K | |
| rubygem-benchmark-ip..> | 2023-10-08 00:33 | 17K | |
| rubygem-benchmark-me..> | 2023-10-07 23:11 | 14K | |
| rubygem-benelux-0.6...> | 2023-10-08 01:56 | 15K | |
| rubygem-best_in_plac..> | 2023-10-14 05:50 | 66K | |
| rubygem-best_in_plac..> | 2023-10-14 16:20 | 66K | |
| rubygem-better_html-..> | 2023-10-07 10:11 | 25K | |
| rubygem-bigdecimal-3..> | 2023-10-06 18:00 | 58K | |
| rubygem-bigrecord-0...> | 2023-10-09 01:58 | 105K | |
| rubygem-bin_utils-0...> | 2023-10-07 06:23 | 21K | |
| rubygem-bindata-2.4...> | 2023-10-06 15:07 | 65K | |
| rubygem-bindex-0.8.1..> | 2023-10-06 19:27 | 16K | |
| rubygem-binding_of_c..> | 2023-10-06 20:11 | 6.7K | |
| rubygem-bio-2.0.4.pkg | 2023-10-07 07:34 | 962K | |
| rubygem-bio-executab..> | 2023-10-11 00:14 | 11K | |
| rubygem-bio-old-biof..> | 2023-10-08 08:57 | 7.7K | |
| rubygem-bio-shell-1...> | 2023-10-10 07:02 | 40K | |
| rubygem-bit-struct-0..> | 2023-10-08 13:00 | 26K | |
| rubygem-blankslate-3..> | 2023-10-14 09:29 | 4.5K | |
| rubygem-blimpy-0.6.7..> | 2023-10-10 08:44 | 21K | |
| rubygem-blockenspiel..> | 2023-10-06 23:17 | 40K | |
| rubygem-bluecloth-2...> | 2023-10-11 00:07 | 80K | |
| rubygem-blurhash-0.1..> | 2023-10-10 08:21 | 11K | |
| rubygem-bolt-3.27.2.pkg | 2023-10-08 20:50 | 200K | |
| rubygem-bones-3.9.0.pkg | 2023-10-07 13:27 | 32K | |
| rubygem-bootsnap-1.1..> | 2023-10-06 20:32 | 33K | |
| rubygem-bootstrap-sa..> | 2023-10-10 22:23 | 223K | |
| rubygem-bootstrap_fo..> | 2023-10-10 09:03 | 91K | |
| rubygem-bosh-gen-0.1..> | 2023-10-10 20:32 | 30K | |
| rubygem-bourbon-7.3...> | 2023-10-10 13:03 | 80K | |
| rubygem-browser-5.3...> | 2023-10-07 21:07 | 50K | |
| rubygem-brpoplpush-r..> | 2023-10-08 05:16 | 9.0K | |
| rubygem-bson-4.15.0.pkg | 2023-10-07 08:30 | 132K | |
| rubygem-buftok-0.3.0..> | 2023-10-07 04:38 | 4.5K | |
| rubygem-bugspots-0.2..> | 2023-10-09 12:12 | 5.6K | |
| rubygem-builder-3.2...> | 2023-10-06 11:28 | 26K | |
| rubygem-bundler-2.4...> | 2023-10-06 13:15 | 364K | |
| rubygem-bundler_ext-..> | 2023-10-06 19:59 | 9.9K | |
| rubygem-bunny-2.9.0.pkg | 2023-10-08 17:38 | 168K | |
| rubygem-byebug-11.1...> | 2023-10-07 07:04 | 75K | |
| rubygem-bzip2-ruby-0..> | 2023-10-14 18:42 | 20K | |
| rubygem-c21e-2.0.0.pkg | 2023-10-09 13:24 | 3.8K | |
| rubygem-cabin-0.9.0.pkg | 2023-10-07 04:05 | 18K | |
| rubygem-caesars-0.7...> | 2023-10-07 10:06 | 15K | |
| rubygem-cairo-1.17.1..> | 2023-10-06 12:46 | 162K | |
| rubygem-cairo-gobjec..> | 2023-10-06 13:41 | 17K | |
| rubygem-cal-heatmap-..> | 2023-10-08 19:47 | 30K | |
| rubygem-callsign-2.2..> | 2023-10-14 05:14 | 1.7K | |
| rubygem-capistrano-3..> | 2023-10-08 06:20 | 61K | |
| rubygem-capistrano-e..> | 2023-10-08 21:19 | 14K | |
| rubygem-capistrano-h..> | 2023-10-09 09:24 | 26K | |
| rubygem-captcha-1.2...> | 2023-10-08 22:03 | 60K | |
| rubygem-capybara-3.3..> | 2023-10-06 19:15 | 311K | |
| rubygem-capybara-scr..> | 2023-10-09 22:14 | 30K | |
| rubygem-carrierwave-..> | 2023-10-08 11:37 | 38K | |
| rubygem-case_transfo..> | 2023-10-08 09:25 | 2.9K | |
| rubygem-case_transfo..> | 2023-10-07 19:51 | 2.9K | |
| rubygem-cbor-0.5.9.6..> | 2023-10-06 22:27 | 38K | |
| rubygem-cdo-1.5.1_1.pkg | 2023-10-08 17:23 | 12K | |
| rubygem-celluloid-0...> | 2023-10-07 12:31 | 72K | |
| rubygem-celluloid-es..> | 2023-10-10 18:07 | 15K | |
| rubygem-celluloid-ex..> | 2023-10-09 14:25 | 4.4K | |
| rubygem-celluloid-fs..> | 2023-10-14 15:27 | 5.7K | |
| rubygem-celluloid-io..> | 2023-10-08 15:08 | 51K | |
| rubygem-celluloid-po..> | 2023-10-10 05:58 | 6.6K | |
| rubygem-celluloid-su..> | 2023-10-08 17:44 | 12K | |
| rubygem-cf-uaa-lib-4..> | 2023-10-11 05:54 | 82K | |
| rubygem-cgi-0.3.6.pkg | 2023-10-07 02:20 | 33K | |
| rubygem-cgi_multipar..> | 2023-10-09 12:40 | 6.7K | |
| rubygem-character_se..> | 2023-10-07 04:07 | 35K | |
| rubygem-charlock_hol..> | 2023-10-07 01:49 | 9.4K | |
| rubygem-checkson-1.3..> | 2023-10-09 10:17 | 5.4K | |
| rubygem-chef-18.2.7.pkg | 2023-10-07 21:12 | 1.3M | |
| rubygem-chef-bin-18...> | 2023-10-08 14:04 | 7.4K | |
| rubygem-chef-bin17-1..> | 2023-10-08 22:20 | 6.7K | |
| rubygem-chef-cleanro..> | 2023-10-07 17:12 | 13K | |
| rubygem-chef-config-..> | 2023-10-06 18:17 | 42K | |
| rubygem-chef-config1..> | 2023-10-06 21:29 | 42K | |
| rubygem-chef-telemet..> | 2023-10-06 19:01 | 9.3K | |
| rubygem-chef-utils-1..> | 2023-10-06 12:57 | 28K | |
| rubygem-chef-utils17..> | 2023-10-06 16:10 | 28K | |
| rubygem-chef-vault-4..> | 2023-10-07 04:29 | 19K | |
| rubygem-chef-zero-15..> | 2023-10-07 07:40 | 61K | |
| rubygem-chef17-17.10..> | 2023-10-07 15:53 | 1.3M | |
| rubygem-cheffish-16...> | 2023-10-14 07:05 | 48K | |
| rubygem-chewy-7.3.4.pkg | 2023-10-09 14:01 | 138K | |
| rubygem-childprocess..> | 2023-10-07 16:00 | 29K | |
| rubygem-childprocess..> | 2023-10-09 03:45 | 29K | |
| rubygem-childprocess..> | 2023-10-11 00:14 | 29K | |
| rubygem-choria-mcorp..> | 2023-10-09 22:28 | 141K | |
| rubygem-chosen-rails..> | 2023-10-09 05:03 | 18K | |
| rubygem-chromedriver..> | 2023-10-06 23:15 | 16K | |
| rubygem-chronic-0.10..> | 2023-10-07 01:39 | 36K | |
| rubygem-chronic_dura..> | 2023-10-09 04:49 | 7.5K | |
| rubygem-chunky_png-1..> | 2023-10-06 20:16 | 288K | |
| rubygem-cinch-2.3.4.pkg | 2023-10-08 11:24 | 67K | |
| rubygem-circuitbox-2..> | 2023-10-07 13:36 | 10K | |
| rubygem-citrus-3.0.2..> | 2023-10-06 21:33 | 35K | |
| rubygem-claide-1.1.0..> | 2023-10-06 17:44 | 23K | |
| rubygem-claide-plugi..> | 2023-10-06 17:02 | 17K | |
| rubygem-clamp-1.3.2.pkg | 2023-10-06 21:49 | 26K | |
| rubygem-classifier-1..> | 2023-10-09 16:45 | 17K | |
| rubygem-classifier-r..> | 2023-10-14 04:15 | 42K | |
| rubygem-cld3-3.6.0.pkg | 2023-10-09 23:08 | 406K | |
| rubygem-climate_cont..> | 2023-10-06 17:29 | 7.2K | |
| rubygem-clio-0.3.0.pkg | 2023-10-07 10:45 | 29K | |
| rubygem-cliprompt-0...> | 2023-10-08 03:15 | 6.4K | |
| rubygem-cloudfiles-1..> | 2023-10-09 13:44 | 27K | |
| rubygem-cloudflare-4..> | 2023-10-08 17:32 | 6.8K | |
| rubygem-clutter-4.2...> | 2023-10-06 20:38 | 36K | |
| rubygem-clutter-gdk-..> | 2023-10-07 04:04 | 11K | |
| rubygem-clutter-gstr..> | 2023-10-08 00:15 | 66K | |
| rubygem-clutter-gtk-..> | 2023-10-07 10:59 | 25K | |
| rubygem-cms_scanner-..> | 2023-10-09 03:18 | 31K | |
| rubygem-cocaine-0.6...> | 2023-10-07 00:26 | 9.6K | |
| rubygem-cocoon-1.2.1..> | 2023-10-09 18:38 | 80K | |
| rubygem-coderay-1.1...> | 2023-10-06 16:31 | 76K | |
| rubygem-coercible-1...> | 2023-10-06 14:46 | 22K | |
| rubygem-coffee-rails..> | 2023-10-07 03:03 | 3.9K | |
| rubygem-coffee-rails..> | 2023-10-07 05:44 | 3.9K | |
| rubygem-coffee-rails..> | 2023-10-06 23:18 | 4.0K | |
| rubygem-coffee-rails..> | 2023-10-07 13:23 | 3.9K | |
| rubygem-coffee-rails..> | 2023-10-07 08:37 | 3.5K | |
| rubygem-coffee-scrip..> | 2023-10-06 20:49 | 3.1K | |
| rubygem-coffee-scrip..> | 2023-10-06 17:11 | 51K | |
| rubygem-cogbot-0.1.1..> | 2023-10-09 04:25 | 16K | |
| rubygem-color-1.8.pkg | 2023-10-08 07:55 | 37K | |
| rubygem-color-tools-..> | 2023-10-09 05:25 | 26K | |
| rubygem-color_diff-0..> | 2023-10-14 04:54 | 4.4K | |
| rubygem-colorator-1...> | 2023-10-06 22:26 | 3.7K | |
| rubygem-colored-1.2.pkg | 2023-10-07 22:35 | 3.3K | |
| rubygem-colored2-3.1..> | 2023-10-06 13:33 | 6.9K | |
| rubygem-colorize-1.1..> | 2023-10-08 03:42 | 14K | |
| rubygem-columnize-0...> | 2023-10-09 08:15 | 14K | |
| rubygem-commander-4...> | 2023-10-07 16:10 | 32K | |
| rubygem-commonmarker..> | 2023-10-07 04:37 | 110K | |
| rubygem-concurrent-r..> | 2023-10-06 09:04 | 235K | |
| rubygem-concurrent-r..> | 2023-10-10 00:57 | 57K | |
| rubygem-concurrent-r..> | 2023-10-06 22:00 | 55K | |
| rubygem-concurrent-r..> | 2023-10-08 13:42 | 20K | |
| rubygem-concurrent-r..> | 2023-10-06 16:41 | 238K | |
| rubygem-configatron-..> | 2023-10-14 12:20 | 15K | |
| rubygem-configstruct..> | 2023-10-08 02:47 | 4.5K | |
| rubygem-configuratio..> | 2023-10-14 18:20 | 8.4K | |
| rubygem-connection_p..> | 2023-10-06 12:58 | 7.9K | |
| rubygem-console-1.23..> | 2023-10-06 15:38 | 14K | |
| rubygem-contracts-0...> | 2023-10-08 12:04 | 36K | |
| rubygem-contracts016..> | 2023-10-08 00:32 | 49K | |
| rubygem-cookbook-omn..> | 2023-10-14 17:50 | 15K | |
| rubygem-cookiejar-0...> | 2023-10-07 00:52 | 16K | |
| rubygem-cool.io-1.8...> | 2023-10-06 20:53 | 52K | |
| rubygem-corefines-1...> | 2023-10-09 10:51 | 31K | |
| rubygem-corefoundati..> | 2023-10-07 07:49 | 9.5K | |
| rubygem-cork-0.3.0.pkg | 2023-10-06 14:05 | 5.6K | |
| rubygem-cose-1.2.0.pkg | 2023-10-07 01:14 | 13K | |
| rubygem-couchrest-2...> | 2023-10-09 13:11 | 51K | |
| rubygem-countries-4...> | 2023-10-07 22:48 | 1.6M | |
| rubygem-cow_proxy-0...> | 2023-10-08 07:42 | 7.8K | |
| rubygem-crack-0.4.5.pkg | 2023-10-06 15:59 | 5.7K | |
| rubygem-crass-1.0.6.pkg | 2023-10-06 10:01 | 14K | |
| rubygem-creole-0.5.0..> | 2023-10-07 10:41 | 10K | |
| rubygem-cri-2.15.11.pkg | 2023-10-06 17:29 | 29K | |
| rubygem-css_parser-1..> | 2023-10-06 12:58 | 16K | |
| rubygem-cssbundling-..> | 2023-10-06 19:45 | 8.0K | |
| rubygem-cssmin-1.0.3..> | 2023-10-08 01:45 | 3.3K | |
| rubygem-csv-3.2.7.pkg | 2023-10-07 20:45 | 52K | |
| rubygem-cuba-4.0.1.pkg | 2023-10-09 02:51 | 22K | |
| rubygem-cucumber-9.0..> | 2023-10-08 06:07 | 69K | |
| rubygem-cucumber-ci-..> | 2023-10-07 00:07 | 5.8K | |
| rubygem-cucumber-cor..> | 2023-10-06 23:14 | 22K | |
| rubygem-cucumber-cuc..> | 2023-10-06 23:15 | 19K | |
| rubygem-cucumber-ghe..> | 2023-10-06 21:32 | 27K | |
| rubygem-cucumber-htm..> | 2023-10-07 04:36 | 440K | |
| rubygem-cucumber-mes..> | 2023-10-06 15:39 | 18K | |
| rubygem-cucumber-rai..> | 2023-10-10 06:40 | 14K | |
| rubygem-cucumber-tag..> | 2023-10-06 22:40 | 3.4K | |
| rubygem-cucumber-wir..> | 2023-10-14 13:12 | 9.6K | |
| rubygem-curb-1.0.5.pkg | 2023-10-10 08:11 | 67K | |
| rubygem-curses-1.3.2..> | 2023-10-08 11:51 | 31K | |
| rubygem-cvss-suite-3..> | 2023-10-08 07:12 | 16K | |
| rubygem-cyoi-0.11.3_..> | 2023-10-07 18:00 | 25K | |
| rubygem-d3_rails-4.1..> | 2023-10-08 08:06 | 109K | |
| rubygem-daemon_contr..> | 2023-10-09 15:31 | 27K | |
| rubygem-daemons-1.4...> | 2023-10-07 08:55 | 24K | |
| rubygem-dalli-3.2.5.pkg | 2023-10-06 22:02 | 36K | |
| rubygem-danger-9.3.0..> | 2023-10-06 22:13 | 73K | |
| rubygem-danger-gitla..> | 2023-10-06 23:22 | 2.2K | |
| rubygem-data_objects..> | 2023-10-07 02:55 | 25K | |
| rubygem-datamapper-1..> | 2023-10-09 02:25 | 3.0K | |
| rubygem-date-3.3.3.pkg | 2023-10-06 13:07 | 94K | |
| rubygem-davclient-0...> | 2023-10-08 22:40 | 20K | |
| rubygem-dbd-pg-0.3.9..> | 2023-10-08 17:52 | 47K | |
| rubygem-dbd-sqlite3-..> | 2023-10-08 18:37 | 36K | |
| rubygem-dbf-4.2.4.pkg | 2023-10-07 23:36 | 100K | |
| rubygem-dbi-0.4.5_1.pkg | 2023-10-07 17:06 | 61K | |
| rubygem-dbm-1.1.0.pkg | 2023-10-07 16:47 | 8.7K | |
| rubygem-ddmemoize-1...> | 2023-10-09 11:10 | 8.4K | |
| rubygem-ddmetrics-1...> | 2023-10-06 13:43 | 12K | |
| rubygem-ddplugin-1.0..> | 2023-10-06 15:16 | 6.2K | |
| rubygem-ddtrace-1.14..> | 2023-10-08 12:04 | 353K | |
| rubygem-debase-ruby_..> | 2023-10-07 11:40 | 333K | |
| rubygem-debug-1.8.0.pkg | 2023-10-09 15:10 | 73K | |
| rubygem-debug_inspec..> | 2023-10-06 17:20 | 6.9K | |
| rubygem-debugger-lin..> | 2023-10-12 05:55 | 13K | |
| rubygem-debugger-rub..> | 2023-10-07 00:53 | 104K | |
| rubygem-debugger-xml..> | 2023-10-14 12:26 | 26K | |
| rubygem-deckar01-tas..> | 2023-10-07 23:37 | 17K | |
| rubygem-declarative-..> | 2023-10-06 10:58 | 7.3K | |
| rubygem-declarative-..> | 2023-10-10 18:12 | 5.4K | |
| rubygem-declarative_..> | 2023-10-08 09:17 | 32K | |
| rubygem-deep_merge-1..> | 2023-10-06 22:37 | 11K | |
| rubygem-deep_test-1...> | 2023-10-08 21:55 | 37K | |
| rubygem-deface-1.9.0..> | 2023-10-09 00:57 | 43K | |
| rubygem-default_valu..> | 2023-10-09 21:23 | 11K | |
| rubygem-delayed_job-..> | 2023-10-09 06:34 | 34K | |
| rubygem-delayer-1.2...> | 2023-10-07 01:00 | 8.6K | |
| rubygem-delayer-defe..> | 2023-10-07 21:20 | 18K | |
| rubygem-delegate-0.3..> | 2023-10-14 05:32 | 7.0K | |
| rubygem-deprecated-3..> | 2023-10-09 10:38 | 3.8K | |
| rubygem-deprecated2-..> | 2023-10-07 03:16 | 3.9K | |
| rubygem-derailed_ben..> | 2023-10-10 12:26 | 95K | |
| rubygem-descendants_..> | 2023-10-06 13:37 | 8.1K | |
| rubygem-devfile-0.0...> | 2023-10-08 11:23 | 18M | |
| rubygem-device_detec..> | 2023-10-08 07:24 | 282K | |
| rubygem-devise-4.9.2..> | 2023-10-08 01:59 | 77K | |
| rubygem-devise-rails..> | 2023-10-07 15:10 | 78K | |
| rubygem-devise-rails..> | 2023-10-09 02:46 | 78K | |
| rubygem-devise-rails..> | 2023-10-10 07:35 | 78K | |
| rubygem-devise-rails..> | 2023-10-08 00:14 | 75K | |
| rubygem-devise-rails..> | 2023-10-07 08:12 | 78K | |
| rubygem-devise-two-f..> | 2023-10-09 14:33 | 20K | |
| rubygem-devise-two-f..> | 2023-10-09 18:11 | 20K | |
| rubygem-devise-two-f..> | 2023-10-09 15:04 | 20K | |
| rubygem-devise-two-f..> | 2023-10-10 20:37 | 22K | |
| rubygem-devise-two-f..> | 2023-10-07 20:31 | 20K | |
| rubygem-devise48-rai..> | 2023-10-08 09:54 | 75K | |
| rubygem-devise_pam_a..> | 2023-10-09 01:01 | 5.2K | |
| rubygem-devise_pam_a..> | 2023-10-09 16:35 | 5.2K | |
| rubygem-did_you_mean..> | 2023-10-14 11:29 | 40K | |
| rubygem-diff-lcs-1.5..> | 2023-10-06 14:45 | 45K | |
| rubygem-diff_match_p..> | 2023-10-07 16:28 | 20K | |
| rubygem-diffy-3.4.2.pkg | 2023-10-07 11:46 | 14K | |
| rubygem-dig_rb-1.0.1..> | 2023-10-09 03:20 | 5.0K | |
| rubygem-digest-3.1.1..> | 2023-10-10 14:13 | 27K | |
| rubygem-digest-crc-0..> | 2023-10-07 01:06 | 55K | |
| rubygem-directory_wa..> | 2023-10-07 21:05 | 24K | |
| rubygem-discard-rail..> | 2023-10-09 01:51 | 11K | |
| rubygem-discordrb-we..> | 2023-10-07 21:54 | 4.8K | |
| rubygem-discordrb-we..> | 2023-10-09 20:58 | 4.8K | |
| rubygem-ditz-0.5_3.pkg | 2023-10-09 15:13 | 61K | |
| rubygem-diva-2.0.1.pkg | 2023-10-08 01:44 | 12K | |
| rubygem-dm-aggregate..> | 2023-10-08 06:02 | 11K | |
| rubygem-dm-chunked_q..> | 2023-10-12 04:19 | 7.4K | |
| rubygem-dm-constrain..> | 2023-10-07 19:37 | 12K | |
| rubygem-dm-core-1.2...> | 2023-10-07 00:52 | 160K | |
| rubygem-dm-do-adapte..> | 2023-10-07 10:13 | 10K | |
| rubygem-dm-migration..> | 2023-10-07 22:03 | 30K | |
| rubygem-dm-mysql-ada..> | 2023-10-14 07:01 | 4.5K | |
| rubygem-dm-observer-..> | 2023-10-14 15:26 | 5.2K | |
| rubygem-dm-pager-1.1..> | 2023-10-09 18:24 | 9.7K | |
| rubygem-dm-paperclip..> | 2023-10-09 10:02 | 67K | |
| rubygem-dm-postgres-..> | 2023-10-10 23:19 | 4.2K | |
| rubygem-dm-serialize..> | 2023-10-07 14:17 | 15K | |
| rubygem-dm-timestamp..> | 2023-10-07 22:19 | 5.8K | |
| rubygem-dm-transacti..> | 2023-10-07 23:30 | 9.9K | |
| rubygem-dm-types-1.2..> | 2023-10-07 14:36 | 25K | |
| rubygem-dm-validatio..> | 2023-10-07 18:02 | 48K | |
| rubygem-dnsruby-1.61..> | 2023-10-07 13:05 | 208K | |
| rubygem-do_mysql-0.1..> | 2023-10-07 12:17 | 27K | |
| rubygem-do_postgres-..> | 2023-10-08 06:16 | 26K | |
| rubygem-do_sqlite3-0..> | 2023-10-08 17:32 | 23K | |
| rubygem-docdiff-0.6...> | 2023-10-08 12:36 | 116K | |
| rubygem-docile-1.4.0..> | 2023-10-06 23:59 | 12K | |
| rubygem-docker-api-1..> | 2023-10-08 02:24 | 23K | |
| rubygem-docopt-0.6.1..> | 2023-10-07 16:17 | 14K | |
| rubygem-dogapi-1.45...> | 2023-10-07 21:02 | 49K | |
| rubygem-domain_name-..> | 2023-10-06 11:04 | 99K | |
| rubygem-domainatrix-..> | 2023-10-10 14:47 | 32K | |
| rubygem-doorkeeper-5..> | 2023-10-08 22:27 | 86K | |
| rubygem-doorkeeper-o..> | 2023-10-07 17:46 | 20K | |
| rubygem-doorkeeper-r..> | 2023-10-10 12:32 | 86K | |
| rubygem-doorkeeper-r..> | 2023-10-10 00:58 | 86K | |
| rubygem-doorkeeper-r..> | 2023-10-14 16:42 | 86K | |
| rubygem-doorkeeper-r..> | 2023-10-07 03:55 | 86K | |
| rubygem-dotenv-2.8.1..> | 2023-10-06 19:16 | 9.2K | |
| rubygem-dotenv-rails..> | 2023-10-09 10:10 | 6.3K | |
| rubygem-dotenv-rails..> | 2023-10-14 09:29 | 6.3K | |
| rubygem-dotenv-rails..> | 2023-10-08 12:28 | 6.3K | |
| rubygem-dotenv-rails..> | 2023-10-09 22:40 | 6.3K | |
| rubygem-dragonfly-1...> | 2023-10-10 17:34 | 408K | |
| rubygem-drb-2.1.1.pkg | 2023-10-08 05:44 | 24K | |
| rubygem-dropbox-sdk-..> | 2023-10-08 03:14 | 50K | |
| rubygem-dropzonejs-r..> | 2023-10-14 17:13 | 20K | |
| rubygem-dry-configur..> | 2023-10-14 11:56 | 11K | |
| rubygem-dry-containe..> | 2023-10-10 17:20 | 9.0K | |
| rubygem-dry-core-1.0..> | 2023-10-06 13:33 | 19K | |
| rubygem-dry-equalize..> | 2023-10-10 09:39 | 11K | |
| rubygem-dry-inflecto..> | 2023-10-06 14:10 | 7.7K | |
| rubygem-dry-logic-1...> | 2023-10-06 15:15 | 12K | |
| rubygem-dry-types-1...> | 2023-10-06 17:20 | 38K | |
| rubygem-drydock-0.6...> | 2023-10-06 19:32 | 19K | |
| rubygem-duo_api-1.3...> | 2023-10-07 10:27 | 6.5K | |
| rubygem-dynflow-1.8...> | 2023-10-07 04:37 | 599K | |
| rubygem-e2mmap-0.1.0..> | 2023-10-07 21:44 | 4.3K | |
| rubygem-ecma-re-vali..> | 2023-10-07 04:54 | 5.6K | |
| rubygem-ed25519-1.3...> | 2023-10-07 03:31 | 133K | |
| rubygem-edavis10-obj..> | 2023-10-09 02:10 | 13K | |
| rubygem-elastic-apm-..> | 2023-10-11 06:07 | 109K | |
| rubygem-elastic-tran..> | 2023-10-08 02:32 | 48K | |
| rubygem-elasticsearc..> | 2023-10-10 09:01 | 18K | |
| rubygem-elasticsearc..> | 2023-10-08 06:59 | 153K | |
| rubygem-elasticsearc..> | 2023-10-06 19:02 | 78K | |
| rubygem-elasticsearc..> | 2023-10-06 21:41 | 76K | |
| rubygem-elasticsearc..> | 2023-10-07 15:01 | 60K | |
| rubygem-elasticsearc..> | 2023-10-07 12:01 | 58K | |
| rubygem-elasticsearc..> | 2023-10-07 23:10 | 58K | |
| rubygem-elasticsearc..> | 2023-10-10 13:18 | 25K | |
| rubygem-elasticsearc..> | 2023-10-08 04:24 | 4.1M | |
| rubygem-elasticsearc..> | 2023-10-06 18:59 | 48K | |
| rubygem-elasticsearc..> | 2023-10-06 21:01 | 45K | |
| rubygem-elasticsearc..> | 2023-10-09 06:43 | 55K | |
| rubygem-elasticsearc..> | 2023-10-07 07:21 | 11K | |
| rubygem-elasticsearc..> | 2023-10-07 00:58 | 9.8K | |
| rubygem-elif-0.1.0.pkg | 2023-10-10 02:36 | 18K | |
| rubygem-em-http-requ..> | 2023-10-07 20:29 | 209K | |
| rubygem-em-redis-uni..> | 2023-10-14 09:37 | 14K | |
| rubygem-em-socksify-..> | 2023-10-07 05:20 | 5.8K | |
| rubygem-em-twitter-0..> | 2023-10-07 12:58 | 14K | |
| rubygem-em-websocket..> | 2023-10-06 19:28 | 27K | |
| rubygem-email_reply_..> | 2023-10-10 05:58 | 14K | |
| rubygem-email_reply_..> | 2023-10-08 15:42 | 19K | |
| rubygem-email_reply_..> | 2023-10-07 19:19 | 31K | |
| rubygem-emk-sinatra-..> | 2023-10-08 11:02 | 3.3K | |
| rubygem-emoji-1.0.7.pkg | 2023-10-08 19:30 | 1.2M | |
| rubygem-emoji_regex-..> | 2023-10-14 07:54 | 4.8K | |
| rubygem-emot-0.0.4.pkg | 2023-10-08 09:21 | 12K | |
| rubygem-encryptor-3...> | 2023-10-06 20:32 | 12K | |
| rubygem-english-0.7...> | 2023-10-08 21:33 | 5.3K | |
| rubygem-enumerable-s..> | 2023-10-07 00:38 | 342K | |
| rubygem-enumerize-2...> | 2023-10-10 13:49 | 27K | |
| rubygem-epp-client-a..> | 2023-10-14 09:14 | 11K | |
| rubygem-epp-client-b..> | 2023-10-07 11:30 | 74K | |
| rubygem-epp-client-r..> | 2023-10-08 10:54 | 13K | |
| rubygem-epp-client-s..> | 2023-10-07 19:00 | 21K | |
| rubygem-epp-client-s..> | 2023-10-08 21:01 | 5.4K | |
| rubygem-equalizer-0...> | 2023-10-07 09:31 | 9.7K | |
| rubygem-equatable-0...> | 2023-10-07 11:30 | 4.9K | |
| rubygem-erb-4.0.3.pkg | 2023-10-07 12:43 | 17K | |
| rubygem-errand-0.8.1..> | 2023-10-08 04:00 | 8.0K | |
| rubygem-error_highli..> | 2023-10-09 03:51 | 7.3K | |
| rubygem-erubi-1.12.0..> | 2023-10-06 11:05 | 8.7K | |
| rubygem-erubis-2.7.0..> | 2023-10-06 11:44 | 120K | |
| rubygem-escape_utils..> | 2023-10-07 03:36 | 20K | |
| rubygem-et-orbi-1.2...> | 2023-10-06 19:03 | 14K | |
| rubygem-etc-1.4.2.pkg | 2023-10-08 04:58 | 17K | |
| rubygem-ethon-0.16.0..> | 2023-10-07 03:56 | 51K | |
| rubygem-event_emitte..> | 2023-10-07 20:16 | 6.5K | |
| rubygem-eventmachine..> | 2023-10-06 18:05 | 205K | |
| rubygem-eventmachine..> | 2023-10-07 22:22 | 26K | |
| rubygem-exception_no..> | 2023-10-09 01:57 | 45K | |
| rubygem-excon-0.102...> | 2023-10-06 12:52 | 147K | |
| rubygem-execjs-2.8.1..> | 2023-10-06 17:04 | 14K | |
| rubygem-exifr-1.3.10..> | 2023-10-10 03:26 | 243K | |
| rubygem-expression_p..> | 2023-10-07 09:11 | 3.5K | |
| rubygem-extended-mar..> | 2023-10-07 09:21 | 8.8K | |
| rubygem-extlib-0.9.1..> | 2023-10-07 05:09 | 55K | |
| rubygem-extpp-0.1.1.pkg | 2023-10-07 05:47 | 8.1K | |
| rubygem-extras-0.3.0..> | 2023-10-07 00:01 | 3.9K | |
| rubygem-ezamar-2009...> | 2023-10-09 02:19 | 13K | |
| rubygem-ezcrypto-0.7..> | 2023-10-10 18:21 | 94K | |
| rubygem-ezprint-1.0...> | 2023-10-09 20:34 | 5.0K | |
| rubygem-fabrication-..> | 2023-10-08 16:18 | 12K | |
| rubygem-facets-3.1.0..> | 2023-10-08 01:33 | 286K | |
| rubygem-facter-4.4.3..> | 2023-10-06 21:39 | 148K | |
| rubygem-faker-3.2.1.pkg | 2023-10-08 00:32 | 1.1M | |
| rubygem-familia-0.7...> | 2023-10-08 00:31 | 19K | |
| rubygem-faraday-2.7...> | 2023-10-06 10:06 | 59K | |
| rubygem-faraday-cook..> | 2023-10-06 19:11 | 4.3K | |
| rubygem-faraday-em_h..> | 2023-10-06 11:55 | 5.6K | |
| rubygem-faraday-em_s..> | 2023-10-06 11:38 | 4.7K | |
| rubygem-faraday-exco..> | 2023-10-14 10:23 | 4.0K | |
| rubygem-faraday-exco..> | 2023-10-06 11:29 | 3.9K | |
| rubygem-faraday-foll..> | 2023-10-06 14:58 | 5.4K | |
| rubygem-faraday-http..> | 2023-10-06 18:18 | 18K | |
| rubygem-faraday-http..> | 2023-10-08 21:05 | 4.3K | |
| rubygem-faraday-http..> | 2023-10-06 11:48 | 4.4K | |
| rubygem-faraday-mult..> | 2023-10-06 11:55 | 7.0K | |
| rubygem-faraday-net_..> | 2023-10-06 09:37 | 4.6K | |
| rubygem-faraday-net_..> | 2023-10-06 11:47 | 4.7K | |
| rubygem-faraday-net_..> | 2023-10-07 02:44 | 5.0K | |
| rubygem-faraday-net_..> | 2023-10-06 11:17 | 4.3K | |
| rubygem-faraday-patr..> | 2023-10-14 08:29 | 4.0K | |
| rubygem-faraday-patr..> | 2023-10-06 11:18 | 4.2K | |
| rubygem-faraday-rack..> | 2023-10-09 08:10 | 3.6K | |
| rubygem-faraday-rack..> | 2023-10-06 11:42 | 3.7K | |
| rubygem-faraday-retr..> | 2023-10-06 17:25 | 7.8K | |
| rubygem-faraday-retr..> | 2023-10-06 11:00 | 6.6K | |
| rubygem-faraday0-0.1..> | 2023-10-06 16:59 | 60K | |
| rubygem-faraday1-1.1..> | 2023-10-06 12:50 | 61K | |
| rubygem-faraday14-1...> | 2023-10-08 22:06 | 64K | |
| rubygem-faraday_midd..> | 2023-10-06 16:36 | 13K | |
| rubygem-faraday_midd..> | 2023-10-10 00:19 | 5.5K | |
| rubygem-faraday_midd..> | 2023-10-08 09:18 | 5.1K | |
| rubygem-faraday_midd..> | 2023-10-06 23:59 | 4.1K | |
| rubygem-faraday_midd..> | 2023-10-06 22:35 | 13K | |
| rubygem-fast-stemmer..> | 2023-10-07 21:30 | 9.3K | |
| rubygem-fast_blank-1..> | 2023-10-07 12:00 | 6.6K | |
| rubygem-fast_gettext..> | 2023-10-06 20:15 | 25K | |
| rubygem-fast_stack-0..> | 2023-10-11 06:09 | 4.9K | |
| rubygem-fast_xor-1.1..> | 2023-10-08 19:06 | 5.6K | |
| rubygem-fast_xs-0.8...> | 2023-10-14 11:49 | 19K | |
| rubygem-fastercsv-1...> | 2023-10-07 06:05 | 92K | |
| rubygem-fastimage-2...> | 2023-10-08 04:21 | 12K | |
| rubygem-fastri-0.3.1..> | 2023-10-10 08:16 | 42K | |
| rubygem-fattr-2.4.0.pkg | 2023-10-07 08:49 | 10K | |
| rubygem-faye-1.4.0.pkg | 2023-10-09 07:57 | 78K | |
| rubygem-faye-websock..> | 2023-10-07 15:25 | 15K | |
| rubygem-fcgi-0.9.2.2..> | 2023-10-10 08:38 | 14K | |
| rubygem-fcntl-1.0.2.pkg | 2023-10-09 22:54 | 2.8K | |
| rubygem-feed-normali..> | 2023-10-09 01:04 | 37K | |
| rubygem-feedjira-3.2..> | 2023-10-10 18:08 | 307K | |
| rubygem-ffaker-2.21...> | 2023-10-07 21:33 | 392K | |
| rubygem-ffi-1.15.5_1..> | 2023-10-06 12:08 | 89K | |
| rubygem-ffi-compiler..> | 2023-10-06 16:28 | 11K | |
| rubygem-ffi-libarchi..> | 2023-10-07 02:01 | 12K | |
| rubygem-ffi-win32-ex..> | 2023-10-07 01:27 | 8.9K | |
| rubygem-ffi-yajl-2.3..> | 2023-10-06 22:07 | 113K | |
| rubygem-fftw3-0.3.pkg | 2023-10-09 18:12 | 7.0K | |
| rubygem-fiber-annota..> | 2023-10-06 12:17 | 3.9K | |
| rubygem-fiber-local-..> | 2023-10-06 13:16 | 2.1K | |
| rubygem-fiddle-1.1.1..> | 2023-10-06 12:43 | 30K | |
| rubygem-file-tail-1...> | 2023-10-08 13:22 | 16K | |
| rubygem-filesize-0.2..> | 2023-10-07 14:30 | 4.7K | |
| rubygem-fileutils-1...> | 2023-10-07 21:16 | 16K | |
| rubygem-find-0.1.1.pkg | 2023-10-10 06:19 | 4.4K | |
| rubygem-fission-0.5...> | 2023-10-06 16:21 | 38K | |
| rubygem-flamegraph-0..> | 2023-10-14 16:47 | 92K | |
| rubygem-flexmock-2.3..> | 2023-10-09 04:59 | 56K | |
| rubygem-flipper-0.28..> | 2023-10-07 14:17 | 96K | |
| rubygem-flipper-acti..> | 2023-10-10 12:50 | 6.7K | |
| rubygem-flipper-acti..> | 2023-10-09 20:55 | 5.6K | |
| rubygem-flipper-acti..> | 2023-10-07 15:07 | 5.6K | |
| rubygem-flipper-acti..> | 2023-10-14 11:10 | 3.2K | |
| rubygem-flipper-acti..> | 2023-10-09 01:18 | 3.1K | |
| rubygem-flipper-acti..> | 2023-10-08 06:06 | 3.1K | |
| rubygem-flipper-ui-0..> | 2023-10-09 16:29 | 284K | |
| rubygem-flipper025-0..> | 2023-10-07 07:14 | 89K | |
| rubygem-flowdock-0.7..> | 2023-10-07 23:54 | 9.1K | |
| rubygem-fluent-logge..> | 2023-10-08 00:47 | 16K | |
| rubygem-fluent-mixin..> | 2023-10-08 01:00 | 6.3K | |
| rubygem-fluent-plugi..> | 2023-10-09 10:22 | 6.3K | |
| rubygem-fluent-plugi..> | 2023-10-10 17:20 | 6.0K | |
| rubygem-fluent-plugi..> | 2023-10-10 00:11 | 4.1K | |
| rubygem-fluentd-1.16..> | 2023-10-07 07:17 | 727K | |
| rubygem-flvtool2-1.0..> | 2023-10-08 08:42 | 24K | |
| rubygem-fog-2.3.0.pkg | 2023-10-07 06:07 | 397K | |
| rubygem-fog-aliyun-0..> | 2023-10-06 19:04 | 40K | |
| rubygem-fog-atmos-0...> | 2023-10-06 22:28 | 15K | |
| rubygem-fog-aws-3.19..> | 2023-10-06 22:43 | 378K | |
| rubygem-fog-azure-0...> | 2023-10-09 18:52 | 12K | |
| rubygem-fog-brightbo..> | 2023-10-06 19:39 | 75K | |
| rubygem-fog-cloudatc..> | 2023-10-06 20:18 | 8.4K | |
| rubygem-fog-cloudsta..> | 2023-10-06 22:01 | 79K | |
| rubygem-fog-core-2.3..> | 2023-10-06 15:33 | 48K | |
| rubygem-fog-core1-1...> | 2023-10-06 17:20 | 47K | |
| rubygem-fog-core210-..> | 2023-10-06 16:32 | 47K | |
| rubygem-fog-core220-..> | 2023-10-10 06:36 | 48K | |
| rubygem-fog-digitalo..> | 2023-10-06 22:23 | 41K | |
| rubygem-fog-dnsimple..> | 2023-10-06 19:51 | 9.5K | |
| rubygem-fog-dynect-0..> | 2023-10-06 22:47 | 14K | |
| rubygem-fog-ecloud-0..> | 2023-10-06 21:41 | 62K | |
| rubygem-fog-google-1..> | 2023-10-06 19:18 | 138K | |
| rubygem-fog-gridscal..> | 2023-10-10 01:16 | 24K | |
| rubygem-fog-internet..> | 2023-10-06 19:35 | 40K | |
| rubygem-fog-joyent-0..> | 2023-10-08 14:41 | 23K | |
| rubygem-fog-json-1.2..> | 2023-10-06 16:54 | 5.3K | |
| rubygem-fog-local-0...> | 2023-10-06 20:18 | 11K | |
| rubygem-fog-openstac..> | 2023-10-06 22:30 | 210K | |
| rubygem-fog-ovirt-2...> | 2023-10-06 22:05 | 26K | |
| rubygem-fog-powerdns..> | 2023-10-06 19:04 | 8.3K | |
| rubygem-fog-profitbr..> | 2023-10-06 21:16 | 55K | |
| rubygem-fog-rackspac..> | 2023-10-06 18:54 | 197K | |
| rubygem-fog-radosgw-..> | 2023-10-06 22:53 | 11K | |
| rubygem-fog-riakcs-0..> | 2023-10-06 21:13 | 14K | |
| rubygem-fog-sakuracl..> | 2023-10-06 21:49 | 19K | |
| rubygem-fog-serverlo..> | 2023-10-06 21:59 | 13K | |
| rubygem-fog-softlaye..> | 2023-10-06 22:00 | 179K | |
| rubygem-fog-storm_on..> | 2023-10-06 19:37 | 25K | |
| rubygem-fog-terremar..> | 2023-10-06 19:30 | 22K | |
| rubygem-fog-vmfusion..> | 2023-10-06 18:36 | 8.0K | |
| rubygem-fog-voxel-0...> | 2023-10-06 18:58 | 16K | |
| rubygem-fog-vsphere-..> | 2023-10-06 20:14 | 63K | |
| rubygem-fog-xenserve..> | 2023-10-06 22:39 | 87K | |
| rubygem-fog-xml-0.1...> | 2023-10-06 18:04 | 7.9K | |
| rubygem-font-awesome..> | 2023-10-10 09:38 | 481K | |
| rubygem-font-awesome..> | 2023-10-08 16:09 | 481K | |
| rubygem-font-awesome..> | 2023-10-14 09:48 | 481K | |
| rubygem-font-awesome..> | 2023-10-08 17:46 | 481K | |
| rubygem-font-awesome..> | 2023-10-08 12:15 | 481K | |
| rubygem-foreigner-1...> | 2023-10-14 13:19 | 11K | |
| rubygem-foreman-0.87..> | 2023-10-10 05:03 | 64K | |
| rubygem-formatador-1..> | 2023-10-06 12:15 | 8.9K | |
| rubygem-fortune_gem-..> | 2023-10-07 15:18 | 38K | |
| rubygem-forwardable-..> | 2023-10-06 14:48 | 4.0K | |
| rubygem-forwardable-..> | 2023-10-06 18:16 | 3.5K | |
| rubygem-fpm-1.15.1.pkg | 2023-10-14 10:11 | 106K | |
| rubygem-fssm-0.2.10.pkg | 2023-10-12 04:09 | 17K | |
| rubygem-fugit-1.8.1.pkg | 2023-10-07 05:12 | 22K | |
| rubygem-fuubar-2.5.1..> | 2023-10-09 08:13 | 6.5K | |
| rubygem-fuzzy_match-..> | 2023-10-07 05:26 | 103K | |
| rubygem-fuzzyurl-0.9..> | 2023-10-06 13:47 | 5.1K | |
| rubygem-gapic-common..> | 2023-10-06 20:22 | 31K | |
| rubygem-gd2-1.1.1_7.pkg | 2023-10-14 17:38 | 23K | |
| rubygem-gdata-1.1.2.pkg | 2023-10-14 03:21 | 17K | |
| rubygem-gdbm-2.1.0,2..> | 2023-10-07 07:13 | 10K | |
| rubygem-gdk3-4.2.0.pkg | 2023-10-06 22:27 | 29K | |
| rubygem-gdk4-4.2.0.pkg | 2023-10-06 18:48 | 25K | |
| rubygem-gdk_pixbuf2-..> | 2023-10-06 16:37 | 28K | |
| rubygem-gem-compare-..> | 2023-10-09 09:17 | 28K | |
| rubygem-gem_plugin-0..> | 2023-10-08 21:44 | 26K | |
| rubygem-gemcutter-0...> | 2023-10-08 18:15 | 7.6K | |
| rubygem-gemdiff-4.1...> | 2023-10-09 16:38 | 9.9K | |
| rubygem-geminabox-2...> | 2023-10-14 14:29 | 18K | |
| rubygem-gemnasium-pa..> | 2023-10-07 22:02 | 7.5K | |
| rubygem-gemoji-4.1.0..> | 2023-10-07 20:26 | 34K | |
| rubygem-gemoji3-3.0...> | 2023-10-07 04:27 | 62K | |
| rubygem-gemojione-4...> | 2023-10-07 09:54 | 17M | |
| rubygem-gemojione32-..> | 2023-10-08 09:00 | 4.4M | |
| rubygem-gems-1.2.0.pkg | 2023-10-06 20:19 | 7.5K | |
| rubygem-generator-0...> | 2023-10-14 09:43 | 4.5K | |
| rubygem-generator_sp..> | 2023-10-10 21:55 | 7.2K | |
| rubygem-generator_sp..> | 2023-10-14 07:08 | 7.2K | |
| rubygem-geokit-1.14...> | 2023-10-08 09:33 | 78K | |
| rubygem-georuby-2.5...> | 2023-10-08 15:08 | 130K | |
| rubygem-gepub-1.0.15..> | 2023-10-07 16:13 | 32K | |
| rubygem-get_process_..> | 2023-10-08 08:03 | 7.6K | |
| rubygem-getopt-1.6.0..> | 2023-10-11 17:30 | 16K | |
| rubygem-getoptlong-0..> | 2023-10-14 15:36 | 9.9K | |
| rubygem-gettext-3.4...> | 2023-10-06 22:38 | 201K | |
| rubygem-gettext-setu..> | 2023-10-07 09:11 | 14K | |
| rubygem-gettext_i18n..> | 2023-10-07 02:35 | 9.1K | |
| rubygem-gettext_i18n..> | 2023-10-10 05:13 | 10K | |
| rubygem-gettext_i18n..> | 2023-10-07 11:08 | 10K | |
| rubygem-gettext_i18n..> | 2023-10-09 03:26 | 21K | |
| rubygem-gettext_i18n..> | 2023-10-09 16:25 | 21K | |
| rubygem-gettext_i18n..> | 2023-10-09 13:29 | 21K | |
| rubygem-gettext_i18n..> | 2023-10-10 15:35 | 21K | |
| rubygem-gettext_i18n..> | 2023-10-08 07:40 | 21K | |
| rubygem-gh-0.18.0_1.pkg | 2023-10-08 01:01 | 12K | |
| rubygem-gibbler-0.9...> | 2023-10-07 00:52 | 20K | |
| rubygem-gio2-4.2.0.pkg | 2023-10-06 14:16 | 34K | |
| rubygem-git-1.18.0.pkg | 2023-10-06 16:06 | 40K | |
| rubygem-git-version-..> | 2023-10-10 19:08 | 20K | |
| rubygem-gitaly-16.2...> | 2023-10-07 14:50 | 33K | |
| rubygem-gitaly-proto..> | 2023-10-08 20:17 | 16K | |
| rubygem-github-lingu..> | 2023-10-08 02:10 | 2.2M | |
| rubygem-github-marku..> | 2023-10-07 09:51 | 30K | |
| rubygem-github_api-0..> | 2023-10-07 15:24 | 130K | |
| rubygem-gitlab-4.18...> | 2023-10-06 20:24 | 59K | |
| rubygem-gitlab-chron..> | 2023-10-08 08:41 | 37K | |
| rubygem-gitlab-dange..> | 2023-10-08 02:35 | 122K | |
| rubygem-gitlab-derai..> | 2023-10-14 11:10 | 95K | |
| rubygem-gitlab-exper..> | 2023-10-07 16:15 | 29K | |
| rubygem-gitlab-flowd..> | 2023-10-10 12:22 | 7.7K | |
| rubygem-gitlab-fog-a..> | 2023-10-08 06:57 | 52K | |
| rubygem-gitlab-gollu..> | 2023-10-08 12:36 | 41K | |
| rubygem-gitlab-gollu..> | 2023-10-07 14:21 | 7.9K | |
| rubygem-gitlab-grit-..> | 2023-10-07 16:08 | 39K | |
| rubygem-gitlab-labki..> | 2023-10-08 09:52 | 27K | |
| rubygem-gitlab-licen..> | 2023-10-08 08:18 | 8.3K | |
| rubygem-gitlab-licen..> | 2023-10-14 14:53 | 139K | |
| rubygem-gitlab-mail_..> | 2023-10-08 09:13 | 35K | |
| rubygem-gitlab-marku..> | 2023-10-07 19:24 | 33K | |
| rubygem-gitlab-net-d..> | 2023-10-07 21:44 | 46K | |
| rubygem-gitlab-pygme..> | 2023-10-10 06:06 | 1.1M | |
| rubygem-gitlab-sidek..> | 2023-10-14 17:24 | 17K | |
| rubygem-gitlab-turbo..> | 2023-10-11 03:04 | 17K | |
| rubygem-gitlab_chron..> | 2023-10-07 21:38 | 8.2K | |
| rubygem-gitlab_emoji..> | 2023-10-08 12:36 | 3.8K | |
| rubygem-gitlab_git-1..> | 2023-10-10 01:39 | 23K | |
| rubygem-gitlab_meta-..> | 2023-10-09 16:38 | 1.6K | |
| rubygem-gitlab_omnia..> | 2023-10-08 00:34 | 11K | |
| rubygem-glib2-4.2.0.pkg | 2023-10-06 11:45 | 149K | |
| rubygem-globalid-0.4..> | 2023-10-06 18:11 | 9.3K | |
| rubygem-globalid-rai..> | 2023-10-06 18:13 | 9.9K | |
| rubygem-globalid-rai..> | 2023-10-06 17:39 | 9.9K | |
| rubygem-globalid-rai..> | 2023-10-06 16:58 | 9.9K | |
| rubygem-globalid-rai..> | 2023-10-06 13:54 | 9.9K | |
| rubygem-globalid-rai..> | 2023-10-06 14:11 | 11K | |
| rubygem-globalid-rai..> | 2023-10-06 13:37 | 11K | |
| rubygem-gnome-4.2.0.pkg | 2023-10-09 07:44 | 708 | |
| rubygem-gobject-intr..> | 2023-10-06 13:20 | 64K | |
| rubygem-god-0.13.7.pkg | 2023-10-09 04:23 | 80K | |
| rubygem-goldfinger-2..> | 2023-10-08 15:36 | 4.8K | |
| rubygem-gollum-5.3.2..> | 2023-10-10 16:42 | 2.9M | |
| rubygem-gollum-grit_..> | 2023-10-09 16:38 | 4.2K | |
| rubygem-gollum-grit_..> | 2023-10-11 14:08 | 4.2K | |
| rubygem-gollum-lib-5..> | 2023-10-08 05:58 | 44K | |
| rubygem-gollum-rugge..> | 2023-10-07 03:19 | 9.7K | |
| rubygem-gon-rails5-6..> | 2023-10-08 13:28 | 142K | |
| rubygem-gon-rails50-..> | 2023-10-10 23:05 | 142K | |
| rubygem-gon-rails60-..> | 2023-10-09 04:05 | 143K | |
| rubygem-gon-rails61-..> | 2023-10-09 18:38 | 143K | |
| rubygem-gon-rails70-..> | 2023-10-07 22:08 | 143K | |
| rubygem-google-api-c..> | 2023-10-08 09:55 | 3.0M | |
| rubygem-google-apis-..> | 2023-10-14 12:43 | 52K | |
| rubygem-google-apis-..> | 2023-10-08 11:26 | 46K | |
| rubygem-google-apis-..> | 2023-10-08 12:54 | 75K | |
| rubygem-google-apis-..> | 2023-10-08 06:28 | 21K | |
| rubygem-google-apis-..> | 2023-10-07 15:05 | 29K | |
| rubygem-google-apis-..> | 2023-10-09 22:52 | 20K | |
| rubygem-google-apis-..> | 2023-10-10 21:19 | 31K | |
| rubygem-google-apis-..> | 2023-10-06 18:00 | 228K | |
| rubygem-google-apis-..> | 2023-10-08 09:39 | 215K | |
| rubygem-google-apis-..> | 2023-10-07 12:46 | 50K | |
| rubygem-google-apis-..> | 2023-10-07 16:25 | 53K | |
| rubygem-google-apis-..> | 2023-10-06 14:53 | 28K | |
| rubygem-google-apis-..> | 2023-10-06 19:05 | 15K | |
| rubygem-google-apis-..> | 2023-10-06 16:49 | 29K | |
| rubygem-google-apis-..> | 2023-10-09 21:41 | 37K | |
| rubygem-google-apis-..> | 2023-10-06 23:51 | 22K | |
| rubygem-google-apis-..> | 2023-10-08 03:14 | 31K | |
| rubygem-google-apis-..> | 2023-10-10 04:00 | 15K | |
| rubygem-google-apis-..> | 2023-10-08 15:32 | 15K | |
| rubygem-google-apis-..> | 2023-10-06 17:47 | 11K | |
| rubygem-google-apis-..> | 2023-10-06 17:44 | 55K | |
| rubygem-google-apis-..> | 2023-10-10 04:47 | 9.9K | |
| rubygem-google-apis-..> | 2023-10-06 18:26 | 29K | |
| rubygem-google-apis-..> | 2023-10-07 18:51 | 43K | |
| rubygem-google-apis-..> | 2023-10-14 03:46 | 64K | |
| rubygem-google-apis-..> | 2023-10-06 18:11 | 39K | |
| rubygem-google-apis-..> | 2023-10-07 12:10 | 36K | |
| rubygem-google-apis-..> | 2023-10-06 16:09 | 29K | |
| rubygem-google-cloud..> | 2023-10-14 06:11 | 82K | |
| rubygem-google-cloud..> | 2023-10-09 07:41 | 67K | |
| rubygem-google-cloud..> | 2023-10-07 19:16 | 66K | |
| rubygem-google-cloud..> | 2023-10-07 13:02 | 46K | |
| rubygem-google-cloud..> | 2023-10-07 08:07 | 16K | |
| rubygem-google-cloud..> | 2023-10-08 21:08 | 26K | |
| rubygem-google-cloud..> | 2023-10-06 17:46 | 12K | |
| rubygem-google-cloud..> | 2023-10-06 21:55 | 11K | |
| rubygem-google-cloud..> | 2023-10-10 10:03 | 45K | |
| rubygem-google-cloud..> | 2023-10-07 19:33 | 72K | |
| rubygem-google-cloud..> | 2023-10-08 04:28 | 28K | |
| rubygem-google-cloud..> | 2023-10-10 06:25 | 65K | |
| rubygem-google-cloud..> | 2023-10-07 17:58 | 53K | |
| rubygem-google-cloud..> | 2023-10-10 02:17 | 23K | |
| rubygem-google-cloud..> | 2023-10-14 12:43 | 71K | |
| rubygem-google-cloud..> | 2023-10-07 14:14 | 61K | |
| rubygem-google-cloud..> | 2023-10-07 12:52 | 53K | |
| rubygem-google-cloud..> | 2023-10-07 19:16 | 55K | |
| rubygem-google-cloud..> | 2023-10-07 21:20 | 70K | |
| rubygem-google-cloud..> | 2023-10-10 14:55 | 14K | |
| rubygem-google-cloud..> | 2023-10-07 18:53 | 14K | |
| rubygem-google-cloud..> | 2023-10-07 10:39 | 47K | |
| rubygem-google-gax-1..> | 2023-10-08 16:20 | 36K | |
| rubygem-google-iam-c..> | 2023-10-10 18:26 | 9.7K | |
| rubygem-google-iam-c..> | 2023-10-08 02:27 | 28K | |
| rubygem-google-iam-v..> | 2023-10-07 07:33 | 29K | |
| rubygem-google-proto..> | 2023-10-06 11:56 | 115K | |
| rubygem-google-proto..> | 2023-10-07 17:21 | 112K | |
| rubygem-googleapis-c..> | 2023-10-06 16:54 | 3.4K | |
| rubygem-googleapis-c..> | 2023-10-06 13:02 | 77K | |
| rubygem-googleauth-1..> | 2023-10-06 13:16 | 40K | |
| rubygem-gpgme-2.0.23..> | 2023-10-07 19:46 | 3.3M | |
| rubygem-gpgr-0.1.0.pkg | 2023-10-09 06:53 | 7.8K | |
| rubygem-graf-0.0.5.pkg | 2023-10-08 21:54 | 4.1K | |
| rubygem-grape-1.8.0.pkg | 2023-10-06 19:00 | 203K | |
| rubygem-grape-entity..> | 2023-10-07 03:07 | 39K | |
| rubygem-grape-path-h..> | 2023-10-08 06:07 | 13K | |
| rubygem-grape-route-..> | 2023-10-09 03:59 | 11K | |
| rubygem-grape-swagge..> | 2023-10-07 05:31 | 218K | |
| rubygem-grape-swagge..> | 2023-10-08 01:01 | 8.0K | |
| rubygem-grape17-1.7...> | 2023-10-07 21:47 | 203K | |
| rubygem-grape_loggin..> | 2023-10-07 19:30 | 9.8K | |
| rubygem-graphiql-rai..> | 2023-10-07 11:48 | 882K | |
| rubygem-graphlient-0..> | 2023-10-08 01:59 | 137K | |
| rubygem-graphql-1.13..> | 2023-10-06 20:27 | 266K | |
| rubygem-graphql-clie..> | 2023-10-07 03:23 | 22K | |
| rubygem-graphql-docs..> | 2023-10-07 10:37 | 1.1M | |
| rubygem-grpc-1.58.0.pkg | 2023-10-06 14:52 | 146K | |
| rubygem-grpc-google-..> | 2023-10-06 21:57 | 9.4K | |
| rubygem-gruff-0.23.0..> | 2023-10-08 03:53 | 164K | |
| rubygem-gssapi-1.3.1..> | 2023-10-06 13:32 | 14K | |
| rubygem-gstreamer-4...> | 2023-10-07 00:16 | 26K | |
| rubygem-gtk2-3.4.3_2..> | 2023-10-08 07:00 | 497K | |
| rubygem-gtk3-4.2.0.pkg | 2023-10-07 08:47 | 774K | |
| rubygem-gtk4-4.2.0.pkg | 2023-10-06 23:36 | 71K | |
| rubygem-gtksourcevie..> | 2023-10-07 11:43 | 13K | |
| rubygem-gtksourcevie..> | 2023-10-07 20:47 | 13K | |
| rubygem-guard-2.18.0..> | 2023-10-08 01:00 | 54K | |
| rubygem-guard-compat..> | 2023-10-08 03:35 | 8.1K | |
| rubygem-guard-cucumb..> | 2023-10-10 10:03 | 9.5K | |
| rubygem-guard-livere..> | 2023-10-08 12:01 | 19K | |
| rubygem-guard-minite..> | 2023-10-14 04:17 | 8.6K | |
| rubygem-guard-rspec-..> | 2023-10-12 10:28 | 25K | |
| rubygem-guess_html_e..> | 2023-10-07 18:44 | 21K | |
| rubygem-gyoku-1.3.1_..> | 2023-10-06 12:19 | 13K | |
| rubygem-hackpad-cli-..> | 2023-10-09 00:12 | 16K | |
| rubygem-haiti-hash-1..> | 2023-10-10 01:23 | 84K | |
| rubygem-haml-6.1.2.pkg | 2023-10-07 10:34 | 68K | |
| rubygem-haml-coderay..> | 2023-10-10 04:06 | 2.6K | |
| rubygem-haml-contrib..> | 2023-10-11 06:40 | 3.3K | |
| rubygem-haml-rails-r..> | 2023-10-10 15:49 | 10K | |
| rubygem-haml5-5.2.2.pkg | 2023-10-06 23:14 | 76K | |
| rubygem-hamlit-2.15...> | 2023-10-08 09:56 | 59K | |
| rubygem-hamlit-rails..> | 2023-10-09 07:20 | 8.1K | |
| rubygem-hamlit-rails..> | 2023-10-10 15:12 | 8.1K | |
| rubygem-hamlit-rails..> | 2023-10-14 10:30 | 8.1K | |
| rubygem-hamlit-rails..> | 2023-10-14 05:07 | 8.1K | |
| rubygem-hammer_cli-3..> | 2023-10-07 00:51 | 177K | |
| rubygem-hammer_cli_f..> | 2023-10-07 16:18 | 376K | |
| rubygem-hammer_cli_f..> | 2023-10-14 12:28 | 14K | |
| rubygem-hammer_cli_f..> | 2023-10-10 18:17 | 3.5K | |
| rubygem-hammer_cli_f..> | 2023-10-10 05:45 | 3.8K | |
| rubygem-hamster-3.0...> | 2023-10-06 15:09 | 102K | |
| rubygem-hana-1.3.7.pkg | 2023-10-07 02:11 | 9.8K | |
| rubygem-hangouts-cha..> | 2023-10-07 13:32 | 5.0K | |
| rubygem-hashdiff-1.0..> | 2023-10-06 17:56 | 16K | |
| rubygem-hashery-2.1...> | 2023-10-06 11:18 | 36K | |
| rubygem-hashicorp-ch..> | 2023-10-07 12:32 | 9.3K | |
| rubygem-hashie-5.0.0..> | 2023-10-06 14:02 | 44K | |
| rubygem-hashie-forbi..> | 2023-10-09 04:14 | 12K | |
| rubygem-hashie4-4.1...> | 2023-10-06 19:54 | 42K | |
| rubygem-haversine_di..> | 2023-10-08 13:02 | 3.3K | |
| rubygem-health_check..> | 2023-10-10 13:46 | 29K | |
| rubygem-health_check..> | 2023-10-08 11:21 | 29K | |
| rubygem-heapy-0.2.0.pkg | 2023-10-08 04:29 | 9.2K | |
| rubygem-her-1.1.1_1.pkg | 2023-10-14 13:50 | 47K | |
| rubygem-heredoc_unin..> | 2023-10-08 04:48 | 6.6K | |
| rubygem-heroics-0.1...> | 2023-10-08 06:16 | 16K | |
| rubygem-heroku-api-0..> | 2023-10-14 06:41 | 35K | |
| rubygem-heroku-nav-0..> | 2023-10-09 20:55 | 9.4K | |
| rubygem-hiera-3.12.0..> | 2023-10-06 21:52 | 35K | |
| rubygem-hiera-eyaml-..> | 2023-10-08 02:34 | 33K | |
| rubygem-hiera-file-1..> | 2023-10-10 20:31 | 2.6K | |
| rubygem-hieracles-0...> | 2023-10-08 16:51 | 40K | |
| rubygem-highline-2.1..> | 2023-10-06 20:46 | 201K | |
| rubygem-highline1-1...> | 2023-10-07 03:25 | 206K | |
| rubygem-hike-2.1.3,1..> | 2023-10-09 12:22 | 6.2K | |
| rubygem-hike1-1.2.3,..> | 2023-10-07 06:01 | 6.2K | |
| rubygem-hikidoc-0.1...> | 2023-10-07 00:09 | 17K | |
| rubygem-hipchat-1.6...> | 2023-10-07 13:24 | 22K | |
| rubygem-hiredis-0.6...> | 2023-10-08 15:43 | 137K | |
| rubygem-histogram-0...> | 2023-10-07 04:53 | 12K | |
| rubygem-hitimes-2.0...> | 2023-10-08 06:53 | 22K | |
| rubygem-hkdf-1.0.0.pkg | 2023-10-08 18:53 | 6.0K | |
| rubygem-hkdf0-0.3.0.pkg | 2023-10-08 00:07 | 5.4K | |
| rubygem-hocon-1.4.0.pkg | 2023-10-06 17:03 | 88K | |
| rubygem-hoe-3.26.0.pkg | 2023-10-07 20:46 | 175K | |
| rubygem-holidays-8.6..> | 2023-10-11 14:54 | 103K | |
| rubygem-hpricot-0.8...> | 2023-10-05 17:43 | 233K | |
| rubygem-hrr_rb_ssh-0..> | 2023-10-07 02:45 | 53K | |
| rubygem-hrr_rb_ssh-e..> | 2023-10-07 18:38 | 10K | |
| rubygem-html-pipelin..> | 2023-10-06 22:11 | 30K | |
| rubygem-html-proofer..> | 2023-10-09 10:22 | 20K | |
| rubygem-html2haml-2...> | 2023-10-07 23:46 | 17K | |
| rubygem-html2text-0...> | 2023-10-07 18:48 | 14K | |
| rubygem-htmlentities..> | 2023-10-06 22:00 | 23K | |
| rubygem-http-5.1.1_1..> | 2023-10-07 01:20 | 70K | |
| rubygem-http-accept-..> | 2023-10-06 13:36 | 7.5K | |
| rubygem-http-cookie-..> | 2023-10-06 13:25 | 32K | |
| rubygem-http-form_da..> | 2023-10-06 19:02 | 14K | |
| rubygem-http-parser-..> | 2023-10-06 20:48 | 20K | |
| rubygem-http3-3.3.0_..> | 2023-10-08 05:43 | 60K | |
| rubygem-http4-4.4.1.pkg | 2023-10-07 06:14 | 64K | |
| rubygem-http_accept_..> | 2023-10-09 09:51 | 7.8K | |
| rubygem-http_parser...> | 2023-10-06 16:51 | 28K | |
| rubygem-http_router-..> | 2023-10-07 04:18 | 146K | |
| rubygem-httparty-0.2..> | 2023-10-06 18:14 | 41K | |
| rubygem-httparty020-..> | 2023-10-07 10:29 | 40K | |
| rubygem-httpauth-0.2..> | 2023-10-09 15:46 | 11K | |
| rubygem-httpclient-2..> | 2023-10-06 12:44 | 229K | |
| rubygem-httpi-2.4.2.pkg | 2023-10-06 23:18 | 37K | |
| rubygem-httplog-1.6...> | 2023-10-09 11:37 | 12K | |
| rubygem-hurley-0.2.pkg | 2023-10-10 02:10 | 27K | |
| rubygem-i18n-1.14.1,..> | 2023-10-06 09:22 | 38K | |
| rubygem-i18n-tasks-r..> | 2023-10-08 22:46 | 57K | |
| rubygem-i18n_data-0...> | 2023-10-07 05:38 | 203K | |
| rubygem-icalendar-2...> | 2023-10-07 14:28 | 37K | |
| rubygem-ice_cube-0.1..> | 2023-10-07 02:23 | 28K | |
| rubygem-ice_nine-0.1..> | 2023-10-06 12:23 | 16K | |
| rubygem-iconv-1.0.8.pkg | 2023-10-10 06:43 | 16K | |
| rubygem-idn-ruby-0.1..> | 2023-10-06 18:33 | 15K | |
| rubygem-iesd-1.2.2.pkg | 2023-10-10 15:19 | 9.9K | |
| rubygem-image_proces..> | 2023-10-06 22:59 | 13K | |
| rubygem-image_scienc..> | 2023-10-14 16:54 | 13K | |
| rubygem-imagesize-0...> | 2023-10-08 12:10 | 73K | |
| rubygem-importmap-ra..> | 2023-10-06 22:05 | 52K | |
| rubygem-inflecto-0.0..> | 2023-10-07 17:47 | 14K | |
| rubygem-influxdb-0.8..> | 2023-10-09 14:25 | 38K | |
| rubygem-ini-0.1.1.pkg | 2023-10-11 00:57 | 6.7K | |
| rubygem-inifile-3.0...> | 2023-10-08 07:21 | 14K | |
| rubygem-iniparse-1.5..> | 2023-10-07 08:49 | 12K | |
| rubygem-innate-2015...> | 2023-10-07 10:22 | 92K | |
| rubygem-insist-1.0.0..> | 2023-10-06 23:57 | 7.9K | |
| rubygem-inspec-core-..> | 2023-10-07 03:17 | 354K | |
| rubygem-instance_sto..> | 2023-10-07 07:14 | 3.8K | |
| rubygem-interact-0.5..> | 2023-10-10 09:53 | 8.3K | |
| rubygem-interfacez-1..> | 2023-10-07 18:29 | 6.2K | |
| rubygem-invisible_ca..> | 2023-10-08 02:40 | 22K | |
| rubygem-io-console-0..> | 2023-10-06 21:03 | 11K | |
| rubygem-io-event-1.3..> | 2023-10-06 14:18 | 16K | |
| rubygem-io-like-0.3...> | 2023-10-06 17:46 | 342K | |
| rubygem-io-nonblock-..> | 2023-10-09 10:12 | 4.6K | |
| rubygem-io-wait-0.3...> | 2023-10-09 12:40 | 5.9K | |
| rubygem-io-wait01-0...> | 2023-10-10 16:21 | 3.5K | |
| rubygem-iobuffer-1.1..> | 2023-10-06 16:33 | 7.0K | |
| rubygem-iostruct-0.0..> | 2023-10-07 03:32 | 4.4K | |
| rubygem-ipaddr-1.2.5..> | 2023-10-08 07:01 | 7.5K | |
| rubygem-ipaddress-0...> | 2023-10-06 17:40 | 30K | |
| rubygem-iproto-0.3.1..> | 2023-10-07 22:07 | 6.2K | |
| rubygem-ipynbdiff-0...> | 2023-10-10 10:56 | 7.3K | |
| rubygem-irb-1.8.1.pkg | 2023-10-08 00:05 | 70K | |
| rubygem-iso-639-0.3...> | 2023-10-10 23:26 | 13K | |
| rubygem-iso8601-0.13..> | 2023-10-14 07:06 | 21K | |
| rubygem-itamae-1.10...> | 2023-10-09 14:42 | 37K | |
| rubygem-itextomml-1...> | 2023-10-09 01:28 | 58K | |
| rubygem-jaeger-clien..> | 2023-10-07 03:56 | 30K | |
| rubygem-jammit-0.7.0..> | 2023-10-10 15:18 | 16K | |
| rubygem-jaro_winkler..> | 2023-10-09 05:04 | 9.4K | |
| rubygem-jasmine-core..> | 2023-10-09 07:08 | 73K | |
| rubygem-jbuilder-2.9..> | 2023-10-07 07:25 | 23K | |
| rubygem-jbuilder-rai..> | 2023-10-07 07:30 | 23K | |
| rubygem-jbuilder-rai..> | 2023-10-07 03:29 | 23K | |
| rubygem-jbuilder-rai..> | 2023-10-07 03:28 | 23K | |
| rubygem-jbuilder-rai..> | 2023-10-07 07:40 | 23K | |
| rubygem-jbuilder-rai..> | 2023-10-07 08:14 | 23K | |
| rubygem-jdbc-mysql-5..> | 2023-10-08 11:25 | 934K | |
| rubygem-jekyll-4.3.2..> | 2023-10-07 01:33 | 106K | |
| rubygem-jekyll-archi..> | 2023-10-09 12:09 | 3.3K | |
| rubygem-jekyll-asset..> | 2023-10-14 09:12 | 30K | |
| rubygem-jekyll-coffe..> | 2023-10-10 00:05 | 1.5K | |
| rubygem-jekyll-email..> | 2023-10-11 03:27 | 3.5K | |
| rubygem-jekyll-feed-..> | 2023-10-07 17:53 | 9.9K | |
| rubygem-jekyll-gist-..> | 2023-10-09 12:56 | 8.6K | |
| rubygem-jekyll-menti..> | 2023-10-08 14:05 | 2.5K | |
| rubygem-jekyll-pagin..> | 2023-10-10 16:10 | 8.1K | |
| rubygem-jekyll-redir..> | 2023-10-11 11:27 | 14K | |
| rubygem-jekyll-sanit..> | 2023-10-08 02:22 | 2.6K | |
| rubygem-jekyll-sass-..> | 2023-10-06 20:54 | 4.7K | |
| rubygem-jekyll-sass-..> | 2023-10-06 21:14 | 2.4K | |
| rubygem-jekyll-seo-t..> | 2023-10-08 09:20 | 18K | |
| rubygem-jekyll-sitem..> | 2023-10-10 06:06 | 67K | |
| rubygem-jekyll-watch..> | 2023-10-06 20:28 | 2.9K | |
| rubygem-jekyll3-3.9...> | 2023-10-07 03:47 | 96K | |
| rubygem-jemoji-0.13...> | 2023-10-10 09:18 | 2.3K | |
| rubygem-jenkins_api_..> | 2023-10-09 23:43 | 563K | |
| rubygem-jeweler-2.3...> | 2023-10-09 06:42 | 51K | |
| rubygem-jira-ruby-2...> | 2023-10-09 13:10 | 57K | |
| rubygem-jira-ruby21-..> | 2023-10-08 09:14 | 55K | |
| rubygem-jmespath-1.6..> | 2023-10-06 15:36 | 17K | |
| rubygem-journey-1.0...> | 2023-10-14 08:46 | 24K | |
| rubygem-jquery-atwho..> | 2023-10-10 11:47 | 16K | |
| rubygem-jquery-rails..> | 2023-10-07 03:19 | 280K | |
| rubygem-jquery-rails..> | 2023-10-07 08:48 | 280K | |
| rubygem-jquery-rails..> | 2023-10-07 03:40 | 280K | |
| rubygem-jquery-scrol..> | 2023-10-09 00:03 | 5.9K | |
| rubygem-jquery-turbo..> | 2023-10-10 04:08 | 7.6K | |
| rubygem-jquery-ui-ra..> | 2023-10-14 06:08 | 142K | |
| rubygem-jquery-ui-th..> | 2023-10-11 04:12 | 303K | |
| rubygem-jruby-jars-9..> | 2023-10-07 14:42 | 25M | |
| rubygem-jruby-rack-1..> | 2023-10-07 21:32 | 257K | |
| rubygem-js_regex-3.1..> | 2023-10-08 05:58 | 13K | |
| rubygem-jsbundling-r..> | 2023-10-06 20:28 | 6.6K | |
| rubygem-jsmin-1.0.1_..> | 2023-10-08 07:44 | 3.0K | |
| rubygem-jsobfu-0.4.2..> | 2023-10-07 08:31 | 21K | |
| rubygem-json-2.6.3.pkg | 2023-10-06 14:00 | 51K | |
| rubygem-json-canonic..> | 2023-10-07 04:09 | 7.1K | |
| rubygem-json-jwt-1.1..> | 2023-10-06 16:38 | 11K | |
| rubygem-json-jwt115-..> | 2023-10-06 19:31 | 11K | |
| rubygem-json-ld-3.3...> | 2023-10-07 11:51 | 74K | |
| rubygem-json-ld-prel..> | 2023-10-09 04:05 | 97K | |
| rubygem-json-schema-..> | 2023-10-08 07:54 | 28K | |
| rubygem-json1-1.8.6.pkg | 2023-10-07 05:19 | 107K | |
| rubygem-json_pure-2...> | 2023-10-06 09:29 | 31K | |
| rubygem-json_pure1-1..> | 2023-10-07 09:44 | 87K | |
| rubygem-json_schema-..> | 2023-10-06 15:13 | 30K | |
| rubygem-json_schemer..> | 2023-10-07 16:18 | 11K | |
| rubygem-jsonapi-rend..> | 2023-10-07 21:22 | 5.4K | |
| rubygem-jsonb_access..> | 2023-10-07 19:33 | 15K | |
| rubygem-jsonpath-1.1..> | 2023-10-07 01:47 | 18K | |
| rubygem-jwt-2.7.1.pkg | 2023-10-06 10:45 | 36K | |
| rubygem-kafo-7.1.0.pkg | 2023-10-12 12:19 | 216K | |
| rubygem-kafo_parsers..> | 2023-10-07 13:40 | 6.9K | |
| rubygem-kafo_wizards..> | 2023-10-07 15:38 | 7.3K | |
| rubygem-kaminari-1.2..> | 2023-10-14 02:55 | 19K | |
| rubygem-kaminari-act..> | 2023-10-08 07:41 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-08 05:24 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-08 08:24 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-07 17:04 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-08 09:38 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-08 09:02 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-07 08:35 | 2.9K | |
| rubygem-kaminari-act..> | 2023-10-08 01:38 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-07 20:51 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-08 06:49 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-07 20:22 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-08 04:32 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-08 11:22 | 4.7K | |
| rubygem-kaminari-act..> | 2023-10-07 02:45 | 4.7K | |
| rubygem-kaminari-cor..> | 2023-10-06 23:11 | 14K | |
| rubygem-kaminari-rai..> | 2023-10-09 17:49 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-14 06:11 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-11 04:07 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-09 23:59 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-08 19:17 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-08 21:24 | 19K | |
| rubygem-kaminari-rai..> | 2023-10-07 10:46 | 19K | |
| rubygem-kas-grpc-0.2..> | 2023-10-07 16:14 | 3.1K | |
| rubygem-kgio-2.11.4.pkg | 2023-10-07 00:14 | 48K | |
| rubygem-kramdown-2.4..> | 2023-10-06 13:58 | 115K | |
| rubygem-kramdown-par..> | 2023-10-06 16:09 | 9.3K | |
| rubygem-kramdown1-1...> | 2023-10-08 22:53 | 236K | |
| rubygem-kramdown23-2..> | 2023-10-07 22:59 | 115K | |
| rubygem-kt-paperclip..> | 2023-10-10 17:56 | 229K | |
| rubygem-kubeclient-4..> | 2023-10-07 11:36 | 30K | |
| rubygem-kwalify-0.7...> | 2023-10-09 20:41 | 135K | |
| rubygem-language_ser..> | 2023-10-06 17:15 | 67K | |
| rubygem-launchy-2.5...> | 2023-10-07 10:30 | 25K | |
| rubygem-layout_yulli..> | 2023-10-14 05:07 | 45K | |
| rubygem-lazy_priorit..> | 2023-10-09 07:19 | 2.2K | |
| rubygem-leo_manager_..> | 2023-10-07 17:23 | 12K | |
| rubygem-less-1.2.21.pkg | 2023-10-10 04:37 | 46K | |
| rubygem-libarchive-0..> | 2023-10-10 13:51 | 24K | |
| rubygem-libdatadog-3..> | 2023-10-07 13:41 | 2.3M | |
| rubygem-libddprof-0...> | 2023-10-09 15:15 | 2.7M | |
| rubygem-libddwaf-1.1..> | 2023-10-08 01:13 | 19K | |
| rubygem-librarian-0...> | 2023-10-14 09:45 | 41K | |
| rubygem-librarian-pu..> | 2023-10-09 03:44 | 18K | |
| rubygem-librarianp-1..> | 2023-10-08 00:37 | 46K | |
| rubygem-librmpd-0.1...> | 2023-10-10 21:30 | 32K | |
| rubygem-libxml-ruby-..> | 2023-10-06 19:07 | 282K | |
| rubygem-libyajl2-1.2..> | 2023-10-06 16:25 | 30K | |
| rubygem-license-acce..> | 2023-10-06 21:58 | 12K | |
| rubygem-license_find..> | 2023-10-07 16:30 | 142K | |
| rubygem-license_scou..> | 2023-10-08 02:51 | 1.6M | |
| rubygem-licensee-9.1..> | 2023-10-07 09:53 | 198K | |
| rubygem-lighthouse-a..> | 2023-10-08 16:42 | 6.1K | |
| rubygem-linguistics-..> | 2023-10-10 04:50 | 92K | |
| rubygem-link_header-..> | 2023-10-06 21:33 | 5.3K | |
| rubygem-liquid-5.4.0..> | 2023-10-10 12:44 | 42K | |
| rubygem-liquid-tag-p..> | 2023-10-11 00:20 | 3.4K | |
| rubygem-liquid-tag-p..> | 2023-10-08 09:34 | 3.7K | |
| rubygem-liquid4-4.0...> | 2023-10-06 22:01 | 64K | |
| rubygem-listen-3.8.0..> | 2023-10-06 16:28 | 26K | |
| rubygem-lita-4.8.0_1..> | 2023-10-08 07:45 | 56K | |
| rubygem-lita-gems-1...> | 2023-10-14 02:44 | 3.8K | |
| rubygem-lita-irc-2.2..> | 2023-10-10 22:54 | 7.0K | |
| rubygem-little-plugg..> | 2023-10-06 11:34 | 6.7K | |
| rubygem-llhttp-ffi-0..> | 2023-10-06 22:34 | 29K | |
| rubygem-local_time-2..> | 2023-10-10 07:36 | 21K | |
| rubygem-local_time-r..> | 2023-10-14 04:40 | 21K | |
| rubygem-locale-2.1.3..> | 2023-10-06 15:48 | 94K | |
| rubygem-lockbox-1.1...> | 2023-10-08 04:29 | 24K | |
| rubygem-lockfile-2.1..> | 2023-10-09 12:43 | 17K | |
| rubygem-log4r-1.1.10..> | 2023-10-07 01:05 | 105K | |
| rubygem-loggability-..> | 2023-10-07 20:07 | 31K | |
| rubygem-logger-1.5.3..> | 2023-10-09 15:45 | 9.4K | |
| rubygem-logging-2.3...> | 2023-10-06 13:06 | 73K | |
| rubygem-logify-0.2.0..> | 2023-10-14 07:39 | 10K | |
| rubygem-lograge-0.13..> | 2023-10-08 21:45 | 8.5K | |
| rubygem-lograge-rail..> | 2023-10-14 18:41 | 8.5K | |
| rubygem-lograge-rail..> | 2023-10-14 06:02 | 8.5K | |
| rubygem-lograge-rail..> | 2023-10-11 00:44 | 8.5K | |
| rubygem-lograge-rail..> | 2023-10-09 13:01 | 8.5K | |
| rubygem-lograge-rail..> | 2023-10-08 10:30 | 8.5K | |
| rubygem-logster-1.2...> | 2023-10-14 17:27 | 1.0M | |
| rubygem-lolcat-100.0..> | 2023-10-09 13:23 | 114K | |
| rubygem-loofah-2.21...> | 2023-10-06 10:42 | 26K | |
| rubygem-loquacious-1..> | 2023-10-07 09:32 | 18K | |
| rubygem-lru_redux-1...> | 2023-10-08 07:56 | 8.7K | |
| rubygem-ltsv-0.1.0.pkg | 2023-10-07 01:42 | 5.5K | |
| rubygem-lumberjack-1..> | 2023-10-07 08:16 | 26K | |
| rubygem-macaddr-1.7...> | 2023-10-07 06:00 | 8.1K | |
| rubygem-mail-2.8.1,2..> | 2023-10-06 16:32 | 230K | |
| rubygem-mail_room-0...> | 2023-10-10 06:09 | 21K | |
| rubygem-mailboxer-0...> | 2023-10-09 21:32 | 35K | |
| rubygem-mailfactory-..> | 2023-10-14 10:16 | 6.8K | |
| rubygem-main-6.3.0.pkg | 2023-10-07 23:13 | 34K | |
| rubygem-makara61-0.5..> | 2023-10-10 04:15 | 40K | |
| rubygem-manpages-0.6..> | 2023-10-07 18:35 | 11K | |
| rubygem-map-6.6.0.pkg | 2023-10-07 07:15 | 19K | |
| rubygem-marcel-1.0.2..> | 2023-10-06 14:07 | 35K | |
| rubygem-marginalia-1..> | 2023-10-07 23:01 | 11K | |
| rubygem-mario-redis-..> | 2023-10-14 13:16 | 10K | |
| rubygem-markaby-0.9...> | 2023-10-09 13:35 | 19K | |
| rubygem-maruku-0.7.3..> | 2023-10-09 17:40 | 120K | |
| rubygem-mathn-0.1.0.pkg | 2023-10-08 06:43 | 6.5K | |
| rubygem-matrix-0.4.2..> | 2023-10-06 10:50 | 21K | |
| rubygem-maxmind-db-1..> | 2023-10-14 08:10 | 118K | |
| rubygem-mdl-0.11.0_2..> | 2023-10-08 21:14 | 14K | |
| rubygem-mechanize-2...> | 2023-10-08 10:11 | 119K | |
| rubygem-memcache-1.5..> | 2023-10-14 11:32 | 27K | |
| rubygem-memcache-cli..> | 2023-10-10 09:00 | 26K | |
| rubygem-memo_wise-1...> | 2023-10-06 15:35 | 156K | |
| rubygem-memoist-0.16..> | 2023-10-07 21:11 | 9.7K | |
| rubygem-memoizable-0..> | 2023-10-07 08:12 | 10K | |
| rubygem-memoize-1.3...> | 2023-10-08 22:00 | 4.9K | |
| rubygem-memory_profi..> | 2023-10-07 01:00 | 12K | |
| rubygem-merb-assets-..> | 2023-10-14 08:06 | 27K | |
| rubygem-merb-core-1...> | 2023-10-07 21:10 | 1.0M | |
| rubygem-merb-haml-1...> | 2023-10-10 19:38 | 7.3K | |
| rubygem-merb-helpers..> | 2023-10-14 12:47 | 60K | |
| rubygem-merb-param-p..> | 2023-10-10 21:30 | 5.9K | |
| rubygem-mercenary-0...> | 2023-10-06 22:49 | 14K | |
| rubygem-message_bus-..> | 2023-10-09 02:23 | 152K | |
| rubygem-metaclass-0...> | 2023-10-08 17:30 | 3.1K | |
| rubygem-metaid-1.0.pkg | 2023-10-11 17:51 | 1.2K | |
| rubygem-metasm-1.0.5..> | 2023-10-06 18:46 | 609K | |
| rubygem-metasploit-a..> | 2023-10-10 08:02 | 23K | |
| rubygem-metasploit-c..> | 2023-10-06 22:54 | 12K | |
| rubygem-metasploit-c..> | 2023-10-07 10:54 | 93K | |
| rubygem-metasploit-m..> | 2023-10-06 19:41 | 70K | |
| rubygem-metasploit-p..> | 2023-10-08 09:39 | 7.7M | |
| rubygem-metasploit_d..> | 2023-10-07 05:57 | 152K | |
| rubygem-metasploit_p..> | 2023-10-08 10:17 | 6.9M | |
| rubygem-method_sourc..> | 2023-10-06 15:16 | 10K | |
| rubygem-micromachine..> | 2023-10-07 17:42 | 6.1K | |
| rubygem-middleware-0..> | 2023-10-08 05:58 | 8.3K | |
| rubygem-mime-types-3..> | 2023-10-06 13:29 | 31K | |
| rubygem-mime-types-d..> | 2023-10-06 11:55 | 136K | |
| rubygem-mimemagic-0...> | 2023-10-07 05:07 | 7.6K | |
| rubygem-mini_histogr..> | 2023-10-08 03:07 | 14K | |
| rubygem-mini_magick-..> | 2023-10-06 18:02 | 15K | |
| rubygem-mini_magick4..> | 2023-10-08 09:43 | 15K | |
| rubygem-mini_mime-1...> | 2023-10-06 12:36 | 21K | |
| rubygem-mini_portile..> | 2023-10-06 09:27 | 25K | |
| rubygem-mini_portile..> | 2023-10-09 20:18 | 22K | |
| rubygem-minima-2.5.1..> | 2023-10-08 23:48 | 16K | |
| rubygem-minitar-0.9.pkg | 2023-10-06 18:37 | 27K | |
| rubygem-minitar-cli-..> | 2023-10-08 10:33 | 14K | |
| rubygem-minitest-5.2..> | 2023-10-06 09:21 | 74K | |
| rubygem-mixlib-archi..> | 2023-10-07 01:28 | 7.4K | |
| rubygem-mixlib-authe..> | 2023-10-06 23:23 | 12K | |
| rubygem-mixlib-cli-2..> | 2023-10-06 19:33 | 10K | |
| rubygem-mixlib-confi..> | 2023-10-06 15:19 | 10K | |
| rubygem-mixlib-insta..> | 2023-10-09 10:02 | 34K | |
| rubygem-mixlib-log-3..> | 2023-10-06 19:01 | 8.6K | |
| rubygem-mixlib-shell..> | 2023-10-06 13:59 | 22K | |
| rubygem-mixlib-versi..> | 2023-10-08 03:51 | 11K | |
| rubygem-mize-0.4.1.pkg | 2023-10-07 03:50 | 7.5K | |
| rubygem-mkrf-0.2.3.pkg | 2023-10-08 14:09 | 257K | |
| rubygem-mmap2-2.2.9_..> | 2023-10-09 13:52 | 20K | |
| rubygem-mocha-2.1.0.pkg | 2023-10-08 05:58 | 56K | |
| rubygem-mogilefs-cli..> | 2023-10-08 13:15 | 68K | |
| rubygem-molinillo-0...> | 2023-10-07 08:14 | 24K | |
| rubygem-moneta-1.6.0..> | 2023-10-07 09:11 | 66K | |
| rubygem-money-6.14.1..> | 2023-10-09 01:05 | 41K | |
| rubygem-mongo-2.19.1..> | 2023-10-08 06:57 | 943K | |
| rubygem-mono_logger-..> | 2023-10-07 09:28 | 6.9K | |
| rubygem-mothra-0.0.3..> | 2023-10-10 23:50 | 5.5K | |
| rubygem-mousetrap-ra..> | 2023-10-14 17:49 | 29K | |
| rubygem-mqtt-0.6.0.pkg | 2023-10-07 18:52 | 32K | |
| rubygem-ms_rest-0.7...> | 2023-10-06 20:29 | 143K | |
| rubygem-ms_rest_azur..> | 2023-10-07 01:07 | 16K | |
| rubygem-msgpack-1.7...> | 2023-10-06 18:25 | 39K | |
| rubygem-mspec-1.9.1.pkg | 2023-10-14 12:07 | 100K | |
| rubygem-mtrc-0.0.4.pkg | 2023-10-06 19:28 | 3.7K | |
| rubygem-multi_json-1..> | 2023-10-06 10:27 | 17K | |
| rubygem-multi_json11..> | 2023-10-08 08:01 | 17K | |
| rubygem-multi_test-1..> | 2023-10-07 05:56 | 6.0K | |
| rubygem-multi_xml-0...> | 2023-10-06 14:25 | 11K | |
| rubygem-multipart-po..> | 2023-10-06 10:24 | 9.1K | |
| rubygem-murder-0.1.2..> | 2023-10-10 05:27 | 90K | |
| rubygem-murmurhash3-..> | 2023-10-07 07:34 | 8.4K | |
| rubygem-mustache-1.1..> | 2023-10-05 17:41 | 37K | |
| rubygem-mustache-sin..> | 2023-10-08 00:16 | 6.7K | |
| rubygem-mustache0-0...> | 2023-10-10 22:04 | 38K | |
| rubygem-mustermann-3..> | 2023-10-06 13:39 | 42K | |
| rubygem-mustermann-g..> | 2023-10-06 16:48 | 7.1K | |
| rubygem-mutex_m-0.1...> | 2023-10-08 20:43 | 3.5K | |
| rubygem-mutter-0.5.3..> | 2023-10-07 19:02 | 8.2K | |
| rubygem-mysql2-0.5.5..> | 2023-10-07 20:44 | 68K | |
| rubygem-nakayoshi_fo..> | 2023-10-09 17:53 | 4.3K | |
| rubygem-nanoc-4.12.1..> | 2023-10-10 06:36 | 55K | |
| rubygem-nanoc-checki..> | 2023-10-07 02:34 | 7.9K | |
| rubygem-nanoc-cli-4...> | 2023-10-06 22:36 | 19K | |
| rubygem-nanoc-core-4..> | 2023-10-06 18:00 | 52K | |
| rubygem-nanoc-deploy..> | 2023-10-07 12:48 | 6.4K | |
| rubygem-nap-1.1.0.pkg | 2023-10-06 15:04 | 140K | |
| rubygem-narray-0.6.1..> | 2023-10-07 04:48 | 132K | |
| rubygem-narray_miss-..> | 2023-10-07 20:12 | 12K | |
| rubygem-native-packa..> | 2023-10-06 10:49 | 19K | |
| rubygem-nats-pure-0...> | 2023-10-08 04:57 | 15K | |
| rubygem-naught-1.1.0..> | 2023-10-07 09:27 | 16K | |
| rubygem-necromancer-..> | 2023-10-10 06:29 | 12K | |
| rubygem-needle-1.3.0..> | 2023-10-08 20:07 | 579K | |
| rubygem-neighbor-0.2..> | 2023-10-08 09:23 | 7.2K | |
| rubygem-nenv-0.3.0.pkg | 2023-10-06 18:35 | 6.7K | |
| rubygem-neovim-0.9.1..> | 2023-10-08 15:39 | 40K | |
| rubygem-nessus_rest-..> | 2023-10-08 07:31 | 8.4K | |
| rubygem-nested_form-..> | 2023-10-11 18:21 | 116K | |
| rubygem-nesty-1.0.2.pkg | 2023-10-08 06:58 | 5.9K | |
| rubygem-net-dns-0.9...> | 2023-10-12 12:19 | 46K | |
| rubygem-net-ftp-0.2...> | 2023-10-07 09:28 | 13K | |
| rubygem-net-http-0.3..> | 2023-10-09 20:33 | 39K | |
| rubygem-net-http-dig..> | 2023-10-07 07:33 | 6.9K | |
| rubygem-net-http-per..> | 2023-10-06 18:11 | 21K | |
| rubygem-net-http-per..> | 2023-10-07 03:36 | 22K | |
| rubygem-net-http-pip..> | 2023-10-07 09:46 | 8.1K | |
| rubygem-net-http011-..> | 2023-10-08 11:35 | 29K | |
| rubygem-net-imap-0.3..> | 2023-10-06 14:06 | 61K | |
| rubygem-net-irc-0.0...> | 2023-10-09 16:50 | 49K | |
| rubygem-net-ldap-0.1..> | 2023-10-07 02:52 | 56K | |
| rubygem-net-ldap017-..> | 2023-10-08 05:23 | 55K | |
| rubygem-net-netrc-0...> | 2023-10-10 17:32 | 4.8K | |
| rubygem-net-ntp-2.1...> | 2023-10-07 19:40 | 4.6K | |
| rubygem-net-ping-2.0..> | 2023-10-10 08:18 | 23K | |
| rubygem-net-pop-0.1...> | 2023-10-06 14:08 | 9.8K | |
| rubygem-net-protocol..> | 2023-10-06 13:24 | 6.6K | |
| rubygem-net-protocol..> | 2023-10-08 09:30 | 6.5K | |
| rubygem-net-scp-4.0...> | 2023-10-06 16:08 | 22K | |
| rubygem-net-scp1-1.2..> | 2023-10-08 03:48 | 24K | |
| rubygem-net-sftp-4.0..> | 2023-10-07 07:15 | 42K | |
| rubygem-net-sftp2-2...> | 2023-10-09 17:48 | 53K | |
| rubygem-net-smtp-0.3..> | 2023-10-06 14:51 | 11K | |
| rubygem-net-ssh-7.2...> | 2023-10-06 18:26 | 113K | |
| rubygem-net-ssh-gate..> | 2023-10-07 00:35 | 7.2K | |
| rubygem-net-ssh-krb-..> | 2023-10-07 17:25 | 9.5K | |
| rubygem-net-ssh-mult..> | 2023-10-07 19:13 | 24K | |
| rubygem-net-ssh5-5.2..> | 2023-10-09 18:37 | 106K | |
| rubygem-net-ssh6-6.1..> | 2023-10-06 14:15 | 108K | |
| rubygem-net-telnet-0..> | 2023-10-07 09:50 | 12K | |
| rubygem-netaddr-2.0...> | 2023-10-08 20:21 | 17K | |
| rubygem-netrc-0.11.0..> | 2023-10-06 12:16 | 7.4K | |
| rubygem-network_inte..> | 2023-10-08 10:29 | 8.8K | |
| rubygem-newrelic-gra..> | 2023-10-09 19:32 | 11K | |
| rubygem-newrelic_rpm..> | 2023-10-07 22:49 | 266K | |
| rubygem-nexpose-7.3...> | 2023-10-07 20:13 | 99K | |
| rubygem-nice-ffi-0.4..> | 2023-10-08 14:49 | 19K | |
| rubygem-nicovideo-0...> | 2023-10-10 18:24 | 13K | |
| rubygem-nio4r-2.5.9.pkg | 2023-10-06 16:40 | 45K | |
| rubygem-nkf-0.1.3.pkg | 2023-10-09 18:31 | 111K | |
| rubygem-nmap-parser-..> | 2023-10-08 19:33 | 17K | |
| rubygem-no_proxy_fix..> | 2023-10-06 17:42 | 5.8K | |
| rubygem-nokogiri-1.1..> | 2023-10-06 10:00 | 369K | |
| rubygem-nokogiri-dif..> | 2023-10-08 22:44 | 5.9K | |
| rubygem-nokogiri111-..> | 2023-10-07 13:26 | 126K | |
| rubygem-nokogumbo-2...> | 2023-10-14 12:40 | 243K | |
| rubygem-nori-2.6.0.pkg | 2023-10-06 12:13 | 18K | |
| rubygem-notiffany-0...> | 2023-10-07 05:22 | 18K | |
| rubygem-notify-0.5.2..> | 2023-10-08 05:51 | 4.3K | |
| rubygem-nprogress-ra..> | 2023-10-11 05:45 | 8.3K | |
| rubygem-nsa-rails5-0..> | 2023-10-10 08:19 | 7.2K | |
| rubygem-nsa-rails61-..> | 2023-10-10 13:52 | 7.2K | |
| rubygem-ntlm-http-0...> | 2023-10-09 10:05 | 10K | |
| rubygem-numerizer-0...> | 2023-10-07 03:04 | 5.0K | |
| rubygem-numru-misc-0..> | 2023-10-11 14:08 | 14K | |
| rubygem-numru-units-..> | 2023-10-09 04:29 | 35K | |
| rubygem-oauth-0.5.14..> | 2023-10-06 16:33 | 36K | |
| rubygem-oauth2-2.0.9..> | 2023-10-06 23:05 | 28K | |
| rubygem-oauth21-1.4...> | 2023-10-07 00:19 | 23K | |
| rubygem-oci-2.18.0.pkg | 2023-10-09 12:21 | 2.8M | |
| rubygem-octicons-19...> | 2023-10-07 06:09 | 121K | |
| rubygem-octokit-7.1...> | 2023-10-07 16:13 | 71K | |
| rubygem-octokit4-4.2..> | 2023-10-07 16:38 | 70K | |
| rubygem-octokit5-5.6..> | 2023-10-06 17:52 | 70K | |
| rubygem-octokit6-6.1..> | 2023-10-06 19:46 | 70K | |
| rubygem-octopress-3...> | 2023-10-08 17:54 | 24K | |
| rubygem-octopress-de..> | 2023-10-07 16:43 | 12K | |
| rubygem-octopress-es..> | 2023-10-08 09:36 | 4.5K | |
| rubygem-octopress-ho..> | 2023-10-07 14:39 | 6.2K | |
| rubygem-oembed-0.2.0..> | 2023-10-09 15:56 | 8.0K | |
| rubygem-ohai-18.1.3.pkg | 2023-10-07 01:30 | 107K | |
| rubygem-ohai17-17.9...> | 2023-10-07 04:04 | 104K | |
| rubygem-oj-3.16.1.pkg | 2023-10-07 00:29 | 223K | |
| rubygem-oj-introspec..> | 2023-10-07 19:46 | 9.2K | |
| rubygem-oj313-3.13.2..> | 2023-10-08 09:09 | 225K | |
| rubygem-omniauth-2.1..> | 2023-10-06 19:41 | 19K | |
| rubygem-omniauth-ali..> | 2023-10-08 07:17 | 4.2K | |
| rubygem-omniauth-atl..> | 2023-10-08 08:45 | 5.7K | |
| rubygem-omniauth-aut..> | 2023-10-08 11:00 | 28K | |
| rubygem-omniauth-aut..> | 2023-10-10 06:32 | 6.3K | |
| rubygem-omniauth-azu..> | 2023-10-08 04:28 | 6.3K | |
| rubygem-omniauth-azu..> | 2023-10-08 21:55 | 6.9K | |
| rubygem-omniauth-bit..> | 2023-10-10 22:54 | 4.1K | |
| rubygem-omniauth-cas..> | 2023-10-09 02:06 | 13K | |
| rubygem-omniauth-din..> | 2023-10-07 17:46 | 5.8K | |
| rubygem-omniauth-fac..> | 2023-10-07 12:55 | 16K | |
| rubygem-omniauth-git..> | 2023-10-07 17:23 | 5.7K | |
| rubygem-omniauth-git..> | 2023-10-14 05:13 | 5.0K | |
| rubygem-omniauth-git..> | 2023-10-10 10:06 | 4.9K | |
| rubygem-omniauth-goo..> | 2023-10-07 16:50 | 19K | |
| rubygem-omniauth-jwt..> | 2023-10-09 16:09 | 6.0K | |
| rubygem-omniauth-ker..> | 2023-10-10 01:27 | 4.4K | |
| rubygem-omniauth-mul..> | 2023-10-07 20:05 | 5.3K | |
| rubygem-omniauth-oau..> | 2023-10-07 09:42 | 6.0K | |
| rubygem-omniauth-oau..> | 2023-10-07 02:19 | 8.4K | |
| rubygem-omniauth-oau..> | 2023-10-07 23:29 | 9.0K | |
| rubygem-omniauth-ope..> | 2023-10-09 22:38 | 7.3K | |
| rubygem-omniauth-rai..> | 2023-10-09 22:51 | 7.3K | |
| rubygem-omniauth-sal..> | 2023-10-14 12:44 | 6.3K | |
| rubygem-omniauth-sam..> | 2023-10-08 04:15 | 13K | |
| rubygem-omniauth-sam..> | 2023-10-14 17:38 | 13K | |
| rubygem-omniauth-shi..> | 2023-10-10 10:40 | 8.1K | |
| rubygem-omniauth-shi..> | 2023-10-08 07:50 | 8.1K | |
| rubygem-omniauth-twi..> | 2023-10-08 07:16 | 8.1K | |
| rubygem-omniauth-ult..> | 2023-10-08 12:47 | 4.9K | |
| rubygem-omniauth1-1...> | 2023-10-06 21:07 | 17K | |
| rubygem-omniauth_cro..> | 2023-10-09 03:34 | 11K | |
| rubygem-omniauth_ope..> | 2023-10-08 09:48 | 18K | |
| rubygem-omnibus-9.0...> | 2023-10-09 11:25 | 1.1M | |
| rubygem-open-uri-0.3..> | 2023-10-10 07:23 | 9.5K | |
| rubygem-open-uri-cac..> | 2023-10-09 01:26 | 3.2K | |
| rubygem-open3-0.1.2.pkg | 2023-10-10 12:33 | 9.0K | |
| rubygem-open3_backpo..> | 2023-10-10 03:13 | 12K | |
| rubygem-open4-1.3.4.pkg | 2023-10-06 15:10 | 14K | |
| rubygem-opengl-0.10...> | 2023-10-10 04:27 | 417K | |
| rubygem-openid-redis..> | 2023-10-09 23:18 | 2.6K | |
| rubygem-openid_conne..> | 2023-10-07 01:41 | 27K | |
| rubygem-opennebula-6..> | 2023-10-10 11:18 | 164K | |
| rubygem-openssl-3.1...> | 2023-10-06 23:02 | 134K | |
| rubygem-openssl-ccm-..> | 2023-10-06 23:56 | 20K | |
| rubygem-openssl-cmac..> | 2023-10-07 03:09 | 6.2K | |
| rubygem-openssl-sign..> | 2023-10-06 20:41 | 11K | |
| rubygem-opentracing-..> | 2023-10-06 20:46 | 13K | |
| rubygem-openvas-omp-..> | 2023-10-08 06:44 | 7.9K | |
| rubygem-opml-1.0.0.pkg | 2023-10-14 05:05 | 7.3K | |
| rubygem-opt_parse_va..> | 2023-10-07 10:13 | 11K | |
| rubygem-optimist-3.1..> | 2023-10-06 13:47 | 25K | |
| rubygem-optparse-0.3..> | 2023-10-14 11:08 | 34K | |
| rubygem-orchestrator..> | 2023-10-07 12:47 | 7.3K | |
| rubygem-org-ruby-0.9..> | 2023-10-08 02:45 | 27K | |
| rubygem-origami-2.1...> | 2023-10-08 17:21 | 189K | |
| rubygem-orm_adapter-..> | 2023-10-06 22:49 | 11K | |
| rubygem-os-1.1.4.pkg | 2023-10-06 10:59 | 9.0K | |
| rubygem-ostatus2-2.0..> | 2023-10-09 19:42 | 4.4K | |
| rubygem-ostruct-0.5...> | 2023-10-11 06:17 | 7.8K | |
| rubygem-ovirt-engine..> | 2023-10-06 16:36 | 222K | |
| rubygem-ox-2.14.17.pkg | 2023-10-10 08:31 | 84K | |
| rubygem-oxidized-0.2..> | 2023-10-07 10:36 | 118K | |
| rubygem-oxidized-scr..> | 2023-10-14 15:17 | 7.0K | |
| rubygem-oxidized-web..> | 2023-10-10 14:45 | 198K | |
| rubygem-p4ruby-2017...> | 2023-10-10 01:02 | 920K | |
| rubygem-packetfu-1.1..> | 2023-10-08 01:05 | 539K | |
| rubygem-packetgen-3...> | 2023-10-09 14:08 | 87K | |
| rubygem-pagerduty-4...> | 2023-10-07 12:39 | 11K | |
| rubygem-paint-2.3.0.pkg | 2023-10-07 07:06 | 17K | |
| rubygem-pairing_heap..> | 2023-10-07 06:59 | 9.8K | |
| rubygem-pango-4.2.0.pkg | 2023-10-06 18:07 | 22K | |
| rubygem-paperclip-av..> | 2023-10-10 08:34 | 140K | |
| rubygem-paperclip-av..> | 2023-10-09 13:59 | 140K | |
| rubygem-paperclip-ra..> | 2023-10-07 19:10 | 223K | |
| rubygem-paperclip-ra..> | 2023-10-07 12:37 | 223K | |
| rubygem-parallel-1.2..> | 2023-10-06 17:34 | 6.5K | |
| rubygem-paranoia-2.6..> | 2023-10-10 14:43 | 14K | |
| rubygem-parse-cron-0..> | 2023-10-07 22:36 | 6.3K | |
| rubygem-parser-3.2.2..> | 2023-10-06 13:55 | 475K | |
| rubygem-parslet-2.0...> | 2023-10-07 20:06 | 68K | |
| rubygem-parslet1-1.8..> | 2023-10-06 21:42 | 68K | |
| rubygem-passenger-ap..> | 2023-10-09 10:30 | 8.6M | |
| rubygem-passenger-ng..> | 2023-10-08 22:07 | 7.8M | |
| rubygem-pastel-0.8.0..> | 2023-10-06 13:45 | 12K | |
| rubygem-patch_finder..> | 2023-10-08 07:04 | 11K | |
| rubygem-pathname-0.2..> | 2023-10-06 20:39 | 18K | |
| rubygem-pathspec-1.1..> | 2023-10-07 16:30 | 17K | |
| rubygem-pathutil-0.1..> | 2023-10-06 21:31 | 8.2K | |
| rubygem-patron-0.13...> | 2023-10-08 07:45 | 44K | |
| rubygem-pbkdf2-ruby-..> | 2023-10-09 18:36 | 9.1K | |
| rubygem-pcaprub-0.13..> | 2023-10-07 02:17 | 30K | |
| rubygem-pdf-core-0.9..> | 2023-10-06 11:52 | 32K | |
| rubygem-pdf-reader-2..> | 2023-10-06 12:32 | 138K | |
| rubygem-pdf-writer-1..> | 2023-10-09 09:29 | 245K | |
| rubygem-pdfkit-0.8.7..> | 2023-10-07 10:37 | 21K | |
| rubygem-pdk-3.0.0.pkg | 2023-10-11 12:40 | 113K | |
| rubygem-pedump-0.6.6..> | 2023-10-07 11:44 | 330K | |
| rubygem-peek-1.1.0.pkg | 2023-10-08 04:29 | 22K | |
| rubygem-peek-gc-rail..> | 2023-10-09 11:07 | 3.6K | |
| rubygem-peek-host-1...> | 2023-10-09 06:13 | 3.1K | |
| rubygem-peek-perform..> | 2023-10-09 10:11 | 7.8K | |
| rubygem-peek-rails4-..> | 2023-10-14 18:48 | 22K | |
| rubygem-peek-rails52..> | 2023-10-07 15:07 | 22K | |
| rubygem-peek-rails60..> | 2023-10-10 09:15 | 22K | |
| rubygem-peek-rails61..> | 2023-10-09 11:06 | 22K | |
| rubygem-peek-rails70..> | 2023-10-07 13:11 | 22K | |
| rubygem-peek-rblinep..> | 2023-10-08 18:56 | 6.9K | |
| rubygem-peek-redis-r..> | 2023-10-14 09:09 | 3.6K | |
| rubygem-pg-1.5.4.pkg | 2023-10-06 20:22 | 161K | |
| rubygem-pg_array_par..> | 2023-10-08 06:51 | 5.9K | |
| rubygem-pg_query-4.2..> | 2023-10-06 23:55 | 504K | |
| rubygem-pghero-3.3.4..> | 2023-10-09 16:29 | 288K | |
| rubygem-pghero-rails..> | 2023-10-09 13:37 | 263K | |
| rubygem-pghero-rails..> | 2023-10-09 07:04 | 263K | |
| rubygem-pghero-rails..> | 2023-10-14 10:43 | 288K | |
| rubygem-phone-1.2.3.pkg | 2023-10-08 12:07 | 20K | |
| rubygem-pkg-config-1..> | 2023-10-06 09:12 | 18K | |
| rubygem-pl-puppetdb-..> | 2023-10-08 07:33 | 8.0K | |
| rubygem-platform-0.4..> | 2023-10-07 17:06 | 2.4K | |
| rubygem-platform-api..> | 2023-10-08 16:04 | 58K | |
| rubygem-pleaserun-0...> | 2023-10-07 23:53 | 28K | |
| rubygem-plist-3.6.0.pkg | 2023-10-06 22:46 | 5.6K | |
| rubygem-pluggaloid-1..> | 2023-10-07 21:49 | 16K | |
| rubygem-png-1.2.1.pkg | 2023-10-08 16:47 | 15K | |
| rubygem-po_to_json-2..> | 2023-10-07 07:10 | 5.2K | |
| rubygem-polyamorous-..> | 2023-10-09 04:38 | 4.1K | |
| rubygem-polyglot-0.3..> | 2023-10-06 12:20 | 4.5K | |
| rubygem-pony-1.13.pkg | 2023-10-14 18:44 | 9.4K | |
| rubygem-popen4-0.1.4..> | 2023-10-14 08:07 | 5.3K | |
| rubygem-poppler-4.2...> | 2023-10-07 00:17 | 83K | |
| rubygem-posix-spawn-..> | 2023-10-07 04:46 | 26K | |
| rubygem-postgres_ext..> | 2023-10-08 12:30 | 20K | |
| rubygem-power_assert..> | 2023-10-07 06:58 | 11K | |
| rubygem-powerbar-1.0..> | 2023-10-06 23:49 | 8.5K | |
| rubygem-powerpack-0...> | 2023-10-10 02:11 | 14K | |
| rubygem-pp-0.4.0.pkg | 2023-10-09 15:42 | 6.5K | |
| rubygem-pqueue-2.1.0..> | 2023-10-14 08:40 | 7.4K | |
| rubygem-prawn-2.4.0.pkg | 2023-10-06 12:12 | 239K | |
| rubygem-prawn-core-0..> | 2023-10-08 11:34 | 3.2M | |
| rubygem-prawn-flexib..> | 2023-10-09 14:43 | 19K | |
| rubygem-prawn-format..> | 2023-10-10 05:42 | 78K | |
| rubygem-prawn-graph-..> | 2023-10-10 04:30 | 21K | |
| rubygem-prawn-icon-3..> | 2023-10-06 14:34 | 1.0M | |
| rubygem-prawn-js-0.7..> | 2023-10-09 14:21 | 4.7K | |
| rubygem-prawn-layout..> | 2023-10-08 12:11 | 22K | |
| rubygem-prawn-securi..> | 2023-10-09 05:00 | 14K | |
| rubygem-prawn-svg-0...> | 2023-10-06 15:20 | 212K | |
| rubygem-prawn-table-..> | 2023-10-06 14:40 | 52K | |
| rubygem-prawn-templa..> | 2023-10-06 15:00 | 21K | |
| rubygem-prawn_shapes..> | 2023-10-07 15:54 | 8.1K | |
| rubygem-premailer-1...> | 2023-10-07 03:30 | 18K | |
| rubygem-premailer-ra..> | 2023-10-10 01:09 | 21K | |
| rubygem-premailer-ra..> | 2023-10-14 17:27 | 21K | |
| rubygem-premailer-ra..> | 2023-10-14 13:37 | 21K | |
| rubygem-premailer-ra..> | 2023-10-10 10:09 | 21K | |
| rubygem-premailer-ra..> | 2023-10-14 14:38 | 19K | |
| rubygem-premailer-ra..> | 2023-10-14 04:20 | 21K | |
| rubygem-premailer-ra..> | 2023-10-07 13:04 | 19K | |
| rubygem-prettier_pri..> | 2023-10-07 00:52 | 20K | |
| rubygem-pretty-xml-0..> | 2023-10-09 20:16 | 2.6K | |
| rubygem-prettyprint-..> | 2023-10-07 18:24 | 7.8K | |
| rubygem-prime-0.1.2.pkg | 2023-10-06 16:13 | 7.5K | |
| rubygem-private_addr..> | 2023-10-08 22:14 | 6.2K | |
| rubygem-profile-0.4...> | 2023-10-14 18:37 | 4.2K | |
| rubygem-progressbar-..> | 2023-10-07 14:17 | 13K | |
| rubygem-prometheus-c..> | 2023-10-07 23:10 | 51K | |
| rubygem-propshaft-0...> | 2023-10-06 20:32 | 9.9K | |
| rubygem-protected_at..> | 2023-10-14 18:58 | 12K | |
| rubygem-protobuf-cuc..> | 2023-10-14 12:45 | 172K | |
| rubygem-protocol-2.0..> | 2023-10-06 21:16 | 24K | |
| rubygem-protocol-hpa..> | 2023-10-06 17:13 | 16K | |
| rubygem-protocol-htt..> | 2023-10-06 17:21 | 19K | |
| rubygem-protocol-htt..> | 2023-10-06 19:22 | 9.7K | |
| rubygem-protocol-htt..> | 2023-10-06 19:18 | 20K | |
| rubygem-protocol-rac..> | 2023-10-08 11:44 | 11K | |
| rubygem-protocol-web..> | 2023-10-08 11:24 | 12K | |
| rubygem-proxifier-1...> | 2023-10-07 07:43 | 6.4K | |
| rubygem-proxifier2-1..> | 2023-10-07 08:26 | 6.5K | |
| rubygem-pry-0.14.2.pkg | 2023-10-06 21:23 | 127K | |
| rubygem-pry-byebug-3..> | 2023-10-09 14:22 | 12K | |
| rubygem-pry-rails-0...> | 2023-10-09 13:48 | 14K | |
| rubygem-pry-remote-0..> | 2023-10-08 23:56 | 4.9K | |
| rubygem-pry-remote-e..> | 2023-10-14 13:29 | 26K | |
| rubygem-pstore-0.1.2..> | 2023-10-10 01:53 | 9.7K | |
| rubygem-psych-5.1.0.pkg | 2023-10-06 14:45 | 34K | |
| rubygem-psych3-3.3.4..> | 2023-10-07 00:51 | 34K | |
| rubygem-ptreloaded-0..> | 2023-10-09 07:44 | 11K | |
| rubygem-public_suffi..> | 2023-10-06 10:00 | 96K | |
| rubygem-public_suffi..> | 2023-10-08 03:12 | 82K | |
| rubygem-puma-6.3.1.pkg | 2023-10-06 18:58 | 178K | |
| rubygem-puma_worker_..> | 2023-10-09 01:51 | 10K | |
| rubygem-pundit-2.3.1..> | 2023-10-09 13:30 | 23K | |
| rubygem-pundit61-2.3..> | 2023-10-09 04:24 | 23K | |
| rubygem-puppet-lint-..> | 2023-10-10 19:44 | 69K | |
| rubygem-puppet-resou..> | 2023-10-06 21:52 | 90K | |
| rubygem-puppet-strin..> | 2023-10-07 23:31 | 52K | |
| rubygem-puppet_forge..> | 2023-10-07 00:24 | 239K | |
| rubygem-puppetdb_cli..> | 2023-10-10 08:43 | 15K | |
| rubygem-puppetfile-r..> | 2023-10-08 09:38 | 147K | |
| rubygem-puppetserver..> | 2023-10-08 04:57 | 38K | |
| rubygem-pusher-clien..> | 2023-10-08 05:01 | 123K | |
| rubygem-pygments.rb-..> | 2023-10-14 12:46 | 789K | |
| rubygem-pyu-ruby-sas..> | 2023-10-06 23:48 | 5.6K | |
| rubygem-qiniu-6.9.1.pkg | 2023-10-07 22:23 | 25K | |
| rubygem-que-2.2.1.pkg | 2023-10-06 19:00 | 61K | |
| rubygem-que-schedule..> | 2023-10-08 23:48 | 17K | |
| rubygem-r10k-3.16.0.pkg | 2023-10-07 22:22 | 145K | |
| rubygem-r18n-core-5...> | 2023-10-07 01:33 | 43K | |
| rubygem-r18n-desktop..> | 2023-10-09 02:10 | 12K | |
| rubygem-r18n-rails-5..> | 2023-10-09 07:43 | 12K | |
| rubygem-r18n-rails-a..> | 2023-10-08 01:15 | 12K | |
| rubygem-raabro-1.4.0..> | 2023-10-06 19:35 | 9.5K | |
| rubygem-rabbirack-2...> | 2023-10-09 13:33 | 12K | |
| rubygem-rabbit-3.0.1..> | 2023-10-08 06:24 | 4.3M | |
| rubygem-rabbiter-2.0..> | 2023-10-10 20:41 | 17K | |
| rubygem-rabl-0.16.1.pkg | 2023-10-08 23:31 | 27K | |
| rubygem-rabl-rails50..> | 2023-10-08 23:20 | 27K | |
| rubygem-racc-1.7.1.pkg | 2023-10-06 09:20 | 59K | |
| rubygem-rack-3.0.8,3..> | 2023-10-06 15:33 | 86K | |
| rubygem-rack-accept-..> | 2023-10-06 15:43 | 11K | |
| rubygem-rack-attack-..> | 2023-10-07 16:00 | 23K | |
| rubygem-rack-cache-1..> | 2023-10-06 18:30 | 24K | |
| rubygem-rack-contrib..> | 2023-10-14 16:57 | 23K | |
| rubygem-rack-cors-1...> | 2023-10-08 06:48 | 45K | |
| rubygem-rack-mini-pr..> | 2023-10-09 00:19 | 353K | |
| rubygem-rack-mount-0..> | 2023-10-08 12:11 | 20K | |
| rubygem-rack-oauth2-..> | 2023-10-09 18:41 | 27K | |
| rubygem-rack-oauth21..> | 2023-10-06 18:32 | 32K | |
| rubygem-rack-openid-..> | 2023-10-07 21:19 | 5.1K | |
| rubygem-rack-protect..> | 2023-10-06 17:22 | 16K | |
| rubygem-rack-protect..> | 2023-10-06 19:00 | 14K | |
| rubygem-rack-protect..> | 2023-10-06 19:05 | 14K | |
| rubygem-rack-proxy-0..> | 2023-10-06 21:22 | 11K | |
| rubygem-rack-raw-upl..> | 2023-10-10 13:17 | 12K | |
| rubygem-rack-session..> | 2023-10-07 14:43 | 11K | |
| rubygem-rack-ssl-1.4..> | 2023-10-14 05:41 | 2.7K | |
| rubygem-rack-test-2...> | 2023-10-06 13:24 | 17K | |
| rubygem-rack-timeout..> | 2023-10-07 10:58 | 21K | |
| rubygem-rack16-1.6.1..> | 2023-10-06 11:10 | 190K | |
| rubygem-rack22-2.2.8..> | 2023-10-06 12:11 | 125K | |
| rubygem-rack_csrf-2...> | 2023-10-09 15:28 | 18K | |
| rubygem-rackup-2.1.0..> | 2023-10-08 03:52 | 12K | |
| rubygem-railroad-0.5..> | 2023-10-14 13:30 | 16K | |
| rubygem-rails-deprec..> | 2023-10-06 10:08 | 22K | |
| rubygem-rails-deprec..> | 2023-10-09 17:00 | 22K | |
| rubygem-rails-deprec..> | 2023-10-09 14:08 | 22K | |
| rubygem-rails-dom-te..> | 2023-10-06 19:11 | 11K | |
| rubygem-rails-dom-te..> | 2023-10-06 12:05 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:10 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:48 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:57 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:02 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:22 | 13K | |
| rubygem-rails-dom-te..> | 2023-10-06 11:43 | 13K | |
| rubygem-rails-html-s..> | 2023-10-06 11:21 | 19K | |
| rubygem-rails-i18n-r..> | 2023-10-11 00:35 | 92K | |
| rubygem-rails-i18n-r..> | 2023-10-14 17:04 | 92K | |
| rubygem-rails-i18n-r..> | 2023-10-09 22:39 | 92K | |
| rubygem-rails-i18n-r..> | 2023-10-09 01:57 | 100K | |
| rubygem-rails-i18n-r..> | 2023-10-07 17:08 | 100K | |
| rubygem-rails-i18n-r..> | 2023-10-08 04:53 | 100K | |
| rubygem-rails-observ..> | 2023-10-06 19:15 | 11K | |
| rubygem-rails-settin..> | 2023-10-09 14:55 | 6.9K | |
| rubygem-rails-settin..> | 2023-10-14 07:18 | 6.9K | |
| rubygem-rails-settin..> | 2023-10-10 10:01 | 6.9K | |
| rubygem-rails-settin..> | 2023-10-09 06:49 | 6.9K | |
| rubygem-rails4-4.2.1..> | 2023-10-08 09:45 | 1.3M | |
| rubygem-rails5-5.1.7..> | 2023-10-08 11:45 | 3.8K | |
| rubygem-rails50-5.0...> | 2023-10-08 06:25 | 3.7K | |
| rubygem-rails52-5.2...> | 2023-10-08 01:04 | 3.8K | |
| rubygem-rails60-6.0...> | 2023-10-08 10:23 | 4.0K | |
| rubygem-rails61-6.1...> | 2023-10-07 17:03 | 3.9K | |
| rubygem-rails70-7.0...> | 2023-10-07 08:08 | 4.6K | |
| rubygem-rails_12fact..> | 2023-10-08 12:22 | 4.6K | |
| rubygem-rails_autoli..> | 2023-10-09 01:41 | 5.2K | |
| rubygem-rails_serve_..> | 2023-10-08 02:09 | 633K | |
| rubygem-rails_stdout..> | 2023-10-08 03:55 | 66K | |
| rubygem-railsbench-0..> | 2023-10-14 09:01 | 74K | |
| rubygem-railties4-4...> | 2023-10-06 17:44 | 109K | |
| rubygem-railties5-5...> | 2023-10-06 17:14 | 204K | |
| rubygem-railties50-5..> | 2023-10-06 17:42 | 200K | |
| rubygem-railties52-5..> | 2023-10-06 17:23 | 211K | |
| rubygem-railties60-6..> | 2023-10-06 18:14 | 424K | |
| rubygem-railties61-6..> | 2023-10-06 16:19 | 425K | |
| rubygem-railties70-7..> | 2023-10-06 17:02 | 135K | |
| rubygem-rainbow-3.1...> | 2023-10-06 17:41 | 9.9K | |
| rubygem-raindrops-0...> | 2023-10-07 01:20 | 49K | |
| rubygem-rak-1.4_1.pkg | 2023-10-11 01:56 | 12K | |
| rubygem-rake-13.0.6.pkg | 2023-10-06 14:21 | 70K | |
| rubygem-rake-compile..> | 2023-10-08 01:06 | 30K | |
| rubygem-rake-compile..> | 2023-10-08 22:20 | 17K | |
| rubygem-rake-contrib..> | 2023-10-08 19:19 | 4.5K | |
| rubygem-ramaze-2012...> | 2023-10-14 08:14 | 422K | |
| rubygem-ransack-4.0...> | 2023-10-09 17:34 | 473K | |
| rubygem-raphael-rail..> | 2023-10-08 23:15 | 98K | |
| rubygem-rapt-0.2.2.pkg | 2023-10-10 16:16 | 15K | |
| rubygem-rash-0.4.0_1..> | 2023-10-08 20:47 | 4.8K | |
| rubygem-rash_alt-0.4..> | 2023-10-08 20:37 | 5.9K | |
| rubygem-rasn1-0.12.1..> | 2023-10-07 21:03 | 23K | |
| rubygem-rate_throttl..> | 2023-10-07 21:04 | 15K | |
| rubygem-razorback-sc..> | 2023-10-10 09:07 | 2.0K | |
| rubygem-rb-fsevent-0..> | 2023-10-06 12:54 | 31K | |
| rubygem-rb-gsl-2.1.0..> | 2023-10-08 13:45 | 632K | |
| rubygem-rb-inotify-0..> | 2023-10-06 13:07 | 12K | |
| rubygem-rb-kqueue-0...> | 2023-10-06 14:57 | 15K | |
| rubygem-rb_sys-0.9.7..> | 2023-10-07 01:02 | 22K | |
| rubygem-rbase-0.1.3.pkg | 2023-10-08 22:16 | 7.4K | |
| rubygem-rblineprof-0..> | 2023-10-07 17:07 | 8.9K | |
| rubygem-rbnacl-5.0.0..> | 2023-10-08 00:15 | 201K | |
| rubygem-rbnacl-libso..> | 2023-10-10 02:48 | 4.6M | |
| rubygem-rbovirt-0.1...> | 2023-10-10 21:34 | 21K | |
| rubygem-rbpdf-1.21.3..> | 2023-10-07 18:47 | 149K | |
| rubygem-rbpdf-font-1..> | 2023-10-07 06:41 | 8.3M | |
| rubygem-rbs-3.2.1.pkg | 2023-10-08 09:55 | 761K | |
| rubygem-rbs_json_sch..> | 2023-10-09 04:24 | 10K | |
| rubygem-rbtrace-0.4...> | 2023-10-07 16:45 | 27K | |
| rubygem-rbtree-0.4.6..> | 2023-10-06 15:50 | 42K | |
| rubygem-rbvmomi-3.0...> | 2023-10-08 10:38 | 179K | |
| rubygem-rbvmomi2-3.6..> | 2023-10-06 17:08 | 174K | |
| rubygem-rchardet-1.8..> | 2023-10-06 15:20 | 88K | |
| rubygem-rdf-3.3.0.pkg | 2023-10-07 08:27 | 123K | |
| rubygem-rdf-normaliz..> | 2023-10-10 21:11 | 11K | |
| rubygem-rdiscount-2...> | 2023-10-05 17:42 | 59K | |
| rubygem-rdoc-6.5.0.pkg | 2023-10-06 19:02 | 432K | |
| rubygem-rdoc63-6.3.3..> | 2023-10-07 18:20 | 381K | |
| rubygem-rdtool-0.6.3..> | 2023-10-07 02:54 | 87K | |
| rubygem-re2-1.7.0_1.pkg | 2023-10-07 18:45 | 30K | |
| rubygem-react-rails-..> | 2023-10-08 14:13 | 415K | |
| rubygem-react-rails-..> | 2023-10-14 10:40 | 415K | |
| rubygem-readline-0.0..> | 2023-10-09 15:30 | 3.1K | |
| rubygem-readline-ext..> | 2023-10-14 18:54 | 13K | |
| rubygem-readwriteset..> | 2023-10-07 04:24 | 9.6K | |
| rubygem-recaptcha-5...> | 2023-10-07 12:28 | 18K | |
| rubygem-recog-2.3.23..> | 2023-10-06 20:53 | 310K | |
| rubygem-recursive-op..> | 2023-10-07 01:44 | 17K | |
| rubygem-red-arrow-13..> | 2023-10-07 22:41 | 115K | |
| rubygem-red-arrow-da..> | 2023-10-09 04:49 | 9.8K | |
| rubygem-red-colors-0..> | 2023-10-06 10:57 | 76K | |
| rubygem-red-datasets..> | 2023-10-14 05:45 | 56K | |
| rubygem-red-gandiva-..> | 2023-10-08 12:26 | 11K | |
| rubygem-red-parquet-..> | 2023-10-10 13:42 | 9.4K | |
| rubygem-redcarpet-3...> | 2023-10-08 07:36 | 51K | |
| rubygem-redcloth-4.3..> | 2023-10-07 22:08 | 149K | |
| rubygem-redfish_clie..> | 2023-10-08 20:30 | 11K | |
| rubygem-redis-5.0.7.pkg | 2023-10-06 16:09 | 40K | |
| rubygem-redis-action..> | 2023-10-08 00:28 | 11K | |
| rubygem-redis-action..> | 2023-10-08 06:45 | 11K | |
| rubygem-redis-action..> | 2023-10-08 10:35 | 11K | |
| rubygem-redis-action..> | 2023-10-07 21:27 | 11K | |
| rubygem-redis-action..> | 2023-10-08 08:56 | 11K | |
| rubygem-redis-action..> | 2023-10-07 22:37 | 11K | |
| rubygem-redis-action..> | 2023-10-08 07:17 | 11K | |
| rubygem-redis-active..> | 2023-10-08 09:26 | 11K | |
| rubygem-redis-active..> | 2023-10-07 17:39 | 11K | |
| rubygem-redis-active..> | 2023-10-07 20:57 | 11K | |
| rubygem-redis-active..> | 2023-10-08 03:37 | 11K | |
| rubygem-redis-active..> | 2023-10-07 17:02 | 11K | |
| rubygem-redis-active..> | 2023-10-07 21:14 | 11K | |
| rubygem-redis-client..> | 2023-10-06 14:53 | 22K | |
| rubygem-redis-cluste..> | 2023-10-08 06:42 | 14K | |
| rubygem-redis-cluste..> | 2023-10-08 13:14 | 5.2K | |
| rubygem-redis-namesp..> | 2023-10-06 21:26 | 15K | |
| rubygem-redis-namesp..> | 2023-10-07 11:46 | 14K | |
| rubygem-redis-rack-2..> | 2023-10-07 03:25 | 10K | |
| rubygem-redis-rails-..> | 2023-10-10 20:36 | 4.3K | |
| rubygem-redis-rails-..> | 2023-10-09 21:37 | 4.4K | |
| rubygem-redis-rails-..> | 2023-10-10 02:26 | 4.4K | |
| rubygem-redis-rails-..> | 2023-10-09 06:18 | 4.4K | |
| rubygem-redis-rails-..> | 2023-10-09 22:13 | 4.4K | |
| rubygem-redis-rails-..> | 2023-10-08 17:10 | 4.4K | |
| rubygem-redis-store-..> | 2023-10-06 20:23 | 22K | |
| rubygem-redis4-4.8.1..> | 2023-10-06 20:06 | 55K | |
| rubygem-redlock-2.0...> | 2023-10-09 16:52 | 15K | |
| rubygem-redlock1-1.3..> | 2023-10-07 23:42 | 14K | |
| rubygem-redmine_plug..> | 2023-10-09 00:52 | 9.5K | |
| rubygem-reentrant_fl..> | 2023-10-08 07:47 | 4.9K | |
| rubygem-ref-2.0.0.pkg | 2023-10-07 22:19 | 12K | |
| rubygem-regexp_parse..> | 2023-10-06 15:49 | 57K | |
| rubygem-regexp_prope..> | 2023-10-06 23:40 | 13K | |
| rubygem-reline-0.3.8..> | 2023-10-07 08:24 | 44K | |
| rubygem-representabl..> | 2023-10-06 13:36 | 65K | |
| rubygem-request_stor..> | 2023-10-07 05:35 | 6.0K | |
| rubygem-request_stor..> | 2023-10-09 02:19 | 5.6K | |
| rubygem-require_all-..> | 2023-10-10 09:13 | 11K | |
| rubygem-resolv-0.2.2..> | 2023-10-07 21:42 | 18K | |
| rubygem-resolv-repla..> | 2023-10-14 09:04 | 3.5K | |
| rubygem-responders-3..> | 2023-10-07 03:38 | 15K | |
| rubygem-responders-r..> | 2023-10-07 07:06 | 15K | |
| rubygem-responders-r..> | 2023-10-07 11:37 | 16K | |
| rubygem-responders-r..> | 2023-10-07 18:45 | 16K | |
| rubygem-responders-r..> | 2023-10-07 06:02 | 16K | |
| rubygem-responders-r..> | 2023-10-06 20:46 | 16K | |
| rubygem-resque-2.2.1..> | 2023-10-07 17:39 | 87K | |
| rubygem-resque-sched..> | 2023-10-08 23:22 | 38K | |
| rubygem-rest-client-..> | 2023-10-06 14:58 | 131K | |
| rubygem-retriable-3...> | 2023-10-06 12:51 | 13K | |
| rubygem-retryable-3...> | 2023-10-07 20:21 | 10K | |
| rubygem-reverse_mark..> | 2023-10-06 21:58 | 20K | |
| rubygem-rex-arch-0.1..> | 2023-10-06 23:01 | 12K | |
| rubygem-rex-bin_tool..> | 2023-10-08 11:23 | 58K | |
| rubygem-rex-core-0.1..> | 2023-10-06 19:31 | 24K | |
| rubygem-rex-encoder-..> | 2023-10-07 01:29 | 32K | |
| rubygem-rex-exploita..> | 2023-10-07 14:08 | 65K | |
| rubygem-rex-java-0.1..> | 2023-10-08 03:07 | 16K | |
| rubygem-rex-mime-0.1..> | 2023-10-07 23:24 | 9.7K | |
| rubygem-rex-nop-0.1...> | 2023-10-07 12:04 | 15K | |
| rubygem-rex-ole-0.1...> | 2023-10-08 08:59 | 19K | |
| rubygem-rex-powershe..> | 2023-10-07 21:56 | 24K | |
| rubygem-rex-random_i..> | 2023-10-07 06:02 | 11K | |
| rubygem-rex-registry..> | 2023-10-08 00:06 | 9.9K | |
| rubygem-rex-rop_buil..> | 2023-10-07 22:32 | 11K | |
| rubygem-rex-socket-0..> | 2023-10-07 09:07 | 33K | |
| rubygem-rex-sslscan-..> | 2023-10-08 03:30 | 11K | |
| rubygem-rex-struct2-..> | 2023-10-07 03:27 | 11K | |
| rubygem-rex-text-0.2..> | 2023-10-06 17:00 | 38K | |
| rubygem-rex-zip-0.1...> | 2023-10-08 04:35 | 16K | |
| rubygem-rexml-3.2.6.pkg | 2023-10-06 12:41 | 83K | |
| rubygem-rfacebook-0...> | 2023-10-10 11:06 | 11K | |
| rubygem-rfeedfinder-..> | 2023-10-10 21:11 | 26K | |
| rubygem-rgen-0.9.1.pkg | 2023-10-07 00:46 | 196K | |
| rubygem-rgeo-3.0.0.pkg | 2023-10-08 09:23 | 96K | |
| rubygem-rgeo-geojson..> | 2023-10-08 18:03 | 7.2K | |
| rubygem-rgeo-proj4-4..> | 2023-10-10 17:33 | 11K | |
| rubygem-rgeo-shapefi..> | 2023-10-09 23:20 | 11K | |
| rubygem-rgl-0.5.10.pkg | 2023-10-07 13:01 | 56K | |
| rubygem-rhc-1.32.2_2..> | 2023-10-10 15:38 | 190K | |
| rubygem-ri_cal-0.8.8..> | 2023-10-08 12:44 | 346K | |
| rubygem-rice-4.1.0.pkg | 2023-10-09 23:17 | 86K | |
| rubygem-riemann-clie..> | 2023-10-07 05:17 | 19K | |
| rubygem-riemann-dash..> | 2023-10-14 08:28 | 280K | |
| rubygem-riemann-rabb..> | 2023-10-09 18:09 | 228K | |
| rubygem-riemann-tail..> | 2023-10-09 17:00 | 225K | |
| rubygem-riemann-tool..> | 2023-10-07 12:35 | 311K | |
| rubygem-right_aws-3...> | 2023-10-10 21:01 | 147K | |
| rubygem-right_flexis..> | 2023-10-11 06:03 | 16K | |
| rubygem-right_gogrid..> | 2023-10-08 21:05 | 14K | |
| rubygem-right_http_c..> | 2023-10-08 01:42 | 98K | |
| rubygem-right_sliceh..> | 2023-10-08 22:49 | 13K | |
| rubygem-rinda-0.1.1.pkg | 2023-10-08 15:01 | 12K | |
| rubygem-rinku-2.0.6.pkg | 2023-10-07 07:31 | 17K | |
| rubygem-rkelly-remix..> | 2023-10-06 20:00 | 59K | |
| rubygem-rly-0.2.3.pkg | 2023-10-07 16:58 | 20K | |
| rubygem-rmagick-5.3...> | 2023-10-06 23:25 | 190K | |
| rubygem-rmail-1.1.4.pkg | 2023-10-14 09:35 | 60K | |
| rubygem-rmmseg-cpp-0..> | 2023-10-10 19:57 | 634K | |
| rubygem-roadie-5.2.0..> | 2023-10-07 03:48 | 46K | |
| rubygem-roadie-rails..> | 2023-10-09 23:57 | 11K | |
| rubygem-roadie-rails..> | 2023-10-09 21:47 | 12K | |
| rubygem-roadie-rails..> | 2023-10-07 10:21 | 12K | |
| rubygem-roadie3-3.5...> | 2023-10-08 11:46 | 46K | |
| rubygem-roauth-0.0.8..> | 2023-10-09 18:41 | 4.3K | |
| rubygem-robotex-1.0...> | 2023-10-07 18:25 | 4.4K | |
| rubygem-robots-0.10...> | 2023-10-14 18:18 | 7.8K | |
| rubygem-roda-3.71.0.pkg | 2023-10-08 22:38 | 174K | |
| rubygem-rodzilla-0.3..> | 2023-10-07 15:29 | 15K | |
| rubygem-ronn-0.7.3.pkg | 2023-10-05 17:44 | 51K | |
| rubygem-rotp-6.3.0.pkg | 2023-10-07 03:38 | 18K | |
| rubygem-rouge-4.1.3.pkg | 2023-10-06 17:29 | 429K | |
| rubygem-rouge3-3.30...> | 2023-10-06 22:43 | 420K | |
| rubygem-rpam2-4.0.2.pkg | 2023-10-07 17:48 | 6.6K | |
| rubygem-rqrcode-0.10..> | 2023-10-07 08:07 | 22K | |
| rubygem-rqrcode-rail..> | 2023-10-07 20:12 | 4.4K | |
| rubygem-rqrcode2-2.2..> | 2023-10-11 01:06 | 97K | |
| rubygem-rqrcode_core..> | 2023-10-08 07:17 | 14K | |
| rubygem-rr-1.2.1.pkg | 2023-10-10 14:37 | 81K | |
| rubygem-rrd-ffi-0.2...> | 2023-10-07 02:26 | 18K | |
| rubygem-rscm-0.5.1.pkg | 2023-10-09 23:04 | 139K | |
| rubygem-rsec-0.4.3.pkg | 2023-10-06 20:38 | 20K | |
| rubygem-rspec-3.12.0..> | 2023-10-06 23:02 | 4.5K | |
| rubygem-rspec-core-3..> | 2023-10-06 17:49 | 130K | |
| rubygem-rspec-expect..> | 2023-10-06 17:17 | 69K | |
| rubygem-rspec-its-1...> | 2023-10-06 21:59 | 10K | |
| rubygem-rspec-logspl..> | 2023-10-11 17:51 | 4.7K | |
| rubygem-rspec-mocks-..> | 2023-10-06 17:21 | 63K | |
| rubygem-rspec-rails-..> | 2023-10-14 02:53 | 58K | |
| rubygem-rspec-suppor..> | 2023-10-06 14:03 | 30K | |
| rubygem-rspec_junit_..> | 2023-10-09 20:47 | 7.6K | |
| rubygem-rss-0.3.0.pkg | 2023-10-07 19:48 | 42K | |
| rubygem-rsvg2-4.2.0.pkg | 2023-10-07 03:39 | 16K | |
| rubygem-rsync-1.0.9_..> | 2023-10-07 23:23 | 6.4K | |
| rubygem-rtlit-0.0.5.pkg | 2023-10-10 01:42 | 6.0K | |
| rubygem-rttool-1.0.3..> | 2023-10-07 06:35 | 29K | |
| rubygem-rubocop-1.56..> | 2023-10-06 18:53 | 479K | |
| rubygem-rubocop-ast-..> | 2023-10-06 18:19 | 48K | |
| rubygem-rubocop-capy..> | 2023-10-07 09:31 | 12K | |
| rubygem-rubocop-fact..> | 2023-10-07 06:44 | 14K | |
| rubygem-rubocop-perf..> | 2023-10-07 22:35 | 34K | |
| rubygem-rubocop-rake..> | 2023-10-08 18:39 | 8.5K | |
| rubygem-rubocop-rspe..> | 2023-10-08 07:33 | 76K | |
| rubygem-ruby-atmos-p..> | 2023-10-09 18:38 | 30K | |
| rubygem-ruby-augeas-..> | 2023-10-06 16:56 | 22K | |
| rubygem-ruby-bsdconv..> | 2023-10-14 12:19 | 10K | |
| rubygem-ruby-bugzill..> | 2023-10-08 22:43 | 18K | |
| rubygem-ruby-enum-0...> | 2023-10-09 12:28 | 117K | |
| rubygem-ruby-filemag..> | 2023-10-10 10:08 | 18K | |
| rubygem-ruby-fogbugz..> | 2023-10-08 04:57 | 6.2K | |
| rubygem-ruby-gdsii-1..> | 2023-10-09 17:28 | 44K | |
| rubygem-ruby-graphvi..> | 2023-10-08 13:02 | 102K | |
| rubygem-ruby-growl-4..> | 2023-10-10 17:53 | 192K | |
| rubygem-ruby-hmac-0...> | 2023-10-07 21:53 | 4.8K | |
| rubygem-ruby-libvirt..> | 2023-10-08 14:54 | 93K | |
| rubygem-ruby-lsp-0.9..> | 2023-10-09 09:34 | 52K | |
| rubygem-ruby-macho-3..> | 2023-10-07 20:59 | 28K | |
| rubygem-ruby-magic-0..> | 2023-10-08 05:59 | 29K | |
| rubygem-ruby-mp3info..> | 2023-10-09 10:32 | 82K | |
| rubygem-ruby-netcdf-..> | 2023-10-10 23:24 | 78K | |
| rubygem-ruby-oembed-..> | 2023-10-14 17:30 | 35K | |
| rubygem-ruby-ogginfo..> | 2023-10-11 07:58 | 70K | |
| rubygem-ruby-ole-1.2..> | 2023-10-08 00:13 | 43K | |
| rubygem-ruby-openai-..> | 2023-10-11 00:43 | 18K | |
| rubygem-ruby-openai3..> | 2023-10-07 11:58 | 14K | |
| rubygem-ruby-openid-..> | 2023-10-07 07:31 | 271K | |
| rubygem-ruby-prof-1...> | 2023-10-10 13:45 | 82K | |
| rubygem-ruby-progres..> | 2023-10-06 18:16 | 13K | |
| rubygem-ruby-qmail-0..> | 2023-10-09 18:42 | 8.9K | |
| rubygem-ruby-rc4-0.1..> | 2023-10-06 12:07 | 4.5K | |
| rubygem-ruby-readabi..> | 2023-10-10 17:59 | 195K | |
| rubygem-ruby-saml-1...> | 2023-10-07 03:06 | 58K | |
| rubygem-ruby-shout-2..> | 2023-10-09 14:35 | 11K | |
| rubygem-ruby-statist..> | 2023-10-07 18:54 | 18K | |
| rubygem-ruby-termios..> | 2023-10-06 13:34 | 22K | |
| rubygem-ruby-vips-2...> | 2023-10-06 17:15 | 55K | |
| rubygem-ruby-xslt-0...> | 2023-10-09 10:01 | 31K | |
| rubygem-ruby-xz-1.0...> | 2023-10-09 23:56 | 20K | |
| rubygem-ruby-yadis-0..> | 2023-10-09 02:33 | 15K | |
| rubygem-ruby2_keywor..> | 2023-10-06 09:39 | 6.7K | |
| rubygem-ruby2ruby-2...> | 2023-10-09 13:15 | 21K | |
| rubygem-ruby_dep-1.5..> | 2023-10-09 14:22 | 8.4K | |
| rubygem-ruby_expect-..> | 2023-10-07 17:37 | 11K | |
| rubygem-ruby_languag..> | 2023-10-09 01:21 | 24K | |
| rubygem-ruby_memchec..> | 2023-10-09 16:15 | 12K | |
| rubygem-ruby_parser-..> | 2023-10-06 16:00 | 313K | |
| rubygem-ruby_smb-3.2..> | 2023-10-08 02:34 | 297K | |
| rubygem-rubygems-mir..> | 2023-10-09 01:39 | 8.3K | |
| rubygem-rubygems-tas..> | 2023-10-10 00:11 | 18K | |
| rubygem-rubygems-tes..> | 2023-10-08 22:15 | 14K | |
| rubygem-rubyinline-3..> | 2023-10-07 09:31 | 23K | |
| rubygem-rubyinlineac..> | 2023-10-08 07:25 | 10K | |
| rubygem-rubyipmi-0.1..> | 2023-10-09 06:12 | 30K | |
| rubygem-rubyntlm-0.6..> | 2023-10-06 12:54 | 27K | |
| rubygem-rubypants-0...> | 2023-10-07 08:17 | 10K | |
| rubygem-rubytree-2.0..> | 2023-10-09 23:56 | 42K | |
| rubygem-rubytter-1.5..> | 2023-10-07 21:15 | 12K | |
| rubygem-rubyzip-2.3...> | 2023-10-06 14:40 | 33K | |
| rubygem-rubyzip2-2.0..> | 2023-10-09 18:36 | 48K | |
| rubygem-rubyzip13-1...> | 2023-10-08 03:59 | 122K | |
| rubygem-rubyzip20-2...> | 2023-10-14 18:42 | 32K | |
| rubygem-rudy-0.9.8.0..> | 2023-10-09 19:49 | 88K | |
| rubygem-rufus-schedu..> | 2023-10-08 06:59 | 33K | |
| rubygem-rugged-1.6.3..> | 2023-10-06 21:04 | 1.3M | |
| rubygem-rugments-1.0..> | 2023-10-08 14:38 | 130K | |
| rubygem-runt-0.9.0.pkg | 2023-10-10 09:37 | 77K | |
| rubygem-ruport-1.8.0..> | 2023-10-09 12:29 | 225K | |
| rubygem-rye-0.9.13_1..> | 2023-10-07 11:59 | 1.3M | |
| rubygem-safe_yaml-1...> | 2023-10-06 22:07 | 26K | |
| rubygem-safety_net_a..> | 2023-10-07 09:40 | 13K | |
| rubygem-sanitize-6.0..> | 2023-10-07 16:15 | 38K | |
| rubygem-sass-3.7.4.pkg | 2023-10-06 16:35 | 168K | |
| rubygem-sass-listen-..> | 2023-10-06 15:19 | 23K | |
| rubygem-sass-rails-r..> | 2023-10-07 03:24 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-07 05:44 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-07 03:59 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-07 03:46 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-07 04:07 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-07 07:26 | 3.9K | |
| rubygem-sass-rails-r..> | 2023-10-14 07:23 | 3.9K | |
| rubygem-sassc-2.4.0.pkg | 2023-10-06 16:22 | 663K | |
| rubygem-sassc-rails-..> | 2023-10-06 20:31 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-06 21:06 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-06 21:29 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-06 21:25 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-06 21:47 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-06 22:25 | 28K | |
| rubygem-sassc-rails-..> | 2023-10-08 01:09 | 28K | |
| rubygem-sassc22-2.2...> | 2023-10-06 18:24 | 644K | |
| rubygem-savon-2.11.2..> | 2023-10-10 23:59 | 130K | |
| rubygem-sawyer-0.9.2..> | 2023-10-06 14:57 | 9.2K | |
| rubygem-sax-machine-..> | 2023-10-07 18:28 | 21K | |
| rubygem-scanf-1.0.0.pkg | 2023-10-06 22:04 | 8.4K | |
| rubygem-scenic61-1.7..> | 2023-10-09 01:57 | 34K | |
| rubygem-schash-0.1.2..> | 2023-10-07 19:30 | 5.4K | |
| rubygem-scientist-1...> | 2023-10-08 23:57 | 19K | |
| rubygem-scruffy-0.2...> | 2023-10-09 03:28 | 162K | |
| rubygem-scrypt-3.0.7..> | 2023-10-08 12:33 | 20K | |
| rubygem-scss_lint-0...> | 2023-10-10 08:17 | 96K | |
| rubygem-sd_notify-0...> | 2023-10-06 18:33 | 3.8K | |
| rubygem-sdbm-1.0.0.pkg | 2023-10-07 07:50 | 12K | |
| rubygem-sdoc-2.6.1.pkg | 2023-10-07 06:45 | 173K | |
| rubygem-securecompar..> | 2023-10-09 16:23 | 4.1K | |
| rubygem-securerandom..> | 2023-10-10 06:22 | 6.7K | |
| rubygem-seed-fu-2.3...> | 2023-10-07 16:47 | 10K | |
| rubygem-select2-rail..> | 2023-10-11 07:21 | 53K | |
| rubygem-selenium-web..> | 2023-10-06 22:39 | 4.8M | |
| rubygem-semantic-ui-..> | 2023-10-09 09:56 | 657K | |
| rubygem-semantic_pup..> | 2023-10-06 20:15 | 26K | |
| rubygem-semantic_ran..> | 2023-10-06 21:34 | 7.9K | |
| rubygem-semi_semanti..> | 2023-10-10 10:45 | 3.2K | |
| rubygem-semver2-3.4...> | 2023-10-08 05:13 | 6.1K | |
| rubygem-semver_diale..> | 2023-10-08 22:52 | 9.8K | |
| rubygem-semver_diale..> | 2023-10-08 00:33 | 9.7K | |
| rubygem-semverse-3.0..> | 2023-10-06 22:09 | 7.8K | |
| rubygem-sentry-rails..> | 2023-10-07 13:38 | 16K | |
| rubygem-sentry-raven..> | 2023-10-08 09:23 | 45K | |
| rubygem-sentry-ruby-..> | 2023-10-07 04:51 | 46K | |
| rubygem-sentry-ruby-..> | 2023-10-09 01:38 | 40K | |
| rubygem-sentry-sidek..> | 2023-10-07 19:46 | 9.0K | |
| rubygem-sequel-5.72...> | 2023-10-06 21:41 | 603K | |
| rubygem-serialport-1..> | 2023-10-14 14:38 | 18K | |
| rubygem-server_sent_..> | 2023-10-07 15:10 | 9.4K | |
| rubygem-serverengine..> | 2023-10-06 22:52 | 36K | |
| rubygem-serverspec-2..> | 2023-10-14 06:37 | 38K | |
| rubygem-set-1.0.3.pkg | 2023-10-06 16:30 | 11K | |
| rubygem-settingslogi..> | 2023-10-14 03:08 | 8.3K | |
| rubygem-sexp_process..> | 2023-10-06 13:49 | 44K | |
| rubygem-shell-0.8.1.pkg | 2023-10-10 16:33 | 14K | |
| rubygem-shell2html-0..> | 2023-10-07 23:09 | 6.8K | |
| rubygem-shellany-0.0..> | 2023-10-06 19:08 | 5.7K | |
| rubygem-shellplay-0...> | 2023-10-09 22:03 | 43K | |
| rubygem-shellwords-0..> | 2023-10-14 09:57 | 6.0K | |
| rubygem-shoulda-4.0...> | 2023-10-14 07:07 | 17K | |
| rubygem-shoulda-cont..> | 2023-10-07 21:17 | 29K | |
| rubygem-shoulda-matc..> | 2023-10-07 22:57 | 68K | |
| rubygem-sidekiq-7.1...> | 2023-10-07 05:21 | 242K | |
| rubygem-sidekiq-bulk..> | 2023-10-10 05:44 | 7.4K | |
| rubygem-sidekiq-cron..> | 2023-10-14 06:27 | 26K | |
| rubygem-sidekiq-cron..> | 2023-10-07 15:30 | 24K | |
| rubygem-sidekiq-sche..> | 2023-10-14 17:18 | 22K | |
| rubygem-sidekiq-uniq..> | 2023-10-12 10:28 | 74K | |
| rubygem-sidekiq6-6.5..> | 2023-10-08 03:10 | 299K | |
| rubygem-sidetiq-0.7...> | 2023-10-10 16:49 | 19K | |
| rubygem-sigdump-0.2...> | 2023-10-06 18:26 | 8.4K | |
| rubygem-signet-0.18...> | 2023-10-06 11:58 | 27K | |
| rubygem-simple-navig..> | 2023-10-09 06:08 | 38K | |
| rubygem-simple-navig..> | 2023-10-08 22:10 | 38K | |
| rubygem-simple-navig..> | 2023-10-08 18:35 | 38K | |
| rubygem-simple-rss-1..> | 2023-10-07 11:27 | 29K | |
| rubygem-simple_form-..> | 2023-10-10 05:42 | 68K | |
| rubygem-simple_form-..> | 2023-10-10 00:25 | 70K | |
| rubygem-simple_form-..> | 2023-10-09 15:10 | 70K | |
| rubygem-simple_form-..> | 2023-10-08 22:24 | 70K | |
| rubygem-simple_oauth..> | 2023-10-07 05:28 | 5.5K | |
| rubygem-simple_po_pa..> | 2023-10-06 23:04 | 40K | |
| rubygem-simplecov-0...> | 2023-10-10 16:46 | 40K | |
| rubygem-simplecov-ht..> | 2023-10-07 18:29 | 273K | |
| rubygem-simplecov_js..> | 2023-10-07 23:17 | 3.2K | |
| rubygem-simpleidn-0...> | 2023-10-07 00:23 | 86K | |
| rubygem-sinatra-3.1...> | 2023-10-06 23:02 | 116K | |
| rubygem-sinatra-cont..> | 2023-10-08 06:49 | 28K | |
| rubygem-sinatra-cont..> | 2023-10-07 14:10 | 44K | |
| rubygem-sinatra-cont..> | 2023-10-07 10:26 | 28K | |
| rubygem-sinatra-r18n..> | 2023-10-09 17:36 | 11K | |
| rubygem-sinatra-resp..> | 2023-10-08 14:38 | 11K | |
| rubygem-sinatra1-1.4..> | 2023-10-07 02:01 | 276K | |
| rubygem-sinatra2-2.2..> | 2023-10-07 00:04 | 264K | |
| rubygem-singleton-0...> | 2023-10-06 14:56 | 4.7K | |
| rubygem-sitemap_gene..> | 2023-10-09 12:54 | 43K | |
| rubygem-six-0.2.2.pkg | 2023-10-10 02:56 | 2.8K | |
| rubygem-sixarm_ruby_..> | 2023-10-07 01:24 | 44K | |
| rubygem-skiptrace-0...> | 2023-10-14 17:22 | 16K | |
| rubygem-slack-messen..> | 2023-10-07 19:31 | 10K | |
| rubygem-slack-notifi..> | 2023-10-10 15:38 | 10K | |
| rubygem-slim-5.1.1.pkg | 2023-10-11 10:59 | 80K | |
| rubygem-slop-4.10.1.pkg | 2023-10-06 23:18 | 17K | |
| rubygem-slop3-3.6.0.pkg | 2023-10-07 10:37 | 19K | |
| rubygem-slow_enumera..> | 2023-10-06 14:14 | 9.3K | |
| rubygem-smart_proper..> | 2023-10-07 00:16 | 19K | |
| rubygem-smart_proxy_..> | 2023-10-08 01:45 | 29K | |
| rubygem-smart_proxy_..> | 2023-10-09 07:54 | 34K | |
| rubygem-smart_proxy_..> | 2023-10-09 12:09 | 25K | |
| rubygem-smashing-1.3..> | 2023-10-08 13:45 | 1.2M | |
| rubygem-snaky_hash-2..> | 2023-10-06 16:48 | 9.2K | |
| rubygem-snappy-0.0.1..> | 2023-10-10 10:04 | 321K | |
| rubygem-snmp-1.2.0.pkg | 2023-10-08 15:42 | 159K | |
| rubygem-snowplow-tra..> | 2023-10-07 22:42 | 22K | |
| rubygem-soap4r-1.5.8..> | 2023-10-07 12:00 | 231K | |
| rubygem-socksify-1.7..> | 2023-10-06 18:43 | 17K | |
| rubygem-solve-4.0.4.pkg | 2023-10-09 20:05 | 14K | |
| rubygem-sorbet-runti..> | 2023-10-07 10:24 | 72K | |
| rubygem-sorted_set-1..> | 2023-10-06 20:09 | 4.5K | |
| rubygem-spamcheck-1...> | 2023-10-08 07:41 | 2.7K | |
| rubygem-specinfra-2...> | 2023-10-07 23:34 | 83K | |
| rubygem-spreadsheet-..> | 2023-10-09 07:53 | 157K | |
| rubygem-spring-4.1.1..> | 2023-10-07 00:55 | 26K | |
| rubygem-spring-watch..> | 2023-10-10 18:11 | 5.3K | |
| rubygem-sprockets-4...> | 2023-10-07 15:26 | 68K | |
| rubygem-sprockets-es..> | 2023-10-08 12:44 | 3.2K | |
| rubygem-sprockets-he..> | 2023-10-08 06:00 | 13K | |
| rubygem-sprockets-ra..> | 2023-10-06 16:13 | 11K | |
| rubygem-sprockets-ra..> | 2023-10-06 17:53 | 11K | |
| rubygem-sprockets-ra..> | 2023-10-06 17:24 | 11K | |
| rubygem-sprockets-ra..> | 2023-10-06 16:52 | 12K | |
| rubygem-sprockets-ra..> | 2023-10-06 18:03 | 12K | |
| rubygem-sprockets-ra..> | 2023-10-06 17:48 | 12K | |
| rubygem-sprockets-ra..> | 2023-10-06 22:10 | 12K | |
| rubygem-sprockets-sa..> | 2023-10-10 12:52 | 12K | |
| rubygem-sprockets2-2..> | 2023-10-08 07:33 | 35K | |
| rubygem-sprockets3-3..> | 2023-10-06 14:27 | 59K | |
| rubygem-spruz-0.2.13..> | 2023-10-14 05:18 | 21K | |
| rubygem-sqlite3-1.6...> | 2023-10-06 22:08 | 3.1M | |
| rubygem-sqlite3-ruby..> | 2023-10-07 22:04 | 5.6K | |
| rubygem-ssh_data-1.3..> | 2023-10-07 23:49 | 14K | |
| rubygem-sshkey-3.0.0..> | 2023-10-07 20:45 | 25K | |
| rubygem-sshkit-1.21...> | 2023-10-06 22:14 | 134K | |
| rubygem-sslshake-1.3..> | 2023-10-06 20:33 | 8.8K | |
| rubygem-ssrf_filter-..> | 2023-10-07 05:58 | 5.5K | |
| rubygem-stackdriver-..> | 2023-10-07 19:40 | 13K | |
| rubygem-stackprof-0...> | 2023-10-08 10:24 | 64K | |
| rubygem-stamp-0.6.0.pkg | 2023-10-08 22:09 | 9.5K | |
| rubygem-state_machin..> | 2023-10-09 17:32 | 474K | |
| rubygem-state_machin..> | 2023-10-06 22:47 | 50K | |
| rubygem-state_machin..> | 2023-10-07 05:59 | 12K | |
| rubygem-state_machin..> | 2023-10-10 04:41 | 19K | |
| rubygem-state_machin..> | 2023-10-07 23:03 | 20K | |
| rubygem-statsd-0.5.4..> | 2023-10-08 14:48 | 8.0K | |
| rubygem-statsd-instr..> | 2023-10-10 18:12 | 51K | |
| rubygem-statsd-ruby-..> | 2023-10-08 03:48 | 12K | |
| rubygem-stella-2.1.2..> | 2023-10-10 03:00 | 1.0M | |
| rubygem-stemmer-1.0...> | 2023-10-11 05:37 | 2.5K | |
| rubygem-stimulus-rai..> | 2023-10-06 21:27 | 58K | |
| rubygem-stomp-1.4.10..> | 2023-10-12 06:28 | 78K | |
| rubygem-stompserver-..> | 2023-10-10 12:57 | 27K | |
| rubygem-stoplight-4...> | 2023-10-10 04:32 | 23K | |
| rubygem-storable-0.8..> | 2023-10-06 22:12 | 13K | |
| rubygem-stream-0.5.5..> | 2023-10-07 06:36 | 11K | |
| rubygem-streamio-ffm..> | 2023-10-09 12:50 | 14K | |
| rubygem-stringex-2.8..> | 2023-10-07 08:28 | 99K | |
| rubygem-stringio-3.0..> | 2023-10-06 12:35 | 15K | |
| rubygem-strings-0.2...> | 2023-10-06 13:52 | 11K | |
| rubygem-strings-ansi..> | 2023-10-06 12:45 | 6.5K | |
| rubygem-strong_migra..> | 2023-10-09 16:38 | 23K | |
| rubygem-strong_migra..> | 2023-10-09 10:12 | 23K | |
| rubygem-strptime-0.2..> | 2023-10-06 19:08 | 16K | |
| rubygem-strscan-3.0...> | 2023-10-09 14:18 | 12K | |
| rubygem-structured_w..> | 2023-10-09 12:20 | 8.6K | |
| rubygem-stud-0.0.23.pkg | 2023-10-07 02:43 | 12K | |
| rubygem-subexec-0.2...> | 2023-10-11 03:43 | 2.6K | |
| rubygem-sucker_punch..> | 2023-10-06 21:12 | 15K | |
| rubygem-sugar-high-0..> | 2023-10-14 04:57 | 20K | |
| rubygem-sumbur-0.1.2..> | 2023-10-08 02:57 | 5.3K | |
| rubygem-sundawg_coun..> | 2023-10-09 08:26 | 13K | |
| rubygem-svn2git-2.4...> | 2023-10-09 01:48 | 14K | |
| rubygem-swagger-bloc..> | 2023-10-08 08:27 | 19K | |
| rubygem-swd-1.2.0.pkg | 2023-10-06 22:05 | 7.9K | |
| rubygem-sync-0.5.0.pkg | 2023-10-06 22:43 | 5.0K | |
| rubygem-syntax-1.2.2..> | 2023-10-14 12:18 | 16K | |
| rubygem-syntax_sugge..> | 2023-10-09 10:08 | 33K | |
| rubygem-syntax_tree-..> | 2023-10-08 05:46 | 167K | |
| rubygem-sys-admin-1...> | 2023-10-10 17:15 | 26K | |
| rubygem-sys-cpu-1.0...> | 2023-10-14 02:56 | 25K | |
| rubygem-sys-filesyst..> | 2023-10-06 17:25 | 23K | |
| rubygem-sys-host-0.6..> | 2023-10-10 22:15 | 9.7K | |
| rubygem-sys-proctabl..> | 2023-10-07 22:58 | 42K | |
| rubygem-sys-uname-1...> | 2023-10-07 01:38 | 20K | |
| rubygem-sys-uptime-0..> | 2023-10-09 10:16 | 14K | |
| rubygem-sysinfo-0.8...> | 2023-10-07 09:12 | 8.7K | |
| rubygem-syslog-0.1.1..> | 2023-10-09 19:23 | 10K | |
| rubygem-syslog-logge..> | 2023-10-07 05:14 | 6.3K | |
| rubygem-systemu-2.6...> | 2023-10-06 20:15 | 12K | |
| rubygem-t-4.0.0.pkg | 2023-10-09 01:30 | 24K | |
| rubygem-table_print-..> | 2023-10-10 17:28 | 22K | |
| rubygem-tailwindcss-..> | 2023-10-06 21:21 | 684K | |
| rubygem-tanuki_emoji..> | 2023-10-07 10:14 | 6.1M | |
| rubygem-tarantool-0...> | 2023-10-09 22:36 | 40K | |
| rubygem-task_list-1...> | 2023-10-09 16:40 | 13K | |
| rubygem-taskjuggler-..> | 2023-10-10 06:07 | 564K | |
| rubygem-tdiff-0.3.4.pkg | 2023-10-08 04:09 | 6.6K | |
| rubygem-teamocil-1.4..> | 2023-10-09 02:31 | 12K | |
| rubygem-telesign-2.2..> | 2023-10-07 05:15 | 4.9K | |
| rubygem-telesignente..> | 2023-10-08 00:27 | 3.9K | |
| rubygem-tempfile-0.1..> | 2023-10-09 12:27 | 7.4K | |
| rubygem-templater-1...> | 2023-10-10 03:26 | 27K | |
| rubygem-temple-0.10...> | 2023-10-06 23:04 | 35K | |
| rubygem-term-ansicol..> | 2023-10-08 06:19 | 37K | |
| rubygem-termcolor-1...> | 2023-10-08 06:53 | 4.6K | |
| rubygem-terminal-tab..> | 2023-10-06 16:16 | 17K | |
| rubygem-termtter-2.2..> | 2023-10-12 12:45 | 1.4M | |
| rubygem-terrapin-0.6..> | 2023-10-06 19:31 | 14K | |
| rubygem-terser-1.0.2..> | 2023-10-08 00:46 | 111K | |
| rubygem-terser11-1.1..> | 2023-10-08 13:35 | 143K | |
| rubygem-test-unit-3...> | 2023-10-08 01:12 | 77K | |
| rubygem-text-1.3.1.pkg | 2023-10-06 17:43 | 99K | |
| rubygem-thin-1.8.2.pkg | 2023-10-07 22:56 | 51K | |
| rubygem-thor-1.2.2.pkg | 2023-10-06 14:26 | 44K | |
| rubygem-thor0-0.20.3..> | 2023-10-07 09:56 | 46K | |
| rubygem-thor10-1.0.1..> | 2023-10-08 08:53 | 46K | |
| rubygem-thread_safe-..> | 2023-10-06 08:45 | 34K | |
| rubygem-thrift-0.16...> | 2023-10-06 19:11 | 71K | |
| rubygem-thwait-0.2.0..> | 2023-10-14 13:53 | 4.3K | |
| rubygem-tidy_ffi-1.0..> | 2023-10-10 02:10 | 8.7K | |
| rubygem-tilt-2.2.0.pkg | 2023-10-06 16:18 | 22K | |
| rubygem-tilt1-1.4.1.pkg | 2023-10-07 01:33 | 36K | |
| rubygem-time-0.2.2.pkg | 2023-10-06 21:40 | 10K | |
| rubygem-timecop-0.9...> | 2023-10-10 03:24 | 8.2K | |
| rubygem-timeliness-0..> | 2023-10-06 16:59 | 21K | |
| rubygem-timeout-0.4...> | 2023-10-06 11:50 | 4.5K | |
| rubygem-timers-4.3.5..> | 2023-10-06 15:07 | 8.8K | |
| rubygem-timfel-krb5-..> | 2023-10-08 06:17 | 8.4K | |
| rubygem-tinder-1.10...> | 2023-10-09 19:34 | 15K | |
| rubygem-tins-1.32.1.pkg | 2023-10-07 03:56 | 86K | |
| rubygem-tinyatom-0.3..> | 2023-10-08 16:21 | 4.3K | |
| rubygem-tinymce-rail..> | 2023-10-09 23:43 | 495K | |
| rubygem-titlecase-0...> | 2023-10-08 00:14 | 3.0K | |
| rubygem-tk-0.4.0.pkg | 2023-10-09 08:20 | 1.2M | |
| rubygem-tmpdir-0.1.3..> | 2023-10-11 23:56 | 4.9K | |
| rubygem-tmuxinator-3..> | 2023-10-09 21:38 | 27K | |
| rubygem-to_regexp-0...> | 2023-10-10 03:29 | 5.9K | |
| rubygem-toml-0.3.0.pkg | 2023-10-14 11:24 | 6.9K | |
| rubygem-toml-rb-2.2...> | 2023-10-07 01:25 | 8.2K | |
| rubygem-tomlrb-2.0.3..> | 2023-10-06 13:03 | 9.3K | |
| rubygem-tomlrb1-1.3...> | 2023-10-06 15:33 | 6.4K | |
| rubygem-tool-0.2.3.pkg | 2023-10-10 13:23 | 6.8K | |
| rubygem-totoridipjp-..> | 2023-10-07 22:59 | 3.6K | |
| rubygem-tpm-key_atte..> | 2023-10-07 03:40 | 28K | |
| rubygem-tracer-0.2.2..> | 2023-10-14 09:30 | 10K | |
| rubygem-traces-0.11...> | 2023-10-06 21:29 | 8.5K | |
| rubygem-trailblazer-..> | 2023-10-06 10:58 | 6.2K | |
| rubygem-train-3.10.8..> | 2023-10-10 23:37 | 13K | |
| rubygem-train-core-3..> | 2023-10-06 21:51 | 39K | |
| rubygem-train-rest-0..> | 2023-10-07 07:55 | 10K | |
| rubygem-train-winrm-..> | 2023-10-07 08:56 | 9.8K | |
| rubygem-transaction-..> | 2023-10-07 13:07 | 13K | |
| rubygem-travis-1.11...> | 2023-10-09 08:42 | 165K | |
| rubygem-treetop-1.6...> | 2023-10-06 14:15 | 74K | |
| rubygem-trollop-2.9...> | 2023-10-07 14:53 | 24K | |
| rubygem-trollop1-1.1..> | 2023-10-08 00:44 | 17K | |
| rubygem-truncato-0.7..> | 2023-10-08 04:01 | 5.1K | |
| rubygem-tsort-0.1.1.pkg | 2023-10-10 15:33 | 6.3K | |
| rubygem-ttfunk-1.7.0..> | 2023-10-06 11:27 | 55K | |
| rubygem-tty-0.10.0_1..> | 2023-10-09 18:03 | 43K | |
| rubygem-tty-box-0.7...> | 2023-10-06 18:28 | 9.4K | |
| rubygem-tty-color-0...> | 2023-10-06 12:58 | 6.1K | |
| rubygem-tty-command-..> | 2023-10-07 07:13 | 18K | |
| rubygem-tty-config-0..> | 2023-10-07 23:01 | 17K | |
| rubygem-tty-cursor-0..> | 2023-10-06 13:25 | 5.9K | |
| rubygem-tty-editor-0..> | 2023-10-07 12:04 | 8.3K | |
| rubygem-tty-file-0.1..> | 2023-10-07 15:37 | 16K | |
| rubygem-tty-font-0.5..> | 2023-10-07 18:51 | 14K | |
| rubygem-tty-logger-0..> | 2023-10-07 16:15 | 17K | |
| rubygem-tty-markdown..> | 2023-10-07 14:51 | 13K | |
| rubygem-tty-pager-0...> | 2023-10-08 11:21 | 11K | |
| rubygem-tty-pie-0.4...> | 2023-10-07 21:05 | 7.8K | |
| rubygem-tty-platform..> | 2023-10-06 15:13 | 4.4K | |
| rubygem-tty-progress..> | 2023-10-07 18:26 | 24K | |
| rubygem-tty-prompt-0..> | 2023-10-06 16:50 | 41K | |
| rubygem-tty-reader-0..> | 2023-10-06 13:43 | 14K | |
| rubygem-tty-screen-0..> | 2023-10-06 12:55 | 6.7K | |
| rubygem-tty-spinner-..> | 2023-10-07 22:36 | 13K | |
| rubygem-tty-table-0...> | 2023-10-06 18:40 | 24K | |
| rubygem-tty-tree-0.4..> | 2023-10-08 00:41 | 7.2K | |
| rubygem-tty-which-0...> | 2023-10-07 10:11 | 4.9K | |
| rubygem-tumblr_clien..> | 2023-10-10 13:09 | 14K | |
| rubygem-turbo-rails-..> | 2023-10-06 21:34 | 107K | |
| rubygem-turbolinks-5..> | 2023-10-07 03:31 | 3.4K | |
| rubygem-turbolinks-s..> | 2023-10-06 23:00 | 10K | |
| rubygem-turn-0.9.7_1..> | 2023-10-09 03:47 | 28K | |
| rubygem-tweetstream-..> | 2023-10-14 05:38 | 29K | |
| rubygem-twitter-8.0...> | 2023-10-07 14:17 | 66K | |
| rubygem-twitter-stre..> | 2023-10-07 12:08 | 10K | |
| rubygem-twitter-text..> | 2023-10-07 05:39 | 46K | |
| rubygem-twitter-text..> | 2023-10-06 23:59 | 37K | |
| rubygem-twitter4r-0...> | 2023-10-10 02:04 | 34K | |
| rubygem-twitter_oaut..> | 2023-10-08 01:53 | 9.4K | |
| rubygem-typed-array-..> | 2023-10-08 09:30 | 7.1K | |
| rubygem-typeprof-0.2..> | 2023-10-10 14:56 | 60K | |
| rubygem-typhoeus-1.4..> | 2023-10-08 04:29 | 48K | |
| rubygem-tzinfo-2.0.6..> | 2023-10-06 09:36 | 61K | |
| rubygem-tzinfo-data-..> | 2023-10-06 19:56 | 142K | |
| rubygem-tzinfo1-1.2...> | 2023-10-06 09:21 | 122K | |
| rubygem-u2f-1.0.0.pkg | 2023-10-09 10:36 | 11K | |
| rubygem-uber-0.1.0.pkg | 2023-10-06 11:58 | 11K | |
| rubygem-uglifier-4.2..> | 2023-10-07 03:51 | 115K | |
| rubygem-uh-2.1.1.pkg | 2023-10-07 21:45 | 18K | |
| rubygem-uh-layout-0...> | 2023-10-08 03:37 | 6.0K | |
| rubygem-uh-wm-0.2.1.pkg | 2023-10-09 07:50 | 13K | |
| rubygem-un-0.2.1.pkg | 2023-10-09 07:35 | 6.4K | |
| rubygem-underscore-r..> | 2023-10-10 12:00 | 16K | |
| rubygem-unf-0.1.4.pkg | 2023-10-06 10:46 | 65K | |
| rubygem-unf_ext-0.0...> | 2023-10-06 09:32 | 151K | |
| rubygem-unicode-0.4...> | 2023-10-11 09:19 | 75K | |
| rubygem-unicode-disp..> | 2023-10-06 12:41 | 9.5K | |
| rubygem-unicode_plot..> | 2023-10-07 11:43 | 26K | |
| rubygem-unicode_util..> | 2023-10-06 13:19 | 168K | |
| rubygem-unicorn-6.1...> | 2023-10-07 17:15 | 177K | |
| rubygem-unicorn-work..> | 2023-10-08 15:49 | 5.6K | |
| rubygem-unix-crypt-1..> | 2023-10-07 18:32 | 9.1K | |
| rubygem-unleash-3.2...> | 2023-10-08 05:27 | 21K | |
| rubygem-uri-0.12.2.pkg | 2023-10-07 03:17 | 28K | |
| rubygem-uri-redis-1...> | 2023-10-07 09:50 | 5.5K | |
| rubygem-uri_template..> | 2023-10-07 03:47 | 18K | |
| rubygem-url_escape-2..> | 2023-10-08 19:33 | 15K | |
| rubygem-url_mount-0...> | 2023-10-06 20:36 | 13K | |
| rubygem-url_safe_bas..> | 2023-10-12 11:46 | 3.5K | |
| rubygem-useragent-0...> | 2023-10-08 07:10 | 11K | |
| rubygem-uuid-2.3.9.pkg | 2023-10-08 03:33 | 11K | |
| rubygem-uuidtools-2...> | 2023-10-06 21:34 | 21K | |
| rubygem-vagrant-bhyv..> | 2023-10-10 18:57 | 18K | |
| rubygem-vagrant-muta..> | 2023-10-09 00:59 | 22K | |
| rubygem-vagrant-vbgu..> | 2023-10-09 21:41 | 34K | |
| rubygem-vagrant_clou..> | 2023-10-07 17:43 | 16K | |
| rubygem-valid-1.2.0.pkg | 2023-10-10 18:59 | 5.7K | |
| rubygem-valid_email-..> | 2023-10-07 14:47 | 13K | |
| rubygem-validatable-..> | 2023-10-09 16:01 | 13K | |
| rubygem-validate_ema..> | 2023-10-06 22:23 | 2.4K | |
| rubygem-validate_url..> | 2023-10-06 20:28 | 5.2K | |
| rubygem-validates_ho..> | 2023-10-07 13:12 | 10K | |
| rubygem-validates_ti..> | 2023-10-09 18:17 | 24K | |
| rubygem-vault-0.17.0..> | 2023-10-07 06:05 | 43K | |
| rubygem-vcr-6.2.0.pkg | 2023-10-08 14:53 | 35K | |
| rubygem-vegas-0.1.11..> | 2023-10-07 00:20 | 9.4K | |
| rubygem-version_gem-..> | 2023-10-06 15:10 | 13K | |
| rubygem-version_sort..> | 2023-10-08 02:24 | 5.3K | |
| rubygem-versionomy-0..> | 2023-10-08 03:17 | 42K | |
| rubygem-view_compone..> | 2023-10-11 11:42 | 53K | |
| rubygem-view_compone..> | 2023-10-08 04:53 | 53K | |
| rubygem-vimgolf-0.5...> | 2023-10-14 13:18 | 10K | |
| rubygem-virtus-2.0.0..> | 2023-10-06 16:21 | 43K | |
| rubygem-visage-app-2..> | 2023-10-08 14:38 | 270K | |
| rubygem-vmail-2.9.8_..> | 2023-10-08 20:25 | 64K | |
| rubygem-vmstat-2.3.1..> | 2023-10-07 16:13 | 23K | |
| rubygem-vpim-13.11.1..> | 2023-10-10 04:02 | 82K | |
| rubygem-vte3-4.2.0.pkg | 2023-10-07 16:04 | 15K | |
| rubygem-vte4-4.2.0.pkg | 2023-10-07 12:52 | 15K | |
| rubygem-warbler-2.0...> | 2023-10-10 20:26 | 54K | |
| rubygem-warden-1.2.9..> | 2023-10-06 19:44 | 16K | |
| rubygem-warning-1.3...> | 2023-10-07 12:58 | 6.7K | |
| rubygem-wasabi-3.5.0..> | 2023-10-08 09:28 | 143K | |
| rubygem-wdm-0.1.1.pkg | 2023-10-08 04:10 | 3.9K | |
| rubygem-weakref-0.1...> | 2023-10-10 19:13 | 4.2K | |
| rubygem-web-console-..> | 2023-10-07 02:25 | 25K | |
| rubygem-web-console-..> | 2023-10-07 04:11 | 25K | |
| rubygem-web-console2..> | 2023-10-07 07:26 | 22K | |
| rubygem-web-console3..> | 2023-10-07 07:28 | 24K | |
| rubygem-web-console3..> | 2023-10-07 05:39 | 24K | |
| rubygem-web-console3..> | 2023-10-07 05:33 | 24K | |
| rubygem-webauthn-3.0..> | 2023-10-07 20:14 | 34K | |
| rubygem-webby-0.9.4_..> | 2023-10-09 19:40 | 190K | |
| rubygem-webdrivers-5..> | 2023-10-09 23:34 | 23K | |
| rubygem-webfinger-1...> | 2023-10-06 18:50 | 7.9K | |
| rubygem-webmock-3.19..> | 2023-10-06 18:38 | 56K | |
| rubygem-webpacker-ra..> | 2023-10-09 13:59 | 200K | |
| rubygem-webpacker-ra..> | 2023-10-07 03:47 | 200K | |
| rubygem-webpacker4-r..> | 2023-10-07 00:44 | 192K | |
| rubygem-webpush-1.1...> | 2023-10-08 21:09 | 13K | |
| rubygem-webrick-1.8...> | 2023-10-06 12:26 | 49K | |
| rubygem-webrobots-0...> | 2023-10-07 07:28 | 18K | |
| rubygem-websocket-1...> | 2023-10-06 16:15 | 24K | |
| rubygem-websocket-cl..> | 2023-10-09 16:04 | 7.2K | |
| rubygem-websocket-dr..> | 2023-10-06 17:28 | 19K | |
| rubygem-websocket-ex..> | 2023-10-06 15:03 | 7.0K | |
| rubygem-whatlanguage..> | 2023-10-11 00:44 | 2.7M | |
| rubygem-whois-5.1.0.pkg | 2023-10-07 15:27 | 78K | |
| rubygem-wikicloth-0...> | 2023-10-09 13:28 | 106K | |
| rubygem-wikicloth081..> | 2023-10-08 04:47 | 106K | |
| rubygem-will_paginat..> | 2023-10-10 22:34 | 15K | |
| rubygem-win32-file-0..> | 2023-10-14 13:27 | 16K | |
| rubygem-win32-file-s..> | 2023-10-14 09:12 | 15K | |
| rubygem-win32-file-s..> | 2023-10-07 16:11 | 18K | |
| rubygem-windows_erro..> | 2023-10-07 09:23 | 240K | |
| rubygem-winrm-2.3.6.pkg | 2023-10-06 14:45 | 36K | |
| rubygem-winrm-elevat..> | 2023-10-06 22:32 | 9.2K | |
| rubygem-winrm-fs-1.3..> | 2023-10-06 17:20 | 18K | |
| rubygem-wisper-2.0.1..> | 2023-10-06 12:25 | 18K | |
| rubygem-with_env-1.1..> | 2023-10-07 06:12 | 3.7K | |
| rubygem-wmi-lite-1.0..> | 2023-10-06 21:13 | 6.5K | |
| rubygem-xdg2-2.2.5.pkg | 2023-10-07 13:27 | 12K | |
| rubygem-xdg3-3.1.1_1..> | 2023-10-09 22:43 | 11K | |
| rubygem-xdg4-4.5.0_1..> | 2023-10-10 22:52 | 10K | |
| rubygem-xdg5-5.3.0.pkg | 2023-10-08 21:10 | 10K | |
| rubygem-xdg6-6.6.2.pkg | 2023-10-10 10:55 | 10K | |
| rubygem-xdr-3.0.3.pkg | 2023-10-08 02:14 | 13K | |
| rubygem-xml-simple-1..> | 2023-10-06 17:46 | 8.5K | |
| rubygem-xmlrpc-0.3.3..> | 2023-10-06 16:32 | 24K | |
| rubygem-xorcist-1.1...> | 2023-10-08 13:56 | 5.1K | |
| rubygem-xpath-3.2.0.pkg | 2023-10-06 17:22 | 10K | |
| rubygem-xxhash-0.5.0..> | 2023-10-10 17:28 | 12K | |
| rubygem-ya2yaml-0.31..> | 2023-10-09 09:10 | 9.2K | |
| rubygem-yajl-ruby-1...> | 2023-10-06 22:24 | 385K | |
| rubygem-yapra-0.2.2.pkg | 2023-10-09 20:46 | 39K | |
| rubygem-yard-0.9.34.pkg | 2023-10-07 08:29 | 546K | |
| rubygem-yard-chef-2...> | 2023-10-14 11:16 | 116K | |
| rubygem-yarp-0.11.0.pkg | 2023-10-07 10:31 | 534K | |
| rubygem-yell-2.2.2.pkg | 2023-10-07 21:57 | 20K | |
| rubygem-yui-compress..> | 2023-10-08 18:36 | 735K | |
| rubygem-zeitwerk-2.6..> | 2023-10-06 10:02 | 31K | |
| rubygem-zentest-4.12..> | 2023-10-06 19:15 | 38K | |
| rubygem-zhexdump-0.0..> | 2023-10-07 07:11 | 5.7K | |
| rubygem-zlib-3.0.0.pkg | 2023-10-14 11:13 | 28K | |
| rubygem-zmq-2.1.4_1.pkg | 2023-10-12 03:20 | 21K | |
| rubygem-zonefile-1.0..> | 2023-10-07 22:16 | 8.5K | |
| rubygem-zstd-ruby-1...> | 2023-10-14 17:44 | 288K | |
| rubymine-2023.1.1_1.pkg | 2023-10-09 14:47 | 219M | |
| rude-0.70_4.pkg | 2023-10-10 10:30 | 35K | |
| rudeconfig-5.0.5_3.pkg | 2023-10-09 12:37 | 60K | |
| rudiments-1.4.2.pkg | 2023-10-06 23:39 | 1.2M | |
| ruff-0.0.289.pkg | 2023-10-09 22:25 | 3.5M | |
| rump-20170822_2.pkg | 2023-10-10 23:29 | 3.5M | |
| rumur-2023.05.21.pkg | 2023-10-14 04:46 | 431K | |
| runas-0.1.1.pkg | 2023-10-09 21:50 | 4.2K | |
| runawk-1.6.1.pkg | 2023-10-08 07:26 | 60K | |
| rundeck3-3.4.10.pkg | 2023-10-14 05:48 | 140M | |
| runelite-2.2.0.pkg | 2023-10-14 04:11 | 2.2M | |
| runiq-1.2.2_7.pkg | 2023-10-10 14:19 | 289K | |
| runit-2.1.2_4.pkg | 2023-10-08 07:26 | 301K | |
| runit-faster-2.1.3.7..> | 2023-10-11 16:10 | 326K | |
| runj-g20230316_2.pkg | 2023-10-10 03:30 | 4.7M | |
| runner-1.1.pkg | 2023-10-10 05:10 | 188K | |
| runwhen-2021.04.30_2..> | 2023-10-14 12:17 | 10K | |
| ruqola-1.9.2.pkg | 2023-10-11 03:18 | 1.7M | |
| rush-2.3.pkg | 2023-10-09 07:26 | 237K | |
| rush-parallelization..> | 2023-10-14 01:51 | 2.2M | |
| rust-1.72.0.pkg | 2023-10-05 20:50 | 130M | |
| rust-analyzer-2023.0..> | 2023-10-06 00:40 | 6.4M | |
| rust-bindgen-cli-0.6..> | 2023-10-06 00:19 | 1.3M | |
| rust-cbindgen-0.24.3..> | 2023-10-06 00:18 | 1.0M | |
| rust-coreutils-0.0.2..> | 2023-10-05 23:32 | 2.2M | |
| rust-findutils-0.4.2..> | 2023-10-06 00:44 | 627K | |
| rust-nightly-1.72.0...> | 2023-10-06 00:06 | 227M | |
| rustc-demangle-0.1.2..> | 2023-10-06 00:44 | 281K | |
| rustdesk-server-1.1...> | 2023-10-06 02:16 | 1.8M | |
| rustscan-2.1.1_9.pkg | 2023-10-06 00:27 | 1.5M | |
| rustypaste-0.13.0_1.pkg | 2023-10-06 00:09 | 1.5M | |
| rustypaste-cli-0.7.0..> | 2023-10-06 00:55 | 933K | |
| ruut-0.7.0_11.pkg | 2023-10-09 19:31 | 308K | |
| rvi-1.0.0.pkg | 2023-10-09 13:18 | 5.5K | |
| rvm-1.20.pkg | 2023-10-10 01:02 | 153K | |
| rvman-1.11_6.pkg | 2023-10-14 09:47 | 449K | |
| rw-1.0_1.pkg | 2023-10-10 01:22 | 12K | |
| rw-aspell-0.50.0_1,1..> | 2023-10-14 08:32 | 35K | |
| rw-libreoffice-7.5.5..> | 2023-10-07 22:03 | 240K | |
| rx-editor-0.5.2_21.pkg | 2023-10-09 13:09 | 670K | |
| rxcpp-4.1.1.23.pkg | 2023-10-14 06:01 | 88K | |
| rxp-1.4.4_2.pkg | 2023-10-14 07:03 | 123K | |
| rxtx-openjdk8-2.2p2_..> | 2023-10-07 06:23 | 83K | |
| rxvt-unicode-9.31.pkg | 2023-10-08 08:39 | 845K | |
| rzip-2.1_1.pkg | 2023-10-07 14:17 | 15K | |
| s-0.6.8_2.pkg | 2023-10-09 16:03 | 2.3M | |
| s-nail-14.9.24.pkg | 2023-10-08 12:13 | 537K | |
| s-news-0.1.11_5.pkg | 2023-10-09 09:42 | 45K | |
| s-tui-1.1.4.pkg | 2023-10-09 01:31 | 56K | |
| s2-0.10.0_5.pkg | 2023-10-07 22:12 | 787K | |
| s2n-tls-1.3.51,1.pkg | 2023-10-06 09:19 | 1.1M | |
| s2tc-1.0+20151228_3.pkg | 2023-10-09 07:44 | 95K | |
| s3mod-1.09_2.pkg | 2023-10-14 12:25 | 12K | |
| s5-1.1_2.pkg | 2023-10-10 18:21 | 391K | |
| s5cmd-2.2.2.pkg | 2023-10-10 10:59 | 3.4M | |
| s6-2.11.3.2.pkg | 2023-10-08 07:48 | 316K | |
| s6-rc-0.5.4.1.pkg | 2023-10-14 10:41 | 132K | |
| s6-rc-run-0.5.4.1.pkg | 2023-10-08 21:18 | 132K | |
| s10sh-0.2.2_3.pkg | 2023-10-09 05:52 | 27K | |
| s390x-binutils-2.40_..> | 2023-10-09 18:15 | 1.8M | |
| sa-stats-1.0_3.pkg | 2023-10-14 14:20 | 3.6K | |
| sa-utils-0.04.pkg | 2023-10-08 16:58 | 2.3K | |
| sa_IN-libreoffice-7...> | 2023-10-08 05:49 | 296K | |
| sablevm-1.13_14.pkg | 2023-10-09 07:38 | 137K | |
| sablevm-classpath-1...> | 2023-10-08 00:57 | 6.2M | |
| sablotron-1.0.3_4.pkg | 2023-10-07 16:32 | 489K | |
| sabnzbd-4.0.2_1.pkg | 2023-10-10 02:20 | 1.0M | |
| sabre-20100501.pkg | 2023-10-07 11:44 | 126K | |
| sabredav-4.4.0.pkg | 2023-10-10 07:16 | 204K | |
| sacc-1.01.pkg | 2023-10-10 09:08 | 16K | |
| sad-0.4.23_2.pkg | 2023-10-14 09:02 | 673K | |
| safe-iop-0.3.2.pkg | 2023-10-09 09:56 | 9.9K | |
| safe-rm-0.12.pkg | 2023-10-09 03:16 | 4.6K | |
| safecat-1.13.pkg | 2023-10-12 12:02 | 14K | |
| safecopy-1.7.pkg | 2023-10-09 15:57 | 28K | |
| safesh-1.5.pkg | 2023-10-10 22:55 | 8.3K | |
| saga-9.1.2.pkg | 2023-10-10 06:18 | 6.4M | |
| sage-0.2.0_8.pkg | 2023-10-14 18:29 | 93K | |
| sagittarius-scheme-0..> | 2023-10-08 19:42 | 2.3M | |
| sake-0.15.0_2.pkg | 2023-10-08 20:46 | 2.3M | |
| sakisafe-2.2.1.pkg | 2023-10-09 18:28 | 6.5K | |
| sakura-3.8.7.pkg | 2023-10-14 17:08 | 51K | |
| salmon-1.10.2_1.pkg | 2023-10-11 07:23 | 15M | |
| salome-configuration..> | 2023-10-07 15:43 | 79K | |
| salome-kernel-9.11.0..> | 2023-10-09 01:50 | 4.4M | |
| salut-0.3.1_9.pkg | 2023-10-10 03:44 | 1.7M | |
| sam-g20230103_1.pkg | 2023-10-10 15:08 | 103K | |
| sam2p-0.49.4_3,1.pkg | 2023-10-08 19:14 | 207K | |
| sam2pairwise-1.0.0.pkg | 2023-10-07 16:54 | 16K | |
| samba-nsupdate-9.16...> | 2023-10-08 06:29 | 917K | |
| samba413-4.13.17_5.pkg | 2023-10-06 15:02 | 13M | |
| samdruckerserver-0.2..> | 2023-10-08 22:44 | 5.4K | |
| sameboy-0.15.8.pkg | 2023-10-09 07:12 | 404K | |
| samefile-2.15_1.pkg | 2023-10-10 09:37 | 12K | |
| samesame-1.10_2.pkg | 2023-10-14 14:35 | 869K | |
| samhain-4.4.3.pkg | 2023-10-11 00:06 | 612K | |
| samhain-client-4.4.3..> | 2023-10-09 04:27 | 634K | |
| samhain-server-4.4.3..> | 2023-10-14 17:48 | 608K | |
| sampleicc-1.6.8_1.pkg | 2023-10-07 14:40 | 406K | |
| samplicator-1.3.8.r1..> | 2023-10-08 19:01 | 12K | |
| samplv1-lv2-0.9.32.pkg | 2023-10-08 14:57 | 361K | |
| sampsvr-0.3c_1.pkg | 2023-10-08 17:10 | 1.1M | |
| samtools-1.17.pkg | 2023-10-07 09:26 | 452K | |
| samurai-1.2.17.pkg | 2023-10-10 15:21 | 30K | |
| sancp-1.6.1_6.pkg | 2023-10-10 10:14 | 49K | |
| sane-airscan-0.99.26..> | 2023-10-14 09:21 | 117K | |
| sane-backends-1.2.1_..> | 2023-10-06 13:57 | 3.6M | |
| sanoid-2.1.0.pkg | 2023-10-09 11:23 | 31K | |
| sanoid-devel-1.0.0.2..> | 2023-10-09 04:21 | 29K | |
| sansi-1.0.2.pkg | 2023-10-09 23:46 | 3.0K | |
| sarep-1.1.pkg | 2023-10-08 16:19 | 3.6K | |
| sarg-2.4.0_2.pkg | 2023-10-14 17:17 | 512K | |
| sarien-0.7.0_3.pkg | 2023-10-09 04:25 | 70K | |
| sary-1.2.0_5.pkg | 2023-10-08 03:02 | 67K | |
| sas2ircu-20.00.00.00..> | 2023-10-14 15:19 | 256K | |
| sash-3.8.pkg | 2023-10-14 05:11 | 463K | |
| sasp-0.1_5.pkg | 2023-10-10 20:21 | 5.6K | |
| sassc-3.6.1.pkg | 2023-10-06 10:09 | 5.7K | |
| sat-libreoffice-7.5...> | 2023-10-08 04:52 | 336K | |
| sather-specification..> | 2023-10-14 18:17 | 56K | |
| sather-tutorial-0003..> | 2023-10-09 04:11 | 229K | |
| sauerbraten-20201221..> | 2023-10-14 12:03 | 914M | |
| savage-0.2.0_15.pkg | 2023-10-10 00:41 | 616K | |
| savelogs-1.98_1.pkg | 2023-10-11 00:40 | 64K | |
| savvycan-213,2.pkg | 2023-10-10 12:52 | 1.3M | |
| sawfish-1.13.0_3.pkg | 2023-10-07 22:07 | 2.3M | |
| sawfish-pager-0.90.3..> | 2023-10-09 21:05 | 23K | |
| sawfish-themes-0.13.pkg | 2023-10-10 15:21 | 567K | |
| saxon-6.5.5_1.pkg | 2023-10-10 19:58 | 1.1M | |
| saxon-devel-9.1.0.8_..> | 2023-10-07 21:42 | 3.1M | |
| saxon-he-10.6.pkg | 2023-10-06 19:43 | 5.4M | |
| sayaka-3.5.1_2.pkg | 2023-10-10 09:58 | 148K | |
| sayonara-1.7.0_1.pkg | 2023-10-10 18:51 | 1.8M | |
| sbagen-1.4.5.pkg | 2023-10-09 11:26 | 79K | |
| sbcl-2.3.8,1.pkg | 2023-10-06 21:06 | 7.9M | |
| sbd-1.37.pkg | 2023-10-10 13:54 | 20K | |
| sblim-wbemcli-1.6.3.pkg | 2023-10-09 20:53 | 107K | |
| sbm-0.8.pkg | 2023-10-14 08:16 | 7.1K | |
| sbt-1.9.6.pkg | 2023-10-07 02:12 | 3.3M | |
| sbxkb-0.7.6_3.pkg | 2023-10-09 18:28 | 56K | |
| sc-7.16_3.pkg | 2023-10-09 14:45 | 139K | |
| sc-aspell-1.0_1,2.pkg | 2023-10-09 10:57 | 4.7M | |
| sc-im-0.8.3.pkg | 2023-10-11 06:29 | 160K | |
| sc3-plugins-3.9.0_13..> | 2023-10-09 20:54 | 2.5M | |
| scala-3.1.0.pkg | 2023-10-08 06:39 | 33M | |
| scalapack-2.2.0_1.pkg | 2023-10-06 18:24 | 4.5M | |
| scalapackfx-1.2.pkg | 2023-10-07 00:27 | 185K | |
| scalatest-1.6.1.pkg | 2023-10-08 20:52 | 6.7M | |
| scale2x-3.1_1.pkg | 2023-10-08 22:10 | 72K | |
| scalpel-2.0.pkg | 2023-10-14 11:40 | 30K | |
| scam-backscatter-1.5..> | 2023-10-08 16:28 | 16K | |
| scamper-20230614b.pkg | 2023-10-08 11:16 | 744K | |
| scan_ffs-1.2.pkg | 2023-10-08 13:17 | 6.3K | |
| scanbd-1.5.1_2.pkg | 2023-10-09 13:53 | 32K | |
| scanbuttond-0.2.3_2.pkg | 2023-10-14 08:41 | 22K | |
| scandoc-0.14.pkg | 2023-10-10 07:19 | 38K | |
| scanlogd-2.2.8_1.pkg | 2023-10-08 22:07 | 8.6K | |
| scanmem-0.17.pkg | 2023-10-09 16:42 | 76K | |
| scantailor-1.0.16_3.pkg | 2023-10-10 08:56 | 2.5M | |
| scare-1.3.10.pkg | 2023-10-12 05:07 | 129K | |
| scavenge-2.0_1.pkg | 2023-10-09 19:23 | 3.6K | |
| scc-3.1.0_2.pkg | 2023-10-08 14:21 | 1.5M | |
| sccache-0.5.4_1,1.pkg | 2023-10-09 12:07 | 3.5M | |
| sccache-overlay-0.2...> | 2023-10-08 13:32 | 2.0M | |
| sccs-2023.04.19.pkg | 2023-10-07 14:26 | 450K | |
| scct-0.1.pkg | 2023-10-10 11:04 | 2.3K | |
| scdoc-1.11.2.pkg | 2023-10-06 15:28 | 12K | |
| scew-1.2.0.pkg | 2023-10-11 00:50 | 40K | |
| schedutils-0.7.2.pkg | 2023-10-14 03:59 | 7.3K | |
| scheme48-1.9.2.pkg | 2023-10-09 19:24 | 2.1M | |
| schilybase-2023.04.1..> | 2023-10-06 15:58 | 649K | |
| schilytools-3_1.pkg | 2023-10-08 20:00 | 972 | |
| schilyutils-2023.04...> | 2023-10-07 18:34 | 454K | |
| schismtracker-202309..> | 2023-10-09 18:57 | 367K | |
| scid-4.7.0.pkg | 2023-10-09 13:36 | 9.2M | |
| scidavis-2.9.2_1.pkg | 2023-10-10 00:16 | 1.6M | |
| scilab-6.1.1_10.pkg | 2023-10-08 02:13 | 93M | |
| scilab-toolbox-swt-0..> | 2023-10-14 08:45 | 661K | |
| scim-1.4.9_7.pkg | 2023-10-06 21:55 | 952K | |
| scim-input-pad-0.1.3..> | 2023-10-11 09:44 | 75K | |
| scim-kmfl-imengine-0..> | 2023-10-14 10:53 | 76K | |
| scim-m17n-0.2.3_10.pkg | 2023-10-10 04:05 | 27K | |
| scim-openvanilla-0.7..> | 2023-10-14 07:50 | 43K | |
| scim-table-imengine-..> | 2023-10-07 02:26 | 202K | |
| scimark2-java-2.0_2.pkg | 2023-10-10 20:16 | 30K | |
| scimark2c-2.1.pkg | 2023-10-14 06:06 | 8.4K | |
| scimark4c-4.pkg | 2023-10-09 07:30 | 9.8K | |
| scintilla-4.4.5_1.pkg | 2023-10-08 08:16 | 776K | |
| sciplot-plotting-lib..> | 2023-10-09 19:10 | 48K | |
| scite-4.4.5_1.pkg | 2023-10-08 21:51 | 772K | |
| scli-0.7.1.pkg | 2023-10-10 22:41 | 123K | |
| scloader-0.32_1.pkg | 2023-10-08 13:49 | 70K | |
| scm-5f2_10.pkg | 2023-10-07 10:46 | 656K | |
| scmxx-0.9.0_3.pkg | 2023-10-14 15:09 | 157K | |
| scons-py39-4.4.0.pkg | 2023-10-06 11:51 | 1.9M | |
| scorec-core-2.2.7.55..> | 2023-10-14 02:41 | 1.1M | |
| scotch-6.0.4.a7_4.pkg | 2023-10-06 23:14 | 2.7M | |
| scourge-0.21.1_15.pkg | 2023-10-11 06:24 | 718K | |
| scourge-data-0.21.1.pkg | 2023-10-08 11:27 | 122M | |
| scponly-4.8.20110526..> | 2023-10-11 06:03 | 23K | |
| scr2png-1.2_8.pkg | 2023-10-08 04:03 | 6.6K | |
| scr2txt-1.2.pkg | 2023-10-08 01:11 | 5.4K | |
| scr_ipfm-0.64.pkg | 2023-10-09 22:41 | 21K | |
| scramble-0.9.5_12.pkg | 2023-10-08 23:26 | 403K | |
| scratch-1.4.0.7.pkg | 2023-10-10 07:13 | 33M | |
| scrcpy-2.1.1.pkg | 2023-10-10 19:34 | 133K | |
| screcord-lv2-g201712..> | 2023-10-10 06:59 | 12K | |
| screen-4.9.1.pkg | 2023-10-08 09:01 | 474K | |
| screen-message-0.25_..> | 2023-10-09 07:28 | 11K | |
| screenFetch-3.9.1.59..> | 2023-10-09 12:55 | 58K | |
| screenFetch-nox11-3...> | 2023-10-08 13:07 | 58K | |
| screengrab-2.6.0.pkg | 2023-10-07 16:04 | 169K | |
| screenie-20120406.pkg | 2023-10-14 07:22 | 3.5K | |
| screenkey-1.5_1.pkg | 2023-10-09 11:23 | 82K | |
| scribus-devel-1.5.8_..> | 2023-10-09 21:08 | 70M | |
| script4rss-0.4b.pkg | 2023-10-10 12:31 | 7.5K | |
| scripts-1.0.1_1.pkg | 2023-10-08 15:44 | 6.6K | |
| scrm-1.7.4.pkg | 2023-10-09 02:15 | 72K | |
| scrot-1.10.pkg | 2023-10-09 23:23 | 71K | |
| scrypt-1.3.1_1.pkg | 2023-10-09 19:16 | 35K | |
| scs-3.2.3.pkg | 2023-10-14 18:53 | 161K | |
| scss-0.4.2_3.pkg | 2023-10-08 14:41 | 29K | |
| sct-1.0.0.pkg | 2023-10-08 23:56 | 4.8K | |
| sctd-0.2.0_26.pkg | 2023-10-10 20:52 | 273K | |
| scte35dump-0.1.6_23.pkg | 2023-10-10 23:50 | 545K | |
| scterc-0.0.1.pkg | 2023-10-11 01:02 | 3.5K | |
| sctplib-1.0.26.pkg | 2023-10-07 12:29 | 114K | |
| scudcloud-1.65_7.pkg | 2023-10-10 01:28 | 54K | |
| scummvm-2.7.1.pkg | 2023-10-07 15:14 | 67M | |
| scummvm-tools-2.7.0_..> | 2023-10-14 12:54 | 1.1M | |
| scwm-icons-0.99.2_2.pkg | 2023-10-10 20:54 | 1.1M | |
| scws-1.2.3.pkg | 2023-10-08 11:36 | 36K | |
| sd-0.7.6_30.pkg | 2023-10-09 09:25 | 506K | |
| sd-agent-1.13.4_1.pkg | 2023-10-14 04:08 | 30K | |
| sd-libreoffice-7.5.5..> | 2023-10-07 14:02 | 290K | |
| sd-mux-ctrl-g2020021..> | 2023-10-11 00:15 | 10K | |
| sdb-1.0.2_17.pkg | 2023-10-14 17:53 | 8.8M | |
| sdbus-cpp-1.3.0_2.pkg | 2023-10-08 09:29 | 150K | |
| sdcc-4.0.0_4.pkg | 2023-10-09 10:23 | 4.8M | |
| sdcv-0.5.2_4.pkg | 2023-10-10 02:11 | 53K | |
| sddm-0.20.0_3.pkg | 2023-10-08 19:26 | 3.3M | |
| sddm-freebsd-black-t..> | 2023-10-10 08:53 | 82K | |
| sdformat-8.0.0_4.pkg | 2023-10-09 19:26 | 284K | |
| sdif-2.8.20170401.pkg | 2023-10-10 05:18 | 12K | |
| sdig-0.45_2.pkg | 2023-10-14 04:19 | 46K | |
| sdl-1.2.15_16,2.pkg | 2023-10-06 14:58 | 685K | |
| sdl-ball-1.04_1.pkg | 2023-10-09 20:30 | 3.0M | |
| sdl-sopwith-2.3.0.pkg | 2023-10-09 07:16 | 49K | |
| sdl2-2.28.3.pkg | 2023-10-06 13:22 | 1.2M | |
| sdl2_gfx-1.0.4.pkg | 2023-10-07 01:13 | 47K | |
| sdl2_gpu-0.12.0.pkg | 2023-10-07 18:32 | 1.9M | |
| sdl2_image-2.6.3_3.pkg | 2023-10-06 15:12 | 68K | |
| sdl2_mixer-2.6.3_1.pkg | 2023-10-06 20:00 | 70K | |
| sdl2_net-2.2.0.pkg | 2023-10-07 00:22 | 18K | |
| sdl2_sound-2.0.2.pkg | 2023-10-07 23:29 | 312K | |
| sdl2_ttf-2.20.2.pkg | 2023-10-06 18:36 | 46K | |
| sdl2pp-0.18.1_1.pkg | 2023-10-08 00:23 | 70K | |
| sdl12-compat-1.2.64.pkg | 2023-10-11 01:03 | 75K | |
| sdl_audiolib-git2022..> | 2023-10-07 13:01 | 134K | |
| sdl_console-2.1_7.pkg | 2023-10-09 02:13 | 21K | |
| sdl_gfx-2.0.26.pkg | 2023-10-06 20:45 | 60K | |
| sdl_image-1.2.12_13.pkg | 2023-10-06 19:26 | 42K | |
| sdl_jewels-1.1.1_5.pkg | 2023-10-08 18:08 | 158K | |
| sdl_lopan-10_5.pkg | 2023-10-10 18:23 | 349K | |
| sdl_mixer-1.2.12_14.pkg | 2023-10-06 20:42 | 121K | |
| sdl_net-1.2.8_3.pkg | 2023-10-08 06:46 | 14K | |
| sdl_pango-0.1.2_11.pkg | 2023-10-06 21:31 | 11K | |
| sdl_scavenger-145.20..> | 2023-10-08 22:31 | 184K | |
| sdl_sound-1.0.3_16.pkg | 2023-10-07 09:48 | 90K | |
| sdl_ttf-2.0.11_8.pkg | 2023-10-06 21:51 | 25K | |
| sdlmm-0.1.8_9.pkg | 2023-10-14 07:23 | 71K | |
| sdlpop-1.23.pkg | 2023-10-09 18:44 | 463K | |
| sdlroids-1.3.4_19.pkg | 2023-10-14 16:42 | 82K | |
| sdlsand-20061017_6.pkg | 2023-10-14 12:14 | 14K | |
| sdlskk-0.5_4.pkg | 2023-10-08 17:18 | 31K | |
| sdocbook-xml-1.1_2,2..> | 2023-10-05 16:41 | 15K | |
| sdom-0.5.1_2.pkg | 2023-10-10 02:55 | 38K | |
| sdorfehs-1.5.pkg | 2023-10-09 03:18 | 80K | |
| sdpa-7.3.17.pkg | 2023-10-09 15:09 | 1.1M | |
| sdparm-1.12.pkg | 2023-10-09 20:14 | 137K | |
| sdr++-1.0.4_4.pkg | 2023-10-10 19:23 | 1.5M | |
| sdr-wspr-0.1.0_12.pkg | 2023-10-14 15:47 | 82K | |
| sdsl-lite-2.1.1.137.pkg | 2023-10-07 01:01 | 383K | |
| sdts++-1.5.1_21.pkg | 2023-10-10 18:34 | 380K | |
| sdump-2015.01.16_2.pkg | 2023-10-10 01:01 | 27K | |
| sdwmbar-1.3.pkg | 2023-10-09 09:12 | 3.7K | |
| se-3.0.1.pkg | 2023-10-10 16:57 | 72K | |
| sea-defender-0.9_5.pkg | 2023-10-09 13:04 | 97K | |
| seabattle-1.1_1.pkg | 2023-10-10 01:12 | 37K | |
| seabios-1.16.1_1.pkg | 2023-10-07 17:38 | 94K | |
| seafile-client-8.0.8..> | 2023-10-08 00:00 | 179K | |
| seafile-gui-8.0.8.pkg | 2023-10-10 20:21 | 1.3M | |
| seafile-server-9.0.1..> | 2023-10-08 09:04 | 594K | |
| seahorse-41.0_1.pkg | 2023-10-06 19:28 | 1.1M | |
| seahub-9.0.10_1.pkg | 2023-10-09 18:54 | 17M | |
| seal-4.1.1.pkg | 2023-10-14 02:53 | 274K | |
| seamonkey-2.53.17_1.pkg | 2023-10-14 05:15 | 40M | |
| searx-1.0.0.pkg | 2023-10-08 16:56 | 1.6M | |
| seatd-0.8.0.pkg | 2023-10-06 16:48 | 35K | |
| seaview-5.0.5_1,1.pkg | 2023-10-10 10:04 | 360K | |
| seaweedfs-3.52_2.pkg | 2023-10-14 03:58 | 19M | |
| sec-2.9.2.pkg | 2023-10-08 21:15 | 128K | |
| seccure-0.5_9.pkg | 2023-10-11 18:21 | 25K | |
| seclists-2023.3.pkg | 2023-10-09 14:27 | 409M | |
| secp256k1-0.4.0.pkg | 2023-10-07 09:36 | 1.1M | |
| secpanel-0.6.1_5,1.pkg | 2023-10-10 16:01 | 38K | |
| sectar-1.02.pkg | 2023-10-09 23:28 | 19K | |
| sectok-20030825_2.pkg | 2023-10-09 08:25 | 16K | |
| secure_delete-3.1_1.pkg | 2023-10-14 03:19 | 51K | |
| seda-3.0_2.pkg | 2023-10-08 12:23 | 271K | |
| sedsed-1.0_1.pkg | 2023-10-10 14:17 | 15K | |
| sedutil-1.12.pkg | 2023-10-10 10:34 | 115K | |
| see-3.1.1424_4.pkg | 2023-10-09 21:36 | 305K | |
| seed7-05.20230913.pkg | 2023-10-14 09:39 | 2.6M | |
| seejpeg-1.10_6.pkg | 2023-10-08 12:30 | 20K | |
| seer-gdb-2.1.pkg | 2023-10-10 07:04 | 614K | |
| seexpr-3.4.4.0_2.pkg | 2023-10-09 16:44 | 426K | |
| segyio-1.9.11.pkg | 2023-10-08 00:38 | 39K | |
| sekrit-twc-zimg-3.0...> | 2023-10-06 17:54 | 305K | |
| selectwm-0.4.1_11.pkg | 2023-10-10 21:55 | 13K | |
| selene-0.25.0_5.pkg | 2023-10-09 16:50 | 1.8M | |
| selenium-4.8.3.pkg | 2023-10-10 19:05 | 26M | |
| self-service-passwor..> | 2023-10-14 18:49 | 2.4M | |
| self-service-passwor..> | 2023-10-09 12:37 | 2.4M | |
| self-service-passwor..> | 2023-10-14 13:52 | 2.4M | |
| self-service-passwor..> | 2023-10-09 10:30 | 2.4M | |
| semantik-1.2.10.pkg | 2023-10-10 04:47 | 590K | |
| semaphore-2.9.2_1.pkg | 2023-10-10 13:05 | 4.2M | |
| semi-1.14.7.20230104..> | 2023-10-07 04:41 | 113K | |
| semi-emacs_canna-1.1..> | 2023-10-07 00:51 | 113K | |
| semi-emacs_devel-1.1..> | 2023-10-07 05:22 | 113K | |
| semi-emacs_devel_nox..> | 2023-10-07 01:18 | 113K | |
| semi-emacs_nox-1.14...> | 2023-10-07 06:46 | 113K | |
| sems-1.7.0.g20200510..> | 2023-10-09 00:08 | 3.5M | |
| sendEmail-1.56_2.pkg | 2023-10-09 02:51 | 25K | |
| sendSNPP-v1.03_1.pkg | 2023-10-08 16:55 | 8.0K | |
| sendip-2.5_4.pkg | 2023-10-09 06:56 | 33K | |
| sendmail-8.17.2.pkg | 2023-10-09 20:09 | 1.2M | |
| sendmail-devel-8.17...> | 2023-10-09 18:11 | 1.2M | |
| sendok-0.9.2.pkg | 2023-10-09 17:17 | 9.3K | |
| sendsms-0.2.4.pkg | 2023-10-08 14:41 | 13K | |
| sendxmpp-1.24_1.pkg | 2023-10-10 18:19 | 11K | |
| senken-0.3.0_16.pkg | 2023-10-10 09:40 | 926K | |
| senna-1.1.5_10,1.pkg | 2023-10-07 03:56 | 527K | |
| sensu-go-6.9.2_2.pkg | 2023-10-09 11:24 | 5.2M | |
| sent-1_1.pkg | 2023-10-09 23:31 | 14K | |
| sentencepiece-0.1.99..> | 2023-10-07 13:09 | 972K | |
| sentinel-1.7b_5.pkg | 2023-10-14 14:51 | 37K | |
| sentry-cli-2.20.5_2.pkg | 2023-10-09 16:24 | 3.1M | |
| seom-2010011201_3.pkg | 2023-10-07 12:34 | 21K | |
| separate-0.5.8_6,1.pkg | 2023-10-09 22:02 | 79K | |
| seq2-0.2_1.pkg | 2023-10-14 04:18 | 7.4K | |
| seq2gif-0.10.4.pkg | 2023-10-09 21:07 | 105K | |
| seqan-2.4.0.pkg | 2023-10-10 02:16 | 4.8M | |
| seqan-apps-2.4.0_11.pkg | 2023-10-09 13:18 | 7.9M | |
| seqan1-1.3.1_4.pkg | 2023-10-08 23:56 | 1.3M | |
| seqan3-3.3.0.pkg | 2023-10-10 23:37 | 713K | |
| seqio-1.2.2_1.pkg | 2023-10-09 10:21 | 401K | |
| seqkit-2.5.1_1.pkg | 2023-10-14 01:26 | 5.4M | |
| seqtk-1.4.pkg | 2023-10-08 06:20 | 35K | |
| sequeler-0.8.2_4.pkg | 2023-10-09 19:00 | 157K | |
| sequoia-1.16.0.pkg | 2023-10-10 01:22 | 564 | |
| sequoia-sq-0.31.0_2.pkg | 2023-10-08 05:25 | 2.6M | |
| seqwish-0.7.9.pkg | 2023-10-09 12:30 | 312K | |
| ser2net-3.5.1.pkg | 2023-10-08 17:11 | 67K | |
| serac-g20220823_4.pkg | 2023-10-08 16:19 | 515K | |
| serd-0.30.16.pkg | 2023-10-06 14:52 | 49K | |
| serdisplib-1.97.9.pkg | 2023-10-14 17:18 | 136K | |
| serendipity-2.3.5_1.pkg | 2023-10-08 14:14 | 5.1M | |
| serf-1.3.9_7.pkg | 2023-10-06 13:15 | 78K | |
| serialmail-0.75_3.pkg | 2023-10-10 09:03 | 34K | |
| serialoverip-1.0.pkg | 2023-10-08 21:51 | 4.7K | |
| serviio-2.3_1.pkg | 2023-10-10 10:22 | 27M | |
| servingxml-1.1.2.pkg | 2023-10-09 12:52 | 9.4M | |
| servlet-api-2.5_3.pkg | 2023-10-07 14:43 | 97K | |
| sessreg-1.1.2.pkg | 2023-10-07 00:22 | 5.9K | |
| setaudit-1.0.3.pkg | 2023-10-08 13:31 | 4.7K | |
| setcdboot-1.0.pkg | 2023-10-14 18:20 | 4.1K | |
| setlayout-20080210.pkg | 2023-10-09 11:43 | 3.0K | |
| sets-1.0.0_3.pkg | 2023-10-09 14:49 | 11K | |
| setsid-2.37.pkg | 2023-10-07 07:54 | 5.0K | |
| setxkbmap-1.3.2.pkg | 2023-10-06 13:40 | 10K | |
| sex-1.0_1.pkg | 2023-10-14 08:40 | 6.8K | |
| sextractor-2.5.0_2.pkg | 2023-10-14 07:02 | 188K | |
| sfcgal-1.4.1_4.pkg | 2023-10-06 10:57 | 1.6M | |
| sfeed-1.9.pkg | 2023-10-10 00:57 | 86K | |
| sfft-0.1.0_12.pkg | 2023-10-10 18:49 | 163K | |
| sflowtool-6.02.pkg | 2023-10-09 08:25 | 47K | |
| sfm-0.4.pkg | 2023-10-14 05:32 | 29K | |
| sfml-2.5.1_4.pkg | 2023-10-07 17:13 | 1.0M | |
| sfml1-1.6_8.pkg | 2023-10-07 14:11 | 2.8M | |
| sfnt2woff-20091004.pkg | 2023-10-09 14:39 | 11K | |
| sfront-0.99.pkg | 2023-10-10 08:11 | 456K | |
| sfsexp-1.4.1.pkg | 2023-10-06 19:18 | 33K | |
| sftpgo-2.5.4.pkg | 2023-10-08 15:32 | 11M | |
| sfwbar-1.0.b12.pkg | 2023-10-09 00:56 | 157K | |
| sg3_utils-1.48.pkg | 2023-10-07 08:36 | 916K | |
| sgb-20090810_1.pkg | 2023-10-10 14:39 | 263K | |
| sgf2tex-3.3_6.pkg | 2023-10-14 08:32 | 63K | |
| sgifonts-1.0.1_5.pkg | 2023-10-08 20:22 | 146K | |
| sgmlformat-1.7_7.pkg | 2023-10-10 15:32 | 86K | |
| sgmls-1.1.91_2.pkg | 2023-10-06 16:04 | 108K | |
| sgrep-0.99_2.pkg | 2023-10-09 18:39 | 34K | |
| sgrep2-1.94a.pkg | 2023-10-09 09:51 | 71K | |
| sgt-puzzles-20230828..> | 2023-10-10 06:29 | 2.5M | |
| sgwi-1.1.8_1.pkg | 2023-10-10 10:02 | 11K | |
| sha1collisiondetecti..> | 2023-10-10 12:11 | 16K | |
| sha2wordlist-1.0.201..> | 2023-10-14 08:15 | 9.9K | |
| shaaft-0.5.0_26.pkg | 2023-10-10 19:08 | 500K | |
| shaderc-2023.6.pkg | 2023-10-06 06:40 | 2.7M | |
| shadered-1.5.6.pkg | 2023-10-14 15:53 | 5.2M | |
| shadowsocks-libev-3...> | 2023-10-11 05:09 | 194K | |
| shadowsocks-rust-1.1..> | 2023-10-10 05:15 | 3.8M | |
| shairplay-0.9.0.2015..> | 2023-10-14 17:18 | 85K | |
| shairport-sync-4.2_1..> | 2023-10-09 05:07 | 136K | |
| shapelib-1.5.0.pkg | 2023-10-08 00:21 | 107K | |
| shards-0.17.2.pkg | 2023-10-07 13:46 | 316K | |
| shared-color-profile..> | 2023-10-10 15:12 | 5.2M | |
| shared-desktop-ontol..> | 2023-10-10 11:05 | 87K | |
| shared-mime-info-2.2..> | 2023-10-05 17:27 | 524K | |
| sharedance-0.6_7.pkg | 2023-10-09 08:56 | 10K | |
| sharefonts-0.10_8.pkg | 2023-10-11 11:31 | 698K | |
| sharpconstruct-0.11_..> | 2023-10-09 17:14 | 275K | |
| sharutils-4.15.2_2.pkg | 2023-10-07 22:13 | 212K | |
| shc-4.0.3.pkg | 2023-10-06 17:48 | 19K | |
| shed-1.15.pkg | 2023-10-10 03:33 | 18K | |
| sheerdns-1.04.pkg | 2023-10-09 03:21 | 25K | |
| shell-hist-g20190515..> | 2023-10-10 00:20 | 450K | |
| shell-toolbox-201905..> | 2023-10-11 17:20 | 10K | |
| shellbench-20200806.pkg | 2023-10-10 06:04 | 5.5K | |
| shelldap-1.5.1.pkg | 2023-10-11 00:18 | 27K | |
| shellharden-4.3.0_7.pkg | 2023-10-09 09:43 | 148K | |
| shellinabox-2.20_5.pkg | 2023-10-09 13:33 | 110K | |
| shelxle-1.0.1556.pkg | 2023-10-09 03:51 | 4.9M | |
| sherlock-lv2-0.28.0_..> | 2023-10-08 13:05 | 251K | |
| shflags-1.3.0.pkg | 2023-10-08 14:31 | 9.8K | |
| shfmt-3.7.0_2.pkg | 2023-10-09 20:00 | 1.0M | |
| shibboleth-idp-4.3.1..> | 2023-10-09 23:43 | 57M | |
| shibboleth-sp-3.4.1_..> | 2023-10-09 03:26 | 1.0M | |
| shikane-0.2.0_2.pkg | 2023-10-08 14:28 | 651K | |
| shim-0.9_5.pkg | 2023-10-14 15:24 | 438K | |
| shiori-1.6.0.r.1.pkg | 2023-10-08 23:41 | 8.6M | |
| shlock-2.7.1.pkg | 2023-10-14 18:04 | 9.8K | |
| shmap-0.3.2_2.pkg | 2023-10-10 21:23 | 23K | |
| shmcat-1.8.pkg | 2023-10-14 07:59 | 15K | |
| shmux-1.0.3.pkg | 2023-10-11 00:18 | 36K | |
| shntool-3.0.10_3.pkg | 2023-10-10 15:06 | 63K | |
| shockolate-0.8.2.43_..> | 2023-10-09 18:11 | 612K | |
| shootingstar-1.2.0_1..> | 2023-10-14 07:17 | 7.2M | |
| shortwave-3.2.0_8.pkg | 2023-10-10 10:04 | 1.9M | |
| shotcut-22.06.23_2.pkg | 2023-10-14 16:02 | 2.1M | |
| shotman-0.4.5_1.pkg | 2023-10-09 13:56 | 603K | |
| shotwell-0.30.18_1.pkg | 2023-10-14 05:19 | 3.0M | |
| showdown-0.6_3.pkg | 2023-10-14 09:42 | 18K | |
| showfont-1.0.5.pkg | 2023-10-10 19:48 | 6.9K | |
| showimage-1.12.pkg | 2023-10-10 19:21 | 50K | |
| showkey-1.7.pkg | 2023-10-09 02:07 | 5.2K | |
| showkeys-g20191004.pkg | 2023-10-09 14:20 | 4.7K | |
| showmethekey-1.11.1.pkg | 2023-10-10 08:09 | 42K | |
| shrinkpdf-1.1,1.pkg | 2023-10-10 19:36 | 4.3K | |
| shroud-wrapper-gener..> | 2023-10-09 14:19 | 278K | |
| shtk-1.6.pkg | 2023-10-10 10:21 | 100K | |
| shtool-2.0.8.pkg | 2023-10-09 04:48 | 112K | |
| shuf-3.0.pkg | 2023-10-07 16:14 | 7.4K | |
| shuffle-20010603.pkg | 2023-10-10 05:18 | 5.9K | |
| shuffle-db-1.0.r1_1.pkg | 2023-10-09 23:30 | 6.9K | |
| shunit2-2.1.8.93.pkg | 2023-10-10 01:13 | 8.0K | |
| shuriken-0.5.2.5_1.pkg | 2023-10-10 05:32 | 845K | |
| shx-0.2.4_2.pkg | 2023-10-14 07:16 | 101K | |
| si-libreoffice-7.5.5..> | 2023-10-08 06:27 | 2.7M | |
| sic-0.23a.pkg | 2023-10-10 05:22 | 49K | |
| siconos-4.4.0_5.pkg | 2023-10-10 14:59 | 2.0M | |
| sid-libreoffice-7.5...> | 2023-10-08 07:10 | 2.7M | |
| sid-milter-1.0.0_8.pkg | 2023-10-10 09:05 | 84K | |
| sidplay-1.0.9.pkg | 2023-10-09 02:40 | 25K | |
| sidplay2-2.0.9_4.pkg | 2023-10-14 18:25 | 42K | |
| sidplayer-4.4_9.pkg | 2023-10-10 15:44 | 95K | |
| sidplayfp-2.5.0_2.pkg | 2023-10-14 07:04 | 75K | |
| sie-nmsg-1.2.1_3.pkg | 2023-10-08 09:14 | 16K | |
| siege-4.1.6.pkg | 2023-10-09 20:33 | 87K | |
| siegfried-1.10.1_2.pkg | 2023-10-14 02:26 | 2.2M | |
| sierra-gtk-themes-20..> | 2023-10-11 02:12 | 646K | |
| siesta-4.1.5_1.pkg | 2023-10-14 15:54 | 2.7M | |
| sieve-connect-0.90.pkg | 2023-10-14 18:39 | 50K | |
| sift-0.9.0_35.pkg | 2023-10-11 17:22 | 1.0M | |
| sig2dot-0.35.pkg | 2023-10-09 10:30 | 4.9K | |
| sigar-1.7.3_2.pkg | 2023-10-07 03:14 | 80K | |
| sigdigger-0.3.0.1_1.pkg | 2023-10-14 16:34 | 5.9M | |
| sigi-3.6.1_2.pkg | 2023-10-09 07:57 | 410K | |
| sigil-2.0.1.pkg | 2023-10-08 12:59 | 5.8M | |
| signal-cli-0.9.0_1,1..> | 2023-10-07 19:13 | 18M | |
| signal-fts5-extensio..> | 2023-10-07 15:00 | 2.7M | |
| signald-0.15.0_2.pkg | 2023-10-09 12:46 | 17M | |
| signify-0.12,1.pkg | 2023-10-06 19:23 | 59K | |
| signing-party-2.10.pkg | 2023-10-08 15:25 | 120K | |
| signon-kwallet-exten..> | 2023-10-06 09:26 | 8.2K | |
| signon-plugin-oauth2..> | 2023-10-06 07:32 | 57K | |
| signon-qt5-8.60_1.pkg | 2023-10-06 07:29 | 339K | |
| signon-ui-0.17.355.pkg | 2023-10-06 14:08 | 60K | |
| sigrok-cli-0.7.2_1.pkg | 2023-10-10 04:00 | 39K | |
| sigrok-firmware-2015..> | 2023-10-09 10:59 | 289K | |
| sigrok-firmware-fx2l..> | 2023-10-07 21:01 | 9.8K | |
| sigrok-firmware-util..> | 2023-10-07 14:13 | 9.9K | |
| sigrot-1.0.pkg | 2023-10-10 13:13 | 5.7K | |
| sigslot-1.0.0.pkg | 2023-10-09 14:22 | 5.3K | |
| sigutils-0.3.0_1.pkg | 2023-10-07 05:15 | 75K | |
| sigviewer-0.6.4.13_2..> | 2023-10-09 07:13 | 281K | |
| silc-toolkit-1.1.12_..> | 2023-10-14 06:01 | 1.9M | |
| silentbob-3.2.pkg | 2023-10-08 12:54 | 38K | |
| silgraphite-2.3.1_4.pkg | 2023-10-08 10:53 | 268K | |
| silice-g20221229_1.pkg | 2023-10-10 13:27 | 1.2M | |
| silicon-0.1.124.pkg | 2023-10-09 15:58 | 41K | |
| silicon-code-visuali..> | 2023-10-09 23:18 | 2.0M | |
| silktools-3.19.2.pkg | 2023-10-07 19:33 | 1.7M | |
| silo-4.11.68_1.pkg | 2023-10-06 22:28 | 553K | |
| silq-20230412_1.pkg | 2023-10-09 10:44 | 772K | |
| sim4-2003.09.21_1.pkg | 2023-10-14 08:48 | 42K | |
| simage-1.7.0_12.pkg | 2023-10-06 17:51 | 81K | |
| simavr-1.7_3.pkg | 2023-10-14 14:33 | 715K | |
| simbody-3.7_5.pkg | 2023-10-07 21:44 | 19M | |
| simd-viterbi-2.0.3_1..> | 2023-10-09 14:01 | 9.5K | |
| simde-0.7.6.pkg | 2023-10-07 01:22 | 366K | |
| simdjson-3.1.5.pkg | 2023-10-07 02:15 | 184K | |
| simgear-2020.3.18_2.pkg | 2023-10-08 07:53 | 1.8M | |
| simh-3.9.0_5.pkg | 2023-10-09 17:12 | 3.5M | |
| simh-hp2100-3.11.0.3..> | 2023-10-10 19:31 | 812K | |
| simh-hp3000-3.11.0.1..> | 2023-10-09 02:13 | 480K | |
| simh-hpdoc-3.11.0.pkg | 2023-10-08 04:53 | 444K | |
| simian-2.5.10.pkg | 2023-10-10 13:50 | 144K | |
| simint-0.8.pkg | 2023-10-10 04:06 | 4.7M | |
| simlib-3.06.pkg | 2023-10-09 17:09 | 657K | |
| simple-dftd3-1.0.0.pkg | 2023-10-07 02:43 | 399K | |
| simple-fb2-reader-1...> | 2023-10-14 18:38 | 32K | |
| simple-scan-44.0.pkg | 2023-10-14 05:04 | 1.0M | |
| simple-web-server-3...> | 2023-10-10 00:46 | 19K | |
| simpleagenda-0.43_13..> | 2023-10-08 09:12 | 153K | |
| simpleini-4.20.pkg | 2023-10-08 03:55 | 23K | |
| simpleirc-1.3.pkg | 2023-10-09 04:14 | 6.7K | |
| simpleitk-2.3.0.pkg | 2023-10-09 12:47 | 36M | |
| simplemod-1.1_1.pkg | 2023-10-07 14:42 | 3.5K | |
| simpleproxy-3.4_1.pkg | 2023-10-10 00:02 | 12K | |
| simplescreenrecorder..> | 2023-10-14 18:29 | 1.2M | |
| simplestroke-1.3.1.pkg | 2023-10-08 20:41 | 9.8K | |
| simplevaders-0.8.1_1..> | 2023-10-14 10:32 | 314K | |
| simpleviewer-3.1.7_1..> | 2023-10-09 18:16 | 524K | |
| simscan-1.4.0_9.pkg | 2023-10-14 15:11 | 22K | |
| simsmith-9.9_1.pkg | 2023-10-14 06:38 | 3.4M | |
| simsu-1.4.2_1.pkg | 2023-10-09 20:06 | 268K | |
| simutrans-123.0.1_1.pkg | 2023-10-14 07:08 | 2.7M | |
| simutrans-pak64-123...> | 2023-10-08 16:21 | 3.5M | |
| simutrans-pak128-2.8..> | 2023-10-08 04:05 | 35M | |
| simutrans-pak128.ger..> | 2023-10-14 05:12 | 171M | |
| since-1.1.pkg | 2023-10-10 10:25 | 13K | |
| singular-4.3.2_2.pkg | 2023-10-08 05:06 | 11M | |
| siod-3.6.2.pkg | 2023-10-09 11:07 | 211K | |
| sioyek-2.0.0_1.pkg | 2023-10-14 04:39 | 556K | |
| sipcalc-1.1.6.pkg | 2023-10-08 17:38 | 29K | |
| sipp-3.5.1_6.pkg | 2023-10-08 22:43 | 179K | |
| siproxd-0.8.2_1.pkg | 2023-10-09 15:13 | 106K | |
| sipsak-0.9.8.1.pkg | 2023-10-08 13:26 | 44K | |
| sirc-2.211_2.pkg | 2023-10-09 17:36 | 93K | |
| siren-0.10_4.pkg | 2023-10-09 19:08 | 64K | |
| siril-1.0.6_7.pkg | 2023-10-10 03:12 | 1.4M | |
| sirius-quantum-chemi..> | 2023-10-14 14:22 | 1.9M | |
| sisc-1.16.6_3.pkg | 2023-10-10 20:36 | 732K | |
| sisl-4.6.0.44.pkg | 2023-10-08 13:54 | 503K | |
| sispmctl-4.11.pkg | 2023-10-08 12:35 | 17K | |
| sitecopy-0.16.6_8.pkg | 2023-10-10 22:23 | 91K | |
| sjasmplus-1.20.3.pkg | 2023-10-11 01:25 | 333K | |
| sjeng-11.2_3.pkg | 2023-10-09 04:34 | 68K | |
| sjitter-0.18.1b.pkg | 2023-10-08 22:10 | 7.8K | |
| sk-aspell-2.01.2,1.pkg | 2023-10-14 07:53 | 1.2M | |
| sk-hunspell-20110228..> | 2023-10-09 21:45 | 665K | |
| sk-hyphen-2004.04.15..> | 2023-10-10 16:42 | 5.5K | |
| sk-libreoffice-7.5.5..> | 2023-10-07 23:47 | 3.2M | |
| sk-mythes-2020.08.30..> | 2023-10-08 19:48 | 152K | |
| skalibs-2.13.1.1.pkg | 2023-10-06 22:49 | 212K | |
| skanlite-23.08.1.pkg | 2023-10-07 03:21 | 2.4M | |
| skanpage-23.08.1.pkg | 2023-10-09 12:52 | 135K | |
| skem-1.0.2_2.pkg | 2023-10-14 04:18 | 15K | |
| sketchy-20070218_1.pkg | 2023-10-09 16:26 | 287K | |
| skeuos-gtk-themes-20..> | 2023-10-09 00:51 | 1.1M | |
| ski-6.13.pkg | 2023-10-10 08:57 | 17K | |
| skim-fuzzy-finder-0...> | 2023-10-09 10:22 | 803K | |
| skinlf-6.7.pkg | 2023-10-07 02:40 | 311K | |
| skippy-xd-0.5.0_3.pkg | 2023-10-11 13:07 | 47K | |
| skopeo-1.13.2_1.pkg | 2023-10-07 13:24 | 14M | |
| skrooge-2.30.0.pkg | 2023-10-10 00:45 | 12M | |
| sks-1.1.6_1.pkg | 2023-10-14 09:23 | 960K | |
| skstream-0.3.9_9.pkg | 2023-10-08 00:07 | 37K | |
| skypat-3.1.1.pkg | 2023-10-14 10:57 | 382K | |
| skyutils-3.0.pkg | 2023-10-07 23:30 | 68K | |
| sl-5.02.pkg | 2023-10-09 10:16 | 7.9K | |
| sl-aspell-0.50.0_1,1..> | 2023-10-10 08:54 | 5.0M | |
| sl-hunspell-2020.12...> | 2023-10-08 23:00 | 924K | |
| sl-hyphen-2007.01.27..> | 2023-10-09 21:09 | 3.4K | |
| sl-libreoffice-7.5.5..> | 2023-10-07 23:00 | 3.1M | |
| sl-mythes-2016.06.30..> | 2023-10-10 06:01 | 261K | |
| sl2tps-0.4.2_2.pkg | 2023-10-10 22:34 | 12K | |
| slack-0.15.2_3.pkg | 2023-10-10 01:26 | 36K | |
| slack-term-0.5.0_15.pkg | 2023-10-08 12:51 | 2.2M | |
| slackcat-1.7.3_13.pkg | 2023-10-10 10:50 | 2.3M | |
| slade-3.1.13_5.pkg | 2023-10-09 05:17 | 5.4M | |
| slapd-cyrus-1.00_2.pkg | 2023-10-09 11:18 | 11K | |
| slashem-tty-0.0.7E.7..> | 2023-10-08 21:37 | 1.1M | |
| slatec-4.1_13.pkg | 2023-10-10 11:41 | 1.5M | |
| slclust-2010.02.02.pkg | 2023-10-09 08:36 | 12K | |
| sleef-3.5.1.62.pkg | 2023-10-06 17:33 | 695K | |
| slepc-3.19.2.pkg | 2023-10-07 04:14 | 5.2M | |
| sleuth-1.4.4.pkg | 2023-10-09 22:48 | 8.3K | |
| sleuthkit-4.7.0.pkg | 2023-10-08 22:25 | 1.2M | |
| slf4j-1.7.21.pkg | 2023-10-07 08:23 | 161K | |
| slgrace-0.2.2_11.pkg | 2023-10-10 18:28 | 19K | |
| slib-3b6.pkg | 2023-10-07 12:16 | 524K | |
| slib-guile18-3b6_3.pkg | 2023-10-14 11:40 | 756 | |
| slib-guile22-3b6_3.pkg | 2023-10-14 14:53 | 756 | |
| slib-guile30-3b6_3.pkg | 2023-10-09 09:59 | 756 | |
| slibtool-0.5.34.pkg | 2023-10-10 02:30 | 47K | |
| slick-greeter-1.6.0_..> | 2023-10-08 22:37 | 265K | |
| sliderule-1.0_10.pkg | 2023-10-09 19:28 | 21K | |
| slides-3.4.0_1.pkg | 2023-10-10 03:58 | 164K | |
| slides-presentation-..> | 2023-10-09 23:59 | 4.1M | |
| slim-1.3.6_23.pkg | 2023-10-07 21:53 | 249K | |
| slim-freebsd-black-t..> | 2023-10-14 16:22 | 71K | |
| slim-freebsd-dark-th..> | 2023-10-09 06:14 | 69K | |
| slim-freebsd-themes-..> | 2023-10-14 18:15 | 189K | |
| slim-themes-1.0.1_2.pkg | 2023-10-09 17:50 | 4.9M | |
| slime-2.26.1.9_9.pkg | 2023-10-11 21:22 | 722K | |
| slime-emacs_canna-2...> | 2023-10-14 11:01 | 722K | |
| slime-emacs_devel-2...> | 2023-10-12 06:35 | 722K | |
| slime-emacs_devel_no..> | 2023-10-10 11:06 | 723K | |
| slime-emacs_nox-2.26..> | 2023-10-14 04:59 | 722K | |
| slimta-0.9.0.pkg | 2023-10-09 11:06 | 33K | |
| slisp-1.2_1.pkg | 2023-10-14 18:52 | 15K | |
| sloccount-2.26_1.pkg | 2023-10-14 11:30 | 93K | |
| slock-1.4_2.pkg | 2023-10-09 13:14 | 6.0K | |
| slony1v2-2.2.11.pkg | 2023-10-14 10:55 | 407K | |
| slop-7.6_4.pkg | 2023-10-07 23:17 | 96K | |
| slowcat-2.2.pkg | 2023-10-07 10:05 | 1.6K | |
| slowcgi-7.1.20220916..> | 2023-10-10 14:36 | 12K | |
| slowhttptest-1.9.0.pkg | 2023-10-11 08:23 | 29K | |
| slowloris-0.7_2.pkg | 2023-10-08 21:04 | 6.4K | |
| slrn-1.0.3a_1.pkg | 2023-10-10 14:04 | 503K | |
| slrnface-2.1.1_6.pkg | 2023-10-09 06:44 | 14K | |
| sls-1.00.pkg | 2023-10-11 05:04 | 17K | |
| slst-0.2_1.pkg | 2023-10-14 14:49 | 8.1K | |
| slump-0.003.02.pkg | 2023-10-08 15:59 | 95K | |
| slurm-0.4.4_1.pkg | 2023-10-14 05:35 | 27K | |
| slurm-wlm-20.02.7_3.pkg | 2023-10-06 10:17 | 5.2M | |
| slurp-1.4.0.pkg | 2023-10-07 02:08 | 14K | |
| sly-1.0.43.20230624.pkg | 2023-10-07 20:35 | 1.5M | |
| sly-asdf-0.2.0.20221..> | 2023-10-10 08:10 | 15K | |
| sly-asdf-emacs_canna..> | 2023-10-09 17:17 | 15K | |
| sly-asdf-emacs_devel..> | 2023-10-09 12:06 | 15K | |
| sly-asdf-emacs_devel..> | 2023-10-09 06:50 | 15K | |
| sly-asdf-emacs_nox-0..> | 2023-10-10 01:23 | 15K | |
| sly-emacs_canna-1.0...> | 2023-10-08 10:35 | 1.5M | |
| sly-emacs_devel-1.0...> | 2023-10-08 07:28 | 1.5M | |
| sly-emacs_devel_nox-..> | 2023-10-07 17:03 | 1.5M | |
| sly-emacs_nox-1.0.43..> | 2023-10-07 15:39 | 1.5M | |
| sly-named-readtables..> | 2023-10-11 07:08 | 29K | |
| sly-named-readtables..> | 2023-10-08 12:33 | 29K | |
| sly-named-readtables..> | 2023-10-08 12:45 | 29K | |
| sly-named-readtables..> | 2023-10-09 15:20 | 29K | |
| sly-named-readtables..> | 2023-10-10 00:13 | 29K | |
| sly-quicklisp-202112..> | 2023-10-09 20:32 | 47K | |
| sly-quicklisp-emacs_..> | 2023-10-10 20:59 | 47K | |
| sly-quicklisp-emacs_..> | 2023-10-09 16:59 | 47K | |
| sly-quicklisp-emacs_..> | 2023-10-14 11:25 | 47K | |
| sly-quicklisp-emacs_..> | 2023-10-14 08:30 | 47K | |
| sma-1.4.pkg | 2023-10-14 17:58 | 37K | |
| smake-2023.04.19.pkg | 2023-10-06 17:10 | 57K | |
| smart-0.4.1_1.pkg | 2023-10-07 15:46 | 16K | |
| smartctl_exporter-0...> | 2023-10-11 00:37 | 3.0M | |
| smartirc4net-1.1_3.pkg | 2023-10-10 07:42 | 77K | |
| smartmontools-7.4.pkg | 2023-10-06 21:46 | 545K | |
| smarty-php80-4.3.2.pkg | 2023-10-08 16:18 | 140K | |
| smarty-php81-4.3.2.pkg | 2023-10-10 10:05 | 140K | |
| smarty-php82-4.3.2.pkg | 2023-10-10 15:03 | 140K | |
| smarty-php83-4.3.2.pkg | 2023-10-09 22:33 | 140K | |
| smarty2-php80-2.6.32..> | 2023-10-08 01:49 | 176K | |
| smarty2-php81-2.6.32..> | 2023-10-08 01:10 | 176K | |
| smarty2-php82-2.6.32..> | 2023-10-07 11:05 | 176K | |
| smarty2-php83-2.6.32..> | 2023-10-08 03:01 | 176K | |
| smarty3-php80-3.1.48..> | 2023-10-08 02:07 | 143K | |
| smarty3-php81-3.1.48..> | 2023-10-07 18:15 | 143K | |
| smarty3-php82-3.1.48..> | 2023-10-07 12:33 | 143K | |
| smarty3-php83-3.1.48..> | 2023-10-08 07:09 | 143K | |
| smb4k-3.1.0_4.pkg | 2023-10-10 13:39 | 2.5M | |
| smb_auth-0.05_10.pkg | 2023-10-09 21:40 | 7.7K | |
| smbftpd-2.4_1.pkg | 2023-10-09 12:23 | 54K | |
| smbldap-tools-0.9.11..> | 2023-10-09 18:12 | 264K | |
| smc-4.3.0_2.pkg | 2023-10-10 03:20 | 758K | |
| smcroute-2.1.0.pkg | 2023-10-09 20:53 | 32K | |
| smenu-1.2.0.pkg | 2023-10-09 08:50 | 97K | |
| smfsav-1.4.0_4.pkg | 2023-10-09 16:52 | 17K | |
| smfsav-devel-2.1_2.pkg | 2023-10-09 04:26 | 18K | |
| smhasher-1.0_1.pkg | 2023-10-14 15:47 | 76K | |
| smi-1.4_2.pkg | 2023-10-09 04:37 | 9.9K | |
| smithwaterman-g20160..> | 2023-10-10 10:29 | 63K | |
| smlnj-110.98.pkg | 2023-10-14 18:35 | 7.4M | |
| smm++-6.1.1_1.pkg | 2023-10-09 01:21 | 175K | |
| smokeping-2.8.2_4.pkg | 2023-10-14 17:27 | 473K | |
| smoldyn-2.72.pkg | 2023-10-10 10:03 | 822K | |
| smooth-0.9.10_1.pkg | 2023-10-07 09:26 | 426K | |
| smp_utils-0.99.pkg | 2023-10-10 12:50 | 169K | |
| smpeg-0.4.4_17.pkg | 2023-10-06 16:08 | 124K | |
| smpeg2-2.0.0_4.pkg | 2023-10-07 04:08 | 125K | |
| smplayer-23.6.0.pkg | 2023-10-08 07:13 | 3.2M | |
| smplayer-skins-20.11..> | 2023-10-07 00:47 | 472K | |
| smplayer-themes-20.1..> | 2023-10-07 00:34 | 2.5M | |
| smproxy-1.0.6.pkg | 2023-10-07 06:34 | 9.8K | |
| sms_client-3.0.2_3.pkg | 2023-10-10 09:14 | 63K | |
| smssend-3.6.pkg | 2023-10-09 12:55 | 71K | |
| smstools-3.1.21_1.pkg | 2023-10-09 00:08 | 262K | |
| smtp-cli-3.6.pkg | 2023-10-09 03:32 | 10K | |
| smtpfeed-1.23.pkg | 2023-10-09 18:22 | 72K | |
| smtpmail-0.4.5.pkg | 2023-10-09 14:57 | 9.9K | |
| smtprc-2.0.3.pkg | 2023-10-08 17:04 | 30K | |
| smtprelay-1.10.0_2.pkg | 2023-10-14 01:26 | 1.5M | |
| smtptrapd-1.6_1.pkg | 2023-10-09 14:53 | 7.4K | |
| smtube-21.10.0_2.pkg | 2023-10-09 22:52 | 257K | |
| smu-1.5.pkg | 2023-10-09 07:37 | 7.9K | |
| smug-0.3.3_3.pkg | 2023-10-09 01:26 | 836K | |
| smurflog-2.1_1.pkg | 2023-10-09 13:50 | 6.3K | |
| smuxi-1.1_3.pkg | 2023-10-11 05:37 | 2.1M | |
| smv-2.5.4.3_10.pkg | 2023-10-08 23:52 | 193K | |
| snack-2.2.10_7.pkg | 2023-10-08 03:09 | 272K | |
| snakemake-6.15.5_1.pkg | 2023-10-10 08:18 | 463K | |
| snap-1.01,1.pkg | 2023-10-08 19:34 | 5.9K | |
| snap7-1.4.2.pkg | 2023-10-10 18:16 | 76K | |
| snapcast-0.27.0_3.pkg | 2023-10-10 04:36 | 1.0M | |
| snappy-1.1.10.pkg | 2023-10-05 17:44 | 29K | |
| snappyjava-1.1.7.5.pkg | 2023-10-07 12:52 | 1.8M | |
| snappymail-php80-2.2..> | 2023-10-08 12:24 | 4.7M | |
| snappymail-php81-2.2..> | 2023-10-14 15:09 | 4.7M | |
| snappymail-php82-2.2..> | 2023-10-10 12:14 | 4.7M | |
| snappymail-php83-2.2..> | 2023-10-14 15:05 | 4.7M | |
| snapraid-12.2.pkg | 2023-10-10 08:47 | 253K | |
| snarf-7.0.pkg | 2023-10-10 15:12 | 15K | |
| snazy-0.51.3.pkg | 2023-10-14 11:36 | 715K | |
| snd-22.9_2.pkg | 2023-10-09 17:51 | 7.9M | |
| sndio-1.9.0.pkg | 2023-10-05 16:43 | 114K | |
| sndy-0.0.5.pkg | 2023-10-08 18:49 | 2.4K | |
| snes9x-gtk-1.62.3_1.pkg | 2023-10-09 12:07 | 2.3M | |
| sngrep-1.6.0.pkg | 2023-10-10 06:05 | 73K | |
| sniffglue-0.15.0_14.pkg | 2023-10-09 09:20 | 632K | |
| sniffit-0.5.pkg | 2023-10-10 13:20 | 45K | |
| sniproxy-0.6.1.pkg | 2023-10-10 13:09 | 32K | |
| snitch-testing-1.2.2..> | 2023-10-09 16:32 | 76K | |
| snitch-testing-heade..> | 2023-10-09 23:57 | 35K | |
| snmp_exporter-0.20.0..> | 2023-10-08 15:24 | 4.1M | |
| snmptt-1.4.2_1.pkg | 2023-10-09 17:27 | 93K | |
| snns-4.3_1.pkg | 2023-10-09 04:15 | 1.4M | |
| snobol4-2.3.1_2.pkg | 2023-10-09 16:42 | 324K | |
| snoopy-2.5.1.pkg | 2023-10-08 12:57 | 43K | |
| snooze-0.5.pkg | 2023-10-07 17:38 | 10K | |
| snort-2.9.20_1.pkg | 2023-10-08 05:47 | 3.0M | |
| snort-rep-1.10_1.pkg | 2023-10-14 16:18 | 16K | |
| snort2pfcd-3.2.pkg | 2023-10-09 08:23 | 17K | |
| snort3-3.1.70.0,1.pkg | 2023-10-09 00:48 | 1.9M | |
| snortsam-2.70_1.pkg | 2023-10-10 02:12 | 94K | |
| snortsnarf-1.0_1,1.pkg | 2023-10-08 17:44 | 140K | |
| snowballstemmer-2.2...> | 2023-10-05 16:58 | 123K | |
| snowflake-tor-2.5.1_..> | 2023-10-07 08:12 | 10M | |
| snpeff-5.1.pkg | 2023-10-07 19:28 | 52M | |
| sntop-1.4.3_1.pkg | 2023-10-08 21:37 | 21K | |
| snzip-1.0.5.pkg | 2023-10-08 15:07 | 37K | |
| so-0.4.6_13.pkg | 2023-10-14 09:10 | 1.4M | |
| so-hunspell-1.0.2_1.pkg | 2023-10-14 07:17 | 71K | |
| so-synth-lv2-1.5.pkg | 2023-10-09 19:45 | 8.8K | |
| soapui-5.5.0.pkg | 2023-10-10 06:05 | 46M | |
| sobby-0.4.8_5.pkg | 2023-10-08 18:50 | 83K | |
| sobjectizer-5.7.4.2.pkg | 2023-10-06 19:41 | 690K | |
| socat-1.7.4.4.pkg | 2023-10-07 02:38 | 175K | |
| soci-4.0.3_5.pkg | 2023-10-06 19:04 | 418K | |
| sock-0.4.2.pkg | 2023-10-14 16:08 | 15K | |
| sockaddr-1.0.5_1.pkg | 2023-10-09 17:42 | 1.8M | |
| socket-1.2.pkg | 2023-10-08 12:32 | 11K | |
| socket_wrapper-1.1.9..> | 2023-10-08 02:26 | 23K | |
| socketapi-2.2.19.pkg | 2023-10-09 06:51 | 156K | |
| socketbind-1.pkg | 2023-10-14 09:10 | 2.6K | |
| socketpipe-1.10.pkg | 2023-10-09 11:27 | 8.9K | |
| socketw-3.10.27.pkg | 2023-10-09 04:56 | 30K | |
| socklog-2.1.0_1.pkg | 2023-10-09 09:45 | 48K | |
| sofa-20210512.pkg | 2023-10-08 05:22 | 122K | |
| sofia-sip-1.13.16.pkg | 2023-10-07 02:47 | 1.0M | |
| soft-serve-0.5.5_1.pkg | 2023-10-14 07:19 | 6.5M | |
| softether-4.42.9798_..> | 2023-10-08 21:03 | 2.9M | |
| softether-devel-4.43..> | 2023-10-14 15:12 | 2.9M | |
| softether5-5.02.5180..> | 2023-10-09 01:20 | 3.4M | |
| softflowd-1.0.0.pkg | 2023-10-09 09:57 | 34K | |
| softhsm2-2.6.1_2.pkg | 2023-10-14 05:27 | 535K | |
| sogo-5.8.4.pkg | 2023-10-09 06:39 | 18M | |
| sogo-activesync-5.8...> | 2023-10-10 11:56 | 18M | |
| sogo2-2.4.3_1.pkg | 2023-10-09 22:44 | 2.2M | |
| sogo2-activesync-2.4..> | 2023-10-10 09:51 | 2.3M | |
| soju-0.6.2_2.pkg | 2023-10-10 21:30 | 32M | |
| sokoban-1.0_2.pkg | 2023-10-10 22:57 | 17K | |
| sol-1.0.8.pkg | 2023-10-11 03:56 | 28K | |
| sol2-4.0.0.a.pkg | 2023-10-07 21:51 | 131K | |
| solaar-1.0.1_1.pkg | 2023-10-14 10:29 | 149K | |
| solanum-4.0.0_2.pkg | 2023-10-09 00:54 | 255K | |
| solarconquest-0.2_13..> | 2023-10-08 22:39 | 77K | |
| solarized-1.0.0.pkg | 2023-10-09 23:04 | 140K | |
| solarus-1.6.5.pkg | 2023-10-07 22:57 | 1.3M | |
| solarus-quest-editor..> | 2023-10-10 03:22 | 55M | |
| solfege-nosound-3.23..> | 2023-10-14 10:55 | 3.2M | |
| solidity-0.8.21.pkg | 2023-10-09 03:42 | 3.2M | |
| solitaire-19980817_1..> | 2023-10-14 03:56 | 3.6K | |
| solver-0.1_1.pkg | 2023-10-09 02:31 | 450K | |
| solvespace-3.1_2.pkg | 2023-10-09 21:57 | 2.8M | |
| somafm-cli-0.3.1_1.pkg | 2023-10-14 13:12 | 4.1K | |
| somebar-1.0.3.pkg | 2023-10-11 08:01 | 38K | |
| sonar-scanner-cli-4...> | 2023-10-07 18:25 | 571K | |
| sonarqube-ant-task-2..> | 2023-10-08 15:27 | 555K | |
| sonarqube-community-..> | 2023-10-10 10:14 | 346M | |
| sonarr-3.0.10.1567_1..> | 2023-10-09 17:26 | 8.6M | |
| songrec-0.3.2_8.pkg | 2023-10-14 06:06 | 1.3M | |
| sonic-1.4.3_1.pkg | 2023-10-10 21:40 | 3.9M | |
| sonic-visualiser-4.0..> | 2023-10-08 13:42 | 2.9M | |
| sonivox-3.6.12.pkg | 2023-10-07 03:34 | 242K | |
| sonivox-eas-1.5.0_2.pkg | 2023-10-14 05:56 | 158K | |
| soothsayer-0.6.3_3.pkg | 2023-10-09 23:41 | 4.6M | |
| sope-5.8.4.pkg | 2023-10-07 17:03 | 3.5M | |
| sope2-2.4.3_1.pkg | 2023-10-08 03:36 | 1.6M | |
| sops-3.7.3_13.pkg | 2023-10-14 01:46 | 5.1M | |
| sord-0.16.14.pkg | 2023-10-06 17:45 | 32K | |
| sortmail-1.20.pkg | 2023-10-10 04:14 | 21K | |
| sound-juicer-3.38.0_..> | 2023-10-10 18:31 | 573K | |
| sound-of-sorting-0.6..> | 2023-10-10 06:34 | 94K | |
| soundgrab-1.0.1_4.pkg | 2023-10-14 04:44 | 47K | |
| soundtouch-2.3.1.pkg | 2023-10-06 23:16 | 57K | |
| soundtracker-1.0.3_3..> | 2023-10-14 17:08 | 405K | |
| source-highlight-3.1..> | 2023-10-06 19:42 | 1.0M | |
| source-sans-ttf-3.04..> | 2023-10-08 11:14 | 791K | |
| sourcecodepro-ttf-2...> | 2023-10-07 19:31 | 483K | |
| sourceserifpro-ttf-3..> | 2023-10-08 08:22 | 610K | |
| sowing-1.1.18_1.pkg | 2023-10-11 10:26 | 149K | |
| sowon-g20201203.pkg | 2023-10-14 17:21 | 73K | |
| sox-14.4.2.20210509_..> | 2023-10-06 14:33 | 352K | |
| sp2sp-20090213_1.pkg | 2023-10-09 06:11 | 16K | |
| spacefm-1.0.6_3.pkg | 2023-10-08 15:50 | 1.0M | |
| spacejunk-1.0.5_3.pkg | 2023-10-10 14:24 | 5.1M | |
| spamass-iXhash-1.5.5..> | 2023-10-14 10:01 | 11K | |
| spamass-milter-0.4.0..> | 2023-10-10 08:09 | 41K | |
| spamass-rules-201901..> | 2023-10-09 01:39 | 32K | |
| spamassassin-4.0.0_4..> | 2023-10-07 03:28 | 1.0M | |
| spamassassin-devel-2..> | 2023-10-14 04:25 | 1.0M | |
| spamassassin-dqs-1.4..> | 2023-10-09 03:44 | 8.8K | |
| spambnc-30.f,1.pkg | 2023-10-09 07:52 | 218K | |
| spamcup-1.09_5.pkg | 2023-10-09 00:41 | 6.2K | |
| spamd-4.9.1_6.pkg | 2023-10-09 09:46 | 55K | |
| spamguard-1.8_1.pkg | 2023-10-10 08:39 | 23K | |
| spamilter-0.60_5.pkg | 2023-10-08 22:40 | 47K | |
| spampd-2.61_2.pkg | 2023-10-08 22:35 | 34K | |
| spamprobe-1.4d_20.pkg | 2023-10-14 17:30 | 174K | |
| spamstats-0.6c_2.pkg | 2023-10-08 17:05 | 13K | |
| spandsp-3.0.0.g20211..> | 2023-10-07 00:01 | 598K | |
| spar-0.5.10_6.pkg | 2023-10-09 16:33 | 72K | |
| sparc64-binutils-2.4..> | 2023-10-07 16:21 | 1.8M | |
| sparc64-gcc9-9.5.0_1..> | 2023-10-08 15:06 | 17M | |
| sparsehash-2.0.4.pkg | 2023-10-06 22:07 | 76K | |
| sparta-dsmc-2022.07...> | 2023-10-10 16:08 | 475K | |
| spass-3.2.5_5.pkg | 2023-10-10 00:54 | 63K | |
| spass-qt5-3.2.5_5.pkg | 2023-10-08 22:29 | 54K | |
| spatialindex-1.9.3.pkg | 2023-10-06 15:59 | 275K | |
| spatialite-5.0.1_7.pkg | 2023-10-06 10:38 | 4.8M | |
| spatialite-tools-5.0..> | 2023-10-09 13:23 | 203K | |
| spatialite_gui-2.1.0..> | 2023-10-08 18:07 | 1.7M | |
| spawn-fcgi-1.6.4_2.pkg | 2023-10-08 07:20 | 9.5K | |
| spblas-1.03.pkg | 2023-10-10 23:04 | 1.3M | |
| spc2it-0.4.0.pkg | 2023-10-09 18:52 | 24K | |
| spcm-0.5.7.6.pkg | 2023-10-09 00:57 | 77K | |
| spdlog-1.12.0.pkg | 2023-10-06 18:15 | 186K | |
| speak-1.2.pkg | 2023-10-08 15:06 | 14K | |
| species-1.2d_1.pkg | 2023-10-09 08:35 | 110K | |
| spectacle-23.08.1.pkg | 2023-10-07 08:48 | 1.4M | |
| spectacle-lv2-2.0.1_..> | 2023-10-09 14:19 | 829K | |
| spectmorph-0.6.0.pkg | 2023-10-14 09:23 | 30M | |
| spectools-201108.r1_..> | 2023-10-10 21:33 | 65K | |
| spectra-1.0.1_1.pkg | 2023-10-06 19:58 | 53K | |
| spectral-817_6.pkg | 2023-10-10 21:01 | 639K | |
| spectre-meltdown-che..> | 2023-10-09 16:13 | 48K | |
| spectrogram-20190725..> | 2023-10-14 04:58 | 9.2K | |
| spectrwm-3.4.1_1.pkg | 2023-10-14 05:46 | 86K | |
| speech-denoiser-lv2-..> | 2023-10-08 16:47 | 3.5K | |
| speech-dispatcher-0...> | 2023-10-05 18:03 | 3.5M | |
| speedcrunch-0.12.0_3..> | 2023-10-11 06:53 | 734K | |
| speedtables-1.13.18_..> | 2023-10-09 15:41 | 180K | |
| speedtest-go-1.6.6.pkg | 2023-10-09 11:06 | 2.2M | |
| speex-1.2.1,1.pkg | 2023-10-05 16:44 | 112K | |
| speexdsp-1.2.1.pkg | 2023-10-05 16:43 | 63K | |
| spegla-1.1p5.pkg | 2023-10-08 21:22 | 56K | |
| spek-0.8.5_1.pkg | 2023-10-10 14:43 | 86K | |
| spellcast-1.2_2.pkg | 2023-10-09 01:16 | 62K | |
| spellutils-0.7_4.pkg | 2023-10-14 14:24 | 19K | |
| spfft-1.0.6_1.pkg | 2023-10-07 16:10 | 96K | |
| spfmilter-2.001_2.pkg | 2023-10-09 09:26 | 16K | |
| spfval-0.0.1.pkg | 2023-10-09 08:45 | 7.5K | |
| spglib-2.1.0.pkg | 2023-10-06 18:10 | 196K | |
| spheral-2023.06.0.pkg | 2023-10-09 23:22 | 5.5M | |
| sphinx3-0.8_2.pkg | 2023-10-14 13:12 | 20M | |
| sphinxbase-0.8_2.pkg | 2023-10-07 21:07 | 255K | |
| sphinxsearch-2.2.11_..> | 2023-10-14 03:02 | 2.2M | |
| spice-3f5.2_14.pkg | 2023-10-08 15:52 | 807K | |
| spice-gtk-0.37_4.pkg | 2023-10-07 18:12 | 449K | |
| spice-protocol-0.14...> | 2023-10-07 01:29 | 18K | |
| spicetrade-1.2_4.pkg | 2023-10-10 08:08 | 170M | |
| spider-1.1_4.pkg | 2023-10-12 12:19 | 57K | |
| spidermonkey78-78.15..> | 2023-10-07 07:25 | 7.1M | |
| spidermonkey91-91.13..> | 2023-10-08 02:26 | 4.5M | |
| spidermonkey102-102...> | 2023-10-06 11:45 | 4.7M | |
| spiff-1.0.8_15.pkg | 2023-10-14 11:27 | 1.1M | |
| spim-8.0.pkg | 2023-10-09 07:51 | 239K | |
| spin-6.5.2.pkg | 2023-10-14 10:15 | 435K | |
| spindown-0.4.pkg | 2023-10-09 10:45 | 8.8K | |
| spine-1.2.25.pkg | 2023-10-10 23:35 | 51K | |
| spinner-1.2.4.pkg | 2023-10-14 03:01 | 13K | |
| spiped-1.6.2.pkg | 2023-10-08 19:29 | 61K | |
| spiralloops-2.0.0_9.pkg | 2023-10-09 11:38 | 44K | |
| spiralsynth-0.1.7_8.pkg | 2023-10-10 08:21 | 46K | |
| spiralsynthmodular-0..> | 2023-10-10 05:18 | 639K | |
| spiritvnc-0.4.6_1.pkg | 2023-10-09 20:13 | 53K | |
| spirv-llvm-translato..> | 2023-10-06 21:22 | 616K | |
| spirv-llvm-translato..> | 2023-10-06 21:51 | 547K | |
| spirv-llvm-translato..> | 2023-10-06 22:22 | 629K | |
| spirv-llvm-translato..> | 2023-10-06 22:21 | 659K | |
| spirv-llvm-translato..> | 2023-10-06 20:10 | 687K | |
| spirv-llvm-translato..> | 2023-10-08 01:05 | 722K | |
| spirv-tools-2023.4.r..> | 2023-10-05 17:55 | 3.3M | |
| spl-1.2.1_5.pkg | 2023-10-14 05:24 | 37K | |
| spla-1.5.5.pkg | 2023-10-07 19:50 | 98K | |
| splat-1.4.2_1.pkg | 2023-10-11 13:50 | 117K | |
| spleen-font-2.0.0.pkg | 2023-10-09 21:14 | 153K | |
| splint-3.1.2.pkg | 2023-10-07 08:08 | 643K | |
| splitpatch-1.1.pkg | 2023-10-08 14:16 | 5.3K | |
| splix-2.0.0_9.pkg | 2023-10-08 16:37 | 41K | |
| spm-0.20200208.pkg | 2023-10-09 08:56 | 3.8K | |
| spmfilter-0.6.7_6.pkg | 2023-10-07 11:06 | 71K | |
| spmfilter-clamav-0.2..> | 2023-10-14 13:42 | 9.2K | |
| spoa-4.1.0.pkg | 2023-10-10 11:19 | 83K | |
| spoofer-1.4.11_1.pkg | 2023-10-10 16:24 | 304K | |
| spook-20050207_5.pkg | 2023-10-09 19:15 | 65K | |
| spooles-2.2_15.pkg | 2023-10-06 23:55 | 4.4M | |
| spooles-mpich-2.2_15..> | 2023-10-09 14:00 | 3.8M | |
| spot-2.11.6.pkg | 2023-10-08 05:52 | 2.5M | |
| spotify-player-0.10...> | 2023-10-12 09:29 | 2.5M | |
| spotify-qt-3.10.pkg | 2023-10-11 00:25 | 499K | |
| spotify-tui-0.25.0_2..> | 2023-10-10 20:12 | 1.7M | |
| spotifyd-0.3.3_19.pkg | 2023-10-07 10:59 | 1.3M | |
| spp-0.4.2.pkg | 2023-10-14 15:20 | 21K | |
| spr-1.3.4_7.pkg | 2023-10-14 10:40 | 2.1M | |
| spread-3.17.4_7.pkg | 2023-10-07 17:48 | 176K | |
| spread-j-3.17.3_1.pkg | 2023-10-10 04:53 | 60K | |
| spread-sheet-widget-..> | 2023-10-07 12:18 | 75K | |
| spreadlogd-1.4.2.pkg | 2023-10-08 20:56 | 19K | |
| spring-106.0.1.pkg | 2023-10-07 16:15 | 11M | |
| springframework-3.2...> | 2023-10-09 18:13 | 35M | |
| springframework31-3...> | 2023-10-14 06:04 | 17M | |
| springgraph-0.88_3.pkg | 2023-10-08 13:53 | 8.2K | |
| sprop-0.1.pkg | 2023-10-14 17:33 | 3.6K | |
| spyder-5.4.5.pkg | 2023-10-08 10:37 | 9.1M | |
| sq-hunspell-1.6.2_1.pkg | 2023-10-10 01:03 | 480K | |
| sq-libreoffice-7.5.5..> | 2023-10-07 13:57 | 2.6M | |
| sql-ledger-3.2.12.pkg | 2023-10-09 14:50 | 1.2M | |
| sql-workbench-127,1.pkg | 2023-10-14 12:56 | 6.5M | |
| sqlcached-r6_4.pkg | 2023-10-09 14:40 | 12K | |
| sqlcipher-3.4.2.pkg | 2023-10-08 09:36 | 770K | |
| sqlclient-1.8.1_9.pkg | 2023-10-07 02:22 | 124K | |
| sqlgrey-1.8.0_4.pkg | 2023-10-14 13:28 | 42K | |
| sqlite-2.8.17_5.pkg | 2023-10-07 00:00 | 386K | |
| sqlite-ext-miscfuncs..> | 2023-10-14 11:57 | 11K | |
| sqlite-ext-pcre-2010..> | 2023-10-14 16:11 | 3.1K | |
| sqlite-ext-regexp-3...> | 2023-10-14 05:15 | 8.3K | |
| sqlite-ext-spellfix-..> | 2023-10-08 21:18 | 15K | |
| sqlite3-3.43.1,1.pkg | 2023-10-05 16:51 | 1.3M | |
| sqlite3-icu-3.43.1,1..> | 2023-10-10 01:30 | 1.3M | |
| sqlite3-tcl-3.43.1,1..> | 2023-10-10 09:54 | 1.7M | |
| sqlitebrowser-3.12.1..> | 2023-10-14 17:50 | 2.2M | |
| sqliteconvert-0.1.2.pkg | 2023-10-10 20:33 | 20K | |
| sqlitecpp-3.3.1.pkg | 2023-10-08 16:44 | 39K | |
| sqlitejdbc-056_2.pkg | 2023-10-08 09:42 | 39K | |
| sqlitemanager-1.2.4.pkg | 2023-10-09 13:48 | 598K | |
| sqliteodbc-0.9999.pkg | 2023-10-08 20:06 | 158K | |
| sqlitestudio-3.4.4.pkg | 2023-10-14 07:49 | 4.4M | |
| sqlninja-0.2.6.pkg | 2023-10-09 02:14 | 187K | |
| sqlrelay-1.9.3.pkg | 2023-10-08 00:26 | 2.2M | |
| sqsh-2.5.16.1_2.pkg | 2023-10-09 21:44 | 149K | |
| sqstat-1.20_1.pkg | 2023-10-10 00:12 | 10K | |
| sqtop-2015.02.08.pkg | 2023-10-10 22:05 | 71K | |
| squash-1.0_21.pkg | 2023-10-09 08:29 | 43K | |
| squashfs-tools-4.6.1..> | 2023-10-10 13:13 | 222K | |
| squashfs-tools-ng-1...> | 2023-10-07 09:19 | 269K | |
| squeak-4.10.2_13.pkg | 2023-10-07 22:41 | 11M | |
| squeekboard-1.22.0_2..> | 2023-10-14 04:13 | 1.5M | |
| squeezelite-1.9.9.14..> | 2023-10-10 10:30 | 59K | |
| squid-5.9.pkg | 2023-10-08 04:04 | 2.5M | |
| squid-langpack-7.0.0..> | 2023-10-10 02:47 | 199K | |
| squidGuard-1.4_15.pkg | 2023-10-14 11:59 | 507K | |
| squid_radius_auth-1...> | 2023-10-10 01:19 | 10K | |
| squidanalyzer-6.5.pkg | 2023-10-10 14:03 | 146K | |
| squidclamav-7.2.pkg | 2023-10-10 01:16 | 67K | |
| squidpurge-1.17_4.pkg | 2023-10-08 15:39 | 14K | |
| squidview-0.86.pkg | 2023-10-10 03:27 | 71K | |
| squirrel-3.1_3.pkg | 2023-10-07 21:55 | 206K | |
| squirrel-sql-4.6.0.pkg | 2023-10-08 22:38 | 50M | |
| squirrelmail-abook_i..> | 2023-10-10 16:15 | 22K | |
| squirrelmail-abook_i..> | 2023-10-09 05:59 | 22K | |
| squirrelmail-abook_i..> | 2023-10-14 18:01 | 22K | |
| squirrelmail-abook_i..> | 2023-10-08 15:28 | 22K | |
| squirrelmail-askuser..> | 2023-10-11 06:30 | 2.4K | |
| squirrelmail-askuser..> | 2023-10-09 23:31 | 2.4K | |
| squirrelmail-askuser..> | 2023-10-10 08:31 | 2.4K | |
| squirrelmail-askuser..> | 2023-10-08 23:58 | 2.4K | |
| squirrelmail-avelsie..> | 2023-10-09 16:51 | 280K | |
| squirrelmail-avelsie..> | 2023-10-09 11:35 | 280K | |
| squirrelmail-avelsie..> | 2023-10-09 12:16 | 280K | |
| squirrelmail-avelsie..> | 2023-10-08 22:40 | 280K | |
| squirrelmail-calenda..> | 2023-10-08 09:01 | 15K | |
| squirrelmail-calenda..> | 2023-10-07 12:17 | 15K | |
| squirrelmail-calenda..> | 2023-10-07 21:54 | 15K | |
| squirrelmail-calenda..> | 2023-10-07 23:15 | 15K | |
| squirrelmail-change-..> | 2023-10-10 02:17 | 27K | |
| squirrelmail-change-..> | 2023-10-11 00:20 | 27K | |
| squirrelmail-change_..> | 2023-10-09 06:33 | 46K | |
| squirrelmail-change_..> | 2023-10-08 20:13 | 46K | |
| squirrelmail-change_..> | 2023-10-10 08:53 | 46K | |
| squirrelmail-change_..> | 2023-10-08 17:19 | 46K | |
| squirrelmail-check-q..> | 2023-10-10 14:07 | 36K | |
| squirrelmail-check-q..> | 2023-10-10 04:11 | 36K | |
| squirrelmail-check-q..> | 2023-10-08 18:53 | 36K | |
| squirrelmail-check-q..> | 2023-10-14 13:19 | 36K | |
| squirrelmail-compati..> | 2023-10-07 19:16 | 35K | |
| squirrelmail-compati..> | 2023-10-08 07:50 | 35K | |
| squirrelmail-compati..> | 2023-10-08 06:49 | 35K | |
| squirrelmail-compati..> | 2023-10-08 03:14 | 35K | |
| squirrelmail-decode-..> | 2023-10-10 19:14 | 164K | |
| squirrelmail-email_f..> | 2023-10-14 09:43 | 16K | |
| squirrelmail-email_f..> | 2023-10-11 14:08 | 16K | |
| squirrelmail-email_f..> | 2023-10-09 21:03 | 16K | |
| squirrelmail-email_f..> | 2023-10-10 18:48 | 16K | |
| squirrelmail-login_a..> | 2023-10-09 21:00 | 26K | |
| squirrelmail-login_a..> | 2023-10-09 02:37 | 26K | |
| squirrelmail-login_a..> | 2023-10-09 06:24 | 26K | |
| squirrelmail-login_a..> | 2023-10-10 07:36 | 26K | |
| squirrelmail-login_n..> | 2023-10-14 03:05 | 12K | |
| squirrelmail-login_n..> | 2023-10-09 18:01 | 12K | |
| squirrelmail-login_n..> | 2023-10-14 03:01 | 12K | |
| squirrelmail-login_n..> | 2023-10-09 04:29 | 12K | |
| squirrelmail-mark_re..> | 2023-10-10 00:51 | 16K | |
| squirrelmail-mark_re..> | 2023-10-09 09:51 | 16K | |
| squirrelmail-mark_re..> | 2023-10-14 07:19 | 16K | |
| squirrelmail-mark_re..> | 2023-10-09 16:55 | 16K | |
| squirrelmail-multilo..> | 2023-10-09 20:54 | 19K | |
| squirrelmail-multilo..> | 2023-10-08 20:19 | 19K | |
| squirrelmail-multilo..> | 2023-10-14 17:14 | 19K | |
| squirrelmail-multilo..> | 2023-10-10 20:32 | 19K | |
| squirrelmail-notes-p..> | 2023-10-11 00:12 | 14K | |
| squirrelmail-notes-p..> | 2023-10-14 04:08 | 14K | |
| squirrelmail-notes-p..> | 2023-10-09 01:47 | 14K | |
| squirrelmail-notes-p..> | 2023-10-14 15:17 | 14K | |
| squirrelmail-notify-..> | 2023-10-12 09:47 | 16K | |
| squirrelmail-notify-..> | 2023-10-09 17:18 | 16K | |
| squirrelmail-notify-..> | 2023-10-14 16:21 | 16K | |
| squirrelmail-notify-..> | 2023-10-09 17:20 | 16K | |
| squirrelmail-passwor..> | 2023-10-14 16:05 | 13K | |
| squirrelmail-passwor..> | 2023-10-09 18:15 | 13K | |
| squirrelmail-passwor..> | 2023-10-14 16:04 | 13K | |
| squirrelmail-passwor..> | 2023-10-10 20:38 | 13K | |
| squirrelmail-php80-2..> | 2023-10-07 08:07 | 522K | |
| squirrelmail-php81-2..> | 2023-10-07 05:49 | 522K | |
| squirrelmail-php82-2..> | 2023-10-07 01:57 | 522K | |
| squirrelmail-php83-2..> | 2023-10-07 00:39 | 522K | |
| squirrelmail-plugins..> | 2023-10-10 00:12 | 852 | |
| squirrelmail-plugins..> | 2023-10-10 12:33 | 852 | |
| squirrelmail-plugins..> | 2023-10-14 12:38 | 852 | |
| squirrelmail-plugins..> | 2023-10-09 14:34 | 856 | |
| squirrelmail-pupdate..> | 2023-10-14 07:18 | 12K | |
| squirrelmail-pupdate..> | 2023-10-14 06:04 | 12K | |
| squirrelmail-pupdate..> | 2023-10-14 11:39 | 12K | |
| squirrelmail-pupdate..> | 2023-10-09 03:31 | 12K | |
| squirrelmail-qmailad..> | 2023-10-09 17:57 | 11K | |
| squirrelmail-qmailad..> | 2023-10-11 00:38 | 11K | |
| squirrelmail-qmailad..> | 2023-10-08 11:57 | 11K | |
| squirrelmail-qmailad..> | 2023-10-09 22:27 | 11K | |
| squirrelmail-quota_u..> | 2023-10-10 12:43 | 36K | |
| squirrelmail-quota_u..> | 2023-10-11 09:19 | 36K | |
| squirrelmail-quota_u..> | 2023-10-14 16:29 | 36K | |
| squirrelmail-quota_u..> | 2023-10-10 03:25 | 36K | |
| squirrelmail-sasql-p..> | 2023-10-10 23:00 | 35K | |
| squirrelmail-sasql-p..> | 2023-10-14 12:55 | 35K | |
| squirrelmail-secure_..> | 2023-10-14 18:55 | 16K | |
| squirrelmail-secure_..> | 2023-10-14 09:11 | 16K | |
| squirrelmail-secure_..> | 2023-10-08 16:12 | 16K | |
| squirrelmail-secure_..> | 2023-10-11 15:06 | 16K | |
| squirrelmail-shared_..> | 2023-10-10 05:36 | 212K | |
| squirrelmail-shared_..> | 2023-10-14 13:20 | 212K | |
| squirrelmail-shared_..> | 2023-10-10 23:11 | 212K | |
| squirrelmail-shared_..> | 2023-10-11 01:29 | 212K | |
| squirrelmail-spam-bu..> | 2023-10-09 22:12 | 58K | |
| squirrelmail-spam-bu..> | 2023-10-09 18:25 | 58K | |
| squirrelmail-spam-bu..> | 2023-10-08 18:41 | 58K | |
| squirrelmail-spam-bu..> | 2023-10-09 13:16 | 58K | |
| squirrelmail-squirre..> | 2023-10-10 18:02 | 26K | |
| squirrelmail-squirre..> | 2023-10-09 23:22 | 26K | |
| squirrelmail-squirre..> | 2023-10-10 12:08 | 26K | |
| squirrelmail-squirre..> | 2023-10-09 14:54 | 26K | |
| squirrelmail-timeout..> | 2023-10-14 15:25 | 5.0K | |
| squirrelmail-timeout..> | 2023-10-14 12:30 | 5.0K | |
| squirrelmail-timeout..> | 2023-10-09 11:50 | 5.0K | |
| squirrelmail-timeout..> | 2023-10-10 03:27 | 5.0K | |
| squirrelmail-transla..> | 2023-10-08 12:56 | 3.1M | |
| squirrelmail-transla..> | 2023-10-14 12:21 | 3.1M | |
| squirrelmail-transla..> | 2023-10-09 03:11 | 3.1M | |
| squirrelmail-transla..> | 2023-10-14 18:53 | 3.1M | |
| squirrelmail-unsafe_..> | 2023-10-10 17:19 | 12K | |
| squirrelmail-unsafe_..> | 2023-10-09 14:42 | 12K | |
| squirrelmail-unsafe_..> | 2023-10-10 07:38 | 12K | |
| squirrelmail-unsafe_..> | 2023-10-10 00:02 | 12K | |
| squirrelmail-user_sp..> | 2023-10-08 22:01 | 3.7K | |
| squirrelmail-user_sp..> | 2023-10-10 07:41 | 3.7K | |
| squirrelmail-user_sp..> | 2023-10-14 15:56 | 3.7K | |
| squirrelmail-user_sp..> | 2023-10-14 05:33 | 3.7K | |
| squirrelmail-vlogin-..> | 2023-10-09 16:22 | 51K | |
| squirrelmail-vlogin-..> | 2023-10-10 03:18 | 51K | |
| squirrelmail-vlogin-..> | 2023-10-08 15:17 | 51K | |
| squirrelmail-vlogin-..> | 2023-10-09 14:10 | 51K | |
| squirrelmail-web_sea..> | 2023-10-09 13:19 | 4.1K | |
| squirrelmail-web_sea..> | 2023-10-08 16:17 | 4.1K | |
| squirrelmail-web_sea..> | 2023-10-09 12:55 | 4.1K | |
| squirrelmail-web_sea..> | 2023-10-10 06:26 | 4.1K | |
| squirrelmail-wettero..> | 2023-10-09 11:26 | 2.3K | |
| squirrelmail-wettero..> | 2023-10-09 16:30 | 2.3K | |
| squirrelmail-wettero..> | 2023-10-09 05:49 | 2.3K | |
| squirrelmail-wettero..> | 2023-10-14 10:29 | 2.3K | |
| squish-1.15_1.pkg | 2023-10-06 22:02 | 20K | |
| squsq-3.3.pkg | 2023-10-10 21:14 | 9.7K | |
| sqwebmail-6.0.6.pkg | 2023-10-08 12:13 | 458K | |
| sr-aspell-0.02_1,2.pkg | 2023-10-09 20:32 | 3.5M | |
| sr-hunspell-0.18_1.pkg | 2023-10-14 17:06 | 799K | |
| sr-libreoffice-7.5.5..> | 2023-10-08 06:14 | 500K | |
| sr_Latn-libreoffice-..> | 2023-10-08 07:18 | 184K | |
| sra-tools-3.0.6.pkg | 2023-10-08 10:37 | 87M | |
| srain-1.3.1_2.pkg | 2023-10-08 22:23 | 1.9M | |
| srandrd-0.6.0.15.pkg | 2023-10-10 18:51 | 20K | |
| sratom-0.6.14_1.pkg | 2023-10-06 22:57 | 13K | |
| srecord-1.64_18.pkg | 2023-10-09 09:51 | 1.1M | |
| sredird-2.2.2_1.pkg | 2023-10-10 05:46 | 16K | |
| srelay-0.4.8p3.pkg | 2023-10-08 19:49 | 28K | |
| srg-1.3.6.pkg | 2023-10-10 03:53 | 43K | |
| srm-1.2.15.pkg | 2023-10-09 12:00 | 16K | |
| srt-1.5.3.pkg | 2023-10-07 09:22 | 700K | |
| srvx-1.3.1.pkg | 2023-10-08 21:59 | 212K | |
| ss-hunspell-20110323..> | 2023-10-14 11:57 | 83K | |
| ss-libreoffice-7.5.5..> | 2023-10-08 10:59 | 202K | |
| ss5-3.8.9.8_3.pkg | 2023-10-12 04:22 | 195K | |
| ssb-0.1.1_14.pkg | 2023-10-09 02:21 | 1.1M | |
| sscalc-1.0.pkg | 2023-10-09 19:40 | 43K | |
| ssd_report-0.4.pkg | 2023-10-09 21:15 | 4.9K | |
| ssd_report-smartmont..> | 2023-10-09 19:25 | 4.9K | |
| ssddiff-0.2_4.pkg | 2023-10-10 04:22 | 40K | |
| ssdeep-2.14.1.pkg | 2023-10-10 03:16 | 31K | |
| ssed-3.62_4.pkg | 2023-10-10 06:11 | 87K | |
| sselp-0.2.pkg | 2023-10-09 03:26 | 3.7K | |
| ssgless-1.3.pkg | 2023-10-09 12:22 | 1.1K | |
| ssh-chat-1.10.1_15.pkg | 2023-10-11 00:55 | 2.0M | |
| ssh-multiadd-1.3.2.pkg | 2023-10-10 13:38 | 6.4K | |
| ssh-tools-1.7_1.pkg | 2023-10-10 20:31 | 10K | |
| ssh-vault-0.12.6_15.pkg | 2023-10-08 19:26 | 1.7M | |
| sshbuddy-1.05_2.pkg | 2023-10-10 04:25 | 9.3K | |
| sshguard-2.4.2_2,1.pkg | 2023-10-09 08:08 | 303K | |
| sshout-1.2.0_1.pkg | 2023-10-08 13:04 | 38K | |
| sshpass-1.10.pkg | 2023-10-07 03:32 | 8.9K | |
| sshping-0.1.4.pkg | 2023-10-11 01:51 | 20K | |
| sshsudo-1.0_1.pkg | 2023-10-09 00:13 | 2.7K | |
| ssht-1.5.2.pkg | 2023-10-09 07:54 | 96K | |
| ssl-admin-1.3.0_1.pkg | 2023-10-09 14:37 | 11K | |
| ssldump-0.9b3_5.pkg | 2023-10-10 05:14 | 27K | |
| sslh-1.22c_1.pkg | 2023-10-14 16:37 | 58K | |
| ssllabs-scan-1.5.0_1..> | 2023-10-08 23:05 | 1.6M | |
| sslproxy-0.9.4,1.pkg | 2023-10-08 12:34 | 148K | |
| sslscan-2.0.16.pkg | 2023-10-09 16:41 | 1.5M | |
| sslsplit-0.5.5_1.pkg | 2023-10-10 03:36 | 83K | |
| ssmtp-2.64_7.pkg | 2023-10-09 22:55 | 20K | |
| ssocr-2.23.1.pkg | 2023-10-09 18:53 | 29K | |
| ssr-lv2-g20210922_1.pkg | 2023-10-14 18:46 | 268K | |
| sssd-1.16.5_10.pkg | 2023-10-14 12:16 | 1.7M | |
| sssd-smb-1.16.5_10.pkg | 2023-10-10 14:10 | 2.0M | |
| sssnips-0.05.pkg | 2023-10-10 01:54 | 35K | |
| ssspl-0.1.pkg | 2023-10-09 23:07 | 5.3K | |
| ssss-0.5_4.pkg | 2023-10-08 21:15 | 11K | |
| sst-1.23.pkg | 2023-10-09 18:45 | 15K | |
| sswf-1.8.4_7.pkg | 2023-10-09 01:29 | 2.4M | |
| ssync-2.3_2.pkg | 2023-10-09 19:30 | 21K | |
| st-1.9_2.pkg | 2023-10-09 17:43 | 71K | |
| st-libreoffice-7.5.5..> | 2023-10-08 01:18 | 198K | |
| stacks-2.4_2.pkg | 2023-10-08 07:26 | 1.1M | |
| staf-3.4.26_1.pkg | 2023-10-10 12:22 | 1.5M | |
| stagit-1.2_1.pkg | 2023-10-09 22:18 | 23K | |
| stalepid-1.0.2.pkg | 2023-10-09 14:09 | 4.6K | |
| stalonetray-0.8.5.pkg | 2023-10-08 01:45 | 41K | |
| stamp-2.0.8_13.pkg | 2023-10-08 17:26 | 53K | |
| stan-2.33.0.pkg | 2023-10-10 20:50 | 122K | |
| stanmath-4.7.0.pkg | 2023-10-07 19:39 | 594K | |
| star-2023.04.19.pkg | 2023-10-07 20:31 | 283K | |
| star-history-1.0.13_..> | 2023-10-09 02:35 | 816K | |
| stardates-1.6.1.pkg | 2023-10-09 21:30 | 15K | |
| stardict-3.0.6_6.pkg | 2023-10-09 22:30 | 1.0M | |
| stardict-dict-fa_IR-..> | 2023-10-14 09:38 | 8.5M | |
| stardict-dictd_mova-..> | 2023-10-10 08:59 | 69M | |
| stardict-quick-2.4.2..> | 2023-10-14 17:17 | 21M | |
| stardict-rptts-2.1.0..> | 2023-10-11 11:29 | 85M | |
| starfetch-0.0.4.pkg | 2023-10-09 14:34 | 69K | |
| starfighter-2.4_1.pkg | 2023-10-08 12:20 | 47M | |
| starlanes-1.2.2.pkg | 2023-10-08 17:20 | 21K | |
| starplot-0.95.5_10.pkg | 2023-10-09 03:28 | 539K | |
| stars-1.0_1.pkg | 2023-10-08 22:21 | 6.6K | |
| starship-1.16.0_2.pkg | 2023-10-14 16:18 | 2.1M | |
| starttls-0.10_30.pkg | 2023-10-10 03:22 | 6.3K | |
| starttls-emacs_canna..> | 2023-10-10 12:05 | 6.3K | |
| starttls-emacs_devel..> | 2023-10-10 18:47 | 6.3K | |
| starttls-emacs_devel..> | 2023-10-08 13:52 | 6.3K | |
| starttls-emacs_nox-0..> | 2023-10-10 13:21 | 6.3K | |
| startup-notification..> | 2023-10-06 12:14 | 23K | |
| statcvs-0.7.0_1.pkg | 2023-10-10 03:52 | 2.2M | |
| statik-0.1.2_15,1.pkg | 2023-10-08 17:09 | 584K | |
| statsite-0.8.0_2.pkg | 2023-10-09 06:38 | 67K | |
| statsvn-0.7.0_5.pkg | 2023-10-14 15:37 | 2.4M | |
| stb-g20211010.pkg | 2023-10-07 11:08 | 294K | |
| stc-1.4_8.pkg | 2023-10-09 04:44 | 1.9M | |
| stdman-2022.07.30.pkg | 2023-10-08 23:31 | 3.8M | |
| stdx-allocator-3.0.2..> | 2023-10-06 20:46 | 98K | |
| sted-0.2.2.pkg | 2023-10-10 07:10 | 11K | |
| steghide-0.5.1_8.pkg | 2023-10-14 08:55 | 132K | |
| stegify-1.2.2_14.pkg | 2023-10-14 16:27 | 635K | |
| stegosaurus-lv2-0.0...> | 2023-10-14 07:21 | 33K | |
| stella-6.7.pkg | 2023-10-14 06:27 | 2.7M | |
| stellarium-23.1.pkg | 2023-10-14 18:07 | 279M | |
| stellarsolver-2.4_2.pkg | 2023-10-07 14:19 | 1.6M | |
| stendhal-1.35.pkg | 2023-10-10 05:20 | 56M | |
| step-23.08.1.pkg | 2023-10-07 05:54 | 1.2M | |
| step-certificates-0...> | 2023-10-14 02:34 | 8.0M | |
| step-cli-0.23.4_3.pkg | 2023-10-07 22:27 | 7.5M | |
| stepcode-0.8.1.pkg | 2023-10-10 08:36 | 3.1M | |
| steps-mono-0.3.29.pkg | 2023-10-14 04:03 | 17K | |
| stepsync-1.0_3.pkg | 2023-10-14 16:39 | 23K | |
| sterm-0.9.pkg | 2023-10-07 08:55 | 45K | |
| stfl-0.24_1.pkg | 2023-10-07 19:23 | 100K | |
| stixfonts-2.13.pkg | 2023-10-07 16:12 | 6.1M | |
| stjerm-0.18_1.pkg | 2023-10-14 04:01 | 18K | |
| stk-5.0.1.pkg | 2023-10-06 19:19 | 492K | |
| stlfilt-20080203.pkg | 2023-10-10 15:38 | 21K | |
| stlink-1.7.0.pkg | 2023-10-10 09:28 | 130K | |
| stm32flash-0.7.pkg | 2023-10-14 16:34 | 24K | |
| stockfish-16.pkg | 2023-10-10 00:00 | 30M | |
| stoken-0.93.pkg | 2023-10-14 05:59 | 56K | |
| stone-2.4.pkg | 2023-10-10 00:16 | 72K | |
| stone-phaser-lv2-0.1..> | 2023-10-09 21:07 | 1.0M | |
| stonesoup-0.30.1.pkg | 2023-10-10 13:53 | 6.5M | |
| stonesoup-sdl-0.30.1..> | 2023-10-10 01:32 | 21M | |
| storj-1.86.1_1.pkg | 2023-10-09 05:46 | 54M | |
| stork-1.6.0_5.pkg | 2023-10-08 22:08 | 1.2M | |
| stormbaancoureur-2.1..> | 2023-10-10 12:59 | 2.9M | |
| stormlib-9.25.pkg | 2023-10-07 11:49 | 129K | |
| stow-2.3.1.pkg | 2023-10-08 11:01 | 360K | |
| stowES-0.5.7.pkg | 2023-10-14 09:48 | 48K | |
| stp-2.3.3_10,1.pkg | 2023-10-07 23:17 | 954K | |
| str-0.9.12_1.pkg | 2023-10-08 04:08 | 71K | |
| stratagus-3.3.2_1.pkg | 2023-10-07 22:15 | 802K | |
| strawberry-qt5-1.0.1..> | 2023-10-08 15:28 | 4.7M | |
| strawberry-qt6-1.0.1..> | 2023-10-14 12:10 | 5.2M | |
| stream-5.10.pkg | 2023-10-14 12:30 | 11K | |
| streamripper-1.64.6_..> | 2023-10-09 02:17 | 60K | |
| streamtranscoder-1.2..> | 2023-10-09 07:50 | 34K | |
| streamvbyte-1.0.0.pkg | 2023-10-06 20:09 | 9.7K | |
| stress-1.0.4_1.pkg | 2023-10-09 23:20 | 12K | |
| stress-ng-0.16.02_2.pkg | 2023-10-14 09:35 | 516K | |
| stressdisk-1.0.13_2.pkg | 2023-10-08 16:34 | 788K | |
| string-machine-lv2-0..> | 2023-10-09 19:55 | 143K | |
| string_theory-3.7.pkg | 2023-10-07 23:02 | 26K | |
| stringencoders-3.10...> | 2023-10-10 12:54 | 21K | |
| stringtie-2.1.1.pkg | 2023-10-07 07:45 | 278K | |
| strongswan-5.9.11_2.pkg | 2023-10-09 18:43 | 932K | |
| stuffbin-1.1.0_14.pkg | 2023-10-10 20:46 | 1.2M | |
| stuffit-5.2.0.611_1.pkg | 2023-10-09 13:14 | 1.0M | |
| stumpwm-22.11_6.pkg | 2023-10-10 08:35 | 815K | |
| stund-0.96.pkg | 2023-10-09 19:08 | 27K | |
| stunnel-5.71,1.pkg | 2023-10-06 23:50 | 187K | |
| stxxl-1.4.1.pkg | 2023-10-09 08:33 | 635K | |
| stylua-0.18.1_1.pkg | 2023-10-09 01:16 | 1.1M | |
| stymulator-0.21a_4.pkg | 2023-10-14 06:14 | 41K | |
| su-exec-0.2.pkg | 2023-10-09 23:34 | 3.1K | |
| su-exec-static-0.2.pkg | 2023-10-09 05:52 | 380K | |
| subcalc-1.3.pkg | 2023-10-10 01:52 | 17K | |
| subfinder-2.6.3.pkg | 2023-10-09 22:18 | 6.3M | |
| submodules2tuple-1.0..> | 2023-10-10 15:22 | 1.9K | |
| subnetcalc-2.4.18.pkg | 2023-10-11 01:29 | 14K | |
| subread-2.0.2.pkg | 2023-10-08 05:14 | 672K | |
| subsonic-standalone-..> | 2023-10-14 10:46 | 46M | |
| subsurface-5.0.10_2.pkg | 2023-10-09 17:46 | 8.2M | |
| subsync-g20190702_1.pkg | 2023-10-08 15:14 | 16K | |
| subtitlecomposer-0.7..> | 2023-10-10 10:50 | 735K | |
| subtitleoffsetmodifi..> | 2023-10-10 03:04 | 2.0K | |
| subtle-0.11.3224.pkg | 2023-10-09 12:55 | 142K | |
| subtools-20081026.pkg | 2023-10-10 18:19 | 12K | |
| subversion-1.14.2_3.pkg | 2023-10-06 15:41 | 3.2M | |
| subversion-book-4515..> | 2023-10-14 10:15 | 462K | |
| subversion-gnome-key..> | 2023-10-10 17:20 | 3.7K | |
| subversion-lts-1.10...> | 2023-10-08 02:17 | 3.1M | |
| subversive-2.0.0_1.pkg | 2023-10-09 22:10 | 31M | |
| suck-cnews-4.3.4.pkg | 2023-10-10 07:36 | 91K | |
| suckblow-1.1.pkg | 2023-10-14 04:35 | 6.0K | |
| sudo-1.9.14p3.pkg | 2023-10-06 19:15 | 1.6M | |
| sudo-font-0.64.pkg | 2023-10-14 06:53 | 1.4M | |
| sudoscript-2.1.2.pkg | 2023-10-10 21:22 | 129K | |
| sudsol-0.1.pkg | 2023-10-09 10:35 | 8.7K | |
| suil-0.10.12_2.pkg | 2023-10-07 08:26 | 23K | |
| suitecrm-7.14.0.pkg | 2023-10-14 05:12 | 32M | |
| suitesparse-7.1.0.pkg | 2023-10-06 22:50 | 1.0K | |
| suitesparse-amd-3.0...> | 2023-10-06 09:05 | 282K | |
| suitesparse-btf-2.0...> | 2023-10-06 10:00 | 15K | |
| suitesparse-camd-3.0..> | 2023-10-06 09:05 | 272K | |
| suitesparse-ccolamd-..> | 2023-10-06 09:07 | 32K | |
| suitesparse-cholmod-..> | 2023-10-06 09:10 | 1.2M | |
| suitesparse-colamd-3..> | 2023-10-06 09:07 | 22K | |
| suitesparse-config-7..> | 2023-10-06 09:04 | 28K | |
| suitesparse-csparse-..> | 2023-10-08 19:55 | 876 | |
| suitesparse-cxsparse..> | 2023-10-06 11:54 | 111K | |
| suitesparse-graphbla..> | 2023-10-06 18:02 | 19M | |
| suitesparse-klu-2.0...> | 2023-10-06 10:12 | 389K | |
| suitesparse-ldl-3.0...> | 2023-10-06 15:53 | 233K | |
| suitesparse-mongoose..> | 2023-10-06 17:27 | 259K | |
| suitesparse-rbio-4.0..> | 2023-10-06 16:22 | 46K | |
| suitesparse-spex-2.0..> | 2023-10-06 18:18 | 380K | |
| suitesparse-spqr-3.0..> | 2023-10-06 11:59 | 297K | |
| suitesparse-umfpack-..> | 2023-10-06 09:22 | 1.1M | |
| sumo-1.2.0_13.pkg | 2023-10-10 15:46 | 13M | |
| sunclock-3.57_3.pkg | 2023-10-08 19:34 | 1.4M | |
| sundials-6.6.0.pkg | 2023-10-06 12:03 | 710K | |
| sunpromake-2023.04.1..> | 2023-10-07 11:33 | 123K | |
| sunwait-20041208.pkg | 2023-10-08 13:33 | 7.8K | |
| sunxi-tools-1.4.2.pkg | 2023-10-09 17:13 | 34K | |
| sup-2.0.20200824.pkg | 2023-10-08 19:52 | 60K | |
| super-3.30.3_1.pkg | 2023-10-10 20:17 | 92K | |
| supercollider-3.11.2..> | 2023-10-07 19:45 | 5.0M | |
| superiotool-4.18,1.pkg | 2023-10-08 15:01 | 32K | |
| superlu-5.3.0_1.pkg | 2023-10-06 17:52 | 1.1M | |
| superlu-dist-8.1.2_1..> | 2023-10-06 20:56 | 1.3M | |
| supertux-0.1.3_14.pkg | 2023-10-09 08:58 | 5.4M | |
| supertux2-0.6.3_5.pkg | 2023-10-08 12:27 | 157M | |
| supertuxkart-1.4_1.pkg | 2023-10-09 10:04 | 618M | |
| suphp-php80-0.7.2_2.pkg | 2023-10-09 16:48 | 74K | |
| suphp-php81-0.7.2_2.pkg | 2023-10-08 20:35 | 73K | |
| suphp-php82-0.7.2_2.pkg | 2023-10-10 05:04 | 74K | |
| suphp-php83-0.7.2_2.pkg | 2023-10-14 13:03 | 73K | |
| surblhost-0.8.0.pkg | 2023-10-10 16:11 | 17K | |
| surelog-1.74.pkg | 2023-10-08 04:47 | 2.4M | |
| surf-browser-2.1_1.pkg | 2023-10-14 02:34 | 23K | |
| surge-synthesizer-lv..> | 2023-10-11 12:34 | 59M | |
| surge-synthesizer-xt..> | 2023-10-09 19:01 | 75M | |
| suricata-7.0.0.pkg | 2023-10-11 10:53 | 3.0M | |
| suscan-0.3.0_1.pkg | 2023-10-08 03:17 | 423K | |
| sushi-42.0_2.pkg | 2023-10-08 11:19 | 74K | |
| suwidgets-0.3.0_1.pkg | 2023-10-08 08:23 | 267K | |
| suxus-1.5_4.pkg | 2023-10-09 18:57 | 5.0K | |
| suyimazu-2023.09.pkg | 2023-10-09 15:16 | 8.3K | |
| sv-aspell-0.51.0_1,1..> | 2023-10-09 09:27 | 961K | |
| sv-hunspell-2.40.pkg | 2023-10-14 05:10 | 587K | |
| sv-libreoffice-7.5.5..> | 2023-10-08 07:32 | 3.1M | |
| sv-mythes-2008.06.10..> | 2023-10-09 21:24 | 213K | |
| svg2pdf-0.1.3_6.pkg | 2023-10-10 01:36 | 5.3K | |
| svg2png-0.1.3_6.pkg | 2023-10-08 10:13 | 5.4K | |
| svgalib-1.4.3_7.pkg | 2023-10-08 09:15 | 549K | |
| svgbob-0.7.1_4.pkg | 2023-10-14 10:12 | 457K | |
| svk-2.2.3_6.pkg | 2023-10-08 10:37 | 350K | |
| svlint-0.9.0_1.pkg | 2023-10-09 18:22 | 3.1M | |
| svls-0.2.9_3.pkg | 2023-10-10 07:26 | 2.8M | |
| svmlight-6.02_2.pkg | 2023-10-08 03:21 | 74K | |
| svn2cl-0.14.pkg | 2023-10-09 08:38 | 20K | |
| svn2git-1.0.18.pkg | 2023-10-10 06:02 | 88K | |
| svn_load_dirs-1.8.4.pkg | 2023-10-14 16:31 | 22K | |
| svntrac-2.0.1_4.pkg | 2023-10-08 20:11 | 145K | |
| svnup-1.08.pkg | 2023-10-09 19:36 | 26K | |
| svt-av1-1.7.0.pkg | 2023-10-05 17:53 | 1.9M | |
| svt-hevc-1.5.1_1.pkg | 2023-10-07 11:35 | 595K | |
| svt-vp9-0.3.0_1.pkg | 2023-10-08 10:05 | 369K | |
| svxlink-19.09.1_3.pkg | 2023-10-08 02:14 | 916K | |
| sw-aspell-0.50.0_1,1..> | 2023-10-09 14:16 | 294K | |
| sw_TZ-libreoffice-7...> | 2023-10-07 18:41 | 221K | |
| swaks-20201014.0.pkg | 2023-10-09 21:40 | 52K | |
| swank-clojure-1.2.1.pkg | 2023-10-09 14:52 | 38K | |
| swapd-1.0.5_2.pkg | 2023-10-09 01:16 | 9.7K | |
| swapexd-0.4.pkg | 2023-10-09 09:22 | 5.6K | |
| swapmon-1.5.pkg | 2023-10-08 19:43 | 5.7K | |
| swappy-1.5.1_1.pkg | 2023-10-08 22:18 | 28K | |
| swapusage-1.0.0.pkg | 2023-10-09 15:07 | 3.1K | |
| swarp-0.1_1.pkg | 2023-10-09 09:38 | 3.4K | |
| swatchdog-3.2.4.pkg | 2023-10-08 21:22 | 28K | |
| sway-1.8.1_1.pkg | 2023-10-10 10:55 | 4.9M | |
| sway-audio-idle-inhi..> | 2023-10-10 07:38 | 8.1K | |
| sway-devel-1.8.1.194..> | 2023-10-10 05:28 | 4.9M | |
| swaybg-1.2.0.pkg | 2023-10-08 01:12 | 11K | |
| swayfloatingswitcher..> | 2023-10-14 09:35 | 21K | |
| swayfx-0.3.2.pkg | 2023-10-08 14:28 | 4.9M | |
| swayidle-1.8.0.pkg | 2023-10-10 02:23 | 13K | |
| swayimg-1.12_2.pkg | 2023-10-09 04:16 | 46K | |
| swaylock-1.7.2_1.pkg | 2023-10-09 16:01 | 26K | |
| swaylock-effects-1.6..> | 2023-10-08 20:10 | 40K | |
| swaync-0.9.0_1.pkg | 2023-10-08 23:36 | 154K | |
| swayr-0.27.0_2.pkg | 2023-10-10 15:11 | 1.0M | |
| swayrbar-0.3.6_3.pkg | 2023-10-14 03:37 | 854K | |
| swaysettings-0.4.0_3..> | 2023-10-10 12:23 | 113K | |
| swe-2.10.03,1.pkg | 2023-10-09 14:14 | 353K | |
| sweep-0.9.3_15,1.pkg | 2023-10-10 10:52 | 347K | |
| sweeper-23.08.1.pkg | 2023-10-11 00:48 | 395K | |
| sweethome3d-7.1.pkg | 2023-10-14 14:09 | 24M | |
| swell-foop-41.1_1.pkg | 2023-10-07 09:18 | 247K | |
| swfmill-0.3.6_5.pkg | 2023-10-10 08:12 | 248K | |
| swftools-0.9.2_12.pkg | 2023-10-08 13:01 | 1.8M | |
| swh-lv2-1.0.16.4.pkg | 2023-10-09 12:49 | 169K | |
| swhplugins-0.4.17.pkg | 2023-10-06 19:00 | 322K | |
| swi-pl-9.0.4_1.pkg | 2023-10-09 11:09 | 6.2M | |
| swig-4.1.1.pkg | 2023-10-05 17:27 | 5.5M | |
| swig40-4.0.2.pkg | 2023-10-05 16:46 | 1.0M | |
| swiggle-0.4_10.pkg | 2023-10-10 18:12 | 14K | |
| swissfileknife-1.9.9..> | 2023-10-14 16:29 | 747K | |
| switchBashZsh-1.3.pkg | 2023-10-09 09:39 | 5.5K | |
| sword-1.8.1_16.pkg | 2023-10-07 19:06 | 1.1M | |
| swt-4.21_1.pkg | 2023-10-06 19:45 | 1.3M | |
| sxhkd-0.6.2.pkg | 2023-10-08 07:33 | 29K | |
| sxml-1.0.7.pkg | 2023-10-09 02:33 | 23K | |
| sxmo-wayout-0.1.4.pkg | 2023-10-09 00:40 | 16K | |
| sxpc-1.4_2.pkg | 2023-10-14 14:38 | 9.9K | |
| sxsame-3.02_1.pkg | 2023-10-09 13:39 | 43K | |
| syck-0.70.pkg | 2023-10-14 04:06 | 43K | |
| sylpheed-3.7.0_6.pkg | 2023-10-08 15:08 | 1.5M | |
| symbola-12.pkg | 2023-10-09 13:59 | 1.4M | |
| symengine-0.10.1_1.pkg | 2023-10-06 13:05 | 9.1M | |
| symfpu-g20190517.pkg | 2023-10-07 10:04 | 34K | |
| symlinks-1.4.pkg | 2023-10-09 06:30 | 6.4K | |
| symmetrica-3.0.1.pkg | 2023-10-08 02:23 | 2.3M | |
| symon-2.88.pkg | 2023-10-11 01:17 | 49K | |
| sympa-6.2.70.pkg | 2023-10-09 00:18 | 3.1M | |
| symphytum-2.6.pkg | 2023-10-14 05:36 | 3.6M | |
| sympol-0.1.9_8.pkg | 2023-10-10 09:41 | 313K | |
| sympow-2.023.6_3.pkg | 2023-10-07 21:00 | 2.5M | |
| synaesthesia-2.4_7.pkg | 2023-10-14 04:25 | 57K | |
| synapse-0.2.99.4_3.pkg | 2023-10-08 19:29 | 409K | |
| syncplay-1.6.4.a_1.pkg | 2023-10-08 14:21 | 280K | |
| syncterm-1.0.pkg | 2023-10-14 03:56 | 1.5M | |
| syncthing-1.24.0_1.pkg | 2023-10-09 18:14 | 17M | |
| syncthingtray-1.4.1_..> | 2023-10-08 21:32 | 729K | |
| synergy-1.14.6.19,3.pkg | 2023-10-07 22:14 | 436K | |
| synfig-1.4.4_10.pkg | 2023-10-08 11:50 | 2.4M | |
| synfigstudio-1.4.4_1..> | 2023-10-14 11:41 | 3.9M | |
| syngesture-1.0.1_1.pkg | 2023-10-10 18:10 | 451K | |
| synth-2.13_1.pkg | 2023-10-11 00:50 | 717K | |
| synthpod-lv2-g201904..> | 2023-10-10 00:44 | 407K | |
| synthv1-lv2-0.9.32.pkg | 2023-10-09 08:55 | 330K | |
| sysbench-1.0.20_1.pkg | 2023-10-09 22:45 | 92K | |
| sysconftool-0.21.pkg | 2023-10-07 09:32 | 13K | |
| sysctlbyname-improve..> | 2023-10-07 05:42 | 4.8K | |
| sysctlinfo-kmod-2022..> | 2023-10-07 03:16 | 13K | |
| sysctlview-2.1_3.pkg | 2023-10-09 19:06 | 62K | |
| sysfsutils-2.1.0_3.pkg | 2023-10-09 07:32 | 39K | |
| sysgather-1.0.p10_1.pkg | 2023-10-08 20:40 | 18K | |
| sysinfo-1.0.1_2.pkg | 2023-10-07 14:07 | 15K | |
| syslinux-6.03.pkg | 2023-10-08 09:46 | 2.5M | |
| syslog-ng-4.3.1.pkg | 2023-10-08 15:00 | 956K | |
| syslogger-1.0.pkg | 2023-10-11 00:12 | 4.9K | |
| sysmon-0.93_1.pkg | 2023-10-09 01:24 | 244K | |
| sysrc-5.2.pkg | 2023-10-10 12:22 | 14K | |
| system-config-printe..> | 2023-10-14 16:57 | 728K | |
| systemc-2.3.4.pkg | 2023-10-07 00:12 | 5.3M | |
| systempreferences-1...> | 2023-10-07 04:32 | 262K | |
| sysvbanner-1.0.15.pkg | 2023-10-11 00:02 | 3.9K | |
| szap_s2-20100129s_1.pkg | 2023-10-09 00:58 | 10K | |
| szip-1.12b_2.pkg | 2023-10-14 03:04 | 23K | |
| szl-libreoffice-7.5...> | 2023-10-07 14:07 | 498K | |
| szyszka-3.0.0_3.pkg | 2023-10-14 07:18 | 841K | |
| t-prot-3.4.pkg | 2023-10-14 13:12 | 44K | |
| t1lib-5.1.2_5,1.pkg | 2023-10-05 17:35 | 756K | |
| t1utils-1.32.pkg | 2023-10-06 20:16 | 53K | |
| t3d-1.1_2.pkg | 2023-10-14 11:16 | 14K | |
| tDOM-0.9.1.pkg | 2023-10-07 11:03 | 236K | |
| tRNAscan-SE-2.0.11.pkg | 2023-10-09 08:35 | 2.4M | |
| ta-aspell-20040424.1..> | 2023-10-08 20:24 | 97K | |
| ta-lib-0.4.0_2.pkg | 2023-10-07 09:18 | 279K | |
| ta-libreoffice-7.5.5..> | 2023-10-07 17:11 | 3.0M | |
| ta2as-0.8.2.pkg | 2023-10-09 16:35 | 10K | |
| tabbed-0.6.pkg | 2023-10-09 14:36 | 14K | |
| tabixpp-1.0.0.10_2.pkg | 2023-10-10 01:25 | 14K | |
| table.el-1.5.54_1.pkg | 2023-10-09 02:23 | 49K | |
| tableutil-0.6_1.pkg | 2023-10-09 06:22 | 21K | |
| tablist-1.0.13_5.pkg | 2023-10-08 01:48 | 32K | |
| tablist-emacs_canna-..> | 2023-10-07 19:54 | 32K | |
| tablist-emacs_devel-..> | 2023-10-08 09:59 | 32K | |
| tablist-emacs_devel_..> | 2023-10-10 14:06 | 32K | |
| tablist-emacs_nox-1...> | 2023-10-09 13:59 | 32K | |
| tablix2-0.3.5_8.pkg | 2023-10-14 07:20 | 317K | |
| tabulate-1.5.pkg | 2023-10-09 21:12 | 39K | |
| tac_plus-F4.0.4.28.pkg | 2023-10-09 19:56 | 118K | |
| tacacs-202302261244.pkg | 2023-10-08 15:35 | 2.6M | |
| tachyon-0.98.9.pkg | 2023-10-08 10:28 | 73K | |
| tads-2.5.9.pkg | 2023-10-09 14:41 | 302K | |
| taglib-1.13.1.pkg | 2023-10-06 10:33 | 333K | |
| taglib-extras-1.0.1.pkg | 2023-10-08 00:05 | 21K | |
| taglookup-0.2_5.pkg | 2023-10-08 12:34 | 30K | |
| tagref-1.8.4_2.pkg | 2023-10-09 08:34 | 539K | |
| tagsoup-1.2.1_1.pkg | 2023-10-10 11:37 | 86K | |
| tagutil-3.1_1.pkg | 2023-10-14 13:07 | 24K | |
| tai64nfrac-1.4.pkg | 2023-10-10 02:58 | 5.6K | |
| taiga-s20200907_2.pkg | 2023-10-10 10:24 | 8.6K | |
| tailor-0.9.37_1.pkg | 2023-10-10 16:46 | 231K | |
| tailscale-1.48.2.pkg | 2023-10-14 07:56 | 8.2M | |
| taipan-0.9_2.pkg | 2023-10-10 05:06 | 20K | |
| taisei-1.3.2_2.pkg | 2023-10-10 19:23 | 61M | |
| tali-40.8_1.pkg | 2023-10-07 05:54 | 335K | |
| talkatu-g2019031701_..> | 2023-10-10 11:31 | 149K | |
| talkfilters-2.3.8_2.pkg | 2023-10-08 07:27 | 446K | |
| talloc-2.3.4.pkg | 2023-10-06 11:15 | 45K | |
| tamago-4.0.6.0.20041..> | 2023-10-14 09:30 | 397K | |
| tamago-emacs_canna-4..> | 2023-10-09 13:08 | 397K | |
| tamago-emacs_devel-4..> | 2023-10-09 16:59 | 396K | |
| tamago-emacs_devel_n..> | 2023-10-14 18:19 | 396K | |
| tamago-emacs_nox-4.0..> | 2023-10-14 10:21 | 397K | |
| tamgamp-lv2-g2020061..> | 2023-10-10 06:11 | 657K | |
| tamsyn-font-1.11_1.pkg | 2023-10-08 16:43 | 58K | |
| tamzen-font-1.11.5.pkg | 2023-10-09 14:06 | 24K | |
| tang-14.pkg | 2023-10-09 02:43 | 19K | |
| tanglet-1.6.4_1.pkg | 2023-10-14 11:45 | 21M | |
| tanks-of-freedom-0.7..> | 2023-10-09 23:28 | 7.9M | |
| tap-plugins-0.7.2.pkg | 2023-10-07 16:29 | 52K | |
| tap-plugins-lv2-g201..> | 2023-10-10 04:23 | 8.9M | |
| tapidbus-0.2.1_7.pkg | 2023-10-09 00:53 | 7.9K | |
| tar-stream-chunker-1..> | 2023-10-08 20:17 | 4.4K | |
| tarantool-2.11.1.pkg | 2023-10-10 05:07 | 1.7M | |
| tarantool-c-1.0.1_5.pkg | 2023-10-14 08:39 | 185K | |
| tardy-1.28_15.pkg | 2023-10-14 07:55 | 119K | |
| tarpaulin-0.26.1_1.pkg | 2023-10-10 02:50 | 1.6M | |
| tarsnap-1.0.40_1.pkg | 2023-10-07 20:44 | 256K | |
| tarsnap-gui-1.0.2_4.pkg | 2023-10-11 17:52 | 425K | |
| tarsnap-periodic-1.0..> | 2023-10-10 08:20 | 2.2K | |
| tartarus-0.9.8_5.pkg | 2023-10-08 16:05 | 37K | |
| tartest-2023.04.19.pkg | 2023-10-07 12:04 | 151K | |
| taskctl-1.4.2_15.pkg | 2023-10-10 04:04 | 2.7M | |
| taskd-1.1.0_8.pkg | 2023-10-09 05:28 | 159K | |
| taskflow-3.6.0.pkg | 2023-10-06 16:46 | 126K | |
| tasksh-1.2.0_4.pkg | 2023-10-10 16:03 | 89K | |
| taskwarrior-2.6.2.pkg | 2023-10-07 22:51 | 780K | |
| taskwarrior-tui-0.24..> | 2023-10-14 12:01 | 966K | |
| tass64-1.58.2974.pkg | 2023-10-09 11:03 | 319K | |
| taucs-2.2_24.pkg | 2023-10-14 03:24 | 1.2M | |
| tauthon-2.8.5.pkg | 2023-10-10 09:25 | 12M | |
| tautulli-2.12.2.pkg | 2023-10-10 10:19 | 14M | |
| taxonkit-0.15.0_1.pkg | 2023-10-09 18:02 | 2.5M | |
| tayga-0.9.2.pkg | 2023-10-14 10:19 | 24K | |
| tbb-2020.3_4.pkg | 2023-10-07 11:34 | 11M | |
| tbclock-1.10.pkg | 2023-10-10 03:33 | 12K | |
| tbku-1.120_1.pkg | 2023-10-09 02:12 | 491K | |
| tblis-1.2.0.pkg | 2023-10-09 03:15 | 1.8M | |
| tblite-0.3.0_1.pkg | 2023-10-08 12:52 | 2.3M | |
| tcbasic-2.2.0.pkg | 2023-10-09 10:15 | 15K | |
| tcc-0.9.26_6.pkg | 2023-10-10 11:12 | 143K | |
| tcd-2.2.0_8.pkg | 2023-10-08 18:33 | 11K | |
| tcexam-php80-15.0.4.pkg | 2023-10-08 21:17 | 13M | |
| tcexam-php81-15.0.4.pkg | 2023-10-11 06:03 | 13M | |
| tcexam-php82-15.0.4.pkg | 2023-10-10 15:03 | 13M | |
| tcexam-php83-15.0.4.pkg | 2023-10-09 16:21 | 13M | |
| tcl-Trf-2.1.4_4.pkg | 2023-10-07 00:36 | 103K | |
| tcl-lmdb-0.4.2.pkg | 2023-10-10 20:12 | 11K | |
| tcl-manual-20131001.pkg | 2023-10-10 19:20 | 1.0M | |
| tcl-memchan-2.3.pkg | 2023-10-09 19:47 | 39K | |
| tcl-mmap-1.1.pkg | 2023-10-08 22:43 | 6.9K | |
| tcl-signal-1.4.5.pkg | 2023-10-10 05:08 | 6.6K | |
| tcl-sqlite3-3.34.1.pkg | 2023-10-08 04:04 | 19K | |
| tcl-wrapper-1.1_3.pkg | 2023-10-07 05:58 | 8.0K | |
| tcl85-8.5.19_4.pkg | 2023-10-07 10:19 | 2.0M | |
| tcl86-8.6.13.pkg | 2023-10-05 16:49 | 2.4M | |
| tcl86-sql-20000114_7..> | 2023-10-08 13:13 | 8.4K | |
| tcl87-8.7.a5_1.pkg | 2023-10-06 18:48 | 2.3M | |
| tclX-8.4.1.pkg | 2023-10-08 11:27 | 145K | |
| tclap-1.4.0.r1.pkg | 2023-10-09 21:44 | 25K | |
| tclap12-1.2.5.pkg | 2023-10-08 06:18 | 3.1M | |
| tclbsd-1.9.2.pkg | 2023-10-09 17:34 | 122K | |
| tclcheck-1.1.14.pkg | 2023-10-10 00:54 | 10K | |
| tclgeomap-2.11.6.pkg | 2023-10-07 01:04 | 69K | |
| tclhttpd-3.5.1_4.pkg | 2023-10-09 22:47 | 327K | |
| tcllauncher-1.10.pkg | 2023-10-09 08:12 | 15K | |
| tcllib-1.21.pkg | 2023-10-07 04:49 | 2.3M | |
| tcllibc-1.21.pkg | 2023-10-14 11:05 | 109K | |
| tclock-1.0.1_3.pkg | 2023-10-14 04:32 | 9.1K | |
| tclreadline-2.3.8.pkg | 2023-10-09 13:56 | 46K | |
| tclsasl-1.0_3.pkg | 2023-10-14 15:25 | 26K | |
| tclsoap-1.6.7.pkg | 2023-10-10 01:47 | 40K | |
| tclsyslog-2.1_1.pkg | 2023-10-10 08:45 | 7.8K | |
| tclthread-2.8.8.pkg | 2023-10-14 04:37 | 107K | |
| tcltls-1.7.18.pkg | 2023-10-07 01:56 | 23K | |
| tcludp-1.0.11.pkg | 2023-10-12 11:58 | 12K | |
| tclvfs-20080503.pkg | 2023-10-09 06:19 | 70K | |
| tclwebtest-1.0_3.pkg | 2023-10-10 20:01 | 75K | |
| tclxml-3.3_7.pkg | 2023-10-08 11:14 | 139K | |
| tcmplex-panteltje-0...> | 2023-10-10 04:48 | 44K | |
| tcpblast-1.1_1.pkg | 2023-10-09 10:06 | 3.7K | |
| tcpcat-1.2.0.pkg | 2023-10-14 05:30 | 10K | |
| tcpcrypt-0.5_1.pkg | 2023-10-09 20:33 | 48K | |
| tcpdump-4.99.4_1.pkg | 2023-10-08 20:03 | 406K | |
| tcpflow-1.5.0_6.pkg | 2023-10-09 06:39 | 232K | |
| tcpick-0.2.1_1.pkg | 2023-10-14 15:22 | 23K | |
| tcpillust-2.01_2,1.pkg | 2023-10-10 00:27 | 33K | |
| tcping-2.1.0.pkg | 2023-10-09 19:07 | 5.4K | |
| tcpkali-1.1.1.201801..> | 2023-10-09 02:16 | 130K | |
| tcplist-2.2_2.pkg | 2023-10-09 16:33 | 9.2K | |
| tcpmssd-1.1_1.pkg | 2023-10-10 15:12 | 7.0K | |
| tcpproxy-1.2.pkg | 2023-10-10 10:13 | 22K | |
| tcpreen-1.4.4_3.pkg | 2023-10-09 12:23 | 28K | |
| tcpreplay-4.4.3.pkg | 2023-10-10 21:49 | 173K | |
| tcpser-g20210425,1.pkg | 2023-10-09 17:40 | 26K | |
| tcpsg-0.0.2.pkg | 2023-10-14 18:01 | 6.2K | |
| tcpshow-1.74_2.pkg | 2023-10-10 00:47 | 19K | |
| tcpslice-1.6,1.pkg | 2023-10-09 04:40 | 16K | |
| tcpsplit-0.2.pkg | 2023-10-10 13:54 | 6.7K | |
| tcpstat-1.5.pkg | 2023-10-10 20:53 | 29K | |
| tcptrace-6.6.8.pkg | 2023-10-09 13:54 | 144K | |
| tcptraceroute-1.5bet..> | 2023-10-09 03:51 | 32K | |
| tcptrack-1.4.2_3.pkg | 2023-10-14 13:51 | 24K | |
| tcpview-1.0_7.pkg | 2023-10-10 16:01 | 103K | |
| tcpwatch-1.3_4.pkg | 2023-10-09 09:25 | 23K | |
| tcpxd-1.4_2.pkg | 2023-10-11 04:11 | 8.2K | |
| tcpxtract-1.0.1.pkg | 2023-10-08 15:11 | 13K | |
| tcshrc-1.6.2.pkg | 2023-10-08 12:25 | 26K | |
| td-system-tools-1.2...> | 2023-10-14 07:16 | 12K | |
| tdb-1.4.7,1.pkg | 2023-10-06 12:24 | 72K | |
| tdbc-1.1.5.pkg | 2023-10-14 13:21 | 93K | |
| tdetect-0.2.pkg | 2023-10-09 18:34 | 4.2K | |
| tdfiglet-0.5.pkg | 2023-10-14 14:07 | 2.1M | |
| tdfsb-0.0.10_10.pkg | 2023-10-14 13:55 | 31K | |
| tdiary-5.2.4.pkg | 2023-10-08 22:17 | 3.6M | |
| tdir-1.73.pkg | 2023-10-08 21:40 | 5.4K | |
| tdl-1.5.2_2.pkg | 2023-10-11 12:16 | 33K | |
| tdlib-1.8.0.pkg | 2023-10-10 03:16 | 11M | |
| te-aspell-0.01.2_1,2..> | 2023-10-10 19:56 | 885K | |
| te-hunspell-0.01.2_3..> | 2023-10-14 14:07 | 413K | |
| te-libreoffice-7.5.5..> | 2023-10-07 22:38 | 349K | |
| tea-62.0.2.pkg | 2023-10-08 21:32 | 674K | |
| tealdeer-1.6.1_1.pkg | 2023-10-08 15:30 | 1.2M | |
| team-3.1_3.pkg | 2023-10-09 06:10 | 9.1K | |
| teamspeak3-server-3...> | 2023-10-14 12:24 | 6.7M | |
| teamwords-0.2.1_10.pkg | 2023-10-14 10:46 | 1.7M | |
| teapot-2.3.0.pkg | 2023-10-10 19:29 | 306K | |
| teckit-2.5.11.pkg | 2023-10-05 16:45 | 1.1M | |
| tecnoballz-0.93.1_2.pkg | 2023-10-09 18:23 | 1.6M | |
| teco-0398_1.pkg | 2023-10-10 20:30 | 202K | |
| ted-2.23_5.pkg | 2023-10-10 17:12 | 2.1M | |
| teem-1.11.0.pkg | 2023-10-09 18:53 | 1.0M | |
| teeworlds-0.7.5_2.pkg | 2023-10-10 19:11 | 8.0M | |
| tela-icon-theme-2023..> | 2023-10-08 04:06 | 2.1M | |
| telak-0.7_1.pkg | 2023-10-14 17:34 | 9.3K | |
| telegraf-1.28.1.pkg | 2023-10-14 05:46 | 34M | |
| telegram-cli-2020010..> | 2023-10-14 13:52 | 899K | |
| telegram-desktop-4.8..> | 2023-10-10 05:58 | 31M | |
| telegram-desktop-qt6..> | 2023-10-08 20:17 | 31M | |
| telegram-purple-1.4...> | 2023-10-10 00:51 | 400K | |
| telegramqml-0.9.2_4.pkg | 2023-10-07 16:05 | 383K | |
| teleirc-2.3.0_2.pkg | 2023-10-12 00:38 | 1.9M | |
| telepathy-accounts-s..> | 2023-10-06 17:45 | 8.3K | |
| telepathy-farstream-..> | 2023-10-06 12:45 | 101K | |
| telepathy-gabble-0.1..> | 2023-10-07 09:38 | 678K | |
| telepathy-glib-0.24...> | 2023-10-06 12:03 | 2.0M | |
| telepathy-idle-0.2.0..> | 2023-10-07 10:28 | 51K | |
| telepathy-logger-0.8..> | 2023-10-06 14:46 | 144K | |
| telepathy-logger-qt5..> | 2023-10-06 17:19 | 46K | |
| telepathy-mission-co..> | 2023-10-06 14:38 | 183K | |
| telepathy-qt5-0.9.8_..> | 2023-10-06 15:14 | 3.8M | |
| telepathy-salut-0.8...> | 2023-10-10 12:50 | 418K | |
| telepathy-sofiasip-0..> | 2023-10-09 09:25 | 48K | |
| teleport-5.2.5_3.pkg | 2023-10-10 00:11 | 33M | |
| tellico-3.5.1.pkg | 2023-10-10 02:47 | 5.9M | |
| tempcontrol-1.2_3.pkg | 2023-10-14 07:06 | 22K | |
| temperature.app-1.5.pkg | 2023-10-11 02:43 | 16K | |
| tempest_for_eliza-1...> | 2023-10-14 05:34 | 13K | |
| template-glib-3.36.1..> | 2023-10-07 22:09 | 69K | |
| template_-2.2.3.pkg | 2023-10-08 12:30 | 16K | |
| templatelite-2.10.pkg | 2023-10-09 21:43 | 175K | |
| tenebrae-1.04_13.pkg | 2023-10-14 18:24 | 2.8M | |
| tenshi-0.17_1.pkg | 2023-10-14 12:32 | 24K | |
| teo-1.8.4_1.pkg | 2023-10-09 05:49 | 150K | |
| tepl6-6.4.0_2.pkg | 2023-10-06 19:23 | 230K | |
| tere-1.5.1_1.pkg | 2023-10-08 16:06 | 723K | |
| termatrix-0.2.pkg | 2023-10-08 14:14 | 4.7K | |
| termbox-1.1.3.pkg | 2023-10-14 10:58 | 40K | |
| termcolor-2.1.0.pkg | 2023-10-07 19:49 | 5.1K | |
| terminal-image-viewe..> | 2023-10-14 10:10 | 89K | |
| terminal.app-0.9.9_5..> | 2023-10-08 06:01 | 85K | |
| terminality-2.1.pkg | 2023-10-09 01:35 | 147K | |
| terminator-2.1.3.pkg | 2023-10-08 13:36 | 428K | |
| terminfo-db-20210816..> | 2023-10-07 17:30 | 285K | |
| terminology-1.13.0_1..> | 2023-10-10 04:25 | 2.5M | |
| terminus-font-4.49.1..> | 2023-10-14 15:49 | 1.5M | |
| terminus-ttf-4.49.3.pkg | 2023-10-12 11:45 | 345K | |
| termit-3.1_1.pkg | 2023-10-10 17:49 | 39K | |
| termplay-2.0.6_29.pkg | 2023-10-10 01:46 | 510K | |
| termscp-0.10.0_7.pkg | 2023-10-14 12:02 | 2.9M | |
| termshark-2.4.0_12.pkg | 2023-10-10 17:52 | 4.5M | |
| termshot-0.2.7_2.pkg | 2023-10-14 02:16 | 1.8M | |
| terraform-1.5.6_1.pkg | 2023-10-08 05:09 | 13M | |
| terraform-docs-0.16...> | 2023-10-10 07:05 | 4.2M | |
| terraform-provider-g..> | 2023-10-14 10:56 | 4.6M | |
| terraform-provider-v..> | 2023-10-08 19:35 | 4.6M | |
| terraform-switcher-0..> | 2023-10-08 17:48 | 3.1M | |
| terragrunt-0.50.6_1.pkg | 2023-10-09 11:58 | 8.0M | |
| teseq-1.1.1_1.pkg | 2023-10-10 22:34 | 50K | |
| tesseract-5.3.2.pkg | 2023-10-07 04:59 | 2.2M | |
| tesseract-data-4.1.0..> | 2023-10-05 16:51 | 368M | |
| tesseract-game-2014...> | 2023-10-08 20:21 | 915K | |
| tesseract-game-data-..> | 2023-10-07 10:28 | 233M | |
| test-drive-0.4.0.7_1..> | 2023-10-14 03:24 | 22K | |
| testdisk-7.1_1.pkg | 2023-10-09 04:01 | 361K | |
| testssl.sh-3.0.8.pkg | 2023-10-11 05:05 | 701K | |
| tet-aspell-0.1.1_1,2..> | 2023-10-09 21:58 | 63K | |
| tetgen-1.5.1.pkg | 2023-10-07 21:30 | 302K | |
| tetradraw-2.0.2_1.pkg | 2023-10-09 05:43 | 57K | |
| tetraproc-0.8.6_3.pkg | 2023-10-09 18:25 | 52K | |
| tetrinet-0.11_1.pkg | 2023-10-14 10:10 | 43K | |
| tetrinet-x-1.13.16_2..> | 2023-10-10 09:24 | 32K | |
| tetzle-2.2.2_1.pkg | 2023-10-08 22:00 | 471K | |
| tevent-0.13.0_1.pkg | 2023-10-06 13:49 | 48K | |
| tex-basic-engines-20..> | 2023-10-05 20:06 | 1.0M | |
| tex-dvipdfmx-2023031..> | 2023-10-06 11:16 | 3.1M | |
| tex-dvipsk-2023.1.pkg | 2023-10-06 06:24 | 3.1M | |
| tex-formats-20230313..> | 2023-10-06 08:00 | 17M | |
| tex-jadetex-3.13_5.pkg | 2023-10-06 21:32 | 11M | |
| tex-kpathsea-6.3.5.pkg | 2023-10-05 16:45 | 167K | |
| tex-libtexlua-5.3.6_..> | 2023-10-05 16:46 | 173K | |
| tex-libtexluajit-2.1..> | 2023-10-05 16:47 | 357K | |
| tex-luatex-1.16.0_1.pkg | 2023-10-06 10:51 | 77M | |
| tex-ptexenc-1.4.3.pkg | 2023-10-05 16:46 | 28K | |
| tex-synctex-2.0.0_2.pkg | 2023-10-07 06:47 | 75K | |
| tex-web2c-20230313.pkg | 2023-10-05 19:52 | 1.0M | |
| tex-xdvik-22.87.06_2..> | 2023-10-08 07:31 | 353K | |
| tex-xetex-0.99993_4.pkg | 2023-10-06 12:36 | 42M | |
| tex-xmltex-1.9_4.pkg | 2023-10-06 17:23 | 9.2M | |
| texi2db-0.5_1.pkg | 2023-10-14 09:51 | 17K | |
| texi2html-5.0_2,1.pkg | 2023-10-05 17:08 | 486K | |
| texi2mdoc-0.1.2.pkg | 2023-10-09 14:36 | 22K | |
| texinfo-7.0.3,1.pkg | 2023-10-05 17:12 | 1.3M | |
| texlab-4.2.0_10.pkg | 2023-10-09 11:39 | 8.6M | |
| texlive-base-2023031..> | 2023-10-05 21:41 | 4.2M | |
| texlive-docs-2023031..> | 2023-10-07 14:03 | 2.3G | |
| texlive-full-2023031..> | 2023-10-14 09:08 | 940 | |
| texlive-texmf-202303..> | 2023-10-06 07:43 | 1.1G | |
| texlive-texmf-source..> | 2023-10-14 10:35 | 66M | |
| texlive-tlmgr-202303..> | 2023-10-05 16:48 | 2.5M | |
| texmacs-1.99.4_6.pkg | 2023-10-10 09:29 | 19M | |
| texmaker-5.0.3_4,3.pkg | 2023-10-10 11:25 | 9.6M | |
| texstudio-4.6.3.pkg | 2023-10-09 03:17 | 28M | |
| textadept-11.4_1.pkg | 2023-10-09 18:11 | 2.8M | |
| textmail-20070803_40..> | 2023-10-09 17:48 | 20K | |
| textmaze-1.2.pkg | 2023-10-14 13:05 | 7.2K | |
| textnote-1.3.0_14.pkg | 2023-10-14 16:58 | 1.4M | |
| textogif-1.1_4.pkg | 2023-10-09 16:27 | 3.9K | |
| textql-g20210706_7.pkg | 2023-10-10 07:31 | 1.5M | |
| texvc-20050202_8.pkg | 2023-10-10 16:36 | 282K | |
| texworks-0.6.7_3.pkg | 2023-10-11 00:48 | 2.4M | |
| teyjus-2.1.7_1.pkg | 2023-10-10 03:41 | 1.1M | |
| tf-5.0b8_4.pkg | 2023-10-14 14:56 | 327K | |
| tfel-mfront-4.0.0_3.pkg | 2023-10-14 09:08 | 3.1M | |
| tfel-mfront-edf-3.2...> | 2023-10-07 09:08 | 2.6M | |
| tfhe-1.0.1.30.pkg | 2023-10-14 10:49 | 108K | |
| tflint-0.47.0_1.pkg | 2023-10-08 18:01 | 6.3M | |
| tfsec-1.28.1_9.pkg | 2023-10-14 15:43 | 9.4M | |
| tftp-hpa-5.2_1.pkg | 2023-10-08 05:16 | 39K | |
| tftpgrab-0.2.pkg | 2023-10-10 08:35 | 13K | |
| tg-libreoffice-7.5.5..> | 2023-10-07 23:07 | 2.5M | |
| tg_owt-0.0.20230501_..> | 2023-10-07 21:43 | 6.7M | |
| tgif-4.2.5_3.pkg | 2023-10-08 08:07 | 1.2M | |
| tgif2tex-2.13_4.pkg | 2023-10-09 07:05 | 49K | |
| th-libreoffice-7.5.5..> | 2023-10-07 14:06 | 602K | |
| thales-1.0_5.pkg | 2023-10-14 18:44 | 75K | |
| thanos-0.28.0_10.pkg | 2023-10-09 22:57 | 14M | |
| the-3.3.r4_2.pkg | 2023-10-10 04:40 | 408K | |
| the-algorithms-c++-g..> | 2023-10-14 06:17 | 512K | |
| the-way-0.19.2_5.pkg | 2023-10-09 20:56 | 2.3M | |
| the_silver_searcher-..> | 2023-10-09 14:02 | 35K | |
| thebridge-1.09_2.pkg | 2023-10-09 08:48 | 92K | |
| thefish-0.6.7_1.pkg | 2023-10-09 07:31 | 35K | |
| thefuck-3.32.pkg | 2023-10-09 08:34 | 127K | |
| thegrind-0.1.2_6.pkg | 2023-10-09 14:31 | 114K | |
| theonionbox-4.3.1_2.pkg | 2023-10-14 12:40 | 11M | |
| thermofun-0.4.4.pkg | 2023-10-11 01:17 | 1.0M | |
| thewidgetfactory-0.2..> | 2023-10-09 06:51 | 10K | |
| thingylaunch-3.0.1.pkg | 2023-10-09 19:04 | 33K | |
| thinkingrock-2.2.1_3..> | 2023-10-14 15:59 | 30M | |
| thirtybees-1.3.0.pkg | 2023-10-10 06:32 | 26M | |
| thokr-0.4.1_7.pkg | 2023-10-09 11:10 | 570K | |
| thonny-py39-4.1.2.pkg | 2023-10-10 09:05 | 1.6M | |
| three.js-156.pkg | 2023-10-08 10:34 | 231M | |
| threema-web-2.5.0.pkg | 2023-10-09 10:00 | 22M | |
| thrift-0.16.0,1.pkg | 2023-10-08 09:27 | 1.1M | |
| thrift-c_glib-0.16.0..> | 2023-10-08 22:27 | 62K | |
| thrift-cpp-0.16.0_2,..> | 2023-10-06 17:11 | 303K | |
| thrill-g20200406_1.pkg | 2023-10-10 19:08 | 2.6M | |
| throttled-0.5.2.pkg | 2023-10-08 16:52 | 13K | |
| thrulay-0.9_1.pkg | 2023-10-08 12:04 | 61K | |
| thrust-1.9.5_1.pkg | 2023-10-07 23:48 | 491K | |
| thttpd-2.29_1.pkg | 2023-10-08 18:01 | 64K | |
| thumbnail_index-1998..> | 2023-10-10 23:59 | 6.0K | |
| thunar-4.18.7.pkg | 2023-10-07 09:26 | 1.3M | |
| thunar-archive-plugi..> | 2023-10-07 19:06 | 33K | |
| thunar-media-tags-pl..> | 2023-10-08 10:02 | 55K | |
| thunar-vcs-plugin-0...> | 2023-10-08 05:39 | 164K | |
| thunderbird-102.15.1..> | 2023-10-14 02:19 | 54M | |
| thunderbird-dictiona..> | 2023-10-14 10:25 | 13M | |
| thundercache-6.1_16.pkg | 2023-10-08 14:50 | 189K | |
| ti-hunspell-20090911..> | 2023-10-10 05:39 | 361K | |
| tiatracker-1.3_2.pkg | 2023-10-14 06:18 | 3.9M | |
| ticcutils-0.32_5.pkg | 2023-10-07 00:21 | 257K | |
| ticker-4.5.14_2.pkg | 2023-10-08 23:50 | 2.9M | |
| tickrs-0.14.9_1.pkg | 2023-10-12 01:29 | 1.2M | |
| tidy-devel-090315.c_..> | 2023-10-09 14:41 | 255K | |
| tidy-html5-5.8.0_2.pkg | 2023-10-07 02:31 | 376K | |
| tidy-lib-090315.c_3.pkg | 2023-10-07 04:59 | 268K | |
| tidy4-20000804_3.pkg | 2023-10-09 14:20 | 102K | |
| tidyp-1.04_2.pkg | 2023-10-07 01:26 | 199K | |
| tiempo-1.9.0_1.pkg | 2023-10-09 03:39 | 1.5M | |
| tiemu3-3.03_13.pkg | 2023-10-14 15:09 | 1.5M | |
| tif22pnm-0.14_1.pkg | 2023-10-08 07:48 | 34K | |
| tiff-4.4.0_2.pkg | 2023-10-05 17:41 | 864K | |
| tiffgt-4.5.1_1.pkg | 2023-10-10 03:33 | 8.7K | |
| tifmerge-1.0_1.pkg | 2023-10-14 14:53 | 4.9K | |
| tig-2.5.8.pkg | 2023-10-09 10:08 | 189K | |
| tigcc-0.96.b8_11.pkg | 2023-10-10 00:55 | 3.0M | |
| tigervnc-server-1.13..> | 2023-10-10 08:59 | 1.1M | |
| tigervnc-viewer-1.13..> | 2023-10-07 12:45 | 293K | |
| tigervnc-viewer-java..> | 2023-10-11 13:54 | 568K | |
| tightvnc-1.3.10_8.pkg | 2023-10-10 07:51 | 699K | |
| tijmp-0.7_1.pkg | 2023-10-09 19:08 | 112K | |
| tikiwiki-24.2.pkg | 2023-10-09 17:44 | 49M | |
| tikzit-2.1.6_26.pkg | 2023-10-08 22:33 | 293K | |
| tilda-1.5.0_2.pkg | 2023-10-09 04:22 | 93K | |
| tile38-1.12.0_14.pkg | 2023-10-09 10:39 | 4.5M | |
| tiled-1.8.6.pkg | 2023-10-09 03:39 | 2.7M | |
| tiledb-2.16.3.pkg | 2023-10-08 06:46 | 5.5M | |
| tilem-2.0_5.pkg | 2023-10-14 03:44 | 2.2M | |
| tileworld-1.3.0_6.pkg | 2023-10-08 17:31 | 685K | |
| tilix-1.9.5_1.pkg | 2023-10-14 07:25 | 1.3M | |
| tilp2-1.18_3.pkg | 2023-10-08 23:05 | 310K | |
| timbl-6.8.2.pkg | 2023-10-14 14:41 | 305K | |
| timbre-mill-0.5.6_1.pkg | 2023-10-10 02:25 | 182K | |
| timed-8.1_1.pkg | 2023-10-08 17:39 | 32K | |
| timeless-1.0_7.pkg | 2023-10-09 20:45 | 284K | |
| timelimit-1.9.2.pkg | 2023-10-08 12:08 | 7.4K | |
| timely-lv2-g20190412..> | 2023-10-10 23:04 | 5.6K | |
| timemachine-0.3.3_9.pkg | 2023-10-10 15:06 | 75K | |
| timemon-4.2_6.pkg | 2023-10-07 16:20 | 28K | |
| timescaledb-2.11.2.pkg | 2023-10-08 04:14 | 499K | |
| timescaledb-backup-0..> | 2023-10-10 16:07 | 2.2M | |
| timescaledb-tune-0.1..> | 2023-10-09 01:46 | 697K | |
| timetrace-0.14.3_15.pkg | 2023-10-09 22:13 | 2.0M | |
| timewarrior-1.6.0.pkg | 2023-10-10 12:34 | 290K | |
| timezonemap-0.4.5.2_..> | 2023-10-07 11:13 | 1.9M | |
| timg-1.5.1.pkg | 2023-10-09 03:20 | 156K | |
| timidity++-2.15.0.pkg | 2023-10-07 20:20 | 477K | |
| timidity++-emacs-2.1..> | 2023-10-11 06:13 | 9.2K | |
| timidity++-gtk-2.15...> | 2023-10-09 15:05 | 18K | |
| timidity++-motif-2.1..> | 2023-10-09 21:47 | 11K | |
| timidity++-slang-2.1..> | 2023-10-14 05:19 | 8.1K | |
| timidity++-xaw-2.15...> | 2023-10-14 15:49 | 63K | |
| timidity++-xskin-2.1..> | 2023-10-09 03:20 | 22K | |
| timidity-0.2i_1.pkg | 2023-10-06 17:47 | 8.9M | |
| tin-2.6.2_1.pkg | 2023-10-10 15:42 | 611K | |
| tinc-1.0.36_2.pkg | 2023-10-08 19:52 | 100K | |
| tinc-devel-1.1pre18_..> | 2023-10-10 21:49 | 224K | |
| tinker-8.10.5_1.pkg | 2023-10-14 14:43 | 28M | |
| tint2-16.7_3.pkg | 2023-10-07 11:25 | 336K | |
| tintfu-0.0.4_3.pkg | 2023-10-14 04:27 | 69K | |
| tintin++-2.02.31.pkg | 2023-10-08 19:42 | 1.4M | |
| tiny-bignum-c-g20210..> | 2023-10-14 09:32 | 13K | |
| tiny-network-utiliti..> | 2023-10-08 00:35 | 9.2K | |
| tinycbor-0.6.0.pkg | 2023-10-11 09:35 | 42K | |
| tinycdb-0.78_2.pkg | 2023-10-07 00:41 | 28K | |
| tinyfugue-devel-5.1...> | 2023-10-14 05:39 | 351K | |
| tinygo-0.19.0_14.pkg | 2023-10-08 18:29 | 26M | |
| tinylaf-1.4.0.pkg | 2023-10-10 12:46 | 888K | |
| tinyldap-0.0.2017031..> | 2023-10-10 05:13 | 79K | |
| tinymce-6.7.0.pkg | 2023-10-11 05:36 | 530K | |
| tinymt-1.1.2.pkg | 2023-10-10 18:48 | 7.2K | |
| tinyobjloader-2.0.0...> | 2023-10-09 01:47 | 73K | |
| tinyows-1.2.0_5.pkg | 2023-10-10 21:04 | 166K | |
| tinyproxy-1.11.1,1.pkg | 2023-10-10 14:04 | 50K | |
| tinystats-1.1.pkg | 2023-10-14 11:09 | 9.4K | |
| tinywm-1.3_2.pkg | 2023-10-08 23:22 | 4.2K | |
| tinyxml-2.6.2_4.pkg | 2023-10-06 16:51 | 132K | |
| tinyxml2-9.0.0,1.pkg | 2023-10-06 16:20 | 95K | |
| tio-2.0.pkg | 2023-10-09 15:58 | 30K | |
| tippecanoe-2.26.1.pkg | 2023-10-09 06:00 | 414K | |
| tiramisu-2.0.2021110..> | 2023-10-09 18:24 | 10K | |
| tircproxy-0.4.5_4.pkg | 2023-10-08 22:54 | 15K | |
| titlefix-0.5.3.pkg | 2023-10-08 22:11 | 5.8K | |
| tits-1.3.0.pkg | 2023-10-08 15:55 | 25K | |
| tivodecode-0.2.p4.pkg | 2023-10-09 11:03 | 32K | |
| tivoka-3.5.2.pkg | 2023-10-10 18:12 | 12K | |
| tix-8.4.3_1.pkg | 2023-10-14 15:11 | 335K | |
| tk-aspell-0.01.0_1.pkg | 2023-10-09 06:17 | 66K | |
| tk-hunspell-0.1.6.pkg | 2023-10-14 07:23 | 167K | |
| tk-wrapper-1.1_3.pkg | 2023-10-06 22:13 | 7.8K | |
| tk85-8.5.19_2.pkg | 2023-10-09 18:19 | 1.7M | |
| tk86-8.6.13.pkg | 2023-10-06 07:41 | 1.8M | |
| tk87-8.7.a5.pkg | 2023-10-07 07:14 | 762K | |
| tkRunIt-0.94.1_2.pkg | 2023-10-12 12:37 | 6.7K | |
| tkabber-1.1.2_2.pkg | 2023-10-08 11:05 | 902K | |
| tkabber-plugins-1.1...> | 2023-10-10 00:52 | 659K | |
| tkcon-2.5.pkg | 2023-10-08 21:39 | 114K | |
| tkcron-2.12_3.pkg | 2023-10-08 12:00 | 4.8K | |
| tkcvs-8.2.3.pkg | 2023-10-09 09:28 | 177K | |
| tkdiff-5.0.pkg | 2023-10-07 14:45 | 211K | |
| tkdnd-2.8.pkg | 2023-10-09 16:52 | 37K | |
| tkdvd-4.0.9_4.pkg | 2023-10-10 11:21 | 42K | |
| tkeca-4.4.3.pkg | 2023-10-09 02:34 | 38K | |
| tkfont-1.1_3.pkg | 2023-10-09 17:10 | 14K | |
| tkgate-2.1.pkg | 2023-10-10 10:31 | 4.8M | |
| tkinfo-2.11.pkg | 2023-10-08 12:35 | 43K | |
| tkmoo-0.3.32_3.pkg | 2023-10-10 03:04 | 75K | |
| tkp4-1.12_2.pkg | 2023-10-08 20:19 | 95K | |
| tkpng-0.9_1.pkg | 2023-10-06 21:02 | 14K | |
| tkregexp-3.1.pkg | 2023-10-10 07:18 | 25K | |
| tkscanfax-1.1.8_2,1.pkg | 2023-10-08 14:36 | 165K | |
| tkshape-0.4_2.pkg | 2023-10-09 14:52 | 23K | |
| tktable-2.10_1.pkg | 2023-10-08 05:45 | 56K | |
| tktray-1.3.9.pkg | 2023-10-08 00:08 | 14K | |
| tktreectrl-2.4.1.pkg | 2023-10-07 22:58 | 316K | |
| tkxmlive-0.1.5_2.pkg | 2023-10-09 20:53 | 68K | |
| tl-aspell-0.02.1_1,2..> | 2023-10-09 18:51 | 94K | |
| tl-expected-1.1.0_1.pkg | 2023-10-08 06:31 | 12K | |
| tla-1.3.5_1.pkg | 2023-10-09 23:53 | 363K | |
| tlapack-g20220628_1.pkg | 2023-10-09 00:56 | 82K | |
| tlb-0.11a_1.pkg | 2023-10-10 04:37 | 26K | |
| tlci-0.1.0.2.pkg | 2023-10-08 19:03 | 13K | |
| tlf-1.4.1_1.pkg | 2023-10-09 16:57 | 254K | |
| tllist-1.1.0.pkg | 2023-10-06 22:33 | 3.1K | |
| tls-check-1.0.2_7.pkg | 2023-10-08 21:44 | 132K | |
| tlsc-2.0.pkg | 2023-10-09 17:55 | 8.5K | |
| tlsdate-0.0.13_5.pkg | 2023-10-09 06:27 | 158K | |
| tlsh-4.7.2.pkg | 2023-10-11 01:29 | 885K | |
| tlwg-ttf-0.6.1.pkg | 2023-10-11 13:21 | 1.8M | |
| tlx-0.6.1.pkg | 2023-10-10 13:07 | 865K | |
| tm-0.4.1_1.pkg | 2023-10-08 22:01 | 15K | |
| tmake-2.12.pkg | 2023-10-10 13:15 | 37K | |
| tmate-2.4.0_3.pkg | 2023-10-08 18:44 | 208K | |
| tmate-ssh-server-g20..> | 2023-10-14 08:49 | 168K | |
| tmatrix-1.4.pkg | 2023-10-08 15:58 | 38K | |
| tme-0.8_7.pkg | 2023-10-14 09:43 | 414K | |
| tmpmail-1.2.3.pkg | 2023-10-09 22:04 | 4.6K | |
| tmpreaper-1.6.17.pkg | 2023-10-08 22:34 | 13K | |
| tmpwatch-2.11.pkg | 2023-10-10 06:16 | 14K | |
| tmu-1.901.b_2.pkg | 2023-10-10 20:30 | 834K | |
| tmux-3.3a_1.pkg | 2023-10-06 23:57 | 406K | |
| tmux-mem-cpu-load-3...> | 2023-10-11 00:38 | 14K | |
| tmux-xpanes-4.1.4.pkg | 2023-10-09 17:56 | 28K | |
| tmux23-2.3_1.pkg | 2023-10-08 12:07 | 238K | |
| tmv-0.75_9.pkg | 2023-10-09 09:24 | 4.0M | |
| tn-aspell-1.0.1.0_1,..> | 2023-10-10 02:39 | 41K | |
| tn-hunspell-20110323..> | 2023-10-08 19:08 | 65K | |
| tn-libreoffice-7.5.5..> | 2023-10-08 05:02 | 184K | |
| tn5250-0.17.4_1.pkg | 2023-10-10 21:57 | 158K | |
| tnef-1.4.12.pkg | 2023-10-07 16:57 | 28K | |
| tnef2txt-1.4.pkg | 2023-10-08 22:04 | 8.5K | |
| tnftp-20230507.pkg | 2023-10-09 16:28 | 83K | |
| tnftpd-20200704.pkg | 2023-10-09 20:28 | 89K | |
| tnt-1.2.6.pkg | 2023-10-07 17:02 | 42K | |
| tntnet-2.2.1_5.pkg | 2023-10-14 10:49 | 591K | |
| tnylpo-1.1.4.pkg | 2023-10-09 07:51 | 79K | |
| tochnog-20140100_11.pkg | 2023-10-08 23:58 | 327K | |
| todo-2.12.0.pkg | 2023-10-09 07:04 | 15K | |
| todour-2.22.pkg | 2023-10-14 09:03 | 206K | |
| tofi-0.9.1.pkg | 2023-10-14 05:24 | 47K | |
| togl-2.0_2.pkg | 2023-10-07 04:55 | 122K | |
| toilet-0.3_2.pkg | 2023-10-08 22:20 | 707K | |
| tokay-0.6.4_1.pkg | 2023-10-08 15:34 | 694K | |
| tokei-12.1.2_25.pkg | 2023-10-09 11:53 | 1.0M | |
| tokio-console-0.1.7_..> | 2023-10-14 14:51 | 1.5M | |
| tokodon-23.08.1.pkg | 2023-10-14 18:33 | 387K | |
| tokyocabinet-1.4.48.pkg | 2023-10-06 22:02 | 1.0M | |
| tokyodystopia-0.9.15..> | 2023-10-14 06:49 | 129K | |
| tokyopromenade-0.9.2..> | 2023-10-09 19:43 | 91K | |
| tokyotyrant-1.1.41_2..> | 2023-10-06 23:34 | 187K | |
| tolua++-1.0.93_3.pkg | 2023-10-07 02:22 | 45K | |
| tolua-5.2.4.pkg | 2023-10-10 07:44 | 47K | |
| tomatoes-1.55_2.pkg | 2023-10-11 05:01 | 8.0M | |
| tomcat-devel-11.0.0...> | 2023-10-09 18:49 | 10M | |
| tomcat-native-1.2.38..> | 2023-10-10 17:14 | 87K | |
| tomcat9-9.0.80.pkg | 2023-10-07 20:54 | 9.9M | |
| tomcat85-8.5.93.pkg | 2023-10-06 20:41 | 9.0M | |
| tomcat101-10.1.13.pkg | 2023-10-08 04:42 | 11M | |
| tome4-1.7.6.pkg | 2023-10-14 12:50 | 453M | |
| tome4-beta-1.6.0.b7_..> | 2023-10-09 10:23 | 397M | |
| tomee-1.7.4.pkg | 2023-10-08 15:08 | 29M | |
| toml-f-0.3.1_1.pkg | 2023-10-06 23:07 | 389K | |
| toml11-3.7.1.pkg | 2023-10-07 05:36 | 56K | |
| tomsfastmath-0.13.1_..> | 2023-10-09 11:08 | 88K | |
| tong-1.3_2.pkg | 2023-10-08 15:11 | 44M | |
| toolboxkit-0.8_11.pkg | 2023-10-07 15:12 | 5.6K | |
| toonel-0.0.50.50_1.pkg | 2023-10-11 06:04 | 110K | |
| tooth-g20230115_1.pkg | 2023-10-14 16:40 | 203K | |
| topaz-3.41_2.pkg | 2023-10-08 20:53 | 294K | |
| topcom-0.17.8_1.pkg | 2023-10-07 10:36 | 2.6M | |
| topgrade-11.0.2_3.pkg | 2023-10-08 14:40 | 1.1M | |
| topless-1.52.pkg | 2023-10-10 00:08 | 6.8K | |
| topologic-space-mode..> | 2023-10-08 00:53 | 255K | |
| toppler-1.3_3.pkg | 2023-10-09 02:41 | 1.6M | |
| tor-0.4.8.5.pkg | 2023-10-06 22:19 | 2.2M | |
| tor-browser-12.0.6_4..> | 2023-10-10 12:38 | 53M | |
| torcs-1.3.7_5.pkg | 2023-10-08 20:57 | 323M | |
| tornado-1.4_4.pkg | 2023-10-08 19:20 | 36K | |
| torque-2.5.13_2,1.pkg | 2023-10-08 06:05 | 880K | |
| torrent-0.8.2_12.pkg | 2023-10-09 21:24 | 430K | |
| torrent-file-editor-..> | 2023-10-09 14:34 | 278K | |
| torrentcheck-1.00_1.pkg | 2023-10-10 09:14 | 15K | |
| torrentsniff-0.3.0_1..> | 2023-10-14 13:49 | 4.8K | |
| torrentzip-0.2_3.pkg | 2023-10-14 11:14 | 21K | |
| torrus-2.09_2.pkg | 2023-10-14 12:42 | 424K | |
| torsocks-2.3.0_1.pkg | 2023-10-14 13:50 | 65K | |
| tortoisehg-6.5.1.pkg | 2023-10-08 16:07 | 1.6M | |
| tosha-0.6_1.pkg | 2023-10-10 10:46 | 29K | |
| totd-1.5.1_2.pkg | 2023-10-11 19:26 | 38K | |
| totem-3.38.2_4.pkg | 2023-10-06 18:27 | 941K | |
| totem-pl-parser-3.26..> | 2023-10-06 11:27 | 93K | |
| totp-cli-1.5.3_1.pkg | 2023-10-10 17:46 | 2.3M | |
| touchegg-2.0.17.pkg | 2023-10-08 15:58 | 87K | |
| tox_extension_messag..> | 2023-10-07 18:50 | 6.3K | |
| toxbot-g20180325_2.pkg | 2023-10-10 20:06 | 12K | |
| toxcore-0.2.18_3,1.pkg | 2023-10-06 19:51 | 289K | |
| toxext-0.0.3_2.pkg | 2023-10-07 03:00 | 8.5K | |
| toxic-0.11.3_3.pkg | 2023-10-08 23:59 | 886K | |
| toxins-g20180217_2.pkg | 2023-10-10 06:18 | 22K | |
| toybox-0.8.10.pkg | 2023-10-14 11:33 | 146K | |
| toycars-0.3.10_9.pkg | 2023-10-09 22:03 | 5.6M | |
| tpasm-1.11.pkg | 2023-10-10 13:07 | 104K | |
| tpb-0.6.4_13.pkg | 2023-10-09 10:07 | 28K | |
| tpm-emulator-0.7.4_2..> | 2023-10-06 19:44 | 110K | |
| tpm-quote-tools-1.0...> | 2023-10-14 07:53 | 24K | |
| tpm-tools-1.3.9.1_1.pkg | 2023-10-09 21:50 | 149K | |
| tpm2-abrmd-3.0.0.pkg | 2023-10-10 11:15 | 120K | |
| tpm2-tools-5.5.pkg | 2023-10-10 06:17 | 598K | |
| tpm2-tss-4.0.1.pkg | 2023-10-08 06:08 | 1.0M | |
| tpop3d-1.5.5_5.pkg | 2023-10-10 07:20 | 81K | |
| tr-aspell-0.50.0_1,1..> | 2023-10-10 01:51 | 481K | |
| tr-libreoffice-7.5.5..> | 2023-10-07 13:57 | 3.1M | |
| trac-devel-1.5.4.pkg | 2023-10-09 20:38 | 2.0M | |
| trackballs-1.3.4_1.pkg | 2023-10-09 22:54 | 30M | |
| tracker-2.3.4_10.pkg | 2023-10-06 13:07 | 855K | |
| tracker-miners-2.3.5..> | 2023-10-11 18:13 | 443K | |
| tracker3-3.5.3.pkg | 2023-10-06 16:44 | 1.8M | |
| tractorgen-0.31.7_2.pkg | 2023-10-08 20:05 | 6.1K | |
| tradcpp-0.5.3.pkg | 2023-10-05 16:44 | 26K | |
| traefik-2.10.4_1.pkg | 2023-10-14 01:20 | 24M | |
| traff-0.7_2.pkg | 2023-10-14 11:49 | 13K | |
| trafficserver-9.2.1.pkg | 2023-10-14 09:22 | 3.1M | |
| trafshow-5.2.3_3,1.pkg | 2023-10-09 19:04 | 51K | |
| trafshow3-3.1_8,1.pkg | 2023-10-08 16:01 | 18K | |
| traingame-0.3_27.pkg | 2023-10-08 14:18 | 959K | |
| trang-20220510.pkg | 2023-10-10 01:01 | 742K | |
| trans-1.20.pkg | 2023-10-14 17:13 | 104K | |
| transcrypt-2.2.3.pkg | 2023-10-09 17:30 | 14K | |
| transfig-3.2.5e_4.pkg | 2023-10-07 11:33 | 222K | |
| transient-0.4.3.pkg | 2023-10-07 06:50 | 117K | |
| transient-devel-0.4...> | 2023-10-07 07:10 | 118K | |
| transient-devel-emac..> | 2023-10-07 04:48 | 117K | |
| transient-devel-emac..> | 2023-10-07 02:15 | 117K | |
| transient-devel-emac..> | 2023-10-07 01:26 | 117K | |
| transient-devel-emac..> | 2023-10-07 03:41 | 117K | |
| transient-emacs_cann..> | 2023-10-07 06:28 | 117K | |
| transient-emacs_deve..> | 2023-10-07 05:32 | 117K | |
| transient-emacs_deve..> | 2023-10-07 08:43 | 117K | |
| transient-emacs_nox-..> | 2023-10-07 07:31 | 117K | |
| translate-1.20.pkg | 2023-10-14 07:14 | 4.5K | |
| translate-shell-0.9...> | 2023-10-14 10:38 | 45K | |
| translate-toolkit-3...> | 2023-10-09 15:31 | 1.2M | |
| transmission-cli-4.0..> | 2023-10-14 09:57 | 1.0M | |
| transmission-daemon-..> | 2023-10-14 03:57 | 1.1M | |
| transmission-full-4...> | 2023-10-14 15:18 | 2.5M | |
| transmission-gtk-4.0..> | 2023-10-10 20:17 | 1.1M | |
| transmission-qt-4.0...> | 2023-10-09 08:22 | 1.0M | |
| transmission-remote-..> | 2023-10-08 22:14 | 1.8M | |
| transmission-remote-..> | 2023-10-10 01:22 | 1.8M | |
| transmission-utils-4..> | 2023-10-09 23:13 | 912K | |
| transproxy-1.6.pkg | 2023-10-09 16:09 | 15K | |
| transset-1.0.2_2,1.pkg | 2023-10-09 16:21 | 8.2K | |
| transwarp-2.2.3.pkg | 2023-10-09 22:42 | 18K | |
| traverso-0.49.6_6.pkg | 2023-10-10 00:14 | 955K | |
| trayer-1.1.8_1.pkg | 2023-10-14 09:08 | 22K | |
| trdsql-0.11.1_2.pkg | 2023-10-14 01:33 | 3.6M | |
| tree-2.1.0.pkg | 2023-10-07 01:29 | 45K | |
| tree-sitter-0.20.8.pkg | 2023-10-05 17:01 | 102K | |
| tree-sitter-graph-0...> | 2023-10-14 09:37 | 885K | |
| treefmt-0.5.0_7.pkg | 2023-10-09 14:54 | 718K | |
| treeform-1.0.3.pkg | 2023-10-11 16:36 | 1.6M | |
| treekin-0.5.1_4.pkg | 2023-10-10 18:57 | 57K | |
| treeline-3.1.6.pkg | 2023-10-09 20:01 | 823K | |
| treepuzzle-5.2.pkg | 2023-10-10 21:45 | 175K | |
| treepy.el-0.1.2_9.pkg | 2023-10-07 09:54 | 10K | |
| treepy.el-emacs_cann..> | 2023-10-07 07:04 | 10K | |
| treepy.el-emacs_deve..> | 2023-10-07 00:39 | 10K | |
| treepy.el-emacs_deve..> | 2023-10-07 05:06 | 10K | |
| treepy.el-emacs_nox-..> | 2023-10-07 00:37 | 10K | |
| treesheets-1.0.20230..> | 2023-10-09 14:37 | 2.6M | |
| treewm-0.4.5_6.pkg | 2023-10-10 17:23 | 87K | |
| trellis-g2022100712.pkg | 2023-10-08 06:57 | 1.7M | |
| tremulous-1.1.0_13.pkg | 2023-10-10 04:49 | 92M | |
| trenchbroom-2.0.0.b_..> | 2023-10-08 21:49 | 1.7M | |
| trezord-2.0.33_2.pkg | 2023-10-08 13:18 | 2.3M | |
| triangle-1.6_5.pkg | 2023-10-06 18:35 | 134K | |
| triceratops-lv2-0.5...> | 2023-10-10 23:02 | 271K | |
| trickle-1.07_7.pkg | 2023-10-10 15:17 | 33K | |
| trigger-rally-0.6.6...> | 2023-10-10 04:27 | 113M | |
| trilinos-13.4.1_4.pkg | 2023-10-08 02:06 | 51M | |
| trimadap-0.1.3_1.pkg | 2023-10-07 14:23 | 11K | |
| trimines-1.3.0_7.pkg | 2023-10-10 10:51 | 45K | |
| trimmomatic-0.39.pkg | 2023-10-07 14:35 | 118K | |
| trio-1.16_1.pkg | 2023-10-08 10:27 | 80K | |
| triplane-1.08.r20130..> | 2023-10-14 14:44 | 1.0M | |
| trippy-0.8.0_3.pkg | 2023-10-14 11:34 | 1.4M | |
| tripwire-2.4.3.8.pkg | 2023-10-10 14:09 | 811K | |
| triton-0.9_1.pkg | 2023-10-10 19:28 | 863K | |
| triton-guesttools-0...> | 2023-10-10 16:52 | 4.7K | |
| trlan-201009_12.pkg | 2023-10-10 17:32 | 272K | |
| trlib-0.4.pkg | 2023-10-14 18:16 | 55K | |
| trn-3.6.pkg | 2023-10-08 19:06 | 181K | |
| trn4-4.0.b77.pkg | 2023-10-10 05:20 | 319K | |
| trojita-0.7_11.pkg | 2023-10-09 01:30 | 1.1M | |
| trojka-1.0_1.pkg | 2023-10-10 06:27 | 11K | |
| trompeloeil-45.pkg | 2023-10-14 02:56 | 216K | |
| trousers-0.3.14_4.pkg | 2023-10-07 05:36 | 474K | |
| trove4j-3.1a1.pkg | 2023-10-10 16:23 | 2.6M | |
| truc-0.12.0_3.pkg | 2023-10-10 17:47 | 1.1M | |
| trueos-libqt5-201710..> | 2023-10-07 21:06 | 401K | |
| trueprint-5.4_2.pkg | 2023-10-09 16:30 | 55K | |
| trunk-0.17.5_1.pkg | 2023-10-08 21:58 | 2.8M | |
| trurl-0.8.pkg | 2023-10-08 23:55 | 16K | |
| trustedqsl-2.6.3.pkg | 2023-10-09 00:47 | 1.3M | |
| ts-1.0.2.pkg | 2023-10-09 15:24 | 30K | |
| ts-hunspell-20110323..> | 2023-10-09 20:51 | 98K | |
| ts-libreoffice-7.5.5..> | 2023-10-07 13:54 | 196K | |
| tsclient-0.150_12.pkg | 2023-10-14 13:10 | 314K | |
| tsctp-0.7.5.pkg | 2023-10-10 14:27 | 6.6K | |
| tse3-0.3.1_2.pkg | 2023-10-10 23:57 | 423K | |
| tsearch_extras-0.3_2..> | 2023-10-09 15:17 | 3.5K | |
| tsito-0.8.4.pkg | 2023-10-14 13:12 | 96K | |
| tslib-1.22.pkg | 2023-10-10 14:06 | 92K | |
| tsocks-1.8.b5_9.pkg | 2023-10-08 21:47 | 27K | |
| tsung-1.8.0.pkg | 2023-10-10 09:22 | 545K | |
| tt-15.1.pkg | 2023-10-14 13:26 | 16K | |
| tt-libreoffice-7.5.5..> | 2023-10-07 16:46 | 127K | |
| tt-rss-g20230614,2.pkg | 2023-10-10 03:17 | 5.4M | |
| tt2020-0.2.1.pkg | 2023-10-09 14:14 | 74M | |
| tta-3.4.1.pkg | 2023-10-14 06:51 | 16K | |
| ttcp-1.12_2.pkg | 2023-10-14 04:45 | 10K | |
| ttf2pt1-3.4.4_7.pkg | 2023-10-07 17:22 | 187K | |
| ttfautohint-1.8.4.pkg | 2023-10-07 00:39 | 181K | |
| tth-4.03_3.pkg | 2023-10-09 08:31 | 228K | |
| tthsum-1.3.2_1.pkg | 2023-10-09 18:58 | 22K | |
| ttk-1.2.0.pkg | 2023-10-08 14:07 | 8.6M | |
| ttmath-0.9.3.2019101..> | 2023-10-09 08:26 | 81K | |
| ttt-2011.04_5.pkg | 2023-10-09 05:07 | 110K | |
| tttcmds-1.0.20190920..> | 2023-10-09 07:41 | 232K | |
| tty-clock-2.3.pkg | 2023-10-09 14:35 | 8.8K | |
| tty-solitaire-1.3.1.pkg | 2023-10-14 08:46 | 12K | |
| ttyd-1.7.3.pkg | 2023-10-08 05:55 | 188K | |
| ttygif-1.4.0_2.pkg | 2023-10-09 16:49 | 6.0K | |
| ttyload-0.5.3_1.pkg | 2023-10-14 12:36 | 11K | |
| ttyplot-1.4.pkg | 2023-10-10 11:10 | 6.4K | |
| ttyrec-1.0.8_3.pkg | 2023-10-14 07:59 | 11K | |
| tuareg-mode-2.0.8_16..> | 2023-10-10 18:22 | 78K | |
| tuareg-mode-emacs_ca..> | 2023-10-14 05:13 | 78K | |
| tuareg-mode-emacs_de..> | 2023-10-08 20:43 | 78K | |
| tuareg-mode-emacs_de..> | 2023-10-10 20:38 | 78K | |
| tuareg-mode-emacs_no..> | 2023-10-14 15:19 | 78K | |
| tuc-1.10_1.pkg | 2023-10-08 10:16 | 4.9K | |
| tuckr-0.8.1_2.pkg | 2023-10-11 21:44 | 398K | |
| tudu-0.10.3.pkg | 2023-10-09 01:56 | 86K | |
| tuifeed-0.3.2_5.pkg | 2023-10-14 16:16 | 1.3M | |
| tumble-0.38_1.pkg | 2023-10-10 08:38 | 35K | |
| tumgreyspf-1.38_3.pkg | 2023-10-14 09:10 | 16K | |
| tuner-1.5.1_2.pkg | 2023-10-10 23:51 | 109K | |
| tuneradio-1.3.pkg | 2023-10-10 06:59 | 3.6K | |
| tuning-primer-1.6.r1..> | 2023-10-11 02:42 | 12K | |
| tunneller-0.6_14.pkg | 2023-10-10 19:45 | 1.8M | |
| tup-0.7.11.pkg | 2023-10-14 10:42 | 655K | |
| tuptime-5.2.2_2.pkg | 2023-10-14 14:31 | 14K | |
| turbo-g20230621.pkg | 2023-10-11 22:57 | 848K | |
| turbostat-4.17_3.pkg | 2023-10-08 12:57 | 40K | |
| turboxsl-b03.c2.c9,1..> | 2023-10-11 06:28 | 145K | |
| turnserver-4.6.2.pkg | 2023-10-10 03:00 | 538K | |
| tusc-0.4.7_14.pkg | 2023-10-08 14:53 | 2.5M | |
| tusd-1.12.1_1.pkg | 2023-10-09 18:46 | 7.4M | |
| tut-2.0.1_4.pkg | 2023-10-12 04:23 | 3.0M | |
| tux_aqfh-1.0.14_12.pkg | 2023-10-10 17:11 | 2.9M | |
| tuxkart-0.4.0_7.pkg | 2023-10-10 12:09 | 3.9M | |
| tuxpaint-0.9.28_2.pkg | 2023-10-08 09:57 | 8.3M | |
| tuxpaint-config-0.0...> | 2023-10-11 02:52 | 249K | |
| tuxpaint-fonts-2004...> | 2023-10-14 13:45 | 4.9M | |
| tuxpaint-stamps-2023..> | 2023-10-11 18:10 | 156M | |
| tuxracer-0.61_15.pkg | 2023-10-14 06:52 | 5.6M | |
| tuxtype-1.8.3_3.pkg | 2023-10-09 19:59 | 10M | |
| tv-fonts-1.1_6.pkg | 2023-10-08 07:42 | 226K | |
| tvbrowser-4.2.7.pkg | 2023-10-14 06:16 | 5.3M | |
| tvheadend-4.2.8_6.pkg | 2023-10-09 20:16 | 5.3M | |
| tvm-0.13.0.pkg | 2023-10-07 18:46 | 9.8M | |
| tvmet-1.7.2_1.pkg | 2023-10-08 18:40 | 176K | |
| tvtwm-pl11_1.pkg | 2023-10-08 15:41 | 113K | |
| tw_cli-9.5.5_1.pkg | 2023-10-10 18:34 | 615K | |
| tweak-3.02.pkg | 2023-10-09 18:42 | 34K | |
| tweedledum-1.1.1.pkg | 2023-10-09 16:39 | 436K | |
| tweeny-3.6.pkg | 2023-10-09 22:44 | 14K | |
| twemoji-color-font-t..> | 2023-10-06 22:00 | 3.4M | |
| twemproxy-0.5.0.pkg | 2023-10-10 21:29 | 88K | |
| twiggy-0.6.0_7.pkg | 2023-10-09 18:46 | 648K | |
| twiki-6.1.0,2.pkg | 2023-10-08 11:59 | 14M | |
| twiki-BehaviourContr..> | 2023-10-06 22:04 | 15K | |
| twiki-BlogAddOn-0.0...> | 2023-10-10 04:03 | 231K | |
| twiki-BugzillaLinkPl..> | 2023-10-08 19:30 | 6.2K | |
| twiki-ClassicSkin-0...> | 2023-10-11 07:30 | 42K | |
| twiki-CommentPlugin-..> | 2023-10-08 23:50 | 20K | |
| twiki-EditTablePlugi..> | 2023-10-09 13:16 | 72K | |
| twiki-EmptyPlugin-0...> | 2023-10-10 13:36 | 11K | |
| twiki-GluePlugin-0.0..> | 2023-10-09 08:41 | 7.6K | |
| twiki-InterwikiPlugi..> | 2023-10-09 22:56 | 7.1K | |
| twiki-JSCalendarCont..> | 2023-10-10 02:31 | 327K | |
| twiki-LDAPPasswordCh..> | 2023-10-10 00:16 | 5.4K | |
| twiki-LdapContrib-0...> | 2023-10-07 14:57 | 26K | |
| twiki-LdapNgPlugin-0..> | 2023-10-09 22:01 | 6.8K | |
| twiki-MailerContrib-..> | 2023-10-07 11:02 | 38K | |
| twiki-MathModePlugin..> | 2023-10-10 06:42 | 13K | |
| twiki-NewUserPlugin-..> | 2023-10-11 13:21 | 8.5K | |
| twiki-PatternSkin-0...> | 2023-10-09 19:02 | 476K | |
| twiki-PreferencesPlu..> | 2023-10-14 11:10 | 8.9K | |
| twiki-RenderListPlug..> | 2023-10-10 22:28 | 16K | |
| twiki-SlideShowPlugi..> | 2023-10-14 09:28 | 13K | |
| twiki-SmiliesPlugin-..> | 2023-10-08 22:14 | 11K | |
| twiki-SpreadSheetPlu..> | 2023-10-08 03:01 | 23K | |
| twiki-SubscribePlugi..> | 2023-10-12 12:45 | 28K | |
| twiki-TWikiUserMappi..> | 2023-10-08 11:20 | 30K | |
| twiki-TablePlugin-0...> | 2023-10-07 21:53 | 20K | |
| twiki-TagMePlugin-0...> | 2023-10-14 06:24 | 94K | |
| twiki-TinyMCEPlugin-..> | 2023-10-10 11:35 | 449K | |
| twiki-TipsContrib-0...> | 2023-10-14 08:05 | 11K | |
| twiki-TopicVarsPlugi..> | 2023-10-10 02:53 | 4.3K | |
| twiki-TwistyContrib-..> | 2023-10-07 01:43 | 8.1K | |
| twiki-TwistyPlugin-0..> | 2023-10-07 18:15 | 15K | |
| twiki-WysiwygPlugin-..> | 2023-10-08 09:19 | 52K | |
| twind-1.1.0_5.pkg | 2023-10-10 01:33 | 2.7M | |
| twirssi-2.8.0.pkg | 2023-10-10 02:06 | 29K | |
| twitch-tui-2.5.1_1.pkg | 2023-10-10 15:30 | 1.0M | |
| twm-1.0.12.pkg | 2023-10-07 01:52 | 88K | |
| twmn-g20190917_4.pkg | 2023-10-08 18:50 | 131K | |
| twms-0.06y_1.pkg | 2023-10-14 11:00 | 48K | |
| twoftpd-1.43_1.pkg | 2023-10-10 16:01 | 41K | |
| twolame-0.4.0_3.pkg | 2023-10-06 23:09 | 103K | |
| twpsk-4.3_3.pkg | 2023-10-14 05:59 | 62K | |
| txt2html-2.51_2.pkg | 2023-10-12 04:20 | 62K | |
| txt2man-1.7.1.pkg | 2023-10-07 08:21 | 14K | |
| txtbdf2ps-0.7.1_1.pkg | 2023-10-09 14:55 | 14K | |
| tycho-0.1.pkg | 2023-10-08 14:04 | 18K | |
| typeshare-1.7.0_1.pkg | 2023-10-09 16:43 | 957K | |
| typespeed-0.6.5_3.pkg | 2023-10-09 01:50 | 60K | |
| typetools-2.110.pkg | 2023-10-08 02:28 | 669K | |
| typo3-11-php80-11.5...> | 2023-10-09 14:02 | 23M | |
| typo3-11-php81-11.5...> | 2023-10-09 18:33 | 23M | |
| typo3-11-php82-11.5...> | 2023-10-09 21:06 | 23M | |
| typo3-11-php83-11.5...> | 2023-10-10 09:28 | 23M | |
| typo3-12-php81-12.4...> | 2023-10-14 11:54 | 20M | |
| typometer-1.0.1.pkg | 2023-10-10 05:26 | 459K | |
| typst-0.7.0_1.pkg | 2023-10-10 17:56 | 8.7M | |
| tyrian-data-21.pkg | 2023-10-09 09:56 | 3.5M | |
| tzdialog-1.2.pkg | 2023-10-10 07:19 | 16K | |
| tzdiff-1.2.pkg | 2023-10-14 09:10 | 4.9K | |
| u-boot-a13-olinuxino..> | 2023-10-10 13:38 | 283K | |
| u-boot-a64-olinuxino..> | 2023-10-08 20:42 | 285K | |
| u-boot-bananapi-2023..> | 2023-10-09 05:19 | 267K | |
| u-boot-bananapim2-20..> | 2023-10-09 13:57 | 256K | |
| u-boot-beaglebone-20..> | 2023-10-09 09:25 | 327K | |
| u-boot-chip-2023.07...> | 2023-10-10 19:04 | 265K | |
| u-boot-clearfog-2023..> | 2023-10-10 23:37 | 276K | |
| u-boot-cubieboard-20..> | 2023-10-08 12:04 | 264K | |
| u-boot-cubieboard2-2..> | 2023-10-09 15:48 | 265K | |
| u-boot-cubox-humming..> | 2023-10-09 02:03 | 264K | |
| u-boot-firefly-rk339..> | 2023-10-14 08:17 | 345K | |
| u-boot-imx-serial-lo..> | 2023-10-08 21:10 | 58K | |
| u-boot-nanopi-neo2-2..> | 2023-10-08 12:45 | 283K | |
| u-boot-nanopi-r4s-20..> | 2023-10-08 21:48 | 346K | |
| u-boot-nanopi_a64-20..> | 2023-10-09 06:16 | 285K | |
| u-boot-nanopi_m1plus..> | 2023-10-09 01:04 | 254K | |
| u-boot-nanopi_neo-20..> | 2023-10-10 03:45 | 237K | |
| u-boot-nanopi_neo_ai..> | 2023-10-14 05:56 | 233K | |
| u-boot-olimex-a20-so..> | 2023-10-09 22:02 | 266K | |
| u-boot-olinuxino-lim..> | 2023-10-14 12:02 | 263K | |
| u-boot-olinuxino-lim..> | 2023-10-11 09:31 | 297K | |
| u-boot-olinuxino-lim..> | 2023-10-10 21:09 | 298K | |
| u-boot-orangepi-one-..> | 2023-10-14 05:55 | 253K | |
| u-boot-orangepi-pc-2..> | 2023-10-11 05:20 | 259K | |
| u-boot-orangepi-pc-p..> | 2023-10-14 12:01 | 260K | |
| u-boot-orangepi-pc2-..> | 2023-10-14 04:11 | 321K | |
| u-boot-orangepi-plus..> | 2023-10-11 17:43 | 260K | |
| u-boot-orangepi-zero..> | 2023-10-14 06:16 | 246K | |
| u-boot-orangepi-zero..> | 2023-10-10 07:22 | 283K | |
| u-boot-orangepi_r1-2..> | 2023-10-09 09:02 | 246K | |
| u-boot-pandaboard-20..> | 2023-10-08 16:51 | 237K | |
| u-boot-pcduino3-2023..> | 2023-10-08 19:06 | 265K | |
| u-boot-pine-h64-2023..> | 2023-10-08 12:04 | 284K | |
| u-boot-pine64-2023.0..> | 2023-10-10 02:38 | 286K | |
| u-boot-pine64-lts-20..> | 2023-10-10 09:21 | 294K | |
| u-boot-pinebook-2023..> | 2023-10-09 05:08 | 288K | |
| u-boot-pinebookpro-2..> | 2023-10-09 17:06 | 379K | |
| u-boot-qemu-arm-2023..> | 2023-10-08 14:55 | 296K | |
| u-boot-qemu-arm64-20..> | 2023-10-14 18:21 | 310K | |
| u-boot-qemu-riscv64-..> | 2023-10-14 12:27 | 286K | |
| u-boot-riotboard-202..> | 2023-10-09 10:23 | 239K | |
| u-boot-rock-pi-4-202..> | 2023-10-09 01:26 | 418K | |
| u-boot-rock64-2023.0..> | 2023-10-14 12:09 | 306K | |
| u-boot-rockpro64-202..> | 2023-10-09 00:05 | 393K | |
| u-boot-rpi-0-w-2023...> | 2023-10-14 12:10 | 211K | |
| u-boot-rpi-2023.07.0..> | 2023-10-10 12:46 | 211K | |
| u-boot-rpi-arm64-202..> | 2023-10-14 15:14 | 240K | |
| u-boot-rpi2-2023.07...> | 2023-10-10 05:47 | 209K | |
| u-boot-rpi3-32-2023...> | 2023-10-10 04:22 | 212K | |
| u-boot-rpi3-2023.07...> | 2023-10-10 16:12 | 226K | |
| u-boot-rpi4-2023.07...> | 2023-10-09 02:27 | 246K | |
| u-boot-sifive-fu540-..> | 2023-10-10 15:09 | 337K | |
| u-boot-sifive-fu740-..> | 2023-10-10 18:57 | 387K | |
| u-boot-sinovoip-bpi-..> | 2023-10-10 06:35 | 247K | |
| u-boot-sopine-2023.0..> | 2023-10-14 10:19 | 294K | |
| u-boot-sopine-spi-20..> | 2023-10-09 18:48 | 296K | |
| u-boot-tools-2020.07..> | 2023-10-07 23:09 | 141K | |
| u-boot-wandboard-202..> | 2023-10-10 12:06 | 273K | |
| u2f-devd-1.1.10_8.pkg | 2023-10-05 16:39 | 1.8K | |
| u6rd-1.6_3.pkg | 2023-10-10 09:33 | 14K | |
| uTox-0.17.2_4.pkg | 2023-10-09 04:43 | 407K | |
| ua-1.0.1.pkg | 2023-10-09 18:40 | 30K | |
| ua_parser-core-0.5.0..> | 2023-10-07 01:49 | 30K | |
| uacme-1.7.4_1.pkg | 2023-10-09 22:44 | 79K | |
| uade-3.03.pkg | 2023-10-08 18:33 | 1.4M | |
| uae-0.8.29_4.pkg | 2023-10-10 00:27 | 544K | |
| uarduno-1.02_1.pkg | 2023-10-14 04:39 | 4.7K | |
| uartlirc-0.3_2.pkg | 2023-10-09 16:24 | 23K | |
| ubench-0.32.pkg | 2023-10-09 01:55 | 7.6K | |
| ubh-2.5_3.pkg | 2023-10-09 20:55 | 25K | |
| ubuntu-font-0.83_2.pkg | 2023-10-07 21:37 | 1.4M | |
| ubuntu-keyring-2021...> | 2023-10-07 10:15 | 25K | |
| ucarp-1.5.2.20171201..> | 2023-10-09 17:28 | 16K | |
| ucc-1.6.2.pkg | 2023-10-14 08:10 | 54K | |
| uchardet-0.0.8.pkg | 2023-10-05 17:44 | 95K | |
| uchiwa-0.18.2_15.pkg | 2023-10-09 03:28 | 6.5M | |
| ucl-1.03_5.pkg | 2023-10-06 19:11 | 42K | |
| uclcmd-0.2.20211204.pkg | 2023-10-07 17:40 | 15K | |
| ucommon-7.0.0_6.pkg | 2023-10-07 23:11 | 429K | |
| ucon64-2.2.2.pkg | 2023-10-10 14:06 | 285K | |
| uconvert-1.01.pkg | 2023-10-09 02:45 | 30K | |
| ucpp-1.3.2,1.pkg | 2023-10-06 23:07 | 36K | |
| ucsc-userapps-414_1.pkg | 2023-10-14 18:35 | 6.5M | |
| ucspi-ipc-0.67.pkg | 2023-10-09 23:53 | 49K | |
| ucspi-proxy-1.1.pkg | 2023-10-09 21:39 | 18K | |
| ucspi-ssl-0.99b_1.pkg | 2023-10-14 16:40 | 72K | |
| ucspi-tcp-0.88_2.pkg | 2023-10-06 18:35 | 67K | |
| ucspi-unix-1.0.pkg | 2023-10-14 04:51 | 10K | |
| ucto-0.29.pkg | 2023-10-09 10:32 | 163K | |
| uctodata-0.9.1.pkg | 2023-10-08 10:09 | 13K | |
| udfclient-0.8.11.pkg | 2023-10-09 03:25 | 152K | |
| udis86-1.7.2_4.pkg | 2023-10-08 05:35 | 65K | |
| udns-0.4_2.pkg | 2023-10-08 06:58 | 75K | |
| udpbroadcastrelay-0...> | 2023-10-10 13:51 | 7.5K | |
| udpt-g20200202.pkg | 2023-10-10 03:50 | 46K | |
| udptunnel-1.1_1.pkg | 2023-10-10 06:13 | 6.0K | |
| udpxy-1.0.25.1.pkg | 2023-10-10 22:54 | 37K | |
| udt-4.11_1.pkg | 2023-10-14 06:59 | 183K | |
| udunits-2.2.28.pkg | 2023-10-06 17:28 | 132K | |
| uefi-edk2-bhyve-csm-..> | 2023-10-06 20:56 | 761K | |
| uemacs-4.0_1.pkg | 2023-10-14 10:09 | 120K | |
| ufdbGuard-1.35.3.pkg | 2023-10-10 12:18 | 454K | |
| ufetch-0.3.pkg | 2023-10-10 05:26 | 1.4K | |
| ufoai-2.5_12.pkg | 2023-10-09 13:58 | 2.6M | |
| ufoai-data-2.5_1.pkg | 2023-10-08 09:54 | 1.0G | |
| ufraw-0.22.20210424_..> | 2023-10-07 14:16 | 639K | |
| ufs_copy-20060921_2.pkg | 2023-10-14 16:34 | 236K | |
| uftp-5.0.1,1.pkg | 2023-10-09 21:41 | 142K | |
| ug-libreoffice-7.5.5..> | 2023-10-08 00:13 | 2.6M | |
| ugene-40.1.pkg | 2023-10-09 13:59 | 27M | |
| uget-2.2.3_1.pkg | 2023-10-09 15:01 | 351K | |
| ugrep-4.1.0.pkg | 2023-10-09 05:18 | 330K | |
| uhd-4.2.0.0_1.pkg | 2023-10-08 07:59 | 6.7M | |
| uhdm-1.74.pkg | 2023-10-07 07:22 | 1.0M | |
| uhex-1.0.4.pkg | 2023-10-09 18:29 | 8.9K | |
| uhexen-0.601_12.pkg | 2023-10-09 21:59 | 203K | |
| uhexen2-1.5.9_4.pkg | 2023-10-07 13:34 | 5.1M | |
| uhexen2-extras-1.5.6..> | 2023-10-09 11:10 | 37M | |
| uhidd-0.2.1_5.pkg | 2023-10-08 15:46 | 60K | |
| uhttpmock-0.5.3_1.pkg | 2023-10-06 11:11 | 59K | |
| uhub-0.5.1.pkg | 2023-10-10 16:12 | 113K | |
| uid_wrapper-1.2.4.pkg | 2023-10-08 08:44 | 13K | |
| uif2iso-0.1.7c_1.pkg | 2023-10-10 02:25 | 38K | |
| uim-1.9.0.b.20220927..> | 2023-10-08 03:20 | 2.0M | |
| uim-el-1.9.0.b.20220..> | 2023-10-14 02:47 | 34K | |
| uim-el-emacs_canna-1..> | 2023-10-08 20:55 | 34K | |
| uim-el-emacs_devel-1..> | 2023-10-10 04:20 | 34K | |
| uim-el-emacs_devel_n..> | 2023-10-09 21:59 | 34K | |
| uim-el-emacs_nox-1.9..> | 2023-10-14 16:52 | 34K | |
| uim-gtk-1.9.0.b.2022..> | 2023-10-11 13:42 | 92K | |
| uim-gtk3-1.9.0.b.202..> | 2023-10-09 03:45 | 77K | |
| uim-m17nlib-1.9.0.b...> | 2023-10-14 11:23 | 13K | |
| uim-qt5-1.9.0.b.2022..> | 2023-10-09 11:19 | 150K | |
| uird-1.1.pkg | 2023-10-09 16:25 | 10K | |
| ujprog-g20191117_1.pkg | 2023-10-14 05:41 | 24K | |
| uk-aspell-1.4.0.0_1,..> | 2023-10-08 13:08 | 703K | |
| uk-hunspell-1.8.0_1.pkg | 2023-10-09 03:02 | 434K | |
| uk-hyphen-2005.03.08..> | 2023-10-10 13:40 | 5.1K | |
| uk-libgd-2.3.3_7,1.pkg | 2023-10-07 14:40 | 205K | |
| uk-libreoffice-7.5.5..> | 2023-10-07 13:53 | 3.2M | |
| uk-mythes-1.8.0.pkg | 2023-10-08 12:49 | 231K | |
| uk-phone-2.7.pkg | 2023-10-09 02:14 | 70K | |
| uk-postcodes-2.2.pkg | 2023-10-09 16:35 | 167K | |
| uk-webalizer-2.23.8_..> | 2023-10-08 12:20 | 130K | |
| ukncbtl-g20221102.pkg | 2023-10-10 09:35 | 163K | |
| ukrmol+-3.2_3.pkg | 2023-10-10 13:01 | 2.2M | |
| ulauncher-5.15.3.pkg | 2023-10-11 00:05 | 1.4M | |
| ulfius-2.7.13.pkg | 2023-10-06 19:57 | 95K | |
| ultimatestunts-0.7.7..> | 2023-10-10 05:30 | 20M | |
| ultragetopt-0.6.0_1.pkg | 2023-10-08 05:12 | 8.3K | |
| ultralist-1.7.0_15.pkg | 2023-10-08 22:40 | 2.5M | |
| ulxmlrpcpp-1.7.5_3.pkg | 2023-10-08 17:09 | 449K | |
| umark-2.0.0.b3_9.pkg | 2023-10-11 10:50 | 143K | |
| umbrello-23.08.1_1.pkg | 2023-10-10 01:17 | 4.9M | |
| umix-1.0.2_3.pkg | 2023-10-09 18:44 | 19K | |
| uml2svg-0.18.pkg | 2023-10-10 01:57 | 250K | |
| umlgraph-5.7.2.pkg | 2023-10-10 02:28 | 62K | |
| umodplayer-0.b5.1_4.pkg | 2023-10-14 10:54 | 26K | |
| umodunpack-0.4.pkg | 2023-10-08 18:32 | 7.2K | |
| ump-math-0.8.6_14.pkg | 2023-10-10 07:27 | 239K | |
| umurmur-0.2.20.pkg | 2023-10-14 18:15 | 40K | |
| unace-1.2b_3.pkg | 2023-10-08 09:29 | 13K | |
| unadf-0.8.0.pkg | 2023-10-11 13:27 | 155K | |
| unalz-0.66.pkg | 2023-10-09 10:18 | 27K | |
| unar-1.10.1_23.pkg | 2023-10-07 22:22 | 1.0M | |
| unarj-2.65_2.pkg | 2023-10-07 19:47 | 19K | |
| unarr-1.1.0.pkg | 2023-10-07 11:47 | 74K | |
| unbound-1.18.0.pkg | 2023-10-06 16:08 | 2.3M | |
| unbound_exporter-0.4..> | 2023-10-10 22:40 | 2.5M | |
| uncle-0.2_1.pkg | 2023-10-10 16:52 | 4.0K | |
| unclutter-8_3.pkg | 2023-10-08 17:21 | 7.7K | |
| unclutter-xfixes-1.6..> | 2023-10-08 17:20 | 8.7K | |
| uncrustify-0.77.1.pkg | 2023-10-08 23:10 | 519K | |
| undead-1.1.8_1.pkg | 2023-10-08 00:38 | 258K | |
| undernet-ircu-2.10.1..> | 2023-10-14 16:10 | 800K | |
| undms-1.3.pkg | 2023-10-14 10:48 | 9.1K | |
| unetbootin-702_2.pkg | 2023-10-08 21:18 | 429K | |
| unfoo-1.0.8.pkg | 2023-10-10 05:03 | 3.0K | |
| unfs3-0.9.23.pkg | 2023-10-14 16:36 | 45K | |
| unhide-20210124.pkg | 2023-10-14 10:57 | 252K | |
| uni-2.5.1_14.pkg | 2023-10-09 02:24 | 1.0M | |
| uni2ascii-4.18.pkg | 2023-10-14 14:36 | 35K | |
| unibilium-2.1.1.pkg | 2023-10-06 11:55 | 111K | |
| unicode-emoji-15.0.pkg | 2023-10-05 16:39 | 77K | |
| unicorn-1.0.2.pkg | 2023-10-07 03:57 | 2.1M | |
| unieject-6_7.pkg | 2023-10-08 16:45 | 28K | |
| unifi7-7.4.162.pkg | 2023-10-09 21:16 | 132M | |
| unikmer-0.19.1_8.pkg | 2023-10-09 22:41 | 2.5M | |
| unique-1.1.6_8.pkg | 2023-10-07 00:43 | 52K | |
| unison-2.53.3_1.pkg | 2023-10-09 19:35 | 1.9M | |
| unison-nox11-2.53.3_..> | 2023-10-08 15:33 | 1.0M | |
| unison240-2.40.128_7..> | 2023-10-09 20:38 | 2.3M | |
| unison240-nox11-2.40..> | 2023-10-10 13:18 | 1.5M | |
| unison248-2.48.15_5.pkg | 2023-10-10 09:13 | 1.8M | |
| unison248-nox11-2.48..> | 2023-10-11 00:25 | 939K | |
| unison251-2.51.5_3.pkg | 2023-10-09 23:18 | 1.8M | |
| unison251-nox11-2.51..> | 2023-10-09 16:33 | 968K | |
| unit-1.31.0_2.pkg | 2023-10-07 14:28 | 778K | |
| unit-java8-1.31.0_2.pkg | 2023-10-14 05:45 | 6.6M | |
| unit-perl5.34-1.31.0..> | 2023-10-10 17:26 | 34K | |
| unit-php80-1.31.0_2.pkg | 2023-10-10 20:00 | 31K | |
| unit-php81-1.31.0_2.pkg | 2023-10-10 21:11 | 31K | |
| unit-php82-1.31.0_2.pkg | 2023-10-14 16:24 | 31K | |
| unit-php83-1.31.0_2.pkg | 2023-10-14 04:38 | 31K | |
| unit-python39-1.31.0..> | 2023-10-10 00:08 | 50K | |
| unit-ruby3.1-1.31.0_..> | 2023-10-11 12:57 | 35K | |
| unit-wasm-1.31.0_2.pkg | 2023-10-09 09:03 | 30K | |
| unitc-1.31.0.pkg | 2023-10-08 23:58 | 3.8K | |
| units-2.16_2.pkg | 2023-10-10 18:15 | 198K | |
| uniutils-2.27_2.pkg | 2023-10-10 04:19 | 169K | |
| universal-ctags-p6.0..> | 2023-10-07 17:19 | 831K | |
| universal-fp-library..> | 2023-10-14 09:09 | 400K | |
| unix-selfauth-helper..> | 2023-10-05 16:54 | 4.6K | |
| unix2dos-1.3_1.pkg | 2023-10-08 08:30 | 5.5K | |
| unix2tcp-0.8.3.pkg | 2023-10-14 07:15 | 7.9K | |
| unixODBC-2.3.11.pkg | 2023-10-06 16:40 | 506K | |
| unixbench-5.1.3.51_1..> | 2023-10-11 15:51 | 98K | |
| unixcw-3.5.1_2.pkg | 2023-10-07 15:51 | 149K | |
| unknown-horizons-201..> | 2023-10-09 20:44 | 238M | |
| unlzx-1.1.pkg | 2023-10-09 14:06 | 10K | |
| unmakeself-1.1_1.pkg | 2023-10-07 16:34 | 4.4K | |
| unmass-0.92.pkg | 2023-10-10 01:14 | 26K | |
| unnethack-5.1.0.2013..> | 2023-10-09 00:24 | 1.2M | |
| unoconv-0.7.pkg | 2023-10-08 19:10 | 79K | |
| unordered-dense-4.1...> | 2023-10-08 23:03 | 16K | |
| unpaper-7.0.0_2.pkg | 2023-10-07 22:21 | 34K | |
| unquote-1.0.b4.pkg | 2023-10-08 23:47 | 7.6K | |
| unrar-6.23,6.pkg | 2023-10-06 18:39 | 129K | |
| unrar-iconv-6.23,6.pkg | 2023-10-08 12:28 | 130K | |
| unroff-1.0.2_5.pkg | 2023-10-09 07:41 | 84K | |
| unrpa-2.3.0.pkg | 2023-10-09 08:34 | 23K | |
| unrtf-0.21.10.pkg | 2023-10-08 09:15 | 39K | |
| unshield-1.5.1.pkg | 2023-10-07 16:38 | 22K | |
| unstow-0.1.1.pkg | 2023-10-10 13:58 | 3.0K | |
| untahris-3.1_6.pkg | 2023-10-09 02:26 | 614K | |
| unuran-1.11.0.pkg | 2023-10-08 19:53 | 1.5M | |
| unzip-6.0_8.pkg | 2023-10-05 16:55 | 133K | |
| unzoo-4.4_2.pkg | 2023-10-06 21:57 | 18K | |
| up-0.4_14.pkg | 2023-10-09 19:59 | 827K | |
| up-imapproxy-1.2.8.p..> | 2023-10-09 14:17 | 44K | |
| upclient-5.0.b8_7.pkg | 2023-10-08 21:16 | 43K | |
| update-station-1.5.pkg | 2023-10-08 20:16 | 59K | |
| updatedd-2.6_2.pkg | 2023-10-10 02:32 | 285K | |
| uperf-1.0.7,1.pkg | 2023-10-09 00:28 | 62K | |
| upnp-1.14.18,1.pkg | 2023-10-06 20:46 | 524K | |
| upower-1.90.2.pkg | 2023-10-06 12:25 | 88K | |
| upp-15260_1.pkg | 2023-10-10 05:40 | 82M | |
| upscaler-1.1.2_1.pkg | 2023-10-10 13:48 | 22K | |
| upsdaemon-1.0.pkg | 2023-10-09 14:06 | 6.5K | |
| upslug-2.11.pkg | 2023-10-10 01:00 | 24K | |
| uptimed-0.4.6.pkg | 2023-10-09 21:35 | 23K | |
| upx-4.0.2.pkg | 2023-10-08 09:16 | 547K | |
| uqm-0.8.0.pkg | 2023-10-10 07:47 | 8.9M | |
| urbackup-client-2.5...> | 2023-10-14 08:39 | 1.1M | |
| urbackup-server-2.5...> | 2023-10-10 07:28 | 3.0M | |
| urbanterror-data-4.2..> | 2023-10-11 03:32 | 1.7G | |
| urbit-0.6.0.pkg | 2023-10-14 03:40 | 254K | |
| urelay-1.0.pkg | 2023-10-08 18:52 | 7.0K | |
| urh-2.9.4_3.pkg | 2023-10-10 10:26 | 3.2M | |
| urho3d-1.7.1_1.pkg | 2023-10-10 08:23 | 172M | |
| uriparser-0.9.6.pkg | 2023-10-06 09:54 | 441K | |
| urjtag-2021.03_1.pkg | 2023-10-14 16:58 | 818K | |
| urlendec-1.0_1.pkg | 2023-10-09 14:56 | 20K | |
| urlview-0.9.20131021..> | 2023-10-07 03:48 | 11K | |
| urt-3.1b1_12.pkg | 2023-10-08 06:30 | 2.0M | |
| urw-base35-fonts-202..> | 2023-10-07 05:20 | 8.0M | |
| urweb-20200209_1.pkg | 2023-10-10 05:05 | 3.1M | |
| urwfonts-1.0_8.pkg | 2023-10-09 15:14 | 1.2M | |
| urwfonts-ttf-1.0.7b1..> | 2023-10-08 11:00 | 1.2M | |
| urxvt-font-size-1.3_..> | 2023-10-08 17:38 | 6.0K | |
| urxvt-perls-2.0_1.pkg | 2023-10-14 04:38 | 6.8K | |
| usb_modeswitch-2.6.0..> | 2023-10-10 06:00 | 54K | |
| usbhid-dump-1.4.pkg | 2023-10-07 00:15 | 16K | |
| usbids-20230116.pkg | 2023-10-05 16:39 | 199K | |
| usbmuxd-1.1.1_2.pkg | 2023-10-08 09:23 | 35K | |
| usbredir-0.8.0.pkg | 2023-10-14 05:47 | 47K | |
| usbrh-libusb-0.05_1.pkg | 2023-10-09 18:44 | 4.9K | |
| usbtop-1.0_7.pkg | 2023-10-10 09:33 | 12K | |
| usbutils-0.91.pkg | 2023-10-08 05:03 | 45K | |
| uschedule-0.7.1_1.pkg | 2023-10-09 16:37 | 81K | |
| usd-21.11_5.pkg | 2023-10-08 14:51 | 4.9M | |
| usendmail-0.1.6_2.pkg | 2023-10-09 20:46 | 20K | |
| userinfo-2.5.pkg | 2023-10-09 16:15 | 17K | |
| userlist-0.1.pkg | 2023-10-08 22:14 | 1.0K | |
| usermatic-0.6.1.pkg | 2023-10-08 19:47 | 23K | |
| usermin-1.861.pkg | 2023-10-10 00:49 | 13M | |
| userneu-1.38_1.pkg | 2023-10-08 04:06 | 16K | |
| userneu-devel-1.43_2..> | 2023-10-10 06:12 | 21K | |
| usockets-0.8.1.pkg | 2023-10-07 16:12 | 21K | |
| usql-0.14.12_2.pkg | 2023-10-14 02:26 | 5.8M | |
| usrinfo-.10.pkg | 2023-10-09 11:20 | 6.4K | |
| ustreamer-5.42.pkg | 2023-10-10 09:25 | 107K | |
| utcount-0.1_1.pkg | 2023-10-08 12:05 | 5.5K | |
| utdns-1.1.pkg | 2023-10-08 12:07 | 7.7K | |
| utf8cpp-3.2.4.pkg | 2023-10-06 22:24 | 9.5K | |
| utf8proc-2.8.0.pkg | 2023-10-06 12:49 | 61K | |
| utftools-1.6_1.pkg | 2023-10-08 15:00 | 17K | |
| utftpd-0.2.4_2.pkg | 2023-10-10 23:17 | 46K | |
| uthash-2.3.0.pkg | 2023-10-05 16:39 | 50K | |
| util-linux-2.39.2.pkg | 2023-10-07 08:22 | 516K | |
| utopia-1.1.pkg | 2023-10-14 12:18 | 185K | |
| utouch-kmod-0.0.5.pkg | 2023-10-09 00:04 | 8.4K | |
| uudeview-0.5.20.pkg | 2023-10-08 08:10 | 39K | |
| uulib-0.5.20_2.pkg | 2023-10-07 07:41 | 138K | |
| uvg266-0.4.1_1.pkg | 2023-10-09 06:55 | 367K | |
| uw-ttyp0-1.3_2.pkg | 2023-10-09 19:35 | 1.7M | |
| uwebsockets-20.45.0.pkg | 2023-10-08 12:41 | 57K | |
| uwsgi-py39-2.0.21.pkg | 2023-10-10 09:13 | 384K | |
| uwsgitop-0.10_1.pkg | 2023-10-09 18:19 | 5.1K | |
| uxplay-1.66.pkg | 2023-10-11 08:44 | 240K | |
| uz-aspell-0.6.0_1,2.pkg | 2023-10-10 19:44 | 526K | |
| uz-libreoffice-7.5.5..> | 2023-10-07 18:02 | 213K | |
| uzap-1.0.pkg | 2023-10-09 14:36 | 14K | |
| v-0.4.1.pkg | 2023-10-10 08:21 | 5.8M | |
| v2ray-4.36.2_15.pkg | 2023-10-10 12:12 | 9.9M | |
| v4l-utils-1.23.0_2.pkg | 2023-10-10 07:28 | 592K | |
| v4l_compat-1.23.0_2.pkg | 2023-10-05 16:40 | 78K | |
| v7sh-1.0_1.pkg | 2023-10-10 20:18 | 30K | |
| v8-10.4.132.20_2.pkg | 2023-10-07 05:25 | 11M | |
| v8-beta-10.4.132.20_..> | 2023-10-10 13:01 | 11M | |
| v1541commander-1.1.pkg | 2023-10-10 05:51 | 188K | |
| v_sim-3.8.0_8.pkg | 2023-10-10 03:38 | 2.9M | |
| vacation-3.3.3.pkg | 2023-10-10 11:10 | 11K | |
| vacuum-lint-tool-0.3..> | 2023-10-10 21:52 | 7.6M | |
| vagrant-2.3.7.pkg | 2023-10-14 05:26 | 1.5M | |
| vala-0.56.8,1.pkg | 2023-10-05 17:31 | 1.8M | |
| vale-2.29.0.pkg | 2023-10-06 17:51 | 6.5M | |
| valentina-0.7.52.pkg | 2023-10-10 01:52 | 6.4M | |
| valgrind-3.21.0_1,1.pkg | 2023-10-08 00:20 | 53M | |
| valgrind-devel-3.22...> | 2023-10-09 02:09 | 53M | |
| validator-1.3_5.pkg | 2023-10-10 10:18 | 2.4M | |
| valyriatear-1.1.0_4.pkg | 2023-10-10 21:11 | 91M | |
| vamos-0.7.1_27.pkg | 2023-10-14 02:51 | 1.4M | |
| vamp-plugin-sdk-2.9...> | 2023-10-07 08:57 | 230K | |
| vampire-4.8.pkg | 2023-10-10 06:29 | 1.7M | |
| vamps-0.99.2_10.pkg | 2023-10-08 18:46 | 33K | |
| vanguards-tor-0.3.1.pkg | 2023-10-14 05:49 | 33K | |
| vanilla-conquer-g202..> | 2023-10-10 06:44 | 1.2M | |
| vapoursynth-fmtconv-..> | 2023-10-14 15:14 | 2.3M | |
| vapoursynth-l-smash-..> | 2023-10-09 04:11 | 58K | |
| vapoursynth-r63.pkg | 2023-10-06 22:38 | 3.3M | |
| vapoursynth-vmaf-r7.pkg | 2023-10-09 19:06 | 8.4K | |
| vapoursynth-waifu2x-..> | 2023-10-09 12:42 | 890K | |
| vapoursynth-waifu2x-..> | 2023-10-14 03:51 | 20M | |
| varconf-1.0.1_10.pkg | 2023-10-10 11:59 | 51K | |
| variety-0.8.5_2.pkg | 2023-10-08 15:33 | 650K | |
| varnish-ip2location-..> | 2023-10-10 19:51 | 5.7K | |
| varnish-ip2proxy-1.2..> | 2023-10-10 13:03 | 5.9K | |
| varnish-libvmod-dige..> | 2023-10-14 04:42 | 13K | |
| varnish-libvmod-dyna..> | 2023-10-09 11:00 | 37K | |
| varnish-libvmod-file..> | 2023-10-08 13:22 | 160K | |
| varnish-libvmod-geoi..> | 2023-10-14 12:16 | 7.7K | |
| varnish-libvmod-maxm..> | 2023-10-10 05:24 | 4.7K | |
| varnish-libvmod-quer..> | 2023-10-08 17:07 | 13K | |
| varnish-libvmod-redi..> | 2023-10-09 13:56 | 57K | |
| varnish-modules-0.22..> | 2023-10-14 10:36 | 58K | |
| varnish6-6.6.2.pkg | 2023-10-07 11:55 | 898K | |
| varnish7-7.3.0_1.pkg | 2023-10-08 07:42 | 961K | |
| varnish_exporter-1.6..> | 2023-10-14 04:59 | 2.2M | |
| vasm-1.8c.pkg | 2023-10-07 18:20 | 1.1M | |
| vault-1.14.0_3.pkg | 2023-10-14 13:00 | 31M | |
| vaultwarden-1.29.2.pkg | 2023-10-08 15:09 | 6.4M | |
| vaultwarden_web-vaul..> | 2023-10-07 11:15 | 6.6M | |
| vavoom-1.33_17.pkg | 2023-10-07 15:25 | 1.8M | |
| vavoom-extras-1.30_4..> | 2023-10-14 16:04 | 16M | |
| vba-1.7.2_13.pkg | 2023-10-10 08:13 | 242K | |
| vban-tools-g20201011..> | 2023-10-09 19:19 | 20K | |
| vbetool-1.1_2.pkg | 2023-10-09 09:12 | 36K | |
| vbindiff-3.0.b5.pkg | 2023-10-09 03:13 | 27K | |
| vboxtool-0.5_4.pkg | 2023-10-09 21:26 | 9.0K | |
| vbsfilter-1.15_4.pkg | 2023-10-10 22:21 | 5.9K | |
| vbz-compression-1.0...> | 2023-10-07 01:42 | 14K | |
| vc-1.4.3.pkg | 2023-10-06 15:07 | 224K | |
| vc-intrinsics-llvm11..> | 2023-10-07 03:23 | 98K | |
| vc-intrinsics-llvm12..> | 2023-10-07 01:19 | 97K | |
| vc-intrinsics-llvm13..> | 2023-10-07 06:49 | 97K | |
| vc-intrinsics-llvm14..> | 2023-10-07 08:52 | 97K | |
| vc-intrinsics-llvm15..> | 2023-10-14 16:15 | 98K | |
| vcdgear-1.6d.pkg | 2023-10-10 20:40 | 58K | |
| vcdimager-2.0.1_4.pkg | 2023-10-07 00:56 | 286K | |
| vcf-split-0.1.5.4.pkg | 2023-10-10 23:48 | 9.6K | |
| vcf2hap-0.1.6.pkg | 2023-10-11 08:20 | 4.9K | |
| vcflib-1.0.7.pkg | 2023-10-07 11:42 | 2.0M | |
| vcftools-0.1.16_1.pkg | 2023-10-07 15:05 | 361K | |
| vcg-1.30_3.pkg | 2023-10-07 08:38 | 290K | |
| vcglib-2020.09.pkg | 2023-10-08 10:47 | 4.5M | |
| vchanger-1.0.3.pkg | 2023-10-09 04:52 | 90K | |
| vcmi-1.3.2.pkg | 2023-10-10 04:56 | 7.7M | |
| vcp-2.2_1.pkg | 2023-10-10 20:33 | 17K | |
| vde-1.5.7.pkg | 2023-10-08 12:00 | 50K | |
| vde2-2.3.3.pkg | 2023-10-07 09:09 | 155K | |
| vdesk-1.2_4.pkg | 2023-10-10 12:49 | 6.1K | |
| vdmfec-1.0.pkg | 2023-10-11 10:59 | 16K | |
| vdpauinfo-1.5.pkg | 2023-10-11 06:14 | 7.6K | |
| vdradmin-am-3.6.10.pkg | 2023-10-10 01:55 | 412K | |
| vdt-0.4.4.pkg | 2023-10-07 19:45 | 25K | |
| ve-hunspell-20110323..> | 2023-10-10 11:56 | 54K | |
| ve-libreoffice-7.5.5..> | 2023-10-08 06:32 | 199K | |
| vec-libreoffice-7.5...> | 2023-10-07 14:08 | 510K | |
| vector-0.10.0_27.pkg | 2023-10-10 15:02 | 6.1M | |
| vectoroids-1.1.0_17.pkg | 2023-10-10 17:48 | 249K | |
| ved-2023.04.19.pkg | 2023-10-07 13:04 | 96K | |
| veditor-1.2.2_4.pkg | 2023-10-10 00:41 | 664K | |
| vegeta-12.11.0_1.pkg | 2023-10-08 20:46 | 3.1M | |
| veles-2018.05.0_4.pkg | 2023-10-10 21:59 | 618K | |
| veloren-weekly-s2023..> | 2023-10-10 07:42 | 264M | |
| velvet-1.2.10_2.pkg | 2023-10-10 20:12 | 618K | |
| venice-0.752.b.pkg | 2023-10-10 18:49 | 4.1M | |
| vera++-1.3.0_18.pkg | 2023-10-08 15:52 | 187K | |
| vera-1.23.pkg | 2023-10-14 10:38 | 179K | |
| veracrypt-1.25.9_1.pkg | 2023-10-09 21:44 | 2.5M | |
| verdict-1.4.2_1.pkg | 2023-10-07 08:54 | 709K | |
| verilator-5.016.pkg | 2023-10-08 11:34 | 2.0M | |
| verilog-mode.el-801_..> | 2023-10-07 15:45 | 95K | |
| verilog-mode.el-emac..> | 2023-10-08 09:12 | 95K | |
| verilog-mode.el-emac..> | 2023-10-07 12:25 | 95K | |
| verilog-mode.el-emac..> | 2023-10-07 16:37 | 95K | |
| verilog-mode.el-emac..> | 2023-10-07 15:31 | 95K | |
| veroroute-2.36,1.pkg | 2023-10-10 22:42 | 475K | |
| vertx-2.1.1.pkg | 2023-10-09 10:11 | 5.9M | |
| veryl-0.5.5_5.pkg | 2023-10-09 18:07 | 1.1M | |
| vether-kmod-g2021121..> | 2023-10-09 09:00 | 4.1K | |
| vexcl-1.4.3_2.pkg | 2023-10-14 07:20 | 143K | |
| vexim-php80-2.3_3.pkg | 2023-10-09 16:22 | 89K | |
| vexim-php81-2.3_3.pkg | 2023-10-08 14:04 | 89K | |
| vexim-php82-2.3_3.pkg | 2023-10-08 19:30 | 89K | |
| vexim-php83-2.3_3.pkg | 2023-10-14 04:20 | 89K | |
| vfc-2.1.3.pkg | 2023-10-11 15:19 | 78K | |
| vfront-0.96.c_2.pkg | 2023-10-09 01:28 | 2.7M | |
| vger-2.0.1.pkg | 2023-10-09 02:56 | 13K | |
| vgmplay-0.40.9_2.pkg | 2023-10-09 18:27 | 303K | |
| vgmtools-g20220718.pkg | 2023-10-09 15:16 | 164K | |
| vgrep-2.6.1_7.pkg | 2023-10-10 00:20 | 1.0M | |
| vhostcname-2.00.pkg | 2023-10-10 17:32 | 14K | |
| vhs-0.6.0_1.pkg | 2023-10-09 06:58 | 5.0M | |
| vi-aspell-0.01.1.1_1..> | 2023-10-10 21:06 | 41K | |
| vi-hunspell-20141110..> | 2023-10-10 09:21 | 9.4K | |
| vi-libreoffice-7.5.5..> | 2023-10-07 17:03 | 2.8M | |
| vi-libviet-20010210_..> | 2023-10-07 21:12 | 12K | |
| vi-unicode-uhoai-2.1..> | 2023-10-08 22:13 | 25K | |
| vi-urwvn-3.04_5.pkg | 2023-10-09 21:23 | 1.0M | |
| vi-vietunicode-hanno..> | 2023-10-10 21:50 | 16M | |
| vi-vietunicode-trich..> | 2023-10-10 05:03 | 1.0M | |
| vi-vietunicode-web1-..> | 2023-10-11 09:09 | 877K | |
| vi-vis2u-1.0.pkg | 2023-10-08 23:00 | 3.5K | |
| vi-vn7to8-1.1.1.pkg | 2023-10-10 06:17 | 14K | |
| vi-vnconvert-1.0_1.pkg | 2023-10-10 03:02 | 9.7K | |
| vi-vnless-1.0_1.pkg | 2023-10-10 09:33 | 34K | |
| vi-vnpstext-1.1_1.pkg | 2023-10-09 01:13 | 9.8K | |
| vi-vnroff-2.1.pkg | 2023-10-09 08:36 | 6.2K | |
| vi-x-unikey-1.0.4.pkg | 2023-10-08 22:06 | 75K | |
| viamillipede-0.89.pkg | 2023-10-09 03:42 | 20K | |
| vice-3.7.1_4.pkg | 2023-10-08 13:44 | 4.9M | |
| victor-mono-ttf-1.5...> | 2023-10-11 00:57 | 725K | |
| victoria-metrics-1.8..> | 2023-10-10 03:52 | 12M | |
| vid.stab-0.98.2.pkg | 2023-10-06 15:06 | 48K | |
| viddy-0.3.4_14.pkg | 2023-10-09 14:19 | 2.6M | |
| video-trimmer-0.8.1_..> | 2023-10-09 05:45 | 787K | |
| videogen-0.33_1.pkg | 2023-10-08 18:53 | 18K | |
| viennacl-1.7.1_6.pkg | 2023-10-07 15:51 | 362K | |
| viennarna-2.6.3.pkg | 2023-10-08 00:25 | 16M | |
| viewfax-2.6_1.pkg | 2023-10-14 05:02 | 46K | |
| viewglob-2.0.4_9.pkg | 2023-10-08 16:51 | 102K | |
| viewklass-0.7.2_1.pkg | 2023-10-14 16:17 | 128K | |
| viewnior-1.8_2.pkg | 2023-10-10 23:13 | 119K | |
| viewres-1.0.6.pkg | 2023-10-14 05:15 | 15K | |
| vifm-0.12.pkg | 2023-10-11 06:27 | 757K | |
| vigenere-1.0.pkg | 2023-10-10 05:54 | 7.1K | |
| vigil-1.26.3_1.pkg | 2023-10-08 23:50 | 2.7M | |
| vigor-0.016_4.pkg | 2023-10-14 09:29 | 195K | |
| vigra-1.11.1_28.pkg | 2023-10-06 21:55 | 948K | |
| vii-4.2_5.pkg | 2023-10-09 02:33 | 13K | |
| viking-1.10.pkg | 2023-10-14 15:00 | 2.8M | |
| vile-9.8y.pkg | 2023-10-10 09:35 | 1.0M | |
| vils-20020228_1.pkg | 2023-10-09 00:07 | 1.6K | |
| vim-9.0.1876.pkg | 2023-10-06 15:56 | 8.0M | |
| vim-colorschemes-leg..> | 2023-10-10 15:12 | 8.8K | |
| vim-gtk2-9.0.1876.pkg | 2023-10-10 02:12 | 8.1M | |
| vim-gtk3-9.0.1876.pkg | 2023-10-08 09:49 | 8.1M | |
| vim-motif-9.0.1876.pkg | 2023-10-08 12:21 | 8.1M | |
| vim-tiny-9.0.1876.pkg | 2023-10-09 14:01 | 1.4M | |
| vim-x11-9.0.1876.pkg | 2023-10-10 04:19 | 8.0M | |
| vimb-3.7.0.pkg | 2023-10-14 17:13 | 78K | |
| vimpager-2.06.202007..> | 2023-10-09 13:11 | 59K | |
| vimpc-0.09.2_1.pkg | 2023-10-09 21:44 | 247K | |
| vinagre-3.22.0_8.pkg | 2023-10-10 22:03 | 1.3M | |
| vinci-1.0.5.pkg | 2023-10-10 13:21 | 30K | |
| vino-3.22.0_2.pkg | 2023-10-07 16:32 | 355K | |
| violet-2.1.0.pkg | 2023-10-09 14:35 | 3.2M | |
| violetland-0.5_21.pkg | 2023-10-09 17:49 | 8.2M | |
| vipack-0.9.1.pkg | 2023-10-10 22:11 | 239K | |
| vips-8.14.4_1.pkg | 2023-10-06 13:55 | 2.3M | |
| vipster-1.19.1.b.14_..> | 2023-10-09 22:29 | 656K | |
| virglrenderer-0.8.2_..> | 2023-10-10 23:20 | 160K | |
| virt-manager-4.1.0_2..> | 2023-10-08 21:38 | 1.0M | |
| virt-viewer-11.0_4.pkg | 2023-10-14 09:46 | 231K | |
| virt-what-1.25.pkg | 2023-10-10 00:39 | 14K | |
| virtboard-0.0.6_1.pkg | 2023-10-10 17:17 | 59K | |
| virtual_oss-1.3.1.pkg | 2023-10-07 11:48 | 55K | |
| virtual_oss_ctl-1.3...> | 2023-10-09 17:57 | 40K | |
| virtualbox-ose-6.1.4..> | 2023-10-07 19:49 | 38M | |
| virtualbox-ose-addit..> | 2023-10-10 22:36 | 1.1M | |
| virtualbox-ose-addit..> | 2023-10-08 13:07 | 676K | |
| virtualbox-ose-addit..> | 2023-10-10 14:00 | 956K | |
| virtualbox-ose-addit..> | 2023-10-14 12:02 | 469K | |
| virtualbox-ose-kmod-..> | 2023-10-07 04:50 | 128K | |
| virtualbox-ose-kmod-..> | 2023-10-08 10:34 | 122K | |
| virtualbox-ose-legac..> | 2023-10-09 09:15 | 22M | |
| virtualbox-ose-nox11..> | 2023-10-09 13:22 | 14M | |
| virtualbox-ose-nox11..> | 2023-10-14 12:33 | 11M | |
| virtualgl-3.1.pkg | 2023-10-08 01:06 | 763K | |
| virtualmin-7.2,1.pkg | 2023-10-10 00:13 | 4.4M | |
| virtualpg-2.0.1.pkg | 2023-10-07 21:12 | 24K | |
| viruskiller-1.03_7.pkg | 2023-10-11 13:25 | 4.1M | |
| vis-0.8.pkg | 2023-10-09 20:53 | 273K | |
| visitors-0.7.0_1.pkg | 2023-10-14 13:45 | 64K | |
| visp-3.5.0_10.pkg | 2023-10-10 16:34 | 2.5M | |
| visp-go-g20210723_15..> | 2023-10-14 04:42 | 6.0M | |
| visprint-2.1_3.pkg | 2023-10-09 01:10 | 9.4K | |
| visualboyadvance-m-2..> | 2023-10-08 13:43 | 497K | |
| visualpolylib-0.9_1.pkg | 2023-10-09 01:45 | 34K | |
| visualvm-2.1.5.pkg | 2023-10-08 17:19 | 13M | |
| vit-1.2_1.pkg | 2023-10-08 13:34 | 15K | |
| vitables-3.0.3.pkg | 2023-10-09 23:39 | 415K | |
| vitetris-0.59.1.pkg | 2023-10-14 14:04 | 62K | |
| vitunes-2.3_5.pkg | 2023-10-09 09:25 | 55K | |
| viu-1.4.0_17.pkg | 2023-10-10 11:14 | 671K | |
| vivid-0.8.0_16.pkg | 2023-10-09 10:31 | 342K | |
| viz-1.1.1_1.pkg | 2023-10-10 06:19 | 32K | |
| vizone-0.1.pkg | 2023-10-09 07:02 | 2.0K | |
| vkd3d-1.8.pkg | 2023-10-07 00:41 | 614K | |
| vkmark-2017.08.36.pkg | 2023-10-10 08:29 | 722K | |
| vkoverhead-1.2.pkg | 2023-10-10 00:22 | 122K | |
| vkpeak-20230812.pkg | 2023-10-09 22:24 | 612K | |
| vkquake-1.30.1.pkg | 2023-10-10 05:37 | 743K | |
| vlc-3.0.18_6,4.pkg | 2023-10-07 01:54 | 9.0M | |
| vlock-2.2.3_4.pkg | 2023-10-09 23:40 | 26K | |
| vm-bhyve-1.5.0.pkg | 2023-10-14 07:36 | 62K | |
| vm-bhyve-devel-1.5.0..> | 2023-10-14 16:50 | 62K | |
| vm-lv2-0.14.0_2.pkg | 2023-10-08 22:13 | 256K | |
| vm-to-tor-1.0.pkg | 2023-10-08 12:32 | 11K | |
| vmaf-2.3.1.pkg | 2023-10-05 17:33 | 285K | |
| vmdktool-1.4.pkg | 2023-10-14 08:23 | 13K | |
| vmips-1.5.1_2.pkg | 2023-10-12 05:09 | 133K | |
| vmpk-0.8.8_3.pkg | 2023-10-12 08:11 | 459K | |
| vms-empire-1.16.pkg | 2023-10-08 12:41 | 77K | |
| vmsbackup-4.1.1.pkg | 2023-10-10 06:55 | 10K | |
| vmtouch-1.3.1.pkg | 2023-10-09 14:23 | 15K | |
| vmutils-1.87.7_1.pkg | 2023-10-14 06:14 | 25M | |
| vmw-060510_2.pkg | 2023-10-08 16:44 | 52K | |
| vncreflector-1.2.4_7..> | 2023-10-10 02:55 | 49K | |
| vnote-3.17.0.pkg | 2023-10-09 05:03 | 6.5M | |
| vnstat-2.11_1.pkg | 2023-10-08 17:17 | 124K | |
| vo-amrwbenc-0.1.3_1.pkg | 2023-10-10 10:12 | 96K | |
| voadi-0.3.pkg | 2023-10-10 00:24 | 4.5M | |
| vobcopy-1.2.0_8.pkg | 2023-10-08 20:36 | 43K | |
| voc-2.1.2.pkg | 2023-10-07 10:11 | 1.5M | |
| void-zones-tools-1.0..> | 2023-10-14 15:16 | 12K | |
| voipong-2.0.pkg | 2023-10-09 20:13 | 83K | |
| volk-2.5.1.pkg | 2023-10-06 19:43 | 581K | |
| volleyball-0.8.6_12.pkg | 2023-10-09 14:08 | 761K | |
| vollkorn-ttf-4.105_1..> | 2023-10-07 20:12 | 1.2M | |
| volman-0.7_2.pkg | 2023-10-10 03:02 | 5.2K | |
| volpack-1.0b3_1.pkg | 2023-10-08 19:22 | 167K | |
| volta-0.3.0_1.pkg | 2023-10-09 11:12 | 24K | |
| volumeicon-0.5.1_2.pkg | 2023-10-10 06:19 | 34K | |
| vor-0.5.8.pkg | 2023-10-10 13:56 | 184K | |
| vorbis-tools-1.4.2_3..> | 2023-10-06 17:46 | 173K | |
| vorbisgain-0.37_5.pkg | 2023-10-10 20:20 | 22K | |
| voro++-0.4.6_1.pkg | 2023-10-07 01:35 | 161K | |
| vortex-2.9.0.59_2.pkg | 2023-10-14 16:33 | 30K | |
| votca-2022.1.pkg | 2023-10-10 22:29 | 41M | |
| vote-1.2.pkg | 2023-10-08 19:31 | 4.2K | |
| vouch-proxy-0.39.0_6..> | 2023-10-09 06:18 | 3.0M | |
| vowpal_wabbit-7.10_2..> | 2023-10-09 14:34 | 773K | |
| vp-1.8_2.pkg | 2023-10-10 07:22 | 8.1K | |
| vpaint-1.7_3.pkg | 2023-10-09 04:07 | 710K | |
| vpnc-0.5.3_14.pkg | 2023-10-08 17:28 | 58K | |
| vpnc-scripts-2021040..> | 2023-10-06 23:43 | 14K | |
| vpopmail-5.4.33_4.pkg | 2023-10-07 02:44 | 375K | |
| vqadmin-2.3.6_1.pkg | 2023-10-09 13:48 | 65K | |
| vqcc-gtk-0.5_10.pkg | 2023-10-09 06:49 | 86K | |
| vrflash-0.24.pkg | 2023-10-14 15:16 | 19K | |
| vrfy-1.0_2.pkg | 2023-10-14 07:25 | 19K | |
| vscode-1.82.2.pkg | 2023-10-11 19:20 | 73M | |
| vsearch-2.23.0.pkg | 2023-10-14 15:31 | 191K | |
| vsftpd-ext-3.0.3.1_1..> | 2023-10-10 00:32 | 127K | |
| vsftpd-ssl-3.0.5_1.pkg | 2023-10-14 17:37 | 114K | |
| vshnu-1.0500.pkg | 2023-10-10 05:18 | 40K | |
| vsound-0.6_7.pkg | 2023-10-08 16:58 | 7.6K | |
| vsqlite-0.3.13_19.pkg | 2023-10-09 17:27 | 77K | |
| vst3sdk-3.7.7.b.19.pkg | 2023-10-08 08:34 | 13M | |
| vstr-1.0.15_1.pkg | 2023-10-14 18:51 | 289K | |
| vt-0.57721_3.pkg | 2023-10-07 11:34 | 634K | |
| vt100-0.2.pkg | 2023-10-14 12:46 | 31K | |
| vt100-art-and-animat..> | 2023-10-08 12:43 | 181K | |
| vte-0.28.2_4.pkg | 2023-10-07 07:04 | 308K | |
| vte3-0.70.2_3.pkg | 2023-10-06 17:05 | 380K | |
| vtk8-8.2.0_3.pkg | 2023-10-07 18:27 | 19M | |
| vtk9-9.2.6_2.pkg | 2023-10-06 13:43 | 30M | |
| vtkmpeg2encode-5.10...> | 2023-10-10 10:44 | 52K | |
| vttest-2018.08.11.pkg | 2023-10-09 18:37 | 88K | |
| vtun-3.0.4_8.pkg | 2023-10-09 22:05 | 51K | |
| vtwm-5.5.0.pkg | 2023-10-10 01:22 | 170K | |
| vulkan-caps-viewer-3..> | 2023-10-09 18:03 | 385K | |
| vulkan-extension-lay..> | 2023-10-08 21:49 | 303K | |
| vulkan-headers-1.3.2..> | 2023-10-05 17:39 | 1.2M | |
| vulkan-loader-1.3.26..> | 2023-10-05 17:46 | 116K | |
| vulkan-tools-1.3.264..> | 2023-10-06 16:13 | 322K | |
| vulkan-validation-la..> | 2023-10-09 19:27 | 5.7M | |
| vuls-0.13.7_14.pkg | 2023-10-11 15:42 | 5.8M | |
| vultr-cli-2.17.0_2.pkg | 2023-10-09 09:59 | 2.7M | |
| vultures-eye-2.3.67_..> | 2023-10-14 08:18 | 25M | |
| vuxml-1.1_6.pkg | 2023-10-09 12:11 | 8.3K | |
| vuze-5.7.4.0_2.pkg | 2023-10-08 22:53 | 12M | |
| vv-1.4.0.383_7.pkg | 2023-10-09 06:50 | 3.4M | |
| vvdec-2.1.1.pkg | 2023-10-10 17:48 | 661K | |
| vvenc-1.9.0_1.pkg | 2023-10-09 18:33 | 1.3M | |
| vxl-3.3.2_2.pkg | 2023-10-06 14:12 | 4.8M | |
| vxquery-0.2.1.pkg | 2023-10-14 15:03 | 34K | |
| vxtools-0.2_1.pkg | 2023-10-10 20:03 | 23K | |
| vym-2.9.22.pkg | 2023-10-10 06:49 | 5.3M | |
| vzvol-0.7.0_2.pkg | 2023-10-08 23:37 | 9.6K | |
| w3m-0.5.3.20230129.pkg | 2023-10-05 17:10 | 876K | |
| w3m-img-0.5.3.202301..> | 2023-10-07 23:23 | 902K | |
| w3mir-1.0.10_3.pkg | 2023-10-09 17:19 | 80K | |
| w9wm-0.4.2_2.pkg | 2023-10-10 03:27 | 22K | |
| w_scan2-1.0.14.pkg | 2023-10-08 18:34 | 138K | |
| wa-aspell-0.50.0_1,1..> | 2023-10-14 10:03 | 632K | |
| wa-hunspell-0.4.15_1..> | 2023-10-10 01:03 | 45K | |
| wabt-1.0.33_1.pkg | 2023-10-10 18:56 | 942K | |
| wackamole-2.1.5_1.pkg | 2023-10-08 17:09 | 40K | |
| waffle-1.6.1.15_3.pkg | 2023-10-07 21:14 | 98K | |
| waifu2x-converter-cp..> | 2023-10-07 11:43 | 10M | |
| waifu2x-ncnn-vulkan-..> | 2023-10-07 23:27 | 32M | |
| waiho-0.2_12.pkg | 2023-10-08 08:10 | 53K | |
| wait_on-1.1.2.pkg | 2023-10-14 06:29 | 7.0K | |
| wakeonlan-0.42.pkg | 2023-10-09 19:14 | 5.4K | |
| walk-1.6.2_1.pkg | 2023-10-10 15:02 | 910K | |
| walker-3.8_1.pkg | 2023-10-09 20:42 | 11K | |
| walld-1.4.4_1.pkg | 2023-10-10 08:59 | 15K | |
| wallpapers-freebsd-k..> | 2023-10-14 16:06 | 4.1M | |
| wallutils-5.12.7_2.pkg | 2023-10-09 22:10 | 6.3M | |
| wand-libconfig-1.0.5..> | 2023-10-14 16:40 | 16K | |
| wanderer-3.2.pkg | 2023-10-09 20:17 | 48K | |
| wanderlust-2.15.9.b...> | 2023-10-09 14:09 | 861K | |
| wanderlust-emacs_can..> | 2023-10-10 20:05 | 861K | |
| wanderlust-emacs_dev..> | 2023-10-14 12:26 | 861K | |
| wanderlust-emacs_dev..> | 2023-10-08 18:42 | 861K | |
| wanderlust-emacs_nox..> | 2023-10-10 07:53 | 861K | |
| wandio-1.0.5.pkg | 2023-10-09 00:06 | 24K | |
| wangle-2023.09.18.00..> | 2023-10-07 08:29 | 310K | |
| wannier90-3.1.0_3.pkg | 2023-10-07 08:13 | 863K | |
| wanted-ports-0.2.pkg | 2023-10-08 11:57 | 7.8K | |
| waon-0.10_6.pkg | 2023-10-14 07:38 | 64K | |
| wapanel-1.1.0_3.pkg | 2023-10-10 05:57 | 224K | |
| wargus-3.3.2_1.pkg | 2023-10-14 10:31 | 3.5M | |
| warmux-11.04.1_10.pkg | 2023-10-10 14:38 | 98M | |
| warzone2100-4.3.5_1.pkg | 2023-10-08 14:51 | 220M | |
| wasi-compiler-rt11-1..> | 2023-10-08 21:39 | 17K | |
| wasi-compiler-rt13-1..> | 2023-10-07 05:40 | 18K | |
| wasi-libc-g20210923.pkg | 2023-10-06 18:47 | 392K | |
| wasi-libcxx-13.0.1.pkg | 2023-10-07 00:46 | 657K | |
| wasm-pack-0.12.1_2.pkg | 2023-10-09 12:31 | 1.2M | |
| wasm3-0.5.0_2.pkg | 2023-10-09 20:17 | 58K | |
| wasmer-4.1.2_2.pkg | 2023-10-10 11:56 | 9.2M | |
| watchfolder-0.3.3_1.pkg | 2023-10-09 22:57 | 44K | |
| watchman-4.5.0,1.pkg | 2023-10-08 02:33 | 79K | |
| watchmen-0.09.pkg | 2023-10-14 07:08 | 18K | |
| watershot-0.2.1_1.pkg | 2023-10-14 09:08 | 2.2M | |
| wavbreaker-0.16_1.pkg | 2023-10-14 08:45 | 76K | |
| wavegain-1.2.8_3.pkg | 2023-10-07 11:02 | 27K | |
| wavelib-g20200528.pkg | 2023-10-11 15:31 | 122K | |
| wavetral-g20210517_5..> | 2023-10-14 11:08 | 47K | |
| wavpack-5.6.0.pkg | 2023-10-06 20:16 | 176K | |
| wavplay-2.0.pkg | 2023-10-08 10:29 | 15K | |
| way-displays-1.9.0.pkg | 2023-10-09 03:11 | 300K | |
| waybar-0.9.22.pkg | 2023-10-10 19:27 | 502K | |
| waybar-nopulse-0.9.2..> | 2023-10-08 22:33 | 496K | |
| wayfire-0.7.5_1.pkg | 2023-10-07 07:10 | 943K | |
| wayfire-plugins-extr..> | 2023-10-08 17:57 | 254K | |
| wayidle-0.1.1_3.pkg | 2023-10-09 01:39 | 185K | |
| wayland-1.22.0.pkg | 2023-10-05 17:39 | 126K | |
| wayland-logout-1.4.pkg | 2023-10-07 01:42 | 3.8K | |
| wayland-protocols-1...> | 2023-10-05 17:39 | 76K | |
| wayland-utils-1.2.0.pkg | 2023-10-06 17:19 | 14K | |
| waylandpp-1.0.0.pkg | 2023-10-06 18:04 | 573K | |
| waylock-0.6.2_1.pkg | 2023-10-10 11:58 | 17K | |
| waynergy-0.0.16.pkg | 2023-10-08 16:10 | 44K | |
| wayout-1.1.3_4.pkg | 2023-10-14 16:04 | 277K | |
| waypipe-0.8.6_2.pkg | 2023-10-09 15:23 | 80K | |
| wayvnc-0.6.2_1.pkg | 2023-10-09 06:46 | 49K | |
| wazuh-agent-4.5.0.pkg | 2023-10-14 05:04 | 4.0M | |
| wazuh-dashboard-4.5...> | 2023-10-10 19:41 | 23M | |
| wazuh-indexer-4.5.0.pkg | 2023-10-10 03:25 | 2.5K | |
| wazuh-manager-4.5.0.pkg | 2023-10-08 06:16 | 57M | |
| wazuh-server-4.5.0.pkg | 2023-10-09 14:40 | 8.9K | |
| wbar-2.3.4_6.pkg | 2023-10-08 22:09 | 74K | |
| wbxml2-0.11.8.pkg | 2023-10-08 00:45 | 80K | |
| wcalc-2.5_3.pkg | 2023-10-09 17:34 | 99K | |
| wcd-6.0.5.pkg | 2023-10-09 20:58 | 496K | |
| wcm-0.7.5_1.pkg | 2023-10-14 11:50 | 280K | |
| wcslib-8.1.pkg | 2023-10-07 09:15 | 2.4M | |
| wdiag-0.10.2.pkg | 2023-10-09 15:22 | 10K | |
| wdiff-1.2.2_2.pkg | 2023-10-07 20:16 | 90K | |
| wdisplays-1.1.1.pkg | 2023-10-08 01:35 | 33K | |
| wdm-1.28_16.pkg | 2023-10-10 10:44 | 374K | |
| wdns-0.12.0.pkg | 2023-10-06 22:42 | 56K | |
| wdune-1.956_3.pkg | 2023-10-14 06:48 | 19M | |
| weather-2.4.4.pkg | 2023-10-09 16:34 | 2.2M | |
| web-mode-15.1_16.pkg | 2023-10-09 05:29 | 83K | |
| web-mode-emacs_canna..> | 2023-10-10 12:45 | 83K | |
| web-mode-emacs_devel..> | 2023-10-14 03:11 | 83K | |
| web-mode-emacs_devel..> | 2023-10-09 06:31 | 83K | |
| web-mode-emacs_nox-1..> | 2023-10-09 02:30 | 83K | |
| webalizer-2.23.8_14.pkg | 2023-10-08 08:18 | 129K | |
| webalizer-geodb-2021..> | 2023-10-08 19:57 | 745K | |
| webalizer-geoip-2.23..> | 2023-10-08 12:28 | 261K | |
| webbench-1.5.pkg | 2023-10-09 04:11 | 8.5K | |
| webbrowser-0.3.pkg | 2023-10-07 11:05 | 2.3K | |
| webcamd-5.17.1.2_1.pkg | 2023-10-06 15:01 | 1.6M | |
| webcamoid-9.1.1_1.pkg | 2023-10-09 22:21 | 9.3M | |
| webcopy-0.98b7.pkg | 2023-10-09 04:58 | 13K | |
| webcpp-0.8.4.pkg | 2023-10-08 16:00 | 91K | |
| webcrawl-1.10_1.pkg | 2023-10-10 05:13 | 15K | |
| webdis-0.1.20_1.pkg | 2023-10-11 00:25 | 72K | |
| weberp-4.15.2.pkg | 2023-10-09 17:34 | 19M | |
| webfonts-0.30_14.pkg | 2023-10-06 19:48 | 4.2M | |
| webfs-1.21.pkg | 2023-10-14 10:21 | 23K | |
| webgrind-1.9.2.pkg | 2023-10-10 18:35 | 100K | |
| webhook-2.8.0_15.pkg | 2023-10-08 19:54 | 2.5M | |
| webinject-1.41_1.pkg | 2023-10-14 06:18 | 21K | |
| webkit2-gtk3-2.34.6_..> | 2023-10-06 11:52 | 18M | |
| webkit2-gtk4-2.38.3_..> | 2023-10-06 17:15 | 23M | |
| weblint++-1.15_3.pkg | 2023-10-08 09:33 | 15K | |
| webmin-2.013.pkg | 2023-10-08 05:48 | 35M | |
| webp-1.3.1_1.pkg | 2023-10-05 17:46 | 410K | |
| webp-pixbuf-loader-0..> | 2023-10-14 06:00 | 7.7K | |
| webresolve-0.2.0_1.pkg | 2023-10-14 06:04 | 7.2K | |
| webrtc-audio-process..> | 2023-10-10 23:06 | 507K | |
| webrtc-audio-process..> | 2023-10-05 17:25 | 482K | |
| websh-3.6.0b5_8.pkg | 2023-10-10 09:27 | 86K | |
| websieve-0.63.a_3.pkg | 2023-10-11 09:16 | 24K | |
| website-2.6.0.pkg | 2023-10-09 15:50 | 142K | |
| websocat-1.12.0.pkg | 2023-10-08 04:43 | 691K | |
| websocketd-0.4.1_14.pkg | 2023-10-09 07:33 | 1.8M | |
| websocketpp-0.8.2.pkg | 2023-10-08 02:48 | 112K | |
| websockify-0.11.0.pkg | 2023-10-10 20:53 | 48K | |
| webstone-2.5_2.pkg | 2023-10-10 19:07 | 55K | |
| websvn-php80-2.8.2.pkg | 2023-10-09 01:54 | 204K | |
| websvn-php81-2.8.2.pkg | 2023-10-10 06:57 | 204K | |
| websvn-php82-2.8.2.pkg | 2023-10-10 23:34 | 204K | |
| websvn-php83-2.8.2.pkg | 2023-10-08 22:21 | 204K | |
| webtrees20-2.0.25.pkg | 2023-10-09 00:36 | 19M | |
| webtrees21-2.1.17.pkg | 2023-10-14 18:17 | 20M | |
| webtunnel-tor-0.0.1_..> | 2023-10-10 13:04 | 1.6M | |
| weebsay-0.0.20210508..> | 2023-10-14 11:44 | 2.0M | |
| weechat-4.0.4.pkg | 2023-10-08 11:55 | 2.5M | |
| weedit-2.0.3.pkg | 2023-10-14 12:04 | 11K | |
| weex-2.8.4.2.pkg | 2023-10-10 12:05 | 48K | |
| wego-2.2_2.pkg | 2023-10-09 09:51 | 1.8M | |
| weka-3.8.6.pkg | 2023-10-14 05:24 | 12M | |
| welle.io-2.4_1.pkg | 2023-10-08 19:08 | 350K | |
| wemux-3.2.0_1.pkg | 2023-10-08 12:48 | 12K | |
| wesnoth-1.16.9,1.pkg | 2023-10-14 14:25 | 413M | |
| wev-1.0.0_2.pkg | 2023-10-09 23:18 | 29K | |
| wezterm-20230408.112..> | 2023-10-09 08:13 | 74M | |
| wf-config-0.7.1_2.pkg | 2023-10-06 20:27 | 107K | |
| wf-recorder-0.4.1.pkg | 2023-10-09 09:15 | 39K | |
| wf-shell-0.7.0_6.pkg | 2023-10-08 06:52 | 5.9M | |
| wf-shell-nopulse-0.7..> | 2023-10-08 23:49 | 5.8M | |
| wfa2-lib-2.3.2_1.pkg | 2023-10-07 09:45 | 107K | |
| wfb2sql-0.6_1.pkg | 2023-10-14 17:59 | 12K | |
| wfmath-1.0.2_10.pkg | 2023-10-07 05:28 | 151K | |
| wget-1.21.4.pkg | 2023-10-06 23:23 | 697K | |
| wget2-2.0.1.pkg | 2023-10-08 22:41 | 468K | |
| wgetpaste-2.33.pkg | 2023-10-10 03:22 | 14K | |
| whatmask-1.2_2.pkg | 2023-10-09 08:30 | 7.6K | |
| whatpix-1.2_2.pkg | 2023-10-08 15:11 | 4.6K | |
| whatweb-0.5.5.1.b351..> | 2023-10-10 08:56 | 2.3M | |
| when-1.1.45.pkg | 2023-10-08 13:46 | 48K | |
| whichman-2.4.pkg | 2023-10-11 13:25 | 14K | |
| whichwayisup-0.7.9_1..> | 2023-10-08 21:05 | 940K | |
| whois-5.5.7.pkg | 2023-10-10 19:39 | 57K | |
| whoseip-1.00.pkg | 2023-10-09 13:53 | 28K | |
| whoson-2.05_1.pkg | 2023-10-14 06:40 | 39K | |
| whowatch-1.4_1.pkg | 2023-10-10 18:12 | 15K | |
| whysynth-20120903_7.pkg | 2023-10-10 00:17 | 1.5M | |
| widelands-1.1_6.pkg | 2023-10-08 16:49 | 374M | |
| widentd-1.04_1.pkg | 2023-10-10 22:28 | 6.7K | |
| wifi-firmware-ath10k..> | 2023-10-07 18:17 | 2.4M | |
| wifi-firmware-ath11k..> | 2023-10-07 18:14 | 2.7M | |
| wifi-firmware-mt76-k..> | 2023-10-07 15:27 | 2.1M | |
| wifi-firmware-rtw88-..> | 2023-10-07 15:21 | 219K | |
| wifi-firmware-rtw89-..> | 2023-10-08 03:07 | 603K | |
| wifibox-1.2.2.pkg | 2023-10-09 16:31 | 768 | |
| wifibox-alpine-20230..> | 2023-10-08 03:22 | 100M | |
| wifibox-alpine-ath10..> | 2023-10-07 17:10 | 18M | |
| wifibox-alpine-ath11..> | 2023-10-07 21:29 | 25M | |
| wifibox-alpine-brcm-..> | 2023-10-08 05:00 | 18M | |
| wifibox-alpine-iwlwi..> | 2023-10-07 22:56 | 60M | |
| wifibox-alpine-marve..> | 2023-10-07 11:30 | 12M | |
| wifibox-alpine-media..> | 2023-10-07 20:12 | 19M | |
| wifibox-alpine-rt61-..> | 2023-10-07 21:24 | 14M | |
| wifibox-alpine-rtlwi..> | 2023-10-08 07:16 | 12M | |
| wifibox-alpine-rtw88..> | 2023-10-07 10:40 | 12M | |
| wifibox-alpine-rtw89..> | 2023-10-07 21:33 | 13M | |
| wifibox-ath10k-1.2.2..> | 2023-10-09 02:11 | 772 | |
| wifibox-ath11k-1.2.2..> | 2023-10-09 09:10 | 772 | |
| wifibox-brcm-1.2.2.pkg | 2023-10-08 22:07 | 772 | |
| wifibox-core-0.11.0.pkg | 2023-10-07 20:02 | 12K | |
| wifibox-iwlwifi-1.2...> | 2023-10-14 15:05 | 772 | |
| wifibox-marvell-1.2...> | 2023-10-10 12:43 | 772 | |
| wifibox-mediatek-1.2..> | 2023-10-08 16:58 | 776 | |
| wifibox-rt61-1.2.2.pkg | 2023-10-10 23:20 | 772 | |
| wifibox-rtlwifi-1.2...> | 2023-10-09 13:07 | 772 | |
| wifibox-rtw88-1.2.2.pkg | 2023-10-08 17:21 | 772 | |
| wifibox-rtw89-1.2.2.pkg | 2023-10-14 04:50 | 772 | |
| wifimgr-1.23_1.pkg | 2023-10-14 09:01 | 73K | |
| wiggle-1.3.pkg | 2023-10-14 05:18 | 57K | |
| wiimms-2.23.a_10.pkg | 2023-10-08 12:34 | 716K | |
| wiki-tui-0.8.2_1.pkg | 2023-10-14 17:38 | 1.3M | |
| wikicalc-1.0.pkg | 2023-10-14 11:00 | 161K | |
| wikiman-2.13.2.pkg | 2023-10-14 01:41 | 13K | |
| wildfly10-10.1.0_2.pkg | 2023-10-08 06:02 | 127M | |
| wildfly11-11.0.0_1.pkg | 2023-10-09 13:17 | 143M | |
| wildfly12-12.0.0_1.pkg | 2023-10-08 21:43 | 152M | |
| wildfly13-13.0.0_1.pkg | 2023-10-09 16:12 | 167M | |
| wildfly14-14.0.1.pkg | 2023-10-08 12:33 | 161M | |
| wildfly15-15.0.1.pkg | 2023-10-09 23:54 | 162M | |
| wildfly16-16.0.0.pkg | 2023-10-08 16:03 | 163M | |
| wildfly17-17.0.1.pkg | 2023-10-09 03:51 | 166M | |
| wildfly18-18.0.1.pkg | 2023-10-10 03:08 | 167M | |
| wildfly24-24.0.1.pkg | 2023-10-08 20:41 | 192M | |
| wildfly25-25.0.1.pkg | 2023-10-14 09:48 | 201M | |
| wildfly26-26.0.1.pkg | 2023-10-09 07:29 | 196M | |
| wildfly90-9.0.2_2.pkg | 2023-10-14 09:12 | 125M | |
| wildmidi-0.4.2.pkg | 2023-10-06 23:27 | 85K | |
| wimlib-1.13.0_2.pkg | 2023-10-09 00:59 | 284K | |
| win98se-icon-theme-0..> | 2023-10-09 03:47 | 10M | |
| window-1.0_1.pkg | 2023-10-09 23:41 | 71K | |
| windowmaker-0.95.9_3..> | 2023-10-08 04:13 | 1.7M | |
| wine-8.0.2,1.pkg | 2023-10-07 23:55 | 29M | |
| wine-devel-8.11_2,1.pkg | 2023-10-10 07:38 | 29M | |
| wine-gecko-2.47.2.pkg | 2023-10-07 10:42 | 56M | |
| wine-gecko-devel-2.4..> | 2023-10-08 23:14 | 52M | |
| wine-mono-7.4.0.pkg | 2023-10-08 08:08 | 82M | |
| wine-mono-devel-8.0...> | 2023-10-10 03:52 | 79M | |
| wine7-7.0.2_2.pkg | 2023-10-08 00:54 | 32M | |
| winetricks-20230212.pkg | 2023-10-07 16:50 | 152K | |
| wings-2.2.9_1.pkg | 2023-10-09 14:10 | 11M | |
| wininfo-0.7_12.pkg | 2023-10-09 08:47 | 13K | |
| wipe-2.3.1_1.pkg | 2023-10-12 04:36 | 22K | |
| wipeclean-1.1.2_1,1.pkg | 2023-10-10 00:01 | 38K | |
| wireguard-2,1.pkg | 2023-10-07 14:56 | 1.0K | |
| wireguard-go-0.0.202..> | 2023-10-09 10:40 | 846K | |
| wireguard-kmod-0.0.2..> | 2023-10-07 06:32 | 39K | |
| wireguard-tools-1.0...> | 2023-10-07 08:27 | 51K | |
| wireguard-tools-lite..> | 2023-10-14 10:37 | 43K | |
| wireproxy-1.0.6_2.pkg | 2023-10-10 02:35 | 1.9M | |
| wireshark-4.0.8.pkg | 2023-10-14 08:03 | 24M | |
| wireshark-nox11-4.0...> | 2023-10-08 07:59 | 20M | |
| wise-2.4.1_1.pkg | 2023-10-14 07:29 | 1.2M | |
| with-editor-3.3.2.pkg | 2023-10-07 06:41 | 25K | |
| with-editor-devel-3...> | 2023-10-07 00:08 | 25K | |
| with-editor-devel-em..> | 2023-10-07 07:26 | 25K | |
| with-editor-devel-em..> | 2023-10-07 07:23 | 25K | |
| with-editor-devel-em..> | 2023-10-07 05:45 | 25K | |
| with-editor-devel-em..> | 2023-10-07 08:59 | 25K | |
| with-editor-emacs_ca..> | 2023-10-07 03:10 | 25K | |
| with-editor-emacs_de..> | 2023-10-07 00:39 | 25K | |
| with-editor-emacs_de..> | 2023-10-07 09:51 | 25K | |
| with-editor-emacs_no..> | 2023-10-07 06:21 | 25K | |
| with-g20180520.pkg | 2023-10-09 01:42 | 4.3K | |
| wizardkit-0.1_11.pkg | 2023-10-08 04:37 | 8.4K | |
| wizznic-1.1_1,1.pkg | 2023-10-14 18:39 | 23M | |
| wkhtmltopdf-0.12.6_1..> | 2023-10-07 00:28 | 29M | |
| wl-clipboard-2.2.1.pkg | 2023-10-07 13:25 | 26K | |
| wl-gammarelay-rs-0.3..> | 2023-10-10 15:10 | 701K | |
| wl-screenrec-s202309..> | 2023-10-10 03:42 | 399K | |
| wlan2eth-1.3_1.pkg | 2023-10-10 12:57 | 4.7K | |
| wlclock-1.0.1.pkg | 2023-10-09 18:14 | 15K | |
| wlogout-1.1.1_2.pkg | 2023-10-09 04:38 | 86K | |
| wlr-randr-0.3.0.pkg | 2023-10-14 18:16 | 7.0K | |
| wlr-which-key-0.1.1_..> | 2023-10-08 22:02 | 355K | |
| wlrctl-0.2.2.pkg | 2023-10-11 06:16 | 14K | |
| wlroots-0.16.2_1.pkg | 2023-10-06 23:09 | 364K | |
| wlroots-devel-0.16.0..> | 2023-10-08 05:32 | 400K | |
| wlroots015-0.15.1_2.pkg | 2023-10-07 17:34 | 318K | |
| wlsunset-0.3.0.pkg | 2023-10-10 03:31 | 12K | |
| wlvncc-s20230105_3.pkg | 2023-10-10 18:30 | 66K | |
| wm2-4.0_2.pkg | 2023-10-08 15:58 | 33K | |
| wmCalClock-1.26_2.pkg | 2023-10-10 06:06 | 46K | |
| wmScoreBoard-0.30_4.pkg | 2023-10-09 23:00 | 12K | |
| wmakerconf-2.12_12.pkg | 2023-10-08 18:03 | 251K | |
| wmanager-0.2.1_15.pkg | 2023-10-14 06:21 | 14K | |
| wmanager-addons-0.02..> | 2023-10-07 17:46 | 7.7K | |
| wmapp-0.0.4.3_2.pkg | 2023-10-14 07:18 | 64K | |
| wmappl-0.71_2.pkg | 2023-10-10 09:15 | 32K | |
| wmbday-0.3.1_2.pkg | 2023-10-09 10:22 | 12K | |
| wmbiff-0.4.36_1.pkg | 2023-10-14 11:29 | 48K | |
| wmbinclock-0.51.pkg | 2023-10-09 09:57 | 9.8K | |
| wmblob-1.0.4_2.pkg | 2023-10-10 07:11 | 17K | |
| wmblueclock-0.0_3.pkg | 2023-10-09 08:03 | 7.9K | |
| wmbluecpu-0.4_4.pkg | 2023-10-10 10:50 | 7.7K | |
| wmbsdbatt-0.1_5.pkg | 2023-10-08 22:14 | 9.9K | |
| wmbutton-0.6.1_2.pkg | 2023-10-14 15:14 | 29K | |
| wmcalendar-0.5.2_19.pkg | 2023-10-14 08:12 | 34K | |
| wmcliphist-1.0_3.pkg | 2023-10-09 15:37 | 56K | |
| wmclock-1.0.16.pkg | 2023-10-14 10:22 | 21K | |
| wmclockmon-0.8.1_9.pkg | 2023-10-10 23:13 | 46K | |
| wmconfig-1.5.1.pkg | 2023-10-14 05:34 | 60K | |
| wmcpuload-1.1.1.pkg | 2023-10-14 13:26 | 16K | |
| wmctrl-1.07_7.pkg | 2023-10-08 06:10 | 17K | |
| wmcube-0.98_4.pkg | 2023-10-09 16:13 | 25K | |
| wmdiskmon-0.0.2_4.pkg | 2023-10-10 01:13 | 12K | |
| wmdrawer-0.10.5_13.pkg | 2023-10-08 12:31 | 38K | |
| wmenu-0.1.4.pkg | 2023-10-10 19:43 | 14K | |
| wmeyes-1.2_1.pkg | 2023-10-08 19:31 | 11K | |
| wmfishtime-1.24_8.pkg | 2023-10-08 15:54 | 13K | |
| wmflame-0.60_3.pkg | 2023-10-10 00:07 | 18K | |
| wmfocus-1.4.0_3.pkg | 2023-10-08 16:52 | 603K | |
| wmforecast-1.9.0.pkg | 2023-10-08 18:45 | 42K | |
| wmget-0.6.0_8.pkg | 2023-10-10 16:34 | 23K | |
| wmglobe-1.3_11.pkg | 2023-10-14 15:21 | 62K | |
| wmi-client-1.3.16_4.pkg | 2023-10-07 15:08 | 1.5M | |
| wmicons-1.0_2.pkg | 2023-10-07 01:56 | 1.2M | |
| wmii-3.6_7.pkg | 2023-10-08 12:39 | 86K | |
| wmii-devel-3.9.2_3.pkg | 2023-10-14 14:41 | 290K | |
| wmitime-0.5.pkg | 2023-10-08 14:24 | 12K | |
| wmix-3.1_3.pkg | 2023-10-10 23:53 | 19K | |
| wmjulia-0.40_5.pkg | 2023-10-14 14:36 | 13K | |
| wmjupiter-1.21_1.pkg | 2023-10-10 03:09 | 11K | |
| wmmaiload-2.3.0_2.pkg | 2023-10-09 21:17 | 32K | |
| wmmemfree-0.7_4.pkg | 2023-10-11 14:54 | 8.2K | |
| wmmemload-0.1.8.pkg | 2023-10-09 00:03 | 11K | |
| wmmoonclock-1.30.pkg | 2023-10-14 10:26 | 120K | |
| wmmp-0.12.6.pkg | 2023-10-08 14:45 | 23K | |
| wmname-0.1_2.pkg | 2023-10-09 06:14 | 3.2K | |
| wmnd-0.4.18.pkg | 2023-10-09 14:46 | 27K | |
| wmnet-1.2_3.pkg | 2023-10-10 16:57 | 11K | |
| wmnetload-1.3_5.pkg | 2023-10-14 18:50 | 15K | |
| wmpal-0.6.1.pkg | 2023-10-10 07:22 | 119K | |
| wmpinboard-1.0_5.pkg | 2023-10-08 22:03 | 51K | |
| wmping-0.2.1_2.pkg | 2023-10-14 10:58 | 15K | |
| wmpuzzle-0.5.2.pkg | 2023-10-08 18:55 | 17K | |
| wmqstat-0.0.4_3.pkg | 2023-10-08 22:15 | 13K | |
| wmscript-1.0.pkg | 2023-10-08 16:00 | 14K | |
| wmsmixer-0.5.1_1.pkg | 2023-10-10 01:43 | 15K | |
| wmsolar-1.1.pkg | 2023-10-10 18:04 | 45K | |
| wmspaceweather-1.04_..> | 2023-10-08 22:32 | 11K | |
| wmsun-1.05,1.pkg | 2023-10-10 05:44 | 12K | |
| wmsystemtray-1.4.pkg | 2023-10-09 12:38 | 15K | |
| wmtictactoe-1.1.1.pkg | 2023-10-08 23:07 | 14K | |
| wmtime-1.0b2_2.pkg | 2023-10-09 20:16 | 10K | |
| wmtimer-2.92_12.pkg | 2023-10-10 17:41 | 13K | |
| wmtop-0.84_3.pkg | 2023-10-14 04:40 | 17K | |
| wmtunlo-0.1.3_4.pkg | 2023-10-09 23:15 | 12K | |
| wmupmon-0.1.3_5.pkg | 2023-10-14 17:59 | 11K | |
| wmutils-core-1.7.pkg | 2023-10-10 00:06 | 24K | |
| wmutils-opt-1.0.pkg | 2023-10-11 03:32 | 11K | |
| wmwave-0.4_7.pkg | 2023-10-08 12:57 | 11K | |
| wmweather+-2.18_1.pkg | 2023-10-09 07:00 | 68K | |
| wmwifi-0.4_5.pkg | 2023-10-09 16:43 | 11K | |
| wmwork-0.2.5_3.pkg | 2023-10-09 07:26 | 16K | |
| wmx-8.pkg | 2023-10-14 18:25 | 69K | |
| wob-0.15.1.pkg | 2023-10-09 18:34 | 16K | |
| woff2-1.0.2_5.pkg | 2023-10-06 09:12 | 60K | |
| wofi-1.3_1.pkg | 2023-10-10 11:02 | 56K | |
| wol-0.7.1_4.pkg | 2023-10-09 23:35 | 25K | |
| wolf-shaper-1.0.2_1.pkg | 2023-10-09 08:55 | 658K | |
| wolfpack-4.4.1.pkg | 2023-10-10 00:25 | 664K | |
| wolfssh-1.4.14.pkg | 2023-10-08 20:31 | 160K | |
| wolfssl-5.6.3.pkg | 2023-10-07 20:52 | 1.1M | |
| wop-0.4.3_15.pkg | 2023-10-14 09:28 | 4.2M | |
| word2x-0.005_2.pkg | 2023-10-10 07:12 | 40K | |
| wordgrinder-0.6.pkg | 2023-10-09 00:28 | 95K | |
| wordplay-7.22_1.pkg | 2023-10-14 11:25 | 84K | |
| wordpress-6.2.2_1,1.pkg | 2023-10-09 00:42 | 15M | |
| wordsearch-2.1.pkg | 2023-10-09 01:54 | 15K | |
| wordwarvi-1.0.4_1.pkg | 2023-10-14 15:51 | 8.3M | |
| worker-4.12.1.pkg | 2023-10-09 18:55 | 1.3M | |
| workrave-1.10.50_2.pkg | 2023-10-14 06:40 | 7.9M | |
| workrave-xfce-1.10.5..> | 2023-10-09 19:31 | 7.9M | |
| worldofpadman-1.2.20..> | 2023-10-08 12:50 | 583M | |
| worldtools-1.3.1_1.pkg | 2023-10-10 19:41 | 9.1K | |
| wpa_supplicant-2.10_..> | 2023-10-08 20:40 | 577K | |
| wpa_supplicant-devel..> | 2023-10-09 12:16 | 613K | |
| wpa_supplicant29-2.9..> | 2023-10-09 04:02 | 537K | |
| wpa_supplicant_gui-2..> | 2023-10-11 01:14 | 248K | |
| wpebackend-fdo-1.12...> | 2023-10-06 09:14 | 31K | |
| wping-0.1a_5.pkg | 2023-10-09 16:51 | 3.1K | |
| wput-0.6.2_7.pkg | 2023-10-09 08:43 | 103K | |
| wqy-fonts-20100803_1..> | 2023-10-08 05:22 | 12M | |
| wrangler-1.19.12_13.pkg | 2023-10-09 15:30 | 3.1M | |
| wrapland-0.527.0.pkg | 2023-10-07 01:54 | 2.0M | |
| wrapsrv-1.0.0_1.pkg | 2023-10-14 10:11 | 5.6K | |
| write-good-1.0.8_1.pkg | 2023-10-10 05:33 | 6.0M | |
| writeas-cli-2.0.0.w_..> | 2023-10-10 02:10 | 2.6M | |
| writefreely-0.13.2_9..> | 2023-10-09 03:32 | 7.8M | |
| wrk-luajit-4.2.0.pkg | 2023-10-08 15:23 | 28K | |
| wsdlpull-1.24_3.pkg | 2023-10-09 10:33 | 269K | |
| wshowkeys-1.0.pkg | 2023-10-10 05:04 | 11K | |
| wsjtx-2.5.4_8.pkg | 2023-10-08 18:19 | 13M | |
| wsjtz-2.5.4.1.22_5.pkg | 2023-10-10 15:11 | 15M | |
| wslay-1.1.1.22.pkg | 2023-10-07 17:06 | 17K | |
| wsmake-0.7.901_1.pkg | 2023-10-10 18:58 | 426K | |
| wt-4.8.0_3.pkg | 2023-10-08 11:11 | 7.2M | |
| wtf-20230906.pkg | 2023-10-14 12:18 | 29K | |
| wthrr-1.1.1_3.pkg | 2023-10-08 17:41 | 1.2M | |
| wtype-0.4.pkg | 2023-10-11 11:27 | 7.5K | |
| wuzz-0.5.0_15.pkg | 2023-10-09 07:28 | 2.4M | |
| wuzzah-0.53.pkg | 2023-10-14 07:48 | 12K | |
| wv-1.2.9_8.pkg | 2023-10-07 00:03 | 274K | |
| wv2-0.4.2_10.pkg | 2023-10-08 18:28 | 227K | |
| wvkbd-0.14.pkg | 2023-10-14 03:52 | 33K | |
| wwl-1.3.pkg | 2023-10-14 10:49 | 4.9K | |
| wwplot-0.0.9_2.pkg | 2023-10-14 18:55 | 12K | |
| wwwoffle-2.9j.pkg | 2023-10-07 22:47 | 614K | |
| wx30-gtk2-3.0.5.1_3.pkg | 2023-10-07 22:41 | 5.3M | |
| wx30-gtk3-3.0.5.1_3.pkg | 2023-10-06 12:15 | 5.3M | |
| wx32-gtk2-3.2.1_2.pkg | 2023-10-08 22:07 | 5.8M | |
| wx32-gtk3-3.2.1_2.pkg | 2023-10-06 15:48 | 5.8M | |
| wxformbuilder-3.5.0...> | 2023-10-10 13:26 | 1.2M | |
| wxguitar-1.01_13.pkg | 2023-10-14 04:56 | 309K | |
| wxhexeditor-0.24_4.pkg | 2023-10-14 10:01 | 378K | |
| wxlauncher-0.10.1.pkg | 2023-10-08 07:24 | 763K | |
| wxmacmolplt-7.7.43_4..> | 2023-10-14 11:47 | 1.5M | |
| wxmaxima-23.07.0.pkg | 2023-10-10 01:42 | 3.1M | |
| wxsvg-1.5.24_2.pkg | 2023-10-07 20:48 | 646K | |
| wy60-2.0.9.pkg | 2023-10-10 09:39 | 39K | |
| wyrmgus-5.3.6_1.pkg | 2023-10-08 01:52 | 2.1M | |
| wyrmsun-5.3.6_1.pkg | 2023-10-10 00:51 | 334M | |
| wzdftpd-0.8.3_9.pkg | 2023-10-14 05:18 | 280K | |
| x-face-e21-20070306_..> | 2023-10-08 09:41 | 33K | |
| x-face-e21-emacs_can..> | 2023-10-07 19:30 | 33K | |
| x-face-e21-emacs_dev..> | 2023-10-07 23:56 | 33K | |
| x-face-e21-emacs_dev..> | 2023-10-08 01:01 | 33K | |
| x-face-e21-emacs_nox..> | 2023-10-07 23:58 | 33K | |
| x-on-resize-0.2.pkg | 2023-10-10 10:47 | 9.0K | |
| x026-1.2.pkg | 2023-10-10 19:56 | 346K | |
| x2goclient-4.1.2.2_3..> | 2023-10-09 19:36 | 1.1M | |
| x2goclient-cli-3.0.1..> | 2023-10-07 11:35 | 4.6K | |
| x2vnc-1.7.2,1.pkg | 2023-10-12 07:21 | 25K | |
| x2x-1.30.20180709.pkg | 2023-10-10 19:22 | 26K | |
| x11perf-1.6.1.pkg | 2023-10-07 08:00 | 56K | |
| x11vnc-0.9.16_5.pkg | 2023-10-08 18:54 | 791K | |
| x16-emulator-r44.pkg | 2023-10-08 22:22 | 79K | |
| x16-rom-r44.pkg | 2023-10-07 17:23 | 61K | |
| x42-plugins-lv2-2023..> | 2023-10-09 18:02 | 1.2M | |
| x48-0.6.4_1.pkg | 2023-10-08 13:03 | 433K | |
| x49gp-20100425_9.pkg | 2023-10-14 05:56 | 2.5M | |
| x86info-1.31.s03.pkg | 2023-10-09 13:36 | 60K | |
| x264-0.164.3095_2.pkg | 2023-10-08 09:06 | 58K | |
| x265-3.4_2.pkg | 2023-10-05 17:55 | 1.8M | |
| x3270-4.2_1.pkg | 2023-10-09 15:18 | 1.7M | |
| xNetHack-8.0.pkg | 2023-10-09 02:39 | 2.0M | |
| xNetHack-nox11-8.0.pkg | 2023-10-09 09:32 | 1.9M | |
| xNetHack-qt-8.0.pkg | 2023-10-14 10:33 | 2.1M | |
| xa65-2.3.14.pkg | 2023-10-08 09:00 | 95K | |
| xalan-c-1.12_7.pkg | 2023-10-09 22:46 | 897K | |
| xalan-j-2.7.2.pkg | 2023-10-07 09:18 | 8.9M | |
| xalarm-3.06.pkg | 2023-10-09 06:38 | 33K | |
| xanalyser-1.32_3.pkg | 2023-10-09 10:32 | 26K | |
| xanim-2.92.0_10.pkg | 2023-10-08 10:08 | 294K | |
| xannotate-g20220604.pkg | 2023-10-10 23:15 | 4.9K | |
| xantfarm-1.16_2.pkg | 2023-10-14 10:05 | 13K | |
| xaos-4.2.1_1.pkg | 2023-10-14 15:07 | 432K | |
| xapian-bindings-1.4...> | 2023-10-08 19:02 | 684 | |
| xapian-bindings12-1...> | 2023-10-10 09:30 | 540 | |
| xapian-core-1.4.23,1..> | 2023-10-05 16:49 | 1.8M | |
| xapian-core12-1.2.25..> | 2023-10-07 20:45 | 2.7M | |
| xapian-omega-1.4.23.pkg | 2023-10-08 07:40 | 335K | |
| xapian-omega12-1.2.2..> | 2023-10-09 00:55 | 224K | |
| xapp-2.2.14_1.pkg | 2023-10-06 17:25 | 201K | |
| xapsd-g20230329_2.pkg | 2023-10-08 07:51 | 2.4M | |
| xar-1.6.1_2.pkg | 2023-10-08 15:39 | 91K | |
| xarcan-0.6.0_6.pkg | 2023-10-11 14:50 | 775K | |
| xarchive-0.2.8.6_10.pkg | 2023-10-10 15:23 | 35K | |
| xarchiver-0.5.4.21.pkg | 2023-10-10 06:19 | 453K | |
| xascii-1.0.pkg | 2023-10-08 15:09 | 7.4K | |
| xasteroids-5.0_2.pkg | 2023-10-14 06:30 | 12K | |
| xastir-2.2.0.pkg | 2023-10-10 23:40 | 1.1M | |
| xataxx-1.0_2.pkg | 2023-10-09 15:07 | 26K | |
| xauth-1.1.1.pkg | 2023-10-07 02:35 | 21K | |
| xautolock-2.2_1.pkg | 2023-10-10 20:57 | 16K | |
| xautomation-1.09_1.pkg | 2023-10-08 20:25 | 36K | |
| xawtv-3.107_1.pkg | 2023-10-09 15:03 | 331K | |
| xbacklight-1.2.3.pkg | 2023-10-07 00:12 | 6.4K | |
| xballoon-1.0_3.pkg | 2023-10-14 19:02 | 7.1K | |
| xbanish-1.8.pkg | 2023-10-10 02:06 | 7.3K | |
| xbat-1.11_11.pkg | 2023-10-10 07:17 | 102K | |
| xbatt-1.2.1_4.pkg | 2023-10-10 08:10 | 7.1K | |
| xbattbar-1.4.2_8.pkg | 2023-10-08 16:05 | 7.4K | |
| xbiff-1.0.4.pkg | 2023-10-09 05:18 | 9.7K | |
| xbill-2.1_11.pkg | 2023-10-10 03:39 | 37K | |
| xbindkeys-1.8.7.pkg | 2023-10-09 08:33 | 15K | |
| xbitmaps-1.1.2.pkg | 2023-10-05 17:00 | 20K | |
| xbl-1.1.6.pkg | 2023-10-10 07:09 | 102K | |
| xblackjack-2.2_4.pkg | 2023-10-14 05:21 | 48K | |
| xblas-1.0.248.pkg | 2023-10-07 17:41 | 1.4M | |
| xblast-2.10.4_18.pkg | 2023-10-14 15:43 | 7.8M | |
| xblood-2.0_2.pkg | 2023-10-10 11:16 | 5.9K | |
| xbmbrowser-5.1_3.pkg | 2023-10-08 14:13 | 31K | |
| xboard-4.9.1_3.pkg | 2023-10-11 05:01 | 1.2M | |
| xboard-devel-4.8.0.2..> | 2023-10-09 01:22 | 1.1M | |
| xboing-2.4_6.pkg | 2023-10-08 20:49 | 444K | |
| xbomb-2.2b.pkg | 2023-10-09 17:14 | 18K | |
| xbraitenberg-0.9_2.pkg | 2023-10-14 05:23 | 66K | |
| xbrightness-0.3.pkg | 2023-10-06 23:33 | 5.2K | |
| xbt-g20221002_1.pkg | 2023-10-14 13:49 | 89K | |
| xbubble-0.5.8_7.pkg | 2023-10-09 14:53 | 5.0M | |
| xbuffy-3.3.3_4.pkg | 2023-10-08 23:17 | 18K | |
| xbyak-6.73.pkg | 2023-10-08 08:12 | 49K | |
| xc3sprog-g20221005,1..> | 2023-10-09 17:03 | 112K | |
| xca-2.4.0.pkg | 2023-10-08 19:55 | 944K | |
| xcaddy-0.3.5_1.pkg | 2023-10-08 10:09 | 1.0M | |
| xcalc-1.1.2.pkg | 2023-10-07 05:03 | 22K | |
| xcalendar-4.0.2008_2..> | 2023-10-12 11:15 | 34K | |
| xcalib-0.10.pkg | 2023-10-07 07:41 | 24K | |
| xcape-1.2.9.pkg | 2023-10-14 09:05 | 7.8K | |
| xcb-2.4_3.pkg | 2023-10-10 11:50 | 16K | |
| xcb-imdkit-1.0.5.pkg | 2023-10-06 13:57 | 284K | |
| xcb-proto-1.15.2.pkg | 2023-10-05 17:14 | 106K | |
| xcb-util-0.4.1,1.pkg | 2023-10-05 17:25 | 12K | |
| xcb-util-cursor-0.1...> | 2023-10-06 09:41 | 13K | |
| xcb-util-errors-1.0...> | 2023-10-06 16:30 | 13K | |
| xcb-util-image-0.4.1..> | 2023-10-05 17:28 | 17K | |
| xcb-util-keysyms-0.4..> | 2023-10-05 17:29 | 6.5K | |
| xcb-util-renderutil-..> | 2023-10-05 17:28 | 8.3K | |
| xcb-util-wm-0.4.2.pkg | 2023-10-05 17:29 | 39K | |
| xcb-util-xrm-1.3.pkg | 2023-10-07 00:56 | 17K | |
| xcbautolock-0.2.2.pkg | 2023-10-14 08:04 | 5.5K | |
| xcd-1.7_3.pkg | 2023-10-09 12:31 | 10K | |
| xcdplayer-2.2_5.pkg | 2023-10-10 23:55 | 24K | |
| xcdroast-0.98.a.16_9..> | 2023-10-09 01:17 | 374K | |
| xcftools-1.0.8.20130..> | 2023-10-09 12:59 | 41K | |
| xcfun-2.1.1.1.pkg | 2023-10-06 18:32 | 4.5M | |
| xchadance-1.0_2.pkg | 2023-10-10 05:37 | 9.7K | |
| xcheckers-2.2.3_3.pkg | 2023-10-10 13:55 | 30K | |
| xchm-1.34.pkg | 2023-10-09 10:24 | 176K | |
| xchomp-pl1_2.pkg | 2023-10-08 14:22 | 17K | |
| xcircuit-3.10.30,1.pkg | 2023-10-09 18:18 | 475K | |
| xcite-1.60_23.pkg | 2023-10-10 09:41 | 20K | |
| xcite-emacs_canna-1...> | 2023-10-10 20:13 | 20K | |
| xcite-emacs_devel-1...> | 2023-10-09 12:59 | 20K | |
| xcite-emacs_devel_no..> | 2023-10-10 01:55 | 20K | |
| xcite-emacs_nox-1.60..> | 2023-10-10 02:58 | 20K | |
| xclickroot-1.3.pkg | 2023-10-09 16:14 | 3.5K | |
| xclip-0.13.82.pkg | 2023-10-06 11:09 | 18K | |
| xclipboard-1.1.3,1.pkg | 2023-10-09 18:36 | 14K | |
| xclock-1.0.9.pkg | 2023-10-07 07:49 | 24K | |
| xcm-0.5.4_1.pkg | 2023-10-12 08:40 | 21K | |
| xcmd-1.8_2.pkg | 2023-10-10 21:34 | 13K | |
| xcmsdb-1.0.5.pkg | 2023-10-07 09:57 | 16K | |
| xcoloredit-1.2_2.pkg | 2023-10-09 18:46 | 13K | |
| xcolors-1.3_5.pkg | 2023-10-10 02:42 | 7.9K | |
| xcompmgr-1.1.8.pkg | 2023-10-11 01:53 | 16K | |
| xconq-7.5.0.0.p.0.20..> | 2023-10-08 23:54 | 4.4M | |
| xconsole-1.0.8.pkg | 2023-10-06 23:57 | 9.0K | |
| xcoral-3.47_4.pkg | 2023-10-09 11:36 | 2.0M | |
| xcowsay-1.6_1.pkg | 2023-10-10 00:19 | 62K | |
| xcp-0.12.0_1.pkg | 2023-10-14 17:01 | 652K | |
| xcpc-20070122_15.pkg | 2023-10-09 09:40 | 89K | |
| xcpustate-2.9_3.pkg | 2023-10-08 19:10 | 16K | |
| xcruiser-0.30_3.pkg | 2023-10-09 18:09 | 25K | |
| xcrysden-1.6.2_4.pkg | 2023-10-07 20:18 | 2.0M | |
| xcscope.el-1.5_4.pkg | 2023-10-08 23:18 | 24K | |
| xcubes-5.5.2_2.pkg | 2023-10-08 21:10 | 17K | |
| xcursor-themes-1.0.6..> | 2023-10-07 10:04 | 309K | |
| xcursorgen-1.0.8.pkg | 2023-10-07 01:46 | 7.1K | |
| xcut-0.2_3.pkg | 2023-10-11 10:48 | 4.3K | |
| xcwcp-3.5.1_2.pkg | 2023-10-08 19:08 | 54K | |
| xd-0.0.4_26.pkg | 2023-10-10 08:26 | 333K | |
| xd3d-8.3.1_21.pkg | 2023-10-09 18:23 | 1.5M | |
| xdaliclock-2.48.pkg | 2023-10-14 05:44 | 86K | |
| xdaliclock-classic-2..> | 2023-10-14 06:37 | 41K | |
| xdeblock-1.0_3.pkg | 2023-10-14 10:54 | 94K | |
| xdelta-1.1.4_5.pkg | 2023-10-07 05:46 | 99K | |
| xdelta3-3.1.0_3,1.pkg | 2023-10-09 00:32 | 71K | |
| xdemineur-2.1.1_1.pkg | 2023-10-11 09:35 | 15K | |
| xdemorse-3.6.7.pkg | 2023-10-10 02:35 | 33K | |
| xdesktopwaves-1.4.pkg | 2023-10-10 12:51 | 27K | |
| xdeview-0.5.20_3.pkg | 2023-10-14 06:28 | 45K | |
| xdg-dbus-proxy-0.1.5..> | 2023-10-11 01:45 | 21K | |
| xdg-desktop-portal-w..> | 2023-10-14 13:06 | 33K | |
| xdg-user-dirs-0.18.pkg | 2023-10-06 22:09 | 34K | |
| xdg-utils-1.1.3_2.pkg | 2023-10-05 17:28 | 51K | |
| xdgagrab-0.3_2.pkg | 2023-10-14 06:44 | 4.6K | |
| xdgmenumaker-2.1.pkg | 2023-10-10 13:06 | 32K | |
| xdgpaths-0.2.5_5.pkg | 2023-10-08 10:45 | 26K | |
| xdialog-2.3.1_9.pkg | 2023-10-09 15:08 | 295K | |
| xdigger-1.0.10_4.pkg | 2023-10-10 04:02 | 32K | |
| xdino-5.5.2_2.pkg | 2023-10-08 22:25 | 26K | |
| xdiskusage-1.54.pkg | 2023-10-10 03:12 | 20K | |
| xditview-1.0.5.pkg | 2023-10-09 06:39 | 23K | |
| xdm-1.1.14_3.pkg | 2023-10-14 06:42 | 96K | |
| xdms-1.3.2.pkg | 2023-10-09 06:31 | 21K | |
| xdo-0.5.7.pkg | 2023-10-09 18:16 | 8.7K | |
| xdotool-3.20211022.1..> | 2023-10-06 22:40 | 61K | |
| xdpyinfo-1.3.2_4.pkg | 2023-10-06 16:55 | 13K | |
| xdrawchem-1.11.0.2_2..> | 2023-10-10 20:28 | 673K | |
| xdriinfo-1.0.6_4.pkg | 2023-10-07 07:12 | 4.4K | |
| xdtm-2.5.8_2.pkg | 2023-10-14 06:17 | 89K | |
| xdu-3.0_4.pkg | 2023-10-14 05:09 | 12K | |
| xdx-2.91_1.pkg | 2023-10-10 13:35 | 91K | |
| xe-1.0.pkg | 2023-10-08 07:27 | 11K | |
| xe-guest-utilities-6..> | 2023-10-09 22:46 | 3.6K | |
| xearth-1.2.pkg | 2023-10-09 02:30 | 111K | |
| xed-3.2.4_1.pkg | 2023-10-10 20:45 | 2.0M | |
| xedit-1.2.2_1.pkg | 2023-10-14 02:48 | 295K | |
| xelfviewer-0.05.pkg | 2023-10-08 14:48 | 3.1M | |
| xemeraldia-0.4.3_2.pkg | 2023-10-10 14:57 | 21K | |
| xen-guest-tools-4.16..> | 2023-10-08 03:11 | 21K | |
| xen-kernel-4.17.0_1.pkg | 2023-10-08 22:24 | 1.0M | |
| xen-tools-4.17.0_1.pkg | 2023-10-14 06:51 | 35M | |
| xenv-4.0.pkg | 2023-10-10 02:21 | 57K | |
| xephem-4.1.0_1.pkg | 2023-10-10 23:19 | 11M | |
| xephyr-21.1.8_5,1.pkg | 2023-10-14 07:47 | 776K | |
| xerces-c3-3.2.4.pkg | 2023-10-05 17:03 | 2.1M | |
| xerces-j-2.12.2.pkg | 2023-10-06 19:39 | 3.3M | |
| xeus-3.1.0_1.pkg | 2023-10-07 10:03 | 254K | |
| xeus-zmq-1.1.0.pkg | 2023-10-08 01:15 | 247K | |
| xev-1.2.4.pkg | 2023-10-07 07:48 | 12K | |
| xeyes+-2.02_2.pkg | 2023-10-11 01:24 | 19K | |
| xeyes-1.3.0.pkg | 2023-10-11 08:23 | 11K | |
| xf86-input-egalax-0...> | 2023-10-14 18:58 | 5.4K | |
| xf86-input-elographi..> | 2023-10-10 11:05 | 7.9K | |
| xf86-input-evdev-2.1..> | 2023-10-06 18:43 | 28K | |
| xf86-input-joystick-..> | 2023-10-09 13:15 | 21K | |
| xf86-input-keyboard-..> | 2023-10-07 00:31 | 7.9K | |
| xf86-input-libinput-..> | 2023-10-06 21:44 | 38K | |
| xf86-input-mouse-1.9..> | 2023-10-07 02:00 | 30K | |
| xf86-input-synaptics..> | 2023-10-06 21:34 | 50K | |
| xf86-input-vmmouse-1..> | 2023-10-08 15:18 | 9.6K | |
| xf86-input-void-1.4...> | 2023-10-09 08:55 | 3.4K | |
| xf86-input-wacom-0.3..> | 2023-10-08 14:08 | 79K | |
| xf86-video-amdgpu-22..> | 2023-10-10 07:37 | 57K | |
| xf86-video-apm-1.3.0..> | 2023-10-10 13:06 | 15K | |
| xf86-video-ark-0.7.5..> | 2023-10-09 19:14 | 6.9K | |
| xf86-video-ast-1.1.5..> | 2023-10-10 22:13 | 37K | |
| xf86-video-ati-19.1...> | 2023-10-09 23:07 | 131K | |
| xf86-video-chips-1.4..> | 2023-10-09 16:31 | 40K | |
| xf86-video-cirrus-1...> | 2023-10-10 15:51 | 22K | |
| xf86-video-dummy-0.3..> | 2023-10-14 16:15 | 5.9K | |
| xf86-video-i128-1.4...> | 2023-10-10 08:56 | 19K | |
| xf86-video-i740-1.4...> | 2023-10-10 15:24 | 17K | |
| xf86-video-intel-2.9..> | 2023-10-10 02:40 | 618K | |
| xf86-video-mach64-6...> | 2023-10-09 22:50 | 57K | |
| xf86-video-mga-2.0.0..> | 2023-10-11 00:37 | 57K | |
| xf86-video-neomagic-..> | 2023-10-08 23:28 | 24K | |
| xf86-video-nv-2.1.22..> | 2023-10-14 11:02 | 62K | |
| xf86-video-openchrom..> | 2023-10-09 04:25 | 121K | |
| xf86-video-qxl-0.1.6..> | 2023-10-10 23:08 | 100K | |
| xf86-video-r128-6.12..> | 2023-10-14 14:11 | 41K | |
| xf86-video-rendition..> | 2023-10-10 04:44 | 32K | |
| xf86-video-savage-2...> | 2023-10-08 20:32 | 55K | |
| xf86-video-scfb-0.0...> | 2023-10-07 10:04 | 9.1K | |
| xf86-video-siliconmo..> | 2023-10-09 03:24 | 41K | |
| xf86-video-sis-0.12...> | 2023-10-14 06:48 | 210K | |
| xf86-video-tdfx-1.5...> | 2023-10-08 14:03 | 24K | |
| xf86-video-vesa-2.5...> | 2023-10-07 05:54 | 11K | |
| xf86-video-vmware-13..> | 2023-10-09 00:14 | 62K | |
| xf86-video-voodoo-1...> | 2023-10-14 14:32 | 10K | |
| xf86dga-1.0.3_1.pkg | 2023-10-07 02:24 | 4.8K | |
| xfaces-3.3_5.pkg | 2023-10-09 12:12 | 53K | |
| xfburn-0.7.0.pkg | 2023-10-08 00:36 | 398K | |
| xfce-4.18.pkg | 2023-10-09 13:24 | 780 | |
| xfce-icons-elementar..> | 2023-10-08 13:56 | 6.3M | |
| xfce-installed-setti..> | 2023-10-11 10:50 | 3.7K | |
| xfce4-appfinder-4.18..> | 2023-10-07 13:05 | 142K | |
| xfce4-appmenu-plugin..> | 2023-10-09 10:55 | 53K | |
| xfce4-battery-plugin..> | 2023-10-08 10:01 | 87K | |
| xfce4-bsdcpufreq-plu..> | 2023-10-07 20:09 | 6.8K | |
| xfce4-calculator-plu..> | 2023-10-07 19:56 | 72K | |
| xfce4-clipman-plugin..> | 2023-10-08 01:24 | 151K | |
| xfce4-conf-4.18.1.pkg | 2023-10-06 12:33 | 148K | |
| xfce4-cpugraph-plugi..> | 2023-10-07 10:28 | 92K | |
| xfce4-dashboard-1.0...> | 2023-10-07 10:52 | 2.5M | |
| xfce4-datetime-plugi..> | 2023-10-08 08:07 | 28K | |
| xfce4-desktop-4.18.1..> | 2023-10-07 17:15 | 1.3M | |
| xfce4-dev-tools-4.18..> | 2023-10-07 06:53 | 20K | |
| xfce4-dict-plugin-0...> | 2023-10-07 16:18 | 151K | |
| xfce4-diskperf-plugi..> | 2023-10-07 13:02 | 43K | |
| xfce4-docklike-plugi..> | 2023-10-09 18:34 | 62K | |
| xfce4-fsguard-plugin..> | 2023-10-07 18:48 | 57K | |
| xfce4-generic-slider..> | 2023-10-08 19:34 | 30K | |
| xfce4-genmon-plugin-..> | 2023-10-08 02:03 | 49K | |
| xfce4-goodies-4.18_3..> | 2023-10-09 21:59 | 1.7K | |
| xfce4-mailwatch-plug..> | 2023-10-08 08:40 | 144K | |
| xfce4-mixer-4.18.1_1..> | 2023-10-14 05:29 | 100K | |
| xfce4-mixer-full-4.1..> | 2023-10-14 14:51 | 112K | |
| xfce4-mount-plugin-1..> | 2023-10-07 14:28 | 77K | |
| xfce4-mpc-plugin-0.5..> | 2023-10-10 02:25 | 33K | |
| xfce4-netload-plugin..> | 2023-10-07 12:24 | 46K | |
| xfce4-notes-plugin-1..> | 2023-10-08 02:10 | 108K | |
| xfce4-notifyd-0.9.0.pkg | 2023-10-08 03:26 | 180K | |
| xfce4-panel-4.18.4.pkg | 2023-10-06 20:13 | 821K | |
| xfce4-panel-profiles..> | 2023-10-10 05:43 | 85K | |
| xfce4-places-plugin-..> | 2023-10-08 19:34 | 57K | |
| xfce4-power-manager-..> | 2023-10-07 20:11 | 480K | |
| xfce4-pulseaudio-plu..> | 2023-10-10 19:28 | 84K | |
| xfce4-screensaver-4...> | 2023-10-07 13:18 | 223K | |
| xfce4-screenshooter-..> | 2023-10-07 19:06 | 156K | |
| xfce4-session-4.18.3..> | 2023-10-07 13:20 | 291K | |
| xfce4-settings-4.18...> | 2023-10-08 00:26 | 796K | |
| xfce4-smartbookmark-..> | 2023-10-07 13:09 | 18K | |
| xfce4-stopwatch-plug..> | 2023-10-08 05:11 | 20K | |
| xfce4-systemload-plu..> | 2023-10-07 10:23 | 46K | |
| xfce4-taskmanager-1...> | 2023-10-08 02:43 | 94K | |
| xfce4-terminal-1.1.0..> | 2023-10-08 09:13 | 348K | |
| xfce4-time-out-plugi..> | 2023-10-08 04:32 | 51K | |
| xfce4-timer-plugin-1..> | 2023-10-08 03:37 | 50K | |
| xfce4-tumbler-4.18.1..> | 2023-10-06 19:49 | 129K | |
| xfce4-verve-plugin-2..> | 2023-10-08 11:01 | 38K | |
| xfce4-volumed-pulse-..> | 2023-10-11 06:02 | 9.6K | |
| xfce4-wavelan-plugin..> | 2023-10-07 22:22 | 32K | |
| xfce4-weather-plugin..> | 2023-10-07 12:47 | 2.3M | |
| xfce4-whiskermenu-pl..> | 2023-10-07 11:25 | 203K | |
| xfce4-windowck-plugi..> | 2023-10-10 06:42 | 64K | |
| xfce4-wm-4.18.0_1.pkg | 2023-10-08 08:37 | 429K | |
| xfce4-wm-themes-4.10..> | 2023-10-08 10:15 | 492K | |
| xfce4-xkb-plugin-0.8..> | 2023-10-07 12:43 | 412K | |
| xfd-1.1.4.pkg | 2023-10-14 05:44 | 14K | |
| xfe-1.45.pkg | 2023-10-10 06:22 | 1.4M | |
| xfig-3.2.8b.pkg | 2023-10-08 11:54 | 5.0M | |
| xfireworks-1.4_2.pkg | 2023-10-10 15:21 | 23K | |
| xfishtank-2.2_2.pkg | 2023-10-14 11:02 | 62K | |
| xfmpc-0.3.1.pkg | 2023-10-09 13:28 | 80K | |
| xfontsel-1.0.6.pkg | 2023-10-08 09:41 | 22K | |
| xforms-1.2.4_6,1.pkg | 2023-10-07 08:53 | 835K | |
| xforward-1.0_1.pkg | 2023-10-11 06:32 | 11K | |
| xfpovray-1.3.1_13.pkg | 2023-10-10 15:53 | 252K | |
| xfractint-20.04p16.pkg | 2023-10-08 20:52 | 609K | |
| xfrisk-1.2_6.pkg | 2023-10-10 23:10 | 113K | |
| xfs-1.2.0_1,1.pkg | 2023-10-09 19:05 | 53K | |
| xfsinfo-1.0.6.pkg | 2023-10-09 20:43 | 5.2K | |
| xfsm-1.99_1.pkg | 2023-10-09 07:52 | 23K | |
| xfsprogs-3.2.4_3.pkg | 2023-10-07 19:54 | 718K | |
| xfstt-1.11.pkg | 2023-10-10 09:03 | 48K | |
| xgalaga++-0.9.pkg | 2023-10-08 15:47 | 47K | |
| xgalaga-2.1.1.0.pkg | 2023-10-14 16:32 | 194K | |
| xgalaga-sdl-2.1.1.0_..> | 2023-10-09 04:25 | 323K | |
| xgamma-1.0.7.pkg | 2023-10-07 08:14 | 5.9K | |
| xgap-4.31_1.pkg | 2023-10-14 10:18 | 44K | |
| xgas-1.0_3.pkg | 2023-10-09 07:35 | 15K | |
| xgboost-1.7.6.pkg | 2023-10-07 05:50 | 1.2M | |
| xgc-1.0.5.pkg | 2023-10-07 06:37 | 29K | |
| xglk-411_7.pkg | 2023-10-10 20:48 | 81K | |
| xglurbules-3.3_2.pkg | 2023-10-10 09:27 | 20K | |
| xgraph-11.3.2.200009..> | 2023-10-08 20:27 | 52K | |
| xgrasp-1.7d_2.pkg | 2023-10-14 18:44 | 34K | |
| xh-0.18.0_3.pkg | 2023-10-10 17:27 | 1.8M | |
| xh-hunspell-20110323..> | 2023-10-10 14:14 | 154K | |
| xh-libreoffice-7.5.5..> | 2023-10-08 04:36 | 203K | |
| xhexagons-5.5.2_2.pkg | 2023-10-10 14:46 | 19K | |
| xhime-1.51_2.pkg | 2023-10-09 09:45 | 29K | |
| xhomer-9.16.06_2,1.pkg | 2023-10-09 02:44 | 85K | |
| xhost-1.0.8.pkg | 2023-10-06 16:45 | 9.3K | |
| xhtml-1.0.20020801_5..> | 2023-10-08 10:24 | 17K | |
| xhtml-11-1.1.2010112..> | 2023-10-09 20:47 | 31K | |
| xhtml-basic-1.0.2000..> | 2023-10-08 00:42 | 19K | |
| xhtml-modularization..> | 2023-10-06 23:23 | 408K | |
| xhtml1-xsd-200208.pkg | 2023-10-08 22:50 | 10K | |
| xi-core-0.3.0.202304..> | 2023-10-08 08:58 | 1.1M | |
| xi-term-g20190913_27..> | 2023-10-10 03:46 | 572K | |
| xidle-26052015.pkg | 2023-10-14 12:29 | 7.4K | |
| xin-1.0.0_1.pkg | 2023-10-08 12:07 | 6.5K | |
| xincluder-1.0.d11_7.pkg | 2023-10-09 00:08 | 53K | |
| xine-0.99.14_4.pkg | 2023-10-09 21:31 | 1.6M | |
| xinetd-2.3.15_2.pkg | 2023-10-14 12:31 | 84K | |
| xinfocom-1.8m_1.pkg | 2023-10-14 12:17 | 28K | |
| xinit-1.4.2,1.pkg | 2023-10-07 07:23 | 14K | |
| xinput-1.6.3.pkg | 2023-10-07 04:35 | 22K | |
| xinvaders-2.1.1_11.pkg | 2023-10-09 15:02 | 23K | |
| xinvaders3d-1.3.6_3.pkg | 2023-10-10 22:23 | 18K | |
| xiphos-4.2.1_10.pkg | 2023-10-14 07:00 | 6.0M | |
| xisola-1.0_2.pkg | 2023-10-08 20:05 | 6.9K | |
| xisp-2.7p4_9.pkg | 2023-10-08 22:09 | 138K | |
| xjewel-1.6_6.pkg | 2023-10-09 16:31 | 27K | |
| xjig-2.4_5.pkg | 2023-10-09 23:21 | 43K | |
| xjobs-20200726.pkg | 2023-10-10 03:32 | 32K | |
| xjump-2.7.5_3.pkg | 2023-10-10 15:26 | 12K | |
| xjumpx-1.4_3.pkg | 2023-10-14 15:10 | 25K | |
| xkb-switch-1.8.5.pkg | 2023-10-09 19:37 | 22K | |
| xkbcomp-1.4.5.pkg | 2023-10-05 17:25 | 79K | |
| xkbctrl-1.0_2.pkg | 2023-10-10 04:02 | 8.8K | |
| xkbevd-1.1.4.pkg | 2023-10-07 05:07 | 15K | |
| xkbind-2010.05.20.pkg | 2023-10-09 11:45 | 15K | |
| xkbprint-1.0.5.pkg | 2023-10-14 14:06 | 38K | |
| xkbset-0.8.pkg | 2023-10-14 17:21 | 14K | |
| xkbutils-1.0.4_2.pkg | 2023-10-07 06:00 | 16K | |
| xkeyboard-config-2.3..> | 2023-10-05 17:25 | 648K | |
| xkeycaps-2.46_3.pkg | 2023-10-09 16:56 | 103K | |
| xkeywrap-1.1_3.pkg | 2023-10-08 13:18 | 35K | |
| xkill-1.0.5.pkg | 2023-10-07 08:21 | 7.1K | |
| xkoules-1.4_4.pkg | 2023-10-09 07:56 | 181K | |
| xlaby-2.0.1_3.pkg | 2023-10-09 10:38 | 17K | |
| xlapack-3.11.0_1.pkg | 2023-10-14 10:02 | 2.3M | |
| xldlas-0.85_9.pkg | 2023-10-14 08:35 | 116K | |
| xlennart-1.1.1_1.pkg | 2023-10-14 18:25 | 47K | |
| xless-1.7_2.pkg | 2023-10-14 13:22 | 22K | |
| xlhtml-0.5_5,1.pkg | 2023-10-06 23:19 | 46K | |
| xli-1.17.0_18.pkg | 2023-10-08 11:53 | 121K | |
| xlife++-2.3.pkg | 2023-10-14 03:55 | 22M | |
| xlife-6.7.6.pkg | 2023-10-09 08:38 | 162K | |
| xlnt-1.5.0.92.pkg | 2023-10-08 22:59 | 667K | |
| xload-1.1.3.pkg | 2023-10-08 15:08 | 7.6K | |
| xloadimage-4.1.24_1.pkg | 2023-10-10 12:43 | 97K | |
| xlockmore-5.71_1.pkg | 2023-10-07 16:33 | 709K | |
| xlog-2.0.24_1.pkg | 2023-10-14 18:34 | 9.7M | |
| xlogical-1.0.8.pkg | 2023-10-14 11:41 | 1.4M | |
| xlogo-1.0.6.pkg | 2023-10-10 22:48 | 9.4K | |
| xlreader-0.9.0.pkg | 2023-10-14 16:04 | 9.9K | |
| xls2txt-1.0.1_26.pkg | 2023-10-10 10:49 | 516K | |
| xlsatoms-1.1.4.pkg | 2023-10-07 01:44 | 5.8K | |
| xlsclients-1.1.5.pkg | 2023-10-06 23:45 | 7.7K | |
| xlsfonts-1.0.6.pkg | 2023-10-08 11:23 | 9.4K | |
| xlupe-1.1_3.pkg | 2023-10-09 11:44 | 11K | |
| xmag-1.0.6.pkg | 2023-10-14 05:15 | 17K | |
| xmahjongg-3.7_3.pkg | 2023-10-10 19:55 | 415K | |
| xmail-1.6_2.pkg | 2023-10-10 19:01 | 69K | |
| xmailbox-2.5_2.pkg | 2023-10-08 19:05 | 29K | |
| xmailwatcher-1.6_2.pkg | 2023-10-10 02:51 | 11K | |
| xmake-1.06_1.pkg | 2023-10-08 06:21 | 14K | |
| xman-1.1.5.pkg | 2023-10-10 23:09 | 32K | |
| xmangekyou-2.0.1_3.pkg | 2023-10-10 05:13 | 24K | |
| xmascot-2.6a.2020083..> | 2023-10-12 04:09 | 134K | |
| xmastermind-0.1_8.pkg | 2023-10-08 22:39 | 16K | |
| xmball-5.5.2_2.pkg | 2023-10-14 17:34 | 23K | |
| xmbibtex-1.7_4.pkg | 2023-10-14 14:28 | 41K | |
| xmbmon-205_14.pkg | 2023-10-10 14:42 | 50K | |
| xmcd-3.3.2_21.pkg | 2023-10-10 14:02 | 599K | |
| xmdiary-3.0.3_6.pkg | 2023-10-09 02:27 | 774K | |
| xmedcon-0.23.0.pkg | 2023-10-08 01:45 | 609K | |
| xmemory-3.7_3.pkg | 2023-10-14 13:41 | 208K | |
| xmenu-4.5.5.pkg | 2023-10-09 19:40 | 26K | |
| xmessage-1.0.5.pkg | 2023-10-06 12:14 | 10K | |
| xmh-1.0.3.pkg | 2023-10-09 21:35 | 71K | |
| xmill-0.8.pkg | 2023-10-09 00:15 | 695K | |
| xmille-2.0_4.pkg | 2023-10-08 20:35 | 28K | |
| xmine-1.0.3_2.pkg | 2023-10-14 07:45 | 17K | |
| xminehunter-0.4_5.pkg | 2023-10-09 03:05 | 14K | |
| xmines-1.0_3.pkg | 2023-10-14 12:30 | 14K | |
| xmix-2.1_3.pkg | 2023-10-10 00:15 | 8.2K | |
| xmixer-0.9.4_8.pkg | 2023-10-10 14:46 | 35K | |
| xml-commons-1.4.01.pkg | 2023-10-06 23:43 | 207K | |
| xml-format-0.2.pkg | 2023-10-10 05:58 | 8.5K | |
| xml-lite.el-1.1_22,1..> | 2023-10-08 13:53 | 8.8K | |
| xml-lite.el-emacs_ca..> | 2023-10-14 18:12 | 8.8K | |
| xml-lite.el-emacs_de..> | 2023-10-09 06:09 | 8.9K | |
| xml-lite.el-emacs_de..> | 2023-10-10 17:08 | 8.9K | |
| xml-lite.el-emacs_no..> | 2023-10-10 00:35 | 8.8K | |
| xml-security-1.5.5_1..> | 2023-10-14 11:17 | 693K | |
| xml2c-20151019_2.pkg | 2023-10-10 06:31 | 7.7K | |
| xmlada-23.0.0_2.pkg | 2023-10-08 11:25 | 2.2M | |
| xmlcatmgr-2.2_3.pkg | 2023-10-05 16:41 | 22K | |
| xmlcharent-0.3_2.pkg | 2023-10-05 16:41 | 12K | |
| xmlcopyeditor-1.3.1...> | 2023-10-10 01:08 | 1.1M | |
| xmlenc-0.52_2.pkg | 2023-10-09 23:08 | 49K | |
| xmlf90-1.5.6.pkg | 2023-10-07 02:57 | 492K | |
| xmlformat-1.04_1.pkg | 2023-10-11 01:58 | 91K | |
| xmlgen-1.4.pkg | 2023-10-14 18:40 | 17K | |
| xmlgraphics-commons-..> | 2023-10-06 20:38 | 1.0M | |
| xmlindent-0.2.17_1.pkg | 2023-10-08 14:36 | 13K | |
| xmlink-5.5.2_2.pkg | 2023-10-10 05:37 | 19K | |
| xmlppm-0.98.3_2.pkg | 2023-10-10 01:22 | 30K | |
| xmlroff-0.6.3_2.pkg | 2023-10-08 12:10 | 390K | |
| xmlrpc-c-1.54.06.pkg | 2023-10-07 20:49 | 1.4M | |
| xmlrpc-epi-0.54.2_4.pkg | 2023-10-14 07:15 | 70K | |
| xmlsec1-1.2.38.pkg | 2023-10-06 15:09 | 608K | |
| xmlstarlet-1.6.1_3.pkg | 2023-10-06 10:02 | 216K | |
| xmlto-0.0.28.pkg | 2023-10-05 17:34 | 39K | |
| xmltooling-3.2.4.pkg | 2023-10-07 04:55 | 681K | |
| xmlwrapp-0.7.0_25.pkg | 2023-10-14 18:43 | 863K | |
| xmmix-1.2.2_5.pkg | 2023-10-14 18:40 | 19K | |
| xmodmap-1.0.10.pkg | 2023-10-06 16:53 | 21K | |
| xmoontool-3.0.3_8.pkg | 2023-10-09 06:45 | 17K | |
| xmore-1.0.3.pkg | 2023-10-09 00:57 | 4.2K | |
| xmorse-20041125_10.pkg | 2023-10-10 01:25 | 15K | |
| xmotd-1.17.3.b_2.pkg | 2023-10-09 14:53 | 16K | |
| xmoto-0.6.2_2.pkg | 2023-10-08 19:23 | 32M | |
| xmountains-2.10.pkg | 2023-10-10 03:15 | 20K | |
| xmp-4.2.0_2,1.pkg | 2023-10-10 01:22 | 23K | |
| xmpp-client-20170324..> | 2023-10-08 12:11 | 1.6M | |
| xmrig-6.20.0.pkg | 2023-10-14 18:11 | 1.0M | |
| xmris-4.04_5.pkg | 2023-10-11 03:06 | 145K | |
| xmsg-1.1_2.pkg | 2023-10-14 16:22 | 8.6K | |
| xmulti-2.00b4_4.pkg | 2023-10-09 07:29 | 200K | |
| xmx-1.1_3.pkg | 2023-10-10 08:20 | 24K | |
| xnec2c-4.4.12_1.pkg | 2023-10-14 09:09 | 1.3M | |
| xnecview-1.36_3.pkg | 2023-10-12 02:06 | 65K | |
| xnee-3.19_2.pkg | 2023-10-10 03:47 | 104K | |
| xneko-1.0_1,1.pkg | 2023-10-08 12:53 | 9.7K | |
| xneur-0.20.0_3.pkg | 2023-10-07 17:55 | 305K | |
| xnotify-0.9.3.pkg | 2023-10-10 13:07 | 15K | |
| xob-0.3_1.pkg | 2023-10-09 11:25 | 19K | |
| xoct-5.5.2_2.pkg | 2023-10-09 12:57 | 24K | |
| xoids-1.5_1.pkg | 2023-10-09 21:30 | 33K | |
| xoj-1.0_2.pkg | 2023-10-10 09:04 | 7.0K | |
| xom-1.2.11,1.pkg | 2023-10-08 07:01 | 513K | |
| xonotic-0.8.6_1.pkg | 2023-10-10 13:14 | 1.1G | |
| xoops-2.5.10.pkg | 2023-10-09 01:27 | 6.8M | |
| xopcodecalc-0.05.pkg | 2023-10-10 21:11 | 182K | |
| xorg-7.7_3.pkg | 2023-10-10 13:50 | 600 | |
| xorg-apps-7.7_4.pkg | 2023-10-08 02:29 | 1.1K | |
| xorg-cf-files-1.0.8.pkg | 2023-10-05 16:54 | 163K | |
| xorg-docs-1.7.2,1.pkg | 2023-10-07 19:26 | 92K | |
| xorg-drivers-7.7_7.pkg | 2023-10-08 00:57 | 768 | |
| xorg-fonts-7.7_1.pkg | 2023-10-07 17:17 | 528 | |
| xorg-fonts-75dpi-7.7..> | 2023-10-07 09:35 | 520 | |
| xorg-fonts-100dpi-7...> | 2023-10-07 04:33 | 520 | |
| xorg-fonts-cyrillic-..> | 2023-10-07 01:25 | 504 | |
| xorg-fonts-miscbitma..> | 2023-10-06 16:48 | 632 | |
| xorg-fonts-truetype-..> | 2023-10-05 17:41 | 512 | |
| xorg-fonts-type1-7.7..> | 2023-10-07 00:20 | 508 | |
| xorg-libraries-7.7_5..> | 2023-10-07 18:35 | 856 | |
| xorg-macros-1.19.3.pkg | 2023-10-05 16:40 | 21K | |
| xorg-minimal-7.5.2_3..> | 2023-10-07 18:41 | 560 | |
| xorg-nestserver-21.1..> | 2023-10-10 10:25 | 590K | |
| xorg-server-21.1.8_5..> | 2023-10-06 16:04 | 1.5M | |
| xorg-sgml-doctools-1..> | 2023-10-14 15:43 | 8.6K | |
| xorg-vfbserver-21.1...> | 2023-10-06 17:31 | 712K | |
| xorgproto-2022.1_1.pkg | 2023-10-05 16:41 | 221K | |
| xorgramana-0.0.8_11.pkg | 2023-10-09 11:07 | 387K | |
| xorgxrdp-0.9.19_1.pkg | 2023-10-07 18:46 | 75K | |
| xorgxrdp-devel-0.9.8..> | 2023-10-07 17:46 | 76K | |
| xoris-0.1e_1.pkg | 2023-10-10 15:13 | 5.6K | |
| xorriso-1.5.6.pkg | 2023-10-09 23:52 | 887K | |
| xorsearch-1.11.1.pkg | 2023-10-10 06:29 | 17K | |
| xoscope-2.0_3.pkg | 2023-10-09 15:33 | 68K | |
| xosd-2.2.14_3.pkg | 2023-10-07 13:37 | 48K | |
| xosmulti-1.00_3.pkg | 2023-10-10 00:51 | 18K | |
| xosview-1.23_2.pkg | 2023-10-14 13:51 | 59K | |
| xournal-0.4.8.2016_4..> | 2023-10-09 01:00 | 220K | |
| xournalpp-1.2.1.pkg | 2023-10-08 22:32 | 1.2M | |
| xp-0.5_4.pkg | 2023-10-10 12:38 | 94K | |
| xpad-5.8.0_1.pkg | 2023-10-09 13:25 | 98K | |
| xpad3-3.1_10.pkg | 2023-10-10 03:32 | 56K | |
| xpaint-3.1.4_1.pkg | 2023-10-14 08:34 | 796K | |
| xpanex-5.5.2_2.pkg | 2023-10-09 22:40 | 22K | |
| xparam-1.22_3.pkg | 2023-10-09 23:39 | 1.0M | |
| xpat2-1.07_4.pkg | 2023-10-14 18:37 | 231K | |
| xpbiff-1.27_5.pkg | 2023-10-08 16:06 | 14K | |
| xpdf-4.04,1.pkg | 2023-10-08 08:40 | 1.5M | |
| xpdf3-3.04_11.pkg | 2023-10-14 05:07 | 1.2M | |
| xpdf4-4.04,1.pkg | 2023-10-10 04:34 | 1.5M | |
| xpdfopen-0.86_2.pkg | 2023-10-05 17:32 | 11K | |
| xpeps-2.0_1.pkg | 2023-10-14 06:38 | 6.9K | |
| xpeviewer-0.04.pkg | 2023-10-10 20:28 | 3.2M | |
| xphoon-20000613.pkg | 2023-10-14 18:22 | 53K | |
| xpilot-4.5.5.pkg | 2023-10-14 09:42 | 644K | |
| xpilot-ng-server-4.7..> | 2023-10-09 09:06 | 823K | |
| xpipe-g20200503.pkg | 2023-10-10 13:09 | 8.0K | |
| xpipeman-1.5_1.pkg | 2023-10-10 17:16 | 16K | |
| xpired-1.22_24.pkg | 2023-10-14 12:40 | 407K | |
| xpk-0.1.4_3.pkg | 2023-10-10 04:17 | 49K | |
| xplanet-1.3.1_1.pkg | 2023-10-07 12:22 | 894K | |
| xplot-0.90.7.1_3.pkg | 2023-10-08 13:55 | 36K | |
| xplr-0.21.3_1.pkg | 2023-10-14 09:50 | 1.4M | |
| xporthdmv-1.01.pkg | 2023-10-09 21:50 | 18K | |
| xpostit-3.3.1_3.pkg | 2023-10-08 22:23 | 16K | |
| xpr-1.0.5.pkg | 2023-10-07 06:58 | 32K | |
| xpra-4.4.5.pkg | 2023-10-14 19:03 | 3.5M | |
| xpra-html5-9.0.pkg | 2023-10-09 00:31 | 2.1M | |
| xprintidle-2.1.pkg | 2023-10-14 06:21 | 3.1K | |
| xprobe2-0.3_1.pkg | 2023-10-08 08:31 | 93K | |
| xprompt-1.4_2.pkg | 2023-10-11 00:07 | 12K | |
| xprop-1.2.6.pkg | 2023-10-05 17:26 | 23K | |
| xpuzzletama-1.5b_1.pkg | 2023-10-09 14:32 | 47K | |
| xpx-1.41_2.pkg | 2023-10-14 09:10 | 74K | |
| xpyraminx-5.5.2_2.pkg | 2023-10-08 13:21 | 27K | |
| xqf-1.0.6.2_2.pkg | 2023-10-09 21:27 | 340K | |
| xrally-1.1.1_6.pkg | 2023-10-10 04:42 | 397K | |
| xrandr-1.5.2.pkg | 2023-10-07 07:00 | 37K | |
| xray-core-1.7.5_1.pkg | 2023-10-10 08:51 | 7.8M | |
| xray_re-tools-g20180..> | 2023-10-14 16:13 | 345K | |
| xrdb-1.2.1.pkg | 2023-10-06 12:13 | 17K | |
| xrdp-0.9.23,1.pkg | 2023-10-10 19:04 | 460K | |
| xrdp-devel-0.9.80.b2..> | 2023-10-09 10:08 | 569K | |
| xreader-3.2.2_17.pkg | 2023-10-10 16:37 | 853K | |
| xrefresh-1.0.6.pkg | 2023-10-07 03:15 | 6.1K | |
| xrestop-0.4_5.pkg | 2023-10-10 09:04 | 7.4K | |
| xrick-021212_11.pkg | 2023-10-14 11:45 | 1.5M | |
| xrisk-2.15_2.pkg | 2023-10-09 21:54 | 65K | |
| xroach-4.4_2.pkg | 2023-10-08 12:24 | 11K | |
| xrobots-1.0_5.pkg | 2023-10-14 11:40 | 15K | |
| xrootconsole-0.6_1.pkg | 2023-10-14 07:25 | 8.1K | |
| xrootd-4.10.0_3.pkg | 2023-10-07 22:40 | 2.0M | |
| xrot-1.3.2_2.pkg | 2023-10-09 21:10 | 135K | |
| xrsh-5.92_3.pkg | 2023-10-08 13:17 | 12K | |
| xrsi-0.9_2.pkg | 2023-10-09 01:13 | 5.6K | |
| xrubik-5.5.2_1.pkg | 2023-10-09 23:43 | 33K | |
| xsane-0.999_8.pkg | 2023-10-08 16:45 | 1.5M | |
| xsc-1.6_2.pkg | 2023-10-08 13:49 | 40K | |
| xscavenger-1.4.5_1.pkg | 2023-10-08 19:30 | 126K | |
| xscope-1.4.1_2.pkg | 2023-10-11 10:33 | 86K | |
| xscrabble-2.12_1.pkg | 2023-10-14 14:22 | 438K | |
| xscreensaver-6.06_3.pkg | 2023-10-07 04:18 | 12M | |
| xsd-4.1.0.a11_1.pkg | 2023-10-06 13:23 | 1.7M | |
| xsel-conrad-1.2.0_1.pkg | 2023-10-07 05:23 | 16K | |
| xset-1.2.5.pkg | 2023-10-05 17:26 | 17K | |
| xsetroot-1.1.2.pkg | 2023-10-06 12:50 | 8.9K | |
| xsettingsd-1.0.0.2_1..> | 2023-10-06 18:38 | 23K | |
| xshisen-1.51_4.pkg | 2023-10-10 03:27 | 47K | |
| xshogi-1.4.2.pkg | 2023-10-14 05:38 | 57K | |
| xsimd-11.1.0.pkg | 2023-10-07 08:14 | 98K | |
| xskat-4.0_2.pkg | 2023-10-08 13:07 | 174K | |
| xskewb-5.5.2_2.pkg | 2023-10-10 09:20 | 26K | |
| xskyroot-920428_2.pkg | 2023-10-14 03:03 | 9.6K | |
| xslide.el-0.2.2_2.pkg | 2023-10-11 18:20 | 21K | |
| xsm-1.0.4.pkg | 2023-10-08 09:19 | 38K | |
| xsnow-3.7.5.pkg | 2023-10-11 01:19 | 1.8M | |
| xsokoban-3.3c_2.pkg | 2023-10-09 08:32 | 49K | |
| xsoldier-1.8_1.pkg | 2023-10-10 23:37 | 52K | |
| xsp-4.5_2.pkg | 2023-10-08 04:03 | 278K | |
| xspacewarp-1.2_2.pkg | 2023-10-14 18:56 | 33K | |
| xspread-3.1.1c_4.pkg | 2023-10-14 16:50 | 214K | |
| xspringies-1.12.pkg | 2023-10-10 10:15 | 118K | |
| xssstate-1.1.pkg | 2023-10-08 15:10 | 6.6K | |
| xstarroll-1.1b_3,1.pkg | 2023-10-09 20:50 | 16K | |
| xstdcmap-1.0.5.pkg | 2023-10-09 09:35 | 6.7K | |
| xstow-1.0.2.pkg | 2023-10-14 03:36 | 187K | |
| xstream-1.4.19.pkg | 2023-10-07 23:28 | 538K | |
| xstroke-0.5.12_8.pkg | 2023-10-10 08:36 | 45K | |
| xsv-rs-0.13.0_52.pkg | 2023-10-09 03:59 | 565K | |
| xsvg-0.2.1_7.pkg | 2023-10-08 12:48 | 8.4K | |
| xsynth-dssi-0.9.4_7.pkg | 2023-10-08 21:00 | 109K | |
| xsysstats-1.51_5.pkg | 2023-10-09 10:22 | 21K | |
| xsystem35-1.7.3.p5_7..> | 2023-10-14 09:53 | 327K | |
| xtacy-1.14_2.pkg | 2023-10-10 17:48 | 59K | |
| xtail-2.1.pkg | 2023-10-08 21:47 | 7.9K | |
| xtar-1.4_5.pkg | 2023-10-10 05:23 | 40K | |
| xtb-6.5.1_1.pkg | 2023-10-14 06:49 | 3.4M | |
| xteddy-2.2_1.pkg | 2023-10-10 03:29 | 719K | |
| xtensa-esp32-elf-1.2..> | 2023-10-09 06:10 | 26M | |
| xtensor-0.24.6.pkg | 2023-10-07 08:26 | 186K | |
| xtensor-blas-0.20.0.pkg | 2023-10-09 10:59 | 238K | |
| xtensor-io-0.13.0.pkg | 2023-10-09 12:24 | 30K | |
| xtensor-python-0.26...> | 2023-10-07 23:39 | 14K | |
| xterm-384.pkg | 2023-10-06 17:54 | 381K | |
| xtermcontrol-3.6.pkg | 2023-10-10 19:14 | 19K | |
| xtermset-0.5.2_2.pkg | 2023-10-09 14:42 | 8.0K | |
| xtestpicture-1.2_2.pkg | 2023-10-14 04:29 | 6.9K | |
| xtet42-2.21_5.pkg | 2023-10-12 07:21 | 17K | |
| xtexcad-2.4.1_2.pkg | 2023-10-09 07:25 | 45K | |
| xtexsh-1.4.2_6.pkg | 2023-10-14 18:45 | 15K | |
| xtgyoretsu-git201408..> | 2023-10-14 18:04 | 6.5K | |
| xtic-1.12_2.pkg | 2023-10-09 05:47 | 12K | |
| xtide-2.15.5.pkg | 2023-10-09 10:15 | 1.3M | |
| xtitle-0.4.4.pkg | 2023-10-10 04:12 | 8.4K | |
| xtl-1.4.2.pkg | 2023-10-09 18:48 | 11K | |
| xtl-quant-stack-0.7...> | 2023-10-06 20:59 | 85K | |
| xtoolwait-1.3_2.pkg | 2023-10-09 05:01 | 7.1K | |
| xtrabackup-2.4.28.pkg | 2023-10-08 12:38 | 5.4M | |
| xtrabackup8-8.0.31_1..> | 2023-10-14 18:21 | 13M | |
| xtrader-0.99.9_10.pkg | 2023-10-09 17:20 | 475K | |
| xtrans-1.4.0_1.pkg | 2023-10-05 16:41 | 35K | |
| xtriangles-5.5.2_2.pkg | 2023-10-10 02:15 | 16K | |
| xtrlock-2.15.pkg | 2023-10-10 04:28 | 5.8K | |
| xtrojka-1.2.3_3.pkg | 2023-10-14 06:37 | 28K | |
| xtron-1.1a_3.pkg | 2023-10-10 18:04 | 15K | |
| xtruco-1.0_2.pkg | 2023-10-09 14:46 | 25K | |
| xtset-1.1.pkg | 2023-10-11 05:51 | 5.4K | |
| xtux-20030306.pkg | 2023-10-10 00:42 | 1.1M | |
| xuidesigner-0.9_1.pkg | 2023-10-09 09:53 | 706K | |
| xv-3.10a_22.pkg | 2023-10-07 15:36 | 1.1M | |
| xv-m17n-3.10a_22.pkg | 2023-10-09 02:22 | 1.1M | |
| xvid-1.3.7,1.pkg | 2023-10-05 17:04 | 275K | |
| xvidtune-1.0.3.pkg | 2023-10-14 03:50 | 16K | |
| xvier-1.0_3.pkg | 2023-10-09 06:48 | 25K | |
| xviewer-3.2.4_3.pkg | 2023-10-08 19:43 | 1.1M | |
| xvile-9.8y.pkg | 2023-10-09 15:12 | 1.0M | |
| xvinfo-1.1.5.pkg | 2023-10-07 02:34 | 5.9K | |
| xvkbd-4.1.pkg | 2023-10-10 09:37 | 249K | |
| xvmcinfo-0.1.pkg | 2023-10-10 19:54 | 3.8K | |
| xvt-3.0.1_1.pkg | 2023-10-09 06:16 | 152K | |
| xwallpaper-0.7.4_2.pkg | 2023-10-09 15:43 | 14K | |
| xwatchwin-1.1.1_3.pkg | 2023-10-14 14:29 | 9.7K | |
| xwave-2.2_3.pkg | 2023-10-09 10:24 | 99K | |
| xwayland-22.1.8_1,1.pkg | 2023-10-11 09:57 | 804K | |
| xwayland-devel-21.0...> | 2023-10-06 11:04 | 830K | |
| xwd-1.0.8.pkg | 2023-10-07 09:55 | 15K | |
| xwindiff-1.1.6.pkg | 2023-10-10 00:08 | 48K | |
| xwininfo-1.1.5.pkg | 2023-10-06 21:51 | 19K | |
| xwinwrap-0.3_4.pkg | 2023-10-14 07:57 | 9.1K | |
| xwit-3.4_3.pkg | 2023-10-14 11:27 | 15K | |
| xworld-2.0_2.pkg | 2023-10-14 11:42 | 89K | |
| xworm-1.02_2.pkg | 2023-10-10 17:47 | 26K | |
| xwpe-1.5.30a.pkg | 2023-10-09 18:05 | 214K | |
| xwpick-2.20_2.pkg | 2023-10-11 02:03 | 71K | |
| xwrits-2.26_2.pkg | 2023-10-14 06:14 | 92K | |
| xwud-1.0.5.pkg | 2023-10-07 09:51 | 14K | |
| xxd-9.0.1876.pkg | 2023-10-05 16:44 | 9.1K | |
| xxgdb-1.12_4.pkg | 2023-10-14 11:17 | 43K | |
| xxhash-0.8.2.pkg | 2023-10-05 16:57 | 86K | |
| xxkb-1.11.1_2.pkg | 2023-10-10 03:46 | 31K | |
| xxl-1.0.1_3.pkg | 2023-10-09 08:35 | 176K | |
| xyce-7.7.0.pkg | 2023-10-09 21:10 | 7.7M | |
| xye-0.12.2_4.pkg | 2023-10-08 21:11 | 2.4M | |
| xymon-client-4.3.30.pkg | 2023-10-09 09:38 | 382K | |
| xymon-server-4.3.30_..> | 2023-10-14 13:30 | 4.0M | |
| xzgv-0.9.2_1.pkg | 2023-10-09 17:03 | 71K | |
| xzip-1.8.2_2.pkg | 2023-10-09 12:43 | 51K | |
| xzoom-0.4.pkg | 2023-10-09 20:22 | 11K | |
| xzx-4.6_5.pkg | 2023-10-11 17:39 | 266K | |
| y2l-1.2.pkg | 2023-10-11 09:28 | 9.4K | |
| yabasic-2.90.3,1.pkg | 2023-10-14 17:47 | 169K | |
| yabb-2.6.11_1.pkg | 2023-10-09 08:08 | 1.0M | |
| yacas-1.9.1_1.pkg | 2023-10-10 04:54 | 530K | |
| yacreader-9.13.1_1.pkg | 2023-10-09 16:30 | 1.4M | |
| yacreader-qt6-9.13.1..> | 2023-10-08 21:12 | 1.5M | |
| yad-13.0.pkg | 2023-10-10 11:18 | 175K | |
| yadex-1.7.0_3.pkg | 2023-10-09 11:27 | 295K | |
| yadf-1.0.0_13.pkg | 2023-10-14 06:10 | 741K | |
| yadifa-2.6.4.pkg | 2023-10-08 19:31 | 1.0M | |
| yadm-3.1.1.pkg | 2023-10-09 14:51 | 24K | |
| yaegi-0.15.1_2.pkg | 2023-10-10 00:40 | 5.0M | |
| yaf-2.11.0.pkg | 2023-10-14 06:58 | 417K | |
| yafaray-3.5.1_21.pkg | 2023-10-10 13:16 | 1.4M | |
| yafc-1.3.7.pkg | 2023-10-14 15:17 | 121K | |
| yafic-1.2.2_3.pkg | 2023-10-11 13:53 | 1.4M | |
| yaggo-1.5.11.pkg | 2023-10-07 10:31 | 22K | |
| yagiuda-1.19_1.pkg | 2023-10-09 17:10 | 118K | |
| yahtzee-1.0_2.pkg | 2023-10-10 08:39 | 14K | |
| yajl-2.1.0.pkg | 2023-10-06 13:14 | 58K | |
| yajl-tcl-1.7.0.pkg | 2023-10-11 16:17 | 8.3K | |
| yakuake-23.08.1.pkg | 2023-10-14 13:33 | 378K | |
| yali-1.1_1.pkg | 2023-10-10 13:10 | 8.2K | |
| yalias-0.7_12.pkg | 2023-10-11 12:16 | 11K | |
| yamcha-0.33_2.pkg | 2023-10-14 12:13 | 130K | |
| yamdi-1.9.pkg | 2023-10-09 05:27 | 15K | |
| yami4-2.0.0.pkg | 2023-10-10 17:13 | 339K | |
| yaml-cpp-0.8.0.pkg | 2023-10-06 16:46 | 116K | |
| yaml-mode.el-0.0.15_..> | 2023-10-10 07:58 | 11K | |
| yaml-mode.el-emacs_c..> | 2023-10-09 00:51 | 11K | |
| yaml-mode.el-emacs_d..> | 2023-10-10 22:59 | 11K | |
| yaml-mode.el-emacs_d..> | 2023-10-09 20:28 | 11K | |
| yaml-mode.el-emacs_n..> | 2023-10-14 11:38 | 11K | |
| yaml.el-0.5.3.pkg | 2023-10-07 23:27 | 47K | |
| yaml.el-emacs_canna-..> | 2023-10-07 10:39 | 47K | |
| yaml.el-emacs_devel-..> | 2023-10-08 07:23 | 46K | |
| yaml.el-emacs_devel_..> | 2023-10-07 22:26 | 46K | |
| yaml.el-emacs_nox-0...> | 2023-10-08 04:03 | 47K | |
| yaml2argdata-0.4_1.pkg | 2023-10-07 22:54 | 4.0K | |
| yamlfmt-0.10.0.pkg | 2023-10-08 20:39 | 1.1M | |
| yandex-ddns-g2020061..> | 2023-10-09 19:47 | 1.7M | |
| yank-1.3.0.pkg | 2023-10-09 07:08 | 7.3K | |
| yanopaste-1.3.0_2.pkg | 2023-10-12 12:34 | 361K | |
| yap-6.2.2_11.pkg | 2023-10-09 23:55 | 3.2M | |
| yapet-2.3_1.pkg | 2023-10-09 16:20 | 264K | |
| yaph-0.91.pkg | 2023-10-09 08:17 | 13K | |
| yara-4.2.3.pkg | 2023-10-07 02:22 | 304K | |
| yarn-1.22.18_1.pkg | 2023-10-07 03:25 | 612 | |
| yarn-node18-1.22.19.pkg | 2023-10-06 19:22 | 871K | |
| yarn-node20-1.22.19.pkg | 2023-10-09 13:58 | 871K | |
| yarr-2.4_1.pkg | 2023-10-10 05:34 | 3.3M | |
| yaru-gtk-themes-22.1..> | 2023-10-09 09:30 | 963K | |
| yaru-icon-theme-22.1..> | 2023-10-08 22:37 | 23M | |
| yash-2.54.pkg | 2023-10-09 07:43 | 430K | |
| yasm-1.3.0.pkg | 2023-10-06 17:46 | 532K | |
| yasr-0.6.9_5.pkg | 2023-10-10 14:36 | 51K | |
| yate-6.4.0_2.pkg | 2023-10-09 15:00 | 3.8M | |
| yatex-1.82_7.pkg | 2023-10-14 04:36 | 268K | |
| yaws-2.1.0.pkg | 2023-10-10 00:56 | 1.3M | |
| yaz++-1.6.1_1.pkg | 2023-10-07 13:10 | 100K | |
| yaz-5.31.1_5.pkg | 2023-10-07 03:17 | 1.0M | |
| yaze-ag-2.51.3.pkg | 2023-10-14 10:09 | 2.7M | |
| yazproxy-1.3.9_2.pkg | 2023-10-08 13:55 | 151K | |
| yconalyzer-1.0.4_1.pkg | 2023-10-09 01:29 | 22K | |
| yder-1.4.20.pkg | 2023-10-06 18:07 | 11K | |
| ydiff-1.2,1.pkg | 2023-10-07 08:48 | 23K | |
| ydotool-1.0.4.pkg | 2023-10-10 11:40 | 13K | |
| yeahconsole-0.3.4.pkg | 2023-10-10 03:07 | 7.9K | |
| yeahwm-0.3.5.pkg | 2023-10-14 18:16 | 21K | |
| yell-1.1.pkg | 2023-10-09 06:44 | 2.6K | |
| yelp-42.1_1.pkg | 2023-10-06 22:09 | 817K | |
| yelp-tools-42.0.pkg | 2023-10-05 17:20 | 21K | |
| yelp-xsl-42.0.pkg | 2023-10-05 17:19 | 180K | |
| yencode-0.46_7.pkg | 2023-10-14 07:24 | 50K | |
| yersinia-gtk-0.8.2_3..> | 2023-10-09 23:01 | 121K | |
| yfklog-0.6.0_1.pkg | 2023-10-10 05:10 | 142K | |
| yggdrasil-0.4.3_15.pkg | 2023-10-10 11:09 | 2.0M | |
| yi-aspell-0.01.1.1_1..> | 2023-10-14 06:20 | 385K | |
| yi-hunspell-0.0.3.pkg | 2023-10-08 23:15 | 208K | |
| yices-2.6.4.pkg | 2023-10-06 21:53 | 1.6M | |
| yj-5.1.0_13.pkg | 2023-10-09 09:27 | 1.0M | |
| yj-bruceadams-1.2.0_..> | 2023-10-08 16:50 | 411K | |
| ykclient-2.15.pkg | 2023-10-07 23:41 | 23K | |
| ykpers-1.19.0_1.pkg | 2023-10-07 02:47 | 55K | |
| ylva-1.7.pkg | 2023-10-10 01:33 | 15K | |
| ympd-1.3.0.pkg | 2023-10-09 23:36 | 282K | |
| yoda-1.9.8.pkg | 2023-10-08 17:46 | 794K | |
| yodl-3.10.00_3.pkg | 2023-10-14 03:23 | 1.5M | |
| yorick-2.2.04_2.pkg | 2023-10-12 04:44 | 1.9M | |
| yoshimi-2.3.0.3.pkg | 2023-10-10 23:19 | 11M | |
| yosys-0.33.pkg | 2023-10-06 23:43 | 4.1M | |
| you-get-0.4.1650_1.pkg | 2023-10-08 22:16 | 268K | |
| yourls-1.9.2.pkg | 2023-10-11 00:44 | 2.4M | |
| youtube_dl-2023.03.1..> | 2023-10-14 07:14 | 1.8M | |
| ypsilon-0.9.6.3_12.pkg | 2023-10-14 14:06 | 522K | |
| yptransitd-0.5_8.pkg | 2023-10-09 10:46 | 22K | |
| yq-3.2.3.pkg | 2023-10-14 06:18 | 21K | |
| yquake2-8.10.pkg | 2023-10-10 21:05 | 727K | |
| yt-dlp-2023.07.06.pkg | 2023-10-06 19:31 | 2.6M | |
| ytdl-0.6.4_15.pkg | 2023-10-09 14:51 | 2.3M | |
| ytfzf-2.6.1.pkg | 2023-10-14 01:45 | 50K | |
| ytnef-2.1.2,1.pkg | 2023-10-08 06:31 | 46K | |
| ytree-2.05.pkg | 2023-10-14 16:37 | 68K | |
| yubico-piv-tool-2.3...> | 2023-10-10 23:36 | 146K | |
| yubikey-agent-0.1.6_..> | 2023-10-09 05:22 | 1.3M | |
| yubikey-manager-qt-1..> | 2023-10-10 22:09 | 4.2M | |
| yubikey-personalizat..> | 2023-10-09 18:23 | 533K | |
| yubioath-desktop-5.0..> | 2023-10-10 15:10 | 4.5M | |
| yuck-cmdline-parser-..> | 2023-10-08 20:40 | 31K | |
| yudit-3.1.0.pkg | 2023-10-10 07:55 | 2.4M | |
| yuicompressor-2.4.8_..> | 2023-10-07 13:21 | 728K | |
| yukon-2010011201_3.pkg | 2023-10-08 21:41 | 9.2K | |
| yume-0.2.0_26.pkg | 2023-10-14 08:17 | 356K | |
| yuzu-qt6-s20230918.pkg | 2023-10-10 02:00 | 10M | |
| yuzu-s20230918.pkg | 2023-10-14 06:13 | 11M | |
| yydecode-0.2.10.pkg | 2023-10-08 19:28 | 16K | |
| yyjson-0.8.0.pkg | 2023-10-08 07:24 | 108K | |
| z-1.11.pkg | 2023-10-09 21:51 | 5.9K | |
| z3-4.12.1.pkg | 2023-10-07 08:01 | 12M | |
| z80-asm-2.4.p3.pkg | 2023-10-09 12:07 | 82K | |
| z80asm-1.8.pkg | 2023-10-14 02:45 | 33K | |
| z80ex-1.1.21.pkg | 2023-10-10 13:40 | 45K | |
| z80pack-1.37.pkg | 2023-10-11 07:23 | 2.0M | |
| z88-15_2.pkg | 2023-10-09 06:48 | 37M | |
| z88dk-2.2.pkg | 2023-10-09 09:29 | 3.2M | |
| zabbix4-agent-4.0.48..> | 2023-10-14 08:23 | 234K | |
| zabbix4-java-4.0.48.pkg | 2023-10-08 23:03 | 669K | |
| zabbix4-proxy-4.0.48..> | 2023-10-09 21:41 | 2.7M | |
| zabbix4-server-4.0.4..> | 2023-10-09 17:38 | 2.8M | |
| zabbix5-agent-5.0.37..> | 2023-10-12 11:28 | 252K | |
| zabbix5-java-5.0.37.pkg | 2023-10-08 21:45 | 671K | |
| zabbix5-proxy-5.0.37..> | 2023-10-14 18:54 | 5.5M | |
| zabbix5-server-5.0.3..> | 2023-10-14 11:57 | 5.7M | |
| zabbix6-agent-6.0.21..> | 2023-10-09 07:56 | 286K | |
| zabbix6-frontend-php..> | 2023-10-14 12:55 | 7.5M | |
| zabbix6-frontend-php..> | 2023-10-09 01:49 | 7.5M | |
| zabbix6-frontend-php..> | 2023-10-10 18:15 | 7.5M | |
| zabbix6-frontend-php..> | 2023-10-14 11:36 | 7.5M | |
| zabbix6-java-6.0.21.pkg | 2023-10-10 03:35 | 671K | |
| zabbix6-proxy-6.0.21..> | 2023-10-14 04:34 | 11M | |
| zabbix6-server-6.0.2..> | 2023-10-08 21:44 | 11M | |
| zabbix64-agent-6.4.6..> | 2023-10-09 02:39 | 275K | |
| zabbix64-frontend-ph..> | 2023-10-14 05:56 | 7.9M | |
| zabbix64-frontend-ph..> | 2023-10-09 02:03 | 7.9M | |
| zabbix64-frontend-ph..> | 2023-10-14 06:31 | 7.9M | |
| zabbix64-frontend-ph..> | 2023-10-09 16:46 | 7.9M | |
| zabbix64-java-6.4.6.pkg | 2023-10-10 17:13 | 671K | |
| zabbix64-proxy-6.4.6..> | 2023-10-09 10:12 | 11M | |
| zabbix64-server-6.4...> | 2023-10-09 16:18 | 11M | |
| zam-plugins-lv2-4.1_..> | 2023-10-08 18:44 | 29M | |
| zanata-cli-4.6.2.pkg | 2023-10-09 11:13 | 16M | |
| zanata-platform-4.6...> | 2023-10-08 15:56 | 81M | |
| zangband-2.7.5.p1.pkg | 2023-10-14 06:52 | 1.5M | |
| zanshin-23.08.1.pkg | 2023-10-09 23:27 | 614K | |
| zap-0.8.3.pkg | 2023-10-09 07:44 | 12K | |
| zapcc-g20180622_3.pkg | 2023-10-09 06:09 | 24M | |
| zaproxy-2.13.0_1.pkg | 2023-10-10 05:50 | 205M | |
| zarray-0.1.0.pkg | 2023-10-09 08:46 | 16K | |
| zart-g20191124_5.pkg | 2023-10-10 23:15 | 1.7M | |
| zatacka-0.1.8_11.pkg | 2023-10-08 17:32 | 172K | |
| zathura-0.5.2_1.pkg | 2023-10-07 10:13 | 163K | |
| zathura-cb-0.1.10_1.pkg | 2023-10-11 15:11 | 5.9K | |
| zathura-djvu-0.2.9_2..> | 2023-10-08 21:50 | 8.9K | |
| zathura-pdf-mupdf-0...> | 2023-10-11 01:25 | 8.1K | |
| zathura-pdf-poppler-..> | 2023-10-09 16:32 | 7.0K | |
| zathura-ps-0.2.7_1.pkg | 2023-10-11 00:34 | 5.0K | |
| zaz-1.0.1_1.pkg | 2023-10-09 02:44 | 19M | |
| zbackup-1.4.4_22.pkg | 2023-10-11 07:21 | 77K | |
| zbar-0.23.90_3.pkg | 2023-10-07 08:06 | 208K | |
| zcad-gtk2-0.9.8.5_9.pkg | 2023-10-14 14:28 | 8.0M | |
| zcad-qt5-0.9.8.5_9.pkg | 2023-10-10 21:49 | 7.9M | |
| zchunk-1.3.1.pkg | 2023-10-06 22:38 | 61K | |
| zdoom-2.8.1_11.pkg | 2023-10-08 16:01 | 2.1M | |
| zeal-0.6.1_5.pkg | 2023-10-09 06:22 | 400K | |
| zebra-server-2.0.55_..> | 2023-10-11 16:11 | 726K | |
| zed-1.9.0_2.pkg | 2023-10-10 04:18 | 8.3M | |
| zeek-6.0.1.pkg | 2023-10-09 16:02 | 21M | |
| zeitgeist-1.0.4_1.pkg | 2023-10-06 17:28 | 309K | |
| zellij-0.38.2.pkg | 2023-10-14 14:38 | 4.1M | |
| zenity-3.42.1_1.pkg | 2023-10-06 17:04 | 2.9M | |
| zenphoto-php80-1.6.pkg | 2023-10-09 20:55 | 6.3M | |
| zenphoto-php81-1.6.pkg | 2023-10-09 23:17 | 6.3M | |
| zenphoto-php82-1.6.pkg | 2023-10-09 17:44 | 6.3M | |
| zenphoto-php83-1.6.pkg | 2023-10-14 07:09 | 6.3M | |
| zenxml-2.5.pkg | 2023-10-10 07:09 | 63K | |
| zeroer-0.1_1.pkg | 2023-10-09 09:56 | 5.3K | |
| zeronet-0.7.1_2.pkg | 2023-10-09 02:17 | 1.4M | |
| zerotier-1.12.1.pkg | 2023-10-09 21:50 | 600K | |
| zerowait-httpd-0.8d_..> | 2023-10-14 18:36 | 79K | |
| zetaback-1.0.7.pkg | 2023-10-08 16:36 | 28K | |
| zetaback-devel-2020...> | 2023-10-08 18:45 | 28K | |
| zfp-1.0.0.pkg | 2023-10-06 16:24 | 119K | |
| zfs-periodic-1.0.201..> | 2023-10-10 04:57 | 2.3K | |
| zfs-replicate-0.7_2.pkg | 2023-10-10 22:40 | 5.4K | |
| zfs-snap-diff-1.1.3_..> | 2023-10-10 18:44 | 4.8M | |
| zfs-snapshot-clean-0..> | 2023-10-14 03:51 | 3.4K | |
| zfs-snapshot-mgmt-20..> | 2023-10-14 05:28 | 5.6K | |
| zfs-stats-1.3.2.pkg | 2023-10-10 08:04 | 9.6K | |
| zfs-stats-lite-1.4.pkg | 2023-10-09 02:58 | 8.0K | |
| zfsnap-1.11.1_1.pkg | 2023-10-14 15:55 | 6.3K | |
| zfsnap2-2.0.0.b3_3.pkg | 2023-10-10 04:35 | 18K | |
| zfstools-0.3.6_2.pkg | 2023-10-08 22:53 | 7.6K | |
| zgrab2-0.1.7_2.pkg | 2023-10-09 15:27 | 3.6M | |
| zgv-5.9_10.pkg | 2023-10-10 02:13 | 198K | |
| zh-CJKUnifonts-0.2.2..> | 2023-10-09 01:31 | 15M | |
| zh-CNS11643-font-98...> | 2023-10-09 19:54 | 24M | |
| zh-FreeWnn-lib-1.1.1..> | 2023-10-07 12:31 | 156K | |
| zh-FreeWnn-server-1...> | 2023-10-09 12:07 | 900K | |
| zh-arphicttf-2.11_6.pkg | 2023-10-07 17:17 | 12M | |
| zh-aterm-1.0.1.pkg | 2023-10-09 16:02 | 75K | |
| zh-auto-cn-l10n-1.1_..> | 2023-10-09 01:10 | 7.3K | |
| zh-auto-tw-l10n-1.16..> | 2023-10-08 21:16 | 9.0K | |
| zh-autoconvert-0.3.1..> | 2023-10-09 07:41 | 147K | |
| zh-bitchx-1.2.1_3,1.pkg | 2023-10-09 10:21 | 1.0M | |
| zh-bug5-1.18.pkg | 2023-10-10 22:23 | 5.8K | |
| zh-c2t-1.0.pkg | 2023-10-08 22:24 | 21K | |
| zh-cconv-0.6.3.pkg | 2023-10-08 18:08 | 301K | |
| zh-celvis-1.3.pkg | 2023-10-08 21:40 | 53K | |
| zh-chiconv-11.3.pkg | 2023-10-14 05:59 | 5.7K | |
| zh-chinese-calendar-..> | 2023-10-10 03:17 | 428K | |
| zh-cless-290.pkg | 2023-10-08 17:03 | 62K | |
| zh-cnprint-3.30b_1.pkg | 2023-10-14 10:51 | 4.2M | |
| zh-dictd-database-1...> | 2023-10-11 21:21 | 5.6M | |
| zh-enscript-a4-1.6.6..> | 2023-10-09 03:52 | 322K | |
| zh-eterm-0.9.6_5.pkg | 2023-10-08 19:01 | 477K | |
| zh-fandol-0.3_1.pkg | 2023-10-09 07:08 | 21M | |
| zh-fcitx-4.2.9.8_1.pkg | 2023-10-07 01:01 | 7.0M | |
| zh-fcitx-chewing-0.2..> | 2023-10-11 00:04 | 14K | |
| zh-fcitx-cloudpinyin..> | 2023-10-10 03:06 | 15K | |
| zh-fcitx-configtool-..> | 2023-10-08 14:18 | 27K | |
| zh-fcitx-libpinyin-0..> | 2023-10-10 14:54 | 9.9M | |
| zh-fcitx-rime-0.3.2_..> | 2023-10-10 12:07 | 34K | |
| zh-fcitx-table-extra..> | 2023-10-09 14:30 | 4.0M | |
| zh-fcitx-ui-light-0...> | 2023-10-10 10:39 | 26K | |
| zh-fcitx5-chewing-5...> | 2023-10-09 11:47 | 30K | |
| zh-fcitx5-chinese-ad..> | 2023-10-08 06:15 | 1.0M | |
| zh-fcitx5-mcbopomofo..> | 2023-10-10 22:18 | 1.4M | |
| zh-fcitx5-rime-5.0.1..> | 2023-10-08 19:05 | 64K | |
| zh-fcitx5-table-extr..> | 2023-10-14 09:04 | 26M | |
| zh-fcitx5-table-othe..> | 2023-10-10 22:50 | 857K | |
| zh-fireflyttf-LGJ-1...> | 2023-10-09 07:09 | 4.9M | |
| zh-font-std-0.0.2009..> | 2023-10-09 11:25 | 1.1K | |
| zh-fortunetw-1.4.pkg | 2023-10-10 18:57 | 102K | |
| zh-gb2jis-1.5.pkg | 2023-10-09 16:03 | 27K | |
| zh-gb2ps-2.02.pkg | 2023-10-10 23:32 | 1.3M | |
| zh-gcin-2.9.0_1.pkg | 2023-10-07 20:04 | 3.9M | |
| zh-gcin-gtk3-2.9.0_1..> | 2023-10-09 21:52 | 5.4K | |
| zh-gcin-qt5-2.9.0.pkg | 2023-10-14 12:47 | 15K | |
| zh-gydict-1.0_1.pkg | 2023-10-10 13:48 | 1.5K | |
| zh-hc-3.0.pkg | 2023-10-08 23:45 | 23K | |
| zh-ibus-cangjie-2.4.pkg | 2023-10-14 14:59 | 23K | |
| zh-ibus-chewing-1.5...> | 2023-10-12 05:16 | 63K | |
| zh-ibus-libpinyin-1...> | 2023-10-08 18:47 | 610K | |
| zh-ibus-pinyin-1.5.0..> | 2023-10-14 06:05 | 396K | |
| zh-ibus-rime-1.5.0_1..> | 2023-10-08 20:16 | 20K | |
| zh-ibus-table-chines..> | 2023-10-10 21:43 | 10M | |
| zh-jis2gb-1.5.pkg | 2023-10-08 12:40 | 25K | |
| zh-kcfonts-1.05_4.pkg | 2023-10-08 11:22 | 1.1M | |
| zh-libcangjie-1.3_1.pkg | 2023-10-07 02:13 | 1.3M | |
| zh-libchewing-0.5.1_..> | 2023-10-07 13:06 | 1.5M | |
| zh-libime-1.0.17_1.pkg | 2023-10-07 09:26 | 24M | |
| zh-libime-jyutping-1..> | 2023-10-10 08:47 | 13M | |
| zh-libpinyin-2.8.1.pkg | 2023-10-08 04:23 | 11M | |
| zh-librime-1.7.3_6.pkg | 2023-10-06 21:31 | 627K | |
| zh-libtabe-0.2.6_8.pkg | 2023-10-06 20:16 | 2.5M | |
| zh-lunar-2.1_1.pkg | 2023-10-14 18:51 | 12K | |
| zh-moettf-2.0_7.pkg | 2023-10-10 18:28 | 19M | |
| zh-muni-1.0.pkg | 2023-10-08 15:36 | 20K | |
| zh-oicq-1.6_1.pkg | 2023-10-10 03:44 | 24K | |
| zh-opencc-1.0.5_3.pkg | 2023-10-06 16:47 | 1.1M | |
| zh-opendesktop-fonts..> | 2023-10-08 22:36 | 16M | |
| zh-oto-0.5_1.pkg | 2023-10-09 19:55 | 70K | |
| zh-pcmanx-1.3_3.pkg | 2023-10-10 07:58 | 242K | |
| zh-phpbb-tw-2.0.23.pkg | 2023-10-14 10:39 | 398K | |
| zh-phpbb3-tw-3.0.12.pkg | 2023-10-10 21:02 | 1.4M | |
| zh-pycangjie-1.3.pkg | 2023-10-07 15:00 | 43K | |
| zh-pyzy-0.1.0_9.pkg | 2023-10-08 06:18 | 1.0M | |
| zh-qe-0.1.1_3.pkg | 2023-10-14 08:24 | 45K | |
| zh-rime-array-g20210..> | 2023-10-07 17:29 | 5.3M | |
| zh-rime-bopomofo-g20..> | 2023-10-07 16:42 | 82K | |
| zh-rime-cangjie-g202..> | 2023-10-08 11:17 | 7.4M | |
| zh-rime-cantonese-g2..> | 2023-10-07 22:27 | 19M | |
| zh-rime-combo-pinyin..> | 2023-10-07 20:11 | 12K | |
| zh-rime-data-full-g2..> | 2023-10-10 01:02 | 788 | |
| zh-rime-double-pinyi..> | 2023-10-08 02:26 | 20K | |
| zh-rime-emoji-g20210..> | 2023-10-07 21:59 | 49K | |
| zh-rime-essay-g20210..> | 2023-10-05 16:39 | 1.3M | |
| zh-rime-ipa-g2020041..> | 2023-10-07 16:14 | 20K | |
| zh-rime-jyutping-g20..> | 2023-10-07 21:11 | 14M | |
| zh-rime-luna-pinyin-..> | 2023-10-07 00:50 | 5.7M | |
| zh-rime-middle-chine..> | 2023-10-08 05:36 | 7.1M | |
| zh-rime-pinyin-simp-..> | 2023-10-07 14:08 | 966K | |
| zh-rime-prelude-g202..> | 2023-10-05 16:39 | 9.9K | |
| zh-rime-quick-g20190..> | 2023-10-07 15:49 | 4.8M | |
| zh-rime-scj-g2019012..> | 2023-10-08 03:13 | 929K | |
| zh-rime-soutzoe-g201..> | 2023-10-08 01:28 | 4.0M | |
| zh-rime-stenotype-g2..> | 2023-10-07 19:17 | 8.6K | |
| zh-rime-stroke-g2019..> | 2023-10-08 04:26 | 3.0M | |
| zh-rime-terra-pinyin..> | 2023-10-06 23:28 | 5.2M | |
| zh-rime-wubi-g202009..> | 2023-10-07 21:34 | 2.6M | |
| zh-rime-wugniu-g2019..> | 2023-10-07 22:43 | 4.6M | |
| zh-scim-fcitx-3.1.1_..> | 2023-10-10 09:40 | 1.0M | |
| zh-scim-pinyin-0.5.9..> | 2023-10-07 16:39 | 1.7M | |
| zh-scim-tables-0.5.1..> | 2023-10-08 03:37 | 3.6M | |
| zh-sourcehansans-sc-..> | 2023-10-09 06:36 | 76M | |
| zh-sourcehansans-tc-..> | 2023-10-08 19:51 | 76M | |
| zh-sourcehanserif-sc..> | 2023-10-14 05:57 | 98M | |
| zh-sourcehanserif-tc..> | 2023-10-14 05:27 | 98M | |
| zh-taipeisanstc-b.pkg | 2023-10-14 15:17 | 23M | |
| zh-tin-2.6.2_1.pkg | 2023-10-09 03:59 | 609K | |
| zh-tintin++-2.02.31.pkg | 2023-10-10 00:04 | 1.4M | |
| zh-ttf2pt1-3.4.0.pkg | 2023-10-10 17:13 | 91K | |
| zh-ttfm-0.9.5_7.pkg | 2023-10-08 05:10 | 26K | |
| zh-ve-1.1.pkg | 2023-10-14 17:29 | 31K | |
| zh-wenju-1.6_4.pkg | 2023-10-10 04:06 | 865K | |
| zh-wordpress-zh_CN-6..> | 2023-10-10 12:47 | 15M | |
| zh-wordpress-zh_TW-6..> | 2023-10-10 23:58 | 15M | |
| zh_CN-libreoffice-7...> | 2023-10-08 03:44 | 3.2M | |
| zh_TW-libreoffice-7...> | 2023-10-07 19:11 | 3.2M | |
| zhlt-3.4.pkg | 2023-10-09 11:31 | 148K | |
| zidrav-1.2.0_2.pkg | 2023-10-14 18:22 | 21K | |
| zig-0.10.1_2.pkg | 2023-10-07 19:59 | 17M | |
| zile-2.6.2.pkg | 2023-10-14 13:40 | 129K | |
| zillion-0.1_13.pkg | 2023-10-07 14:07 | 27K | |
| zim-0.75.2_1.pkg | 2023-10-10 01:28 | 1.7M | |
| zimg-5.0.0_9.pkg | 2023-10-09 21:26 | 52K | |
| zimpl-3.3.6_1.pkg | 2023-10-10 00:19 | 128K | |
| zine-0.16.0_2.pkg | 2023-10-10 16:55 | 2.6M | |
| zint-2.12.0.pkg | 2023-10-08 02:36 | 708K | |
| zip-3.0_1.pkg | 2023-10-05 16:54 | 220K | |
| zipmix-20070221.pkg | 2023-10-08 12:15 | 7.0K | |
| zipper-1.5_9.pkg | 2023-10-07 12:02 | 53K | |
| zisofs-tools-1.0.8_1..> | 2023-10-14 08:00 | 20K | |
| zita-alsa-pcmi-0.6.1..> | 2023-10-07 12:30 | 18K | |
| zita-at1-0.6.2_2.pkg | 2023-10-10 22:21 | 31K | |
| zita-bls1-0.3.3_2.pkg | 2023-10-10 19:42 | 30K | |
| zita-convolver-4.0.3..> | 2023-10-08 06:14 | 14K | |
| zita-dpl1-0.3.3_2.pkg | 2023-10-14 11:12 | 24K | |
| zita-jclient-0.4.2_4..> | 2023-10-08 08:03 | 6.3K | |
| zita-mu1-0.3.3_2.pkg | 2023-10-11 06:11 | 47K | |
| zita-njbridge-0.4.8_..> | 2023-10-10 18:24 | 25K | |
| zita-resampler-1.10...> | 2023-10-07 03:52 | 10K | |
| zita-rev1-0.2.2_2.pkg | 2023-10-14 09:12 | 38K | |
| zkgroup-0.7.4_19,1.pkg | 2023-10-07 00:20 | 228K | |
| zkt-1.1.6.pkg | 2023-10-10 07:22 | 85K | |
| zlib-ng-2.0.6.pkg | 2023-10-14 15:10 | 105K | |
| zlint-3.5.0_2.pkg | 2023-10-09 12:35 | 1.7M | |
| zls-0.10.0_1.pkg | 2023-10-08 23:53 | 1.3M | |
| zmap-3.0.0.pkg | 2023-10-14 08:01 | 97K | |
| zmusic-1.1.12_1.pkg | 2023-10-08 11:33 | 807K | |
| zn_poly-0.9.2.pkg | 2023-10-08 10:47 | 56K | |
| znapzend-0.21.2_1.pkg | 2023-10-10 12:25 | 68K | |
| znc-1.8.2_10.pkg | 2023-10-08 03:46 | 3.0M | |
| znc-clientbuffer-1.0..> | 2023-10-08 12:41 | 15K | |
| znc-push-1.0.0.173_7..> | 2023-10-08 13:43 | 52K | |
| znotes-0.4.7.pkg | 2023-10-08 16:53 | 215K | |
| zogftw-0.0.2022.06.2..> | 2023-10-09 22:19 | 21K | |
| zola-0.17.2_4.pkg | 2023-10-09 05:23 | 21M | |
| zoneinfo-2023.c.pkg | 2023-10-09 17:34 | 107K | |
| zoneminder-1.36.33_2..> | 2023-10-10 10:49 | 7.0M | |
| zonenotify-0.1_1.pkg | 2023-10-10 14:14 | 4.0K | |
| zoo-2.10.1_4.pkg | 2023-10-07 04:40 | 59K | |
| zookeeper-3.8.1.pkg | 2023-10-10 10:58 | 12M | |
| zoom-1.1.5_3.pkg | 2023-10-08 16:10 | 349K | |
| zoom-video-conferenc..> | 2023-10-14 13:40 | 50M | |
| zopfli-1.0.3_1.pkg | 2023-10-06 16:28 | 211K | |
| zorba-2.7.0_38.pkg | 2023-10-14 09:58 | 6.3M | |
| zorin-gtk-themes-3.4..> | 2023-10-09 02:04 | 363K | |
| zorin-icon-themes-2...> | 2023-10-10 02:55 | 43M | |
| zorro-1.1.8_3.pkg | 2023-10-09 11:04 | 12K | |
| zoxide-0.9.0_6.pkg | 2023-10-14 13:34 | 353K | |
| zpaqfranz-55.12_1.pkg | 2023-10-09 10:45 | 595K | |
| zphoto-1.2_14.pkg | 2023-10-08 14:52 | 184K | |
| zplugins-lv2-0.2.5_1..> | 2023-10-10 14:23 | 77K | |
| zpool-iostat-viz-3_1..> | 2023-10-09 04:08 | 6.6K | |
| zq-1.9.0_2.pkg | 2023-10-10 03:38 | 7.5M | |
| zrep-2.0.2.pkg | 2023-10-09 12:10 | 24K | |
| zrepl-0.6.0_9.pkg | 2023-10-14 10:58 | 4.7M | |
| zrythm-1.0.0.a.26.0...> | 2023-10-11 21:43 | 1.3M | |
| zsd-0.0.2014.12.07.pkg | 2023-10-08 21:47 | 8.5K | |
| zsh-5.9_2.pkg | 2023-10-06 20:04 | 4.6M | |
| zsh-antigen-2.2.3.pkg | 2023-10-11 17:51 | 17K | |
| zsh-autosuggestions-..> | 2023-10-08 21:52 | 8.1K | |
| zsh-completions-0.35..> | 2023-10-10 09:57 | 246K | |
| zsh-navigation-tools..> | 2023-10-10 21:10 | 129K | |
| zsh-syntax-highlight..> | 2023-10-14 04:58 | 31K | |
| zsm-0.4.0.pkg | 2023-10-14 04:21 | 12K | |
| zstd-1.5.5.pkg | 2023-10-05 17:21 | 538K | |
| zstr-1.0.7.pkg | 2023-10-07 18:33 | 5.9K | |
| zsync-0.6.2_2.pkg | 2023-10-14 12:36 | 72K | |
| zthread-2.3.2_2.pkg | 2023-10-10 02:27 | 103K | |
| ztoolkit-0.1.2_2.pkg | 2023-10-08 11:27 | 38K | |
| ztop-0.2.1_10.pkg | 2023-10-10 05:44 | 539K | |
| ztrack-1.0.pkg | 2023-10-10 00:20 | 13K | |
| zu-aspell-0.50.0_1,1..> | 2023-10-08 21:08 | 478K | |
| zu-hunspell-20110323..> | 2023-10-09 14:44 | 309K | |
| zu-libreoffice-7.5.5..> | 2023-10-08 07:23 | 218K | |
| zuki-themes-4.0.pkg | 2023-10-14 06:23 | 227K | |
| zutils-1.12.pkg | 2023-10-09 11:41 | 81K | |
| zx-g20221101.pkg | 2023-10-09 09:04 | 44K | |
| zxfer-1.1.7.pkg | 2023-10-09 11:10 | 34K | |
| zxing-cpp-2.1.0.pkg | 2023-10-06 08:04 | 503K | |
| zycore-c-1.4.1.pkg | 2023-10-07 13:08 | 44K | |
| zydis-4.0.0.pkg | 2023-10-14 04:03 | 173K | |
| zynaddsubfx-3.0.6_2,..> | 2023-10-08 16:59 | 6.6M | |
| zyre-2.0.1.pkg | 2023-10-14 16:53 | 47K | |
| zziplib-0.13.72_1.pkg | 2023-10-05 17:45 | 88K | |
| zzuf-0.13_1.pkg | 2023-10-09 18:23 | 110K | |
To use these repoistories over TLS you should download and install the Pacy World Root CA:
fetch -qo /tmp/ca.crt http://cdn.pacyworld.com/pacyworld.com/ca/alt_ca-morante_root.crt && [ "$(sha256 -q /tmp/ca.crt)" = "22d07a03345496ea9dc3ee767c991117e355405cab8d13e98d192474ef0296ce" ] && mv /tmp/ca.crt /usr/share/certs/trusted/alt_ca-morante_root.pem && certctl rehash || echo "HASH MISMATCH: Trust not established."
Package Build Stats and Status